aboutsummaryrefslogtreecommitdiffstats
path: root/tools
diff options
context:
space:
mode:
Diffstat (limited to 'tools')
-rw-r--r--tools/arch/arm64/include/uapi/asm/kvm.h6
-rw-r--r--tools/arch/x86/include/asm/cpufeatures.h11
-rw-r--r--tools/arch/x86/include/uapi/asm/kvm.h1
-rw-r--r--tools/bpf/bpftool/Documentation/bpftool-btf.rst9
-rw-r--r--tools/bpf/bpftool/Makefile7
-rw-r--r--tools/bpf/bpftool/bash-completion/bpftool7
-rw-r--r--tools/bpf/bpftool/btf.c51
-rw-r--r--tools/bpf/bpftool/cfg.c1
-rw-r--r--tools/bpf/bpftool/feature.c23
-rw-r--r--tools/bpf/bpftool/prog.c17
-rw-r--r--tools/bpf/resolve_btfids/main.c12
-rw-r--r--tools/build/Build.include2
-rw-r--r--tools/build/Makefile.build20
-rw-r--r--tools/build/Makefile.feature46
-rw-r--r--tools/build/feature/Makefile10
-rw-r--r--tools/build/feature/test-all.c15
-rw-r--r--tools/build/feature/test-libaudit.c11
-rw-r--r--tools/build/feature/test-libelf-zstd.c9
-rw-r--r--tools/hv/.gitignore3
-rw-r--r--tools/hv/hv_fcopy_uio_daemon.c12
-rwxr-xr-xtools/hv/hv_get_dns_info.sh4
-rw-r--r--tools/hv/hv_kvp_daemon.c9
-rwxr-xr-xtools/hv/hv_set_ifconfig.sh2
-rw-r--r--tools/include/linux/filter.h10
-rw-r--r--tools/include/linux/objtool_types.h12
-rw-r--r--tools/include/nolibc/sys.h18
-rw-r--r--tools/include/uapi/asm-generic/mman.h4
-rw-r--r--tools/include/uapi/asm-generic/socket.h2
-rw-r--r--tools/include/uapi/asm-generic/unistd.h11
-rw-r--r--tools/include/uapi/drm/drm.h17
-rw-r--r--tools/include/uapi/linux/bpf.h10
-rw-r--r--tools/include/uapi/linux/if_link.h2
-rw-r--r--tools/include/uapi/linux/if_xdp.h4
-rw-r--r--tools/include/uapi/linux/kvm.h8
-rw-r--r--tools/include/uapi/linux/perf_event.h11
-rw-r--r--tools/include/uapi/linux/stddef.h15
-rw-r--r--tools/lib/api/fs/fs.c6
-rw-r--r--tools/lib/bpf/bpf.c3
-rw-r--r--tools/lib/bpf/bpf.h5
-rw-r--r--tools/lib/bpf/btf.c3
-rw-r--r--tools/lib/bpf/btf_relocate.c2
-rw-r--r--tools/lib/bpf/libbpf.c53
-rw-r--r--tools/lib/bpf/libbpf.h9
-rw-r--r--tools/lib/bpf/libbpf.map4
-rw-r--r--tools/lib/bpf/linker.c248
-rw-r--r--tools/lib/bpf/usdt.c2
-rw-r--r--tools/lib/perf/Documentation/libperf.txt1
-rw-r--r--tools/lib/perf/cpumap.c131
-rw-r--r--tools/lib/perf/evlist.c20
-rw-r--r--tools/lib/perf/include/internal/cpumap.h4
-rw-r--r--tools/lib/perf/include/perf/cpumap.h6
-rw-r--r--tools/lib/perf/libperf.map1
-rw-r--r--tools/net/ynl/Makefile29
-rw-r--r--tools/net/ynl/generated/.gitignore1
-rw-r--r--tools/net/ynl/generated/Makefile51
-rw-r--r--tools/net/ynl/lib/.gitignore1
-rw-r--r--tools/net/ynl/lib/Makefile1
-rw-r--r--tools/net/ynl/pyproject.toml24
-rw-r--r--tools/net/ynl/pyynl/.gitignore2
-rw-r--r--tools/net/ynl/pyynl/__init__.py0
-rwxr-xr-xtools/net/ynl/pyynl/cli.py (renamed from tools/net/ynl/cli.py)45
-rwxr-xr-xtools/net/ynl/pyynl/ethtool.py (renamed from tools/net/ynl/ethtool.py)7
-rw-r--r--tools/net/ynl/pyynl/lib/__init__.py (renamed from tools/net/ynl/lib/__init__.py)0
-rw-r--r--tools/net/ynl/pyynl/lib/nlspec.py (renamed from tools/net/ynl/lib/nlspec.py)5
-rw-r--r--tools/net/ynl/pyynl/lib/ynl.py (renamed from tools/net/ynl/lib/ynl.py)80
-rwxr-xr-xtools/net/ynl/pyynl/ynl_gen_c.py (renamed from tools/net/ynl/ynl-gen-c.py)201
-rwxr-xr-xtools/net/ynl/pyynl/ynl_gen_rst.py (renamed from tools/net/ynl/ynl-gen-rst.py)0
-rwxr-xr-xtools/net/ynl/ynl-regen.sh2
-rw-r--r--tools/objtool/arch/loongarch/special.c3
-rw-r--r--tools/objtool/arch/powerpc/special.c3
-rw-r--r--tools/objtool/arch/x86/special.c4
-rw-r--r--tools/objtool/check.c435
-rw-r--r--tools/objtool/include/objtool/check.h5
-rw-r--r--tools/objtool/include/objtool/special.h3
-rw-r--r--tools/objtool/noreturns.h1
-rw-r--r--tools/perf/Documentation/perf-arm-spe.txt26
-rw-r--r--tools/perf/Documentation/perf-check.txt2
-rw-r--r--tools/perf/Documentation/perf-config.txt2
-rw-r--r--tools/perf/Documentation/perf-ftrace.txt19
-rw-r--r--tools/perf/Documentation/perf-intel-pt.txt596
-rw-r--r--tools/perf/Documentation/perf-lock.txt4
-rw-r--r--tools/perf/Documentation/perf-record.txt4
-rw-r--r--tools/perf/Documentation/perf-test.txt20
-rw-r--r--tools/perf/Documentation/perf-trace.txt5
-rw-r--r--tools/perf/MANIFEST3
-rw-r--r--tools/perf/Makefile.config132
-rw-r--r--tools/perf/Makefile.perf56
-rw-r--r--tools/perf/arch/alpha/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/alpha/entry/syscalls/Makefile.syscalls5
-rw-r--r--tools/perf/arch/alpha/entry/syscalls/syscall.tbl504
-rw-r--r--tools/perf/arch/alpha/include/syscall_table.h2
-rw-r--r--tools/perf/arch/arc/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/arc/entry/syscalls/Makefile.syscalls3
-rw-r--r--tools/perf/arch/arc/include/syscall_table.h2
-rw-r--r--tools/perf/arch/arm/entry/syscalls/Kbuild4
-rw-r--r--tools/perf/arch/arm/entry/syscalls/Makefile.syscalls2
-rw-r--r--tools/perf/arch/arm/entry/syscalls/syscall.tbl483
-rw-r--r--tools/perf/arch/arm/include/syscall_table.h2
-rw-r--r--tools/perf/arch/arm64/Makefile22
-rw-r--r--tools/perf/arch/arm64/entry/syscalls/Kbuild3
-rw-r--r--tools/perf/arch/arm64/entry/syscalls/Makefile.syscalls6
-rwxr-xr-xtools/perf/arch/arm64/entry/syscalls/mksyscalltbl46
-rw-r--r--tools/perf/arch/arm64/entry/syscalls/syscall_32.tbl476
l---------tools/perf/arch/arm64/entry/syscalls/syscall_64.tbl1
-rw-r--r--tools/perf/arch/arm64/include/syscall_table.h8
-rw-r--r--tools/perf/arch/arm64/util/arm-spe.c90
-rw-r--r--tools/perf/arch/csky/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/csky/entry/syscalls/Makefile.syscalls3
-rw-r--r--tools/perf/arch/csky/include/syscall_table.h2
-rw-r--r--tools/perf/arch/loongarch/Makefile22
-rw-r--r--tools/perf/arch/loongarch/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/loongarch/entry/syscalls/Makefile.syscalls3
-rwxr-xr-xtools/perf/arch/loongarch/entry/syscalls/mksyscalltbl45
-rw-r--r--tools/perf/arch/loongarch/include/syscall_table.h2
-rw-r--r--tools/perf/arch/mips/Makefile18
-rw-r--r--tools/perf/arch/mips/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/mips/entry/syscalls/Makefile.syscalls5
-rw-r--r--tools/perf/arch/mips/entry/syscalls/mksyscalltbl32
-rw-r--r--tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl4
-rw-r--r--tools/perf/arch/mips/include/syscall_table.h2
-rw-r--r--tools/perf/arch/parisc/entry/syscalls/Kbuild3
-rw-r--r--tools/perf/arch/parisc/entry/syscalls/Makefile.syscalls6
-rw-r--r--tools/perf/arch/parisc/entry/syscalls/syscall.tbl463
-rw-r--r--tools/perf/arch/parisc/include/syscall_table.h8
-rw-r--r--tools/perf/arch/powerpc/Makefile25
-rw-r--r--tools/perf/arch/powerpc/entry/syscalls/Kbuild3
-rw-r--r--tools/perf/arch/powerpc/entry/syscalls/Makefile.syscalls6
-rwxr-xr-xtools/perf/arch/powerpc/entry/syscalls/mksyscalltbl39
-rw-r--r--tools/perf/arch/powerpc/entry/syscalls/syscall.tbl4
-rw-r--r--tools/perf/arch/powerpc/include/syscall_table.h8
-rw-r--r--tools/perf/arch/powerpc/util/perf_regs.c3
-rw-r--r--tools/perf/arch/riscv/Makefile22
-rw-r--r--tools/perf/arch/riscv/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/riscv/entry/syscalls/Makefile.syscalls4
-rwxr-xr-xtools/perf/arch/riscv/entry/syscalls/mksyscalltbl47
-rw-r--r--tools/perf/arch/riscv/include/syscall_table.h8
-rw-r--r--tools/perf/arch/s390/Makefile21
-rw-r--r--tools/perf/arch/s390/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/s390/entry/syscalls/Makefile.syscalls5
-rwxr-xr-xtools/perf/arch/s390/entry/syscalls/mksyscalltbl32
-rw-r--r--tools/perf/arch/s390/entry/syscalls/syscall.tbl4
-rw-r--r--tools/perf/arch/s390/include/syscall_table.h2
-rw-r--r--tools/perf/arch/sh/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/sh/entry/syscalls/Makefile.syscalls4
-rw-r--r--tools/perf/arch/sh/entry/syscalls/syscall.tbl472
-rw-r--r--tools/perf/arch/sh/include/syscall_table.h2
-rw-r--r--tools/perf/arch/sparc/entry/syscalls/Kbuild3
-rw-r--r--tools/perf/arch/sparc/entry/syscalls/Makefile.syscalls5
-rw-r--r--tools/perf/arch/sparc/entry/syscalls/syscall.tbl514
-rw-r--r--tools/perf/arch/sparc/include/syscall_table.h8
-rw-r--r--tools/perf/arch/x86/Build1
-rw-r--r--tools/perf/arch/x86/Makefile25
-rw-r--r--tools/perf/arch/x86/entry/syscalls/Kbuild3
-rw-r--r--tools/perf/arch/x86/entry/syscalls/Makefile.syscalls6
-rw-r--r--tools/perf/arch/x86/entry/syscalls/syscall_32.tbl4
-rw-r--r--tools/perf/arch/x86/entry/syscalls/syscall_64.tbl4
-rwxr-xr-xtools/perf/arch/x86/entry/syscalls/syscalltbl.sh42
-rw-r--r--tools/perf/arch/x86/include/syscall_table.h8
-rw-r--r--tools/perf/arch/x86/util/Build2
-rw-r--r--tools/perf/arch/x86/util/iostat.c4
-rw-r--r--tools/perf/arch/xtensa/entry/syscalls/Kbuild2
-rw-r--r--tools/perf/arch/xtensa/entry/syscalls/Makefile.syscalls4
-rw-r--r--tools/perf/arch/xtensa/entry/syscalls/syscall.tbl439
-rw-r--r--tools/perf/arch/xtensa/include/syscall_table.h2
-rw-r--r--tools/perf/bench/epoll-wait.c7
-rw-r--r--tools/perf/bench/inject-buildid.c13
-rw-r--r--tools/perf/builtin-annotate.c1
-rw-r--r--tools/perf/builtin-check.c2
-rw-r--r--tools/perf/builtin-config.c38
-rw-r--r--tools/perf/builtin-diff.c5
-rw-r--r--tools/perf/builtin-ftrace.c152
-rw-r--r--tools/perf/builtin-help.c2
-rw-r--r--tools/perf/builtin-inject.c8
-rw-r--r--tools/perf/builtin-kmem.c12
-rw-r--r--tools/perf/builtin-kvm.c61
-rw-r--r--tools/perf/builtin-kwork.c7
-rw-r--r--tools/perf/builtin-lock.c281
-rw-r--r--tools/perf/builtin-mem.c1
-rw-r--r--tools/perf/builtin-record.c6
-rw-r--r--tools/perf/builtin-report.c6
-rw-r--r--tools/perf/builtin-sched.c1
-rw-r--r--tools/perf/builtin-script.c404
-rw-r--r--tools/perf/builtin-stat.c27
-rw-r--r--tools/perf/builtin-top.c6
-rw-r--r--tools/perf/builtin-trace.c131
-rw-r--r--tools/perf/builtin.h6
-rwxr-xr-xtools/perf/check-headers.sh9
-rw-r--r--tools/perf/perf.c6
-rw-r--r--tools/perf/perf.h2
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/exception.json2
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/general.json2
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l1d_cache.json6
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l2_cache.json14
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l3_cache.json4
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/ll_cache.json4
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/memory.json2
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/metrics.json93
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/retired.json4
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/spec_operation.json14
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/stall.json8
-rw-r--r--tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/tlb.json4
-rw-r--r--tools/perf/pmu-events/arch/arm64/common-and-microarch.json715
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/core-imp-def.json6
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/cycle_accounting.json122
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/energy.json17
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/exception.json42
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/fp_operation.json209
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/gcycle.json97
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/general.json10
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/hwpf.json52
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1d_cache.json113
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1i_cache.json52
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l2_cache.json160
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l3_cache.json159
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/ll_cache.json10
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/memory.json10
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pipeline.json208
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pmu.json10
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/retired.json30
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/spec_operation.json171
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/stall.json94
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/sve.json254
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/tlb.json362
-rw-r--r--tools/perf/pmu-events/arch/arm64/fujitsu/monaka/trace.json18
-rw-r--r--tools/perf/pmu-events/arch/arm64/mapfile.csv1
-rw-r--r--tools/perf/pmu-events/arch/arm64/recommended.json5
-rwxr-xr-xtools/perf/pmu-events/jevents.py16
-rw-r--r--tools/perf/scripts/Makefile.syscalls61
-rw-r--r--tools/perf/scripts/python/Perf-Trace-Util/Context.c20
-rw-r--r--tools/perf/scripts/python/mem-phys-addr.py177
-rwxr-xr-xtools/perf/scripts/syscalltbl.sh86
-rw-r--r--tools/perf/tests/Build6
-rw-r--r--tools/perf/tests/builtin-test.c227
-rw-r--r--tools/perf/tests/code-reading.c92
-rw-r--r--tools/perf/tests/cpumap.c62
-rw-r--r--tools/perf/tests/event_groups.c31
-rw-r--r--tools/perf/tests/expr.c19
-rw-r--r--tools/perf/tests/hwmon_pmu.c29
-rw-r--r--tools/perf/tests/make7
-rw-r--r--tools/perf/tests/parse-events.c25
-rwxr-xr-xtools/perf/tests/shell/base_probe/test_adding_blacklisted.sh4
-rwxr-xr-xtools/perf/tests/shell/base_probe/test_adding_kernel.sh8
-rwxr-xr-xtools/perf/tests/shell/base_probe/test_basic.sh4
-rwxr-xr-xtools/perf/tests/shell/base_probe/test_invalid_options.sh9
-rwxr-xr-xtools/perf/tests/shell/base_probe/test_line_semantics.sh9
-rwxr-xr-xtools/perf/tests/shell/base_report/setup.sh2
-rwxr-xr-xtools/perf/tests/shell/base_report/test_basic.sh2
-rw-r--r--tools/perf/tests/shell/common/init.sh7
-rw-r--r--tools/perf/tests/shell/coresight/Makefile2
-rwxr-xr-xtools/perf/tests/shell/ftrace.sh5
-rw-r--r--tools/perf/tests/shell/lib/perf_json_output_lint.py14
-rwxr-xr-xtools/perf/tests/shell/perftool-testsuite_probe.sh2
-rwxr-xr-xtools/perf/tests/shell/record+probe_libc_inet_pton.sh36
-rwxr-xr-xtools/perf/tests/shell/stat+std_output.sh2
-rwxr-xr-xtools/perf/tests/shell/stat.sh6
-rwxr-xr-xtools/perf/tests/shell/test_arm_spe.sh30
-rwxr-xr-xtools/perf/tests/shell/test_brstack.sh4
-rwxr-xr-xtools/perf/tests/shell/test_intel_pt.sh28
-rwxr-xr-xtools/perf/tests/shell/test_task_analyzer.sh2
-rwxr-xr-xtools/perf/tests/shell/trace_btf_general.sh94
-rw-r--r--tools/perf/tests/sigtrap.c20
-rw-r--r--tools/perf/tests/stat.c16
-rw-r--r--tools/perf/tests/switch-tracking.c2
-rw-r--r--tools/perf/tests/tests-scripts.c2
-rw-r--r--tools/perf/tests/tests.h10
-rw-r--r--tools/perf/tests/workloads/landlock.c2
-rwxr-xr-xtools/perf/trace/beauty/arch_errno_names.sh3
-rwxr-xr-xtools/perf/trace/beauty/fs_at_flags.sh3
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/fcntl.h5
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/mount.h14
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/prctl.h27
-rw-r--r--tools/perf/ui/browsers/annotate.c2
-rw-r--r--tools/perf/ui/browsers/scripts.c177
-rw-r--r--tools/perf/ui/gtk/annotate.c16
-rw-r--r--tools/perf/ui/hist.c2
-rw-r--r--tools/perf/util/Build7
-rw-r--r--tools/perf/util/annotate.c32
-rw-r--r--tools/perf/util/annotate.h21
-rw-r--r--tools/perf/util/arm-spe-decoder/arm-spe-decoder.h9
-rw-r--r--tools/perf/util/arm-spe.c86
-rw-r--r--tools/perf/util/auxtrace.c67
-rw-r--r--tools/perf/util/auxtrace.h6
-rw-r--r--tools/perf/util/bpf-event.c10
-rw-r--r--tools/perf/util/bpf_ftrace.c15
-rw-r--r--tools/perf/util/bpf_kwork.c2
-rw-r--r--tools/perf/util/bpf_kwork_top.c2
-rw-r--r--tools/perf/util/bpf_lock_contention.c142
-rw-r--r--tools/perf/util/bpf_off_cpu.c5
-rw-r--r--tools/perf/util/bpf_skel/func_latency.bpf.c46
-rw-r--r--tools/perf/util/bpf_skel/kwork_top.bpf.c4
-rw-r--r--tools/perf/util/bpf_skel/lock_contention.bpf.c95
-rw-r--r--tools/perf/util/bpf_skel/lock_data.h15
-rw-r--r--tools/perf/util/bpf_skel/vmlinux/vmlinux.h8
-rw-r--r--tools/perf/util/btf.c27
-rw-r--r--tools/perf/util/btf.h10
-rw-r--r--tools/perf/util/build-id.c4
-rw-r--r--tools/perf/util/cgroup.c2
-rw-r--r--tools/perf/util/config.c27
-rw-r--r--tools/perf/util/config.h1
-rw-r--r--tools/perf/util/data-convert-bt.c10
-rw-r--r--tools/perf/util/data-convert-json.c8
-rw-r--r--tools/perf/util/disasm.c5
-rw-r--r--tools/perf/util/dlfilter.c3
-rw-r--r--tools/perf/util/env.c30
-rw-r--r--tools/perf/util/env.h6
-rw-r--r--tools/perf/util/evsel.c316
-rw-r--r--tools/perf/util/evsel.h13
-rw-r--r--tools/perf/util/evsel_config.h1
-rw-r--r--tools/perf/util/evsel_fprintf.c4
-rw-r--r--tools/perf/util/expr.c5
-rw-r--r--tools/perf/util/ftrace.h9
-rwxr-xr-xtools/perf/util/generate-cmdlist.sh4
-rw-r--r--tools/perf/util/header.c8
-rw-r--r--tools/perf/util/hist.c114
-rw-r--r--tools/perf/util/hist.h14
-rw-r--r--tools/perf/util/hwmon_pmu.c15
-rw-r--r--tools/perf/util/intel-pt-decoder/Build18
-rw-r--r--tools/perf/util/intel-pt-decoder/intel-pt-insn-decoder.c3
-rw-r--r--tools/perf/util/jitdump.c15
-rw-r--r--tools/perf/util/kvm-stat.c70
-rw-r--r--tools/perf/util/kvm-stat.h3
-rw-r--r--tools/perf/util/kwork.h7
-rw-r--r--tools/perf/util/llvm-c-helpers.cpp1
-rw-r--r--tools/perf/util/lock-contention.c143
-rw-r--r--tools/perf/util/lock-contention.h20
-rw-r--r--tools/perf/util/machine.c6
-rw-r--r--tools/perf/util/maps.c7
-rw-r--r--tools/perf/util/mem-events.c5
-rw-r--r--tools/perf/util/namespaces.c7
-rw-r--r--tools/perf/util/namespaces.h3
-rw-r--r--tools/perf/util/parse-events.c26
-rw-r--r--tools/perf/util/parse-events.h1
-rw-r--r--tools/perf/util/parse-events.l1
-rw-r--r--tools/perf/util/path.c8
-rw-r--r--tools/perf/util/path.h2
-rw-r--r--tools/perf/util/perf_event_attr_fprintf.c7
-rw-r--r--tools/perf/util/pmu.c31
-rw-r--r--tools/perf/util/probe-event.c52
-rw-r--r--tools/perf/util/probe-event.h1
-rw-r--r--tools/perf/util/probe-finder.c15
-rw-r--r--tools/perf/util/probe-finder.h5
-rw-r--r--tools/perf/util/python.c341
-rw-r--r--tools/perf/util/scripting-engines/trace-event-perl.c3
-rw-r--r--tools/perf/util/scripting-engines/trace-event-python.c66
-rw-r--r--tools/perf/util/session.c1
-rw-r--r--tools/perf/util/sort.c33
-rw-r--r--tools/perf/util/stat-display.c242
-rw-r--r--tools/perf/util/stat-shadow.c5
-rw-r--r--tools/perf/util/stat.h3
-rw-r--r--tools/perf/util/stream.c7
-rw-r--r--tools/perf/util/stream.h10
-rw-r--r--tools/perf/util/string.c15
-rw-r--r--tools/perf/util/svghelper.c1
-rw-r--r--tools/perf/util/symbol-elf.c6
-rw-r--r--tools/perf/util/symbol.c9
-rw-r--r--tools/perf/util/synthetic-events.c14
-rw-r--r--tools/perf/util/syscalltbl.c90
-rw-r--r--tools/perf/util/syscalltbl.h1
-rw-r--r--tools/perf/util/trace-event-parse.c2
-rw-r--r--tools/perf/util/trace-event-scripting.c187
-rw-r--r--tools/perf/util/trace-event.h7
-rw-r--r--tools/perf/util/values.c106
-rw-r--r--tools/perf/util/values.h9
-rw-r--r--tools/power/cpupower/Makefile8
-rw-r--r--tools/power/cpupower/bindings/python/Makefile10
-rw-r--r--tools/power/cpupower/bindings/python/README25
-rw-r--r--tools/power/cpupower/bindings/python/raw_pylibcpupower.swg5
-rw-r--r--tools/power/cpupower/lib/cpufreq.c18
-rw-r--r--tools/power/cpupower/lib/cpufreq.h8
-rw-r--r--tools/power/cpupower/utils/cpufreq-info.c36
-rw-r--r--tools/power/cpupower/utils/helpers/amd.c18
-rw-r--r--tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c4
-rw-r--r--tools/power/cpupower/utils/idle_monitor/mperf_monitor.c17
-rw-r--r--tools/power/cpupower/utils/idle_monitor/nhm_idle.c2
-rw-r--r--tools/power/cpupower/utils/idle_monitor/snb_idle.c4
-rw-r--r--tools/power/x86/intel-speed-select/isst-config.c2
-rw-r--r--tools/power/x86/intel-speed-select/isst-core-tpmi.c2
-rw-r--r--tools/sched_ext/include/scx/common.bpf.h184
-rw-r--r--tools/sched_ext/include/scx/common.h6
-rw-r--r--tools/sched_ext/include/scx/compat.bpf.h5
-rw-r--r--tools/sched_ext/include/scx/compat.h1
-rw-r--r--tools/sched_ext/include/scx/enums.autogen.bpf.h105
-rw-r--r--tools/sched_ext/include/scx/enums.autogen.h41
-rw-r--r--tools/sched_ext/include/scx/enums.bpf.h12
-rw-r--r--tools/sched_ext/include/scx/enums.h27
-rw-r--r--tools/sched_ext/include/scx/user_exit_info.h9
-rw-r--r--tools/sched_ext/scx_central.bpf.c13
-rw-r--r--tools/sched_ext/scx_central.c3
-rw-r--r--tools/sched_ext/scx_flatcg.bpf.c25
-rw-r--r--tools/sched_ext/scx_flatcg.c1
-rw-r--r--tools/sched_ext/scx_qmap.bpf.c2
-rw-r--r--tools/sched_ext/scx_qmap.c2
-rw-r--r--tools/sched_ext/scx_simple.bpf.c9
-rw-r--r--tools/scripts/Makefile.arch4
-rw-r--r--tools/scripts/syscall.tbl409
-rw-r--r--tools/testing/cxl/cxl_core_exports.c2
-rw-r--r--tools/testing/cxl/test/cxl.c4
-rw-r--r--tools/testing/cxl/test/mem.c2
-rw-r--r--tools/testing/cxl/test/mock.c28
-rw-r--r--tools/testing/ktest/examples/include/defaults.conf2
-rwxr-xr-xtools/testing/ktest/ktest.pl9
-rwxr-xr-xtools/testing/kunit/kunit.py11
-rw-r--r--tools/testing/kunit/kunit_kernel.py3
-rw-r--r--tools/testing/kunit/qemu_configs/arm64.py2
-rw-r--r--tools/testing/nvdimm/test/ndtest.c2
-rw-r--r--tools/testing/selftests/acct/acct_syscall.c2
-rw-r--r--tools/testing/selftests/alsa/Makefile2
-rw-r--r--tools/testing/selftests/arm64/abi/hwcap.c235
-rw-r--r--tools/testing/selftests/arm64/abi/syscall-abi-asm.S32
-rw-r--r--tools/testing/selftests/arm64/fp/kernel-test.c3
-rw-r--r--tools/testing/selftests/bpf/.gitignore2
-rw-r--r--tools/testing/selftests/bpf/Makefile116
-rw-r--r--tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile19
-rw-r--r--tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile19
-rw-r--r--tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile19
-rw-r--r--tools/testing/selftests/bpf/bpf_testmod/Makefile20
-rw-r--r--tools/testing/selftests/bpf/config1
-rw-r--r--tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c (renamed from tools/testing/selftests/bpf/test_lpm_map.c)405
-rw-r--r--tools/testing/selftests/bpf/map_tests/task_storage_map.c4
-rw-r--r--tools/testing/selftests/bpf/network_helpers.c2
-rw-r--r--tools/testing/selftests/bpf/network_helpers.h96
-rw-r--r--tools/testing/selftests/bpf/prog_tests/btf_distill.c76
-rw-r--r--tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c28
-rw-r--r--tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c107
-rw-r--r--tools/testing/selftests/bpf/prog_tests/core_reloc.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/fd_array.c441
-rw-r--r--tools/testing/selftests/bpf/prog_tests/fill_link_info.c4
-rw-r--r--tools/testing/selftests/bpf/prog_tests/flow_dissector.c329
-rw-r--r--tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c792
-rw-r--r--tools/testing/selftests/bpf/prog_tests/free_timer.c165
-rw-r--r--tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c27
-rw-r--r--tools/testing/selftests/bpf/prog_tests/missed.c1
-rw-r--r--tools/testing/selftests/bpf/prog_tests/raw_tp_null.c3
-rw-r--r--tools/testing/selftests/bpf/prog_tests/socket_helpers.h394
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockmap_basic.c136
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h385
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockopt_sk.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/task_local_storage.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_change_tail.c62
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_netkit.c49
-rw-r--r--tools/testing/selftests/bpf/prog_tests/verifier.c25
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_bonding.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c87
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c166
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_metadata.c21
-rw-r--r--tools/testing/selftests/bpf/progs/bad_struct_ops.c2
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_misc.h12
-rw-r--r--tools/testing/selftests/bpf/progs/cb_refs.c2
-rw-r--r--tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c15
-rw-r--r--tools/testing/selftests/bpf/progs/changes_pkt_data.c39
-rw-r--r--tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c18
-rw-r--r--tools/testing/selftests/bpf/progs/dynptr_fail.c28
-rw-r--r--tools/testing/selftests/bpf/progs/epilogue_exit.c4
-rw-r--r--tools/testing/selftests/bpf/progs/epilogue_tailcall.c4
-rw-r--r--tools/testing/selftests/bpf/progs/exceptions_fail.c4
-rw-r--r--tools/testing/selftests/bpf/progs/free_timer.c71
-rw-r--r--tools/testing/selftests/bpf/progs/irq.c444
-rw-r--r--tools/testing/selftests/bpf/progs/iters.c40
-rw-r--r--tools/testing/selftests/bpf/progs/iters_state_safety.c14
-rw-r--r--tools/testing/selftests/bpf/progs/iters_testmod.c2
-rw-r--r--tools/testing/selftests/bpf/progs/iters_testmod_seq.c4
-rw-r--r--tools/testing/selftests/bpf/progs/jit_probe_mem.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_destructive.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_fail.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_race.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_test.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c2
-rw-r--r--tools/testing/selftests/bpf/progs/local_kptr_stash.c2
-rw-r--r--tools/testing/selftests/bpf/progs/map_kptr.c2
-rw-r--r--tools/testing/selftests/bpf/progs/map_kptr_fail.c4
-rw-r--r--tools/testing/selftests/bpf/progs/missed_kprobe.c2
-rw-r--r--tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c8
-rw-r--r--tools/testing/selftests/bpf/progs/nested_acquire.c2
-rw-r--r--tools/testing/selftests/bpf/progs/preempt_lock.c28
-rw-r--r--tools/testing/selftests/bpf/progs/pro_epilogue.c4
-rw-r--r--tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c4
-rw-r--r--tools/testing/selftests/bpf/progs/raw_tp_null.c19
-rw-r--r--tools/testing/selftests/bpf/progs/raw_tp_null_fail.c24
-rw-r--r--tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c4
-rw-r--r--tools/testing/selftests/bpf/progs/sock_addr_kern.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_detach.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_module.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_private_stack.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c2
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c2
-rw-r--r--tools/testing/selftests/bpf/progs/syscall.c6
-rw-r--r--tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c4
-rw-r--r--tools/testing/selftests/bpf/progs/tc_bpf2bpf.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_cls_redirect.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_cls_redirect.h2
-rw-r--r--tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_fill_link_info.c13
-rw-r--r--tools/testing/selftests/bpf/progs/test_global_func10.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_module_attach.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c40
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_change_tail.c106
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_link.c15
-rw-r--r--tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c8
-rw-r--r--tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c12
-rw-r--r--tools/testing/selftests/bpf/progs/test_xdp_meta.c4
-rw-r--r--tools/testing/selftests/bpf/progs/test_xdp_redirect.c26
-rw-r--r--tools/testing/selftests/bpf/progs/uninit_stack.c5
-rw-r--r--tools/testing/selftests/bpf/progs/unsupported_ops.c2
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_array_access.c188
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_basic_stack.c2
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_bits_iter.c8
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_bounds.c134
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c40
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_const_or.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_d_path.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c12
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_int_ptr.c2
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_map_in_map.c2
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_may_goto_1.c97
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_may_goto_2.c28
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_mtu.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_raw_stack.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_sock.c56
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_spill_fill.c35
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_spin_lock.c28
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_unpriv.c2
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_var_off.c8
-rw-r--r--tools/testing/selftests/bpf/progs/wq.c2
-rw-r--r--tools/testing/selftests/bpf/progs/wq_failures.c2
-rw-r--r--tools/testing/selftests/bpf/sdt.h2
-rwxr-xr-xtools/testing/selftests/bpf/test_bpftool_synctypes.py28
-rw-r--r--tools/testing/selftests/bpf/test_flow_dissector.c780
-rwxr-xr-xtools/testing/selftests/bpf/test_flow_dissector.sh178
-rw-r--r--tools/testing/selftests/bpf/test_kmods/.gitignore (renamed from tools/testing/selftests/bpf/bpf_testmod/.gitignore)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/Makefile21
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_x.c (renamed from tools/testing/selftests/bpf/bpf_test_modorder_x/bpf_test_modorder_x.c)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_y.c (renamed from tools/testing/selftests/bpf/bpf_test_modorder_y/bpf_test_modorder_y.c)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_test_no_cfi.c (renamed from tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_testmod-events.h (renamed from tools/testing/selftests/bpf/bpf_testmod/bpf_testmod-events.h)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_testmod.c (renamed from tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_testmod.h (renamed from tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.h)0
-rw-r--r--tools/testing/selftests/bpf/test_kmods/bpf_testmod_kfunc.h (renamed from tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h)0
-rw-r--r--tools/testing/selftests/bpf/test_loader.c46
-rw-r--r--tools/testing/selftests/bpf/test_progs.c15
-rw-r--r--tools/testing/selftests/bpf/test_progs.h15
-rw-r--r--tools/testing/selftests/bpf/test_sockmap.c6
-rwxr-xr-xtools/testing/selftests/bpf/test_tc_tunnel.sh1
-rwxr-xr-xtools/testing/selftests/bpf/test_xdp_meta.sh58
-rwxr-xr-xtools/testing/selftests/bpf/test_xdp_redirect.sh79
-rw-r--r--tools/testing/selftests/bpf/trace_helpers.c4
-rw-r--r--tools/testing/selftests/bpf/verifier/calls.c2
-rw-r--r--tools/testing/selftests/bpf/verifier/map_kptr.c2
-rw-r--r--tools/testing/selftests/bpf/veristat.c159
-rw-r--r--tools/testing/selftests/bpf/xdp_hw_metadata.c5
-rwxr-xr-xtools/testing/selftests/cgroup/test_cpuset_prs.sh33
-rw-r--r--tools/testing/selftests/coredump/Makefile7
-rw-r--r--tools/testing/selftests/coredump/README.rst50
-rwxr-xr-xtools/testing/selftests/coredump/stackdump14
-rw-r--r--tools/testing/selftests/coredump/stackdump_test.c151
-rw-r--r--tools/testing/selftests/cpufreq/.gitignore2
-rw-r--r--tools/testing/selftests/cpufreq/Makefile1
-rw-r--r--tools/testing/selftests/damon/Makefile2
-rw-r--r--tools/testing/selftests/drivers/net/Makefile3
-rw-r--r--tools/testing/selftests/drivers/net/bonding/Makefile2
-rwxr-xr-xtools/testing/selftests/drivers/net/bonding/bond_macvlan.sh99
-rwxr-xr-xtools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh96
-rw-r--r--tools/testing/selftests/drivers/net/bonding/config1
-rwxr-xr-xtools/testing/selftests/drivers/net/hds.py120
-rw-r--r--tools/testing/selftests/drivers/net/hw/ncdevmem.c3
-rwxr-xr-xtools/testing/selftests/drivers/net/hw/pp_alloc_fail.py6
-rwxr-xr-xtools/testing/selftests/drivers/net/hw/rss_ctx.py12
-rw-r--r--tools/testing/selftests/drivers/net/lib/py/env.py10
-rw-r--r--tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh225
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_lag.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh55
-rwxr-xr-xtools/testing/selftests/drivers/net/netcons_basic.sh218
-rwxr-xr-xtools/testing/selftests/drivers/net/netcons_overflow.sh67
-rwxr-xr-xtools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh9
-rwxr-xr-xtools/testing/selftests/drivers/net/queues.py51
-rwxr-xr-xtools/testing/selftests/drivers/net/stats.py113
-rw-r--r--tools/testing/selftests/exec/.gitignore4
-rw-r--r--tools/testing/selftests/exec/Makefile19
-rwxr-xr-xtools/testing/selftests/exec/check-exec-tests.sh205
-rw-r--r--tools/testing/selftests/exec/check-exec.c456
-rw-r--r--tools/testing/selftests/exec/config2
-rw-r--r--tools/testing/selftests/exec/execveat.c75
-rw-r--r--tools/testing/selftests/exec/false.c5
-rw-r--r--tools/testing/selftests/filesystems/nsfs/.gitignore (renamed from tools/testing/selftests/nsfs/.gitignore)1
-rw-r--r--tools/testing/selftests/filesystems/nsfs/Makefile (renamed from tools/testing/selftests/nsfs/Makefile)4
-rw-r--r--tools/testing/selftests/filesystems/nsfs/config (renamed from tools/testing/selftests/nsfs/config)0
-rw-r--r--tools/testing/selftests/filesystems/nsfs/iterate_mntns.c149
-rw-r--r--tools/testing/selftests/filesystems/nsfs/owner.c (renamed from tools/testing/selftests/nsfs/owner.c)0
-rw-r--r--tools/testing/selftests/filesystems/nsfs/pidns.c (renamed from tools/testing/selftests/nsfs/pidns.c)0
-rw-r--r--tools/testing/selftests/filesystems/statmount/.gitignore1
-rw-r--r--tools/testing/selftests/filesystems/statmount/Makefile2
-rw-r--r--tools/testing/selftests/filesystems/statmount/listmount_test.c66
-rw-r--r--tools/testing/selftests/ftrace/Makefile2
-rw-r--r--tools/testing/selftests/ftrace/poll.c74
-rw-r--r--tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc8
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc19
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc4
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc4
-rw-r--r--tools/testing/selftests/ftrace/test.d/event/event-mod.tc191
-rw-r--r--tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc2
-rw-r--r--tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc74
-rw-r--r--tools/testing/selftests/hid/.gitignore1
-rw-r--r--tools/testing/selftests/hid/progs/hid_bpf_helpers.h19
-rwxr-xr-xtools/testing/selftests/hid/run-hid-tools-tests.sh16
-rw-r--r--tools/testing/selftests/iommu/iommufd_fail_nth.c14
-rw-r--r--tools/testing/selftests/ipc/msgque.c2
-rw-r--r--tools/testing/selftests/kselftest.h28
-rw-r--r--tools/testing/selftests/kselftest/ksft.py3
-rw-r--r--tools/testing/selftests/kselftest/ktap_helpers.sh21
-rw-r--r--tools/testing/selftests/kselftest_harness.h24
-rw-r--r--tools/testing/selftests/kvm/aarch64/set_id_regs.c1
-rw-r--r--tools/testing/selftests/kvm/s390x/ucontrol_test.c172
-rw-r--r--tools/testing/selftests/landlock/Makefile6
-rw-r--r--tools/testing/selftests/landlock/common.h38
-rw-r--r--tools/testing/selftests/landlock/fs_test.c178
-rw-r--r--tools/testing/selftests/landlock/ptrace_test.c2
-rw-r--r--tools/testing/selftests/landlock/sandbox-and-launch.c82
-rw-r--r--tools/testing/selftests/landlock/wait-pipe.c42
-rw-r--r--tools/testing/selftests/landlock/wrappers.h47
-rwxr-xr-xtools/testing/selftests/livepatch/test-callbacks.sh2
-rwxr-xr-xtools/testing/selftests/livepatch/test-sysfs.sh71
-rw-r--r--tools/testing/selftests/lsm/lsm_set_self_attr_test.c7
-rw-r--r--tools/testing/selftests/media_tests/regression_test.txt8
-rw-r--r--tools/testing/selftests/memfd/memfd_test.c57
-rw-r--r--tools/testing/selftests/mm/cow.c8
-rw-r--r--tools/testing/selftests/mm/hugetlb_dio.c14
-rw-r--r--tools/testing/selftests/net/Makefile2
-rw-r--r--tools/testing/selftests/net/busy_poller.c88
-rw-r--r--tools/testing/selftests/net/cmsg_sender.c11
-rwxr-xr-xtools/testing/selftests/net/cmsg_so_priority.sh151
-rwxr-xr-xtools/testing/selftests/net/cmsg_time.sh35
-rwxr-xr-xtools/testing/selftests/net/fdb_notify.sh6
-rwxr-xr-xtools/testing/selftests/net/fib_rule_tests.sh31
-rw-r--r--tools/testing/selftests/net/forwarding/Makefile1
-rwxr-xr-xtools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh25
-rw-r--r--tools/testing/selftests/net/forwarding/lib.sh11
-rwxr-xr-xtools/testing/selftests/net/forwarding/local_termination.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/router_bridge_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/vxlan_reserved.sh352
-rw-r--r--tools/testing/selftests/net/ipsec.c3
-rw-r--r--tools/testing/selftests/net/lib.sh68
-rw-r--r--tools/testing/selftests/net/lib/py/ksft.py5
-rw-r--r--tools/testing/selftests/net/lib/py/utils.py6
-rw-r--r--tools/testing/selftests/net/lib/py/ynl.py20
-rw-r--r--tools/testing/selftests/net/mptcp/mptcp_connect.c43
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_connect.sh13
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_join.sh9
-rw-r--r--tools/testing/selftests/net/mptcp/mptcp_lib.sh21
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_sockopt.sh17
-rwxr-xr-xtools/testing/selftests/net/mptcp/simult_flows.sh21
-rwxr-xr-xtools/testing/selftests/net/netfilter/rpath.sh18
-rwxr-xr-xtools/testing/selftests/net/nl_netdev.py19
-rwxr-xr-xtools/testing/selftests/net/openvswitch/openvswitch.sh6
-rwxr-xr-xtools/testing/selftests/net/packetdrill/ksft_runner.sh24
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt18
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt13
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt29
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt35
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt23
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt21
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt36
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt21
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt38
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt72
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt36
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt72
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt50
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt43
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt41
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt53
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt50
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt40
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt43
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt37
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt64
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt62
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt26
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt20
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt42
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt30
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt20
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt54
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt38
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt92
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt91
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt145
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt23
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt37
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt32
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt24
-rw-r--r--tools/testing/selftests/net/tls.c478
-rwxr-xr-xtools/testing/selftests/net/udpgso_bench.sh3
-rwxr-xr-xtools/testing/selftests/net/vlan_bridge_binding.sh256
-rw-r--r--tools/testing/selftests/net/ynl.mk3
-rw-r--r--tools/testing/selftests/nolibc/Makefile11
-rw-r--r--tools/testing/selftests/nolibc/nolibc-test.c44
-rwxr-xr-xtools/testing/selftests/nolibc/run-tests.sh9
-rw-r--r--tools/testing/selftests/pid_namespace/.gitignore1
-rw-r--r--tools/testing/selftests/pid_namespace/Makefile2
-rw-r--r--tools/testing/selftests/pid_namespace/pid_max.c358
-rw-r--r--tools/testing/selftests/pidfd/.gitignore2
-rw-r--r--tools/testing/selftests/pidfd/Makefile3
-rw-r--r--tools/testing/selftests/pidfd/pidfd.h40
-rw-r--r--tools/testing/selftests/pidfd/pidfd_bind_mount.c188
-rw-r--r--tools/testing/selftests/pidfd/pidfd_file_handle_test.c503
-rw-r--r--tools/testing/selftests/pidfd/pidfd_setns_test.c47
-rw-r--r--tools/testing/selftests/pidfd/pidfd_wait.c47
-rw-r--r--tools/testing/selftests/powerpc/benchmarks/gettimeofday.c2
-rw-r--r--tools/testing/selftests/powerpc/include/pkeys.h8
-rw-r--r--tools/testing/selftests/powerpc/ptrace/core-pkey.c31
-rw-r--r--tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c26
-rw-r--r--tools/testing/selftests/powerpc/vphn/test-vphn.c2
-rwxr-xr-xtools/testing/selftests/rcutorture/bin/kvm-remote.sh25
-rw-r--r--tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot1
-rw-r--r--tools/testing/selftests/resctrl/Makefile1
-rw-r--r--tools/testing/selftests/resctrl/cmt_test.c4
-rw-r--r--tools/testing/selftests/resctrl/mba_test.c2
-rw-r--r--tools/testing/selftests/resctrl/mbm_test.c4
-rw-r--r--tools/testing/selftests/resctrl/resctrl.h6
-rw-r--r--tools/testing/selftests/resctrl/resctrl_tests.c9
-rw-r--r--tools/testing/selftests/resctrl/resctrlfs.c137
-rw-r--r--tools/testing/selftests/ring-buffer/map_test.c8
-rw-r--r--tools/testing/selftests/riscv/abi/pointer_masking.c28
-rw-r--r--tools/testing/selftests/riscv/vector/v_initval_nolibc.c4
-rw-r--r--tools/testing/selftests/riscv/vector/vstate_prctl.c2
-rw-r--r--tools/testing/selftests/rseq/rseq.c32
-rw-r--r--tools/testing/selftests/rseq/rseq.h9
-rwxr-xr-xtools/testing/selftests/run_kselftest.sh2
-rw-r--r--tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/dsp_local_on.bpf.c7
-rw-r--r--tools/testing/selftests/sched_ext/dsp_local_on.c5
-rw-r--r--tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/exit.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/maximal.bpf.c8
-rw-r--r--tools/testing/selftests/sched_ext/runner.c15
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c8
-rwxr-xr-xtools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py21
-rw-r--r--tools/testing/selftests/tc-testing/tc-tests/filters/flow.json4
-rw-r--r--tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json20
-rw-r--r--tools/testing/selftests/timers/clocksource-switch.c6
-rw-r--r--tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c41
-rw-r--r--tools/testing/selftests/vDSO/parse_vdso.c110
-rw-r--r--tools/testing/selftests/zram/.gitignore2
-rw-r--r--tools/testing/shared/linux/maple_tree.h2
-rw-r--r--tools/testing/vma/linux/atomic.h2
-rw-r--r--tools/testing/vma/vma.c4
-rw-r--r--tools/testing/vma/vma_internal.h4
-rw-r--r--tools/testing/vsock/README15
-rw-r--r--tools/testing/vsock/control.c9
-rw-r--r--tools/testing/vsock/msg_zerocopy_common.c10
-rw-r--r--tools/testing/vsock/msg_zerocopy_common.h1
-rw-r--r--tools/testing/vsock/util.c175
-rw-r--r--tools/testing/vsock/util.h9
-rw-r--r--tools/testing/vsock/vsock_perf.c20
-rw-r--r--tools/testing/vsock/vsock_test.c340
-rw-r--r--tools/testing/vsock/vsock_test_zerocopy.c2
-rw-r--r--tools/testing/vsock/vsock_uring_test.c2
-rw-r--r--tools/tracing/rtla/src/timerlat_hist.c177
784 files changed, 26953 insertions, 6689 deletions
diff --git a/tools/arch/arm64/include/uapi/asm/kvm.h b/tools/arch/arm64/include/uapi/asm/kvm.h
index 964df31da975..66736ff04011 100644
--- a/tools/arch/arm64/include/uapi/asm/kvm.h
+++ b/tools/arch/arm64/include/uapi/asm/kvm.h
@@ -484,6 +484,12 @@ enum {
*/
#define KVM_SYSTEM_EVENT_RESET_FLAG_PSCI_RESET2 (1ULL << 0)
+/*
+ * Shutdown caused by a PSCI v1.3 SYSTEM_OFF2 call.
+ * Valid only when the system event has a type of KVM_SYSTEM_EVENT_SHUTDOWN.
+ */
+#define KVM_SYSTEM_EVENT_SHUTDOWN_FLAG_PSCI_OFF2 (1ULL << 0)
+
/* run->fail_entry.hardware_entry_failure_reason codes. */
#define KVM_EXIT_FAIL_ENTRY_CPU_UNSUPPORTED (1ULL << 0)
diff --git a/tools/arch/x86/include/asm/cpufeatures.h b/tools/arch/x86/include/asm/cpufeatures.h
index 23698d0f4bb4..17b6590748c0 100644
--- a/tools/arch/x86/include/asm/cpufeatures.h
+++ b/tools/arch/x86/include/asm/cpufeatures.h
@@ -215,7 +215,7 @@
#define X86_FEATURE_SPEC_STORE_BYPASS_DISABLE ( 7*32+23) /* Disable Speculative Store Bypass. */
#define X86_FEATURE_LS_CFG_SSBD ( 7*32+24) /* AMD SSBD implementation via LS_CFG MSR */
#define X86_FEATURE_IBRS ( 7*32+25) /* "ibrs" Indirect Branch Restricted Speculation */
-#define X86_FEATURE_IBPB ( 7*32+26) /* "ibpb" Indirect Branch Prediction Barrier */
+#define X86_FEATURE_IBPB ( 7*32+26) /* "ibpb" Indirect Branch Prediction Barrier without a guaranteed RSB flush */
#define X86_FEATURE_STIBP ( 7*32+27) /* "stibp" Single Thread Indirect Branch Predictors */
#define X86_FEATURE_ZEN ( 7*32+28) /* Generic flag for all Zen and newer */
#define X86_FEATURE_L1TF_PTEINV ( 7*32+29) /* L1TF workaround PTE inversion */
@@ -317,6 +317,9 @@
#define X86_FEATURE_ZEN1 (11*32+31) /* CPU based on Zen1 microarchitecture */
/* Intel-defined CPU features, CPUID level 0x00000007:1 (EAX), word 12 */
+#define X86_FEATURE_SHA512 (12*32+ 0) /* SHA512 instructions */
+#define X86_FEATURE_SM3 (12*32+ 1) /* SM3 instructions */
+#define X86_FEATURE_SM4 (12*32+ 2) /* SM4 instructions */
#define X86_FEATURE_AVX_VNNI (12*32+ 4) /* "avx_vnni" AVX VNNI instructions */
#define X86_FEATURE_AVX512_BF16 (12*32+ 5) /* "avx512_bf16" AVX512 BFLOAT16 instructions */
#define X86_FEATURE_CMPCCXADD (12*32+ 7) /* CMPccXADD instructions */
@@ -348,6 +351,7 @@
#define X86_FEATURE_CPPC (13*32+27) /* "cppc" Collaborative Processor Performance Control */
#define X86_FEATURE_AMD_PSFD (13*32+28) /* Predictive Store Forwarding Disable */
#define X86_FEATURE_BTC_NO (13*32+29) /* Not vulnerable to Branch Type Confusion */
+#define X86_FEATURE_AMD_IBPB_RET (13*32+30) /* IBPB clears return address predictor */
#define X86_FEATURE_BRS (13*32+31) /* "brs" Branch Sampling available */
/* Thermal and Power Management Leaf, CPUID level 0x00000006 (EAX), word 14 */
@@ -472,7 +476,9 @@
#define X86_FEATURE_BHI_CTRL (21*32+ 2) /* BHI_DIS_S HW control available */
#define X86_FEATURE_CLEAR_BHB_HW (21*32+ 3) /* BHI_DIS_S HW control enabled */
#define X86_FEATURE_CLEAR_BHB_LOOP_ON_VMEXIT (21*32+ 4) /* Clear branch history at vmexit using SW loop */
-#define X86_FEATURE_AMD_FAST_CPPC (21*32 + 5) /* AMD Fast CPPC */
+#define X86_FEATURE_AMD_FAST_CPPC (21*32 + 5) /* Fast CPPC */
+#define X86_FEATURE_AMD_HETEROGENEOUS_CORES (21*32 + 6) /* Heterogeneous Core Topology */
+#define X86_FEATURE_AMD_WORKLOAD_CLASS (21*32 + 7) /* Workload Classification */
/*
* BUG word(s)
@@ -523,4 +529,5 @@
#define X86_BUG_DIV0 X86_BUG(1*32 + 1) /* "div0" AMD DIV0 speculation bug */
#define X86_BUG_RFDS X86_BUG(1*32 + 2) /* "rfds" CPU is vulnerable to Register File Data Sampling */
#define X86_BUG_BHI X86_BUG(1*32 + 3) /* "bhi" CPU is affected by Branch History Injection */
+#define X86_BUG_IBPB_NO_RET X86_BUG(1*32 + 4) /* "ibpb_no_ret" IBPB omits return target predictions */
#endif /* _ASM_X86_CPUFEATURES_H */
diff --git a/tools/arch/x86/include/uapi/asm/kvm.h b/tools/arch/x86/include/uapi/asm/kvm.h
index a8debbf2f702..88585c1de416 100644
--- a/tools/arch/x86/include/uapi/asm/kvm.h
+++ b/tools/arch/x86/include/uapi/asm/kvm.h
@@ -440,6 +440,7 @@ struct kvm_sync_regs {
#define KVM_X86_QUIRK_FIX_HYPERCALL_INSN (1 << 5)
#define KVM_X86_QUIRK_MWAIT_NEVER_UD_FAULTS (1 << 6)
#define KVM_X86_QUIRK_SLOT_ZAP_ALL (1 << 7)
+#define KVM_X86_QUIRK_STUFF_FEATURE_MSRS (1 << 8)
#define KVM_STATE_NESTED_FORMAT_VMX 0
#define KVM_STATE_NESTED_FORMAT_SVM 1
diff --git a/tools/bpf/bpftool/Documentation/bpftool-btf.rst b/tools/bpf/bpftool/Documentation/bpftool-btf.rst
index 3f6bca03ad2e..d47dddc2b4ee 100644
--- a/tools/bpf/bpftool/Documentation/bpftool-btf.rst
+++ b/tools/bpf/bpftool/Documentation/bpftool-btf.rst
@@ -24,7 +24,7 @@ BTF COMMANDS
=============
| **bpftool** **btf** { **show** | **list** } [**id** *BTF_ID*]
-| **bpftool** **btf dump** *BTF_SRC* [**format** *FORMAT*]
+| **bpftool** **btf dump** *BTF_SRC* [**format** *FORMAT*] [**root_id** *ROOT_ID*]
| **bpftool** **btf help**
|
| *BTF_SRC* := { **id** *BTF_ID* | **prog** *PROG* | **map** *MAP* [{**key** | **value** | **kv** | **all**}] | **file** *FILE* }
@@ -43,7 +43,7 @@ bpftool btf { show | list } [id *BTF_ID*]
that hold open file descriptors (FDs) against BTF objects. On such kernels
bpftool will automatically emit this information as well.
-bpftool btf dump *BTF_SRC*
+bpftool btf dump *BTF_SRC* [format *FORMAT*] [root_id *ROOT_ID*]
Dump BTF entries from a given *BTF_SRC*.
When **id** is specified, BTF object with that ID will be loaded and all
@@ -67,6 +67,11 @@ bpftool btf dump *BTF_SRC*
formatting, the output is sorted by default. Use the **unsorted** option
to avoid sorting the output.
+ **root_id** option can be used to filter a dump to a single type and all
+ its dependent types. It cannot be used with any other types of filtering
+ (such as the "key", "value", or "kv" arguments when dumping BTF for a map).
+ It can be passed multiple times to dump multiple types.
+
bpftool btf help
Print short help message.
diff --git a/tools/bpf/bpftool/Makefile b/tools/bpf/bpftool/Makefile
index a4263dfb5e03..dd9f3ec84201 100644
--- a/tools/bpf/bpftool/Makefile
+++ b/tools/bpf/bpftool/Makefile
@@ -106,6 +106,7 @@ FEATURE_TESTS += libbfd-liberty
FEATURE_TESTS += libbfd-liberty-z
FEATURE_TESTS += disassembler-four-args
FEATURE_TESTS += disassembler-init-styled
+FEATURE_TESTS += libelf-zstd
FEATURE_DISPLAY := clang-bpf-co-re
FEATURE_DISPLAY += llvm
@@ -132,6 +133,12 @@ endif
LIBS = $(LIBBPF) -lelf -lz
LIBS_BOOTSTRAP = $(LIBBPF_BOOTSTRAP) -lelf -lz
+
+ifeq ($(feature-libelf-zstd),1)
+LIBS += -lzstd
+LIBS_BOOTSTRAP += -lzstd
+endif
+
ifeq ($(feature-libcap), 1)
CFLAGS += -DUSE_LIBCAP
LIBS += -lcap
diff --git a/tools/bpf/bpftool/bash-completion/bpftool b/tools/bpf/bpftool/bash-completion/bpftool
index 0c541498c301..1ce409a6cbd9 100644
--- a/tools/bpf/bpftool/bash-completion/bpftool
+++ b/tools/bpf/bpftool/bash-completion/bpftool
@@ -930,19 +930,24 @@ _bpftool()
format)
COMPREPLY=( $( compgen -W "c raw" -- "$cur" ) )
;;
+ root_id)
+ return 0;
+ ;;
c)
- COMPREPLY=( $( compgen -W "unsorted" -- "$cur" ) )
+ COMPREPLY=( $( compgen -W "unsorted root_id" -- "$cur" ) )
;;
*)
# emit extra options
case ${words[3]} in
id|file)
+ COMPREPLY=( $( compgen -W "root_id" -- "$cur" ) )
_bpftool_once_attr 'format'
;;
map|prog)
if [[ ${words[3]} == "map" ]] && [[ $cword == 6 ]]; then
COMPREPLY+=( $( compgen -W "key value kv all" -- "$cur" ) )
fi
+ COMPREPLY=( $( compgen -W "root_id" -- "$cur" ) )
_bpftool_once_attr 'format'
;;
*)
diff --git a/tools/bpf/bpftool/btf.c b/tools/bpf/bpftool/btf.c
index d005e4fd6128..2636655ac180 100644
--- a/tools/bpf/bpftool/btf.c
+++ b/tools/bpf/bpftool/btf.c
@@ -27,6 +27,8 @@
#define KFUNC_DECL_TAG "bpf_kfunc"
#define FASTCALL_DECL_TAG "bpf_fastcall"
+#define MAX_ROOT_IDS 16
+
static const char * const btf_kind_str[NR_BTF_KINDS] = {
[BTF_KIND_UNKN] = "UNKNOWN",
[BTF_KIND_INT] = "INT",
@@ -880,12 +882,14 @@ static int do_dump(int argc, char **argv)
{
bool dump_c = false, sort_dump_c = true;
struct btf *btf = NULL, *base = NULL;
- __u32 root_type_ids[2];
+ __u32 root_type_ids[MAX_ROOT_IDS];
+ bool have_id_filtering;
int root_type_cnt = 0;
__u32 btf_id = -1;
const char *src;
int fd = -1;
int err = 0;
+ int i;
if (!REQ_ARGS(2)) {
usage();
@@ -973,6 +977,8 @@ static int do_dump(int argc, char **argv)
goto done;
}
+ have_id_filtering = !!root_type_cnt;
+
while (argc) {
if (is_prefix(*argv, "format")) {
NEXT_ARG();
@@ -992,6 +998,36 @@ static int do_dump(int argc, char **argv)
goto done;
}
NEXT_ARG();
+ } else if (is_prefix(*argv, "root_id")) {
+ __u32 root_id;
+ char *end;
+
+ if (have_id_filtering) {
+ p_err("cannot use root_id with other type filtering");
+ err = -EINVAL;
+ goto done;
+ } else if (root_type_cnt == MAX_ROOT_IDS) {
+ p_err("only %d root_id are supported", MAX_ROOT_IDS);
+ err = -E2BIG;
+ goto done;
+ }
+
+ NEXT_ARG();
+ root_id = strtoul(*argv, &end, 0);
+ if (*end) {
+ err = -1;
+ p_err("can't parse %s as root ID", *argv);
+ goto done;
+ }
+ for (i = 0; i < root_type_cnt; i++) {
+ if (root_type_ids[i] == root_id) {
+ err = -EINVAL;
+ p_err("duplicate root_id %d supplied", root_id);
+ goto done;
+ }
+ }
+ root_type_ids[root_type_cnt++] = root_id;
+ NEXT_ARG();
} else if (is_prefix(*argv, "unsorted")) {
sort_dump_c = false;
NEXT_ARG();
@@ -1017,6 +1053,17 @@ static int do_dump(int argc, char **argv)
}
}
+ /* Invalid root IDs causes half emitted boilerplate and then unclean
+ * exit. It's an ugly user experience, so handle common error here.
+ */
+ for (i = 0; i < root_type_cnt; i++) {
+ if (root_type_ids[i] >= btf__type_cnt(btf)) {
+ err = -EINVAL;
+ p_err("invalid root ID: %u", root_type_ids[i]);
+ goto done;
+ }
+ }
+
if (dump_c) {
if (json_output) {
p_err("JSON output for C-syntax dump is not supported");
@@ -1391,7 +1438,7 @@ static int do_help(int argc, char **argv)
fprintf(stderr,
"Usage: %1$s %2$s { show | list } [id BTF_ID]\n"
- " %1$s %2$s dump BTF_SRC [format FORMAT]\n"
+ " %1$s %2$s dump BTF_SRC [format FORMAT] [root_id ROOT_ID]\n"
" %1$s %2$s help\n"
"\n"
" BTF_SRC := { id BTF_ID | prog PROG | map MAP [{key | value | kv | all}] | file FILE }\n"
diff --git a/tools/bpf/bpftool/cfg.c b/tools/bpf/bpftool/cfg.c
index eec437cca2ea..e3785f9a697d 100644
--- a/tools/bpf/bpftool/cfg.c
+++ b/tools/bpf/bpftool/cfg.c
@@ -302,6 +302,7 @@ static bool func_add_bb_edges(struct func_node *func)
insn = bb->tail;
if (!is_jmp_insn(insn->code) ||
+ BPF_OP(insn->code) == BPF_CALL ||
BPF_OP(insn->code) == BPF_EXIT) {
e->dst = bb_next(bb);
e->flags |= EDGE_FLAG_FALLTHROUGH;
diff --git a/tools/bpf/bpftool/feature.c b/tools/bpf/bpftool/feature.c
index 4dbc4fcdf473..24fecdf8e430 100644
--- a/tools/bpf/bpftool/feature.c
+++ b/tools/bpf/bpftool/feature.c
@@ -885,6 +885,28 @@ probe_v3_isa_extension(const char *define_prefix, __u32 ifindex)
"V3_ISA_EXTENSION");
}
+/*
+ * Probe for the v4 instruction set extension introduced in commit 1f9a1ea821ff
+ * ("bpf: Support new sign-extension load insns").
+ */
+static void
+probe_v4_isa_extension(const char *define_prefix, __u32 ifindex)
+{
+ struct bpf_insn insns[5] = {
+ BPF_MOV64_IMM(BPF_REG_0, 0),
+ BPF_JMP32_IMM(BPF_JEQ, BPF_REG_0, 1, 1),
+ BPF_JMP32_A(1),
+ BPF_MOV64_IMM(BPF_REG_0, 1),
+ BPF_EXIT_INSN()
+ };
+
+ probe_misc_feature(insns, ARRAY_SIZE(insns),
+ define_prefix, ifindex,
+ "have_v4_isa_extension",
+ "ISA extension v4",
+ "V4_ISA_EXTENSION");
+}
+
static void
section_system_config(enum probe_component target, const char *define_prefix)
{
@@ -1029,6 +1051,7 @@ static void section_misc(const char *define_prefix, __u32 ifindex)
probe_bounded_loops(define_prefix, ifindex);
probe_v2_isa_extension(define_prefix, ifindex);
probe_v3_isa_extension(define_prefix, ifindex);
+ probe_v4_isa_extension(define_prefix, ifindex);
print_end_section();
}
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 2ff949ea82fa..e71be67f1d86 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -822,11 +822,18 @@ prog_dump(struct bpf_prog_info *info, enum dump_mode mode,
printf("%s:\n", sym_name);
}
- if (disasm_print_insn(img, lens[i], opcodes,
- name, disasm_opt, btf,
- prog_linfo, ksyms[i], i,
- linum))
- goto exit_free;
+ if (ksyms) {
+ if (disasm_print_insn(img, lens[i], opcodes,
+ name, disasm_opt, btf,
+ prog_linfo, ksyms[i], i,
+ linum))
+ goto exit_free;
+ } else {
+ if (disasm_print_insn(img, lens[i], opcodes,
+ name, disasm_opt, btf,
+ NULL, 0, 0, false))
+ goto exit_free;
+ }
img += lens[i];
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index bd9f960bce3d..d47191c6e55e 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -141,6 +141,7 @@ struct object {
};
static int verbose;
+static int warnings;
static int eprintf(int level, int var, const char *fmt, ...)
{
@@ -604,6 +605,7 @@ static int symbols_resolve(struct object *obj)
if (id->id) {
pr_info("WARN: multiple IDs found for '%s': %d, %d - using %d\n",
str, id->id, type_id, id->id);
+ warnings++;
} else {
id->id = type_id;
(*nr)--;
@@ -625,8 +627,10 @@ static int id_patch(struct object *obj, struct btf_id *id)
int i;
/* For set, set8, id->id may be 0 */
- if (!id->id && !id->is_set && !id->is_set8)
+ if (!id->id && !id->is_set && !id->is_set8) {
pr_err("WARN: resolve_btfids: unresolved symbol %s\n", id->name);
+ warnings++;
+ }
for (i = 0; i < id->addr_cnt; i++) {
unsigned long addr = id->addr[i];
@@ -782,6 +786,7 @@ int main(int argc, const char **argv)
.funcs = RB_ROOT,
.sets = RB_ROOT,
};
+ bool fatal_warnings = false;
struct option btfid_options[] = {
OPT_INCR('v', "verbose", &verbose,
"be more verbose (show errors, etc)"),
@@ -789,6 +794,8 @@ int main(int argc, const char **argv)
"BTF data"),
OPT_STRING('b', "btf_base", &obj.base_btf_path, "file",
"path of file providing base BTF"),
+ OPT_BOOLEAN(0, "fatal_warnings", &fatal_warnings,
+ "turn warnings into errors"),
OPT_END()
};
int err = -1;
@@ -823,7 +830,8 @@ int main(int argc, const char **argv)
if (symbols_patch(&obj))
goto out;
- err = 0;
+ if (!(fatal_warnings && warnings))
+ err = 0;
out:
if (obj.efile.elf) {
elf_end(obj.efile.elf);
diff --git a/tools/build/Build.include b/tools/build/Build.include
index c2a95ab47379..e45b2eb0d24a 100644
--- a/tools/build/Build.include
+++ b/tools/build/Build.include
@@ -13,6 +13,8 @@
comma := ,
squote := '
pound := \#
+empty :=
+space := $(empty) $(empty)
###
# Name of target with a '.' as filename prefix. foo/bar.o => foo/.bar.o
diff --git a/tools/build/Makefile.build b/tools/build/Makefile.build
index 5fb3fb3d97e0..e710ed67a1b4 100644
--- a/tools/build/Makefile.build
+++ b/tools/build/Makefile.build
@@ -12,26 +12,6 @@
PHONY := __build
__build:
-ifeq ($(V),1)
- quiet =
- Q =
-else
- quiet=quiet_
- Q=@
-endif
-
-# If the user is running make -s (silent mode), suppress echoing of commands
-# make-4.0 (and later) keep single letter options in the 1st word of MAKEFLAGS.
-ifeq ($(filter 3.%,$(MAKE_VERSION)),)
-short-opts := $(firstword -$(MAKEFLAGS))
-else
-short-opts := $(filter-out --%,$(MAKEFLAGS))
-endif
-
-ifneq ($(findstring s,$(short-opts)),)
- quiet=silent_
-endif
-
build-dir := $(srctree)/tools/build
# Define $(fixdep) for dep-cmd function
diff --git a/tools/build/Makefile.feature b/tools/build/Makefile.feature
index bca47d136f05..1931b6321314 100644
--- a/tools/build/Makefile.feature
+++ b/tools/build/Makefile.feature
@@ -28,6 +28,41 @@ endef
# the rule that uses them - an example for that is the 'bionic'
# feature check. ]
#
+# These + the ones in FEATURE_TESTS_EXTRA are included in
+# tools/build/feature/test-all.c and we try to build it all together
+# then setting all those features to '1' meaning they are all enabled.
+#
+# There are things like fortify-source that will be set to 1 because test-all
+# is built with the flags needed to test if its enabled, resulting in
+#
+# $ rm -rf /tmp/b ; mkdir /tmp/b ; make -C tools/perf O=/tmp/b feature-dump
+# $ grep fortify-source /tmp/b/FEATURE-DUMP
+# feature-fortify-source=1
+# $
+#
+# All the others should have lines in tools/build/feature/test-all.c like:
+#
+# #define main main_test_disassembler_init_styled
+# # include "test-disassembler-init-styled.c"
+# #undef main
+#
+# #define main main_test_libzstd
+# # include "test-libzstd.c"
+# #undef main
+#
+# int main(int argc, char *argv[])
+# {
+# main_test_disassembler_four_args();
+# main_test_libzstd();
+# return 0;
+# }
+#
+# If the sample above works, then we end up with these lines in the FEATURE-DUMP
+# file:
+#
+# feature-disassembler-four-args=1
+# feature-libzstd=1
+#
FEATURE_TESTS_BASIC := \
backtrace \
libdw \
@@ -38,17 +73,16 @@ FEATURE_TESTS_BASIC := \
glibc \
libbfd \
libbfd-buildid \
- libcap \
libelf \
libelf-getphdrnum \
libelf-gelf_getnote \
libelf-getshdrstrndx \
+ libelf-zstd \
libnuma \
numa_num_possible_cpus \
libperl \
libpython \
libslang \
- libslang-include-subdir \
libtraceevent \
libtracefs \
libcpupower \
@@ -89,13 +123,6 @@ FEATURE_TESTS_EXTRA := \
libbfd-liberty \
libbfd-liberty-z \
libopencsd \
- libunwind-x86 \
- libunwind-x86_64 \
- libunwind-arm \
- libunwind-aarch64 \
- libunwind-debug-frame \
- libunwind-debug-frame-arm \
- libunwind-debug-frame-aarch64 \
cxx \
llvm \
clang \
@@ -122,7 +149,6 @@ FEATURE_DISPLAY ?= \
glibc \
libbfd \
libbfd-buildid \
- libcap \
libelf \
libnuma \
numa_num_possible_cpus \
diff --git a/tools/build/feature/Makefile b/tools/build/feature/Makefile
index 043dfd00fce7..cb1e3e2feedf 100644
--- a/tools/build/feature/Makefile
+++ b/tools/build/feature/Makefile
@@ -13,7 +13,6 @@ FILES= \
test-gtk2.bin \
test-gtk2-infobar.bin \
test-hello.bin \
- test-libaudit.bin \
test-libbfd.bin \
test-libbfd-buildid.bin \
test-disassembler-four-args.bin \
@@ -28,6 +27,7 @@ FILES= \
test-libelf-getphdrnum.bin \
test-libelf-gelf_getnote.bin \
test-libelf-getshdrstrndx.bin \
+ test-libelf-zstd.bin \
test-libdebuginfod.bin \
test-libnuma.bin \
test-numa_num_possible_cpus.bin \
@@ -110,7 +110,7 @@ all: $(FILES)
__BUILD = $(CC) $(CFLAGS) -MD -Wall -Werror -o $@ $(patsubst %.bin,%.c,$(@F)) $(LDFLAGS)
BUILD = $(__BUILD) > $(@:.bin=.make.output) 2>&1
BUILD_BFD = $(BUILD) -DPACKAGE='"perf"' -lbfd -ldl
- BUILD_ALL = $(BUILD) -fstack-protector-all -O2 -D_FORTIFY_SOURCE=2 -ldw -lelf -lnuma -lelf -lslang $(FLAGS_PERL_EMBED) $(FLAGS_PYTHON_EMBED) -DPACKAGE='"perf"' -lbfd -ldl -lz -llzma -lzstd -lcap
+ BUILD_ALL = $(BUILD) -fstack-protector-all -O2 -D_FORTIFY_SOURCE=2 -ldw -lelf -lnuma -lelf -lslang $(FLAGS_PERL_EMBED) $(FLAGS_PYTHON_EMBED) -DPACKAGE='"perf"' -lbfd -ldl -lz -llzma -lzstd
__BUILDXX = $(CXX) $(CXXFLAGS) -MD -Wall -Werror -o $@ $(patsubst %.bin,%.cpp,$(@F)) $(LDFLAGS)
BUILDXX = $(__BUILDXX) > $(@:.bin=.make.output) 2>&1
@@ -196,6 +196,9 @@ $(OUTPUT)test-libelf-gelf_getnote.bin:
$(OUTPUT)test-libelf-getshdrstrndx.bin:
$(BUILD) -lelf
+$(OUTPUT)test-libelf-zstd.bin:
+ $(BUILD) -lelf -lz -lzstd
+
$(OUTPUT)test-libdebuginfod.bin:
$(BUILD) -ldebuginfod
@@ -228,9 +231,6 @@ $(OUTPUT)test-libunwind-debug-frame-arm.bin:
$(OUTPUT)test-libunwind-debug-frame-aarch64.bin:
$(BUILD) -lelf -llzma -lunwind-aarch64
-$(OUTPUT)test-libaudit.bin:
- $(BUILD) -laudit
-
$(OUTPUT)test-libslang.bin:
$(BUILD) -lslang
diff --git a/tools/build/feature/test-all.c b/tools/build/feature/test-all.c
index 59ef3d7fe6a4..03ddaac6f4c4 100644
--- a/tools/build/feature/test-all.c
+++ b/tools/build/feature/test-all.c
@@ -58,8 +58,8 @@
# include "test-libelf-getshdrstrndx.c"
#undef main
-#define main main_test_libunwind
-# include "test-libunwind.c"
+#define main main_test_libelf_zstd
+# include "test-libelf-zstd.c"
#undef main
#define main main_test_libslang
@@ -170,6 +170,14 @@
# include "test-libzstd.c"
#undef main
+#define main main_test_libtraceevent
+# include "test-libtraceevent.c"
+#undef main
+
+#define main main_test_libtracefs
+# include "test-libtracefs.c"
+#undef main
+
int main(int argc, char *argv[])
{
main_test_libpython();
@@ -184,7 +192,6 @@ int main(int argc, char *argv[])
main_test_libelf_getphdrnum();
main_test_libelf_gelf_getnote();
main_test_libelf_getshdrstrndx();
- main_test_libunwind();
main_test_libslang();
main_test_libbfd();
main_test_libbfd_buildid();
@@ -208,6 +215,8 @@ int main(int argc, char *argv[])
main_test_reallocarray();
main_test_disassembler_four_args();
main_test_libzstd();
+ main_test_libtraceevent();
+ main_test_libtracefs();
return 0;
}
diff --git a/tools/build/feature/test-libaudit.c b/tools/build/feature/test-libaudit.c
deleted file mode 100644
index f5b0863fa1ec..000000000000
--- a/tools/build/feature/test-libaudit.c
+++ /dev/null
@@ -1,11 +0,0 @@
-// SPDX-License-Identifier: GPL-2.0
-#include <libaudit.h>
-
-extern int printf(const char *format, ...);
-
-int main(void)
-{
- printf("error message: %s\n", audit_errno_to_name(0));
-
- return audit_open();
-}
diff --git a/tools/build/feature/test-libelf-zstd.c b/tools/build/feature/test-libelf-zstd.c
new file mode 100644
index 000000000000..a1324a1db3bb
--- /dev/null
+++ b/tools/build/feature/test-libelf-zstd.c
@@ -0,0 +1,9 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <stddef.h>
+#include <libelf.h>
+
+int main(void)
+{
+ elf_compress(NULL, ELFCOMPRESS_ZSTD, 0);
+ return 0;
+}
diff --git a/tools/hv/.gitignore b/tools/hv/.gitignore
new file mode 100644
index 000000000000..0c5bc15d602f
--- /dev/null
+++ b/tools/hv/.gitignore
@@ -0,0 +1,3 @@
+hv_fcopy_uio_daemon
+hv_kvp_daemon
+hv_vss_daemon
diff --git a/tools/hv/hv_fcopy_uio_daemon.c b/tools/hv/hv_fcopy_uio_daemon.c
index 7a00f3066a98..0198321d14a2 100644
--- a/tools/hv/hv_fcopy_uio_daemon.c
+++ b/tools/hv/hv_fcopy_uio_daemon.c
@@ -35,8 +35,6 @@
#define WIN8_SRV_MINOR 1
#define WIN8_SRV_VERSION (WIN8_SRV_MAJOR << 16 | WIN8_SRV_MINOR)
-#define MAX_FOLDER_NAME 15
-#define MAX_PATH_LEN 15
#define FCOPY_UIO "/sys/bus/vmbus/devices/eb765408-105f-49b6-b4aa-c123b64d17d4/uio"
#define FCOPY_VER_COUNT 1
@@ -51,7 +49,7 @@ static const int fw_versions[] = {
#define HV_RING_SIZE 0x4000 /* 16KB ring buffer size */
-unsigned char desc[HV_RING_SIZE];
+static unsigned char desc[HV_RING_SIZE];
static int target_fd;
static char target_fname[PATH_MAX];
@@ -409,8 +407,8 @@ int main(int argc, char *argv[])
struct vmbus_br txbr, rxbr;
void *ring;
uint32_t len = HV_RING_SIZE;
- char uio_name[MAX_FOLDER_NAME] = {0};
- char uio_dev_path[MAX_PATH_LEN] = {0};
+ char uio_name[NAME_MAX] = {0};
+ char uio_dev_path[PATH_MAX] = {0};
static struct option long_options[] = {
{"help", no_argument, 0, 'h' },
@@ -468,8 +466,10 @@ int main(int argc, char *argv[])
*/
ret = pread(fcopy_fd, &tmp, sizeof(int), 0);
if (ret < 0) {
+ if (errno == EINTR || errno == EAGAIN)
+ continue;
syslog(LOG_ERR, "pread failed: %s", strerror(errno));
- continue;
+ goto close;
}
len = HV_RING_SIZE;
diff --git a/tools/hv/hv_get_dns_info.sh b/tools/hv/hv_get_dns_info.sh
index 058c17b46ffc..268521234d4b 100755
--- a/tools/hv/hv_get_dns_info.sh
+++ b/tools/hv/hv_get_dns_info.sh
@@ -1,4 +1,4 @@
-#!/bin/bash
+#!/bin/sh
# This example script parses /etc/resolv.conf to retrive DNS information.
# In the interest of keeping the KVP daemon code free of distro specific
@@ -10,4 +10,4 @@
# this script can be based on the Network Manager APIs for retrieving DNS
# entries.
-cat /etc/resolv.conf 2>/dev/null | awk '/^nameserver/ { print $2 }'
+exec awk '/^nameserver/ { print $2 }' /etc/resolv.conf 2>/dev/null
diff --git a/tools/hv/hv_kvp_daemon.c b/tools/hv/hv_kvp_daemon.c
index ae57bf69ad4a..04ba035d67e9 100644
--- a/tools/hv/hv_kvp_daemon.c
+++ b/tools/hv/hv_kvp_daemon.c
@@ -725,7 +725,7 @@ static void kvp_get_ipconfig_info(char *if_name,
* .
*/
- sprintf(cmd, KVP_SCRIPTS_PATH "%s", "hv_get_dns_info");
+ sprintf(cmd, "exec %s %s", KVP_SCRIPTS_PATH "hv_get_dns_info", if_name);
/*
* Execute the command to gather DNS info.
@@ -742,7 +742,7 @@ static void kvp_get_ipconfig_info(char *if_name,
* Enabled: DHCP enabled.
*/
- sprintf(cmd, KVP_SCRIPTS_PATH "%s %s", "hv_get_dhcp_info", if_name);
+ sprintf(cmd, "exec %s %s", KVP_SCRIPTS_PATH "hv_get_dhcp_info", if_name);
file = popen(cmd, "r");
if (file == NULL)
@@ -1606,8 +1606,9 @@ static int kvp_set_ip_info(char *if_name, struct hv_kvp_ipaddr_value *new_val)
* invoke the external script to do its magic.
*/
- str_len = snprintf(cmd, sizeof(cmd), KVP_SCRIPTS_PATH "%s %s %s",
- "hv_set_ifconfig", if_filename, nm_filename);
+ str_len = snprintf(cmd, sizeof(cmd), "exec %s %s %s",
+ KVP_SCRIPTS_PATH "hv_set_ifconfig",
+ if_filename, nm_filename);
/*
* This is a little overcautious, but it's necessary to suppress some
* false warnings from gcc 8.0.1.
diff --git a/tools/hv/hv_set_ifconfig.sh b/tools/hv/hv_set_ifconfig.sh
index 440a91b35823..2f8baed2b8f7 100755
--- a/tools/hv/hv_set_ifconfig.sh
+++ b/tools/hv/hv_set_ifconfig.sh
@@ -81,7 +81,7 @@ echo "ONBOOT=yes" >> $1
cp $1 /etc/sysconfig/network-scripts/
-chmod 600 $2
+umask 0177
interface=$(echo $2 | awk -F - '{ print $2 }')
filename="${2##*/}"
diff --git a/tools/include/linux/filter.h b/tools/include/linux/filter.h
index 65aa8ce142e5..bcc6df79301a 100644
--- a/tools/include/linux/filter.h
+++ b/tools/include/linux/filter.h
@@ -273,6 +273,16 @@
.off = OFF, \
.imm = 0 })
+/* Unconditional jumps, gotol pc + imm32 */
+
+#define BPF_JMP32_A(IMM) \
+ ((struct bpf_insn) { \
+ .code = BPF_JMP32 | BPF_JA, \
+ .dst_reg = 0, \
+ .src_reg = 0, \
+ .off = 0, \
+ .imm = IMM })
+
/* Function call */
#define BPF_EMIT_CALL(FUNC) \
diff --git a/tools/include/linux/objtool_types.h b/tools/include/linux/objtool_types.h
index 453a4f4ef39d..df5d9fa84dba 100644
--- a/tools/include/linux/objtool_types.h
+++ b/tools/include/linux/objtool_types.h
@@ -54,4 +54,16 @@ struct unwind_hint {
#define UNWIND_HINT_TYPE_SAVE 6
#define UNWIND_HINT_TYPE_RESTORE 7
+/*
+ * Annotate types
+ */
+#define ANNOTYPE_NOENDBR 1
+#define ANNOTYPE_RETPOLINE_SAFE 2
+#define ANNOTYPE_INSTR_BEGIN 3
+#define ANNOTYPE_INSTR_END 4
+#define ANNOTYPE_UNRET_BEGIN 5
+#define ANNOTYPE_IGNORE_ALTS 6
+#define ANNOTYPE_INTRA_FUNCTION_CALL 7
+#define ANNOTYPE_REACHABLE 8
+
#endif /* _LINUX_OBJTOOL_TYPES_H */
diff --git a/tools/include/nolibc/sys.h b/tools/include/nolibc/sys.h
index 7b82bc3cf107..d4a5c2399a66 100644
--- a/tools/include/nolibc/sys.h
+++ b/tools/include/nolibc/sys.h
@@ -23,6 +23,7 @@
#include <linux/prctl.h>
#include <linux/resource.h>
#include <linux/utsname.h>
+#include <linux/signal.h>
#include "arch.h"
#include "errno.h"
@@ -1226,6 +1227,23 @@ pid_t waitpid(pid_t pid, int *status, int options)
/*
+ * int waitid(idtype_t idtype, id_t id, siginfo_t *infop, int options);
+ */
+
+static __attribute__((unused))
+int sys_waitid(int which, pid_t pid, siginfo_t *infop, int options, struct rusage *rusage)
+{
+ return my_syscall5(__NR_waitid, which, pid, infop, options, rusage);
+}
+
+static __attribute__((unused))
+int waitid(int which, pid_t pid, siginfo_t *infop, int options)
+{
+ return __sysret(sys_waitid(which, pid, infop, options, NULL));
+}
+
+
+/*
* ssize_t write(int fd, const void *buf, size_t count);
*/
diff --git a/tools/include/uapi/asm-generic/mman.h b/tools/include/uapi/asm-generic/mman.h
index 406f7718f9ad..51d2556af54a 100644
--- a/tools/include/uapi/asm-generic/mman.h
+++ b/tools/include/uapi/asm-generic/mman.h
@@ -19,4 +19,8 @@
#define MCL_FUTURE 2 /* lock all future mappings */
#define MCL_ONFAULT 4 /* lock all pages that are faulted in */
+#define SHADOW_STACK_SET_TOKEN (1ULL << 0) /* Set up a restore token in the shadow stack */
+#define SHADOW_STACK_SET_MARKER (1ULL << 1) /* Set up a top of stack marker in the shadow stack */
+
+
#endif /* __ASM_GENERIC_MMAN_H */
diff --git a/tools/include/uapi/asm-generic/socket.h b/tools/include/uapi/asm-generic/socket.h
index 281df9139d2b..ffff554a5230 100644
--- a/tools/include/uapi/asm-generic/socket.h
+++ b/tools/include/uapi/asm-generic/socket.h
@@ -126,6 +126,8 @@
#define SCM_TS_OPT_ID 78
+#define SO_RCVPRIORITY 79
+
#if !defined(__KERNEL__)
#if __BITS_PER_LONG == 64 || (defined(__x86_64__) && defined(__ILP32__))
diff --git a/tools/include/uapi/asm-generic/unistd.h b/tools/include/uapi/asm-generic/unistd.h
index 5bf6148cac2b..88dc393c2bca 100644
--- a/tools/include/uapi/asm-generic/unistd.h
+++ b/tools/include/uapi/asm-generic/unistd.h
@@ -841,8 +841,17 @@ __SYSCALL(__NR_lsm_list_modules, sys_lsm_list_modules)
#define __NR_mseal 462
__SYSCALL(__NR_mseal, sys_mseal)
+#define __NR_setxattrat 463
+__SYSCALL(__NR_setxattrat, sys_setxattrat)
+#define __NR_getxattrat 464
+__SYSCALL(__NR_getxattrat, sys_getxattrat)
+#define __NR_listxattrat 465
+__SYSCALL(__NR_listxattrat, sys_listxattrat)
+#define __NR_removexattrat 466
+__SYSCALL(__NR_removexattrat, sys_removexattrat)
+
#undef __NR_syscalls
-#define __NR_syscalls 463
+#define __NR_syscalls 467
/*
* 32 bit systems traditionally used different
diff --git a/tools/include/uapi/drm/drm.h b/tools/include/uapi/drm/drm.h
index 16122819edfe..7fba37b94401 100644
--- a/tools/include/uapi/drm/drm.h
+++ b/tools/include/uapi/drm/drm.h
@@ -1024,6 +1024,13 @@ struct drm_crtc_queue_sequence {
__u64 user_data; /* user data passed to event */
};
+#define DRM_CLIENT_NAME_MAX_LEN 64
+struct drm_set_client_name {
+ __u64 name_len;
+ __u64 name;
+};
+
+
#if defined(__cplusplus)
}
#endif
@@ -1288,6 +1295,16 @@ extern "C" {
*/
#define DRM_IOCTL_MODE_CLOSEFB DRM_IOWR(0xD0, struct drm_mode_closefb)
+/**
+ * DRM_IOCTL_SET_CLIENT_NAME - Attach a name to a drm_file
+ *
+ * Having a name allows for easier tracking and debugging.
+ * The length of the name (without null ending char) must be
+ * <= DRM_CLIENT_NAME_MAX_LEN.
+ * The call will fail if the name contains whitespaces or non-printable chars.
+ */
+#define DRM_IOCTL_SET_CLIENT_NAME DRM_IOWR(0xD1, struct drm_set_client_name)
+
/*
* Device specific ioctls should only be in their respective headers
* The device specific ioctl range is from 0x40 to 0x9f.
diff --git a/tools/include/uapi/linux/bpf.h b/tools/include/uapi/linux/bpf.h
index 4162afc6b5d0..2acf9b336371 100644
--- a/tools/include/uapi/linux/bpf.h
+++ b/tools/include/uapi/linux/bpf.h
@@ -1573,6 +1573,16 @@ union bpf_attr {
* If provided, prog_flags should have BPF_F_TOKEN_FD flag set.
*/
__s32 prog_token_fd;
+ /* The fd_array_cnt can be used to pass the length of the
+ * fd_array array. In this case all the [map] file descriptors
+ * passed in this array will be bound to the program, even if
+ * the maps are not referenced directly. The functionality is
+ * similar to the BPF_PROG_BIND_MAP syscall, but maps can be
+ * used by the verifier during the program load. If provided,
+ * then the fd_array[0,...,fd_array_cnt-1] is expected to be
+ * continuous.
+ */
+ __u32 fd_array_cnt;
};
struct { /* anonymous struct used by BPF_OBJ_* commands */
diff --git a/tools/include/uapi/linux/if_link.h b/tools/include/uapi/linux/if_link.h
index 8516c1ccd57a..7e46ca4cd31b 100644
--- a/tools/include/uapi/linux/if_link.h
+++ b/tools/include/uapi/linux/if_link.h
@@ -1315,6 +1315,8 @@ enum {
IFLA_NETKIT_MODE,
IFLA_NETKIT_SCRUB,
IFLA_NETKIT_PEER_SCRUB,
+ IFLA_NETKIT_HEADROOM,
+ IFLA_NETKIT_TAILROOM,
__IFLA_NETKIT_MAX,
};
#define IFLA_NETKIT_MAX (__IFLA_NETKIT_MAX - 1)
diff --git a/tools/include/uapi/linux/if_xdp.h b/tools/include/uapi/linux/if_xdp.h
index 2f082b01ff22..42ec5ddaab8d 100644
--- a/tools/include/uapi/linux/if_xdp.h
+++ b/tools/include/uapi/linux/if_xdp.h
@@ -117,12 +117,12 @@ struct xdp_options {
((1ULL << XSK_UNALIGNED_BUF_OFFSET_SHIFT) - 1)
/* Request transmit timestamp. Upon completion, put it into tx_timestamp
- * field of union xsk_tx_metadata.
+ * field of struct xsk_tx_metadata.
*/
#define XDP_TXMD_FLAGS_TIMESTAMP (1 << 0)
/* Request transmit checksum offload. Checksum start position and offset
- * are communicated via csum_start and csum_offset fields of union
+ * are communicated via csum_start and csum_offset fields of struct
* xsk_tx_metadata.
*/
#define XDP_TXMD_FLAGS_CHECKSUM (1 << 1)
diff --git a/tools/include/uapi/linux/kvm.h b/tools/include/uapi/linux/kvm.h
index 637efc055145..502ea63b5d2e 100644
--- a/tools/include/uapi/linux/kvm.h
+++ b/tools/include/uapi/linux/kvm.h
@@ -1158,7 +1158,15 @@ enum kvm_device_type {
#define KVM_DEV_TYPE_ARM_PV_TIME KVM_DEV_TYPE_ARM_PV_TIME
KVM_DEV_TYPE_RISCV_AIA,
#define KVM_DEV_TYPE_RISCV_AIA KVM_DEV_TYPE_RISCV_AIA
+ KVM_DEV_TYPE_LOONGARCH_IPI,
+#define KVM_DEV_TYPE_LOONGARCH_IPI KVM_DEV_TYPE_LOONGARCH_IPI
+ KVM_DEV_TYPE_LOONGARCH_EIOINTC,
+#define KVM_DEV_TYPE_LOONGARCH_EIOINTC KVM_DEV_TYPE_LOONGARCH_EIOINTC
+ KVM_DEV_TYPE_LOONGARCH_PCHPIC,
+#define KVM_DEV_TYPE_LOONGARCH_PCHPIC KVM_DEV_TYPE_LOONGARCH_PCHPIC
+
KVM_DEV_TYPE_MAX,
+
};
struct kvm_vfio_spapr_tce {
diff --git a/tools/include/uapi/linux/perf_event.h b/tools/include/uapi/linux/perf_event.h
index 4842c36fdf80..0524d541d4e3 100644
--- a/tools/include/uapi/linux/perf_event.h
+++ b/tools/include/uapi/linux/perf_event.h
@@ -511,7 +511,16 @@ struct perf_event_attr {
__u16 sample_max_stack;
__u16 __reserved_2;
__u32 aux_sample_size;
- __u32 __reserved_3;
+
+ union {
+ __u32 aux_action;
+ struct {
+ __u32 aux_start_paused : 1, /* start AUX area tracing paused */
+ aux_pause : 1, /* on overflow, pause AUX area tracing */
+ aux_resume : 1, /* on overflow, resume AUX area tracing */
+ __reserved_3 : 29;
+ };
+ };
/*
* User provided data if sigtrap=1, passed back to user via
diff --git a/tools/include/uapi/linux/stddef.h b/tools/include/uapi/linux/stddef.h
index bb6ea517efb5..c53cde425406 100644
--- a/tools/include/uapi/linux/stddef.h
+++ b/tools/include/uapi/linux/stddef.h
@@ -8,6 +8,13 @@
#define __always_inline __inline__
#endif
+/* Not all C++ standards support type declarations inside an anonymous union */
+#ifndef __cplusplus
+#define __struct_group_tag(TAG) TAG
+#else
+#define __struct_group_tag(TAG)
+#endif
+
/**
* __struct_group() - Create a mirrored named and anonyomous struct
*
@@ -20,14 +27,14 @@
* and size: one anonymous and one named. The former's members can be used
* normally without sub-struct naming, and the latter can be used to
* reason about the start, end, and size of the group of struct members.
- * The named struct can also be explicitly tagged for layer reuse, as well
- * as both having struct attributes appended.
+ * The named struct can also be explicitly tagged for layer reuse (C only),
+ * as well as both having struct attributes appended.
*/
#define __struct_group(TAG, NAME, ATTRS, MEMBERS...) \
union { \
struct { MEMBERS } ATTRS; \
- struct TAG { MEMBERS } ATTRS NAME; \
- }
+ struct __struct_group_tag(TAG) { MEMBERS } ATTRS NAME; \
+ } ATTRS
/**
* __DECLARE_FLEX_ARRAY() - Declare a flexible array usable in a union
diff --git a/tools/lib/api/fs/fs.c b/tools/lib/api/fs/fs.c
index 337fde770e45..edec23406dbc 100644
--- a/tools/lib/api/fs/fs.c
+++ b/tools/lib/api/fs/fs.c
@@ -296,7 +296,7 @@ int filename__read_int(const char *filename, int *value)
int fd = open(filename, O_RDONLY), err = -1;
if (fd < 0)
- return -1;
+ return -errno;
if (read(fd, line, sizeof(line)) > 0) {
*value = atoi(line);
@@ -314,7 +314,7 @@ static int filename__read_ull_base(const char *filename,
int fd = open(filename, O_RDONLY), err = -1;
if (fd < 0)
- return -1;
+ return -errno;
if (read(fd, line, sizeof(line)) > 0) {
*value = strtoull(line, NULL, base);
@@ -372,7 +372,7 @@ int filename__write_int(const char *filename, int value)
char buf[64];
if (fd < 0)
- return err;
+ return -errno;
sprintf(buf, "%d", value);
if (write(fd, buf, sizeof(buf)) == sizeof(buf))
diff --git a/tools/lib/bpf/bpf.c b/tools/lib/bpf/bpf.c
index becdfa701c75..359f73ead613 100644
--- a/tools/lib/bpf/bpf.c
+++ b/tools/lib/bpf/bpf.c
@@ -238,7 +238,7 @@ int bpf_prog_load(enum bpf_prog_type prog_type,
const struct bpf_insn *insns, size_t insn_cnt,
struct bpf_prog_load_opts *opts)
{
- const size_t attr_sz = offsetofend(union bpf_attr, prog_token_fd);
+ const size_t attr_sz = offsetofend(union bpf_attr, fd_array_cnt);
void *finfo = NULL, *linfo = NULL;
const char *func_info, *line_info;
__u32 log_size, log_level, attach_prog_fd, attach_btf_obj_fd;
@@ -311,6 +311,7 @@ int bpf_prog_load(enum bpf_prog_type prog_type,
attr.line_info_cnt = OPTS_GET(opts, line_info_cnt, 0);
attr.fd_array = ptr_to_u64(OPTS_GET(opts, fd_array, NULL));
+ attr.fd_array_cnt = OPTS_GET(opts, fd_array_cnt, 0);
if (log_level) {
attr.log_buf = ptr_to_u64(log_buf);
diff --git a/tools/lib/bpf/bpf.h b/tools/lib/bpf/bpf.h
index a4a7b1ad1b63..435da95d2058 100644
--- a/tools/lib/bpf/bpf.h
+++ b/tools/lib/bpf/bpf.h
@@ -107,9 +107,12 @@ struct bpf_prog_load_opts {
*/
__u32 log_true_size;
__u32 token_fd;
+
+ /* if set, provides the length of fd_array */
+ __u32 fd_array_cnt;
size_t :0;
};
-#define bpf_prog_load_opts__last_field token_fd
+#define bpf_prog_load_opts__last_field fd_array_cnt
LIBBPF_API int bpf_prog_load(enum bpf_prog_type prog_type,
const char *prog_name, const char *license,
diff --git a/tools/lib/bpf/btf.c b/tools/lib/bpf/btf.c
index 12468ae0d573..48c66f3a9200 100644
--- a/tools/lib/bpf/btf.c
+++ b/tools/lib/bpf/btf.c
@@ -283,7 +283,7 @@ static int btf_parse_str_sec(struct btf *btf)
return -EINVAL;
}
if (!btf->base_btf && start[0]) {
- pr_debug("Invalid BTF string section\n");
+ pr_debug("Malformed BTF string section, did you forget to provide base BTF?\n");
return -EINVAL;
}
return 0;
@@ -1186,6 +1186,7 @@ static struct btf *btf_parse_elf(const char *path, struct btf *base_btf,
elf = elf_begin(fd, ELF_C_READ, NULL);
if (!elf) {
+ err = -LIBBPF_ERRNO__FORMAT;
pr_warn("failed to open %s as ELF file\n", path);
goto done;
}
diff --git a/tools/lib/bpf/btf_relocate.c b/tools/lib/bpf/btf_relocate.c
index b72f83e15156..53d1f3541bce 100644
--- a/tools/lib/bpf/btf_relocate.c
+++ b/tools/lib/bpf/btf_relocate.c
@@ -212,7 +212,7 @@ static int btf_relocate_map_distilled_base(struct btf_relocate *r)
* need to match both name and size, otherwise embedding the base
* struct/union in the split type is invalid.
*/
- for (id = r->nr_dist_base_types; id < r->nr_split_types; id++) {
+ for (id = r->nr_dist_base_types; id < r->nr_dist_base_types + r->nr_split_types; id++) {
err = btf_mark_embedded_composite_type_ids(r, id);
if (err)
goto done;
diff --git a/tools/lib/bpf/libbpf.c b/tools/lib/bpf/libbpf.c
index 66173ddb5a2d..194809da5172 100644
--- a/tools/lib/bpf/libbpf.c
+++ b/tools/lib/bpf/libbpf.c
@@ -1731,12 +1731,24 @@ static int sys_memfd_create(const char *name, unsigned flags)
#ifndef MFD_CLOEXEC
#define MFD_CLOEXEC 0x0001U
#endif
+#ifndef MFD_NOEXEC_SEAL
+#define MFD_NOEXEC_SEAL 0x0008U
+#endif
static int create_placeholder_fd(void)
{
+ unsigned int flags = MFD_CLOEXEC | MFD_NOEXEC_SEAL;
+ const char *name = "libbpf-placeholder-fd";
int fd;
- fd = ensure_good_fd(sys_memfd_create("libbpf-placeholder-fd", MFD_CLOEXEC));
+ fd = ensure_good_fd(sys_memfd_create(name, flags));
+ if (fd >= 0)
+ return fd;
+ else if (errno != EINVAL)
+ return -errno;
+
+ /* Possibly running on kernel without MFD_NOEXEC_SEAL */
+ fd = ensure_good_fd(sys_memfd_create(name, flags & ~MFD_NOEXEC_SEAL));
if (fd < 0)
return -errno;
return fd;
@@ -11375,9 +11387,33 @@ static int avail_kallsyms_cb(unsigned long long sym_addr, char sym_type,
struct kprobe_multi_resolve *res = data->res;
int err;
- if (!bsearch(&sym_name, data->syms, data->cnt, sizeof(*data->syms), avail_func_cmp))
+ if (!glob_match(sym_name, res->pattern))
return 0;
+ if (!bsearch(&sym_name, data->syms, data->cnt, sizeof(*data->syms), avail_func_cmp)) {
+ /* Some versions of kernel strip out .llvm.<hash> suffix from
+ * function names reported in available_filter_functions, but
+ * don't do so for kallsyms. While this is clearly a kernel
+ * bug (fixed by [0]) we try to accommodate that in libbpf to
+ * make multi-kprobe usability a bit better: if no match is
+ * found, we will strip .llvm. suffix and try one more time.
+ *
+ * [0] fb6a421fb615 ("kallsyms: Match symbols exactly with CONFIG_LTO_CLANG")
+ */
+ char sym_trim[256], *psym_trim = sym_trim, *sym_sfx;
+
+ if (!(sym_sfx = strstr(sym_name, ".llvm.")))
+ return 0;
+
+ /* psym_trim vs sym_trim dance is done to avoid pointer vs array
+ * coercion differences and get proper `const char **` pointer
+ * which avail_func_cmp() expects
+ */
+ snprintf(sym_trim, sizeof(sym_trim), "%.*s", (int)(sym_sfx - sym_name), sym_name);
+ if (!bsearch(&psym_trim, data->syms, data->cnt, sizeof(*data->syms), avail_func_cmp))
+ return 0;
+ }
+
err = libbpf_ensure_mem((void **)&res->addrs, &res->cap, sizeof(*res->addrs), res->cnt + 1);
if (err)
return err;
@@ -11522,7 +11558,7 @@ bpf_program__attach_kprobe_multi_opts(const struct bpf_program *prog,
struct bpf_link *link = NULL;
const unsigned long *addrs;
int err, link_fd, prog_fd;
- bool retprobe, session;
+ bool retprobe, session, unique_match;
const __u64 *cookies;
const char **syms;
size_t cnt;
@@ -11541,6 +11577,7 @@ bpf_program__attach_kprobe_multi_opts(const struct bpf_program *prog,
addrs = OPTS_GET(opts, addrs, false);
cnt = OPTS_GET(opts, cnt, false);
cookies = OPTS_GET(opts, cookies, false);
+ unique_match = OPTS_GET(opts, unique_match, false);
if (!pattern && !addrs && !syms)
return libbpf_err_ptr(-EINVAL);
@@ -11548,6 +11585,8 @@ bpf_program__attach_kprobe_multi_opts(const struct bpf_program *prog,
return libbpf_err_ptr(-EINVAL);
if (!pattern && !cnt)
return libbpf_err_ptr(-EINVAL);
+ if (!pattern && unique_match)
+ return libbpf_err_ptr(-EINVAL);
if (addrs && syms)
return libbpf_err_ptr(-EINVAL);
@@ -11558,6 +11597,14 @@ bpf_program__attach_kprobe_multi_opts(const struct bpf_program *prog,
err = libbpf_available_kallsyms_parse(&res);
if (err)
goto error;
+
+ if (unique_match && res.cnt != 1) {
+ pr_warn("prog '%s': failed to find a unique match for '%s' (%zu matches)\n",
+ prog->name, pattern, res.cnt);
+ err = -EINVAL;
+ goto error;
+ }
+
addrs = res.addrs;
cnt = res.cnt;
}
diff --git a/tools/lib/bpf/libbpf.h b/tools/lib/bpf/libbpf.h
index b2ce3a72b11d..3020ee45303a 100644
--- a/tools/lib/bpf/libbpf.h
+++ b/tools/lib/bpf/libbpf.h
@@ -552,10 +552,12 @@ struct bpf_kprobe_multi_opts {
bool retprobe;
/* create session kprobes */
bool session;
+ /* enforce unique match */
+ bool unique_match;
size_t :0;
};
-#define bpf_kprobe_multi_opts__last_field session
+#define bpf_kprobe_multi_opts__last_field unique_match
LIBBPF_API struct bpf_link *
bpf_program__attach_kprobe_multi_opts(const struct bpf_program *prog,
@@ -1796,9 +1798,14 @@ struct bpf_linker_file_opts {
struct bpf_linker;
LIBBPF_API struct bpf_linker *bpf_linker__new(const char *filename, struct bpf_linker_opts *opts);
+LIBBPF_API struct bpf_linker *bpf_linker__new_fd(int fd, struct bpf_linker_opts *opts);
LIBBPF_API int bpf_linker__add_file(struct bpf_linker *linker,
const char *filename,
const struct bpf_linker_file_opts *opts);
+LIBBPF_API int bpf_linker__add_fd(struct bpf_linker *linker, int fd,
+ const struct bpf_linker_file_opts *opts);
+LIBBPF_API int bpf_linker__add_buf(struct bpf_linker *linker, void *buf, size_t buf_sz,
+ const struct bpf_linker_file_opts *opts);
LIBBPF_API int bpf_linker__finalize(struct bpf_linker *linker);
LIBBPF_API void bpf_linker__free(struct bpf_linker *linker);
diff --git a/tools/lib/bpf/libbpf.map b/tools/lib/bpf/libbpf.map
index 54b6f312cfa8..a8b2936a1646 100644
--- a/tools/lib/bpf/libbpf.map
+++ b/tools/lib/bpf/libbpf.map
@@ -432,4 +432,8 @@ LIBBPF_1.5.0 {
} LIBBPF_1.4.0;
LIBBPF_1.6.0 {
+ global:
+ bpf_linker__add_buf;
+ bpf_linker__add_fd;
+ bpf_linker__new_fd;
} LIBBPF_1.5.0;
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index cf71d149fe26..b52f71c59616 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -4,6 +4,10 @@
*
* Copyright (c) 2021 Facebook
*/
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
#include <stdbool.h>
#include <stddef.h>
#include <stdio.h>
@@ -16,6 +20,7 @@
#include <elf.h>
#include <libelf.h>
#include <fcntl.h>
+#include <sys/mman.h>
#include "libbpf.h"
#include "btf.h"
#include "libbpf_internal.h"
@@ -152,15 +157,19 @@ struct bpf_linker {
/* global (including extern) ELF symbols */
int glob_sym_cnt;
struct glob_sym *glob_syms;
+
+ bool fd_is_owned;
};
#define pr_warn_elf(fmt, ...) \
libbpf_print(LIBBPF_WARN, "libbpf: " fmt ": %s\n", ##__VA_ARGS__, elf_errmsg(-1))
-static int init_output_elf(struct bpf_linker *linker, const char *file);
+static int init_output_elf(struct bpf_linker *linker);
-static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
- const struct bpf_linker_file_opts *opts,
+static int bpf_linker_add_file(struct bpf_linker *linker, int fd,
+ const char *filename);
+
+static int linker_load_obj_file(struct bpf_linker *linker,
struct src_obj *obj);
static int linker_sanity_check_elf(struct src_obj *obj);
static int linker_sanity_check_elf_symtab(struct src_obj *obj, struct src_sec *sec);
@@ -191,7 +200,7 @@ void bpf_linker__free(struct bpf_linker *linker)
if (linker->elf)
elf_end(linker->elf);
- if (linker->fd >= 0)
+ if (linker->fd >= 0 && linker->fd_is_owned)
close(linker->fd);
strset__free(linker->strtab_strs);
@@ -233,9 +242,63 @@ struct bpf_linker *bpf_linker__new(const char *filename, struct bpf_linker_opts
if (!linker)
return errno = ENOMEM, NULL;
- linker->fd = -1;
+ linker->filename = strdup(filename);
+ if (!linker->filename) {
+ err = -ENOMEM;
+ goto err_out;
+ }
+
+ linker->fd = open(filename, O_WRONLY | O_CREAT | O_TRUNC | O_CLOEXEC, 0644);
+ if (linker->fd < 0) {
+ err = -errno;
+ pr_warn("failed to create '%s': %d\n", filename, err);
+ goto err_out;
+ }
+ linker->fd_is_owned = true;
+
+ err = init_output_elf(linker);
+ if (err)
+ goto err_out;
+
+ return linker;
+
+err_out:
+ bpf_linker__free(linker);
+ return errno = -err, NULL;
+}
+
+struct bpf_linker *bpf_linker__new_fd(int fd, struct bpf_linker_opts *opts)
+{
+ struct bpf_linker *linker;
+ char filename[32];
+ int err;
+
+ if (fd < 0)
+ return errno = EINVAL, NULL;
+
+ if (!OPTS_VALID(opts, bpf_linker_opts))
+ return errno = EINVAL, NULL;
+
+ if (elf_version(EV_CURRENT) == EV_NONE) {
+ pr_warn_elf("libelf initialization failed");
+ return errno = EINVAL, NULL;
+ }
- err = init_output_elf(linker, filename);
+ linker = calloc(1, sizeof(*linker));
+ if (!linker)
+ return errno = ENOMEM, NULL;
+
+ snprintf(filename, sizeof(filename), "fd:%d", fd);
+ linker->filename = strdup(filename);
+ if (!linker->filename) {
+ err = -ENOMEM;
+ goto err_out;
+ }
+
+ linker->fd = fd;
+ linker->fd_is_owned = false;
+
+ err = init_output_elf(linker);
if (err)
goto err_out;
@@ -294,23 +357,12 @@ static Elf64_Sym *add_new_sym(struct bpf_linker *linker, size_t *sym_idx)
return sym;
}
-static int init_output_elf(struct bpf_linker *linker, const char *file)
+static int init_output_elf(struct bpf_linker *linker)
{
int err, str_off;
Elf64_Sym *init_sym;
struct dst_sec *sec;
- linker->filename = strdup(file);
- if (!linker->filename)
- return -ENOMEM;
-
- linker->fd = open(file, O_WRONLY | O_CREAT | O_TRUNC | O_CLOEXEC, 0644);
- if (linker->fd < 0) {
- err = -errno;
- pr_warn("failed to create '%s': %s\n", file, errstr(err));
- return err;
- }
-
linker->elf = elf_begin(linker->fd, ELF_C_WRITE, NULL);
if (!linker->elf) {
pr_warn_elf("failed to create ELF object");
@@ -436,19 +488,16 @@ static int init_output_elf(struct bpf_linker *linker, const char *file)
return 0;
}
-int bpf_linker__add_file(struct bpf_linker *linker, const char *filename,
- const struct bpf_linker_file_opts *opts)
+static int bpf_linker_add_file(struct bpf_linker *linker, int fd,
+ const char *filename)
{
struct src_obj obj = {};
int err = 0;
- if (!OPTS_VALID(opts, bpf_linker_file_opts))
- return libbpf_err(-EINVAL);
-
- if (!linker->elf)
- return libbpf_err(-EINVAL);
+ obj.filename = filename;
+ obj.fd = fd;
- err = err ?: linker_load_obj_file(linker, filename, opts, &obj);
+ err = err ?: linker_load_obj_file(linker, &obj);
err = err ?: linker_append_sec_data(linker, &obj);
err = err ?: linker_append_elf_syms(linker, &obj);
err = err ?: linker_append_elf_relos(linker, &obj);
@@ -463,12 +512,91 @@ int bpf_linker__add_file(struct bpf_linker *linker, const char *filename,
free(obj.sym_map);
if (obj.elf)
elf_end(obj.elf);
- if (obj.fd >= 0)
- close(obj.fd);
+ return err;
+}
+
+int bpf_linker__add_file(struct bpf_linker *linker, const char *filename,
+ const struct bpf_linker_file_opts *opts)
+{
+ int fd, err;
+
+ if (!OPTS_VALID(opts, bpf_linker_file_opts))
+ return libbpf_err(-EINVAL);
+
+ if (!linker->elf)
+ return libbpf_err(-EINVAL);
+
+ fd = open(filename, O_RDONLY | O_CLOEXEC);
+ if (fd < 0) {
+ err = -errno;
+ pr_warn("failed to open file '%s': %s\n", filename, errstr(err));
+ return libbpf_err(err);
+ }
+
+ err = bpf_linker_add_file(linker, fd, filename);
+ close(fd);
return libbpf_err(err);
}
+int bpf_linker__add_fd(struct bpf_linker *linker, int fd,
+ const struct bpf_linker_file_opts *opts)
+{
+ char filename[32];
+ int err;
+
+ if (!OPTS_VALID(opts, bpf_linker_file_opts))
+ return libbpf_err(-EINVAL);
+
+ if (!linker->elf)
+ return libbpf_err(-EINVAL);
+
+ if (fd < 0)
+ return libbpf_err(-EINVAL);
+
+ snprintf(filename, sizeof(filename), "fd:%d", fd);
+ err = bpf_linker_add_file(linker, fd, filename);
+ return libbpf_err(err);
+}
+
+int bpf_linker__add_buf(struct bpf_linker *linker, void *buf, size_t buf_sz,
+ const struct bpf_linker_file_opts *opts)
+{
+ char filename[32];
+ int fd, written, ret;
+
+ if (!OPTS_VALID(opts, bpf_linker_file_opts))
+ return libbpf_err(-EINVAL);
+
+ if (!linker->elf)
+ return libbpf_err(-EINVAL);
+
+ snprintf(filename, sizeof(filename), "mem:%p+%zu", buf, buf_sz);
+
+ fd = memfd_create(filename, 0);
+ if (fd < 0) {
+ ret = -errno;
+ pr_warn("failed to create memfd '%s': %s\n", filename, errstr(ret));
+ return libbpf_err(ret);
+ }
+
+ written = 0;
+ while (written < buf_sz) {
+ ret = write(fd, buf, buf_sz);
+ if (ret < 0) {
+ ret = -errno;
+ pr_warn("failed to write '%s': %s\n", filename, errstr(ret));
+ goto err_out;
+ }
+ written += ret;
+ }
+
+ ret = bpf_linker_add_file(linker, fd, filename);
+err_out:
+ close(fd);
+ return libbpf_err(ret);
+}
+
static bool is_dwarf_sec_name(const char *name)
{
/* approximation, but the actual list is too long */
@@ -534,8 +662,7 @@ static struct src_sec *add_src_sec(struct src_obj *obj, const char *sec_name)
return sec;
}
-static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
- const struct bpf_linker_file_opts *opts,
+static int linker_load_obj_file(struct bpf_linker *linker,
struct src_obj *obj)
{
int err = 0;
@@ -554,36 +681,26 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
#error "Unknown __BYTE_ORDER__"
#endif
- pr_debug("linker: adding object file '%s'...\n", filename);
-
- obj->filename = filename;
+ pr_debug("linker: adding object file '%s'...\n", obj->filename);
- obj->fd = open(filename, O_RDONLY | O_CLOEXEC);
- if (obj->fd < 0) {
- err = -errno;
- pr_warn("failed to open file '%s': %s\n", filename, errstr(err));
- return err;
- }
obj->elf = elf_begin(obj->fd, ELF_C_READ_MMAP, NULL);
if (!obj->elf) {
- err = -errno;
- pr_warn_elf("failed to parse ELF file '%s'", filename);
- return err;
+ pr_warn_elf("failed to parse ELF file '%s'", obj->filename);
+ return -EINVAL;
}
/* Sanity check ELF file high-level properties */
ehdr = elf64_getehdr(obj->elf);
if (!ehdr) {
- err = -errno;
- pr_warn_elf("failed to get ELF header for %s", filename);
- return err;
+ pr_warn_elf("failed to get ELF header for %s", obj->filename);
+ return -EINVAL;
}
/* Linker output endianness set by first input object */
obj_byteorder = ehdr->e_ident[EI_DATA];
if (obj_byteorder != ELFDATA2LSB && obj_byteorder != ELFDATA2MSB) {
err = -EOPNOTSUPP;
- pr_warn("unknown byte order of ELF file %s\n", filename);
+ pr_warn("unknown byte order of ELF file %s\n", obj->filename);
return err;
}
if (link_byteorder == ELFDATANONE) {
@@ -593,7 +710,7 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
obj_byteorder == ELFDATA2MSB ? "big" : "little");
} else if (link_byteorder != obj_byteorder) {
err = -EOPNOTSUPP;
- pr_warn("byte order mismatch with ELF file %s\n", filename);
+ pr_warn("byte order mismatch with ELF file %s\n", obj->filename);
return err;
}
@@ -601,14 +718,13 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
|| ehdr->e_machine != EM_BPF
|| ehdr->e_ident[EI_CLASS] != ELFCLASS64) {
err = -EOPNOTSUPP;
- pr_warn_elf("unsupported kind of ELF file %s", filename);
+ pr_warn_elf("unsupported kind of ELF file %s", obj->filename);
return err;
}
if (elf_getshdrstrndx(obj->elf, &obj->shstrs_sec_idx)) {
- err = -errno;
- pr_warn_elf("failed to get SHSTRTAB section index for %s", filename);
- return err;
+ pr_warn_elf("failed to get SHSTRTAB section index for %s", obj->filename);
+ return -EINVAL;
}
scn = NULL;
@@ -618,26 +734,23 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
shdr = elf64_getshdr(scn);
if (!shdr) {
- err = -errno;
pr_warn_elf("failed to get section #%zu header for %s",
- sec_idx, filename);
- return err;
+ sec_idx, obj->filename);
+ return -EINVAL;
}
sec_name = elf_strptr(obj->elf, obj->shstrs_sec_idx, shdr->sh_name);
if (!sec_name) {
- err = -errno;
pr_warn_elf("failed to get section #%zu name for %s",
- sec_idx, filename);
- return err;
+ sec_idx, obj->filename);
+ return -EINVAL;
}
data = elf_getdata(scn, 0);
if (!data) {
- err = -errno;
pr_warn_elf("failed to get section #%zu (%s) data from %s",
- sec_idx, sec_name, filename);
- return err;
+ sec_idx, sec_name, obj->filename);
+ return -EINVAL;
}
sec = add_src_sec(obj, sec_name);
@@ -672,7 +785,7 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
err = libbpf_get_error(obj->btf);
if (err) {
pr_warn("failed to parse .BTF from %s: %s\n",
- filename, errstr(err));
+ obj->filename, errstr(err));
return err;
}
sec->skipped = true;
@@ -683,7 +796,7 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
err = libbpf_get_error(obj->btf_ext);
if (err) {
pr_warn("failed to parse .BTF.ext from '%s': %s\n",
- filename, errstr(err));
+ obj->filename, errstr(err));
return err;
}
sec->skipped = true;
@@ -700,7 +813,7 @@ static int linker_load_obj_file(struct bpf_linker *linker, const char *filename,
break;
default:
pr_warn("unrecognized section #%zu (%s) in %s\n",
- sec_idx, sec_name, filename);
+ sec_idx, sec_name, obj->filename);
err = -EINVAL;
return err;
}
@@ -2680,22 +2793,23 @@ int bpf_linker__finalize(struct bpf_linker *linker)
/* Finalize ELF layout */
if (elf_update(linker->elf, ELF_C_NULL) < 0) {
- err = -errno;
+ err = -EINVAL;
pr_warn_elf("failed to finalize ELF layout");
return libbpf_err(err);
}
/* Write out final ELF contents */
if (elf_update(linker->elf, ELF_C_WRITE) < 0) {
- err = -errno;
+ err = -EINVAL;
pr_warn_elf("failed to write ELF contents");
return libbpf_err(err);
}
elf_end(linker->elf);
- close(linker->fd);
-
linker->elf = NULL;
+
+ if (linker->fd_is_owned)
+ close(linker->fd);
linker->fd = -1;
return 0;
diff --git a/tools/lib/bpf/usdt.c b/tools/lib/bpf/usdt.c
index 5f085736c6c4..4e4a52742b01 100644
--- a/tools/lib/bpf/usdt.c
+++ b/tools/lib/bpf/usdt.c
@@ -661,7 +661,7 @@ static int collect_usdt_targets(struct usdt_manager *man, Elf *elf, const char *
* [0] https://sourceware.org/systemtap/wiki/UserSpaceProbeImplementation
*/
usdt_abs_ip = note.loc_addr;
- if (base_addr)
+ if (base_addr && note.base_addr)
usdt_abs_ip += base_addr - note.base_addr;
/* When attaching uprobes (which is what USDTs basically are)
diff --git a/tools/lib/perf/Documentation/libperf.txt b/tools/lib/perf/Documentation/libperf.txt
index fcfb9499ef9c..59aabdd3cabf 100644
--- a/tools/lib/perf/Documentation/libperf.txt
+++ b/tools/lib/perf/Documentation/libperf.txt
@@ -39,7 +39,6 @@ SYNOPSIS
struct perf_cpu_map *perf_cpu_map__new_any_cpu(void);
struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list);
- struct perf_cpu_map *perf_cpu_map__read(FILE *file);
struct perf_cpu_map *perf_cpu_map__get(struct perf_cpu_map *map);
struct perf_cpu_map *perf_cpu_map__merge(struct perf_cpu_map *orig,
struct perf_cpu_map *other);
diff --git a/tools/lib/perf/cpumap.c b/tools/lib/perf/cpumap.c
index cae799ad44e1..fcc47214062a 100644
--- a/tools/lib/perf/cpumap.c
+++ b/tools/lib/perf/cpumap.c
@@ -1,4 +1,5 @@
// SPDX-License-Identifier: GPL-2.0-only
+#include <errno.h>
#include <perf/cpumap.h>
#include <stdlib.h>
#include <linux/refcount.h>
@@ -10,6 +11,9 @@
#include <ctype.h>
#include <limits.h>
#include "internal.h"
+#include <api/fs/fs.h>
+
+#define MAX_NR_CPUS 4096
void perf_cpu_map__set_nr(struct perf_cpu_map *map, int nr_cpus)
{
@@ -100,12 +104,12 @@ static struct perf_cpu_map *cpu_map__new_sysconf(void)
static struct perf_cpu_map *cpu_map__new_sysfs_online(void)
{
struct perf_cpu_map *cpus = NULL;
- FILE *onlnf;
+ char *buf = NULL;
+ size_t buf_len;
- onlnf = fopen("/sys/devices/system/cpu/online", "r");
- if (onlnf) {
- cpus = perf_cpu_map__read(onlnf);
- fclose(onlnf);
+ if (sysfs__read_str("devices/system/cpu/online", &buf, &buf_len) >= 0) {
+ cpus = perf_cpu_map__new(buf);
+ free(buf);
}
return cpus;
}
@@ -158,62 +162,6 @@ static struct perf_cpu_map *cpu_map__trim_new(int nr_cpus, const struct perf_cpu
return cpus;
}
-struct perf_cpu_map *perf_cpu_map__read(FILE *file)
-{
- struct perf_cpu_map *cpus = NULL;
- int nr_cpus = 0;
- struct perf_cpu *tmp_cpus = NULL, *tmp;
- int max_entries = 0;
- int n, cpu, prev;
- char sep;
-
- sep = 0;
- prev = -1;
- for (;;) {
- n = fscanf(file, "%u%c", &cpu, &sep);
- if (n <= 0)
- break;
- if (prev >= 0) {
- int new_max = nr_cpus + cpu - prev - 1;
-
- WARN_ONCE(new_max >= MAX_NR_CPUS, "Perf can support %d CPUs. "
- "Consider raising MAX_NR_CPUS\n", MAX_NR_CPUS);
-
- if (new_max >= max_entries) {
- max_entries = new_max + MAX_NR_CPUS / 2;
- tmp = realloc(tmp_cpus, max_entries * sizeof(struct perf_cpu));
- if (tmp == NULL)
- goto out_free_tmp;
- tmp_cpus = tmp;
- }
-
- while (++prev < cpu)
- tmp_cpus[nr_cpus++].cpu = prev;
- }
- if (nr_cpus == max_entries) {
- max_entries += MAX_NR_CPUS;
- tmp = realloc(tmp_cpus, max_entries * sizeof(struct perf_cpu));
- if (tmp == NULL)
- goto out_free_tmp;
- tmp_cpus = tmp;
- }
-
- tmp_cpus[nr_cpus++].cpu = cpu;
- if (n == 2 && sep == '-')
- prev = cpu;
- else
- prev = -1;
- if (n == 1 || sep == '\n')
- break;
- }
-
- if (nr_cpus > 0)
- cpus = cpu_map__trim_new(nr_cpus, tmp_cpus);
-out_free_tmp:
- free(tmp_cpus);
- return cpus;
-}
-
struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list)
{
struct perf_cpu_map *cpus = NULL;
@@ -238,7 +186,7 @@ struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list)
p = NULL;
start_cpu = strtoul(cpu_list, &p, 0);
if (start_cpu >= INT_MAX
- || (*p != '\0' && *p != ',' && *p != '-'))
+ || (*p != '\0' && *p != ',' && *p != '-' && *p != '\n'))
goto invalid;
if (*p == '-') {
@@ -246,7 +194,7 @@ struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list)
p = NULL;
end_cpu = strtoul(cpu_list, &p, 0);
- if (end_cpu >= INT_MAX || (*p != '\0' && *p != ','))
+ if (end_cpu >= INT_MAX || (*p != '\0' && *p != ',' && *p != '\n'))
goto invalid;
if (end_cpu < start_cpu)
@@ -265,7 +213,7 @@ struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list)
goto invalid;
if (nr_cpus == max_entries) {
- max_entries += MAX_NR_CPUS;
+ max_entries += max(end_cpu - start_cpu + 1, 16UL);
tmp = realloc(tmp_cpus, max_entries * sizeof(struct perf_cpu));
if (tmp == NULL)
goto invalid;
@@ -279,14 +227,15 @@ struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list)
cpu_list = p;
}
- if (nr_cpus > 0)
+ if (nr_cpus > 0) {
cpus = cpu_map__trim_new(nr_cpus, tmp_cpus);
- else if (*cpu_list != '\0') {
+ } else if (*cpu_list != '\0') {
pr_warning("Unexpected characters at end of cpu list ('%s'), using online CPUs.",
cpu_list);
cpus = perf_cpu_map__new_online_cpus();
- } else
+ } else {
cpus = perf_cpu_map__new_any_cpu();
+ }
invalid:
free(tmp_cpus);
out:
@@ -436,46 +385,49 @@ bool perf_cpu_map__is_subset(const struct perf_cpu_map *a, const struct perf_cpu
}
/*
- * Merge two cpumaps
+ * Merge two cpumaps.
+ *
+ * If 'other' is subset of '*orig', '*orig' keeps itself with no reference count
+ * change (similar to "realloc").
+ *
+ * If '*orig' is subset of 'other', '*orig' reuses 'other' with its reference
+ * count increased.
*
- * orig either gets freed and replaced with a new map, or reused
- * with no reference count change (similar to "realloc")
- * other has its reference count increased.
+ * Otherwise, '*orig' gets freed and replaced with a new map.
*/
-
-struct perf_cpu_map *perf_cpu_map__merge(struct perf_cpu_map *orig,
- struct perf_cpu_map *other)
+int perf_cpu_map__merge(struct perf_cpu_map **orig, struct perf_cpu_map *other)
{
struct perf_cpu *tmp_cpus;
int tmp_len;
int i, j, k;
struct perf_cpu_map *merged;
- if (perf_cpu_map__is_subset(orig, other))
- return orig;
- if (perf_cpu_map__is_subset(other, orig)) {
- perf_cpu_map__put(orig);
- return perf_cpu_map__get(other);
+ if (perf_cpu_map__is_subset(*orig, other))
+ return 0;
+ if (perf_cpu_map__is_subset(other, *orig)) {
+ perf_cpu_map__put(*orig);
+ *orig = perf_cpu_map__get(other);
+ return 0;
}
- tmp_len = __perf_cpu_map__nr(orig) + __perf_cpu_map__nr(other);
+ tmp_len = __perf_cpu_map__nr(*orig) + __perf_cpu_map__nr(other);
tmp_cpus = malloc(tmp_len * sizeof(struct perf_cpu));
if (!tmp_cpus)
- return NULL;
+ return -ENOMEM;
/* Standard merge algorithm from wikipedia */
i = j = k = 0;
- while (i < __perf_cpu_map__nr(orig) && j < __perf_cpu_map__nr(other)) {
- if (__perf_cpu_map__cpu(orig, i).cpu <= __perf_cpu_map__cpu(other, j).cpu) {
- if (__perf_cpu_map__cpu(orig, i).cpu == __perf_cpu_map__cpu(other, j).cpu)
+ while (i < __perf_cpu_map__nr(*orig) && j < __perf_cpu_map__nr(other)) {
+ if (__perf_cpu_map__cpu(*orig, i).cpu <= __perf_cpu_map__cpu(other, j).cpu) {
+ if (__perf_cpu_map__cpu(*orig, i).cpu == __perf_cpu_map__cpu(other, j).cpu)
j++;
- tmp_cpus[k++] = __perf_cpu_map__cpu(orig, i++);
+ tmp_cpus[k++] = __perf_cpu_map__cpu(*orig, i++);
} else
tmp_cpus[k++] = __perf_cpu_map__cpu(other, j++);
}
- while (i < __perf_cpu_map__nr(orig))
- tmp_cpus[k++] = __perf_cpu_map__cpu(orig, i++);
+ while (i < __perf_cpu_map__nr(*orig))
+ tmp_cpus[k++] = __perf_cpu_map__cpu(*orig, i++);
while (j < __perf_cpu_map__nr(other))
tmp_cpus[k++] = __perf_cpu_map__cpu(other, j++);
@@ -483,8 +435,9 @@ struct perf_cpu_map *perf_cpu_map__merge(struct perf_cpu_map *orig,
merged = cpu_map__trim_new(k, tmp_cpus);
free(tmp_cpus);
- perf_cpu_map__put(orig);
- return merged;
+ perf_cpu_map__put(*orig);
+ *orig = merged;
+ return 0;
}
struct perf_cpu_map *perf_cpu_map__intersect(struct perf_cpu_map *orig,
diff --git a/tools/lib/perf/evlist.c b/tools/lib/perf/evlist.c
index c6d67fc9e57e..b1f4c8176b32 100644
--- a/tools/lib/perf/evlist.c
+++ b/tools/lib/perf/evlist.c
@@ -47,6 +47,20 @@ static void __perf_evlist__propagate_maps(struct perf_evlist *evlist,
*/
perf_cpu_map__put(evsel->cpus);
evsel->cpus = perf_cpu_map__intersect(evlist->user_requested_cpus, evsel->own_cpus);
+
+ /*
+ * Empty cpu lists would eventually get opened as "any" so remove
+ * genuinely empty ones before they're opened in the wrong place.
+ */
+ if (perf_cpu_map__is_empty(evsel->cpus)) {
+ struct perf_evsel *next = perf_evlist__next(evlist, evsel);
+
+ perf_evlist__remove(evlist, evsel);
+ /* Keep idx contiguous */
+ if (next)
+ list_for_each_entry_from(next, &evlist->entries, node)
+ next->idx--;
+ }
} else if (!evsel->own_cpus || evlist->has_user_cpus ||
(!evsel->requires_cpu && perf_cpu_map__has_any_cpu(evlist->user_requested_cpus))) {
/*
@@ -75,16 +89,16 @@ static void __perf_evlist__propagate_maps(struct perf_evlist *evlist,
evsel->threads = perf_thread_map__get(evlist->threads);
}
- evlist->all_cpus = perf_cpu_map__merge(evlist->all_cpus, evsel->cpus);
+ perf_cpu_map__merge(&evlist->all_cpus, evsel->cpus);
}
static void perf_evlist__propagate_maps(struct perf_evlist *evlist)
{
- struct perf_evsel *evsel;
+ struct perf_evsel *evsel, *n;
evlist->needs_map_propagation = true;
- perf_evlist__for_each_evsel(evlist, evsel)
+ list_for_each_entry_safe(evsel, n, &evlist->entries, node)
__perf_evlist__propagate_maps(evlist, evsel);
}
diff --git a/tools/lib/perf/include/internal/cpumap.h b/tools/lib/perf/include/internal/cpumap.h
index 49649eb51ce4..e2be2d17c32b 100644
--- a/tools/lib/perf/include/internal/cpumap.h
+++ b/tools/lib/perf/include/internal/cpumap.h
@@ -21,10 +21,6 @@ DECLARE_RC_STRUCT(perf_cpu_map) {
struct perf_cpu map[];
};
-#ifndef MAX_NR_CPUS
-#define MAX_NR_CPUS 2048
-#endif
-
struct perf_cpu_map *perf_cpu_map__alloc(int nr_cpus);
int perf_cpu_map__idx(const struct perf_cpu_map *cpus, struct perf_cpu cpu);
bool perf_cpu_map__is_subset(const struct perf_cpu_map *a, const struct perf_cpu_map *b);
diff --git a/tools/lib/perf/include/perf/cpumap.h b/tools/lib/perf/include/perf/cpumap.h
index 90457d17fb2f..188a667babc6 100644
--- a/tools/lib/perf/include/perf/cpumap.h
+++ b/tools/lib/perf/include/perf/cpumap.h
@@ -3,7 +3,6 @@
#define __LIBPERF_CPUMAP_H
#include <perf/core.h>
-#include <stdio.h>
#include <stdbool.h>
/** A wrapper around a CPU to avoid confusion with the perf_cpu_map's map's indices. */
@@ -37,10 +36,9 @@ LIBPERF_API struct perf_cpu_map *perf_cpu_map__new_online_cpus(void);
* perf_cpu_map__new_online_cpus is returned.
*/
LIBPERF_API struct perf_cpu_map *perf_cpu_map__new(const char *cpu_list);
-LIBPERF_API struct perf_cpu_map *perf_cpu_map__read(FILE *file);
LIBPERF_API struct perf_cpu_map *perf_cpu_map__get(struct perf_cpu_map *map);
-LIBPERF_API struct perf_cpu_map *perf_cpu_map__merge(struct perf_cpu_map *orig,
- struct perf_cpu_map *other);
+LIBPERF_API int perf_cpu_map__merge(struct perf_cpu_map **orig,
+ struct perf_cpu_map *other);
LIBPERF_API struct perf_cpu_map *perf_cpu_map__intersect(struct perf_cpu_map *orig,
struct perf_cpu_map *other);
LIBPERF_API void perf_cpu_map__put(struct perf_cpu_map *map);
diff --git a/tools/lib/perf/libperf.map b/tools/lib/perf/libperf.map
index 2aa79b696032..fdd8304fe9d0 100644
--- a/tools/lib/perf/libperf.map
+++ b/tools/lib/perf/libperf.map
@@ -6,7 +6,6 @@ LIBPERF_0.0.1 {
perf_cpu_map__get;
perf_cpu_map__put;
perf_cpu_map__new;
- perf_cpu_map__read;
perf_cpu_map__nr;
perf_cpu_map__cpu;
perf_cpu_map__has_any_cpu_or_is_empty;
diff --git a/tools/net/ynl/Makefile b/tools/net/ynl/Makefile
index d1cdf2a8f826..211df5a93ad9 100644
--- a/tools/net/ynl/Makefile
+++ b/tools/net/ynl/Makefile
@@ -1,5 +1,17 @@
# SPDX-License-Identifier: GPL-2.0
+include ../../scripts/Makefile.arch
+
+INSTALL ?= install
+prefix ?= /usr
+ifeq ($(LP64), 1)
+ libdir_relative = lib64
+else
+ libdir_relative = lib
+endif
+libdir ?= $(prefix)/$(libdir_relative)
+includedir ?= $(prefix)/include
+
SUBDIRS = lib generated samples
all: $(SUBDIRS) libynl.a
@@ -21,5 +33,20 @@ clean distclean:
fi \
done
rm -f libynl.a
+ rm -rf pyynl/__pycache__
+ rm -rf pyynl/lib/__pycache__
+ rm -rf pyynl.egg-info
+ rm -rf build
+
+install: libynl.a lib/*.h
+ @echo -e "\tINSTALL libynl.a"
+ @$(INSTALL) -d $(DESTDIR)$(libdir)
+ @$(INSTALL) -m 0644 libynl.a $(DESTDIR)$(libdir)/libynl.a
+ @echo -e "\tINSTALL libynl headers"
+ @$(INSTALL) -d $(DESTDIR)$(includedir)/ynl
+ @$(INSTALL) -m 0644 lib/*.h $(DESTDIR)$(includedir)/ynl/
+ @echo -e "\tINSTALL pyynl"
+ @pip install --prefix=$(DESTDIR)$(prefix) .
+ @make -C generated install
-.PHONY: all clean distclean $(SUBDIRS)
+.PHONY: all clean distclean install $(SUBDIRS)
diff --git a/tools/net/ynl/generated/.gitignore b/tools/net/ynl/generated/.gitignore
index ade488626d26..859a6fb446e1 100644
--- a/tools/net/ynl/generated/.gitignore
+++ b/tools/net/ynl/generated/.gitignore
@@ -1,2 +1,3 @@
*-user.c
*-user.h
+*.rst
diff --git a/tools/net/ynl/generated/Makefile b/tools/net/ynl/generated/Makefile
index 7db5240de58a..21f9e299dc75 100644
--- a/tools/net/ynl/generated/Makefile
+++ b/tools/net/ynl/generated/Makefile
@@ -7,32 +7,44 @@ ifeq ("$(DEBUG)","1")
CFLAGS += -g -fsanitize=address -fsanitize=leak -static-libasan
endif
+INSTALL ?= install
+prefix ?= /usr
+datarootdir ?= $(prefix)/share
+docdir ?= $(datarootdir)/doc
+includedir ?= $(prefix)/include
+
include ../Makefile.deps
YNL_GEN_ARG_ethtool:=--user-header linux/ethtool_netlink.h \
--exclude-op stats-get
-TOOL:=../ynl-gen-c.py
+TOOL:=../pyynl/ynl_gen_c.py
+TOOL_RST:=../pyynl/ynl_gen_rst.py
+SPECS_DIR:=../../../../Documentation/netlink/specs
GENS_PATHS=$(shell grep -nrI --files-without-match \
'protocol: netlink' \
- ../../../../Documentation/netlink/specs/)
-GENS=$(patsubst ../../../../Documentation/netlink/specs/%.yaml,%,${GENS_PATHS})
+ $(SPECS_DIR))
+GENS=$(patsubst $(SPECS_DIR)/%.yaml,%,${GENS_PATHS})
SRCS=$(patsubst %,%-user.c,${GENS})
HDRS=$(patsubst %,%-user.h,${GENS})
OBJS=$(patsubst %,%-user.o,${GENS})
-all: protos.a $(HDRS) $(SRCS) $(KHDRS) $(KSRCS) $(UAPI)
+SPECS_PATHS=$(wildcard $(SPECS_DIR)/*.yaml)
+SPECS=$(patsubst $(SPECS_DIR)/%.yaml,%,${SPECS_PATHS})
+RSTS=$(patsubst %,%.rst,${SPECS})
+
+all: protos.a $(HDRS) $(SRCS) $(KHDRS) $(KSRCS) $(UAPI) $(RSTS)
protos.a: $(OBJS)
@echo -e "\tAR $@"
@ar rcs $@ $(OBJS)
-%-user.h: ../../../../Documentation/netlink/specs/%.yaml $(TOOL)
+%-user.h: $(SPECS_DIR)/%.yaml $(TOOL)
@echo -e "\tGEN $@"
@$(TOOL) --mode user --header --spec $< -o $@ $(YNL_GEN_ARG_$*)
-%-user.c: ../../../../Documentation/netlink/specs/%.yaml $(TOOL)
+%-user.c: $(SPECS_DIR)/%.yaml $(TOOL)
@echo -e "\tGEN $@"
@$(TOOL) --mode user --source --spec $< -o $@ $(YNL_GEN_ARG_$*)
@@ -40,14 +52,37 @@ protos.a: $(OBJS)
@echo -e "\tCC $@"
@$(COMPILE.c) $(CFLAGS_$*) -o $@ $<
+%.rst: $(SPECS_DIR)/%.yaml $(TOOL_RST)
+ @echo -e "\tGEN_RST $@"
+ @$(TOOL_RST) -o $@ -i $<
+
clean:
rm -f *.o
distclean: clean
- rm -f *.c *.h *.a
+ rm -f *.c *.h *.a *.rst
regen:
@../ynl-regen.sh
-.PHONY: all clean distclean regen
+install-headers: $(HDRS)
+ @echo -e "\tINSTALL generated headers"
+ @$(INSTALL) -d $(DESTDIR)$(includedir)/ynl
+ @$(INSTALL) -m 0644 *.h $(DESTDIR)$(includedir)/ynl/
+
+install-rsts: $(RSTS)
+ @echo -e "\tINSTALL generated docs"
+ @$(INSTALL) -d $(DESTDIR)$(docdir)/ynl
+ @$(INSTALL) -m 0644 $(RSTS) $(DESTDIR)$(docdir)/ynl/
+
+install-specs:
+ @echo -e "\tINSTALL specs"
+ @$(INSTALL) -d $(DESTDIR)$(datarootdir)/ynl
+ @$(INSTALL) -m 0644 ../../../../Documentation/netlink/*.yaml $(DESTDIR)$(datarootdir)/ynl/
+ @$(INSTALL) -d $(DESTDIR)$(datarootdir)/ynl/specs
+ @$(INSTALL) -m 0644 $(SPECS_DIR)/*.yaml $(DESTDIR)$(datarootdir)/ynl/specs/
+
+install: install-headers install-rsts install-specs
+
+.PHONY: all clean distclean regen install install-headers install-rsts install-specs
.DEFAULT_GOAL: all
diff --git a/tools/net/ynl/lib/.gitignore b/tools/net/ynl/lib/.gitignore
index 296c4035dbf2..a4383358ec72 100644
--- a/tools/net/ynl/lib/.gitignore
+++ b/tools/net/ynl/lib/.gitignore
@@ -1,2 +1 @@
-__pycache__/
*.d
diff --git a/tools/net/ynl/lib/Makefile b/tools/net/ynl/lib/Makefile
index 94c49cca3dca..4b2b98704ff9 100644
--- a/tools/net/ynl/lib/Makefile
+++ b/tools/net/ynl/lib/Makefile
@@ -19,7 +19,6 @@ ynl.a: $(OBJS)
clean:
rm -f *.o *.d *~
- rm -rf __pycache__
distclean: clean
rm -f *.a
diff --git a/tools/net/ynl/pyproject.toml b/tools/net/ynl/pyproject.toml
new file mode 100644
index 000000000000..a81d8779b0e0
--- /dev/null
+++ b/tools/net/ynl/pyproject.toml
@@ -0,0 +1,24 @@
+[build-system]
+requires = ["setuptools>=61.0"]
+build-backend = "setuptools.build_meta"
+
+[project]
+name = "pyynl"
+authors = [
+ {name = "Donald Hunter", email = "donald.hunter@gmail.com"},
+ {name = "Jakub Kicinski", email = "kuba@kernel.org"},
+]
+description = "yaml netlink (ynl)"
+version = "0.0.1"
+requires-python = ">=3.9"
+dependencies = [
+ "pyyaml==6.*",
+ "jsonschema==4.*"
+]
+
+[tool.setuptools.packages.find]
+include = ["pyynl", "pyynl.lib"]
+
+[project.scripts]
+ynl = "pyynl.cli:main"
+ynl-ethtool = "pyynl.ethtool:main"
diff --git a/tools/net/ynl/pyynl/.gitignore b/tools/net/ynl/pyynl/.gitignore
new file mode 100644
index 000000000000..b801cd2d016e
--- /dev/null
+++ b/tools/net/ynl/pyynl/.gitignore
@@ -0,0 +1,2 @@
+__pycache__/
+lib/__pycache__/
diff --git a/tools/net/ynl/pyynl/__init__.py b/tools/net/ynl/pyynl/__init__.py
new file mode 100644
index 000000000000..e69de29bb2d1
--- /dev/null
+++ b/tools/net/ynl/pyynl/__init__.py
diff --git a/tools/net/ynl/cli.py b/tools/net/ynl/pyynl/cli.py
index 41d9fa5c818d..794e3c7dcc65 100755
--- a/tools/net/ynl/cli.py
+++ b/tools/net/ynl/pyynl/cli.py
@@ -3,6 +3,7 @@
import argparse
import json
+import os
import pathlib
import pprint
import sys
@@ -10,6 +11,24 @@ import sys
sys.path.append(pathlib.Path(__file__).resolve().parent.as_posix())
from lib import YnlFamily, Netlink, NlError
+sys_schema_dir='/usr/share/ynl'
+relative_schema_dir='../../../../Documentation/netlink'
+
+def schema_dir():
+ script_dir = os.path.dirname(os.path.abspath(__file__))
+ schema_dir = os.path.abspath(f"{script_dir}/{relative_schema_dir}")
+ if not os.path.isdir(schema_dir):
+ schema_dir = sys_schema_dir
+ if not os.path.isdir(schema_dir):
+ raise Exception(f"Schema directory {schema_dir} does not exist")
+ return schema_dir
+
+def spec_dir():
+ spec_dir = schema_dir() + '/specs'
+ if not os.path.isdir(spec_dir):
+ raise Exception(f"Spec directory {spec_dir} does not exist")
+ return spec_dir
+
class YnlEncoder(json.JSONEncoder):
def default(self, obj):
@@ -32,7 +51,14 @@ def main():
parser = argparse.ArgumentParser(description=description,
epilog=epilog)
- parser.add_argument('--spec', dest='spec', type=str, required=True)
+ spec_group = parser.add_mutually_exclusive_group(required=True)
+ spec_group.add_argument('--family', dest='family', type=str,
+ help='name of the netlink FAMILY')
+ spec_group.add_argument('--list-families', action='store_true',
+ help='list all netlink families supported by YNL (has spec)')
+ spec_group.add_argument('--spec', dest='spec', type=str,
+ help='choose the family by SPEC file path')
+
parser.add_argument('--schema', dest='schema', type=str)
parser.add_argument('--no-schema', action='store_true')
parser.add_argument('--json', dest='json_text', type=str)
@@ -70,6 +96,12 @@ def main():
else:
pprint.PrettyPrinter().pprint(msg)
+ if args.list_families:
+ for filename in sorted(os.listdir(spec_dir())):
+ if filename.endswith('.yaml'):
+ print(filename.removesuffix('.yaml'))
+ return
+
if args.no_schema:
args.schema = ''
@@ -77,7 +109,16 @@ def main():
if args.json_text:
attrs = json.loads(args.json_text)
- ynl = YnlFamily(args.spec, args.schema, args.process_unknown,
+ if args.family:
+ spec = f"{spec_dir()}/{args.family}.yaml"
+ if args.schema is None and spec.startswith(sys_schema_dir):
+ args.schema = '' # disable schema validation when installed
+ else:
+ spec = args.spec
+ if not os.path.isfile(spec):
+ raise Exception(f"Spec file {spec} does not exist")
+
+ ynl = YnlFamily(spec, args.schema, args.process_unknown,
recv_size=args.dbg_small_recv)
if args.dbg_small_recv:
ynl.set_recv_dbg(True)
diff --git a/tools/net/ynl/ethtool.py b/tools/net/ynl/pyynl/ethtool.py
index ebb0a11f67bf..af7fddd7b085 100755
--- a/tools/net/ynl/ethtool.py
+++ b/tools/net/ynl/pyynl/ethtool.py
@@ -11,6 +11,7 @@ import os
sys.path.append(pathlib.Path(__file__).resolve().parent.as_posix())
from lib import YnlFamily
+from cli import schema_dir, spec_dir
def args_to_req(ynl, op_name, args, req):
"""
@@ -156,10 +157,8 @@ def main():
args = parser.parse_args()
script_abs_dir = os.path.dirname(os.path.abspath(sys.argv[0]))
- spec = os.path.join(script_abs_dir,
- '../../../Documentation/netlink/specs/ethtool.yaml')
- schema = os.path.join(script_abs_dir,
- '../../../Documentation/netlink/genetlink-legacy.yaml')
+ spec = os.path.join(spec_dir(), 'ethtool.yaml')
+ schema = os.path.join(schema_dir(), 'genetlink-legacy.yaml')
ynl = YnlFamily(spec, schema)
diff --git a/tools/net/ynl/lib/__init__.py b/tools/net/ynl/pyynl/lib/__init__.py
index 9137b83e580a..9137b83e580a 100644
--- a/tools/net/ynl/lib/__init__.py
+++ b/tools/net/ynl/pyynl/lib/__init__.py
diff --git a/tools/net/ynl/lib/nlspec.py b/tools/net/ynl/pyynl/lib/nlspec.py
index a745739655ad..314ec8007496 100644
--- a/tools/net/ynl/lib/nlspec.py
+++ b/tools/net/ynl/pyynl/lib/nlspec.py
@@ -219,7 +219,10 @@ class SpecAttrSet(SpecElement):
else:
real_set = family.attr_sets[self.subset_of]
for elem in self.yaml['attributes']:
- attr = real_set[elem['name']]
+ real_attr = real_set[elem['name']]
+ combined_elem = real_attr.yaml | elem
+ attr = self.new_attr(combined_elem, real_attr.value)
+
self.attrs[attr.name] = attr
self.attrs_by_val[attr.value] = attr
diff --git a/tools/net/ynl/lib/ynl.py b/tools/net/ynl/pyynl/lib/ynl.py
index 01ec01a90e76..08f8bf89cfc2 100644
--- a/tools/net/ynl/lib/ynl.py
+++ b/tools/net/ynl/pyynl/lib/ynl.py
@@ -556,10 +556,10 @@ class YnlFamily(SpecFamily):
if attr["type"] == 'nest':
nl_type |= Netlink.NLA_F_NESTED
attr_payload = b''
- sub_attrs = SpaceAttrs(self.attr_sets[space], value, search_attrs)
+ sub_space = attr['nested-attributes']
+ sub_attrs = SpaceAttrs(self.attr_sets[sub_space], value, search_attrs)
for subname, subvalue in value.items():
- attr_payload += self._add_attr(attr['nested-attributes'],
- subname, subvalue, sub_attrs)
+ attr_payload += self._add_attr(sub_space, subname, subvalue, sub_attrs)
elif attr["type"] == 'flag':
if not value:
# If value is absent or false then skip attribute creation.
@@ -733,41 +733,45 @@ class YnlFamily(SpecFamily):
self._rsp_add(rsp, attr_name, None, self._decode_unknown(attr))
continue
- if attr_spec["type"] == 'nest':
- subdict = self._decode(NlAttrs(attr.raw), attr_spec['nested-attributes'], search_attrs)
- decoded = subdict
- elif attr_spec["type"] == 'string':
- decoded = attr.as_strz()
- elif attr_spec["type"] == 'binary':
- decoded = self._decode_binary(attr, attr_spec)
- elif attr_spec["type"] == 'flag':
- decoded = True
- elif attr_spec.is_auto_scalar:
- decoded = attr.as_auto_scalar(attr_spec['type'], attr_spec.byte_order)
- elif attr_spec["type"] in NlAttr.type_formats:
- decoded = attr.as_scalar(attr_spec['type'], attr_spec.byte_order)
- if 'enum' in attr_spec:
- decoded = self._decode_enum(decoded, attr_spec)
- elif attr_spec.display_hint:
- decoded = self._formatted_string(decoded, attr_spec.display_hint)
- elif attr_spec["type"] == 'indexed-array':
- decoded = self._decode_array_attr(attr, attr_spec)
- elif attr_spec["type"] == 'bitfield32':
- value, selector = struct.unpack("II", attr.raw)
- if 'enum' in attr_spec:
- value = self._decode_enum(value, attr_spec)
- selector = self._decode_enum(selector, attr_spec)
- decoded = {"value": value, "selector": selector}
- elif attr_spec["type"] == 'sub-message':
- decoded = self._decode_sub_msg(attr, attr_spec, search_attrs)
- elif attr_spec["type"] == 'nest-type-value':
- decoded = self._decode_nest_type_value(attr, attr_spec)
- else:
- if not self.process_unknown:
- raise Exception(f'Unknown {attr_spec["type"]} with name {attr_spec["name"]}')
- decoded = self._decode_unknown(attr)
-
- self._rsp_add(rsp, attr_spec["name"], attr_spec.is_multi, decoded)
+ try:
+ if attr_spec["type"] == 'nest':
+ subdict = self._decode(NlAttrs(attr.raw), attr_spec['nested-attributes'], search_attrs)
+ decoded = subdict
+ elif attr_spec["type"] == 'string':
+ decoded = attr.as_strz()
+ elif attr_spec["type"] == 'binary':
+ decoded = self._decode_binary(attr, attr_spec)
+ elif attr_spec["type"] == 'flag':
+ decoded = True
+ elif attr_spec.is_auto_scalar:
+ decoded = attr.as_auto_scalar(attr_spec['type'], attr_spec.byte_order)
+ elif attr_spec["type"] in NlAttr.type_formats:
+ decoded = attr.as_scalar(attr_spec['type'], attr_spec.byte_order)
+ if 'enum' in attr_spec:
+ decoded = self._decode_enum(decoded, attr_spec)
+ elif attr_spec.display_hint:
+ decoded = self._formatted_string(decoded, attr_spec.display_hint)
+ elif attr_spec["type"] == 'indexed-array':
+ decoded = self._decode_array_attr(attr, attr_spec)
+ elif attr_spec["type"] == 'bitfield32':
+ value, selector = struct.unpack("II", attr.raw)
+ if 'enum' in attr_spec:
+ value = self._decode_enum(value, attr_spec)
+ selector = self._decode_enum(selector, attr_spec)
+ decoded = {"value": value, "selector": selector}
+ elif attr_spec["type"] == 'sub-message':
+ decoded = self._decode_sub_msg(attr, attr_spec, search_attrs)
+ elif attr_spec["type"] == 'nest-type-value':
+ decoded = self._decode_nest_type_value(attr, attr_spec)
+ else:
+ if not self.process_unknown:
+ raise Exception(f'Unknown {attr_spec["type"]} with name {attr_spec["name"]}')
+ decoded = self._decode_unknown(attr)
+
+ self._rsp_add(rsp, attr_spec["name"], attr_spec.is_multi, decoded)
+ except:
+ print(f"Error decoding '{attr_spec.name}' from '{space}'")
+ raise
return rsp
diff --git a/tools/net/ynl/ynl-gen-c.py b/tools/net/ynl/pyynl/ynl_gen_c.py
index d8201c4b1520..c2eabc90dce8 100755
--- a/tools/net/ynl/ynl-gen-c.py
+++ b/tools/net/ynl/pyynl/ynl_gen_c.py
@@ -79,6 +79,20 @@ class Type(SpecAttr):
self.enum_name = None
delattr(self, "enum_name")
+ def _get_real_attr(self):
+ # if the attr is for a subset return the "real" attr (just one down, does not recurse)
+ return self.family.attr_sets[self.attr_set.subset_of][self.name]
+
+ def set_request(self):
+ self.request = True
+ if self.attr_set.subset_of:
+ self._get_real_attr().set_request()
+
+ def set_reply(self):
+ self.reply = True
+ if self.attr_set.subset_of:
+ self._get_real_attr().set_reply()
+
def get_limit(self, limit, default=None):
value = self.checks.get(limit, default)
if value is None:
@@ -106,6 +120,10 @@ class Type(SpecAttr):
enum_name = f"{self.attr_set.name_prefix}{self.name}"
self.enum_name = c_upper(enum_name)
+ if self.attr_set.subset_of:
+ if self.checks != self._get_real_attr().checks:
+ raise Exception("Overriding checks not supported by codegen, yet")
+
def is_multi_val(self):
return None
@@ -801,6 +819,8 @@ class EnumSet(SpecEnumSet):
self.user_type = 'int'
self.value_pfx = yaml.get('name-prefix', f"{family.ident_name}-{yaml['name']}-")
+ self.header = yaml.get('header', None)
+ self.enum_cnt_name = yaml.get('enum-cnt-name', None)
super().__init__(family, yaml)
@@ -1117,17 +1137,17 @@ class Family(SpecFamily):
for _, struct in self.pure_nested_structs.items():
if struct.request:
for _, arg in struct.member_list():
- arg.request = True
+ arg.set_request()
if struct.reply:
for _, arg in struct.member_list():
- arg.reply = True
+ arg.set_reply()
for root_set, rs_members in self.root_sets.items():
for attr, spec in self.attr_sets[root_set].items():
if attr in rs_members['request']:
- spec.request = True
+ spec.set_request()
if attr in rs_members['reply']:
- spec.reply = True
+ spec.set_reply()
def _load_global_policy(self):
global_set = set()
@@ -1763,7 +1783,14 @@ def parse_rsp_nested(ri, struct):
f'{struct.ptr_name}dst = yarg->data;']
init_lines = []
- _multi_parse(ri, struct, init_lines, local_vars)
+ if struct.member_list():
+ _multi_parse(ri, struct, init_lines, local_vars)
+ else:
+ # Empty nest
+ ri.cw.block_start()
+ ri.cw.p('return 0;')
+ ri.cw.block_end()
+ ri.cw.nl()
def parse_rsp_msg(ri, deref=False):
@@ -2384,6 +2411,17 @@ def print_kernel_family_struct_src(family, cw):
if not kernel_can_gen_family_struct(family):
return
+ if 'sock-priv' in family.kernel_family:
+ # Generate "trampolines" to make CFI happy
+ cw.write_func("static void", f"__{family.c_name}_nl_sock_priv_init",
+ [f"{family.c_name}_nl_sock_priv_init(priv);"],
+ ["void *priv"])
+ cw.nl()
+ cw.write_func("static void", f"__{family.c_name}_nl_sock_priv_destroy",
+ [f"{family.c_name}_nl_sock_priv_destroy(priv);"],
+ ["void *priv"])
+ cw.nl()
+
cw.block_start(f"struct genl_family {family.ident_name}_nl_family __ro_after_init =")
cw.p('.name\t\t= ' + family.fam_key + ',')
cw.p('.version\t= ' + family.ver_key + ',')
@@ -2401,9 +2439,8 @@ def print_kernel_family_struct_src(family, cw):
cw.p(f'.n_mcgrps\t= ARRAY_SIZE({family.c_name}_nl_mcgrps),')
if 'sock-priv' in family.kernel_family:
cw.p(f'.sock_priv_size\t= sizeof({family.kernel_family["sock-priv"]}),')
- # Force cast here, actual helpers take pointer to the real type.
- cw.p(f'.sock_priv_init\t= (void *){family.c_name}_nl_sock_priv_init,')
- cw.p(f'.sock_priv_destroy = (void *){family.c_name}_nl_sock_priv_destroy,')
+ cw.p(f'.sock_priv_init\t= __{family.c_name}_nl_sock_priv_init,')
+ cw.p(f'.sock_priv_destroy = __{family.c_name}_nl_sock_priv_destroy,')
cw.block_end(';')
@@ -2417,6 +2454,87 @@ def uapi_enum_start(family, cw, obj, ckey='', enum_name='enum-name'):
cw.block_start(line=start_line)
+def render_uapi_unified(family, cw, max_by_define, separate_ntf):
+ max_name = c_upper(family.get('cmd-max-name', f"{family.op_prefix}MAX"))
+ cnt_name = c_upper(family.get('cmd-cnt-name', f"__{family.op_prefix}MAX"))
+ max_value = f"({cnt_name} - 1)"
+
+ uapi_enum_start(family, cw, family['operations'], 'enum-name')
+ val = 0
+ for op in family.msgs.values():
+ if separate_ntf and ('notify' in op or 'event' in op):
+ continue
+
+ suffix = ','
+ if op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(op.enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+
+def render_uapi_directional(family, cw, max_by_define):
+ max_name = f"{family.op_prefix}USER_MAX"
+ cnt_name = f"__{family.op_prefix}USER_CNT"
+ max_value = f"({cnt_name} - 1)"
+
+ cw.block_start(line='enum')
+ cw.p(c_upper(f'{family.name}_MSG_USER_NONE = 0,'))
+ val = 0
+ for op in family.msgs.values():
+ if 'do' in op and 'event' not in op:
+ suffix = ','
+ if op.value and op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(op.enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+ max_name = f"{family.op_prefix}KERNEL_MAX"
+ cnt_name = f"__{family.op_prefix}KERNEL_CNT"
+ max_value = f"({cnt_name} - 1)"
+
+ cw.block_start(line='enum')
+ cw.p(c_upper(f'{family.name}_MSG_KERNEL_NONE = 0,'))
+ val = 0
+ for op in family.msgs.values():
+ if ('do' in op and 'reply' in op['do']) or 'notify' in op or 'event' in op:
+ enum_name = op.enum_name
+ if 'event' not in op and 'notify' not in op:
+ enum_name = f'{enum_name}_REPLY'
+
+ suffix = ','
+ if op.value and op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+
def render_uapi(family, cw):
hdr_prot = f"_UAPI_LINUX_{c_upper(family.uapi_header_name)}_H"
hdr_prot = hdr_prot.replace('/', '_')
@@ -2440,6 +2558,9 @@ def render_uapi(family, cw):
if const['type'] == 'enum' or const['type'] == 'flags':
enum = family.consts[const['name']]
+ if enum.header:
+ continue
+
if enum.has_doc():
if enum.has_entry_doc():
cw.p('/**')
@@ -2472,9 +2593,12 @@ def render_uapi(family, cw):
max_val = f' = {enum.get_mask()},'
cw.p(max_name + max_val)
else:
+ cnt_name = enum.enum_cnt_name
max_name = c_upper(name_pfx + 'max')
- cw.p('__' + max_name + ',')
- cw.p(max_name + ' = (__' + max_name + ' - 1)')
+ if not cnt_name:
+ cnt_name = '__' + name_pfx + 'max'
+ cw.p(c_upper(cnt_name) + ',')
+ cw.p(max_name + ' = (' + c_upper(cnt_name) + ' - 1)')
cw.block_end(line=';')
cw.nl()
elif const['type'] == 'const':
@@ -2503,7 +2627,8 @@ def render_uapi(family, cw):
val = attr.value
val += 1
cw.p(attr.enum_name + suffix)
- cw.nl()
+ if attr_set.items():
+ cw.nl()
cw.p(attr_set.cnt_name + ('' if max_by_define else ','))
if not max_by_define:
cw.p(f"{attr_set.max_name} = {max_value}")
@@ -2515,30 +2640,12 @@ def render_uapi(family, cw):
# Commands
separate_ntf = 'async-prefix' in family['operations']
- max_name = c_upper(family.get('cmd-max-name', f"{family.op_prefix}MAX"))
- cnt_name = c_upper(family.get('cmd-cnt-name', f"__{family.op_prefix}MAX"))
- max_value = f"({cnt_name} - 1)"
-
- uapi_enum_start(family, cw, family['operations'], 'enum-name')
- val = 0
- for op in family.msgs.values():
- if separate_ntf and ('notify' in op or 'event' in op):
- continue
-
- suffix = ','
- if op.value != val:
- suffix = f" = {op.value},"
- val = op.value
- cw.p(op.enum_name + suffix)
- val += 1
- cw.nl()
- cw.p(cnt_name + ('' if max_by_define else ','))
- if not max_by_define:
- cw.p(f"{max_name} = {max_value}")
- cw.block_end(line=';')
- if max_by_define:
- cw.p(f"#define {max_name} {max_value}")
- cw.nl()
+ if family.msg_id_model == 'unified':
+ render_uapi_unified(family, cw, max_by_define, separate_ntf)
+ elif family.msg_id_model == 'directional':
+ render_uapi_directional(family, cw, max_by_define)
+ else:
+ raise Exception(f'Unsupported message enum-model {family.msg_id_model}')
if separate_ntf:
uapi_enum_start(family, cw, family['operations'], enum_name='async-enum')
@@ -2635,7 +2742,8 @@ def find_kernel_root(full_path):
def main():
parser = argparse.ArgumentParser(description='Netlink simple parsing generator')
- parser.add_argument('--mode', dest='mode', type=str, required=True)
+ parser.add_argument('--mode', dest='mode', type=str, required=True,
+ choices=('user', 'kernel', 'uapi'))
parser.add_argument('--spec', dest='spec', type=str, required=True)
parser.add_argument('--header', dest='header', action='store_true', default=None)
parser.add_argument('--source', dest='header', action='store_false')
@@ -2662,13 +2770,6 @@ def main():
os.sys.exit(1)
return
- supported_models = ['unified']
- if args.mode in ['user', 'kernel']:
- supported_models += ['directional']
- if parsed.msg_id_model not in supported_models:
- print(f'Message enum-model {parsed.msg_id_model} not supported for {args.mode} generation')
- os.sys.exit(1)
-
cw = CodeWriter(BaseNlLib(), args.out_file, overwrite=(not args.cmp_out))
_, spec_kernel = find_kernel_root(args.spec)
@@ -2696,7 +2797,10 @@ def main():
cw.p('#define ' + hdr_prot)
cw.nl()
- hdr_file=os.path.basename(args.out_file[:-2]) + ".h"
+ if args.out_file:
+ hdr_file = os.path.basename(args.out_file[:-2]) + ".h"
+ else:
+ hdr_file = "generated_header_file.h"
if args.mode == 'kernel':
cw.p('#include <net/netlink.h>')
@@ -2718,12 +2822,17 @@ def main():
else:
cw.p(f'#include "{hdr_file}"')
cw.p('#include "ynl.h"')
- headers = [parsed.uapi_header]
+ headers = []
for definition in parsed['definitions']:
if 'header' in definition:
headers.append(definition['header'])
+ if args.mode == 'user':
+ headers.append(parsed.uapi_header)
+ seen_header = []
for one in headers:
- cw.p(f"#include <{one}>")
+ if one not in seen_header:
+ cw.p(f"#include <{one}>")
+ seen_header.append(one)
cw.nl()
if args.mode == "user":
diff --git a/tools/net/ynl/ynl-gen-rst.py b/tools/net/ynl/pyynl/ynl_gen_rst.py
index 6c56d0d726b4..6c56d0d726b4 100755
--- a/tools/net/ynl/ynl-gen-rst.py
+++ b/tools/net/ynl/pyynl/ynl_gen_rst.py
diff --git a/tools/net/ynl/ynl-regen.sh b/tools/net/ynl/ynl-regen.sh
index a37304dcc88e..81b4ecd89100 100755
--- a/tools/net/ynl/ynl-regen.sh
+++ b/tools/net/ynl/ynl-regen.sh
@@ -1,7 +1,7 @@
#!/bin/bash
# SPDX-License-Identifier: GPL-2.0 OR BSD-3-Clause
-TOOL=$(dirname $(realpath $0))/ynl-gen-c.py
+TOOL=$(dirname $(realpath $0))/pyynl/ynl_gen_c.py
force=
search=
diff --git a/tools/objtool/arch/loongarch/special.c b/tools/objtool/arch/loongarch/special.c
index 9bba1e9318e0..87230ed570fd 100644
--- a/tools/objtool/arch/loongarch/special.c
+++ b/tools/objtool/arch/loongarch/special.c
@@ -9,7 +9,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
}
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
return NULL;
}
diff --git a/tools/objtool/arch/powerpc/special.c b/tools/objtool/arch/powerpc/special.c
index d33868147196..51610689abf7 100644
--- a/tools/objtool/arch/powerpc/special.c
+++ b/tools/objtool/arch/powerpc/special.c
@@ -13,7 +13,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
}
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
exit(-1);
}
diff --git a/tools/objtool/arch/x86/special.c b/tools/objtool/arch/x86/special.c
index 4ea0f9815fda..9c1c9df09aaa 100644
--- a/tools/objtool/arch/x86/special.c
+++ b/tools/objtool/arch/x86/special.c
@@ -109,7 +109,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
* NOTE: MITIGATION_RETPOLINE made it harder still to decode dynamic jumps.
*/
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
struct reloc *text_reloc, *rodata_reloc;
struct section *table_sec;
@@ -158,5 +159,6 @@ struct reloc *arch_find_switch_table(struct objtool_file *file,
if (reloc_type(text_reloc) == R_X86_64_PC32)
file->ignore_unreachables = true;
+ *table_size = 0;
return rodata_reloc;
}
diff --git a/tools/objtool/check.c b/tools/objtool/check.c
index 4ce176ad411f..753dbc4f8198 100644
--- a/tools/objtool/check.c
+++ b/tools/objtool/check.c
@@ -150,6 +150,15 @@ static inline struct reloc *insn_jump_table(struct instruction *insn)
return NULL;
}
+static inline unsigned long insn_jump_table_size(struct instruction *insn)
+{
+ if (insn->type == INSN_JUMP_DYNAMIC ||
+ insn->type == INSN_CALL_DYNAMIC)
+ return insn->_jump_table_size;
+
+ return 0;
+}
+
static bool is_jump_table_jump(struct instruction *insn)
{
struct alt_group *alt_group = insn->alt_group;
@@ -614,108 +623,6 @@ static int init_pv_ops(struct objtool_file *file)
return 0;
}
-static struct instruction *find_last_insn(struct objtool_file *file,
- struct section *sec)
-{
- struct instruction *insn = NULL;
- unsigned int offset;
- unsigned int end = (sec->sh.sh_size > 10) ? sec->sh.sh_size - 10 : 0;
-
- for (offset = sec->sh.sh_size - 1; offset >= end && !insn; offset--)
- insn = find_insn(file, sec, offset);
-
- return insn;
-}
-
-/*
- * Mark "ud2" instructions and manually annotated dead ends.
- */
-static int add_dead_ends(struct objtool_file *file)
-{
- struct section *rsec;
- struct reloc *reloc;
- struct instruction *insn;
- uint64_t offset;
-
- /*
- * Check for manually annotated dead ends.
- */
- rsec = find_section_by_name(file->elf, ".rela.discard.unreachable");
- if (!rsec)
- goto reachable;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type == STT_SECTION) {
- offset = reloc_addend(reloc);
- } else if (reloc->sym->local_label) {
- offset = reloc->sym->offset;
- } else {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, offset);
- if (insn)
- insn = prev_insn_same_sec(file, insn);
- else if (offset == reloc->sym->sec->sh.sh_size) {
- insn = find_last_insn(file, reloc->sym->sec);
- if (!insn) {
- WARN("can't find unreachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
- } else {
- WARN("can't find unreachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
-
- insn->dead_end = true;
- }
-
-reachable:
- /*
- * These manually annotated reachable checks are needed for GCC 4.4,
- * where the Linux unreachable() macro isn't supported. In that case
- * GCC doesn't know the "ud2" is fatal, so it generates code as if it's
- * not a dead end.
- */
- rsec = find_section_by_name(file->elf, ".rela.discard.reachable");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type == STT_SECTION) {
- offset = reloc_addend(reloc);
- } else if (reloc->sym->local_label) {
- offset = reloc->sym->offset;
- } else {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, offset);
- if (insn)
- insn = prev_insn_same_sec(file, insn);
- else if (offset == reloc->sym->sec->sh.sh_size) {
- insn = find_last_insn(file, reloc->sym->sec);
- if (!insn) {
- WARN("can't find reachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
- } else {
- WARN("can't find reachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
-
- insn->dead_end = false;
- }
-
- return 0;
-}
-
static int create_static_call_sections(struct objtool_file *file)
{
struct static_call_site *site;
@@ -1310,40 +1217,6 @@ static void add_uaccess_safe(struct objtool_file *file)
}
/*
- * FIXME: For now, just ignore any alternatives which add retpolines. This is
- * a temporary hack, as it doesn't allow ORC to unwind from inside a retpoline.
- * But it at least allows objtool to understand the control flow *around* the
- * retpoline.
- */
-static int add_ignore_alternatives(struct objtool_file *file)
-{
- struct section *rsec;
- struct reloc *reloc;
- struct instruction *insn;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.ignore_alts");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.ignore_alts entry");
- return -1;
- }
-
- insn->ignore_alts = true;
- }
-
- return 0;
-}
-
-/*
* Symbols that replace INSN_CALL_DYNAMIC, every (tail) call to such a symbol
* will be added to the .retpoline_sites section.
*/
@@ -2073,6 +1946,7 @@ out:
static int add_jump_table(struct objtool_file *file, struct instruction *insn,
struct reloc *next_table)
{
+ unsigned long table_size = insn_jump_table_size(insn);
struct symbol *pfunc = insn_func(insn)->pfunc;
struct reloc *table = insn_jump_table(insn);
struct instruction *dest_insn;
@@ -2087,6 +1961,8 @@ static int add_jump_table(struct objtool_file *file, struct instruction *insn,
for_each_reloc_from(table->sec, reloc) {
/* Check for the end of the table: */
+ if (table_size && reloc_offset(reloc) - reloc_offset(table) >= table_size)
+ break;
if (reloc != table && reloc == next_table)
break;
@@ -2131,12 +2007,12 @@ static int add_jump_table(struct objtool_file *file, struct instruction *insn,
* find_jump_table() - Given a dynamic jump, find the switch jump table
* associated with it.
*/
-static struct reloc *find_jump_table(struct objtool_file *file,
- struct symbol *func,
- struct instruction *insn)
+static void find_jump_table(struct objtool_file *file, struct symbol *func,
+ struct instruction *insn)
{
struct reloc *table_reloc;
struct instruction *dest_insn, *orig_insn = insn;
+ unsigned long table_size;
/*
* Backward search using the @first_jump_src links, these help avoid
@@ -2157,17 +2033,17 @@ static struct reloc *find_jump_table(struct objtool_file *file,
insn->jump_dest->offset > orig_insn->offset))
break;
- table_reloc = arch_find_switch_table(file, insn);
+ table_reloc = arch_find_switch_table(file, insn, &table_size);
if (!table_reloc)
continue;
dest_insn = find_insn(file, table_reloc->sym->sec, reloc_addend(table_reloc));
if (!dest_insn || !insn_func(dest_insn) || insn_func(dest_insn)->pfunc != func)
continue;
- return table_reloc;
+ orig_insn->_jump_table = table_reloc;
+ orig_insn->_jump_table_size = table_size;
+ break;
}
-
- return NULL;
}
/*
@@ -2178,7 +2054,6 @@ static void mark_func_jump_tables(struct objtool_file *file,
struct symbol *func)
{
struct instruction *insn, *last = NULL;
- struct reloc *reloc;
func_for_each_insn(file, func, insn) {
if (!last)
@@ -2201,9 +2076,7 @@ static void mark_func_jump_tables(struct objtool_file *file,
if (insn->type != INSN_JUMP_DYNAMIC)
continue;
- reloc = find_jump_table(file, func, insn);
- if (reloc)
- insn->_jump_table = reloc;
+ find_jump_table(file, func, insn);
}
}
@@ -2373,185 +2246,147 @@ static int read_unwind_hints(struct objtool_file *file)
return 0;
}
-static int read_noendbr_hints(struct objtool_file *file)
+static int read_annotate(struct objtool_file *file,
+ int (*func)(struct objtool_file *file, int type, struct instruction *insn))
{
+ struct section *sec;
struct instruction *insn;
- struct section *rsec;
struct reloc *reloc;
+ uint64_t offset;
+ int type, ret;
- rsec = find_section_by_name(file->elf, ".rela.discard.noendbr");
- if (!rsec)
+ sec = find_section_by_name(file->elf, ".discard.annotate_insn");
+ if (!sec)
return 0;
- for_each_reloc(rsec, reloc) {
- insn = find_insn(file, reloc->sym->sec,
- reloc->sym->offset + reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.noendbr entry");
- return -1;
- }
+ if (!sec->rsec)
+ return 0;
- insn->noendbr = 1;
+ if (sec->sh.sh_entsize != 8) {
+ static bool warned = false;
+ if (!warned) {
+ WARN("%s: dodgy linker, sh_entsize != 8", sec->name);
+ warned = true;
+ }
+ sec->sh.sh_entsize = 8;
}
- return 0;
-}
-
-static int read_retpoline_hints(struct objtool_file *file)
-{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.retpoline_safe");
- if (!rsec)
- return 0;
+ for_each_reloc(sec->rsec, reloc) {
+ type = *(u32 *)(sec->data->d_buf + (reloc_idx(reloc) * sec->sh.sh_entsize) + 4);
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ offset = reloc->sym->offset + reloc_addend(reloc);
+ insn = find_insn(file, reloc->sym->sec, offset);
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
if (!insn) {
- WARN("bad .discard.retpoline_safe entry");
+ WARN("bad .discard.annotate_insn entry: %d of type %d", reloc_idx(reloc), type);
return -1;
}
- if (insn->type != INSN_JUMP_DYNAMIC &&
- insn->type != INSN_CALL_DYNAMIC &&
- insn->type != INSN_RETURN &&
- insn->type != INSN_NOP) {
- WARN_INSN(insn, "retpoline_safe hint not an indirect jump/call/ret/nop");
- return -1;
- }
-
- insn->retpoline_safe = true;
+ ret = func(file, type, insn);
+ if (ret < 0)
+ return ret;
}
return 0;
}
-static int read_instr_hints(struct objtool_file *file)
+static int __annotate_early(struct objtool_file *file, int type, struct instruction *insn)
{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
+ switch (type) {
+ case ANNOTYPE_IGNORE_ALTS:
+ insn->ignore_alts = true;
+ break;
- rsec = find_section_by_name(file->elf, ".rela.discard.instr_end");
- if (!rsec)
- return 0;
+ /*
+ * Must be before read_unwind_hints() since that needs insn->noendbr.
+ */
+ case ANNOTYPE_NOENDBR:
+ insn->noendbr = 1;
+ break;
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ default:
+ break;
+ }
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_end entry");
- return -1;
- }
+ return 0;
+}
- insn->instr--;
- }
+static int __annotate_ifc(struct objtool_file *file, int type, struct instruction *insn)
+{
+ unsigned long dest_off;
- rsec = find_section_by_name(file->elf, ".rela.discard.instr_begin");
- if (!rsec)
+ if (type != ANNOTYPE_INTRA_FUNCTION_CALL)
return 0;
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ if (insn->type != INSN_CALL) {
+ WARN_INSN(insn, "intra_function_call not a direct call");
+ return -1;
+ }
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_begin entry");
- return -1;
- }
+ /*
+ * Treat intra-function CALLs as JMPs, but with a stack_op.
+ * See add_call_destinations(), which strips stack_ops from
+ * normal CALLs.
+ */
+ insn->type = INSN_JUMP_UNCONDITIONAL;
- insn->instr++;
+ dest_off = arch_jump_destination(insn);
+ insn->jump_dest = find_insn(file, insn->sec, dest_off);
+ if (!insn->jump_dest) {
+ WARN_INSN(insn, "can't find call dest at %s+0x%lx",
+ insn->sec->name, dest_off);
+ return -1;
}
return 0;
}
-static int read_validate_unret_hints(struct objtool_file *file)
+static int __annotate_late(struct objtool_file *file, int type, struct instruction *insn)
{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.validate_unret");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ switch (type) {
+ case ANNOTYPE_NOENDBR:
+ /* early */
+ break;
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_end entry");
+ case ANNOTYPE_RETPOLINE_SAFE:
+ if (insn->type != INSN_JUMP_DYNAMIC &&
+ insn->type != INSN_CALL_DYNAMIC &&
+ insn->type != INSN_RETURN &&
+ insn->type != INSN_NOP) {
+ WARN_INSN(insn, "retpoline_safe hint not an indirect jump/call/ret/nop");
return -1;
}
- insn->unret = 1;
- }
-
- return 0;
-}
-
-static int read_intra_function_calls(struct objtool_file *file)
-{
- struct instruction *insn;
- struct section *rsec;
- struct reloc *reloc;
+ insn->retpoline_safe = true;
+ break;
- rsec = find_section_by_name(file->elf, ".rela.discard.intra_function_calls");
- if (!rsec)
- return 0;
+ case ANNOTYPE_INSTR_BEGIN:
+ insn->instr++;
+ break;
- for_each_reloc(rsec, reloc) {
- unsigned long dest_off;
+ case ANNOTYPE_INSTR_END:
+ insn->instr--;
+ break;
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s",
- rsec->name);
- return -1;
- }
+ case ANNOTYPE_UNRET_BEGIN:
+ insn->unret = 1;
+ break;
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.intra_function_call entry");
- return -1;
- }
+ case ANNOTYPE_IGNORE_ALTS:
+ /* early */
+ break;
- if (insn->type != INSN_CALL) {
- WARN_INSN(insn, "intra_function_call not a direct call");
- return -1;
- }
+ case ANNOTYPE_INTRA_FUNCTION_CALL:
+ /* ifc */
+ break;
- /*
- * Treat intra-function CALLs as JMPs, but with a stack_op.
- * See add_call_destinations(), which strips stack_ops from
- * normal CALLs.
- */
- insn->type = INSN_JUMP_UNCONDITIONAL;
+ case ANNOTYPE_REACHABLE:
+ insn->dead_end = false;
+ break;
- dest_off = arch_jump_destination(insn);
- insn->jump_dest = find_insn(file, insn->sec, dest_off);
- if (!insn->jump_dest) {
- WARN_INSN(insn, "can't find call dest at %s+0x%lx",
- insn->sec->name, dest_off);
- return -1;
- }
+ default:
+ WARN_INSN(insn, "Unknown annotation type: %d", type);
+ break;
}
return 0;
@@ -2666,14 +2501,7 @@ static int decode_sections(struct objtool_file *file)
add_ignores(file);
add_uaccess_safe(file);
- ret = add_ignore_alternatives(file);
- if (ret)
- return ret;
-
- /*
- * Must be before read_unwind_hints() since that needs insn->noendbr.
- */
- ret = read_noendbr_hints(file);
+ ret = read_annotate(file, __annotate_early);
if (ret)
return ret;
@@ -2695,7 +2523,7 @@ static int decode_sections(struct objtool_file *file)
* Must be before add_call_destination(); it changes INSN_CALL to
* INSN_JUMP.
*/
- ret = read_intra_function_calls(file);
+ ret = read_annotate(file, __annotate_ifc);
if (ret)
return ret;
@@ -2703,14 +2531,6 @@ static int decode_sections(struct objtool_file *file)
if (ret)
return ret;
- /*
- * Must be after add_call_destinations() such that it can override
- * dead_end_function() marks.
- */
- ret = add_dead_ends(file);
- if (ret)
- return ret;
-
ret = add_jump_table_alts(file);
if (ret)
return ret;
@@ -2719,15 +2539,11 @@ static int decode_sections(struct objtool_file *file)
if (ret)
return ret;
- ret = read_retpoline_hints(file);
- if (ret)
- return ret;
-
- ret = read_instr_hints(file);
- if (ret)
- return ret;
-
- ret = read_validate_unret_hints(file);
+ /*
+ * Must be after add_call_destinations() such that it can override
+ * dead_end_function() marks.
+ */
+ ret = read_annotate(file, __annotate_late);
if (ret)
return ret;
@@ -3820,9 +3636,12 @@ static int validate_branch(struct objtool_file *file, struct symbol *func,
break;
case INSN_CONTEXT_SWITCH:
- if (func && (!next_insn || !next_insn->hint)) {
- WARN_INSN(insn, "unsupported instruction in callable function");
- return 1;
+ if (func) {
+ if (!next_insn || !next_insn->hint) {
+ WARN_INSN(insn, "unsupported instruction in callable function");
+ return 1;
+ }
+ break;
}
return 0;
diff --git a/tools/objtool/include/objtool/check.h b/tools/objtool/include/objtool/check.h
index daa46f1f0965..e1cd13cd28a3 100644
--- a/tools/objtool/include/objtool/check.h
+++ b/tools/objtool/include/objtool/check.h
@@ -71,7 +71,10 @@ struct instruction {
struct instruction *first_jump_src;
union {
struct symbol *_call_dest;
- struct reloc *_jump_table;
+ struct {
+ struct reloc *_jump_table;
+ unsigned long _jump_table_size;
+ };
};
struct alternative *alts;
struct symbol *sym;
diff --git a/tools/objtool/include/objtool/special.h b/tools/objtool/include/objtool/special.h
index 86d4af9c5aa9..e7ee7ffccefd 100644
--- a/tools/objtool/include/objtool/special.h
+++ b/tools/objtool/include/objtool/special.h
@@ -38,5 +38,6 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
struct instruction *insn,
struct reloc *reloc);
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn);
+ struct instruction *insn,
+ unsigned long *table_size);
#endif /* _SPECIAL_H */
diff --git a/tools/objtool/noreturns.h b/tools/objtool/noreturns.h
index f37614cc2c1b..b2174894f9f7 100644
--- a/tools/objtool/noreturns.h
+++ b/tools/objtool/noreturns.h
@@ -19,6 +19,7 @@ NORETURN(__x64_sys_exit_group)
NORETURN(arch_cpu_idle_dead)
NORETURN(bch2_trans_in_restart_error)
NORETURN(bch2_trans_restart_error)
+NORETURN(bch2_trans_unlocked_error)
NORETURN(cpu_bringup_and_idle)
NORETURN(cpu_startup_entry)
NORETURN(do_exit)
diff --git a/tools/perf/Documentation/perf-arm-spe.txt b/tools/perf/Documentation/perf-arm-spe.txt
index de2b0b479249..37afade4f1b2 100644
--- a/tools/perf/Documentation/perf-arm-spe.txt
+++ b/tools/perf/Documentation/perf-arm-spe.txt
@@ -150,6 +150,7 @@ arm_spe/load_filter=1,min_latency=10/'
pct_enable=1 - collect physical timestamp instead of virtual timestamp (PMSCR.PCT) - requires privilege
store_filter=1 - collect stores only (PMSFCR.ST)
ts_enable=1 - enable timestamping with value of generic timer (PMSCR.TS)
+ discard=1 - enable SPE PMU events but don't collect sample data - see 'Discard mode' (PMBLIMITR.FM = DISCARD)
+++*+++ Latency is the total latency from the point at which sampling started on that instruction, rather
than only the execution latency.
@@ -220,6 +221,31 @@ Common errors
Increase sampling interval (see above)
+PMU events
+~~~~~~~~~~
+
+SPE has events that can be counted on core PMUs. These are prefixed with
+SAMPLE_, for example SAMPLE_POP, SAMPLE_FEED, SAMPLE_COLLISION and
+SAMPLE_FEED_BR.
+
+These events will only count when an SPE event is running on the same core that
+the PMU event is opened on, otherwise they read as 0. There are various ways to
+ensure that the PMU event and SPE event are scheduled together depending on the
+way the event is opened. For example opening both events as per-process events
+on the same process, although it's not guaranteed that the PMU event is enabled
+first when context switching. For that reason it may be better to open the PMU
+event as a systemwide event and then open SPE on the process of interest.
+
+Discard mode
+~~~~~~~~~~~~
+
+SPE related (SAMPLE_* etc) core PMU events can be used without the overhead of
+collecting sample data if discard mode is supported (optional from Armv8.6).
+First run a system wide SPE session (or on the core of interest) using options
+to minimize output. Then run perf stat:
+
+ perf record -e arm_spe/discard/ -a -N -B --no-bpf-event -o - > /dev/null &
+ perf stat -e SAMPLE_FEED_LD
SEE ALSO
--------
diff --git a/tools/perf/Documentation/perf-check.txt b/tools/perf/Documentation/perf-check.txt
index 31741499e786..a764a4629220 100644
--- a/tools/perf/Documentation/perf-check.txt
+++ b/tools/perf/Documentation/perf-check.txt
@@ -51,7 +51,6 @@ feature::
dwarf_getlocations / HAVE_LIBDW_SUPPORT
dwarf-unwind / HAVE_DWARF_UNWIND_SUPPORT
auxtrace / HAVE_AUXTRACE_SUPPORT
- libaudit / HAVE_LIBAUDIT_SUPPORT
libbfd / HAVE_LIBBFD_SUPPORT
libcapstone / HAVE_LIBCAPSTONE_SUPPORT
libcrypto / HAVE_LIBCRYPTO_SUPPORT
@@ -67,7 +66,6 @@ feature::
libunwind / HAVE_LIBUNWIND_SUPPORT
lzma / HAVE_LZMA_SUPPORT
numa_num_possible_cpus / HAVE_LIBNUMA_SUPPORT
- syscall_table / HAVE_SYSCALL_TABLE_SUPPORT
zlib / HAVE_ZLIB_SUPPORT
zstd / HAVE_ZSTD_SUPPORT
diff --git a/tools/perf/Documentation/perf-config.txt b/tools/perf/Documentation/perf-config.txt
index 1f668d4724e3..36ebebc875ea 100644
--- a/tools/perf/Documentation/perf-config.txt
+++ b/tools/perf/Documentation/perf-config.txt
@@ -40,7 +40,7 @@ The '$HOME/.perfconfig' file is used to store a per-user configuration.
The file '$(sysconfdir)/perfconfig' can be used to
store a system-wide default configuration.
-One an disable reading config files by setting the PERF_CONFIG environment
+One can disable reading config files by setting the PERF_CONFIG environment
variable to /dev/null, or provide an alternate config file by setting that
variable.
diff --git a/tools/perf/Documentation/perf-ftrace.txt b/tools/perf/Documentation/perf-ftrace.txt
index eaec8253be68..b77f58c4d2fd 100644
--- a/tools/perf/Documentation/perf-ftrace.txt
+++ b/tools/perf/Documentation/perf-ftrace.txt
@@ -148,6 +148,17 @@ OPTIONS for 'perf ftrace latency'
--use-nsec::
Use nano-second instead of micro-second as a base unit of the histogram.
+--bucket-range=::
+ Bucket range in ms or ns (according to -n/--use-nsec), default is log2() mode.
+
+--min-latency=::
+ Minimum latency for the start of the first bucket, in ms or ns (according to
+ -n/--use-nsec).
+
+--max-latency=::
+ Maximum latency for the start of the last bucket, in ms or ns (according to
+ -n/--use-nsec). The setting is ignored if the value results in more than
+ 22 buckets.
OPTIONS for 'perf ftrace profile'
---------------------------------
@@ -190,6 +201,14 @@ OPTIONS for 'perf ftrace profile'
Sort the result by the given field. Available values are:
total, avg, max, count, name. Default is 'total'.
+--graph-opts::
+ List of options allowed to set:
+
+ - nosleep-time - Measure on-CPU time only for function_graph tracer.
+ - noirqs - Ignore functions that happen inside interrupt.
+ - thresh=<n> - Setup trace duration threshold in microseconds.
+ - depth=<n> - Set max depth for function graph tracer to follow.
+
SEE ALSO
--------
diff --git a/tools/perf/Documentation/perf-intel-pt.txt b/tools/perf/Documentation/perf-intel-pt.txt
index 59ab1ff9d75f..cc0f37f0fa5a 100644
--- a/tools/perf/Documentation/perf-intel-pt.txt
+++ b/tools/perf/Documentation/perf-intel-pt.txt
@@ -151,7 +151,7 @@ displayed as follows:
There are two ways that instructions-per-cycle (IPC) can be calculated depending
on the recording.
-If the 'cyc' config term (see config terms section below) was used, then IPC
+If the 'cyc' config term (see <<_config_terms,config terms>> section below) was used, then IPC
and cycle events are calculated using the cycle count from CYC packets, otherwise
MTC packets are used - refer to the 'mtc' config term. When MTC is used, however,
the values are less accurate because the timing is less accurate.
@@ -239,7 +239,7 @@ which is the same as
-e intel_pt/tsc=1,noretcomp=0/
-Note there are now new config terms - see section 'config terms' further below.
+Note there are other config terms - see section <<_config_terms,config terms>> further below.
The config terms are listed in /sys/devices/intel_pt/format. They are bit
fields within the config member of the struct perf_event_attr which is
@@ -311,218 +311,271 @@ perf_event_attr is displayed if the -vv option is used e.g.
config terms
~~~~~~~~~~~~
-The June 2015 version of Intel 64 and IA-32 Architectures Software Developer
-Manuals, Chapter 36 Intel Processor Trace, defined new Intel PT features.
-Some of the features are reflect in new config terms. All the config terms are
-described below.
-
-tsc Always supported. Produces TSC timestamp packets to provide
- timing information. In some cases it is possible to decode
- without timing information, for example a per-thread context
- that does not overlap executable memory maps.
-
- The default config selects tsc (i.e. tsc=1).
-
-noretcomp Always supported. Disables "return compression" so a TIP packet
- is produced when a function returns. Causes more packets to be
- produced but might make decoding more reliable.
-
- The default config does not select noretcomp (i.e. noretcomp=0).
-
-psb_period Allows the frequency of PSB packets to be specified.
-
- The PSB packet is a synchronization packet that provides a
- starting point for decoding or recovery from errors.
-
- Support for psb_period is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/psb_cyc
-
- which contains "1" if the feature is supported and "0"
- otherwise.
-
- Valid values are given by:
-
- /sys/bus/event_source/devices/intel_pt/caps/psb_periods
-
- which contains a hexadecimal value, the bits of which represent
- valid values e.g. bit 2 set means value 2 is valid.
-
- The psb_period value is converted to the approximate number of
- trace bytes between PSB packets as:
-
- 2 ^ (value + 11)
-
- e.g. value 3 means 16KiB bytes between PSBs
-
- If an invalid value is entered, the error message
- will give a list of valid values e.g.
-
- $ perf record -e intel_pt/psb_period=15/u uname
- Invalid psb_period for intel_pt. Valid values are: 0-5
-
- If MTC packets are selected, the default config selects a value
- of 3 (i.e. psb_period=3) or the nearest lower value that is
- supported (0 is always supported). Otherwise the default is 0.
-
- If decoding is expected to be reliable and the buffer is large
- then a large PSB period can be used.
-
- Because a TSC packet is produced with PSB, the PSB period can
- also affect the granularity to timing information in the absence
- of MTC or CYC.
-
-mtc Produces MTC timing packets.
-
- MTC packets provide finer grain timestamp information than TSC
- packets. MTC packets record time using the hardware crystal
- clock (CTC) which is related to TSC packets using a TMA packet.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/mtc
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
- The frequency of MTC packets can also be specified - see
- mtc_period below.
-
-mtc_period Specifies how frequently MTC packets are produced - see mtc
- above for how to determine if MTC packets are supported.
-
- Valid values are given by:
-
- /sys/bus/event_source/devices/intel_pt/caps/mtc_periods
-
- which contains a hexadecimal value, the bits of which represent
- valid values e.g. bit 2 set means value 2 is valid.
-
- The mtc_period value is converted to the MTC frequency as:
-
- CTC-frequency / (2 ^ value)
-
- e.g. value 3 means one eighth of CTC-frequency
-
- Where CTC is the hardware crystal clock, the frequency of which
- can be related to TSC via values provided in cpuid leaf 0x15.
-
- If an invalid value is entered, the error message
- will give a list of valid values e.g.
-
- $ perf record -e intel_pt/mtc_period=15/u uname
- Invalid mtc_period for intel_pt. Valid values are: 0,3,6,9
-
- The default value is 3 or the nearest lower value
- that is supported (0 is always supported).
-
-cyc Produces CYC timing packets.
-
- CYC packets provide even finer grain timestamp information than
- MTC and TSC packets. A CYC packet contains the number of CPU
- cycles since the last CYC packet. Unlike MTC and TSC packets,
- CYC packets are only sent when another packet is also sent.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/psb_cyc
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
- The number of CYC packets produced can be reduced by specifying
- a threshold - see cyc_thresh below.
-
-cyc_thresh Specifies how frequently CYC packets are produced - see cyc
- above for how to determine if CYC packets are supported.
-
- Valid cyc_thresh values are given by:
-
- /sys/bus/event_source/devices/intel_pt/caps/cycle_thresholds
-
- which contains a hexadecimal value, the bits of which represent
- valid values e.g. bit 2 set means value 2 is valid.
-
- The cyc_thresh value represents the minimum number of CPU cycles
- that must have passed before a CYC packet can be sent. The
- number of CPU cycles is:
-
- 2 ^ (value - 1)
-
- e.g. value 4 means 8 CPU cycles must pass before a CYC packet
- can be sent. Note a CYC packet is still only sent when another
- packet is sent, not at, e.g. every 8 CPU cycles.
-
- If an invalid value is entered, the error message
- will give a list of valid values e.g.
-
- $ perf record -e intel_pt/cyc,cyc_thresh=15/u uname
- Invalid cyc_thresh for intel_pt. Valid values are: 0-12
-
- CYC packets are not requested by default.
-
-pt Specifies pass-through which enables the 'branch' config term.
-
- The default config selects 'pt' if it is available, so a user will
- never need to specify this term.
-
-branch Enable branch tracing. Branch tracing is enabled by default so to
- disable branch tracing use 'branch=0'.
-
- The default config selects 'branch' if it is available.
-
-ptw Enable PTWRITE packets which are produced when a ptwrite instruction
- is executed.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/ptwrite
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
- As an alternative, refer to "Emulated PTWRITE" further below.
-
-fup_on_ptw Enable a FUP packet to follow the PTWRITE packet. The FUP packet
- provides the address of the ptwrite instruction. In the absence of
- fup_on_ptw, the decoder will use the address of the previous branch
- if branch tracing is enabled, otherwise the address will be zero.
- Note that fup_on_ptw will work even when branch tracing is disabled.
-
-pwr_evt Enable power events. The power events provide information about
- changes to the CPU C-state.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/power_event_trace
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
-event Enable Event Trace. The events provide information about asynchronous
- events.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/event_trace
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
-notnt Disable TNT packets. Without TNT packets, it is not possible to walk
- executable code to reconstruct control flow, however FUP, TIP, TIP.PGE
- and TIP.PGD packets still indicate asynchronous control flow, and (if
- return compression is disabled - see noretcomp) return statements.
- The advantage of eliminating TNT packets is reducing the size of the
- trace and corresponding tracing overhead.
-
- Support for this feature is indicated by:
-
- /sys/bus/event_source/devices/intel_pt/caps/tnt_disable
-
- which contains "1" if the feature is supported and
- "0" otherwise.
-
+Config terms are parameters specified with the -e intel_pt// event option,
+for example:
+
+ -e intel_pt/cyc/
+
+which selects cycle accurate mode. Each config term can have a value which
+defaults to 1, so the above is the same as:
+
+ -e intel_pt/cyc=1/
+
+Some terms are set by default, so must be set to 0 to turn them off. For
+example, to turn off branch tracing:
+
+ -e intel_pt/branch=0/
+
+Multiple config terms are separated by commas, for example:
+
+ -e intel_pt/cyc,mtc_period=9/
+
+There are also common config terms, see linkperf:perf-record[1] documentation.
+
+Intel PT config terms are described below.
+
+*tsc*::
+Always supported. Produces TSC timestamp packets to provide
+timing information. In some cases it is possible to decode
+without timing information, for example a per-thread context
+that does not overlap executable memory maps.
++
+The default config selects tsc (i.e. tsc=1).
+
+*noretcomp*::
+Always supported. Disables "return compression" so a TIP packet
+is produced when a function returns. Causes more packets to be
+produced but might make decoding more reliable.
++
+The default config does not select noretcomp (i.e. noretcomp=0).
+
+*psb_period*::
+Allows the frequency of PSB packets to be specified.
++
+The PSB packet is a synchronization packet that provides a
+starting point for decoding or recovery from errors.
++
+Support for psb_period is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/psb_cyc
++
+which contains "1" if the feature is supported and "0"
+otherwise.
++
+Valid values are given by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/psb_periods
++
+which contains a hexadecimal value, the bits of which represent
+valid values e.g. bit 2 set means value 2 is valid.
++
+The psb_period value is converted to the approximate number of
+trace bytes between PSB packets as:
++
+ 2 ^ (value + 11)
++
+e.g. value 3 means 16KiB bytes between PSBs
++
+If an invalid value is entered, the error message
+will give a list of valid values e.g.
++
+ $ perf record -e intel_pt/psb_period=15/u uname
+ Invalid psb_period for intel_pt. Valid values are: 0-5
++
+If MTC packets are selected, the default config selects a value
+of 3 (i.e. psb_period=3) or the nearest lower value that is
+supported (0 is always supported). Otherwise the default is 0.
++
+If decoding is expected to be reliable and the buffer is large
+then a large PSB period can be used.
++
+Because a TSC packet is produced with PSB, the PSB period can
+also affect the granularity to timing information in the absence
+of MTC or CYC.
+
+*mtc*::
+Produces MTC timing packets.
++
+MTC packets provide finer grain timestamp information than TSC
+packets. MTC packets record time using the hardware crystal
+clock (CTC) which is related to TSC packets using a TMA packet.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/mtc
++
+which contains "1" if the feature is supported and
+"0" otherwise.
++
+The frequency of MTC packets can also be specified - see
+mtc_period below.
+
+*mtc_period*::
+Specifies how frequently MTC packets are produced - see mtc
+above for how to determine if MTC packets are supported.
++
+Valid values are given by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/mtc_periods
++
+which contains a hexadecimal value, the bits of which represent
+valid values e.g. bit 2 set means value 2 is valid.
++
+The mtc_period value is converted to the MTC frequency as:
+
+ CTC-frequency / (2 ^ value)
++
+e.g. value 3 means one eighth of CTC-frequency
++
+Where CTC is the hardware crystal clock, the frequency of which
+can be related to TSC via values provided in cpuid leaf 0x15.
++
+If an invalid value is entered, the error message
+will give a list of valid values e.g.
++
+ $ perf record -e intel_pt/mtc_period=15/u uname
+ Invalid mtc_period for intel_pt. Valid values are: 0,3,6,9
++
+The default value is 3 or the nearest lower value
+that is supported (0 is always supported).
+
+*cyc*::
+Produces CYC timing packets.
++
+CYC packets provide even finer grain timestamp information than
+MTC and TSC packets. A CYC packet contains the number of CPU
+cycles since the last CYC packet. Unlike MTC and TSC packets,
+CYC packets are only sent when another packet is also sent.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/psb_cyc
++
+which contains "1" if the feature is supported and
+"0" otherwise.
++
+The number of CYC packets produced can be reduced by specifying
+a threshold - see cyc_thresh below.
+
+*cyc_thresh*::
+Specifies how frequently CYC packets are produced - see cyc
+above for how to determine if CYC packets are supported.
++
+Valid cyc_thresh values are given by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/cycle_thresholds
++
+which contains a hexadecimal value, the bits of which represent
+valid values e.g. bit 2 set means value 2 is valid.
++
+The cyc_thresh value represents the minimum number of CPU cycles
+that must have passed before a CYC packet can be sent. The
+number of CPU cycles is:
++
+ 2 ^ (value - 1)
++
+e.g. value 4 means 8 CPU cycles must pass before a CYC packet
+can be sent. Note a CYC packet is still only sent when another
+packet is sent, not at, e.g. every 8 CPU cycles.
++
+If an invalid value is entered, the error message
+will give a list of valid values e.g.
++
+ $ perf record -e intel_pt/cyc,cyc_thresh=15/u uname
+ Invalid cyc_thresh for intel_pt. Valid values are: 0-12
++
+CYC packets are not requested by default.
+
+*pt*::
+Specifies pass-through which enables the 'branch' config term.
++
+The default config selects 'pt' if it is available, so a user will
+never need to specify this term.
+
+*branch*::
+Enable branch tracing. Branch tracing is enabled by default so to
+disable branch tracing use 'branch=0'.
++
+The default config selects 'branch' if it is available.
+
+*ptw*::
+Enable PTWRITE packets which are produced when a ptwrite instruction
+is executed.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/ptwrite
++
+which contains "1" if the feature is supported and
+"0" otherwise.
++
+As an alternative, refer to "Emulated PTWRITE" further below.
+
+*fup_on_ptw*::
+Enable a FUP packet to follow the PTWRITE packet. The FUP packet
+provides the address of the ptwrite instruction. In the absence of
+fup_on_ptw, the decoder will use the address of the previous branch
+if branch tracing is enabled, otherwise the address will be zero.
+Note that fup_on_ptw will work even when branch tracing is disabled.
+
+*pwr_evt*::
+Enable power events. The power events provide information about
+changes to the CPU C-state.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/power_event_trace
++
+which contains "1" if the feature is supported and
+"0" otherwise.
+
+*event*::
+Enable Event Trace. The events provide information about asynchronous
+events.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/event_trace
++
+which contains "1" if the feature is supported and
+"0" otherwise.
+
+*notnt*::
+Disable TNT packets. Without TNT packets, it is not possible to walk
+executable code to reconstruct control flow, however FUP, TIP, TIP.PGE
+and TIP.PGD packets still indicate asynchronous control flow, and (if
+return compression is disabled - see noretcomp) return statements.
+The advantage of eliminating TNT packets is reducing the size of the
+trace and corresponding tracing overhead.
++
+Support for this feature is indicated by:
++
+ /sys/bus/event_source/devices/intel_pt/caps/tnt_disable
++
+which contains "1" if the feature is supported and
+"0" otherwise.
+
+*aux-action=start-paused*::
+Start tracing paused, refer to the section <<_pause_or_resume_tracing,Pause or Resume Tracing>>
+
+
+config terms on other events
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+Some Intel PT features work with other events, features such as AUX area sampling
+and PEBS-via-PT. In those cases, the other events can have config terms below:
+
+*aux-sample-size*::
+ Used to set the AUX area sample size, refer to the section
+ <<_aux_area_sampling_option,AUX area sampling option>>
+
+*aux-output*::
+ Used to select PEBS-via-PT, refer to the
+ section <<_pebs_via_intel_pt,PEBS via Intel PT>>
+
+*aux-action*::
+ Used to pause or resume tracing, refer to the section
+ <<_pause_or_resume_tracing,Pause or Resume Tracing>>
AUX area sampling option
~~~~~~~~~~~~~~~~~~~~~~~~
@@ -596,7 +649,8 @@ The default snapshot size is the auxtrace mmap size. If neither auxtrace mmap s
nor snapshot size is specified, then the default is 4MiB for privileged users
(or if /proc/sys/kernel/perf_event_paranoid < 0), 128KiB for unprivileged users.
If an unprivileged user does not specify mmap pages, the mmap pages will be
-reduced as described in the 'new auxtrace mmap size option' section below.
+reduced as described in the <<_new_auxtrace_mmap_size_option,new auxtrace mmap size option>>
+section below.
The snapshot size is displayed if the option -vv is used e.g.
@@ -952,11 +1006,11 @@ transaction start, commit or abort.
Note that "instructions", "cycles", "branches" and "transactions" events
depend on code flow packets which can be disabled by using the config term
-"branch=0". Refer to the config terms section above.
+"branch=0". Refer to the <<_config_terms,config terms>> section above.
"ptwrite" events record the payload of the ptwrite instruction and whether
"fup_on_ptw" was used. "ptwrite" events depend on PTWRITE packets which are
-recorded only if the "ptw" config term was used. Refer to the config terms
+recorded only if the "ptw" config term was used. Refer to the <<_config_terms,config terms>>
section above. perf script "synth" field displays "ptwrite" information like
this: "ip: 0 payload: 0x123456789abcdef0" where "ip" is 1 if "fup_on_ptw" was
used.
@@ -964,7 +1018,7 @@ used.
"Power" events correspond to power event packets and CBR (core-to-bus ratio)
packets. While CBR packets are always recorded when tracing is enabled, power
event packets are recorded only if the "pwr_evt" config term was used. Refer to
-the config terms section above. The power events record information about
+the <<_config_terms,config terms>> section above. The power events record information about
C-state changes, whereas CBR is indicative of CPU frequency. perf script
"event,synth" fields display information like this:
@@ -1120,7 +1174,7 @@ What *will* be decoded with the (single) q option:
- asynchronous branches such as interrupts
- indirect branches
- function return target address *if* the noretcomp config term (refer
- config terms section) was used
+ <<_config_terms,config terms>> section) was used
- start of (control-flow) tracing
- end of (control-flow) tracing, if it is not out of context
- power events, ptwrite, transaction start and abort
@@ -1133,7 +1187,7 @@ Repeating the q option (double-q i.e. qq) results in even faster decoding and ev
less detail. The decoder decodes only extended PSB (PSB+) packets, getting the
instruction pointer if there is a FUP packet within PSB+ (i.e. between PSB and
PSBEND). Note PSB packets occur regularly in the trace based on the psb_period
-config term (refer config terms section). There will be a FUP packet if the
+config term (refer <<_config_terms,config terms>> section). There will be a FUP packet if the
PSB+ occurs while control flow is being traced.
What will *not* be decoded with the qq option:
@@ -1867,6 +1921,108 @@ For pipe mode, the order of events and timestamps can presumably
be messed up.
+Pause or Resume Tracing
+-----------------------
+
+With newer Kernels, it is possible to use other selected events to pause
+or resume Intel PT tracing. This is configured by using the "aux-action"
+config term:
+
+"aux-action=pause" is used with events that are to pause Intel PT tracing.
+
+"aux-action=resume" is used with events that are to resume Intel PT tracing.
+
+"aux-action=start-paused" is used with the Intel PT event to start in a
+paused state.
+
+For example, to trace only the uname system call (sys_newuname) when running the
+command line utility uname:
+
+ $ perf record --kcore -e intel_pt/aux-action=start-paused/k,syscalls:sys_enter_newuname/aux-action=resume/,syscalls:sys_exit_newuname/aux-action=pause/ uname
+ Linux
+ [ perf record: Woken up 1 times to write data ]
+ [ perf record: Captured and wrote 0.043 MB perf.data ]
+ $ perf script --call-trace
+ uname 30805 [000] 24001.058782799: name: 0x7ffc9c1865b0
+ uname 30805 [000] 24001.058784424: psb offs: 0
+ uname 30805 [000] 24001.058784424: cbr: 39 freq: 3904 MHz (139%)
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) __x64_sys_newuname
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) down_read
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) __cond_resched
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) preempt_count_add
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) in_lock_functions
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) preempt_count_sub
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) up_read
+ uname 30805 [000] 24001.058784629: ([kernel.kallsyms]) preempt_count_add
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) in_lock_functions
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) preempt_count_sub
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) _copy_to_user
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) syscall_exit_to_user_mode
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) syscall_exit_work
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) perf_syscall_exit
+ uname 30805 [000] 24001.058784838: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_trace_buf_alloc
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_swevent_get_recursion_context
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_tp_event
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_trace_buf_update
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) tracing_gen_ctx_irq_test
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_swevent_event
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) __perf_event_account_interrupt
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) __this_cpu_preempt_check
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_event_output_forward
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) perf_event_aux_pause
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) ring_buffer_get
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) __rcu_read_lock
+ uname 30805 [000] 24001.058785046: ([kernel.kallsyms]) __rcu_read_unlock
+ uname 30805 [000] 24001.058785254: ([kernel.kallsyms]) pt_event_stop
+ uname 30805 [000] 24001.058785254: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058785254: ([kernel.kallsyms]) debug_smp_processor_id
+ uname 30805 [000] 24001.058785254: ([kernel.kallsyms]) native_write_msr
+ uname 30805 [000] 24001.058785463: ([kernel.kallsyms]) native_write_msr
+ uname 30805 [000] 24001.058785639: 0x0
+
+The example above uses tracepoints, but any kind of sampled event can be used.
+
+For example:
+
+ Tracing between arch_cpu_idle_enter() and arch_cpu_idle_exit() using breakpoint events:
+
+ $ sudo cat /proc/kallsyms | sort | grep ' arch_cpu_idle_enter\| arch_cpu_idle_exit'
+ ffffffffb605bf60 T arch_cpu_idle_enter
+ ffffffffb614d8a0 W arch_cpu_idle_exit
+ $ sudo perf record --kcore -a -e intel_pt/aux-action=start-paused/k -e mem:0xffffffffb605bf60:x/aux-action=resume/ -e mem:0xffffffffb614d8a0:x/aux-action=pause/ -- sleep 1
+ [ perf record: Woken up 1 times to write data ]
+ [ perf record: Captured and wrote 1.387 MB perf.data ]
+
+ Tracing __alloc_pages() using kprobes:
+
+ $ sudo perf probe --add '__alloc_pages order'
+ Added new event: probe:__alloc_pages (on __alloc_pages with order)
+ $ sudo perf probe --add __alloc_pages%return
+ Added new event: probe:__alloc_pages__return (on __alloc_pages%return)
+ $ sudo perf record --kcore -aR -e intel_pt/aux-action=start-paused/k -e probe:__alloc_pages/aux-action=resume/ -e probe:__alloc_pages__return/aux-action=pause/ -- sleep 1
+ [ perf record: Woken up 1 times to write data ]
+ [ perf record: Captured and wrote 1.490 MB perf.data ]
+
+ Tracing starting at main() using a uprobe event:
+
+ $ sudo perf probe -x /usr/bin/uname main
+ Added new event: probe_uname:main (on main in /usr/bin/uname)
+ $ sudo perf record -e intel_pt/-aux-action=start-paused/u -e probe_uname:main/aux-action=resume/ -- uname
+ Linux
+ [ perf record: Woken up 1 times to write data ]
+ [ perf record: Captured and wrote 0.031 MB perf.data ]
+
+ Tracing occasionally using cycles events with different periods:
+
+ $ perf record --kcore -a -m,64M -e intel_pt/aux-action=start-paused/k -e cycles/aux-action=pause,period=1000000/Pk -e cycles/aux-action=resume,period=10500000/Pk -- firefox
+ [ perf record: Woken up 19 times to write data ]
+ [ perf record: Captured and wrote 16.561 MB perf.data ]
+
+
EXAMPLE
-------
diff --git a/tools/perf/Documentation/perf-lock.txt b/tools/perf/Documentation/perf-lock.txt
index 57a940399de0..d3793054f7d3 100644
--- a/tools/perf/Documentation/perf-lock.txt
+++ b/tools/perf/Documentation/perf-lock.txt
@@ -187,8 +187,8 @@ CONTENTION OPTIONS
Show lock contention only for given lock types (comma separated list).
Available values are:
semaphore, spinlock, rwlock, rwlock:R, rwlock:W, rwsem, rwsem:R, rwsem:W,
- rtmutex, rwlock-rt, rwlock-rt:R, rwlock-rt:W, pcpu-sem, pcpu-sem:R, pcpu-sem:W,
- mutex
+ rtmutex, rwlock-rt, rwlock-rt:R, rwlock-rt:W, percpu-rwmem, pcpu-sem,
+ pcpu-sem:R, pcpu-sem:W, mutex
Note that RW-variant of locks have :R and :W suffix. Names without the
suffix are shortcuts for the both variants. Ex) rwsem = rwsem:R + rwsem:W.
diff --git a/tools/perf/Documentation/perf-record.txt b/tools/perf/Documentation/perf-record.txt
index 242223240a08..80686d590de2 100644
--- a/tools/perf/Documentation/perf-record.txt
+++ b/tools/perf/Documentation/perf-record.txt
@@ -68,6 +68,10 @@ OPTIONS
like this: name=\'CPU_CLK_UNHALTED.THREAD:cmask=0x1\'.
- 'aux-output': Generate AUX records instead of events. This requires
that an AUX area event is also provided.
+ - 'aux-action': "pause" or "resume" to pause or resume an AUX
+ area event (the group leader) when this event occurs.
+ "start-paused" on an AUX area event itself, will
+ start in a paused state.
- 'aux-sample-size': Set sample size for AUX area sampling. If the
'--aux-sample' option has been used, set aux-sample-size=0 to disable
AUX area sampling for the event.
diff --git a/tools/perf/Documentation/perf-test.txt b/tools/perf/Documentation/perf-test.txt
index efcdec528a8f..32da0d1fa86a 100644
--- a/tools/perf/Documentation/perf-test.txt
+++ b/tools/perf/Documentation/perf-test.txt
@@ -28,18 +28,22 @@ OPTIONS
Tests to skip (comma separated numeric list).
-v::
+-vv::
+-vvv::
--verbose::
- Be more verbose.
+ With a single '-v', verbose level 1, only failing test output
+ is displayed. With '-vv' and higher all test output is shown.
-S::
--sequential::
- Run tests one after the other, this is the default mode.
-
--p::
---parallel::
- Run tests in parallel, speeds up the whole process but is not safe with
- the current infrastructure, where some tests that compete for some resources,
- for instance, 'perf probe' tests that add/remove probes or clean all probes, etc.
+ Run all tests one after the other. By default "exclusive"
+ tests are run sequentially, but other tests are run in
+ parallel to speed execution.
+
+-r::
+--runs-per-test::
+ Run each test the given number of times, by default once. This
+ option can be useful to determine if a test is flaky.
-F::
--dont-fork::
diff --git a/tools/perf/Documentation/perf-trace.txt b/tools/perf/Documentation/perf-trace.txt
index 6e0cc50bbc13..fb3d2af33844 100644
--- a/tools/perf/Documentation/perf-trace.txt
+++ b/tools/perf/Documentation/perf-trace.txt
@@ -241,6 +241,11 @@ the thread executes on the designated CPUs. Default is to monitor all CPUs.
printing using the existing 'perf trace' syscall arg beautifiers to map integer
arguments to strings (pid to comm, syscall id to syscall name, etc).
+--force-btf::
+ Use btf_dump to pretty print syscall argument data, instead of using hand-crafted pretty
+ printers. This option is intended for testing BTF integration in perf trace. btf_dump-based
+ pretty-printing serves as a fallback to hand-crafted pretty printers, as the latter can
+ better pretty-print integer flags and struct pointers.
PAGEFAULTS
----------
diff --git a/tools/perf/MANIFEST b/tools/perf/MANIFEST
index dc42de1785ce..364b55b00b48 100644
--- a/tools/perf/MANIFEST
+++ b/tools/perf/MANIFEST
@@ -1,5 +1,8 @@
+COPYING
+LICENSES/preferred/GPL-2.0
arch/arm64/tools/gen-sysreg.awk
arch/arm64/tools/sysreg
+arch/*/include/uapi/asm/bpf_perf_event.h
tools/perf
tools/arch
tools/scripts
diff --git a/tools/perf/Makefile.config b/tools/perf/Makefile.config
index 2916d59c88cd..a148ca9efca9 100644
--- a/tools/perf/Makefile.config
+++ b/tools/perf/Makefile.config
@@ -28,63 +28,58 @@ include $(srctree)/tools/scripts/Makefile.arch
$(call detected_var,SRCARCH)
-ifneq ($(NO_SYSCALL_TABLE),1)
- NO_SYSCALL_TABLE := 1
-
- ifeq ($(SRCARCH),$(filter $(SRCARCH),x86 powerpc arm64 s390 mips loongarch riscv))
- NO_SYSCALL_TABLE := 0
- endif
-
- ifneq ($(NO_SYSCALL_TABLE),1)
- CFLAGS += -DHAVE_SYSCALL_TABLE_SUPPORT
- endif
-endif
+CFLAGS += -I$(OUTPUT)arch/$(SRCARCH)/include/generated
# Additional ARCH settings for ppc
ifeq ($(SRCARCH),powerpc)
- CFLAGS += -I$(OUTPUT)arch/powerpc/include/generated
- LIBUNWIND_LIBS := -lunwind -lunwind-ppc64
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS := -lunwind -lunwind-ppc64
+ endif
endif
# Additional ARCH settings for x86
ifeq ($(SRCARCH),x86)
$(call detected,CONFIG_X86)
- CFLAGS += -I$(OUTPUT)arch/x86/include/generated
ifeq (${IS_64_BIT}, 1)
CFLAGS += -DHAVE_ARCH_X86_64_SUPPORT
ARCH_INCLUDE = ../../arch/x86/lib/memcpy_64.S ../../arch/x86/lib/memset_64.S
- LIBUNWIND_LIBS = -lunwind-x86_64 -lunwind -llzma
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind-x86_64 -lunwind -llzma
+ endif
$(call detected,CONFIG_X86_64)
else
- LIBUNWIND_LIBS = -lunwind-x86 -llzma -lunwind
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind-x86 -llzma -lunwind
+ endif
endif
endif
ifeq ($(SRCARCH),arm)
- LIBUNWIND_LIBS = -lunwind -lunwind-arm
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind -lunwind-arm
+ endif
endif
ifeq ($(SRCARCH),arm64)
- CFLAGS += -I$(OUTPUT)arch/arm64/include/generated
- LIBUNWIND_LIBS = -lunwind -lunwind-aarch64
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind -lunwind-aarch64
+ endif
endif
ifeq ($(SRCARCH),loongarch)
- CFLAGS += -I$(OUTPUT)arch/loongarch/include/generated
- LIBUNWIND_LIBS = -lunwind -lunwind-loongarch64
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind -lunwind-loongarch64
+ endif
endif
ifeq ($(ARCH),s390)
- CFLAGS += -fPIC -I$(OUTPUT)arch/s390/include/generated
+ CFLAGS += -fPIC
endif
ifeq ($(ARCH),mips)
- CFLAGS += -I$(OUTPUT)arch/mips/include/generated
- LIBUNWIND_LIBS = -lunwind -lunwind-mips
-endif
-
-ifeq ($(ARCH),riscv)
- CFLAGS += -I$(OUTPUT)arch/riscv/include/generated
+ ifndef NO_LIBUNWIND
+ LIBUNWIND_LIBS = -lunwind -lunwind-mips
+ endif
endif
# So far there's only x86 and arm libdw unwind support merged in perf.
@@ -121,16 +116,18 @@ ifdef LIBUNWIND_DIR
$(foreach libunwind_arch,$(LIBUNWIND_ARCHS),$(call libunwind_arch_set_flags,$(libunwind_arch)))
endif
-# Set per-feature check compilation flags
-FEATURE_CHECK_CFLAGS-libunwind = $(LIBUNWIND_CFLAGS)
-FEATURE_CHECK_LDFLAGS-libunwind = $(LIBUNWIND_LDFLAGS) $(LIBUNWIND_LIBS)
-FEATURE_CHECK_CFLAGS-libunwind-debug-frame = $(LIBUNWIND_CFLAGS)
-FEATURE_CHECK_LDFLAGS-libunwind-debug-frame = $(LIBUNWIND_LDFLAGS) $(LIBUNWIND_LIBS)
-
-FEATURE_CHECK_LDFLAGS-libunwind-arm += -lunwind -lunwind-arm
-FEATURE_CHECK_LDFLAGS-libunwind-aarch64 += -lunwind -lunwind-aarch64
-FEATURE_CHECK_LDFLAGS-libunwind-x86 += -lunwind -llzma -lunwind-x86
-FEATURE_CHECK_LDFLAGS-libunwind-x86_64 += -lunwind -llzma -lunwind-x86_64
+ifndef NO_LIBUNWIND
+ # Set per-feature check compilation flags
+ FEATURE_CHECK_CFLAGS-libunwind = $(LIBUNWIND_CFLAGS)
+ FEATURE_CHECK_LDFLAGS-libunwind = $(LIBUNWIND_LDFLAGS) $(LIBUNWIND_LIBS)
+ FEATURE_CHECK_CFLAGS-libunwind-debug-frame = $(LIBUNWIND_CFLAGS)
+ FEATURE_CHECK_LDFLAGS-libunwind-debug-frame = $(LIBUNWIND_LDFLAGS) $(LIBUNWIND_LIBS)
+
+ FEATURE_CHECK_LDFLAGS-libunwind-arm += -lunwind -lunwind-arm
+ FEATURE_CHECK_LDFLAGS-libunwind-aarch64 += -lunwind -lunwind-aarch64
+ FEATURE_CHECK_LDFLAGS-libunwind-x86 += -lunwind -llzma -lunwind-x86
+ FEATURE_CHECK_LDFLAGS-libunwind-x86_64 += -lunwind -llzma -lunwind-x86_64
+endif
FEATURE_CHECK_LDFLAGS-libcrypto = -lcrypto
@@ -155,7 +152,7 @@ ifdef LIBDW_DIR
endif
DWARFLIBS := -ldw
ifeq ($(findstring -static,${LDFLAGS}),-static)
- DWARFLIBS += -lelf -lz -llzma -lbz2 -lzstd
+ DWARFLIBS += -lelf -lz -llzma -lbz2
LIBDW_VERSION := $(shell $(PKG_CONFIG) --modversion libdw).0.0
LIBDW_VERSION_1 := $(word 1, $(subst ., ,$(LIBDW_VERSION)))
@@ -550,6 +547,12 @@ ifndef NO_LIBELF
CFLAGS += -DHAVE_ELF_GETSHDRSTRNDX_SUPPORT
endif
+ ifeq ($(feature-libelf-zstd), 1)
+ ifdef NO_LIBZSTD
+ $(error Error: libzstd is required by libelf, please do not set NO_LIBZSTD)
+ endif
+ endif
+
ifndef NO_LIBDEBUGINFOD
$(call feature_check,libdebuginfod)
ifeq ($(feature-libdebuginfod), 1)
@@ -734,26 +737,25 @@ ifeq ($(dwarf-post-unwind),1)
$(call detected,CONFIG_DWARF_UNWIND)
endif
-ifndef NO_LOCAL_LIBUNWIND
- ifeq ($(SRCARCH),$(filter $(SRCARCH),arm arm64))
- $(call feature_check,libunwind-debug-frame)
- ifneq ($(feature-libunwind-debug-frame), 1)
- $(warning No debug_frame support found in libunwind)
+ifndef NO_LIBUNWIND
+ ifndef NO_LOCAL_LIBUNWIND
+ ifeq ($(SRCARCH),$(filter $(SRCARCH),arm arm64))
+ $(call feature_check,libunwind-debug-frame)
+ ifneq ($(feature-libunwind-debug-frame), 1)
+ $(warning No debug_frame support found in libunwind)
+ CFLAGS += -DNO_LIBUNWIND_DEBUG_FRAME
+ endif
+ else
+ # non-ARM has no dwarf_find_debug_frame() function:
CFLAGS += -DNO_LIBUNWIND_DEBUG_FRAME
endif
- else
- # non-ARM has no dwarf_find_debug_frame() function:
- CFLAGS += -DNO_LIBUNWIND_DEBUG_FRAME
+ EXTLIBS += $(LIBUNWIND_LIBS)
+ LDFLAGS += $(LIBUNWIND_LIBS)
+ endif
+ ifeq ($(findstring -static,${LDFLAGS}),-static)
+ # gcc -static links libgcc_eh which contans piece of libunwind
+ LIBUNWIND_LDFLAGS += -Wl,--allow-multiple-definition
endif
- EXTLIBS += $(LIBUNWIND_LIBS)
- LDFLAGS += $(LIBUNWIND_LIBS)
-endif
-ifeq ($(findstring -static,${LDFLAGS}),-static)
- # gcc -static links libgcc_eh which contans piece of libunwind
- LIBUNWIND_LDFLAGS += -Wl,--allow-multiple-definition
-endif
-
-ifndef NO_LIBUNWIND
CFLAGS += -DHAVE_LIBUNWIND_SUPPORT
CFLAGS += $(LIBUNWIND_CFLAGS)
LDFLAGS += $(LIBUNWIND_LDFLAGS)
@@ -761,21 +763,7 @@ ifndef NO_LIBUNWIND
endif
ifneq ($(NO_LIBTRACEEVENT),1)
- ifeq ($(NO_SYSCALL_TABLE),0)
- $(call detected,CONFIG_TRACE)
- else
- ifndef NO_LIBAUDIT
- $(call feature_check,libaudit)
- ifneq ($(feature-libaudit), 1)
- $(warning No libaudit.h found, disables 'trace' tool, please install audit-libs-devel or libaudit-dev)
- NO_LIBAUDIT := 1
- else
- CFLAGS += -DHAVE_LIBAUDIT_SUPPORT
- EXTLIBS += -laudit
- $(call detected,CONFIG_TRACE)
- endif
- endif
- endif
+ $(call detected,CONFIG_TRACE)
endif
ifndef NO_LIBCRYPTO
@@ -1172,7 +1160,6 @@ endif
# libtraceevent is a recommended dependency picked up from the system.
ifneq ($(NO_LIBTRACEEVENT),1)
- $(call feature_check,libtraceevent)
ifeq ($(feature-libtraceevent), 1)
CFLAGS += -DHAVE_LIBTRACEEVENT $(shell $(PKG_CONFIG) --cflags libtraceevent)
LDFLAGS += $(shell $(PKG_CONFIG) --libs-only-L libtraceevent)
@@ -1188,7 +1175,6 @@ ifneq ($(NO_LIBTRACEEVENT),1)
$(error ERROR: libtraceevent is missing. Please install libtraceevent-dev/libtraceevent-devel and/or set LIBTRACEEVENT_DIR or build with NO_LIBTRACEEVENT=1)
endif
- $(call feature_check,libtracefs)
ifeq ($(feature-libtracefs), 1)
CFLAGS += $(shell $(PKG_CONFIG) --cflags libtracefs)
LDFLAGS += $(shell $(PKG_CONFIG) --libs-only-L libtracefs)
diff --git a/tools/perf/Makefile.perf b/tools/perf/Makefile.perf
index d74241a15131..55d6ce9ea52f 100644
--- a/tools/perf/Makefile.perf
+++ b/tools/perf/Makefile.perf
@@ -59,8 +59,6 @@ include ../scripts/utilities.mak
#
# Define NO_LIBNUMA if you do not want numa perf benchmark
#
-# Define NO_LIBAUDIT if you do not want libaudit support
-#
# Define NO_LIBBIONIC if you do not want bionic support
#
# Define NO_LIBCRYPTO if you do not want libcrypto (openssl) support
@@ -119,10 +117,6 @@ include ../scripts/utilities.mak
#
# Define LIBBPF_DYNAMIC to enable libbpf dynamic linking.
#
-# Define NO_SYSCALL_TABLE=1 to disable the use of syscall id to/from name tables
-# generated from the kernel .tbl or unistd.h files and use, if available, libaudit
-# for doing the conversions to/from strings/id.
-#
# Define NO_LIBPFM4 to disable libpfm4 events extension.
#
# Define NO_LIBDEBUGINFOD if you do not want support debuginfod
@@ -167,12 +161,47 @@ export VPATH
SOURCE := $(shell ln -sf $(srctree)/tools/perf $(OUTPUT)/source)
endif
+# Beautify output
+# ---------------------------------------------------------------------------
+#
+# Most of build commands in Kbuild start with "cmd_". You can optionally define
+# "quiet_cmd_*". If defined, the short log is printed. Otherwise, no log from
+# that command is printed by default.
+#
+# e.g.)
+# quiet_cmd_depmod = DEPMOD $(MODLIB)
+# cmd_depmod = $(srctree)/scripts/depmod.sh $(DEPMOD) $(KERNELRELEASE)
+#
+# A simple variant is to prefix commands with $(Q) - that's useful
+# for commands that shall be hidden in non-verbose mode.
+#
+# $(Q)$(MAKE) $(build)=scripts/basic
+#
+# To put more focus on warnings, be less verbose as default
+# Use 'make V=1' to see the full commands
+
ifeq ($(V),1)
+ quiet =
Q =
else
- Q = @
+ quiet=quiet_
+ Q=@
endif
+# If the user is running make -s (silent mode), suppress echoing of commands
+# make-4.0 (and later) keep single letter options in the 1st word of MAKEFLAGS.
+ifeq ($(filter 3.%,$(MAKE_VERSION)),)
+short-opts := $(firstword -$(MAKEFLAGS))
+else
+short-opts := $(filter-out --%,$(MAKEFLAGS))
+endif
+
+ifneq ($(findstring s,$(short-opts)),)
+ quiet=silent_
+endif
+
+export quiet Q
+
# Do not use make's built-in rules
# (this improves performance and avoids hard-to-debug behaviour);
MAKEFLAGS += -r
@@ -310,6 +339,7 @@ ifeq ($(filter feature-dump,$(MAKECMDGOALS)),feature-dump)
FEATURE_TESTS := all
endif
endif
+include $(srctree)/tools/perf/scripts/Makefile.syscalls
include Makefile.config
endif
@@ -487,6 +517,9 @@ endif
EXTLIBS := $(call filter-out,$(EXCLUDE_EXTLIBS),$(EXTLIBS))
LIBS = -Wl,--whole-archive $(PERFLIBS) $(EXTRA_PERFLIBS) -Wl,--no-whole-archive -Wl,--start-group $(EXTLIBS) -Wl,--end-group
+PERFLIBS_PY := $(call filter-out,$(LIBPERF_BENCH) $(LIBPERF_TEST),$(PERFLIBS))
+LIBS_PY = -Wl,--whole-archive $(PERFLIBS_PY) $(EXTRA_PERFLIBS) -Wl,--no-whole-archive -Wl,--start-group $(EXTLIBS) -Wl,--end-group
+
export INSTALL SHELL_PATH
### Build rules
@@ -735,9 +768,9 @@ all: shell_compatibility_test $(ALL_PROGRAMS) $(LANG_BINDINGS) $(OTHER_PROGRAMS)
# Create python binding output directory if not already present
$(shell [ -d '$(OUTPUT)python' ] || mkdir -p '$(OUTPUT)python')
-$(OUTPUT)python/perf$(PYTHON_EXTENSION_SUFFIX): util/python.c util/setup.py $(PERFLIBS)
+$(OUTPUT)python/perf$(PYTHON_EXTENSION_SUFFIX): util/python.c util/setup.py $(PERFLIBS_PY)
$(QUIET_GEN)LDSHARED="$(CC) -pthread -shared" \
- CFLAGS='$(CFLAGS)' LDFLAGS='$(LDFLAGS) $(LIBS)' \
+ CFLAGS='$(CFLAGS)' LDFLAGS='$(LDFLAGS) $(LIBS_PY)' \
$(PYTHON_WORD) util/setup.py \
--quiet build_ext; \
cp $(PYTHON_EXTBUILD_LIB)perf*.so $(OUTPUT)python/
@@ -1094,11 +1127,6 @@ endif
$(INSTALL) $(OUTPUT)perf-archive -t '$(DESTDIR_SQ)$(perfexec_instdir_SQ)'
$(call QUIET_INSTALL, perf-iostat) \
$(INSTALL) $(OUTPUT)perf-iostat -t '$(DESTDIR_SQ)$(perfexec_instdir_SQ)'
-ifndef NO_LIBAUDIT
- $(call QUIET_INSTALL, strace/groups) \
- $(INSTALL) -d -m 755 '$(DESTDIR_SQ)$(STRACE_GROUPS_INSTDIR_SQ)'; \
- $(INSTALL) trace/strace/groups/* -m 644 -t '$(DESTDIR_SQ)$(STRACE_GROUPS_INSTDIR_SQ)'
-endif
ifndef NO_LIBPERL
$(call QUIET_INSTALL, perl-scripts) \
$(INSTALL) -d -m 755 '$(DESTDIR_SQ)$(perfexec_instdir_SQ)/scripts/perl/Perf-Trace-Util/lib/Perf/Trace'; \
diff --git a/tools/perf/arch/alpha/entry/syscalls/Kbuild b/tools/perf/arch/alpha/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9a41e3572c3a
--- /dev/null
+++ b/tools/perf/arch/alpha/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/alpha/entry/syscalls/Makefile.syscalls b/tools/perf/arch/alpha/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..690168aac34d
--- /dev/null
+++ b/tools/perf/arch/alpha/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,5 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_64 +=
+
+syscalltbl = $(srctree)/tools/perf/arch/alpha/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/alpha/entry/syscalls/syscall.tbl b/tools/perf/arch/alpha/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..74720667fe09
--- /dev/null
+++ b/tools/perf/arch/alpha/entry/syscalls/syscall.tbl
@@ -0,0 +1,504 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# system call numbers and entry vectors for alpha
+#
+# The format is:
+# <number> <abi> <name> <entry point>
+#
+# The <abi> is always "common" for this file
+#
+0 common osf_syscall alpha_syscall_zero
+1 common exit sys_exit
+2 common fork alpha_fork
+3 common read sys_read
+4 common write sys_write
+5 common osf_old_open sys_ni_syscall
+6 common close sys_close
+7 common osf_wait4 sys_osf_wait4
+8 common osf_old_creat sys_ni_syscall
+9 common link sys_link
+10 common unlink sys_unlink
+11 common osf_execve sys_ni_syscall
+12 common chdir sys_chdir
+13 common fchdir sys_fchdir
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 common chown sys_chown
+17 common brk sys_osf_brk
+18 common osf_getfsstat sys_ni_syscall
+19 common lseek sys_lseek
+20 common getxpid sys_getxpid
+21 common osf_mount sys_osf_mount
+22 common umount2 sys_umount
+23 common setuid sys_setuid
+24 common getxuid sys_getxuid
+25 common exec_with_loader sys_ni_syscall
+26 common ptrace sys_ptrace
+27 common osf_nrecvmsg sys_ni_syscall
+28 common osf_nsendmsg sys_ni_syscall
+29 common osf_nrecvfrom sys_ni_syscall
+30 common osf_naccept sys_ni_syscall
+31 common osf_ngetpeername sys_ni_syscall
+32 common osf_ngetsockname sys_ni_syscall
+33 common access sys_access
+34 common osf_chflags sys_ni_syscall
+35 common osf_fchflags sys_ni_syscall
+36 common sync sys_sync
+37 common kill sys_kill
+38 common osf_old_stat sys_ni_syscall
+39 common setpgid sys_setpgid
+40 common osf_old_lstat sys_ni_syscall
+41 common dup sys_dup
+42 common pipe sys_alpha_pipe
+43 common osf_set_program_attributes sys_osf_set_program_attributes
+44 common osf_profil sys_ni_syscall
+45 common open sys_open
+46 common osf_old_sigaction sys_ni_syscall
+47 common getxgid sys_getxgid
+48 common osf_sigprocmask sys_osf_sigprocmask
+49 common osf_getlogin sys_ni_syscall
+50 common osf_setlogin sys_ni_syscall
+51 common acct sys_acct
+52 common sigpending sys_sigpending
+54 common ioctl sys_ioctl
+55 common osf_reboot sys_ni_syscall
+56 common osf_revoke sys_ni_syscall
+57 common symlink sys_symlink
+58 common readlink sys_readlink
+59 common execve sys_execve
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common osf_old_fstat sys_ni_syscall
+63 common getpgrp sys_getpgrp
+64 common getpagesize sys_getpagesize
+65 common osf_mremap sys_ni_syscall
+66 common vfork alpha_vfork
+67 common stat sys_newstat
+68 common lstat sys_newlstat
+69 common osf_sbrk sys_ni_syscall
+70 common osf_sstk sys_ni_syscall
+71 common mmap sys_osf_mmap
+72 common osf_old_vadvise sys_ni_syscall
+73 common munmap sys_munmap
+74 common mprotect sys_mprotect
+75 common madvise sys_madvise
+76 common vhangup sys_vhangup
+77 common osf_kmodcall sys_ni_syscall
+78 common osf_mincore sys_ni_syscall
+79 common getgroups sys_getgroups
+80 common setgroups sys_setgroups
+81 common osf_old_getpgrp sys_ni_syscall
+82 common setpgrp sys_setpgid
+83 common osf_setitimer compat_sys_setitimer
+84 common osf_old_wait sys_ni_syscall
+85 common osf_table sys_ni_syscall
+86 common osf_getitimer compat_sys_getitimer
+87 common gethostname sys_gethostname
+88 common sethostname sys_sethostname
+89 common getdtablesize sys_getdtablesize
+90 common dup2 sys_dup2
+91 common fstat sys_newfstat
+92 common fcntl sys_fcntl
+93 common osf_select sys_osf_select
+94 common poll sys_poll
+95 common fsync sys_fsync
+96 common setpriority sys_setpriority
+97 common socket sys_socket
+98 common connect sys_connect
+99 common accept sys_accept
+100 common getpriority sys_osf_getpriority
+101 common send sys_send
+102 common recv sys_recv
+103 common sigreturn sys_sigreturn
+104 common bind sys_bind
+105 common setsockopt sys_setsockopt
+106 common listen sys_listen
+107 common osf_plock sys_ni_syscall
+108 common osf_old_sigvec sys_ni_syscall
+109 common osf_old_sigblock sys_ni_syscall
+110 common osf_old_sigsetmask sys_ni_syscall
+111 common sigsuspend sys_sigsuspend
+112 common osf_sigstack sys_osf_sigstack
+113 common recvmsg sys_recvmsg
+114 common sendmsg sys_sendmsg
+115 common osf_old_vtrace sys_ni_syscall
+116 common osf_gettimeofday sys_osf_gettimeofday
+117 common osf_getrusage sys_osf_getrusage
+118 common getsockopt sys_getsockopt
+120 common readv sys_readv
+121 common writev sys_writev
+122 common osf_settimeofday sys_osf_settimeofday
+123 common fchown sys_fchown
+124 common fchmod sys_fchmod
+125 common recvfrom sys_recvfrom
+126 common setreuid sys_setreuid
+127 common setregid sys_setregid
+128 common rename sys_rename
+129 common truncate sys_truncate
+130 common ftruncate sys_ftruncate
+131 common flock sys_flock
+132 common setgid sys_setgid
+133 common sendto sys_sendto
+134 common shutdown sys_shutdown
+135 common socketpair sys_socketpair
+136 common mkdir sys_mkdir
+137 common rmdir sys_rmdir
+138 common osf_utimes sys_osf_utimes
+139 common osf_old_sigreturn sys_ni_syscall
+140 common osf_adjtime sys_ni_syscall
+141 common getpeername sys_getpeername
+142 common osf_gethostid sys_ni_syscall
+143 common osf_sethostid sys_ni_syscall
+144 common getrlimit sys_getrlimit
+145 common setrlimit sys_setrlimit
+146 common osf_old_killpg sys_ni_syscall
+147 common setsid sys_setsid
+148 common quotactl sys_quotactl
+149 common osf_oldquota sys_ni_syscall
+150 common getsockname sys_getsockname
+153 common osf_pid_block sys_ni_syscall
+154 common osf_pid_unblock sys_ni_syscall
+156 common sigaction sys_osf_sigaction
+157 common osf_sigwaitprim sys_ni_syscall
+158 common osf_nfssvc sys_ni_syscall
+159 common osf_getdirentries sys_osf_getdirentries
+160 common osf_statfs sys_osf_statfs
+161 common osf_fstatfs sys_osf_fstatfs
+163 common osf_asynch_daemon sys_ni_syscall
+164 common osf_getfh sys_ni_syscall
+165 common osf_getdomainname sys_osf_getdomainname
+166 common setdomainname sys_setdomainname
+169 common osf_exportfs sys_ni_syscall
+181 common osf_alt_plock sys_ni_syscall
+184 common osf_getmnt sys_ni_syscall
+187 common osf_alt_sigpending sys_ni_syscall
+188 common osf_alt_setsid sys_ni_syscall
+199 common osf_swapon sys_swapon
+200 common msgctl sys_old_msgctl
+201 common msgget sys_msgget
+202 common msgrcv sys_msgrcv
+203 common msgsnd sys_msgsnd
+204 common semctl sys_old_semctl
+205 common semget sys_semget
+206 common semop sys_semop
+207 common osf_utsname sys_osf_utsname
+208 common lchown sys_lchown
+209 common shmat sys_shmat
+210 common shmctl sys_old_shmctl
+211 common shmdt sys_shmdt
+212 common shmget sys_shmget
+213 common osf_mvalid sys_ni_syscall
+214 common osf_getaddressconf sys_ni_syscall
+215 common osf_msleep sys_ni_syscall
+216 common osf_mwakeup sys_ni_syscall
+217 common msync sys_msync
+218 common osf_signal sys_ni_syscall
+219 common osf_utc_gettime sys_ni_syscall
+220 common osf_utc_adjtime sys_ni_syscall
+222 common osf_security sys_ni_syscall
+223 common osf_kloadcall sys_ni_syscall
+224 common osf_stat sys_osf_stat
+225 common osf_lstat sys_osf_lstat
+226 common osf_fstat sys_osf_fstat
+227 common osf_statfs64 sys_osf_statfs64
+228 common osf_fstatfs64 sys_osf_fstatfs64
+233 common getpgid sys_getpgid
+234 common getsid sys_getsid
+235 common sigaltstack sys_sigaltstack
+236 common osf_waitid sys_ni_syscall
+237 common osf_priocntlset sys_ni_syscall
+238 common osf_sigsendset sys_ni_syscall
+239 common osf_set_speculative sys_ni_syscall
+240 common osf_msfs_syscall sys_ni_syscall
+241 common osf_sysinfo sys_osf_sysinfo
+242 common osf_uadmin sys_ni_syscall
+243 common osf_fuser sys_ni_syscall
+244 common osf_proplist_syscall sys_osf_proplist_syscall
+245 common osf_ntp_adjtime sys_ni_syscall
+246 common osf_ntp_gettime sys_ni_syscall
+247 common osf_pathconf sys_ni_syscall
+248 common osf_fpathconf sys_ni_syscall
+250 common osf_uswitch sys_ni_syscall
+251 common osf_usleep_thread sys_osf_usleep_thread
+252 common osf_audcntl sys_ni_syscall
+253 common osf_audgen sys_ni_syscall
+254 common sysfs sys_sysfs
+255 common osf_subsys_info sys_ni_syscall
+256 common osf_getsysinfo sys_osf_getsysinfo
+257 common osf_setsysinfo sys_osf_setsysinfo
+258 common osf_afs_syscall sys_ni_syscall
+259 common osf_swapctl sys_ni_syscall
+260 common osf_memcntl sys_ni_syscall
+261 common osf_fdatasync sys_ni_syscall
+300 common bdflush sys_ni_syscall
+301 common sethae sys_sethae
+302 common mount sys_mount
+303 common old_adjtimex sys_old_adjtimex
+304 common swapoff sys_swapoff
+305 common getdents sys_getdents
+306 common create_module sys_ni_syscall
+307 common init_module sys_init_module
+308 common delete_module sys_delete_module
+309 common get_kernel_syms sys_ni_syscall
+310 common syslog sys_syslog
+311 common reboot sys_reboot
+312 common clone alpha_clone
+313 common uselib sys_uselib
+314 common mlock sys_mlock
+315 common munlock sys_munlock
+316 common mlockall sys_mlockall
+317 common munlockall sys_munlockall
+318 common sysinfo sys_sysinfo
+319 common _sysctl sys_ni_syscall
+# 320 was sys_idle
+321 common oldumount sys_oldumount
+322 common swapon sys_swapon
+323 common times sys_times
+324 common personality sys_personality
+325 common setfsuid sys_setfsuid
+326 common setfsgid sys_setfsgid
+327 common ustat sys_ustat
+328 common statfs sys_statfs
+329 common fstatfs sys_fstatfs
+330 common sched_setparam sys_sched_setparam
+331 common sched_getparam sys_sched_getparam
+332 common sched_setscheduler sys_sched_setscheduler
+333 common sched_getscheduler sys_sched_getscheduler
+334 common sched_yield sys_sched_yield
+335 common sched_get_priority_max sys_sched_get_priority_max
+336 common sched_get_priority_min sys_sched_get_priority_min
+337 common sched_rr_get_interval sys_sched_rr_get_interval
+338 common afs_syscall sys_ni_syscall
+339 common uname sys_newuname
+340 common nanosleep sys_nanosleep
+341 common mremap sys_mremap
+342 common nfsservctl sys_ni_syscall
+343 common setresuid sys_setresuid
+344 common getresuid sys_getresuid
+345 common pciconfig_read sys_pciconfig_read
+346 common pciconfig_write sys_pciconfig_write
+347 common query_module sys_ni_syscall
+348 common prctl sys_prctl
+349 common pread64 sys_pread64
+350 common pwrite64 sys_pwrite64
+351 common rt_sigreturn sys_rt_sigreturn
+352 common rt_sigaction sys_rt_sigaction
+353 common rt_sigprocmask sys_rt_sigprocmask
+354 common rt_sigpending sys_rt_sigpending
+355 common rt_sigtimedwait sys_rt_sigtimedwait
+356 common rt_sigqueueinfo sys_rt_sigqueueinfo
+357 common rt_sigsuspend sys_rt_sigsuspend
+358 common select sys_select
+359 common gettimeofday sys_gettimeofday
+360 common settimeofday sys_settimeofday
+361 common getitimer sys_getitimer
+362 common setitimer sys_setitimer
+363 common utimes sys_utimes
+364 common getrusage sys_getrusage
+365 common wait4 sys_wait4
+366 common adjtimex sys_adjtimex
+367 common getcwd sys_getcwd
+368 common capget sys_capget
+369 common capset sys_capset
+370 common sendfile sys_sendfile64
+371 common setresgid sys_setresgid
+372 common getresgid sys_getresgid
+373 common dipc sys_ni_syscall
+374 common pivot_root sys_pivot_root
+375 common mincore sys_mincore
+376 common pciconfig_iobase sys_pciconfig_iobase
+377 common getdents64 sys_getdents64
+378 common gettid sys_gettid
+379 common readahead sys_readahead
+# 380 is unused
+381 common tkill sys_tkill
+382 common setxattr sys_setxattr
+383 common lsetxattr sys_lsetxattr
+384 common fsetxattr sys_fsetxattr
+385 common getxattr sys_getxattr
+386 common lgetxattr sys_lgetxattr
+387 common fgetxattr sys_fgetxattr
+388 common listxattr sys_listxattr
+389 common llistxattr sys_llistxattr
+390 common flistxattr sys_flistxattr
+391 common removexattr sys_removexattr
+392 common lremovexattr sys_lremovexattr
+393 common fremovexattr sys_fremovexattr
+394 common futex sys_futex
+395 common sched_setaffinity sys_sched_setaffinity
+396 common sched_getaffinity sys_sched_getaffinity
+397 common tuxcall sys_ni_syscall
+398 common io_setup sys_io_setup
+399 common io_destroy sys_io_destroy
+400 common io_getevents sys_io_getevents
+401 common io_submit sys_io_submit
+402 common io_cancel sys_io_cancel
+405 common exit_group sys_exit_group
+406 common lookup_dcookie sys_ni_syscall
+407 common epoll_create sys_epoll_create
+408 common epoll_ctl sys_epoll_ctl
+409 common epoll_wait sys_epoll_wait
+410 common remap_file_pages sys_remap_file_pages
+411 common set_tid_address sys_set_tid_address
+412 common restart_syscall sys_restart_syscall
+413 common fadvise64 sys_fadvise64
+414 common timer_create sys_timer_create
+415 common timer_settime sys_timer_settime
+416 common timer_gettime sys_timer_gettime
+417 common timer_getoverrun sys_timer_getoverrun
+418 common timer_delete sys_timer_delete
+419 common clock_settime sys_clock_settime
+420 common clock_gettime sys_clock_gettime
+421 common clock_getres sys_clock_getres
+422 common clock_nanosleep sys_clock_nanosleep
+423 common semtimedop sys_semtimedop
+424 common tgkill sys_tgkill
+425 common stat64 sys_stat64
+426 common lstat64 sys_lstat64
+427 common fstat64 sys_fstat64
+428 common vserver sys_ni_syscall
+429 common mbind sys_ni_syscall
+430 common get_mempolicy sys_ni_syscall
+431 common set_mempolicy sys_ni_syscall
+432 common mq_open sys_mq_open
+433 common mq_unlink sys_mq_unlink
+434 common mq_timedsend sys_mq_timedsend
+435 common mq_timedreceive sys_mq_timedreceive
+436 common mq_notify sys_mq_notify
+437 common mq_getsetattr sys_mq_getsetattr
+438 common waitid sys_waitid
+439 common add_key sys_add_key
+440 common request_key sys_request_key
+441 common keyctl sys_keyctl
+442 common ioprio_set sys_ioprio_set
+443 common ioprio_get sys_ioprio_get
+444 common inotify_init sys_inotify_init
+445 common inotify_add_watch sys_inotify_add_watch
+446 common inotify_rm_watch sys_inotify_rm_watch
+447 common fdatasync sys_fdatasync
+448 common kexec_load sys_kexec_load
+449 common migrate_pages sys_migrate_pages
+450 common openat sys_openat
+451 common mkdirat sys_mkdirat
+452 common mknodat sys_mknodat
+453 common fchownat sys_fchownat
+454 common futimesat sys_futimesat
+455 common fstatat64 sys_fstatat64
+456 common unlinkat sys_unlinkat
+457 common renameat sys_renameat
+458 common linkat sys_linkat
+459 common symlinkat sys_symlinkat
+460 common readlinkat sys_readlinkat
+461 common fchmodat sys_fchmodat
+462 common faccessat sys_faccessat
+463 common pselect6 sys_pselect6
+464 common ppoll sys_ppoll
+465 common unshare sys_unshare
+466 common set_robust_list sys_set_robust_list
+467 common get_robust_list sys_get_robust_list
+468 common splice sys_splice
+469 common sync_file_range sys_sync_file_range
+470 common tee sys_tee
+471 common vmsplice sys_vmsplice
+472 common move_pages sys_move_pages
+473 common getcpu sys_getcpu
+474 common epoll_pwait sys_epoll_pwait
+475 common utimensat sys_utimensat
+476 common signalfd sys_signalfd
+477 common timerfd sys_ni_syscall
+478 common eventfd sys_eventfd
+479 common recvmmsg sys_recvmmsg
+480 common fallocate sys_fallocate
+481 common timerfd_create sys_timerfd_create
+482 common timerfd_settime sys_timerfd_settime
+483 common timerfd_gettime sys_timerfd_gettime
+484 common signalfd4 sys_signalfd4
+485 common eventfd2 sys_eventfd2
+486 common epoll_create1 sys_epoll_create1
+487 common dup3 sys_dup3
+488 common pipe2 sys_pipe2
+489 common inotify_init1 sys_inotify_init1
+490 common preadv sys_preadv
+491 common pwritev sys_pwritev
+492 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo
+493 common perf_event_open sys_perf_event_open
+494 common fanotify_init sys_fanotify_init
+495 common fanotify_mark sys_fanotify_mark
+496 common prlimit64 sys_prlimit64
+497 common name_to_handle_at sys_name_to_handle_at
+498 common open_by_handle_at sys_open_by_handle_at
+499 common clock_adjtime sys_clock_adjtime
+500 common syncfs sys_syncfs
+501 common setns sys_setns
+502 common accept4 sys_accept4
+503 common sendmmsg sys_sendmmsg
+504 common process_vm_readv sys_process_vm_readv
+505 common process_vm_writev sys_process_vm_writev
+506 common kcmp sys_kcmp
+507 common finit_module sys_finit_module
+508 common sched_setattr sys_sched_setattr
+509 common sched_getattr sys_sched_getattr
+510 common renameat2 sys_renameat2
+511 common getrandom sys_getrandom
+512 common memfd_create sys_memfd_create
+513 common execveat sys_execveat
+514 common seccomp sys_seccomp
+515 common bpf sys_bpf
+516 common userfaultfd sys_userfaultfd
+517 common membarrier sys_membarrier
+518 common mlock2 sys_mlock2
+519 common copy_file_range sys_copy_file_range
+520 common preadv2 sys_preadv2
+521 common pwritev2 sys_pwritev2
+522 common statx sys_statx
+523 common io_pgetevents sys_io_pgetevents
+524 common pkey_mprotect sys_pkey_mprotect
+525 common pkey_alloc sys_pkey_alloc
+526 common pkey_free sys_pkey_free
+527 common rseq sys_rseq
+528 common statfs64 sys_statfs64
+529 common fstatfs64 sys_fstatfs64
+530 common getegid sys_getegid
+531 common geteuid sys_geteuid
+532 common getppid sys_getppid
+# all other architectures have common numbers for new syscall, alpha
+# is the exception.
+534 common pidfd_send_signal sys_pidfd_send_signal
+535 common io_uring_setup sys_io_uring_setup
+536 common io_uring_enter sys_io_uring_enter
+537 common io_uring_register sys_io_uring_register
+538 common open_tree sys_open_tree
+539 common move_mount sys_move_mount
+540 common fsopen sys_fsopen
+541 common fsconfig sys_fsconfig
+542 common fsmount sys_fsmount
+543 common fspick sys_fspick
+544 common pidfd_open sys_pidfd_open
+545 common clone3 alpha_clone3
+546 common close_range sys_close_range
+547 common openat2 sys_openat2
+548 common pidfd_getfd sys_pidfd_getfd
+549 common faccessat2 sys_faccessat2
+550 common process_madvise sys_process_madvise
+551 common epoll_pwait2 sys_epoll_pwait2
+552 common mount_setattr sys_mount_setattr
+553 common quotactl_fd sys_quotactl_fd
+554 common landlock_create_ruleset sys_landlock_create_ruleset
+555 common landlock_add_rule sys_landlock_add_rule
+556 common landlock_restrict_self sys_landlock_restrict_self
+# 557 reserved for memfd_secret
+558 common process_mrelease sys_process_mrelease
+559 common futex_waitv sys_futex_waitv
+560 common set_mempolicy_home_node sys_ni_syscall
+561 common cachestat sys_cachestat
+562 common fchmodat2 sys_fchmodat2
+563 common map_shadow_stack sys_map_shadow_stack
+564 common futex_wake sys_futex_wake
+565 common futex_wait sys_futex_wait
+566 common futex_requeue sys_futex_requeue
+567 common statmount sys_statmount
+568 common listmount sys_listmount
+569 common lsm_get_self_attr sys_lsm_get_self_attr
+570 common lsm_set_self_attr sys_lsm_set_self_attr
+571 common lsm_list_modules sys_lsm_list_modules
+572 common mseal sys_mseal
diff --git a/tools/perf/arch/alpha/include/syscall_table.h b/tools/perf/arch/alpha/include/syscall_table.h
new file mode 100644
index 000000000000..b53e31c15805
--- /dev/null
+++ b/tools/perf/arch/alpha/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_64.h>
diff --git a/tools/perf/arch/arc/entry/syscalls/Kbuild b/tools/perf/arch/arc/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..11707c481a24
--- /dev/null
+++ b/tools/perf/arch/arc/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
diff --git a/tools/perf/arch/arc/entry/syscalls/Makefile.syscalls b/tools/perf/arch/arc/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..391d30ab7a83
--- /dev/null
+++ b/tools/perf/arch/arc/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += arc time32 renameat stat64 rlimit
diff --git a/tools/perf/arch/arc/include/syscall_table.h b/tools/perf/arch/arc/include/syscall_table.h
new file mode 100644
index 000000000000..4c942821662d
--- /dev/null
+++ b/tools/perf/arch/arc/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_32.h>
diff --git a/tools/perf/arch/arm/entry/syscalls/Kbuild b/tools/perf/arch/arm/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9d777540f089
--- /dev/null
+++ b/tools/perf/arch/arm/entry/syscalls/Kbuild
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += oabi
+syscalltbl = $(srctree)/tools/perf/arch/arm/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/arm/entry/syscalls/Makefile.syscalls b/tools/perf/arch/arm/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..11707c481a24
--- /dev/null
+++ b/tools/perf/arch/arm/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
diff --git a/tools/perf/arch/arm/entry/syscalls/syscall.tbl b/tools/perf/arch/arm/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..49eeb2ad8dbd
--- /dev/null
+++ b/tools/perf/arch/arm/entry/syscalls/syscall.tbl
@@ -0,0 +1,483 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# Linux system call numbers and entry vectors
+#
+# The format is:
+# <num> <abi> <name> [<entry point> [<oabi compat entry point>]]
+#
+# Where abi is:
+# common - for system calls shared between oabi and eabi (may have compat)
+# oabi - for oabi-only system calls (may have compat)
+# eabi - for eabi-only system calls
+#
+# For each syscall number, "common" is mutually exclusive with oabi and eabi
+#
+0 common restart_syscall sys_restart_syscall
+1 common exit sys_exit
+2 common fork sys_fork
+3 common read sys_read
+4 common write sys_write
+5 common open sys_open
+6 common close sys_close
+# 7 was sys_waitpid
+8 common creat sys_creat
+9 common link sys_link
+10 common unlink sys_unlink
+11 common execve sys_execve
+12 common chdir sys_chdir
+13 oabi time sys_time32
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 common lchown sys_lchown16
+# 17 was sys_break
+# 18 was sys_stat
+19 common lseek sys_lseek
+20 common getpid sys_getpid
+21 common mount sys_mount
+22 oabi umount sys_oldumount
+23 common setuid sys_setuid16
+24 common getuid sys_getuid16
+25 oabi stime sys_stime32
+26 common ptrace sys_ptrace
+27 oabi alarm sys_alarm
+# 28 was sys_fstat
+29 common pause sys_pause
+30 oabi utime sys_utime32
+# 31 was sys_stty
+# 32 was sys_gtty
+33 common access sys_access
+34 common nice sys_nice
+# 35 was sys_ftime
+36 common sync sys_sync
+37 common kill sys_kill
+38 common rename sys_rename
+39 common mkdir sys_mkdir
+40 common rmdir sys_rmdir
+41 common dup sys_dup
+42 common pipe sys_pipe
+43 common times sys_times
+# 44 was sys_prof
+45 common brk sys_brk
+46 common setgid sys_setgid16
+47 common getgid sys_getgid16
+# 48 was sys_signal
+49 common geteuid sys_geteuid16
+50 common getegid sys_getegid16
+51 common acct sys_acct
+52 common umount2 sys_umount
+# 53 was sys_lock
+54 common ioctl sys_ioctl
+55 common fcntl sys_fcntl
+# 56 was sys_mpx
+57 common setpgid sys_setpgid
+# 58 was sys_ulimit
+# 59 was sys_olduname
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common ustat sys_ustat
+63 common dup2 sys_dup2
+64 common getppid sys_getppid
+65 common getpgrp sys_getpgrp
+66 common setsid sys_setsid
+67 common sigaction sys_sigaction
+# 68 was sys_sgetmask
+# 69 was sys_ssetmask
+70 common setreuid sys_setreuid16
+71 common setregid sys_setregid16
+72 common sigsuspend sys_sigsuspend
+73 common sigpending sys_sigpending
+74 common sethostname sys_sethostname
+75 common setrlimit sys_setrlimit
+# Back compat 2GB limited rlimit
+76 oabi getrlimit sys_old_getrlimit
+77 common getrusage sys_getrusage
+78 common gettimeofday sys_gettimeofday
+79 common settimeofday sys_settimeofday
+80 common getgroups sys_getgroups16
+81 common setgroups sys_setgroups16
+82 oabi select sys_old_select
+83 common symlink sys_symlink
+# 84 was sys_lstat
+85 common readlink sys_readlink
+86 common uselib sys_uselib
+87 common swapon sys_swapon
+88 common reboot sys_reboot
+89 oabi readdir sys_old_readdir
+90 oabi mmap sys_old_mmap
+91 common munmap sys_munmap
+92 common truncate sys_truncate
+93 common ftruncate sys_ftruncate
+94 common fchmod sys_fchmod
+95 common fchown sys_fchown16
+96 common getpriority sys_getpriority
+97 common setpriority sys_setpriority
+# 98 was sys_profil
+99 common statfs sys_statfs
+100 common fstatfs sys_fstatfs
+# 101 was sys_ioperm
+102 oabi socketcall sys_socketcall sys_oabi_socketcall
+103 common syslog sys_syslog
+104 common setitimer sys_setitimer
+105 common getitimer sys_getitimer
+106 common stat sys_newstat
+107 common lstat sys_newlstat
+108 common fstat sys_newfstat
+# 109 was sys_uname
+# 110 was sys_iopl
+111 common vhangup sys_vhangup
+# 112 was sys_idle
+# syscall to call a syscall!
+113 oabi syscall sys_syscall
+114 common wait4 sys_wait4
+115 common swapoff sys_swapoff
+116 common sysinfo sys_sysinfo
+117 oabi ipc sys_ipc sys_oabi_ipc
+118 common fsync sys_fsync
+119 common sigreturn sys_sigreturn_wrapper
+120 common clone sys_clone
+121 common setdomainname sys_setdomainname
+122 common uname sys_newuname
+# 123 was sys_modify_ldt
+124 common adjtimex sys_adjtimex_time32
+125 common mprotect sys_mprotect
+126 common sigprocmask sys_sigprocmask
+# 127 was sys_create_module
+128 common init_module sys_init_module
+129 common delete_module sys_delete_module
+# 130 was sys_get_kernel_syms
+131 common quotactl sys_quotactl
+132 common getpgid sys_getpgid
+133 common fchdir sys_fchdir
+134 common bdflush sys_ni_syscall
+135 common sysfs sys_sysfs
+136 common personality sys_personality
+# 137 was sys_afs_syscall
+138 common setfsuid sys_setfsuid16
+139 common setfsgid sys_setfsgid16
+140 common _llseek sys_llseek
+141 common getdents sys_getdents
+142 common _newselect sys_select
+143 common flock sys_flock
+144 common msync sys_msync
+145 common readv sys_readv
+146 common writev sys_writev
+147 common getsid sys_getsid
+148 common fdatasync sys_fdatasync
+149 common _sysctl sys_ni_syscall
+150 common mlock sys_mlock
+151 common munlock sys_munlock
+152 common mlockall sys_mlockall
+153 common munlockall sys_munlockall
+154 common sched_setparam sys_sched_setparam
+155 common sched_getparam sys_sched_getparam
+156 common sched_setscheduler sys_sched_setscheduler
+157 common sched_getscheduler sys_sched_getscheduler
+158 common sched_yield sys_sched_yield
+159 common sched_get_priority_max sys_sched_get_priority_max
+160 common sched_get_priority_min sys_sched_get_priority_min
+161 common sched_rr_get_interval sys_sched_rr_get_interval_time32
+162 common nanosleep sys_nanosleep_time32
+163 common mremap sys_mremap
+164 common setresuid sys_setresuid16
+165 common getresuid sys_getresuid16
+# 166 was sys_vm86
+# 167 was sys_query_module
+168 common poll sys_poll
+169 common nfsservctl
+170 common setresgid sys_setresgid16
+171 common getresgid sys_getresgid16
+172 common prctl sys_prctl
+173 common rt_sigreturn sys_rt_sigreturn_wrapper
+174 common rt_sigaction sys_rt_sigaction
+175 common rt_sigprocmask sys_rt_sigprocmask
+176 common rt_sigpending sys_rt_sigpending
+177 common rt_sigtimedwait sys_rt_sigtimedwait_time32
+178 common rt_sigqueueinfo sys_rt_sigqueueinfo
+179 common rt_sigsuspend sys_rt_sigsuspend
+180 common pread64 sys_pread64 sys_oabi_pread64
+181 common pwrite64 sys_pwrite64 sys_oabi_pwrite64
+182 common chown sys_chown16
+183 common getcwd sys_getcwd
+184 common capget sys_capget
+185 common capset sys_capset
+186 common sigaltstack sys_sigaltstack
+187 common sendfile sys_sendfile
+# 188 reserved
+# 189 reserved
+190 common vfork sys_vfork
+# SuS compliant getrlimit
+191 common ugetrlimit sys_getrlimit
+192 common mmap2 sys_mmap2
+193 common truncate64 sys_truncate64 sys_oabi_truncate64
+194 common ftruncate64 sys_ftruncate64 sys_oabi_ftruncate64
+195 common stat64 sys_stat64 sys_oabi_stat64
+196 common lstat64 sys_lstat64 sys_oabi_lstat64
+197 common fstat64 sys_fstat64 sys_oabi_fstat64
+198 common lchown32 sys_lchown
+199 common getuid32 sys_getuid
+200 common getgid32 sys_getgid
+201 common geteuid32 sys_geteuid
+202 common getegid32 sys_getegid
+203 common setreuid32 sys_setreuid
+204 common setregid32 sys_setregid
+205 common getgroups32 sys_getgroups
+206 common setgroups32 sys_setgroups
+207 common fchown32 sys_fchown
+208 common setresuid32 sys_setresuid
+209 common getresuid32 sys_getresuid
+210 common setresgid32 sys_setresgid
+211 common getresgid32 sys_getresgid
+212 common chown32 sys_chown
+213 common setuid32 sys_setuid
+214 common setgid32 sys_setgid
+215 common setfsuid32 sys_setfsuid
+216 common setfsgid32 sys_setfsgid
+217 common getdents64 sys_getdents64
+218 common pivot_root sys_pivot_root
+219 common mincore sys_mincore
+220 common madvise sys_madvise
+221 common fcntl64 sys_fcntl64 sys_oabi_fcntl64
+# 222 for tux
+# 223 is unused
+224 common gettid sys_gettid
+225 common readahead sys_readahead sys_oabi_readahead
+226 common setxattr sys_setxattr
+227 common lsetxattr sys_lsetxattr
+228 common fsetxattr sys_fsetxattr
+229 common getxattr sys_getxattr
+230 common lgetxattr sys_lgetxattr
+231 common fgetxattr sys_fgetxattr
+232 common listxattr sys_listxattr
+233 common llistxattr sys_llistxattr
+234 common flistxattr sys_flistxattr
+235 common removexattr sys_removexattr
+236 common lremovexattr sys_lremovexattr
+237 common fremovexattr sys_fremovexattr
+238 common tkill sys_tkill
+239 common sendfile64 sys_sendfile64
+240 common futex sys_futex_time32
+241 common sched_setaffinity sys_sched_setaffinity
+242 common sched_getaffinity sys_sched_getaffinity
+243 common io_setup sys_io_setup
+244 common io_destroy sys_io_destroy
+245 common io_getevents sys_io_getevents_time32
+246 common io_submit sys_io_submit
+247 common io_cancel sys_io_cancel
+248 common exit_group sys_exit_group
+249 common lookup_dcookie sys_ni_syscall
+250 common epoll_create sys_epoll_create
+251 common epoll_ctl sys_epoll_ctl sys_oabi_epoll_ctl
+252 common epoll_wait sys_epoll_wait
+253 common remap_file_pages sys_remap_file_pages
+# 254 for set_thread_area
+# 255 for get_thread_area
+256 common set_tid_address sys_set_tid_address
+257 common timer_create sys_timer_create
+258 common timer_settime sys_timer_settime32
+259 common timer_gettime sys_timer_gettime32
+260 common timer_getoverrun sys_timer_getoverrun
+261 common timer_delete sys_timer_delete
+262 common clock_settime sys_clock_settime32
+263 common clock_gettime sys_clock_gettime32
+264 common clock_getres sys_clock_getres_time32
+265 common clock_nanosleep sys_clock_nanosleep_time32
+266 common statfs64 sys_statfs64_wrapper
+267 common fstatfs64 sys_fstatfs64_wrapper
+268 common tgkill sys_tgkill
+269 common utimes sys_utimes_time32
+270 common arm_fadvise64_64 sys_arm_fadvise64_64
+271 common pciconfig_iobase sys_pciconfig_iobase
+272 common pciconfig_read sys_pciconfig_read
+273 common pciconfig_write sys_pciconfig_write
+274 common mq_open sys_mq_open
+275 common mq_unlink sys_mq_unlink
+276 common mq_timedsend sys_mq_timedsend_time32
+277 common mq_timedreceive sys_mq_timedreceive_time32
+278 common mq_notify sys_mq_notify
+279 common mq_getsetattr sys_mq_getsetattr
+280 common waitid sys_waitid
+281 common socket sys_socket
+282 common bind sys_bind sys_oabi_bind
+283 common connect sys_connect sys_oabi_connect
+284 common listen sys_listen
+285 common accept sys_accept
+286 common getsockname sys_getsockname
+287 common getpeername sys_getpeername
+288 common socketpair sys_socketpair
+289 common send sys_send
+290 common sendto sys_sendto sys_oabi_sendto
+291 common recv sys_recv
+292 common recvfrom sys_recvfrom
+293 common shutdown sys_shutdown
+294 common setsockopt sys_setsockopt
+295 common getsockopt sys_getsockopt
+296 common sendmsg sys_sendmsg sys_oabi_sendmsg
+297 common recvmsg sys_recvmsg
+298 common semop sys_semop sys_oabi_semop
+299 common semget sys_semget
+300 common semctl sys_old_semctl
+301 common msgsnd sys_msgsnd
+302 common msgrcv sys_msgrcv
+303 common msgget sys_msgget
+304 common msgctl sys_old_msgctl
+305 common shmat sys_shmat
+306 common shmdt sys_shmdt
+307 common shmget sys_shmget
+308 common shmctl sys_old_shmctl
+309 common add_key sys_add_key
+310 common request_key sys_request_key
+311 common keyctl sys_keyctl
+312 common semtimedop sys_semtimedop_time32 sys_oabi_semtimedop
+313 common vserver
+314 common ioprio_set sys_ioprio_set
+315 common ioprio_get sys_ioprio_get
+316 common inotify_init sys_inotify_init
+317 common inotify_add_watch sys_inotify_add_watch
+318 common inotify_rm_watch sys_inotify_rm_watch
+319 common mbind sys_mbind
+320 common get_mempolicy sys_get_mempolicy
+321 common set_mempolicy sys_set_mempolicy
+322 common openat sys_openat
+323 common mkdirat sys_mkdirat
+324 common mknodat sys_mknodat
+325 common fchownat sys_fchownat
+326 common futimesat sys_futimesat_time32
+327 common fstatat64 sys_fstatat64 sys_oabi_fstatat64
+328 common unlinkat sys_unlinkat
+329 common renameat sys_renameat
+330 common linkat sys_linkat
+331 common symlinkat sys_symlinkat
+332 common readlinkat sys_readlinkat
+333 common fchmodat sys_fchmodat
+334 common faccessat sys_faccessat
+335 common pselect6 sys_pselect6_time32
+336 common ppoll sys_ppoll_time32
+337 common unshare sys_unshare
+338 common set_robust_list sys_set_robust_list
+339 common get_robust_list sys_get_robust_list
+340 common splice sys_splice
+341 common arm_sync_file_range sys_sync_file_range2
+342 common tee sys_tee
+343 common vmsplice sys_vmsplice
+344 common move_pages sys_move_pages
+345 common getcpu sys_getcpu
+346 common epoll_pwait sys_epoll_pwait
+347 common kexec_load sys_kexec_load
+348 common utimensat sys_utimensat_time32
+349 common signalfd sys_signalfd
+350 common timerfd_create sys_timerfd_create
+351 common eventfd sys_eventfd
+352 common fallocate sys_fallocate
+353 common timerfd_settime sys_timerfd_settime32
+354 common timerfd_gettime sys_timerfd_gettime32
+355 common signalfd4 sys_signalfd4
+356 common eventfd2 sys_eventfd2
+357 common epoll_create1 sys_epoll_create1
+358 common dup3 sys_dup3
+359 common pipe2 sys_pipe2
+360 common inotify_init1 sys_inotify_init1
+361 common preadv sys_preadv
+362 common pwritev sys_pwritev
+363 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo
+364 common perf_event_open sys_perf_event_open
+365 common recvmmsg sys_recvmmsg_time32
+366 common accept4 sys_accept4
+367 common fanotify_init sys_fanotify_init
+368 common fanotify_mark sys_fanotify_mark
+369 common prlimit64 sys_prlimit64
+370 common name_to_handle_at sys_name_to_handle_at
+371 common open_by_handle_at sys_open_by_handle_at
+372 common clock_adjtime sys_clock_adjtime32
+373 common syncfs sys_syncfs
+374 common sendmmsg sys_sendmmsg
+375 common setns sys_setns
+376 common process_vm_readv sys_process_vm_readv
+377 common process_vm_writev sys_process_vm_writev
+378 common kcmp sys_kcmp
+379 common finit_module sys_finit_module
+380 common sched_setattr sys_sched_setattr
+381 common sched_getattr sys_sched_getattr
+382 common renameat2 sys_renameat2
+383 common seccomp sys_seccomp
+384 common getrandom sys_getrandom
+385 common memfd_create sys_memfd_create
+386 common bpf sys_bpf
+387 common execveat sys_execveat
+388 common userfaultfd sys_userfaultfd
+389 common membarrier sys_membarrier
+390 common mlock2 sys_mlock2
+391 common copy_file_range sys_copy_file_range
+392 common preadv2 sys_preadv2
+393 common pwritev2 sys_pwritev2
+394 common pkey_mprotect sys_pkey_mprotect
+395 common pkey_alloc sys_pkey_alloc
+396 common pkey_free sys_pkey_free
+397 common statx sys_statx
+398 common rseq sys_rseq
+399 common io_pgetevents sys_io_pgetevents_time32
+400 common migrate_pages sys_migrate_pages
+401 common kexec_file_load sys_kexec_file_load
+# 402 is unused
+403 common clock_gettime64 sys_clock_gettime
+404 common clock_settime64 sys_clock_settime
+405 common clock_adjtime64 sys_clock_adjtime
+406 common clock_getres_time64 sys_clock_getres
+407 common clock_nanosleep_time64 sys_clock_nanosleep
+408 common timer_gettime64 sys_timer_gettime
+409 common timer_settime64 sys_timer_settime
+410 common timerfd_gettime64 sys_timerfd_gettime
+411 common timerfd_settime64 sys_timerfd_settime
+412 common utimensat_time64 sys_utimensat
+413 common pselect6_time64 sys_pselect6
+414 common ppoll_time64 sys_ppoll
+416 common io_pgetevents_time64 sys_io_pgetevents
+417 common recvmmsg_time64 sys_recvmmsg
+418 common mq_timedsend_time64 sys_mq_timedsend
+419 common mq_timedreceive_time64 sys_mq_timedreceive
+420 common semtimedop_time64 sys_semtimedop
+421 common rt_sigtimedwait_time64 sys_rt_sigtimedwait
+422 common futex_time64 sys_futex
+423 common sched_rr_get_interval_time64 sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+435 common clone3 sys_clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/arm/include/syscall_table.h b/tools/perf/arch/arm/include/syscall_table.h
new file mode 100644
index 000000000000..4c942821662d
--- /dev/null
+++ b/tools/perf/arch/arm/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_32.h>
diff --git a/tools/perf/arch/arm64/Makefile b/tools/perf/arch/arm64/Makefile
index 91570d5d428e..087e099fb453 100644
--- a/tools/perf/arch/arm64/Makefile
+++ b/tools/perf/arch/arm64/Makefile
@@ -1,25 +1,3 @@
# SPDX-License-Identifier: GPL-2.0
PERF_HAVE_JITDUMP := 1
HAVE_KVM_STAT_SUPPORT := 1
-
-#
-# Syscall table generation for perf
-#
-
-out := $(OUTPUT)arch/arm64/include/generated/asm
-header := $(out)/syscalls.c
-incpath := $(srctree)/tools
-sysdef := $(srctree)/tools/arch/arm64/include/uapi/asm/unistd.h
-sysprf := $(srctree)/tools/perf/arch/arm64/entry/syscalls/
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' '$(CC)' '$(HOSTCC)' $(incpath) $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, arm64) $(RM) $(header)
-
-archheaders: $(header)
diff --git a/tools/perf/arch/arm64/entry/syscalls/Kbuild b/tools/perf/arch/arm64/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..84c6599b4ea6
--- /dev/null
+++ b/tools/perf/arch/arm64/entry/syscalls/Kbuild
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/arm64/entry/syscalls/Makefile.syscalls b/tools/perf/arch/arm64/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..e7e78c2d1c02
--- /dev/null
+++ b/tools/perf/arch/arm64/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 +=
+syscall_abis_64 += renameat rlimit memfd_secret
+
+syscalltbl = $(srctree)/tools/perf/arch/arm64/entry/syscalls/syscall_%.tbl
diff --git a/tools/perf/arch/arm64/entry/syscalls/mksyscalltbl b/tools/perf/arch/arm64/entry/syscalls/mksyscalltbl
deleted file mode 100755
index 27d747c92d44..000000000000
--- a/tools/perf/arch/arm64/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,46 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf. Derived from
-# powerpc script.
-#
-# Copyright IBM Corp. 2017
-# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com>
-# Changed by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com>
-# Changed by: Kim Phillips <kim.phillips@arm.com>
-
-gcc=$1
-hostcc=$2
-incpath=$3
-input=$4
-
-if ! test -r $input; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_sc_table()
-{
- local sc nr max_nr
-
- while read sc nr; do
- printf "%s\n" " [$nr] = \"$sc\","
- max_nr=$nr
- done
-
- echo "#define SYSCALLTBL_ARM64_MAX_ID $max_nr"
-}
-
-create_table()
-{
- echo "#include \"$input\""
- echo "static const char *const syscalltbl_arm64[] = {"
- create_sc_table
- echo "};"
-}
-
-$gcc -E -dM -x c -I $incpath/include/uapi $input \
- |awk '$2 ~ "__NR" && $3 !~ "__NR3264_" {
- sub("^#define __NR(3264)?_", "");
- print | "sort -k2 -n"}' \
- |create_table
diff --git a/tools/perf/arch/arm64/entry/syscalls/syscall_32.tbl b/tools/perf/arch/arm64/entry/syscalls/syscall_32.tbl
new file mode 100644
index 000000000000..9a37930d4e26
--- /dev/null
+++ b/tools/perf/arch/arm64/entry/syscalls/syscall_32.tbl
@@ -0,0 +1,476 @@
+# SPDX-License-Identifier: GPL-2.0-only
+#
+# AArch32 (compat) system call definitions.
+#
+# Copyright (C) 2001-2005 Russell King
+# Copyright (C) 2012 ARM Ltd.
+#
+# This file corresponds to arch/arm/tools/syscall.tbl
+# for the native EABI syscalls and should be kept in sync
+# Instead of the OABI syscalls, it contains pointers to
+# the compat entry points where they differ from the native
+# syscalls.
+#
+0 common restart_syscall sys_restart_syscall
+1 common exit sys_exit
+2 common fork sys_fork
+3 common read sys_read
+4 common write sys_write
+5 common open sys_open compat_sys_open
+6 common close sys_close
+# 7 was sys_waitpid
+8 common creat sys_creat
+9 common link sys_link
+10 common unlink sys_unlink
+11 common execve sys_execve compat_sys_execve
+12 common chdir sys_chdir
+# 13 was sys_time
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 common lchown sys_lchown16
+# 17 was sys_break
+# 18 was sys_stat
+19 common lseek sys_lseek compat_sys_lseek
+20 common getpid sys_getpid
+21 common mount sys_mount
+# 22 was sys_umount
+23 common setuid sys_setuid16
+24 common getuid sys_getuid16
+# 25 was sys_stime
+26 common ptrace sys_ptrace compat_sys_ptrace
+# 27 was sys_alarm
+# 28 was sys_fstat
+29 common pause sys_pause
+# 30 was sys_utime
+# 31 was sys_stty
+# 32 was sys_gtty
+33 common access sys_access
+34 common nice sys_nice
+# 35 was sys_ftime
+36 common sync sys_sync
+37 common kill sys_kill
+38 common rename sys_rename
+39 common mkdir sys_mkdir
+40 common rmdir sys_rmdir
+41 common dup sys_dup
+42 common pipe sys_pipe
+43 common times sys_times compat_sys_times
+# 44 was sys_prof
+45 common brk sys_brk
+46 common setgid sys_setgid16
+47 common getgid sys_getgid16
+# 48 was sys_signal
+49 common geteuid sys_geteuid16
+50 common getegid sys_getegid16
+51 common acct sys_acct
+52 common umount2 sys_umount
+# 53 was sys_lock
+54 common ioctl sys_ioctl compat_sys_ioctl
+55 common fcntl sys_fcntl compat_sys_fcntl
+# 56 was sys_mpx
+57 common setpgid sys_setpgid
+# 58 was sys_ulimit
+# 59 was sys_olduname
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common ustat sys_ustat compat_sys_ustat
+63 common dup2 sys_dup2
+64 common getppid sys_getppid
+65 common getpgrp sys_getpgrp
+66 common setsid sys_setsid
+67 common sigaction sys_sigaction compat_sys_sigaction
+# 68 was sys_sgetmask
+# 69 was sys_ssetmask
+70 common setreuid sys_setreuid16
+71 common setregid sys_setregid16
+72 common sigsuspend sys_sigsuspend
+73 common sigpending sys_sigpending compat_sys_sigpending
+74 common sethostname sys_sethostname
+75 common setrlimit sys_setrlimit compat_sys_setrlimit
+# 76 was compat_sys_getrlimit
+77 common getrusage sys_getrusage compat_sys_getrusage
+78 common gettimeofday sys_gettimeofday compat_sys_gettimeofday
+79 common settimeofday sys_settimeofday compat_sys_settimeofday
+80 common getgroups sys_getgroups16
+81 common setgroups sys_setgroups16
+# 82 was compat_sys_select
+83 common symlink sys_symlink
+# 84 was sys_lstat
+85 common readlink sys_readlink
+86 common uselib sys_uselib
+87 common swapon sys_swapon
+88 common reboot sys_reboot
+# 89 was sys_readdir
+# 90 was sys_mmap
+91 common munmap sys_munmap
+92 common truncate sys_truncate compat_sys_truncate
+93 common ftruncate sys_ftruncate compat_sys_ftruncate
+94 common fchmod sys_fchmod
+95 common fchown sys_fchown16
+96 common getpriority sys_getpriority
+97 common setpriority sys_setpriority
+# 98 was sys_profil
+99 common statfs sys_statfs compat_sys_statfs
+100 common fstatfs sys_fstatfs compat_sys_fstatfs
+# 101 was sys_ioperm
+# 102 was sys_socketcall
+103 common syslog sys_syslog
+104 common setitimer sys_setitimer compat_sys_setitimer
+105 common getitimer sys_getitimer compat_sys_getitimer
+106 common stat sys_newstat compat_sys_newstat
+107 common lstat sys_newlstat compat_sys_newlstat
+108 common fstat sys_newfstat compat_sys_newfstat
+# 109 was sys_uname
+# 110 was sys_iopl
+111 common vhangup sys_vhangup
+# 112 was sys_idle
+# 113 was sys_syscall
+114 common wait4 sys_wait4 compat_sys_wait4
+115 common swapoff sys_swapoff
+116 common sysinfo sys_sysinfo compat_sys_sysinfo
+# 117 was sys_ipc
+118 common fsync sys_fsync
+119 common sigreturn sys_sigreturn_wrapper compat_sys_sigreturn
+120 common clone sys_clone
+121 common setdomainname sys_setdomainname
+122 common uname sys_newuname
+# 123 was sys_modify_ldt
+124 common adjtimex sys_adjtimex_time32
+125 common mprotect sys_mprotect
+126 common sigprocmask sys_sigprocmask compat_sys_sigprocmask
+# 127 was sys_create_module
+128 common init_module sys_init_module
+129 common delete_module sys_delete_module
+# 130 was sys_get_kernel_syms
+131 common quotactl sys_quotactl
+132 common getpgid sys_getpgid
+133 common fchdir sys_fchdir
+134 common bdflush sys_ni_syscall
+135 common sysfs sys_sysfs
+136 common personality sys_personality
+# 137 was sys_afs_syscall
+138 common setfsuid sys_setfsuid16
+139 common setfsgid sys_setfsgid16
+140 common _llseek sys_llseek
+141 common getdents sys_getdents compat_sys_getdents
+142 common _newselect sys_select compat_sys_select
+143 common flock sys_flock
+144 common msync sys_msync
+145 common readv sys_readv
+146 common writev sys_writev
+147 common getsid sys_getsid
+148 common fdatasync sys_fdatasync
+149 common _sysctl sys_ni_syscall
+150 common mlock sys_mlock
+151 common munlock sys_munlock
+152 common mlockall sys_mlockall
+153 common munlockall sys_munlockall
+154 common sched_setparam sys_sched_setparam
+155 common sched_getparam sys_sched_getparam
+156 common sched_setscheduler sys_sched_setscheduler
+157 common sched_getscheduler sys_sched_getscheduler
+158 common sched_yield sys_sched_yield
+159 common sched_get_priority_max sys_sched_get_priority_max
+160 common sched_get_priority_min sys_sched_get_priority_min
+161 common sched_rr_get_interval sys_sched_rr_get_interval_time32
+162 common nanosleep sys_nanosleep_time32
+163 common mremap sys_mremap
+164 common setresuid sys_setresuid16
+165 common getresuid sys_getresuid16
+# 166 was sys_vm86
+# 167 was sys_query_module
+168 common poll sys_poll
+169 common nfsservctl sys_ni_syscall
+170 common setresgid sys_setresgid16
+171 common getresgid sys_getresgid16
+172 common prctl sys_prctl
+173 common rt_sigreturn sys_rt_sigreturn_wrapper compat_sys_rt_sigreturn
+174 common rt_sigaction sys_rt_sigaction compat_sys_rt_sigaction
+175 common rt_sigprocmask sys_rt_sigprocmask compat_sys_rt_sigprocmask
+176 common rt_sigpending sys_rt_sigpending compat_sys_rt_sigpending
+177 common rt_sigtimedwait sys_rt_sigtimedwait_time32 compat_sys_rt_sigtimedwait_time32
+178 common rt_sigqueueinfo sys_rt_sigqueueinfo compat_sys_rt_sigqueueinfo
+179 common rt_sigsuspend sys_rt_sigsuspend compat_sys_rt_sigsuspend
+180 common pread64 sys_pread64 compat_sys_aarch32_pread64
+181 common pwrite64 sys_pwrite64 compat_sys_aarch32_pwrite64
+182 common chown sys_chown16
+183 common getcwd sys_getcwd
+184 common capget sys_capget
+185 common capset sys_capset
+186 common sigaltstack sys_sigaltstack compat_sys_sigaltstack
+187 common sendfile sys_sendfile compat_sys_sendfile
+# 188 reserved
+# 189 reserved
+190 common vfork sys_vfork
+# SuS compliant getrlimit
+191 common ugetrlimit sys_getrlimit compat_sys_getrlimit
+192 common mmap2 sys_mmap2 compat_sys_aarch32_mmap2
+193 common truncate64 sys_truncate64 compat_sys_aarch32_truncate64
+194 common ftruncate64 sys_ftruncate64 compat_sys_aarch32_ftruncate64
+195 common stat64 sys_stat64
+196 common lstat64 sys_lstat64
+197 common fstat64 sys_fstat64
+198 common lchown32 sys_lchown
+199 common getuid32 sys_getuid
+200 common getgid32 sys_getgid
+201 common geteuid32 sys_geteuid
+202 common getegid32 sys_getegid
+203 common setreuid32 sys_setreuid
+204 common setregid32 sys_setregid
+205 common getgroups32 sys_getgroups
+206 common setgroups32 sys_setgroups
+207 common fchown32 sys_fchown
+208 common setresuid32 sys_setresuid
+209 common getresuid32 sys_getresuid
+210 common setresgid32 sys_setresgid
+211 common getresgid32 sys_getresgid
+212 common chown32 sys_chown
+213 common setuid32 sys_setuid
+214 common setgid32 sys_setgid
+215 common setfsuid32 sys_setfsuid
+216 common setfsgid32 sys_setfsgid
+217 common getdents64 sys_getdents64
+218 common pivot_root sys_pivot_root
+219 common mincore sys_mincore
+220 common madvise sys_madvise
+221 common fcntl64 sys_fcntl64 compat_sys_fcntl64
+# 222 for tux
+# 223 is unused
+224 common gettid sys_gettid
+225 common readahead sys_readahead compat_sys_aarch32_readahead
+226 common setxattr sys_setxattr
+227 common lsetxattr sys_lsetxattr
+228 common fsetxattr sys_fsetxattr
+229 common getxattr sys_getxattr
+230 common lgetxattr sys_lgetxattr
+231 common fgetxattr sys_fgetxattr
+232 common listxattr sys_listxattr
+233 common llistxattr sys_llistxattr
+234 common flistxattr sys_flistxattr
+235 common removexattr sys_removexattr
+236 common lremovexattr sys_lremovexattr
+237 common fremovexattr sys_fremovexattr
+238 common tkill sys_tkill
+239 common sendfile64 sys_sendfile64
+240 common futex sys_futex_time32
+241 common sched_setaffinity sys_sched_setaffinity compat_sys_sched_setaffinity
+242 common sched_getaffinity sys_sched_getaffinity compat_sys_sched_getaffinity
+243 common io_setup sys_io_setup compat_sys_io_setup
+244 common io_destroy sys_io_destroy
+245 common io_getevents sys_io_getevents_time32
+246 common io_submit sys_io_submit compat_sys_io_submit
+247 common io_cancel sys_io_cancel
+248 common exit_group sys_exit_group
+249 common lookup_dcookie sys_ni_syscall
+250 common epoll_create sys_epoll_create
+251 common epoll_ctl sys_epoll_ctl
+252 common epoll_wait sys_epoll_wait
+253 common remap_file_pages sys_remap_file_pages
+# 254 for set_thread_area
+# 255 for get_thread_area
+256 common set_tid_address sys_set_tid_address
+257 common timer_create sys_timer_create compat_sys_timer_create
+258 common timer_settime sys_timer_settime32
+259 common timer_gettime sys_timer_gettime32
+260 common timer_getoverrun sys_timer_getoverrun
+261 common timer_delete sys_timer_delete
+262 common clock_settime sys_clock_settime32
+263 common clock_gettime sys_clock_gettime32
+264 common clock_getres sys_clock_getres_time32
+265 common clock_nanosleep sys_clock_nanosleep_time32
+266 common statfs64 sys_statfs64_wrapper compat_sys_aarch32_statfs64
+267 common fstatfs64 sys_fstatfs64_wrapper compat_sys_aarch32_fstatfs64
+268 common tgkill sys_tgkill
+269 common utimes sys_utimes_time32
+270 common arm_fadvise64_64 sys_arm_fadvise64_64 compat_sys_aarch32_fadvise64_64
+271 common pciconfig_iobase sys_pciconfig_iobase
+272 common pciconfig_read sys_pciconfig_read
+273 common pciconfig_write sys_pciconfig_write
+274 common mq_open sys_mq_open compat_sys_mq_open
+275 common mq_unlink sys_mq_unlink
+276 common mq_timedsend sys_mq_timedsend_time32
+277 common mq_timedreceive sys_mq_timedreceive_time32
+278 common mq_notify sys_mq_notify compat_sys_mq_notify
+279 common mq_getsetattr sys_mq_getsetattr compat_sys_mq_getsetattr
+280 common waitid sys_waitid compat_sys_waitid
+281 common socket sys_socket
+282 common bind sys_bind
+283 common connect sys_connect
+284 common listen sys_listen
+285 common accept sys_accept
+286 common getsockname sys_getsockname
+287 common getpeername sys_getpeername
+288 common socketpair sys_socketpair
+289 common send sys_send
+290 common sendto sys_sendto
+291 common recv sys_recv compat_sys_recv
+292 common recvfrom sys_recvfrom compat_sys_recvfrom
+293 common shutdown sys_shutdown
+294 common setsockopt sys_setsockopt
+295 common getsockopt sys_getsockopt
+296 common sendmsg sys_sendmsg compat_sys_sendmsg
+297 common recvmsg sys_recvmsg compat_sys_recvmsg
+298 common semop sys_semop
+299 common semget sys_semget
+300 common semctl sys_old_semctl compat_sys_old_semctl
+301 common msgsnd sys_msgsnd compat_sys_msgsnd
+302 common msgrcv sys_msgrcv compat_sys_msgrcv
+303 common msgget sys_msgget
+304 common msgctl sys_old_msgctl compat_sys_old_msgctl
+305 common shmat sys_shmat compat_sys_shmat
+306 common shmdt sys_shmdt
+307 common shmget sys_shmget
+308 common shmctl sys_old_shmctl compat_sys_old_shmctl
+309 common add_key sys_add_key
+310 common request_key sys_request_key
+311 common keyctl sys_keyctl compat_sys_keyctl
+312 common semtimedop sys_semtimedop_time32
+313 common vserver sys_ni_syscall
+314 common ioprio_set sys_ioprio_set
+315 common ioprio_get sys_ioprio_get
+316 common inotify_init sys_inotify_init
+317 common inotify_add_watch sys_inotify_add_watch
+318 common inotify_rm_watch sys_inotify_rm_watch
+319 common mbind sys_mbind
+320 common get_mempolicy sys_get_mempolicy
+321 common set_mempolicy sys_set_mempolicy
+322 common openat sys_openat compat_sys_openat
+323 common mkdirat sys_mkdirat
+324 common mknodat sys_mknodat
+325 common fchownat sys_fchownat
+326 common futimesat sys_futimesat_time32
+327 common fstatat64 sys_fstatat64
+328 common unlinkat sys_unlinkat
+329 common renameat sys_renameat
+330 common linkat sys_linkat
+331 common symlinkat sys_symlinkat
+332 common readlinkat sys_readlinkat
+333 common fchmodat sys_fchmodat
+334 common faccessat sys_faccessat
+335 common pselect6 sys_pselect6_time32 compat_sys_pselect6_time32
+336 common ppoll sys_ppoll_time32 compat_sys_ppoll_time32
+337 common unshare sys_unshare
+338 common set_robust_list sys_set_robust_list compat_sys_set_robust_list
+339 common get_robust_list sys_get_robust_list compat_sys_get_robust_list
+340 common splice sys_splice
+341 common arm_sync_file_range sys_sync_file_range2 compat_sys_aarch32_sync_file_range2
+342 common tee sys_tee
+343 common vmsplice sys_vmsplice
+344 common move_pages sys_move_pages
+345 common getcpu sys_getcpu
+346 common epoll_pwait sys_epoll_pwait compat_sys_epoll_pwait
+347 common kexec_load sys_kexec_load compat_sys_kexec_load
+348 common utimensat sys_utimensat_time32
+349 common signalfd sys_signalfd compat_sys_signalfd
+350 common timerfd_create sys_timerfd_create
+351 common eventfd sys_eventfd
+352 common fallocate sys_fallocate compat_sys_aarch32_fallocate
+353 common timerfd_settime sys_timerfd_settime32
+354 common timerfd_gettime sys_timerfd_gettime32
+355 common signalfd4 sys_signalfd4 compat_sys_signalfd4
+356 common eventfd2 sys_eventfd2
+357 common epoll_create1 sys_epoll_create1
+358 common dup3 sys_dup3
+359 common pipe2 sys_pipe2
+360 common inotify_init1 sys_inotify_init1
+361 common preadv sys_preadv compat_sys_preadv
+362 common pwritev sys_pwritev compat_sys_pwritev
+363 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo compat_sys_rt_tgsigqueueinfo
+364 common perf_event_open sys_perf_event_open
+365 common recvmmsg sys_recvmmsg_time32 compat_sys_recvmmsg_time32
+366 common accept4 sys_accept4
+367 common fanotify_init sys_fanotify_init
+368 common fanotify_mark sys_fanotify_mark compat_sys_fanotify_mark
+369 common prlimit64 sys_prlimit64
+370 common name_to_handle_at sys_name_to_handle_at
+371 common open_by_handle_at sys_open_by_handle_at compat_sys_open_by_handle_at
+372 common clock_adjtime sys_clock_adjtime32
+373 common syncfs sys_syncfs
+374 common sendmmsg sys_sendmmsg compat_sys_sendmmsg
+375 common setns sys_setns
+376 common process_vm_readv sys_process_vm_readv
+377 common process_vm_writev sys_process_vm_writev
+378 common kcmp sys_kcmp
+379 common finit_module sys_finit_module
+380 common sched_setattr sys_sched_setattr
+381 common sched_getattr sys_sched_getattr
+382 common renameat2 sys_renameat2
+383 common seccomp sys_seccomp
+384 common getrandom sys_getrandom
+385 common memfd_create sys_memfd_create
+386 common bpf sys_bpf
+387 common execveat sys_execveat compat_sys_execveat
+388 common userfaultfd sys_userfaultfd
+389 common membarrier sys_membarrier
+390 common mlock2 sys_mlock2
+391 common copy_file_range sys_copy_file_range
+392 common preadv2 sys_preadv2 compat_sys_preadv2
+393 common pwritev2 sys_pwritev2 compat_sys_pwritev2
+394 common pkey_mprotect sys_pkey_mprotect
+395 common pkey_alloc sys_pkey_alloc
+396 common pkey_free sys_pkey_free
+397 common statx sys_statx
+398 common rseq sys_rseq
+399 common io_pgetevents sys_io_pgetevents_time32 compat_sys_io_pgetevents
+400 common migrate_pages sys_migrate_pages
+401 common kexec_file_load sys_kexec_file_load
+# 402 is unused
+403 common clock_gettime64 sys_clock_gettime
+404 common clock_settime64 sys_clock_settime
+405 common clock_adjtime64 sys_clock_adjtime
+406 common clock_getres_time64 sys_clock_getres
+407 common clock_nanosleep_time64 sys_clock_nanosleep
+408 common timer_gettime64 sys_timer_gettime
+409 common timer_settime64 sys_timer_settime
+410 common timerfd_gettime64 sys_timerfd_gettime
+411 common timerfd_settime64 sys_timerfd_settime
+412 common utimensat_time64 sys_utimensat
+413 common pselect6_time64 sys_pselect6 compat_sys_pselect6_time64
+414 common ppoll_time64 sys_ppoll compat_sys_ppoll_time64
+416 common io_pgetevents_time64 sys_io_pgetevents compat_sys_io_pgetevents_time64
+417 common recvmmsg_time64 sys_recvmmsg compat_sys_recvmmsg_time64
+418 common mq_timedsend_time64 sys_mq_timedsend
+419 common mq_timedreceive_time64 sys_mq_timedreceive
+420 common semtimedop_time64 sys_semtimedop
+421 common rt_sigtimedwait_time64 sys_rt_sigtimedwait compat_sys_rt_sigtimedwait_time64
+422 common futex_time64 sys_futex
+423 common sched_rr_get_interval_time64 sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+435 common clone3 sys_clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2 compat_sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
diff --git a/tools/perf/arch/arm64/entry/syscalls/syscall_64.tbl b/tools/perf/arch/arm64/entry/syscalls/syscall_64.tbl
new file mode 120000
index 000000000000..4fdd58f10c15
--- /dev/null
+++ b/tools/perf/arch/arm64/entry/syscalls/syscall_64.tbl
@@ -0,0 +1 @@
+../../../../../scripts/syscall.tbl \ No newline at end of file
diff --git a/tools/perf/arch/arm64/include/syscall_table.h b/tools/perf/arch/arm64/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/arm64/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/arm64/util/arm-spe.c b/tools/perf/arch/arm64/util/arm-spe.c
index 22b19dcc6beb..4301181b8e45 100644
--- a/tools/perf/arch/arm64/util/arm-spe.c
+++ b/tools/perf/arch/arm64/util/arm-spe.c
@@ -274,33 +274,9 @@ static void arm_spe_setup_evsel(struct evsel *evsel, struct perf_cpu_map *cpus)
evsel__set_sample_bit(evsel, PHYS_ADDR);
}
-static int arm_spe_recording_options(struct auxtrace_record *itr,
- struct evlist *evlist,
- struct record_opts *opts)
+static int arm_spe_setup_aux_buffer(struct record_opts *opts)
{
- struct arm_spe_recording *sper =
- container_of(itr, struct arm_spe_recording, itr);
- struct evsel *evsel, *tmp;
- struct perf_cpu_map *cpus = evlist->core.user_requested_cpus;
bool privileged = perf_event_paranoid_check(-1);
- struct evsel *tracking_evsel;
- int err;
-
- sper->evlist = evlist;
-
- evlist__for_each_entry(evlist, evsel) {
- if (evsel__is_aux_event(evsel)) {
- if (!strstarts(evsel->pmu->name, ARM_SPE_PMU_NAME)) {
- pr_err("Found unexpected auxtrace event: %s\n",
- evsel->pmu->name);
- return -EINVAL;
- }
- opts->full_auxtrace = true;
- }
- }
-
- if (!opts->full_auxtrace)
- return 0;
/*
* we are in snapshot mode.
@@ -330,6 +306,9 @@ static int arm_spe_recording_options(struct auxtrace_record *itr,
pr_err("Failed to calculate default snapshot size and/or AUX area tracing mmap pages\n");
return -EINVAL;
}
+
+ pr_debug2("%sx snapshot size: %zu\n", ARM_SPE_PMU_NAME,
+ opts->auxtrace_snapshot_size);
}
/* We are in full trace mode but '-m,xyz' wasn't specified */
@@ -355,14 +334,15 @@ static int arm_spe_recording_options(struct auxtrace_record *itr,
}
}
- if (opts->auxtrace_snapshot_mode)
- pr_debug2("%sx snapshot size: %zu\n", ARM_SPE_PMU_NAME,
- opts->auxtrace_snapshot_size);
+ return 0;
+}
- evlist__for_each_entry_safe(evlist, tmp, evsel) {
- if (evsel__is_aux_event(evsel))
- arm_spe_setup_evsel(evsel, cpus);
- }
+static int arm_spe_setup_tracking_event(struct evlist *evlist,
+ struct record_opts *opts)
+{
+ int err;
+ struct evsel *tracking_evsel;
+ struct perf_cpu_map *cpus = evlist->core.user_requested_cpus;
/* Add dummy event to keep tracking */
err = parse_event(evlist, "dummy:u");
@@ -388,6 +368,52 @@ static int arm_spe_recording_options(struct auxtrace_record *itr,
return 0;
}
+static int arm_spe_recording_options(struct auxtrace_record *itr,
+ struct evlist *evlist,
+ struct record_opts *opts)
+{
+ struct arm_spe_recording *sper =
+ container_of(itr, struct arm_spe_recording, itr);
+ struct evsel *evsel, *tmp;
+ struct perf_cpu_map *cpus = evlist->core.user_requested_cpus;
+ bool discard = false;
+ int err;
+
+ sper->evlist = evlist;
+
+ evlist__for_each_entry(evlist, evsel) {
+ if (evsel__is_aux_event(evsel)) {
+ if (!strstarts(evsel->pmu->name, ARM_SPE_PMU_NAME)) {
+ pr_err("Found unexpected auxtrace event: %s\n",
+ evsel->pmu->name);
+ return -EINVAL;
+ }
+ opts->full_auxtrace = true;
+ }
+ }
+
+ if (!opts->full_auxtrace)
+ return 0;
+
+ evlist__for_each_entry_safe(evlist, tmp, evsel) {
+ if (evsel__is_aux_event(evsel)) {
+ arm_spe_setup_evsel(evsel, cpus);
+ if (evsel->core.attr.config &
+ perf_pmu__format_bits(evsel->pmu, "discard"))
+ discard = true;
+ }
+ }
+
+ if (discard)
+ return 0;
+
+ err = arm_spe_setup_aux_buffer(opts);
+ if (err)
+ return err;
+
+ return arm_spe_setup_tracking_event(evlist, opts);
+}
+
static int arm_spe_parse_snapshot_options(struct auxtrace_record *itr __maybe_unused,
struct record_opts *opts,
const char *str)
diff --git a/tools/perf/arch/csky/entry/syscalls/Kbuild b/tools/perf/arch/csky/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..11707c481a24
--- /dev/null
+++ b/tools/perf/arch/csky/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
diff --git a/tools/perf/arch/csky/entry/syscalls/Makefile.syscalls b/tools/perf/arch/csky/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..ea2dd10d0571
--- /dev/null
+++ b/tools/perf/arch/csky/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += csky time32 stat64 rlimit
diff --git a/tools/perf/arch/csky/include/syscall_table.h b/tools/perf/arch/csky/include/syscall_table.h
new file mode 100644
index 000000000000..4c942821662d
--- /dev/null
+++ b/tools/perf/arch/csky/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_32.h>
diff --git a/tools/perf/arch/loongarch/Makefile b/tools/perf/arch/loongarch/Makefile
index 52544d59245b..087e099fb453 100644
--- a/tools/perf/arch/loongarch/Makefile
+++ b/tools/perf/arch/loongarch/Makefile
@@ -1,25 +1,3 @@
# SPDX-License-Identifier: GPL-2.0
PERF_HAVE_JITDUMP := 1
HAVE_KVM_STAT_SUPPORT := 1
-
-#
-# Syscall table generation for perf
-#
-
-out := $(OUTPUT)arch/loongarch/include/generated/asm
-header := $(out)/syscalls.c
-incpath := $(srctree)/tools
-sysdef := $(srctree)/tools/arch/loongarch/include/uapi/asm/unistd.h
-sysprf := $(srctree)/tools/perf/arch/loongarch/entry/syscalls/
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' '$(CC)' '$(HOSTCC)' $(incpath) $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, loongarch) $(RM) $(header)
-
-archheaders: $(header)
diff --git a/tools/perf/arch/loongarch/entry/syscalls/Kbuild b/tools/perf/arch/loongarch/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9a41e3572c3a
--- /dev/null
+++ b/tools/perf/arch/loongarch/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/loongarch/entry/syscalls/Makefile.syscalls b/tools/perf/arch/loongarch/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..47d32da2aed8
--- /dev/null
+++ b/tools/perf/arch/loongarch/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_64 +=
diff --git a/tools/perf/arch/loongarch/entry/syscalls/mksyscalltbl b/tools/perf/arch/loongarch/entry/syscalls/mksyscalltbl
deleted file mode 100755
index c10ad3580aef..000000000000
--- a/tools/perf/arch/loongarch/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,45 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf. Derived from
-# powerpc script.
-#
-# Author(s): Ming Wang <wangming01@loongson.cn>
-# Author(s): Huacai Chen <chenhuacai@loongson.cn>
-# Copyright (C) 2020-2023 Loongson Technology Corporation Limited
-
-gcc=$1
-hostcc=$2
-incpath=$3
-input=$4
-
-if ! test -r $input; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_sc_table()
-{
- local sc nr max_nr
-
- while read sc nr; do
- printf "%s\n" " [$nr] = \"$sc\","
- max_nr=$nr
- done
-
- echo "#define SYSCALLTBL_LOONGARCH_MAX_ID $max_nr"
-}
-
-create_table()
-{
- echo "#include \"$input\""
- echo "static const char *const syscalltbl_loongarch[] = {"
- create_sc_table
- echo "};"
-}
-
-$gcc -E -dM -x c -I $incpath/include/uapi $input \
- |awk '$2 ~ "__NR" && $3 !~ "__NR3264_" {
- sub("^#define __NR(3264)?_", "");
- print | "sort -k2 -n"}' \
- |create_table
diff --git a/tools/perf/arch/loongarch/include/syscall_table.h b/tools/perf/arch/loongarch/include/syscall_table.h
new file mode 100644
index 000000000000..9d0646d3455c
--- /dev/null
+++ b/tools/perf/arch/loongarch/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscall_table_64.h>
diff --git a/tools/perf/arch/mips/Makefile b/tools/perf/arch/mips/Makefile
deleted file mode 100644
index 827168f1077a..000000000000
--- a/tools/perf/arch/mips/Makefile
+++ /dev/null
@@ -1,18 +0,0 @@
-# SPDX-License-Identifier: GPL-2.0
-# Syscall table generation for perf
-out := $(OUTPUT)arch/mips/include/generated/asm
-header := $(out)/syscalls_n64.c
-sysprf := $(srctree)/tools/perf/arch/mips/entry/syscalls
-sysdef := $(sysprf)/syscall_n64.tbl
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, mips) $(RM) $(header)
-
-archheaders: $(header)
diff --git a/tools/perf/arch/mips/entry/syscalls/Kbuild b/tools/perf/arch/mips/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9a41e3572c3a
--- /dev/null
+++ b/tools/perf/arch/mips/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/mips/entry/syscalls/Makefile.syscalls b/tools/perf/arch/mips/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..9ee914bdfb05
--- /dev/null
+++ b/tools/perf/arch/mips/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,5 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_64 += n64
+
+syscalltbl = $(srctree)/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
diff --git a/tools/perf/arch/mips/entry/syscalls/mksyscalltbl b/tools/perf/arch/mips/entry/syscalls/mksyscalltbl
deleted file mode 100644
index c0d93f959c4e..000000000000
--- a/tools/perf/arch/mips/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,32 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf. Derived from
-# s390 script.
-#
-# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com>
-# Changed by: Tiezhu Yang <yangtiezhu@loongson.cn>
-
-SYSCALL_TBL=$1
-
-if ! test -r $SYSCALL_TBL; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_table()
-{
- local max_nr nr abi sc discard
-
- echo 'static const char *const syscalltbl_mips_n64[] = {'
- while read nr abi sc discard; do
- printf '\t[%d] = "%s",\n' $nr $sc
- max_nr=$nr
- done
- echo '};'
- echo "#define SYSCALLTBL_MIPS_N64_MAX_ID $max_nr"
-}
-
-grep -E "^[[:digit:]]+[[:space:]]+(n64)" $SYSCALL_TBL \
- |sort -k1 -n \
- |create_table
diff --git a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
index 1464c6be6eb3..c844cd5cda62 100644
--- a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
+++ b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
@@ -377,3 +377,7 @@
460 n64 lsm_set_self_attr sys_lsm_set_self_attr
461 n64 lsm_list_modules sys_lsm_list_modules
462 n64 mseal sys_mseal
+463 n64 setxattrat sys_setxattrat
+464 n64 getxattrat sys_getxattrat
+465 n64 listxattrat sys_listxattrat
+466 n64 removexattrat sys_removexattrat
diff --git a/tools/perf/arch/mips/include/syscall_table.h b/tools/perf/arch/mips/include/syscall_table.h
new file mode 100644
index 000000000000..b53e31c15805
--- /dev/null
+++ b/tools/perf/arch/mips/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_64.h>
diff --git a/tools/perf/arch/parisc/entry/syscalls/Kbuild b/tools/perf/arch/parisc/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..84c6599b4ea6
--- /dev/null
+++ b/tools/perf/arch/parisc/entry/syscalls/Kbuild
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/parisc/entry/syscalls/Makefile.syscalls b/tools/perf/arch/parisc/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..ae326fecb83b
--- /dev/null
+++ b/tools/perf/arch/parisc/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 +=
+syscall_abis_64 +=
+
+syscalltbl = $(srctree)/tools/perf/arch/parisc/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/parisc/entry/syscalls/syscall.tbl b/tools/perf/arch/parisc/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..66dc406b12e4
--- /dev/null
+++ b/tools/perf/arch/parisc/entry/syscalls/syscall.tbl
@@ -0,0 +1,463 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# system call numbers and entry vectors for parisc
+#
+# The format is:
+# <number> <abi> <name> <entry point> <compat entry point>
+#
+# The <abi> can be common, 64, or 32 for this file.
+#
+0 common restart_syscall sys_restart_syscall
+1 common exit sys_exit
+2 common fork sys_fork_wrapper
+3 common read sys_read
+4 common write sys_write
+5 common open sys_open compat_sys_open
+6 common close sys_close
+7 common waitpid sys_waitpid
+8 common creat sys_creat
+9 common link sys_link
+10 common unlink sys_unlink
+11 common execve sys_execve compat_sys_execve
+12 common chdir sys_chdir
+13 32 time sys_time32
+13 64 time sys_time
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 common lchown sys_lchown
+17 common socket sys_socket
+18 common stat sys_newstat compat_sys_newstat
+19 common lseek sys_lseek compat_sys_lseek
+20 common getpid sys_getpid
+21 common mount sys_mount
+22 common bind sys_bind
+23 common setuid sys_setuid
+24 common getuid sys_getuid
+25 32 stime sys_stime32
+25 64 stime sys_stime
+26 common ptrace sys_ptrace compat_sys_ptrace
+27 common alarm sys_alarm
+28 common fstat sys_newfstat compat_sys_newfstat
+29 common pause sys_pause
+30 32 utime sys_utime32
+30 64 utime sys_utime
+31 common connect sys_connect
+32 common listen sys_listen
+33 common access sys_access
+34 common nice sys_nice
+35 common accept sys_accept
+36 common sync sys_sync
+37 common kill sys_kill
+38 common rename sys_rename
+39 common mkdir sys_mkdir
+40 common rmdir sys_rmdir
+41 common dup sys_dup
+42 common pipe sys_pipe
+43 common times sys_times compat_sys_times
+44 common getsockname sys_getsockname
+45 common brk sys_brk
+46 common setgid sys_setgid
+47 common getgid sys_getgid
+48 common signal sys_signal
+49 common geteuid sys_geteuid
+50 common getegid sys_getegid
+51 common acct sys_acct
+52 common umount2 sys_umount
+53 common getpeername sys_getpeername
+54 common ioctl sys_ioctl compat_sys_ioctl
+55 common fcntl sys_fcntl compat_sys_fcntl
+56 common socketpair sys_socketpair
+57 common setpgid sys_setpgid
+58 common send sys_send
+59 common uname sys_newuname
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common ustat sys_ustat compat_sys_ustat
+63 common dup2 sys_dup2
+64 common getppid sys_getppid
+65 common getpgrp sys_getpgrp
+66 common setsid sys_setsid
+67 common pivot_root sys_pivot_root
+68 common sgetmask sys_sgetmask sys32_unimplemented
+69 common ssetmask sys_ssetmask sys32_unimplemented
+70 common setreuid sys_setreuid
+71 common setregid sys_setregid
+72 common mincore sys_mincore
+73 common sigpending sys_sigpending compat_sys_sigpending
+74 common sethostname sys_sethostname
+75 common setrlimit sys_setrlimit compat_sys_setrlimit
+76 common getrlimit sys_getrlimit compat_sys_getrlimit
+77 common getrusage sys_getrusage compat_sys_getrusage
+78 common gettimeofday sys_gettimeofday compat_sys_gettimeofday
+79 common settimeofday sys_settimeofday compat_sys_settimeofday
+80 common getgroups sys_getgroups
+81 common setgroups sys_setgroups
+82 common sendto sys_sendto
+83 common symlink sys_symlink
+84 common lstat sys_newlstat compat_sys_newlstat
+85 common readlink sys_readlink
+86 common uselib sys_ni_syscall
+87 common swapon sys_swapon
+88 common reboot sys_reboot
+89 common mmap2 sys_mmap2
+90 common mmap sys_mmap
+91 common munmap sys_munmap
+92 common truncate sys_truncate compat_sys_truncate
+93 common ftruncate sys_ftruncate compat_sys_ftruncate
+94 common fchmod sys_fchmod
+95 common fchown sys_fchown
+96 common getpriority sys_getpriority
+97 common setpriority sys_setpriority
+98 common recv sys_recv compat_sys_recv
+99 common statfs sys_statfs compat_sys_statfs
+100 common fstatfs sys_fstatfs compat_sys_fstatfs
+101 common stat64 sys_stat64
+# 102 was socketcall
+103 common syslog sys_syslog
+104 common setitimer sys_setitimer compat_sys_setitimer
+105 common getitimer sys_getitimer compat_sys_getitimer
+106 common capget sys_capget
+107 common capset sys_capset
+108 32 pread64 parisc_pread64
+108 64 pread64 sys_pread64
+109 32 pwrite64 parisc_pwrite64
+109 64 pwrite64 sys_pwrite64
+110 common getcwd sys_getcwd
+111 common vhangup sys_vhangup
+112 common fstat64 sys_fstat64
+113 common vfork sys_vfork_wrapper
+114 common wait4 sys_wait4 compat_sys_wait4
+115 common swapoff sys_swapoff
+116 common sysinfo sys_sysinfo compat_sys_sysinfo
+117 common shutdown sys_shutdown
+118 common fsync sys_fsync
+119 common madvise parisc_madvise
+120 common clone sys_clone_wrapper
+121 common setdomainname sys_setdomainname
+122 common sendfile sys_sendfile compat_sys_sendfile
+123 common recvfrom sys_recvfrom compat_sys_recvfrom
+124 32 adjtimex sys_adjtimex_time32
+124 64 adjtimex sys_adjtimex
+125 common mprotect sys_mprotect
+126 common sigprocmask sys_sigprocmask compat_sys_sigprocmask
+# 127 was create_module
+128 common init_module sys_init_module
+129 common delete_module sys_delete_module
+# 130 was get_kernel_syms
+131 common quotactl sys_quotactl
+132 common getpgid sys_getpgid
+133 common fchdir sys_fchdir
+134 common bdflush sys_ni_syscall
+135 common sysfs sys_sysfs
+136 32 personality parisc_personality
+136 64 personality sys_personality
+# 137 was afs_syscall
+138 common setfsuid sys_setfsuid
+139 common setfsgid sys_setfsgid
+140 common _llseek sys_llseek
+141 common getdents sys_getdents compat_sys_getdents
+142 common _newselect sys_select compat_sys_select
+143 common flock sys_flock
+144 common msync sys_msync
+145 common readv sys_readv
+146 common writev sys_writev
+147 common getsid sys_getsid
+148 common fdatasync sys_fdatasync
+149 common _sysctl sys_ni_syscall
+150 common mlock sys_mlock
+151 common munlock sys_munlock
+152 common mlockall sys_mlockall
+153 common munlockall sys_munlockall
+154 common sched_setparam sys_sched_setparam
+155 common sched_getparam sys_sched_getparam
+156 common sched_setscheduler sys_sched_setscheduler
+157 common sched_getscheduler sys_sched_getscheduler
+158 common sched_yield sys_sched_yield
+159 common sched_get_priority_max sys_sched_get_priority_max
+160 common sched_get_priority_min sys_sched_get_priority_min
+161 32 sched_rr_get_interval sys_sched_rr_get_interval_time32
+161 64 sched_rr_get_interval sys_sched_rr_get_interval
+162 32 nanosleep sys_nanosleep_time32
+162 64 nanosleep sys_nanosleep
+163 common mremap sys_mremap
+164 common setresuid sys_setresuid
+165 common getresuid sys_getresuid
+166 common sigaltstack sys_sigaltstack compat_sys_sigaltstack
+# 167 was query_module
+168 common poll sys_poll
+# 169 was nfsservctl
+170 common setresgid sys_setresgid
+171 common getresgid sys_getresgid
+172 common prctl sys_prctl
+173 common rt_sigreturn sys_rt_sigreturn_wrapper
+174 common rt_sigaction sys_rt_sigaction compat_sys_rt_sigaction
+175 common rt_sigprocmask sys_rt_sigprocmask compat_sys_rt_sigprocmask
+176 common rt_sigpending sys_rt_sigpending compat_sys_rt_sigpending
+177 32 rt_sigtimedwait sys_rt_sigtimedwait_time32 compat_sys_rt_sigtimedwait_time32
+177 64 rt_sigtimedwait sys_rt_sigtimedwait
+178 common rt_sigqueueinfo sys_rt_sigqueueinfo compat_sys_rt_sigqueueinfo
+179 common rt_sigsuspend sys_rt_sigsuspend compat_sys_rt_sigsuspend
+180 common chown sys_chown
+181 common setsockopt sys_setsockopt sys_setsockopt
+182 common getsockopt sys_getsockopt sys_getsockopt
+183 common sendmsg sys_sendmsg compat_sys_sendmsg
+184 common recvmsg sys_recvmsg compat_sys_recvmsg
+185 common semop sys_semop
+186 common semget sys_semget
+187 common semctl sys_semctl compat_sys_semctl
+188 common msgsnd sys_msgsnd compat_sys_msgsnd
+189 common msgrcv sys_msgrcv compat_sys_msgrcv
+190 common msgget sys_msgget
+191 common msgctl sys_msgctl compat_sys_msgctl
+192 common shmat sys_shmat compat_sys_shmat
+193 common shmdt sys_shmdt
+194 common shmget sys_shmget
+195 common shmctl sys_shmctl compat_sys_shmctl
+# 196 was getpmsg
+# 197 was putpmsg
+198 common lstat64 sys_lstat64
+199 32 truncate64 parisc_truncate64
+199 64 truncate64 sys_truncate64
+200 32 ftruncate64 parisc_ftruncate64
+200 64 ftruncate64 sys_ftruncate64
+201 common getdents64 sys_getdents64
+202 common fcntl64 sys_fcntl64 compat_sys_fcntl64
+# 203 was attrctl
+# 204 was acl_get
+# 205 was acl_set
+206 common gettid sys_gettid
+207 32 readahead parisc_readahead
+207 64 readahead sys_readahead
+208 common tkill sys_tkill
+209 common sendfile64 sys_sendfile64 compat_sys_sendfile64
+210 32 futex sys_futex_time32
+210 64 futex sys_futex
+211 common sched_setaffinity sys_sched_setaffinity compat_sys_sched_setaffinity
+212 common sched_getaffinity sys_sched_getaffinity compat_sys_sched_getaffinity
+# 213 was set_thread_area
+# 214 was get_thread_area
+215 common io_setup sys_io_setup compat_sys_io_setup
+216 common io_destroy sys_io_destroy
+217 32 io_getevents sys_io_getevents_time32
+217 64 io_getevents sys_io_getevents
+218 common io_submit sys_io_submit compat_sys_io_submit
+219 common io_cancel sys_io_cancel
+# 220 was alloc_hugepages
+# 221 was free_hugepages
+222 common exit_group sys_exit_group
+223 common lookup_dcookie sys_ni_syscall
+224 common epoll_create sys_epoll_create
+225 common epoll_ctl sys_epoll_ctl
+226 common epoll_wait sys_epoll_wait
+227 common remap_file_pages sys_remap_file_pages
+228 32 semtimedop sys_semtimedop_time32
+228 64 semtimedop sys_semtimedop
+229 common mq_open sys_mq_open compat_sys_mq_open
+230 common mq_unlink sys_mq_unlink
+231 32 mq_timedsend sys_mq_timedsend_time32
+231 64 mq_timedsend sys_mq_timedsend
+232 32 mq_timedreceive sys_mq_timedreceive_time32
+232 64 mq_timedreceive sys_mq_timedreceive
+233 common mq_notify sys_mq_notify compat_sys_mq_notify
+234 common mq_getsetattr sys_mq_getsetattr compat_sys_mq_getsetattr
+235 common waitid sys_waitid compat_sys_waitid
+236 32 fadvise64_64 parisc_fadvise64_64
+236 64 fadvise64_64 sys_fadvise64_64
+237 common set_tid_address sys_set_tid_address
+238 common setxattr sys_setxattr
+239 common lsetxattr sys_lsetxattr
+240 common fsetxattr sys_fsetxattr
+241 common getxattr sys_getxattr
+242 common lgetxattr sys_lgetxattr
+243 common fgetxattr sys_fgetxattr
+244 common listxattr sys_listxattr
+245 common llistxattr sys_llistxattr
+246 common flistxattr sys_flistxattr
+247 common removexattr sys_removexattr
+248 common lremovexattr sys_lremovexattr
+249 common fremovexattr sys_fremovexattr
+250 common timer_create sys_timer_create compat_sys_timer_create
+251 32 timer_settime sys_timer_settime32
+251 64 timer_settime sys_timer_settime
+252 32 timer_gettime sys_timer_gettime32
+252 64 timer_gettime sys_timer_gettime
+253 common timer_getoverrun sys_timer_getoverrun
+254 common timer_delete sys_timer_delete
+255 32 clock_settime sys_clock_settime32
+255 64 clock_settime sys_clock_settime
+256 32 clock_gettime sys_clock_gettime32
+256 64 clock_gettime sys_clock_gettime
+257 32 clock_getres sys_clock_getres_time32
+257 64 clock_getres sys_clock_getres
+258 32 clock_nanosleep sys_clock_nanosleep_time32
+258 64 clock_nanosleep sys_clock_nanosleep
+259 common tgkill sys_tgkill
+260 common mbind sys_mbind
+261 common get_mempolicy sys_get_mempolicy
+262 common set_mempolicy sys_set_mempolicy
+# 263 was vserver
+264 common add_key sys_add_key
+265 common request_key sys_request_key
+266 common keyctl sys_keyctl compat_sys_keyctl
+267 common ioprio_set sys_ioprio_set
+268 common ioprio_get sys_ioprio_get
+269 common inotify_init sys_inotify_init
+270 common inotify_add_watch sys_inotify_add_watch
+271 common inotify_rm_watch sys_inotify_rm_watch
+272 common migrate_pages sys_migrate_pages
+273 32 pselect6 sys_pselect6_time32 compat_sys_pselect6_time32
+273 64 pselect6 sys_pselect6
+274 32 ppoll sys_ppoll_time32 compat_sys_ppoll_time32
+274 64 ppoll sys_ppoll
+275 common openat sys_openat compat_sys_openat
+276 common mkdirat sys_mkdirat
+277 common mknodat sys_mknodat
+278 common fchownat sys_fchownat
+279 32 futimesat sys_futimesat_time32
+279 64 futimesat sys_futimesat
+280 common fstatat64 sys_fstatat64
+281 common unlinkat sys_unlinkat
+282 common renameat sys_renameat
+283 common linkat sys_linkat
+284 common symlinkat sys_symlinkat
+285 common readlinkat sys_readlinkat
+286 common fchmodat sys_fchmodat
+287 common faccessat sys_faccessat
+288 common unshare sys_unshare
+289 common set_robust_list sys_set_robust_list compat_sys_set_robust_list
+290 common get_robust_list sys_get_robust_list compat_sys_get_robust_list
+291 common splice sys_splice
+292 32 sync_file_range parisc_sync_file_range
+292 64 sync_file_range sys_sync_file_range
+293 common tee sys_tee
+294 common vmsplice sys_vmsplice
+295 common move_pages sys_move_pages
+296 common getcpu sys_getcpu
+297 common epoll_pwait sys_epoll_pwait compat_sys_epoll_pwait
+298 common statfs64 sys_statfs64 compat_sys_statfs64
+299 common fstatfs64 sys_fstatfs64 compat_sys_fstatfs64
+300 common kexec_load sys_kexec_load compat_sys_kexec_load
+301 32 utimensat sys_utimensat_time32
+301 64 utimensat sys_utimensat
+302 common signalfd sys_signalfd compat_sys_signalfd
+# 303 was timerfd
+304 common eventfd sys_eventfd
+305 32 fallocate parisc_fallocate
+305 64 fallocate sys_fallocate
+306 common timerfd_create parisc_timerfd_create
+307 32 timerfd_settime sys_timerfd_settime32
+307 64 timerfd_settime sys_timerfd_settime
+308 32 timerfd_gettime sys_timerfd_gettime32
+308 64 timerfd_gettime sys_timerfd_gettime
+309 common signalfd4 parisc_signalfd4 parisc_compat_signalfd4
+310 common eventfd2 parisc_eventfd2
+311 common epoll_create1 sys_epoll_create1
+312 common dup3 sys_dup3
+313 common pipe2 parisc_pipe2
+314 common inotify_init1 parisc_inotify_init1
+315 common preadv sys_preadv compat_sys_preadv
+316 common pwritev sys_pwritev compat_sys_pwritev
+317 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo compat_sys_rt_tgsigqueueinfo
+318 common perf_event_open sys_perf_event_open
+319 32 recvmmsg sys_recvmmsg_time32 compat_sys_recvmmsg_time32
+319 64 recvmmsg sys_recvmmsg
+320 common accept4 sys_accept4
+321 common prlimit64 sys_prlimit64
+322 common fanotify_init sys_fanotify_init
+323 common fanotify_mark sys_fanotify_mark compat_sys_fanotify_mark
+324 32 clock_adjtime sys_clock_adjtime32
+324 64 clock_adjtime sys_clock_adjtime
+325 common name_to_handle_at sys_name_to_handle_at
+326 common open_by_handle_at sys_open_by_handle_at compat_sys_open_by_handle_at
+327 common syncfs sys_syncfs
+328 common setns sys_setns
+329 common sendmmsg sys_sendmmsg compat_sys_sendmmsg
+330 common process_vm_readv sys_process_vm_readv
+331 common process_vm_writev sys_process_vm_writev
+332 common kcmp sys_kcmp
+333 common finit_module sys_finit_module
+334 common sched_setattr sys_sched_setattr
+335 common sched_getattr sys_sched_getattr
+336 32 utimes sys_utimes_time32
+336 64 utimes sys_utimes
+337 common renameat2 sys_renameat2
+338 common seccomp sys_seccomp
+339 common getrandom sys_getrandom
+340 common memfd_create sys_memfd_create
+341 common bpf sys_bpf
+342 common execveat sys_execveat compat_sys_execveat
+343 common membarrier sys_membarrier
+344 common userfaultfd parisc_userfaultfd
+345 common mlock2 sys_mlock2
+346 common copy_file_range sys_copy_file_range
+347 common preadv2 sys_preadv2 compat_sys_preadv2
+348 common pwritev2 sys_pwritev2 compat_sys_pwritev2
+349 common statx sys_statx
+350 32 io_pgetevents sys_io_pgetevents_time32 compat_sys_io_pgetevents
+350 64 io_pgetevents sys_io_pgetevents
+351 common pkey_mprotect sys_pkey_mprotect
+352 common pkey_alloc sys_pkey_alloc
+353 common pkey_free sys_pkey_free
+354 common rseq sys_rseq
+355 common kexec_file_load sys_kexec_file_load sys_kexec_file_load
+356 common cacheflush sys_cacheflush
+# up to 402 is unassigned and reserved for arch specific syscalls
+403 32 clock_gettime64 sys_clock_gettime sys_clock_gettime
+404 32 clock_settime64 sys_clock_settime sys_clock_settime
+405 32 clock_adjtime64 sys_clock_adjtime sys_clock_adjtime
+406 32 clock_getres_time64 sys_clock_getres sys_clock_getres
+407 32 clock_nanosleep_time64 sys_clock_nanosleep sys_clock_nanosleep
+408 32 timer_gettime64 sys_timer_gettime sys_timer_gettime
+409 32 timer_settime64 sys_timer_settime sys_timer_settime
+410 32 timerfd_gettime64 sys_timerfd_gettime sys_timerfd_gettime
+411 32 timerfd_settime64 sys_timerfd_settime sys_timerfd_settime
+412 32 utimensat_time64 sys_utimensat sys_utimensat
+413 32 pselect6_time64 sys_pselect6 compat_sys_pselect6_time64
+414 32 ppoll_time64 sys_ppoll compat_sys_ppoll_time64
+416 32 io_pgetevents_time64 sys_io_pgetevents compat_sys_io_pgetevents_time64
+417 32 recvmmsg_time64 sys_recvmmsg compat_sys_recvmmsg_time64
+418 32 mq_timedsend_time64 sys_mq_timedsend sys_mq_timedsend
+419 32 mq_timedreceive_time64 sys_mq_timedreceive sys_mq_timedreceive
+420 32 semtimedop_time64 sys_semtimedop sys_semtimedop
+421 32 rt_sigtimedwait_time64 sys_rt_sigtimedwait compat_sys_rt_sigtimedwait_time64
+422 32 futex_time64 sys_futex sys_futex
+423 32 sched_rr_get_interval_time64 sys_sched_rr_get_interval sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+435 common clone3 sys_clone3_wrapper
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2 compat_sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
diff --git a/tools/perf/arch/parisc/include/syscall_table.h b/tools/perf/arch/parisc/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/parisc/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/powerpc/Makefile b/tools/perf/arch/powerpc/Makefile
index dc8f4fb8e324..a295a80ea078 100644
--- a/tools/perf/arch/powerpc/Makefile
+++ b/tools/perf/arch/powerpc/Makefile
@@ -1,28 +1,3 @@
# SPDX-License-Identifier: GPL-2.0
HAVE_KVM_STAT_SUPPORT := 1
PERF_HAVE_JITDUMP := 1
-
-#
-# Syscall table generation for perf
-#
-
-out := $(OUTPUT)arch/powerpc/include/generated/asm
-header32 := $(out)/syscalls_32.c
-header64 := $(out)/syscalls_64.c
-sysprf := $(srctree)/tools/perf/arch/powerpc/entry/syscalls
-sysdef := $(sysprf)/syscall.tbl
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header64): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' '64' $(sysdef) > $@
-
-$(header32): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' '32' $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, powerpc) $(RM) $(header32) $(header64)
-
-archheaders: $(header32) $(header64)
diff --git a/tools/perf/arch/powerpc/entry/syscalls/Kbuild b/tools/perf/arch/powerpc/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..84c6599b4ea6
--- /dev/null
+++ b/tools/perf/arch/powerpc/entry/syscalls/Kbuild
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/powerpc/entry/syscalls/Makefile.syscalls b/tools/perf/arch/powerpc/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..e35afbc57c79
--- /dev/null
+++ b/tools/perf/arch/powerpc/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += nospu
+syscall_abis_64 += nospu
+
+syscalltbl = $(srctree)/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl b/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl
deleted file mode 100755
index 0eb316fe6dd1..000000000000
--- a/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,39 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf. Derived from
-# s390 script.
-#
-# Copyright IBM Corp. 2017
-# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com>
-# Changed by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com>
-
-wordsize=$1
-SYSCALL_TBL=$2
-
-if ! test -r $SYSCALL_TBL; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_table()
-{
- local wordsize=$1
- local max_nr nr abi sc discard
- max_nr=-1
- nr=0
-
- echo "static const char *const syscalltbl_powerpc_${wordsize}[] = {"
- while read nr abi sc discard; do
- if [ "$max_nr" -lt "$nr" ]; then
- printf '\t[%d] = "%s",\n' $nr $sc
- max_nr=$nr
- fi
- done
- echo '};'
- echo "#define SYSCALLTBL_POWERPC_${wordsize}_MAX_ID $max_nr"
-}
-
-grep -E "^[[:digit:]]+[[:space:]]+(common|spu|nospu|${wordsize})" $SYSCALL_TBL \
- |sort -k1 -n \
- |create_table ${wordsize}
diff --git a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
index ebae8415dfbb..d8b4ab78bef0 100644
--- a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
@@ -553,3 +553,7 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/powerpc/include/syscall_table.h b/tools/perf/arch/powerpc/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/powerpc/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/powerpc/util/perf_regs.c b/tools/perf/arch/powerpc/util/perf_regs.c
index e8e6e6fc6f17..bd36cfd420a2 100644
--- a/tools/perf/arch/powerpc/util/perf_regs.c
+++ b/tools/perf/arch/powerpc/util/perf_regs.c
@@ -16,6 +16,7 @@
#define PVR_POWER9 0x004E
#define PVR_POWER10 0x0080
+#define PVR_POWER11 0x0082
static const struct sample_reg sample_reg_masks[] = {
SMPL_REG(r0, PERF_REG_POWERPC_R0),
@@ -207,7 +208,7 @@ uint64_t arch__intr_reg_mask(void)
version = (((mfspr(SPRN_PVR)) >> 16) & 0xFFFF);
if (version == PVR_POWER9)
extended_mask = PERF_REG_PMU_MASK_300;
- else if (version == PVR_POWER10)
+ else if ((version == PVR_POWER10) || (version == PVR_POWER11))
extended_mask = PERF_REG_PMU_MASK_31;
else
return mask;
diff --git a/tools/perf/arch/riscv/Makefile b/tools/perf/arch/riscv/Makefile
index 18ad078000e2..087e099fb453 100644
--- a/tools/perf/arch/riscv/Makefile
+++ b/tools/perf/arch/riscv/Makefile
@@ -1,25 +1,3 @@
# SPDX-License-Identifier: GPL-2.0
PERF_HAVE_JITDUMP := 1
HAVE_KVM_STAT_SUPPORT := 1
-
-#
-# Syscall table generation for perf
-#
-
-out := $(OUTPUT)arch/riscv/include/generated/asm
-header := $(out)/syscalls.c
-incpath := $(srctree)/tools
-sysdef := $(srctree)/tools/arch/riscv/include/uapi/asm/unistd.h
-sysprf := $(srctree)/tools/perf/arch/riscv/entry/syscalls/
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' '$(CC)' '$(HOSTCC)' $(incpath) $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, riscv) $(RM) $(header)
-
-archheaders: $(header)
diff --git a/tools/perf/arch/riscv/entry/syscalls/Kbuild b/tools/perf/arch/riscv/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9a41e3572c3a
--- /dev/null
+++ b/tools/perf/arch/riscv/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/riscv/entry/syscalls/Makefile.syscalls b/tools/perf/arch/riscv/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..9668fd1faf60
--- /dev/null
+++ b/tools/perf/arch/riscv/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += riscv memfd_secret
+syscall_abis_64 += riscv rlimit memfd_secret
diff --git a/tools/perf/arch/riscv/entry/syscalls/mksyscalltbl b/tools/perf/arch/riscv/entry/syscalls/mksyscalltbl
deleted file mode 100755
index c59f5e852b97..000000000000
--- a/tools/perf/arch/riscv/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,47 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf. Derived from
-# powerpc script.
-#
-# Copyright IBM Corp. 2017
-# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com>
-# Changed by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com>
-# Changed by: Kim Phillips <kim.phillips@arm.com>
-# Changed by: Björn Töpel <bjorn@rivosinc.com>
-
-gcc=$1
-hostcc=$2
-incpath=$3
-input=$4
-
-if ! test -r $input; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_sc_table()
-{
- local sc nr max_nr
-
- while read sc nr; do
- printf "%s\n" " [$nr] = \"$sc\","
- max_nr=$nr
- done
-
- echo "#define SYSCALLTBL_RISCV_MAX_ID $max_nr"
-}
-
-create_table()
-{
- echo "#include \"$input\""
- echo "static const char *const syscalltbl_riscv[] = {"
- create_sc_table
- echo "};"
-}
-
-$gcc -E -dM -x c -I $incpath/include/uapi $input \
- |awk '$2 ~ "__NR" && $3 !~ "__NR3264_" {
- sub("^#define __NR(3264)?_", "");
- print | "sort -k2 -n"}' \
- |create_table
diff --git a/tools/perf/arch/riscv/include/syscall_table.h b/tools/perf/arch/riscv/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/riscv/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/s390/Makefile b/tools/perf/arch/s390/Makefile
index c431c21b11ef..0033698a65ce 100644
--- a/tools/perf/arch/s390/Makefile
+++ b/tools/perf/arch/s390/Makefile
@@ -1,24 +1,3 @@
# SPDX-License-Identifier: GPL-2.0-only
HAVE_KVM_STAT_SUPPORT := 1
PERF_HAVE_JITDUMP := 1
-
-#
-# Syscall table generation for perf
-#
-
-out := $(OUTPUT)arch/s390/include/generated/asm
-header := $(out)/syscalls_64.c
-sysprf := $(srctree)/tools/perf/arch/s390/entry/syscalls
-sysdef := $(sysprf)/syscall.tbl
-systbl := $(sysprf)/mksyscalltbl
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sysdef) $(systbl)
- $(Q)$(SHELL) '$(systbl)' $(sysdef) > $@
-
-clean::
- $(call QUIET_CLEAN, s390) $(RM) $(header)
-
-archheaders: $(header)
diff --git a/tools/perf/arch/s390/entry/syscalls/Kbuild b/tools/perf/arch/s390/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..9a41e3572c3a
--- /dev/null
+++ b/tools/perf/arch/s390/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/s390/entry/syscalls/Makefile.syscalls b/tools/perf/arch/s390/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..9762d7abf17c
--- /dev/null
+++ b/tools/perf/arch/s390/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,5 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_64 += renameat rlimit memfd_secret
+
+syscalltbl = $(srctree)/tools/perf/arch/s390/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/s390/entry/syscalls/mksyscalltbl b/tools/perf/arch/s390/entry/syscalls/mksyscalltbl
deleted file mode 100755
index 52eb88a77c94..000000000000
--- a/tools/perf/arch/s390/entry/syscalls/mksyscalltbl
+++ /dev/null
@@ -1,32 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-#
-# Generate system call table for perf
-#
-# Copyright IBM Corp. 2017, 2018
-# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com>
-#
-
-SYSCALL_TBL=$1
-
-if ! test -r $SYSCALL_TBL; then
- echo "Could not read input file" >&2
- exit 1
-fi
-
-create_table()
-{
- local max_nr nr abi sc discard
-
- echo 'static const char *const syscalltbl_s390_64[] = {'
- while read nr abi sc discard; do
- printf '\t[%d] = "%s",\n' $nr $sc
- max_nr=$nr
- done
- echo '};'
- echo "#define SYSCALLTBL_S390_64_MAX_ID $max_nr"
-}
-
-grep -E "^[[:digit:]]+[[:space:]]+(common|64)" $SYSCALL_TBL \
- |sort -k1 -n \
- |create_table
diff --git a/tools/perf/arch/s390/entry/syscalls/syscall.tbl b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
index 01071182763e..e9115b4d8b63 100644
--- a/tools/perf/arch/s390/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
@@ -465,3 +465,7 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal sys_mseal
+463 common setxattrat sys_setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat sys_removexattrat
diff --git a/tools/perf/arch/s390/include/syscall_table.h b/tools/perf/arch/s390/include/syscall_table.h
new file mode 100644
index 000000000000..b53e31c15805
--- /dev/null
+++ b/tools/perf/arch/s390/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_64.h>
diff --git a/tools/perf/arch/sh/entry/syscalls/Kbuild b/tools/perf/arch/sh/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..11707c481a24
--- /dev/null
+++ b/tools/perf/arch/sh/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
diff --git a/tools/perf/arch/sh/entry/syscalls/Makefile.syscalls b/tools/perf/arch/sh/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..25080390e4ed
--- /dev/null
+++ b/tools/perf/arch/sh/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 +=
+syscalltbl = $(srctree)/tools/perf/arch/sh/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/sh/entry/syscalls/syscall.tbl b/tools/perf/arch/sh/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..c8cad33bf250
--- /dev/null
+++ b/tools/perf/arch/sh/entry/syscalls/syscall.tbl
@@ -0,0 +1,472 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# system call numbers and entry vectors for sh
+#
+# The format is:
+# <number> <abi> <name> <entry point>
+#
+# The <abi> is always "common" for this file
+#
+0 common restart_syscall sys_restart_syscall
+1 common exit sys_exit
+2 common fork sys_fork
+3 common read sys_read
+4 common write sys_write
+5 common open sys_open
+6 common close sys_close
+7 common waitpid sys_waitpid
+8 common creat sys_creat
+9 common link sys_link
+10 common unlink sys_unlink
+11 common execve sys_execve
+12 common chdir sys_chdir
+13 common time sys_time32
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 common lchown sys_lchown16
+# 17 was break
+18 common oldstat sys_stat
+19 common lseek sys_lseek
+20 common getpid sys_getpid
+21 common mount sys_mount
+22 common umount sys_oldumount
+23 common setuid sys_setuid16
+24 common getuid sys_getuid16
+25 common stime sys_stime32
+26 common ptrace sys_ptrace
+27 common alarm sys_alarm
+28 common oldfstat sys_fstat
+29 common pause sys_pause
+30 common utime sys_utime32
+# 31 was stty
+# 32 was gtty
+33 common access sys_access
+34 common nice sys_nice
+# 35 was ftime
+36 common sync sys_sync
+37 common kill sys_kill
+38 common rename sys_rename
+39 common mkdir sys_mkdir
+40 common rmdir sys_rmdir
+41 common dup sys_dup
+42 common pipe sys_sh_pipe
+43 common times sys_times
+# 44 was prof
+45 common brk sys_brk
+46 common setgid sys_setgid16
+47 common getgid sys_getgid16
+48 common signal sys_signal
+49 common geteuid sys_geteuid16
+50 common getegid sys_getegid16
+51 common acct sys_acct
+52 common umount2 sys_umount
+# 53 was lock
+54 common ioctl sys_ioctl
+55 common fcntl sys_fcntl
+# 56 was mpx
+57 common setpgid sys_setpgid
+# 58 was ulimit
+# 59 was olduname
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common ustat sys_ustat
+63 common dup2 sys_dup2
+64 common getppid sys_getppid
+65 common getpgrp sys_getpgrp
+66 common setsid sys_setsid
+67 common sigaction sys_sigaction
+68 common sgetmask sys_sgetmask
+69 common ssetmask sys_ssetmask
+70 common setreuid sys_setreuid16
+71 common setregid sys_setregid16
+72 common sigsuspend sys_sigsuspend
+73 common sigpending sys_sigpending
+74 common sethostname sys_sethostname
+75 common setrlimit sys_setrlimit
+76 common getrlimit sys_old_getrlimit
+77 common getrusage sys_getrusage
+78 common gettimeofday sys_gettimeofday
+79 common settimeofday sys_settimeofday
+80 common getgroups sys_getgroups16
+81 common setgroups sys_setgroups16
+# 82 was select
+83 common symlink sys_symlink
+84 common oldlstat sys_lstat
+85 common readlink sys_readlink
+86 common uselib sys_uselib
+87 common swapon sys_swapon
+88 common reboot sys_reboot
+89 common readdir sys_old_readdir
+90 common mmap old_mmap
+91 common munmap sys_munmap
+92 common truncate sys_truncate
+93 common ftruncate sys_ftruncate
+94 common fchmod sys_fchmod
+95 common fchown sys_fchown16
+96 common getpriority sys_getpriority
+97 common setpriority sys_setpriority
+# 98 was profil
+99 common statfs sys_statfs
+100 common fstatfs sys_fstatfs
+# 101 was ioperm
+102 common socketcall sys_socketcall
+103 common syslog sys_syslog
+104 common setitimer sys_setitimer
+105 common getitimer sys_getitimer
+106 common stat sys_newstat
+107 common lstat sys_newlstat
+108 common fstat sys_newfstat
+109 common olduname sys_uname
+# 110 was iopl
+111 common vhangup sys_vhangup
+# 112 was idle
+# 113 was vm86old
+114 common wait4 sys_wait4
+115 common swapoff sys_swapoff
+116 common sysinfo sys_sysinfo
+117 common ipc sys_ipc
+118 common fsync sys_fsync
+119 common sigreturn sys_sigreturn
+120 common clone sys_clone
+121 common setdomainname sys_setdomainname
+122 common uname sys_newuname
+123 common cacheflush sys_cacheflush
+124 common adjtimex sys_adjtimex_time32
+125 common mprotect sys_mprotect
+126 common sigprocmask sys_sigprocmask
+# 127 was create_module
+128 common init_module sys_init_module
+129 common delete_module sys_delete_module
+# 130 was get_kernel_syms
+131 common quotactl sys_quotactl
+132 common getpgid sys_getpgid
+133 common fchdir sys_fchdir
+134 common bdflush sys_ni_syscall
+135 common sysfs sys_sysfs
+136 common personality sys_personality
+# 137 was afs_syscall
+138 common setfsuid sys_setfsuid16
+139 common setfsgid sys_setfsgid16
+140 common _llseek sys_llseek
+141 common getdents sys_getdents
+142 common _newselect sys_select
+143 common flock sys_flock
+144 common msync sys_msync
+145 common readv sys_readv
+146 common writev sys_writev
+147 common getsid sys_getsid
+148 common fdatasync sys_fdatasync
+149 common _sysctl sys_ni_syscall
+150 common mlock sys_mlock
+151 common munlock sys_munlock
+152 common mlockall sys_mlockall
+153 common munlockall sys_munlockall
+154 common sched_setparam sys_sched_setparam
+155 common sched_getparam sys_sched_getparam
+156 common sched_setscheduler sys_sched_setscheduler
+157 common sched_getscheduler sys_sched_getscheduler
+158 common sched_yield sys_sched_yield
+159 common sched_get_priority_max sys_sched_get_priority_max
+160 common sched_get_priority_min sys_sched_get_priority_min
+161 common sched_rr_get_interval sys_sched_rr_get_interval_time32
+162 common nanosleep sys_nanosleep_time32
+163 common mremap sys_mremap
+164 common setresuid sys_setresuid16
+165 common getresuid sys_getresuid16
+# 166 was vm86
+# 167 was query_module
+168 common poll sys_poll
+169 common nfsservctl sys_ni_syscall
+170 common setresgid sys_setresgid16
+171 common getresgid sys_getresgid16
+172 common prctl sys_prctl
+173 common rt_sigreturn sys_rt_sigreturn
+174 common rt_sigaction sys_rt_sigaction
+175 common rt_sigprocmask sys_rt_sigprocmask
+176 common rt_sigpending sys_rt_sigpending
+177 common rt_sigtimedwait sys_rt_sigtimedwait_time32
+178 common rt_sigqueueinfo sys_rt_sigqueueinfo
+179 common rt_sigsuspend sys_rt_sigsuspend
+180 common pread64 sys_pread_wrapper
+181 common pwrite64 sys_pwrite_wrapper
+182 common chown sys_chown16
+183 common getcwd sys_getcwd
+184 common capget sys_capget
+185 common capset sys_capset
+186 common sigaltstack sys_sigaltstack
+187 common sendfile sys_sendfile
+# 188 is reserved for getpmsg
+# 189 is reserved for putpmsg
+190 common vfork sys_vfork
+191 common ugetrlimit sys_getrlimit
+192 common mmap2 sys_mmap2
+193 common truncate64 sys_truncate64
+194 common ftruncate64 sys_ftruncate64
+195 common stat64 sys_stat64
+196 common lstat64 sys_lstat64
+197 common fstat64 sys_fstat64
+198 common lchown32 sys_lchown
+199 common getuid32 sys_getuid
+200 common getgid32 sys_getgid
+201 common geteuid32 sys_geteuid
+202 common getegid32 sys_getegid
+203 common setreuid32 sys_setreuid
+204 common setregid32 sys_setregid
+205 common getgroups32 sys_getgroups
+206 common setgroups32 sys_setgroups
+207 common fchown32 sys_fchown
+208 common setresuid32 sys_setresuid
+209 common getresuid32 sys_getresuid
+210 common setresgid32 sys_setresgid
+211 common getresgid32 sys_getresgid
+212 common chown32 sys_chown
+213 common setuid32 sys_setuid
+214 common setgid32 sys_setgid
+215 common setfsuid32 sys_setfsuid
+216 common setfsgid32 sys_setfsgid
+217 common pivot_root sys_pivot_root
+218 common mincore sys_mincore
+219 common madvise sys_madvise
+220 common getdents64 sys_getdents64
+221 common fcntl64 sys_fcntl64
+# 222 is reserved for tux
+# 223 is unused
+224 common gettid sys_gettid
+225 common readahead sys_readahead
+226 common setxattr sys_setxattr
+227 common lsetxattr sys_lsetxattr
+228 common fsetxattr sys_fsetxattr
+229 common getxattr sys_getxattr
+230 common lgetxattr sys_lgetxattr
+231 common fgetxattr sys_fgetxattr
+232 common listxattr sys_listxattr
+233 common llistxattr sys_llistxattr
+234 common flistxattr sys_flistxattr
+235 common removexattr sys_removexattr
+236 common lremovexattr sys_lremovexattr
+237 common fremovexattr sys_fremovexattr
+238 common tkill sys_tkill
+239 common sendfile64 sys_sendfile64
+240 common futex sys_futex_time32
+241 common sched_setaffinity sys_sched_setaffinity
+242 common sched_getaffinity sys_sched_getaffinity
+# 243 is reserved for set_thread_area
+# 244 is reserved for get_thread_area
+245 common io_setup sys_io_setup
+246 common io_destroy sys_io_destroy
+247 common io_getevents sys_io_getevents_time32
+248 common io_submit sys_io_submit
+249 common io_cancel sys_io_cancel
+250 common fadvise64 sys_fadvise64
+# 251 is unused
+252 common exit_group sys_exit_group
+253 common lookup_dcookie sys_ni_syscall
+254 common epoll_create sys_epoll_create
+255 common epoll_ctl sys_epoll_ctl
+256 common epoll_wait sys_epoll_wait
+257 common remap_file_pages sys_remap_file_pages
+258 common set_tid_address sys_set_tid_address
+259 common timer_create sys_timer_create
+260 common timer_settime sys_timer_settime32
+261 common timer_gettime sys_timer_gettime32
+262 common timer_getoverrun sys_timer_getoverrun
+263 common timer_delete sys_timer_delete
+264 common clock_settime sys_clock_settime32
+265 common clock_gettime sys_clock_gettime32
+266 common clock_getres sys_clock_getres_time32
+267 common clock_nanosleep sys_clock_nanosleep_time32
+268 common statfs64 sys_statfs64
+269 common fstatfs64 sys_fstatfs64
+270 common tgkill sys_tgkill
+271 common utimes sys_utimes_time32
+272 common fadvise64_64 sys_fadvise64_64_wrapper
+# 273 is reserved for vserver
+274 common mbind sys_mbind
+275 common get_mempolicy sys_get_mempolicy
+276 common set_mempolicy sys_set_mempolicy
+277 common mq_open sys_mq_open
+278 common mq_unlink sys_mq_unlink
+279 common mq_timedsend sys_mq_timedsend_time32
+280 common mq_timedreceive sys_mq_timedreceive_time32
+281 common mq_notify sys_mq_notify
+282 common mq_getsetattr sys_mq_getsetattr
+283 common kexec_load sys_kexec_load
+284 common waitid sys_waitid
+285 common add_key sys_add_key
+286 common request_key sys_request_key
+287 common keyctl sys_keyctl
+288 common ioprio_set sys_ioprio_set
+289 common ioprio_get sys_ioprio_get
+290 common inotify_init sys_inotify_init
+291 common inotify_add_watch sys_inotify_add_watch
+292 common inotify_rm_watch sys_inotify_rm_watch
+# 293 is unused
+294 common migrate_pages sys_migrate_pages
+295 common openat sys_openat
+296 common mkdirat sys_mkdirat
+297 common mknodat sys_mknodat
+298 common fchownat sys_fchownat
+299 common futimesat sys_futimesat_time32
+300 common fstatat64 sys_fstatat64
+301 common unlinkat sys_unlinkat
+302 common renameat sys_renameat
+303 common linkat sys_linkat
+304 common symlinkat sys_symlinkat
+305 common readlinkat sys_readlinkat
+306 common fchmodat sys_fchmodat
+307 common faccessat sys_faccessat
+308 common pselect6 sys_pselect6_time32
+309 common ppoll sys_ppoll_time32
+310 common unshare sys_unshare
+311 common set_robust_list sys_set_robust_list
+312 common get_robust_list sys_get_robust_list
+313 common splice sys_splice
+314 common sync_file_range sys_sh_sync_file_range6
+315 common tee sys_tee
+316 common vmsplice sys_vmsplice
+317 common move_pages sys_move_pages
+318 common getcpu sys_getcpu
+319 common epoll_pwait sys_epoll_pwait
+320 common utimensat sys_utimensat_time32
+321 common signalfd sys_signalfd
+322 common timerfd_create sys_timerfd_create
+323 common eventfd sys_eventfd
+324 common fallocate sys_fallocate
+325 common timerfd_settime sys_timerfd_settime32
+326 common timerfd_gettime sys_timerfd_gettime32
+327 common signalfd4 sys_signalfd4
+328 common eventfd2 sys_eventfd2
+329 common epoll_create1 sys_epoll_create1
+330 common dup3 sys_dup3
+331 common pipe2 sys_pipe2
+332 common inotify_init1 sys_inotify_init1
+333 common preadv sys_preadv
+334 common pwritev sys_pwritev
+335 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo
+336 common perf_event_open sys_perf_event_open
+337 common fanotify_init sys_fanotify_init
+338 common fanotify_mark sys_fanotify_mark
+339 common prlimit64 sys_prlimit64
+340 common socket sys_socket
+341 common bind sys_bind
+342 common connect sys_connect
+343 common listen sys_listen
+344 common accept sys_accept
+345 common getsockname sys_getsockname
+346 common getpeername sys_getpeername
+347 common socketpair sys_socketpair
+348 common send sys_send
+349 common sendto sys_sendto
+350 common recv sys_recv
+351 common recvfrom sys_recvfrom
+352 common shutdown sys_shutdown
+353 common setsockopt sys_setsockopt
+354 common getsockopt sys_getsockopt
+355 common sendmsg sys_sendmsg
+356 common recvmsg sys_recvmsg
+357 common recvmmsg sys_recvmmsg_time32
+358 common accept4 sys_accept4
+359 common name_to_handle_at sys_name_to_handle_at
+360 common open_by_handle_at sys_open_by_handle_at
+361 common clock_adjtime sys_clock_adjtime32
+362 common syncfs sys_syncfs
+363 common sendmmsg sys_sendmmsg
+364 common setns sys_setns
+365 common process_vm_readv sys_process_vm_readv
+366 common process_vm_writev sys_process_vm_writev
+367 common kcmp sys_kcmp
+368 common finit_module sys_finit_module
+369 common sched_getattr sys_sched_getattr
+370 common sched_setattr sys_sched_setattr
+371 common renameat2 sys_renameat2
+372 common seccomp sys_seccomp
+373 common getrandom sys_getrandom
+374 common memfd_create sys_memfd_create
+375 common bpf sys_bpf
+376 common execveat sys_execveat
+377 common userfaultfd sys_userfaultfd
+378 common membarrier sys_membarrier
+379 common mlock2 sys_mlock2
+380 common copy_file_range sys_copy_file_range
+381 common preadv2 sys_preadv2
+382 common pwritev2 sys_pwritev2
+383 common statx sys_statx
+384 common pkey_mprotect sys_pkey_mprotect
+385 common pkey_alloc sys_pkey_alloc
+386 common pkey_free sys_pkey_free
+387 common rseq sys_rseq
+388 common sync_file_range2 sys_sync_file_range2
+# room for arch specific syscalls
+393 common semget sys_semget
+394 common semctl sys_semctl
+395 common shmget sys_shmget
+396 common shmctl sys_shmctl
+397 common shmat sys_shmat
+398 common shmdt sys_shmdt
+399 common msgget sys_msgget
+400 common msgsnd sys_msgsnd
+401 common msgrcv sys_msgrcv
+402 common msgctl sys_msgctl
+403 common clock_gettime64 sys_clock_gettime
+404 common clock_settime64 sys_clock_settime
+405 common clock_adjtime64 sys_clock_adjtime
+406 common clock_getres_time64 sys_clock_getres
+407 common clock_nanosleep_time64 sys_clock_nanosleep
+408 common timer_gettime64 sys_timer_gettime
+409 common timer_settime64 sys_timer_settime
+410 common timerfd_gettime64 sys_timerfd_gettime
+411 common timerfd_settime64 sys_timerfd_settime
+412 common utimensat_time64 sys_utimensat
+413 common pselect6_time64 sys_pselect6
+414 common ppoll_time64 sys_ppoll
+416 common io_pgetevents_time64 sys_io_pgetevents
+417 common recvmmsg_time64 sys_recvmmsg
+418 common mq_timedsend_time64 sys_mq_timedsend
+419 common mq_timedreceive_time64 sys_mq_timedreceive
+420 common semtimedop_time64 sys_semtimedop
+421 common rt_sigtimedwait_time64 sys_rt_sigtimedwait
+422 common futex_time64 sys_futex
+423 common sched_rr_get_interval_time64 sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+# 435 reserved for clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/sh/include/syscall_table.h b/tools/perf/arch/sh/include/syscall_table.h
new file mode 100644
index 000000000000..4c942821662d
--- /dev/null
+++ b/tools/perf/arch/sh/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_32.h>
diff --git a/tools/perf/arch/sparc/entry/syscalls/Kbuild b/tools/perf/arch/sparc/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..84c6599b4ea6
--- /dev/null
+++ b/tools/perf/arch/sparc/entry/syscalls/Kbuild
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/sparc/entry/syscalls/Makefile.syscalls b/tools/perf/arch/sparc/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..212c1800b644
--- /dev/null
+++ b/tools/perf/arch/sparc/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,5 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 +=
+syscall_abis_64 +=
+syscalltbl = $(srctree)/tools/perf/arch/sparc/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/sparc/entry/syscalls/syscall.tbl b/tools/perf/arch/sparc/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..727f99d333b3
--- /dev/null
+++ b/tools/perf/arch/sparc/entry/syscalls/syscall.tbl
@@ -0,0 +1,514 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# system call numbers and entry vectors for sparc
+#
+# The format is:
+# <number> <abi> <name> <entry point> <compat entry point>
+#
+# The <abi> can be common, 64, or 32 for this file.
+#
+0 common restart_syscall sys_restart_syscall
+1 32 exit sys_exit sparc_exit
+1 64 exit sparc_exit
+2 common fork sys_fork
+3 common read sys_read
+4 common write sys_write
+5 common open sys_open compat_sys_open
+6 common close sys_close
+7 common wait4 sys_wait4 compat_sys_wait4
+8 common creat sys_creat
+9 common link sys_link
+10 common unlink sys_unlink
+11 32 execv sunos_execv
+11 64 execv sys_nis_syscall
+12 common chdir sys_chdir
+13 32 chown sys_chown16
+13 64 chown sys_chown
+14 common mknod sys_mknod
+15 common chmod sys_chmod
+16 32 lchown sys_lchown16
+16 64 lchown sys_lchown
+17 common brk sys_brk
+18 common perfctr sys_nis_syscall
+19 common lseek sys_lseek compat_sys_lseek
+20 common getpid sys_getpid
+21 common capget sys_capget
+22 common capset sys_capset
+23 32 setuid sys_setuid16
+23 64 setuid sys_setuid
+24 32 getuid sys_getuid16
+24 64 getuid sys_getuid
+25 common vmsplice sys_vmsplice
+26 common ptrace sys_ptrace compat_sys_ptrace
+27 common alarm sys_alarm
+28 common sigaltstack sys_sigaltstack compat_sys_sigaltstack
+29 32 pause sys_pause
+29 64 pause sys_nis_syscall
+30 32 utime sys_utime32
+30 64 utime sys_utime
+31 32 lchown32 sys_lchown
+32 32 fchown32 sys_fchown
+33 common access sys_access
+34 common nice sys_nice
+35 32 chown32 sys_chown
+36 common sync sys_sync
+37 common kill sys_kill
+38 common stat sys_newstat compat_sys_newstat
+39 32 sendfile sys_sendfile compat_sys_sendfile
+39 64 sendfile sys_sendfile64
+40 common lstat sys_newlstat compat_sys_newlstat
+41 common dup sys_dup
+42 common pipe sys_sparc_pipe
+43 common times sys_times compat_sys_times
+44 32 getuid32 sys_getuid
+45 common umount2 sys_umount
+46 32 setgid sys_setgid16
+46 64 setgid sys_setgid
+47 32 getgid sys_getgid16
+47 64 getgid sys_getgid
+48 common signal sys_signal
+49 32 geteuid sys_geteuid16
+49 64 geteuid sys_geteuid
+50 32 getegid sys_getegid16
+50 64 getegid sys_getegid
+51 common acct sys_acct
+52 64 memory_ordering sys_memory_ordering
+53 32 getgid32 sys_getgid
+54 common ioctl sys_ioctl compat_sys_ioctl
+55 common reboot sys_reboot
+56 32 mmap2 sys_mmap2 sys32_mmap2
+57 common symlink sys_symlink
+58 common readlink sys_readlink
+59 32 execve sys_execve sys32_execve
+59 64 execve sys64_execve
+60 common umask sys_umask
+61 common chroot sys_chroot
+62 common fstat sys_newfstat compat_sys_newfstat
+63 common fstat64 sys_fstat64 compat_sys_fstat64
+64 common getpagesize sys_getpagesize
+65 common msync sys_msync
+66 common vfork sys_vfork
+67 common pread64 sys_pread64 compat_sys_pread64
+68 common pwrite64 sys_pwrite64 compat_sys_pwrite64
+69 32 geteuid32 sys_geteuid
+70 32 getegid32 sys_getegid
+71 common mmap sys_mmap
+72 32 setreuid32 sys_setreuid
+73 32 munmap sys_munmap
+73 64 munmap sys_64_munmap
+74 common mprotect sys_mprotect
+75 common madvise sys_madvise
+76 common vhangup sys_vhangup
+77 32 truncate64 sys_truncate64 compat_sys_truncate64
+78 common mincore sys_mincore
+79 32 getgroups sys_getgroups16
+79 64 getgroups sys_getgroups
+80 32 setgroups sys_setgroups16
+80 64 setgroups sys_setgroups
+81 common getpgrp sys_getpgrp
+82 32 setgroups32 sys_setgroups
+83 common setitimer sys_setitimer compat_sys_setitimer
+84 32 ftruncate64 sys_ftruncate64 compat_sys_ftruncate64
+85 common swapon sys_swapon
+86 common getitimer sys_getitimer compat_sys_getitimer
+87 32 setuid32 sys_setuid
+88 common sethostname sys_sethostname
+89 32 setgid32 sys_setgid
+90 common dup2 sys_dup2
+91 32 setfsuid32 sys_setfsuid
+92 common fcntl sys_fcntl compat_sys_fcntl
+93 common select sys_select compat_sys_select
+94 32 setfsgid32 sys_setfsgid
+95 common fsync sys_fsync
+96 common setpriority sys_setpriority
+97 common socket sys_socket
+98 common connect sys_connect
+99 common accept sys_accept
+100 common getpriority sys_getpriority
+101 common rt_sigreturn sys_rt_sigreturn sys32_rt_sigreturn
+102 common rt_sigaction sys_rt_sigaction compat_sys_rt_sigaction
+103 common rt_sigprocmask sys_rt_sigprocmask compat_sys_rt_sigprocmask
+104 common rt_sigpending sys_rt_sigpending compat_sys_rt_sigpending
+105 32 rt_sigtimedwait sys_rt_sigtimedwait_time32 compat_sys_rt_sigtimedwait_time32
+105 64 rt_sigtimedwait sys_rt_sigtimedwait
+106 common rt_sigqueueinfo sys_rt_sigqueueinfo compat_sys_rt_sigqueueinfo
+107 common rt_sigsuspend sys_rt_sigsuspend compat_sys_rt_sigsuspend
+108 32 setresuid32 sys_setresuid
+108 64 setresuid sys_setresuid
+109 32 getresuid32 sys_getresuid
+109 64 getresuid sys_getresuid
+110 32 setresgid32 sys_setresgid
+110 64 setresgid sys_setresgid
+111 32 getresgid32 sys_getresgid
+111 64 getresgid sys_getresgid
+112 32 setregid32 sys_setregid
+113 common recvmsg sys_recvmsg compat_sys_recvmsg
+114 common sendmsg sys_sendmsg compat_sys_sendmsg
+115 32 getgroups32 sys_getgroups
+116 common gettimeofday sys_gettimeofday compat_sys_gettimeofday
+117 common getrusage sys_getrusage compat_sys_getrusage
+118 common getsockopt sys_getsockopt sys_getsockopt
+119 common getcwd sys_getcwd
+120 common readv sys_readv
+121 common writev sys_writev
+122 common settimeofday sys_settimeofday compat_sys_settimeofday
+123 32 fchown sys_fchown16
+123 64 fchown sys_fchown
+124 common fchmod sys_fchmod
+125 common recvfrom sys_recvfrom compat_sys_recvfrom
+126 32 setreuid sys_setreuid16
+126 64 setreuid sys_setreuid
+127 32 setregid sys_setregid16
+127 64 setregid sys_setregid
+128 common rename sys_rename
+129 common truncate sys_truncate compat_sys_truncate
+130 common ftruncate sys_ftruncate compat_sys_ftruncate
+131 common flock sys_flock
+132 common lstat64 sys_lstat64 compat_sys_lstat64
+133 common sendto sys_sendto
+134 common shutdown sys_shutdown
+135 common socketpair sys_socketpair
+136 common mkdir sys_mkdir
+137 common rmdir sys_rmdir
+138 32 utimes sys_utimes_time32
+138 64 utimes sys_utimes
+139 common stat64 sys_stat64 compat_sys_stat64
+140 common sendfile64 sys_sendfile64
+141 common getpeername sys_getpeername
+142 32 futex sys_futex_time32
+142 64 futex sys_futex
+143 common gettid sys_gettid
+144 common getrlimit sys_getrlimit compat_sys_getrlimit
+145 common setrlimit sys_setrlimit compat_sys_setrlimit
+146 common pivot_root sys_pivot_root
+147 common prctl sys_prctl
+148 common pciconfig_read sys_pciconfig_read
+149 common pciconfig_write sys_pciconfig_write
+150 common getsockname sys_getsockname
+151 common inotify_init sys_inotify_init
+152 common inotify_add_watch sys_inotify_add_watch
+153 common poll sys_poll
+154 common getdents64 sys_getdents64
+155 32 fcntl64 sys_fcntl64 compat_sys_fcntl64
+156 common inotify_rm_watch sys_inotify_rm_watch
+157 common statfs sys_statfs compat_sys_statfs
+158 common fstatfs sys_fstatfs compat_sys_fstatfs
+159 common umount sys_oldumount
+160 common sched_set_affinity sys_sched_setaffinity compat_sys_sched_setaffinity
+161 common sched_get_affinity sys_sched_getaffinity compat_sys_sched_getaffinity
+162 common getdomainname sys_getdomainname
+163 common setdomainname sys_setdomainname
+164 64 utrap_install sys_utrap_install
+165 common quotactl sys_quotactl
+166 common set_tid_address sys_set_tid_address
+167 common mount sys_mount
+168 common ustat sys_ustat compat_sys_ustat
+169 common setxattr sys_setxattr
+170 common lsetxattr sys_lsetxattr
+171 common fsetxattr sys_fsetxattr
+172 common getxattr sys_getxattr
+173 common lgetxattr sys_lgetxattr
+174 common getdents sys_getdents compat_sys_getdents
+175 common setsid sys_setsid
+176 common fchdir sys_fchdir
+177 common fgetxattr sys_fgetxattr
+178 common listxattr sys_listxattr
+179 common llistxattr sys_llistxattr
+180 common flistxattr sys_flistxattr
+181 common removexattr sys_removexattr
+182 common lremovexattr sys_lremovexattr
+183 32 sigpending sys_sigpending compat_sys_sigpending
+183 64 sigpending sys_nis_syscall
+184 common query_module sys_ni_syscall
+185 common setpgid sys_setpgid
+186 common fremovexattr sys_fremovexattr
+187 common tkill sys_tkill
+188 32 exit_group sys_exit_group sparc_exit_group
+188 64 exit_group sparc_exit_group
+189 common uname sys_newuname
+190 common init_module sys_init_module
+191 32 personality sys_personality sys_sparc64_personality
+191 64 personality sys_sparc64_personality
+192 32 remap_file_pages sys_sparc_remap_file_pages sys_remap_file_pages
+192 64 remap_file_pages sys_remap_file_pages
+193 common epoll_create sys_epoll_create
+194 common epoll_ctl sys_epoll_ctl
+195 common epoll_wait sys_epoll_wait
+196 common ioprio_set sys_ioprio_set
+197 common getppid sys_getppid
+198 32 sigaction sys_sparc_sigaction compat_sys_sparc_sigaction
+198 64 sigaction sys_nis_syscall
+199 common sgetmask sys_sgetmask
+200 common ssetmask sys_ssetmask
+201 32 sigsuspend sys_sigsuspend
+201 64 sigsuspend sys_nis_syscall
+202 common oldlstat sys_newlstat compat_sys_newlstat
+203 common uselib sys_uselib
+204 32 readdir sys_old_readdir compat_sys_old_readdir
+204 64 readdir sys_nis_syscall
+205 common readahead sys_readahead compat_sys_readahead
+206 common socketcall sys_socketcall compat_sys_socketcall
+207 common syslog sys_syslog
+208 common lookup_dcookie sys_ni_syscall
+209 common fadvise64 sys_fadvise64 compat_sys_fadvise64
+210 common fadvise64_64 sys_fadvise64_64 compat_sys_fadvise64_64
+211 common tgkill sys_tgkill
+212 common waitpid sys_waitpid
+213 common swapoff sys_swapoff
+214 common sysinfo sys_sysinfo compat_sys_sysinfo
+215 32 ipc sys_ipc compat_sys_ipc
+215 64 ipc sys_sparc_ipc
+216 32 sigreturn sys_sigreturn sys32_sigreturn
+216 64 sigreturn sys_nis_syscall
+217 common clone sys_clone
+218 common ioprio_get sys_ioprio_get
+219 32 adjtimex sys_adjtimex_time32
+219 64 adjtimex sys_sparc_adjtimex
+220 32 sigprocmask sys_sigprocmask compat_sys_sigprocmask
+220 64 sigprocmask sys_nis_syscall
+221 common create_module sys_ni_syscall
+222 common delete_module sys_delete_module
+223 common get_kernel_syms sys_ni_syscall
+224 common getpgid sys_getpgid
+225 common bdflush sys_ni_syscall
+226 common sysfs sys_sysfs
+227 common afs_syscall sys_nis_syscall
+228 common setfsuid sys_setfsuid16
+229 common setfsgid sys_setfsgid16
+230 common _newselect sys_select compat_sys_select
+231 32 time sys_time32
+232 common splice sys_splice
+233 32 stime sys_stime32
+233 64 stime sys_stime
+234 common statfs64 sys_statfs64 compat_sys_statfs64
+235 common fstatfs64 sys_fstatfs64 compat_sys_fstatfs64
+236 common _llseek sys_llseek
+237 common mlock sys_mlock
+238 common munlock sys_munlock
+239 common mlockall sys_mlockall
+240 common munlockall sys_munlockall
+241 common sched_setparam sys_sched_setparam
+242 common sched_getparam sys_sched_getparam
+243 common sched_setscheduler sys_sched_setscheduler
+244 common sched_getscheduler sys_sched_getscheduler
+245 common sched_yield sys_sched_yield
+246 common sched_get_priority_max sys_sched_get_priority_max
+247 common sched_get_priority_min sys_sched_get_priority_min
+248 32 sched_rr_get_interval sys_sched_rr_get_interval_time32
+248 64 sched_rr_get_interval sys_sched_rr_get_interval
+249 32 nanosleep sys_nanosleep_time32
+249 64 nanosleep sys_nanosleep
+250 32 mremap sys_mremap
+250 64 mremap sys_64_mremap
+251 common _sysctl sys_ni_syscall
+252 common getsid sys_getsid
+253 common fdatasync sys_fdatasync
+254 32 nfsservctl sys_ni_syscall sys_nis_syscall
+254 64 nfsservctl sys_nis_syscall
+255 common sync_file_range sys_sync_file_range compat_sys_sync_file_range
+256 32 clock_settime sys_clock_settime32
+256 64 clock_settime sys_clock_settime
+257 32 clock_gettime sys_clock_gettime32
+257 64 clock_gettime sys_clock_gettime
+258 32 clock_getres sys_clock_getres_time32
+258 64 clock_getres sys_clock_getres
+259 32 clock_nanosleep sys_clock_nanosleep_time32
+259 64 clock_nanosleep sys_clock_nanosleep
+260 common sched_getaffinity sys_sched_getaffinity compat_sys_sched_getaffinity
+261 common sched_setaffinity sys_sched_setaffinity compat_sys_sched_setaffinity
+262 32 timer_settime sys_timer_settime32
+262 64 timer_settime sys_timer_settime
+263 32 timer_gettime sys_timer_gettime32
+263 64 timer_gettime sys_timer_gettime
+264 common timer_getoverrun sys_timer_getoverrun
+265 common timer_delete sys_timer_delete
+266 common timer_create sys_timer_create compat_sys_timer_create
+# 267 was vserver
+267 common vserver sys_nis_syscall
+268 common io_setup sys_io_setup compat_sys_io_setup
+269 common io_destroy sys_io_destroy
+270 common io_submit sys_io_submit compat_sys_io_submit
+271 common io_cancel sys_io_cancel
+272 32 io_getevents sys_io_getevents_time32
+272 64 io_getevents sys_io_getevents
+273 common mq_open sys_mq_open compat_sys_mq_open
+274 common mq_unlink sys_mq_unlink
+275 32 mq_timedsend sys_mq_timedsend_time32
+275 64 mq_timedsend sys_mq_timedsend
+276 32 mq_timedreceive sys_mq_timedreceive_time32
+276 64 mq_timedreceive sys_mq_timedreceive
+277 common mq_notify sys_mq_notify compat_sys_mq_notify
+278 common mq_getsetattr sys_mq_getsetattr compat_sys_mq_getsetattr
+279 common waitid sys_waitid compat_sys_waitid
+280 common tee sys_tee
+281 common add_key sys_add_key
+282 common request_key sys_request_key
+283 common keyctl sys_keyctl compat_sys_keyctl
+284 common openat sys_openat compat_sys_openat
+285 common mkdirat sys_mkdirat
+286 common mknodat sys_mknodat
+287 common fchownat sys_fchownat
+288 32 futimesat sys_futimesat_time32
+288 64 futimesat sys_futimesat
+289 common fstatat64 sys_fstatat64 compat_sys_fstatat64
+290 common unlinkat sys_unlinkat
+291 common renameat sys_renameat
+292 common linkat sys_linkat
+293 common symlinkat sys_symlinkat
+294 common readlinkat sys_readlinkat
+295 common fchmodat sys_fchmodat
+296 common faccessat sys_faccessat
+297 32 pselect6 sys_pselect6_time32 compat_sys_pselect6_time32
+297 64 pselect6 sys_pselect6
+298 32 ppoll sys_ppoll_time32 compat_sys_ppoll_time32
+298 64 ppoll sys_ppoll
+299 common unshare sys_unshare
+300 common set_robust_list sys_set_robust_list compat_sys_set_robust_list
+301 common get_robust_list sys_get_robust_list compat_sys_get_robust_list
+302 common migrate_pages sys_migrate_pages
+303 common mbind sys_mbind
+304 common get_mempolicy sys_get_mempolicy
+305 common set_mempolicy sys_set_mempolicy
+306 common kexec_load sys_kexec_load compat_sys_kexec_load
+307 common move_pages sys_move_pages
+308 common getcpu sys_getcpu
+309 common epoll_pwait sys_epoll_pwait compat_sys_epoll_pwait
+310 32 utimensat sys_utimensat_time32
+310 64 utimensat sys_utimensat
+311 common signalfd sys_signalfd compat_sys_signalfd
+312 common timerfd_create sys_timerfd_create
+313 common eventfd sys_eventfd
+314 common fallocate sys_fallocate compat_sys_fallocate
+315 32 timerfd_settime sys_timerfd_settime32
+315 64 timerfd_settime sys_timerfd_settime
+316 32 timerfd_gettime sys_timerfd_gettime32
+316 64 timerfd_gettime sys_timerfd_gettime
+317 common signalfd4 sys_signalfd4 compat_sys_signalfd4
+318 common eventfd2 sys_eventfd2
+319 common epoll_create1 sys_epoll_create1
+320 common dup3 sys_dup3
+321 common pipe2 sys_pipe2
+322 common inotify_init1 sys_inotify_init1
+323 common accept4 sys_accept4
+324 common preadv sys_preadv compat_sys_preadv
+325 common pwritev sys_pwritev compat_sys_pwritev
+326 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo compat_sys_rt_tgsigqueueinfo
+327 common perf_event_open sys_perf_event_open
+328 32 recvmmsg sys_recvmmsg_time32 compat_sys_recvmmsg_time32
+328 64 recvmmsg sys_recvmmsg
+329 common fanotify_init sys_fanotify_init
+330 common fanotify_mark sys_fanotify_mark compat_sys_fanotify_mark
+331 common prlimit64 sys_prlimit64
+332 common name_to_handle_at sys_name_to_handle_at
+333 common open_by_handle_at sys_open_by_handle_at compat_sys_open_by_handle_at
+334 32 clock_adjtime sys_clock_adjtime32
+334 64 clock_adjtime sys_sparc_clock_adjtime
+335 common syncfs sys_syncfs
+336 common sendmmsg sys_sendmmsg compat_sys_sendmmsg
+337 common setns sys_setns
+338 common process_vm_readv sys_process_vm_readv
+339 common process_vm_writev sys_process_vm_writev
+340 32 kern_features sys_ni_syscall sys_kern_features
+340 64 kern_features sys_kern_features
+341 common kcmp sys_kcmp
+342 common finit_module sys_finit_module
+343 common sched_setattr sys_sched_setattr
+344 common sched_getattr sys_sched_getattr
+345 common renameat2 sys_renameat2
+346 common seccomp sys_seccomp
+347 common getrandom sys_getrandom
+348 common memfd_create sys_memfd_create
+349 common bpf sys_bpf
+350 32 execveat sys_execveat sys32_execveat
+350 64 execveat sys64_execveat
+351 common membarrier sys_membarrier
+352 common userfaultfd sys_userfaultfd
+353 common bind sys_bind
+354 common listen sys_listen
+355 common setsockopt sys_setsockopt sys_setsockopt
+356 common mlock2 sys_mlock2
+357 common copy_file_range sys_copy_file_range
+358 common preadv2 sys_preadv2 compat_sys_preadv2
+359 common pwritev2 sys_pwritev2 compat_sys_pwritev2
+360 common statx sys_statx
+361 32 io_pgetevents sys_io_pgetevents_time32 compat_sys_io_pgetevents
+361 64 io_pgetevents sys_io_pgetevents
+362 common pkey_mprotect sys_pkey_mprotect
+363 common pkey_alloc sys_pkey_alloc
+364 common pkey_free sys_pkey_free
+365 common rseq sys_rseq
+# room for arch specific syscalls
+392 64 semtimedop sys_semtimedop
+393 common semget sys_semget
+394 common semctl sys_semctl compat_sys_semctl
+395 common shmget sys_shmget
+396 common shmctl sys_shmctl compat_sys_shmctl
+397 common shmat sys_shmat compat_sys_shmat
+398 common shmdt sys_shmdt
+399 common msgget sys_msgget
+400 common msgsnd sys_msgsnd compat_sys_msgsnd
+401 common msgrcv sys_msgrcv compat_sys_msgrcv
+402 common msgctl sys_msgctl compat_sys_msgctl
+403 32 clock_gettime64 sys_clock_gettime sys_clock_gettime
+404 32 clock_settime64 sys_clock_settime sys_clock_settime
+405 32 clock_adjtime64 sys_clock_adjtime sys_clock_adjtime
+406 32 clock_getres_time64 sys_clock_getres sys_clock_getres
+407 32 clock_nanosleep_time64 sys_clock_nanosleep sys_clock_nanosleep
+408 32 timer_gettime64 sys_timer_gettime sys_timer_gettime
+409 32 timer_settime64 sys_timer_settime sys_timer_settime
+410 32 timerfd_gettime64 sys_timerfd_gettime sys_timerfd_gettime
+411 32 timerfd_settime64 sys_timerfd_settime sys_timerfd_settime
+412 32 utimensat_time64 sys_utimensat sys_utimensat
+413 32 pselect6_time64 sys_pselect6 compat_sys_pselect6_time64
+414 32 ppoll_time64 sys_ppoll compat_sys_ppoll_time64
+416 32 io_pgetevents_time64 sys_io_pgetevents compat_sys_io_pgetevents_time64
+417 32 recvmmsg_time64 sys_recvmmsg compat_sys_recvmmsg_time64
+418 32 mq_timedsend_time64 sys_mq_timedsend sys_mq_timedsend
+419 32 mq_timedreceive_time64 sys_mq_timedreceive sys_mq_timedreceive
+420 32 semtimedop_time64 sys_semtimedop sys_semtimedop
+421 32 rt_sigtimedwait_time64 sys_rt_sigtimedwait compat_sys_rt_sigtimedwait_time64
+422 32 futex_time64 sys_futex sys_futex
+423 32 sched_rr_get_interval_time64 sys_sched_rr_get_interval sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+# 435 reserved for clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2 compat_sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/sparc/include/syscall_table.h b/tools/perf/arch/sparc/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/sparc/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/x86/Build b/tools/perf/arch/x86/Build
index 87d057491343..02a1ca780a20 100644
--- a/tools/perf/arch/x86/Build
+++ b/tools/perf/arch/x86/Build
@@ -2,7 +2,6 @@ perf-util-y += util/
perf-test-y += tests/
ifdef SHELLCHECK
- SHELL_TESTS := entry/syscalls/syscalltbl.sh
TEST_LOGS := $(SHELL_TESTS:%=%.shellcheck_log)
else
SHELL_TESTS :=
diff --git a/tools/perf/arch/x86/Makefile b/tools/perf/arch/x86/Makefile
index a6b6e0a9308a..a295a80ea078 100644
--- a/tools/perf/arch/x86/Makefile
+++ b/tools/perf/arch/x86/Makefile
@@ -1,28 +1,3 @@
# SPDX-License-Identifier: GPL-2.0
HAVE_KVM_STAT_SUPPORT := 1
PERF_HAVE_JITDUMP := 1
-
-###
-# Syscall table generation
-#
-
-generated := $(OUTPUT)arch/x86/include/generated
-out := $(generated)/asm
-header := $(out)/syscalls_64.c
-header_32 := $(out)/syscalls_32.c
-sys := $(srctree)/tools/perf/arch/x86/entry/syscalls
-systbl := $(sys)/syscalltbl.sh
-
-# Create output directory if not already present
-$(shell [ -d '$(out)' ] || mkdir -p '$(out)')
-
-$(header): $(sys)/syscall_64.tbl $(systbl)
- $(Q)$(SHELL) '$(systbl)' $(sys)/syscall_64.tbl 'x86_64' > $@
-
-$(header_32): $(sys)/syscall_32.tbl $(systbl)
- $(Q)$(SHELL) '$(systbl)' $(sys)/syscall_32.tbl 'x86' > $@
-
-clean::
- $(call QUIET_CLEAN, x86) $(RM) -r $(header) $(generated)
-
-archheaders: $(header) $(header_32)
diff --git a/tools/perf/arch/x86/entry/syscalls/Kbuild b/tools/perf/arch/x86/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..84c6599b4ea6
--- /dev/null
+++ b/tools/perf/arch/x86/entry/syscalls/Kbuild
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
+syscall-y += syscalls_64.h
diff --git a/tools/perf/arch/x86/entry/syscalls/Makefile.syscalls b/tools/perf/arch/x86/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..db3d5d6d4e56
--- /dev/null
+++ b/tools/perf/arch/x86/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 += i386
+syscall_abis_64 +=
+
+syscalltbl = $(srctree)/tools/perf/arch/x86/entry/syscalls/syscall_%.tbl
diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
index 534c74b14fab..4d0fb2fba7e2 100644
--- a/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
+++ b/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
@@ -468,3 +468,7 @@
460 i386 lsm_set_self_attr sys_lsm_set_self_attr
461 i386 lsm_list_modules sys_lsm_list_modules
462 i386 mseal sys_mseal
+463 i386 setxattrat sys_setxattrat
+464 i386 getxattrat sys_getxattrat
+465 i386 listxattrat sys_listxattrat
+466 i386 removexattrat sys_removexattrat
diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
index 7093ee21c0d1..5eb708bff1c7 100644
--- a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
+++ b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
@@ -386,6 +386,10 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
#
# Due to a historical design error, certain syscalls are numbered differently
diff --git a/tools/perf/arch/x86/entry/syscalls/syscalltbl.sh b/tools/perf/arch/x86/entry/syscalls/syscalltbl.sh
deleted file mode 100755
index 2b71f99933a5..000000000000
--- a/tools/perf/arch/x86/entry/syscalls/syscalltbl.sh
+++ /dev/null
@@ -1,42 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-
-in="$1"
-arch="$2"
-
-syscall_macro() {
- nr="$1"
- name="$2"
-
- echo " [$nr] = \"$name\","
-}
-
-emit() {
- nr="$1"
- entry="$2"
-
- syscall_macro "$nr" "$entry"
-}
-
-echo "static const char *const syscalltbl_${arch}[] = {"
-
-sorted_table=$(mktemp /tmp/syscalltbl.XXXXXX)
-grep '^[0-9]' "$in" | sort -n > $sorted_table
-
-max_nr=0
-# the params are: nr abi name entry compat
-# use _ for intentionally unused variables according to SC2034
-while read nr _ name _ _; do
- if [ $nr -ge 512 ] ; then # discard compat sycalls
- break
- fi
-
- emit "$nr" "$name"
- max_nr=$nr
-done < $sorted_table
-
-rm -f $sorted_table
-
-echo "};"
-
-echo "#define SYSCALLTBL_${arch}_MAX_ID ${max_nr}"
diff --git a/tools/perf/arch/x86/include/syscall_table.h b/tools/perf/arch/x86/include/syscall_table.h
new file mode 100644
index 000000000000..7ff51b783000
--- /dev/null
+++ b/tools/perf/arch/x86/include/syscall_table.h
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/bitsperlong.h>
+
+#if __BITS_PER_LONG == 64
+#include <asm/syscalls_64.h>
+#else
+#include <asm/syscalls_32.h>
+#endif
diff --git a/tools/perf/arch/x86/util/Build b/tools/perf/arch/x86/util/Build
index 848327378694..06d7c0205b3d 100644
--- a/tools/perf/arch/x86/util/Build
+++ b/tools/perf/arch/x86/util/Build
@@ -15,6 +15,6 @@ perf-util-$(CONFIG_LOCAL_LIBUNWIND) += unwind-libunwind.o
perf-util-$(CONFIG_LIBDW_DWARF_UNWIND) += unwind-libdw.o
perf-util-$(CONFIG_AUXTRACE) += auxtrace.o
-perf-util-$(CONFIG_AUXTRACE) += archinsn.o
+perf-util-y += archinsn.o
perf-util-$(CONFIG_AUXTRACE) += intel-pt.o
perf-util-$(CONFIG_AUXTRACE) += intel-bts.o
diff --git a/tools/perf/arch/x86/util/iostat.c b/tools/perf/arch/x86/util/iostat.c
index 366b44d0bb7e..00f645a0c18a 100644
--- a/tools/perf/arch/x86/util/iostat.c
+++ b/tools/perf/arch/x86/util/iostat.c
@@ -403,6 +403,10 @@ void iostat_prefix(struct evlist *evlist,
struct iio_root_port *rp = evlist->selected->priv;
if (rp) {
+ /*
+ * TODO: This is the incorrect format in JSON mode.
+ * See prepare_timestamp()
+ */
if (ts)
sprintf(prefix, "%6lu.%09lu%s%04x:%02x%s",
ts->tv_sec, ts->tv_nsec,
diff --git a/tools/perf/arch/xtensa/entry/syscalls/Kbuild b/tools/perf/arch/xtensa/entry/syscalls/Kbuild
new file mode 100644
index 000000000000..11707c481a24
--- /dev/null
+++ b/tools/perf/arch/xtensa/entry/syscalls/Kbuild
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0
+syscall-y += syscalls_32.h
diff --git a/tools/perf/arch/xtensa/entry/syscalls/Makefile.syscalls b/tools/perf/arch/xtensa/entry/syscalls/Makefile.syscalls
new file mode 100644
index 000000000000..d4aa2358460c
--- /dev/null
+++ b/tools/perf/arch/xtensa/entry/syscalls/Makefile.syscalls
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0
+
+syscall_abis_32 +=
+syscalltbl = $(srctree)/tools/perf/arch/xtensa/entry/syscalls/syscall.tbl
diff --git a/tools/perf/arch/xtensa/entry/syscalls/syscall.tbl b/tools/perf/arch/xtensa/entry/syscalls/syscall.tbl
new file mode 100644
index 000000000000..37effc1b134e
--- /dev/null
+++ b/tools/perf/arch/xtensa/entry/syscalls/syscall.tbl
@@ -0,0 +1,439 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# system call numbers and entry vectors for xtensa
+#
+# The format is:
+# <number> <abi> <name> <entry point>
+#
+# The <abi> is always "common" for this file
+#
+0 common spill sys_ni_syscall
+1 common xtensa sys_ni_syscall
+2 common available4 sys_ni_syscall
+3 common available5 sys_ni_syscall
+4 common available6 sys_ni_syscall
+5 common available7 sys_ni_syscall
+6 common available8 sys_ni_syscall
+7 common available9 sys_ni_syscall
+# File Operations
+8 common open sys_open
+9 common close sys_close
+10 common dup sys_dup
+11 common dup2 sys_dup2
+12 common read sys_read
+13 common write sys_write
+14 common select sys_select
+15 common lseek sys_lseek
+16 common poll sys_poll
+17 common _llseek sys_llseek
+18 common epoll_wait sys_epoll_wait
+19 common epoll_ctl sys_epoll_ctl
+20 common epoll_create sys_epoll_create
+21 common creat sys_creat
+22 common truncate sys_truncate
+23 common ftruncate sys_ftruncate
+24 common readv sys_readv
+25 common writev sys_writev
+26 common fsync sys_fsync
+27 common fdatasync sys_fdatasync
+28 common truncate64 sys_truncate64
+29 common ftruncate64 sys_ftruncate64
+30 common pread64 sys_pread64
+31 common pwrite64 sys_pwrite64
+32 common link sys_link
+33 common rename sys_rename
+34 common symlink sys_symlink
+35 common readlink sys_readlink
+36 common mknod sys_mknod
+37 common pipe sys_pipe
+38 common unlink sys_unlink
+39 common rmdir sys_rmdir
+40 common mkdir sys_mkdir
+41 common chdir sys_chdir
+42 common fchdir sys_fchdir
+43 common getcwd sys_getcwd
+44 common chmod sys_chmod
+45 common chown sys_chown
+46 common stat sys_newstat
+47 common stat64 sys_stat64
+48 common lchown sys_lchown
+49 common lstat sys_newlstat
+50 common lstat64 sys_lstat64
+51 common available51 sys_ni_syscall
+52 common fchmod sys_fchmod
+53 common fchown sys_fchown
+54 common fstat sys_newfstat
+55 common fstat64 sys_fstat64
+56 common flock sys_flock
+57 common access sys_access
+58 common umask sys_umask
+59 common getdents sys_getdents
+60 common getdents64 sys_getdents64
+61 common fcntl64 sys_fcntl64
+62 common fallocate sys_fallocate
+63 common fadvise64_64 xtensa_fadvise64_64
+64 common utime sys_utime32
+65 common utimes sys_utimes_time32
+66 common ioctl sys_ioctl
+67 common fcntl sys_fcntl
+68 common setxattr sys_setxattr
+69 common getxattr sys_getxattr
+70 common listxattr sys_listxattr
+71 common removexattr sys_removexattr
+72 common lsetxattr sys_lsetxattr
+73 common lgetxattr sys_lgetxattr
+74 common llistxattr sys_llistxattr
+75 common lremovexattr sys_lremovexattr
+76 common fsetxattr sys_fsetxattr
+77 common fgetxattr sys_fgetxattr
+78 common flistxattr sys_flistxattr
+79 common fremovexattr sys_fremovexattr
+# File Map / Shared Memory Operations
+80 common mmap2 sys_mmap_pgoff
+81 common munmap sys_munmap
+82 common mprotect sys_mprotect
+83 common brk sys_brk
+84 common mlock sys_mlock
+85 common munlock sys_munlock
+86 common mlockall sys_mlockall
+87 common munlockall sys_munlockall
+88 common mremap sys_mremap
+89 common msync sys_msync
+90 common mincore sys_mincore
+91 common madvise sys_madvise
+92 common shmget sys_shmget
+93 common shmat xtensa_shmat
+94 common shmctl sys_old_shmctl
+95 common shmdt sys_shmdt
+# Socket Operations
+96 common socket sys_socket
+97 common setsockopt sys_setsockopt
+98 common getsockopt sys_getsockopt
+99 common shutdown sys_shutdown
+100 common bind sys_bind
+101 common connect sys_connect
+102 common listen sys_listen
+103 common accept sys_accept
+104 common getsockname sys_getsockname
+105 common getpeername sys_getpeername
+106 common sendmsg sys_sendmsg
+107 common recvmsg sys_recvmsg
+108 common send sys_send
+109 common recv sys_recv
+110 common sendto sys_sendto
+111 common recvfrom sys_recvfrom
+112 common socketpair sys_socketpair
+113 common sendfile sys_sendfile
+114 common sendfile64 sys_sendfile64
+115 common sendmmsg sys_sendmmsg
+# Process Operations
+116 common clone sys_clone
+117 common execve sys_execve
+118 common exit sys_exit
+119 common exit_group sys_exit_group
+120 common getpid sys_getpid
+121 common wait4 sys_wait4
+122 common waitid sys_waitid
+123 common kill sys_kill
+124 common tkill sys_tkill
+125 common tgkill sys_tgkill
+126 common set_tid_address sys_set_tid_address
+127 common gettid sys_gettid
+128 common setsid sys_setsid
+129 common getsid sys_getsid
+130 common prctl sys_prctl
+131 common personality sys_personality
+132 common getpriority sys_getpriority
+133 common setpriority sys_setpriority
+134 common setitimer sys_setitimer
+135 common getitimer sys_getitimer
+136 common setuid sys_setuid
+137 common getuid sys_getuid
+138 common setgid sys_setgid
+139 common getgid sys_getgid
+140 common geteuid sys_geteuid
+141 common getegid sys_getegid
+142 common setreuid sys_setreuid
+143 common setregid sys_setregid
+144 common setresuid sys_setresuid
+145 common getresuid sys_getresuid
+146 common setresgid sys_setresgid
+147 common getresgid sys_getresgid
+148 common setpgid sys_setpgid
+149 common getpgid sys_getpgid
+150 common getppid sys_getppid
+151 common getpgrp sys_getpgrp
+# 152 was set_thread_area
+152 common reserved152 sys_ni_syscall
+# 153 was get_thread_area
+153 common reserved153 sys_ni_syscall
+154 common times sys_times
+155 common acct sys_acct
+156 common sched_setaffinity sys_sched_setaffinity
+157 common sched_getaffinity sys_sched_getaffinity
+158 common capget sys_capget
+159 common capset sys_capset
+160 common ptrace sys_ptrace
+161 common semtimedop sys_semtimedop_time32
+162 common semget sys_semget
+163 common semop sys_semop
+164 common semctl sys_old_semctl
+165 common available165 sys_ni_syscall
+166 common msgget sys_msgget
+167 common msgsnd sys_msgsnd
+168 common msgrcv sys_msgrcv
+169 common msgctl sys_old_msgctl
+170 common available170 sys_ni_syscall
+# File System
+171 common umount2 sys_umount
+172 common mount sys_mount
+173 common swapon sys_swapon
+174 common chroot sys_chroot
+175 common pivot_root sys_pivot_root
+176 common umount sys_oldumount
+177 common swapoff sys_swapoff
+178 common sync sys_sync
+179 common syncfs sys_syncfs
+180 common setfsuid sys_setfsuid
+181 common setfsgid sys_setfsgid
+182 common sysfs sys_sysfs
+183 common ustat sys_ustat
+184 common statfs sys_statfs
+185 common fstatfs sys_fstatfs
+186 common statfs64 sys_statfs64
+187 common fstatfs64 sys_fstatfs64
+# System
+188 common setrlimit sys_setrlimit
+189 common getrlimit sys_getrlimit
+190 common getrusage sys_getrusage
+191 common futex sys_futex_time32
+192 common gettimeofday sys_gettimeofday
+193 common settimeofday sys_settimeofday
+194 common adjtimex sys_adjtimex_time32
+195 common nanosleep sys_nanosleep_time32
+196 common getgroups sys_getgroups
+197 common setgroups sys_setgroups
+198 common sethostname sys_sethostname
+199 common setdomainname sys_setdomainname
+200 common syslog sys_syslog
+201 common vhangup sys_vhangup
+202 common uselib sys_uselib
+203 common reboot sys_reboot
+204 common quotactl sys_quotactl
+# 205 was old nfsservctl
+205 common nfsservctl sys_ni_syscall
+206 common _sysctl sys_ni_syscall
+207 common bdflush sys_ni_syscall
+208 common uname sys_newuname
+209 common sysinfo sys_sysinfo
+210 common init_module sys_init_module
+211 common delete_module sys_delete_module
+212 common sched_setparam sys_sched_setparam
+213 common sched_getparam sys_sched_getparam
+214 common sched_setscheduler sys_sched_setscheduler
+215 common sched_getscheduler sys_sched_getscheduler
+216 common sched_get_priority_max sys_sched_get_priority_max
+217 common sched_get_priority_min sys_sched_get_priority_min
+218 common sched_rr_get_interval sys_sched_rr_get_interval_time32
+219 common sched_yield sys_sched_yield
+222 common available222 sys_ni_syscall
+# Signal Handling
+223 common restart_syscall sys_restart_syscall
+224 common sigaltstack sys_sigaltstack
+225 common rt_sigreturn xtensa_rt_sigreturn
+226 common rt_sigaction sys_rt_sigaction
+227 common rt_sigprocmask sys_rt_sigprocmask
+228 common rt_sigpending sys_rt_sigpending
+229 common rt_sigtimedwait sys_rt_sigtimedwait_time32
+230 common rt_sigqueueinfo sys_rt_sigqueueinfo
+231 common rt_sigsuspend sys_rt_sigsuspend
+# Message
+232 common mq_open sys_mq_open
+233 common mq_unlink sys_mq_unlink
+234 common mq_timedsend sys_mq_timedsend_time32
+235 common mq_timedreceive sys_mq_timedreceive_time32
+236 common mq_notify sys_mq_notify
+237 common mq_getsetattr sys_mq_getsetattr
+238 common available238 sys_ni_syscall
+239 common io_setup sys_io_setup
+# IO
+240 common io_destroy sys_io_destroy
+241 common io_submit sys_io_submit
+242 common io_getevents sys_io_getevents_time32
+243 common io_cancel sys_io_cancel
+244 common clock_settime sys_clock_settime32
+245 common clock_gettime sys_clock_gettime32
+246 common clock_getres sys_clock_getres_time32
+247 common clock_nanosleep sys_clock_nanosleep_time32
+# Timer
+248 common timer_create sys_timer_create
+249 common timer_delete sys_timer_delete
+250 common timer_settime sys_timer_settime32
+251 common timer_gettime sys_timer_gettime32
+252 common timer_getoverrun sys_timer_getoverrun
+# System
+253 common reserved253 sys_ni_syscall
+254 common lookup_dcookie sys_ni_syscall
+255 common available255 sys_ni_syscall
+256 common add_key sys_add_key
+257 common request_key sys_request_key
+258 common keyctl sys_keyctl
+259 common available259 sys_ni_syscall
+260 common readahead sys_readahead
+261 common remap_file_pages sys_remap_file_pages
+262 common migrate_pages sys_migrate_pages
+263 common mbind sys_mbind
+264 common get_mempolicy sys_get_mempolicy
+265 common set_mempolicy sys_set_mempolicy
+266 common unshare sys_unshare
+267 common move_pages sys_move_pages
+268 common splice sys_splice
+269 common tee sys_tee
+270 common vmsplice sys_vmsplice
+271 common available271 sys_ni_syscall
+272 common pselect6 sys_pselect6_time32
+273 common ppoll sys_ppoll_time32
+274 common epoll_pwait sys_epoll_pwait
+275 common epoll_create1 sys_epoll_create1
+276 common inotify_init sys_inotify_init
+277 common inotify_add_watch sys_inotify_add_watch
+278 common inotify_rm_watch sys_inotify_rm_watch
+279 common inotify_init1 sys_inotify_init1
+280 common getcpu sys_getcpu
+281 common kexec_load sys_ni_syscall
+282 common ioprio_set sys_ioprio_set
+283 common ioprio_get sys_ioprio_get
+284 common set_robust_list sys_set_robust_list
+285 common get_robust_list sys_get_robust_list
+286 common available286 sys_ni_syscall
+287 common available287 sys_ni_syscall
+# Relative File Operations
+288 common openat sys_openat
+289 common mkdirat sys_mkdirat
+290 common mknodat sys_mknodat
+291 common unlinkat sys_unlinkat
+292 common renameat sys_renameat
+293 common linkat sys_linkat
+294 common symlinkat sys_symlinkat
+295 common readlinkat sys_readlinkat
+296 common utimensat sys_utimensat_time32
+297 common fchownat sys_fchownat
+298 common futimesat sys_futimesat_time32
+299 common fstatat64 sys_fstatat64
+300 common fchmodat sys_fchmodat
+301 common faccessat sys_faccessat
+302 common available302 sys_ni_syscall
+303 common available303 sys_ni_syscall
+304 common signalfd sys_signalfd
+# 305 was timerfd
+306 common eventfd sys_eventfd
+307 common recvmmsg sys_recvmmsg_time32
+308 common setns sys_setns
+309 common signalfd4 sys_signalfd4
+310 common dup3 sys_dup3
+311 common pipe2 sys_pipe2
+312 common timerfd_create sys_timerfd_create
+313 common timerfd_settime sys_timerfd_settime32
+314 common timerfd_gettime sys_timerfd_gettime32
+315 common available315 sys_ni_syscall
+316 common eventfd2 sys_eventfd2
+317 common preadv sys_preadv
+318 common pwritev sys_pwritev
+319 common available319 sys_ni_syscall
+320 common fanotify_init sys_fanotify_init
+321 common fanotify_mark sys_fanotify_mark
+322 common process_vm_readv sys_process_vm_readv
+323 common process_vm_writev sys_process_vm_writev
+324 common name_to_handle_at sys_name_to_handle_at
+325 common open_by_handle_at sys_open_by_handle_at
+326 common sync_file_range2 sys_sync_file_range2
+327 common perf_event_open sys_perf_event_open
+328 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo
+329 common clock_adjtime sys_clock_adjtime32
+330 common prlimit64 sys_prlimit64
+331 common kcmp sys_kcmp
+332 common finit_module sys_finit_module
+333 common accept4 sys_accept4
+334 common sched_setattr sys_sched_setattr
+335 common sched_getattr sys_sched_getattr
+336 common renameat2 sys_renameat2
+337 common seccomp sys_seccomp
+338 common getrandom sys_getrandom
+339 common memfd_create sys_memfd_create
+340 common bpf sys_bpf
+341 common execveat sys_execveat
+342 common userfaultfd sys_userfaultfd
+343 common membarrier sys_membarrier
+344 common mlock2 sys_mlock2
+345 common copy_file_range sys_copy_file_range
+346 common preadv2 sys_preadv2
+347 common pwritev2 sys_pwritev2
+348 common pkey_mprotect sys_pkey_mprotect
+349 common pkey_alloc sys_pkey_alloc
+350 common pkey_free sys_pkey_free
+351 common statx sys_statx
+352 common rseq sys_rseq
+# 353 through 402 are unassigned to sync up with generic numbers
+403 common clock_gettime64 sys_clock_gettime
+404 common clock_settime64 sys_clock_settime
+405 common clock_adjtime64 sys_clock_adjtime
+406 common clock_getres_time64 sys_clock_getres
+407 common clock_nanosleep_time64 sys_clock_nanosleep
+408 common timer_gettime64 sys_timer_gettime
+409 common timer_settime64 sys_timer_settime
+410 common timerfd_gettime64 sys_timerfd_gettime
+411 common timerfd_settime64 sys_timerfd_settime
+412 common utimensat_time64 sys_utimensat
+413 common pselect6_time64 sys_pselect6
+414 common ppoll_time64 sys_ppoll
+416 common io_pgetevents_time64 sys_io_pgetevents
+417 common recvmmsg_time64 sys_recvmmsg
+418 common mq_timedsend_time64 sys_mq_timedsend
+419 common mq_timedreceive_time64 sys_mq_timedreceive
+420 common semtimedop_time64 sys_semtimedop
+421 common rt_sigtimedwait_time64 sys_rt_sigtimedwait
+422 common futex_time64 sys_futex
+423 common sched_rr_get_interval_time64 sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+435 common clone3 sys_clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+# 447 reserved for memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/xtensa/include/syscall_table.h b/tools/perf/arch/xtensa/include/syscall_table.h
new file mode 100644
index 000000000000..4c942821662d
--- /dev/null
+++ b/tools/perf/arch/xtensa/include/syscall_table.h
@@ -0,0 +1,2 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#include <asm/syscalls_32.h>
diff --git a/tools/perf/bench/epoll-wait.c b/tools/perf/bench/epoll-wait.c
index ef5c4257844d..20fe4f72b4af 100644
--- a/tools/perf/bench/epoll-wait.c
+++ b/tools/perf/bench/epoll-wait.c
@@ -420,7 +420,12 @@ static int cmpworker(const void *p1, const void *p2)
struct worker *w1 = (struct worker *) p1;
struct worker *w2 = (struct worker *) p2;
- return w1->tid > w2->tid;
+
+ if (w1->tid > w2->tid)
+ return 1;
+ if (w1->tid < w2->tid)
+ return -1;
+ return 0;
}
int bench_epoll_wait(int argc, const char **argv)
diff --git a/tools/perf/bench/inject-buildid.c b/tools/perf/bench/inject-buildid.c
index a759eb2328be..f55c07e4be94 100644
--- a/tools/perf/bench/inject-buildid.c
+++ b/tools/perf/bench/inject-buildid.c
@@ -52,7 +52,7 @@ struct bench_dso {
static int nr_dsos;
static struct bench_dso *dsos;
-extern int cmd_inject(int argc, const char *argv[]);
+extern int main(int argc, const char **argv);
static const struct option options[] = {
OPT_UINTEGER('i', "iterations", &iterations,
@@ -294,7 +294,7 @@ static int setup_injection(struct bench_data *data, bool build_id_all)
if (data->pid == 0) {
const char **inject_argv;
- int inject_argc = 2;
+ int inject_argc = 3;
close(data->input_pipe[1]);
close(data->output_pipe[0]);
@@ -318,15 +318,16 @@ static int setup_injection(struct bench_data *data, bool build_id_all)
if (inject_argv == NULL)
exit(1);
- inject_argv[0] = strdup("inject");
- inject_argv[1] = strdup("-b");
+ inject_argv[0] = strdup("perf");
+ inject_argv[1] = strdup("inject");
+ inject_argv[2] = strdup("-b");
if (build_id_all)
- inject_argv[2] = strdup("--buildid-all");
+ inject_argv[3] = strdup("--buildid-all");
/* signal that we're ready to go */
close(ready_pipe[1]);
- cmd_inject(inject_argc, inject_argv);
+ main(inject_argc, inject_argv);
exit(0);
}
diff --git a/tools/perf/builtin-annotate.c b/tools/perf/builtin-annotate.c
index bb87e6e7687d..836ae0122dab 100644
--- a/tools/perf/builtin-annotate.c
+++ b/tools/perf/builtin-annotate.c
@@ -7,6 +7,7 @@
* a histogram of results, along various sorting keys.
*/
#include "builtin.h"
+#include "perf.h"
#include "util/color.h"
#include <linux/list.h>
diff --git a/tools/perf/builtin-check.c b/tools/perf/builtin-check.c
index 2346536a5ee1..61a11a9b4e75 100644
--- a/tools/perf/builtin-check.c
+++ b/tools/perf/builtin-check.c
@@ -31,7 +31,6 @@ struct feature_status supported_features[] = {
FEATURE_STATUS("dwarf_getlocations", HAVE_LIBDW_SUPPORT),
FEATURE_STATUS("dwarf-unwind", HAVE_DWARF_UNWIND_SUPPORT),
FEATURE_STATUS("auxtrace", HAVE_AUXTRACE_SUPPORT),
- FEATURE_STATUS("libaudit", HAVE_LIBAUDIT_SUPPORT),
FEATURE_STATUS("libbfd", HAVE_LIBBFD_SUPPORT),
FEATURE_STATUS("libcapstone", HAVE_LIBCAPSTONE_SUPPORT),
FEATURE_STATUS("libcrypto", HAVE_LIBCRYPTO_SUPPORT),
@@ -47,7 +46,6 @@ struct feature_status supported_features[] = {
FEATURE_STATUS("libunwind", HAVE_LIBUNWIND_SUPPORT),
FEATURE_STATUS("lzma", HAVE_LZMA_SUPPORT),
FEATURE_STATUS("numa_num_possible_cpus", HAVE_LIBNUMA_SUPPORT),
- FEATURE_STATUS("syscall_table", HAVE_SYSCALL_TABLE_SUPPORT),
FEATURE_STATUS("zlib", HAVE_ZLIB_SUPPORT),
FEATURE_STATUS("zstd", HAVE_ZSTD_SUPPORT),
diff --git a/tools/perf/builtin-config.c b/tools/perf/builtin-config.c
index 2e8363778935..45b5312fbe83 100644
--- a/tools/perf/builtin-config.c
+++ b/tools/perf/builtin-config.c
@@ -154,6 +154,44 @@ static int parse_config_arg(char *arg, char **var, char **value)
return 0;
}
+int perf_config__set_variable(const char *var, const char *value)
+{
+ char path[PATH_MAX];
+ char *user_config = mkpath(path, sizeof(path), "%s/.perfconfig", getenv("HOME"));
+ const char *config_filename;
+ struct perf_config_set *set;
+ int ret = -1;
+
+ if (use_system_config)
+ config_exclusive_filename = perf_etc_perfconfig();
+ else if (use_user_config)
+ config_exclusive_filename = user_config;
+
+ if (!config_exclusive_filename)
+ config_filename = user_config;
+ else
+ config_filename = config_exclusive_filename;
+
+ set = perf_config_set__new();
+ if (!set)
+ goto out_err;
+
+ if (perf_config_set__collect(set, config_filename, var, value) < 0) {
+ pr_err("Failed to add '%s=%s'\n", var, value);
+ goto out_err;
+ }
+
+ if (set_config(set, config_filename) < 0) {
+ pr_err("Failed to set the configs on %s\n", config_filename);
+ goto out_err;
+ }
+
+ ret = 0;
+out_err:
+ perf_config_set__delete(set);
+ return ret;
+}
+
int cmd_config(int argc, const char **argv)
{
int i, ret = -1;
diff --git a/tools/perf/builtin-diff.c b/tools/perf/builtin-diff.c
index 82fb7773e03e..ae490d58af92 100644
--- a/tools/perf/builtin-diff.c
+++ b/tools/perf/builtin-diff.c
@@ -6,6 +6,7 @@
* DSOs and symbol information, sort them and produce a diff.
*/
#include "builtin.h"
+#include "perf.h"
#include "util/debug.h"
#include "util/event.h"
@@ -1019,12 +1020,12 @@ static int process_base_stream(struct data__file *data_base,
continue;
es_base = evsel_streams__entry(data_base->evlist_streams,
- evsel_base->core.idx);
+ evsel_base);
if (!es_base)
return -1;
es_pair = evsel_streams__entry(data_pair->evlist_streams,
- evsel_pair->core.idx);
+ evsel_pair);
if (!es_pair)
return -1;
diff --git a/tools/perf/builtin-ftrace.c b/tools/perf/builtin-ftrace.c
index 272d3c70810e..cfd770ec7286 100644
--- a/tools/perf/builtin-ftrace.c
+++ b/tools/perf/builtin-ftrace.c
@@ -43,6 +43,8 @@
static volatile sig_atomic_t workload_exec_errno;
static volatile sig_atomic_t done;
+static struct stats latency_stats; /* for tracepoints */
+
static void sig_handler(int sig __maybe_unused)
{
done = true;
@@ -726,9 +728,11 @@ out:
return (done && !workload_exec_errno) ? 0 : -1;
}
-static void make_histogram(int buckets[], char *buf, size_t len, char *linebuf,
- bool use_nsec)
+static void make_histogram(struct perf_ftrace *ftrace, int buckets[],
+ char *buf, size_t len, char *linebuf)
{
+ int min_latency = ftrace->min_latency;
+ int max_latency = ftrace->max_latency;
char *p, *q;
char *unit;
double num;
@@ -774,16 +778,34 @@ static void make_histogram(int buckets[], char *buf, size_t len, char *linebuf,
if (!unit || strncmp(unit, " us", 3))
goto next;
- if (use_nsec)
+ if (ftrace->use_nsec)
num *= 1000;
- i = log2(num);
- if (i < 0)
- i = 0;
+ i = 0;
+ if (num < min_latency)
+ goto do_inc;
+
+ num -= min_latency;
+
+ if (!ftrace->bucket_range) {
+ i = log2(num);
+ if (i < 0)
+ i = 0;
+ } else {
+ // Less than 1 unit (ms or ns), or, in the future,
+ // than the min latency desired.
+ if (num > 0) // 1st entry: [ 1 unit .. bucket_range units ]
+ i = num / ftrace->bucket_range + 1;
+ if (num >= max_latency - min_latency)
+ i = NUM_BUCKET -1;
+ }
if (i >= NUM_BUCKET)
i = NUM_BUCKET - 1;
+ num += min_latency;
+do_inc:
buckets[i]++;
+ update_stats(&latency_stats, num);
next:
/* empty the line buffer for the next output */
@@ -794,8 +816,10 @@ next:
strcat(linebuf, p);
}
-static void display_histogram(int buckets[], bool use_nsec)
+static void display_histogram(struct perf_ftrace *ftrace, int buckets[])
{
+ int min_latency = ftrace->min_latency;
+ bool use_nsec = ftrace->use_nsec;
int i;
int total = 0;
int bar_total = 46; /* to fit in 80 column */
@@ -814,30 +838,74 @@ static void display_histogram(int buckets[], bool use_nsec)
" DURATION ", "COUNT", bar_total, "GRAPH");
bar_len = buckets[0] * bar_total / total;
- printf(" %4d - %-4d %s | %10d | %.*s%*s |\n",
- 0, 1, use_nsec ? "ns" : "us", buckets[0], bar_len, bar, bar_total - bar_len, "");
+
+ printf(" %4d - %4d %s | %10d | %.*s%*s |\n",
+ 0, min_latency ?: 1, use_nsec ? "ns" : "us",
+ buckets[0], bar_len, bar, bar_total - bar_len, "");
for (i = 1; i < NUM_BUCKET - 1; i++) {
- int start = (1 << (i - 1));
- int stop = 1 << i;
+ unsigned int start, stop;
const char *unit = use_nsec ? "ns" : "us";
- if (start >= 1024) {
- start >>= 10;
- stop >>= 10;
- unit = use_nsec ? "us" : "ms";
+ if (!ftrace->bucket_range) {
+ start = (1 << (i - 1));
+ stop = 1 << i;
+
+ if (start >= 1024) {
+ start >>= 10;
+ stop >>= 10;
+ unit = use_nsec ? "us" : "ms";
+ }
+ } else {
+ start = (i - 1) * ftrace->bucket_range + min_latency;
+ stop = i * ftrace->bucket_range + min_latency;
+
+ if (start >= ftrace->max_latency)
+ break;
+ if (stop > ftrace->max_latency)
+ stop = ftrace->max_latency;
+
+ if (start >= 1000) {
+ double dstart = start / 1000.0,
+ dstop = stop / 1000.0;
+ printf(" %4.2f - %-4.2f", dstart, dstop);
+ unit = use_nsec ? "us" : "ms";
+ goto print_bucket_info;
+ }
}
+
+ printf(" %4d - %4d", start, stop);
+print_bucket_info:
bar_len = buckets[i] * bar_total / total;
- printf(" %4d - %-4d %s | %10d | %.*s%*s |\n",
- start, stop, unit, buckets[i], bar_len, bar,
+ printf(" %s | %10d | %.*s%*s |\n", unit, buckets[i], bar_len, bar,
bar_total - bar_len, "");
}
bar_len = buckets[NUM_BUCKET - 1] * bar_total / total;
- printf(" %4d - %-4s %s | %10d | %.*s%*s |\n",
- 1, "...", use_nsec ? "ms" : " s", buckets[NUM_BUCKET - 1],
+ if (!ftrace->bucket_range) {
+ printf(" %4d - %-4s %s", 1, "...", use_nsec ? "ms" : "s ");
+ } else {
+ unsigned int upper_outlier = (NUM_BUCKET - 2) * ftrace->bucket_range + min_latency;
+ if (upper_outlier > ftrace->max_latency)
+ upper_outlier = ftrace->max_latency;
+
+ if (upper_outlier >= 1000) {
+ double dstart = upper_outlier / 1000.0;
+
+ printf(" %4.2f - %-4s %s", dstart, "...", use_nsec ? "us" : "ms");
+ } else {
+ printf(" %4d - %4s %s", upper_outlier, "...", use_nsec ? "ns" : "us");
+ }
+ }
+ printf(" | %10d | %.*s%*s |\n", buckets[NUM_BUCKET - 1],
bar_len, bar, bar_total - bar_len, "");
+ printf("\n# statistics (in %s)\n", ftrace->use_nsec ? "nsec" : "usec");
+ printf(" total time: %20.0f\n", latency_stats.mean * latency_stats.n);
+ printf(" avg time: %20.0f\n", latency_stats.mean);
+ printf(" max time: %20"PRIu64"\n", latency_stats.max);
+ printf(" min time: %20"PRIu64"\n", latency_stats.min);
+ printf(" count: %20.0f\n", latency_stats.n);
}
static int prepare_func_latency(struct perf_ftrace *ftrace)
@@ -876,6 +944,8 @@ static int prepare_func_latency(struct perf_ftrace *ftrace)
if (fd < 0)
pr_err("failed to open trace_pipe\n");
+ init_stats(&latency_stats);
+
put_tracing_file(trace_file);
return fd;
}
@@ -905,7 +975,7 @@ static int stop_func_latency(struct perf_ftrace *ftrace)
static int read_func_latency(struct perf_ftrace *ftrace, int buckets[])
{
if (ftrace->target.use_bpf)
- return perf_ftrace__latency_read_bpf(ftrace, buckets);
+ return perf_ftrace__latency_read_bpf(ftrace, buckets, &latency_stats);
return 0;
}
@@ -951,7 +1021,7 @@ static int __cmd_latency(struct perf_ftrace *ftrace)
if (n < 0)
break;
- make_histogram(buckets, buf, n, line, ftrace->use_nsec);
+ make_histogram(ftrace, buckets, buf, n, line);
}
}
@@ -968,12 +1038,12 @@ static int __cmd_latency(struct perf_ftrace *ftrace)
int n = read(trace_fd, buf, sizeof(buf) - 1);
if (n <= 0)
break;
- make_histogram(buckets, buf, n, line, ftrace->use_nsec);
+ make_histogram(ftrace, buckets, buf, n, line);
}
read_func_latency(ftrace, buckets);
- display_histogram(buckets, ftrace->use_nsec);
+ display_histogram(ftrace, buckets);
out:
close(trace_fd);
@@ -996,6 +1066,7 @@ static int prepare_func_profile(struct perf_ftrace *ftrace)
{
ftrace->tracer = "function_graph";
ftrace->graph_tail = 1;
+ ftrace->graph_verbose = 0;
ftrace->profile_hash = hashmap__new(profile_hash, profile_equal, NULL);
if (ftrace->profile_hash == NULL)
@@ -1151,8 +1222,9 @@ static int cmp_profile_data(const void *a, const void *b)
if (v1 > v2)
return -1;
- else
+ if (v1 < v2)
return 1;
+ return 0;
}
static void print_profile_result(struct perf_ftrace *ftrace)
@@ -1557,6 +1629,12 @@ int cmd_ftrace(int argc, const char **argv)
#endif
OPT_BOOLEAN('n', "use-nsec", &ftrace.use_nsec,
"Use nano-second histogram"),
+ OPT_UINTEGER(0, "bucket-range", &ftrace.bucket_range,
+ "Bucket range in ms or ns (-n/--use-nsec), default is log2() mode"),
+ OPT_UINTEGER(0, "min-latency", &ftrace.min_latency,
+ "Minimum latency (1st bucket). Works only with --bucket-range."),
+ OPT_UINTEGER(0, "max-latency", &ftrace.max_latency,
+ "Maximum latency (last bucket). Works only with --bucket-range and total buckets less than 22."),
OPT_PARENT(common_options),
};
const struct option profile_options[] = {
@@ -1575,6 +1653,9 @@ int cmd_ftrace(int argc, const char **argv)
OPT_CALLBACK('s', "sort", &profile_sort, "key",
"Sort result by key: total (default), avg, max, count, name.",
parse_sort_key),
+ OPT_CALLBACK(0, "graph-opts", &ftrace, "options",
+ "Graph tracer options, available options: nosleep-time,noirqs,thresh=<n>,depth=<n>",
+ parse_graph_tracer_opts),
OPT_PARENT(common_options),
};
const struct option *options = ftrace_options;
@@ -1652,6 +1733,29 @@ int cmd_ftrace(int argc, const char **argv)
ret = -EINVAL;
goto out_delete_filters;
}
+ if (!ftrace.bucket_range && ftrace.min_latency) {
+ pr_err("--min-latency works only with --bucket-range\n");
+ parse_options_usage(ftrace_usage, options,
+ "min-latency", /*short_opt=*/false);
+ ret = -EINVAL;
+ goto out_delete_filters;
+ }
+ if (ftrace.bucket_range && !ftrace.min_latency) {
+ /* default min latency should be the bucket range */
+ ftrace.min_latency = ftrace.bucket_range;
+ }
+ if (!ftrace.bucket_range && ftrace.max_latency) {
+ pr_err("--max-latency works only with --bucket-range\n");
+ parse_options_usage(ftrace_usage, options,
+ "max-latency", /*short_opt=*/false);
+ ret = -EINVAL;
+ goto out_delete_filters;
+ }
+ if (ftrace.bucket_range && !ftrace.max_latency) {
+ /* default max latency should depend on bucket range and num_buckets */
+ ftrace.max_latency = (NUM_BUCKET - 2) * ftrace.bucket_range +
+ ftrace.min_latency;
+ }
cmd_func = __cmd_latency;
break;
case PERF_FTRACE_PROFILE:
diff --git a/tools/perf/builtin-help.c b/tools/perf/builtin-help.c
index 0854d3cd9f6a..7be6fb6df595 100644
--- a/tools/perf/builtin-help.c
+++ b/tools/perf/builtin-help.c
@@ -447,9 +447,7 @@ int cmd_help(int argc, const char **argv)
#ifdef HAVE_LIBELF_SUPPORT
"probe",
#endif
-#if defined(HAVE_LIBAUDIT_SUPPORT) || defined(HAVE_SYSCALL_TABLE_SUPPORT)
"trace",
-#endif
NULL };
const char *builtin_help_usage[] = {
"perf help [--all] [--man|--web|--info] [command]",
diff --git a/tools/perf/builtin-inject.c b/tools/perf/builtin-inject.c
index d6989195a061..11e49cafa3af 100644
--- a/tools/perf/builtin-inject.c
+++ b/tools/perf/builtin-inject.c
@@ -2367,10 +2367,10 @@ int cmd_inject(int argc, const char **argv)
};
int ret;
const char *known_build_ids = NULL;
- bool build_ids;
- bool build_id_all;
- bool mmap2_build_ids;
- bool mmap2_build_id_all;
+ bool build_ids = false;
+ bool build_id_all = false;
+ bool mmap2_build_ids = false;
+ bool mmap2_build_id_all = false;
struct option options[] = {
OPT_BOOLEAN('b', "build-ids", &build_ids,
diff --git a/tools/perf/builtin-kmem.c b/tools/perf/builtin-kmem.c
index 4d8d94146f8d..67fb1946ef13 100644
--- a/tools/perf/builtin-kmem.c
+++ b/tools/perf/builtin-kmem.c
@@ -761,6 +761,7 @@ static int parse_gfp_flags(struct evsel *evsel, struct perf_sample *sample,
};
struct trace_seq seq;
char *str, *pos = NULL;
+ const struct tep_event *tp_format;
if (nr_gfps) {
struct gfp_flag key = {
@@ -772,8 +773,9 @@ static int parse_gfp_flags(struct evsel *evsel, struct perf_sample *sample,
}
trace_seq_init(&seq);
- tep_print_event(evsel->tp_format->tep,
- &seq, &record, "%s", TEP_PRINT_INFO);
+ tp_format = evsel__tp_format(evsel);
+ if (tp_format)
+ tep_print_event(tp_format->tep, &seq, &record, "%s", TEP_PRINT_INFO);
str = strtok_r(seq.buffer, " ", &pos);
while (str) {
@@ -2012,13 +2014,13 @@ int cmd_kmem(int argc, const char **argv)
if (kmem_page) {
struct evsel *evsel = evlist__find_tracepoint_by_name(session->evlist, "kmem:mm_page_alloc");
+ const struct tep_event *tp_format = evsel ? evsel__tp_format(evsel) : NULL;
- if (evsel == NULL) {
+ if (tp_format == NULL) {
pr_err(errmsg, "page", "page");
goto out_delete;
}
-
- kmem_page_size = tep_get_page_size(evsel->tp_format->tep);
+ kmem_page_size = tep_get_page_size(tp_format->tep);
symbol_conf.use_callchain = true;
}
diff --git a/tools/perf/builtin-kvm.c b/tools/perf/builtin-kvm.c
index 274568d712d1..67fd2b006b0b 100644
--- a/tools/perf/builtin-kvm.c
+++ b/tools/perf/builtin-kvm.c
@@ -615,67 +615,6 @@ static const char *get_filename_for_perf_kvm(void)
#if defined(HAVE_KVM_STAT_SUPPORT) && defined(HAVE_LIBTRACEEVENT)
-void exit_event_get_key(struct evsel *evsel,
- struct perf_sample *sample,
- struct event_key *key)
-{
- key->info = 0;
- key->key = evsel__intval(evsel, sample, kvm_exit_reason);
-}
-
-bool kvm_exit_event(struct evsel *evsel)
-{
- return evsel__name_is(evsel, kvm_exit_trace);
-}
-
-bool exit_event_begin(struct evsel *evsel,
- struct perf_sample *sample, struct event_key *key)
-{
- if (kvm_exit_event(evsel)) {
- exit_event_get_key(evsel, sample, key);
- return true;
- }
-
- return false;
-}
-
-bool kvm_entry_event(struct evsel *evsel)
-{
- return evsel__name_is(evsel, kvm_entry_trace);
-}
-
-bool exit_event_end(struct evsel *evsel,
- struct perf_sample *sample __maybe_unused,
- struct event_key *key __maybe_unused)
-{
- return kvm_entry_event(evsel);
-}
-
-static const char *get_exit_reason(struct perf_kvm_stat *kvm,
- struct exit_reasons_table *tbl,
- u64 exit_code)
-{
- while (tbl->reason != NULL) {
- if (tbl->exit_code == exit_code)
- return tbl->reason;
- tbl++;
- }
-
- pr_err("unknown kvm exit code:%lld on %s\n",
- (unsigned long long)exit_code, kvm->exit_reasons_isa);
- return "UNKNOWN";
-}
-
-void exit_event_decode_key(struct perf_kvm_stat *kvm,
- struct event_key *key,
- char *decode)
-{
- const char *exit_reason = get_exit_reason(kvm, key->exit_reasons,
- key->key);
-
- scnprintf(decode, KVM_EVENT_NAME_LEN, "%s", exit_reason);
-}
-
static bool register_kvm_events_ops(struct perf_kvm_stat *kvm)
{
struct kvm_reg_events_ops *events_ops = kvm_reg_events_ops;
diff --git a/tools/perf/builtin-kwork.c b/tools/perf/builtin-kwork.c
index 8234410cba4c..c41a68d073de 100644
--- a/tools/perf/builtin-kwork.c
+++ b/tools/perf/builtin-kwork.c
@@ -6,6 +6,7 @@
*/
#include "builtin.h"
+#include "perf.h"
#include "util/data.h"
#include "util/evlist.h"
@@ -1103,7 +1104,8 @@ static char *evsel__softirq_name(struct evsel *evsel, u64 num)
char *name = NULL;
bool found = false;
struct tep_print_flag_sym *sym = NULL;
- struct tep_print_arg *args = evsel->tp_format->print_fmt.args;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_print_arg *args = tp_format ? tp_format->print_fmt.args : NULL;
if ((args == NULL) || (args->next == NULL))
return NULL;
@@ -1846,7 +1848,7 @@ static void process_skipped_events(struct perf_kwork *kwork,
}
}
-struct kwork_work *perf_kwork_add_work(struct perf_kwork *kwork,
+static struct kwork_work *perf_kwork_add_work(struct perf_kwork *kwork,
struct kwork_class *class,
struct kwork_work *key)
{
@@ -2344,6 +2346,7 @@ int cmd_kwork(int argc, const char **argv)
.all_runtime = 0,
.all_count = 0,
.nr_skipped_events = { 0 },
+ .add_work = perf_kwork_add_work,
};
static const char default_report_sort_order[] = "runtime, max, count";
static const char default_latency_sort_order[] = "avg, max, count";
diff --git a/tools/perf/builtin-lock.c b/tools/perf/builtin-lock.c
index 062e2b56a2ab..5d405cd8e696 100644
--- a/tools/perf/builtin-lock.c
+++ b/tools/perf/builtin-lock.c
@@ -46,15 +46,6 @@
static struct perf_session *session;
static struct target target;
-/* based on kernel/lockdep.c */
-#define LOCKHASH_BITS 12
-#define LOCKHASH_SIZE (1UL << LOCKHASH_BITS)
-
-static struct hlist_head *lockhash_table;
-
-#define __lockhashfn(key) hash_long((unsigned long)key, LOCKHASH_BITS)
-#define lockhashentry(key) (lockhash_table + __lockhashfn((key)))
-
static struct rb_root thread_stats;
static bool combine_locks;
@@ -67,24 +58,13 @@ static unsigned long bpf_map_entries = MAX_ENTRIES;
static int max_stack_depth = CONTENTION_STACK_DEPTH;
static int stack_skip = CONTENTION_STACK_SKIP;
static int print_nr_entries = INT_MAX / 2;
-static LIST_HEAD(callstack_filters);
static const char *output_name = NULL;
static FILE *lock_output;
-struct callstack_filter {
- struct list_head list;
- char name[];
-};
-
static struct lock_filter filters;
static enum lock_aggr_mode aggr_mode = LOCK_AGGR_ADDR;
-static bool needs_callstack(void)
-{
- return !list_empty(&callstack_filters);
-}
-
static struct thread_stat *thread_stat_find(u32 tid)
{
struct rb_node *node;
@@ -477,93 +457,6 @@ static struct lock_stat *pop_from_result(void)
return container_of(node, struct lock_stat, rb);
}
-struct lock_stat *lock_stat_find(u64 addr)
-{
- struct hlist_head *entry = lockhashentry(addr);
- struct lock_stat *ret;
-
- hlist_for_each_entry(ret, entry, hash_entry) {
- if (ret->addr == addr)
- return ret;
- }
- return NULL;
-}
-
-struct lock_stat *lock_stat_findnew(u64 addr, const char *name, int flags)
-{
- struct hlist_head *entry = lockhashentry(addr);
- struct lock_stat *ret, *new;
-
- hlist_for_each_entry(ret, entry, hash_entry) {
- if (ret->addr == addr)
- return ret;
- }
-
- new = zalloc(sizeof(struct lock_stat));
- if (!new)
- goto alloc_failed;
-
- new->addr = addr;
- new->name = strdup(name);
- if (!new->name) {
- free(new);
- goto alloc_failed;
- }
-
- new->flags = flags;
- new->wait_time_min = ULLONG_MAX;
-
- hlist_add_head(&new->hash_entry, entry);
- return new;
-
-alloc_failed:
- pr_err("memory allocation failed\n");
- return NULL;
-}
-
-bool match_callstack_filter(struct machine *machine, u64 *callstack)
-{
- struct map *kmap;
- struct symbol *sym;
- u64 ip;
- const char *arch = perf_env__arch(machine->env);
-
- if (list_empty(&callstack_filters))
- return true;
-
- for (int i = 0; i < max_stack_depth; i++) {
- struct callstack_filter *filter;
-
- /*
- * In powerpc, the callchain saved by kernel always includes
- * first three entries as the NIP (next instruction pointer),
- * LR (link register), and the contents of LR save area in the
- * second stack frame. In certain scenarios its possible to have
- * invalid kernel instruction addresses in either LR or the second
- * stack frame's LR. In that case, kernel will store that address as
- * zero.
- *
- * The below check will continue to look into callstack,
- * incase first or second callstack index entry has 0
- * address for powerpc.
- */
- if (!callstack || (!callstack[i] && (strcmp(arch, "powerpc") ||
- (i != 1 && i != 2))))
- break;
-
- ip = callstack[i];
- sym = machine__find_kernel_symbol(machine, ip, &kmap);
- if (sym == NULL)
- continue;
-
- list_for_each_entry(filter, &callstack_filters, list) {
- if (strstr(sym->name, filter->name))
- return true;
- }
- }
- return false;
-}
-
struct trace_lock_handler {
/* it's used on CONFIG_LOCKDEP */
int (*acquire_event)(struct evsel *evsel,
@@ -1165,7 +1058,7 @@ static int report_lock_contention_begin_event(struct evsel *evsel,
if (callstack == NULL)
return -ENOMEM;
- if (!match_callstack_filter(machine, callstack)) {
+ if (!match_callstack_filter(machine, callstack, max_stack_depth)) {
free(callstack);
return 0;
}
@@ -1575,8 +1468,13 @@ static void sort_result(void)
static const struct {
unsigned int flags;
- const char *str;
- const char *name;
+ /*
+ * Name of the lock flags (access), with delimeter ':'.
+ * For example, rwsem:R of rwsem:W.
+ */
+ const char *flags_name;
+ /* Name of the lock (type), for example, rwlock or rwsem. */
+ const char *lock_name;
} lock_type_table[] = {
{ 0, "semaphore", "semaphore" },
{ LCB_F_SPIN, "spinlock", "spinlock" },
@@ -1591,45 +1489,32 @@ static const struct {
{ LCB_F_PERCPU | LCB_F_WRITE, "pcpu-sem:W", "percpu-rwsem" },
{ LCB_F_MUTEX, "mutex", "mutex" },
{ LCB_F_MUTEX | LCB_F_SPIN, "mutex", "mutex" },
- /* alias for get_type_flag() */
- { LCB_F_MUTEX | LCB_F_SPIN, "mutex-spin", "mutex" },
+ /* alias for optimistic spinning only */
+ { LCB_F_MUTEX | LCB_F_SPIN, "mutex:spin", "mutex-spin" },
};
-static const char *get_type_str(unsigned int flags)
+static const char *get_type_flags_name(unsigned int flags)
{
- flags &= LCB_F_MAX_FLAGS - 1;
+ flags &= LCB_F_TYPE_MASK;
for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
if (lock_type_table[i].flags == flags)
- return lock_type_table[i].str;
+ return lock_type_table[i].flags_name;
}
return "unknown";
}
-static const char *get_type_name(unsigned int flags)
+static const char *get_type_lock_name(unsigned int flags)
{
- flags &= LCB_F_MAX_FLAGS - 1;
+ flags &= LCB_F_TYPE_MASK;
for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
if (lock_type_table[i].flags == flags)
- return lock_type_table[i].name;
+ return lock_type_table[i].lock_name;
}
return "unknown";
}
-static unsigned int get_type_flag(const char *str)
-{
- for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
- if (!strcmp(lock_type_table[i].name, str))
- return lock_type_table[i].flags;
- }
- for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
- if (!strcmp(lock_type_table[i].str, str))
- return lock_type_table[i].flags;
- }
- return UINT_MAX;
-}
-
static void lock_filter_finish(void)
{
zfree(&filters.types);
@@ -1646,6 +1531,12 @@ static void lock_filter_finish(void)
zfree(&filters.cgrps);
filters.nr_cgrps = 0;
+
+ for (int i = 0; i < filters.nr_slabs; i++)
+ free(filters.slabs[i]);
+
+ zfree(&filters.slabs);
+ filters.nr_slabs = 0;
}
static void sort_contention_result(void)
@@ -1732,7 +1623,7 @@ static void print_lock_stat_stdio(struct lock_contention *con, struct lock_stat
switch (aggr_mode) {
case LOCK_AGGR_CALLER:
- fprintf(lock_output, " %10s %s\n", get_type_str(st->flags), st->name);
+ fprintf(lock_output, " %10s %s\n", get_type_flags_name(st->flags), st->name);
break;
case LOCK_AGGR_TASK:
pid = st->addr;
@@ -1742,7 +1633,7 @@ static void print_lock_stat_stdio(struct lock_contention *con, struct lock_stat
break;
case LOCK_AGGR_ADDR:
fprintf(lock_output, " %016llx %s (%s)\n", (unsigned long long)st->addr,
- st->name, get_type_name(st->flags));
+ st->name, get_type_lock_name(st->flags));
break;
case LOCK_AGGR_CGROUP:
fprintf(lock_output, " %s\n", st->name);
@@ -1783,7 +1674,7 @@ static void print_lock_stat_csv(struct lock_contention *con, struct lock_stat *s
switch (aggr_mode) {
case LOCK_AGGR_CALLER:
- fprintf(lock_output, "%s%s %s", get_type_str(st->flags), sep, st->name);
+ fprintf(lock_output, "%s%s %s", get_type_flags_name(st->flags), sep, st->name);
if (verbose <= 0)
fprintf(lock_output, "\n");
break;
@@ -1795,7 +1686,7 @@ static void print_lock_stat_csv(struct lock_contention *con, struct lock_stat *s
break;
case LOCK_AGGR_ADDR:
fprintf(lock_output, "%llx%s %s%s %s\n", (unsigned long long)st->addr, sep,
- st->name, sep, get_type_name(st->flags));
+ st->name, sep, get_type_lock_name(st->flags));
break;
case LOCK_AGGR_CGROUP:
fprintf(lock_output, "%s\n",st->name);
@@ -2150,7 +2041,8 @@ static int __cmd_contention(int argc, const char **argv)
goto out_delete;
}
- if (lock_contention_prepare(&con) < 0) {
+ err = lock_contention_prepare(&con);
+ if (err < 0) {
pr_err("lock contention BPF setup failed\n");
goto out_delete;
}
@@ -2171,10 +2063,14 @@ static int __cmd_contention(int argc, const char **argv)
}
}
- if (setup_output_field(true, output_fields))
+ err = setup_output_field(true, output_fields);
+ if (err) {
+ pr_err("Failed to setup output field\n");
goto out_delete;
+ }
- if (select_key(true))
+ err = select_key(true);
+ if (err)
goto out_delete;
if (symbol_conf.field_sep) {
@@ -2350,29 +2246,61 @@ static int parse_lock_type(const struct option *opt __maybe_unused, const char *
int unset __maybe_unused)
{
char *s, *tmp, *tok;
- int ret = 0;
s = strdup(str);
if (s == NULL)
return -1;
for (tok = strtok_r(s, ", ", &tmp); tok; tok = strtok_r(NULL, ", ", &tmp)) {
- unsigned int flags = get_type_flag(tok);
+ bool found = false;
- if (flags == -1U) {
- pr_err("Unknown lock flags: %s\n", tok);
- ret = -1;
- break;
+ /* `tok` is a flags name if it contains ':'. */
+ if (strchr(tok, ':')) {
+ for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
+ if (!strcmp(lock_type_table[i].flags_name, tok) &&
+ add_lock_type(lock_type_table[i].flags)) {
+ found = true;
+ break;
+ }
+ }
+
+ if (!found) {
+ pr_err("Unknown lock flags name: %s\n", tok);
+ free(s);
+ return -1;
+ }
+
+ continue;
}
- if (!add_lock_type(flags)) {
- ret = -1;
- break;
+ /*
+ * Otherwise `tok` is a lock name.
+ * Single lock name could contain multiple flags.
+ * Replace alias `pcpu-sem` with actual name `percpu-rwsem.
+ */
+ if (!strcmp(tok, "pcpu-sem"))
+ tok = (char *)"percpu-rwsem";
+ for (unsigned int i = 0; i < ARRAY_SIZE(lock_type_table); i++) {
+ if (!strcmp(lock_type_table[i].lock_name, tok)) {
+ if (add_lock_type(lock_type_table[i].flags)) {
+ found = true;
+ } else {
+ free(s);
+ return -1;
+ }
+ }
}
+
+ if (!found) {
+ pr_err("Unknown lock name: %s\n", tok);
+ free(s);
+ return -1;
+ }
+
}
free(s);
- return ret;
+ return 0;
}
static bool add_lock_addr(unsigned long addr)
@@ -2412,6 +2340,27 @@ static bool add_lock_sym(char *name)
return true;
}
+static bool add_lock_slab(char *name)
+{
+ char **tmp;
+ char *sym = strdup(name);
+
+ if (sym == NULL) {
+ pr_err("Memory allocation failure\n");
+ return false;
+ }
+
+ tmp = realloc(filters.slabs, (filters.nr_slabs + 1) * sizeof(*filters.slabs));
+ if (tmp == NULL) {
+ pr_err("Memory allocation failure\n");
+ return false;
+ }
+
+ tmp[filters.nr_slabs++] = sym;
+ filters.slabs = tmp;
+ return true;
+}
+
static int parse_lock_addr(const struct option *opt __maybe_unused, const char *str,
int unset __maybe_unused)
{
@@ -2435,6 +2384,14 @@ static int parse_lock_addr(const struct option *opt __maybe_unused, const char *
continue;
}
+ if (*tok == '&') {
+ if (!add_lock_slab(tok + 1)) {
+ ret = -1;
+ break;
+ }
+ continue;
+ }
+
/*
* At this moment, we don't have kernel symbols. Save the symbols
* in a separate list and resolve them to addresses later.
@@ -2449,34 +2406,6 @@ static int parse_lock_addr(const struct option *opt __maybe_unused, const char *
return ret;
}
-static int parse_call_stack(const struct option *opt __maybe_unused, const char *str,
- int unset __maybe_unused)
-{
- char *s, *tmp, *tok;
- int ret = 0;
-
- s = strdup(str);
- if (s == NULL)
- return -1;
-
- for (tok = strtok_r(s, ", ", &tmp); tok; tok = strtok_r(NULL, ", ", &tmp)) {
- struct callstack_filter *entry;
-
- entry = malloc(sizeof(*entry) + strlen(tok) + 1);
- if (entry == NULL) {
- pr_err("Memory allocation failure\n");
- free(s);
- return -1;
- }
-
- strcpy(entry->name, tok);
- list_add_tail(&entry->list, &callstack_filters);
- }
-
- free(s);
- return ret;
-}
-
static int parse_output(const struct option *opt __maybe_unused, const char *str,
int unset __maybe_unused)
{
diff --git a/tools/perf/builtin-mem.c b/tools/perf/builtin-mem.c
index 651188c1d825..99d5e1491a28 100644
--- a/tools/perf/builtin-mem.c
+++ b/tools/perf/builtin-mem.c
@@ -4,6 +4,7 @@
#include <sys/stat.h>
#include <unistd.h>
#include "builtin.h"
+#include "perf.h"
#include <subcmd/parse-options.h>
#include "util/auxtrace.h"
diff --git a/tools/perf/builtin-record.c b/tools/perf/builtin-record.c
index f83252472921..5db1aedf48df 100644
--- a/tools/perf/builtin-record.c
+++ b/tools/perf/builtin-record.c
@@ -860,7 +860,9 @@ static int record__auxtrace_init(struct record *rec)
if (err)
return err;
- auxtrace_regroup_aux_output(rec->evlist);
+ err = auxtrace_parse_aux_action(rec->evlist);
+ if (err)
+ return err;
return auxtrace_parse_filters(rec->evlist);
}
@@ -1748,10 +1750,8 @@ static void record__init_features(struct record *rec)
if (rec->no_buildid)
perf_header__clear_feat(&session->header, HEADER_BUILD_ID);
-#ifdef HAVE_LIBTRACEEVENT
if (!have_tracepoints(&rec->evlist->core.entries))
perf_header__clear_feat(&session->header, HEADER_TRACING_DATA);
-#endif
if (!rec->opts.branch_stack)
perf_header__clear_feat(&session->header, HEADER_BRANCH_STACK);
diff --git a/tools/perf/builtin-report.c b/tools/perf/builtin-report.c
index 048c91960ba9..f5fbd670d619 100644
--- a/tools/perf/builtin-report.c
+++ b/tools/perf/builtin-report.c
@@ -348,11 +348,9 @@ static int process_read_event(const struct perf_tool *tool,
struct report *rep = container_of(tool, struct report, tool);
if (rep->show_threads) {
- const char *name = evsel__name(evsel);
int err = perf_read_values_add_value(&rep->show_threads_values,
event->read.pid, event->read.tid,
- evsel->core.idx,
- name,
+ evsel,
event->read.value);
if (err)
@@ -1422,7 +1420,7 @@ int cmd_report(int argc, const char **argv)
OPT_STRING(0, "addr2line", &addr2line_path, "path",
"addr2line binary to use for line numbers"),
OPT_BOOLEAN(0, "demangle", &symbol_conf.demangle,
- "Disable symbol demangling"),
+ "Symbol demangling. Enabled by default, use --no-demangle to disable."),
OPT_BOOLEAN(0, "demangle-kernel", &symbol_conf.demangle_kernel,
"Enable kernel symbol demangling"),
OPT_BOOLEAN(0, "mem-mode", &report.mem_mode, "mem access profile"),
diff --git a/tools/perf/builtin-sched.c b/tools/perf/builtin-sched.c
index 7049c60ebf77..26ece6e9bfd1 100644
--- a/tools/perf/builtin-sched.c
+++ b/tools/perf/builtin-sched.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
#include "builtin.h"
+#include "perf.h"
#include "perf-sys.h"
#include "util/cpumap.h"
diff --git a/tools/perf/builtin-script.c b/tools/perf/builtin-script.c
index 9e47905f75a6..33667b534634 100644
--- a/tools/perf/builtin-script.c
+++ b/tools/perf/builtin-script.c
@@ -85,15 +85,12 @@ static bool system_wide;
static bool print_flags;
static const char *cpu_list;
static DECLARE_BITMAP(cpu_bitmap, MAX_NR_CPUS);
-static struct perf_stat_config stat_config;
static int max_blocks;
static bool native_arch;
static struct dlfilter *dlfilter;
static int dlargc;
static char **dlargv;
-unsigned int scripting_max_stack = PERF_MAX_STACK_DEPTH;
-
enum perf_output_field {
PERF_OUTPUT_COMM = 1ULL << 0,
PERF_OUTPUT_TID = 1ULL << 1,
@@ -224,6 +221,10 @@ enum {
OUTPUT_TYPE_MAX
};
+// We need to refactor the evsel->priv use in in 'perf script' to allow for
+// using that area, that is being used only in some cases.
+#define OUTPUT_TYPE_UNSET -1
+
/* default set to maintain compatibility with current format */
static struct {
bool user_set;
@@ -397,6 +398,14 @@ static inline int output_type(unsigned int type)
return OUTPUT_TYPE_OTHER;
}
+static inline int evsel__output_type(struct evsel *evsel)
+{
+ if (evsel->script_output_type == OUTPUT_TYPE_UNSET)
+ evsel->script_output_type = output_type(evsel->core.attr.type);
+
+ return evsel->script_output_type;
+}
+
static bool output_set_by_user(void)
{
int j;
@@ -421,13 +430,13 @@ static const char *output_field2str(enum perf_output_field field)
return str;
}
-#define PRINT_FIELD(x) (output[output_type(attr->type)].fields & PERF_OUTPUT_##x)
+#define PRINT_FIELD(x) (output[evsel__output_type(evsel)].fields & PERF_OUTPUT_##x)
static int evsel__do_check_stype(struct evsel *evsel, u64 sample_type, const char *sample_msg,
enum perf_output_field field, bool allow_user_set)
{
struct perf_event_attr *attr = &evsel->core.attr;
- int type = output_type(attr->type);
+ int type = evsel__output_type(evsel);
const char *evname;
if (attr->sample_type & sample_type)
@@ -461,7 +470,6 @@ static int evsel__check_stype(struct evsel *evsel, u64 sample_type, const char *
static int evsel__check_attr(struct evsel *evsel, struct perf_session *session)
{
- struct perf_event_attr *attr = &evsel->core.attr;
bool allow_user_set;
if (evsel__is_dummy_event(evsel))
@@ -578,9 +586,9 @@ static int evsel__check_attr(struct evsel *evsel, struct perf_session *session)
return 0;
}
-static void set_print_ip_opts(struct perf_event_attr *attr)
+static void evsel__set_print_ip_opts(struct evsel *evsel)
{
- unsigned int type = output_type(attr->type);
+ unsigned int type = evsel__output_type(evsel);
output[type].print_ip_opts = 0;
if (PRINT_FIELD(IP))
@@ -610,7 +618,7 @@ static struct evsel *find_first_output_type(struct evlist *evlist,
evlist__for_each_entry(evlist, evsel) {
if (evsel__is_dummy_event(evsel))
continue;
- if (output_type(evsel->core.attr.type) == (int)type)
+ if (evsel__output_type(evsel) == (int)type)
return evsel;
}
return NULL;
@@ -652,7 +660,7 @@ static int perf_session__check_output_opt(struct perf_session *session)
if (output[j].fields & PERF_OUTPUT_DSOFF)
output[j].fields |= PERF_OUTPUT_DSO;
- set_print_ip_opts(&evsel->core.attr);
+ evsel__set_print_ip_opts(evsel);
tod |= output[j].fields & PERF_OUTPUT_TOD;
}
@@ -688,7 +696,7 @@ static int perf_session__check_output_opt(struct perf_session *session)
output[j].fields |= PERF_OUTPUT_SYM;
output[j].fields |= PERF_OUTPUT_SYMOFFSET;
output[j].fields |= PERF_OUTPUT_DSO;
- set_print_ip_opts(&evsel->core.attr);
+ evsel__set_print_ip_opts(evsel);
goto out;
}
}
@@ -792,7 +800,6 @@ static int perf_sample__fprintf_start(struct perf_script *script,
struct evsel *evsel,
u32 type, FILE *fp)
{
- struct perf_event_attr *attr = &evsel->core.attr;
unsigned long secs;
unsigned long long nsecs;
int printed = 0;
@@ -944,7 +951,7 @@ static int print_bstack_flags(FILE *fp, struct branch_entry *br)
static int perf_sample__fprintf_brstack(struct perf_sample *sample,
struct thread *thread,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
struct branch_stack *br = sample->branch_stack;
struct branch_entry *entries = perf_sample__branch_entries(sample);
@@ -983,7 +990,7 @@ static int perf_sample__fprintf_brstack(struct perf_sample *sample,
static int perf_sample__fprintf_brstacksym(struct perf_sample *sample,
struct thread *thread,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
struct branch_stack *br = sample->branch_stack;
struct branch_entry *entries = perf_sample__branch_entries(sample);
@@ -1021,7 +1028,7 @@ static int perf_sample__fprintf_brstacksym(struct perf_sample *sample,
static int perf_sample__fprintf_brstackoff(struct perf_sample *sample,
struct thread *thread,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
struct branch_stack *br = sample->branch_stack;
struct branch_entry *entries = perf_sample__branch_entries(sample);
@@ -1188,7 +1195,7 @@ out:
return ret;
}
-static int any_dump_insn(struct perf_event_attr *attr __maybe_unused,
+static int any_dump_insn(struct evsel *evsel __maybe_unused,
struct perf_insn *x, uint64_t ip,
u8 *inbuf, int inlen, int *lenp,
FILE *fp)
@@ -1216,15 +1223,14 @@ static int add_padding(FILE *fp, int printed, int padding)
static int ip__fprintf_jump(uint64_t ip, struct branch_entry *en,
struct perf_insn *x, u8 *inbuf, int len,
int insn, FILE *fp, int *total_cycles,
- struct perf_event_attr *attr,
- struct thread *thread,
struct evsel *evsel,
+ struct thread *thread,
u64 br_cntr)
{
int ilen = 0;
int printed = fprintf(fp, "\t%016" PRIx64 "\t", ip);
- printed += add_padding(fp, any_dump_insn(attr, x, ip, inbuf, len, &ilen, fp), 30);
+ printed += add_padding(fp, any_dump_insn(evsel, x, ip, inbuf, len, &ilen, fp), 30);
printed += fprintf(fp, "\t");
if (PRINT_FIELD(BRSTACKINSNLEN))
@@ -1280,7 +1286,7 @@ static int ip__fprintf_jump(uint64_t ip, struct branch_entry *en,
static int ip__fprintf_sym(uint64_t addr, struct thread *thread,
u8 cpumode, int cpu, struct symbol **lastsym,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
struct addr_location al;
int off, printed = 0, ret = 0;
@@ -1356,10 +1362,10 @@ static int perf_sample__fprintf_brstackinsn(struct perf_sample *sample,
machine, thread, &x.is64bit, &x.cpumode, false);
if (len > 0) {
printed += ip__fprintf_sym(entries[nr - 1].from, thread,
- x.cpumode, x.cpu, &lastsym, attr, fp);
+ x.cpumode, x.cpu, &lastsym, evsel, fp);
printed += ip__fprintf_jump(entries[nr - 1].from, &entries[nr - 1],
&x, buffer, len, 0, fp, &total_cycles,
- attr, thread, evsel, br_cntr);
+ evsel, thread, br_cntr);
if (PRINT_FIELD(SRCCODE))
printed += print_srccode(thread, x.cpumode, entries[nr - 1].from);
}
@@ -1387,19 +1393,19 @@ static int perf_sample__fprintf_brstackinsn(struct perf_sample *sample,
for (off = 0; off < (unsigned)len; off += ilen) {
uint64_t ip = start + off;
- printed += ip__fprintf_sym(ip, thread, x.cpumode, x.cpu, &lastsym, attr, fp);
+ printed += ip__fprintf_sym(ip, thread, x.cpumode, x.cpu, &lastsym, evsel, fp);
if (ip == end) {
if (PRINT_FIELD(BRCNTR) && sample->branch_stack_cntr)
br_cntr = sample->branch_stack_cntr[i];
printed += ip__fprintf_jump(ip, &entries[i], &x, buffer + off, len - off, ++insn, fp,
- &total_cycles, attr, thread, evsel, br_cntr);
+ &total_cycles, evsel, thread, br_cntr);
if (PRINT_FIELD(SRCCODE))
printed += print_srccode(thread, x.cpumode, ip);
break;
} else {
ilen = 0;
printed += fprintf(fp, "\t%016" PRIx64 "\t", ip);
- printed += any_dump_insn(attr, &x, ip, buffer + off, len - off, &ilen, fp);
+ printed += any_dump_insn(evsel, &x, ip, buffer + off, len - off, &ilen, fp);
if (PRINT_FIELD(BRSTACKINSNLEN))
printed += fprintf(fp, "\tilen: %d", ilen);
printed += fprintf(fp, "\n");
@@ -1438,7 +1444,7 @@ static int perf_sample__fprintf_brstackinsn(struct perf_sample *sample,
end = start + 128;
}
len = grab_bb(buffer, start, end, machine, thread, &x.is64bit, &x.cpumode, true);
- printed += ip__fprintf_sym(start, thread, x.cpumode, x.cpu, &lastsym, attr, fp);
+ printed += ip__fprintf_sym(start, thread, x.cpumode, x.cpu, &lastsym, evsel, fp);
if (len <= 0) {
/* Print at least last IP if basic block did not work */
len = grab_bb(buffer, sample->ip, sample->ip,
@@ -1447,7 +1453,7 @@ static int perf_sample__fprintf_brstackinsn(struct perf_sample *sample,
goto out;
ilen = 0;
printed += fprintf(fp, "\t%016" PRIx64 "\t", sample->ip);
- printed += any_dump_insn(attr, &x, sample->ip, buffer, len, &ilen, fp);
+ printed += any_dump_insn(evsel, &x, sample->ip, buffer, len, &ilen, fp);
if (PRINT_FIELD(BRSTACKINSNLEN))
printed += fprintf(fp, "\tilen: %d", ilen);
printed += fprintf(fp, "\n");
@@ -1458,7 +1464,7 @@ static int perf_sample__fprintf_brstackinsn(struct perf_sample *sample,
for (off = 0; off <= end - start; off += ilen) {
ilen = 0;
printed += fprintf(fp, "\t%016" PRIx64 "\t", start + off);
- printed += any_dump_insn(attr, &x, start + off, buffer + off, len - off, &ilen, fp);
+ printed += any_dump_insn(evsel, &x, start + off, buffer + off, len - off, &ilen, fp);
if (PRINT_FIELD(BRSTACKINSNLEN))
printed += fprintf(fp, "\tilen: %d", ilen);
printed += fprintf(fp, "\n");
@@ -1482,13 +1488,13 @@ out:
static int perf_sample__fprintf_addr(struct perf_sample *sample,
struct thread *thread,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
struct addr_location al;
int printed = fprintf(fp, "%16" PRIx64, sample->addr);
addr_location__init(&al);
- if (!sample_addr_correlates_sym(attr))
+ if (!sample_addr_correlates_sym(&evsel->core.attr))
goto out;
thread__resolve(thread, &al, sample);
@@ -1515,11 +1521,10 @@ static const char *resolve_branch_sym(struct perf_sample *sample,
struct addr_location *addr_al,
u64 *ip)
{
- struct perf_event_attr *attr = &evsel->core.attr;
const char *name = NULL;
if (sample->flags & (PERF_IP_FLAG_CALL | PERF_IP_FLAG_TRACE_BEGIN)) {
- if (sample_addr_correlates_sym(attr)) {
+ if (sample_addr_correlates_sym(&evsel->core.attr)) {
if (!addr_al->thread)
thread__resolve(thread, addr_al, sample);
if (addr_al->sym)
@@ -1545,7 +1550,6 @@ static int perf_sample__fprintf_callindent(struct perf_sample *sample,
struct addr_location *addr_al,
FILE *fp)
{
- struct perf_event_attr *attr = &evsel->core.attr;
size_t depth = thread_stack__depth(thread, sample->cpu);
const char *name = NULL;
static int spacing;
@@ -1589,19 +1593,6 @@ static int perf_sample__fprintf_callindent(struct perf_sample *sample,
return len + dlen;
}
-__weak void arch_fetch_insn(struct perf_sample *sample __maybe_unused,
- struct thread *thread __maybe_unused,
- struct machine *machine __maybe_unused)
-{
-}
-
-void script_fetch_insn(struct perf_sample *sample, struct thread *thread,
- struct machine *machine)
-{
- if (sample->insn_len == 0 && native_arch)
- arch_fetch_insn(sample, thread, machine);
-}
-
static int perf_sample__fprintf_insn(struct perf_sample *sample,
struct evsel *evsel,
struct perf_event_attr *attr,
@@ -1611,7 +1602,7 @@ static int perf_sample__fprintf_insn(struct perf_sample *sample,
{
int printed = 0;
- script_fetch_insn(sample, thread, machine);
+ script_fetch_insn(sample, thread, machine, native_arch);
if (PRINT_FIELD(INSNLEN))
printed += fprintf(fp, " ilen: %d", sample->insn_len);
@@ -1630,7 +1621,7 @@ static int perf_sample__fprintf_insn(struct perf_sample *sample,
}
static int perf_sample__fprintf_ipc(struct perf_sample *sample,
- struct perf_event_attr *attr, FILE *fp)
+ struct evsel *evsel, FILE *fp)
{
unsigned int ipc;
@@ -1651,7 +1642,7 @@ static int perf_sample__fprintf_bts(struct perf_sample *sample,
struct machine *machine, FILE *fp)
{
struct perf_event_attr *attr = &evsel->core.attr;
- unsigned int type = output_type(attr->type);
+ unsigned int type = evsel__output_type(evsel);
bool print_srcline_last = false;
int printed = 0;
@@ -1688,10 +1679,10 @@ static int perf_sample__fprintf_bts(struct perf_sample *sample,
((evsel->core.attr.sample_type & PERF_SAMPLE_ADDR) &&
!output[type].user_set)) {
printed += fprintf(fp, " => ");
- printed += perf_sample__fprintf_addr(sample, thread, attr, fp);
+ printed += perf_sample__fprintf_addr(sample, thread, evsel, fp);
}
- printed += perf_sample__fprintf_ipc(sample, attr, fp);
+ printed += perf_sample__fprintf_ipc(sample, evsel, fp);
if (print_srcline_last)
printed += map__fprintf_srcline(al->map, al->addr, "\n ", fp);
@@ -1709,87 +1700,6 @@ static int perf_sample__fprintf_bts(struct perf_sample *sample,
return printed;
}
-static struct {
- u32 flags;
- const char *name;
-} sample_flags[] = {
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL, "call"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN, "return"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CONDITIONAL, "jcc"},
- {PERF_IP_FLAG_BRANCH, "jmp"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_INTERRUPT, "int"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN | PERF_IP_FLAG_INTERRUPT, "iret"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_SYSCALLRET, "syscall"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN | PERF_IP_FLAG_SYSCALLRET, "sysret"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_ASYNC, "async"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_ASYNC | PERF_IP_FLAG_INTERRUPT, "hw int"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TX_ABORT, "tx abrt"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TRACE_BEGIN, "tr strt"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TRACE_END, "tr end"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_VMENTRY, "vmentry"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_VMEXIT, "vmexit"},
- {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_BRANCH_MISS, "br miss"},
- {0, NULL}
-};
-
-static const char *sample_flags_to_name(u32 flags)
-{
- int i;
-
- for (i = 0; sample_flags[i].name ; i++) {
- if (sample_flags[i].flags == flags)
- return sample_flags[i].name;
- }
-
- return NULL;
-}
-
-int perf_sample__sprintf_flags(u32 flags, char *str, size_t sz)
-{
- u32 xf = PERF_IP_FLAG_IN_TX | PERF_IP_FLAG_INTR_DISABLE |
- PERF_IP_FLAG_INTR_TOGGLE;
- const char *chars = PERF_IP_FLAG_CHARS;
- const size_t n = strlen(PERF_IP_FLAG_CHARS);
- const char *name = NULL;
- size_t i, pos = 0;
- char xs[16] = {0};
-
- if (flags & xf)
- snprintf(xs, sizeof(xs), "(%s%s%s)",
- flags & PERF_IP_FLAG_IN_TX ? "x" : "",
- flags & PERF_IP_FLAG_INTR_DISABLE ? "D" : "",
- flags & PERF_IP_FLAG_INTR_TOGGLE ? "t" : "");
-
- name = sample_flags_to_name(flags & ~xf);
- if (name)
- return snprintf(str, sz, "%-15s%6s", name, xs);
-
- if (flags & PERF_IP_FLAG_TRACE_BEGIN) {
- name = sample_flags_to_name(flags & ~(xf | PERF_IP_FLAG_TRACE_BEGIN));
- if (name)
- return snprintf(str, sz, "tr strt %-7s%6s", name, xs);
- }
-
- if (flags & PERF_IP_FLAG_TRACE_END) {
- name = sample_flags_to_name(flags & ~(xf | PERF_IP_FLAG_TRACE_END));
- if (name)
- return snprintf(str, sz, "tr end %-7s%6s", name, xs);
- }
-
- for (i = 0; i < n; i++, flags >>= 1) {
- if ((flags & 1) && pos < sz)
- str[pos++] = chars[i];
- }
- for (; i < 32; i++, flags >>= 1) {
- if ((flags & 1) && pos < sz)
- str[pos++] = '?';
- }
- if (pos < sz)
- str[pos] = 0;
-
- return pos;
-}
-
static int perf_sample__fprintf_flags(u32 flags, FILE *fp)
{
char str[SAMPLE_FLAGS_BUF_SIZE];
@@ -2254,7 +2164,7 @@ static void process_event(struct perf_script *script,
{
struct thread *thread = al->thread;
struct perf_event_attr *attr = &evsel->core.attr;
- unsigned int type = output_type(attr->type);
+ unsigned int type = evsel__output_type(evsel);
struct evsel_script *es = evsel->priv;
FILE *fp = es->fp;
char str[PAGE_SIZE_NAME_LEN];
@@ -2289,15 +2199,20 @@ static void process_event(struct perf_script *script,
}
#ifdef HAVE_LIBTRACEEVENT
if (PRINT_FIELD(TRACE) && sample->raw_data) {
- event_format__fprintf(evsel->tp_format, sample->cpu,
- sample->raw_data, sample->raw_size, fp);
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ if (tp_format) {
+ event_format__fprintf(tp_format, sample->cpu,
+ sample->raw_data, sample->raw_size,
+ fp);
+ }
}
#endif
if (attr->type == PERF_TYPE_SYNTH && PRINT_FIELD(SYNTH))
perf_sample__fprintf_synth(sample, evsel, fp);
if (PRINT_FIELD(ADDR))
- perf_sample__fprintf_addr(sample, thread, attr, fp);
+ perf_sample__fprintf_addr(sample, thread, evsel, fp);
if (PRINT_FIELD(DATA_SRC))
data_src__fprintf(sample->data_src, fp);
@@ -2347,11 +2262,11 @@ static void process_event(struct perf_script *script,
perf_sample__fprintf_uregs(sample, attr, arch, fp);
if (PRINT_FIELD(BRSTACK))
- perf_sample__fprintf_brstack(sample, thread, attr, fp);
+ perf_sample__fprintf_brstack(sample, thread, evsel, fp);
else if (PRINT_FIELD(BRSTACKSYM))
- perf_sample__fprintf_brstacksym(sample, thread, attr, fp);
+ perf_sample__fprintf_brstacksym(sample, thread, evsel, fp);
else if (PRINT_FIELD(BRSTACKOFF))
- perf_sample__fprintf_brstackoff(sample, thread, attr, fp);
+ perf_sample__fprintf_brstackoff(sample, thread, evsel, fp);
if (evsel__is_bpf_output(evsel) && PRINT_FIELD(BPF_OUTPUT))
perf_sample__fprintf_bpf_output(sample, fp);
@@ -2366,7 +2281,7 @@ static void process_event(struct perf_script *script,
if (PRINT_FIELD(CODE_PAGE_SIZE))
fprintf(fp, " %s", get_page_size_name(sample->code_page_size, str));
- perf_sample__fprintf_ipc(sample, attr, fp);
+ perf_sample__fprintf_ipc(sample, evsel, fp);
fprintf(fp, "\n");
@@ -2599,14 +2514,14 @@ static int process_attr(const struct perf_tool *tool, union perf_event *event,
sample_type & PERF_SAMPLE_BRANCH_STACK ||
(sample_type & PERF_SAMPLE_REGS_USER &&
sample_type & PERF_SAMPLE_STACK_USER))) {
- int type = output_type(evsel->core.attr.type);
+ int type = evsel__output_type(evsel);
if (!(output[type].user_unset_fields & PERF_OUTPUT_IP))
output[type].fields |= PERF_OUTPUT_IP;
if (!(output[type].user_unset_fields & PERF_OUTPUT_SYM))
output[type].fields |= PERF_OUTPUT_SYM;
}
- set_print_ip_opts(&evsel->core.attr);
+ evsel__set_print_ip_opts(evsel);
return 0;
}
@@ -2959,79 +2874,18 @@ static int __cmd_script(struct perf_script *script)
return ret;
}
-struct script_spec {
- struct list_head node;
- struct scripting_ops *ops;
- char spec[];
-};
-
-static LIST_HEAD(script_specs);
-
-static struct script_spec *script_spec__new(const char *spec,
- struct scripting_ops *ops)
-{
- struct script_spec *s = malloc(sizeof(*s) + strlen(spec) + 1);
-
- if (s != NULL) {
- strcpy(s->spec, spec);
- s->ops = ops;
- }
-
- return s;
-}
-
-static void script_spec__add(struct script_spec *s)
-{
- list_add_tail(&s->node, &script_specs);
-}
-
-static struct script_spec *script_spec__find(const char *spec)
+static int list_available_languages_cb(struct scripting_ops *ops, const char *spec)
{
- struct script_spec *s;
-
- list_for_each_entry(s, &script_specs, node)
- if (strcasecmp(s->spec, spec) == 0)
- return s;
- return NULL;
-}
-
-int script_spec_register(const char *spec, struct scripting_ops *ops)
-{
- struct script_spec *s;
-
- s = script_spec__find(spec);
- if (s)
- return -1;
-
- s = script_spec__new(spec, ops);
- if (!s)
- return -1;
- else
- script_spec__add(s);
-
+ fprintf(stderr, " %-42s [%s]\n", spec, ops->name);
return 0;
}
-static struct scripting_ops *script_spec__lookup(const char *spec)
-{
- struct script_spec *s = script_spec__find(spec);
- if (!s)
- return NULL;
-
- return s->ops;
-}
-
static void list_available_languages(void)
{
- struct script_spec *s;
-
fprintf(stderr, "\n");
fprintf(stderr, "Scripting language extensions (used in "
"perf script -s [spec:]script.[spec]):\n\n");
-
- list_for_each_entry(s, &script_specs, node)
- fprintf(stderr, " %-42s [%s]\n", s->spec, s->ops->name);
-
+ script_spec__for_each(&list_available_languages_cb);
fprintf(stderr, "\n");
}
@@ -3523,144 +3377,6 @@ static void free_dlarg(void)
free(dlargv);
}
-/*
- * Some scripts specify the required events in their "xxx-record" file,
- * this function will check if the events in perf.data match those
- * mentioned in the "xxx-record".
- *
- * Fixme: All existing "xxx-record" are all in good formats "-e event ",
- * which is covered well now. And new parsing code should be added to
- * cover the future complex formats like event groups etc.
- */
-static int check_ev_match(char *dir_name, char *scriptname,
- struct perf_session *session)
-{
- char filename[MAXPATHLEN], evname[128];
- char line[BUFSIZ], *p;
- struct evsel *pos;
- int match, len;
- FILE *fp;
-
- scnprintf(filename, MAXPATHLEN, "%s/bin/%s-record", dir_name, scriptname);
-
- fp = fopen(filename, "r");
- if (!fp)
- return -1;
-
- while (fgets(line, sizeof(line), fp)) {
- p = skip_spaces(line);
- if (*p == '#')
- continue;
-
- while (strlen(p)) {
- p = strstr(p, "-e");
- if (!p)
- break;
-
- p += 2;
- p = skip_spaces(p);
- len = strcspn(p, " \t");
- if (!len)
- break;
-
- snprintf(evname, len + 1, "%s", p);
-
- match = 0;
- evlist__for_each_entry(session->evlist, pos) {
- if (evsel__name_is(pos, evname)) {
- match = 1;
- break;
- }
- }
-
- if (!match) {
- fclose(fp);
- return -1;
- }
- }
- }
-
- fclose(fp);
- return 0;
-}
-
-/*
- * Return -1 if none is found, otherwise the actual scripts number.
- *
- * Currently the only user of this function is the script browser, which
- * will list all statically runnable scripts, select one, execute it and
- * show the output in a perf browser.
- */
-int find_scripts(char **scripts_array, char **scripts_path_array, int num,
- int pathlen)
-{
- struct dirent *script_dirent, *lang_dirent;
- char scripts_path[MAXPATHLEN], lang_path[MAXPATHLEN];
- DIR *scripts_dir, *lang_dir;
- struct perf_session *session;
- struct perf_data data = {
- .path = input_name,
- .mode = PERF_DATA_MODE_READ,
- };
- char *temp;
- int i = 0;
-
- session = perf_session__new(&data, NULL);
- if (IS_ERR(session))
- return PTR_ERR(session);
-
- snprintf(scripts_path, MAXPATHLEN, "%s/scripts", get_argv_exec_path());
-
- scripts_dir = opendir(scripts_path);
- if (!scripts_dir) {
- perf_session__delete(session);
- return -1;
- }
-
- for_each_lang(scripts_path, scripts_dir, lang_dirent) {
- scnprintf(lang_path, MAXPATHLEN, "%s/%s", scripts_path,
- lang_dirent->d_name);
-#ifndef HAVE_LIBPERL_SUPPORT
- if (strstr(lang_path, "perl"))
- continue;
-#endif
-#ifndef HAVE_LIBPYTHON_SUPPORT
- if (strstr(lang_path, "python"))
- continue;
-#endif
-
- lang_dir = opendir(lang_path);
- if (!lang_dir)
- continue;
-
- for_each_script(lang_path, lang_dir, script_dirent) {
- /* Skip those real time scripts: xxxtop.p[yl] */
- if (strstr(script_dirent->d_name, "top."))
- continue;
- if (i >= num)
- break;
- snprintf(scripts_path_array[i], pathlen, "%s/%s",
- lang_path,
- script_dirent->d_name);
- temp = strchr(script_dirent->d_name, '.');
- snprintf(scripts_array[i],
- (temp - script_dirent->d_name) + 1,
- "%s", script_dirent->d_name);
-
- if (check_ev_match(lang_path,
- scripts_array[i], session))
- continue;
-
- i++;
- }
- closedir(lang_dir);
- }
-
- closedir(scripts_dir);
- perf_session__delete(session);
- return i;
-}
-
static char *get_script_path(const char *script_root, const char *suffix)
{
struct dirent *script_dirent, *lang_dirent;
diff --git a/tools/perf/builtin-stat.c b/tools/perf/builtin-stat.c
index fdf5172646a5..77e327d4a9a7 100644
--- a/tools/perf/builtin-stat.c
+++ b/tools/perf/builtin-stat.c
@@ -112,8 +112,6 @@ static struct target target = {
.uid = UINT_MAX,
};
-#define METRIC_ONLY_LEN 20
-
static volatile sig_atomic_t child_pid = -1;
static int detailed_run = 0;
static bool transaction_run;
@@ -151,21 +149,6 @@ static struct perf_stat perf_stat;
static volatile sig_atomic_t done = 0;
-static struct perf_stat_config stat_config = {
- .aggr_mode = AGGR_GLOBAL,
- .aggr_level = MAX_CACHE_LVL + 1,
- .scale = true,
- .unit_width = 4, /* strlen("unit") */
- .run_count = 1,
- .metric_only_len = METRIC_ONLY_LEN,
- .walltime_nsecs_stats = &walltime_nsecs_stats,
- .ru_stats = &ru_stats,
- .big_num = true,
- .ctl_fd = -1,
- .ctl_fd_ack = -1,
- .iostat_run = false,
-};
-
/* Options set from the command line. */
struct opt_aggr_mode {
bool node, socket, die, cluster, cache, core, thread, no_aggr;
@@ -1071,16 +1054,6 @@ static void sig_atexit(void)
kill(getpid(), signr);
}
-void perf_stat__set_big_num(int set)
-{
- stat_config.big_num = (set != 0);
-}
-
-void perf_stat__set_no_csv_summary(int set)
-{
- stat_config.no_csv_summary = (set != 0);
-}
-
static int stat__set_big_num(const struct option *opt __maybe_unused,
const char *s __maybe_unused, int unset)
{
diff --git a/tools/perf/builtin-top.c b/tools/perf/builtin-top.c
index 724a79386321..4fd31d29b2ab 100644
--- a/tools/perf/builtin-top.c
+++ b/tools/perf/builtin-top.c
@@ -267,9 +267,9 @@ static void perf_top__show_details(struct perf_top *top)
if (top->evlist->enabled) {
if (top->zero)
- symbol__annotate_zero_histogram(symbol, top->sym_evsel->core.idx);
+ symbol__annotate_zero_histogram(symbol, top->sym_evsel);
else
- symbol__annotate_decay_histogram(symbol, top->sym_evsel->core.idx);
+ symbol__annotate_decay_histogram(symbol, top->sym_evsel);
}
if (more != 0)
printf("%d lines not displayed, maybe increase display entries [e]\n", more);
@@ -809,7 +809,7 @@ static void perf_event__process_sample(const struct perf_tool *tool,
* invalid --vmlinux ;-)
*/
if (!machine->kptr_restrict_warned && !top->vmlinux_warned &&
- __map__is_kernel(al.map) && map__has_symbols(al.map)) {
+ __map__is_kernel(al.map) && !map__has_symbols(al.map)) {
if (symbol_conf.vmlinux_name) {
char serr[256];
diff --git a/tools/perf/builtin-trace.c b/tools/perf/builtin-trace.c
index 6a1a128fe645..d7c7d29291fb 100644
--- a/tools/perf/builtin-trace.c
+++ b/tools/perf/builtin-trace.c
@@ -389,7 +389,12 @@ static struct syscall_arg_fmt *evsel__syscall_arg_fmt(struct evsel *evsel)
}
if (et->fmt == NULL) {
- et->fmt = calloc(evsel->tp_format->format.nr_fields, sizeof(struct syscall_arg_fmt));
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ if (tp_format == NULL)
+ goto out_delete;
+
+ et->fmt = calloc(tp_format->format.nr_fields, sizeof(struct syscall_arg_fmt));
if (et->fmt == NULL)
goto out_delete;
}
@@ -1108,7 +1113,6 @@ static bool syscall_arg__strtoul_btf_type(char *bf __maybe_unused, size_t size _
.strtoul = STUL_STRARRAY_FLAGS, \
.parm = &strarray__##array, }
-#include "trace/beauty/arch_errno_names.c"
#include "trace/beauty/eventfd.c"
#include "trace/beauty/futex_op.c"
#include "trace/beauty/futex_val3.c"
@@ -2069,30 +2073,11 @@ static int trace__read_syscall_info(struct trace *trace, int id)
const char *name = syscalltbl__name(trace->sctbl, id);
int err;
-#ifdef HAVE_SYSCALL_TABLE_SUPPORT
if (trace->syscalls.table == NULL) {
trace->syscalls.table = calloc(trace->sctbl->syscalls.max_id + 1, sizeof(*sc));
if (trace->syscalls.table == NULL)
return -ENOMEM;
}
-#else
- if (id > trace->sctbl->syscalls.max_id || (id == 0 && trace->syscalls.table == NULL)) {
- // When using libaudit we don't know beforehand what is the max syscall id
- struct syscall *table = realloc(trace->syscalls.table, (id + 1) * sizeof(*sc));
-
- if (table == NULL)
- return -ENOMEM;
-
- // Need to memset from offset 0 and +1 members if brand new
- if (trace->syscalls.table == NULL)
- memset(table, 0, (id + 1) * sizeof(*sc));
- else
- memset(table + trace->sctbl->syscalls.max_id + 1, 0, (id - trace->sctbl->syscalls.max_id) * sizeof(*sc));
-
- trace->syscalls.table = table;
- trace->sctbl->syscalls.max_id = id;
- }
-#endif
sc = trace->syscalls.table + id;
if (sc->nonexistent)
return -EEXIST;
@@ -2154,8 +2139,12 @@ static int evsel__init_tp_arg_scnprintf(struct evsel *evsel, bool *use_btf)
struct syscall_arg_fmt *fmt = evsel__syscall_arg_fmt(evsel);
if (fmt != NULL) {
- syscall_arg_fmt__init_array(fmt, evsel->tp_format->format.fields, use_btf);
- return 0;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ if (tp_format) {
+ syscall_arg_fmt__init_array(fmt, tp_format->format.fields, use_btf);
+ return 0;
+ }
}
return -ENOMEM;
@@ -2439,18 +2428,7 @@ static struct syscall *trace__syscall_info(struct trace *trace,
err = -EINVAL;
-#ifdef HAVE_SYSCALL_TABLE_SUPPORT
if (id > trace->sctbl->syscalls.max_id) {
-#else
- if (id >= trace->sctbl->syscalls.max_id) {
- /*
- * With libaudit we don't know beforehand what is the max_id,
- * so we let trace__read_syscall_info() figure that out as we
- * go on reading syscalls.
- */
- err = trace__read_syscall_info(trace, id);
- if (err)
-#endif
goto out_cant_read;
}
@@ -2581,7 +2559,6 @@ static int trace__fprintf_sample(struct trace *trace, struct evsel *evsel,
static void *syscall__augmented_args(struct syscall *sc, struct perf_sample *sample, int *augmented_args_size, int raw_augmented_args_size)
{
- void *augmented_args = NULL;
/*
* For now with BPF raw_augmented we hook into raw_syscalls:sys_enter
* and there we get all 6 syscall args plus the tracepoint common fields
@@ -2599,10 +2576,24 @@ static void *syscall__augmented_args(struct syscall *sc, struct perf_sample *sam
int args_size = raw_augmented_args_size ?: sc->args_size;
*augmented_args_size = sample->raw_size - args_size;
- if (*augmented_args_size > 0)
- augmented_args = sample->raw_data + args_size;
+ if (*augmented_args_size > 0) {
+ static uintptr_t argbuf[1024]; /* assuming single-threaded */
+
+ if ((size_t)(*augmented_args_size) > sizeof(argbuf))
+ return NULL;
+
+ /*
+ * The perf ring-buffer is 8-byte aligned but sample->raw_data
+ * is not because it's preceded by u32 size. Later, beautifier
+ * will use the augmented args with stricter alignments like in
+ * some struct. To make sure it's aligned, let's copy the args
+ * into a static buffer as it's single-threaded for now.
+ */
+ memcpy(argbuf, sample->raw_data + args_size, *augmented_args_size);
- return augmented_args;
+ return argbuf;
+ }
+ return NULL;
}
static void syscall__exit(struct syscall *sc)
@@ -3027,7 +3018,8 @@ static size_t trace__fprintf_tp_fields(struct trace *trace, struct evsel *evsel,
{
char bf[2048];
size_t size = sizeof(bf);
- struct tep_format_field *field = evsel->tp_format->format.fields;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field *field = tp_format ? tp_format->format.fields : NULL;
struct syscall_arg_fmt *arg = __evsel__syscall_arg_fmt(evsel);
size_t printed = 0, btf_printed;
unsigned long val;
@@ -3145,11 +3137,13 @@ static int trace__event_handler(struct trace *trace, struct evsel *evsel,
if (evsel__is_bpf_output(evsel)) {
bpf_output__fprintf(trace, sample);
- } else if (evsel->tp_format) {
- if (strncmp(evsel->tp_format->name, "sys_enter_", 10) ||
- trace__fprintf_sys_enter(trace, evsel, sample)) {
+ } else {
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ if (tp_format && (strncmp(tp_format->name, "sys_enter_", 10) ||
+ trace__fprintf_sys_enter(trace, evsel, sample))) {
if (trace->libtraceevent_print) {
- event_format__fprintf(evsel->tp_format, sample->cpu,
+ event_format__fprintf(tp_format, sample->cpu,
sample->raw_data, sample->raw_size,
trace->output);
} else {
@@ -4077,17 +4071,23 @@ static int ordered_events__deliver_event(struct ordered_events *oe,
static struct syscall_arg_fmt *evsel__find_syscall_arg_fmt_by_name(struct evsel *evsel, char *arg,
char **type)
{
- struct tep_format_field *field;
struct syscall_arg_fmt *fmt = __evsel__syscall_arg_fmt(evsel);
+ const struct tep_event *tp_format;
- if (evsel->tp_format == NULL || fmt == NULL)
+ if (!fmt)
return NULL;
- for (field = evsel->tp_format->format.fields; field; field = field->next, ++fmt)
+ tp_format = evsel__tp_format(evsel);
+ if (!tp_format)
+ return NULL;
+
+ for (const struct tep_format_field *field = tp_format->format.fields; field;
+ field = field->next, ++fmt) {
if (strcmp(field->name, arg) == 0) {
*type = field->type;
return fmt;
}
+ }
return NULL;
}
@@ -4843,13 +4843,18 @@ static void evsel__set_syscall_arg_fmt(struct evsel *evsel, const char *name)
const struct syscall_fmt *scfmt = syscall_fmt__find(name);
if (scfmt) {
- int skip = 0;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
- if (strcmp(evsel->tp_format->format.fields->name, "__syscall_nr") == 0 ||
- strcmp(evsel->tp_format->format.fields->name, "nr") == 0)
- ++skip;
+ if (tp_format) {
+ int skip = 0;
- memcpy(fmt + skip, scfmt->arg, (evsel->tp_format->format.nr_fields - skip) * sizeof(*fmt));
+ if (strcmp(tp_format->format.fields->name, "__syscall_nr") == 0 ||
+ strcmp(tp_format->format.fields->name, "nr") == 0)
+ ++skip;
+
+ memcpy(fmt + skip, scfmt->arg,
+ (tp_format->format.nr_fields - skip) * sizeof(*fmt));
+ }
}
}
}
@@ -4859,10 +4864,16 @@ static int evlist__set_syscall_tp_fields(struct evlist *evlist, bool *use_btf)
struct evsel *evsel;
evlist__for_each_entry(evlist, evsel) {
- if (evsel->priv || !evsel->tp_format)
+ const struct tep_event *tp_format;
+
+ if (evsel->priv)
+ continue;
+
+ tp_format = evsel__tp_format(evsel);
+ if (!tp_format)
continue;
- if (strcmp(evsel->tp_format->system, "syscalls")) {
+ if (strcmp(tp_format->system, "syscalls")) {
evsel__init_tp_arg_scnprintf(evsel, use_btf);
continue;
}
@@ -4870,20 +4881,24 @@ static int evlist__set_syscall_tp_fields(struct evlist *evlist, bool *use_btf)
if (evsel__init_syscall_tp(evsel))
return -1;
- if (!strncmp(evsel->tp_format->name, "sys_enter_", 10)) {
+ if (!strncmp(tp_format->name, "sys_enter_", 10)) {
struct syscall_tp *sc = __evsel__syscall_tp(evsel);
if (__tp_field__init_ptr(&sc->args, sc->id.offset + sizeof(u64)))
return -1;
- evsel__set_syscall_arg_fmt(evsel, evsel->tp_format->name + sizeof("sys_enter_") - 1);
- } else if (!strncmp(evsel->tp_format->name, "sys_exit_", 9)) {
+ evsel__set_syscall_arg_fmt(evsel,
+ tp_format->name + sizeof("sys_enter_") - 1);
+ } else if (!strncmp(tp_format->name, "sys_exit_", 9)) {
struct syscall_tp *sc = __evsel__syscall_tp(evsel);
- if (__tp_field__init_uint(&sc->ret, sizeof(u64), sc->id.offset + sizeof(u64), evsel->needs_swap))
+ if (__tp_field__init_uint(&sc->ret, sizeof(u64),
+ sc->id.offset + sizeof(u64),
+ evsel->needs_swap))
return -1;
- evsel__set_syscall_arg_fmt(evsel, evsel->tp_format->name + sizeof("sys_exit_") - 1);
+ evsel__set_syscall_arg_fmt(evsel,
+ tp_format->name + sizeof("sys_exit_") - 1);
}
}
diff --git a/tools/perf/builtin.h b/tools/perf/builtin.h
index 94f4b3769bf7..a07e93c53848 100644
--- a/tools/perf/builtin.h
+++ b/tools/perf/builtin.h
@@ -2,10 +2,6 @@
#ifndef BUILTIN_H
#define BUILTIN_H
-#include <stddef.h>
-#include <linux/compiler.h>
-#include <tools/config.h>
-
struct feature_status {
const char *name;
const char *macro;
@@ -56,6 +52,4 @@ int cmd_ftrace(int argc, const char **argv);
int cmd_daemon(int argc, const char **argv);
int cmd_kwork(int argc, const char **argv);
-int find_scripts(char **scripts_array, char **scripts_path_array, int num,
- int pathlen);
#endif
diff --git a/tools/perf/check-headers.sh b/tools/perf/check-headers.sh
index a05c1c105c51..d3c6e10dce73 100755
--- a/tools/perf/check-headers.sh
+++ b/tools/perf/check-headers.sh
@@ -71,6 +71,7 @@ FILES=(
"include/uapi/asm-generic/ioctls.h"
"include/uapi/asm-generic/mman-common.h"
"include/uapi/asm-generic/unistd.h"
+ "scripts/syscall.tbl"
)
declare -a SYNC_CHECK_FILES
@@ -201,6 +202,14 @@ check_2 tools/perf/arch/x86/entry/syscalls/syscall_64.tbl arch/x86/entry/syscall
check_2 tools/perf/arch/powerpc/entry/syscalls/syscall.tbl arch/powerpc/kernel/syscalls/syscall.tbl
check_2 tools/perf/arch/s390/entry/syscalls/syscall.tbl arch/s390/kernel/syscalls/syscall.tbl
check_2 tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl arch/mips/kernel/syscalls/syscall_n64.tbl
+check_2 tools/perf/arch/arm/entry/syscalls/syscall.tbl arch/arm/tools/syscall.tbl
+check_2 tools/perf/arch/sh/entry/syscalls/syscall.tbl arch/sh/kernel/syscalls/syscall.tbl
+check_2 tools/perf/arch/sparc/entry/syscalls/syscall.tbl arch/sparc/kernel/syscalls/syscall.tbl
+check_2 tools/perf/arch/xtensa/entry/syscalls/syscall.tbl arch/xtensa/kernel/syscalls/syscall.tbl
+check_2 tools/perf/arch/alpha/entry/syscalls/syscall.tbl arch/alpha/entry/syscalls/syscall.tbl
+check_2 tools/perf/arch/parisc/entry/syscalls/syscall.tbl arch/parisc/entry/syscalls/syscall.tbl
+check_2 tools/perf/arch/arm64/entry/syscalls/syscall_32.tbl arch/arm64/entry/syscalls/syscall_32.tbl
+check_2 tools/perf/arch/arm64/entry/syscalls/syscall_64.tbl arch/arm64/entry/syscalls/syscall_64.tbl
for i in "${BEAUTY_FILES[@]}"
do
diff --git a/tools/perf/perf.c b/tools/perf/perf.c
index a2987f2cfe1a..f0617cc41f5f 100644
--- a/tools/perf/perf.c
+++ b/tools/perf/perf.c
@@ -84,7 +84,7 @@ static struct cmd_struct commands[] = {
#endif
{ "kvm", cmd_kvm, 0 },
{ "test", cmd_test, 0 },
-#if defined(HAVE_LIBTRACEEVENT) && (defined(HAVE_LIBAUDIT_SUPPORT) || defined(HAVE_SYSCALL_TABLE_SUPPORT))
+#if defined(HAVE_LIBTRACEEVENT)
{ "trace", cmd_trace, 0 },
#endif
{ "inject", cmd_inject, 0 },
@@ -514,10 +514,6 @@ int main(int argc, const char **argv)
fprintf(stderr,
"trace command not available: missing libtraceevent devel package at build time.\n");
goto out;
-#elif !defined(HAVE_LIBAUDIT_SUPPORT) && !defined(HAVE_SYSCALL_TABLE_SUPPORT)
- fprintf(stderr,
- "trace command not available: missing audit-libs devel package at build time.\n");
- goto out;
#else
setup_path();
argv[0] = "trace";
diff --git a/tools/perf/perf.h b/tools/perf/perf.h
index c004dd4e65a3..3cb40965549f 100644
--- a/tools/perf/perf.h
+++ b/tools/perf/perf.h
@@ -3,7 +3,7 @@
#define _PERF_PERF_H
#ifndef MAX_NR_CPUS
-#define MAX_NR_CPUS 2048
+#define MAX_NR_CPUS 4096
#endif
enum perf_affinity {
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/exception.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/exception.json
index 4404b8e91690..7126fbf292e0 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/exception.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/exception.json
@@ -5,7 +5,7 @@
},
{
"ArchStdEvent": "EXC_RETURN",
- "PublicDescription": "Counts any architecturally executed exception return instructions. Eg: AArch64: ERET"
+ "PublicDescription": "Counts any architecturally executed exception return instructions. For example: AArch64: ERET"
},
{
"ArchStdEvent": "EXC_UNDEF",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/general.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/general.json
index 428810f855b8..c5dcdcf43c58 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/general.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/general.json
@@ -5,6 +5,6 @@
},
{
"ArchStdEvent": "CNT_CYCLES",
- "PublicDescription": "Counts constant frequency cycles"
+ "PublicDescription": "Increments at a constant frequency equal to the rate of increment of the System Counter, CNTPCT_EL0."
}
]
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l1d_cache.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l1d_cache.json
index da7c129f2569..799d106d5173 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l1d_cache.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l1d_cache.json
@@ -1,11 +1,11 @@
[
{
"ArchStdEvent": "L1D_CACHE_REFILL",
- "PublicDescription": "Counts level 1 data cache refills caused by speculatively executed load or store operations that missed in the level 1 data cache. This event only counts one event per cache line. This event does not count cache line allocations from preload instructions or from hardware cache prefetching."
+ "PublicDescription": "Counts level 1 data cache refills caused by speculatively executed load or store operations that missed in the level 1 data cache. This event only counts one event per cache line."
},
{
"ArchStdEvent": "L1D_CACHE",
- "PublicDescription": "Counts level 1 data cache accesses from any load/store operations. Atomic operations that resolve in the CPUs caches (near atomic operations) count as both a write access and read access. Each access to a cache line is counted including the multiple accesses caused by single instructions such as LDM or STM. Each access to other level 1 data or unified memory structures, for example refill buffers, write buffers, and write-back buffers, are also counted."
+ "PublicDescription": "Counts level 1 data cache accesses from any load/store operations. Atomic operations that resolve in the CPUs caches (near atomic operations) counts as both a write access and read access. Each access to a cache line is counted including the multiple accesses caused by single instructions such as LDM or STM. Each access to other level 1 data or unified memory structures, for example refill buffers, write buffers, and write-back buffers, are also counted."
},
{
"ArchStdEvent": "L1D_CACHE_WB",
@@ -17,7 +17,7 @@
},
{
"ArchStdEvent": "L1D_CACHE_RD",
- "PublicDescription": "Counts level 1 data cache accesses from any load operation. Atomic load operations that resolve in the CPUs caches count as both a write access and read access."
+ "PublicDescription": "Counts level 1 data cache accesses from any load operation. Atomic load operations that resolve in the CPUs caches counts as both a write access and read access."
},
{
"ArchStdEvent": "L1D_CACHE_WR",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l2_cache.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l2_cache.json
index 0e31d0daf88b..ed8291ab9737 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l2_cache.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l2_cache.json
@@ -1,11 +1,11 @@
[
{
"ArchStdEvent": "L2D_CACHE",
- "PublicDescription": "Counts level 2 cache accesses. level 2 cache is a unified cache for data and instruction accesses. Accesses are for misses in the first level caches or translation resolutions due to accesses. This event also counts write back of dirty data from level 1 data cache to the L2 cache."
+ "PublicDescription": "Counts accesses to the level 2 cache due to data accesses. Level 2 cache is a unified cache for data and instruction accesses. Accesses are for misses in the first level data cache or translation resolutions due to accesses. This event also counts write back of dirty data from level 1 data cache to the L2 cache."
},
{
"ArchStdEvent": "L2D_CACHE_REFILL",
- "PublicDescription": "Counts cache line refills into the level 2 cache. level 2 cache is a unified cache for data and instruction accesses. Accesses are for misses in the level 1 caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts cache line refills into the level 2 cache. Level 2 cache is a unified cache for data and instruction accesses. Accesses are for misses in the level 1 data cache or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L2D_CACHE_WB",
@@ -13,23 +13,23 @@
},
{
"ArchStdEvent": "L2D_CACHE_ALLOCATE",
- "PublicDescription": "TBD"
+ "PublicDescription": "Counts level 2 cache line allocates that do not fetch data from outside the level 2 data or unified cache."
},
{
"ArchStdEvent": "L2D_CACHE_RD",
- "PublicDescription": "Counts level 2 cache accesses due to memory read operations. level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts level 2 data cache accesses due to memory read operations. Level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 data cache or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L2D_CACHE_WR",
- "PublicDescription": "Counts level 2 cache accesses due to memory write operations. level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts level 2 cache accesses due to memory write operations. Level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 data cache or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L2D_CACHE_REFILL_RD",
- "PublicDescription": "Counts refills for memory accesses due to memory read operation counted by L2D_CACHE_RD. level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts refills for memory accesses due to memory read operation counted by L2D_CACHE_RD. Level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 data cache or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L2D_CACHE_REFILL_WR",
- "PublicDescription": "Counts refills for memory accesses due to memory write operation counted by L2D_CACHE_WR. level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts refills for memory accesses due to memory write operation counted by L2D_CACHE_WR. Level 2 cache is a unified cache for data and instruction accesses, accesses are for misses in the level 1 data cache or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L2D_CACHE_WB_VICTIM",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l3_cache.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l3_cache.json
index 45bfba532df7..4a2e72fc5ada 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l3_cache.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/l3_cache.json
@@ -9,11 +9,11 @@
},
{
"ArchStdEvent": "L3D_CACHE",
- "PublicDescription": "Counts level 3 cache accesses. level 3 cache is a unified cache for data and instruction accesses. Accesses are for misses in the lower level caches or translation resolutions due to accesses."
+ "PublicDescription": "Counts level 3 cache accesses. Level 3 cache is a unified cache for data and instruction accesses. Accesses are for misses in the lower level caches or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L3D_CACHE_RD",
- "PublicDescription": "TBD"
+ "PublicDescription": "Counts level 3 cache accesses caused by any memory read operation. Level 3 cache is a unified cache for data and instruction accesses. Accesses are for misses in the lower level caches or translation resolutions due to accesses."
},
{
"ArchStdEvent": "L3D_CACHE_LMISS_RD",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/ll_cache.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/ll_cache.json
index bb712d57d58a..fd5a2e0099b8 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/ll_cache.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/ll_cache.json
@@ -1,10 +1,10 @@
[
{
"ArchStdEvent": "LL_CACHE_RD",
- "PublicDescription": "Counts read transactions that were returned from outside the core cluster. This event counts when the system register CPUECTLR.EXTLLC bit is set. This event counts read transactions returned from outside the core if those transactions are either hit in the system level cache or missed in the SLC and are returned from any other external sources."
+ "PublicDescription": "Counts read transactions that were returned from outside the core cluster. This event counts for external last level cache when the system register CPUECTLR.EXTLLC bit is set, otherwise it counts for the L3 cache. This event counts read transactions returned from outside the core if those transactions are either hit in the system level cache or missed in the SLC and are returned from any other external sources."
},
{
"ArchStdEvent": "LL_CACHE_MISS_RD",
- "PublicDescription": "Counts read transactions that were returned from outside the core cluster but missed in the system level cache. This event counts when the system register CPUECTLR.EXTLLC bit is set. This event counts read transactions returned from outside the core if those transactions are missed in the System level Cache. The data source of the transaction is indicated by a field in the CHI transaction returning to the CPU. This event does not count reads caused by cache maintenance operations."
+ "PublicDescription": "Counts read transactions that were returned from outside the core cluster but missed in the system level cache. This event counts for external last level cache when the system register CPUECTLR.EXTLLC bit is set, otherwise it counts for L3 cache. This event counts read transactions returned from outside the core if those transactions are missed in the System level Cache. The data source of the transaction is indicated by a field in the CHI transaction returning to the CPU. This event does not count reads caused by cache maintenance operations."
}
]
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/memory.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/memory.json
index 106a97f8b2e7..bb3491012a8f 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/memory.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/memory.json
@@ -33,7 +33,7 @@
},
{
"ArchStdEvent": "MEM_ACCESS_CHECKED",
- "PublicDescription": "Counts the number of memory read and write accesses in a cycle that are tag checked by the Memory Tagging Extension (MTE)."
+ "PublicDescription": "Counts the number of memory read and write accesses counted by MEM_ACCESS that are tag checked by the Memory Tagging Extension (MTE). This event is implemented as the sum of MEM_ACCESS_CHECKED_RD and MEM_ACCESS_CHECKED_WR"
},
{
"ArchStdEvent": "MEM_ACCESS_CHECKED_RD",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/metrics.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/metrics.json
index 5f449270b448..97d352f94323 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/metrics.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/metrics.json
@@ -5,7 +5,7 @@
},
{
"MetricName": "backend_stalled_cycles",
- "MetricExpr": "((STALL_BACKEND / CPU_CYCLES) * 100)",
+ "MetricExpr": "STALL_BACKEND / CPU_CYCLES * 100",
"BriefDescription": "This metric is the percentage of cycles that were stalled due to resource constraints in the backend unit of the processor.",
"MetricGroup": "Cycle_Accounting",
"ScaleUnit": "1percent of cycles"
@@ -16,45 +16,45 @@
},
{
"MetricName": "branch_misprediction_ratio",
- "MetricExpr": "(BR_MIS_PRED_RETIRED / BR_RETIRED)",
+ "MetricExpr": "BR_MIS_PRED_RETIRED / BR_RETIRED",
"BriefDescription": "This metric measures the ratio of branches mispredicted to the total number of branches architecturally executed. This gives an indication of the effectiveness of the branch prediction unit.",
"MetricGroup": "Miss_Ratio;Branch_Effectiveness",
- "ScaleUnit": "1per branch"
+ "ScaleUnit": "100percent of branches"
},
{
"MetricName": "branch_mpki",
- "MetricExpr": "((BR_MIS_PRED_RETIRED / INST_RETIRED) * 1000)",
+ "MetricExpr": "BR_MIS_PRED_RETIRED / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of branch mispredictions per thousand instructions executed.",
"MetricGroup": "MPKI;Branch_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "branch_percentage",
- "MetricExpr": "(((BR_IMMED_SPEC + BR_INDIRECT_SPEC) / INST_SPEC) * 100)",
+ "MetricExpr": "(BR_IMMED_SPEC + BR_INDIRECT_SPEC) / INST_SPEC * 100",
"BriefDescription": "This metric measures branch operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
},
{
"MetricName": "crypto_percentage",
- "MetricExpr": "((CRYPTO_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "CRYPTO_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures crypto operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
},
{
"MetricName": "dtlb_mpki",
- "MetricExpr": "((DTLB_WALK / INST_RETIRED) * 1000)",
+ "MetricExpr": "DTLB_WALK / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of data TLB Walks per thousand instructions executed.",
"MetricGroup": "MPKI;DTLB_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "dtlb_walk_ratio",
- "MetricExpr": "(DTLB_WALK / L1D_TLB)",
+ "MetricExpr": "DTLB_WALK / L1D_TLB",
"BriefDescription": "This metric measures the ratio of data TLB Walks to the total number of data TLB accesses. This gives an indication of the effectiveness of the data TLB accesses.",
"MetricGroup": "Miss_Ratio;DTLB_Effectiveness",
- "ScaleUnit": "1per TLB access"
+ "ScaleUnit": "100percent of TLB accesses"
},
{
"ArchStdEvent": "frontend_bound",
@@ -62,147 +62,147 @@
},
{
"MetricName": "frontend_stalled_cycles",
- "MetricExpr": "((STALL_FRONTEND / CPU_CYCLES) * 100)",
+ "MetricExpr": "STALL_FRONTEND / CPU_CYCLES * 100",
"BriefDescription": "This metric is the percentage of cycles that were stalled due to resource constraints in the frontend unit of the processor.",
"MetricGroup": "Cycle_Accounting",
"ScaleUnit": "1percent of cycles"
},
{
"MetricName": "integer_dp_percentage",
- "MetricExpr": "((DP_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "DP_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures scalar integer operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
},
{
"MetricName": "ipc",
- "MetricExpr": "(INST_RETIRED / CPU_CYCLES)",
+ "MetricExpr": "INST_RETIRED / CPU_CYCLES",
"BriefDescription": "This metric measures the number of instructions retired per cycle.",
"MetricGroup": "General",
"ScaleUnit": "1per cycle"
},
{
"MetricName": "itlb_mpki",
- "MetricExpr": "((ITLB_WALK / INST_RETIRED) * 1000)",
+ "MetricExpr": "ITLB_WALK / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of instruction TLB Walks per thousand instructions executed.",
"MetricGroup": "MPKI;ITLB_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "itlb_walk_ratio",
- "MetricExpr": "(ITLB_WALK / L1I_TLB)",
+ "MetricExpr": "ITLB_WALK / L1I_TLB",
"BriefDescription": "This metric measures the ratio of instruction TLB Walks to the total number of instruction TLB accesses. This gives an indication of the effectiveness of the instruction TLB accesses.",
"MetricGroup": "Miss_Ratio;ITLB_Effectiveness",
- "ScaleUnit": "1per TLB access"
+ "ScaleUnit": "100percent of TLB accesses"
},
{
"MetricName": "l1d_cache_miss_ratio",
- "MetricExpr": "(L1D_CACHE_REFILL / L1D_CACHE)",
+ "MetricExpr": "L1D_CACHE_REFILL / L1D_CACHE",
"BriefDescription": "This metric measures the ratio of level 1 data cache accesses missed to the total number of level 1 data cache accesses. This gives an indication of the effectiveness of the level 1 data cache.",
"MetricGroup": "Miss_Ratio;L1D_Cache_Effectiveness",
- "ScaleUnit": "1per cache access"
+ "ScaleUnit": "100percent of cache accesses"
},
{
"MetricName": "l1d_cache_mpki",
- "MetricExpr": "((L1D_CACHE_REFILL / INST_RETIRED) * 1000)",
+ "MetricExpr": "L1D_CACHE_REFILL / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of level 1 data cache accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;L1D_Cache_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "l1d_tlb_miss_ratio",
- "MetricExpr": "(L1D_TLB_REFILL / L1D_TLB)",
+ "MetricExpr": "L1D_TLB_REFILL / L1D_TLB",
"BriefDescription": "This metric measures the ratio of level 1 data TLB accesses missed to the total number of level 1 data TLB accesses. This gives an indication of the effectiveness of the level 1 data TLB.",
"MetricGroup": "Miss_Ratio;DTLB_Effectiveness",
- "ScaleUnit": "1per TLB access"
+ "ScaleUnit": "100percent of TLB accesses"
},
{
"MetricName": "l1d_tlb_mpki",
- "MetricExpr": "((L1D_TLB_REFILL / INST_RETIRED) * 1000)",
- "BriefDescription": "This metric measures the number of level 1 instruction TLB accesses missed per thousand instructions executed.",
+ "MetricExpr": "L1D_TLB_REFILL / INST_RETIRED * 1000",
+ "BriefDescription": "This metric measures the number of level 1 data TLB accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;DTLB_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "l1i_cache_miss_ratio",
- "MetricExpr": "(L1I_CACHE_REFILL / L1I_CACHE)",
+ "MetricExpr": "L1I_CACHE_REFILL / L1I_CACHE",
"BriefDescription": "This metric measures the ratio of level 1 instruction cache accesses missed to the total number of level 1 instruction cache accesses. This gives an indication of the effectiveness of the level 1 instruction cache.",
"MetricGroup": "Miss_Ratio;L1I_Cache_Effectiveness",
- "ScaleUnit": "1per cache access"
+ "ScaleUnit": "100percent of cache accesses"
},
{
"MetricName": "l1i_cache_mpki",
- "MetricExpr": "((L1I_CACHE_REFILL / INST_RETIRED) * 1000)",
+ "MetricExpr": "L1I_CACHE_REFILL / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of level 1 instruction cache accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;L1I_Cache_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "l1i_tlb_miss_ratio",
- "MetricExpr": "(L1I_TLB_REFILL / L1I_TLB)",
+ "MetricExpr": "L1I_TLB_REFILL / L1I_TLB",
"BriefDescription": "This metric measures the ratio of level 1 instruction TLB accesses missed to the total number of level 1 instruction TLB accesses. This gives an indication of the effectiveness of the level 1 instruction TLB.",
"MetricGroup": "Miss_Ratio;ITLB_Effectiveness",
- "ScaleUnit": "1per TLB access"
+ "ScaleUnit": "100percent of TLB accesses"
},
{
"MetricName": "l1i_tlb_mpki",
- "MetricExpr": "((L1I_TLB_REFILL / INST_RETIRED) * 1000)",
+ "MetricExpr": "L1I_TLB_REFILL / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of level 1 instruction TLB accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;ITLB_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "l2_cache_miss_ratio",
- "MetricExpr": "(L2D_CACHE_REFILL / L2D_CACHE)",
+ "MetricExpr": "L2D_CACHE_REFILL / L2D_CACHE",
"BriefDescription": "This metric measures the ratio of level 2 cache accesses missed to the total number of level 2 cache accesses. This gives an indication of the effectiveness of the level 2 cache, which is a unified cache that stores both data and instruction. Note that cache accesses in this cache are either data memory access or instruction fetch as this is a unified cache.",
"MetricGroup": "Miss_Ratio;L2_Cache_Effectiveness",
- "ScaleUnit": "1per cache access"
+ "ScaleUnit": "100percent of cache accesses"
},
{
"MetricName": "l2_cache_mpki",
- "MetricExpr": "((L2D_CACHE_REFILL / INST_RETIRED) * 1000)",
+ "MetricExpr": "L2D_CACHE_REFILL / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of level 2 unified cache accesses missed per thousand instructions executed. Note that cache accesses in this cache are either data memory access or instruction fetch as this is a unified cache.",
"MetricGroup": "MPKI;L2_Cache_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "l2_tlb_miss_ratio",
- "MetricExpr": "(L2D_TLB_REFILL / L2D_TLB)",
+ "MetricExpr": "L2D_TLB_REFILL / L2D_TLB",
"BriefDescription": "This metric measures the ratio of level 2 unified TLB accesses missed to the total number of level 2 unified TLB accesses. This gives an indication of the effectiveness of the level 2 TLB.",
"MetricGroup": "Miss_Ratio;ITLB_Effectiveness;DTLB_Effectiveness",
- "ScaleUnit": "1per TLB access"
+ "ScaleUnit": "100percent of TLB accesses"
},
{
"MetricName": "l2_tlb_mpki",
- "MetricExpr": "((L2D_TLB_REFILL / INST_RETIRED) * 1000)",
+ "MetricExpr": "L2D_TLB_REFILL / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of level 2 unified TLB accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;ITLB_Effectiveness;DTLB_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "ll_cache_read_hit_ratio",
- "MetricExpr": "((LL_CACHE_RD - LL_CACHE_MISS_RD) / LL_CACHE_RD)",
+ "MetricExpr": "(LL_CACHE_RD - LL_CACHE_MISS_RD) / LL_CACHE_RD",
"BriefDescription": "This metric measures the ratio of last level cache read accesses hit in the cache to the total number of last level cache accesses. This gives an indication of the effectiveness of the last level cache for read traffic. Note that cache accesses in this cache are either data memory access or instruction fetch as this is a system level cache.",
"MetricGroup": "LL_Cache_Effectiveness",
- "ScaleUnit": "1per cache access"
+ "ScaleUnit": "100percent of cache accesses"
},
{
"MetricName": "ll_cache_read_miss_ratio",
- "MetricExpr": "(LL_CACHE_MISS_RD / LL_CACHE_RD)",
+ "MetricExpr": "LL_CACHE_MISS_RD / LL_CACHE_RD",
"BriefDescription": "This metric measures the ratio of last level cache read accesses missed to the total number of last level cache accesses. This gives an indication of the effectiveness of the last level cache for read traffic. Note that cache accesses in this cache are either data memory access or instruction fetch as this is a system level cache.",
"MetricGroup": "Miss_Ratio;LL_Cache_Effectiveness",
- "ScaleUnit": "1per cache access"
+ "ScaleUnit": "100percent of cache accesses"
},
{
"MetricName": "ll_cache_read_mpki",
- "MetricExpr": "((LL_CACHE_MISS_RD / INST_RETIRED) * 1000)",
+ "MetricExpr": "LL_CACHE_MISS_RD / INST_RETIRED * 1000",
"BriefDescription": "This metric measures the number of last level cache read accesses missed per thousand instructions executed.",
"MetricGroup": "MPKI;LL_Cache_Effectiveness",
"ScaleUnit": "1MPKI"
},
{
"MetricName": "load_percentage",
- "MetricExpr": "((LD_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "LD_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures load operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
@@ -213,21 +213,21 @@
},
{
"MetricName": "scalar_fp_percentage",
- "MetricExpr": "((VFP_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "VFP_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures scalar floating point operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
},
{
"MetricName": "simd_percentage",
- "MetricExpr": "((ASE_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "ASE_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures advanced SIMD operations as a percentage of total operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
},
{
"MetricName": "store_percentage",
- "MetricExpr": "((ST_SPEC / INST_SPEC) * 100)",
+ "MetricExpr": "ST_SPEC / INST_SPEC * 100",
"BriefDescription": "This metric measures store operations as a percentage of operations speculatively executed.",
"MetricGroup": "Operation_Mix",
"ScaleUnit": "1percent of operations"
@@ -300,5 +300,12 @@
"MetricGroup": "Operation_Mix",
"MetricName": "branch_indirect_spec_rate",
"ScaleUnit": "100%"
+ },
+ {
+ "MetricName": "sve_all_percentage",
+ "MetricExpr": "SVE_INST_SPEC / INST_SPEC * 100",
+ "BriefDescription": "This metric measures scalable vector operations, including loads and stores, as a percentage of operations speculatively executed.",
+ "MetricGroup": "Operation_Mix",
+ "ScaleUnit": "1percent of operations"
}
]
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/retired.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/retired.json
index f297b049b62f..337e6a916f2b 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/retired.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/retired.json
@@ -9,7 +9,7 @@
},
{
"ArchStdEvent": "CID_WRITE_RETIRED",
- "PublicDescription": "Counts architecturally executed writes to the CONTEXTIDR register, which usually contain the kernel PID and can be output with hardware trace."
+ "PublicDescription": "Counts architecturally executed writes to the CONTEXTIDR_EL1 register, which usually contain the kernel PID and can be output with hardware trace."
},
{
"ArchStdEvent": "TTBR_WRITE_RETIRED",
@@ -17,7 +17,7 @@
},
{
"ArchStdEvent": "BR_RETIRED",
- "PublicDescription": "Counts architecturally executed branches, whether the branch is taken or not. Instructions that explicitly write to the PC are also counted."
+ "PublicDescription": "Counts architecturally executed branches, whether the branch is taken or not. Instructions that explicitly write to the PC are also counted. Note that exception generating instructions, exception return instructions and context synchronization instructions are not counted."
},
{
"ArchStdEvent": "BR_MIS_PRED_RETIRED",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/spec_operation.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/spec_operation.json
index 1af961f8a6c8..a7ea0d4c4ea4 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/spec_operation.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/spec_operation.json
@@ -5,7 +5,7 @@
},
{
"ArchStdEvent": "BR_PRED",
- "PublicDescription": "Counts branches speculatively executed and were predicted right."
+ "PublicDescription": "Counts all speculatively executed branches."
},
{
"ArchStdEvent": "INST_SPEC",
@@ -29,7 +29,7 @@
},
{
"ArchStdEvent": "LDREX_SPEC",
- "PublicDescription": "Counts Load-Exclusive operations that have been speculatively executed. Eg: LDREX, LDX"
+ "PublicDescription": "Counts Load-Exclusive operations that have been speculatively executed. For example: LDREX, LDX"
},
{
"ArchStdEvent": "STREX_PASS_SPEC",
@@ -73,15 +73,15 @@
},
{
"ArchStdEvent": "BR_IMMED_SPEC",
- "PublicDescription": "Counts immediate branch operations which are speculatively executed."
+ "PublicDescription": "Counts direct branch operations which are speculatively executed."
},
{
"ArchStdEvent": "BR_RETURN_SPEC",
- "PublicDescription": "Counts procedure return operations (RET) which are speculatively executed."
+ "PublicDescription": "Counts procedure return operations (RET, RETAA and RETAB) which are speculatively executed."
},
{
"ArchStdEvent": "BR_INDIRECT_SPEC",
- "PublicDescription": "Counts indirect branch operations including procedure returns, which are speculatively executed. This includes operations that force a software change of the PC, other than exception-generating operations. Eg: BR Xn, RET"
+ "PublicDescription": "Counts indirect branch operations including procedure returns, which are speculatively executed. This includes operations that force a software change of the PC, other than exception-generating operations and direct branch instructions. Some examples of the instructions counted by this event include BR Xn, RET, etc..."
},
{
"ArchStdEvent": "ISB_SPEC",
@@ -97,11 +97,11 @@
},
{
"ArchStdEvent": "RC_LD_SPEC",
- "PublicDescription": "Counts any load acquire operations that are speculatively executed. Eg: LDAR, LDARH, LDARB"
+ "PublicDescription": "Counts any load acquire operations that are speculatively executed. For example: LDAR, LDARH, LDARB"
},
{
"ArchStdEvent": "RC_ST_SPEC",
- "PublicDescription": "Counts any store release operations that are speculatively executed. Eg: STLR, STLRH, STLRB'"
+ "PublicDescription": "Counts any store release operations that are speculatively executed. For example: STLR, STLRH, STLRB"
},
{
"ArchStdEvent": "ASE_INST_SPEC",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/stall.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/stall.json
index bbbebc805034..1fcba19dfb7d 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/stall.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/stall.json
@@ -1,7 +1,7 @@
[
{
"ArchStdEvent": "STALL_FRONTEND",
- "PublicDescription": "Counts cycles when frontend could not send any micro-operations to the rename stage because of frontend resource stalls caused by fetch memory latency or branch prediction flow stalls. All the frontend slots were empty during the cycle when this event counts."
+ "PublicDescription": "Counts cycles when frontend could not send any micro-operations to the rename stage because of frontend resource stalls caused by fetch memory latency or branch prediction flow stalls. STALL_FRONTEND_SLOTS counts SLOTS during the cycle when this event counts."
},
{
"ArchStdEvent": "STALL_BACKEND",
@@ -9,11 +9,11 @@
},
{
"ArchStdEvent": "STALL",
- "PublicDescription": "Counts cycles when no operations are sent to the rename unit from the frontend or from the rename unit to the backend for any reason (either frontend or backend stall)."
+ "PublicDescription": "Counts cycles when no operations are sent to the rename unit from the frontend or from the rename unit to the backend for any reason (either frontend or backend stall). This event is the sum of STALL_FRONTEND and STALL_BACKEND"
},
{
"ArchStdEvent": "STALL_SLOT_BACKEND",
- "PublicDescription": "Counts slots per cycle in which no operations are sent from the rename unit to the backend due to backend resource constraints."
+ "PublicDescription": "Counts slots per cycle in which no operations are sent from the rename unit to the backend due to backend resource constraints. STALL_BACKEND counts during the cycle when STALL_SLOT_BACKEND counts at least 1."
},
{
"ArchStdEvent": "STALL_SLOT_FRONTEND",
@@ -21,7 +21,7 @@
},
{
"ArchStdEvent": "STALL_SLOT",
- "PublicDescription": "Counts slots per cycle in which no operations are sent to the rename unit from the frontend or from the rename unit to the backend for any reason (either frontend or backend stall)."
+ "PublicDescription": "Counts slots per cycle in which no operations are sent to the rename unit from the frontend or from the rename unit to the backend for any reason (either frontend or backend stall). STALL_SLOT is the sum of STALL_SLOT_FRONTEND and STALL_SLOT_BACKEND."
},
{
"ArchStdEvent": "STALL_BACKEND_MEM",
diff --git a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/tlb.json b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/tlb.json
index b550af1831f5..5704f1e83af9 100644
--- a/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/tlb.json
+++ b/tools/perf/pmu-events/arch/arm64/arm/neoverse-n2-v2/tlb.json
@@ -25,11 +25,11 @@
},
{
"ArchStdEvent": "DTLB_WALK",
- "PublicDescription": "Counts data memory translation table walks caused by a miss in the L2 TLB driven by a memory access. Note that partial translations that also cause a table walk are counted. This event does not count table walks caused by TLB maintenance operations."
+ "PublicDescription": "Counts number of demand data translation table walks caused by a miss in the L2 TLB and performing at least one memory access. Translation table walks are counted even if the translation ended up taking a translation fault for reasons different than EPD, E0PD and NFD. Note that partial translations that cause a translation table walk are also counted. Also note that this event counts walks triggered by software preloads, but not walks triggered by hardware prefetchers, and that this event does not count walks triggered by TLB maintenance operations."
},
{
"ArchStdEvent": "ITLB_WALK",
- "PublicDescription": "Counts instruction memory translation table walks caused by a miss in the L2 TLB driven by a memory access. Partial translations that also cause a table walk are counted. This event does not count table walks caused by TLB maintenance operations."
+ "PublicDescription": "Counts number of instruction translation table walks caused by a miss in the L2 TLB and performing at least one memory access. Translation table walks are counted even if the translation ended up taking a translation fault for reasons different than EPD, E0PD and NFD. Note that partial translations that cause a translation table walk are also counted. Also note that this event does not count walks triggered by TLB maintenance operations."
},
{
"ArchStdEvent": "L1D_TLB_REFILL_RD",
diff --git a/tools/perf/pmu-events/arch/arm64/common-and-microarch.json b/tools/perf/pmu-events/arch/arm64/common-and-microarch.json
index 492083b99256..dddecc946575 100644
--- a/tools/perf/pmu-events/arch/arm64/common-and-microarch.json
+++ b/tools/perf/pmu-events/arch/arm64/common-and-microarch.json
@@ -534,6 +534,11 @@
"BriefDescription": "SVE operations speculatively executed"
},
{
+ "EventCode": "0x8007",
+ "EventName": "ASE_SVE_INST_SPEC",
+ "BriefDescription": "Operation speculatively executed, Advanced SIMD or SVE."
+ },
+ {
"PublicDescription": "Microarchitectural operation, Operations speculatively executed.",
"EventCode": "0x8008",
"EventName": "UOP_SPEC",
@@ -552,48 +557,393 @@
"BriefDescription": "Floating-point Operations speculatively executed."
},
{
+ "EventCode": "0x8011",
+ "EventName": "ASE_FP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD."
+ },
+ {
+ "EventCode": "0x8012",
+ "EventName": "SVE_FP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE."
+ },
+ {
+ "EventCode": "0x8013",
+ "EventName": "ASE_SVE_FP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE."
+ },
+ {
"PublicDescription": "Floating-point half-precision operations speculatively executed",
"EventCode": "0x8014",
"EventName": "FP_HP_SPEC",
"BriefDescription": "Floating-point half-precision operations speculatively executed"
},
{
+ "EventCode": "0x8015",
+ "EventName": "ASE_FP_HP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD half precision."
+ },
+ {
+ "EventCode": "0x8016",
+ "EventName": "SVE_FP_HP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE half precision."
+ },
+ {
+ "EventCode": "0x8017",
+ "EventName": "ASE_SVE_FP_HP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE half precision."
+ },
+ {
"PublicDescription": "Floating-point single-precision operations speculatively executed",
"EventCode": "0x8018",
"EventName": "FP_SP_SPEC",
"BriefDescription": "Floating-point single-precision operations speculatively executed"
},
{
+ "EventCode": "0x8019",
+ "EventName": "ASE_FP_SP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD single precision."
+ },
+ {
+ "EventCode": "0x801A",
+ "EventName": "SVE_FP_SP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE single precision."
+ },
+ {
+ "EventCode": "0x801B",
+ "EventName": "ASE_SVE_FP_SP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE single precision."
+ },
+ {
"PublicDescription": "Floating-point double-precision operations speculatively executed",
"EventCode": "0x801C",
"EventName": "FP_DP_SPEC",
"BriefDescription": "Floating-point double-precision operations speculatively executed"
},
{
+ "EventCode": "0x801D",
+ "EventName": "ASE_FP_DP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD double precision."
+ },
+ {
+ "EventCode": "0x801E",
+ "EventName": "SVE_FP_DP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE double precision."
+ },
+ {
+ "EventCode": "0x801F",
+ "EventName": "ASE_SVE_FP_DP_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE double precision."
+ },
+ {
+ "EventCode": "0x8020",
+ "EventName": "FP_DIV_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, divide."
+ },
+ {
+ "EventCode": "0x8021",
+ "EventName": "ASE_FP_DIV_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD divide."
+ },
+ {
+ "EventCode": "0x8022",
+ "EventName": "SVE_FP_DIV_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE divide."
+ },
+ {
+ "EventCode": "0x8023",
+ "EventName": "ASE_SVE_FP_DIV_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE divide."
+ },
+ {
+ "EventCode": "0x8024",
+ "EventName": "FP_SQRT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, square root."
+ },
+ {
+ "EventCode": "0x8025",
+ "EventName": "ASE_FP_SQRT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD square root."
+ },
+ {
+ "EventCode": "0x8026",
+ "EventName": "SVE_FP_SQRT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE square root."
+ },
+ {
+ "EventCode": "0x8027",
+ "EventName": "ASE_SVE_FP_SQRT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE square-root."
+ },
+ {
"PublicDescription": "Floating-point FMA Operations speculatively executed.",
"EventCode": "0x8028",
"EventName": "FP_FMA_SPEC",
"BriefDescription": "Floating-point FMA Operations speculatively executed."
},
{
+ "EventCode": "0x8029",
+ "EventName": "ASE_FP_FMA_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD FMA."
+ },
+ {
+ "EventCode": "0x802A",
+ "EventName": "SVE_FP_FMA_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE FMA."
+ },
+ {
+ "EventCode": "0x802B",
+ "EventName": "ASE_SVE_FP_FMA_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE FMA."
+ },
+ {
+ "EventCode": "0x802C",
+ "EventName": "FP_MUL_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, multiply."
+ },
+ {
+ "EventCode": "0x802D",
+ "EventName": "ASE_FP_MUL_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD multiply."
+ },
+ {
+ "EventCode": "0x802E",
+ "EventName": "SVE_FP_MUL_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE multiply."
+ },
+ {
+ "EventCode": "0x802F",
+ "EventName": "ASE_SVE_FP_MUL_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE multiply."
+ },
+ {
+ "EventCode": "0x8030",
+ "EventName": "FP_ADDSUB_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, add or subtract."
+ },
+ {
+ "EventCode": "0x8031",
+ "EventName": "ASE_FP_ADDSUB_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD add or subtract."
+ },
+ {
+ "EventCode": "0x8032",
+ "EventName": "SVE_FP_ADDSUB_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE add or subtract."
+ },
+ {
+ "EventCode": "0x8033",
+ "EventName": "ASE_SVE_FP_ADDSUB_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE add or subtract."
+ },
+ {
"PublicDescription": "Floating-point reciprocal estimate Operations speculatively executed.",
"EventCode": "0x8034",
"EventName": "FP_RECPE_SPEC",
"BriefDescription": "Floating-point reciprocal estimate Operations speculatively executed."
},
{
+ "EventCode": "0x8035",
+ "EventName": "ASE_FP_RECPE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD reciprocal estimate."
+ },
+ {
+ "EventCode": "0x8036",
+ "EventName": "SVE_FP_RECPE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE reciprocal estimate."
+ },
+ {
+ "EventCode": "0x8037",
+ "EventName": "ASE_SVE_FP_RECPE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE reciprocal estimate."
+ },
+ {
"PublicDescription": "floating-point convert Operations speculatively executed.",
"EventCode": "0x8038",
"EventName": "FP_CVT_SPEC",
"BriefDescription": "floating-point convert Operations speculatively executed."
},
{
+ "EventCode": "0x8039",
+ "EventName": "ASE_FP_CVT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD convert."
+ },
+ {
+ "EventCode": "0x803A",
+ "EventName": "SVE_FP_CVT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE convert."
+ },
+ {
+ "EventCode": "0x803B",
+ "EventName": "ASE_SVE_FP_CVT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE convert."
+ },
+ {
+ "EventCode": "0x803C",
+ "EventName": "SVE_FP_AREDUCE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE accumulating reduction."
+ },
+ {
+ "EventCode": "0x803D",
+ "EventName": "ASE_FP_PREDUCE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD pairwise add step."
+ },
+ {
+ "EventCode": "0x803E",
+ "EventName": "SVE_FP_VREDUCE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, SVE vector reduction."
+ },
+ {
+ "EventCode": "0x803F",
+ "EventName": "ASE_SVE_FP_VREDUCE_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE vector reduction."
+ },
+ {
+ "EventCode": "0x8040",
+ "EventName": "INT_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed."
+ },
+ {
+ "EventCode": "0x8041",
+ "EventName": "ASE_INT_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD."
+ },
+ {
+ "EventCode": "0x8042",
+ "EventName": "SVE_INT_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE."
+ },
+ {
"PublicDescription": "Advanced SIMD and SVE integer Operations speculatively executed.",
"EventCode": "0x8043",
"EventName": "ASE_SVE_INT_SPEC",
"BriefDescription": "Advanced SIMD and SVE integer Operations speculatively executed."
},
{
+ "EventCode": "0x8044",
+ "EventName": "INT_DIV_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, divide."
+ },
+ {
+ "EventCode": "0x8045",
+ "EventName": "INT_DIV64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, 64-bit divide."
+ },
+ {
+ "EventCode": "0x8046",
+ "EventName": "SVE_INT_DIV_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE divide."
+ },
+ {
+ "EventCode": "0x8047",
+ "EventName": "SVE_INT_DIV64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE 64-bit divide."
+ },
+ {
+ "EventCode": "0x8048",
+ "EventName": "INT_MUL_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, multiply."
+ },
+ {
+ "EventCode": "0x8049",
+ "EventName": "ASE_INT_MUL_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD multiply."
+ },
+ {
+ "EventCode": "0x804A",
+ "EventName": "SVE_INT_MUL_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE multiply."
+ },
+ {
+ "EventCode": "0x804B",
+ "EventName": "ASE_SVE_INT_MUL_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD or SVE multiply."
+ },
+ {
+ "EventCode": "0x804C",
+ "EventName": "INT_MUL64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, 64\u00d764 multiply."
+ },
+ {
+ "EventCode": "0x804D",
+ "EventName": "SVE_INT_MUL64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE 64\u00d764 multiply."
+ },
+ {
+ "EventCode": "0x804E",
+ "EventName": "INT_MULH64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, 64\u00d764 multiply returning high part."
+ },
+ {
+ "EventCode": "0x804F",
+ "EventName": "SVE_INT_MULH64_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE 64\u00d764 multiply high part."
+ },
+ {
+ "EventCode": "0x8058",
+ "EventName": "NONFP_SPEC",
+ "BriefDescription": "Non-floating-point Operation speculatively executed."
+ },
+ {
+ "EventCode": "0x8059",
+ "EventName": "ASE_NONFP_SPEC",
+ "BriefDescription": "Non-floating-point Operation speculatively executed, Advanced SIMD."
+ },
+ {
+ "EventCode": "0x805A",
+ "EventName": "SVE_NONFP_SPEC",
+ "BriefDescription": "Non-floating-point Operation speculatively executed, SVE."
+ },
+ {
+ "EventCode": "0x805B",
+ "EventName": "ASE_SVE_NONFP_SPEC",
+ "BriefDescription": "Non-floating-point Operation speculatively executed, Advanced SIMD or SVE."
+ },
+ {
+ "EventCode": "0x805D",
+ "EventName": "ASE_INT_VREDUCE_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD reduction."
+ },
+ {
+ "EventCode": "0x805E",
+ "EventName": "SVE_INT_VREDUCE_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, SVE reduction."
+ },
+ {
+ "EventCode": "0x805F",
+ "EventName": "ASE_SVE_INT_VREDUCE_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD or SVE reduction."
+ },
+ {
+ "EventCode": "0x8060",
+ "EventName": "SVE_PERM_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE permute."
+ },
+ {
+ "EventCode": "0x8065",
+ "EventName": "SVE_XPIPE_Z2R_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE vector to scalar cross-pipe."
+ },
+ {
+ "EventCode": "0x8066",
+ "EventName": "SVE_XPIPE_R2Z_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE scalar to vector cross-pipe."
+ },
+ {
+ "EventCode": "0x8068",
+ "EventName": "SVE_PGEN_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE predicate generating."
+ },
+ {
+ "EventCode": "0x8069",
+ "EventName": "SVE_PGEN_FLG_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE predicate flag setting."
+ },
+ {
+ "EventCode": "0x806D",
+ "EventName": "SVE_PPERM_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE predicate permute."
+ },
+ {
"PublicDescription": "SVE predicated Operations speculatively executed.",
"EventCode": "0x8074",
"EventName": "SVE_PRED_SPEC",
@@ -630,6 +980,16 @@
"BriefDescription": "SVE MOVPRFX Operations speculatively executed."
},
{
+ "EventCode": "0x807D",
+ "EventName": "SVE_MOVPRFX_Z_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE MOVPRFX zeroing predication."
+ },
+ {
+ "EventCode": "0x807E",
+ "EventName": "SVE_MOVPRFX_M_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE MOVPRFX merging predication."
+ },
+ {
"PublicDescription": "SVE MOVPRFX unfused Operations speculatively executed.",
"EventCode": "0x807F",
"EventName": "SVE_MOVPRFX_U_SPEC",
@@ -696,6 +1056,16 @@
"BriefDescription": "SVE contiguous prefetch element Operations speculatively executed."
},
{
+ "EventCode": "0x80A1",
+ "EventName": "SVE_LDNT_CONTIG_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE non-temporal contiguous load element."
+ },
+ {
+ "EventCode": "0x80A2",
+ "EventName": "SVE_STNT_CONTIG_SPEC",
+ "BriefDescription": "Operation speculatively executed, SVE non-temporal contiguous store element."
+ },
+ {
"PublicDescription": "Advanced SIMD and SVE contiguous load multiple vector Operations speculatively executed.",
"EventCode": "0x80A5",
"EventName": "ASE_SVE_LD_MULTI_SPEC",
@@ -786,6 +1156,16 @@
"BriefDescription": "Non-scalable double-precision floating-point element Operations speculatively executed."
},
{
+ "EventCode": "0x80C8",
+ "EventName": "INT_SCALE_OPS_SPEC",
+ "BriefDescription": "Scalable integer element arithmetic operations Speculatively executed."
+ },
+ {
+ "EventCode": "0x80C9",
+ "EventName": "INT_FIXED_OPS_SPEC",
+ "BriefDescription": "Non-scalable integer element arithmetic operations Speculatively executed."
+ },
+ {
"PublicDescription": "Advanced SIMD and SVE 8-bit integer operations speculatively executed",
"EventCode": "0x80E3",
"EventName": "ASE_SVE_INT8_SPEC",
@@ -808,5 +1188,340 @@
"EventCode": "0x80EF",
"EventName": "ASE_SVE_INT64_SPEC",
"BriefDescription": "Advanced SIMD and SVE 64-bit integer operations speculatively executed"
+ },
+ {
+ "EventCode": "0x80F3",
+ "EventName": "ASE_SVE_FP_DOT_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE dot-product."
+ },
+ {
+ "EventCode": "0x80F7",
+ "EventName": "ASE_SVE_FP_MMLA_SPEC",
+ "BriefDescription": "Floating-point Operation speculatively executed, Advanced SIMD or SVE matrix multiply."
+ },
+ {
+ "EventCode": "0x80FB",
+ "EventName": "ASE_SVE_INT_DOT_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD or SVE dot-product."
+ },
+ {
+ "EventCode": "0x80FF",
+ "EventName": "ASE_SVE_INT_MMLA_SPEC",
+ "BriefDescription": "Integer Operation speculatively executed, Advanced SIMD or SVE matrix multiply."
+ },
+ {
+ "EventCode": "0x8128",
+ "EventName": "DTLB_WALK_PERCYC",
+ "BriefDescription": "Data translation table walks in progress."
+ },
+ {
+ "EventCode": "0x8129",
+ "EventName": "ITLB_WALK_PERCYC",
+ "BriefDescription": "Instruction translation table walks in progress."
+ },
+ {
+ "EventCode": "0x8136",
+ "EventName": "DTLB_STEP",
+ "BriefDescription": "Data TLB translation table walk, step."
+ },
+ {
+ "EventCode": "0x8137",
+ "EventName": "ITLB_STEP",
+ "BriefDescription": "Instruction TLB translation table walk, step."
+ },
+ {
+ "EventCode": "0x8138",
+ "EventName": "DTLB_WALK_LARGE",
+ "BriefDescription": "Data TLB large page translation table walk."
+ },
+ {
+ "EventCode": "0x8139",
+ "EventName": "ITLB_WALK_LARGE",
+ "BriefDescription": "Instruction TLB large page translation table walk."
+ },
+ {
+ "EventCode": "0x813A",
+ "EventName": "DTLB_WALK_SMALL",
+ "BriefDescription": "Data TLB small page translation table walk."
+ },
+ {
+ "EventCode": "0x813B",
+ "EventName": "ITLB_WALK_SMALL",
+ "BriefDescription": "Instruction TLB small page translation table walk."
+ },
+ {
+ "EventCode": "0x8144",
+ "EventName": "L1D_CACHE_MISS",
+ "BriefDescription": "Level 1 data cache demand access miss."
+ },
+ {
+ "EventCode": "0x8145",
+ "EventName": "L1I_CACHE_HWPRF",
+ "BriefDescription": "Level 1 instruction cache hardware prefetch."
+ },
+ {
+ "EventCode": "0x814C",
+ "EventName": "L2D_CACHE_MISS",
+ "BriefDescription": "Level 2 data cache demand access miss."
+ },
+ {
+ "EventCode": "0x8154",
+ "EventName": "L1D_CACHE_HWPRF",
+ "BriefDescription": "Level 1 data cache hardware prefetch."
+ },
+ {
+ "EventCode": "0x8155",
+ "EventName": "L2D_CACHE_HWPRF",
+ "BriefDescription": "Level 2 data cache hardware prefetch."
+ },
+ {
+ "EventCode": "0x8158",
+ "EventName": "STALL_FRONTEND_MEMBOUND",
+ "BriefDescription": "Frontend stall cycles, memory bound."
+ },
+ {
+ "EventCode": "0x8159",
+ "EventName": "STALL_FRONTEND_L1I",
+ "BriefDescription": "Frontend stall cycles, level 1 instruction cache."
+ },
+ {
+ "EventCode": "0x815A",
+ "EventName": "STALL_FRONTEND_L2I",
+ "BriefDescription": "Frontend stall cycles, level 2 instruction cache."
+ },
+ {
+ "EventCode": "0x815B",
+ "EventName": "STALL_FRONTEND_MEM",
+ "BriefDescription": "Frontend stall cycles, last level PE cache or memory."
+ },
+ {
+ "EventCode": "0x815C",
+ "EventName": "STALL_FRONTEND_TLB",
+ "BriefDescription": "Frontend stall cycles, TLB."
+ },
+ {
+ "EventCode": "0x8160",
+ "EventName": "STALL_FRONTEND_CPUBOUND",
+ "BriefDescription": "Frontend stall cycles, processor bound."
+ },
+ {
+ "EventCode": "0x8161",
+ "EventName": "STALL_FRONTEND_FLOW",
+ "BriefDescription": "Frontend stall cycles, flow control."
+ },
+ {
+ "EventCode": "0x8162",
+ "EventName": "STALL_FRONTEND_FLUSH",
+ "BriefDescription": "Frontend stall cycles, flush recovery."
+ },
+ {
+ "EventCode": "0x8163",
+ "EventName": "STALL_FRONTEND_RENAME",
+ "BriefDescription": "Frontend stall cycles, rename full."
+ },
+ {
+ "EventCode": "0x8164",
+ "EventName": "STALL_BACKEND_MEMBOUND",
+ "BriefDescription": "Backend stall cycles, memory bound."
+ },
+ {
+ "EventCode": "0x8165",
+ "EventName": "STALL_BACKEND_L1D",
+ "BriefDescription": "Backend stall cycles, level 1 data cache."
+ },
+ {
+ "EventCode": "0x8166",
+ "EventName": "STALL_BACKEND_L2D",
+ "BriefDescription": "Backend stall cycles, level 2 data cache."
+ },
+ {
+ "EventCode": "0x8167",
+ "EventName": "STALL_BACKEND_TLB",
+ "BriefDescription": "Backend stall cycles, TLB."
+ },
+ {
+ "EventCode": "0x8168",
+ "EventName": "STALL_BACKEND_ST",
+ "BriefDescription": "Backend stall cycles, store."
+ },
+ {
+ "EventCode": "0x816A",
+ "EventName": "STALL_BACKEND_CPUBOUND",
+ "BriefDescription": "Backend stall cycles, processor bound."
+ },
+ {
+ "EventCode": "0x816B",
+ "EventName": "STALL_BACKEND_BUSY",
+ "BriefDescription": "Backend stall cycles, backend busy."
+ },
+ {
+ "EventCode": "0x816C",
+ "EventName": "STALL_BACKEND_ILOCK",
+ "BriefDescription": "Backend stall cycles, input dependency."
+ },
+ {
+ "EventCode": "0x816D",
+ "EventName": "STALL_BACKEND_RENAME",
+ "BriefDescription": "Backend stall cycles, rename full."
+ },
+ {
+ "EventCode": "0x816E",
+ "EventName": "STALL_BACKEND_ATOMIC",
+ "BriefDescription": "Backend stall cycles, atomic operation."
+ },
+ {
+ "EventCode": "0x816F",
+ "EventName": "STALL_BACKEND_MEMCPYSET",
+ "BriefDescription": "Backend stall cycles, Memory Copy or Set operation."
+ },
+ {
+ "EventCode": "0x8186",
+ "EventName": "UOP_RETIRED",
+ "BriefDescription": "Micro-operation architecturally executed."
+ },
+ {
+ "EventCode": "0x8188",
+ "EventName": "DTLB_WALK_BLOCK",
+ "BriefDescription": "Data TLB block translation table walk."
+ },
+ {
+ "EventCode": "0x8189",
+ "EventName": "ITLB_WALK_BLOCK",
+ "BriefDescription": "Instruction TLB block translation table walk."
+ },
+ {
+ "EventCode": "0x818A",
+ "EventName": "DTLB_WALK_PAGE",
+ "BriefDescription": "Data TLB page translation table walk."
+ },
+ {
+ "EventCode": "0x818B",
+ "EventName": "ITLB_WALK_PAGE",
+ "BriefDescription": "Instruction TLB page translation table walk."
+ },
+ {
+ "EventCode": "0x81B8",
+ "EventName": "L1I_CACHE_REFILL_HWPRF",
+ "BriefDescription": "Level 1 instruction cache refill, hardware prefetch."
+ },
+ {
+ "EventCode": "0x81BC",
+ "EventName": "L1D_CACHE_REFILL_HWPRF",
+ "BriefDescription": "Level 1 data cache refill, hardware prefetch."
+ },
+ {
+ "EventCode": "0x81BD",
+ "EventName": "L2D_CACHE_REFILL_HWPRF",
+ "BriefDescription": "Level 2 data cache refill, hardware prefetch."
+ },
+ {
+ "EventCode": "0x81C0",
+ "EventName": "L1I_CACHE_HIT_RD",
+ "BriefDescription": "Level 1 instruction cache demand fetch hit."
+ },
+ {
+ "EventCode": "0x81C4",
+ "EventName": "L1D_CACHE_HIT_RD",
+ "BriefDescription": "Level 1 data cache demand access hit, read."
+ },
+ {
+ "EventCode": "0x81C5",
+ "EventName": "L2D_CACHE_HIT_RD",
+ "BriefDescription": "Level 2 data cache demand access hit, read."
+ },
+ {
+ "EventCode": "0x81C8",
+ "EventName": "L1D_CACHE_HIT_WR",
+ "BriefDescription": "Level 1 data cache demand access hit, write."
+ },
+ {
+ "EventCode": "0x81C9",
+ "EventName": "L2D_CACHE_HIT_WR",
+ "BriefDescription": "Level 2 data cache demand access hit, write."
+ },
+ {
+ "EventCode": "0x8200",
+ "EventName": "L1I_CACHE_HIT",
+ "BriefDescription": "Level 1 instruction cache hit."
+ },
+ {
+ "EventCode": "0x8204",
+ "EventName": "L1D_CACHE_HIT",
+ "BriefDescription": "Level 1 data cache hit."
+ },
+ {
+ "EventCode": "0x8205",
+ "EventName": "L2D_CACHE_HIT",
+ "BriefDescription": "Level 2 data cache hit."
+ },
+ {
+ "EventCode": "0x8240",
+ "EventName": "L1I_LFB_HIT_RD",
+ "BriefDescription": "Level 1 instruction cache demand fetch line-fill buffer hit."
+ },
+ {
+ "EventCode": "0x8244",
+ "EventName": "L1D_LFB_HIT_RD",
+ "BriefDescription": "Level 1 data cache demand access line-fill buffer hit, read."
+ },
+ {
+ "EventCode": "0x8245",
+ "EventName": "L2D_LFB_HIT_RD",
+ "BriefDescription": "Level 2 data cache demand access line-fill buffer hit, read."
+ },
+ {
+ "EventCode": "0x8248",
+ "EventName": "L1D_LFB_HIT_WR",
+ "BriefDescription": "Level 1 data cache demand access line-fill buffer hit, write."
+ },
+ {
+ "EventCode": "0x8249",
+ "EventName": "L2D_LFB_HIT_WR",
+ "BriefDescription": "Level 2 data cache demand access line-fill buffer hit, write."
+ },
+ {
+ "EventCode": "0x8280",
+ "EventName": "L1I_CACHE_PRF",
+ "BriefDescription": "Level 1 instruction cache, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x8284",
+ "EventName": "L1D_CACHE_PRF",
+ "BriefDescription": "Level 1 data cache, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x8285",
+ "EventName": "L2D_CACHE_PRF",
+ "BriefDescription": "Level 2 data cache, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x8288",
+ "EventName": "L1I_CACHE_REFILL_PRF",
+ "BriefDescription": "Level 1 instruction cache refill, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x828C",
+ "EventName": "L1D_CACHE_REFILL_PRF",
+ "BriefDescription": "Level 1 data cache refill, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x828D",
+ "EventName": "L2D_CACHE_REFILL_PRF",
+ "BriefDescription": "Level 2 data cache refill, preload or prefetch hit."
+ },
+ {
+ "EventCode": "0x8320",
+ "EventName": "L1D_CACHE_REFILL_PERCYC",
+ "BriefDescription": "Level 1 data or unified cache refills in progress."
+ },
+ {
+ "EventCode": "0x8321",
+ "EventName": "L2D_CACHE_REFILL_PERCYC",
+ "BriefDescription": "Level 2 data or unified cache refills in progress."
+ },
+ {
+ "EventCode": "0x8324",
+ "EventName": "L1I_CACHE_REFILL_PERCYC",
+ "BriefDescription": "Level 1 instruction or unified cache refills in progress."
}
]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/core-imp-def.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/core-imp-def.json
new file mode 100644
index 000000000000..52f5ca1482fe
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/core-imp-def.json
@@ -0,0 +1,6 @@
+[
+ {
+ "ArchStdEvent": "L1I_CACHE_PRF",
+ "BriefDescription": "This event counts fetch counted by either Level 1 instruction hardware prefetch or Level 1 instruction software prefetch."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/cycle_accounting.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/cycle_accounting.json
new file mode 100644
index 000000000000..24ff5d8dbb98
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/cycle_accounting.json
@@ -0,0 +1,122 @@
+[
+ {
+ "EventCode": "0x0182",
+ "EventName": "LD_COMP_WAIT_L1_MISS",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted load/store/prefetch operation waits for L2 cache access."
+ },
+ {
+ "EventCode": "0x0183",
+ "EventName": "LD_COMP_WAIT_L1_MISS_EX",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted integer load operation waits for L2 cache access."
+ },
+ {
+ "EventCode": "0x0184",
+ "EventName": "LD_COMP_WAIT",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted load/store/prefetch operation waits for L1D cache, L2 cache and memory access."
+ },
+ {
+ "EventCode": "0x0185",
+ "EventName": "LD_COMP_WAIT_EX",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted integer load operation waits for L1D cache, L2 cache and memory access."
+ },
+ {
+ "EventCode": "0x0186",
+ "EventName": "LD_COMP_WAIT_PFP_BUSY",
+ "BriefDescription": "This event counts every cycle that no instruction was committed due to the lack of an available prefetch port."
+ },
+ {
+ "EventCode": "0x0187",
+ "EventName": "LD_COMP_WAIT_PFP_BUSY_EX",
+ "BriefDescription": "This event counts the LD_COMP_WAIT_PFP_BUSY caused by an integer load operation."
+ },
+ {
+ "EventCode": "0x0188",
+ "EventName": "LD_COMP_WAIT_PFP_BUSY_SWPF",
+ "BriefDescription": "This event counts the LD_COMP_WAIT_PFP_BUSY caused by a software prefetch instruction."
+ },
+ {
+ "EventCode": "0x0189",
+ "EventName": "EU_COMP_WAIT",
+ "BriefDescription": "This event counts every cycle that no instruction was committed and the oldest and uncommitted instruction is an integer or floating-point/SIMD instruction."
+ },
+ {
+ "EventCode": "0x018A",
+ "EventName": "FL_COMP_WAIT",
+ "BriefDescription": "This event counts every cycle that no instruction was committed and the oldest and uncommitted instruction is a floating-point/SIMD instruction."
+ },
+ {
+ "EventCode": "0x018B",
+ "EventName": "BR_COMP_WAIT",
+ "BriefDescription": "This event counts every cycle that no instruction was committed and the oldest and uncommitted instruction is a branch instruction."
+ },
+ {
+ "EventCode": "0x018C",
+ "EventName": "ROB_EMPTY",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the CSE is empty."
+ },
+ {
+ "EventCode": "0x018D",
+ "EventName": "ROB_EMPTY_STQ_BUSY",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the CSE is empty and the store port (SP) is full."
+ },
+ {
+ "EventCode": "0x018E",
+ "EventName": "WFE_WFI_CYCLE",
+ "BriefDescription": "This event counts every cycle that the instruction unit is halted by the WFE/WFI instruction."
+ },
+ {
+ "EventCode": "0x018F",
+ "EventName": "RETENTION_CYCLE",
+ "BriefDescription": "This event counts every cycle that the instruction unit is halted by the RETENTION state."
+ },
+ {
+ "EventCode": "0x0190",
+ "EventName": "_0INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that no instruction was committed, but counts at the time when commits MOVPRFX only."
+ },
+ {
+ "EventCode": "0x0191",
+ "EventName": "_1INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that one instruction is committed."
+ },
+ {
+ "EventCode": "0x0192",
+ "EventName": "_2INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that two instructions are committed."
+ },
+ {
+ "EventCode": "0x0193",
+ "EventName": "_3INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that three instructions are committed."
+ },
+ {
+ "EventCode": "0x0194",
+ "EventName": "_4INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that four instructions are committed."
+ },
+ {
+ "EventCode": "0x0195",
+ "EventName": "_5INST_COMMIT",
+ "BriefDescription": "This event counts every cycle that five instructions are committed."
+ },
+ {
+ "EventCode": "0x0198",
+ "EventName": "UOP_ONLY_COMMIT",
+ "BriefDescription": "This event counts every cycle that only any micro-operations are committed."
+ },
+ {
+ "EventCode": "0x0199",
+ "EventName": "SINGLE_MOVPRFX_COMMIT",
+ "BriefDescription": "This event counts every cycle that only the MOVPRFX instruction is committed."
+ },
+ {
+ "EventCode": "0x019C",
+ "EventName": "LD_COMP_WAIT_L2_MISS",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted load/store/prefetch operation waits for L2 cache miss."
+ },
+ {
+ "EventCode": "0x019D",
+ "EventName": "LD_COMP_WAIT_L2_MISS_EX",
+ "BriefDescription": "This event counts every cycle that no instruction was committed because the oldest and uncommitted integer load operation waits for L2 cache miss."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/energy.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/energy.json
new file mode 100644
index 000000000000..b55173f71e42
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/energy.json
@@ -0,0 +1,17 @@
+[
+ {
+ "EventCode": "0x01F0",
+ "EventName": "EA_CORE",
+ "BriefDescription": "This event counts energy consumption of core."
+ },
+ {
+ "EventCode": "0x03F0",
+ "EventName": "EA_L3",
+ "BriefDescription": "This event counts energy consumption of L3 cache."
+ },
+ {
+ "EventCode": "0x03F1",
+ "EventName": "EA_LDO_LOSS",
+ "BriefDescription": "This event counts energy consumption of LDO loss."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/exception.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/exception.json
new file mode 100644
index 000000000000..f231712fe261
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/exception.json
@@ -0,0 +1,42 @@
+[
+ {
+ "ArchStdEvent": "EXC_TAKEN",
+ "BriefDescription": "This event counts each exception taken."
+ },
+ {
+ "ArchStdEvent": "EXC_RETURN",
+ "BriefDescription": "This event counts each executed exception return instruction."
+ },
+ {
+ "ArchStdEvent": "EXC_UNDEF",
+ "BriefDescription": "This event counts only other synchronous exceptions that are taken locally."
+ },
+ {
+ "ArchStdEvent": "EXC_SVC",
+ "BriefDescription": "This event counts only Supervisor Call exceptions that are taken locally."
+ },
+ {
+ "ArchStdEvent": "EXC_PABORT",
+ "BriefDescription": "This event counts only Instruction Abort exceptions that are taken locally."
+ },
+ {
+ "ArchStdEvent": "EXC_DABORT",
+ "BriefDescription": "This event counts only Data Abort or SError interrupt exceptions that are taken locally."
+ },
+ {
+ "ArchStdEvent": "EXC_IRQ",
+ "BriefDescription": "This event counts only IRQ exceptions that are taken locally, including Virtual IRQ exceptions."
+ },
+ {
+ "ArchStdEvent": "EXC_FIQ",
+ "BriefDescription": "This event counts only FIQ exceptions that are taken locally, including Virtual FIQ exceptions."
+ },
+ {
+ "ArchStdEvent": "EXC_SMC",
+ "BriefDescription": "This event counts only Secure Monitor Call exceptions. The counter does not increment on SMC instructions trapped as a Hyp Trap exception."
+ },
+ {
+ "ArchStdEvent": "EXC_HVC",
+ "BriefDescription": "This event counts for both Hypervisor Call exceptions taken locally in the hypervisor and those taken as an exception from Non-secure EL1."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/fp_operation.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/fp_operation.json
new file mode 100644
index 000000000000..a3c368959199
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/fp_operation.json
@@ -0,0 +1,209 @@
+[
+ {
+ "EventCode": "0x0105",
+ "EventName": "FP_MV_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point move operations."
+ },
+ {
+ "EventCode": "0x0112",
+ "EventName": "FP_LD_SPEC",
+ "BriefDescription": "This event counts architecturally executed NOSIMD load operations that using SIMD&FP registers."
+ },
+ {
+ "EventCode": "0x0113",
+ "EventName": "FP_ST_SPEC",
+ "BriefDescription": "This event counts architecturally executed NOSIMD store operations that using SIMD&FP registers."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point operations."
+ },
+ {
+ "ArchStdEvent": "FP_HP_SPEC",
+ "BriefDescription": "This event counts architecturally executed half-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_HP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD half-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_HP_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE half-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_HP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE half-precision floating-point operations."
+ },
+ {
+ "ArchStdEvent": "FP_SP_SPEC",
+ "BriefDescription": "This event counts architecturally executed single-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_SP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD single-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_SP_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE single-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_SP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE single-precision floating-point operations."
+ },
+ {
+ "ArchStdEvent": "FP_DP_SPEC",
+ "BriefDescription": "This event counts architecturally executed double-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_DP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD double-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_DP_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE double-precision floating-point operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_DP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE double-precision floating-point operations."
+ },
+ {
+ "ArchStdEvent": "FP_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point divide operation."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point divide operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point divide operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point divide operations."
+ },
+ {
+ "ArchStdEvent": "FP_SQRT_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point square root operation."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_SQRT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point square root operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_SQRT_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point square root operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_SQRT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point square root operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_FMA_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point FMA operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_FMA_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point FMA operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_FMA_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point FMA operations."
+ },
+ {
+ "ArchStdEvent": "FP_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point multiply operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point multiply operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point multiply operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point multiply operations."
+ },
+ {
+ "ArchStdEvent": "FP_ADDSUB_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point add or subtract operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_ADDSUB_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point add or subtract operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_ADDSUB_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point add or subtract operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_ADDSUB_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point add or subtract operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_RECPE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point reciprocal estimate operations."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_RECPE_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point reciprocal estimate operations."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_RECPE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point reciprocal estimate operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_CVT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point convert operation."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_CVT_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point convert operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_CVT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point convert operations."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_AREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point accumulating reduction operations."
+ },
+ {
+ "ArchStdEvent": "ASE_FP_PREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD floating-point pairwise add step operations."
+ },
+ {
+ "ArchStdEvent": "SVE_FP_VREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE floating-point vector reduction operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_VREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE floating-point vector reduction operations."
+ },
+ {
+ "ArchStdEvent": "FP_SCALE_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE arithmetic operations. See FP_SCALE_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by (128 / CSIZE) and by twice that amount for operations that would also be counted by SVE_FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_FIXED_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed v8SIMD&FP arithmetic operations. See FP_FIXED_OPS_SPEC of ARMv9 Reference Manual for more information. The event counter is incremented by the specified number of elements for Advanced SIMD operations or by 1 for scalar operations, and by twice those amounts for operations that would also be counted by FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_DOT_SPEC",
+ "BriefDescription": "This event counts architecturally executed microarchitectural Advanced SIMD or SVE floating-point dot-product operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_FP_MMLA_SPEC",
+ "BriefDescription": "This event counts architecturally executed microarchitectural Advanced SIMD or SVE floating-point matrix multiply operation."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/gcycle.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/gcycle.json
new file mode 100644
index 000000000000..b4ceddc0d25e
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/gcycle.json
@@ -0,0 +1,97 @@
+[
+ {
+ "EventCode": "0x0880",
+ "EventName": "GCYCLES",
+ "BriefDescription": "This event counts the number of cycles at 100MHz."
+ },
+ {
+ "EventCode": "0x0890",
+ "EventName": "FL0_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 0."
+ },
+ {
+ "EventCode": "0x0891",
+ "EventName": "FL1_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 1."
+ },
+ {
+ "EventCode": "0x0892",
+ "EventName": "FL2_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 2."
+ },
+ {
+ "EventCode": "0x0893",
+ "EventName": "FL3_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 3."
+ },
+ {
+ "EventCode": "0x0894",
+ "EventName": "FL4_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 4."
+ },
+ {
+ "EventCode": "0x0895",
+ "EventName": "FL5_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 5."
+ },
+ {
+ "EventCode": "0x0896",
+ "EventName": "FL6_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 6."
+ },
+ {
+ "EventCode": "0x0897",
+ "EventName": "FL7_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 7."
+ },
+ {
+ "EventCode": "0x0898",
+ "EventName": "FL8_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 8."
+ },
+ {
+ "EventCode": "0x0899",
+ "EventName": "FL9_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 9."
+ },
+ {
+ "EventCode": "0x089A",
+ "EventName": "FL10_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 10."
+ },
+ {
+ "EventCode": "0x089B",
+ "EventName": "FL11_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 11."
+ },
+ {
+ "EventCode": "0x089C",
+ "EventName": "FL12_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 12."
+ },
+ {
+ "EventCode": "0x089D",
+ "EventName": "FL13_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 13."
+ },
+ {
+ "EventCode": "0x089E",
+ "EventName": "FL14_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 14."
+ },
+ {
+ "EventCode": "0x089F",
+ "EventName": "FL15_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the Frequency Level 15."
+ },
+ {
+ "EventCode": "0x08A0",
+ "EventName": "RETENTION_GCYCLES",
+ "BriefDescription": "This event counts the number of cycles where the measured core is staying in the RETENTION state."
+ },
+ {
+ "EventCode": "0x08A1",
+ "EventName": "RETENTION_COUNT",
+ "BriefDescription": "This event counts the number of changes from the normal state to the RETENTION state."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/general.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/general.json
new file mode 100644
index 000000000000..32f0fbfc4de4
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/general.json
@@ -0,0 +1,10 @@
+[
+ {
+ "ArchStdEvent": "CPU_CYCLES",
+ "BriefDescription": "This event counts every cycle."
+ },
+ {
+ "ArchStdEvent": "CNT_CYCLES",
+ "BriefDescription": "This event counts the constant frequency cycles counter increments at a constant frequency equal to the rate of increment of the System counter."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/hwpf.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/hwpf.json
new file mode 100644
index 000000000000..a784a032f353
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/hwpf.json
@@ -0,0 +1,52 @@
+[
+ {
+ "EventCode": "0x0230",
+ "EventName": "L1HWPF_STREAM_PF",
+ "BriefDescription": "This event counts streaming prefetch requests to L1D cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0231",
+ "EventName": "L1HWPF_STRIDE_PF",
+ "BriefDescription": "This event counts stride prefetch requests to L1D cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0232",
+ "EventName": "L1HWPF_PFTGT_PF",
+ "BriefDescription": "This event counts LDS prefetch requests to L1D cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0234",
+ "EventName": "L2HWPF_STREAM_PF",
+ "BriefDescription": "This event counts streaming prefetch requests to L2 cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0235",
+ "EventName": "L2HWPF_STRIDE_PF",
+ "BriefDescription": "This event counts stride prefetch requests to L2 cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0237",
+ "EventName": "L2HWPF_OTHER",
+ "BriefDescription": "This event counts prefetch requests to L2 cache generated by the other causes."
+ },
+ {
+ "EventCode": "0x0238",
+ "EventName": "L3HWPF_STREAM_PF",
+ "BriefDescription": "This event counts streaming prefetch requests to L3 cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x0239",
+ "EventName": "L3HWPF_STRIDE_PF",
+ "BriefDescription": "This event counts stride prefetch requests to L3 cache generated by hardware prefetcher."
+ },
+ {
+ "EventCode": "0x023B",
+ "EventName": "L3HWPF_OTHER",
+ "BriefDescription": "This event counts prefetch requests to L3 cache generated by the other causes."
+ },
+ {
+ "EventCode": "0x023C",
+ "EventName": "L1IHWPF_NEXTLINE_PF",
+ "BriefDescription": "This event counts next line's prefetch requests to L1I cache generated by hardware prefetcher."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1d_cache.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1d_cache.json
new file mode 100644
index 000000000000..b0818a2fedb0
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1d_cache.json
@@ -0,0 +1,113 @@
+[
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL",
+ "BriefDescription": "This event counts operations that cause a refill of the L1D cache. See L1D_CACHE_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE",
+ "BriefDescription": "This event counts operations that cause a cache access to the L1D cache. See L1D_CACHE of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_WB",
+ "BriefDescription": "This event counts every write-back of data from the L1D cache. See L1D_CACHE_WB of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_LMISS_RD",
+ "BriefDescription": "This event counts operations that cause a refill of the L1D cache that incurs additional latency."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_RD",
+ "BriefDescription": "This event counts L1D CACHE caused by read access."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_WR",
+ "BriefDescription": "This event counts L1D CACHE caused by write access."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL_RD",
+ "BriefDescription": "This event counts L1D_CACHE_REFILL caused by read access."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL_WR",
+ "BriefDescription": "This event counts L1D_CACHE_REFILL caused by write access."
+ },
+ {
+ "EventCode": "0x0200",
+ "EventName": "L1D_CACHE_DM",
+ "BriefDescription": "This event counts L1D_CACHE caused by demand access."
+ },
+ {
+ "EventCode": "0x0201",
+ "EventName": "L1D_CACHE_DM_RD",
+ "BriefDescription": "This event counts L1D_CACHE caused by demand read access."
+ },
+ {
+ "EventCode": "0x0202",
+ "EventName": "L1D_CACHE_DM_WR",
+ "BriefDescription": "This event counts L1D_CACHE caused by demand write access."
+ },
+ {
+ "EventCode": "0x0208",
+ "EventName": "L1D_CACHE_REFILL_DM",
+ "BriefDescription": "This event counts L1D_CACHE_REFILL caused by demand access."
+ },
+ {
+ "EventCode": "0x0209",
+ "EventName": "L1D_CACHE_REFILL_DM_RD",
+ "BriefDescription": "This event counts L1D_CACHE_REFILL caused by demand read access."
+ },
+ {
+ "EventCode": "0x020A",
+ "EventName": "L1D_CACHE_REFILL_DM_WR",
+ "BriefDescription": "This event counts L1D_CACHE_REFILL caused by demand write access."
+ },
+ {
+ "EventCode": "0x020D",
+ "EventName": "L1D_CACHE_BTC",
+ "BriefDescription": "This event counts demand access that hits cache line with shared status and requests exclusive access in the Level 1 data cache, causing a coherence access to outside of the Level 1 caches of this PE."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_MISS",
+ "BriefDescription": "This event counts demand access that misses in the Level 1 data cache, causing an access to outside of the Level 1 caches of this PE."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_HWPRF",
+ "BriefDescription": "This event counts access counted by L1D_CACHE that is due to a hardware prefetch."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL_HWPRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L1D_CACHE_HWPRF that causes a refill of the Level 1 data cache from outside of the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_HIT_RD",
+ "BriefDescription": "This event counts demand read counted by L1D_CACHE_RD that hits in the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_HIT_WR",
+ "BriefDescription": "This event counts demand write counted by L1D_CACHE_WR that hits in the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_HIT",
+ "BriefDescription": "This event counts access counted by L1D_CACHE that hits in the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_LFB_HIT_RD",
+ "BriefDescription": "This event counts demand access counted by L1D_CACHE_HIT_RD that hits a cache line that is in the process of being loaded into the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_LFB_HIT_WR",
+ "BriefDescription": "This event counts demand access counted by L1D_CACHE_HIT_WR that hits a cache line that is in the process of being loaded into the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_PRF",
+ "BriefDescription": "This event counts fetch counted by either Level 1 data hardware prefetch or Level 1 data software prefetch."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL_PRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L1D_CACHE_PRF that causes a refill of the Level 1 data cache from outside of the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L1D_CACHE_REFILL_PERCYC",
+ "BriefDescription": "The counter counts by the number of cache refills counted by L1D_CACHE_REFILL in progress on each Processor cycle."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1i_cache.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1i_cache.json
new file mode 100644
index 000000000000..8680d8ec461d
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l1i_cache.json
@@ -0,0 +1,52 @@
+[
+ {
+ "ArchStdEvent": "L1I_CACHE_REFILL",
+ "BriefDescription": "This event counts operations that cause a refill of the L1I cache. See L1I_CACHE_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE",
+ "BriefDescription": "This event counts operations that cause a cache access to the L1I cache. See L1I_CACHE of ARMv9 Reference Manual for more information."
+ },
+ {
+ "EventCode": "0x0207",
+ "EventName": "L1I_CACHE_DM_RD",
+ "BriefDescription": "This event counts L1I_CACHE caused by demand read access."
+ },
+ {
+ "EventCode": "0x020F",
+ "EventName": "L1I_CACHE_REFILL_DM_RD",
+ "BriefDescription": "This event counts L1I_CACHE_REFILL caused by demand read access."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_LMISS",
+ "BriefDescription": "This event counts operations that cause a refill of the L1I cache that incurs additional latency."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_HWPRF",
+ "BriefDescription": "This event counts access counted by L1I_CACHE that is due to a hardware prefetch."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_REFILL_HWPRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L1I_CACHE_HWPRF that causes a refill of the Level 1 instruction cache from outside of the Level 1 instruction cache."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_HIT_RD",
+ "BriefDescription": "This event counts demand fetch counted by L1I_CACHE_DM_RD that hits in the Level 1 instruction cache."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_HIT",
+ "BriefDescription": "This event counts access counted by L1I_CACHE that hits in the Level 1 instruction cache."
+ },
+ {
+ "ArchStdEvent": "L1I_LFB_HIT_RD",
+ "BriefDescription": "This event counts demand access counted by L1I_CACHE_HIT_RD that hits a cache line that is in the process of being loaded into the Level 1 instruction cache."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_REFILL_PRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L1I_CACHE_PRF that causes a refill of the Level 1 instruction cache from outside of the Level 1 instruction cache."
+ },
+ {
+ "ArchStdEvent": "L1I_CACHE_REFILL_PERCYC",
+ "BriefDescription": "The counter counts by the number of cache refills counted by L1I_CACHE_REFILL in progress on each Processor cycle."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l2_cache.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l2_cache.json
new file mode 100644
index 000000000000..9e092752e6db
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l2_cache.json
@@ -0,0 +1,160 @@
+[
+ {
+ "ArchStdEvent": "L2D_CACHE",
+ "BriefDescription": "This event counts operations that cause a cache access to the L2 cache. See L2D_CACHE of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL",
+ "BriefDescription": "This event counts operations that cause a refill of the L2 cache. See L2D_CACHE_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_WB",
+ "BriefDescription": "This event counts every write-back of data from the L2 cache caused by L2 replace, non-temporal-store and DC ZVA."
+ },
+ {
+ "ArchStdEvent": "L2I_TLB_REFILL",
+ "BriefDescription": "This event counts operations that cause a TLB refill of the L2I TLB. See L2I_TLB_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2I_TLB",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I TLB. See L2I_TLB of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_RD",
+ "BriefDescription": "This event counts L2D CACHE caused by read access."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_WR",
+ "BriefDescription": "This event counts L2D CACHE caused by write access."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL_RD",
+ "BriefDescription": "This event counts L2D CACHE_REFILL caused by read access."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL_WR",
+ "BriefDescription": "This event counts L2D CACHE_REFILL caused by write access."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_WB_VICTIM",
+ "BriefDescription": "This event counts every write-back of data from the L2 cache caused by L2 replace."
+ },
+ {
+ "EventCode": "0x0300",
+ "EventName": "L2D_CACHE_DM",
+ "BriefDescription": "This event counts L2D_CACHE caused by demand access."
+ },
+ {
+ "EventCode": "0x0301",
+ "EventName": "L2D_CACHE_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE caused by demand read access."
+ },
+ {
+ "EventCode": "0x0302",
+ "EventName": "L2D_CACHE_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE caused by demand write access."
+ },
+ {
+ "EventCode": "0x0305",
+ "EventName": "L2D_CACHE_HWPRF_ADJACENT",
+ "BriefDescription": "This event counts L2D_CACHE caused by hardware adjacent prefetch access."
+ },
+ {
+ "EventCode": "0x0308",
+ "EventName": "L2D_CACHE_REFILL_DM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL caused by demand access."
+ },
+ {
+ "EventCode": "0x0309",
+ "EventName": "L2D_CACHE_REFILL_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL caused by demand read access."
+ },
+ {
+ "EventCode": "0x030A",
+ "EventName": "L2D_CACHE_REFILL_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL caused by demand write access."
+ },
+ {
+ "EventCode": "0x030B",
+ "EventName": "L2D_CACHE_REFILL_DM_WR_EXCL",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL caused by demand write exclusive access."
+ },
+ {
+ "EventCode": "0x030C",
+ "EventName": "L2D_CACHE_REFILL_DM_WR_ATOM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL caused by demand write atomic access."
+ },
+ {
+ "EventCode": "0x030D",
+ "EventName": "L2D_CACHE_BTC",
+ "BriefDescription": "This event counts demand access that hits cache line with shared status and requests exclusive access in the Level 1 data and Level 2 caches, causing a coherence access to outside of the Level 1 and Level 2 caches of this PE."
+ },
+ {
+ "EventCode": "0x03B0",
+ "EventName": "L2D_CACHE_WB_VICTIM_CLEAN",
+ "BriefDescription": "This event counts every write-back of data from the L2 cache caused by L2 replace where the data is clean. In this case, the data will usually be written to L3 cache."
+ },
+ {
+ "EventCode": "0x03B1",
+ "EventName": "L2D_CACHE_WB_NT",
+ "BriefDescription": "This event counts every write-back of data from the L2 cache caused by non-temporal-store."
+ },
+ {
+ "EventCode": "0x03B2",
+ "EventName": "L2D_CACHE_WB_DCZVA",
+ "BriefDescription": "This event counts every write-back of data from the L2 cache caused by DC ZVA."
+ },
+ {
+ "EventCode": "0x03B3",
+ "EventName": "L2D_CACHE_FB",
+ "BriefDescription": "This event counts every flush-back (drop) of data from the L2 cache."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_LMISS_RD",
+ "BriefDescription": "This event counts operations that cause a refill of the L2D cache that incurs additional latency."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_MISS",
+ "BriefDescription": "This event counts demand access that misses in the Level 1 data and Level 2 caches, causing an access to outside of the Level 1 and Level 2 caches of this PE."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_HWPRF",
+ "BriefDescription": "This event counts access counted by L2D_CACHE that is due to a hardware prefetch."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL_HWPRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L2D_CACHE_HWPRF that causes a refill of the Level 2 cache, or any Level 1 data and instruction cache of this PE, from outside of those caches."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_HIT_RD",
+ "BriefDescription": "This event counts demand read counted by L2D_CACHE_RD that hits in the Level 2 data cache."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_HIT_WR",
+ "BriefDescription": "This event counts demand write counted by L2D_CACHE_WR that hits in the Level 2 data cache."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_HIT",
+ "BriefDescription": "This event counts access counted by L2D_CACHE that hits in the Level 2 data cache."
+ },
+ {
+ "ArchStdEvent": "L2D_LFB_HIT_RD",
+ "BriefDescription": "This event counts demand access counted by L2D_CACHE_HIT_RD that hits a recently fetched line in the Level 2 cache."
+ },
+ {
+ "ArchStdEvent": "L2D_LFB_HIT_WR",
+ "BriefDescription": "This event counts demand access counted by L2D_CACHE_HIT_WR that hits a recently fetched line in the Level 2 cache."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_PRF",
+ "BriefDescription": "This event counts fetch counted by either Level 2 data hardware prefetch or Level 2 data software prefetch."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL_PRF",
+ "BriefDescription": "This event counts hardware prefetch counted by L2D_CACHE_PRF that causes a refill of the Level 2 data cache from outside of the Level 1 data cache."
+ },
+ {
+ "ArchStdEvent": "L2D_CACHE_REFILL_PERCYC",
+ "BriefDescription": "The counter counts by the number of cache refills counted by L2D_CACHE_REFILL in progress on each Processor cycle."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l3_cache.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l3_cache.json
new file mode 100644
index 000000000000..3f3e0d22ac68
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/l3_cache.json
@@ -0,0 +1,159 @@
+[
+ {
+ "ArchStdEvent": "L3D_CACHE",
+ "BriefDescription": "This event counts operations that cause a cache access to the L3 cache, as defined by the sum of L2D_CACHE_REFILL_L3D_CACHE and L2D_CACHE_WB_VICTIM_CLEAN events."
+ },
+ {
+ "ArchStdEvent": "L3D_CACHE_RD",
+ "BriefDescription": "This event counts access counted by L3D_CACHE that is a Memory-read operation, as defined by the L2D_CACHE_REFILL_L3D_CACHE events."
+ },
+ {
+ "EventCode": "0x0390",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE",
+ "BriefDescription": "This event counts operations that cause a cache access to the L3 cache."
+ },
+ {
+ "EventCode": "0x0391",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE_DM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_CACHE caused by demand access."
+ },
+ {
+ "EventCode": "0x0392",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_CACHE caused by demand read access."
+ },
+ {
+ "EventCode": "0x0393",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_CACHE caused by demand write access."
+ },
+ {
+ "EventCode": "0x0394",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE_PRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_CACHE caused by prefetch access."
+ },
+ {
+ "EventCode": "0x0395",
+ "EventName": "L2D_CACHE_REFILL_L3D_CACHE_HWPRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_CACHE caused by hardware prefetch access."
+ },
+ {
+ "EventCode": "0x0396",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS",
+ "BriefDescription": "This event counts operations that cause a miss of the L3 cache."
+ },
+ {
+ "EventCode": "0x0397",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_DM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS caused by demand access."
+ },
+ {
+ "EventCode": "0x0398",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS caused by demand read access."
+ },
+ {
+ "EventCode": "0x0399",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS caused by demand write access."
+ },
+ {
+ "EventCode": "0x039A",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_PRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS caused by prefetch access."
+ },
+ {
+ "EventCode": "0x039B",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_HWPRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS caused by hardware prefetch access."
+ },
+ {
+ "EventCode": "0x039C",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT",
+ "BriefDescription": "This event counts operations that cause a hit of the L3 cache."
+ },
+ {
+ "EventCode": "0x039D",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT_DM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_HIT caused by demand access."
+ },
+ {
+ "EventCode": "0x039E",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_HIT caused by demand read access."
+ },
+ {
+ "EventCode": "0x039F",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_HIT caused by demand write access."
+ },
+ {
+ "EventCode": "0x03A0",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT_PRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_HIT caused by prefetch access."
+ },
+ {
+ "EventCode": "0x03A1",
+ "EventName": "L2D_CACHE_REFILL_L3D_HIT_HWPRF",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_HIT caused by hardware prefetch access."
+ },
+ {
+ "EventCode": "0x03A2",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests hit the PFTGT buffer."
+ },
+ {
+ "EventCode": "0x03A3",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT_DM",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT caused by demand access."
+ },
+ {
+ "EventCode": "0x03A4",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT_DM_RD",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT caused by demand read access."
+ },
+ {
+ "EventCode": "0x03A5",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT_DM_WR",
+ "BriefDescription": "This event counts L2D_CACHE_REFILL_L3D_MISS_PFTGT_HIT caused by demand write access."
+ },
+ {
+ "EventCode": "0x03A6",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_L_MEM",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access the memory in the same socket as the requests."
+ },
+ {
+ "EventCode": "0x03A7",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_FR_MEM",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access the memory in the different socket from the requests."
+ },
+ {
+ "EventCode": "0x03A8",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_L_L2",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access the different L2 cache from the requests in the same Numa nodes as the requests."
+ },
+ {
+ "EventCode": "0x03A9",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_NR_L2",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access L2 cache in the different Numa nodes from the requests in the same socket as the requests."
+ },
+ {
+ "EventCode": "0x03AA",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_NR_L3",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access L3 cache in the different Numa nodes from the requests in the same socket as the requests."
+ },
+ {
+ "EventCode": "0x03AB",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_FR_L2",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access L2 cache in the different socket from the requests."
+ },
+ {
+ "EventCode": "0x03AC",
+ "EventName": "L2D_CACHE_REFILL_L3D_MISS_FR_L3",
+ "BriefDescription": "This event counts the number of L3 cache misses where the requests access L3 cache in the different socket from the requests."
+ },
+ {
+ "ArchStdEvent": "L3D_CACHE_LMISS_RD",
+ "BriefDescription": "This event counts access counted by L3D_CACHE that is not completed by the L3D cache, and a Memory-read operation, as defined by the L2D_CACHE_REFILL_L3D_MISS events."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/ll_cache.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/ll_cache.json
new file mode 100644
index 000000000000..a441b84729ab
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/ll_cache.json
@@ -0,0 +1,10 @@
+[
+ {
+ "ArchStdEvent": "LL_CACHE_RD",
+ "BriefDescription": "This event counts access counted by L3D_CACHE that is a Memory-read operation, as defined by the L2D_CACHE_REFILL_L3D_CACHE events."
+ },
+ {
+ "ArchStdEvent": "LL_CACHE_MISS_RD",
+ "BriefDescription": "This event counts access counted by L3D_CACHE that is not completed by the L3D cache, and a Memory-read operation, as defined by the L2D_CACHE_REFILL_L3D_MISS events."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/memory.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/memory.json
new file mode 100644
index 000000000000..4ef125e3a253
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/memory.json
@@ -0,0 +1,10 @@
+[
+ {
+ "ArchStdEvent": "MEM_ACCESS",
+ "BriefDescription": "This event counts architecturally executed memory-reading instructions and memory-writing instructions, as defined by the LDST_SPEC events."
+ },
+ {
+ "ArchStdEvent": "MEM_ACCESS_RD",
+ "BriefDescription": "This event counts architecturally executed memory-reading instructions, as defined by the LD_SPEC events."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pipeline.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pipeline.json
new file mode 100644
index 000000000000..3cc3105f4a5e
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pipeline.json
@@ -0,0 +1,208 @@
+[
+ {
+ "EventCode": "0x01A0",
+ "EventName": "EAGA_VAL",
+ "BriefDescription": "This event counts valid cycles of EAGA pipeline."
+ },
+ {
+ "EventCode": "0x01A1",
+ "EventName": "EAGB_VAL",
+ "BriefDescription": "This event counts valid cycles of EAGB pipeline."
+ },
+ {
+ "EventCode": "0x01A3",
+ "EventName": "PRX_VAL",
+ "BriefDescription": "This event counts valid cycles of PRX pipeline."
+ },
+ {
+ "EventCode": "0x01A4",
+ "EventName": "EXA_VAL",
+ "BriefDescription": "This event counts valid cycles of EXA pipeline."
+ },
+ {
+ "EventCode": "0x01A5",
+ "EventName": "EXB_VAL",
+ "BriefDescription": "This event counts valid cycles of EXB pipeline."
+ },
+ {
+ "EventCode": "0x01A6",
+ "EventName": "EXC_VAL",
+ "BriefDescription": "This event counts valid cycles of EXC pipeline."
+ },
+ {
+ "EventCode": "0x01A7",
+ "EventName": "EXD_VAL",
+ "BriefDescription": "This event counts valid cycles of EXD pipeline."
+ },
+ {
+ "EventCode": "0x01A8",
+ "EventName": "FLA_VAL",
+ "BriefDescription": "This event counts valid cycles of FLA pipeline."
+ },
+ {
+ "EventCode": "0x01A9",
+ "EventName": "FLB_VAL",
+ "BriefDescription": "This event counts valid cycles of FLB pipeline."
+ },
+ {
+ "EventCode": "0x01AA",
+ "EventName": "STEA_VAL",
+ "BriefDescription": "This event counts valid cycles of STEA pipeline."
+ },
+ {
+ "EventCode": "0x01AB",
+ "EventName": "STEB_VAL",
+ "BriefDescription": "This event counts valid cycles of STEB pipeline."
+ },
+ {
+ "EventCode": "0x01AC",
+ "EventName": "STFL_VAL",
+ "BriefDescription": "This event counts valid cycles of STFL pipeline."
+ },
+ {
+ "EventCode": "0x01AD",
+ "EventName": "STPX_VAL",
+ "BriefDescription": "This event counts valid cycles of STPX pipeline."
+ },
+ {
+ "EventCode": "0x01B0",
+ "EventName": "FLA_VAL_PRD_CNT",
+ "BriefDescription": "This event counts the number of 1's in the predicate bits of request in FLA pipeline, where it is corrected so that it becomes 32 when all bits are 1."
+ },
+ {
+ "EventCode": "0x01B1",
+ "EventName": "FLB_VAL_PRD_CNT",
+ "BriefDescription": "This event counts the number of 1's in the predicate bits of request in FLB pipeline, where it is corrected so that it becomes 32 when all bits are 1."
+ },
+ {
+ "EventCode": "0x01B2",
+ "EventName": "FLA_VAL_FOR_PRD",
+ "BriefDescription": "This event counts valid cycles of FLA pipeline."
+ },
+ {
+ "EventCode": "0x01B3",
+ "EventName": "FLB_VAL_FOR_PRD",
+ "BriefDescription": "This event counts valid cycles of FLB pipeline."
+ },
+ {
+ "EventCode": "0x0240",
+ "EventName": "L1_PIPE0_VAL",
+ "BriefDescription": "This event counts valid cycles of L1D cache pipeline#0."
+ },
+ {
+ "EventCode": "0x0241",
+ "EventName": "L1_PIPE1_VAL",
+ "BriefDescription": "This event counts valid cycles of L1D cache pipeline#1."
+ },
+ {
+ "EventCode": "0x0242",
+ "EventName": "L1_PIPE2_VAL",
+ "BriefDescription": "This event counts valid cycles of L1D cache pipeline#2."
+ },
+ {
+ "EventCode": "0x0250",
+ "EventName": "L1_PIPE0_COMP",
+ "BriefDescription": "This event counts completed requests in L1D cache pipeline#0."
+ },
+ {
+ "EventCode": "0x0251",
+ "EventName": "L1_PIPE1_COMP",
+ "BriefDescription": "This event counts completed requests in L1D cache pipeline#1."
+ },
+ {
+ "EventCode": "0x025A",
+ "EventName": "L1_PIPE_ABORT_STLD_INTLK",
+ "BriefDescription": "This event counts aborted requests in L1D pipelines that due to store-load interlock."
+ },
+ {
+ "EventCode": "0x026C",
+ "EventName": "L1I_PIPE_COMP",
+ "BriefDescription": "This event counts completed requests in L1I cache pipeline."
+ },
+ {
+ "EventCode": "0x026D",
+ "EventName": "L1I_PIPE_VAL",
+ "BriefDescription": "This event counts valid cycles of L1I cache pipeline."
+ },
+ {
+ "EventCode": "0x0278",
+ "EventName": "L1_PIPE0_VAL_IU_TAG_ADRS_SCE",
+ "BriefDescription": "This event counts requests in L1D cache pipeline#0 that its sce bit of tagged address is 1."
+ },
+ {
+ "EventCode": "0x0279",
+ "EventName": "L1_PIPE1_VAL_IU_TAG_ADRS_SCE",
+ "BriefDescription": "This event counts requests in L1D cache pipeline#1 that its sce bit of tagged address is 1."
+ },
+ {
+ "EventCode": "0x02A0",
+ "EventName": "L1_PIPE0_VAL_IU_NOT_SEC0",
+ "BriefDescription": "This event counts requests in L1D cache pipeline#0 that its sector cache ID is not 0."
+ },
+ {
+ "EventCode": "0x02A1",
+ "EventName": "L1_PIPE1_VAL_IU_NOT_SEC0",
+ "BriefDescription": "This event counts requests in L1D cache pipeline#1 that its sector cache ID is not 0."
+ },
+ {
+ "EventCode": "0x02B0",
+ "EventName": "L1_PIPE_COMP_GATHER_2FLOW",
+ "BriefDescription": "This event counts the number of times where 2 elements of the gather instructions became 2 flows because 2 elements could not be combined."
+ },
+ {
+ "EventCode": "0x02B1",
+ "EventName": "L1_PIPE_COMP_GATHER_1FLOW",
+ "BriefDescription": "This event counts the number of times where 2 elements of the gather instructions became 1 flow because 2 elements could be combined."
+ },
+ {
+ "EventCode": "0x02B2",
+ "EventName": "L1_PIPE_COMP_GATHER_0FLOW",
+ "BriefDescription": "This event counts the number of times where 2 elements of the gather instructions became 0 flow because both predicate values are 0."
+ },
+ {
+ "EventCode": "0x02B3",
+ "EventName": "L1_PIPE_COMP_SCATTER_1FLOW",
+ "BriefDescription": "This event counts the number of flows of the scatter instructions."
+ },
+ {
+ "EventCode": "0x02B8",
+ "EventName": "L1_PIPE0_COMP_PRD_CNT",
+ "BriefDescription": "This event counts the number of 1's in the predicate bits of request in L1D cache pipeline#0, where it is corrected so that it becomes 64 when all bits are 1."
+ },
+ {
+ "EventCode": "0x02B9",
+ "EventName": "L1_PIPE1_COMP_PRD_CNT",
+ "BriefDescription": "This event counts the number of 1's in the predicate bits of request in L1D cache pipeline#1, where it is corrected so that it becomes 64 when all bits are 1."
+ },
+ {
+ "EventCode": "0x0330",
+ "EventName": "L2_PIPE_VAL",
+ "BriefDescription": "This event counts valid cycles of L2 cache pipeline."
+ },
+ {
+ "EventCode": "0x0350",
+ "EventName": "L2_PIPE_COMP_ALL",
+ "BriefDescription": "This event counts completed requests in L2 cache pipeline."
+ },
+ {
+ "EventCode": "0x0370",
+ "EventName": "L2_PIPE_COMP_PF_L2MIB_MCH",
+ "BriefDescription": "This event counts operations where software or hardware prefetch hits an L2 cache refill buffer allocated by demand access."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_TLB",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_MEMBOUND when there is a demand instruction miss in the instruction TLB."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_TLB",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when there is a demand data miss in the data TLB."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_ST",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when the backend is stalled waiting for a store."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_ILOCK",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND when operations are available from the frontend but at least one is not ready to be sent to the backend because of an input dependency."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pmu.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pmu.json
new file mode 100644
index 000000000000..65bd6cdd0dd5
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/pmu.json
@@ -0,0 +1,10 @@
+[
+ {
+ "ArchStdEvent": "PMU_OVFS",
+ "BriefDescription": "This event counts the event generated each time one of the condition occurs described in Arm Architecture Reference Manual for A-profile architecture. This event is only for output to the trace unit."
+ },
+ {
+ "ArchStdEvent": "PMU_HOVFS",
+ "BriefDescription": "This event counts the event generated each time an event is counted by an event counter <n> and all of the condition occur described in Arm Architecture Reference Manual for A-profile architecture. This event is only for output to the trace unit."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/retired.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/retired.json
new file mode 100644
index 000000000000..de56aafec2dc
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/retired.json
@@ -0,0 +1,30 @@
+[
+ {
+ "ArchStdEvent": "SW_INCR",
+ "BriefDescription": "This event counts on writes to the PMSWINC register."
+ },
+ {
+ "ArchStdEvent": "INST_RETIRED",
+ "BriefDescription": "This event counts every architecturally executed instruction."
+ },
+ {
+ "ArchStdEvent": "CID_WRITE_RETIRED",
+ "BriefDescription": "This event counts every write to CONTEXTIDR."
+ },
+ {
+ "ArchStdEvent": "BR_RETIRED",
+ "BriefDescription": "This event counts architecturally executed branch instruction."
+ },
+ {
+ "ArchStdEvent": "BR_MIS_PRED_RETIRED",
+ "BriefDescription": "This event counts architecturally executed branch instruction which was mispredicted."
+ },
+ {
+ "ArchStdEvent": "OP_RETIRED",
+ "BriefDescription": "This event counts every architecturally executed micro-operation."
+ },
+ {
+ "ArchStdEvent": "UOP_RETIRED",
+ "BriefDescription": "This event counts micro-operation that would be executed in a Simple sequential execution of the program."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/spec_operation.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/spec_operation.json
new file mode 100644
index 000000000000..4841b43e2871
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/spec_operation.json
@@ -0,0 +1,171 @@
+[
+ {
+ "ArchStdEvent": "BR_MIS_PRED",
+ "BriefDescription": "This event counts each correction to the predicted program flow that occurs because of a misprediction from, or no prediction from, the branch prediction resources and that relates to instructions that the branch prediction resources are capable of predicting."
+ },
+ {
+ "ArchStdEvent": "BR_PRED",
+ "BriefDescription": "This event counts every branch or other change in the program flow that the branch prediction resources are capable of predicting."
+ },
+ {
+ "ArchStdEvent": "INST_SPEC",
+ "BriefDescription": "This event counts every architecturally executed instruction."
+ },
+ {
+ "ArchStdEvent": "OP_SPEC",
+ "BriefDescription": "This event counts every speculatively executed micro-operation."
+ },
+ {
+ "ArchStdEvent": "LDREX_SPEC",
+ "BriefDescription": "This event counts architecturally executed load-exclusive instructions."
+ },
+ {
+ "ArchStdEvent": "STREX_SPEC",
+ "BriefDescription": "This event counts architecturally executed store-exclusive instructions."
+ },
+ {
+ "ArchStdEvent": "LD_SPEC",
+ "BriefDescription": "This event counts architecturally executed memory-reading instructions, as defined by the LD_RETIRED event."
+ },
+ {
+ "ArchStdEvent": "ST_SPEC",
+ "BriefDescription": "This event counts architecturally executed memory-writing instructions, as defined by the ST_RETIRED event. This event counts DCZVA as a store operation."
+ },
+ {
+ "ArchStdEvent": "LDST_SPEC",
+ "BriefDescription": "This event counts architecturally executed memory-reading instructions and memory-writing instructions, as defined by the LD_RETIRED and ST_RETIRED events."
+ },
+ {
+ "ArchStdEvent": "DP_SPEC",
+ "BriefDescription": "This event counts architecturally executed integer data-processing instructions. See DP_SPEC of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "ASE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD data-processing instructions."
+ },
+ {
+ "ArchStdEvent": "VFP_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point data-processing instructions."
+ },
+ {
+ "ArchStdEvent": "PC_WRITE_SPEC",
+ "BriefDescription": "This event counts only software changes of the PC that defined by the instruction architecturally executed, condition code check pass, software change of the PC event."
+ },
+ {
+ "ArchStdEvent": "CRYPTO_SPEC",
+ "BriefDescription": "This event counts architecturally executed cryptographic instructions, except PMULL and VMULL."
+ },
+ {
+ "ArchStdEvent": "BR_IMMED_SPEC",
+ "BriefDescription": "This event counts architecturally executed immediate branch instructions."
+ },
+ {
+ "ArchStdEvent": "BR_RETURN_SPEC",
+ "BriefDescription": "This event counts architecturally executed procedure return operations that defined by the BR_RETURN_RETIRED event."
+ },
+ {
+ "ArchStdEvent": "BR_INDIRECT_SPEC",
+ "BriefDescription": "This event counts architecturally executed indirect branch instructions that includes software change of the PC other than exception-generating instructions and immediate branch instructions."
+ },
+ {
+ "ArchStdEvent": "ISB_SPEC",
+ "BriefDescription": "This event counts architecturally executed Instruction Synchronization Barrier instructions."
+ },
+ {
+ "ArchStdEvent": "DSB_SPEC",
+ "BriefDescription": "This event counts architecturally executed Data Synchronization Barrier instructions."
+ },
+ {
+ "ArchStdEvent": "DMB_SPEC",
+ "BriefDescription": "This event counts architecturally executed Data Memory Barrier instructions, excluding the implied barrier operations of load/store operations with release consistency semantics."
+ },
+ {
+ "ArchStdEvent": "CSDB_SPEC",
+ "BriefDescription": "This event counts speculatively executed control speculation barrier instructions."
+ },
+ {
+ "EventCode": "0x0108",
+ "EventName": "PRD_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that using predicate register."
+ },
+ {
+ "EventCode": "0x0109",
+ "EventName": "IEL_SPEC",
+ "BriefDescription": "This event counts architecturally executed inter-element manipulation operations."
+ },
+ {
+ "EventCode": "0x010A",
+ "EventName": "IREG_SPEC",
+ "BriefDescription": "This event counts architecturally executed inter-register manipulation operations."
+ },
+ {
+ "EventCode": "0x011A",
+ "EventName": "BC_LD_SPEC",
+ "BriefDescription": "This event counts architecturally executed SIMD broadcast floating-point load operations."
+ },
+ {
+ "EventCode": "0x011B",
+ "EventName": "DCZVA_SPEC",
+ "BriefDescription": "This event counts architecturally executed zero blocking operations due to the DC ZVA instruction."
+ },
+ {
+ "EventCode": "0x0121",
+ "EventName": "EFFECTIVE_INST_SPEC",
+ "BriefDescription": "This event counts architecturally executed instructions, excluding the MOVPRFX instruction."
+ },
+ {
+ "EventCode": "0x0123",
+ "EventName": "PRE_INDEX_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that uses pre-index as its addressing mode."
+ },
+ {
+ "EventCode": "0x0124",
+ "EventName": "POST_INDEX_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that uses post-index as its addressing mode."
+ },
+ {
+ "EventCode": "0x0139",
+ "EventName": "UOP_SPLIT",
+ "BriefDescription": "This event counts the occurrence count of the micro-operation split."
+ },
+ {
+ "ArchStdEvent": "ASE_INST_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD operations."
+ },
+ {
+ "ArchStdEvent": "INT_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations due to scalar, Advanced SIMD, and SVE instructions listed in Integer instructions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "INT_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed integer divide operation."
+ },
+ {
+ "ArchStdEvent": "INT_DIV64_SPEC",
+ "BriefDescription": "This event counts architecturally executed 64-bit integer divide operation."
+ },
+ {
+ "ArchStdEvent": "INT_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed integer multiply operation."
+ },
+ {
+ "ArchStdEvent": "INT_MUL64_SPEC",
+ "BriefDescription": "This event counts architecturally executed integer 64-bit x 64-bit multiply operation."
+ },
+ {
+ "ArchStdEvent": "INT_MULH64_SPEC",
+ "BriefDescription": "This event counts architecturally executed integer 64-bit x 64-bit multiply returning high part operation."
+ },
+ {
+ "ArchStdEvent": "NONFP_SPEC",
+ "BriefDescription": "This event counts architecturally executed non-floating-point operations."
+ },
+ {
+ "ArchStdEvent": "INT_SCALE_OPS_SPEC",
+ "BriefDescription": "This event counts each integer ALU operation counted by SVE_INT_SPEC. See ALU operation counts section of ARMv9 Reference Manual for information on the counter increment for different types of instruction."
+ },
+ {
+ "ArchStdEvent": "INT_FIXED_OPS_SPEC",
+ "BriefDescription": "This event counts each integer ALU operation counted by INT_SPEC that is not counted by SVE_INT_SPEC. See ALU operation counts section of ARMv9 Reference Manual for information on the counter increment for different types of instruction."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/stall.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/stall.json
new file mode 100644
index 000000000000..5fb81e2a0a07
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/stall.json
@@ -0,0 +1,94 @@
+[
+ {
+ "ArchStdEvent": "STALL_FRONTEND",
+ "BriefDescription": "This event counts every cycle counted by the CPU_CYCLES event on that no operation was issued because there are no operations available to issue for this PE from the frontend."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND",
+ "BriefDescription": "This event counts every cycle counted by the CPU_CYCLES event on that no operation was issued because the backend is unable to accept any operations."
+ },
+ {
+ "ArchStdEvent": "STALL",
+ "BriefDescription": "This event counts every cycle that no instruction was dispatched from decode unit."
+ },
+ {
+ "ArchStdEvent": "STALL_SLOT_BACKEND",
+ "BriefDescription": "This event counts every cycle that no instruction was dispatched from decode unit due to the backend."
+ },
+ {
+ "ArchStdEvent": "STALL_SLOT_FRONTEND",
+ "BriefDescription": "This event counts every cycle that no instruction was dispatched from decode unit due to the frontend."
+ },
+ {
+ "ArchStdEvent": "STALL_SLOT",
+ "BriefDescription": "This event counts every cycle that no instruction or operation Slot was dispatched from decode unit."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_MEM",
+ "BriefDescription": "This event counts every cycle that no instruction was dispatched from decode unit due to memory stall."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_MEMBOUND",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND when no instructions are delivered from the memory system."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_L1I",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_MEMBOUND when there is a demand instruction miss in the first level of instruction cache."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_L2I",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_MEMBOUND when there is a demand instruction miss in the second level of instruction cache."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_MEM",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_MEMBOUND when there is a demand instruction miss in the last level of instruction cache within the PE clock domain or a non-cacheable instruction fetch in progress."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_CPUBOUND",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND when the frontend is stalled on a frontend processor resource, not including memory."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_FLOW",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_CPUBOUND when the frontend is stalled on unavailability of prediction flow resources."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_FLUSH",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_CPUBOUND when the frontend is recovering from a pipeline flush."
+ },
+ {
+ "ArchStdEvent": "STALL_FRONTEND_RENAME",
+ "BriefDescription": "This event counts every cycle counted by STALL_FRONTEND_CPUBOUND when operations are available from the frontend but at least one is not ready to be sent to the backend because no rename register is available."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_MEMBOUND",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND when the backend is waiting for a memory access to complete."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_L1D",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when there is a demand data miss in L1D cache."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_L2D",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when there is a demand data miss in L2D cache."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_CPUBOUND",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND when the backend is stalled on a processor resource, not including memory."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_BUSY",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND when operations are available from the frontend but the backend is not able to accept an operation because an execution unit is busy."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_RENAME",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_CPUBOUND when operations are available from the frontend but at least one is not ready to be sent to the backend because no rename register is available."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_ATOMIC",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when the backend is processing an Atomic operation."
+ },
+ {
+ "ArchStdEvent": "STALL_BACKEND_MEMCPYSET",
+ "BriefDescription": "This event counts every cycle counted by STALL_BACKEND_MEMBOUND when the backend is processing a Memory Copy or Set instruction."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/sve.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/sve.json
new file mode 100644
index 000000000000..e66b5af00f90
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/sve.json
@@ -0,0 +1,254 @@
+[
+ {
+ "ArchStdEvent": "SIMD_INST_RETIRED",
+ "BriefDescription": "This event counts architecturally executed SIMD instructions, excluding the Advanced SIMD scalar instructions and the instructions listed in Non-SIMD SVE instructions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "SVE_INST_RETIRED",
+ "BriefDescription": "This event counts architecturally executed SVE instructions, including the instructions listed in Non-SIMD SVE instructions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "SVE_INST_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE instructions, including the instructions listed in Non-SIMD SVE instructions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INST_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE operations."
+ },
+ {
+ "ArchStdEvent": "UOP_SPEC",
+ "BriefDescription": "This event counts all architecturally executed micro-operations."
+ },
+ {
+ "ArchStdEvent": "SVE_MATH_SPEC",
+ "BriefDescription": "This event counts architecturally executed math function operations due to the SVE FTSMUL, FTMAD, FTSSEL, and FEXPA instructions."
+ },
+ {
+ "ArchStdEvent": "FP_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations due to scalar, Advanced SIMD, and SVE instructions listed in Floating-point instructions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "FP_FMA_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point fused multiply-add and multiply-subtract operations."
+ },
+ {
+ "ArchStdEvent": "FP_RECPE_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point reciprocal estimate operations due to the Advanced SIMD scalar, Advanced SIMD vector, and SVE FRECPE and FRSQRTE instructions."
+ },
+ {
+ "ArchStdEvent": "FP_CVT_SPEC",
+ "BriefDescription": "This event counts architecturally executed floating-point convert operations due to the scalar, Advanced SIMD, and SVE floating-point conversion instructions listed in Floating-point conversions section of ARMv9 Reference Manual."
+ },
+ {
+ "ArchStdEvent": "ASE_INT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD integer operations."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer operations."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INT_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE integer operations."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_DIV_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer divide operation."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_DIV64_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE 64-bit integer divide operation."
+ },
+ {
+ "ArchStdEvent": "ASE_INT_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD integer multiply operation."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer multiply operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INT_MUL_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE integer multiply operations."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_MUL64_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer 64-bit x 64-bit multiply operation."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_MULH64_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer 64-bit x 64-bit multiply returning high part operations."
+ },
+ {
+ "ArchStdEvent": "ASE_NONFP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD non-floating-point operations."
+ },
+ {
+ "ArchStdEvent": "SVE_NONFP_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE non-floating-point operations."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_NONFP_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE non-floating-point operations."
+ },
+ {
+ "ArchStdEvent": "ASE_INT_VREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD integer reduction operation."
+ },
+ {
+ "ArchStdEvent": "SVE_INT_VREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE integer reduction operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INT_VREDUCE_SPEC",
+ "BriefDescription": "This event counts architecturally executed Advanced SIMD and SVE integer reduction operations."
+ },
+ {
+ "ArchStdEvent": "SVE_PERM_SPEC",
+ "BriefDescription": "This event counts architecturally executed vector or predicate permute operation."
+ },
+ {
+ "ArchStdEvent": "SVE_XPIPE_Z2R_SPEC",
+ "BriefDescription": "This event counts architecturally executed vector to general-purpose scalar cross-pipeline transfer operation."
+ },
+ {
+ "ArchStdEvent": "SVE_XPIPE_R2Z_SPEC",
+ "BriefDescription": "This event counts architecturally executed general-purpose scalar to vector cross-pipeline transfer operation."
+ },
+ {
+ "ArchStdEvent": "SVE_PGEN_SPEC",
+ "BriefDescription": "This event counts architecturally executed predicate-generating operation."
+ },
+ {
+ "ArchStdEvent": "SVE_PGEN_FLG_SPEC",
+ "BriefDescription": "This event counts architecturally executed predicate-generating operation that sets condition flags."
+ },
+ {
+ "ArchStdEvent": "SVE_PPERM_SPEC",
+ "BriefDescription": "This event counts architecturally executed predicate permute operation."
+ },
+ {
+ "ArchStdEvent": "SVE_PRED_SPEC",
+ "BriefDescription": "This event counts architecturally executed SIMD data-processing and load/store operations due to SVE instructions with a Governing predicate operand that determines the Active elements."
+ },
+ {
+ "ArchStdEvent": "SVE_MOVPRFX_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations due to MOVPRFX instructions, whether or not they were fused with the prefixed instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_MOVPRFX_Z_SPEC",
+ "BriefDescription": "This event counts architecturally executed operation counted by SVE_MOVPRFX_SPEC where the operation uses zeroing predication."
+ },
+ {
+ "ArchStdEvent": "SVE_MOVPRFX_M_SPEC",
+ "BriefDescription": "This event counts architecturally executed operation counted by SVE_MOVPRFX_SPEC where the operation uses merging predication."
+ },
+ {
+ "ArchStdEvent": "SVE_MOVPRFX_U_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations due to MOVPRFX instructions that were not fused with the prefixed instruction."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_LD_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to SVE and Advanced SIMD load instructions."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_ST_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to SVE and Advanced SIMD store instructions."
+ },
+ {
+ "ArchStdEvent": "PRF_SPEC",
+ "BriefDescription": "This event counts architecturally executed prefetch operations due to scalar PRFM, PRFUM and SVE PRF instructions."
+ },
+ {
+ "ArchStdEvent": "BASE_LD_REG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to an instruction that loads a general-purpose register."
+ },
+ {
+ "ArchStdEvent": "BASE_ST_REG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to an instruction that stores a general-purpose register, excluding the DC ZVA instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_LDR_REG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to an SVE LDR instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_STR_REG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to an SVE STR instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_LDR_PREG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to an SVE LDR (predicate) instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_STR_PREG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to an SVE STR (predicate) instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_PRF_CONTIG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that prefetch memory due to an SVE predicated single contiguous element prefetch instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_LDNT_CONTIG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operation that reads from memory with a non-temporal hint due to an SVE non-temporal contiguous element load instruction."
+ },
+ {
+ "ArchStdEvent": "SVE_STNT_CONTIG_SPEC",
+ "BriefDescription": "This event counts architecturally executed operation that writes to memory with a non-temporal hint due to an SVE non-temporal contiguous element store instruction."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_LD_MULTI_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to SVE and Advanced SIMD multiple vector contiguous structure load instructions."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_ST_MULTI_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to SVE and Advanced SIMD multiple vector contiguous structure store instructions."
+ },
+ {
+ "ArchStdEvent": "SVE_LD_GATHER_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that read from memory due to SVE non-contiguous gather-load instructions."
+ },
+ {
+ "ArchStdEvent": "SVE_ST_SCATTER_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that write to memory due to SVE non-contiguous scatter-store instructions."
+ },
+ {
+ "ArchStdEvent": "SVE_PRF_GATHER_SPEC",
+ "BriefDescription": "This event counts architecturally executed operations that prefetch memory due to SVE non-contiguous gather-prefetch instructions."
+ },
+ {
+ "ArchStdEvent": "SVE_LDFF_SPEC",
+ "BriefDescription": "This event counts architecturally executed memory read operations due to SVE First-fault and Non-fault load instructions."
+ },
+ {
+ "ArchStdEvent": "FP_HP_SCALE_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE half-precision arithmetic operations. See FP_HP_SCALE_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by 8, or by 16 for operations that would also be counted by SVE_FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_HP_FIXED_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed v8SIMD&FP half-precision arithmetic operations. See FP_HP_FIXED_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by the number of 16-bit elements for Advanced SIMD operations, or by 1 for scalar operations, and by twice those amounts for operations that would also be counted by FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_SP_SCALE_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE single-precision arithmetic operations. See FP_SP_SCALE_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by 4, or by 8 for operations that would also be counted by SVE_FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_SP_FIXED_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed v8SIMD&FP single-precision arithmetic operations. See FP_SP_FIXED_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by the number of 32-bit elements for Advanced SIMD operations, or by 1 for scalar operations, and by twice those amounts for operations that would also be counted by FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_DP_SCALE_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed SVE double-precision arithmetic operations. See FP_DP_SCALE_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by 2, or by 4 for operations that would also be counted by SVE_FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "FP_DP_FIXED_OPS_SPEC",
+ "BriefDescription": "This event counts architecturally executed v8SIMD&FP double-precision arithmetic operations. See FP_DP_FIXED_OPS_SPEC of ARMv9 Reference Manual for more information. This event counter is incremented by 2 for Advanced SIMD operations, or by 1 for scalar operations, and by twice those amounts for operations that would also be counted by FP_FMA_SPEC."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INT_DOT_SPEC",
+ "BriefDescription": "This event counts architecturally executed microarchitectural Advanced SIMD or SVE integer dot-product operation."
+ },
+ {
+ "ArchStdEvent": "ASE_SVE_INT_MMLA_SPEC",
+ "BriefDescription": "This event counts architecturally executed microarchitectural Advanced SIMD or SVE integer matrix multiply operation."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/tlb.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/tlb.json
new file mode 100644
index 000000000000..edc7cb8696c8
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/tlb.json
@@ -0,0 +1,362 @@
+[
+ {
+ "ArchStdEvent": "L1I_TLB_REFILL",
+ "BriefDescription": "This event counts operations that cause a TLB refill of the L1I TLB. See L1I_TLB_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1D_TLB_REFILL",
+ "BriefDescription": "This event counts operations that cause a TLB refill of the L1D TLB. See L1D_TLB_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1D_TLB",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D TLB. See L1D_TLB of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L1I_TLB",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I TLB. See L1I_TLB of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2D_TLB_REFILL",
+ "BriefDescription": "This event counts operations that cause a TLB refill of the L2D TLB. See L2D_TLB_REFILL of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "L2D_TLB",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D TLB. See L2D_TLB of ARMv9 Reference Manual for more information."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK",
+ "BriefDescription": "This event counts data TLB access with at least one translation table walk."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK",
+ "BriefDescription": "This event counts instruction TLB access with at least one translation table walk."
+ },
+ {
+ "EventCode": "0x0C00",
+ "EventName": "L1I_TLB_4K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 4KB page."
+ },
+ {
+ "EventCode": "0x0C01",
+ "EventName": "L1I_TLB_64K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 64KB page."
+ },
+ {
+ "EventCode": "0x0C02",
+ "EventName": "L1I_TLB_2M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 2MB page."
+ },
+ {
+ "EventCode": "0x0C03",
+ "EventName": "L1I_TLB_32M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 32MB page."
+ },
+ {
+ "EventCode": "0x0C04",
+ "EventName": "L1I_TLB_512M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 512MB page."
+ },
+ {
+ "EventCode": "0x0C05",
+ "EventName": "L1I_TLB_1G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 1GB page."
+ },
+ {
+ "EventCode": "0x0C06",
+ "EventName": "L1I_TLB_16G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1I in 16GB page."
+ },
+ {
+ "EventCode": "0x0C08",
+ "EventName": "L1D_TLB_4K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 4KB page."
+ },
+ {
+ "EventCode": "0x0C09",
+ "EventName": "L1D_TLB_64K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 64KB page."
+ },
+ {
+ "EventCode": "0x0C0A",
+ "EventName": "L1D_TLB_2M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 2MB page."
+ },
+ {
+ "EventCode": "0x0C0B",
+ "EventName": "L1D_TLB_32M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 32MB page."
+ },
+ {
+ "EventCode": "0x0C0C",
+ "EventName": "L1D_TLB_512M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 512MB page."
+ },
+ {
+ "EventCode": "0x0C0D",
+ "EventName": "L1D_TLB_1G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 1GB page."
+ },
+ {
+ "EventCode": "0x0C0E",
+ "EventName": "L1D_TLB_16G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L1D in 16GB page."
+ },
+ {
+ "EventCode": "0x0C10",
+ "EventName": "L1I_TLB_REFILL_4K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 4KB page."
+ },
+ {
+ "EventCode": "0x0C11",
+ "EventName": "L1I_TLB_REFILL_64K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 64KB page."
+ },
+ {
+ "EventCode": "0x0C12",
+ "EventName": "L1I_TLB_REFILL_2M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 2MB page."
+ },
+ {
+ "EventCode": "0x0C13",
+ "EventName": "L1I_TLB_REFILL_32M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 32MB page."
+ },
+ {
+ "EventCode": "0x0C14",
+ "EventName": "L1I_TLB_REFILL_512M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 512MB page."
+ },
+ {
+ "EventCode": "0x0C15",
+ "EventName": "L1I_TLB_REFILL_1G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 1GB page."
+ },
+ {
+ "EventCode": "0x0C16",
+ "EventName": "L1I_TLB_REFILL_16G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1I in 16GB page."
+ },
+ {
+ "EventCode": "0x0C18",
+ "EventName": "L1D_TLB_REFILL_4K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 4KB page."
+ },
+ {
+ "EventCode": "0x0C19",
+ "EventName": "L1D_TLB_REFILL_64K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 64KB page."
+ },
+ {
+ "EventCode": "0x0C1A",
+ "EventName": "L1D_TLB_REFILL_2M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 2MB page."
+ },
+ {
+ "EventCode": "0x0C1B",
+ "EventName": "L1D_TLB_REFILL_32M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 32MB page."
+ },
+ {
+ "EventCode": "0x0C1C",
+ "EventName": "L1D_TLB_REFILL_512M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 512MB page."
+ },
+ {
+ "EventCode": "0x0C1D",
+ "EventName": "L1D_TLB_REFILL_1G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 1GB page."
+ },
+ {
+ "EventCode": "0x0C1E",
+ "EventName": "L1D_TLB_REFILL_16G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L1D in 16GB page."
+ },
+ {
+ "EventCode": "0x0C20",
+ "EventName": "L2I_TLB_4K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 4KB page."
+ },
+ {
+ "EventCode": "0x0C21",
+ "EventName": "L2I_TLB_64K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 64KB page."
+ },
+ {
+ "EventCode": "0x0C22",
+ "EventName": "L2I_TLB_2M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 2MB page."
+ },
+ {
+ "EventCode": "0x0C23",
+ "EventName": "L2I_TLB_32M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 32MB page."
+ },
+ {
+ "EventCode": "0x0C24",
+ "EventName": "L2I_TLB_512M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 512MB page."
+ },
+ {
+ "EventCode": "0x0C25",
+ "EventName": "L2I_TLB_1G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 1GB page."
+ },
+ {
+ "EventCode": "0x0C26",
+ "EventName": "L2I_TLB_16G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2I in 16GB page."
+ },
+ {
+ "EventCode": "0x0C28",
+ "EventName": "L2D_TLB_4K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 4KB page."
+ },
+ {
+ "EventCode": "0x0C29",
+ "EventName": "L2D_TLB_64K",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 64KB page."
+ },
+ {
+ "EventCode": "0x0C2A",
+ "EventName": "L2D_TLB_2M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 2MB page."
+ },
+ {
+ "EventCode": "0x0C2B",
+ "EventName": "L2D_TLB_32M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 32MB page."
+ },
+ {
+ "EventCode": "0x0C2C",
+ "EventName": "L2D_TLB_512M",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 512MB page."
+ },
+ {
+ "EventCode": "0x0C2D",
+ "EventName": "L2D_TLB_1G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 1GB page."
+ },
+ {
+ "EventCode": "0x0C2E",
+ "EventName": "L2D_TLB_16G",
+ "BriefDescription": "This event counts operations that cause a TLB access to the L2D in 16GB page."
+ },
+ {
+ "EventCode": "0x0C30",
+ "EventName": "L2I_TLB_REFILL_4K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2Iin 4KB page."
+ },
+ {
+ "EventCode": "0x0C31",
+ "EventName": "L2I_TLB_REFILL_64K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 64KB page."
+ },
+ {
+ "EventCode": "0x0C32",
+ "EventName": "L2I_TLB_REFILL_2M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 2MB page."
+ },
+ {
+ "EventCode": "0x0C33",
+ "EventName": "L2I_TLB_REFILL_32M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 32MB page."
+ },
+ {
+ "EventCode": "0x0C34",
+ "EventName": "L2I_TLB_REFILL_512M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 512MB page."
+ },
+ {
+ "EventCode": "0x0C35",
+ "EventName": "L2I_TLB_REFILL_1G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 1GB page."
+ },
+ {
+ "EventCode": "0x0C36",
+ "EventName": "L2I_TLB_REFILL_16G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2I in 16GB page."
+ },
+ {
+ "EventCode": "0x0C38",
+ "EventName": "L2D_TLB_REFILL_4K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 4KB page."
+ },
+ {
+ "EventCode": "0x0C39",
+ "EventName": "L2D_TLB_REFILL_64K",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 64KB page."
+ },
+ {
+ "EventCode": "0x0C3A",
+ "EventName": "L2D_TLB_REFILL_2M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 2MB page."
+ },
+ {
+ "EventCode": "0x0C3B",
+ "EventName": "L2D_TLB_REFILL_32M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 32MB page."
+ },
+ {
+ "EventCode": "0x0C3C",
+ "EventName": "L2D_TLB_REFILL_512M",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 512MB page."
+ },
+ {
+ "EventCode": "0x0C3D",
+ "EventName": "L2D_TLB_REFILL_1G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 1GB page."
+ },
+ {
+ "EventCode": "0x0C3E",
+ "EventName": "L2D_TLB_REFILL_16G",
+ "BriefDescription": "This event counts operations that cause a TLB refill to the L2D in 16GB page."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK_PERCYC",
+ "BriefDescription": "This event counts the number of DTLB_WALK events in progress on each Processor cycle."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK_PERCYC",
+ "BriefDescription": "This event counts the number of ITLB_WALK events in progress on each Processor cycle."
+ },
+ {
+ "ArchStdEvent": "DTLB_STEP",
+ "BriefDescription": "This event counts translation table walk access made by a refill of the data TLB."
+ },
+ {
+ "ArchStdEvent": "ITLB_STEP",
+ "BriefDescription": "This event counts translation table walk access made by a refill of the instruction TLB."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK_LARGE",
+ "BriefDescription": "This event counts translation table walk counted by DTLB_WALK where the result of the walk yields a large page size."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK_LARGE",
+ "BriefDescription": "This event counts translation table walk counted by ITLB_WALK where the result of the walk yields a large page size."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK_SMALL",
+ "BriefDescription": "This event counts translation table walk counted by DTLB_WALK where the result of the walk yields a small page size."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK_SMALL",
+ "BriefDescription": "This event counts translation table walk counted by ITLB_WALK where the result of the walk yields a small page size."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK_BLOCK",
+ "BriefDescription": "This event counts translation table walk counted by DTLB_WALK where the result of the walk yields a Block."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK_BLOCK",
+ "BriefDescription": "This event counts translation table walk counted by ITLB_WALK where the result of the walk yields a Block."
+ },
+ {
+ "ArchStdEvent": "DTLB_WALK_PAGE",
+ "BriefDescription": "This event counts translation table walk counted by DTLB_WALK where the result of the walk yields a Page."
+ },
+ {
+ "ArchStdEvent": "ITLB_WALK_PAGE",
+ "BriefDescription": "This event counts translation table walk counted by ITLB_WALK where the result of the walk yields a Page."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/trace.json b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/trace.json
new file mode 100644
index 000000000000..0c6e5054c9b5
--- /dev/null
+++ b/tools/perf/pmu-events/arch/arm64/fujitsu/monaka/trace.json
@@ -0,0 +1,18 @@
+[
+ {
+ "ArchStdEvent": "TRB_WRAP",
+ "BriefDescription": "This event counts the event generated each time the current write pointer is wrapped to the base pointer."
+ },
+ {
+ "ArchStdEvent": "TRB_TRIG",
+ "BriefDescription": "This event counts the event generated when a Trace Buffer Extension Trigger Event occurs."
+ },
+ {
+ "ArchStdEvent": "TRCEXTOUT0",
+ "BriefDescription": "This event counts the event generated each time an event is signaled by the trace unit external event 0."
+ },
+ {
+ "ArchStdEvent": "CTI_TRIGOUT4",
+ "BriefDescription": "This event counts the event generated each time an event is signaled on CTI output trigger 4."
+ }
+]
diff --git a/tools/perf/pmu-events/arch/arm64/mapfile.csv b/tools/perf/pmu-events/arch/arm64/mapfile.csv
index f4d1ca4d1493..5c846fe90513 100644
--- a/tools/perf/pmu-events/arch/arm64/mapfile.csv
+++ b/tools/perf/pmu-events/arch/arm64/mapfile.csv
@@ -39,6 +39,7 @@
0x00000000420f5160,v1,cavium/thunderx2,core
0x00000000430f0af0,v1,cavium/thunderx2,core
0x00000000460f0010,v1,fujitsu/a64fx,core
+0x00000000460f0030,v1,fujitsu/monaka,core
0x00000000480fd010,v1,hisilicon/hip08,core
0x00000000500f0000,v1,ampere/emag,core
0x00000000c00fac30,v1,ampere/ampereone,core
diff --git a/tools/perf/pmu-events/arch/arm64/recommended.json b/tools/perf/pmu-events/arch/arm64/recommended.json
index 210afa856091..a3b4941ae90c 100644
--- a/tools/perf/pmu-events/arch/arm64/recommended.json
+++ b/tools/perf/pmu-events/arch/arm64/recommended.json
@@ -318,6 +318,11 @@
"BriefDescription": "Barrier speculatively executed, DMB"
},
{
+ "EventCode": "0x7F",
+ "EventName": "CSDB_SPEC",
+ "BriefDescription": "Barrier Speculatively executed, CSDB."
+ },
+ {
"PublicDescription": "Exception taken, Other synchronous",
"EventCode": "0x81",
"EventName": "EXC_UNDEF",
diff --git a/tools/perf/pmu-events/jevents.py b/tools/perf/pmu-events/jevents.py
index d781a377757a..3e204700b59a 100755
--- a/tools/perf/pmu-events/jevents.py
+++ b/tools/perf/pmu-events/jevents.py
@@ -430,8 +430,11 @@ class JsonEvent:
def to_c_string(self, metric: bool) -> str:
"""Representation of the event as a C struct initializer."""
+ def fix_comment(s: str) -> str:
+ return s.replace('*/', r'\*\/')
+
s = self.build_c_string(metric)
- return f'{{ { _bcs.offsets[s] } }}, /* {s} */\n'
+ return f'{{ { _bcs.offsets[s] } }}, /* {fix_comment(s)} */\n'
@lru_cache(maxsize=None)
@@ -461,12 +464,16 @@ def preprocess_arch_std_files(archpath: str) -> None:
"""Read in all architecture standard events."""
global _arch_std_events
for item in os.scandir(archpath):
- if item.is_file() and item.name.endswith('.json'):
+ if not item.is_file() or not item.name.endswith('.json'):
+ continue
+ try:
for event in read_json_events(item.path, topic=''):
if event.name:
_arch_std_events[event.name.lower()] = event
if event.metric_name:
_arch_std_events[event.metric_name.lower()] = event
+ except Exception as e:
+ raise RuntimeError(f'Failure processing \'{item.name}\' in \'{archpath}\'') from e
def add_events_table_entries(item: os.DirEntry, topic: str) -> None:
@@ -1252,7 +1259,10 @@ def main() -> None:
item_path = '/'.join(parents) + ('/' if len(parents) > 0 else '') + item.name
if 'test' not in item_path and 'common' not in item_path and item_path not in _args.model.split(','):
continue
- action(parents, item)
+ try:
+ action(parents, item)
+ except Exception as e:
+ raise RuntimeError(f'Action failure for \'{item.name}\' in {parents}') from e
if item.is_dir():
ftw(item.path, parents + [item.name], action)
diff --git a/tools/perf/scripts/Makefile.syscalls b/tools/perf/scripts/Makefile.syscalls
new file mode 100644
index 000000000000..8bf55333262e
--- /dev/null
+++ b/tools/perf/scripts/Makefile.syscalls
@@ -0,0 +1,61 @@
+# SPDX-License-Identifier: GPL-2.0
+# This Makefile generates headers in
+# tools/perf/arch/$(SRCARCH)/include/generated/asm from the architecture's
+# syscall table. This will either be from the generic syscall table, or from a
+# table that is specific to that architecture.
+
+PHONY := all
+all:
+
+obj := $(OUTPUT)arch/$(SRCARCH)/include/generated/asm
+
+syscall_abis_32 := common,32
+syscall_abis_64 := common,64
+syscalltbl := $(srctree)/tools/scripts/syscall.tbl
+
+# let architectures override $(syscall_abis_%) and $(syscalltbl)
+-include $(srctree)/tools/perf/arch/$(SRCARCH)/entry/syscalls/Makefile.syscalls
+include $(srctree)/tools/build/Build.include
+-include $(srctree)/tools/perf/arch/$(SRCARCH)/entry/syscalls/Kbuild
+
+systbl := $(srctree)/tools/perf/scripts/syscalltbl.sh
+
+syscall-y := $(addprefix $(obj)/, $(syscall-y))
+
+# Remove stale wrappers when the corresponding files are removed from generic-y
+old-headers := $(wildcard $(obj)/*.h)
+unwanted := $(filter-out $(syscall-y),$(old-headers))
+
+quiet_cmd_remove = REMOVE $(unwanted)
+ cmd_remove = rm -f $(unwanted)
+
+quiet_cmd_systbl = SYSTBL $@
+ cmd_systbl = $(CONFIG_SHELL) $(systbl) \
+ $(if $(systbl-args-$*),$(systbl-args-$*),$(systbl-args)) \
+ --abis $(subst $(space),$(comma),$(strip $(syscall_abis_$*))) \
+ $< $@
+
+all: $(syscall-y)
+ $(if $(unwanted),$(call cmd,remove))
+ @:
+
+$(obj)/syscalls_%.h: $(syscalltbl) $(systbl) FORCE
+ $(call if_changed,systbl)
+
+targets := $(syscall-y)
+
+# Create output directory. Skip it if at least one old header exists
+# since we know the output directory already exists.
+ifeq ($(old-headers),)
+$(shell mkdir -p $(obj))
+endif
+
+PHONY += FORCE
+
+FORCE:
+
+existing-targets := $(wildcard $(sort $(targets)))
+
+-include $(foreach f,$(existing-targets),$(dir $(f)).$(notdir $(f)).cmd)
+
+.PHONY: $(PHONY)
diff --git a/tools/perf/scripts/python/Perf-Trace-Util/Context.c b/tools/perf/scripts/python/Perf-Trace-Util/Context.c
index 01f54d6724a5..60dcfe56d4d9 100644
--- a/tools/perf/scripts/python/Perf-Trace-Util/Context.c
+++ b/tools/perf/scripts/python/Perf-Trace-Util/Context.c
@@ -24,16 +24,6 @@
#include "../../../util/srcline.h"
#include "../../../util/srccode.h"
-#if PY_MAJOR_VERSION < 3
-#define _PyCapsule_GetPointer(arg1, arg2) \
- PyCObject_AsVoidPtr(arg1)
-#define _PyBytes_FromStringAndSize(arg1, arg2) \
- PyString_FromStringAndSize((arg1), (arg2))
-#define _PyUnicode_AsUTF8(arg) \
- PyString_AsString(arg)
-
-PyMODINIT_FUNC initperf_trace_context(void);
-#else
#define _PyCapsule_GetPointer(arg1, arg2) \
PyCapsule_GetPointer((arg1), (arg2))
#define _PyBytes_FromStringAndSize(arg1, arg2) \
@@ -42,7 +32,6 @@ PyMODINIT_FUNC initperf_trace_context(void);
PyUnicode_AsUTF8(arg)
PyMODINIT_FUNC PyInit_perf_trace_context(void);
-#endif
static struct scripting_context *get_args(PyObject *args, const char *name, PyObject **arg2)
{
@@ -104,7 +93,7 @@ static PyObject *perf_sample_insn(PyObject *obj, PyObject *args)
if (c->sample->ip && !c->sample->insn_len && thread__maps(c->al->thread)) {
struct machine *machine = maps__machine(thread__maps(c->al->thread));
- script_fetch_insn(c->sample, c->al->thread, machine);
+ script_fetch_insn(c->sample, c->al->thread, machine, /*native_arch=*/true);
}
if (!c->sample->insn_len)
Py_RETURN_NONE; /* N.B. This is a return statement */
@@ -213,12 +202,6 @@ static PyMethodDef ContextMethods[] = {
{ NULL, NULL, 0, NULL}
};
-#if PY_MAJOR_VERSION < 3
-PyMODINIT_FUNC initperf_trace_context(void)
-{
- (void) Py_InitModule("perf_trace_context", ContextMethods);
-}
-#else
PyMODINIT_FUNC PyInit_perf_trace_context(void)
{
static struct PyModuleDef moduledef = {
@@ -240,4 +223,3 @@ PyMODINIT_FUNC PyInit_perf_trace_context(void)
return mod;
}
-#endif
diff --git a/tools/perf/scripts/python/mem-phys-addr.py b/tools/perf/scripts/python/mem-phys-addr.py
index 1f332e72b9b0..5e237a5a5f1b 100644
--- a/tools/perf/scripts/python/mem-phys-addr.py
+++ b/tools/perf/scripts/python/mem-phys-addr.py
@@ -3,98 +3,125 @@
#
# Copyright (c) 2018, Intel Corporation.
-from __future__ import division
-from __future__ import print_function
-
import os
import sys
-import struct
import re
import bisect
import collections
+from dataclasses import dataclass
+from typing import (Dict, Optional)
sys.path.append(os.environ['PERF_EXEC_PATH'] + \
- '/scripts/python/Perf-Trace-Util/lib/Perf/Trace')
+ '/scripts/python/Perf-Trace-Util/lib/Perf/Trace')
+
+@dataclass(frozen=True)
+class IomemEntry:
+ """Read from a line in /proc/iomem"""
+ begin: int
+ end: int
+ indent: int
+ label: str
-#physical address ranges for System RAM
-system_ram = []
-#physical address ranges for Persistent Memory
-pmem = []
-#file object for proc iomem
-f = None
-#Count for each type of memory
-load_mem_type_cnt = collections.Counter()
-#perf event name
-event_name = None
+# Physical memory layout from /proc/iomem. Key is the indent and then
+# a list of ranges.
+iomem: Dict[int, list[IomemEntry]] = collections.defaultdict(list)
+# Child nodes from the iomem parent.
+children: Dict[IomemEntry, set[IomemEntry]] = collections.defaultdict(set)
+# Maximum indent seen before an entry in the iomem file.
+max_indent: int = 0
+# Count for each range of memory.
+load_mem_type_cnt: Dict[IomemEntry, int] = collections.Counter()
+# Perf event name set from the first sample in the data.
+event_name: Optional[str] = None
def parse_iomem():
- global f
- f = open('/proc/iomem', 'r')
- for i, j in enumerate(f):
- m = re.split('-|:',j,2)
- if m[2].strip() == 'System RAM':
- system_ram.append(int(m[0], 16))
- system_ram.append(int(m[1], 16))
- if m[2].strip() == 'Persistent Memory':
- pmem.append(int(m[0], 16))
- pmem.append(int(m[1], 16))
+ """Populate iomem from /proc/iomem file"""
+ global iomem
+ global max_indent
+ global children
+ with open('/proc/iomem', 'r', encoding='ascii') as f:
+ for line in f:
+ indent = 0
+ while line[indent] == ' ':
+ indent += 1
+ if indent > max_indent:
+ max_indent = indent
+ m = re.split('-|:', line, 2)
+ begin = int(m[0], 16)
+ end = int(m[1], 16)
+ label = m[2].strip()
+ entry = IomemEntry(begin, end, indent, label)
+ # Before adding entry, search for a parent node using its begin.
+ if indent > 0:
+ parent = find_memory_type(begin)
+ assert parent, f"Given indent expected a parent for {label}"
+ children[parent].add(entry)
+ iomem[indent].append(entry)
-def print_memory_type():
- print("Event: %s" % (event_name))
- print("%-40s %10s %10s\n" % ("Memory type", "count", "percentage"), end='')
- print("%-40s %10s %10s\n" % ("----------------------------------------",
- "-----------", "-----------"),
- end='');
- total = sum(load_mem_type_cnt.values())
- for mem_type, count in sorted(load_mem_type_cnt.most_common(), \
- key = lambda kv: (kv[1], kv[0]), reverse = True):
- print("%-40s %10d %10.1f%%\n" %
- (mem_type, count, 100 * count / total),
- end='')
+def find_memory_type(phys_addr) -> Optional[IomemEntry]:
+ """Search iomem for the range containing phys_addr with the maximum indent"""
+ for i in range(max_indent, -1, -1):
+ if i not in iomem:
+ continue
+ position = bisect.bisect_right(iomem[i], phys_addr,
+ key=lambda entry: entry.begin)
+ if position is None:
+ continue
+ iomem_entry = iomem[i][position-1]
+ if iomem_entry.begin <= phys_addr <= iomem_entry.end:
+ return iomem_entry
+ print(f"Didn't find {phys_addr}")
+ return None
-def trace_begin():
- parse_iomem()
+def print_memory_type():
+ print(f"Event: {event_name}")
+ print(f"{'Memory type':<40} {'count':>10} {'percentage':>10}")
+ print(f"{'-' * 40:<40} {'-' * 10:>10} {'-' * 10:>10}")
+ total = sum(load_mem_type_cnt.values())
+ # Add count from children into the parent.
+ for i in range(max_indent, -1, -1):
+ if i not in iomem:
+ continue
+ for entry in iomem[i]:
+ global children
+ for child in children[entry]:
+ if load_mem_type_cnt[child] > 0:
+ load_mem_type_cnt[entry] += load_mem_type_cnt[child]
-def trace_end():
- print_memory_type()
- f.close()
+ def print_entries(entries):
+ """Print counts from parents down to their children"""
+ global children
+ for entry in sorted(entries,
+ key = lambda entry: load_mem_type_cnt[entry],
+ reverse = True):
+ count = load_mem_type_cnt[entry]
+ if count > 0:
+ mem_type = ' ' * entry.indent + f"{entry.begin:x}-{entry.end:x} : {entry.label}"
+ percent = 100 * count / total
+ print(f"{mem_type:<40} {count:>10} {percent:>10.1f}")
+ print_entries(children[entry])
-def is_system_ram(phys_addr):
- #/proc/iomem is sorted
- position = bisect.bisect(system_ram, phys_addr)
- if position % 2 == 0:
- return False
- return True
+ print_entries(iomem[0])
-def is_persistent_mem(phys_addr):
- position = bisect.bisect(pmem, phys_addr)
- if position % 2 == 0:
- return False
- return True
+def trace_begin():
+ parse_iomem()
-def find_memory_type(phys_addr):
- if phys_addr == 0:
- return "N/A"
- if is_system_ram(phys_addr):
- return "System RAM"
+def trace_end():
+ print_memory_type()
- if is_persistent_mem(phys_addr):
- return "Persistent Memory"
+def process_event(param_dict):
+ if "sample" not in param_dict:
+ return
- #slow path, search all
- f.seek(0, 0)
- for j in f:
- m = re.split('-|:',j,2)
- if int(m[0], 16) <= phys_addr <= int(m[1], 16):
- return m[2]
- return "N/A"
+ sample = param_dict["sample"]
+ if "phys_addr" not in sample:
+ return
-def process_event(param_dict):
- name = param_dict["ev_name"]
- sample = param_dict["sample"]
- phys_addr = sample["phys_addr"]
+ phys_addr = sample["phys_addr"]
+ entry = find_memory_type(phys_addr)
+ if entry:
+ load_mem_type_cnt[entry] += 1
- global event_name
- if event_name == None:
- event_name = name
- load_mem_type_cnt[find_memory_type(phys_addr)] += 1
+ global event_name
+ if event_name is None:
+ event_name = param_dict["ev_name"]
diff --git a/tools/perf/scripts/syscalltbl.sh b/tools/perf/scripts/syscalltbl.sh
new file mode 100755
index 000000000000..1ce0d5aa8b50
--- /dev/null
+++ b/tools/perf/scripts/syscalltbl.sh
@@ -0,0 +1,86 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+#
+# Generate a syscall table header.
+#
+# Each line of the syscall table should have the following format:
+#
+# NR ABI NAME [NATIVE] [COMPAT]
+#
+# NR syscall number
+# ABI ABI name
+# NAME syscall name
+# NATIVE native entry point (optional)
+# COMPAT compat entry point (optional)
+
+set -e
+
+usage() {
+ echo >&2 "usage: $0 [--abis ABIS] INFILE OUTFILE" >&2
+ echo >&2
+ echo >&2 " INFILE input syscall table"
+ echo >&2 " OUTFILE output header file"
+ echo >&2
+ echo >&2 "options:"
+ echo >&2 " --abis ABIS ABI(s) to handle (By default, all lines are handled)"
+ exit 1
+}
+
+# default unless specified by options
+abis=
+
+while [ $# -gt 0 ]
+do
+ case $1 in
+ --abis)
+ abis=$(echo "($2)" | tr ',' '|')
+ shift 2;;
+ -*)
+ echo "$1: unknown option" >&2
+ usage;;
+ *)
+ break;;
+ esac
+done
+
+if [ $# -ne 2 ]; then
+ usage
+fi
+
+infile="$1"
+outfile="$2"
+
+nxt=0
+
+syscall_macro() {
+ nr="$1"
+ name="$2"
+
+ echo " [$nr] = \"$name\","
+}
+
+emit() {
+ nr="$1"
+ entry="$2"
+
+ syscall_macro "$nr" "$entry"
+}
+
+echo "static const char *const syscalltbl[] = {" > $outfile
+
+sorted_table=$(mktemp /tmp/syscalltbl.XXXXXX)
+grep -E "^[0-9]+[[:space:]]+$abis" "$infile" | sort -n > $sorted_table
+
+max_nr=0
+# the params are: nr abi name entry compat
+# use _ for intentionally unused variables according to SC2034
+while read nr _ name _ _; do
+ emit "$nr" "$name" >> $outfile
+ max_nr=$nr
+done < $sorted_table
+
+rm -f $sorted_table
+
+echo "};" >> $outfile
+
+echo "#define SYSCALLTBL_MAX_ID ${max_nr}" >> $outfile
diff --git a/tools/perf/tests/Build b/tools/perf/tests/Build
index ec4e1f034742..4bf8d3f5eae7 100644
--- a/tools/perf/tests/Build
+++ b/tools/perf/tests/Build
@@ -5,10 +5,10 @@ perf-test-y += tests-scripts.o
perf-test-y += parse-events.o
perf-test-y += dso-data.o
perf-test-y += vmlinux-kallsyms.o
-perf-test-$(CONFIG_LIBTRACEEVENT) += openat-syscall.o
-perf-test-$(CONFIG_LIBTRACEEVENT) += openat-syscall-all-cpus.o
+perf-test-y += openat-syscall.o
+perf-test-y += openat-syscall-all-cpus.o
perf-test-$(CONFIG_LIBTRACEEVENT) += openat-syscall-tp-fields.o
-perf-test-$(CONFIG_LIBTRACEEVENT) += mmap-basic.o
+perf-test-y += mmap-basic.o
perf-test-y += perf-record.o
perf-test-y += evsel-roundtrip-name.o
perf-test-$(CONFIG_LIBTRACEEVENT) += evsel-tp-sched.o
diff --git a/tools/perf/tests/builtin-test.c b/tools/perf/tests/builtin-test.c
index 8dcf74d3c0a3..14d30a5053be 100644
--- a/tools/perf/tests/builtin-test.c
+++ b/tools/perf/tests/builtin-test.c
@@ -42,6 +42,8 @@
static bool dont_fork;
/* Fork the tests in parallel and wait for their completion. */
static bool sequential;
+/* Number of times each test is run. */
+static unsigned int runs_per_test = 1;
const char *dso_to_test;
const char *test_objdump_path = "objdump";
@@ -60,11 +62,9 @@ static struct test_suite *arch_tests[] = {
static struct test_suite *generic_tests[] = {
&suite__vmlinux_matches_kallsyms,
-#ifdef HAVE_LIBTRACEEVENT
&suite__openat_syscall_event,
&suite__openat_syscall_event_on_all_cpus,
&suite__basic_mmap,
-#endif
&suite__mem,
&suite__parse_events,
&suite__expr,
@@ -151,58 +151,51 @@ static struct test_workload *workloads[] = {
#define workloads__for_each(workload) \
for (unsigned i = 0; i < ARRAY_SIZE(workloads) && ({ workload = workloads[i]; 1; }); i++)
-static int num_subtests(const struct test_suite *t)
+#define test_suite__for_each_test_case(suite, idx) \
+ for (idx = 0; (suite)->test_cases && (suite)->test_cases[idx].name != NULL; idx++)
+
+static int test_suite__num_test_cases(const struct test_suite *t)
{
int num;
- if (!t->test_cases)
- return 0;
-
- num = 0;
- while (t->test_cases[num].name)
- num++;
+ test_suite__for_each_test_case(t, num);
return num;
}
-static bool has_subtests(const struct test_suite *t)
-{
- return num_subtests(t) > 1;
-}
-
-static const char *skip_reason(const struct test_suite *t, int subtest)
+static const char *skip_reason(const struct test_suite *t, int test_case)
{
if (!t->test_cases)
return NULL;
- return t->test_cases[subtest >= 0 ? subtest : 0].skip_reason;
+ return t->test_cases[test_case >= 0 ? test_case : 0].skip_reason;
}
-static const char *test_description(const struct test_suite *t, int subtest)
+static const char *test_description(const struct test_suite *t, int test_case)
{
- if (t->test_cases && subtest >= 0)
- return t->test_cases[subtest].desc;
+ if (t->test_cases && test_case >= 0)
+ return t->test_cases[test_case].desc;
return t->desc;
}
-static test_fnptr test_function(const struct test_suite *t, int subtest)
+static test_fnptr test_function(const struct test_suite *t, int test_case)
{
- if (subtest <= 0)
+ if (test_case <= 0)
return t->test_cases[0].run_case;
- return t->test_cases[subtest].run_case;
+ return t->test_cases[test_case].run_case;
}
-static bool test_exclusive(const struct test_suite *t, int subtest)
+static bool test_exclusive(const struct test_suite *t, int test_case)
{
- if (subtest <= 0)
+ if (test_case <= 0)
return t->test_cases[0].exclusive;
- return t->test_cases[subtest].exclusive;
+ return t->test_cases[test_case].exclusive;
}
-static bool perf_test__matches(const char *desc, int curr, int argc, const char *argv[])
+static bool perf_test__matches(const char *desc, int suite_num, int argc, const char *argv[])
{
int i;
@@ -214,7 +207,7 @@ static bool perf_test__matches(const char *desc, int curr, int argc, const char
long nr = strtoul(argv[i], &end, 10);
if (*end == '\0') {
- if (nr == curr + 1)
+ if (nr == suite_num + 1)
return true;
continue;
}
@@ -229,8 +222,8 @@ static bool perf_test__matches(const char *desc, int curr, int argc, const char
struct child_test {
struct child_process process;
struct test_suite *test;
- int test_num;
- int subtest;
+ int suite_num;
+ int test_case_num;
};
static jmp_buf run_test_jmp_buf;
@@ -260,7 +253,7 @@ static int run_test_child(struct child_process *process)
pr_debug("--- start ---\n");
pr_debug("test child forked, pid %d\n", getpid());
- err = test_function(child->test, child->subtest)(child->test, child->subtest);
+ err = test_function(child->test, child->test_case_num)(child->test, child->test_case_num);
pr_debug("---- end(%d) ----\n", err);
err_out:
@@ -272,15 +265,16 @@ err_out:
#define TEST_RUNNING -3
-static int print_test_result(struct test_suite *t, int i, int subtest, int result, int width,
- int running)
+static int print_test_result(struct test_suite *t, int curr_suite, int curr_test_case,
+ int result, int width, int running)
{
- if (has_subtests(t)) {
+ if (test_suite__num_test_cases(t) > 1) {
int subw = width > 2 ? width - 2 : width;
- pr_info("%3d.%1d: %-*s:", i + 1, subtest + 1, subw, test_description(t, subtest));
+ pr_info("%3d.%1d: %-*s:", curr_suite + 1, curr_test_case + 1, subw,
+ test_description(t, curr_test_case));
} else
- pr_info("%3d: %-*s:", i + 1, width, test_description(t, subtest));
+ pr_info("%3d: %-*s:", curr_suite + 1, width, test_description(t, curr_test_case));
switch (result) {
case TEST_RUNNING:
@@ -290,7 +284,7 @@ static int print_test_result(struct test_suite *t, int i, int subtest, int resul
pr_info(" Ok\n");
break;
case TEST_SKIP: {
- const char *reason = skip_reason(t, subtest);
+ const char *reason = skip_reason(t, curr_test_case);
if (reason)
color_fprintf(stderr, PERF_COLOR_YELLOW, " Skip (%s)\n", reason);
@@ -312,7 +306,7 @@ static void finish_test(struct child_test **child_tests, int running_test, int c
{
struct child_test *child_test = child_tests[running_test];
struct test_suite *t;
- int i, subi, err;
+ int curr_suite, curr_test_case, err;
bool err_done = false;
struct strbuf err_output = STRBUF_INIT;
int last_running = -1;
@@ -323,15 +317,15 @@ static void finish_test(struct child_test **child_tests, int running_test, int c
return;
}
t = child_test->test;
- i = child_test->test_num;
- subi = child_test->subtest;
+ curr_suite = child_test->suite_num;
+ curr_test_case = child_test->test_case_num;
err = child_test->process.err;
/*
* For test suites with subtests, display the suite name ahead of the
* sub test names.
*/
- if (has_subtests(t) && subi == 0)
- pr_info("%3d: %-*s:\n", i + 1, width, test_description(t, -1));
+ if (test_suite__num_test_cases(t) > 1 && curr_test_case == 0)
+ pr_info("%3d: %-*s:\n", curr_suite + 1, width, test_description(t, -1));
/*
* Busy loop reading from the child's stdout/stderr that are set to be
@@ -340,10 +334,11 @@ static void finish_test(struct child_test **child_tests, int running_test, int c
if (err > 0)
fcntl(err, F_SETFL, O_NONBLOCK);
if (verbose > 1) {
- if (has_subtests(t))
- pr_info("%3d.%1d: %s:\n", i + 1, subi + 1, test_description(t, subi));
+ if (test_suite__num_test_cases(t) > 1)
+ pr_info("%3d.%1d: %s:\n", curr_suite + 1, curr_test_case + 1,
+ test_description(t, curr_test_case));
else
- pr_info("%3d: %s:\n", i + 1, test_description(t, -1));
+ pr_info("%3d: %s:\n", curr_suite + 1, test_description(t, -1));
}
while (!err_done) {
struct pollfd pfds[1] = {
@@ -368,7 +363,8 @@ static void finish_test(struct child_test **child_tests, int running_test, int c
*/
fprintf(debug_file(), PERF_COLOR_DELETE_LINE);
}
- print_test_result(t, i, subi, TEST_RUNNING, width, running);
+ print_test_result(t, curr_suite, curr_test_case, TEST_RUNNING,
+ width, running);
last_running = running;
}
}
@@ -406,14 +402,14 @@ static void finish_test(struct child_test **child_tests, int running_test, int c
fprintf(stderr, "%s", err_output.buf);
strbuf_release(&err_output);
- print_test_result(t, i, subi, ret, width, /*running=*/0);
+ print_test_result(t, curr_suite, curr_test_case, ret, width, /*running=*/0);
if (err > 0)
close(err);
zfree(&child_tests[running_test]);
}
-static int start_test(struct test_suite *test, int i, int subi, struct child_test **child,
- int width, int pass)
+static int start_test(struct test_suite *test, int curr_suite, int curr_test_case,
+ struct child_test **child, int width, int pass)
{
int err;
@@ -421,17 +417,18 @@ static int start_test(struct test_suite *test, int i, int subi, struct child_tes
if (dont_fork) {
if (pass == 1) {
pr_debug("--- start ---\n");
- err = test_function(test, subi)(test, subi);
+ err = test_function(test, curr_test_case)(test, curr_test_case);
pr_debug("---- end ----\n");
- print_test_result(test, i, subi, err, width, /*running=*/0);
+ print_test_result(test, curr_suite, curr_test_case, err, width,
+ /*running=*/0);
}
return 0;
}
- if (pass == 1 && !sequential && test_exclusive(test, subi)) {
+ if (pass == 1 && !sequential && test_exclusive(test, curr_test_case)) {
/* When parallel, skip exclusive tests on the first pass. */
return 0;
}
- if (pass != 1 && (sequential || !test_exclusive(test, subi))) {
+ if (pass != 1 && (sequential || !test_exclusive(test, curr_test_case))) {
/* Sequential and non-exclusive tests were run on the first pass. */
return 0;
}
@@ -440,8 +437,8 @@ static int start_test(struct test_suite *test, int i, int subi, struct child_tes
return -ENOMEM;
(*child)->test = test;
- (*child)->test_num = i;
- (*child)->subtest = subi;
+ (*child)->suite_num = curr_suite;
+ (*child)->test_case_num = curr_test_case;
(*child)->process.pid = -1;
(*child)->process.no_stdin = 1;
if (verbose <= 0) {
@@ -481,20 +478,16 @@ static int __cmd_test(struct test_suite **suites, int argc, const char *argv[],
int err = 0;
for (struct test_suite **t = suites; *t; t++) {
- int len = strlen(test_description(*t, -1));
+ int i, len = strlen(test_description(*t, -1));
if (width < len)
width = len;
- if (has_subtests(*t)) {
- for (int subi = 0, subn = num_subtests(*t); subi < subn; subi++) {
- len = strlen(test_description(*t, subi));
- if (width < len)
- width = len;
- num_tests++;
- }
- } else {
- num_tests++;
+ test_suite__for_each_test_case(*t, i) {
+ len = strlen(test_description(*t, i));
+ if (width < len)
+ width = len;
+ num_tests += runs_per_test;
}
}
child_tests = calloc(num_tests, sizeof(*child_tests));
@@ -508,11 +501,11 @@ static int __cmd_test(struct test_suite **suites, int argc, const char *argv[],
for (size_t x = 0; x < num_tests; x++) {
struct child_test *child_test = child_tests[x];
- if (!child_test)
+ if (!child_test || child_test->process.pid <= 0)
continue;
pr_debug3("Killing %d pid %d\n",
- child_test->test_num + 1,
+ child_test->suite_num + 1,
child_test->process.pid);
kill(child_test->process.pid, err);
}
@@ -528,50 +521,48 @@ static int __cmd_test(struct test_suite **suites, int argc, const char *argv[],
*/
for (int pass = 1; pass <= 2; pass++) {
int child_test_num = 0;
- int i = 0;
+ int curr_suite = 0;
- for (struct test_suite **t = suites; *t; t++) {
- int curr = i++;
+ for (struct test_suite **t = suites; *t; t++, curr_suite++) {
+ int curr_test_case;
- if (!perf_test__matches(test_description(*t, -1), curr, argc, argv)) {
+ if (!perf_test__matches(test_description(*t, -1), curr_suite, argc, argv)) {
/*
* Test suite shouldn't be run based on
- * description. See if subtest should.
+ * description. See if any test case should.
*/
bool skip = true;
- for (int subi = 0, subn = num_subtests(*t); subi < subn; subi++) {
- if (perf_test__matches(test_description(*t, subi),
- curr, argc, argv))
+ test_suite__for_each_test_case(*t, curr_test_case) {
+ if (perf_test__matches(test_description(*t, curr_test_case),
+ curr_suite, argc, argv)) {
skip = false;
+ break;
+ }
}
-
if (skip)
continue;
}
- if (intlist__find(skiplist, i)) {
- pr_info("%3d: %-*s:", curr + 1, width, test_description(*t, -1));
+ if (intlist__find(skiplist, curr_suite + 1)) {
+ pr_info("%3d: %-*s:", curr_suite + 1, width,
+ test_description(*t, -1));
color_fprintf(stderr, PERF_COLOR_YELLOW, " Skip (user override)\n");
continue;
}
- if (!has_subtests(*t)) {
- err = start_test(*t, curr, -1, &child_tests[child_test_num++],
- width, pass);
- if (err)
- goto err_out;
- continue;
- }
- for (int subi = 0, subn = num_subtests(*t); subi < subn; subi++) {
- if (!perf_test__matches(test_description(*t, subi),
- curr, argc, argv))
- continue;
-
- err = start_test(*t, curr, subi, &child_tests[child_test_num++],
- width, pass);
- if (err)
- goto err_out;
+ for (unsigned int run = 0; run < runs_per_test; run++) {
+ test_suite__for_each_test_case(*t, curr_test_case) {
+ if (!perf_test__matches(test_description(*t, curr_test_case),
+ curr_suite, argc, argv))
+ continue;
+
+ err = start_test(*t, curr_suite, curr_test_case,
+ &child_tests[child_test_num++],
+ width, pass);
+ if (err)
+ goto err_out;
+ }
}
}
if (!sequential) {
@@ -592,25 +583,24 @@ err_out:
return err;
}
-static int perf_test__list(struct test_suite **suites, int argc, const char **argv)
+static int perf_test__list(FILE *fp, struct test_suite **suites, int argc, const char **argv)
{
- int i = 0;
+ int curr_suite = 0;
- for (struct test_suite **t = suites; *t; t++) {
- int curr = i++;
+ for (struct test_suite **t = suites; *t; t++, curr_suite++) {
+ int curr_test_case;
- if (!perf_test__matches(test_description(*t, -1), curr, argc, argv))
+ if (!perf_test__matches(test_description(*t, -1), curr_suite, argc, argv))
continue;
- pr_info("%3d: %s\n", i, test_description(*t, -1));
+ fprintf(fp, "%3d: %s\n", curr_suite + 1, test_description(*t, -1));
- if (has_subtests(*t)) {
- int subn = num_subtests(*t);
- int subi;
+ if (test_suite__num_test_cases(*t) <= 1)
+ continue;
- for (subi = 0; subi < subn; subi++)
- pr_info("%3d:%1d: %s\n", i, subi + 1,
- test_description(*t, subi));
+ test_suite__for_each_test_case(*t, curr_test_case) {
+ fprintf(fp, "%3d.%1d: %s\n", curr_suite + 1, curr_test_case + 1,
+ test_description(*t, curr_test_case));
}
}
return 0;
@@ -667,27 +657,24 @@ static struct test_suite **build_suites(void)
if (suites[2] == NULL)
suites[2] = create_script_test_suites();
-#define for_each_test(t) \
+#define for_each_suite(suite) \
for (size_t i = 0, j = 0; i < ARRAY_SIZE(suites); i++, j = 0) \
- while ((t = suites[i][j++]) != NULL)
+ while ((suite = suites[i][j++]) != NULL)
- for_each_test(t)
+ for_each_suite(t)
num_suites++;
result = calloc(num_suites + 1, sizeof(struct test_suite *));
for (int pass = 1; pass <= 2; pass++) {
- for_each_test(t) {
+ for_each_suite(t) {
bool exclusive = false;
+ int curr_test_case;
- if (!has_subtests(t)) {
- exclusive = test_exclusive(t, -1);
- } else {
- for (int subi = 0, subn = num_subtests(t); subi < subn; subi++) {
- if (test_exclusive(t, subi)) {
- exclusive = true;
- break;
- }
+ test_suite__for_each_test_case(t, curr_test_case) {
+ if (test_exclusive(t, curr_test_case)) {
+ exclusive = true;
+ break;
}
}
if ((!exclusive && pass == 1) || (exclusive && pass == 2))
@@ -695,7 +682,7 @@ static struct test_suite **build_suites(void)
}
}
return result;
-#undef for_each_test
+#undef for_each_suite
}
int cmd_test(int argc, const char **argv)
@@ -715,6 +702,8 @@ int cmd_test(int argc, const char **argv)
"Do not fork for testcase"),
OPT_BOOLEAN('S', "sequential", &sequential,
"Run the tests one after another rather than in parallel"),
+ OPT_UINTEGER('r', "runs-per-test", &runs_per_test,
+ "Run each test the given number of times, default 1"),
OPT_STRING('w', "workload", &workload, "work", "workload to run for testing, use '--list-workloads' to list the available ones."),
OPT_BOOLEAN(0, "list-workloads", &list_workloads, "List the available builtin workloads to use with -w/--workload"),
OPT_STRING(0, "dso", &dso_to_test, "dso", "dso to test"),
@@ -738,7 +727,7 @@ int cmd_test(int argc, const char **argv)
argc = parse_options_subcommand(argc, argv, test_options, test_subcommands, test_usage, 0);
if (argc >= 1 && !strcmp(argv[0], "list")) {
suites = build_suites();
- ret = perf_test__list(suites, argc - 1, argv + 1);
+ ret = perf_test__list(stdout, suites, argc - 1, argv + 1);
free(suites);
return ret;
}
diff --git a/tools/perf/tests/code-reading.c b/tools/perf/tests/code-reading.c
index 27c82cfb7e7d..b1abb34d7818 100644
--- a/tools/perf/tests/code-reading.c
+++ b/tools/perf/tests/code-reading.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
#include <errno.h>
+#include <linux/kconfig.h>
#include <linux/kernel.h>
#include <linux/types.h>
#include <inttypes.h>
@@ -8,6 +9,7 @@
#include <stdio.h>
#include <string.h>
#include <sys/param.h>
+#include <sys/utsname.h>
#include <perf/cpumap.h>
#include <perf/evlist.h>
#include <perf/mmap.h>
@@ -176,16 +178,104 @@ static int read_objdump_output(FILE *f, void *buf, size_t *len, u64 start_addr)
return err;
}
+/*
+ * Only gets GNU objdump version. Returns 0 for llvm-objdump.
+ */
+static int objdump_version(void)
+{
+ size_t line_len;
+ char cmd[PATH_MAX * 2];
+ char *line = NULL;
+ const char *fmt;
+ FILE *f;
+ int ret;
+
+ int version_tmp, version_num = 0;
+ char *version = 0, *token;
+
+ fmt = "%s --version";
+ ret = snprintf(cmd, sizeof(cmd), fmt, test_objdump_path);
+ if (ret <= 0 || (size_t)ret >= sizeof(cmd))
+ return -1;
+ /* Ignore objdump errors */
+ strcat(cmd, " 2>/dev/null");
+ f = popen(cmd, "r");
+ if (!f) {
+ pr_debug("popen failed\n");
+ return -1;
+ }
+ /* Get first line of objdump --version output */
+ ret = getline(&line, &line_len, f);
+ pclose(f);
+ if (ret < 0) {
+ pr_debug("getline failed\n");
+ return -1;
+ }
+
+ token = strsep(&line, " ");
+ if (token != NULL && !strcmp(token, "GNU")) {
+ // version is last part of first line of objdump --version output.
+ while ((token = strsep(&line, " ")))
+ version = token;
+
+ // Convert version into a format we can compare with
+ token = strsep(&version, ".");
+ version_num = atoi(token);
+ if (version_num)
+ version_num *= 10000;
+
+ token = strsep(&version, ".");
+ version_tmp = atoi(token);
+ if (token)
+ version_num += version_tmp * 100;
+
+ token = strsep(&version, ".");
+ version_tmp = atoi(token);
+ if (token)
+ version_num += version_tmp;
+ }
+
+ return version_num;
+}
+
static int read_via_objdump(const char *filename, u64 addr, void *buf,
size_t len)
{
+ u64 stop_address = addr + len;
+ struct utsname uname_buf;
char cmd[PATH_MAX * 2];
const char *fmt;
FILE *f;
int ret;
+ ret = uname(&uname_buf);
+ if (ret) {
+ pr_debug("uname failed\n");
+ return -1;
+ }
+
+ if (!strncmp(uname_buf.machine, "riscv", 5)) {
+ int version = objdump_version();
+
+ /* Default to this workaround if version parsing fails */
+ if (version < 0 || version > 24100) {
+ /*
+ * Starting at riscv objdump version 2.41, dumping in
+ * the middle of an instruction is not supported. riscv
+ * instructions are aligned along 2-byte intervals and
+ * can be either 2-bytes or 4-bytes. This makes it
+ * possible that the stop-address lands in the middle of
+ * a 4-byte instruction. Increase the stop_address by
+ * two to ensure an instruction is not cut in half, but
+ * leave the len as-is so only the expected number of
+ * bytes are collected.
+ */
+ stop_address += 2;
+ }
+ }
+
fmt = "%s -z -d --start-address=0x%"PRIx64" --stop-address=0x%"PRIx64" %s";
- ret = snprintf(cmd, sizeof(cmd), fmt, test_objdump_path, addr, addr + len,
+ ret = snprintf(cmd, sizeof(cmd), fmt, test_objdump_path, addr, stop_address,
filename);
if (ret <= 0 || (size_t)ret >= sizeof(cmd))
return -1;
diff --git a/tools/perf/tests/cpumap.c b/tools/perf/tests/cpumap.c
index 2f0168b2a5a9..2354246afc5a 100644
--- a/tools/perf/tests/cpumap.c
+++ b/tools/perf/tests/cpumap.c
@@ -156,21 +156,54 @@ static int test__cpu_map_print(struct test_suite *test __maybe_unused, int subte
return 0;
}
-static int test__cpu_map_merge(struct test_suite *test __maybe_unused, int subtest __maybe_unused)
+static int __test__cpu_map_merge(const char *lhs, const char *rhs, int nr, const char *expected)
{
- struct perf_cpu_map *a = perf_cpu_map__new("4,2,1");
- struct perf_cpu_map *b = perf_cpu_map__new("4,5,7");
- struct perf_cpu_map *c = perf_cpu_map__merge(a, b);
+ struct perf_cpu_map *a = perf_cpu_map__new(lhs);
+ struct perf_cpu_map *b = perf_cpu_map__new(rhs);
char buf[100];
- TEST_ASSERT_VAL("failed to merge map: bad nr", perf_cpu_map__nr(c) == 5);
- cpu_map__snprint(c, buf, sizeof(buf));
- TEST_ASSERT_VAL("failed to merge map: bad result", !strcmp(buf, "1-2,4-5,7"));
+ perf_cpu_map__merge(&a, b);
+ TEST_ASSERT_VAL("failed to merge map: bad nr", perf_cpu_map__nr(a) == nr);
+ cpu_map__snprint(a, buf, sizeof(buf));
+ TEST_ASSERT_VAL("failed to merge map: bad result", !strcmp(buf, expected));
perf_cpu_map__put(b);
- perf_cpu_map__put(c);
+
+ /*
+ * If 'b' is a superset of 'a', 'a' points to the same map with the
+ * map 'b'. In this case, the owner 'b' has released the resource above
+ * but 'a' still keeps the ownership, the reference counter should be 1.
+ */
+ TEST_ASSERT_VAL("unexpected refcnt: bad result",
+ refcount_read(perf_cpu_map__refcnt(a)) == 1);
+
+ perf_cpu_map__put(a);
return 0;
}
+static int test__cpu_map_merge(struct test_suite *test __maybe_unused,
+ int subtest __maybe_unused)
+{
+ int ret;
+
+ ret = __test__cpu_map_merge("4,2,1", "4,5,7", 5, "1-2,4-5,7");
+ if (ret)
+ return ret;
+ ret = __test__cpu_map_merge("1-8", "6-9", 9, "1-9");
+ if (ret)
+ return ret;
+ ret = __test__cpu_map_merge("1-8,12-20", "6-9,15", 18, "1-9,12-20");
+ if (ret)
+ return ret;
+ ret = __test__cpu_map_merge("4,2,1", "1", 3, "1-2,4");
+ if (ret)
+ return ret;
+ ret = __test__cpu_map_merge("1", "4,2,1", 3, "1-2,4");
+ if (ret)
+ return ret;
+ ret = __test__cpu_map_merge("1", "1", 1, "1");
+ return ret;
+}
+
static int __test__cpu_map_intersect(const char *lhs, const char *rhs, int nr, const char *expected)
{
struct perf_cpu_map *a = perf_cpu_map__new(lhs);
@@ -219,30 +252,29 @@ static int test__cpu_map_equal(struct test_suite *test __maybe_unused, int subte
struct perf_cpu_map *empty = perf_cpu_map__intersect(one, two);
struct perf_cpu_map *pair = perf_cpu_map__new("1-2");
struct perf_cpu_map *tmp;
- struct perf_cpu_map *maps[] = {empty, any, one, two, pair};
+ struct perf_cpu_map **maps[] = {&empty, &any, &one, &two, &pair};
for (size_t i = 0; i < ARRAY_SIZE(maps); i++) {
/* Maps equal themself. */
- TEST_ASSERT_VAL("equal", perf_cpu_map__equal(maps[i], maps[i]));
+ TEST_ASSERT_VAL("equal", perf_cpu_map__equal(*maps[i], *maps[i]));
for (size_t j = 0; j < ARRAY_SIZE(maps); j++) {
/* Maps dont't equal each other. */
if (i == j)
continue;
- TEST_ASSERT_VAL("not equal", !perf_cpu_map__equal(maps[i], maps[j]));
+ TEST_ASSERT_VAL("not equal", !perf_cpu_map__equal(*maps[i], *maps[j]));
}
}
/* Maps equal made maps. */
- tmp = perf_cpu_map__merge(perf_cpu_map__get(one), two);
- TEST_ASSERT_VAL("pair", perf_cpu_map__equal(pair, tmp));
- perf_cpu_map__put(tmp);
+ perf_cpu_map__merge(&two, one);
+ TEST_ASSERT_VAL("pair", perf_cpu_map__equal(pair, two));
tmp = perf_cpu_map__intersect(pair, one);
TEST_ASSERT_VAL("one", perf_cpu_map__equal(one, tmp));
perf_cpu_map__put(tmp);
for (size_t i = 0; i < ARRAY_SIZE(maps); i++)
- perf_cpu_map__put(maps[i]);
+ perf_cpu_map__put(*maps[i]);
return TEST_OK;
}
diff --git a/tools/perf/tests/event_groups.c b/tools/perf/tests/event_groups.c
index ccd9d8b2903f..c119ff114948 100644
--- a/tools/perf/tests/event_groups.c
+++ b/tools/perf/tests/event_groups.c
@@ -10,9 +10,10 @@
#include "header.h"
#include "../perf-sys.h"
-/* hw: cycles, sw: context-switch, uncore: [arch dependent] */
+/* hw: cycles,instructions sw: context-switch, uncore: [arch dependent] */
static int types[] = {0, 1, -1};
static unsigned long configs[] = {0, 3, 0};
+static unsigned long configs_hw[] = {1};
#define NR_UNCORE_PMUS 5
@@ -93,7 +94,18 @@ static int run_test(int i, int j, int k)
return erroneous ? 0 : -1;
}
- sibling_fd2 = event_open(types[k], configs[k], group_fd);
+ /*
+ * if all three events (leader and two sibling events)
+ * are hardware events, use instructions as one of the
+ * sibling event. There is event constraint in powerpc that
+ * events using same counter cannot be programmed in a group.
+ * Since PERF_COUNT_HW_INSTRUCTIONS is a generic hardware
+ * event and present in all platforms, lets use that.
+ */
+ if (!i && !j && !k)
+ sibling_fd2 = event_open(types[k], configs_hw[k], group_fd);
+ else
+ sibling_fd2 = event_open(types[k], configs[k], group_fd);
if (sibling_fd2 == -1) {
close(sibling_fd1);
close(group_fd);
@@ -124,9 +136,18 @@ static int test__event_groups(struct test_suite *text __maybe_unused, int subtes
if (r)
ret = TEST_FAIL;
- pr_debug("0x%x 0x%lx, 0x%x 0x%lx, 0x%x 0x%lx: %s\n",
- types[i], configs[i], types[j], configs[j],
- types[k], configs[k], r ? "Fail" : "Pass");
+ /*
+ * For all three events as HW events, second sibling
+ * event is picked from configs_hw. So print accordingly
+ */
+ if (!i && !j && !k)
+ pr_debug("0x%x 0x%lx, 0x%x 0x%lx, 0x%x 0x%lx: %s\n",
+ types[i], configs[i], types[j], configs[j],
+ types[k], configs_hw[k], r ? "Fail" : "Pass");
+ else
+ pr_debug("0x%x 0x%lx, 0x%x 0x%lx, 0x%x 0x%lx: %s\n",
+ types[i], configs[i], types[j], configs[j],
+ types[k], configs[k], r ? "Fail" : "Pass");
}
}
}
diff --git a/tools/perf/tests/expr.c b/tools/perf/tests/expr.c
index 41ff1affdfcd..726cf8d4da28 100644
--- a/tools/perf/tests/expr.c
+++ b/tools/perf/tests/expr.c
@@ -75,14 +75,12 @@ static int test__expr(struct test_suite *t __maybe_unused, int subtest __maybe_u
double val, num_cpus_online, num_cpus, num_cores, num_dies, num_packages;
int ret;
struct expr_parse_ctx *ctx;
- bool is_intel = false;
char strcmp_cpuid_buf[256];
struct perf_cpu cpu = {-1};
char *cpuid = get_cpuid_allow_env_override(cpu);
char *escaped_cpuid1, *escaped_cpuid2;
TEST_ASSERT_VAL("get_cpuid", cpuid);
- is_intel = strstr(cpuid, "Intel") != NULL;
TEST_ASSERT_EQUAL("ids_union", test_ids_union(), 0);
@@ -245,12 +243,19 @@ static int test__expr(struct test_suite *t __maybe_unused, int subtest __maybe_u
if (num_dies) // Some platforms do not have CPU die support, for example s390
TEST_ASSERT_VAL("#num_dies >= #num_packages", num_dies >= num_packages);
- TEST_ASSERT_VAL("#system_tsc_freq", expr__parse(&val, ctx, "#system_tsc_freq") == 0);
- if (is_intel)
- TEST_ASSERT_VAL("#system_tsc_freq > 0", val > 0);
- else
- TEST_ASSERT_VAL("#system_tsc_freq == 0", fpclassify(val) == FP_ZERO);
+ if (expr__parse(&val, ctx, "#system_tsc_freq") == 0) {
+ bool is_intel = strstr(cpuid, "Intel") != NULL;
+
+ if (is_intel)
+ TEST_ASSERT_VAL("#system_tsc_freq > 0", val > 0);
+ else
+ TEST_ASSERT_VAL("#system_tsc_freq == 0", fpclassify(val) == FP_ZERO);
+ } else {
+#if defined(__i386__) || defined(__x86_64__)
+ TEST_ASSERT_VAL("#system_tsc_freq unsupported", 0);
+#endif
+ }
/*
* Source count returns the number of events aggregating in a leader
* event including the leader. Check parsing yields an id.
diff --git a/tools/perf/tests/hwmon_pmu.c b/tools/perf/tests/hwmon_pmu.c
index f8bcee9660d5..d2b066a2b557 100644
--- a/tools/perf/tests/hwmon_pmu.c
+++ b/tools/perf/tests/hwmon_pmu.c
@@ -65,7 +65,7 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
{ "temp2_label", "test hwmon event2\n", },
{ "temp2_input", "50000\n", },
};
- int dirfd, file;
+ int hwmon_dirfd = -1, test_dirfd = -1, file;
struct perf_pmu *hwm = NULL;
ssize_t len;
@@ -76,19 +76,24 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
dir[0] = '\0';
return NULL;
}
- dirfd = open(dir, O_DIRECTORY);
- if (dirfd < 0) {
+ test_dirfd = open(dir, O_PATH|O_DIRECTORY);
+ if (test_dirfd < 0) {
pr_err("Failed to open test directory \"%s\"\n", dir);
goto err_out;
}
/* Create the test hwmon directory and give it a name. */
- if (mkdirat(dirfd, "hwmon1234", 0755) < 0) {
+ if (mkdirat(test_dirfd, "hwmon1234", 0755) < 0) {
pr_err("Failed to mkdir hwmon directory\n");
goto err_out;
}
- file = openat(dirfd, "hwmon1234/name", O_WRONLY | O_CREAT, 0600);
- if (!file) {
+ hwmon_dirfd = openat(test_dirfd, "hwmon1234", O_DIRECTORY);
+ if (hwmon_dirfd < 0) {
+ pr_err("Failed to open test hwmon directory \"%s/hwmon1234\"\n", dir);
+ goto err_out;
+ }
+ file = openat(hwmon_dirfd, "name", O_WRONLY | O_CREAT, 0600);
+ if (file < 0) {
pr_err("Failed to open for writing file \"name\"\n");
goto err_out;
}
@@ -104,8 +109,8 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
for (size_t i = 0; i < ARRAY_SIZE(test_items); i++) {
const struct test_item *item = &test_items[i];
- file = openat(dirfd, item->name, O_WRONLY | O_CREAT, 0600);
- if (!file) {
+ file = openat(hwmon_dirfd, item->name, O_WRONLY | O_CREAT, 0600);
+ if (file < 0) {
pr_err("Failed to open for writing file \"%s\"\n", item->name);
goto err_out;
}
@@ -119,16 +124,18 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
}
/* Make the PMU reading the files created above. */
- hwm = perf_pmus__add_test_hwmon_pmu(dirfd, "hwmon1234", test_hwmon_name);
+ hwm = perf_pmus__add_test_hwmon_pmu(hwmon_dirfd, "hwmon1234", test_hwmon_name);
if (!hwm)
pr_err("Test hwmon creation failed\n");
err_out:
if (!hwm) {
test_pmu_put(dir, hwm);
- if (dirfd >= 0)
- close(dirfd);
+ if (hwmon_dirfd >= 0)
+ close(hwmon_dirfd);
}
+ if (test_dirfd >= 0)
+ close(test_dirfd);
return hwm;
}
diff --git a/tools/perf/tests/make b/tools/perf/tests/make
index a7fcbd589752..0ee94caf9ec1 100644
--- a/tools/perf/tests/make
+++ b/tools/perf/tests/make
@@ -86,7 +86,6 @@ make_no_libdw_dwarf_unwind := NO_LIBDW_DWARF_UNWIND=1
make_no_backtrace := NO_BACKTRACE=1
make_no_libcapstone := NO_CAPSTONE=1
make_no_libnuma := NO_LIBNUMA=1
-make_no_libaudit := NO_LIBAUDIT=1
make_no_libbionic := NO_LIBBIONIC=1
make_no_auxtrace := NO_AUXTRACE=1
make_no_libbpf := NO_LIBBPF=1
@@ -97,7 +96,6 @@ make_no_libllvm := NO_LIBLLVM=1
make_with_babeltrace:= LIBBABELTRACE=1
make_with_coresight := CORESIGHT=1
make_no_sdt := NO_SDT=1
-make_no_syscall_tbl := NO_SYSCALL_TABLE=1
make_no_libpfm4 := NO_LIBPFM4=1
make_with_gtk2 := GTK2=1
make_refcnt_check := EXTRA_CFLAGS="-DREFCNT_CHECKING=1"
@@ -122,10 +120,10 @@ make_static := LDFLAGS=-static NO_PERF_READ_VDSO32=1 NO_PERF_READ_VDSOX3
# all the NO_* variable combined
make_minimal := NO_LIBPERL=1 NO_LIBPYTHON=1 NO_GTK2=1
make_minimal += NO_DEMANGLE=1 NO_LIBELF=1 NO_BACKTRACE=1
-make_minimal += NO_LIBNUMA=1 NO_LIBAUDIT=1 NO_LIBBIONIC=1
+make_minimal += NO_LIBNUMA=1 NO_LIBBIONIC=1
make_minimal += NO_LIBDW_DWARF_UNWIND=1 NO_AUXTRACE=1 NO_LIBBPF=1
make_minimal += NO_LIBCRYPTO=1 NO_SDT=1 NO_JVMTI=1 NO_LIBZSTD=1
-make_minimal += NO_LIBCAP=1 NO_SYSCALL_TABLE=1 NO_CAPSTONE=1
+make_minimal += NO_LIBCAP=1 NO_CAPSTONE=1
# $(run) contains all available tests
run := make_pure
@@ -158,7 +156,6 @@ run += make_no_libdw_dwarf_unwind
run += make_no_backtrace
run += make_no_libcapstone
run += make_no_libnuma
-run += make_no_libaudit
run += make_no_libbionic
run += make_no_auxtrace
run += make_no_libbpf
diff --git a/tools/perf/tests/parse-events.c b/tools/perf/tests/parse-events.c
index 82a19674a38f..5ec2e5607987 100644
--- a/tools/perf/tests/parse-events.c
+++ b/tools/perf/tests/parse-events.c
@@ -54,8 +54,6 @@ static bool test_perf_config(const struct perf_evsel *evsel, __u64 expected_conf
return (evsel->attr.config & PERF_HW_EVENT_MASK) == expected_config;
}
-#ifdef HAVE_LIBTRACEEVENT
-
#if defined(__s390x__)
/* Return true if kvm module is available and loaded. Test this
* and return success when trace point kvm_s390_create_vm
@@ -112,7 +110,6 @@ static int test__checkevent_tracepoint_multi(struct evlist *evlist)
}
return TEST_OK;
}
-#endif /* HAVE_LIBTRACEEVENT */
static int test__checkevent_raw(struct evlist *evlist)
{
@@ -311,7 +308,6 @@ static int test__checkevent_breakpoint_rw(struct evlist *evlist)
return TEST_OK;
}
-#ifdef HAVE_LIBTRACEEVENT
static int test__checkevent_tracepoint_modifier(struct evlist *evlist)
{
struct evsel *evsel = evlist__first(evlist);
@@ -340,7 +336,6 @@ test__checkevent_tracepoint_multi_modifier(struct evlist *evlist)
return test__checkevent_tracepoint_multi(evlist);
}
-#endif /* HAVE_LIBTRACEEVENT */
static int test__checkevent_raw_modifier(struct evlist *evlist)
{
@@ -629,7 +624,6 @@ static int test__checkevent_pmu(struct evlist *evlist)
return TEST_OK;
}
-#ifdef HAVE_LIBTRACEEVENT
static int test__checkevent_list(struct evlist *evlist)
{
struct evsel *evsel = evlist__first(evlist);
@@ -671,7 +665,6 @@ static int test__checkevent_list(struct evlist *evlist)
return TEST_OK;
}
-#endif
static int test__checkevent_pmu_name(struct evlist *evlist)
{
@@ -971,7 +964,6 @@ static int test__group2(struct evlist *evlist)
return TEST_OK;
}
-#ifdef HAVE_LIBTRACEEVENT
static int test__group3(struct evlist *evlist __maybe_unused)
{
struct evsel *evsel, *group1_leader = NULL, *group2_leader = NULL;
@@ -1078,7 +1070,6 @@ static int test__group3(struct evlist *evlist __maybe_unused)
}
return TEST_OK;
}
-#endif
static int test__group4(struct evlist *evlist __maybe_unused)
{
@@ -1813,7 +1804,6 @@ static int test__term_equal_legacy(struct evlist *evlist)
return TEST_OK;
}
-#ifdef HAVE_LIBTRACEEVENT
static int count_tracepoints(void)
{
struct dirent *events_ent;
@@ -1867,7 +1857,6 @@ static int test__all_tracepoints(struct evlist *evlist)
return test__checkevent_tracepoint_multi(evlist);
}
-#endif /* HAVE_LIBTRACEVENT */
struct evlist_test {
const char *name;
@@ -1876,7 +1865,6 @@ struct evlist_test {
};
static const struct evlist_test test__events[] = {
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "syscalls:sys_enter_openat",
.check = test__checkevent_tracepoint,
@@ -1887,7 +1875,6 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_tracepoint_multi,
/* 1 */
},
-#endif
{
.name = "r1a",
.check = test__checkevent_raw,
@@ -1938,7 +1925,6 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_breakpoint_w,
/* 1 */
},
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "syscalls:sys_enter_openat:k",
.check = test__checkevent_tracepoint_modifier,
@@ -1949,7 +1935,6 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_tracepoint_multi_modifier,
/* 3 */
},
-#endif
{
.name = "r1a:kp",
.check = test__checkevent_raw_modifier,
@@ -1995,13 +1980,11 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_breakpoint_w_modifier,
/* 2 */
},
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "r1,syscalls:sys_enter_openat:k,1:1:hp",
.check = test__checkevent_list,
/* 3 */
},
-#endif
{
.name = "instructions:G",
.check = test__checkevent_exclude_host_modifier,
@@ -2032,13 +2015,11 @@ static const struct evlist_test test__events[] = {
.check = test__group2,
/* 9 */
},
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "group1{syscalls:sys_enter_openat:H,cycles:kppp},group2{cycles,1:3}:G,instructions:u",
.check = test__group3,
/* 0 */
},
-#endif
{
.name = "{cycles:u,instructions:kp}:p",
.check = test__group4,
@@ -2049,13 +2030,11 @@ static const struct evlist_test test__events[] = {
.check = test__group5,
/* 2 */
},
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "*:*",
.check = test__all_tracepoints,
/* 3 */
},
-#endif
{
.name = "{cycles,cache-misses:G}:H",
.check = test__group_gh1,
@@ -2111,7 +2090,7 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_breakpoint_len_rw_modifier,
/* 4 */
},
-#if defined(__s390x__) && defined(HAVE_LIBTRACEEVENT)
+#if defined(__s390x__)
{
.name = "kvm-s390:kvm_s390_create_vm",
.check = test__checkevent_tracepoint,
@@ -2265,13 +2244,11 @@ static const struct evlist_test test__events[] = {
.check = test__checkevent_breakpoint_2_events,
/* 3 */
},
-#ifdef HAVE_LIBTRACEEVENT
{
.name = "9p:9p_client_req",
.check = test__checkevent_tracepoint,
/* 4 */
},
-#endif
};
static const struct evlist_test test__events_pmu[] = {
diff --git a/tools/perf/tests/shell/base_probe/test_adding_blacklisted.sh b/tools/perf/tests/shell/base_probe/test_adding_blacklisted.sh
index bead723e34af..8226449ac5c3 100755
--- a/tools/perf/tests/shell/base_probe/test_adding_blacklisted.sh
+++ b/tools/perf/tests/shell/base_probe/test_adding_blacklisted.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perf_probe :: Reject blacklisted probes (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
@@ -22,7 +22,7 @@ TEST_RESULT=0
BLACKFUNC_LIST=`head -n 5 /sys/kernel/debug/kprobes/blacklist 2> /dev/null | cut -f2`
if [ -z "$BLACKFUNC_LIST" ]; then
print_overall_skipped
- exit 0
+ exit 2
fi
# try to find vmlinux with DWARF debug info
diff --git a/tools/perf/tests/shell/base_probe/test_adding_kernel.sh b/tools/perf/tests/shell/base_probe/test_adding_kernel.sh
index d541ffd44a93..df288cf90cd6 100755
--- a/tools/perf/tests/shell/base_probe/test_adding_kernel.sh
+++ b/tools/perf/tests/shell/base_probe/test_adding_kernel.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-# Add 'perf probe's, list and remove them
+# perf_probe :: Add probes, list and remove them (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
@@ -33,7 +33,7 @@ fi
check_kprobes_available
if [ $? -ne 0 ]; then
print_overall_skipped
- exit 0
+ exit 2
fi
@@ -169,7 +169,7 @@ print_results $PERF_EXIT_CODE $CHECK_EXIT_CODE "force-adding probes :: second pr
(( TEST_RESULT += $? ))
# adding existing probe with '--force' should pass
-NO_OF_PROBES=`$CMD_PERF probe -l | wc -l`
+NO_OF_PROBES=`$CMD_PERF probe -l $TEST_PROBE| wc -l`
$CMD_PERF probe --force --add $TEST_PROBE 2> $LOGS_DIR/adding_kernel_forceadd_03.err
PERF_EXIT_CODE=$?
@@ -205,7 +205,7 @@ print_results $PERF_EXIT_CODE $CHECK_EXIT_CODE "using doubled probe"
$CMD_PERF probe --del \* 2> $LOGS_DIR/adding_kernel_removing_wildcard.err
PERF_EXIT_CODE=$?
-../common/check_all_lines_matched.pl "Removed event: probe:$TEST_PROBE" "Removed event: probe:${TEST_PROBE}_1" < $LOGS_DIR/adding_kernel_removing_wildcard.err
+../common/check_all_patterns_found.pl "Removed event: probe:$TEST_PROBE" "Removed event: probe:${TEST_PROBE}_1" < $LOGS_DIR/adding_kernel_removing_wildcard.err
CHECK_EXIT_CODE=$?
print_results $PERF_EXIT_CODE $CHECK_EXIT_CODE "removing multiple probes"
diff --git a/tools/perf/tests/shell/base_probe/test_basic.sh b/tools/perf/tests/shell/base_probe/test_basic.sh
index 09669ec479f2..9d8b5afbeddd 100755
--- a/tools/perf/tests/shell/base_probe/test_basic.sh
+++ b/tools/perf/tests/shell/base_probe/test_basic.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perf_probe :: Basic perf probe functionality (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
@@ -19,7 +19,7 @@ TEST_RESULT=0
if ! check_kprobes_available; then
print_overall_skipped
- exit 0
+ exit 2
fi
diff --git a/tools/perf/tests/shell/base_probe/test_invalid_options.sh b/tools/perf/tests/shell/base_probe/test_invalid_options.sh
index 1fedfd8b0d0d..92f7254eb32a 100755
--- a/tools/perf/tests/shell/base_probe/test_invalid_options.sh
+++ b/tools/perf/tests/shell/base_probe/test_invalid_options.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perf_probe :: Reject invalid options (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
@@ -19,9 +19,12 @@ TEST_RESULT=0
if ! check_kprobes_available; then
print_overall_skipped
- exit 0
+ exit 2
fi
+# Check for presence of DWARF
+$CMD_PERF check feature -q dwarf
+[ $? -ne 0 ] && HINT_FAIL="Some of the tests need DWARF to run"
### missing argument
@@ -75,5 +78,5 @@ done
# print overall results
-print_overall_results "$TEST_RESULT"
+print_overall_results "$TEST_RESULT" $HINT_FAIL
exit $?
diff --git a/tools/perf/tests/shell/base_probe/test_line_semantics.sh b/tools/perf/tests/shell/base_probe/test_line_semantics.sh
index d8f4bde0f585..20435b6bf6bc 100755
--- a/tools/perf/tests/shell/base_probe/test_line_semantics.sh
+++ b/tools/perf/tests/shell/base_probe/test_line_semantics.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perf_probe :: Check patterns for line semantics (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
@@ -20,9 +20,12 @@ TEST_RESULT=0
if ! check_kprobes_available; then
print_overall_skipped
- exit 0
+ exit 2
fi
+# Check for presence of DWARF
+$CMD_PERF check feature -q dwarf
+[ $? -ne 0 ] && HINT_FAIL="Some of the tests need DWARF to run"
### acceptable --line descriptions
@@ -51,5 +54,5 @@ done
# print overall results
-print_overall_results "$TEST_RESULT"
+print_overall_results "$TEST_RESULT" $HINT_FAIL
exit $?
diff --git a/tools/perf/tests/shell/base_report/setup.sh b/tools/perf/tests/shell/base_report/setup.sh
index 4caa496660c6..b03501b2e8fc 100755
--- a/tools/perf/tests/shell/base_report/setup.sh
+++ b/tools/perf/tests/shell/base_report/setup.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perftool-testsuite :: perf_report
# SPDX-License-Identifier: GPL-2.0
#
diff --git a/tools/perf/tests/shell/base_report/test_basic.sh b/tools/perf/tests/shell/base_report/test_basic.sh
index 47677cbd4df3..2398eba4d3fd 100755
--- a/tools/perf/tests/shell/base_report/test_basic.sh
+++ b/tools/perf/tests/shell/base_report/test_basic.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-
+# perf_report :: Basic perf report options (exclusive)
# SPDX-License-Identifier: GPL-2.0
#
diff --git a/tools/perf/tests/shell/common/init.sh b/tools/perf/tests/shell/common/init.sh
index 075f17623c8e..26c7525651e0 100644
--- a/tools/perf/tests/shell/common/init.sh
+++ b/tools/perf/tests/shell/common/init.sh
@@ -46,10 +46,13 @@ print_results()
print_overall_results()
{
RETVAL="$1"; shift
+ TASK_COMMENT="$*"
+ test -n "$TASK_COMMENT" && TASK_COMMENT=":: $TASK_COMMENT"
+
if [ $RETVAL -eq 0 ]; then
_echo "$MALLPASS## [ PASS ] ##$MEND $TEST_NAME :: $THIS_TEST_NAME SUMMARY"
else
- _echo "$MALLFAIL## [ FAIL ] ##$MEND $TEST_NAME :: $THIS_TEST_NAME SUMMARY :: $RETVAL failures found"
+ _echo "$MALLFAIL## [ FAIL ] ##$MEND $TEST_NAME :: $THIS_TEST_NAME SUMMARY :: $RETVAL failures found $TASK_COMMENT"
fi
return $RETVAL
}
@@ -85,7 +88,7 @@ consider_skipping()
# the runmode of a testcase needs to be at least the current suite's runmode
if [ $PERFTOOL_TESTSUITE_RUNMODE -lt $TESTCASE_RUNMODE ]; then
print_overall_skipped
- exit 0
+ exit 2
fi
}
diff --git a/tools/perf/tests/shell/coresight/Makefile b/tools/perf/tests/shell/coresight/Makefile
index b070e779703e..fa08fd9a5991 100644
--- a/tools/perf/tests/shell/coresight/Makefile
+++ b/tools/perf/tests/shell/coresight/Makefile
@@ -24,6 +24,6 @@ CLEANDIRS = $(SUBDIRS:%=clean-%)
clean: $(CLEANDIRS)
$(CLEANDIRS):
- $(call QUIET_CLEAN, test-$(@:clean-%=%)) $(Q)$(MAKE) -C $(@:clean-%=%) clean >/dev/null
+ $(call QUIET_CLEAN, test-$(@:clean-%=%)) $(MAKE) -C $(@:clean-%=%) clean >/dev/null
.PHONY: all clean $(SUBDIRS) $(CLEANDIRS) $(INSTALLDIRS)
diff --git a/tools/perf/tests/shell/ftrace.sh b/tools/perf/tests/shell/ftrace.sh
index 2df05052c324..c243731d2fbf 100755
--- a/tools/perf/tests/shell/ftrace.sh
+++ b/tools/perf/tests/shell/ftrace.sh
@@ -67,11 +67,8 @@ test_ftrace_latency() {
test_ftrace_profile() {
echo "perf ftrace profile test"
- perf ftrace profile -m 16M sleep 0.1 > "${output}"
+ perf ftrace profile --graph-opts depth=5 sleep 0.1 > "${output}"
grep ^# "${output}"
- grep sleep "${output}"
- grep schedule "${output}"
- grep execve "${output}"
time_re="[[:space:]]+1[[:digit:]]{5}\.[[:digit:]]{3}"
# 100283.000 100283.000 100283.000 1 __x64_sys_clock_nanosleep
# Check for one *clock_nanosleep line with a Count of just 1 that takes a bit more than 0.1 seconds
diff --git a/tools/perf/tests/shell/lib/perf_json_output_lint.py b/tools/perf/tests/shell/lib/perf_json_output_lint.py
index 8ddb85586131..b066d721f897 100644
--- a/tools/perf/tests/shell/lib/perf_json_output_lint.py
+++ b/tools/perf/tests/shell/lib/perf_json_output_lint.py
@@ -69,16 +69,16 @@ def check_json_output(expected_items):
for item in json.loads(input):
if expected_items != -1:
count = len(item)
- if count != expected_items and count >= 1 and count <= 7 and 'metric-value' in item:
+ if count not in expected_items and count >= 1 and count <= 7 and 'metric-value' in item:
# Events that generate >1 metric may have isolated metric
# values and possibly other prefixes like interval, core,
# aggregate-number, or event-runtime/pcnt-running from multiplexing.
pass
- elif count != expected_items and count >= 1 and count <= 5 and 'metricgroup' in item:
+ elif count not in expected_items and count >= 1 and count <= 5 and 'metricgroup' in item:
pass
- elif count == expected_items + 1 and 'metric-threshold' in item:
+ elif count - 1 in expected_items and 'metric-threshold' in item:
pass
- elif count != expected_items:
+ elif count not in expected_items:
raise RuntimeError(f'wrong number of fields. counted {count} expected {expected_items}'
f' in \'{item}\'')
for key, value in item.items():
@@ -90,11 +90,11 @@ def check_json_output(expected_items):
try:
if args.no_args or args.system_wide or args.event:
- expected_items = 7
+ expected_items = [5, 7]
elif args.interval or args.per_thread or args.system_wide_no_aggr:
- expected_items = 8
+ expected_items = [6, 8]
elif args.per_core or args.per_socket or args.per_node or args.per_die or args.per_cluster or args.per_cache:
- expected_items = 9
+ expected_items = [7, 9]
else:
# If no option is specified, don't check the number of items.
expected_items = -1
diff --git a/tools/perf/tests/shell/perftool-testsuite_probe.sh b/tools/perf/tests/shell/perftool-testsuite_probe.sh
index a0fec33a0358..7b1bfd0f888f 100755
--- a/tools/perf/tests/shell/perftool-testsuite_probe.sh
+++ b/tools/perf/tests/shell/perftool-testsuite_probe.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-# perftool-testsuite_probe
+# perftool-testsuite_probe (exclusive)
# SPDX-License-Identifier: GPL-2.0
test -d "$(dirname "$0")/base_probe" || exit 2
diff --git a/tools/perf/tests/shell/record+probe_libc_inet_pton.sh b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh
index 47a26f25db9f..d5e5193cceb6 100755
--- a/tools/perf/tests/shell/record+probe_libc_inet_pton.sh
+++ b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh
@@ -1,5 +1,5 @@
#!/bin/sh
-# probe libc's inet_pton & backtrace it with ping
+# probe libc's inet_pton & backtrace it with ping (exclusive)
# Installs a probe on libc's inet_pton function, that will use uprobes,
# then use 'perf trace' on a ping to localhost asking for just one packet
@@ -43,17 +43,8 @@ trace_libc_inet_pton_backtrace() {
echo "((__GI_)?getaddrinfo|text_to_binary_address)\+0x[[:xdigit:]]+[[:space:]]\($libc|inlined\)$" >> $expected
echo "(gaih_inet|main)\+0x[[:xdigit:]]+[[:space:]]\(inlined|.*/bin/ping.*\)$" >> $expected
;;
- ppc64|ppc64le)
- eventattr='max-stack=4'
- # Add gaih_inet to expected backtrace only if it is part of libc.
- if nm $libc | grep -F -q gaih_inet.; then
- echo "gaih_inet.*\+0x[[:xdigit:]]+[[:space:]]\($libc\)$" >> $expected
- fi
- echo "getaddrinfo\+0x[[:xdigit:]]+[[:space:]]\($libc\)$" >> $expected
- echo ".*(\+0x[[:xdigit:]]+|\[unknown\])[[:space:]]\(.*/bin/ping.*\)$" >> $expected
- ;;
*)
- eventattr='max-stack=3'
+ eventattr='max-stack=4'
echo ".*(\+0x[[:xdigit:]]+|\[unknown\])[[:space:]]\(.*/bin/ping.*\)$" >> $expected
;;
esac
@@ -76,14 +67,25 @@ trace_libc_inet_pton_backtrace() {
fi
perf script -i $perf_data | tac | grep -m1 ^ping -B9 | tac > $perf_script
- exec 3<$perf_script
exec 4<$expected
- while read line <&3 && read -r pattern <&4; do
+ while read -r pattern <&4; do
+ echo "Pattern: $pattern"
[ -z "$pattern" ] && break
- echo $line
- echo "$line" | grep -E -q "$pattern"
- if [ $? -ne 0 ] ; then
- printf "FAIL: expected backtrace entry \"%s\" got \"%s\"\n" "$pattern" "$line"
+
+ found=0
+
+ # Search lines in the perf script result
+ exec 3<$perf_script
+ while read line <&3; do
+ [ -z "$line" ] && break
+ echo " Matching: $line"
+ ! echo "$line" | grep -E -q "$pattern"
+ found=$?
+ [ $found -eq 1 ] && break
+ done
+
+ if [ $found -ne 1 ] ; then
+ printf "FAIL: Didn't find the expected backtrace entry \"%s\"\n" "$pattern"
return 1
fi
done
diff --git a/tools/perf/tests/shell/stat+std_output.sh b/tools/perf/tests/shell/stat+std_output.sh
index cbf2894b2c84..0f7967be60af 100755
--- a/tools/perf/tests/shell/stat+std_output.sh
+++ b/tools/perf/tests/shell/stat+std_output.sh
@@ -13,7 +13,7 @@ stat_output=$(mktemp /tmp/__perf_test.stat_output.std.XXXXX)
event_name=(cpu-clock task-clock context-switches cpu-migrations page-faults stalled-cycles-frontend stalled-cycles-backend cycles instructions branches branch-misses)
event_metric=("CPUs utilized" "CPUs utilized" "/sec" "/sec" "/sec" "frontend cycles idle" "backend cycles idle" "GHz" "insn per cycle" "/sec" "of all branches")
-skip_metric=("stalled cycles per insn" "tma_" "retiring" "frontend_bound" "bad_speculation" "backend_bound")
+skip_metric=("stalled cycles per insn" "tma_" "retiring" "frontend_bound" "bad_speculation" "backend_bound" "TopdownL1" "percent of slots")
cleanup() {
rm -f "${stat_output}"
diff --git a/tools/perf/tests/shell/stat.sh b/tools/perf/tests/shell/stat.sh
index 7a8adf81e4b3..68323d636fb7 100755
--- a/tools/perf/tests/shell/stat.sh
+++ b/tools/perf/tests/shell/stat.sh
@@ -187,7 +187,11 @@ test_hybrid() {
# Run default Perf stat
cycles_events=$(perf stat -- true 2>&1 | grep -E "/cycles/[uH]*| cycles[:uH]* " -c)
- if [ "$pmus" -ne "$cycles_events" ]
+ # The expectation is that default output will have a cycles events on each
+ # hybrid PMU. In situations with no cycles PMU events, like virtualized, this
+ # can fall back to task-clock and so the end count may be 0. Fail if neither
+ # condition holds.
+ if [ "$pmus" -ne "$cycles_events" ] && [ "0" -ne "$cycles_events" ]
then
echo "hybrid test [Found $pmus PMUs but $cycles_events cycles events. Failed]"
err=1
diff --git a/tools/perf/tests/shell/test_arm_spe.sh b/tools/perf/tests/shell/test_arm_spe.sh
index 3258368634f7..a69aab70dd8a 100755
--- a/tools/perf/tests/shell/test_arm_spe.sh
+++ b/tools/perf/tests/shell/test_arm_spe.sh
@@ -107,7 +107,37 @@ arm_spe_system_wide_test() {
arm_spe_report "SPE system-wide testing" $err
}
+arm_spe_discard_test() {
+ echo "SPE discard mode"
+
+ for f in /sys/bus/event_source/devices/arm_spe_*; do
+ if [ -e "$f/format/discard" ]; then
+ cpu=$(cut -c -1 "$f/cpumask")
+ break
+ fi
+ done
+
+ if [ -z $cpu ]; then
+ arm_spe_report "SPE discard mode not present" 2
+ return
+ fi
+
+ # Test can use wildcard SPE instance and Perf will only open the event
+ # on instances that have that format flag. But make sure the target
+ # runs on an instance with discard mode otherwise we're not testing
+ # anything.
+ perf record -o ${perfdata} -e arm_spe/discard/ -N -B --no-bpf-event \
+ -- taskset --cpu-list $cpu true
+
+ if perf report -i ${perfdata} --stats | grep 'AUX events\|AUXTRACE events'; then
+ arm_spe_report "SPE discard mode found unexpected data" 1
+ else
+ arm_spe_report "SPE discard mode" 0
+ fi
+}
+
arm_spe_snapshot_test
arm_spe_system_wide_test
+arm_spe_discard_test
exit $glb_err
diff --git a/tools/perf/tests/shell/test_brstack.sh b/tools/perf/tests/shell/test_brstack.sh
index 5f14d0cb013f..e01df7581393 100755
--- a/tools/perf/tests/shell/test_brstack.sh
+++ b/tools/perf/tests/shell/test_brstack.sh
@@ -30,7 +30,7 @@ test_user_branches() {
echo "Testing user branch stack sampling"
perf record -o $TMPDIR/perf.data --branch-filter any,save_type,u -- ${TESTPROG} > /dev/null 2>&1
- perf script -i $TMPDIR/perf.data --fields brstacksym | xargs -n1 > $TMPDIR/perf.script
+ perf script -i $TMPDIR/perf.data --fields brstacksym | tr -s ' ' '\n' > $TMPDIR/perf.script
# example of branch entries:
# brstack_foo+0x14/brstack_bar+0x40/P/-/-/0/CALL
@@ -59,7 +59,7 @@ test_filter() {
echo "Testing branch stack filtering permutation ($test_filter_filter,$test_filter_expect)"
perf record -o $TMPDIR/perf.data --branch-filter $test_filter_filter,save_type,u -- ${TESTPROG} > /dev/null 2>&1
- perf script -i $TMPDIR/perf.data --fields brstack | xargs -n1 > $TMPDIR/perf.script
+ perf script -i $TMPDIR/perf.data --fields brstack | tr -s ' ' '\n' | grep '.' > $TMPDIR/perf.script
# fail if we find any branch type that doesn't match any of the expected ones
# also consider UNKNOWN branch types (-)
diff --git a/tools/perf/tests/shell/test_intel_pt.sh b/tools/perf/tests/shell/test_intel_pt.sh
index e6f0070975f6..f3a9a040bacc 100755
--- a/tools/perf/tests/shell/test_intel_pt.sh
+++ b/tools/perf/tests/shell/test_intel_pt.sh
@@ -644,6 +644,33 @@ test_pipe()
return 0
}
+test_pause_resume()
+{
+ echo "--- Test with pause / resume ---"
+ if ! perf_record_no_decode -o "${perfdatafile}" -e intel_pt/aux-action=start-paused/u uname ; then
+ echo "SKIP: pause / resume is not supported"
+ return 2
+ fi
+ if ! perf_record_no_bpf -o "${perfdatafile}" \
+ -e intel_pt/aux-action=start-paused/u \
+ -e instructions/period=50000,aux-action=resume,name=Resume/u \
+ -e instructions/period=100000,aux-action=pause,name=Pause/u uname ; then
+ echo "perf record with pause / resume failed"
+ return 1
+ fi
+ if ! perf script -i "${perfdatafile}" --itrace=b -Fperiod,event | \
+ awk 'BEGIN {paused=1;branches=0}
+ /Resume/ {paused=0}
+ /branches/ {if (paused) exit 1;branches=1}
+ /Pause/ {paused=1}
+ END {if (!branches) exit 1}' ; then
+ echo "perf record with pause / resume failed"
+ return 1
+ fi
+ echo OK
+ return 0
+}
+
count_result()
{
if [ "$1" -eq 2 ] ; then
@@ -672,6 +699,7 @@ test_power_event || ret=$? ; count_result $ret ; ret=0
test_no_tnt || ret=$? ; count_result $ret ; ret=0
test_event_trace || ret=$? ; count_result $ret ; ret=0
test_pipe || ret=$? ; count_result $ret ; ret=0
+test_pause_resume || ret=$? ; count_result $ret ; ret=0
cleanup
diff --git a/tools/perf/tests/shell/test_task_analyzer.sh b/tools/perf/tests/shell/test_task_analyzer.sh
index 7d76fc63d995..e194fcf61df3 100755
--- a/tools/perf/tests/shell/test_task_analyzer.sh
+++ b/tools/perf/tests/shell/test_task_analyzer.sh
@@ -1,5 +1,5 @@
#!/bin/bash
-# perf script task-analyzer tests
+# perf script task-analyzer tests (exclusive)
# SPDX-License-Identifier: GPL-2.0
tmpdir=$(mktemp -d /tmp/perf-script-task-analyzer-XXXXX)
diff --git a/tools/perf/tests/shell/trace_btf_general.sh b/tools/perf/tests/shell/trace_btf_general.sh
new file mode 100755
index 000000000000..e9ee727f3433
--- /dev/null
+++ b/tools/perf/tests/shell/trace_btf_general.sh
@@ -0,0 +1,94 @@
+#!/bin/bash
+# perf trace BTF general tests
+# SPDX-License-Identifier: GPL-2.0
+
+err=0
+set -e
+
+# shellcheck source=lib/probe.sh
+. "$(dirname $0)"/lib/probe.sh
+
+file1=$(mktemp /tmp/file1_XXXX)
+file2=$(echo $file1 | sed 's/file1/file2/g')
+
+buffer="buffer content"
+perf_config_tmp=$(mktemp /tmp/.perfconfig_XXXXX)
+
+trap cleanup EXIT TERM INT HUP
+
+check_vmlinux() {
+ echo "Checking if vmlinux BTF exists"
+ if [ ! -f /sys/kernel/btf/vmlinux ]
+ then
+ echo "Skipped due to missing vmlinux BTF"
+ return 2
+ fi
+ return 0
+}
+
+trace_test_string() {
+ echo "Testing perf trace's string augmentation"
+ if ! perf trace -e renameat* --max-events=1 -- mv ${file1} ${file2} 2>&1 | \
+ grep -q -E "^mv/[0-9]+ renameat(2)?\(.*, \"${file1}\", .*, \"${file2}\", .*\) += +[0-9]+$"
+ then
+ echo "String augmentation test failed"
+ err=1
+ fi
+}
+
+trace_test_buffer() {
+ echo "Testing perf trace's buffer augmentation"
+ # echo will insert a newline (\10) at the end of the buffer
+ if ! perf trace -e write --max-events=1 -- echo "${buffer}" 2>&1 | \
+ grep -q -E "^echo/[0-9]+ write\([0-9]+, ${buffer}.*, [0-9]+\) += +[0-9]+$"
+ then
+ echo "Buffer augmentation test failed"
+ err=1
+ fi
+}
+
+trace_test_struct_btf() {
+ echo "Testing perf trace's struct augmentation"
+ if ! perf trace -e clock_nanosleep --force-btf --max-events=1 -- sleep 1 2>&1 | \
+ grep -q -E "^sleep/[0-9]+ clock_nanosleep\(0, 0, \{1,\}, 0x[0-9a-f]+\) += +[0-9]+$"
+ then
+ echo "BTF struct augmentation test failed"
+ err=1
+ fi
+}
+
+cleanup() {
+ rm -rf ${file1} ${file2} ${perf_config_tmp}
+}
+
+trap_cleanup() {
+ echo "Unexpected signal in ${FUNCNAME[1]}"
+ cleanup
+ exit 1
+}
+
+# don't overwrite user's perf config
+trace_config() {
+ export PERF_CONFIG=${perf_config_tmp}
+ perf config trace.show_arg_names=false trace.show_duration=false \
+ trace.show_timestamp=false trace.args_alignment=0
+}
+
+skip_if_no_perf_trace || exit 2
+check_vmlinux || exit 2
+
+trace_config
+
+trace_test_string
+
+if [ $err = 0 ]; then
+ trace_test_buffer
+fi
+
+if [ $err = 0 ]; then
+ trace_test_struct_btf
+fi
+
+cleanup
+
+exit $err
diff --git a/tools/perf/tests/sigtrap.c b/tools/perf/tests/sigtrap.c
index e6fd934b027a..a67c756f90b8 100644
--- a/tools/perf/tests/sigtrap.c
+++ b/tools/perf/tests/sigtrap.c
@@ -56,6 +56,7 @@ static struct perf_event_attr make_event_attr(void)
#ifdef HAVE_BPF_SKEL
#include <bpf/btf.h>
+#include <util/btf.h>
static struct btf *btf;
@@ -73,21 +74,6 @@ static void btf__exit(void)
btf = NULL;
}
-static const struct btf_member *__btf_type__find_member_by_name(int type_id, const char *member_name)
-{
- const struct btf_type *t = btf__type_by_id(btf, type_id);
- const struct btf_member *m;
- int i;
-
- for (i = 0, m = btf_members(t); i < btf_vlen(t); i++, m++) {
- const char *current_member_name = btf__name_by_offset(btf, m->name_off);
- if (!strcmp(current_member_name, member_name))
- return m;
- }
-
- return NULL;
-}
-
static bool attr_has_sigtrap(void)
{
int id;
@@ -101,7 +87,7 @@ static bool attr_has_sigtrap(void)
if (id < 0)
return false;
- return __btf_type__find_member_by_name(id, "sigtrap") != NULL;
+ return __btf_type__find_member_by_name(btf, id, "sigtrap") != NULL;
}
static bool kernel_with_sleepable_spinlocks(void)
@@ -119,7 +105,7 @@ static bool kernel_with_sleepable_spinlocks(void)
return false;
// Only RT has a "lock" member for "struct spinlock"
- member = __btf_type__find_member_by_name(id, "lock");
+ member = __btf_type__find_member_by_name(btf, id, "lock");
if (member == NULL)
return false;
diff --git a/tools/perf/tests/stat.c b/tools/perf/tests/stat.c
index 6468cc0d0204..d60983657bad 100644
--- a/tools/perf/tests/stat.c
+++ b/tools/perf/tests/stat.c
@@ -27,7 +27,7 @@ static int process_stat_config_event(const struct perf_tool *tool __maybe_unused
struct machine *machine __maybe_unused)
{
struct perf_record_stat_config *config = &event->stat_config;
- struct perf_stat_config stat_config = {};
+ struct perf_stat_config test_stat_config = {};
#define HAS(term, val) \
has_term(config, PERF_STAT_CONFIG_TERM__##term, val)
@@ -39,25 +39,27 @@ static int process_stat_config_event(const struct perf_tool *tool __maybe_unused
#undef HAS
- perf_event__read_stat_config(&stat_config, config);
+ perf_event__read_stat_config(&test_stat_config, config);
- TEST_ASSERT_VAL("wrong aggr_mode", stat_config.aggr_mode == AGGR_CORE);
- TEST_ASSERT_VAL("wrong scale", stat_config.scale == 1);
- TEST_ASSERT_VAL("wrong interval", stat_config.interval == 1);
+ TEST_ASSERT_VAL("wrong aggr_mode", test_stat_config.aggr_mode == AGGR_CORE);
+ TEST_ASSERT_VAL("wrong scale", test_stat_config.scale == 1);
+ TEST_ASSERT_VAL("wrong interval", test_stat_config.interval == 1);
return 0;
}
static int test__synthesize_stat_config(struct test_suite *test __maybe_unused,
int subtest __maybe_unused)
{
- struct perf_stat_config stat_config = {
+ struct perf_stat_config test_stat_config = {
.aggr_mode = AGGR_CORE,
.scale = 1,
.interval = 1,
};
TEST_ASSERT_VAL("failed to synthesize stat_config",
- !perf_event__synthesize_stat_config(NULL, &stat_config, process_stat_config_event, NULL));
+ !perf_event__synthesize_stat_config(NULL, &test_stat_config,
+ process_stat_config_event,
+ NULL));
return 0;
}
diff --git a/tools/perf/tests/switch-tracking.c b/tools/perf/tests/switch-tracking.c
index 5cab17a1942e..576f82a15015 100644
--- a/tools/perf/tests/switch-tracking.c
+++ b/tools/perf/tests/switch-tracking.c
@@ -583,4 +583,4 @@ out_err:
goto out;
}
-DEFINE_SUITE("Track with sched_switch", switch_tracking);
+DEFINE_SUITE_EXCLUSIVE("Track with sched_switch", switch_tracking);
diff --git a/tools/perf/tests/tests-scripts.c b/tools/perf/tests/tests-scripts.c
index cf3ae0c1d871..1d5759d08141 100644
--- a/tools/perf/tests/tests-scripts.c
+++ b/tools/perf/tests/tests-scripts.c
@@ -174,7 +174,7 @@ static void append_script(int dir_fd, const char *name, char *desc,
char filename[PATH_MAX], link[128];
struct test_suite *test_suite, **result_tmp;
struct test_case *tests;
- size_t len;
+ ssize_t len;
char *exclusive;
snprintf(link, sizeof(link), "/proc/%d/fd/%d", getpid(), dir_fd);
diff --git a/tools/perf/tests/tests.h b/tools/perf/tests/tests.h
index cb58b43aa063..8aea344536b8 100644
--- a/tools/perf/tests/tests.h
+++ b/tools/perf/tests/tests.h
@@ -81,6 +81,16 @@ struct test_suite {
.test_cases = tests__##_name, \
}
+#define DEFINE_SUITE_EXCLUSIVE(description, _name) \
+ struct test_case tests__##_name[] = { \
+ TEST_CASE_EXCLUSIVE(description, _name),\
+ { .name = NULL, } \
+ }; \
+ struct test_suite suite__##_name = { \
+ .desc = description, \
+ .test_cases = tests__##_name, \
+ }
+
/* Tests */
DECLARE_SUITE(vmlinux_matches_kallsyms);
DECLARE_SUITE(openat_syscall_event);
diff --git a/tools/perf/tests/workloads/landlock.c b/tools/perf/tests/workloads/landlock.c
index e2b5ef647c09..1f285b7b6236 100644
--- a/tools/perf/tests/workloads/landlock.c
+++ b/tools/perf/tests/workloads/landlock.c
@@ -10,7 +10,7 @@
* 'perf test' workload) we just add the required types and defines here instead
* of including linux/landlock, that isn't available in older systems.
*
- * We are not interested in the the result of the syscall, just in intercepting
+ * We are not interested in the result of the syscall, just in intercepting
* its arguments.
*/
diff --git a/tools/perf/trace/beauty/arch_errno_names.sh b/tools/perf/trace/beauty/arch_errno_names.sh
index 30d3889b2957..b22890b8d272 100755
--- a/tools/perf/trace/beauty/arch_errno_names.sh
+++ b/tools/perf/trace/beauty/arch_errno_names.sh
@@ -57,7 +57,8 @@ create_arch_errno_table_func()
archlist="$1"
default="$2"
- printf 'arch_syscalls__strerrno_t *arch_syscalls__strerrno_function(const char *arch)\n'
+ printf 'static arch_syscalls__strerrno_t *\n'
+ printf 'arch_syscalls__strerrno_function(const char *arch)\n'
printf '{\n'
for arch in $archlist; do
arch_str=$(arch_string "$arch")
diff --git a/tools/perf/trace/beauty/fs_at_flags.sh b/tools/perf/trace/beauty/fs_at_flags.sh
index e3f13f96a27c..fac4d0c049fc 100755
--- a/tools/perf/trace/beauty/fs_at_flags.sh
+++ b/tools/perf/trace/beauty/fs_at_flags.sh
@@ -13,13 +13,14 @@ printf "static const char *fs_at_flags[] = {\n"
regex='^[[:space:]]*#[[:space:]]*define[[:space:]]+AT_([^_]+[[:alnum:]_]+)[[:space:]]+(0x[[:xdigit:]]+)[[:space:]]*.*'
# AT_EACCESS is only meaningful to faccessat, so we will special case it there...
# AT_STATX_SYNC_TYPE is not a bit, its a mask of AT_STATX_SYNC_AS_STAT, AT_STATX_FORCE_SYNC and AT_STATX_DONT_SYNC
-# AT_HANDLE_FID and AT_HANDLE_MNT_ID_UNIQUE are reusing values and are valid only for name_to_handle_at()
+# AT_HANDLE_FID, AT_HANDLE_MNT_ID_UNIQUE and AT_HANDLE_CONNECTABLE are reusing values and are valid only for name_to_handle_at()
# AT_RENAME_NOREPLACE reuses 0x1 and is valid only for renameat2()
grep -E $regex ${linux_fcntl} | \
grep -v AT_EACCESS | \
grep -v AT_STATX_SYNC_TYPE | \
grep -v AT_HANDLE_FID | \
grep -v AT_HANDLE_MNT_ID_UNIQUE | \
+ grep -v AT_HANDLE_CONNECTABLE | \
grep -v AT_RENAME_NOREPLACE | \
sed -r "s/$regex/\2 \1/g" | \
xargs printf "\t[ilog2(%s) + 1] = \"%s\",\n"
diff --git a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
index 87e2dec79fea..6e6907e63bfc 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
@@ -153,9 +153,6 @@
object identity and may not be
usable with open_by_handle_at(2). */
#define AT_HANDLE_MNT_ID_UNIQUE 0x001 /* Return the u64 unique mount ID. */
-
-#if defined(__KERNEL__)
-#define AT_GETATTR_NOSEC 0x80000000
-#endif
+#define AT_HANDLE_CONNECTABLE 0x002 /* Request a connectable file handle */
#endif /* _UAPI_LINUX_FCNTL_H */
diff --git a/tools/perf/trace/beauty/include/uapi/linux/mount.h b/tools/perf/trace/beauty/include/uapi/linux/mount.h
index 225bc366ffcb..c07008816aca 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/mount.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/mount.h
@@ -154,7 +154,7 @@ struct mount_attr {
*/
struct statmount {
__u32 size; /* Total size, including strings */
- __u32 mnt_opts; /* [str] Mount options of the mount */
+ __u32 mnt_opts; /* [str] Options (comma separated, escaped) */
__u64 mask; /* What results were written */
__u32 sb_dev_major; /* Device ID */
__u32 sb_dev_minor;
@@ -173,7 +173,13 @@ struct statmount {
__u32 mnt_root; /* [str] Root of mount relative to root of fs */
__u32 mnt_point; /* [str] Mountpoint relative to current root */
__u64 mnt_ns_id; /* ID of the mount namespace */
- __u64 __spare2[49];
+ __u32 fs_subtype; /* [str] Subtype of fs_type (if any) */
+ __u32 sb_source; /* [str] Source string of the mount */
+ __u32 opt_num; /* Number of fs options */
+ __u32 opt_array; /* [str] Array of nul terminated fs options */
+ __u32 opt_sec_num; /* Number of security options */
+ __u32 opt_sec_array; /* [str] Array of nul terminated security options */
+ __u64 __spare2[46];
char str[]; /* Variable size part containing strings */
};
@@ -207,6 +213,10 @@ struct mnt_id_req {
#define STATMOUNT_FS_TYPE 0x00000020U /* Want/got fs_type */
#define STATMOUNT_MNT_NS_ID 0x00000040U /* Want/got mnt_ns_id */
#define STATMOUNT_MNT_OPTS 0x00000080U /* Want/got mnt_opts */
+#define STATMOUNT_FS_SUBTYPE 0x00000100U /* Want/got fs_subtype */
+#define STATMOUNT_SB_SOURCE 0x00000200U /* Want/got sb_source */
+#define STATMOUNT_OPT_ARRAY 0x00000400U /* Want/got opt_... */
+#define STATMOUNT_OPT_SEC_ARRAY 0x00000800U /* Want/got opt_sec... */
/*
* Special @mnt_id values that can be passed to listmount
diff --git a/tools/perf/trace/beauty/include/uapi/linux/prctl.h b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
index 35791791a879..5c6080680cb2 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/prctl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
@@ -230,7 +230,7 @@ struct prctl_mm_map {
# define PR_PAC_APDBKEY (1UL << 3)
# define PR_PAC_APGAKEY (1UL << 4)
-/* Tagged user address controls for arm64 */
+/* Tagged user address controls for arm64 and RISC-V */
#define PR_SET_TAGGED_ADDR_CTRL 55
#define PR_GET_TAGGED_ADDR_CTRL 56
# define PR_TAGGED_ADDR_ENABLE (1UL << 0)
@@ -244,6 +244,9 @@ struct prctl_mm_map {
# define PR_MTE_TAG_MASK (0xffffUL << PR_MTE_TAG_SHIFT)
/* Unused; kept only for source compatibility */
# define PR_MTE_TCF_SHIFT 1
+/* RISC-V pointer masking tag length */
+# define PR_PMLEN_SHIFT 24
+# define PR_PMLEN_MASK (0x7fUL << PR_PMLEN_SHIFT)
/* Control reclaim behavior when allocating memory */
#define PR_SET_IO_FLUSHER 57
@@ -328,4 +331,26 @@ struct prctl_mm_map {
# define PR_PPC_DEXCR_CTRL_CLEAR_ONEXEC 0x10 /* Clear the aspect on exec */
# define PR_PPC_DEXCR_CTRL_MASK 0x1f
+/*
+ * Get the current shadow stack configuration for the current thread,
+ * this will be the value configured via PR_SET_SHADOW_STACK_STATUS.
+ */
+#define PR_GET_SHADOW_STACK_STATUS 74
+
+/*
+ * Set the current shadow stack configuration. Enabling the shadow
+ * stack will cause a shadow stack to be allocated for the thread.
+ */
+#define PR_SET_SHADOW_STACK_STATUS 75
+# define PR_SHADOW_STACK_ENABLE (1UL << 0)
+# define PR_SHADOW_STACK_WRITE (1UL << 1)
+# define PR_SHADOW_STACK_PUSH (1UL << 2)
+
+/*
+ * Prevent further changes to the specified shadow stack
+ * configuration. All bits may be locked via this call, including
+ * undefined bits.
+ */
+#define PR_LOCK_SHADOW_STACK_STATUS 76
+
#endif /* _LINUX_PRCTL_H */
diff --git a/tools/perf/ui/browsers/annotate.c b/tools/perf/ui/browsers/annotate.c
index d7e727345dab..135d6ce88fb3 100644
--- a/tools/perf/ui/browsers/annotate.c
+++ b/tools/perf/ui/browsers/annotate.c
@@ -754,7 +754,7 @@ static int annotate_browser__run(struct annotate_browser *browser,
hbt->timer(hbt->arg);
if (delay_secs != 0) {
- symbol__annotate_decay_histogram(sym, evsel->core.idx);
+ symbol__annotate_decay_histogram(sym, evsel);
hists__scnprintf_title(hists, title, sizeof(title));
annotate_browser__show(&browser->b, title, help);
}
diff --git a/tools/perf/ui/browsers/scripts.c b/tools/perf/ui/browsers/scripts.c
index e437d7889de6..2d04ece833aa 100644
--- a/tools/perf/ui/browsers/scripts.c
+++ b/tools/perf/ui/browsers/scripts.c
@@ -1,16 +1,18 @@
// SPDX-License-Identifier: GPL-2.0
-#include "../../builtin.h"
-#include "../../perf.h"
#include "../../util/util.h" // perf_exe()
#include "../util.h"
+#include "../../util/evlist.h"
#include "../../util/hist.h"
#include "../../util/debug.h"
+#include "../../util/session.h"
#include "../../util/symbol.h"
#include "../browser.h"
#include "../libslang.h"
#include "config.h"
+#include <linux/err.h>
#include <linux/string.h>
#include <linux/zalloc.h>
+#include <subcmd/exec-cmd.h>
#include <stdlib.h>
#define SCRIPT_NAMELEN 128
@@ -78,6 +80,177 @@ static int scripts_config(const char *var, const char *value, void *data)
}
/*
+ * Some scripts specify the required events in their "xxx-record" file,
+ * this function will check if the events in perf.data match those
+ * mentioned in the "xxx-record".
+ *
+ * Fixme: All existing "xxx-record" are all in good formats "-e event ",
+ * which is covered well now. And new parsing code should be added to
+ * cover the future complex formats like event groups etc.
+ */
+static int check_ev_match(int dir_fd, const char *scriptname, struct perf_session *session)
+{
+ char line[BUFSIZ];
+ FILE *fp;
+
+ {
+ char filename[FILENAME_MAX + 5];
+ int fd;
+
+ scnprintf(filename, sizeof(filename), "bin/%s-record", scriptname);
+ fd = openat(dir_fd, filename, O_RDONLY);
+ if (fd == -1)
+ return -1;
+ fp = fdopen(fd, "r");
+ if (!fp)
+ return -1;
+ }
+
+ while (fgets(line, sizeof(line), fp)) {
+ char *p = skip_spaces(line);
+
+ if (*p == '#')
+ continue;
+
+ while (strlen(p)) {
+ int match, len;
+ struct evsel *pos;
+ char evname[128];
+
+ p = strstr(p, "-e");
+ if (!p)
+ break;
+
+ p += 2;
+ p = skip_spaces(p);
+ len = strcspn(p, " \t");
+ if (!len)
+ break;
+
+ snprintf(evname, len + 1, "%s", p);
+
+ match = 0;
+ evlist__for_each_entry(session->evlist, pos) {
+ if (evsel__name_is(pos, evname)) {
+ match = 1;
+ break;
+ }
+ }
+
+ if (!match) {
+ fclose(fp);
+ return -1;
+ }
+ }
+ }
+
+ fclose(fp);
+ return 0;
+}
+
+/*
+ * Return -1 if none is found, otherwise the actual scripts number.
+ *
+ * Currently the only user of this function is the script browser, which
+ * will list all statically runnable scripts, select one, execute it and
+ * show the output in a perf browser.
+ */
+static int find_scripts(char **scripts_array, char **scripts_path_array, int num,
+ int pathlen)
+{
+ struct dirent *script_dirent, *lang_dirent;
+ int scripts_dir_fd, lang_dir_fd;
+ DIR *scripts_dir, *lang_dir;
+ struct perf_session *session;
+ struct perf_data data = {
+ .path = input_name,
+ .mode = PERF_DATA_MODE_READ,
+ };
+ char *temp;
+ int i = 0;
+ const char *exec_path = get_argv_exec_path();
+
+ session = perf_session__new(&data, NULL);
+ if (IS_ERR(session))
+ return PTR_ERR(session);
+
+ {
+ char scripts_path[PATH_MAX];
+
+ snprintf(scripts_path, sizeof(scripts_path), "%s/scripts", exec_path);
+ scripts_dir_fd = open(scripts_path, O_DIRECTORY);
+ pr_err("Failed to open directory '%s'", scripts_path);
+ if (scripts_dir_fd == -1) {
+ perf_session__delete(session);
+ return -1;
+ }
+ }
+ scripts_dir = fdopendir(scripts_dir_fd);
+ if (!scripts_dir) {
+ close(scripts_dir_fd);
+ perf_session__delete(session);
+ return -1;
+ }
+
+ while ((lang_dirent = readdir(scripts_dir)) != NULL) {
+ if (lang_dirent->d_type != DT_DIR &&
+ (lang_dirent->d_type == DT_UNKNOWN &&
+ !is_directory_at(scripts_dir_fd, lang_dirent->d_name)))
+ continue;
+ if (!strcmp(lang_dirent->d_name, ".") || !strcmp(lang_dirent->d_name, ".."))
+ continue;
+
+#ifndef HAVE_LIBPERL_SUPPORT
+ if (strstr(lang_dirent->d_name, "perl"))
+ continue;
+#endif
+#ifndef HAVE_LIBPYTHON_SUPPORT
+ if (strstr(lang_dirent->d_name, "python"))
+ continue;
+#endif
+
+ lang_dir_fd = openat(scripts_dir_fd, lang_dirent->d_name, O_DIRECTORY);
+ if (lang_dir_fd == -1)
+ continue;
+ lang_dir = fdopendir(lang_dir_fd);
+ if (!lang_dir) {
+ close(lang_dir_fd);
+ continue;
+ }
+ while ((script_dirent = readdir(lang_dir)) != NULL) {
+ if (script_dirent->d_type == DT_DIR)
+ continue;
+ if (script_dirent->d_type == DT_UNKNOWN &&
+ is_directory_at(lang_dir_fd, script_dirent->d_name))
+ continue;
+ /* Skip those real time scripts: xxxtop.p[yl] */
+ if (strstr(script_dirent->d_name, "top."))
+ continue;
+ if (i >= num)
+ break;
+ scnprintf(scripts_path_array[i], pathlen, "%s/scripts/%s/%s",
+ exec_path,
+ lang_dirent->d_name,
+ script_dirent->d_name);
+ temp = strchr(script_dirent->d_name, '.');
+ snprintf(scripts_array[i],
+ (temp - script_dirent->d_name) + 1,
+ "%s", script_dirent->d_name);
+
+ if (check_ev_match(lang_dir_fd, scripts_array[i], session))
+ continue;
+
+ i++;
+ }
+ closedir(lang_dir);
+ }
+
+ closedir(scripts_dir);
+ perf_session__delete(session);
+ return i;
+}
+
+/*
* When success, will copy the full path of the selected script
* into the buffer pointed by script_name, and return 0.
* Return -1 on failure.
diff --git a/tools/perf/ui/gtk/annotate.c b/tools/perf/ui/gtk/annotate.c
index 6da24aa039eb..8920e298420a 100644
--- a/tools/perf/ui/gtk/annotate.c
+++ b/tools/perf/ui/gtk/annotate.c
@@ -3,6 +3,7 @@
#include "util/sort.h"
#include "util/debug.h"
#include "util/annotate.h"
+#include "util/evlist.h"
#include "util/evsel.h"
#include "util/map.h"
#include "util/dso.h"
@@ -26,7 +27,7 @@ static const char *const col_names[] = {
};
static int perf_gtk__get_percent(char *buf, size_t size, struct symbol *sym,
- struct disasm_line *dl, int evidx)
+ struct disasm_line *dl, const struct evsel *evsel)
{
struct annotation *notes;
struct sym_hist *symhist;
@@ -42,8 +43,8 @@ static int perf_gtk__get_percent(char *buf, size_t size, struct symbol *sym,
return 0;
notes = symbol__annotation(sym);
- symhist = annotation__histogram(notes, evidx);
- entry = annotated_source__hist_entry(notes->src, evidx, dl->al.offset);
+ symhist = annotation__histogram(notes, evsel);
+ entry = annotated_source__hist_entry(notes->src, evsel, dl->al.offset);
if (entry)
nr_samples = entry->nr_samples;
@@ -139,16 +140,17 @@ static int perf_gtk__annotate_symbol(GtkWidget *window, struct map_symbol *ms,
gtk_list_store_append(store, &iter);
if (evsel__is_group_event(evsel)) {
- for (i = 0; i < evsel->core.nr_members; i++) {
+ struct evsel *cur_evsel;
+
+ for_each_group_evsel(cur_evsel, evsel__leader(evsel)) {
ret += perf_gtk__get_percent(s + ret,
sizeof(s) - ret,
sym, pos,
- evsel->core.idx + i);
+ cur_evsel);
ret += scnprintf(s + ret, sizeof(s) - ret, " ");
}
} else {
- ret = perf_gtk__get_percent(s, sizeof(s), sym, pos,
- evsel->core.idx);
+ ret = perf_gtk__get_percent(s, sizeof(s), sym, pos, evsel);
}
if (ret)
diff --git a/tools/perf/ui/hist.c b/tools/perf/ui/hist.c
index e5491995adf0..34fda1d5eccb 100644
--- a/tools/perf/ui/hist.c
+++ b/tools/perf/ui/hist.c
@@ -121,7 +121,7 @@ int hpp__fmt(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp,
const char *fmtstr, hpp_snprint_fn print_fn,
enum perf_hpp_fmt_type fmtype)
{
- int len = fmt->user_len ?: fmt->len;
+ int len = max(fmt->user_len ?: fmt->len, (int)strlen(fmt->name));
if (symbol_conf.field_sep) {
return __hpp__fmt(hpp, he, get_field, fmtstr, 1,
diff --git a/tools/perf/util/Build b/tools/perf/util/Build
index c06d2ee9024c..5ec97e8d6b6d 100644
--- a/tools/perf/util/Build
+++ b/tools/perf/util/Build
@@ -86,7 +86,7 @@ perf-util-y += pmu-bison.o
perf-util-y += hwmon_pmu.o
perf-util-y += tool_pmu.o
perf-util-y += svghelper.o
-perf-util-$(CONFIG_LIBTRACEEVENT) += trace-event-info.o
+perf-util-y += trace-event-info.o
perf-util-y += trace-event-scripting.o
perf-util-$(CONFIG_LIBTRACEEVENT) += trace-event.o
perf-util-$(CONFIG_LIBTRACEEVENT) += trace-event-parse.o
@@ -121,8 +121,10 @@ perf-util-y += spark.o
perf-util-y += topdown.o
perf-util-y += iostat.o
perf-util-y += stream.o
+perf-util-y += kvm-stat.o
+perf-util-y += lock-contention.o
perf-util-$(CONFIG_AUXTRACE) += auxtrace.o
-perf-util-$(CONFIG_AUXTRACE) += intel-pt-decoder/
+perf-util-y += intel-pt-decoder/
perf-util-$(CONFIG_AUXTRACE) += intel-pt.o
perf-util-$(CONFIG_AUXTRACE) += intel-bts.o
perf-util-$(CONFIG_AUXTRACE) += arm-spe.o
@@ -168,6 +170,7 @@ perf-util-$(CONFIG_PERF_BPF_SKEL) += bpf_off_cpu.o
perf-util-$(CONFIG_PERF_BPF_SKEL) += bpf-filter.o
perf-util-$(CONFIG_PERF_BPF_SKEL) += bpf-filter-flex.o
perf-util-$(CONFIG_PERF_BPF_SKEL) += bpf-filter-bison.o
+perf-util-$(CONFIG_PERF_BPF_SKEL) += btf.o
ifeq ($(CONFIG_LIBTRACEEVENT),y)
perf-util-$(CONFIG_PERF_BPF_SKEL) += bpf_lock_contention.o
diff --git a/tools/perf/util/annotate.c b/tools/perf/util/annotate.c
index 32e15c9f53f3..0d2ea22bd9e4 100644
--- a/tools/perf/util/annotate.c
+++ b/tools/perf/util/annotate.c
@@ -209,7 +209,7 @@ static int __symbol__account_cycles(struct cyc_hist *ch,
}
static int __symbol__inc_addr_samples(struct map_symbol *ms,
- struct annotated_source *src, int evidx, u64 addr,
+ struct annotated_source *src, struct evsel *evsel, u64 addr,
struct perf_sample *sample)
{
struct symbol *sym = ms->sym;
@@ -228,14 +228,14 @@ static int __symbol__inc_addr_samples(struct map_symbol *ms,
}
offset = addr - sym->start;
- h = annotated_source__histogram(src, evidx);
+ h = annotated_source__histogram(src, evsel);
if (h == NULL) {
pr_debug("%s(%d): ENOMEM! sym->name=%s, start=%#" PRIx64 ", addr=%#" PRIx64 ", end=%#" PRIx64 ", func: %d\n",
__func__, __LINE__, sym->name, sym->start, addr, sym->end, sym->type == STT_FUNC);
return -ENOMEM;
}
- hash_key = offset << 16 | evidx;
+ hash_key = offset << 16 | evsel->core.idx;
if (!hashmap__find(src->samples, hash_key, &entry)) {
entry = zalloc(sizeof(*entry));
if (entry == NULL)
@@ -252,7 +252,7 @@ static int __symbol__inc_addr_samples(struct map_symbol *ms,
pr_debug3("%#" PRIx64 " %s: period++ [addr: %#" PRIx64 ", %#" PRIx64
", evidx=%d] => nr_samples: %" PRIu64 ", period: %" PRIu64 "\n",
- sym->start, sym->name, addr, addr - sym->start, evidx,
+ sym->start, sym->name, addr, addr - sym->start, evsel->core.idx,
entry->nr_samples, entry->period);
return 0;
}
@@ -323,7 +323,7 @@ static int symbol__inc_addr_samples(struct map_symbol *ms,
if (sym == NULL)
return 0;
src = symbol__hists(sym, evsel->evlist->core.nr_entries);
- return src ? __symbol__inc_addr_samples(ms, src, evsel->core.idx, addr, sample) : 0;
+ return src ? __symbol__inc_addr_samples(ms, src, evsel, addr, sample) : 0;
}
static int symbol__account_br_cntr(struct annotated_branch *branch,
@@ -861,15 +861,14 @@ static void calc_percent(struct annotation *notes,
s64 offset, s64 end)
{
struct hists *hists = evsel__hists(evsel);
- int evidx = evsel->core.idx;
- struct sym_hist *sym_hist = annotation__histogram(notes, evidx);
+ struct sym_hist *sym_hist = annotation__histogram(notes, evsel);
unsigned int hits = 0;
u64 period = 0;
while (offset < end) {
struct sym_hist_entry *entry;
- entry = annotated_source__hist_entry(notes->src, evidx, offset);
+ entry = annotated_source__hist_entry(notes->src, evsel, offset);
if (entry) {
hits += entry->nr_samples;
period += entry->period;
@@ -1140,15 +1139,14 @@ static void print_summary(struct rb_root *root, const char *filename)
static void symbol__annotate_hits(struct symbol *sym, struct evsel *evsel)
{
- int evidx = evsel->core.idx;
struct annotation *notes = symbol__annotation(sym);
- struct sym_hist *h = annotation__histogram(notes, evidx);
+ struct sym_hist *h = annotation__histogram(notes, evsel);
u64 len = symbol__size(sym), offset;
for (offset = 0; offset < len; ++offset) {
struct sym_hist_entry *entry;
- entry = annotated_source__hist_entry(notes->src, evidx, offset);
+ entry = annotated_source__hist_entry(notes->src, evsel, offset);
if (entry && entry->nr_samples != 0)
printf("%*" PRIx64 ": %" PRIu64 "\n", BITS_PER_LONG / 2,
sym->start + offset, entry->nr_samples);
@@ -1178,7 +1176,7 @@ int symbol__annotate_printf(struct map_symbol *ms, struct evsel *evsel)
const char *d_filename;
const char *evsel_name = evsel__name(evsel);
struct annotation *notes = symbol__annotation(sym);
- struct sym_hist *h = annotation__histogram(notes, evsel->core.idx);
+ struct sym_hist *h = annotation__histogram(notes, evsel);
struct annotation_line *pos, *queue = NULL;
struct annotation_options *opts = &annotate_opts;
u64 start = map__rip_2objdump(map, sym->start);
@@ -1364,18 +1362,18 @@ out_free_filename:
return err;
}
-void symbol__annotate_zero_histogram(struct symbol *sym, int evidx)
+void symbol__annotate_zero_histogram(struct symbol *sym, struct evsel *evsel)
{
struct annotation *notes = symbol__annotation(sym);
- struct sym_hist *h = annotation__histogram(notes, evidx);
+ struct sym_hist *h = annotation__histogram(notes, evsel);
memset(h, 0, sizeof(*notes->src->histograms) * notes->src->nr_histograms);
}
-void symbol__annotate_decay_histogram(struct symbol *sym, int evidx)
+void symbol__annotate_decay_histogram(struct symbol *sym, struct evsel *evsel)
{
struct annotation *notes = symbol__annotation(sym);
- struct sym_hist *h = annotation__histogram(notes, evidx);
+ struct sym_hist *h = annotation__histogram(notes, evsel);
struct annotation_line *al;
h->nr_samples = 0;
@@ -1385,7 +1383,7 @@ void symbol__annotate_decay_histogram(struct symbol *sym, int evidx)
if (al->offset == -1)
continue;
- entry = annotated_source__hist_entry(notes->src, evidx, al->offset);
+ entry = annotated_source__hist_entry(notes->src, evsel, al->offset);
if (entry == NULL)
continue;
diff --git a/tools/perf/util/annotate.h b/tools/perf/util/annotate.h
index 194a05cbc506..0ba5846dad4d 100644
--- a/tools/perf/util/annotate.h
+++ b/tools/perf/util/annotate.h
@@ -15,6 +15,7 @@
#include "hashmap.h"
#include "disasm.h"
#include "branch.h"
+#include "evsel.h"
struct hist_browser_timer;
struct hist_entry;
@@ -23,7 +24,6 @@ struct map_symbol;
struct addr_map_symbol;
struct option;
struct perf_sample;
-struct evsel;
struct symbol;
struct annotated_data_type;
@@ -373,21 +373,23 @@ static inline u8 annotation__br_cntr_width(void)
void annotation__update_column_widths(struct annotation *notes);
void annotation__toggle_full_addr(struct annotation *notes, struct map_symbol *ms);
-static inline struct sym_hist *annotated_source__histogram(struct annotated_source *src, int idx)
+static inline struct sym_hist *annotated_source__histogram(struct annotated_source *src,
+ const struct evsel *evsel)
{
- return &src->histograms[idx];
+ return &src->histograms[evsel->core.idx];
}
-static inline struct sym_hist *annotation__histogram(struct annotation *notes, int idx)
+static inline struct sym_hist *annotation__histogram(struct annotation *notes,
+ const struct evsel *evsel)
{
- return annotated_source__histogram(notes->src, idx);
+ return annotated_source__histogram(notes->src, evsel);
}
static inline struct sym_hist_entry *
-annotated_source__hist_entry(struct annotated_source *src, int idx, u64 offset)
+annotated_source__hist_entry(struct annotated_source *src, const struct evsel *evsel, u64 offset)
{
struct sym_hist_entry *entry;
- long key = offset << 16 | idx;
+ long key = offset << 16 | evsel->core.idx;
if (!hashmap__find(src->samples, key, &entry))
return NULL;
@@ -441,6 +443,7 @@ enum symbol_disassemble_errno {
SYMBOL_ANNOTATE_ERRNO__ARCH_INIT_REGEXP,
SYMBOL_ANNOTATE_ERRNO__BPF_INVALID_FILE,
SYMBOL_ANNOTATE_ERRNO__BPF_MISSING_BTF,
+ SYMBOL_ANNOTATE_ERRNO__COULDNT_DETERMINE_FILE_TYPE,
__SYMBOL_ANNOTATE_ERRNO__END,
};
@@ -448,8 +451,8 @@ enum symbol_disassemble_errno {
int symbol__strerror_disassemble(struct map_symbol *ms, int errnum, char *buf, size_t buflen);
int symbol__annotate_printf(struct map_symbol *ms, struct evsel *evsel);
-void symbol__annotate_zero_histogram(struct symbol *sym, int evidx);
-void symbol__annotate_decay_histogram(struct symbol *sym, int evidx);
+void symbol__annotate_zero_histogram(struct symbol *sym, struct evsel *evsel);
+void symbol__annotate_decay_histogram(struct symbol *sym, struct evsel *evsel);
void annotated_source__purge(struct annotated_source *as);
int map_symbol__annotation_dump(struct map_symbol *ms, struct evsel *evsel);
diff --git a/tools/perf/util/arm-spe-decoder/arm-spe-decoder.h b/tools/perf/util/arm-spe-decoder/arm-spe-decoder.h
index 358c611eeddb..4bcd627e859f 100644
--- a/tools/perf/util/arm-spe-decoder/arm-spe-decoder.h
+++ b/tools/perf/util/arm-spe-decoder/arm-spe-decoder.h
@@ -67,6 +67,15 @@ enum arm_spe_common_data_source {
ARM_SPE_COMMON_DS_DRAM = 0xe,
};
+enum arm_spe_ampereone_data_source {
+ ARM_SPE_AMPEREONE_LOCAL_CHIP_CACHE_OR_DEVICE = 0x0,
+ ARM_SPE_AMPEREONE_SLC = 0x3,
+ ARM_SPE_AMPEREONE_REMOTE_CHIP_CACHE = 0x5,
+ ARM_SPE_AMPEREONE_DDR = 0x7,
+ ARM_SPE_AMPEREONE_L1D = 0x8,
+ ARM_SPE_AMPEREONE_L2D = 0x9,
+};
+
struct arm_spe_record {
enum arm_spe_sample_type type;
int err;
diff --git a/tools/perf/util/arm-spe.c b/tools/perf/util/arm-spe.c
index dbf13f47879c..12761c39788f 100644
--- a/tools/perf/util/arm-spe.c
+++ b/tools/perf/util/arm-spe.c
@@ -103,6 +103,18 @@ struct arm_spe_queue {
u32 flags;
};
+struct data_source_handle {
+ const struct midr_range *midr_ranges;
+ void (*ds_synth)(const struct arm_spe_record *record,
+ union perf_mem_data_src *data_src);
+};
+
+#define DS(range, func) \
+ { \
+ .midr_ranges = range, \
+ .ds_synth = arm_spe__synth_##func, \
+ }
+
static void arm_spe_dump(struct arm_spe *spe __maybe_unused,
unsigned char *buf, size_t len)
{
@@ -443,6 +455,11 @@ static const struct midr_range common_ds_encoding_cpus[] = {
{},
};
+static const struct midr_range ampereone_ds_encoding_cpus[] = {
+ MIDR_ALL_VERSIONS(MIDR_AMPERE1A),
+ {},
+};
+
static void arm_spe__sample_flags(struct arm_spe_queue *speq)
{
const struct arm_spe_record *record = &speq->decoder->record;
@@ -532,6 +549,49 @@ static void arm_spe__synth_data_source_common(const struct arm_spe_record *recor
}
}
+/*
+ * Source is IMPDEF. Here we convert the source code used on AmpereOne cores
+ * to the common (Neoverse, Cortex) to avoid duplicating the decoding code.
+ */
+static void arm_spe__synth_data_source_ampereone(const struct arm_spe_record *record,
+ union perf_mem_data_src *data_src)
+{
+ struct arm_spe_record common_record;
+
+ switch (record->source) {
+ case ARM_SPE_AMPEREONE_LOCAL_CHIP_CACHE_OR_DEVICE:
+ common_record.source = ARM_SPE_COMMON_DS_PEER_CORE;
+ break;
+ case ARM_SPE_AMPEREONE_SLC:
+ common_record.source = ARM_SPE_COMMON_DS_SYS_CACHE;
+ break;
+ case ARM_SPE_AMPEREONE_REMOTE_CHIP_CACHE:
+ common_record.source = ARM_SPE_COMMON_DS_REMOTE;
+ break;
+ case ARM_SPE_AMPEREONE_DDR:
+ common_record.source = ARM_SPE_COMMON_DS_DRAM;
+ break;
+ case ARM_SPE_AMPEREONE_L1D:
+ common_record.source = ARM_SPE_COMMON_DS_L1D;
+ break;
+ case ARM_SPE_AMPEREONE_L2D:
+ common_record.source = ARM_SPE_COMMON_DS_L2;
+ break;
+ default:
+ pr_warning_once("AmpereOne: Unknown data source (0x%x)\n",
+ record->source);
+ return;
+ }
+
+ common_record.op = record->op;
+ arm_spe__synth_data_source_common(&common_record, data_src);
+}
+
+static const struct data_source_handle data_source_handles[] = {
+ DS(common_ds_encoding_cpus, data_source_common),
+ DS(ampereone_ds_encoding_cpus, data_source_ampereone),
+};
+
static void arm_spe__synth_memory_level(const struct arm_spe_record *record,
union perf_mem_data_src *data_src)
{
@@ -555,12 +615,14 @@ static void arm_spe__synth_memory_level(const struct arm_spe_record *record,
data_src->mem_lvl |= PERF_MEM_LVL_REM_CCE1;
}
-static bool arm_spe__is_common_ds_encoding(struct arm_spe_queue *speq)
+static bool arm_spe__synth_ds(struct arm_spe_queue *speq,
+ const struct arm_spe_record *record,
+ union perf_mem_data_src *data_src)
{
struct arm_spe *spe = speq->spe;
- bool is_in_cpu_list;
u64 *metadata = NULL;
- u64 midr = 0;
+ u64 midr;
+ unsigned int i;
/* Metadata version 1 assumes all CPUs are the same (old behavior) */
if (spe->metadata_ver == 1) {
@@ -592,18 +654,20 @@ static bool arm_spe__is_common_ds_encoding(struct arm_spe_queue *speq)
midr = metadata[ARM_SPE_CPU_MIDR];
}
- is_in_cpu_list = is_midr_in_range_list(midr, common_ds_encoding_cpus);
- if (is_in_cpu_list)
- return true;
- else
- return false;
+ for (i = 0; i < ARRAY_SIZE(data_source_handles); i++) {
+ if (is_midr_in_range_list(midr, data_source_handles[i].midr_ranges)) {
+ data_source_handles[i].ds_synth(record, data_src);
+ return true;
+ }
+ }
+
+ return false;
}
static u64 arm_spe__synth_data_source(struct arm_spe_queue *speq,
const struct arm_spe_record *record)
{
union perf_mem_data_src data_src = { .mem_op = PERF_MEM_OP_NA };
- bool is_common = arm_spe__is_common_ds_encoding(speq);
if (record->op & ARM_SPE_OP_LD)
data_src.mem_op = PERF_MEM_OP_LOAD;
@@ -612,9 +676,7 @@ static u64 arm_spe__synth_data_source(struct arm_spe_queue *speq,
else
return 0;
- if (is_common)
- arm_spe__synth_data_source_common(record, &data_src);
- else
+ if (!arm_spe__synth_ds(speq, record, &data_src))
arm_spe__synth_memory_level(record, &data_src);
if (record->type & (ARM_SPE_TLB_ACCESS | ARM_SPE_TLB_MISS)) {
diff --git a/tools/perf/util/auxtrace.c b/tools/perf/util/auxtrace.c
index ca8682966fae..4d1633d87eff 100644
--- a/tools/perf/util/auxtrace.c
+++ b/tools/perf/util/auxtrace.c
@@ -810,19 +810,76 @@ no_opt:
return auxtrace_validate_aux_sample_size(evlist, opts);
}
-void auxtrace_regroup_aux_output(struct evlist *evlist)
+static struct aux_action_opt {
+ const char *str;
+ u32 aux_action;
+ bool aux_event_opt;
+} aux_action_opts[] = {
+ {"start-paused", BIT(0), true},
+ {"pause", BIT(1), false},
+ {"resume", BIT(2), false},
+ {.str = NULL},
+};
+
+static const struct aux_action_opt *auxtrace_parse_aux_action_str(const char *str)
+{
+ const struct aux_action_opt *opt;
+
+ if (!str)
+ return NULL;
+
+ for (opt = aux_action_opts; opt->str; opt++)
+ if (!strcmp(str, opt->str))
+ return opt;
+
+ return NULL;
+}
+
+int auxtrace_parse_aux_action(struct evlist *evlist)
{
- struct evsel *evsel, *aux_evsel = NULL;
struct evsel_config_term *term;
+ struct evsel *aux_evsel = NULL;
+ struct evsel *evsel;
evlist__for_each_entry(evlist, evsel) {
- if (evsel__is_aux_event(evsel))
+ bool is_aux_event = evsel__is_aux_event(evsel);
+ const struct aux_action_opt *opt;
+
+ if (is_aux_event)
aux_evsel = evsel;
- term = evsel__get_config_term(evsel, AUX_OUTPUT);
+ term = evsel__get_config_term(evsel, AUX_ACTION);
+ if (!term) {
+ if (evsel__get_config_term(evsel, AUX_OUTPUT))
+ goto regroup;
+ continue;
+ }
+ opt = auxtrace_parse_aux_action_str(term->val.str);
+ if (!opt) {
+ pr_err("Bad aux-action '%s'\n", term->val.str);
+ return -EINVAL;
+ }
+ if (opt->aux_event_opt && !is_aux_event) {
+ pr_err("aux-action '%s' can only be used with AUX area event\n",
+ term->val.str);
+ return -EINVAL;
+ }
+ if (!opt->aux_event_opt && is_aux_event) {
+ pr_err("aux-action '%s' cannot be used for AUX area event itself\n",
+ term->val.str);
+ return -EINVAL;
+ }
+ evsel->core.attr.aux_action = opt->aux_action;
+regroup:
/* If possible, group with the AUX event */
- if (term && aux_evsel)
+ if (aux_evsel)
evlist__regroup(evlist, aux_evsel, evsel);
+ if (!evsel__is_aux_event(evsel__leader(evsel))) {
+ pr_err("Events with aux-action must have AUX area event group leader\n");
+ return -EINVAL;
+ }
}
+
+ return 0;
}
struct auxtrace_record *__weak
diff --git a/tools/perf/util/auxtrace.h b/tools/perf/util/auxtrace.h
index dddaf4f3ffed..b0db84d27b25 100644
--- a/tools/perf/util/auxtrace.h
+++ b/tools/perf/util/auxtrace.h
@@ -578,7 +578,7 @@ int auxtrace_parse_snapshot_options(struct auxtrace_record *itr,
int auxtrace_parse_sample_options(struct auxtrace_record *itr,
struct evlist *evlist,
struct record_opts *opts, const char *str);
-void auxtrace_regroup_aux_output(struct evlist *evlist);
+int auxtrace_parse_aux_action(struct evlist *evlist);
int auxtrace_record__options(struct auxtrace_record *itr,
struct evlist *evlist,
struct record_opts *opts);
@@ -799,8 +799,10 @@ int auxtrace_parse_sample_options(struct auxtrace_record *itr __maybe_unused,
}
static inline
-void auxtrace_regroup_aux_output(struct evlist *evlist __maybe_unused)
+int auxtrace_parse_aux_action(struct evlist *evlist __maybe_unused)
{
+ pr_err("AUX area tracing not supported\n");
+ return -EINVAL;
}
static inline
diff --git a/tools/perf/util/bpf-event.c b/tools/perf/util/bpf-event.c
index 13608237c50e..c81444059ad0 100644
--- a/tools/perf/util/bpf-event.c
+++ b/tools/perf/util/bpf-event.c
@@ -289,7 +289,10 @@ static int perf_event__synthesize_one_bpf_prog(struct perf_session *session,
}
info_node->info_linear = info_linear;
- perf_env__insert_bpf_prog_info(env, info_node);
+ if (!perf_env__insert_bpf_prog_info(env, info_node)) {
+ free(info_linear);
+ free(info_node);
+ }
info_linear = NULL;
/*
@@ -480,7 +483,10 @@ static void perf_env__add_bpf_info(struct perf_env *env, u32 id)
info_node = malloc(sizeof(struct bpf_prog_info_node));
if (info_node) {
info_node->info_linear = info_linear;
- perf_env__insert_bpf_prog_info(env, info_node);
+ if (!perf_env__insert_bpf_prog_info(env, info_node)) {
+ free(info_linear);
+ free(info_node);
+ }
} else
free(info_linear);
diff --git a/tools/perf/util/bpf_ftrace.c b/tools/perf/util/bpf_ftrace.c
index 06d1c4018407..25fc280e414a 100644
--- a/tools/perf/util/bpf_ftrace.c
+++ b/tools/perf/util/bpf_ftrace.c
@@ -11,6 +11,7 @@
#include "util/debug.h"
#include "util/evlist.h"
#include "util/bpf_counter.h"
+#include "util/stat.h"
#include "util/bpf_skel/func_latency.skel.h"
@@ -36,6 +37,9 @@ int perf_ftrace__latency_prepare_bpf(struct perf_ftrace *ftrace)
return -1;
}
+ skel->rodata->bucket_range = ftrace->bucket_range;
+ skel->rodata->min_latency = ftrace->min_latency;
+
/* don't need to set cpu filter for system-wide mode */
if (ftrace->target.cpu_list) {
ncpus = perf_cpu_map__nr(ftrace->evlist->core.user_requested_cpus);
@@ -83,6 +87,8 @@ int perf_ftrace__latency_prepare_bpf(struct perf_ftrace *ftrace)
}
}
+ skel->bss->min = INT64_MAX;
+
skel->links.func_begin = bpf_program__attach_kprobe(skel->progs.func_begin,
false, func->name);
if (IS_ERR(skel->links.func_begin)) {
@@ -119,7 +125,7 @@ int perf_ftrace__latency_stop_bpf(struct perf_ftrace *ftrace __maybe_unused)
}
int perf_ftrace__latency_read_bpf(struct perf_ftrace *ftrace __maybe_unused,
- int buckets[])
+ int buckets[], struct stats *stats)
{
int i, fd, err;
u32 idx;
@@ -143,6 +149,13 @@ int perf_ftrace__latency_read_bpf(struct perf_ftrace *ftrace __maybe_unused,
buckets[idx] += hist[i];
}
+ if (skel->bss->count) {
+ stats->mean = skel->bss->total / skel->bss->count;
+ stats->n = skel->bss->count;
+ stats->max = skel->bss->max;
+ stats->min = skel->bss->min;
+ }
+
free(hist);
return 0;
}
diff --git a/tools/perf/util/bpf_kwork.c b/tools/perf/util/bpf_kwork.c
index 6c7126b7670d..5cff755c71fa 100644
--- a/tools/perf/util/bpf_kwork.c
+++ b/tools/perf/util/bpf_kwork.c
@@ -285,7 +285,7 @@ static int add_work(struct perf_kwork *kwork,
(bpf_trace->get_work_name(key, &tmp.name)))
return -1;
- work = perf_kwork_add_work(kwork, tmp.class, &tmp);
+ work = kwork->add_work(kwork, tmp.class, &tmp);
if (work == NULL)
return -1;
diff --git a/tools/perf/util/bpf_kwork_top.c b/tools/perf/util/bpf_kwork_top.c
index 7261cad43468..b6f187dd9136 100644
--- a/tools/perf/util/bpf_kwork_top.c
+++ b/tools/perf/util/bpf_kwork_top.c
@@ -255,7 +255,7 @@ static int add_work(struct perf_kwork *kwork, struct work_key *key,
bpf_trace = kwork_class_bpf_supported_list[type];
tmp.class = bpf_trace->class;
- work = perf_kwork_add_work(kwork, tmp.class, &tmp);
+ work = kwork->add_work(kwork, tmp.class, &tmp);
if (!work)
return -1;
diff --git a/tools/perf/util/bpf_lock_contention.c b/tools/perf/util/bpf_lock_contention.c
index 41a1ad087895..fc8666222399 100644
--- a/tools/perf/util/bpf_lock_contention.c
+++ b/tools/perf/util/bpf_lock_contention.c
@@ -2,6 +2,7 @@
#include "util/cgroup.h"
#include "util/debug.h"
#include "util/evlist.h"
+#include "util/hashmap.h"
#include "util/machine.h"
#include "util/map.h"
#include "util/symbol.h"
@@ -12,17 +13,106 @@
#include <linux/zalloc.h>
#include <linux/string.h>
#include <bpf/bpf.h>
+#include <bpf/btf.h>
#include <inttypes.h>
#include "bpf_skel/lock_contention.skel.h"
#include "bpf_skel/lock_data.h"
static struct lock_contention_bpf *skel;
+static bool has_slab_iter;
+static struct hashmap slab_hash;
+
+static size_t slab_cache_hash(long key, void *ctx __maybe_unused)
+{
+ return key;
+}
+
+static bool slab_cache_equal(long key1, long key2, void *ctx __maybe_unused)
+{
+ return key1 == key2;
+}
+
+static void check_slab_cache_iter(struct lock_contention *con)
+{
+ struct btf *btf = btf__load_vmlinux_btf();
+ s32 ret;
+
+ hashmap__init(&slab_hash, slab_cache_hash, slab_cache_equal, /*ctx=*/NULL);
+
+ if (btf == NULL) {
+ pr_debug("BTF loading failed: %s\n", strerror(errno));
+ return;
+ }
+
+ ret = btf__find_by_name_kind(btf, "bpf_iter__kmem_cache", BTF_KIND_STRUCT);
+ if (ret < 0) {
+ bpf_program__set_autoload(skel->progs.slab_cache_iter, false);
+ pr_debug("slab cache iterator is not available: %d\n", ret);
+ goto out;
+ }
+
+ has_slab_iter = true;
+
+ bpf_map__set_max_entries(skel->maps.slab_caches, con->map_nr_entries);
+out:
+ btf__free(btf);
+}
+
+static void run_slab_cache_iter(void)
+{
+ int fd;
+ char buf[256];
+ long key, *prev_key;
+
+ if (!has_slab_iter)
+ return;
+
+ fd = bpf_iter_create(bpf_link__fd(skel->links.slab_cache_iter));
+ if (fd < 0) {
+ pr_debug("cannot create slab cache iter: %d\n", fd);
+ return;
+ }
+
+ /* This will run the bpf program */
+ while (read(fd, buf, sizeof(buf)) > 0)
+ continue;
+
+ close(fd);
+
+ /* Read the slab cache map and build a hash with IDs */
+ fd = bpf_map__fd(skel->maps.slab_caches);
+ prev_key = NULL;
+ while (!bpf_map_get_next_key(fd, prev_key, &key)) {
+ struct slab_cache_data *data;
+
+ data = malloc(sizeof(*data));
+ if (data == NULL)
+ break;
+
+ if (bpf_map_lookup_elem(fd, &key, data) < 0)
+ break;
+
+ hashmap__add(&slab_hash, data->id, data);
+ prev_key = &key;
+ }
+}
+
+static void exit_slab_cache_iter(void)
+{
+ struct hashmap_entry *cur;
+ unsigned bkt;
+
+ hashmap__for_each_entry(&slab_hash, cur, bkt)
+ free(cur->pvalue);
+
+ hashmap__clear(&slab_hash);
+}
int lock_contention_prepare(struct lock_contention *con)
{
int i, fd;
- int ncpus = 1, ntasks = 1, ntypes = 1, naddrs = 1, ncgrps = 1;
+ int ncpus = 1, ntasks = 1, ntypes = 1, naddrs = 1, ncgrps = 1, nslabs = 1;
struct evlist *evlist = con->evlist;
struct target *target = con->target;
@@ -109,6 +199,15 @@ int lock_contention_prepare(struct lock_contention *con)
skel->rodata->use_cgroup_v2 = 1;
}
+ check_slab_cache_iter(con);
+
+ if (con->filters->nr_slabs && has_slab_iter) {
+ skel->rodata->has_slab = 1;
+ nslabs = con->filters->nr_slabs;
+ }
+
+ bpf_map__set_max_entries(skel->maps.slab_filter, nslabs);
+
if (lock_contention_bpf__load(skel) < 0) {
pr_err("Failed to load lock-contention BPF skeleton\n");
return -1;
@@ -179,6 +278,36 @@ int lock_contention_prepare(struct lock_contention *con)
bpf_program__set_autoload(skel->progs.collect_lock_syms, false);
lock_contention_bpf__attach(skel);
+
+ /* run the slab iterator after attaching */
+ run_slab_cache_iter();
+
+ if (con->filters->nr_slabs) {
+ u8 val = 1;
+ int cache_fd;
+ long key, *prev_key;
+
+ fd = bpf_map__fd(skel->maps.slab_filter);
+
+ /* Read the slab cache map and build a hash with its address */
+ cache_fd = bpf_map__fd(skel->maps.slab_caches);
+ prev_key = NULL;
+ while (!bpf_map_get_next_key(cache_fd, prev_key, &key)) {
+ struct slab_cache_data data;
+
+ if (bpf_map_lookup_elem(cache_fd, &key, &data) < 0)
+ break;
+
+ for (i = 0; i < con->filters->nr_slabs; i++) {
+ if (!strcmp(con->filters->slabs[i], data.name)) {
+ bpf_map_update_elem(fd, &key, &val, BPF_ANY);
+ break;
+ }
+ }
+ prev_key = &key;
+ }
+ }
+
return 0;
}
@@ -347,6 +476,7 @@ static const char *lock_contention_get_name(struct lock_contention *con,
if (con->aggr_mode == LOCK_AGGR_ADDR) {
int lock_fd = bpf_map__fd(skel->maps.lock_syms);
+ struct slab_cache_data *slab_data;
/* per-process locks set upper bits of the flags */
if (flags & LCD_F_MMAP_LOCK)
@@ -365,6 +495,12 @@ static const char *lock_contention_get_name(struct lock_contention *con,
return "rq_lock";
}
+ /* look slab_hash for dynamic locks in a slab object */
+ if (hashmap__find(&slab_hash, flags & LCB_F_SLAB_ID_MASK, &slab_data)) {
+ snprintf(name_buf, sizeof(name_buf), "&%s", slab_data->name);
+ return name_buf;
+ }
+
return "";
}
@@ -458,7 +594,7 @@ int lock_contention_read(struct lock_contention *con)
if (con->save_callstack) {
bpf_map_lookup_elem(stack, &key.stack_id, stack_trace);
- if (!match_callstack_filter(machine, stack_trace)) {
+ if (!match_callstack_filter(machine, stack_trace, con->max_stack)) {
con->nr_filtered += data.count;
goto next;
}
@@ -539,5 +675,7 @@ int lock_contention_finish(struct lock_contention *con)
cgroup__put(cgrp);
}
+ exit_slab_cache_iter();
+
return 0;
}
diff --git a/tools/perf/util/bpf_off_cpu.c b/tools/perf/util/bpf_off_cpu.c
index a590a8ac1f9d..4269b41d1771 100644
--- a/tools/perf/util/bpf_off_cpu.c
+++ b/tools/perf/util/bpf_off_cpu.c
@@ -100,6 +100,11 @@ static void check_sched_switch_args(void)
const struct btf_type *t1, *t2, *t3;
u32 type_id;
+ if (!btf) {
+ pr_debug("Missing btf, check if CONFIG_DEBUG_INFO_BTF is enabled\n");
+ goto cleanup;
+ }
+
type_id = btf__find_by_name_kind(btf, "btf_trace_sched_switch",
BTF_KIND_TYPEDEF);
if ((s32)type_id < 0)
diff --git a/tools/perf/util/bpf_skel/func_latency.bpf.c b/tools/perf/util/bpf_skel/func_latency.bpf.c
index f613dc9cb123..fb144811b34f 100644
--- a/tools/perf/util/bpf_skel/func_latency.bpf.c
+++ b/tools/perf/util/bpf_skel/func_latency.bpf.c
@@ -38,9 +38,18 @@ struct {
int enabled = 0;
+// stats
+__s64 total;
+__s64 count;
+__s64 max;
+__s64 min;
+
const volatile int has_cpu = 0;
const volatile int has_task = 0;
const volatile int use_nsec = 0;
+const volatile unsigned int bucket_range;
+const volatile unsigned int min_latency;
+const volatile unsigned int max_latency;
SEC("kprobe/func")
int BPF_PROG(func_begin)
@@ -92,7 +101,7 @@ int BPF_PROG(func_end)
start = bpf_map_lookup_elem(&functime, &tid);
if (start) {
__s64 delta = bpf_ktime_get_ns() - *start;
- __u32 key;
+ __u32 key = 0;
__u64 *hist;
bpf_map_delete_elem(&functime, &tid);
@@ -100,17 +109,52 @@ int BPF_PROG(func_end)
if (delta < 0)
return 0;
+ if (bucket_range != 0) {
+ delta /= cmp_base;
+
+ if (min_latency > 0) {
+ if (delta > min_latency)
+ delta -= min_latency;
+ else
+ goto do_lookup;
+ }
+
+ // Less than 1 unit (ms or ns), or, in the future,
+ // than the min latency desired.
+ if (delta > 0) { // 1st entry: [ 1 unit .. bucket_range units )
+ // clang 12 doesn't like s64 / u32 division
+ key = (__u64)delta / bucket_range + 1;
+ if (key >= NUM_BUCKET ||
+ delta >= max_latency - min_latency)
+ key = NUM_BUCKET - 1;
+ }
+
+ delta += min_latency;
+ goto do_lookup;
+ }
// calculate index using delta
for (key = 0; key < (NUM_BUCKET - 1); key++) {
if (delta < (cmp_base << key))
break;
}
+do_lookup:
hist = bpf_map_lookup_elem(&latency, &key);
if (!hist)
return 0;
*hist += 1;
+
+ if (bucket_range == 0)
+ delta /= cmp_base;
+
+ __sync_fetch_and_add(&total, delta);
+ __sync_fetch_and_add(&count, 1);
+
+ if (delta > max)
+ max = delta;
+ if (delta < min)
+ min = delta;
}
return 0;
diff --git a/tools/perf/util/bpf_skel/kwork_top.bpf.c b/tools/perf/util/bpf_skel/kwork_top.bpf.c
index 594da91965a2..73e32e063030 100644
--- a/tools/perf/util/bpf_skel/kwork_top.bpf.c
+++ b/tools/perf/util/bpf_skel/kwork_top.bpf.c
@@ -18,7 +18,9 @@ enum kwork_class_type {
};
#define MAX_ENTRIES 102400
-#define MAX_NR_CPUS 2048
+#ifndef MAX_NR_CPUS
+#define MAX_NR_CPUS 4096
+#endif
#define PF_KTHREAD 0x00200000
#define MAX_COMMAND_LEN 16
diff --git a/tools/perf/util/bpf_skel/lock_contention.bpf.c b/tools/perf/util/bpf_skel/lock_contention.bpf.c
index 1069bda5d733..6533ea9b044c 100644
--- a/tools/perf/util/bpf_skel/lock_contention.bpf.c
+++ b/tools/perf/util/bpf_skel/lock_contention.bpf.c
@@ -100,6 +100,20 @@ struct {
__uint(max_entries, 1);
} cgroup_filter SEC(".maps");
+struct {
+ __uint(type, BPF_MAP_TYPE_HASH);
+ __uint(key_size, sizeof(long));
+ __uint(value_size, sizeof(__u8));
+ __uint(max_entries, 1);
+} slab_filter SEC(".maps");
+
+struct {
+ __uint(type, BPF_MAP_TYPE_HASH);
+ __uint(key_size, sizeof(long));
+ __uint(value_size, sizeof(struct slab_cache_data));
+ __uint(max_entries, 1);
+} slab_caches SEC(".maps");
+
struct rw_semaphore___old {
struct task_struct *owner;
} __attribute__((preserve_access_index));
@@ -116,12 +130,15 @@ struct mm_struct___new {
struct rw_semaphore mmap_lock;
} __attribute__((preserve_access_index));
+extern struct kmem_cache *bpf_get_kmem_cache(u64 addr) __ksym __weak;
+
/* control flags */
const volatile int has_cpu;
const volatile int has_task;
const volatile int has_type;
const volatile int has_addr;
const volatile int has_cgroup;
+const volatile int has_slab;
const volatile int needs_callstack;
const volatile int stack_skip;
const volatile int lock_owner;
@@ -136,6 +153,8 @@ int perf_subsys_id = -1;
__u64 end_ts;
+__u32 slab_cache_id;
+
/* error stat */
int task_fail;
int stack_fail;
@@ -202,7 +221,7 @@ static inline int can_record(u64 *ctx)
__u64 addr = ctx[0];
ok = bpf_map_lookup_elem(&addr_filter, &addr);
- if (!ok)
+ if (!ok && !has_slab)
return 0;
}
@@ -215,6 +234,17 @@ static inline int can_record(u64 *ctx)
return 0;
}
+ if (has_slab && bpf_get_kmem_cache) {
+ __u8 *ok;
+ __u64 addr = ctx[0];
+ long kmem_cache_addr;
+
+ kmem_cache_addr = (long)bpf_get_kmem_cache(addr);
+ ok = bpf_map_lookup_elem(&slab_filter, &kmem_cache_addr);
+ if (!ok)
+ return 0;
+ }
+
return 1;
}
@@ -487,8 +517,28 @@ int contention_end(u64 *ctx)
};
int err;
- if (aggr_mode == LOCK_AGGR_ADDR)
- first.flags |= check_lock_type(pelem->lock, pelem->flags);
+ if (aggr_mode == LOCK_AGGR_ADDR) {
+ first.flags |= check_lock_type(pelem->lock,
+ pelem->flags & LCB_F_TYPE_MASK);
+
+ /* Check if it's from a slab object */
+ if (bpf_get_kmem_cache) {
+ struct kmem_cache *s;
+ struct slab_cache_data *d;
+
+ s = bpf_get_kmem_cache(pelem->lock);
+ if (s != NULL) {
+ /*
+ * Save the ID of the slab cache in the flags
+ * (instead of full address) to reduce the
+ * space in the contention_data.
+ */
+ d = bpf_map_lookup_elem(&slab_caches, &s);
+ if (d != NULL)
+ first.flags |= d->id;
+ }
+ }
+ }
err = bpf_map_update_elem(&lock_stat, &key, &first, BPF_NOEXIST);
if (err < 0) {
@@ -563,4 +613,43 @@ int BPF_PROG(end_timestamp)
return 0;
}
+/*
+ * bpf_iter__kmem_cache added recently so old kernels don't have it in the
+ * vmlinux.h. But we cannot add it here since it will cause a compiler error
+ * due to redefinition of the struct on later kernels.
+ *
+ * So it uses a CO-RE trick to access the member only if it has the type.
+ * This will support both old and new kernels without compiler errors.
+ */
+struct bpf_iter__kmem_cache___new {
+ struct kmem_cache *s;
+} __attribute__((preserve_access_index));
+
+SEC("iter/kmem_cache")
+int slab_cache_iter(void *ctx)
+{
+ struct kmem_cache *s = NULL;
+ struct slab_cache_data d;
+ const char *nameptr;
+
+ if (bpf_core_type_exists(struct bpf_iter__kmem_cache)) {
+ struct bpf_iter__kmem_cache___new *iter = ctx;
+
+ s = iter->s;
+ }
+
+ if (s == NULL)
+ return 0;
+
+ nameptr = s->name;
+ bpf_probe_read_kernel_str(d.name, sizeof(d.name), nameptr);
+
+ d.id = ++slab_cache_id << LCB_F_SLAB_ID_SHIFT;
+ if (d.id >= LCB_F_SLAB_ID_END)
+ return 0;
+
+ bpf_map_update_elem(&slab_caches, &s, &d, BPF_NOEXIST);
+ return 0;
+}
+
char LICENSE[] SEC("license") = "Dual BSD/GPL";
diff --git a/tools/perf/util/bpf_skel/lock_data.h b/tools/perf/util/bpf_skel/lock_data.h
index de12892f992f..c15f734d7fc4 100644
--- a/tools/perf/util/bpf_skel/lock_data.h
+++ b/tools/perf/util/bpf_skel/lock_data.h
@@ -32,7 +32,15 @@ struct contention_task_data {
#define LCD_F_MMAP_LOCK (1U << 31)
#define LCD_F_SIGHAND_LOCK (1U << 30)
-#define LCB_F_MAX_FLAGS (1U << 7)
+#define LCB_F_SLAB_ID_SHIFT 16
+#define LCB_F_SLAB_ID_START (1U << 16)
+#define LCB_F_SLAB_ID_END (1U << 26)
+#define LCB_F_SLAB_ID_MASK 0x03FF0000U
+
+#define LCB_F_TYPE_MAX (1U << 7)
+#define LCB_F_TYPE_MASK 0x0000007FU
+
+#define SLAB_NAME_MAX 28
struct contention_data {
u64 total_time;
@@ -54,4 +62,9 @@ enum lock_class_sym {
LOCK_CLASS_RQLOCK,
};
+struct slab_cache_data {
+ u32 id;
+ char name[SLAB_NAME_MAX];
+};
+
#endif /* UTIL_BPF_SKEL_LOCK_DATA_H */
diff --git a/tools/perf/util/bpf_skel/vmlinux/vmlinux.h b/tools/perf/util/bpf_skel/vmlinux/vmlinux.h
index 4dcad7b682bd..7b81d3173917 100644
--- a/tools/perf/util/bpf_skel/vmlinux/vmlinux.h
+++ b/tools/perf/util/bpf_skel/vmlinux/vmlinux.h
@@ -195,4 +195,12 @@ struct bpf_perf_event_data_kern {
*/
struct rq {};
+struct kmem_cache {
+ const char *name;
+} __attribute__((preserve_access_index));
+
+struct bpf_iter__kmem_cache {
+ struct kmem_cache *s;
+} __attribute__((preserve_access_index));
+
#endif // __VMLINUX_H
diff --git a/tools/perf/util/btf.c b/tools/perf/util/btf.c
new file mode 100644
index 000000000000..bb163fe87767
--- /dev/null
+++ b/tools/perf/util/btf.c
@@ -0,0 +1,27 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Arnaldo Carvalho de Melo <acme@redhat.com>
+ *
+ * Copyright (C) 2024, Red Hat, Inc
+ */
+
+#include <bpf/btf.h>
+#include <util/btf.h>
+#include <string.h>
+
+const struct btf_member *__btf_type__find_member_by_name(struct btf *btf,
+ int type_id, const char *member_name)
+{
+ const struct btf_type *t = btf__type_by_id(btf, type_id);
+ const struct btf_member *m;
+ int i;
+
+ for (i = 0, m = btf_members(t); i < btf_vlen(t); i++, m++) {
+ const char *current_member_name = btf__name_by_offset(btf, m->name_off);
+
+ if (!strcmp(current_member_name, member_name))
+ return m;
+ }
+
+ return NULL;
+}
diff --git a/tools/perf/util/btf.h b/tools/perf/util/btf.h
new file mode 100644
index 000000000000..05e6e5bf23d6
--- /dev/null
+++ b/tools/perf/util/btf.h
@@ -0,0 +1,10 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#ifndef __PERF_UTIL_BTF
+#define __PERF_UTIL_BTF 1
+
+struct btf;
+struct btf_member;
+
+const struct btf_member *__btf_type__find_member_by_name(struct btf *btf,
+ int type_id, const char *member_name);
+#endif // __PERF_UTIL_BTF
diff --git a/tools/perf/util/build-id.c b/tools/perf/util/build-id.c
index 8982f68e7230..e763e8d99a43 100644
--- a/tools/perf/util/build-id.c
+++ b/tools/perf/util/build-id.c
@@ -277,7 +277,7 @@ static int write_buildid(const char *name, size_t name_len, struct build_id *bid
struct perf_record_header_build_id b;
size_t len;
- len = sizeof(b) + name_len + 1;
+ len = name_len + 1;
len = PERF_ALIGN(len, sizeof(u64));
memset(&b, 0, sizeof(b));
@@ -286,7 +286,7 @@ static int write_buildid(const char *name, size_t name_len, struct build_id *bid
misc |= PERF_RECORD_MISC_BUILD_ID_SIZE;
b.pid = pid;
b.header.misc = misc;
- b.header.size = len;
+ b.header.size = sizeof(b) + len;
err = do_write(fd, &b, sizeof(b));
if (err < 0)
diff --git a/tools/perf/util/cgroup.c b/tools/perf/util/cgroup.c
index 0f759dd96db7..fbcc0626f9ce 100644
--- a/tools/perf/util/cgroup.c
+++ b/tools/perf/util/cgroup.c
@@ -473,7 +473,7 @@ int evlist__expand_cgroup(struct evlist *evlist, const char *str,
leader = NULL;
evlist__for_each_entry(orig_list, pos) {
- evsel = evsel__clone(pos);
+ evsel = evsel__clone(/*dest=*/NULL, pos);
if (evsel == NULL)
goto out_err;
diff --git a/tools/perf/util/config.c b/tools/perf/util/config.c
index 68f9407ca74b..2d07c9257a1a 100644
--- a/tools/perf/util/config.c
+++ b/tools/perf/util/config.c
@@ -13,6 +13,7 @@
#include <sys/param.h>
#include "cache.h"
#include "callchain.h"
+#include "header.h"
#include <subcmd/exec-cmd.h>
#include "util/event.h" /* proc_map_timeout */
#include "util/hist.h" /* perf_hist_config */
@@ -34,6 +35,22 @@
#define DEBUG_CACHE_DIR ".debug"
+#define METRIC_ONLY_LEN 20
+
+struct perf_stat_config stat_config = {
+ .aggr_mode = AGGR_GLOBAL,
+ .aggr_level = MAX_CACHE_LVL + 1,
+ .scale = true,
+ .unit_width = 4, /* strlen("unit") */
+ .run_count = 1,
+ .metric_only_len = METRIC_ONLY_LEN,
+ .walltime_nsecs_stats = &walltime_nsecs_stats,
+ .ru_stats = &ru_stats,
+ .big_num = true,
+ .ctl_fd = -1,
+ .ctl_fd_ack = -1,
+ .iostat_run = false,
+};
char buildid_dir[MAXPATHLEN]; /* root dir for buildid, binary cache */
@@ -455,6 +472,16 @@ static int perf_ui_config(const char *var, const char *value)
return 0;
}
+void perf_stat__set_big_num(int set)
+{
+ stat_config.big_num = (set != 0);
+}
+
+static void perf_stat__set_no_csv_summary(int set)
+{
+ stat_config.no_csv_summary = (set != 0);
+}
+
static int perf_stat_config(const char *var, const char *value)
{
if (!strcmp(var, "stat.big-num"))
diff --git a/tools/perf/util/config.h b/tools/perf/util/config.h
index 9971313d61c1..a727c95cb119 100644
--- a/tools/perf/util/config.h
+++ b/tools/perf/util/config.h
@@ -50,6 +50,7 @@ int perf_config_set__collect(struct perf_config_set *set, const char *file_name,
const char *var, const char *value);
void perf_config__exit(void);
void perf_config__refresh(void);
+int perf_config__set_variable(const char *var, const char *value);
/**
* perf_config_sections__for_each - iterate thru all the sections
diff --git a/tools/perf/util/data-convert-bt.c b/tools/perf/util/data-convert-bt.c
index f0599c61fab4..5e7ff09fbc95 100644
--- a/tools/perf/util/data-convert-bt.c
+++ b/tools/perf/util/data-convert-bt.c
@@ -426,8 +426,9 @@ static int add_tracepoint_values(struct ctf_writer *cw,
struct evsel *evsel,
struct perf_sample *sample)
{
- struct tep_format_field *common_fields = evsel->tp_format->format.common_fields;
- struct tep_format_field *fields = evsel->tp_format->format.fields;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field *common_fields = tp_format->format.common_fields;
+ struct tep_format_field *fields = tp_format->format.fields;
int ret;
ret = add_tracepoint_fields_values(cw, event_class, event,
@@ -1064,8 +1065,9 @@ static int add_tracepoint_types(struct ctf_writer *cw,
struct evsel *evsel,
struct bt_ctf_event_class *class)
{
- struct tep_format_field *common_fields = evsel->tp_format->format.common_fields;
- struct tep_format_field *fields = evsel->tp_format->format.fields;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field *common_fields = tp_format ? tp_format->format.common_fields : NULL;
+ struct tep_format_field *fields = tp_format ? tp_format->format.fields : NULL;
int ret;
ret = add_tracepoint_fields_types(cw, common_fields, class);
diff --git a/tools/perf/util/data-convert-json.c b/tools/perf/util/data-convert-json.c
index 8304cd2d4a9c..d9f805bf6fb0 100644
--- a/tools/perf/util/data-convert-json.c
+++ b/tools/perf/util/data-convert-json.c
@@ -230,12 +230,12 @@ static int process_sample_event(const struct perf_tool *tool,
#ifdef HAVE_LIBTRACEEVENT
if (sample->raw_data) {
- int i;
- struct tep_format_field **fields;
+ struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field **fields = tp_format ? tep_event_fields(tp_format) : NULL;
- fields = tep_event_fields(evsel->tp_format);
if (fields) {
- i = 0;
+ int i = 0;
+
while (fields[i]) {
struct trace_seq s;
diff --git a/tools/perf/util/disasm.c b/tools/perf/util/disasm.c
index 41a2b08670dc..b7de4d9fd004 100644
--- a/tools/perf/util/disasm.c
+++ b/tools/perf/util/disasm.c
@@ -1245,6 +1245,9 @@ int symbol__strerror_disassemble(struct map_symbol *ms, int errnum, char *buf, s
scnprintf(buf, buflen, "The %s BPF file has no BTF section, compile with -g or use pahole -J.",
dso__long_name(dso));
break;
+ case SYMBOL_ANNOTATE_ERRNO__COULDNT_DETERMINE_FILE_TYPE:
+ scnprintf(buf, buflen, "Couldn't determine the file %s type.", dso__long_name(dso));
+ break;
default:
scnprintf(buf, buflen, "Internal error: Invalid %d error code\n", errnum);
break;
@@ -2289,7 +2292,7 @@ int symbol__disassemble(struct symbol *sym, struct annotate_args *args)
} else if (dso__binary_type(dso) == DSO_BINARY_TYPE__BPF_IMAGE) {
return symbol__disassemble_bpf_image(sym, args);
} else if (dso__binary_type(dso) == DSO_BINARY_TYPE__NOT_FOUND) {
- return -1;
+ return SYMBOL_ANNOTATE_ERRNO__COULDNT_DETERMINE_FILE_TYPE;
} else if (dso__is_kcore(dso)) {
kce.addr = map__rip_2objdump(map, sym->start);
kce.kcore_filename = symfs_filename;
diff --git a/tools/perf/util/dlfilter.c b/tools/perf/util/dlfilter.c
index 7d180bdaedbc..ddacef881af2 100644
--- a/tools/perf/util/dlfilter.c
+++ b/tools/perf/util/dlfilter.c
@@ -234,7 +234,8 @@ static const __u8 *dlfilter__insn(void *ctx, __u32 *len)
struct machine *machine = maps__machine(thread__maps(al->thread));
if (machine)
- script_fetch_insn(d->sample, al->thread, machine);
+ script_fetch_insn(d->sample, al->thread, machine,
+ /*native_arch=*/true);
}
}
diff --git a/tools/perf/util/env.c b/tools/perf/util/env.c
index e2843ca2edd9..cae4f6d63318 100644
--- a/tools/perf/util/env.c
+++ b/tools/perf/util/env.c
@@ -24,15 +24,19 @@ struct perf_env perf_env;
#include "bpf-utils.h"
#include <bpf/libbpf.h>
-void perf_env__insert_bpf_prog_info(struct perf_env *env,
+bool perf_env__insert_bpf_prog_info(struct perf_env *env,
struct bpf_prog_info_node *info_node)
{
+ bool ret;
+
down_write(&env->bpf_progs.lock);
- __perf_env__insert_bpf_prog_info(env, info_node);
+ ret = __perf_env__insert_bpf_prog_info(env, info_node);
up_write(&env->bpf_progs.lock);
+
+ return ret;
}
-void __perf_env__insert_bpf_prog_info(struct perf_env *env, struct bpf_prog_info_node *info_node)
+bool __perf_env__insert_bpf_prog_info(struct perf_env *env, struct bpf_prog_info_node *info_node)
{
__u32 prog_id = info_node->info_linear->info.id;
struct bpf_prog_info_node *node;
@@ -50,13 +54,14 @@ void __perf_env__insert_bpf_prog_info(struct perf_env *env, struct bpf_prog_info
p = &(*p)->rb_right;
} else {
pr_debug("duplicated bpf prog info %u\n", prog_id);
- return;
+ return false;
}
}
rb_link_node(&info_node->rb_node, parent, p);
rb_insert_color(&info_node->rb_node, &env->bpf_progs.infos);
env->bpf_progs.infos_cnt++;
+ return true;
}
struct bpf_prog_info_node *perf_env__find_bpf_prog_info(struct perf_env *env,
@@ -326,10 +331,13 @@ int perf_env__read_cpu_topology_map(struct perf_env *env)
for (idx = 0; idx < nr_cpus; ++idx) {
struct perf_cpu cpu = { .cpu = idx };
+ int core_id = cpu__get_core_id(cpu);
+ int socket_id = cpu__get_socket_id(cpu);
+ int die_id = cpu__get_die_id(cpu);
- env->cpu[idx].core_id = cpu__get_core_id(cpu);
- env->cpu[idx].socket_id = cpu__get_socket_id(cpu);
- env->cpu[idx].die_id = cpu__get_die_id(cpu);
+ env->cpu[idx].core_id = core_id >= 0 ? core_id : -1;
+ env->cpu[idx].socket_id = socket_id >= 0 ? socket_id : -1;
+ env->cpu[idx].die_id = die_id >= 0 ? die_id : -1;
}
env->nr_cpus_avail = nr_cpus;
@@ -472,15 +480,19 @@ const char *perf_env__arch(struct perf_env *env)
return normalize_arch(arch_name);
}
+#if defined(HAVE_LIBTRACEEVENT)
+#include "trace/beauty/arch_errno_names.c"
+#endif
+
const char *perf_env__arch_strerrno(struct perf_env *env __maybe_unused, int err __maybe_unused)
{
-#if defined(HAVE_SYSCALL_TABLE_SUPPORT) && defined(HAVE_LIBTRACEEVENT)
+#if defined(HAVE_LIBTRACEEVENT)
if (env->arch_strerrno == NULL)
env->arch_strerrno = arch_syscalls__strerrno_function(perf_env__arch(env));
return env->arch_strerrno ? env->arch_strerrno(err) : "no arch specific strerrno function";
#else
- return "!(HAVE_SYSCALL_TABLE_SUPPORT && HAVE_LIBTRACEEVENT)";
+ return "!HAVE_LIBTRACEEVENT";
#endif
}
diff --git a/tools/perf/util/env.h b/tools/perf/util/env.h
index ae604c4edbb7..d90e343cf1fa 100644
--- a/tools/perf/util/env.h
+++ b/tools/perf/util/env.h
@@ -56,8 +56,6 @@ struct pmu_caps {
typedef const char *(arch_syscalls__strerrno_t)(int err);
-arch_syscalls__strerrno_t *arch_syscalls__strerrno_function(const char *arch);
-
struct perf_env {
char *hostname;
char *os_release;
@@ -176,9 +174,9 @@ const char *perf_env__raw_arch(struct perf_env *env);
int perf_env__nr_cpus_avail(struct perf_env *env);
void perf_env__init(struct perf_env *env);
-void __perf_env__insert_bpf_prog_info(struct perf_env *env,
+bool __perf_env__insert_bpf_prog_info(struct perf_env *env,
struct bpf_prog_info_node *info_node);
-void perf_env__insert_bpf_prog_info(struct perf_env *env,
+bool perf_env__insert_bpf_prog_info(struct perf_env *env,
struct bpf_prog_info_node *info_node);
struct bpf_prog_info_node *perf_env__find_bpf_prog_info(struct perf_env *env,
__u32 prog_id);
diff --git a/tools/perf/util/evsel.c b/tools/perf/util/evsel.c
index f745723d486b..bc144388f892 100644
--- a/tools/perf/util/evsel.c
+++ b/tools/perf/util/evsel.c
@@ -395,6 +395,7 @@ void evsel__init(struct evsel *evsel,
evsel->group_pmu_name = NULL;
evsel->skippable = false;
evsel->alternate_hw_config = PERF_COUNT_HW_MAX;
+ evsel->script_output_type = -1; // FIXME: OUTPUT_TYPE_UNSET, see builtin-script.c
}
struct evsel *evsel__new_idx(struct perf_event_attr *attr, int idx)
@@ -454,7 +455,7 @@ static int evsel__copy_config_terms(struct evsel *dst, struct evsel *src)
* The assumption is that @orig is not configured nor opened yet.
* So we only care about the attributes that can be set while it's parsed.
*/
-struct evsel *evsel__clone(struct evsel *orig)
+struct evsel *evsel__clone(struct evsel *dest, struct evsel *orig)
{
struct evsel *evsel;
@@ -467,7 +468,11 @@ struct evsel *evsel__clone(struct evsel *orig)
if (orig->bpf_obj)
return NULL;
- evsel = evsel__new(&orig->core.attr);
+ if (dest)
+ evsel = dest;
+ else
+ evsel = evsel__new(&orig->core.attr);
+
if (evsel == NULL)
return NULL;
@@ -512,11 +517,12 @@ struct evsel *evsel__clone(struct evsel *orig)
evsel->core.leader = orig->core.leader;
evsel->max_events = orig->max_events;
- free((char *)evsel->unit);
- evsel->unit = strdup(orig->unit);
- if (evsel->unit == NULL)
- goto out_err;
-
+ zfree(&evsel->unit);
+ if (orig->unit) {
+ evsel->unit = strdup(orig->unit);
+ if (evsel->unit == NULL)
+ goto out_err;
+ }
evsel->scale = orig->scale;
evsel->snapshot = orig->snapshot;
evsel->per_pkg = orig->per_pkg;
@@ -544,53 +550,101 @@ out_err:
return NULL;
}
+static int trace_event__id(const char *sys, const char *name)
+{
+ char *tp_dir = get_events_file(sys);
+ char path[PATH_MAX];
+ int id, err;
+
+ if (!tp_dir)
+ return -1;
+
+ scnprintf(path, PATH_MAX, "%s/%s/id", tp_dir, name);
+ put_events_file(tp_dir);
+ err = filename__read_int(path, &id);
+ if (err)
+ return err;
+
+ return id;
+}
+
/*
* Returns pointer with encoded error via <linux/err.h> interface.
*/
-#ifdef HAVE_LIBTRACEEVENT
struct evsel *evsel__newtp_idx(const char *sys, const char *name, int idx, bool format)
{
+ struct perf_event_attr attr = {
+ .type = PERF_TYPE_TRACEPOINT,
+ .sample_type = (PERF_SAMPLE_RAW | PERF_SAMPLE_TIME |
+ PERF_SAMPLE_CPU | PERF_SAMPLE_PERIOD),
+ };
struct evsel *evsel = zalloc(perf_evsel__object.size);
- int err = -ENOMEM;
+ int err = -ENOMEM, id = -1;
- if (evsel == NULL) {
+ if (evsel == NULL)
goto out_err;
- } else {
- struct perf_event_attr attr = {
- .type = PERF_TYPE_TRACEPOINT,
- .sample_type = (PERF_SAMPLE_RAW | PERF_SAMPLE_TIME |
- PERF_SAMPLE_CPU | PERF_SAMPLE_PERIOD),
- };
- if (asprintf(&evsel->name, "%s:%s", sys, name) < 0)
- goto out_free;
- event_attr_init(&attr);
+ if (asprintf(&evsel->name, "%s:%s", sys, name) < 0)
+ goto out_free;
- if (format) {
- evsel->tp_format = trace_event__tp_format(sys, name);
- if (IS_ERR(evsel->tp_format)) {
- err = PTR_ERR(evsel->tp_format);
- goto out_free;
- }
- attr.config = evsel->tp_format->id;
- } else {
- attr.config = (__u64) -1;
- }
+#ifdef HAVE_LIBTRACEEVENT
+ evsel->tp_sys = strdup(sys);
+ if (!evsel->tp_sys)
+ goto out_free;
+ evsel->tp_name = strdup(name);
+ if (!evsel->tp_name)
+ goto out_free;
+#endif
- attr.sample_period = 1;
- evsel__init(evsel, &attr, idx);
- }
+ event_attr_init(&attr);
+ if (format) {
+ id = trace_event__id(sys, name);
+ if (id < 0) {
+ err = id;
+ goto out_free;
+ }
+ }
+ attr.config = (__u64)id;
+ attr.sample_period = 1;
+ evsel__init(evsel, &attr, idx);
return evsel;
out_free:
zfree(&evsel->name);
+#ifdef HAVE_LIBTRACEEVENT
+ zfree(&evsel->tp_sys);
+ zfree(&evsel->tp_name);
+#endif
free(evsel);
out_err:
return ERR_PTR(err);
}
+
+#ifdef HAVE_LIBTRACEEVENT
+struct tep_event *evsel__tp_format(struct evsel *evsel)
+{
+ struct tep_event *tp_format = evsel->tp_format;
+
+ if (tp_format)
+ return tp_format;
+
+ if (evsel->core.attr.type != PERF_TYPE_TRACEPOINT)
+ return NULL;
+
+ tp_format = trace_event__tp_format(evsel->tp_sys, evsel->tp_name);
+ if (IS_ERR(tp_format)) {
+ int err = -PTR_ERR(evsel->tp_format);
+
+ pr_err("Error getting tracepoint format '%s' '%s'(%d)\n",
+ evsel__name(evsel), strerror(err), err);
+ return NULL;
+ }
+ evsel->tp_format = tp_format;
+ return evsel->tp_format;
+}
#endif
const char *const evsel__hw_names[PERF_COUNT_HW_MAX] = {
@@ -1103,6 +1157,9 @@ static void evsel__apply_config_terms(struct evsel *evsel,
case EVSEL__CONFIG_TERM_AUX_OUTPUT:
attr->aux_output = term->val.aux_output ? 1 : 0;
break;
+ case EVSEL__CONFIG_TERM_AUX_ACTION:
+ /* Already applied by auxtrace */
+ break;
case EVSEL__CONFIG_TERM_AUX_SAMPLE_SIZE:
/* Already applied by auxtrace */
break;
@@ -1587,6 +1644,10 @@ void evsel__exit(struct evsel *evsel)
perf_thread_map__put(evsel->core.threads);
zfree(&evsel->group_name);
zfree(&evsel->name);
+#ifdef HAVE_LIBTRACEEVENT
+ zfree(&evsel->tp_sys);
+ zfree(&evsel->tp_name);
+#endif
zfree(&evsel->filter);
zfree(&evsel->group_pmu_name);
zfree(&evsel->unit);
@@ -2090,16 +2151,17 @@ int evsel__prepare_open(struct evsel *evsel, struct perf_cpu_map *cpus,
return err;
}
-static bool has_attr_feature(struct perf_event_attr *attr, unsigned long flags)
+static bool __has_attr_feature(struct perf_event_attr *attr,
+ struct perf_cpu cpu, unsigned long flags)
{
- int fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, /*cpu=*/-1,
+ int fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, cpu.cpu,
/*group_fd=*/-1, flags);
close(fd);
if (fd < 0) {
attr->exclude_kernel = 1;
- fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, /*cpu=*/-1,
+ fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, cpu.cpu,
/*group_fd=*/-1, flags);
close(fd);
}
@@ -2107,7 +2169,7 @@ static bool has_attr_feature(struct perf_event_attr *attr, unsigned long flags)
if (fd < 0) {
attr->exclude_hv = 1;
- fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, /*cpu=*/-1,
+ fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, cpu.cpu,
/*group_fd=*/-1, flags);
close(fd);
}
@@ -2115,7 +2177,7 @@ static bool has_attr_feature(struct perf_event_attr *attr, unsigned long flags)
if (fd < 0) {
attr->exclude_guest = 1;
- fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, /*cpu=*/-1,
+ fd = syscall(SYS_perf_event_open, attr, /*pid=*/0, cpu.cpu,
/*group_fd=*/-1, flags);
close(fd);
}
@@ -2127,6 +2189,13 @@ static bool has_attr_feature(struct perf_event_attr *attr, unsigned long flags)
return fd >= 0;
}
+static bool has_attr_feature(struct perf_event_attr *attr, unsigned long flags)
+{
+ struct perf_cpu cpu = {.cpu = -1};
+
+ return __has_attr_feature(attr, cpu, flags);
+}
+
static void evsel__detect_missing_pmu_features(struct evsel *evsel)
{
struct perf_event_attr attr = {
@@ -2215,7 +2284,65 @@ found:
errno = old_errno;
}
-static bool evsel__detect_missing_features(struct evsel *evsel)
+static bool evsel__probe_aux_action(struct evsel *evsel, struct perf_cpu cpu)
+{
+ struct perf_event_attr attr = evsel->core.attr;
+ int old_errno = errno;
+
+ attr.disabled = 1;
+ attr.aux_start_paused = 1;
+
+ if (__has_attr_feature(&attr, cpu, /*flags=*/0)) {
+ errno = old_errno;
+ return true;
+ }
+
+ /*
+ * EOPNOTSUPP means the kernel supports the feature but the PMU does
+ * not, so keep that distinction if possible.
+ */
+ if (errno != EOPNOTSUPP)
+ errno = old_errno;
+
+ return false;
+}
+
+static void evsel__detect_missing_aux_action_feature(struct evsel *evsel, struct perf_cpu cpu)
+{
+ static bool detection_done;
+ struct evsel *leader;
+
+ /*
+ * Don't bother probing aux_action if it is not being used or has been
+ * probed before.
+ */
+ if (!evsel->core.attr.aux_action || detection_done)
+ return;
+
+ detection_done = true;
+
+ /*
+ * The leader is an AUX area event. If it has failed, assume the feature
+ * is not supported.
+ */
+ leader = evsel__leader(evsel);
+ if (evsel == leader) {
+ perf_missing_features.aux_action = true;
+ return;
+ }
+
+ /*
+ * AUX area event with aux_action must have been opened successfully
+ * already, so feature is supported.
+ */
+ if (leader->core.attr.aux_action)
+ return;
+
+ if (!evsel__probe_aux_action(leader, cpu))
+ perf_missing_features.aux_action = true;
+}
+
+static bool evsel__detect_missing_features(struct evsel *evsel, struct perf_cpu cpu)
{
static bool detection_done = false;
struct perf_event_attr attr = {
@@ -2225,6 +2352,8 @@ static bool evsel__detect_missing_features(struct evsel *evsel)
};
int old_errno;
+ evsel__detect_missing_aux_action_feature(evsel, cpu);
+
evsel__detect_missing_pmu_features(evsel);
if (evsel__has_br_stack(evsel))
@@ -2439,6 +2568,7 @@ static int evsel__open_cpu(struct evsel *evsel, struct perf_cpu_map *cpus,
int idx, thread, nthreads;
int pid = -1, err, old_errno;
enum rlimit_action set_rlimit = NO_CHANGE;
+ struct perf_cpu cpu;
if (evsel__is_retire_lat(evsel))
return tpebs_start(evsel->evlist);
@@ -2476,6 +2606,7 @@ fallback_missing_features:
}
for (idx = start_cpu_map_idx; idx < end_cpu_map_idx; idx++) {
+ cpu = perf_cpu_map__cpu(cpus, idx);
for (thread = 0; thread < nthreads; thread++) {
int fd, group_fd;
@@ -2496,10 +2627,9 @@ retry_open:
/* Debug message used by test scripts */
pr_debug2_peo("sys_perf_event_open: pid %d cpu %d group_fd %d flags %#lx",
- pid, perf_cpu_map__cpu(cpus, idx).cpu, group_fd, evsel->open_flags);
+ pid, cpu.cpu, group_fd, evsel->open_flags);
- fd = sys_perf_event_open(&evsel->core.attr, pid,
- perf_cpu_map__cpu(cpus, idx).cpu,
+ fd = sys_perf_event_open(&evsel->core.attr, pid, cpu.cpu,
group_fd, evsel->open_flags);
FD(evsel, idx, thread) = fd;
@@ -2515,8 +2645,7 @@ retry_open:
bpf_counter__install_pe(evsel, idx, fd);
if (unlikely(test_attr__enabled())) {
- test_attr__open(&evsel->core.attr, pid,
- perf_cpu_map__cpu(cpus, idx),
+ test_attr__open(&evsel->core.attr, pid, cpu,
fd, group_fd, evsel->open_flags);
}
@@ -2571,12 +2700,12 @@ try_fallback:
if (err == -EMFILE && rlimit__increase_nofile(&set_rlimit))
goto retry_open;
- if (err == -EOPNOTSUPP && evsel__precise_ip_fallback(evsel))
- goto retry_open;
-
- if (err == -EINVAL && evsel__detect_missing_features(evsel))
+ if (err == -EINVAL && evsel__detect_missing_features(evsel, cpu))
goto fallback_missing_features;
+ if (evsel__precise_ip_fallback(evsel))
+ goto retry_open;
+
if (evsel__handle_error_quirks(evsel, err))
goto retry_open;
@@ -3218,12 +3347,16 @@ u16 evsel__id_hdr_size(const struct evsel *evsel)
#ifdef HAVE_LIBTRACEEVENT
struct tep_format_field *evsel__field(struct evsel *evsel, const char *name)
{
- return tep_find_field(evsel->tp_format, name);
+ struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ return tp_format ? tep_find_field(tp_format, name) : NULL;
}
struct tep_format_field *evsel__common_field(struct evsel *evsel, const char *name)
{
- return tep_find_common_field(evsel->tp_format, name);
+ struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ return tp_format ? tep_find_common_field(tp_format, name) : NULL;
}
void *evsel__rawptr(struct evsel *evsel, struct perf_sample *sample, const char *name)
@@ -3448,6 +3581,78 @@ static bool find_process(const char *name)
return ret ? false : true;
}
+static int dump_perf_event_processes(char *msg, size_t size)
+{
+ DIR *proc_dir;
+ struct dirent *proc_entry;
+ int printed = 0;
+
+ proc_dir = opendir(procfs__mountpoint());
+ if (!proc_dir)
+ return 0;
+
+ /* Walk through the /proc directory. */
+ while ((proc_entry = readdir(proc_dir)) != NULL) {
+ char buf[256];
+ DIR *fd_dir;
+ struct dirent *fd_entry;
+ int fd_dir_fd;
+
+ if (proc_entry->d_type != DT_DIR ||
+ !isdigit(proc_entry->d_name[0]) ||
+ strlen(proc_entry->d_name) > sizeof(buf) - 4)
+ continue;
+
+ scnprintf(buf, sizeof(buf), "%s/fd", proc_entry->d_name);
+ fd_dir_fd = openat(dirfd(proc_dir), buf, O_DIRECTORY);
+ if (fd_dir_fd == -1)
+ continue;
+ fd_dir = fdopendir(fd_dir_fd);
+ if (!fd_dir) {
+ close(fd_dir_fd);
+ continue;
+ }
+ while ((fd_entry = readdir(fd_dir)) != NULL) {
+ ssize_t link_size;
+
+ if (fd_entry->d_type != DT_LNK)
+ continue;
+ link_size = readlinkat(fd_dir_fd, fd_entry->d_name, buf, sizeof(buf));
+ if (link_size < 0)
+ continue;
+ /* Take care as readlink doesn't null terminate the string. */
+ if (!strncmp(buf, "anon_inode:[perf_event]", link_size)) {
+ int cmdline_fd;
+ ssize_t cmdline_size;
+
+ scnprintf(buf, sizeof(buf), "%s/cmdline", proc_entry->d_name);
+ cmdline_fd = openat(dirfd(proc_dir), buf, O_RDONLY);
+ if (cmdline_fd == -1)
+ continue;
+ cmdline_size = read(cmdline_fd, buf, sizeof(buf) - 1);
+ close(cmdline_fd);
+ if (cmdline_size < 0)
+ continue;
+ buf[cmdline_size] = '\0';
+ for (ssize_t i = 0; i < cmdline_size; i++) {
+ if (buf[i] == '\0')
+ buf[i] = ' ';
+ }
+
+ if (printed == 0)
+ printed += scnprintf(msg, size, "Possible processes:\n");
+
+ printed += scnprintf(msg + printed, size - printed,
+ "%s %s\n", proc_entry->d_name, buf);
+ break;
+ }
+ }
+ closedir(fd_dir);
+ }
+ closedir(proc_dir);
+ return printed;
+}
+
int __weak arch_evsel__open_strerror(struct evsel *evsel __maybe_unused,
char *msg __maybe_unused,
size_t size __maybe_unused)
@@ -3481,7 +3686,7 @@ int evsel__open_strerror(struct evsel *evsel, struct target *target,
printed += scnprintf(msg, size,
"No permission to enable %s event.\n\n", evsel__name(evsel));
- return scnprintf(msg + printed, size - printed,
+ return printed + scnprintf(msg + printed, size - printed,
"Consider adjusting /proc/sys/kernel/perf_event_paranoid setting to open\n"
"access to performance monitoring and observability operations for processes\n"
"without CAP_PERFMON, CAP_SYS_PTRACE or CAP_SYS_ADMIN Linux capability.\n"
@@ -3526,6 +3731,10 @@ int evsel__open_strerror(struct evsel *evsel, struct target *target,
return scnprintf(msg, size,
"%s: PMU Hardware doesn't support 'aux_output' feature",
evsel__name(evsel));
+ if (evsel->core.attr.aux_action)
+ return scnprintf(msg, size,
+ "%s: PMU Hardware doesn't support 'aux_action' feature",
+ evsel__name(evsel));
if (evsel->core.attr.sample_period != 0)
return scnprintf(msg, size,
"%s: PMU Hardware doesn't support sampling/overflow-interrupts. Try 'perf stat'",
@@ -3544,6 +3753,11 @@ int evsel__open_strerror(struct evsel *evsel, struct target *target,
return scnprintf(msg, size,
"The PMU counters are busy/taken by another profiler.\n"
"We found oprofile daemon running, please stop it and try again.");
+ printed += scnprintf(
+ msg, size,
+ "The PMU %s counters are busy and in use by another process.\n",
+ evsel->pmu ? evsel->pmu->name : "");
+ return printed + dump_perf_event_processes(msg + printed, size - printed);
break;
case EINVAL:
if (evsel->core.attr.sample_type & PERF_SAMPLE_CODE_PAGE_SIZE && perf_missing_features.code_page_size)
@@ -3556,6 +3770,8 @@ int evsel__open_strerror(struct evsel *evsel, struct target *target,
return scnprintf(msg, size, "clockid feature not supported.");
if (perf_missing_features.clockid_wrong)
return scnprintf(msg, size, "wrong clockid (%d).", clockid);
+ if (perf_missing_features.aux_action)
+ return scnprintf(msg, size, "The 'aux_action' feature is not supported, update the kernel.");
if (perf_missing_features.aux_output)
return scnprintf(msg, size, "The 'aux_output' feature is not supported, update the kernel.");
if (!target__has_cpu(target))
diff --git a/tools/perf/util/evsel.h b/tools/perf/util/evsel.h
index 04934a7af174..5e789fa80590 100644
--- a/tools/perf/util/evsel.h
+++ b/tools/perf/util/evsel.h
@@ -59,6 +59,8 @@ struct evsel {
char *group_name;
const char *group_pmu_name;
#ifdef HAVE_LIBTRACEEVENT
+ char *tp_sys;
+ char *tp_name;
struct tep_event *tp_format;
#endif
char *filter;
@@ -119,6 +121,7 @@ struct evsel {
bool default_metricgroup; /* A member of the Default metricgroup */
struct hashmap *per_pkg_mask;
int err;
+ int script_output_type;
struct {
evsel__sb_cb_t *cb;
void *data;
@@ -205,6 +208,7 @@ struct perf_missing_features {
bool weight_struct;
bool read_lost;
bool branch_counters;
+ bool aux_action;
bool inherit_sample_read;
};
@@ -241,26 +245,23 @@ static inline struct evsel *evsel__new(struct perf_event_attr *attr)
return evsel__new_idx(attr, 0);
}
-struct evsel *evsel__clone(struct evsel *orig);
+struct evsel *evsel__clone(struct evsel *dest, struct evsel *orig);
int copy_config_terms(struct list_head *dst, struct list_head *src);
void free_config_terms(struct list_head *config_terms);
-#ifdef HAVE_LIBTRACEEVENT
-struct evsel *evsel__newtp_idx(const char *sys, const char *name, int idx, bool format);
-
/*
* Returns pointer with encoded error via <linux/err.h> interface.
*/
+struct evsel *evsel__newtp_idx(const char *sys, const char *name, int idx, bool format);
static inline struct evsel *evsel__newtp(const char *sys, const char *name)
{
return evsel__newtp_idx(sys, name, 0, true);
}
-#endif
#ifdef HAVE_LIBTRACEEVENT
-struct tep_event *event_format__new(const char *sys, const char *name);
+struct tep_event *evsel__tp_format(struct evsel *evsel);
#endif
void evsel__init(struct evsel *evsel, struct perf_event_attr *attr, int idx);
diff --git a/tools/perf/util/evsel_config.h b/tools/perf/util/evsel_config.h
index aee6f808b512..af52a1516d0b 100644
--- a/tools/perf/util/evsel_config.h
+++ b/tools/perf/util/evsel_config.h
@@ -25,6 +25,7 @@ enum evsel_term_type {
EVSEL__CONFIG_TERM_BRANCH,
EVSEL__CONFIG_TERM_PERCORE,
EVSEL__CONFIG_TERM_AUX_OUTPUT,
+ EVSEL__CONFIG_TERM_AUX_ACTION,
EVSEL__CONFIG_TERM_AUX_SAMPLE_SIZE,
EVSEL__CONFIG_TERM_CFG_CHG,
};
diff --git a/tools/perf/util/evsel_fprintf.c b/tools/perf/util/evsel_fprintf.c
index 86b7f46f9e2a..103984b29b1e 100644
--- a/tools/perf/util/evsel_fprintf.c
+++ b/tools/perf/util/evsel_fprintf.c
@@ -81,13 +81,15 @@ int evsel__fprintf(struct evsel *evsel, struct perf_attr_details *details, FILE
#ifdef HAVE_LIBTRACEEVENT
if (details->trace_fields) {
struct tep_format_field *field;
+ const struct tep_event *tp_format;
if (evsel->core.attr.type != PERF_TYPE_TRACEPOINT) {
printed += comma_fprintf(fp, &first, " (not a tracepoint)");
goto out;
}
- field = evsel->tp_format->format.fields;
+ tp_format = evsel__tp_format(evsel);
+ field = tp_format ? tp_format->format.fields : NULL;
if (field == NULL) {
printed += comma_fprintf(fp, &first, " (no trace field)");
goto out;
diff --git a/tools/perf/util/expr.c b/tools/perf/util/expr.c
index f289044a1f7c..c221dcce6666 100644
--- a/tools/perf/util/expr.c
+++ b/tools/perf/util/expr.c
@@ -285,7 +285,7 @@ struct expr_parse_ctx *expr__ctx_new(void)
{
struct expr_parse_ctx *ctx;
- ctx = malloc(sizeof(struct expr_parse_ctx));
+ ctx = calloc(1, sizeof(struct expr_parse_ctx));
if (!ctx)
return NULL;
@@ -294,9 +294,6 @@ struct expr_parse_ctx *expr__ctx_new(void)
free(ctx);
return NULL;
}
- ctx->sctx.user_requested_cpu_list = NULL;
- ctx->sctx.runtime = 0;
- ctx->sctx.system_wide = false;
return ctx;
}
diff --git a/tools/perf/util/ftrace.h b/tools/perf/util/ftrace.h
index bae649ef50e8..5dee2caba0fe 100644
--- a/tools/perf/util/ftrace.h
+++ b/tools/perf/util/ftrace.h
@@ -7,6 +7,7 @@
struct evlist;
struct hashamp;
+struct stats;
struct perf_ftrace {
struct evlist *evlist;
@@ -20,6 +21,9 @@ struct perf_ftrace {
unsigned long percpu_buffer_size;
bool inherit;
bool use_nsec;
+ unsigned int bucket_range;
+ unsigned int min_latency;
+ unsigned int max_latency;
int graph_depth;
int func_stack_trace;
int func_irq_info;
@@ -43,7 +47,7 @@ int perf_ftrace__latency_prepare_bpf(struct perf_ftrace *ftrace);
int perf_ftrace__latency_start_bpf(struct perf_ftrace *ftrace);
int perf_ftrace__latency_stop_bpf(struct perf_ftrace *ftrace);
int perf_ftrace__latency_read_bpf(struct perf_ftrace *ftrace,
- int buckets[]);
+ int buckets[], struct stats *stats);
int perf_ftrace__latency_cleanup_bpf(struct perf_ftrace *ftrace);
#else /* !HAVE_BPF_SKEL */
@@ -68,7 +72,8 @@ perf_ftrace__latency_stop_bpf(struct perf_ftrace *ftrace __maybe_unused)
static inline int
perf_ftrace__latency_read_bpf(struct perf_ftrace *ftrace __maybe_unused,
- int buckets[] __maybe_unused)
+ int buckets[] __maybe_unused,
+ struct stats *stats __maybe_unused)
{
return -1;
}
diff --git a/tools/perf/util/generate-cmdlist.sh b/tools/perf/util/generate-cmdlist.sh
index 1b5140e5ce99..6a73c903d690 100755
--- a/tools/perf/util/generate-cmdlist.sh
+++ b/tools/perf/util/generate-cmdlist.sh
@@ -38,7 +38,7 @@ do
done
echo "#endif /* HAVE_LIBELF_SUPPORT */"
-echo "#if defined(HAVE_LIBTRACEEVENT) && (defined(HAVE_LIBAUDIT_SUPPORT) || defined(HAVE_SYSCALL_TABLE_SUPPORT))"
+echo "#if defined(HAVE_LIBTRACEEVENT)"
sed -n -e 's/^perf-\([^ ]*\)[ ].* audit*/\1/p' command-list.txt |
sort |
while read cmd
@@ -51,7 +51,7 @@ do
p
}' "Documentation/perf-$cmd.txt"
done
-echo "#endif /* HAVE_LIBTRACEEVENT && (HAVE_LIBAUDIT_SUPPORT || HAVE_SYSCALL_TABLE_SUPPORT) */"
+echo "#endif /* HAVE_LIBTRACEEVENT */"
echo "#ifdef HAVE_LIBTRACEEVENT"
sed -n -e 's/^perf-\([^ ]*\)[ ].* traceevent.*/\1/p' command-list.txt |
diff --git a/tools/perf/util/header.c b/tools/perf/util/header.c
index 3451e542b69a..d06aa86352d3 100644
--- a/tools/perf/util/header.c
+++ b/tools/perf/util/header.c
@@ -3158,7 +3158,10 @@ static int process_bpf_prog_info(struct feat_fd *ff, void *data __maybe_unused)
/* after reading from file, translate offset to address */
bpil_offs_to_addr(info_linear);
info_node->info_linear = info_linear;
- __perf_env__insert_bpf_prog_info(env, info_node);
+ if (!__perf_env__insert_bpf_prog_info(env, info_node)) {
+ free(info_linear);
+ free(info_node);
+ }
}
up_write(&env->bpf_progs.lock);
@@ -3205,7 +3208,8 @@ static int process_bpf_btf(struct feat_fd *ff, void *data __maybe_unused)
if (__do_read(ff, node->data, data_size))
goto out;
- __perf_env__insert_btf(env, node);
+ if (!__perf_env__insert_btf(env, node))
+ free(node);
node = NULL;
}
diff --git a/tools/perf/util/hist.c b/tools/perf/util/hist.c
index fff134565801..0f30f843c566 100644
--- a/tools/perf/util/hist.c
+++ b/tools/perf/util/hist.c
@@ -32,6 +32,9 @@
#include <linux/time64.h>
#include <linux/zalloc.h>
+static int64_t hist_entry__cmp(struct hist_entry *left, struct hist_entry *right);
+static int64_t hist_entry__collapse(struct hist_entry *left, struct hist_entry *right);
+
static bool hists__filter_entry_by_dso(struct hists *hists,
struct hist_entry *he);
static bool hists__filter_entry_by_thread(struct hists *hists,
@@ -1292,19 +1295,35 @@ out:
return err;
}
-int64_t
-hist_entry__cmp(struct hist_entry *left, struct hist_entry *right)
+static int64_t
+hist_entry__cmp_impl(struct perf_hpp_list *hpp_list, struct hist_entry *left,
+ struct hist_entry *right, unsigned long fn_offset,
+ bool ignore_dynamic, bool ignore_skipped)
{
struct hists *hists = left->hists;
struct perf_hpp_fmt *fmt;
- int64_t cmp = 0;
+ perf_hpp_fmt_cmp_t *fn;
+ int64_t cmp;
+
+ /*
+ * Never collapse filtered and non-filtered entries.
+ * Note this is not the same as having an extra (invisible) fmt
+ * that corresponds to the filtered status.
+ */
+ cmp = (int64_t)!!left->filtered - (int64_t)!!right->filtered;
+ if (cmp)
+ return cmp;
- hists__for_each_sort_list(hists, fmt) {
- if (perf_hpp__is_dynamic_entry(fmt) &&
+ perf_hpp_list__for_each_sort_list(hpp_list, fmt) {
+ if (ignore_dynamic && perf_hpp__is_dynamic_entry(fmt) &&
!perf_hpp__defined_dynamic_entry(fmt, hists))
continue;
- cmp = fmt->cmp(fmt, left, right);
+ if (ignore_skipped && perf_hpp__should_skip(fmt, hists))
+ continue;
+
+ fn = (void *)fmt + fn_offset;
+ cmp = (*fn)(fmt, left, right);
if (cmp)
break;
}
@@ -1313,23 +1332,33 @@ hist_entry__cmp(struct hist_entry *left, struct hist_entry *right)
}
int64_t
-hist_entry__collapse(struct hist_entry *left, struct hist_entry *right)
+hist_entry__cmp(struct hist_entry *left, struct hist_entry *right)
{
- struct hists *hists = left->hists;
- struct perf_hpp_fmt *fmt;
- int64_t cmp = 0;
+ return hist_entry__cmp_impl(left->hists->hpp_list, left, right,
+ offsetof(struct perf_hpp_fmt, cmp), true, false);
+}
- hists__for_each_sort_list(hists, fmt) {
- if (perf_hpp__is_dynamic_entry(fmt) &&
- !perf_hpp__defined_dynamic_entry(fmt, hists))
- continue;
+static int64_t
+hist_entry__sort(struct hist_entry *left, struct hist_entry *right)
+{
+ return hist_entry__cmp_impl(left->hists->hpp_list, left, right,
+ offsetof(struct perf_hpp_fmt, sort), false, true);
+}
- cmp = fmt->collapse(fmt, left, right);
- if (cmp)
- break;
- }
+int64_t
+hist_entry__collapse(struct hist_entry *left, struct hist_entry *right)
+{
+ return hist_entry__cmp_impl(left->hists->hpp_list, left, right,
+ offsetof(struct perf_hpp_fmt, collapse), true, false);
+}
- return cmp;
+static int64_t
+hist_entry__collapse_hierarchy(struct perf_hpp_list *hpp_list,
+ struct hist_entry *left,
+ struct hist_entry *right)
+{
+ return hist_entry__cmp_impl(hpp_list, left, right,
+ offsetof(struct perf_hpp_fmt, collapse), false, false);
}
void hist_entry__delete(struct hist_entry *he)
@@ -1503,14 +1532,7 @@ static struct hist_entry *hierarchy_insert_entry(struct hists *hists,
while (*p != NULL) {
parent = *p;
iter = rb_entry(parent, struct hist_entry, rb_node_in);
-
- cmp = 0;
- perf_hpp_list__for_each_sort_list(hpp_list, fmt) {
- cmp = fmt->collapse(fmt, iter, he);
- if (cmp)
- break;
- }
-
+ cmp = hist_entry__collapse_hierarchy(hpp_list, iter, he);
if (!cmp) {
he_stat__add_stat(&iter->stat, &he->stat);
return iter;
@@ -1730,24 +1752,6 @@ int hists__collapse_resort(struct hists *hists, struct ui_progress *prog)
return 0;
}
-static int64_t hist_entry__sort(struct hist_entry *a, struct hist_entry *b)
-{
- struct hists *hists = a->hists;
- struct perf_hpp_fmt *fmt;
- int64_t cmp = 0;
-
- hists__for_each_sort_list(hists, fmt) {
- if (perf_hpp__should_skip(fmt, a->hists))
- continue;
-
- cmp = fmt->sort(fmt, a, b);
- if (cmp)
- break;
- }
-
- return cmp;
-}
-
static void hists__reset_filter_stats(struct hists *hists)
{
hists->nr_non_filtered_entries = 0;
@@ -2449,21 +2453,15 @@ static struct hist_entry *add_dummy_hierarchy_entry(struct hists *hists,
struct rb_node **p;
struct rb_node *parent = NULL;
struct hist_entry *he;
- struct perf_hpp_fmt *fmt;
bool leftmost = true;
p = &root->rb_root.rb_node;
while (*p != NULL) {
- int64_t cmp = 0;
+ int64_t cmp;
parent = *p;
he = rb_entry(parent, struct hist_entry, rb_node_in);
-
- perf_hpp_list__for_each_sort_list(he->hpp_list, fmt) {
- cmp = fmt->collapse(fmt, he, pair);
- if (cmp)
- break;
- }
+ cmp = hist_entry__collapse_hierarchy(he->hpp_list, he, pair);
if (!cmp)
goto out;
@@ -2521,16 +2519,10 @@ static struct hist_entry *hists__find_hierarchy_entry(struct rb_root_cached *roo
while (n) {
struct hist_entry *iter;
- struct perf_hpp_fmt *fmt;
- int64_t cmp = 0;
+ int64_t cmp;
iter = rb_entry(n, struct hist_entry, rb_node_in);
- perf_hpp_list__for_each_sort_list(he->hpp_list, fmt) {
- cmp = fmt->collapse(fmt, iter, he);
- if (cmp)
- break;
- }
-
+ cmp = hist_entry__collapse_hierarchy(he->hpp_list, iter, he);
if (cmp < 0)
n = n->rb_left;
else if (cmp > 0)
diff --git a/tools/perf/util/hist.h b/tools/perf/util/hist.h
index 1131056924d9..46c8373e3146 100644
--- a/tools/perf/util/hist.h
+++ b/tools/perf/util/hist.h
@@ -342,8 +342,6 @@ int hist_entry_iter__add(struct hist_entry_iter *iter, struct addr_location *al,
struct perf_hpp;
struct perf_hpp_fmt;
-int64_t hist_entry__cmp(struct hist_entry *left, struct hist_entry *right);
-int64_t hist_entry__collapse(struct hist_entry *left, struct hist_entry *right);
int hist_entry__transaction_len(void);
int hist_entry__sort_snprintf(struct hist_entry *he, char *bf, size_t size,
struct hists *hists);
@@ -452,6 +450,9 @@ struct perf_hpp {
bool skip;
};
+typedef int64_t (*perf_hpp_fmt_cmp_t)(
+ struct perf_hpp_fmt *, struct hist_entry *, struct hist_entry *);
+
struct perf_hpp_fmt {
const char *name;
int (*header)(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp,
@@ -463,12 +464,9 @@ struct perf_hpp_fmt {
struct hist_entry *he);
int (*entry)(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp,
struct hist_entry *he);
- int64_t (*cmp)(struct perf_hpp_fmt *fmt,
- struct hist_entry *a, struct hist_entry *b);
- int64_t (*collapse)(struct perf_hpp_fmt *fmt,
- struct hist_entry *a, struct hist_entry *b);
- int64_t (*sort)(struct perf_hpp_fmt *fmt,
- struct hist_entry *a, struct hist_entry *b);
+ perf_hpp_fmt_cmp_t cmp;
+ perf_hpp_fmt_cmp_t collapse;
+ perf_hpp_fmt_cmp_t sort;
bool (*equal)(struct perf_hpp_fmt *a, struct perf_hpp_fmt *b);
void (*free)(struct perf_hpp_fmt *fmt);
diff --git a/tools/perf/util/hwmon_pmu.c b/tools/perf/util/hwmon_pmu.c
index e61429b38ba7..4acb9bb19b84 100644
--- a/tools/perf/util/hwmon_pmu.c
+++ b/tools/perf/util/hwmon_pmu.c
@@ -258,8 +258,12 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
if (pmu->pmu.sysfs_aliases_loaded)
return 0;
- /* Use a dup-ed fd as closedir will close it. */
- dup_fd = dup(pmu->hwmon_dir_fd);
+ /*
+ * Use a dup-ed fd as closedir will close it. Use openat so that the
+ * directory contents are refreshed.
+ */
+ dup_fd = openat(pmu->hwmon_dir_fd, ".", O_DIRECTORY);
+
if (dup_fd == -1)
return -ENOMEM;
@@ -336,6 +340,9 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
close(fd);
}
}
+ if (hashmap__size(&pmu->events) == 0)
+ pr_debug2("hwmon_pmu: %s has no events\n", pmu->pmu.name);
+
hashmap__for_each_entry_safe((&pmu->events), cur, tmp, bkt) {
union hwmon_pmu_event_key key = {
.type_and_num = cur->key,
@@ -343,8 +350,8 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
struct hwmon_pmu_event_value *value = cur->pvalue;
if (!test_bit(HWMON_ITEM_INPUT, value->items)) {
- pr_debug("hwmon_pmu: removing event '%s%d' that has no input file\n",
- hwmon_type_strs[key.type], key.num);
+ pr_debug("hwmon_pmu: %s removing event '%s%d' that has no input file\n",
+ pmu->pmu.name, hwmon_type_strs[key.type], key.num);
hashmap__delete(&pmu->events, key.type_and_num, &key, &value);
zfree(&value->label);
zfree(&value->name);
diff --git a/tools/perf/util/intel-pt-decoder/Build b/tools/perf/util/intel-pt-decoder/Build
index 30793d08c6d4..5b8f0149167d 100644
--- a/tools/perf/util/intel-pt-decoder/Build
+++ b/tools/perf/util/intel-pt-decoder/Build
@@ -7,16 +7,24 @@ $(OUTPUT)util/intel-pt-decoder/inat-tables.c: $(inat_tables_script) $(inat_table
$(call rule_mkdir)
@$(call echo-cmd,gen)$(AWK) -f $(inat_tables_script) $(inat_tables_maps) > $@ || rm -f $@
-# Busybox's diff doesn't have -I, avoid warning in the case
+ifeq ($(SRCARCH),x86)
+ perf-util-y += inat.o insn.o
+else
+ perf-util-$(CONFIG_AUXTRACE) += inat.o insn.o
+endif
-$(OUTPUT)util/intel-pt-decoder/intel-pt-insn-decoder.o: util/intel-pt-decoder/intel-pt-insn-decoder.c $(OUTPUT)util/intel-pt-decoder/inat-tables.c
+$(OUTPUT)util/intel-pt-decoder/inat.o: $(srctree)/tools/arch/x86/lib/inat.c $(OUTPUT)util/intel-pt-decoder/inat-tables.c
$(call rule_mkdir)
$(call if_changed_dep,cc_o_c)
-CFLAGS_intel-pt-insn-decoder.o += -I$(OUTPUT)util/intel-pt-decoder
+CFLAGS_inat.o += -I$(OUTPUT)util/intel-pt-decoder
+
+$(OUTPUT)util/intel-pt-decoder/insn.o: $(srctree)/tools/arch/x86/lib/insn.c
+ $(call rule_mkdir)
+ $(call if_changed_dep,cc_o_c)
ifeq ($(CC_NO_CLANG), 1)
- CFLAGS_intel-pt-insn-decoder.o += -Wno-override-init
+ CFLAGS_insn.o += -Wno-override-init
endif
-CFLAGS_intel-pt-insn-decoder.o += -Wno-packed
+CFLAGS_insn.o += -Wno-packed
diff --git a/tools/perf/util/intel-pt-decoder/intel-pt-insn-decoder.c b/tools/perf/util/intel-pt-decoder/intel-pt-insn-decoder.c
index 47cf35799a4d..8fabddc1c0da 100644
--- a/tools/perf/util/intel-pt-decoder/intel-pt-insn-decoder.c
+++ b/tools/perf/util/intel-pt-decoder/intel-pt-insn-decoder.c
@@ -11,9 +11,6 @@
#include <byteswap.h>
#include "../../../arch/x86/include/asm/insn.h"
-#include "../../../arch/x86/lib/inat.c"
-#include "../../../arch/x86/lib/insn.c"
-
#include "event.h"
#include "intel-pt-insn-decoder.h"
diff --git a/tools/perf/util/jitdump.c b/tools/perf/util/jitdump.c
index 346513e5e9b7..f23e21502bf8 100644
--- a/tools/perf/util/jitdump.c
+++ b/tools/perf/util/jitdump.c
@@ -737,7 +737,7 @@ jit_inject(struct jit_buf_desc *jd, const char *path)
* as captured in the RECORD_MMAP record
*/
static int
-jit_detect(const char *mmap_name, pid_t pid, struct nsinfo *nsi)
+jit_detect(const char *mmap_name, pid_t pid, struct nsinfo *nsi, bool *in_pidns)
{
char *p;
char *end = NULL;
@@ -773,11 +773,16 @@ jit_detect(const char *mmap_name, pid_t pid, struct nsinfo *nsi)
if (!end)
return -1;
+ *in_pidns = pid == nsinfo__nstgid(nsi);
/*
* pid does not match mmap pid
* pid==0 in system-wide mode (synthesized)
+ *
+ * If the pid in the file name is equal to the nstgid, then
+ * the agent ran inside a container and perf outside the
+ * container, so record it for further use in jit_inject().
*/
- if (pid && pid2 != nsinfo__nstgid(nsi))
+ if (pid && !(pid2 == pid || *in_pidns))
return -1;
/*
* validate suffix
@@ -830,6 +835,7 @@ jit_process(struct perf_session *session,
struct nsinfo *nsi;
struct evsel *first;
struct jit_buf_desc jd;
+ bool in_pidns = false;
int ret;
thread = machine__findnew_thread(machine, pid, tid);
@@ -844,7 +850,7 @@ jit_process(struct perf_session *session,
/*
* first, detect marker mmap (i.e., the jitdump mmap)
*/
- if (jit_detect(filename, pid, nsi)) {
+ if (jit_detect(filename, pid, nsi, &in_pidns)) {
nsinfo__put(nsi);
/*
@@ -866,6 +872,9 @@ jit_process(struct perf_session *session,
jd.machine = machine;
jd.nsi = nsi;
+ if (in_pidns)
+ nsinfo__set_in_pidns(nsi);
+
/*
* track sample_type to compute id_all layout
* perf sets the same sample type to all events as of now
diff --git a/tools/perf/util/kvm-stat.c b/tools/perf/util/kvm-stat.c
new file mode 100644
index 000000000000..38ace736db5c
--- /dev/null
+++ b/tools/perf/util/kvm-stat.c
@@ -0,0 +1,70 @@
+// SPDX-License-Identifier: GPL-2.0
+#include "debug.h"
+#include "evsel.h"
+#include "kvm-stat.h"
+
+#if defined(HAVE_KVM_STAT_SUPPORT) && defined(HAVE_LIBTRACEEVENT)
+
+bool kvm_exit_event(struct evsel *evsel)
+{
+ return evsel__name_is(evsel, kvm_exit_trace);
+}
+
+void exit_event_get_key(struct evsel *evsel,
+ struct perf_sample *sample,
+ struct event_key *key)
+{
+ key->info = 0;
+ key->key = evsel__intval(evsel, sample, kvm_exit_reason);
+}
+
+
+bool exit_event_begin(struct evsel *evsel,
+ struct perf_sample *sample, struct event_key *key)
+{
+ if (kvm_exit_event(evsel)) {
+ exit_event_get_key(evsel, sample, key);
+ return true;
+ }
+
+ return false;
+}
+
+bool kvm_entry_event(struct evsel *evsel)
+{
+ return evsel__name_is(evsel, kvm_entry_trace);
+}
+
+bool exit_event_end(struct evsel *evsel,
+ struct perf_sample *sample __maybe_unused,
+ struct event_key *key __maybe_unused)
+{
+ return kvm_entry_event(evsel);
+}
+
+static const char *get_exit_reason(struct perf_kvm_stat *kvm,
+ struct exit_reasons_table *tbl,
+ u64 exit_code)
+{
+ while (tbl->reason != NULL) {
+ if (tbl->exit_code == exit_code)
+ return tbl->reason;
+ tbl++;
+ }
+
+ pr_err("unknown kvm exit code:%lld on %s\n",
+ (unsigned long long)exit_code, kvm->exit_reasons_isa);
+ return "UNKNOWN";
+}
+
+void exit_event_decode_key(struct perf_kvm_stat *kvm,
+ struct event_key *key,
+ char *decode)
+{
+ const char *exit_reason = get_exit_reason(kvm, key->exit_reasons,
+ key->key);
+
+ scnprintf(decode, KVM_EVENT_NAME_LEN, "%s", exit_reason);
+}
+
+#endif
diff --git a/tools/perf/util/kvm-stat.h b/tools/perf/util/kvm-stat.h
index 3e9ac754c3d1..4249542544bb 100644
--- a/tools/perf/util/kvm-stat.h
+++ b/tools/perf/util/kvm-stat.h
@@ -115,6 +115,8 @@ struct kvm_reg_events_ops {
struct kvm_events_ops *ops;
};
+#if defined(HAVE_KVM_STAT_SUPPORT) && defined(HAVE_LIBTRACEEVENT)
+
void exit_event_get_key(struct evsel *evsel,
struct perf_sample *sample,
struct event_key *key);
@@ -127,6 +129,7 @@ bool exit_event_end(struct evsel *evsel,
void exit_event_decode_key(struct perf_kvm_stat *kvm,
struct event_key *key,
char *decode);
+#endif
bool kvm_exit_event(struct evsel *evsel);
bool kvm_entry_event(struct evsel *evsel);
diff --git a/tools/perf/util/kwork.h b/tools/perf/util/kwork.h
index 76fe2a821bcf..db00269b73f2 100644
--- a/tools/perf/util/kwork.h
+++ b/tools/perf/util/kwork.h
@@ -1,6 +1,7 @@
#ifndef PERF_UTIL_KWORK_H
#define PERF_UTIL_KWORK_H
+#include "perf.h"
#include "util/tool.h"
#include "util/time-utils.h"
@@ -251,12 +252,14 @@ struct perf_kwork {
* perf kwork top data
*/
struct kwork_top_stat top_stat;
-};
-struct kwork_work *perf_kwork_add_work(struct perf_kwork *kwork,
+ /* Add work callback. */
+ struct kwork_work *(*add_work)(struct perf_kwork *kwork,
struct kwork_class *class,
struct kwork_work *key);
+};
+
#ifdef HAVE_BPF_SKEL
int perf_kwork__trace_prepare_bpf(struct perf_kwork *kwork);
diff --git a/tools/perf/util/llvm-c-helpers.cpp b/tools/perf/util/llvm-c-helpers.cpp
index 663bcaba2041..004081bd12c9 100644
--- a/tools/perf/util/llvm-c-helpers.cpp
+++ b/tools/perf/util/llvm-c-helpers.cpp
@@ -18,7 +18,6 @@
extern "C" {
#include <linux/zalloc.h>
}
-#include "symbol_conf.h"
#include "llvm-c-helpers.h"
extern "C"
diff --git a/tools/perf/util/lock-contention.c b/tools/perf/util/lock-contention.c
new file mode 100644
index 000000000000..92e7b7b572a2
--- /dev/null
+++ b/tools/perf/util/lock-contention.c
@@ -0,0 +1,143 @@
+// SPDX-License-Identifier: GPL-2.0
+#include "debug.h"
+#include "env.h"
+#include "lock-contention.h"
+#include "machine.h"
+#include "symbol.h"
+
+#include <limits.h>
+#include <string.h>
+
+#include <linux/hash.h>
+#include <linux/zalloc.h>
+
+#define __lockhashfn(key) hash_long((unsigned long)key, LOCKHASH_BITS)
+#define lockhashentry(key) (lockhash_table + __lockhashfn((key)))
+
+struct callstack_filter {
+ struct list_head list;
+ char name[];
+};
+
+static LIST_HEAD(callstack_filters);
+struct hlist_head *lockhash_table;
+
+int parse_call_stack(const struct option *opt __maybe_unused, const char *str,
+ int unset __maybe_unused)
+{
+ char *s, *tmp, *tok;
+ int ret = 0;
+
+ s = strdup(str);
+ if (s == NULL)
+ return -1;
+
+ for (tok = strtok_r(s, ", ", &tmp); tok; tok = strtok_r(NULL, ", ", &tmp)) {
+ struct callstack_filter *entry;
+
+ entry = malloc(sizeof(*entry) + strlen(tok) + 1);
+ if (entry == NULL) {
+ pr_err("Memory allocation failure\n");
+ free(s);
+ return -1;
+ }
+
+ strcpy(entry->name, tok);
+ list_add_tail(&entry->list, &callstack_filters);
+ }
+
+ free(s);
+ return ret;
+}
+
+bool needs_callstack(void)
+{
+ return !list_empty(&callstack_filters);
+}
+
+struct lock_stat *lock_stat_find(u64 addr)
+{
+ struct hlist_head *entry = lockhashentry(addr);
+ struct lock_stat *ret;
+
+ hlist_for_each_entry(ret, entry, hash_entry) {
+ if (ret->addr == addr)
+ return ret;
+ }
+ return NULL;
+}
+
+struct lock_stat *lock_stat_findnew(u64 addr, const char *name, int flags)
+{
+ struct hlist_head *entry = lockhashentry(addr);
+ struct lock_stat *ret, *new;
+
+ hlist_for_each_entry(ret, entry, hash_entry) {
+ if (ret->addr == addr)
+ return ret;
+ }
+
+ new = zalloc(sizeof(struct lock_stat));
+ if (!new)
+ goto alloc_failed;
+
+ new->addr = addr;
+ new->name = strdup(name);
+ if (!new->name) {
+ free(new);
+ goto alloc_failed;
+ }
+
+ new->flags = flags;
+ new->wait_time_min = ULLONG_MAX;
+
+ hlist_add_head(&new->hash_entry, entry);
+ return new;
+
+alloc_failed:
+ pr_err("memory allocation failed\n");
+ return NULL;
+}
+
+bool match_callstack_filter(struct machine *machine, u64 *callstack, int max_stack_depth)
+{
+ struct map *kmap;
+ struct symbol *sym;
+ u64 ip;
+ const char *arch = perf_env__arch(machine->env);
+
+ if (list_empty(&callstack_filters))
+ return true;
+
+ for (int i = 0; i < max_stack_depth; i++) {
+ struct callstack_filter *filter;
+
+ /*
+ * In powerpc, the callchain saved by kernel always includes
+ * first three entries as the NIP (next instruction pointer),
+ * LR (link register), and the contents of LR save area in the
+ * second stack frame. In certain scenarios its possible to have
+ * invalid kernel instruction addresses in either LR or the second
+ * stack frame's LR. In that case, kernel will store that address as
+ * zero.
+ *
+ * The below check will continue to look into callstack,
+ * incase first or second callstack index entry has 0
+ * address for powerpc.
+ */
+ if (!callstack || (!callstack[i] && (strcmp(arch, "powerpc") ||
+ (i != 1 && i != 2))))
+ break;
+
+ ip = callstack[i];
+ sym = machine__find_kernel_symbol(machine, ip, &kmap);
+ if (sym == NULL)
+ continue;
+
+ list_for_each_entry(filter, &callstack_filters, list) {
+ if (strstr(sym->name, filter->name))
+ return true;
+ }
+ }
+ return false;
+}
diff --git a/tools/perf/util/lock-contention.h b/tools/perf/util/lock-contention.h
index 1a7248ff3889..a09f7fe877df 100644
--- a/tools/perf/util/lock-contention.h
+++ b/tools/perf/util/lock-contention.h
@@ -10,10 +10,12 @@ struct lock_filter {
int nr_addrs;
int nr_syms;
int nr_cgrps;
+ int nr_slabs;
unsigned int *types;
unsigned long *addrs;
char **syms;
u64 *cgrps;
+ char **slabs;
};
struct lock_stat {
@@ -67,10 +69,11 @@ struct lock_stat {
*/
#define MAX_LOCK_DEPTH 48
-struct lock_stat *lock_stat_find(u64 addr);
-struct lock_stat *lock_stat_findnew(u64 addr, const char *name, int flags);
+/* based on kernel/lockdep.c */
+#define LOCKHASH_BITS 12
+#define LOCKHASH_SIZE (1UL << LOCKHASH_BITS)
-bool match_callstack_filter(struct machine *machine, u64 *callstack);
+extern struct hlist_head *lockhash_table;
/*
* struct lock_seq_stat:
@@ -148,8 +151,17 @@ struct lock_contention {
bool save_callstack;
};
-#ifdef HAVE_BPF_SKEL
+struct option;
+int parse_call_stack(const struct option *opt, const char *str, int unset);
+bool needs_callstack(void);
+struct lock_stat *lock_stat_find(u64 addr);
+struct lock_stat *lock_stat_findnew(u64 addr, const char *name, int flags);
+
+bool match_callstack_filter(struct machine *machine, u64 *callstack, int max_stack_depth);
+
+
+#ifdef HAVE_BPF_SKEL
int lock_contention_prepare(struct lock_contention *con);
int lock_contention_start(void);
int lock_contention_stop(void);
diff --git a/tools/perf/util/machine.c b/tools/perf/util/machine.c
index 4f0ac998b0cc..2d51badfbf2e 100644
--- a/tools/perf/util/machine.c
+++ b/tools/perf/util/machine.c
@@ -134,6 +134,8 @@ struct machine *machine__new_host(void)
if (machine__create_kernel_maps(machine) < 0)
goto out_delete;
+
+ machine->env = &perf_env;
}
return machine;
@@ -1001,7 +1003,7 @@ static int machine__get_running_kernel_start(struct machine *machine,
err = kallsyms__get_symbol_start(filename, "_edata", &addr);
if (err)
- err = kallsyms__get_function_start(filename, "_etext", &addr);
+ err = kallsyms__get_symbol_start(filename, "_etext", &addr);
if (!err)
*end = addr;
@@ -1466,6 +1468,8 @@ static int machine__create_modules(struct machine *machine)
if (modules__parse(modules, machine, machine__create_module))
return -1;
+ maps__fixup_end(machine__kernel_maps(machine));
+
if (!machine__set_modules_path(machine))
return 0;
diff --git a/tools/perf/util/maps.c b/tools/perf/util/maps.c
index 432399cbe5dd..09c9cc326c08 100644
--- a/tools/perf/util/maps.c
+++ b/tools/perf/util/maps.c
@@ -1136,8 +1136,13 @@ struct map *maps__find_next_entry(struct maps *maps, struct map *map)
struct map *result = NULL;
down_read(maps__lock(maps));
+ while (!maps__maps_by_address_sorted(maps)) {
+ up_read(maps__lock(maps));
+ maps__sort_by_address(maps);
+ down_read(maps__lock(maps));
+ }
i = maps__by_address_index(maps, map);
- if (i < maps__nr_maps(maps))
+ if (++i < maps__nr_maps(maps))
result = map__get(maps__maps_by_address(maps)[i]);
up_read(maps__lock(maps));
diff --git a/tools/perf/util/mem-events.c b/tools/perf/util/mem-events.c
index bf5090f5220b..3692e988c86e 100644
--- a/tools/perf/util/mem-events.c
+++ b/tools/perf/util/mem-events.c
@@ -258,6 +258,7 @@ int perf_mem_events__record_args(const char **rec_argv, int *argv_nr)
const char *s;
char *copy;
struct perf_cpu_map *cpu_map = NULL;
+ int ret;
while ((pmu = perf_pmus__scan_mem(pmu)) != NULL) {
for (int j = 0; j < PERF_MEM_EVENTS__MAX; j++) {
@@ -283,7 +284,9 @@ int perf_mem_events__record_args(const char **rec_argv, int *argv_nr)
rec_argv[i++] = "-e";
rec_argv[i++] = copy;
- cpu_map = perf_cpu_map__merge(cpu_map, pmu->cpus);
+ ret = perf_cpu_map__merge(&cpu_map, pmu->cpus);
+ if (ret < 0)
+ return ret;
}
}
diff --git a/tools/perf/util/namespaces.c b/tools/perf/util/namespaces.c
index cb185c5659d6..68f5de2d79c7 100644
--- a/tools/perf/util/namespaces.c
+++ b/tools/perf/util/namespaces.c
@@ -266,11 +266,16 @@ pid_t nsinfo__pid(const struct nsinfo *nsi)
return RC_CHK_ACCESS(nsi)->pid;
}
-pid_t nsinfo__in_pidns(const struct nsinfo *nsi)
+bool nsinfo__in_pidns(const struct nsinfo *nsi)
{
return RC_CHK_ACCESS(nsi)->in_pidns;
}
+void nsinfo__set_in_pidns(struct nsinfo *nsi)
+{
+ RC_CHK_ACCESS(nsi)->in_pidns = true;
+}
+
void nsinfo__mountns_enter(struct nsinfo *nsi,
struct nscookie *nc)
{
diff --git a/tools/perf/util/namespaces.h b/tools/perf/util/namespaces.h
index 8c0731c6cbb7..e95c79b80e27 100644
--- a/tools/perf/util/namespaces.h
+++ b/tools/perf/util/namespaces.h
@@ -58,7 +58,8 @@ void nsinfo__clear_need_setns(struct nsinfo *nsi);
pid_t nsinfo__tgid(const struct nsinfo *nsi);
pid_t nsinfo__nstgid(const struct nsinfo *nsi);
pid_t nsinfo__pid(const struct nsinfo *nsi);
-pid_t nsinfo__in_pidns(const struct nsinfo *nsi);
+bool nsinfo__in_pidns(const struct nsinfo *nsi);
+void nsinfo__set_in_pidns(struct nsinfo *nsi);
void nsinfo__mountns_enter(struct nsinfo *nsi, struct nscookie *nc);
void nsinfo__mountns_exit(struct nscookie *nc);
diff --git a/tools/perf/util/parse-events.c b/tools/perf/util/parse-events.c
index afeb8d815bbf..1e23faa364b1 100644
--- a/tools/perf/util/parse-events.c
+++ b/tools/perf/util/parse-events.c
@@ -489,7 +489,6 @@ int parse_events_add_cache(struct list_head *list, int *idx, const char *name,
return found_supported ? 0 : -EINVAL;
}
-#ifdef HAVE_LIBTRACEEVENT
static void tracepoint_error(struct parse_events_error *e, int err,
const char *sys, const char *name, int column)
{
@@ -644,7 +643,6 @@ static int add_tracepoint_multi_sys(struct parse_events_state *parse_state,
closedir(events_dir);
return ret;
}
-#endif /* HAVE_LIBTRACEEVENT */
size_t default_breakpoint_len(void)
{
@@ -795,6 +793,7 @@ const char *parse_events__term_type_str(enum parse_events__term_type term_type)
[PARSE_EVENTS__TERM_TYPE_DRV_CFG] = "driver-config",
[PARSE_EVENTS__TERM_TYPE_PERCORE] = "percore",
[PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT] = "aux-output",
+ [PARSE_EVENTS__TERM_TYPE_AUX_ACTION] = "aux-action",
[PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE] = "aux-sample-size",
[PARSE_EVENTS__TERM_TYPE_METRIC_ID] = "metric-id",
[PARSE_EVENTS__TERM_TYPE_RAW] = "raw",
@@ -844,6 +843,7 @@ config_term_avail(enum parse_events__term_type term_type, struct parse_events_er
case PARSE_EVENTS__TERM_TYPE_OVERWRITE:
case PARSE_EVENTS__TERM_TYPE_DRV_CFG:
case PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT:
+ case PARSE_EVENTS__TERM_TYPE_AUX_ACTION:
case PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE:
case PARSE_EVENTS__TERM_TYPE_RAW:
case PARSE_EVENTS__TERM_TYPE_LEGACY_CACHE:
@@ -963,6 +963,9 @@ do { \
case PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT:
CHECK_TYPE_VAL(NUM);
break;
+ case PARSE_EVENTS__TERM_TYPE_AUX_ACTION:
+ CHECK_TYPE_VAL(STR);
+ break;
case PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE:
CHECK_TYPE_VAL(NUM);
if (term->val.num > UINT_MAX) {
@@ -1066,7 +1069,6 @@ static int config_term_pmu(struct perf_event_attr *attr,
return config_term_common(attr, term, err);
}
-#ifdef HAVE_LIBTRACEEVENT
static int config_term_tracepoint(struct perf_event_attr *attr,
struct parse_events_term *term,
struct parse_events_error *err)
@@ -1081,6 +1083,7 @@ static int config_term_tracepoint(struct perf_event_attr *attr,
case PARSE_EVENTS__TERM_TYPE_OVERWRITE:
case PARSE_EVENTS__TERM_TYPE_NOOVERWRITE:
case PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT:
+ case PARSE_EVENTS__TERM_TYPE_AUX_ACTION:
case PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE:
return config_term_common(attr, term, err);
case PARSE_EVENTS__TERM_TYPE_USER:
@@ -1111,7 +1114,6 @@ static int config_term_tracepoint(struct perf_event_attr *attr,
return 0;
}
-#endif
static int config_attr(struct perf_event_attr *attr,
const struct parse_events_terms *head,
@@ -1217,6 +1219,9 @@ do { \
ADD_CONFIG_TERM_VAL(AUX_OUTPUT, aux_output,
term->val.num ? 1 : 0, term->weak);
break;
+ case PARSE_EVENTS__TERM_TYPE_AUX_ACTION:
+ ADD_CONFIG_TERM_STR(AUX_ACTION, term->val.str, term->weak);
+ break;
case PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE:
ADD_CONFIG_TERM_VAL(AUX_SAMPLE_SIZE, aux_sample_size,
term->val.num, term->weak);
@@ -1279,6 +1284,7 @@ static int get_config_chgs(struct perf_pmu *pmu, struct parse_events_terms *head
case PARSE_EVENTS__TERM_TYPE_DRV_CFG:
case PARSE_EVENTS__TERM_TYPE_PERCORE:
case PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT:
+ case PARSE_EVENTS__TERM_TYPE_AUX_ACTION:
case PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE:
case PARSE_EVENTS__TERM_TYPE_METRIC_ID:
case PARSE_EVENTS__TERM_TYPE_RAW:
@@ -1303,7 +1309,7 @@ int parse_events_add_tracepoint(struct parse_events_state *parse_state,
struct parse_events_terms *head_config, void *loc_)
{
YYLTYPE *loc = loc_;
-#ifdef HAVE_LIBTRACEEVENT
+
if (head_config) {
struct perf_event_attr attr;
@@ -1318,16 +1324,6 @@ int parse_events_add_tracepoint(struct parse_events_state *parse_state,
else
return add_tracepoint_event(parse_state, list, sys, event,
err, head_config, loc);
-#else
- (void)parse_state;
- (void)list;
- (void)sys;
- (void)event;
- (void)head_config;
- parse_events_error__handle(err, loc->first_column, strdup("unsupported tracepoint"),
- strdup("libtraceevent is necessary for tracepoint support"));
- return -1;
-#endif
}
static int __parse_events_add_numeric(struct parse_events_state *parse_state,
diff --git a/tools/perf/util/parse-events.h b/tools/perf/util/parse-events.h
index 3f4334ec6231..e176a34ab088 100644
--- a/tools/perf/util/parse-events.h
+++ b/tools/perf/util/parse-events.h
@@ -74,6 +74,7 @@ enum parse_events__term_type {
PARSE_EVENTS__TERM_TYPE_DRV_CFG,
PARSE_EVENTS__TERM_TYPE_PERCORE,
PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT,
+ PARSE_EVENTS__TERM_TYPE_AUX_ACTION,
PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE,
PARSE_EVENTS__TERM_TYPE_METRIC_ID,
PARSE_EVENTS__TERM_TYPE_RAW,
diff --git a/tools/perf/util/parse-events.l b/tools/perf/util/parse-events.l
index 14e5bd856a18..bf7f73548605 100644
--- a/tools/perf/util/parse-events.l
+++ b/tools/perf/util/parse-events.l
@@ -321,6 +321,7 @@ overwrite { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_OVERWRITE); }
no-overwrite { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_NOOVERWRITE); }
percore { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_PERCORE); }
aux-output { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_AUX_OUTPUT); }
+aux-action { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_AUX_ACTION); }
aux-sample-size { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_AUX_SAMPLE_SIZE); }
metric-id { return term(yyscanner, PARSE_EVENTS__TERM_TYPE_METRIC_ID); }
cpu-cycles|cycles { return hw_term(yyscanner, PERF_COUNT_HW_CPU_CYCLES); }
diff --git a/tools/perf/util/path.c b/tools/perf/util/path.c
index 00adf872bf00..2e62f272fda8 100644
--- a/tools/perf/util/path.c
+++ b/tools/perf/util/path.c
@@ -68,14 +68,12 @@ bool is_directory(const char *base_path, const struct dirent *dent)
return S_ISDIR(st.st_mode);
}
-bool is_executable_file(const char *base_path, const struct dirent *dent)
+bool is_directory_at(int dir_fd, const char *path)
{
- char path[PATH_MAX];
struct stat st;
- snprintf(path, sizeof(path), "%s/%s", base_path, dent->d_name);
- if (stat(path, &st))
+ if (fstatat(dir_fd, path, &st, /*flags=*/0))
return false;
- return !S_ISDIR(st.st_mode) && (st.st_mode & S_IXUSR);
+ return S_ISDIR(st.st_mode);
}
diff --git a/tools/perf/util/path.h b/tools/perf/util/path.h
index d94902c22222..fb850fb55c60 100644
--- a/tools/perf/util/path.h
+++ b/tools/perf/util/path.h
@@ -12,6 +12,6 @@ int path__join3(char *bf, size_t size, const char *path1, const char *path2, con
bool is_regular_file(const char *file);
bool is_directory(const char *base_path, const struct dirent *dent);
-bool is_executable_file(const char *base_path, const struct dirent *dent);
+bool is_directory_at(int dir_fd, const char *path);
#endif /* _PERF_PATH_H */
diff --git a/tools/perf/util/perf_event_attr_fprintf.c b/tools/perf/util/perf_event_attr_fprintf.c
index 59fbbba79697..c7f3543b9921 100644
--- a/tools/perf/util/perf_event_attr_fprintf.c
+++ b/tools/perf/util/perf_event_attr_fprintf.c
@@ -212,7 +212,6 @@ static void __p_config_hw_cache_id(char *buf, size_t size, u64 value)
}
}
-#ifdef HAVE_LIBTRACEEVENT
static void __p_config_tracepoint_id(char *buf, size_t size, u64 value)
{
char *str = tracepoint_id_to_name(value);
@@ -220,7 +219,6 @@ static void __p_config_tracepoint_id(char *buf, size_t size, u64 value)
print_id_hex(str);
free(str);
}
-#endif
static void __p_config_id(struct perf_pmu *pmu, char *buf, size_t size, u32 type, u64 value)
{
@@ -238,9 +236,7 @@ static void __p_config_id(struct perf_pmu *pmu, char *buf, size_t size, u32 type
case PERF_TYPE_HW_CACHE:
return __p_config_hw_cache_id(buf, size, value);
case PERF_TYPE_TRACEPOINT:
-#ifdef HAVE_LIBTRACEEVENT
return __p_config_tracepoint_id(buf, size, value);
-#endif
case PERF_TYPE_RAW:
case PERF_TYPE_BREAKPOINT:
default:
@@ -335,6 +331,9 @@ int perf_event_attr__fprintf(FILE *fp, struct perf_event_attr *attr,
PRINT_ATTRf(sample_max_stack, p_unsigned);
PRINT_ATTRf(aux_sample_size, p_unsigned);
PRINT_ATTRf(sig_data, p_unsigned);
+ PRINT_ATTRf(aux_start_paused, p_unsigned);
+ PRINT_ATTRf(aux_pause, p_unsigned);
+ PRINT_ATTRf(aux_resume, p_unsigned);
return ret;
}
diff --git a/tools/perf/util/pmu.c b/tools/perf/util/pmu.c
index 08a9d0bd9301..6206c8fe2bf9 100644
--- a/tools/perf/util/pmu.c
+++ b/tools/perf/util/pmu.c
@@ -12,6 +12,7 @@
#include <stdbool.h>
#include <dirent.h>
#include <api/fs/fs.h>
+#include <api/io.h>
#include <locale.h>
#include <fnmatch.h>
#include <math.h>
@@ -748,26 +749,35 @@ static int pmu_alias_terms(struct perf_pmu_alias *alias, int err_loc, struct lis
* Uncore PMUs have a "cpumask" file under sysfs. CPU PMUs (e.g. on arm/arm64)
* may have a "cpus" file.
*/
-static struct perf_cpu_map *pmu_cpumask(int dirfd, const char *name, bool is_core)
+static struct perf_cpu_map *pmu_cpumask(int dirfd, const char *pmu_name, bool is_core)
{
- struct perf_cpu_map *cpus;
const char *templates[] = {
"cpumask",
"cpus",
NULL
};
const char **template;
- char pmu_name[PATH_MAX];
- struct perf_pmu pmu = {.name = pmu_name};
- FILE *file;
- strlcpy(pmu_name, name, sizeof(pmu_name));
for (template = templates; *template; template++) {
- file = perf_pmu__open_file_at(&pmu, dirfd, *template);
- if (!file)
+ struct io io;
+ char buf[128];
+ char *cpumask = NULL;
+ size_t cpumask_len;
+ ssize_t ret;
+ struct perf_cpu_map *cpus;
+
+ io.fd = perf_pmu__pathname_fd(dirfd, pmu_name, *template, O_RDONLY);
+ if (io.fd < 0)
continue;
- cpus = perf_cpu_map__read(file);
- fclose(file);
+
+ io__init(&io, io.fd, buf, sizeof(buf));
+ ret = io__getline(&io, &cpumask, &cpumask_len);
+ close(io.fd);
+ if (ret < 0)
+ continue;
+
+ cpus = perf_cpu_map__new(cpumask);
+ free(cpumask);
if (cpus)
return cpus;
}
@@ -1763,6 +1773,7 @@ int perf_pmu__for_each_format(struct perf_pmu *pmu, void *state, pmu_format_call
"no-overwrite",
"percore",
"aux-output",
+ "aux-action=(pause|resume|start-paused)",
"aux-sample-size=number",
};
struct perf_pmu_format *format;
diff --git a/tools/perf/util/probe-event.c b/tools/perf/util/probe-event.c
index 6d51a4c98ad7..307ad6242a4e 100644
--- a/tools/perf/util/probe-event.c
+++ b/tools/perf/util/probe-event.c
@@ -1370,7 +1370,7 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
{
char *buf = strdup(arg);
char *p;
- int err;
+ int err = 0;
if (!buf)
return -ENOMEM;
@@ -1383,20 +1383,20 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
if (p == buf) {
semantic_error("No file/function name in '%s'.\n", p);
err = -EINVAL;
- goto err;
+ goto out;
}
*(p++) = '\0';
err = parse_line_num(&p, &lr->start, "start line");
if (err)
- goto err;
+ goto out;
if (*p == '+' || *p == '-') {
const char c = *(p++);
err = parse_line_num(&p, &lr->end, "end line");
if (err)
- goto err;
+ goto out;
if (c == '+') {
lr->end += lr->start;
@@ -1416,11 +1416,11 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
if (lr->start > lr->end) {
semantic_error("Start line must be smaller"
" than end line.\n");
- goto err;
+ goto out;
}
if (*p != '\0') {
semantic_error("Tailing with invalid str '%s'.\n", p);
- goto err;
+ goto out;
}
}
@@ -1431,7 +1431,7 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
lr->file = strdup_esq(p);
if (lr->file == NULL) {
err = -ENOMEM;
- goto err;
+ goto out;
}
}
if (*buf != '\0')
@@ -1439,7 +1439,7 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
if (!lr->function && !lr->file) {
semantic_error("Only '@*' is not allowed.\n");
err = -EINVAL;
- goto err;
+ goto out;
}
} else if (strpbrk_esq(buf, "/."))
lr->file = strdup_esq(buf);
@@ -1448,10 +1448,10 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
else { /* Invalid name */
semantic_error("'%s' is not a valid function name.\n", buf);
err = -EINVAL;
- goto err;
+ goto out;
}
-err:
+out:
free(buf);
return err;
}
@@ -2775,7 +2775,7 @@ int show_perf_probe_events(struct strfilter *filter)
static int get_new_event_name(char *buf, size_t len, const char *base,
struct strlist *namelist, bool ret_event,
- bool allow_suffix)
+ bool allow_suffix, bool not_C_symname)
{
int i, ret;
char *p, *nbase;
@@ -2786,10 +2786,24 @@ static int get_new_event_name(char *buf, size_t len, const char *base,
if (!nbase)
return -ENOMEM;
- /* Cut off the dot suffixes (e.g. .const, .isra) and version suffixes */
- p = strpbrk(nbase, ".@");
- if (p && p != nbase)
- *p = '\0';
+ if (not_C_symname) {
+ /* Replace non-alnum with '_' */
+ char *s, *d;
+
+ s = d = nbase;
+ do {
+ if (*s && !isalnum(*s)) {
+ if (d != nbase && *(d - 1) != '_')
+ *d++ = '_';
+ } else
+ *d++ = *s;
+ } while (*s++);
+ } else {
+ /* Cut off the dot suffixes (e.g. .const, .isra) and version suffixes */
+ p = strpbrk(nbase, ".@");
+ if (p && p != nbase)
+ *p = '\0';
+ }
/* Try no suffix number */
ret = e_snprintf(buf, len, "%s%s", nbase, ret_event ? "__return" : "");
@@ -2884,6 +2898,7 @@ static int probe_trace_event__set_name(struct probe_trace_event *tev,
bool allow_suffix)
{
const char *event, *group;
+ bool not_C_symname = true;
char buf[MAX_EVENT_NAME_LEN];
int ret;
@@ -2898,8 +2913,10 @@ static int probe_trace_event__set_name(struct probe_trace_event *tev,
(strncmp(pev->point.function, "0x", 2) != 0) &&
!strisglob(pev->point.function))
event = pev->point.function;
- else
+ else {
event = tev->point.realname;
+ not_C_symname = !is_known_C_lang(tev->lang);
+ }
}
if (pev->group && !pev->sdt)
group = pev->group;
@@ -2916,7 +2933,8 @@ static int probe_trace_event__set_name(struct probe_trace_event *tev,
/* Get an unused new event name */
ret = get_new_event_name(buf, sizeof(buf), event, namelist,
- tev->point.retprobe, allow_suffix);
+ tev->point.retprobe, allow_suffix,
+ not_C_symname);
if (ret < 0)
return ret;
diff --git a/tools/perf/util/probe-event.h b/tools/perf/util/probe-event.h
index 61a5f4ff4e9c..71905ede0207 100644
--- a/tools/perf/util/probe-event.h
+++ b/tools/perf/util/probe-event.h
@@ -58,6 +58,7 @@ struct probe_trace_event {
char *group; /* Group name */
struct probe_trace_point point; /* Trace point */
int nargs; /* Number of args */
+ int lang; /* Dwarf language code */
bool uprobes; /* uprobes only */
struct probe_trace_arg *args; /* Arguments */
};
diff --git a/tools/perf/util/probe-finder.c b/tools/perf/util/probe-finder.c
index 7f2ee0cb43ca..1e769b68da37 100644
--- a/tools/perf/util/probe-finder.c
+++ b/tools/perf/util/probe-finder.c
@@ -35,6 +35,19 @@
/* Kprobe tracer basic type is up to u64 */
#define MAX_BASIC_TYPE_BITS 64
+bool is_known_C_lang(int lang)
+{
+ switch (lang) {
+ case DW_LANG_C89:
+ case DW_LANG_C:
+ case DW_LANG_C99:
+ case DW_LANG_C11:
+ return true;
+ default:
+ return false;
+ }
+}
+
/*
* Probe finder related functions
*/
@@ -1270,6 +1283,8 @@ static int add_probe_trace_event(Dwarf_Die *sc_die, struct probe_finder *pf)
goto end;
}
+ tev->lang = dwarf_srclang(dwarf_diecu(sc_die, &pf->cu_die, NULL, NULL));
+
pr_debug("Probe point found: %s+%lu\n", tev->point.symbol,
tev->point.offset);
diff --git a/tools/perf/util/probe-finder.h b/tools/perf/util/probe-finder.h
index be7b46ea2460..dcf6cc1e1cbe 100644
--- a/tools/perf/util/probe-finder.h
+++ b/tools/perf/util/probe-finder.h
@@ -26,6 +26,9 @@ static inline int is_c_varname(const char *name)
#include "dwarf-aux.h"
#include "debuginfo.h"
+/* Check the language code is known C */
+bool is_known_C_lang(int lang);
+
/* Find probe_trace_events specified by perf_probe_event from debuginfo */
int debuginfo__find_trace_events(struct debuginfo *dbg,
struct perf_probe_event *pev,
@@ -103,6 +106,8 @@ struct line_finder {
int found;
};
+#else
+#define is_known_C_lang(lang) (false)
#endif /* HAVE_LIBDW_SUPPORT */
#endif /*_PROBE_FINDER_H */
diff --git a/tools/perf/util/python.c b/tools/perf/util/python.c
index 2096cdbaa53b..b4bc57859f73 100644
--- a/tools/perf/util/python.c
+++ b/tools/perf/util/python.c
@@ -13,30 +13,12 @@
#include "evsel.h"
#include "event.h"
#include "print_binary.h"
+#include "strbuf.h"
#include "thread_map.h"
#include "trace-event.h"
#include "mmap.h"
-#include "util/bpf-filter.h"
-#include "util/env.h"
-#include "util/kvm-stat.h"
-#include "util/stat.h"
-#include "util/kwork.h"
#include "util/sample.h"
-#include "util/lock-contention.h"
#include <internal/lib.h>
-#include "../builtin.h"
-
-#if PY_MAJOR_VERSION < 3
-#define _PyUnicode_FromString(arg) \
- PyString_FromString(arg)
-#define _PyUnicode_AsString(arg) \
- PyString_AsString(arg)
-#define _PyUnicode_FromFormat(...) \
- PyString_FromFormat(__VA_ARGS__)
-#define _PyLong_FromLong(arg) \
- PyInt_FromLong(arg)
-
-#else
#define _PyUnicode_FromString(arg) \
PyUnicode_FromString(arg)
@@ -44,22 +26,8 @@
PyUnicode_FromFormat(__VA_ARGS__)
#define _PyLong_FromLong(arg) \
PyLong_FromLong(arg)
-#endif
-
-#ifndef Py_TYPE
-#define Py_TYPE(ob) (((PyObject*)(ob))->ob_type)
-#endif
-
-/* Define PyVarObject_HEAD_INIT for python 2.5 */
-#ifndef PyVarObject_HEAD_INIT
-# define PyVarObject_HEAD_INIT(type, size) PyObject_HEAD_INIT(type) size,
-#endif
-#if PY_MAJOR_VERSION < 3
-PyMODINIT_FUNC initperf(void);
-#else
PyMODINIT_FUNC PyInit_perf(void);
-#endif
#define member_def(type, member, ptype, help) \
{ #member, ptype, \
@@ -89,7 +57,7 @@ struct pyrf_event {
sample_member_def(sample_period, period, T_ULONGLONG, "event period"), \
sample_member_def(sample_cpu, cpu, T_UINT, "event cpu"),
-static char pyrf_mmap_event__doc[] = PyDoc_STR("perf mmap event object.");
+static const char pyrf_mmap_event__doc[] = PyDoc_STR("perf mmap event object.");
static PyMemberDef pyrf_mmap_event__members[] = {
sample_members
@@ -104,7 +72,7 @@ static PyMemberDef pyrf_mmap_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_mmap_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_mmap_event__repr(const struct pyrf_event *pevent)
{
PyObject *ret;
char *s;
@@ -117,7 +85,7 @@ static PyObject *pyrf_mmap_event__repr(struct pyrf_event *pevent)
pevent->event.mmap.pgoff, pevent->event.mmap.filename) < 0) {
ret = PyErr_NoMemory();
} else {
- ret = _PyUnicode_FromString(s);
+ ret = PyUnicode_FromString(s);
free(s);
}
return ret;
@@ -133,7 +101,7 @@ static PyTypeObject pyrf_mmap_event__type = {
.tp_repr = (reprfunc)pyrf_mmap_event__repr,
};
-static char pyrf_task_event__doc[] = PyDoc_STR("perf task (fork/exit) event object.");
+static const char pyrf_task_event__doc[] = PyDoc_STR("perf task (fork/exit) event object.");
static PyMemberDef pyrf_task_event__members[] = {
sample_members
@@ -146,9 +114,9 @@ static PyMemberDef pyrf_task_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_task_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_task_event__repr(const struct pyrf_event *pevent)
{
- return _PyUnicode_FromFormat("{ type: %s, pid: %u, ppid: %u, tid: %u, "
+ return PyUnicode_FromFormat("{ type: %s, pid: %u, ppid: %u, tid: %u, "
"ptid: %u, time: %" PRI_lu64 "}",
pevent->event.header.type == PERF_RECORD_FORK ? "fork" : "exit",
pevent->event.fork.pid,
@@ -168,7 +136,7 @@ static PyTypeObject pyrf_task_event__type = {
.tp_repr = (reprfunc)pyrf_task_event__repr,
};
-static char pyrf_comm_event__doc[] = PyDoc_STR("perf comm event object.");
+static const char pyrf_comm_event__doc[] = PyDoc_STR("perf comm event object.");
static PyMemberDef pyrf_comm_event__members[] = {
sample_members
@@ -179,9 +147,9 @@ static PyMemberDef pyrf_comm_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_comm_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_comm_event__repr(const struct pyrf_event *pevent)
{
- return _PyUnicode_FromFormat("{ type: comm, pid: %u, tid: %u, comm: %s }",
+ return PyUnicode_FromFormat("{ type: comm, pid: %u, tid: %u, comm: %s }",
pevent->event.comm.pid,
pevent->event.comm.tid,
pevent->event.comm.comm);
@@ -197,7 +165,7 @@ static PyTypeObject pyrf_comm_event__type = {
.tp_repr = (reprfunc)pyrf_comm_event__repr,
};
-static char pyrf_throttle_event__doc[] = PyDoc_STR("perf throttle event object.");
+static const char pyrf_throttle_event__doc[] = PyDoc_STR("perf throttle event object.");
static PyMemberDef pyrf_throttle_event__members[] = {
sample_members
@@ -208,11 +176,12 @@ static PyMemberDef pyrf_throttle_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_throttle_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_throttle_event__repr(const struct pyrf_event *pevent)
{
- struct perf_record_throttle *te = (struct perf_record_throttle *)(&pevent->event.header + 1);
+ const struct perf_record_throttle *te = (const struct perf_record_throttle *)
+ (&pevent->event.header + 1);
- return _PyUnicode_FromFormat("{ type: %sthrottle, time: %" PRI_lu64 ", id: %" PRI_lu64
+ return PyUnicode_FromFormat("{ type: %sthrottle, time: %" PRI_lu64 ", id: %" PRI_lu64
", stream_id: %" PRI_lu64 " }",
pevent->event.header.type == PERF_RECORD_THROTTLE ? "" : "un",
te->time, te->id, te->stream_id);
@@ -228,7 +197,7 @@ static PyTypeObject pyrf_throttle_event__type = {
.tp_repr = (reprfunc)pyrf_throttle_event__repr,
};
-static char pyrf_lost_event__doc[] = PyDoc_STR("perf lost event object.");
+static const char pyrf_lost_event__doc[] = PyDoc_STR("perf lost event object.");
static PyMemberDef pyrf_lost_event__members[] = {
sample_members
@@ -237,7 +206,7 @@ static PyMemberDef pyrf_lost_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_lost_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_lost_event__repr(const struct pyrf_event *pevent)
{
PyObject *ret;
char *s;
@@ -247,7 +216,7 @@ static PyObject *pyrf_lost_event__repr(struct pyrf_event *pevent)
pevent->event.lost.id, pevent->event.lost.lost) < 0) {
ret = PyErr_NoMemory();
} else {
- ret = _PyUnicode_FromString(s);
+ ret = PyUnicode_FromString(s);
free(s);
}
return ret;
@@ -263,7 +232,7 @@ static PyTypeObject pyrf_lost_event__type = {
.tp_repr = (reprfunc)pyrf_lost_event__repr,
};
-static char pyrf_read_event__doc[] = PyDoc_STR("perf read event object.");
+static const char pyrf_read_event__doc[] = PyDoc_STR("perf read event object.");
static PyMemberDef pyrf_read_event__members[] = {
sample_members
@@ -272,9 +241,9 @@ static PyMemberDef pyrf_read_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_read_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_read_event__repr(const struct pyrf_event *pevent)
{
- return _PyUnicode_FromFormat("{ type: read, pid: %u, tid: %u }",
+ return PyUnicode_FromFormat("{ type: read, pid: %u, tid: %u }",
pevent->event.read.pid,
pevent->event.read.tid);
/*
@@ -293,7 +262,7 @@ static PyTypeObject pyrf_read_event__type = {
.tp_repr = (reprfunc)pyrf_read_event__repr,
};
-static char pyrf_sample_event__doc[] = PyDoc_STR("perf sample event object.");
+static const char pyrf_sample_event__doc[] = PyDoc_STR("perf sample event object.");
static PyMemberDef pyrf_sample_event__members[] = {
sample_members
@@ -301,7 +270,7 @@ static PyMemberDef pyrf_sample_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_sample_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_sample_event__repr(const struct pyrf_event *pevent)
{
PyObject *ret;
char *s;
@@ -309,20 +278,20 @@ static PyObject *pyrf_sample_event__repr(struct pyrf_event *pevent)
if (asprintf(&s, "{ type: sample }") < 0) {
ret = PyErr_NoMemory();
} else {
- ret = _PyUnicode_FromString(s);
+ ret = PyUnicode_FromString(s);
free(s);
}
return ret;
}
#ifdef HAVE_LIBTRACEEVENT
-static bool is_tracepoint(struct pyrf_event *pevent)
+static bool is_tracepoint(const struct pyrf_event *pevent)
{
return pevent->evsel->core.attr.type == PERF_TYPE_TRACEPOINT;
}
static PyObject*
-tracepoint_field(struct pyrf_event *pe, struct tep_format_field *field)
+tracepoint_field(const struct pyrf_event *pe, struct tep_format_field *field)
{
struct tep_handle *pevent = field->event->tep;
void *data = pe->sample.raw_data;
@@ -343,7 +312,7 @@ tracepoint_field(struct pyrf_event *pe, struct tep_format_field *field)
}
if (field->flags & TEP_FIELD_IS_STRING &&
is_printable_array(data + offset, len)) {
- ret = _PyUnicode_FromString((char *)data + offset);
+ ret = PyUnicode_FromString((char *)data + offset);
} else {
ret = PyByteArray_FromStringAndSize((const char *) data + offset, len);
field->flags &= ~TEP_FIELD_IS_STRING;
@@ -411,7 +380,7 @@ static PyTypeObject pyrf_sample_event__type = {
.tp_getattro = (getattrofunc) pyrf_sample_event__getattro,
};
-static char pyrf_context_switch_event__doc[] = PyDoc_STR("perf context_switch event object.");
+static const char pyrf_context_switch_event__doc[] = PyDoc_STR("perf context_switch event object.");
static PyMemberDef pyrf_context_switch_event__members[] = {
sample_members
@@ -421,7 +390,7 @@ static PyMemberDef pyrf_context_switch_event__members[] = {
{ .name = NULL, },
};
-static PyObject *pyrf_context_switch_event__repr(struct pyrf_event *pevent)
+static PyObject *pyrf_context_switch_event__repr(const struct pyrf_event *pevent)
{
PyObject *ret;
char *s;
@@ -432,7 +401,7 @@ static PyObject *pyrf_context_switch_event__repr(struct pyrf_event *pevent)
!!(pevent->event.header.misc & PERF_RECORD_MISC_SWITCH_OUT)) < 0) {
ret = PyErr_NoMemory();
} else {
- ret = _PyUnicode_FromString(s);
+ ret = PyUnicode_FromString(s);
free(s);
}
return ret;
@@ -501,7 +470,7 @@ static PyTypeObject *pyrf_event__type[] = {
[PERF_RECORD_SWITCH_CPU_WIDE] = &pyrf_context_switch_event__type,
};
-static PyObject *pyrf_event__new(union perf_event *event)
+static PyObject *pyrf_event__new(const union perf_event *event)
{
struct pyrf_event *pevent;
PyTypeObject *ptype;
@@ -569,7 +538,7 @@ static PySequenceMethods pyrf_cpu_map__sequence_methods = {
.sq_item = pyrf_cpu_map__item,
};
-static char pyrf_cpu_map__doc[] = PyDoc_STR("cpu map object.");
+static const char pyrf_cpu_map__doc[] = PyDoc_STR("cpu map object.");
static PyTypeObject pyrf_cpu_map__type = {
PyVarObject_HEAD_INIT(NULL, 0)
@@ -638,7 +607,7 @@ static PySequenceMethods pyrf_thread_map__sequence_methods = {
.sq_item = pyrf_thread_map__item,
};
-static char pyrf_thread_map__doc[] = PyDoc_STR("thread map object.");
+static const char pyrf_thread_map__doc[] = PyDoc_STR("thread map object.");
static PyTypeObject pyrf_thread_map__type = {
PyVarObject_HEAD_INIT(NULL, 0)
@@ -812,6 +781,17 @@ static PyObject *pyrf_evsel__open(struct pyrf_evsel *pevsel,
return Py_None;
}
+static PyObject *pyrf_evsel__str(PyObject *self)
+{
+ struct pyrf_evsel *pevsel = (void *)self;
+ struct evsel *evsel = &pevsel->evsel;
+
+ if (!evsel->pmu)
+ return PyUnicode_FromFormat("evsel(%s)", evsel__name(evsel));
+
+ return PyUnicode_FromFormat("evsel(%s/%s/)", evsel->pmu->name, evsel__name(evsel));
+}
+
static PyMethodDef pyrf_evsel__methods[] = {
{
.ml_name = "open",
@@ -822,7 +802,7 @@ static PyMethodDef pyrf_evsel__methods[] = {
{ .ml_name = NULL, }
};
-static char pyrf_evsel__doc[] = PyDoc_STR("perf event selector list object.");
+static const char pyrf_evsel__doc[] = PyDoc_STR("perf event selector list object.");
static PyTypeObject pyrf_evsel__type = {
PyVarObject_HEAD_INIT(NULL, 0)
@@ -833,6 +813,8 @@ static PyTypeObject pyrf_evsel__type = {
.tp_doc = pyrf_evsel__doc,
.tp_methods = pyrf_evsel__methods,
.tp_init = (initproc)pyrf_evsel__init,
+ .tp_str = pyrf_evsel__str,
+ .tp_repr = pyrf_evsel__str,
};
static int pyrf_evsel__setup_types(void)
@@ -918,17 +900,8 @@ static PyObject *pyrf_evlist__get_pollfd(struct pyrf_evlist *pevlist,
for (i = 0; i < evlist->core.pollfd.nr; ++i) {
PyObject *file;
-#if PY_MAJOR_VERSION < 3
- FILE *fp = fdopen(evlist->core.pollfd.entries[i].fd, "r");
-
- if (fp == NULL)
- goto free_list;
-
- file = PyFile_FromFile(fp, "perf", "r", NULL);
-#else
file = PyFile_FromFd(evlist->core.pollfd.entries[i].fd, "perf", "r", -1,
NULL, NULL, NULL, 0);
-#endif
if (file == NULL)
goto free_list;
@@ -1098,8 +1071,10 @@ static PyObject *pyrf_evlist__item(PyObject *obj, Py_ssize_t i)
struct pyrf_evlist *pevlist = (void *)obj;
struct evsel *pos;
- if (i >= pevlist->evlist.core.nr_entries)
+ if (i >= pevlist->evlist.core.nr_entries) {
+ PyErr_SetString(PyExc_IndexError, "Index out of range");
return NULL;
+ }
evlist__for_each_entry(&pevlist->evlist, pos) {
if (i-- == 0)
@@ -1109,12 +1084,36 @@ static PyObject *pyrf_evlist__item(PyObject *obj, Py_ssize_t i)
return Py_BuildValue("O", container_of(pos, struct pyrf_evsel, evsel));
}
+static PyObject *pyrf_evlist__str(PyObject *self)
+{
+ struct pyrf_evlist *pevlist = (void *)self;
+ struct evsel *pos;
+ struct strbuf sb = STRBUF_INIT;
+ bool first = true;
+ PyObject *result;
+
+ strbuf_addstr(&sb, "evlist([");
+ evlist__for_each_entry(&pevlist->evlist, pos) {
+ if (!first)
+ strbuf_addch(&sb, ',');
+ if (!pos->pmu)
+ strbuf_addstr(&sb, evsel__name(pos));
+ else
+ strbuf_addf(&sb, "%s/%s/", pos->pmu->name, evsel__name(pos));
+ first = false;
+ }
+ strbuf_addstr(&sb, "])");
+ result = PyUnicode_FromString(sb.buf);
+ strbuf_release(&sb);
+ return result;
+}
+
static PySequenceMethods pyrf_evlist__sequence_methods = {
.sq_length = pyrf_evlist__length,
.sq_item = pyrf_evlist__item,
};
-static char pyrf_evlist__doc[] = PyDoc_STR("perf event selector list object.");
+static const char pyrf_evlist__doc[] = PyDoc_STR("perf event selector list object.");
static PyTypeObject pyrf_evlist__type = {
PyVarObject_HEAD_INIT(NULL, 0)
@@ -1126,6 +1125,8 @@ static PyTypeObject pyrf_evlist__type = {
.tp_doc = pyrf_evlist__doc,
.tp_methods = pyrf_evlist__methods,
.tp_init = (initproc)pyrf_evlist__init,
+ .tp_repr = pyrf_evlist__str,
+ .tp_str = pyrf_evlist__str,
};
static int pyrf_evlist__setup_types(void)
@@ -1136,10 +1137,12 @@ static int pyrf_evlist__setup_types(void)
#define PERF_CONST(name) { #name, PERF_##name }
-static struct {
+struct perf_constant {
const char *name;
int value;
-} perf__constants[] = {
+};
+
+static const struct perf_constant perf__constants[] = {
PERF_CONST(TYPE_HARDWARE),
PERF_CONST(TYPE_SOFTWARE),
PERF_CONST(TYPE_TRACEPOINT),
@@ -1234,12 +1237,66 @@ static PyObject *pyrf__tracepoint(struct pyrf_evsel *pevsel,
tp_format = trace_event__tp_format(sys, name);
if (IS_ERR(tp_format))
- return _PyLong_FromLong(-1);
+ return PyLong_FromLong(-1);
- return _PyLong_FromLong(tp_format->id);
+ return PyLong_FromLong(tp_format->id);
#endif // HAVE_LIBTRACEEVENT
}
+static PyObject *pyrf_evsel__from_evsel(struct evsel *evsel)
+{
+ struct pyrf_evsel *pevsel = PyObject_New(struct pyrf_evsel, &pyrf_evsel__type);
+
+ if (!pevsel)
+ return NULL;
+
+ memset(&pevsel->evsel, 0, sizeof(pevsel->evsel));
+ evsel__init(&pevsel->evsel, &evsel->core.attr, evsel->core.idx);
+
+ evsel__clone(&pevsel->evsel, evsel);
+ return (PyObject *)pevsel;
+}
+
+static PyObject *pyrf_evlist__from_evlist(struct evlist *evlist)
+{
+ struct pyrf_evlist *pevlist = PyObject_New(struct pyrf_evlist, &pyrf_evlist__type);
+ struct evsel *pos;
+
+ if (!pevlist)
+ return NULL;
+
+ memset(&pevlist->evlist, 0, sizeof(pevlist->evlist));
+ evlist__init(&pevlist->evlist, evlist->core.all_cpus, evlist->core.threads);
+ evlist__for_each_entry(evlist, pos) {
+ struct pyrf_evsel *pevsel = (void *)pyrf_evsel__from_evsel(pos);
+
+ evlist__add(&pevlist->evlist, &pevsel->evsel);
+ }
+ return (PyObject *)pevlist;
+}
+
+static PyObject *pyrf__parse_events(PyObject *self, PyObject *args)
+{
+ const char *input;
+ struct evlist evlist = {};
+ struct parse_events_error err;
+ PyObject *result;
+
+ if (!PyArg_ParseTuple(args, "s", &input))
+ return NULL;
+
+ parse_events_error__init(&err);
+ evlist__init(&evlist, NULL, NULL);
+ if (parse_events(&evlist, input, &err)) {
+ parse_events_error__print(&err, input);
+ PyErr_SetFromErrno(PyExc_OSError);
+ return NULL;
+ }
+ result = pyrf_evlist__from_evlist(&evlist);
+ evlist__exit(&evlist);
+ return result;
+}
+
static PyMethodDef perf__methods[] = {
{
.ml_name = "tracepoint",
@@ -1247,21 +1304,20 @@ static PyMethodDef perf__methods[] = {
.ml_flags = METH_VARARGS | METH_KEYWORDS,
.ml_doc = PyDoc_STR("Get tracepoint config.")
},
+ {
+ .ml_name = "parse_events",
+ .ml_meth = (PyCFunction) pyrf__parse_events,
+ .ml_flags = METH_VARARGS,
+ .ml_doc = PyDoc_STR("Parse a string of events and return an evlist.")
+ },
{ .ml_name = NULL, }
};
-#if PY_MAJOR_VERSION < 3
-PyMODINIT_FUNC initperf(void)
-#else
PyMODINIT_FUNC PyInit_perf(void)
-#endif
{
PyObject *obj;
int i;
PyObject *dict;
-#if PY_MAJOR_VERSION < 3
- PyObject *module = Py_InitModule("perf", perf__methods);
-#else
static struct PyModuleDef moduledef = {
PyModuleDef_HEAD_INIT,
"perf", /* m_name */
@@ -1274,7 +1330,6 @@ PyMODINIT_FUNC PyInit_perf(void)
NULL, /* m_free */
};
PyObject *module = PyModule_Create(&moduledef);
-#endif
if (module == NULL ||
pyrf_event__setup_types() < 0 ||
@@ -1282,11 +1337,7 @@ PyMODINIT_FUNC PyInit_perf(void)
pyrf_evsel__setup_types() < 0 ||
pyrf_thread_map__setup_types() < 0 ||
pyrf_cpu_map__setup_types() < 0)
-#if PY_MAJOR_VERSION < 3
- return;
-#else
return module;
-#endif
/* The page_size is placed in util object. */
page_size = sysconf(_SC_PAGE_SIZE);
@@ -1335,7 +1386,7 @@ PyMODINIT_FUNC PyInit_perf(void)
goto error;
for (i = 0; perf__constants[i].name != NULL; i++) {
- obj = _PyLong_FromLong(perf__constants[i].value);
+ obj = PyLong_FromLong(perf__constants[i].value);
if (obj == NULL)
goto error;
PyDict_SetItemString(dict, perf__constants[i].name, obj);
@@ -1345,109 +1396,5 @@ PyMODINIT_FUNC PyInit_perf(void)
error:
if (PyErr_Occurred())
PyErr_SetString(PyExc_ImportError, "perf: Init failed!");
-#if PY_MAJOR_VERSION >= 3
return module;
-#endif
-}
-
-
-/* The following are stubs to avoid dragging in builtin-* objects. */
-/* TODO: move the code out of the builtin-* file into util. */
-
-unsigned int scripting_max_stack = PERF_MAX_STACK_DEPTH;
-
-#ifdef HAVE_KVM_STAT_SUPPORT
-bool kvm_entry_event(struct evsel *evsel __maybe_unused)
-{
- return false;
-}
-
-bool kvm_exit_event(struct evsel *evsel __maybe_unused)
-{
- return false;
-}
-
-bool exit_event_begin(struct evsel *evsel __maybe_unused,
- struct perf_sample *sample __maybe_unused,
- struct event_key *key __maybe_unused)
-{
- return false;
-}
-
-bool exit_event_end(struct evsel *evsel __maybe_unused,
- struct perf_sample *sample __maybe_unused,
- struct event_key *key __maybe_unused)
-{
- return false;
-}
-
-void exit_event_decode_key(struct perf_kvm_stat *kvm __maybe_unused,
- struct event_key *key __maybe_unused,
- char *decode __maybe_unused)
-{
-}
-#endif // HAVE_KVM_STAT_SUPPORT
-
-int find_scripts(char **scripts_array __maybe_unused, char **scripts_path_array __maybe_unused,
- int num __maybe_unused, int pathlen __maybe_unused)
-{
- return -1;
-}
-
-void perf_stat__set_no_csv_summary(int set __maybe_unused)
-{
-}
-
-void perf_stat__set_big_num(int set __maybe_unused)
-{
-}
-
-int script_spec_register(const char *spec __maybe_unused, struct scripting_ops *ops __maybe_unused)
-{
- return -1;
-}
-
-arch_syscalls__strerrno_t *arch_syscalls__strerrno_function(const char *arch __maybe_unused)
-{
- return NULL;
-}
-
-struct kwork_work *perf_kwork_add_work(struct perf_kwork *kwork __maybe_unused,
- struct kwork_class *class __maybe_unused,
- struct kwork_work *key __maybe_unused)
-{
- return NULL;
-}
-
-void script_fetch_insn(struct perf_sample *sample __maybe_unused,
- struct thread *thread __maybe_unused,
- struct machine *machine __maybe_unused)
-{
-}
-
-int perf_sample__sprintf_flags(u32 flags __maybe_unused, char *str __maybe_unused,
- size_t sz __maybe_unused)
-{
- return -1;
-}
-
-bool match_callstack_filter(struct machine *machine __maybe_unused, u64 *callstack __maybe_unused)
-{
- return false;
-}
-
-struct lock_stat *lock_stat_find(u64 addr __maybe_unused)
-{
- return NULL;
-}
-
-struct lock_stat *lock_stat_findnew(u64 addr __maybe_unused, const char *name __maybe_unused,
- int flags __maybe_unused)
-{
- return NULL;
-}
-
-int cmd_inject(int argc __maybe_unused, const char *argv[] __maybe_unused)
-{
- return -1;
}
diff --git a/tools/perf/util/scripting-engines/trace-event-perl.c b/tools/perf/util/scripting-engines/trace-event-perl.c
index 85b7f188f729..e261a57b87d4 100644
--- a/tools/perf/util/scripting-engines/trace-event-perl.c
+++ b/tools/perf/util/scripting-engines/trace-event-perl.c
@@ -344,7 +344,7 @@ static void perl_process_tracepoint(struct perf_sample *sample,
struct addr_location *al)
{
struct thread *thread = al->thread;
- struct tep_event *event = evsel->tp_format;
+ struct tep_event *event;
struct tep_format_field *field;
static char handler[256];
unsigned long long val;
@@ -362,6 +362,7 @@ static void perl_process_tracepoint(struct perf_sample *sample,
if (evsel->core.attr.type != PERF_TYPE_TRACEPOINT)
return;
+ event = evsel__tp_format(evsel);
if (!event) {
pr_debug("ug! no event found for type %" PRIu64, (u64)evsel->core.attr.config);
return;
diff --git a/tools/perf/util/scripting-engines/trace-event-python.c b/tools/perf/util/scripting-engines/trace-event-python.c
index 8bdae066e839..b1b5e94537e4 100644
--- a/tools/perf/util/scripting-engines/trace-event-python.c
+++ b/tools/perf/util/scripting-engines/trace-event-python.c
@@ -58,22 +58,6 @@
#include "mem-events.h"
#include "util/perf_regs.h"
-#if PY_MAJOR_VERSION < 3
-#define _PyUnicode_FromString(arg) \
- PyString_FromString(arg)
-#define _PyUnicode_FromStringAndSize(arg1, arg2) \
- PyString_FromStringAndSize((arg1), (arg2))
-#define _PyBytes_FromStringAndSize(arg1, arg2) \
- PyString_FromStringAndSize((arg1), (arg2))
-#define _PyLong_FromLong(arg) \
- PyInt_FromLong(arg)
-#define _PyLong_AsLong(arg) \
- PyInt_AsLong(arg)
-#define _PyCapsule_New(arg1, arg2, arg3) \
- PyCObject_FromVoidPtr((arg1), (arg2))
-
-PyMODINIT_FUNC initperf_trace_context(void);
-#else
#define _PyUnicode_FromString(arg) \
PyUnicode_FromString(arg)
#define _PyUnicode_FromStringAndSize(arg1, arg2) \
@@ -88,7 +72,6 @@ PyMODINIT_FUNC initperf_trace_context(void);
PyCapsule_New((arg1), (arg2), (arg3))
PyMODINIT_FUNC PyInit_perf_trace_context(void);
-#endif
#ifdef HAVE_LIBTRACEEVENT
#define TRACE_EVENT_TYPE_MAX \
@@ -181,17 +164,7 @@ static int get_argument_count(PyObject *handler)
{
int arg_count = 0;
- /*
- * The attribute for the code object is func_code in Python 2,
- * whereas it is __code__ in Python 3.0+.
- */
- PyObject *code_obj = PyObject_GetAttrString(handler,
- "func_code");
- if (PyErr_Occurred()) {
- PyErr_Clear();
- code_obj = PyObject_GetAttrString(handler,
- "__code__");
- }
+ PyObject *code_obj = code_obj = PyObject_GetAttrString(handler, "__code__");
PyErr_Clear();
if (code_obj) {
PyObject *arg_count_obj = PyObject_GetAttrString(code_obj,
@@ -949,7 +922,7 @@ static void python_process_tracepoint(struct perf_sample *sample,
struct addr_location *al,
struct addr_location *addr_al)
{
- struct tep_event *event = evsel->tp_format;
+ struct tep_event *event;
PyObject *handler, *context, *t, *obj = NULL, *callchain;
PyObject *dict = NULL, *all_entries_dict = NULL;
static char handler_name[256];
@@ -966,6 +939,7 @@ static void python_process_tracepoint(struct perf_sample *sample,
bitmap_zero(events_defined, TRACE_EVENT_TYPE_MAX);
+ event = evsel__tp_format(evsel);
if (!event) {
snprintf(handler_name, sizeof(handler_name),
"ug! no event found for type %" PRIu64, (u64)evsel->core.attr.config);
@@ -1902,12 +1876,6 @@ static void set_table_handlers(struct tables *tables)
tables->synth_handler = get_handler("synth_data");
}
-#if PY_MAJOR_VERSION < 3
-static void _free_command_line(const char **command_line, int num)
-{
- free(command_line);
-}
-#else
static void _free_command_line(wchar_t **command_line, int num)
{
int i;
@@ -1915,7 +1883,6 @@ static void _free_command_line(wchar_t **command_line, int num)
PyMem_RawFree(command_line[i]);
free(command_line);
}
-#endif
/*
@@ -1925,30 +1892,12 @@ static int python_start_script(const char *script, int argc, const char **argv,
struct perf_session *session)
{
struct tables *tables = &tables_global;
-#if PY_MAJOR_VERSION < 3
- const char **command_line;
-#else
wchar_t **command_line;
-#endif
- /*
- * Use a non-const name variable to cope with python 2.6's
- * PyImport_AppendInittab prototype
- */
- char buf[PATH_MAX], name[19] = "perf_trace_context";
+ char buf[PATH_MAX];
int i, err = 0;
FILE *fp;
scripting_context->session = session;
-#if PY_MAJOR_VERSION < 3
- command_line = malloc((argc + 1) * sizeof(const char *));
- if (!command_line)
- return -1;
-
- command_line[0] = script;
- for (i = 1; i < argc + 1; i++)
- command_line[i] = argv[i - 1];
- PyImport_AppendInittab(name, initperf_trace_context);
-#else
command_line = malloc((argc + 1) * sizeof(wchar_t *));
if (!command_line)
return -1;
@@ -1956,15 +1905,10 @@ static int python_start_script(const char *script, int argc, const char **argv,
command_line[0] = Py_DecodeLocale(script, NULL);
for (i = 1; i < argc + 1; i++)
command_line[i] = Py_DecodeLocale(argv[i - 1], NULL);
- PyImport_AppendInittab(name, PyInit_perf_trace_context);
-#endif
+ PyImport_AppendInittab("perf_trace_context", PyInit_perf_trace_context);
Py_Initialize();
-#if PY_MAJOR_VERSION < 3
- PySys_SetArgv(argc + 1, (char **)command_line);
-#else
PySys_SetArgv(argc + 1, command_line);
-#endif
fp = fopen(script, "r");
if (!fp) {
diff --git a/tools/perf/util/session.c b/tools/perf/util/session.c
index 507e6cba9545..c06e3020a976 100644
--- a/tools/perf/util/session.c
+++ b/tools/perf/util/session.c
@@ -37,6 +37,7 @@
#include "arch/common.h"
#include "units.h"
#include "annotate.h"
+#include "perf.h"
#include <internal/lib.h>
static int perf_session__deliver_event(struct perf_session *session,
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 9dd60c7869a2..3dd33721823f 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -1038,17 +1038,19 @@ static char *get_trace_output(struct hist_entry *he)
.data = he->raw_data,
.size = he->raw_size,
};
+ struct tep_event *tp_format;
evsel = hists_to_evsel(he->hists);
trace_seq_init(&seq);
- if (symbol_conf.raw_trace) {
- tep_print_fields(&seq, he->raw_data, he->raw_size,
- evsel->tp_format);
- } else {
- tep_print_event(evsel->tp_format->tep,
- &seq, &rec, "%s", TEP_PRINT_INFO);
+ tp_format = evsel__tp_format(evsel);
+ if (tp_format) {
+ if (symbol_conf.raw_trace)
+ tep_print_fields(&seq, he->raw_data, he->raw_size, tp_format);
+ else
+ tep_print_event(tp_format->tep, &seq, &rec, "%s", TEP_PRINT_INFO);
}
+
/*
* Trim the buffer, it starts at 4KB and we're not going to
* add anything more to this buffer.
@@ -3293,9 +3295,8 @@ static int __dynamic_dimension__add(struct evsel *evsel,
static int add_evsel_fields(struct evsel *evsel, bool raw_trace, int level)
{
int ret;
- struct tep_format_field *field;
-
- field = evsel->tp_format->format.fields;
+ struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field *field = tp_format ? tp_format->format.fields : NULL;
while (field) {
ret = __dynamic_dimension__add(evsel, field, raw_trace, level);
if (ret < 0)
@@ -3328,13 +3329,19 @@ static int add_all_matching_fields(struct evlist *evlist,
{
int ret = -ESRCH;
struct evsel *evsel;
- struct tep_format_field *field;
evlist__for_each_entry(evlist, evsel) {
+ struct tep_event *tp_format;
+ struct tep_format_field *field;
+
if (evsel->core.attr.type != PERF_TYPE_TRACEPOINT)
continue;
- field = tep_find_any_field(evsel->tp_format, field_name);
+ tp_format = evsel__tp_format(evsel);
+ if (tp_format == NULL)
+ continue;
+
+ field = tep_find_any_field(tp_format, field_name);
if (field == NULL)
continue;
@@ -3416,7 +3423,9 @@ static int add_dynamic_entry(struct evlist *evlist, const char *tok,
if (!strcmp(field_name, "*")) {
ret = add_evsel_fields(evsel, raw_trace, level);
} else {
- struct tep_format_field *field = tep_find_any_field(evsel->tp_format, field_name);
+ struct tep_event *tp_format = evsel__tp_format(evsel);
+ struct tep_format_field *field =
+ tp_format ? tep_find_any_field(tp_format, field_name) : NULL;
if (field == NULL) {
pr_debug("Cannot find event field for %s.%s\n",
diff --git a/tools/perf/util/stat-display.c b/tools/perf/util/stat-display.c
index 53dcdf07f5a2..ba79f73e1cf5 100644
--- a/tools/perf/util/stat-display.c
+++ b/tools/perf/util/stat-display.c
@@ -114,23 +114,59 @@ static void print_running_csv(struct perf_stat_config *config, u64 run, u64 ena)
fprintf(config->output, "%s%" PRIu64 "%s%.2f",
config->csv_sep, run, config->csv_sep, enabled_percent);
}
+struct outstate {
+ /* Std mode: insert a newline before the next metric */
+ bool newline;
+ /* JSON mode: track need for comma for a previous field or not */
+ bool first;
+ /* Num CSV separators remaining to pad out when not all fields are printed */
+ int csv_col_pad;
+
+ /*
+ * The following don't track state across fields, but are here as a shortcut to
+ * pass data to the print functions. The alternative would be to update the
+ * function signatures of the entire print stack to pass them through.
+ */
+ /* Place to output to */
+ FILE * const fh;
+ /* Lines are timestamped in --interval-print mode */
+ char timestamp[64];
+ /* Num items aggregated in current line. See struct perf_stat_aggr.nr */
+ int aggr_nr;
+ /* Core/socket/die etc ID for the current line */
+ struct aggr_cpu_id id;
+ /* Event for current line */
+ struct evsel *evsel;
+ /* Cgroup for current line */
+ struct cgroup *cgrp;
+};
+
+static const char *json_sep(struct outstate *os)
+{
+ const char *sep = os->first ? "" : ", ";
+
+ os->first = false;
+ return sep;
+}
+
+#define json_out(os, format, ...) fprintf((os)->fh, "%s" format, json_sep(os), ##__VA_ARGS__)
-static void print_running_json(struct perf_stat_config *config, u64 run, u64 ena)
+static void print_running_json(struct outstate *os, u64 run, u64 ena)
{
double enabled_percent = 100;
if (run != ena)
enabled_percent = 100 * run / ena;
- fprintf(config->output, "\"event-runtime\" : %" PRIu64 ", \"pcnt-running\" : %.2f, ",
- run, enabled_percent);
+ json_out(os, "\"event-runtime\" : %" PRIu64 ", \"pcnt-running\" : %.2f",
+ run, enabled_percent);
}
-static void print_running(struct perf_stat_config *config,
+static void print_running(struct perf_stat_config *config, struct outstate *os,
u64 run, u64 ena, bool before_metric)
{
if (config->json_output) {
if (before_metric)
- print_running_json(config, run, ena);
+ print_running_json(os, run, ena);
} else if (config->csv_output) {
if (before_metric)
print_running_csv(config, run, ena);
@@ -153,20 +189,20 @@ static void print_noise_pct_csv(struct perf_stat_config *config,
fprintf(config->output, "%s%.2f%%", config->csv_sep, pct);
}
-static void print_noise_pct_json(struct perf_stat_config *config,
+static void print_noise_pct_json(struct outstate *os,
double pct)
{
- fprintf(config->output, "\"variance\" : %.2f, ", pct);
+ json_out(os, "\"variance\" : %.2f", pct);
}
-static void print_noise_pct(struct perf_stat_config *config,
+static void print_noise_pct(struct perf_stat_config *config, struct outstate *os,
double total, double avg, bool before_metric)
{
double pct = rel_stddev_stats(total, avg);
if (config->json_output) {
if (before_metric)
- print_noise_pct_json(config, pct);
+ print_noise_pct_json(os, pct);
} else if (config->csv_output) {
if (before_metric)
print_noise_pct_csv(config, pct);
@@ -176,7 +212,7 @@ static void print_noise_pct(struct perf_stat_config *config,
}
}
-static void print_noise(struct perf_stat_config *config,
+static void print_noise(struct perf_stat_config *config, struct outstate *os,
struct evsel *evsel, double avg, bool before_metric)
{
struct perf_stat_evsel *ps;
@@ -185,7 +221,7 @@ static void print_noise(struct perf_stat_config *config,
return;
ps = evsel->stats;
- print_noise_pct(config, stddev_stats(&ps->res_stats), avg, before_metric);
+ print_noise_pct(config, os, stddev_stats(&ps->res_stats), avg, before_metric);
}
static void print_cgroup_std(struct perf_stat_config *config, const char *cgrp_name)
@@ -198,18 +234,19 @@ static void print_cgroup_csv(struct perf_stat_config *config, const char *cgrp_n
fprintf(config->output, "%s%s", config->csv_sep, cgrp_name);
}
-static void print_cgroup_json(struct perf_stat_config *config, const char *cgrp_name)
+static void print_cgroup_json(struct outstate *os, const char *cgrp_name)
{
- fprintf(config->output, "\"cgroup\" : \"%s\", ", cgrp_name);
+ json_out(os, "\"cgroup\" : \"%s\"", cgrp_name);
}
-static void print_cgroup(struct perf_stat_config *config, struct cgroup *cgrp)
+static void print_cgroup(struct perf_stat_config *config, struct outstate *os,
+ struct cgroup *cgrp)
{
if (nr_cgroups || config->cgroup_list) {
const char *cgrp_name = cgrp ? cgrp->name : "";
if (config->json_output)
- print_cgroup_json(config, cgrp_name);
+ print_cgroup_json(os, cgrp_name);
else if (config->csv_output)
print_cgroup_csv(config, cgrp_name);
else
@@ -324,47 +361,45 @@ static void print_aggr_id_csv(struct perf_stat_config *config,
}
}
-static void print_aggr_id_json(struct perf_stat_config *config,
+static void print_aggr_id_json(struct perf_stat_config *config, struct outstate *os,
struct evsel *evsel, struct aggr_cpu_id id, int aggr_nr)
{
- FILE *output = config->output;
-
switch (config->aggr_mode) {
case AGGR_CORE:
- fprintf(output, "\"core\" : \"S%d-D%d-C%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"core\" : \"S%d-D%d-C%d\", \"aggregate-number\" : %d",
id.socket, id.die, id.core, aggr_nr);
break;
case AGGR_CACHE:
- fprintf(output, "\"cache\" : \"S%d-D%d-L%d-ID%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"cache\" : \"S%d-D%d-L%d-ID%d\", \"aggregate-number\" : %d",
id.socket, id.die, id.cache_lvl, id.cache, aggr_nr);
break;
case AGGR_CLUSTER:
- fprintf(output, "\"cluster\" : \"S%d-D%d-CLS%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"cluster\" : \"S%d-D%d-CLS%d\", \"aggregate-number\" : %d",
id.socket, id.die, id.cluster, aggr_nr);
break;
case AGGR_DIE:
- fprintf(output, "\"die\" : \"S%d-D%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"die\" : \"S%d-D%d\", \"aggregate-number\" : %d",
id.socket, id.die, aggr_nr);
break;
case AGGR_SOCKET:
- fprintf(output, "\"socket\" : \"S%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"socket\" : \"S%d\", \"aggregate-number\" : %d",
id.socket, aggr_nr);
break;
case AGGR_NODE:
- fprintf(output, "\"node\" : \"N%d\", \"aggregate-number\" : %d, ",
+ json_out(os, "\"node\" : \"N%d\", \"aggregate-number\" : %d",
id.node, aggr_nr);
break;
case AGGR_NONE:
if (evsel->percore && !config->percore_show_thread) {
- fprintf(output, "\"core\" : \"S%d-D%d-C%d\"",
+ json_out(os, "\"core\" : \"S%d-D%d-C%d\"",
id.socket, id.die, id.core);
} else if (id.cpu.cpu > -1) {
- fprintf(output, "\"cpu\" : \"%d\", ",
+ json_out(os, "\"cpu\" : \"%d\"",
id.cpu.cpu);
}
break;
case AGGR_THREAD:
- fprintf(output, "\"thread\" : \"%s-%d\", ",
+ json_out(os, "\"thread\" : \"%s-%d\"",
perf_thread_map__comm(evsel->core.threads, id.thread_idx),
perf_thread_map__pid(evsel->core.threads, id.thread_idx));
break;
@@ -376,29 +411,17 @@ static void print_aggr_id_json(struct perf_stat_config *config,
}
}
-static void aggr_printout(struct perf_stat_config *config,
+static void aggr_printout(struct perf_stat_config *config, struct outstate *os,
struct evsel *evsel, struct aggr_cpu_id id, int aggr_nr)
{
if (config->json_output)
- print_aggr_id_json(config, evsel, id, aggr_nr);
+ print_aggr_id_json(config, os, evsel, id, aggr_nr);
else if (config->csv_output)
print_aggr_id_csv(config, evsel, id, aggr_nr);
else
print_aggr_id_std(config, evsel, id, aggr_nr);
}
-struct outstate {
- FILE *fh;
- bool newline;
- bool first;
- const char *prefix;
- int nfields;
- int aggr_nr;
- struct aggr_cpu_id id;
- struct evsel *evsel;
- struct cgroup *cgrp;
-};
-
static void new_line_std(struct perf_stat_config *config __maybe_unused,
void *ctx)
{
@@ -411,9 +434,9 @@ static inline void __new_line_std_csv(struct perf_stat_config *config,
struct outstate *os)
{
fputc('\n', os->fh);
- if (os->prefix)
- fputs(os->prefix, os->fh);
- aggr_printout(config, os->evsel, os->id, os->aggr_nr);
+ if (config->interval)
+ fputs(os->timestamp, os->fh);
+ aggr_printout(config, os, os->evsel, os->id, os->aggr_nr);
}
static inline void __new_line_std(struct outstate *os)
@@ -464,7 +487,7 @@ static void new_line_csv(struct perf_stat_config *config, void *ctx)
int i;
__new_line_std_csv(config, os);
- for (i = 0; i < os->nfields; i++)
+ for (i = 0; i < os->csv_col_pad; i++)
fputs(config->csv_sep, os->fh);
}
@@ -499,9 +522,9 @@ static void print_metric_json(struct perf_stat_config *config __maybe_unused,
FILE *out = os->fh;
if (unit) {
- fprintf(out, "\"metric-value\" : \"%f\", \"metric-unit\" : \"%s\"", val, unit);
+ json_out(os, "\"metric-value\" : \"%f\", \"metric-unit\" : \"%s\"", val, unit);
if (thresh != METRIC_THRESHOLD_UNKNOWN) {
- fprintf(out, ", \"metric-threshold\" : \"%s\"",
+ json_out(os, "\"metric-threshold\" : \"%s\"",
metric_threshold_classify__str(thresh));
}
}
@@ -514,9 +537,11 @@ static void new_line_json(struct perf_stat_config *config, void *ctx)
struct outstate *os = ctx;
fputs("\n{", os->fh);
- if (os->prefix)
- fprintf(os->fh, "%s", os->prefix);
- aggr_printout(config, os->evsel, os->id, os->aggr_nr);
+ os->first = true;
+ if (config->interval)
+ json_out(os, "%s", os->timestamp);
+
+ aggr_printout(config, os, os->evsel, os->id, os->aggr_nr);
}
static void print_metricgroup_header_json(struct perf_stat_config *config,
@@ -526,7 +551,7 @@ static void print_metricgroup_header_json(struct perf_stat_config *config,
if (!metricgroup_name)
return;
- fprintf(config->output, "\"metricgroup\" : \"%s\"}", metricgroup_name);
+ json_out((struct outstate *) ctx, "\"metricgroup\" : \"%s\"}", metricgroup_name);
new_line_json(config, ctx);
}
@@ -539,12 +564,12 @@ static void print_metricgroup_header_csv(struct perf_stat_config *config,
if (!metricgroup_name) {
/* Leave space for running and enabling */
- for (i = 0; i < os->nfields - 2; i++)
+ for (i = 0; i < os->csv_col_pad - 2; i++)
fputs(config->csv_sep, os->fh);
return;
}
- for (i = 0; i < os->nfields; i++)
+ for (i = 0; i < os->csv_col_pad; i++)
fputs(config->csv_sep, os->fh);
fprintf(config->output, "%s", metricgroup_name);
new_line_csv(config, ctx);
@@ -644,7 +669,6 @@ static void print_metric_only_json(struct perf_stat_config *config __maybe_unuse
const char *unit, double val)
{
struct outstate *os = ctx;
- FILE *out = os->fh;
char buf[64], *ends;
char tbuf[1024];
const char *vals;
@@ -661,13 +685,7 @@ static void print_metric_only_json(struct perf_stat_config *config __maybe_unuse
*ends = 0;
if (!vals[0])
vals = "none";
- fprintf(out, "%s\"%s\" : \"%s\"", os->first ? "" : ", ", unit, vals);
- os->first = false;
-}
-
-static void new_line_metric(struct perf_stat_config *config __maybe_unused,
- void *ctx __maybe_unused)
-{
+ json_out(os, "\"%s\" : \"%s\"", unit, vals);
}
static void print_metric_header(struct perf_stat_config *config,
@@ -743,28 +761,27 @@ static void print_counter_value_csv(struct perf_stat_config *config,
fprintf(output, "%s", evsel__name(evsel));
}
-static void print_counter_value_json(struct perf_stat_config *config,
+static void print_counter_value_json(struct outstate *os,
struct evsel *evsel, double avg, bool ok)
{
- FILE *output = config->output;
const char *bad_count = evsel->supported ? CNTR_NOT_COUNTED : CNTR_NOT_SUPPORTED;
if (ok)
- fprintf(output, "\"counter-value\" : \"%f\", ", avg);
+ json_out(os, "\"counter-value\" : \"%f\"", avg);
else
- fprintf(output, "\"counter-value\" : \"%s\", ", bad_count);
+ json_out(os, "\"counter-value\" : \"%s\"", bad_count);
if (evsel->unit)
- fprintf(output, "\"unit\" : \"%s\", ", evsel->unit);
+ json_out(os, "\"unit\" : \"%s\"", evsel->unit);
- fprintf(output, "\"event\" : \"%s\", ", evsel__name(evsel));
+ json_out(os, "\"event\" : \"%s\"", evsel__name(evsel));
}
-static void print_counter_value(struct perf_stat_config *config,
+static void print_counter_value(struct perf_stat_config *config, struct outstate *os,
struct evsel *evsel, double avg, bool ok)
{
if (config->json_output)
- print_counter_value_json(config, evsel, avg, ok);
+ print_counter_value_json(os, evsel, avg, ok);
else if (config->csv_output)
print_counter_value_csv(config, evsel, avg, ok);
else
@@ -772,12 +789,13 @@ static void print_counter_value(struct perf_stat_config *config,
}
static void abs_printout(struct perf_stat_config *config,
+ struct outstate *os,
struct aggr_cpu_id id, int aggr_nr,
struct evsel *evsel, double avg, bool ok)
{
- aggr_printout(config, evsel, id, aggr_nr);
- print_counter_value(config, evsel, avg, ok);
- print_cgroup(config, evsel->cgrp);
+ aggr_printout(config, os, evsel, id, aggr_nr);
+ print_counter_value(config, os, evsel, avg, ok);
+ print_cgroup(config, os, evsel->cgrp);
}
static bool is_mixed_hw_group(struct evsel *counter)
@@ -831,22 +849,23 @@ static void printout(struct perf_stat_config *config, struct outstate *os,
if (config->csv_output) {
pm = config->metric_only ? print_metric_only_csv : print_metric_csv;
- nl = config->metric_only ? new_line_metric : new_line_csv;
+ nl = config->metric_only ? NULL : new_line_csv;
pmh = print_metricgroup_header_csv;
- os->nfields = 4 + (counter->cgrp ? 1 : 0);
+ os->csv_col_pad = 4 + (counter->cgrp ? 1 : 0);
} else if (config->json_output) {
pm = config->metric_only ? print_metric_only_json : print_metric_json;
- nl = config->metric_only ? new_line_metric : new_line_json;
+ nl = config->metric_only ? NULL : new_line_json;
pmh = print_metricgroup_header_json;
} else {
pm = config->metric_only ? print_metric_only : print_metric_std;
- nl = config->metric_only ? new_line_metric : new_line_std;
+ nl = config->metric_only ? NULL : new_line_std;
pmh = print_metricgroup_header_std;
}
if (run == 0 || ena == 0 || counter->counts->scaled == -1) {
if (config->metric_only) {
- pm(config, os, METRIC_THRESHOLD_UNKNOWN, "", "", 0);
+ pm(config, os, METRIC_THRESHOLD_UNKNOWN, /*format=*/NULL,
+ /*unit=*/NULL, /*val=*/0);
return;
}
@@ -868,17 +887,17 @@ static void printout(struct perf_stat_config *config, struct outstate *os,
out.force_header = false;
if (!config->metric_only && !counter->default_metricgroup) {
- abs_printout(config, os->id, os->aggr_nr, counter, uval, ok);
+ abs_printout(config, os, os->id, os->aggr_nr, counter, uval, ok);
- print_noise(config, counter, noise, /*before_metric=*/true);
- print_running(config, run, ena, /*before_metric=*/true);
+ print_noise(config, os, counter, noise, /*before_metric=*/true);
+ print_running(config, os, run, ena, /*before_metric=*/true);
}
if (ok) {
if (!config->metric_only && counter->default_metricgroup) {
void *from = NULL;
- aggr_printout(config, os->evsel, os->id, os->aggr_nr);
+ aggr_printout(config, os, os->evsel, os->id, os->aggr_nr);
/* Print out all the metricgroup with the same metric event. */
do {
int num = 0;
@@ -891,8 +910,8 @@ static void printout(struct perf_stat_config *config, struct outstate *os,
__new_line_std_csv(config, os);
}
- print_noise(config, counter, noise, /*before_metric=*/true);
- print_running(config, run, ena, /*before_metric=*/true);
+ print_noise(config, os, counter, noise, /*before_metric=*/true);
+ print_running(config, os, run, ena, /*before_metric=*/true);
from = perf_stat__print_shadow_stats_metricgroup(config, counter, aggr_idx,
&num, from, &out,
&config->metric_events);
@@ -901,12 +920,12 @@ static void printout(struct perf_stat_config *config, struct outstate *os,
perf_stat__print_shadow_stats(config, counter, uval, aggr_idx,
&out, &config->metric_events);
} else {
- pm(config, os, METRIC_THRESHOLD_UNKNOWN, /*format=*/NULL, /*unit=*/"", /*val=*/0);
+ pm(config, os, METRIC_THRESHOLD_UNKNOWN, /*format=*/NULL, /*unit=*/NULL, /*val=*/0);
}
if (!config->metric_only) {
- print_noise(config, counter, noise, /*before_metric=*/false);
- print_running(config, run, ena, /*before_metric=*/false);
+ print_noise(config, os, counter, noise, /*before_metric=*/false);
+ print_running(config, os, run, ena, /*before_metric=*/false);
}
}
@@ -1083,12 +1102,17 @@ static void print_counter_aggrdata(struct perf_stat_config *config,
return;
if (!metric_only) {
- if (config->json_output)
+ if (config->json_output) {
+ os->first = true;
fputc('{', output);
- if (os->prefix)
- fprintf(output, "%s", os->prefix);
- else if (config->summary && config->csv_output &&
- !config->no_csv_summary && !config->interval)
+ }
+ if (config->interval) {
+ if (config->json_output)
+ json_out(os, "%s", os->timestamp);
+ else
+ fprintf(output, "%s", os->timestamp);
+ } else if (config->summary && config->csv_output &&
+ !config->no_csv_summary)
fprintf(output, "%s%s", "summary", config->csv_sep);
}
@@ -1114,15 +1138,19 @@ static void print_metric_begin(struct perf_stat_config *config,
if (config->json_output)
fputc('{', config->output);
- if (os->prefix)
- fprintf(config->output, "%s", os->prefix);
+ if (config->interval) {
+ if (config->json_output)
+ json_out(os, "%s", os->timestamp);
+ else
+ fprintf(config->output, "%s", os->timestamp);
+ }
evsel = evlist__first(evlist);
id = config->aggr_map->map[aggr_idx];
aggr = &evsel->stats->aggr[aggr_idx];
- aggr_printout(config, evsel, id, aggr->nr);
+ aggr_printout(config, os, evsel, id, aggr->nr);
- print_cgroup(config, os->cgrp ? : evsel->cgrp);
+ print_cgroup(config, os, os->cgrp ? : evsel->cgrp);
}
static void print_metric_end(struct perf_stat_config *config, struct outstate *os)
@@ -1301,7 +1329,7 @@ static void print_metric_headers(struct perf_stat_config *config,
struct perf_stat_output_ctx out = {
.ctx = &os,
.print_metric = print_metric_header,
- .new_line = new_line_metric,
+ .new_line = NULL,
.force_header = true,
};
@@ -1336,20 +1364,20 @@ static void print_metric_headers(struct perf_stat_config *config,
fputc('\n', config->output);
}
-static void prepare_interval(struct perf_stat_config *config,
- char *prefix, size_t len, struct timespec *ts)
+static void prepare_timestamp(struct perf_stat_config *config,
+ struct outstate *os, struct timespec *ts)
{
if (config->iostat_run)
return;
if (config->json_output)
- scnprintf(prefix, len, "\"interval\" : %lu.%09lu, ",
+ scnprintf(os->timestamp, sizeof(os->timestamp), "\"interval\" : %lu.%09lu",
(unsigned long) ts->tv_sec, ts->tv_nsec);
else if (config->csv_output)
- scnprintf(prefix, len, "%lu.%09lu%s",
+ scnprintf(os->timestamp, sizeof(os->timestamp), "%lu.%09lu%s",
(unsigned long) ts->tv_sec, ts->tv_nsec, config->csv_sep);
else
- scnprintf(prefix, len, "%6lu.%09lu ",
+ scnprintf(os->timestamp, sizeof(os->timestamp), "%6lu.%09lu ",
(unsigned long) ts->tv_sec, ts->tv_nsec);
}
@@ -1557,7 +1585,7 @@ static void print_footer(struct perf_stat_config *config)
fprintf(output, " %17.*f +- %.*f seconds time elapsed",
precision, avg, precision, sd);
- print_noise_pct(config, sd, avg, /*before_metric=*/false);
+ print_noise_pct(config, NULL, sd, avg, /*before_metric=*/false);
}
fprintf(output, "\n\n");
@@ -1672,9 +1700,7 @@ void evlist__print_counters(struct evlist *evlist, struct perf_stat_config *conf
int argc, const char **argv)
{
bool metric_only = config->metric_only;
- int interval = config->interval;
struct evsel *counter;
- char buf[64];
struct outstate os = {
.fh = config->output,
.first = true,
@@ -1685,10 +1711,8 @@ void evlist__print_counters(struct evlist *evlist, struct perf_stat_config *conf
if (config->iostat_run)
evlist->selected = evlist__first(evlist);
- if (interval) {
- os.prefix = buf;
- prepare_interval(config, buf, sizeof(buf), ts);
- }
+ if (config->interval)
+ prepare_timestamp(config, &os, ts);
print_header(config, _target, evlist, argc, argv);
@@ -1707,7 +1731,7 @@ void evlist__print_counters(struct evlist *evlist, struct perf_stat_config *conf
case AGGR_THREAD:
case AGGR_GLOBAL:
if (config->iostat_run) {
- iostat_print_counters(evlist, config, ts, buf,
+ iostat_print_counters(evlist, config, ts, os.timestamp,
(iostat_print_counter_t)print_counter, &os);
} else if (config->cgroup_list) {
print_cgroup_counter(config, evlist, &os);
diff --git a/tools/perf/util/stat-shadow.c b/tools/perf/util/stat-shadow.c
index 47718610d5d8..fa8b2a1048ff 100644
--- a/tools/perf/util/stat-shadow.c
+++ b/tools/perf/util/stat-shadow.c
@@ -327,7 +327,8 @@ static void print_instructions(struct perf_stat_config *config,
"insn per cycle", 0);
}
if (max_stalled && instructions) {
- out->new_line(config, ctxp);
+ if (out->new_line)
+ out->new_line(config, ctxp);
print_metric(config, ctxp, METRIC_THRESHOLD_UNKNOWN, "%7.2f ",
"stalled cycles per insn", max_stalled / instructions);
}
@@ -670,7 +671,7 @@ void *perf_stat__print_shadow_stats_metricgroup(struct perf_stat_config *config,
}
}
- if ((*num)++ > 0)
+ if ((*num)++ > 0 && out->new_line)
out->new_line(config, ctxp);
generic_metric(config, mexp, evsel, aggr_idx, out);
}
diff --git a/tools/perf/util/stat.h b/tools/perf/util/stat.h
index 6f8cff3cd39a..2fda9acd7374 100644
--- a/tools/perf/util/stat.h
+++ b/tools/perf/util/stat.h
@@ -117,8 +117,9 @@ struct perf_stat_config {
unsigned int topdown_level;
};
+extern struct perf_stat_config stat_config;
+
void perf_stat__set_big_num(int set);
-void perf_stat__set_no_csv_summary(int set);
void update_stats(struct stats *stats, u64 val);
double avg_stats(struct stats *stats);
diff --git a/tools/perf/util/stream.c b/tools/perf/util/stream.c
index 545e44981a27..3de4a6130853 100644
--- a/tools/perf/util/stream.c
+++ b/tools/perf/util/stream.c
@@ -52,7 +52,6 @@ static struct evlist_streams *evlist_streams__new(int nr_evsel,
goto err;
s->nr_streams_max = nr_streams_max;
- s->evsel_idx = -1;
}
els->ev_streams = es;
@@ -139,7 +138,7 @@ static int evlist__init_callchain_streams(struct evlist *evlist,
hists__output_resort(hists, NULL);
init_hot_callchain(hists, &es[i]);
- es[i].evsel_idx = pos->core.idx;
+ es[i].evsel = pos;
i++;
}
@@ -166,12 +165,12 @@ struct evlist_streams *evlist__create_streams(struct evlist *evlist,
}
struct evsel_streams *evsel_streams__entry(struct evlist_streams *els,
- int evsel_idx)
+ const struct evsel *evsel)
{
struct evsel_streams *es = els->ev_streams;
for (int i = 0; i < els->nr_evsel; i++) {
- if (es[i].evsel_idx == evsel_idx)
+ if (es[i].evsel == evsel)
return &es[i];
}
diff --git a/tools/perf/util/stream.h b/tools/perf/util/stream.h
index bee768874fea..50f7e6e04982 100644
--- a/tools/perf/util/stream.h
+++ b/tools/perf/util/stream.h
@@ -2,7 +2,9 @@
#ifndef __PERF_STREAM_H
#define __PERF_STREAM_H
-#include "callchain.h"
+struct callchain_node;
+struct evlist;
+struct evsel;
struct stream {
struct callchain_node *cnode;
@@ -11,9 +13,9 @@ struct stream {
struct evsel_streams {
struct stream *streams;
+ const struct evsel *evsel;
int nr_streams_max;
int nr_streams;
- int evsel_idx;
u64 streams_hits;
};
@@ -22,15 +24,13 @@ struct evlist_streams {
int nr_evsel;
};
-struct evlist;
-
void evlist_streams__delete(struct evlist_streams *els);
struct evlist_streams *evlist__create_streams(struct evlist *evlist,
int nr_streams_max);
struct evsel_streams *evsel_streams__entry(struct evlist_streams *els,
- int evsel_idx);
+ const struct evsel *evsel);
void evsel_streams__match(struct evsel_streams *es_base,
struct evsel_streams *es_pair);
diff --git a/tools/perf/util/string.c b/tools/perf/util/string.c
index 308fc7ec88cc..c0e927bbadf6 100644
--- a/tools/perf/util/string.c
+++ b/tools/perf/util/string.c
@@ -254,11 +254,20 @@ char *strpbrk_esc(char *str, const char *stopset)
do {
ptr = strpbrk(str, stopset);
- if (ptr == str ||
- (ptr == str + 1 && *(ptr - 1) != '\\'))
+ if (!ptr) {
+ /* stopset not in str. */
break;
+ }
+ if (ptr == str) {
+ /* stopset character is first in str. */
+ break;
+ }
+ if (ptr == str + 1 && str[0] != '\\') {
+ /* stopset chacter is second and wasn't preceded by a '\'. */
+ break;
+ }
str = ptr + 1;
- } while (ptr && *(ptr - 1) == '\\' && *(ptr - 2) != '\\');
+ } while (ptr[-1] == '\\' && ptr[-2] != '\\');
return ptr;
}
diff --git a/tools/perf/util/svghelper.c b/tools/perf/util/svghelper.c
index 2b04f47f4db0..b1d259f590e9 100644
--- a/tools/perf/util/svghelper.c
+++ b/tools/perf/util/svghelper.c
@@ -21,6 +21,7 @@
#include <perf/cpumap.h>
#include "env.h"
+#include "perf.h"
#include "svghelper.h"
static u64 first_time, last_time;
diff --git a/tools/perf/util/symbol-elf.c b/tools/perf/util/symbol-elf.c
index e398abfd13a0..66fd1249660a 100644
--- a/tools/perf/util/symbol-elf.c
+++ b/tools/perf/util/symbol-elf.c
@@ -287,8 +287,9 @@ static bool want_demangle(bool is_kernel_sym)
* Demangle C++ function signature, typically replaced by demangle-cxx.cpp
* version.
*/
-__weak char *cxx_demangle_sym(const char *str __maybe_unused, bool params __maybe_unused,
- bool modifiers __maybe_unused)
+#ifndef HAVE_CXA_DEMANGLE_SUPPORT
+char *cxx_demangle_sym(const char *str __maybe_unused, bool params __maybe_unused,
+ bool modifiers __maybe_unused)
{
#ifdef HAVE_LIBBFD_SUPPORT
int flags = (params ? DMGL_PARAMS : 0) | (modifiers ? DMGL_ANSI : 0);
@@ -302,6 +303,7 @@ __weak char *cxx_demangle_sym(const char *str __maybe_unused, bool params __mayb
return NULL;
#endif
}
+#endif /* !HAVE_CXA_DEMANGLE_SUPPORT */
static char *demangle_sym(struct dso *dso, int kmodule, const char *elf_name)
{
diff --git a/tools/perf/util/symbol.c b/tools/perf/util/symbol.c
index 0037f1163919..49b08adc6ee3 100644
--- a/tools/perf/util/symbol.c
+++ b/tools/perf/util/symbol.c
@@ -154,6 +154,13 @@ static int choose_best_symbol(struct symbol *syma, struct symbol *symb)
else if ((a == 0) && (b > 0))
return SYMBOL_B;
+ if (syma->type != symb->type) {
+ if (syma->type == STT_NOTYPE)
+ return SYMBOL_B;
+ if (symb->type == STT_NOTYPE)
+ return SYMBOL_A;
+ }
+
/* Prefer a non weak symbol over a weak one */
a = syma->binding == STB_WEAK;
b = symb->binding == STB_WEAK;
@@ -257,7 +264,7 @@ void symbols__fixup_end(struct rb_root_cached *symbols, bool is_kallsyms)
* like in:
* ffffffffc1937000 T hdmi_driver_init [snd_hda_codec_hdmi]
*/
- if (prev->end == prev->start && prev->type != STT_NOTYPE) {
+ if (prev->end == prev->start) {
const char *prev_mod;
const char *curr_mod;
diff --git a/tools/perf/util/synthetic-events.c b/tools/perf/util/synthetic-events.c
index a58444c4aed1..6923b0d5efed 100644
--- a/tools/perf/util/synthetic-events.c
+++ b/tools/perf/util/synthetic-events.c
@@ -1686,12 +1686,16 @@ int perf_event__synthesize_sample(union perf_event *event, u64 type, u64 read_fo
}
if (type & PERF_SAMPLE_RAW) {
- u.val32[0] = sample->raw_size;
- *array = u.val64;
- array = (void *)array + sizeof(u32);
+ u32 *array32 = (void *)array;
+
+ *array32 = sample->raw_size;
+ array32++;
+
+ memcpy(array32, sample->raw_data, sample->raw_size);
+ array = (void *)(array32 + (sample->raw_size / sizeof(u32)));
- memcpy(array, sample->raw_data, sample->raw_size);
- array = (void *)array + sample->raw_size;
+ /* make sure the array is 64-bit aligned */
+ BUG_ON(((long)array) % sizeof(u64));
}
if (type & PERF_SAMPLE_BRANCH_STACK) {
diff --git a/tools/perf/util/syscalltbl.c b/tools/perf/util/syscalltbl.c
index 69d8dcf5cf28..928aca4cd6e9 100644
--- a/tools/perf/util/syscalltbl.c
+++ b/tools/perf/util/syscalltbl.c
@@ -10,52 +10,12 @@
#include <linux/compiler.h>
#include <linux/zalloc.h>
-#ifdef HAVE_SYSCALL_TABLE_SUPPORT
#include <string.h>
#include "string2.h"
-#if defined(__x86_64__)
-#include <asm/syscalls_64.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_x86_64_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_x86_64;
-#elif defined(__i386__)
-#include <asm/syscalls_32.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_x86_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_x86;
-#elif defined(__s390x__)
-#include <asm/syscalls_64.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_S390_64_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_s390_64;
-#elif defined(__powerpc64__)
-#include <asm/syscalls_64.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_POWERPC_64_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_powerpc_64;
-#elif defined(__powerpc__)
-#include <asm/syscalls_32.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_POWERPC_32_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_powerpc_32;
-#elif defined(__aarch64__)
-#include <asm/syscalls.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_ARM64_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_arm64;
-#elif defined(__mips__)
-#include <asm/syscalls_n64.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_MIPS_N64_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_mips_n64;
-#elif defined(__loongarch__)
-#include <asm/syscalls.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_LOONGARCH_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_loongarch;
-#elif defined(__riscv)
-#include <asm/syscalls.c>
-const int syscalltbl_native_max_id = SYSCALLTBL_RISCV_MAX_ID;
-static const char *const *syscalltbl_native = syscalltbl_riscv;
-#else
-const int syscalltbl_native_max_id = 0;
-static const char *const syscalltbl_native[] = {
- [0] = "unknown",
-};
-#endif
+#include <syscall_table.h>
+const int syscalltbl_native_max_id = SYSCALLTBL_MAX_ID;
+static const char *const *syscalltbl_native = syscalltbl;
struct syscall {
int id;
@@ -163,47 +123,3 @@ int syscalltbl__strglobmatch_first(struct syscalltbl *tbl, const char *syscall_g
*idx = -1;
return syscalltbl__strglobmatch_next(tbl, syscall_glob, idx);
}
-
-#else /* HAVE_SYSCALL_TABLE_SUPPORT */
-
-#include <libaudit.h>
-
-struct syscalltbl *syscalltbl__new(void)
-{
- struct syscalltbl *tbl = zalloc(sizeof(*tbl));
- if (tbl)
- tbl->audit_machine = audit_detect_machine();
- return tbl;
-}
-
-void syscalltbl__delete(struct syscalltbl *tbl)
-{
- free(tbl);
-}
-
-const char *syscalltbl__name(const struct syscalltbl *tbl, int id)
-{
- return audit_syscall_to_name(id, tbl->audit_machine);
-}
-
-int syscalltbl__id(struct syscalltbl *tbl, const char *name)
-{
- return audit_name_to_syscall(name, tbl->audit_machine);
-}
-
-int syscalltbl__id_at_idx(struct syscalltbl *tbl __maybe_unused, int idx)
-{
- return idx;
-}
-
-int syscalltbl__strglobmatch_next(struct syscalltbl *tbl __maybe_unused,
- const char *syscall_glob __maybe_unused, int *idx __maybe_unused)
-{
- return -1;
-}
-
-int syscalltbl__strglobmatch_first(struct syscalltbl *tbl, const char *syscall_glob, int *idx)
-{
- return syscalltbl__strglobmatch_next(tbl, syscall_glob, idx);
-}
-#endif /* HAVE_SYSCALL_TABLE_SUPPORT */
diff --git a/tools/perf/util/syscalltbl.h b/tools/perf/util/syscalltbl.h
index 2b53b7ed25a6..362411a6d849 100644
--- a/tools/perf/util/syscalltbl.h
+++ b/tools/perf/util/syscalltbl.h
@@ -3,7 +3,6 @@
#define __PERF_SYSCALLTBL_H
struct syscalltbl {
- int audit_machine;
struct {
int max_id;
int nr_entries;
diff --git a/tools/perf/util/trace-event-parse.c b/tools/perf/util/trace-event-parse.c
index 41d53e1b43e7..9c015fc2bcfb 100644
--- a/tools/perf/util/trace-event-parse.c
+++ b/tools/perf/util/trace-event-parse.c
@@ -99,7 +99,7 @@ unsigned long long read_size(struct tep_event *event, void *ptr, int size)
return tep_read_number(event->tep, ptr, size);
}
-void event_format__fprintf(struct tep_event *event,
+void event_format__fprintf(const struct tep_event *event,
int cpu, void *data, int size, FILE *fp)
{
struct tep_record record;
diff --git a/tools/perf/util/trace-event-scripting.c b/tools/perf/util/trace-event-scripting.c
index 5596fcda2c10..4e81e02a4f18 100644
--- a/tools/perf/util/trace-event-scripting.c
+++ b/tools/perf/util/trace-event-scripting.c
@@ -13,14 +13,94 @@
#include <event-parse.h>
#endif
+#include "archinsn.h"
#include "debug.h"
+#include "event.h"
#include "trace-event.h"
#include "evsel.h"
+#include <linux/perf_event.h>
#include <linux/zalloc.h>
#include "util/sample.h"
+unsigned int scripting_max_stack = PERF_MAX_STACK_DEPTH;
+
struct scripting_context *scripting_context;
+struct script_spec {
+ struct list_head node;
+ struct scripting_ops *ops;
+ char spec[];
+};
+
+static LIST_HEAD(script_specs);
+
+static struct script_spec *script_spec__new(const char *spec,
+ struct scripting_ops *ops)
+{
+ struct script_spec *s = malloc(sizeof(*s) + strlen(spec) + 1);
+
+ if (s != NULL) {
+ strcpy(s->spec, spec);
+ s->ops = ops;
+ }
+
+ return s;
+}
+
+static void script_spec__add(struct script_spec *s)
+{
+ list_add_tail(&s->node, &script_specs);
+}
+
+static struct script_spec *script_spec__find(const char *spec)
+{
+ struct script_spec *s;
+
+ list_for_each_entry(s, &script_specs, node)
+ if (strcasecmp(s->spec, spec) == 0)
+ return s;
+ return NULL;
+}
+
+static int script_spec_register(const char *spec, struct scripting_ops *ops)
+{
+ struct script_spec *s;
+
+ s = script_spec__find(spec);
+ if (s)
+ return -1;
+
+ s = script_spec__new(spec, ops);
+ if (!s)
+ return -1;
+
+ script_spec__add(s);
+ return 0;
+}
+
+struct scripting_ops *script_spec__lookup(const char *spec)
+{
+ struct script_spec *s = script_spec__find(spec);
+
+ if (!s)
+ return NULL;
+
+ return s->ops;
+}
+
+int script_spec__for_each(int (*cb)(struct scripting_ops *ops, const char *spec))
+{
+ struct script_spec *s;
+ int ret = 0;
+
+ list_for_each_entry(s, &script_specs, node) {
+ ret = cb(s->ops, s->spec);
+ if (ret)
+ break;
+ }
+ return ret;
+}
+
void scripting_context__update(struct scripting_context *c,
union perf_event *event,
struct perf_sample *sample,
@@ -28,12 +108,14 @@ void scripting_context__update(struct scripting_context *c,
struct addr_location *al,
struct addr_location *addr_al)
{
- c->event_data = sample->raw_data;
- c->pevent = NULL;
#ifdef HAVE_LIBTRACEEVENT
- if (evsel->tp_format)
- c->pevent = evsel->tp_format->tep;
+ const struct tep_event *tp_format = evsel__tp_format(evsel);
+
+ c->pevent = tp_format ? tp_format->tep : NULL;
+#else
+ c->pevent = NULL;
#endif
+ c->event_data = sample->raw_data;
c->event = event;
c->sample = sample;
c->evsel = evsel;
@@ -191,3 +273,100 @@ void setup_perl_scripting(void)
}
#endif
#endif
+
+#if !defined(__i386__) && !defined(__x86_64__)
+void arch_fetch_insn(struct perf_sample *sample __maybe_unused,
+ struct thread *thread __maybe_unused,
+ struct machine *machine __maybe_unused)
+{
+}
+#endif
+
+void script_fetch_insn(struct perf_sample *sample, struct thread *thread,
+ struct machine *machine, bool native_arch)
+{
+ if (sample->insn_len == 0 && native_arch)
+ arch_fetch_insn(sample, thread, machine);
+}
+
+static const struct {
+ u32 flags;
+ const char *name;
+} sample_flags[] = {
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL, "call"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN, "return"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CONDITIONAL, "jcc"},
+ {PERF_IP_FLAG_BRANCH, "jmp"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_INTERRUPT, "int"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN | PERF_IP_FLAG_INTERRUPT, "iret"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_SYSCALLRET, "syscall"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_RETURN | PERF_IP_FLAG_SYSCALLRET, "sysret"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_ASYNC, "async"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_ASYNC | PERF_IP_FLAG_INTERRUPT,
+ "hw int"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TX_ABORT, "tx abrt"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TRACE_BEGIN, "tr strt"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_TRACE_END, "tr end"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_VMENTRY, "vmentry"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_CALL | PERF_IP_FLAG_VMEXIT, "vmexit"},
+ {PERF_IP_FLAG_BRANCH | PERF_IP_FLAG_BRANCH_MISS, "br miss"},
+ {0, NULL}
+};
+
+static const char *sample_flags_to_name(u32 flags)
+{
+ int i;
+
+ for (i = 0; sample_flags[i].name ; i++) {
+ if (sample_flags[i].flags == flags)
+ return sample_flags[i].name;
+ }
+
+ return NULL;
+}
+
+int perf_sample__sprintf_flags(u32 flags, char *str, size_t sz)
+{
+ u32 xf = PERF_IP_FLAG_IN_TX | PERF_IP_FLAG_INTR_DISABLE |
+ PERF_IP_FLAG_INTR_TOGGLE;
+ const char *chars = PERF_IP_FLAG_CHARS;
+ const size_t n = strlen(PERF_IP_FLAG_CHARS);
+ const char *name = NULL;
+ size_t i, pos = 0;
+ char xs[16] = {0};
+
+ if (flags & xf)
+ snprintf(xs, sizeof(xs), "(%s%s%s)",
+ flags & PERF_IP_FLAG_IN_TX ? "x" : "",
+ flags & PERF_IP_FLAG_INTR_DISABLE ? "D" : "",
+ flags & PERF_IP_FLAG_INTR_TOGGLE ? "t" : "");
+
+ name = sample_flags_to_name(flags & ~xf);
+ if (name)
+ return snprintf(str, sz, "%-15s%6s", name, xs);
+
+ if (flags & PERF_IP_FLAG_TRACE_BEGIN) {
+ name = sample_flags_to_name(flags & ~(xf | PERF_IP_FLAG_TRACE_BEGIN));
+ if (name)
+ return snprintf(str, sz, "tr strt %-7s%6s", name, xs);
+ }
+
+ if (flags & PERF_IP_FLAG_TRACE_END) {
+ name = sample_flags_to_name(flags & ~(xf | PERF_IP_FLAG_TRACE_END));
+ if (name)
+ return snprintf(str, sz, "tr end %-7s%6s", name, xs);
+ }
+
+ for (i = 0; i < n; i++, flags >>= 1) {
+ if ((flags & 1) && pos < sz)
+ str[pos++] = chars[i];
+ }
+ for (; i < 32; i++, flags >>= 1) {
+ if ((flags & 1) && pos < sz)
+ str[pos++] = '?';
+ }
+ if (pos < sz)
+ str[pos] = 0;
+
+ return pos;
+}
diff --git a/tools/perf/util/trace-event.h b/tools/perf/util/trace-event.h
index 79b939f947dd..ac9fde2f980c 100644
--- a/tools/perf/util/trace-event.h
+++ b/tools/perf/util/trace-event.h
@@ -39,7 +39,7 @@ trace_event__tp_format(const char *sys, const char *name);
struct tep_event *trace_event__tp_format_id(int id);
-void event_format__fprintf(struct tep_event *event,
+void event_format__fprintf(const struct tep_event *event,
int cpu, void *data, int size, FILE *fp);
int parse_ftrace_file(struct tep_handle *pevent, char *buf, unsigned long size);
@@ -113,10 +113,11 @@ struct scripting_ops {
extern unsigned int scripting_max_stack;
-int script_spec_register(const char *spec, struct scripting_ops *ops);
+struct scripting_ops *script_spec__lookup(const char *spec);
+int script_spec__for_each(int (*cb)(struct scripting_ops *ops, const char *spec));
void script_fetch_insn(struct perf_sample *sample, struct thread *thread,
- struct machine *machine);
+ struct machine *machine, bool native_arch);
void setup_perl_scripting(void);
void setup_python_scripting(void);
diff --git a/tools/perf/util/values.c b/tools/perf/util/values.c
index b9823f414f10..ec72d29f3d58 100644
--- a/tools/perf/util/values.c
+++ b/tools/perf/util/values.c
@@ -8,6 +8,7 @@
#include "values.h"
#include "debug.h"
+#include "evsel.h"
int perf_read_values_init(struct perf_read_values *values)
{
@@ -22,21 +23,17 @@ int perf_read_values_init(struct perf_read_values *values)
values->threads = 0;
values->counters_max = 16;
- values->counterrawid = malloc(values->counters_max
- * sizeof(*values->counterrawid));
- values->countername = malloc(values->counters_max
- * sizeof(*values->countername));
- if (!values->counterrawid || !values->countername) {
- pr_debug("failed to allocate read_values counters arrays");
+ values->counters = malloc(values->counters_max * sizeof(*values->counters));
+ if (!values->counters) {
+ pr_debug("failed to allocate read_values counters array");
goto out_free_counter;
}
- values->counters = 0;
+ values->num_counters = 0;
return 0;
out_free_counter:
- zfree(&values->counterrawid);
- zfree(&values->countername);
+ zfree(&values->counters);
out_free_pid:
zfree(&values->pid);
zfree(&values->tid);
@@ -56,10 +53,7 @@ void perf_read_values_destroy(struct perf_read_values *values)
zfree(&values->value);
zfree(&values->pid);
zfree(&values->tid);
- zfree(&values->counterrawid);
- for (i = 0; i < values->counters; i++)
- zfree(&values->countername[i]);
- zfree(&values->countername);
+ zfree(&values->counters);
}
static int perf_read_values__enlarge_threads(struct perf_read_values *values)
@@ -116,81 +110,71 @@ static int perf_read_values__findnew_thread(struct perf_read_values *values,
static int perf_read_values__enlarge_counters(struct perf_read_values *values)
{
- char **countername;
- int i, counters_max = values->counters_max * 2;
- u64 *counterrawid = realloc(values->counterrawid, counters_max * sizeof(*values->counterrawid));
+ int counters_max = values->counters_max * 2;
+ struct evsel **new_counters = realloc(values->counters,
+ counters_max * sizeof(*values->counters));
- if (!counterrawid) {
- pr_debug("failed to enlarge read_values rawid array");
+ if (!new_counters) {
+ pr_debug("failed to enlarge read_values counters array");
goto out_enomem;
}
- countername = realloc(values->countername, counters_max * sizeof(*values->countername));
- if (!countername) {
- pr_debug("failed to enlarge read_values rawid array");
- goto out_free_rawid;
- }
-
- for (i = 0; i < values->threads; i++) {
+ for (int i = 0; i < values->threads; i++) {
u64 *value = realloc(values->value[i], counters_max * sizeof(**values->value));
- int j;
if (!value) {
pr_debug("failed to enlarge read_values ->values array");
- goto out_free_name;
+ goto out_free_counters;
}
- for (j = values->counters_max; j < counters_max; j++)
+ for (int j = values->counters_max; j < counters_max; j++)
value[j] = 0;
values->value[i] = value;
}
values->counters_max = counters_max;
- values->counterrawid = counterrawid;
- values->countername = countername;
+ values->counters = new_counters;
return 0;
-out_free_name:
- free(countername);
-out_free_rawid:
- free(counterrawid);
+out_free_counters:
+ free(new_counters);
out_enomem:
return -ENOMEM;
}
static int perf_read_values__findnew_counter(struct perf_read_values *values,
- u64 rawid, const char *name)
+ struct evsel *evsel)
{
int i;
- for (i = 0; i < values->counters; i++)
- if (values->counterrawid[i] == rawid)
+ for (i = 0; i < values->num_counters; i++)
+ if (values->counters[i] == evsel)
return i;
- if (values->counters == values->counters_max) {
- i = perf_read_values__enlarge_counters(values);
- if (i)
- return i;
+ if (values->num_counters == values->counters_max) {
+ int err = perf_read_values__enlarge_counters(values);
+
+ if (err)
+ return err;
}
- i = values->counters++;
- values->counterrawid[i] = rawid;
- values->countername[i] = strdup(name);
+ i = values->num_counters++;
+ values->counters[i] = evsel;
return i;
}
int perf_read_values_add_value(struct perf_read_values *values,
u32 pid, u32 tid,
- u64 rawid, const char *name, u64 value)
+ struct evsel *evsel, u64 value)
{
int tindex, cindex;
tindex = perf_read_values__findnew_thread(values, pid, tid);
if (tindex < 0)
return tindex;
- cindex = perf_read_values__findnew_counter(values, rawid, name);
+ cindex = perf_read_values__findnew_counter(values, evsel);
if (cindex < 0)
return cindex;
@@ -205,15 +189,15 @@ static void perf_read_values__display_pretty(FILE *fp,
int pidwidth, tidwidth;
int *counterwidth;
- counterwidth = malloc(values->counters * sizeof(*counterwidth));
+ counterwidth = malloc(values->num_counters * sizeof(*counterwidth));
if (!counterwidth) {
fprintf(fp, "INTERNAL ERROR: Failed to allocate counterwidth array\n");
return;
}
tidwidth = 3;
pidwidth = 3;
- for (j = 0; j < values->counters; j++)
- counterwidth[j] = strlen(values->countername[j]);
+ for (j = 0; j < values->num_counters; j++)
+ counterwidth[j] = strlen(evsel__name(values->counters[j]));
for (i = 0; i < values->threads; i++) {
int width;
@@ -223,7 +207,7 @@ static void perf_read_values__display_pretty(FILE *fp,
width = snprintf(NULL, 0, "%d", values->tid[i]);
if (width > tidwidth)
tidwidth = width;
- for (j = 0; j < values->counters; j++) {
+ for (j = 0; j < values->num_counters; j++) {
width = snprintf(NULL, 0, "%" PRIu64, values->value[i][j]);
if (width > counterwidth[j])
counterwidth[j] = width;
@@ -231,14 +215,14 @@ static void perf_read_values__display_pretty(FILE *fp,
}
fprintf(fp, "# %*s %*s", pidwidth, "PID", tidwidth, "TID");
- for (j = 0; j < values->counters; j++)
- fprintf(fp, " %*s", counterwidth[j], values->countername[j]);
+ for (j = 0; j < values->num_counters; j++)
+ fprintf(fp, " %*s", counterwidth[j], evsel__name(values->counters[j]));
fprintf(fp, "\n");
for (i = 0; i < values->threads; i++) {
fprintf(fp, " %*d %*d", pidwidth, values->pid[i],
tidwidth, values->tid[i]);
- for (j = 0; j < values->counters; j++)
+ for (j = 0; j < values->num_counters; j++)
fprintf(fp, " %*" PRIu64,
counterwidth[j], values->value[i][j]);
fprintf(fp, "\n");
@@ -266,16 +250,16 @@ static void perf_read_values__display_raw(FILE *fp,
if (width > tidwidth)
tidwidth = width;
}
- for (j = 0; j < values->counters; j++) {
- width = strlen(values->countername[j]);
+ for (j = 0; j < values->num_counters; j++) {
+ width = strlen(evsel__name(values->counters[j]));
if (width > namewidth)
namewidth = width;
- width = snprintf(NULL, 0, "%" PRIx64, values->counterrawid[j]);
+ width = snprintf(NULL, 0, "%x", values->counters[j]->core.idx);
if (width > rawwidth)
rawwidth = width;
}
for (i = 0; i < values->threads; i++) {
- for (j = 0; j < values->counters; j++) {
+ for (j = 0; j < values->num_counters; j++) {
width = snprintf(NULL, 0, "%" PRIu64, values->value[i][j]);
if (width > countwidth)
countwidth = width;
@@ -287,12 +271,12 @@ static void perf_read_values__display_raw(FILE *fp,
namewidth, "Name", rawwidth, "Raw",
countwidth, "Count");
for (i = 0; i < values->threads; i++)
- for (j = 0; j < values->counters; j++)
- fprintf(fp, " %*d %*d %*s %*" PRIx64 " %*" PRIu64,
+ for (j = 0; j < values->num_counters; j++)
+ fprintf(fp, " %*d %*d %*s %*x %*" PRIu64,
pidwidth, values->pid[i],
tidwidth, values->tid[i],
- namewidth, values->countername[j],
- rawwidth, values->counterrawid[j],
+ namewidth, evsel__name(values->counters[j]),
+ rawwidth, values->counters[j]->core.idx,
countwidth, values->value[i][j]);
}
diff --git a/tools/perf/util/values.h b/tools/perf/util/values.h
index 791c1ad606c2..bbca33daca19 100644
--- a/tools/perf/util/values.h
+++ b/tools/perf/util/values.h
@@ -5,14 +5,15 @@
#include <stdio.h>
#include <linux/types.h>
+struct evsel;
+
struct perf_read_values {
int threads;
int threads_max;
u32 *pid, *tid;
- int counters;
+ int num_counters;
int counters_max;
- u64 *counterrawid;
- char **countername;
+ struct evsel **counters;
u64 **value;
};
@@ -21,7 +22,7 @@ void perf_read_values_destroy(struct perf_read_values *values);
int perf_read_values_add_value(struct perf_read_values *values,
u32 pid, u32 tid,
- u64 rawid, const char *name, u64 value);
+ struct evsel *evsel, u64 value);
void perf_read_values_display(FILE *fp, struct perf_read_values *values,
int raw);
diff --git a/tools/power/cpupower/Makefile b/tools/power/cpupower/Makefile
index 175004ce44b2..51a95239fe06 100644
--- a/tools/power/cpupower/Makefile
+++ b/tools/power/cpupower/Makefile
@@ -87,11 +87,19 @@ INSTALL_SCRIPT = ${INSTALL} -m 644
# to something more interesting, like "arm-linux-". If you want
# to compile vs uClibc, that can be done here as well.
CROSS ?= #/usr/i386-linux-uclibc/usr/bin/i386-uclibc-
+ifneq ($(CROSS), )
+CC = $(CROSS)gcc
+LD = $(CROSS)gcc
+AR = $(CROSS)ar
+STRIP = $(CROSS)strip
+RANLIB = $(CROSS)ranlib
+else
CC ?= $(CROSS)gcc
LD ?= $(CROSS)gcc
AR ?= $(CROSS)ar
STRIP ?= $(CROSS)strip
RANLIB ?= $(CROSS)ranlib
+endif
HOSTCC = gcc
MKDIR = mkdir
diff --git a/tools/power/cpupower/bindings/python/Makefile b/tools/power/cpupower/bindings/python/Makefile
index e1ebb1d60cd4..741f21477432 100644
--- a/tools/power/cpupower/bindings/python/Makefile
+++ b/tools/power/cpupower/bindings/python/Makefile
@@ -11,6 +11,7 @@ HAVE_PYCONFIG := $(shell if which python-config >/dev/null 2>&1; then echo 1; el
LIB_DIR := ../../lib
PY_INCLUDE = $(firstword $(shell python-config --includes))
OBJECTS_LIB = $(wildcard $(LIB_DIR)/*.o)
+INSTALL_DIR = $(shell python3 -c "import site; print(site.getsitepackages()[0])")
all: _raw_pylibcpupower.so
@@ -28,6 +29,15 @@ else ifeq ($(HAVE_PYCONFIG),0)
endif
swig -python raw_pylibcpupower.swg
+# Only installs the Python bindings
+install: _raw_pylibcpupower.so
+ install -D _raw_pylibcpupower.so $(INSTALL_DIR)/_raw_pylibcpupower.so
+ install -D raw_pylibcpupower.py $(INSTALL_DIR)/raw_pylibcpupower.py
+
+uninstall:
+ rm -f $(INSTALL_DIR)/_raw_pylibcpupower.so
+ rm -f $(INSTALL_DIR)/raw_pylibcpupower.py
+
# Will only clean the bindings folder; will not clean the actual cpupower folder
clean:
rm -f raw_pylibcpupower.py raw_pylibcpupower_wrap.c raw_pylibcpupower_wrap.o _raw_pylibcpupower.so
diff --git a/tools/power/cpupower/bindings/python/README b/tools/power/cpupower/bindings/python/README
index 0a4bb2581e8a..952e2e02fd32 100644
--- a/tools/power/cpupower/bindings/python/README
+++ b/tools/power/cpupower/bindings/python/README
@@ -48,6 +48,31 @@ To run the test script:
$ python test_raw_pylibcpupower.py
+developing/using the bindings directly
+--------------------------------------
+
+You need to add the Python bindings directory to your $PYTHONPATH.
+
+You would set the path in the Bash terminal or in the Bash profile:
+
+PYTHONPATH=~/linux/tools/power/cpupower/bindings/python:$PYTHONPATH
+
+This allows you to set a specific repo of the bindings to use.
+
+
+installing/uninstalling
+-----------------------
+
+Python uses a system specific site-packages folder to look up modules to import
+by default. You do not need to install cpupower to use the SWIG bindings.
+
+You can install and uninstall the bindings to the site-packages with:
+
+sudo make install
+
+sudo make uninstall
+
+
credits
-------
diff --git a/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg b/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
index 96556d87a745..d82af6fa93c3 100644
--- a/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
+++ b/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
@@ -134,6 +134,9 @@ void cpufreq_put_stats(struct cpufreq_stats *stats);
unsigned long cpufreq_get_transitions(unsigned int cpu);
+char *cpufreq_get_energy_performance_preference(unsigned int cpu);
+void cpufreq_put_energy_performance_preference(char *ptr);
+
int cpufreq_set_policy(unsigned int cpu, struct cpufreq_policy *policy);
int cpufreq_modify_policy_min(unsigned int cpu, unsigned long min_freq);
@@ -160,6 +163,8 @@ int cpuidle_state_disable(unsigned int cpu, unsigned int idlestate,
unsigned int disable);
unsigned long cpuidle_state_latency(unsigned int cpu,
unsigned int idlestate);
+unsigned long cpuidle_state_residency(unsigned int cpu,
+ unsigned int idlestate);
unsigned long cpuidle_state_usage(unsigned int cpu,
unsigned int idlestate);
unsigned long long cpuidle_state_time(unsigned int cpu,
diff --git a/tools/power/cpupower/lib/cpufreq.c b/tools/power/cpupower/lib/cpufreq.c
index 1516d23c17c9..8dda3db2dff0 100644
--- a/tools/power/cpupower/lib/cpufreq.c
+++ b/tools/power/cpupower/lib/cpufreq.c
@@ -102,6 +102,10 @@ unsigned long cpufreq_get_sysfs_value_from_table(unsigned int cpu,
if (len == 0)
return 0;
+ if (!strcmp(linebuf, "enabled\n"))
+ return 1;
+ if (!strcmp(linebuf, "disabled\n"))
+ return 0;
value = strtoul(linebuf, &endp, 0);
if (endp == linebuf || errno == ERANGE)
@@ -123,12 +127,14 @@ static unsigned long sysfs_cpufreq_get_one_value(unsigned int cpu,
enum cpufreq_string {
SCALING_DRIVER,
SCALING_GOVERNOR,
+ ENERGY_PERFORMANCE_PREFERENCE,
MAX_CPUFREQ_STRING_FILES
};
static const char *cpufreq_string_files[MAX_CPUFREQ_STRING_FILES] = {
[SCALING_DRIVER] = "scaling_driver",
[SCALING_GOVERNOR] = "scaling_governor",
+ [ENERGY_PERFORMANCE_PREFERENCE] = "energy_performance_preference",
};
@@ -203,6 +209,18 @@ unsigned long cpufreq_get_transition_latency(unsigned int cpu)
return sysfs_cpufreq_get_one_value(cpu, CPUINFO_LATENCY);
}
+char *cpufreq_get_energy_performance_preference(unsigned int cpu)
+{
+ return sysfs_cpufreq_get_one_string(cpu, ENERGY_PERFORMANCE_PREFERENCE);
+}
+
+void cpufreq_put_energy_performance_preference(char *ptr)
+{
+ if (!ptr)
+ return;
+ free(ptr);
+}
+
int cpufreq_get_hardware_limits(unsigned int cpu,
unsigned long *min,
unsigned long *max)
diff --git a/tools/power/cpupower/lib/cpufreq.h b/tools/power/cpupower/lib/cpufreq.h
index 2f3c84035806..bfc617311ebd 100644
--- a/tools/power/cpupower/lib/cpufreq.h
+++ b/tools/power/cpupower/lib/cpufreq.h
@@ -68,6 +68,14 @@ unsigned long cpufreq_get_freq_hardware(unsigned int cpu);
unsigned long cpufreq_get_transition_latency(unsigned int cpu);
+/* determine energy performance preference
+ *
+ * returns NULL on failure, else the string that represents the energy performance
+ * preference requested.
+ */
+char *cpufreq_get_energy_performance_preference(unsigned int cpu);
+void cpufreq_put_energy_performance_preference(char *ptr);
+
/* determine hardware CPU frequency limits
*
* These may be limited further by thermal, energy or other
diff --git a/tools/power/cpupower/utils/cpufreq-info.c b/tools/power/cpupower/utils/cpufreq-info.c
index c96b77365c63..fc750e127404 100644
--- a/tools/power/cpupower/utils/cpufreq-info.c
+++ b/tools/power/cpupower/utils/cpufreq-info.c
@@ -120,7 +120,6 @@ static void print_duration(unsigned long duration)
} else
printf("%lu ns", duration);
}
- return;
}
static int get_boost_mode_x86(unsigned int cpu)
@@ -255,7 +254,12 @@ static int get_freq_kernel(unsigned int cpu, unsigned int human)
static int get_freq_hardware(unsigned int cpu, unsigned int human)
{
- unsigned long freq = cpufreq_get_freq_hardware(cpu);
+ unsigned long freq;
+
+ if (cpupower_cpu_info.caps & CPUPOWER_CAP_APERF)
+ return -EINVAL;
+
+ freq = cpufreq_get_freq_hardware(cpu);
printf(_(" current CPU frequency: "));
if (!freq) {
printf("Unable to call hardware\n");
@@ -418,12 +422,32 @@ static int get_freq_stats(unsigned int cpu, unsigned int human)
return 0;
}
+/* --epp / -z */
+
+static int get_epp(unsigned int cpu, bool interactive)
+{
+ char *epp;
+
+ epp = cpufreq_get_energy_performance_preference(cpu);
+ if (!epp)
+ return -EINVAL;
+ if (interactive)
+ printf(_(" energy performance preference: %s\n"), epp);
+
+ cpufreq_put_energy_performance_preference(epp);
+
+ return 0;
+}
+
/* --latency / -y */
static int get_latency(unsigned int cpu, unsigned int human)
{
unsigned long latency = cpufreq_get_transition_latency(cpu);
+ if (!get_epp(cpu, false))
+ return -EINVAL;
+
printf(_(" maximum transition latency: "));
if (!latency || latency == UINT_MAX) {
printf(_(" Cannot determine or is not supported.\n"));
@@ -457,6 +481,7 @@ static void debug_output_one(unsigned int cpu)
get_related_cpus(cpu);
get_affected_cpus(cpu);
get_latency(cpu, 1);
+ get_epp(cpu, true);
get_hardware_limits(cpu, 1);
freqs = cpufreq_get_available_frequencies(cpu);
@@ -497,6 +522,7 @@ static struct option info_opts[] = {
{"human", no_argument, NULL, 'm'},
{"no-rounding", no_argument, NULL, 'n'},
{"performance", no_argument, NULL, 'c'},
+ {"epp", no_argument, NULL, 'z'},
{ },
};
@@ -510,7 +536,7 @@ int cmd_freq_info(int argc, char **argv)
int output_param = 0;
do {
- ret = getopt_long(argc, argv, "oefwldpgrasmybnc", info_opts,
+ ret = getopt_long(argc, argv, "oefwldpgrasmybncz", info_opts,
NULL);
switch (ret) {
case '?':
@@ -534,6 +560,7 @@ int cmd_freq_info(int argc, char **argv)
case 's':
case 'y':
case 'c':
+ case 'z':
if (output_param) {
output_param = -1;
cont = 0;
@@ -643,6 +670,9 @@ int cmd_freq_info(int argc, char **argv)
case 'c':
ret = get_perf_cap(cpu);
break;
+ case 'z':
+ ret = get_epp(cpu, true);
+ break;
}
if (ret)
return ret;
diff --git a/tools/power/cpupower/utils/helpers/amd.c b/tools/power/cpupower/utils/helpers/amd.c
index 0a56e22240fc..795562e879de 100644
--- a/tools/power/cpupower/utils/helpers/amd.c
+++ b/tools/power/cpupower/utils/helpers/amd.c
@@ -177,6 +177,8 @@ enum amd_pstate_value {
AMD_PSTATE_HIGHEST_PERF,
AMD_PSTATE_MAX_FREQ,
AMD_PSTATE_LOWEST_NONLINEAR_FREQ,
+ AMD_PSTATE_HW_PREFCORE,
+ AMD_PSTATE_PREFCORE_RANKING,
MAX_AMD_PSTATE_VALUE_READ_FILES,
};
@@ -184,6 +186,8 @@ static const char *amd_pstate_value_files[MAX_AMD_PSTATE_VALUE_READ_FILES] = {
[AMD_PSTATE_HIGHEST_PERF] = "amd_pstate_highest_perf",
[AMD_PSTATE_MAX_FREQ] = "amd_pstate_max_freq",
[AMD_PSTATE_LOWEST_NONLINEAR_FREQ] = "amd_pstate_lowest_nonlinear_freq",
+ [AMD_PSTATE_HW_PREFCORE] = "amd_pstate_hw_prefcore",
+ [AMD_PSTATE_PREFCORE_RANKING] = "amd_pstate_prefcore_ranking",
};
static unsigned long amd_pstate_get_data(unsigned int cpu,
@@ -215,7 +219,9 @@ void amd_pstate_boost_init(unsigned int cpu, int *support, int *active)
void amd_pstate_show_perf_and_freq(unsigned int cpu, int no_rounding)
{
- printf(_(" AMD PSTATE Highest Performance: %lu. Maximum Frequency: "),
+
+ printf(_(" amd-pstate limits:\n"));
+ printf(_(" Highest Performance: %lu. Maximum Frequency: "),
amd_pstate_get_data(cpu, AMD_PSTATE_HIGHEST_PERF));
/*
* If boost isn't active, the cpuinfo_max doesn't indicate real max
@@ -224,22 +230,26 @@ void amd_pstate_show_perf_and_freq(unsigned int cpu, int no_rounding)
print_speed(amd_pstate_get_data(cpu, AMD_PSTATE_MAX_FREQ), no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Nominal Performance: %lu. Nominal Frequency: "),
+ printf(_(" Nominal Performance: %lu. Nominal Frequency: "),
acpi_cppc_get_data(cpu, NOMINAL_PERF));
print_speed(acpi_cppc_get_data(cpu, NOMINAL_FREQ) * 1000,
no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Lowest Non-linear Performance: %lu. Lowest Non-linear Frequency: "),
+ printf(_(" Lowest Non-linear Performance: %lu. Lowest Non-linear Frequency: "),
acpi_cppc_get_data(cpu, LOWEST_NONLINEAR_PERF));
print_speed(amd_pstate_get_data(cpu, AMD_PSTATE_LOWEST_NONLINEAR_FREQ),
no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Lowest Performance: %lu. Lowest Frequency: "),
+ printf(_(" Lowest Performance: %lu. Lowest Frequency: "),
acpi_cppc_get_data(cpu, LOWEST_PERF));
print_speed(acpi_cppc_get_data(cpu, LOWEST_FREQ) * 1000, no_rounding);
printf(".\n");
+
+ printf(_(" Preferred Core Support: %lu. Preferred Core Ranking: %lu.\n"),
+ amd_pstate_get_data(cpu, AMD_PSTATE_HW_PREFCORE),
+ amd_pstate_get_data(cpu, AMD_PSTATE_PREFCORE_RANKING));
}
/* AMD P-State Helper Functions ************************************/
diff --git a/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c b/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
index 55e55b6b42f9..f5a2a326b1b7 100644
--- a/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
@@ -117,7 +117,7 @@ static int hsw_ext_start(void)
for (num = 0; num < HSW_EXT_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- hsw_ext_get_count(num, &val, cpu);
+ is_valid[cpu] = !hsw_ext_get_count(num, &val, cpu);
previous_count[num][cpu] = val;
}
}
@@ -134,7 +134,7 @@ static int hsw_ext_stop(void)
for (num = 0; num < HSW_EXT_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !hsw_ext_get_count(num, &val, cpu);
+ is_valid[cpu] |= !hsw_ext_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c b/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
index ae6af354a81d..73b6b10cbdd2 100644
--- a/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
+++ b/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
@@ -33,7 +33,7 @@ static int mperf_get_count_percent(unsigned int self_id, double *percent,
unsigned int cpu);
static int mperf_get_count_freq(unsigned int id, unsigned long long *count,
unsigned int cpu);
-static struct timespec time_start, time_end;
+static struct timespec *time_start, *time_end;
static cstate_t mperf_cstates[MPERF_CSTATE_COUNT] = {
{
@@ -148,7 +148,7 @@ static int mperf_measure_stats(unsigned int cpu)
ret = get_aperf_mperf(cpu, &aval, &mval);
aperf_current_count[cpu] = aval;
mperf_current_count[cpu] = mval;
- is_valid[cpu] = !ret;
+ is_valid[cpu] |= !ret;
return 0;
}
@@ -174,7 +174,7 @@ static int mperf_get_count_percent(unsigned int id, double *percent,
dprint("%s: TSC Ref - mperf_diff: %llu, tsc_diff: %llu\n",
mperf_cstates[id].name, mperf_diff, tsc_diff);
} else if (max_freq_mode == MAX_FREQ_SYSFS) {
- timediff = max_frequency * timespec_diff_us(time_start, time_end);
+ timediff = max_frequency * timespec_diff_us(time_start[cpu], time_end[cpu]);
*percent = 100.0 * mperf_diff / timediff;
dprint("%s: MAXFREQ - mperf_diff: %llu, time_diff: %llu\n",
mperf_cstates[id].name, mperf_diff, timediff);
@@ -207,7 +207,7 @@ static int mperf_get_count_freq(unsigned int id, unsigned long long *count,
if (max_freq_mode == MAX_FREQ_TSC_REF) {
/* Calculate max_freq from TSC count */
tsc_diff = tsc_at_measure_end[cpu] - tsc_at_measure_start[cpu];
- time_diff = timespec_diff_us(time_start, time_end);
+ time_diff = timespec_diff_us(time_start[cpu], time_end[cpu]);
max_frequency = tsc_diff / time_diff;
}
@@ -226,9 +226,8 @@ static int mperf_start(void)
{
int cpu;
- clock_gettime(CLOCK_REALTIME, &time_start);
-
for (cpu = 0; cpu < cpu_count; cpu++) {
+ clock_gettime(CLOCK_REALTIME, &time_start[cpu]);
mperf_get_tsc(&tsc_at_measure_start[cpu]);
mperf_init_stats(cpu);
}
@@ -243,9 +242,9 @@ static int mperf_stop(void)
for (cpu = 0; cpu < cpu_count; cpu++) {
mperf_measure_stats(cpu);
mperf_get_tsc(&tsc_at_measure_end[cpu]);
+ clock_gettime(CLOCK_REALTIME, &time_end[cpu]);
}
- clock_gettime(CLOCK_REALTIME, &time_end);
return 0;
}
@@ -349,6 +348,8 @@ struct cpuidle_monitor *mperf_register(void)
aperf_current_count = calloc(cpu_count, sizeof(unsigned long long));
tsc_at_measure_start = calloc(cpu_count, sizeof(unsigned long long));
tsc_at_measure_end = calloc(cpu_count, sizeof(unsigned long long));
+ time_start = calloc(cpu_count, sizeof(struct timespec));
+ time_end = calloc(cpu_count, sizeof(struct timespec));
mperf_monitor.name_len = strlen(mperf_monitor.name);
return &mperf_monitor;
}
@@ -361,6 +362,8 @@ void mperf_unregister(void)
free(aperf_current_count);
free(tsc_at_measure_start);
free(tsc_at_measure_end);
+ free(time_start);
+ free(time_end);
free(is_valid);
}
diff --git a/tools/power/cpupower/utils/idle_monitor/nhm_idle.c b/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
index 16eaf006f61f..6b1733782ffa 100644
--- a/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
@@ -151,7 +151,7 @@ static int nhm_stop(void)
for (num = 0; num < NHM_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !nhm_get_count(num, &val, cpu);
+ is_valid[cpu] |= !nhm_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/power/cpupower/utils/idle_monitor/snb_idle.c b/tools/power/cpupower/utils/idle_monitor/snb_idle.c
index 811d63ab17a7..5969b88a85b4 100644
--- a/tools/power/cpupower/utils/idle_monitor/snb_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/snb_idle.c
@@ -115,7 +115,7 @@ static int snb_start(void)
for (num = 0; num < SNB_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- snb_get_count(num, &val, cpu);
+ is_valid[cpu] = !snb_get_count(num, &val, cpu);
previous_count[num][cpu] = val;
}
}
@@ -132,7 +132,7 @@ static int snb_stop(void)
for (num = 0; num < SNB_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !snb_get_count(num, &val, cpu);
+ is_valid[cpu] |= !snb_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/power/x86/intel-speed-select/isst-config.c b/tools/power/x86/intel-speed-select/isst-config.c
index 5127be34869e..fadfb02b8611 100644
--- a/tools/power/x86/intel-speed-select/isst-config.c
+++ b/tools/power/x86/intel-speed-select/isst-config.c
@@ -16,7 +16,7 @@ struct process_cmd_struct {
int arg;
};
-static const char *version_str = "v1.20";
+static const char *version_str = "v1.21";
static const int supported_api_ver = 3;
static struct isst_if_platform_info isst_platform_info;
diff --git a/tools/power/x86/intel-speed-select/isst-core-tpmi.c b/tools/power/x86/intel-speed-select/isst-core-tpmi.c
index 32ea70c7dbd8..da53aaa27fc9 100644
--- a/tools/power/x86/intel-speed-select/isst-core-tpmi.c
+++ b/tools/power/x86/intel-speed-select/isst-core-tpmi.c
@@ -329,7 +329,7 @@ static int tpmi_get_get_trls(struct isst_id *id, int config_index,
return 0;
}
-static int tpmi_get_get_trl(struct isst_id *id, int level, int config_index,
+static int tpmi_get_get_trl(struct isst_id *id, int config_index, int level,
int *trl)
{
struct isst_pkg_ctdp_level_info ctdp_level;
diff --git a/tools/sched_ext/include/scx/common.bpf.h b/tools/sched_ext/include/scx/common.bpf.h
index 2f36b7b6418d..f3e15e9efa76 100644
--- a/tools/sched_ext/include/scx/common.bpf.h
+++ b/tools/sched_ext/include/scx/common.bpf.h
@@ -9,7 +9,7 @@
#ifdef LSP
#define __bpf__
-#include "../vmlinux/vmlinux.h"
+#include "../vmlinux.h"
#else
#include "vmlinux.h"
#endif
@@ -24,6 +24,10 @@
#define PF_EXITING 0x00000004
#define CLOCK_MONOTONIC 1
+extern int LINUX_KERNEL_VERSION __kconfig;
+extern const char CONFIG_CC_VERSION_TEXT[64] __kconfig __weak;
+extern const char CONFIG_LOCALVERSION[64] __kconfig __weak;
+
/*
* Earlier versions of clang/pahole lost upper 32bits in 64bit enums which can
* lead to really confusing misbehaviors. Let's trigger a build failure.
@@ -40,9 +44,9 @@ void scx_bpf_dsq_insert(struct task_struct *p, u64 dsq_id, u64 slice, u64 enq_fl
void scx_bpf_dsq_insert_vtime(struct task_struct *p, u64 dsq_id, u64 slice, u64 vtime, u64 enq_flags) __ksym __weak;
u32 scx_bpf_dispatch_nr_slots(void) __ksym;
void scx_bpf_dispatch_cancel(void) __ksym;
-bool scx_bpf_dsq_move_to_local(u64 dsq_id) __ksym;
-void scx_bpf_dsq_move_set_slice(struct bpf_iter_scx_dsq *it__iter, u64 slice) __ksym;
-void scx_bpf_dsq_move_set_vtime(struct bpf_iter_scx_dsq *it__iter, u64 vtime) __ksym;
+bool scx_bpf_dsq_move_to_local(u64 dsq_id) __ksym __weak;
+void scx_bpf_dsq_move_set_slice(struct bpf_iter_scx_dsq *it__iter, u64 slice) __ksym __weak;
+void scx_bpf_dsq_move_set_vtime(struct bpf_iter_scx_dsq *it__iter, u64 vtime) __ksym __weak;
bool scx_bpf_dsq_move(struct bpf_iter_scx_dsq *it__iter, struct task_struct *p, u64 dsq_id, u64 enq_flags) __ksym __weak;
bool scx_bpf_dsq_move_vtime(struct bpf_iter_scx_dsq *it__iter, struct task_struct *p, u64 dsq_id, u64 enq_flags) __ksym __weak;
u32 scx_bpf_reenqueue_local(void) __ksym;
@@ -72,6 +76,7 @@ bool scx_bpf_task_running(const struct task_struct *p) __ksym;
s32 scx_bpf_task_cpu(const struct task_struct *p) __ksym;
struct rq *scx_bpf_cpu_rq(s32 cpu) __ksym;
struct cgroup *scx_bpf_task_cgroup(struct task_struct *p) __ksym __weak;
+u64 scx_bpf_now(void) __ksym __weak;
/*
* Use the following as @it__iter when calling scx_bpf_dsq_move[_vtime]() from
@@ -98,7 +103,7 @@ void ___scx_bpf_bstr_format_checker(const char *fmt, ...) {}
_Pragma("GCC diagnostic push") \
_Pragma("GCC diagnostic ignored \"-Wint-conversion\"") \
___bpf_fill(___param, args); \
- _Pragma("GCC diagnostic pop") \
+ _Pragma("GCC diagnostic pop")
/*
* scx_bpf_exit() wraps the scx_bpf_exit_bstr() kfunc with variadic arguments
@@ -136,6 +141,20 @@ void ___scx_bpf_bstr_format_checker(const char *fmt, ...) {}
___scx_bpf_bstr_format_checker(fmt, ##args); \
})
+/*
+ * scx_bpf_dump_header() is a wrapper around scx_bpf_dump that adds a header
+ * of system information for debugging.
+ */
+#define scx_bpf_dump_header() \
+({ \
+ scx_bpf_dump("kernel: %d.%d.%d %s\ncc: %s\n", \
+ LINUX_KERNEL_VERSION >> 16, \
+ LINUX_KERNEL_VERSION >> 8 & 0xFF, \
+ LINUX_KERNEL_VERSION & 0xFF, \
+ CONFIG_LOCALVERSION, \
+ CONFIG_CC_VERSION_TEXT); \
+})
+
#define BPF_STRUCT_OPS(name, args...) \
SEC("struct_ops/"#name) \
BPF_PROG(name, ##args)
@@ -317,6 +336,66 @@ u32 bpf_cpumask_any_and_distribute(const struct cpumask *src1,
const struct cpumask *src2) __ksym;
u32 bpf_cpumask_weight(const struct cpumask *cpumask) __ksym;
+int bpf_iter_bits_new(struct bpf_iter_bits *it, const u64 *unsafe_ptr__ign, u32 nr_words) __ksym;
+int *bpf_iter_bits_next(struct bpf_iter_bits *it) __ksym;
+void bpf_iter_bits_destroy(struct bpf_iter_bits *it) __ksym;
+
+#define def_iter_struct(name) \
+struct bpf_iter_##name { \
+ struct bpf_iter_bits it; \
+ const struct cpumask *bitmap; \
+};
+
+#define def_iter_new(name) \
+static inline int bpf_iter_##name##_new( \
+ struct bpf_iter_##name *it, const u64 *unsafe_ptr__ign, u32 nr_words) \
+{ \
+ it->bitmap = scx_bpf_get_##name##_cpumask(); \
+ return bpf_iter_bits_new(&it->it, (const u64 *)it->bitmap, \
+ sizeof(struct cpumask) / 8); \
+}
+
+#define def_iter_next(name) \
+static inline int *bpf_iter_##name##_next(struct bpf_iter_##name *it) { \
+ return bpf_iter_bits_next(&it->it); \
+}
+
+#define def_iter_destroy(name) \
+static inline void bpf_iter_##name##_destroy(struct bpf_iter_##name *it) { \
+ scx_bpf_put_cpumask(it->bitmap); \
+ bpf_iter_bits_destroy(&it->it); \
+}
+#define def_for_each_cpu(cpu, name) for_each_##name##_cpu(cpu)
+
+/// Provides iterator for possible and online cpus.
+///
+/// # Example
+///
+/// ```
+/// static inline void example_use() {
+/// int *cpu;
+///
+/// for_each_possible_cpu(cpu){
+/// bpf_printk("CPU %d is possible", *cpu);
+/// }
+///
+/// for_each_online_cpu(cpu){
+/// bpf_printk("CPU %d is online", *cpu);
+/// }
+/// }
+/// ```
+def_iter_struct(possible);
+def_iter_new(possible);
+def_iter_next(possible);
+def_iter_destroy(possible);
+#define for_each_possible_cpu(cpu) bpf_for_each(possible, cpu, NULL, 0)
+
+def_iter_struct(online);
+def_iter_new(online);
+def_iter_next(online);
+def_iter_destroy(online);
+#define for_each_online_cpu(cpu) bpf_for_each(online, cpu, NULL, 0)
+
/*
* Access a cpumask in read-only mode (typically to check bits).
*/
@@ -329,6 +408,100 @@ static __always_inline const struct cpumask *cast_mask(struct bpf_cpumask *mask)
void bpf_rcu_read_lock(void) __ksym;
void bpf_rcu_read_unlock(void) __ksym;
+/*
+ * Time helpers, most of which are from jiffies.h.
+ */
+
+/**
+ * time_delta - Calculate the delta between new and old time stamp
+ * @after: first comparable as u64
+ * @before: second comparable as u64
+ *
+ * Return: the time difference, which is >= 0
+ */
+static inline s64 time_delta(u64 after, u64 before)
+{
+ return (s64)(after - before) > 0 ? : 0;
+}
+
+/**
+ * time_after - returns true if the time a is after time b.
+ * @a: first comparable as u64
+ * @b: second comparable as u64
+ *
+ * Do this with "<0" and ">=0" to only test the sign of the result. A
+ * good compiler would generate better code (and a really good compiler
+ * wouldn't care). Gcc is currently neither.
+ *
+ * Return: %true is time a is after time b, otherwise %false.
+ */
+static inline bool time_after(u64 a, u64 b)
+{
+ return (s64)(b - a) < 0;
+}
+
+/**
+ * time_before - returns true if the time a is before time b.
+ * @a: first comparable as u64
+ * @b: second comparable as u64
+ *
+ * Return: %true is time a is before time b, otherwise %false.
+ */
+static inline bool time_before(u64 a, u64 b)
+{
+ return time_after(b, a);
+}
+
+/**
+ * time_after_eq - returns true if the time a is after or the same as time b.
+ * @a: first comparable as u64
+ * @b: second comparable as u64
+ *
+ * Return: %true is time a is after or the same as time b, otherwise %false.
+ */
+static inline bool time_after_eq(u64 a, u64 b)
+{
+ return (s64)(a - b) >= 0;
+}
+
+/**
+ * time_before_eq - returns true if the time a is before or the same as time b.
+ * @a: first comparable as u64
+ * @b: second comparable as u64
+ *
+ * Return: %true is time a is before or the same as time b, otherwise %false.
+ */
+static inline bool time_before_eq(u64 a, u64 b)
+{
+ return time_after_eq(b, a);
+}
+
+/**
+ * time_in_range - Calculate whether a is in the range of [b, c].
+ * @a: time to test
+ * @b: beginning of the range
+ * @c: end of the range
+ *
+ * Return: %true is time a is in the range [b, c], otherwise %false.
+ */
+static inline bool time_in_range(u64 a, u64 b, u64 c)
+{
+ return time_after_eq(a, b) && time_before_eq(a, c);
+}
+
+/**
+ * time_in_range_open - Calculate whether a is in the range of [b, c).
+ * @a: time to test
+ * @b: beginning of the range
+ * @c: end of the range
+ *
+ * Return: %true is time a is in the range [b, c), otherwise %false.
+ */
+static inline bool time_in_range_open(u64 a, u64 b, u64 c)
+{
+ return time_after_eq(a, b) && time_before(a, c);
+}
+
/*
* Other helpers
@@ -423,5 +596,6 @@ static inline u32 log2_u64(u64 v)
}
#include "compat.bpf.h"
+#include "enums.bpf.h"
#endif /* __SCX_COMMON_BPF_H */
diff --git a/tools/sched_ext/include/scx/common.h b/tools/sched_ext/include/scx/common.h
index 5b0f90152152..dc18b99e55cd 100644
--- a/tools/sched_ext/include/scx/common.h
+++ b/tools/sched_ext/include/scx/common.h
@@ -71,5 +71,11 @@ typedef int64_t s64;
#include "user_exit_info.h"
#include "compat.h"
+#include "enums.h"
+
+/* not available when building kernel tools/sched_ext */
+#if __has_include(<lib/sdt_task.h>)
+#include <lib/sdt_task.h>
+#endif
#endif /* __SCHED_EXT_COMMON_H */
diff --git a/tools/sched_ext/include/scx/compat.bpf.h b/tools/sched_ext/include/scx/compat.bpf.h
index d56520100a26..50e1499ae093 100644
--- a/tools/sched_ext/include/scx/compat.bpf.h
+++ b/tools/sched_ext/include/scx/compat.bpf.h
@@ -125,6 +125,11 @@ bool scx_bpf_dispatch_vtime_from_dsq___compat(struct bpf_iter_scx_dsq *it__iter,
false; \
})
+#define scx_bpf_now() \
+ (bpf_ksym_exists(scx_bpf_now) ? \
+ scx_bpf_now() : \
+ bpf_ktime_get_ns())
+
/*
* Define sched_ext_ops. This may be expanded to define multiple variants for
* backward compatibility. See compat.h::SCX_OPS_LOAD/ATTACH().
diff --git a/tools/sched_ext/include/scx/compat.h b/tools/sched_ext/include/scx/compat.h
index cc56ff9aa252..b50280e2ba2b 100644
--- a/tools/sched_ext/include/scx/compat.h
+++ b/tools/sched_ext/include/scx/compat.h
@@ -149,6 +149,7 @@ static inline long scx_hotplug_seq(void)
__skel = __scx_name##__open(); \
SCX_BUG_ON(!__skel, "Could not open " #__scx_name); \
__skel->struct_ops.__ops_name->hotplug_seq = scx_hotplug_seq(); \
+ SCX_ENUM_INIT(__skel); \
__skel; \
})
diff --git a/tools/sched_ext/include/scx/enums.autogen.bpf.h b/tools/sched_ext/include/scx/enums.autogen.bpf.h
new file mode 100644
index 000000000000..0e941a0d6f88
--- /dev/null
+++ b/tools/sched_ext/include/scx/enums.autogen.bpf.h
@@ -0,0 +1,105 @@
+/*
+ * WARNING: This file is autogenerated from scripts/gen_enums.py. If you would
+ * like to access an enum that is currently missing, add it to the script
+ * and run it from the root directory to update this file.
+ */
+
+const volatile u64 __SCX_OPS_NAME_LEN __weak;
+#define SCX_OPS_NAME_LEN __SCX_OPS_NAME_LEN
+
+const volatile u64 __SCX_SLICE_DFL __weak;
+#define SCX_SLICE_DFL __SCX_SLICE_DFL
+
+const volatile u64 __SCX_SLICE_INF __weak;
+#define SCX_SLICE_INF __SCX_SLICE_INF
+
+const volatile u64 __SCX_DSQ_FLAG_BUILTIN __weak;
+#define SCX_DSQ_FLAG_BUILTIN __SCX_DSQ_FLAG_BUILTIN
+
+const volatile u64 __SCX_DSQ_FLAG_LOCAL_ON __weak;
+#define SCX_DSQ_FLAG_LOCAL_ON __SCX_DSQ_FLAG_LOCAL_ON
+
+const volatile u64 __SCX_DSQ_INVALID __weak;
+#define SCX_DSQ_INVALID __SCX_DSQ_INVALID
+
+const volatile u64 __SCX_DSQ_GLOBAL __weak;
+#define SCX_DSQ_GLOBAL __SCX_DSQ_GLOBAL
+
+const volatile u64 __SCX_DSQ_LOCAL __weak;
+#define SCX_DSQ_LOCAL __SCX_DSQ_LOCAL
+
+const volatile u64 __SCX_DSQ_LOCAL_ON __weak;
+#define SCX_DSQ_LOCAL_ON __SCX_DSQ_LOCAL_ON
+
+const volatile u64 __SCX_DSQ_LOCAL_CPU_MASK __weak;
+#define SCX_DSQ_LOCAL_CPU_MASK __SCX_DSQ_LOCAL_CPU_MASK
+
+const volatile u64 __SCX_TASK_QUEUED __weak;
+#define SCX_TASK_QUEUED __SCX_TASK_QUEUED
+
+const volatile u64 __SCX_TASK_RESET_RUNNABLE_AT __weak;
+#define SCX_TASK_RESET_RUNNABLE_AT __SCX_TASK_RESET_RUNNABLE_AT
+
+const volatile u64 __SCX_TASK_DEQD_FOR_SLEEP __weak;
+#define SCX_TASK_DEQD_FOR_SLEEP __SCX_TASK_DEQD_FOR_SLEEP
+
+const volatile u64 __SCX_TASK_STATE_SHIFT __weak;
+#define SCX_TASK_STATE_SHIFT __SCX_TASK_STATE_SHIFT
+
+const volatile u64 __SCX_TASK_STATE_BITS __weak;
+#define SCX_TASK_STATE_BITS __SCX_TASK_STATE_BITS
+
+const volatile u64 __SCX_TASK_STATE_MASK __weak;
+#define SCX_TASK_STATE_MASK __SCX_TASK_STATE_MASK
+
+const volatile u64 __SCX_TASK_CURSOR __weak;
+#define SCX_TASK_CURSOR __SCX_TASK_CURSOR
+
+const volatile u64 __SCX_TASK_NONE __weak;
+#define SCX_TASK_NONE __SCX_TASK_NONE
+
+const volatile u64 __SCX_TASK_INIT __weak;
+#define SCX_TASK_INIT __SCX_TASK_INIT
+
+const volatile u64 __SCX_TASK_READY __weak;
+#define SCX_TASK_READY __SCX_TASK_READY
+
+const volatile u64 __SCX_TASK_ENABLED __weak;
+#define SCX_TASK_ENABLED __SCX_TASK_ENABLED
+
+const volatile u64 __SCX_TASK_NR_STATES __weak;
+#define SCX_TASK_NR_STATES __SCX_TASK_NR_STATES
+
+const volatile u64 __SCX_TASK_DSQ_ON_PRIQ __weak;
+#define SCX_TASK_DSQ_ON_PRIQ __SCX_TASK_DSQ_ON_PRIQ
+
+const volatile u64 __SCX_KICK_IDLE __weak;
+#define SCX_KICK_IDLE __SCX_KICK_IDLE
+
+const volatile u64 __SCX_KICK_PREEMPT __weak;
+#define SCX_KICK_PREEMPT __SCX_KICK_PREEMPT
+
+const volatile u64 __SCX_KICK_WAIT __weak;
+#define SCX_KICK_WAIT __SCX_KICK_WAIT
+
+const volatile u64 __SCX_ENQ_WAKEUP __weak;
+#define SCX_ENQ_WAKEUP __SCX_ENQ_WAKEUP
+
+const volatile u64 __SCX_ENQ_HEAD __weak;
+#define SCX_ENQ_HEAD __SCX_ENQ_HEAD
+
+const volatile u64 __SCX_ENQ_PREEMPT __weak;
+#define SCX_ENQ_PREEMPT __SCX_ENQ_PREEMPT
+
+const volatile u64 __SCX_ENQ_REENQ __weak;
+#define SCX_ENQ_REENQ __SCX_ENQ_REENQ
+
+const volatile u64 __SCX_ENQ_LAST __weak;
+#define SCX_ENQ_LAST __SCX_ENQ_LAST
+
+const volatile u64 __SCX_ENQ_CLEAR_OPSS __weak;
+#define SCX_ENQ_CLEAR_OPSS __SCX_ENQ_CLEAR_OPSS
+
+const volatile u64 __SCX_ENQ_DSQ_PRIQ __weak;
+#define SCX_ENQ_DSQ_PRIQ __SCX_ENQ_DSQ_PRIQ
+
diff --git a/tools/sched_ext/include/scx/enums.autogen.h b/tools/sched_ext/include/scx/enums.autogen.h
new file mode 100644
index 000000000000..88137a140e72
--- /dev/null
+++ b/tools/sched_ext/include/scx/enums.autogen.h
@@ -0,0 +1,41 @@
+/*
+ * WARNING: This file is autogenerated from scripts/gen_enums.py. If you would
+ * like to access an enum that is currently missing, add it to the script
+ * and run it from the root directory to update this file.
+ */
+
+#define SCX_ENUM_INIT(skel) do { \
+ SCX_ENUM_SET(skel, scx_public_consts, SCX_OPS_NAME_LEN); \
+ SCX_ENUM_SET(skel, scx_public_consts, SCX_SLICE_DFL); \
+ SCX_ENUM_SET(skel, scx_public_consts, SCX_SLICE_INF); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_FLAG_BUILTIN); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_FLAG_LOCAL_ON); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_INVALID); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_GLOBAL); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_LOCAL); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_LOCAL_ON); \
+ SCX_ENUM_SET(skel, scx_dsq_id_flags, SCX_DSQ_LOCAL_CPU_MASK); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_QUEUED); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_RESET_RUNNABLE_AT); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_DEQD_FOR_SLEEP); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_STATE_SHIFT); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_STATE_BITS); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_STATE_MASK); \
+ SCX_ENUM_SET(skel, scx_ent_flags, SCX_TASK_CURSOR); \
+ SCX_ENUM_SET(skel, scx_task_state, SCX_TASK_NONE); \
+ SCX_ENUM_SET(skel, scx_task_state, SCX_TASK_INIT); \
+ SCX_ENUM_SET(skel, scx_task_state, SCX_TASK_READY); \
+ SCX_ENUM_SET(skel, scx_task_state, SCX_TASK_ENABLED); \
+ SCX_ENUM_SET(skel, scx_task_state, SCX_TASK_NR_STATES); \
+ SCX_ENUM_SET(skel, scx_ent_dsq_flags, SCX_TASK_DSQ_ON_PRIQ); \
+ SCX_ENUM_SET(skel, scx_kick_flags, SCX_KICK_IDLE); \
+ SCX_ENUM_SET(skel, scx_kick_flags, SCX_KICK_PREEMPT); \
+ SCX_ENUM_SET(skel, scx_kick_flags, SCX_KICK_WAIT); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_WAKEUP); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_HEAD); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_PREEMPT); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_REENQ); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_LAST); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_CLEAR_OPSS); \
+ SCX_ENUM_SET(skel, scx_enq_flags, SCX_ENQ_DSQ_PRIQ); \
+} while (0)
diff --git a/tools/sched_ext/include/scx/enums.bpf.h b/tools/sched_ext/include/scx/enums.bpf.h
new file mode 100644
index 000000000000..af704c5d6334
--- /dev/null
+++ b/tools/sched_ext/include/scx/enums.bpf.h
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Convenience macros for getting/setting struct scx_enums instances.
+ *
+ * Copyright (c) 2024 Meta Platforms, Inc. and affiliates.
+ */
+#ifndef __SCX_ENUMS_BPF_H
+#define __SCX_ENUMS_BPF_H
+
+#include "enums.autogen.bpf.h"
+
+#endif /* __SCX_ENUMS_BPF_H */
diff --git a/tools/sched_ext/include/scx/enums.h b/tools/sched_ext/include/scx/enums.h
new file mode 100644
index 000000000000..34cbebe974b7
--- /dev/null
+++ b/tools/sched_ext/include/scx/enums.h
@@ -0,0 +1,27 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Define struct scx_enums that stores the load-time values of enums
+ * used by the BPF program.
+ *
+ * Copyright (c) 2024 Meta Platforms, Inc. and affiliates.
+ */
+
+#ifndef __SCX_ENUMS_H
+#define __SCX_ENUMS_H
+
+static inline void __ENUM_set(u64 *val, char *type, char *name)
+{
+ bool res;
+
+ res = __COMPAT_read_enum(type, name, val);
+ SCX_BUG_ON(!res, "enum not found(%s)", name);
+}
+
+#define SCX_ENUM_SET(skel, type, name) do { \
+ __ENUM_set(&skel->rodata->__##name, #type, #name); \
+ } while (0)
+
+
+#include "enums.autogen.h"
+
+#endif /* __SCX_ENUMS_H */
diff --git a/tools/sched_ext/include/scx/user_exit_info.h b/tools/sched_ext/include/scx/user_exit_info.h
index 8ce2734402e1..66f856640ee7 100644
--- a/tools/sched_ext/include/scx/user_exit_info.h
+++ b/tools/sched_ext/include/scx/user_exit_info.h
@@ -10,6 +10,11 @@
#ifndef __USER_EXIT_INFO_H
#define __USER_EXIT_INFO_H
+#ifdef LSP
+#define __bpf__
+#include "../vmlinux.h"
+#endif
+
enum uei_sizes {
UEI_REASON_LEN = 128,
UEI_MSG_LEN = 1024,
@@ -25,9 +30,7 @@ struct user_exit_info {
#ifdef __bpf__
-#ifdef LSP
-#include "../vmlinux/vmlinux.h"
-#else
+#ifndef LSP
#include "vmlinux.h"
#endif
#include <bpf/bpf_core_read.h>
diff --git a/tools/sched_ext/scx_central.bpf.c b/tools/sched_ext/scx_central.bpf.c
index e6fad6211f6c..50bc1737c167 100644
--- a/tools/sched_ext/scx_central.bpf.c
+++ b/tools/sched_ext/scx_central.bpf.c
@@ -57,7 +57,7 @@ enum {
const volatile s32 central_cpu;
const volatile u32 nr_cpu_ids = 1; /* !0 for veristat, set during init */
-const volatile u64 slice_ns = SCX_SLICE_DFL;
+const volatile u64 slice_ns;
bool timer_pinned = true;
u64 nr_total, nr_locals, nr_queued, nr_lost_pids;
@@ -87,11 +87,6 @@ struct {
__type(value, struct central_timer);
} central_timer SEC(".maps");
-static bool vtime_before(u64 a, u64 b)
-{
- return (s64)(a - b) < 0;
-}
-
s32 BPF_STRUCT_OPS(central_select_cpu, struct task_struct *p,
s32 prev_cpu, u64 wake_flags)
{
@@ -245,7 +240,7 @@ void BPF_STRUCT_OPS(central_running, struct task_struct *p)
s32 cpu = scx_bpf_task_cpu(p);
u64 *started_at = ARRAY_ELEM_PTR(cpu_started_at, cpu, nr_cpu_ids);
if (started_at)
- *started_at = bpf_ktime_get_ns() ?: 1; /* 0 indicates idle */
+ *started_at = scx_bpf_now() ?: 1; /* 0 indicates idle */
}
void BPF_STRUCT_OPS(central_stopping, struct task_struct *p, bool runnable)
@@ -258,7 +253,7 @@ void BPF_STRUCT_OPS(central_stopping, struct task_struct *p, bool runnable)
static int central_timerfn(void *map, int *key, struct bpf_timer *timer)
{
- u64 now = bpf_ktime_get_ns();
+ u64 now = scx_bpf_now();
u64 nr_to_kick = nr_queued;
s32 i, curr_cpu;
@@ -279,7 +274,7 @@ static int central_timerfn(void *map, int *key, struct bpf_timer *timer)
/* kick iff the current one exhausted its slice */
started_at = ARRAY_ELEM_PTR(cpu_started_at, cpu, nr_cpu_ids);
if (started_at && *started_at &&
- vtime_before(now, *started_at + slice_ns))
+ time_before(now, *started_at + slice_ns))
continue;
/* and there's something pending */
diff --git a/tools/sched_ext/scx_central.c b/tools/sched_ext/scx_central.c
index 21deea320bd7..1e9f74525d8f 100644
--- a/tools/sched_ext/scx_central.c
+++ b/tools/sched_ext/scx_central.c
@@ -58,6 +58,7 @@ restart:
skel->rodata->central_cpu = 0;
skel->rodata->nr_cpu_ids = libbpf_num_possible_cpus();
+ skel->rodata->slice_ns = __COMPAT_ENUM_OR_ZERO("scx_public_consts", "SCX_SLICE_DFL");
while ((opt = getopt(argc, argv, "s:c:pvh")) != -1) {
switch (opt) {
@@ -97,7 +98,7 @@ restart:
SCX_BUG_ON(!cpuset, "Failed to allocate cpuset");
CPU_ZERO(cpuset);
CPU_SET(skel->rodata->central_cpu, cpuset);
- SCX_BUG_ON(sched_setaffinity(0, sizeof(cpuset), cpuset),
+ SCX_BUG_ON(sched_setaffinity(0, sizeof(*cpuset), cpuset),
"Failed to affinitize to central CPU %d (max %d)",
skel->rodata->central_cpu, skel->rodata->nr_cpu_ids - 1);
CPU_FREE(cpuset);
diff --git a/tools/sched_ext/scx_flatcg.bpf.c b/tools/sched_ext/scx_flatcg.bpf.c
index 4e3afcd260bf..2c720e3ecad5 100644
--- a/tools/sched_ext/scx_flatcg.bpf.c
+++ b/tools/sched_ext/scx_flatcg.bpf.c
@@ -57,7 +57,7 @@ enum {
char _license[] SEC("license") = "GPL";
const volatile u32 nr_cpus = 32; /* !0 for veristat, set during init */
-const volatile u64 cgrp_slice_ns = SCX_SLICE_DFL;
+const volatile u64 cgrp_slice_ns;
const volatile bool fifo_sched;
u64 cvtime_now;
@@ -137,11 +137,6 @@ static u64 div_round_up(u64 dividend, u64 divisor)
return (dividend + divisor - 1) / divisor;
}
-static bool vtime_before(u64 a, u64 b)
-{
- return (s64)(a - b) < 0;
-}
-
static bool cgv_node_less(struct bpf_rb_node *a, const struct bpf_rb_node *b)
{
struct cgv_node *cgc_a, *cgc_b;
@@ -271,7 +266,7 @@ static void cgrp_cap_budget(struct cgv_node *cgv_node, struct fcg_cgrp_ctx *cgc)
*/
max_budget = (cgrp_slice_ns * nr_cpus * cgc->hweight) /
(2 * FCG_HWEIGHT_ONE);
- if (vtime_before(cvtime, cvtime_now - max_budget))
+ if (time_before(cvtime, cvtime_now - max_budget))
cvtime = cvtime_now - max_budget;
cgv_node->cvtime = cvtime;
@@ -401,7 +396,7 @@ void BPF_STRUCT_OPS(fcg_enqueue, struct task_struct *p, u64 enq_flags)
* Limit the amount of budget that an idling task can accumulate
* to one slice.
*/
- if (vtime_before(tvtime, cgc->tvtime_now - SCX_SLICE_DFL))
+ if (time_before(tvtime, cgc->tvtime_now - SCX_SLICE_DFL))
tvtime = cgc->tvtime_now - SCX_SLICE_DFL;
scx_bpf_dsq_insert_vtime(p, cgrp->kn->id, SCX_SLICE_DFL,
@@ -535,7 +530,7 @@ void BPF_STRUCT_OPS(fcg_running, struct task_struct *p)
* from multiple CPUs and thus racy. Any error should be
* contained and temporary. Let's just live with it.
*/
- if (vtime_before(cgc->tvtime_now, p->scx.dsq_vtime))
+ if (time_before(cgc->tvtime_now, p->scx.dsq_vtime))
cgc->tvtime_now = p->scx.dsq_vtime;
}
bpf_cgroup_release(cgrp);
@@ -645,7 +640,7 @@ static bool try_pick_next_cgroup(u64 *cgidp)
cgv_node = container_of(rb_node, struct cgv_node, rb_node);
cgid = cgv_node->cgid;
- if (vtime_before(cvtime_now, cgv_node->cvtime))
+ if (time_before(cvtime_now, cgv_node->cvtime))
cvtime_now = cgv_node->cvtime;
/*
@@ -734,7 +729,7 @@ void BPF_STRUCT_OPS(fcg_dispatch, s32 cpu, struct task_struct *prev)
struct fcg_cpu_ctx *cpuc;
struct fcg_cgrp_ctx *cgc;
struct cgroup *cgrp;
- u64 now = bpf_ktime_get_ns();
+ u64 now = scx_bpf_now();
bool picked_next = false;
cpuc = find_cpu_ctx();
@@ -744,7 +739,7 @@ void BPF_STRUCT_OPS(fcg_dispatch, s32 cpu, struct task_struct *prev)
if (!cpuc->cur_cgid)
goto pick_next_cgroup;
- if (vtime_before(now, cpuc->cur_at + cgrp_slice_ns)) {
+ if (time_before(now, cpuc->cur_at + cgrp_slice_ns)) {
if (scx_bpf_dsq_move_to_local(cpuc->cur_cgid)) {
stat_inc(FCG_STAT_CNS_KEEP);
return;
@@ -920,14 +915,14 @@ void BPF_STRUCT_OPS(fcg_cgroup_move, struct task_struct *p,
struct cgroup *from, struct cgroup *to)
{
struct fcg_cgrp_ctx *from_cgc, *to_cgc;
- s64 vtime_delta;
+ s64 delta;
/* find_cgrp_ctx() triggers scx_ops_error() on lookup failures */
if (!(from_cgc = find_cgrp_ctx(from)) || !(to_cgc = find_cgrp_ctx(to)))
return;
- vtime_delta = p->scx.dsq_vtime - from_cgc->tvtime_now;
- p->scx.dsq_vtime = to_cgc->tvtime_now + vtime_delta;
+ delta = time_delta(p->scx.dsq_vtime, from_cgc->tvtime_now);
+ p->scx.dsq_vtime = to_cgc->tvtime_now + delta;
}
s32 BPF_STRUCT_OPS_SLEEPABLE(fcg_init)
diff --git a/tools/sched_ext/scx_flatcg.c b/tools/sched_ext/scx_flatcg.c
index 5d24ca9c29d9..6dd423eeb4ff 100644
--- a/tools/sched_ext/scx_flatcg.c
+++ b/tools/sched_ext/scx_flatcg.c
@@ -137,6 +137,7 @@ restart:
skel = SCX_OPS_OPEN(flatcg_ops, scx_flatcg);
skel->rodata->nr_cpus = libbpf_num_possible_cpus();
+ skel->rodata->cgrp_slice_ns = __COMPAT_ENUM_OR_ZERO("scx_public_consts", "SCX_SLICE_DFL");
while ((opt = getopt(argc, argv, "s:i:dfvh")) != -1) {
double v;
diff --git a/tools/sched_ext/scx_qmap.bpf.c b/tools/sched_ext/scx_qmap.bpf.c
index ee264947e0c3..3a20bb0c014a 100644
--- a/tools/sched_ext/scx_qmap.bpf.c
+++ b/tools/sched_ext/scx_qmap.bpf.c
@@ -33,7 +33,7 @@ enum consts {
char _license[] SEC("license") = "GPL";
-const volatile u64 slice_ns = SCX_SLICE_DFL;
+const volatile u64 slice_ns;
const volatile u32 stall_user_nth;
const volatile u32 stall_kernel_nth;
const volatile u32 dsp_inf_loop_after;
diff --git a/tools/sched_ext/scx_qmap.c b/tools/sched_ext/scx_qmap.c
index ac45a02b4055..c4912ab2e76f 100644
--- a/tools/sched_ext/scx_qmap.c
+++ b/tools/sched_ext/scx_qmap.c
@@ -64,6 +64,8 @@ int main(int argc, char **argv)
skel = SCX_OPS_OPEN(qmap_ops, scx_qmap);
+ skel->rodata->slice_ns = __COMPAT_ENUM_OR_ZERO("scx_public_consts", "SCX_SLICE_DFL");
+
while ((opt = getopt(argc, argv, "s:e:t:T:l:b:PHd:D:Spvh")) != -1) {
switch (opt) {
case 's':
diff --git a/tools/sched_ext/scx_simple.bpf.c b/tools/sched_ext/scx_simple.bpf.c
index 31f915b286c6..e6de99dba7db 100644
--- a/tools/sched_ext/scx_simple.bpf.c
+++ b/tools/sched_ext/scx_simple.bpf.c
@@ -52,11 +52,6 @@ static void stat_inc(u32 idx)
(*cnt_p)++;
}
-static inline bool vtime_before(u64 a, u64 b)
-{
- return (s64)(a - b) < 0;
-}
-
s32 BPF_STRUCT_OPS(simple_select_cpu, struct task_struct *p, s32 prev_cpu, u64 wake_flags)
{
bool is_idle = false;
@@ -84,7 +79,7 @@ void BPF_STRUCT_OPS(simple_enqueue, struct task_struct *p, u64 enq_flags)
* Limit the amount of budget that an idling task can accumulate
* to one slice.
*/
- if (vtime_before(vtime, vtime_now - SCX_SLICE_DFL))
+ if (time_before(vtime, vtime_now - SCX_SLICE_DFL))
vtime = vtime_now - SCX_SLICE_DFL;
scx_bpf_dsq_insert_vtime(p, SHARED_DSQ, SCX_SLICE_DFL, vtime,
@@ -108,7 +103,7 @@ void BPF_STRUCT_OPS(simple_running, struct task_struct *p)
* thus racy. Any error should be contained and temporary. Let's just
* live with it.
*/
- if (vtime_before(vtime_now, p->scx.dsq_vtime))
+ if (time_before(vtime_now, p->scx.dsq_vtime))
vtime_now = p->scx.dsq_vtime;
}
diff --git a/tools/scripts/Makefile.arch b/tools/scripts/Makefile.arch
index f6a50f06dfc4..eabfe9f411d9 100644
--- a/tools/scripts/Makefile.arch
+++ b/tools/scripts/Makefile.arch
@@ -7,8 +7,8 @@ HOSTARCH := $(shell uname -m | sed -e s/i.86/x86/ -e s/x86_64/x86/ \
-e s/sh[234].*/sh/ -e s/aarch64.*/arm64/ \
-e s/riscv.*/riscv/ -e s/loongarch.*/loongarch/)
-ifndef ARCH
-ARCH := $(HOSTARCH)
+ifeq ($(strip $(ARCH)),)
+override ARCH := $(HOSTARCH)
endif
SRCARCH := $(ARCH)
diff --git a/tools/scripts/syscall.tbl b/tools/scripts/syscall.tbl
new file mode 100644
index 000000000000..ebbdb3c42e9f
--- /dev/null
+++ b/tools/scripts/syscall.tbl
@@ -0,0 +1,409 @@
+# SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note
+#
+# This file contains the system call numbers for all of the
+# more recently added architectures.
+#
+# As a basic principle, no duplication of functionality
+# should be added, e.g. we don't use lseek when llseek
+# is present. New architectures should use this file
+# and implement the less feature-full calls in user space.
+#
+0 common io_setup sys_io_setup compat_sys_io_setup
+1 common io_destroy sys_io_destroy
+2 common io_submit sys_io_submit compat_sys_io_submit
+3 common io_cancel sys_io_cancel
+4 time32 io_getevents sys_io_getevents_time32
+4 64 io_getevents sys_io_getevents
+5 common setxattr sys_setxattr
+6 common lsetxattr sys_lsetxattr
+7 common fsetxattr sys_fsetxattr
+8 common getxattr sys_getxattr
+9 common lgetxattr sys_lgetxattr
+10 common fgetxattr sys_fgetxattr
+11 common listxattr sys_listxattr
+12 common llistxattr sys_llistxattr
+13 common flistxattr sys_flistxattr
+14 common removexattr sys_removexattr
+15 common lremovexattr sys_lremovexattr
+16 common fremovexattr sys_fremovexattr
+17 common getcwd sys_getcwd
+18 common lookup_dcookie sys_ni_syscall
+19 common eventfd2 sys_eventfd2
+20 common epoll_create1 sys_epoll_create1
+21 common epoll_ctl sys_epoll_ctl
+22 common epoll_pwait sys_epoll_pwait compat_sys_epoll_pwait
+23 common dup sys_dup
+24 common dup3 sys_dup3
+25 32 fcntl64 sys_fcntl64 compat_sys_fcntl64
+25 64 fcntl sys_fcntl
+26 common inotify_init1 sys_inotify_init1
+27 common inotify_add_watch sys_inotify_add_watch
+28 common inotify_rm_watch sys_inotify_rm_watch
+29 common ioctl sys_ioctl compat_sys_ioctl
+30 common ioprio_set sys_ioprio_set
+31 common ioprio_get sys_ioprio_get
+32 common flock sys_flock
+33 common mknodat sys_mknodat
+34 common mkdirat sys_mkdirat
+35 common unlinkat sys_unlinkat
+36 common symlinkat sys_symlinkat
+37 common linkat sys_linkat
+# renameat is superseded with flags by renameat2
+38 renameat renameat sys_renameat
+39 common umount2 sys_umount
+40 common mount sys_mount
+41 common pivot_root sys_pivot_root
+42 common nfsservctl sys_ni_syscall
+43 32 statfs64 sys_statfs64 compat_sys_statfs64
+43 64 statfs sys_statfs
+44 32 fstatfs64 sys_fstatfs64 compat_sys_fstatfs64
+44 64 fstatfs sys_fstatfs
+45 32 truncate64 sys_truncate64 compat_sys_truncate64
+45 64 truncate sys_truncate
+46 32 ftruncate64 sys_ftruncate64 compat_sys_ftruncate64
+46 64 ftruncate sys_ftruncate
+47 common fallocate sys_fallocate compat_sys_fallocate
+48 common faccessat sys_faccessat
+49 common chdir sys_chdir
+50 common fchdir sys_fchdir
+51 common chroot sys_chroot
+52 common fchmod sys_fchmod
+53 common fchmodat sys_fchmodat
+54 common fchownat sys_fchownat
+55 common fchown sys_fchown
+56 common openat sys_openat
+57 common close sys_close
+58 common vhangup sys_vhangup
+59 common pipe2 sys_pipe2
+60 common quotactl sys_quotactl
+61 common getdents64 sys_getdents64
+62 32 llseek sys_llseek
+62 64 lseek sys_lseek
+63 common read sys_read
+64 common write sys_write
+65 common readv sys_readv sys_readv
+66 common writev sys_writev sys_writev
+67 common pread64 sys_pread64 compat_sys_pread64
+68 common pwrite64 sys_pwrite64 compat_sys_pwrite64
+69 common preadv sys_preadv compat_sys_preadv
+70 common pwritev sys_pwritev compat_sys_pwritev
+71 32 sendfile64 sys_sendfile64
+71 64 sendfile sys_sendfile64
+72 time32 pselect6 sys_pselect6_time32 compat_sys_pselect6_time32
+72 64 pselect6 sys_pselect6
+73 time32 ppoll sys_ppoll_time32 compat_sys_ppoll_time32
+73 64 ppoll sys_ppoll
+74 common signalfd4 sys_signalfd4 compat_sys_signalfd4
+75 common vmsplice sys_vmsplice
+76 common splice sys_splice
+77 common tee sys_tee
+78 common readlinkat sys_readlinkat
+79 stat64 fstatat64 sys_fstatat64
+79 64 newfstatat sys_newfstatat
+80 stat64 fstat64 sys_fstat64
+80 64 fstat sys_newfstat
+81 common sync sys_sync
+82 common fsync sys_fsync
+83 common fdatasync sys_fdatasync
+84 common sync_file_range sys_sync_file_range compat_sys_sync_file_range
+85 common timerfd_create sys_timerfd_create
+86 time32 timerfd_settime sys_timerfd_settime32
+86 64 timerfd_settime sys_timerfd_settime
+87 time32 timerfd_gettime sys_timerfd_gettime32
+87 64 timerfd_gettime sys_timerfd_gettime
+88 time32 utimensat sys_utimensat_time32
+88 64 utimensat sys_utimensat
+89 common acct sys_acct
+90 common capget sys_capget
+91 common capset sys_capset
+92 common personality sys_personality
+93 common exit sys_exit
+94 common exit_group sys_exit_group
+95 common waitid sys_waitid compat_sys_waitid
+96 common set_tid_address sys_set_tid_address
+97 common unshare sys_unshare
+98 time32 futex sys_futex_time32
+98 64 futex sys_futex
+99 common set_robust_list sys_set_robust_list compat_sys_set_robust_list
+100 common get_robust_list sys_get_robust_list compat_sys_get_robust_list
+101 time32 nanosleep sys_nanosleep_time32
+101 64 nanosleep sys_nanosleep
+102 common getitimer sys_getitimer compat_sys_getitimer
+103 common setitimer sys_setitimer compat_sys_setitimer
+104 common kexec_load sys_kexec_load compat_sys_kexec_load
+105 common init_module sys_init_module
+106 common delete_module sys_delete_module
+107 common timer_create sys_timer_create compat_sys_timer_create
+108 time32 timer_gettime sys_timer_gettime32
+108 64 timer_gettime sys_timer_gettime
+109 common timer_getoverrun sys_timer_getoverrun
+110 time32 timer_settime sys_timer_settime32
+110 64 timer_settime sys_timer_settime
+111 common timer_delete sys_timer_delete
+112 time32 clock_settime sys_clock_settime32
+112 64 clock_settime sys_clock_settime
+113 time32 clock_gettime sys_clock_gettime32
+113 64 clock_gettime sys_clock_gettime
+114 time32 clock_getres sys_clock_getres_time32
+114 64 clock_getres sys_clock_getres
+115 time32 clock_nanosleep sys_clock_nanosleep_time32
+115 64 clock_nanosleep sys_clock_nanosleep
+116 common syslog sys_syslog
+117 common ptrace sys_ptrace compat_sys_ptrace
+118 common sched_setparam sys_sched_setparam
+119 common sched_setscheduler sys_sched_setscheduler
+120 common sched_getscheduler sys_sched_getscheduler
+121 common sched_getparam sys_sched_getparam
+122 common sched_setaffinity sys_sched_setaffinity compat_sys_sched_setaffinity
+123 common sched_getaffinity sys_sched_getaffinity compat_sys_sched_getaffinity
+124 common sched_yield sys_sched_yield
+125 common sched_get_priority_max sys_sched_get_priority_max
+126 common sched_get_priority_min sys_sched_get_priority_min
+127 time32 sched_rr_get_interval sys_sched_rr_get_interval_time32
+127 64 sched_rr_get_interval sys_sched_rr_get_interval
+128 common restart_syscall sys_restart_syscall
+129 common kill sys_kill
+130 common tkill sys_tkill
+131 common tgkill sys_tgkill
+132 common sigaltstack sys_sigaltstack compat_sys_sigaltstack
+133 common rt_sigsuspend sys_rt_sigsuspend compat_sys_rt_sigsuspend
+134 common rt_sigaction sys_rt_sigaction compat_sys_rt_sigaction
+135 common rt_sigprocmask sys_rt_sigprocmask compat_sys_rt_sigprocmask
+136 common rt_sigpending sys_rt_sigpending compat_sys_rt_sigpending
+137 time32 rt_sigtimedwait sys_rt_sigtimedwait_time32 compat_sys_rt_sigtimedwait_time32
+137 64 rt_sigtimedwait sys_rt_sigtimedwait
+138 common rt_sigqueueinfo sys_rt_sigqueueinfo compat_sys_rt_sigqueueinfo
+139 common rt_sigreturn sys_rt_sigreturn compat_sys_rt_sigreturn
+140 common setpriority sys_setpriority
+141 common getpriority sys_getpriority
+142 common reboot sys_reboot
+143 common setregid sys_setregid
+144 common setgid sys_setgid
+145 common setreuid sys_setreuid
+146 common setuid sys_setuid
+147 common setresuid sys_setresuid
+148 common getresuid sys_getresuid
+149 common setresgid sys_setresgid
+150 common getresgid sys_getresgid
+151 common setfsuid sys_setfsuid
+152 common setfsgid sys_setfsgid
+153 common times sys_times compat_sys_times
+154 common setpgid sys_setpgid
+155 common getpgid sys_getpgid
+156 common getsid sys_getsid
+157 common setsid sys_setsid
+158 common getgroups sys_getgroups
+159 common setgroups sys_setgroups
+160 common uname sys_newuname
+161 common sethostname sys_sethostname
+162 common setdomainname sys_setdomainname
+# getrlimit and setrlimit are superseded with prlimit64
+163 rlimit getrlimit sys_getrlimit compat_sys_getrlimit
+164 rlimit setrlimit sys_setrlimit compat_sys_setrlimit
+165 common getrusage sys_getrusage compat_sys_getrusage
+166 common umask sys_umask
+167 common prctl sys_prctl
+168 common getcpu sys_getcpu
+169 time32 gettimeofday sys_gettimeofday compat_sys_gettimeofday
+169 64 gettimeofday sys_gettimeofday
+170 time32 settimeofday sys_settimeofday compat_sys_settimeofday
+170 64 settimeofday sys_settimeofday
+171 time32 adjtimex sys_adjtimex_time32
+171 64 adjtimex sys_adjtimex
+172 common getpid sys_getpid
+173 common getppid sys_getppid
+174 common getuid sys_getuid
+175 common geteuid sys_geteuid
+176 common getgid sys_getgid
+177 common getegid sys_getegid
+178 common gettid sys_gettid
+179 common sysinfo sys_sysinfo compat_sys_sysinfo
+180 common mq_open sys_mq_open compat_sys_mq_open
+181 common mq_unlink sys_mq_unlink
+182 time32 mq_timedsend sys_mq_timedsend_time32
+182 64 mq_timedsend sys_mq_timedsend
+183 time32 mq_timedreceive sys_mq_timedreceive_time32
+183 64 mq_timedreceive sys_mq_timedreceive
+184 common mq_notify sys_mq_notify compat_sys_mq_notify
+185 common mq_getsetattr sys_mq_getsetattr compat_sys_mq_getsetattr
+186 common msgget sys_msgget
+187 common msgctl sys_msgctl compat_sys_msgctl
+188 common msgrcv sys_msgrcv compat_sys_msgrcv
+189 common msgsnd sys_msgsnd compat_sys_msgsnd
+190 common semget sys_semget
+191 common semctl sys_semctl compat_sys_semctl
+192 time32 semtimedop sys_semtimedop_time32
+192 64 semtimedop sys_semtimedop
+193 common semop sys_semop
+194 common shmget sys_shmget
+195 common shmctl sys_shmctl compat_sys_shmctl
+196 common shmat sys_shmat compat_sys_shmat
+197 common shmdt sys_shmdt
+198 common socket sys_socket
+199 common socketpair sys_socketpair
+200 common bind sys_bind
+201 common listen sys_listen
+202 common accept sys_accept
+203 common connect sys_connect
+204 common getsockname sys_getsockname
+205 common getpeername sys_getpeername
+206 common sendto sys_sendto
+207 common recvfrom sys_recvfrom compat_sys_recvfrom
+208 common setsockopt sys_setsockopt sys_setsockopt
+209 common getsockopt sys_getsockopt sys_getsockopt
+210 common shutdown sys_shutdown
+211 common sendmsg sys_sendmsg compat_sys_sendmsg
+212 common recvmsg sys_recvmsg compat_sys_recvmsg
+213 common readahead sys_readahead compat_sys_readahead
+214 common brk sys_brk
+215 common munmap sys_munmap
+216 common mremap sys_mremap
+217 common add_key sys_add_key
+218 common request_key sys_request_key
+219 common keyctl sys_keyctl compat_sys_keyctl
+220 common clone sys_clone
+221 common execve sys_execve compat_sys_execve
+222 32 mmap2 sys_mmap2
+222 64 mmap sys_mmap
+223 32 fadvise64_64 sys_fadvise64_64 compat_sys_fadvise64_64
+223 64 fadvise64 sys_fadvise64_64
+224 common swapon sys_swapon
+225 common swapoff sys_swapoff
+226 common mprotect sys_mprotect
+227 common msync sys_msync
+228 common mlock sys_mlock
+229 common munlock sys_munlock
+230 common mlockall sys_mlockall
+231 common munlockall sys_munlockall
+232 common mincore sys_mincore
+233 common madvise sys_madvise
+234 common remap_file_pages sys_remap_file_pages
+235 common mbind sys_mbind
+236 common get_mempolicy sys_get_mempolicy
+237 common set_mempolicy sys_set_mempolicy
+238 common migrate_pages sys_migrate_pages
+239 common move_pages sys_move_pages
+240 common rt_tgsigqueueinfo sys_rt_tgsigqueueinfo compat_sys_rt_tgsigqueueinfo
+241 common perf_event_open sys_perf_event_open
+242 common accept4 sys_accept4
+243 time32 recvmmsg sys_recvmmsg_time32 compat_sys_recvmmsg_time32
+243 64 recvmmsg sys_recvmmsg
+# Architectures may provide up to 16 syscalls of their own between 244 and 259
+244 arc cacheflush sys_cacheflush
+245 arc arc_settls sys_arc_settls
+246 arc arc_gettls sys_arc_gettls
+247 arc sysfs sys_sysfs
+248 arc arc_usr_cmpxchg sys_arc_usr_cmpxchg
+
+244 csky set_thread_area sys_set_thread_area
+245 csky cacheflush sys_cacheflush
+
+244 nios2 cacheflush sys_cacheflush
+
+244 or1k or1k_atomic sys_or1k_atomic
+
+258 riscv riscv_hwprobe sys_riscv_hwprobe
+259 riscv riscv_flush_icache sys_riscv_flush_icache
+
+260 time32 wait4 sys_wait4 compat_sys_wait4
+260 64 wait4 sys_wait4
+261 common prlimit64 sys_prlimit64
+262 common fanotify_init sys_fanotify_init
+263 common fanotify_mark sys_fanotify_mark
+264 common name_to_handle_at sys_name_to_handle_at
+265 common open_by_handle_at sys_open_by_handle_at
+266 time32 clock_adjtime sys_clock_adjtime32
+266 64 clock_adjtime sys_clock_adjtime
+267 common syncfs sys_syncfs
+268 common setns sys_setns
+269 common sendmmsg sys_sendmmsg compat_sys_sendmmsg
+270 common process_vm_readv sys_process_vm_readv
+271 common process_vm_writev sys_process_vm_writev
+272 common kcmp sys_kcmp
+273 common finit_module sys_finit_module
+274 common sched_setattr sys_sched_setattr
+275 common sched_getattr sys_sched_getattr
+276 common renameat2 sys_renameat2
+277 common seccomp sys_seccomp
+278 common getrandom sys_getrandom
+279 common memfd_create sys_memfd_create
+280 common bpf sys_bpf
+281 common execveat sys_execveat compat_sys_execveat
+282 common userfaultfd sys_userfaultfd
+283 common membarrier sys_membarrier
+284 common mlock2 sys_mlock2
+285 common copy_file_range sys_copy_file_range
+286 common preadv2 sys_preadv2 compat_sys_preadv2
+287 common pwritev2 sys_pwritev2 compat_sys_pwritev2
+288 common pkey_mprotect sys_pkey_mprotect
+289 common pkey_alloc sys_pkey_alloc
+290 common pkey_free sys_pkey_free
+291 common statx sys_statx
+292 time32 io_pgetevents sys_io_pgetevents_time32 compat_sys_io_pgetevents
+292 64 io_pgetevents sys_io_pgetevents
+293 common rseq sys_rseq
+294 common kexec_file_load sys_kexec_file_load
+# 295 through 402 are unassigned to sync up with generic numbers don't use
+403 32 clock_gettime64 sys_clock_gettime
+404 32 clock_settime64 sys_clock_settime
+405 32 clock_adjtime64 sys_clock_adjtime
+406 32 clock_getres_time64 sys_clock_getres
+407 32 clock_nanosleep_time64 sys_clock_nanosleep
+408 32 timer_gettime64 sys_timer_gettime
+409 32 timer_settime64 sys_timer_settime
+410 32 timerfd_gettime64 sys_timerfd_gettime
+411 32 timerfd_settime64 sys_timerfd_settime
+412 32 utimensat_time64 sys_utimensat
+413 32 pselect6_time64 sys_pselect6 compat_sys_pselect6_time64
+414 32 ppoll_time64 sys_ppoll compat_sys_ppoll_time64
+416 32 io_pgetevents_time64 sys_io_pgetevents compat_sys_io_pgetevents_time64
+417 32 recvmmsg_time64 sys_recvmmsg compat_sys_recvmmsg_time64
+418 32 mq_timedsend_time64 sys_mq_timedsend
+419 32 mq_timedreceive_time64 sys_mq_timedreceive
+420 32 semtimedop_time64 sys_semtimedop
+421 32 rt_sigtimedwait_time64 sys_rt_sigtimedwait compat_sys_rt_sigtimedwait_time64
+422 32 futex_time64 sys_futex
+423 32 sched_rr_get_interval_time64 sys_sched_rr_get_interval
+424 common pidfd_send_signal sys_pidfd_send_signal
+425 common io_uring_setup sys_io_uring_setup
+426 common io_uring_enter sys_io_uring_enter
+427 common io_uring_register sys_io_uring_register
+428 common open_tree sys_open_tree
+429 common move_mount sys_move_mount
+430 common fsopen sys_fsopen
+431 common fsconfig sys_fsconfig
+432 common fsmount sys_fsmount
+433 common fspick sys_fspick
+434 common pidfd_open sys_pidfd_open
+435 common clone3 sys_clone3
+436 common close_range sys_close_range
+437 common openat2 sys_openat2
+438 common pidfd_getfd sys_pidfd_getfd
+439 common faccessat2 sys_faccessat2
+440 common process_madvise sys_process_madvise
+441 common epoll_pwait2 sys_epoll_pwait2 compat_sys_epoll_pwait2
+442 common mount_setattr sys_mount_setattr
+443 common quotactl_fd sys_quotactl_fd
+444 common landlock_create_ruleset sys_landlock_create_ruleset
+445 common landlock_add_rule sys_landlock_add_rule
+446 common landlock_restrict_self sys_landlock_restrict_self
+447 memfd_secret memfd_secret sys_memfd_secret
+448 common process_mrelease sys_process_mrelease
+449 common futex_waitv sys_futex_waitv
+450 common set_mempolicy_home_node sys_set_mempolicy_home_node
+451 common cachestat sys_cachestat
+452 common fchmodat2 sys_fchmodat2
+453 common map_shadow_stack sys_map_shadow_stack
+454 common futex_wake sys_futex_wake
+455 common futex_wait sys_futex_wait
+456 common futex_requeue sys_futex_requeue
+457 common statmount sys_statmount
+458 common listmount sys_listmount
+459 common lsm_get_self_attr sys_lsm_get_self_attr
+460 common lsm_set_self_attr sys_lsm_set_self_attr
+461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/testing/cxl/cxl_core_exports.c b/tools/testing/cxl/cxl_core_exports.c
index 077e6883921d..f088792a8925 100644
--- a/tools/testing/cxl/cxl_core_exports.c
+++ b/tools/testing/cxl/cxl_core_exports.c
@@ -4,4 +4,4 @@
#include "cxl.h"
/* Exporting of cxl_core symbols that are only used by cxl_test */
-EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, CXL);
+EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, "CXL");
diff --git a/tools/testing/cxl/test/cxl.c b/tools/testing/cxl/test/cxl.c
index 050725afa45d..d0337c11f9ee 100644
--- a/tools/testing/cxl/test/cxl.c
+++ b/tools/testing/cxl/test/cxl.c
@@ -1531,5 +1531,5 @@ MODULE_PARM_DESC(interleave_arithmetic, "Modulo:0, XOR:1");
module_init(cxl_test_init);
module_exit(cxl_test_exit);
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(ACPI);
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("ACPI");
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/cxl/test/mem.c b/tools/testing/cxl/test/mem.c
index 71916e0e1546..347c1e7b37bd 100644
--- a/tools/testing/cxl/test/mem.c
+++ b/tools/testing/cxl/test/mem.c
@@ -1679,4 +1679,4 @@ static struct platform_driver cxl_mock_mem_driver = {
module_platform_driver(cxl_mock_mem_driver);
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/cxl/test/mock.c b/tools/testing/cxl/test/mock.c
index f4ce96cc11d4..450c7566c33f 100644
--- a/tools/testing/cxl/test/mock.c
+++ b/tools/testing/cxl/test/mock.c
@@ -76,7 +76,7 @@ int __wrap_acpi_table_parse_cedt(enum acpi_cedt_type id,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, ACPI);
+EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, "ACPI");
acpi_status __wrap_acpi_evaluate_integer(acpi_handle handle,
acpi_string pathname,
@@ -147,7 +147,7 @@ struct cxl_hdm *__wrap_devm_cxl_setup_hdm(struct cxl_port *port,
return cxlhdm;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, "CXL");
int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port)
{
@@ -162,7 +162,7 @@ int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, "CXL");
int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm,
struct cxl_endpoint_dvsec_info *info)
@@ -179,7 +179,7 @@ int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, "CXL");
int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port)
{
@@ -194,7 +194,7 @@ int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, "CXL");
int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds)
{
@@ -209,7 +209,7 @@ int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, "CXL");
int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds,
struct cxl_hdm *cxlhdm,
@@ -226,7 +226,7 @@ int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, "CXL");
int __wrap_cxl_dvsec_rr_decode(struct device *dev, struct cxl_port *port,
struct cxl_endpoint_dvsec_info *info)
@@ -242,7 +242,7 @@ int __wrap_cxl_dvsec_rr_decode(struct device *dev, struct cxl_port *port,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, "CXL");
struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port,
struct device *dport_dev,
@@ -266,7 +266,7 @@ struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port,
return dport;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, "CXL");
resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev,
struct cxl_dport *dport)
@@ -283,7 +283,7 @@ resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev,
return component_reg_phys;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, "CXL");
void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port)
{
@@ -297,7 +297,7 @@ void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port)
cxl_endpoint_parse_cdat(port);
put_cxl_mock_ops(index);
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, "CXL");
void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device *host)
{
@@ -309,8 +309,8 @@ void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device
put_cxl_mock_ops(index);
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, "CXL");
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(ACPI);
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("ACPI");
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/ktest/examples/include/defaults.conf b/tools/testing/ktest/examples/include/defaults.conf
index 63a1a83f4f0b..f6d8517a471e 100644
--- a/tools/testing/ktest/examples/include/defaults.conf
+++ b/tools/testing/ktest/examples/include/defaults.conf
@@ -46,7 +46,7 @@ CLEAR_LOG = 1
SSH_USER = root
-# For accesing the machine, we will ssh to root@machine.
+# For accessing the machine, we will ssh to root@machine.
SSH := ssh ${SSH_USER}@${MACHINE}
# Update this. The default here is ktest will ssh to the target box
diff --git a/tools/testing/ktest/ktest.pl b/tools/testing/ktest/ktest.pl
index dacad94e2be4..8c8da966c641 100755
--- a/tools/testing/ktest/ktest.pl
+++ b/tools/testing/ktest/ktest.pl
@@ -1245,7 +1245,7 @@ sub __read_config {
# Config variables are only active while reading the
# config and can be defined anywhere. They also ignore
# TEST_START and DEFAULTS, but are skipped if they are in
- # on of these sections that have SKIP defined.
+ # one of these sections that have SKIP defined.
# The save variable can be
# defined multiple times and the new one simply overrides
# the previous one.
@@ -2419,6 +2419,11 @@ sub get_version {
return if ($have_version);
doprint "$make kernelrelease ... ";
$version = `$make -s kernelrelease | tail -1`;
+ if (!length($version)) {
+ run_command "$make allnoconfig" or return 0;
+ doprint "$make kernelrelease ... ";
+ $version = `$make -s kernelrelease | tail -1`;
+ }
chomp($version);
doprint "$version\n";
$have_version = 1;
@@ -2960,8 +2965,6 @@ sub run_bisect_test {
my $failed = 0;
my $result;
- my $output;
- my $ret;
$in_bisect = 1;
diff --git a/tools/testing/kunit/kunit.py b/tools/testing/kunit/kunit.py
index 676fa99a8b19..7f9ae55fd6d5 100755
--- a/tools/testing/kunit/kunit.py
+++ b/tools/testing/kunit/kunit.py
@@ -312,7 +312,16 @@ def massage_argv(argv: Sequence[str]) -> Sequence[str]:
return list(map(massage_arg, argv))
def get_default_jobs() -> int:
- return len(os.sched_getaffinity(0))
+ if sys.version_info >= (3, 13):
+ if (ncpu := os.process_cpu_count()) is not None:
+ return ncpu
+ raise RuntimeError("os.process_cpu_count() returned None")
+ # See https://github.com/python/cpython/blob/b61fece/Lib/os.py#L1175-L1186.
+ if sys.platform != "darwin":
+ return len(os.sched_getaffinity(0))
+ if (ncpu := os.cpu_count()) is not None:
+ return ncpu
+ raise RuntimeError("os.cpu_count() returned None")
def add_common_opts(parser: argparse.ArgumentParser) -> None:
parser.add_argument('--build_dir',
diff --git a/tools/testing/kunit/kunit_kernel.py b/tools/testing/kunit/kunit_kernel.py
index e76d7894b6c5..d30f90eae9a4 100644
--- a/tools/testing/kunit/kunit_kernel.py
+++ b/tools/testing/kunit/kunit_kernel.py
@@ -125,6 +125,9 @@ class LinuxSourceTreeOperationsQemu(LinuxSourceTreeOperations):
'-append', ' '.join(params + [self._kernel_command_line]),
'-no-reboot',
'-nographic',
+ '-accel', 'kvm',
+ '-accel', 'hvf',
+ '-accel', 'tcg',
'-serial', self._serial] + self._extra_qemu_params
# Note: shlex.join() does what we want, but requires python 3.8+.
print('Running tests with:\n$', ' '.join(shlex.quote(arg) for arg in qemu_command))
diff --git a/tools/testing/kunit/qemu_configs/arm64.py b/tools/testing/kunit/qemu_configs/arm64.py
index d3ff27024755..5c44d3a87e6d 100644
--- a/tools/testing/kunit/qemu_configs/arm64.py
+++ b/tools/testing/kunit/qemu_configs/arm64.py
@@ -9,4 +9,4 @@ CONFIG_SERIAL_AMBA_PL011_CONSOLE=y''',
qemu_arch='aarch64',
kernel_path='arch/arm64/boot/Image.gz',
kernel_command_line='console=ttyAMA0',
- extra_qemu_params=['-machine', 'virt', '-cpu', 'max,pauth-impdef=on'])
+ extra_qemu_params=['-machine', 'virt', '-cpu', 'max'])
diff --git a/tools/testing/nvdimm/test/ndtest.c b/tools/testing/nvdimm/test/ndtest.c
index 892e990c034a..68a064ce598c 100644
--- a/tools/testing/nvdimm/test/ndtest.c
+++ b/tools/testing/nvdimm/test/ndtest.c
@@ -883,7 +883,7 @@ static const struct platform_device_id ndtest_id[] = {
static struct platform_driver ndtest_driver = {
.probe = ndtest_probe,
- .remove_new = ndtest_remove,
+ .remove = ndtest_remove,
.driver = {
.name = KBUILD_MODNAME,
},
diff --git a/tools/testing/selftests/acct/acct_syscall.c b/tools/testing/selftests/acct/acct_syscall.c
index e44e8fe1f4a3..87c044fb9293 100644
--- a/tools/testing/selftests/acct/acct_syscall.c
+++ b/tools/testing/selftests/acct/acct_syscall.c
@@ -24,7 +24,7 @@ int main(void)
// Check if test is run a root
if (geteuid()) {
- ksft_test_result_skip("This test needs root to run!\n");
+ ksft_exit_skip("This test needs root to run!\n");
return 1;
}
diff --git a/tools/testing/selftests/alsa/Makefile b/tools/testing/selftests/alsa/Makefile
index 944279160fed..8dab90ad22bb 100644
--- a/tools/testing/selftests/alsa/Makefile
+++ b/tools/testing/selftests/alsa/Makefile
@@ -27,5 +27,5 @@ include ../lib.mk
$(OUTPUT)/libatest.so: conf.c alsa-local.h
$(CC) $(CFLAGS) -shared -fPIC $< $(LDLIBS) -o $@
-$(OUTPUT)/%: %.c $(TEST_GEN_PROGS_EXTENDED) alsa-local.h
+$(OUTPUT)/%: %.c $(OUTPUT)/libatest.so alsa-local.h
$(CC) $(CFLAGS) $< $(LDLIBS) -latest -o $@
diff --git a/tools/testing/selftests/arm64/abi/hwcap.c b/tools/testing/selftests/arm64/abi/hwcap.c
index 0029ed9c5c9a..35f521e5f41c 100644
--- a/tools/testing/selftests/arm64/abi/hwcap.c
+++ b/tools/testing/selftests/arm64/abi/hwcap.c
@@ -46,6 +46,12 @@ static void atomics_sigill(void)
asm volatile(".inst 0xb82003ff" : : : );
}
+static void cmpbr_sigill(void)
+{
+ /* Not implemented, too complicated and unreliable anyway */
+}
+
+
static void crc32_sigill(void)
{
/* CRC32W W0, W0, W1 */
@@ -82,6 +88,18 @@ static void f8fma_sigill(void)
asm volatile(".inst 0xec0fc00");
}
+static void f8mm4_sigill(void)
+{
+ /* FMMLA V0.4SH, V0.16B, V0.16B */
+ asm volatile(".inst 0x6e00ec00");
+}
+
+static void f8mm8_sigill(void)
+{
+ /* FMMLA V0.4S, V0.16B, V0.16B */
+ asm volatile(".inst 0x6e80ec00");
+}
+
static void faminmax_sigill(void)
{
/* FAMIN V0.4H, V0.4H, V0.4H */
@@ -98,6 +116,12 @@ static void fpmr_sigill(void)
asm volatile("mrs x0, S3_3_C4_C4_2" : : : "x0");
}
+static void fprcvt_sigill(void)
+{
+ /* FCVTAS S0, H0 */
+ asm volatile(".inst 0x1efa0000");
+}
+
static void gcs_sigill(void)
{
unsigned long *gcspr;
@@ -226,6 +250,42 @@ static void sme2p1_sigill(void)
asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
}
+static void sme2p2_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* UXTB Z0.D, P0/Z, Z0.D */
+ asm volatile(".inst 0x4c1a000" : : : );
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void sme_aes_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* AESD z0.b, z0.b, z0.b */
+ asm volatile(".inst 0x4522e400" : : : "z0");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void sme_sbitperm_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* BDEP Z0.B, Z0.B, Z0.B */
+ asm volatile(".inst 0x4500b400" : : : "z0");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
static void smei16i32_sigill(void)
{
/* SMSTART */
@@ -339,8 +399,44 @@ static void smesf8fma_sigill(void)
/* SMSTART */
asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
- /* FMLALB V0.8H, V0.16B, V0.16B */
- asm volatile(".inst 0xec0fc00");
+ /* FMLALB Z0.8H, Z0.B, Z0.B */
+ asm volatile(".inst 0x64205000");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smesfexpa_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* FEXPA Z0.D, Z0.D */
+ asm volatile(".inst 0x04e0b800");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smesmop4_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* SMOP4A ZA0.S, Z0.B, { Z0.B - Z1.B } */
+ asm volatile(".inst 0x80108000");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smestmop_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* STMOPA ZA0.S, { Z0.H - Z1.H }, Z0.H, Z20[0] */
+ asm volatile(".inst 0x80408008");
/* SMSTOP */
asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
@@ -364,18 +460,42 @@ static void sve2p1_sigill(void)
asm volatile(".inst 0x65000000" : : : "z0");
}
+static void sve2p2_sigill(void)
+{
+ /* NOT Z0.D, P0/Z, Z0.D */
+ asm volatile(".inst 0x4cea000" : : : "z0");
+}
+
static void sveaes_sigill(void)
{
/* AESD z0.b, z0.b, z0.b */
asm volatile(".inst 0x4522e400" : : : "z0");
}
+static void sveaes2_sigill(void)
+{
+ /* AESD {Z0.B - Z1.B }, { Z0.B - Z1.B }, Z0.Q */
+ asm volatile(".inst 0x4522ec00" : : : "z0");
+}
+
static void sveb16b16_sigill(void)
{
/* BFADD Z0.H, Z0.H, Z0.H */
asm volatile(".inst 0x65000000" : : : );
}
+static void svebfscale_sigill(void)
+{
+ /* BFSCALE Z0.H, P0/M, Z0.H, Z0.H */
+ asm volatile(".inst 0x65098000" : : : "z0");
+}
+
+static void svef16mm_sigill(void)
+{
+ /* FMMLA Z0.S, Z0.H, Z0.H */
+ asm volatile(".inst 0x6420e400");
+}
+
static void svepmull_sigill(void)
{
/* PMULLB Z0.Q, Z0.D, Z0.D */
@@ -394,6 +514,12 @@ static void svesha3_sigill(void)
asm volatile(".inst 0x4203800" : : : "z0");
}
+static void sveeltperm_sigill(void)
+{
+ /* COMPACT Z0.B, P0, Z0.B */
+ asm volatile(".inst 0x5218000" : : : "x0");
+}
+
static void svesm4_sigill(void)
{
/* SM4E Z0.S, Z0.S, Z0.S */
@@ -470,6 +596,13 @@ static const struct hwcap_data {
.sigill_fn = aes_sigill,
},
{
+ .name = "CMPBR",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_CMPBR,
+ .cpuinfo = "cmpbr",
+ .sigill_fn = cmpbr_sigill,
+ },
+ {
.name = "CRC32",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_CRC32,
@@ -524,6 +657,20 @@ static const struct hwcap_data {
.sigill_fn = f8fma_sigill,
},
{
+ .name = "F8MM8",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_F8MM8,
+ .cpuinfo = "f8mm8",
+ .sigill_fn = f8mm8_sigill,
+ },
+ {
+ .name = "F8MM4",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_F8MM4,
+ .cpuinfo = "f8mm4",
+ .sigill_fn = f8mm4_sigill,
+ },
+ {
.name = "FAMINMAX",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_FAMINMAX,
@@ -546,6 +693,13 @@ static const struct hwcap_data {
.sigill_reliable = true,
},
{
+ .name = "FPRCVT",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_FPRCVT,
+ .cpuinfo = "fprcvt",
+ .sigill_fn = fprcvt_sigill,
+ },
+ {
.name = "GCS",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_GCS,
@@ -692,6 +846,20 @@ static const struct hwcap_data {
.sigill_fn = sme2p1_sigill,
},
{
+ .name = "SME 2.2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME2P2,
+ .cpuinfo = "sme2p2",
+ .sigill_fn = sme2p2_sigill,
+ },
+ {
+ .name = "SME AES",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_AES,
+ .cpuinfo = "smeaes",
+ .sigill_fn = sme_aes_sigill,
+ },
+ {
.name = "SME I16I32",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SME_I16I32,
@@ -741,6 +909,13 @@ static const struct hwcap_data {
.sigill_fn = smelutv2_sigill,
},
{
+ .name = "SME SBITPERM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SBITPERM,
+ .cpuinfo = "smesbitperm",
+ .sigill_fn = sme_sbitperm_sigill,
+ },
+ {
.name = "SME SF8FMA",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SME_SF8FMA,
@@ -762,6 +937,27 @@ static const struct hwcap_data {
.sigill_fn = smesf8dp4_sigill,
},
{
+ .name = "SME SFEXPA",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SFEXPA,
+ .cpuinfo = "smesfexpa",
+ .sigill_fn = smesfexpa_sigill,
+ },
+ {
+ .name = "SME SMOP4",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SMOP4,
+ .cpuinfo = "smesmop4",
+ .sigill_fn = smesmop4_sigill,
+ },
+ {
+ .name = "SME STMOP",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_STMOP,
+ .cpuinfo = "smestmop",
+ .sigill_fn = smestmop_sigill,
+ },
+ {
.name = "SVE",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_SVE,
@@ -784,6 +980,13 @@ static const struct hwcap_data {
.sigill_fn = sve2p1_sigill,
},
{
+ .name = "SVE 2.2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE2P2,
+ .cpuinfo = "sve2p2",
+ .sigill_fn = sve2p2_sigill,
+ },
+ {
.name = "SVE AES",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SVEAES,
@@ -791,6 +994,34 @@ static const struct hwcap_data {
.sigill_fn = sveaes_sigill,
},
{
+ .name = "SVE AES2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_AES2,
+ .cpuinfo = "sveaes2",
+ .sigill_fn = sveaes2_sigill,
+ },
+ {
+ .name = "SVE BFSCALE",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_BFSCALE,
+ .cpuinfo = "svebfscale",
+ .sigill_fn = svebfscale_sigill,
+ },
+ {
+ .name = "SVE ELTPERM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_ELTPERM,
+ .cpuinfo = "sveeltperm",
+ .sigill_fn = sveeltperm_sigill,
+ },
+ {
+ .name = "SVE F16MM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_F16MM,
+ .cpuinfo = "svef16mm",
+ .sigill_fn = svef16mm_sigill,
+ },
+ {
.name = "SVE2 B16B16",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SVE_B16B16,
diff --git a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
index df3230fdac39..66ab2e0bae5f 100644
--- a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
+++ b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
@@ -81,32 +81,31 @@ do_syscall:
stp x27, x28, [sp, #96]
// Set SVCR if we're doing SME
- cbz x1, 1f
+ cbz x1, load_gpr
adrp x2, svcr_in
ldr x2, [x2, :lo12:svcr_in]
msr S3_3_C4_C2_2, x2
-1:
// Load ZA and ZT0 if enabled - uses x12 as scratch due to SME LDR
- tbz x2, #SVCR_ZA_SHIFT, 1f
+ tbz x2, #SVCR_ZA_SHIFT, load_gpr
mov w12, #0
ldr x2, =za_in
-2: _ldr_za 12, 2
+1: _ldr_za 12, 2
add x2, x2, x1
add x12, x12, #1
cmp x1, x12
- bne 2b
+ bne 1b
// ZT0
mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1
ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \
#ID_AA64SMFR0_EL1_SMEver_WIDTH
- cbz x2, 1f
+ cbz x2, load_gpr
adrp x2, zt_in
add x2, x2, :lo12:zt_in
_ldr_zt 2
-1:
+load_gpr:
// Load GPRs x8-x28, and save our SP/FP for later comparison
ldr x2, =gpr_in
add x2, x2, #64
@@ -125,9 +124,9 @@ do_syscall:
str x30, [x2], #8 // LR
// Load FPRs if we're not doing neither SVE nor streaming SVE
- cbnz x0, 1f
+ cbnz x0, check_sve_in
ldr x2, =svcr_in
- tbnz x2, #SVCR_SM_SHIFT, 1f
+ tbnz x2, #SVCR_SM_SHIFT, check_sve_in
ldr x2, =fpr_in
ldp q0, q1, [x2]
@@ -148,8 +147,8 @@ do_syscall:
ldp q30, q31, [x2, #16 * 30]
b 2f
-1:
+check_sve_in:
// Load the SVE registers if we're doing SVE/SME
ldr x2, =z_in
@@ -256,32 +255,31 @@ do_syscall:
stp q30, q31, [x2, #16 * 30]
// Save SVCR if we're doing SME
- cbz x1, 1f
+ cbz x1, check_sve_out
mrs x2, S3_3_C4_C2_2
adrp x3, svcr_out
str x2, [x3, :lo12:svcr_out]
-1:
// Save ZA if it's enabled - uses x12 as scratch due to SME STR
- tbz x2, #SVCR_ZA_SHIFT, 1f
+ tbz x2, #SVCR_ZA_SHIFT, check_sve_out
mov w12, #0
ldr x2, =za_out
-2: _str_za 12, 2
+1: _str_za 12, 2
add x2, x2, x1
add x12, x12, #1
cmp x1, x12
- bne 2b
+ bne 1b
// ZT0
mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1
ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \
#ID_AA64SMFR0_EL1_SMEver_WIDTH
- cbz x2, 1f
+ cbz x2, check_sve_out
adrp x2, zt_out
add x2, x2, :lo12:zt_out
_str_zt 2
-1:
+check_sve_out:
// Save the SVE state if we have some
cbz x0, 1f
diff --git a/tools/testing/selftests/arm64/fp/kernel-test.c b/tools/testing/selftests/arm64/fp/kernel-test.c
index 859345379044..348e8bef62c7 100644
--- a/tools/testing/selftests/arm64/fp/kernel-test.c
+++ b/tools/testing/selftests/arm64/fp/kernel-test.c
@@ -46,8 +46,7 @@ static void handle_kick_signal(int sig, siginfo_t *info, void *context)
}
static char *drivers[] = {
- "crct10dif-arm64-ce",
- /* "crct10dif-arm64-neon", - Same priority as generic */
+ "crct10dif-arm64",
"sha1-ce",
"sha224-arm64",
"sha224-arm64-neon",
diff --git a/tools/testing/selftests/bpf/.gitignore b/tools/testing/selftests/bpf/.gitignore
index c2a1842c3d8b..e2a2c46c008b 100644
--- a/tools/testing/selftests/bpf/.gitignore
+++ b/tools/testing/selftests/bpf/.gitignore
@@ -5,7 +5,6 @@ bpf-syscall*
test_verifier
test_maps
test_lru_map
-test_lpm_map
test_tag
FEATURE-DUMP.libbpf
FEATURE-DUMP.selftests
@@ -19,7 +18,6 @@ feature
urandom_read
test_sockmap
test_lirc_mode2_user
-test_flow_dissector
flow_dissector_load
test_tcpnotify_user
test_libbpf
diff --git a/tools/testing/selftests/bpf/Makefile b/tools/testing/selftests/bpf/Makefile
index 6ad3b1ba1920..87551628e112 100644
--- a/tools/testing/selftests/bpf/Makefile
+++ b/tools/testing/selftests/bpf/Makefile
@@ -41,7 +41,7 @@ srctree := $(patsubst %/,%,$(dir $(srctree)))
srctree := $(patsubst %/,%,$(dir $(srctree)))
endif
-CFLAGS += -g $(OPT_FLAGS) -rdynamic \
+CFLAGS += -g $(OPT_FLAGS) -rdynamic -std=gnu11 \
-Wall -Werror -fno-omit-frame-pointer \
$(GENFLAGS) $(SAN_CFLAGS) $(LIBELF_CFLAGS) \
-I$(CURDIR) -I$(INCLUDE_DIR) -I$(GENDIR) -I$(LIBDIR) \
@@ -54,21 +54,6 @@ PCAP_LIBS := $(shell $(PKG_CONFIG) --libs libpcap 2>/dev/null)
LDLIBS += $(PCAP_LIBS)
CFLAGS += $(PCAP_CFLAGS)
-# The following tests perform type punning and they may break strict
-# aliasing rules, which are exploited by both GCC and clang by default
-# while optimizing. This can lead to broken programs.
-progs/bind4_prog.c-CFLAGS := -fno-strict-aliasing
-progs/bind6_prog.c-CFLAGS := -fno-strict-aliasing
-progs/dynptr_fail.c-CFLAGS := -fno-strict-aliasing
-progs/linked_list_fail.c-CFLAGS := -fno-strict-aliasing
-progs/map_kptr_fail.c-CFLAGS := -fno-strict-aliasing
-progs/syscall.c-CFLAGS := -fno-strict-aliasing
-progs/test_pkt_md_access.c-CFLAGS := -fno-strict-aliasing
-progs/test_sk_lookup.c-CFLAGS := -fno-strict-aliasing
-progs/timer_crash.c-CFLAGS := -fno-strict-aliasing
-progs/test_global_func9.c-CFLAGS := -fno-strict-aliasing
-progs/verifier_nocsr.c-CFLAGS := -fno-strict-aliasing
-
# Some utility functions use LLVM libraries
jit_disasm_helpers.c-CFLAGS = $(LLVM_CFLAGS)
@@ -83,7 +68,7 @@ CLANG_CPUV4 := 1
endif
# Order correspond to 'make run_tests' order
-TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_lpm_map test_progs \
+TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_progs \
test_sockmap \
test_tcpnotify_user test_sysctl \
test_progs-no_alu32
@@ -103,18 +88,6 @@ progs/btf_dump_test_case_packing.c-bpf_gcc-CFLAGS := -Wno-error
progs/btf_dump_test_case_padding.c-bpf_gcc-CFLAGS := -Wno-error
progs/btf_dump_test_case_syntax.c-bpf_gcc-CFLAGS := -Wno-error
-# The following tests do type-punning, via the __imm_insn macro, from
-# `struct bpf_insn' to long and then uses the value. This triggers an
-# "is used uninitialized" warning in GCC due to strict-aliasing
-# rules.
-progs/verifier_ref_tracking.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_unpriv.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_cgroup_storage.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_ld_ind.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_map_ret_val.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_spill_fill.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_subprog_precision.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
-progs/verifier_uninit.c-bpf_gcc-CFLAGS := -fno-strict-aliasing
endif
ifneq ($(CLANG_CPUV4),)
@@ -127,13 +100,10 @@ TEST_FILES = xsk_prereqs.sh $(wildcard progs/btf_dump_test_case_*.c)
# Order correspond to 'make run_tests' order
TEST_PROGS := test_kmod.sh \
- test_xdp_redirect.sh \
test_xdp_redirect_multi.sh \
- test_xdp_meta.sh \
test_tunnel.sh \
test_lwt_seg6local.sh \
test_lirc_mode2.sh \
- test_flow_dissector.sh \
test_xdp_vlan_mode_generic.sh \
test_xdp_vlan_mode_native.sh \
test_lwt_ip_encap.sh \
@@ -151,17 +121,16 @@ TEST_PROGS_EXTENDED := with_addr.sh \
with_tunnels.sh ima_setup.sh verify_sig_setup.sh \
test_xdp_vlan.sh test_bpftool.py
+TEST_KMODS := bpf_testmod.ko bpf_test_no_cfi.ko bpf_test_modorder_x.ko \
+ bpf_test_modorder_y.ko
+TEST_KMOD_TARGETS = $(addprefix $(OUTPUT)/,$(TEST_KMODS))
+
# Compile but not part of 'make run_tests'
TEST_GEN_PROGS_EXTENDED = \
bench \
- bpf_testmod.ko \
- bpf_test_modorder_x.ko \
- bpf_test_modorder_y.ko \
- bpf_test_no_cfi.ko \
flow_dissector_load \
runqslower \
test_cpp \
- test_flow_dissector \
test_lirc_mode2_user \
veristat \
xdp_features \
@@ -184,8 +153,9 @@ override define CLEAN
$(Q)$(RM) -r $(TEST_GEN_PROGS)
$(Q)$(RM) -r $(TEST_GEN_PROGS_EXTENDED)
$(Q)$(RM) -r $(TEST_GEN_FILES)
+ $(Q)$(RM) -r $(TEST_KMODS)
$(Q)$(RM) -r $(EXTRA_CLEAN)
- $(Q)$(MAKE) -C bpf_testmod clean
+ $(Q)$(MAKE) -C test_kmods clean
$(Q)$(MAKE) docs-clean
endef
@@ -203,9 +173,9 @@ ifeq ($(shell expr $(MAKE_VERSION) \>= 4.4), 1)
$(let OUTPUT,$(OUTPUT)/,\
$(eval include ../../../build/Makefile.feature))
else
-OUTPUT := $(OUTPUT)/
+override OUTPUT := $(OUTPUT)/
$(eval include ../../../build/Makefile.feature)
-OUTPUT := $(patsubst %/,%,$(OUTPUT))
+override OUTPUT := $(patsubst %/,%,$(OUTPUT))
endif
endif
@@ -251,7 +221,7 @@ endif
# to build individual tests.
# NOTE: Semicolon at the end is critical to override lib.mk's default static
# rule for binaries.
-$(notdir $(TEST_GEN_PROGS) \
+$(notdir $(TEST_GEN_PROGS) $(TEST_KMODS) \
$(TEST_GEN_PROGS_EXTENDED)): %: $(OUTPUT)/% ;
# sort removes libbpf duplicates when not cross-building
@@ -305,37 +275,19 @@ $(OUTPUT)/sign-file: ../../../../scripts/sign-file.c
$< -o $@ \
$(shell $(PKG_CONFIG) --libs libcrypto 2> /dev/null || echo -lcrypto)
-$(OUTPUT)/bpf_testmod.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_testmod/Makefile bpf_testmod/*.[ch])
- $(call msg,MOD,,$@)
- $(Q)$(RM) bpf_testmod/bpf_testmod.ko # force re-compilation
- $(Q)$(MAKE) $(submake_extras) -C bpf_testmod \
- RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \
- EXTRA_CFLAGS='' EXTRA_LDFLAGS=''
- $(Q)cp bpf_testmod/bpf_testmod.ko $@
-
-$(OUTPUT)/bpf_test_no_cfi.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_no_cfi/Makefile bpf_test_no_cfi/*.[ch])
- $(call msg,MOD,,$@)
- $(Q)$(RM) bpf_test_no_cfi/bpf_test_no_cfi.ko # force re-compilation
- $(Q)$(MAKE) $(submake_extras) -C bpf_test_no_cfi \
- RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \
+# This should really be a grouped target, but make versions before 4.3 don't
+# support that for regular rules. However, pattern matching rules are implicitly
+# treated as grouped even with older versions of make, so as a workaround, the
+# subst() turns the rule into a pattern matching rule
+$(addprefix test_kmods/,$(subst .ko,%ko,$(TEST_KMODS))): $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard test_kmods/Makefile test_kmods/*.[ch])
+ $(Q)$(RM) test_kmods/*.ko test_kmods/*.mod.o # force re-compilation
+ $(Q)$(MAKE) $(submake_extras) -C test_kmods \
+ RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \
EXTRA_CFLAGS='' EXTRA_LDFLAGS=''
- $(Q)cp bpf_test_no_cfi/bpf_test_no_cfi.ko $@
-$(OUTPUT)/bpf_test_modorder_x.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_modorder_x/Makefile bpf_test_modorder_x/*.[ch])
+$(TEST_KMOD_TARGETS): $(addprefix test_kmods/,$(TEST_KMODS))
$(call msg,MOD,,$@)
- $(Q)$(RM) bpf_test_modorder_x/bpf_test_modorder_x.ko # force re-compilation
- $(Q)$(MAKE) $(submake_extras) -C bpf_test_modorder_x \
- RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \
- EXTRA_CFLAGS='' EXTRA_LDFLAGS=''
- $(Q)cp bpf_test_modorder_x/bpf_test_modorder_x.ko $@
-
-$(OUTPUT)/bpf_test_modorder_y.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_modorder_y/Makefile bpf_test_modorder_y/*.[ch])
- $(call msg,MOD,,$@)
- $(Q)$(RM) bpf_test_modorder_y/bpf_test_modorder_y.ko # force re-compilation
- $(Q)$(MAKE) $(submake_extras) -C bpf_test_modorder_y \
- RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \
- EXTRA_CFLAGS='' EXTRA_LDFLAGS=''
- $(Q)cp bpf_test_modorder_y/bpf_test_modorder_y.ko $@
+ $(Q)cp test_kmods/$(@F) $@
DEFAULT_BPFTOOL := $(HOST_SCRATCH_DIR)/sbin/bpftool
@@ -480,10 +432,10 @@ $(shell $(1) $(2) -dM -E - </dev/null | grep -E 'MIPS(EL|EB)|_MIPS_SZ(PTR|LONG)
endef
# Determine target endianness.
-IS_LITTLE_ENDIAN = $(shell $(CC) -dM -E - </dev/null | \
+IS_LITTLE_ENDIAN := $(shell $(CC) -dM -E - </dev/null | \
grep 'define __BYTE_ORDER__ __ORDER_LITTLE_ENDIAN__')
-MENDIAN=$(if $(IS_LITTLE_ENDIAN),-mlittle-endian,-mbig-endian)
-BPF_TARGET_ENDIAN=$(if $(IS_LITTLE_ENDIAN),--target=bpfel,--target=bpfeb)
+MENDIAN:=$(if $(IS_LITTLE_ENDIAN),-mlittle-endian,-mbig-endian)
+BPF_TARGET_ENDIAN:=$(if $(IS_LITTLE_ENDIAN),--target=bpfel,--target=bpfeb)
ifneq ($(CROSS_COMPILE),)
CLANG_TARGET_ARCH = --target=$(notdir $(CROSS_COMPILE:%-=%))
@@ -493,6 +445,8 @@ CLANG_SYS_INCLUDES = $(call get_sys_includes,$(CLANG),$(CLANG_TARGET_ARCH))
BPF_CFLAGS = -g -Wall -Werror -D__TARGET_ARCH_$(SRCARCH) $(MENDIAN) \
-I$(INCLUDE_DIR) -I$(CURDIR) -I$(APIDIR) \
-I$(abspath $(OUTPUT)/../usr/include) \
+ -std=gnu11 \
+ -fno-strict-aliasing \
-Wno-compare-distinct-pointer-types
# TODO: enable me -Wsign-compare
@@ -760,14 +714,12 @@ TRUNNER_EXTRA_SOURCES := test_progs.c \
json_writer.c \
flow_dissector_load.h \
ip_check_defrag_frags.h
-TRUNNER_EXTRA_FILES := $(OUTPUT)/urandom_read $(OUTPUT)/bpf_testmod.ko \
- $(OUTPUT)/bpf_test_no_cfi.ko \
- $(OUTPUT)/bpf_test_modorder_x.ko \
- $(OUTPUT)/bpf_test_modorder_y.ko \
+TRUNNER_EXTRA_FILES := $(OUTPUT)/urandom_read \
$(OUTPUT)/liburandom_read.so \
$(OUTPUT)/xdp_synproxy \
$(OUTPUT)/sign-file \
$(OUTPUT)/uprobe_multi \
+ $(TEST_KMOD_TARGETS) \
ima_setup.sh \
verify_sig_setup.sh \
$(wildcard progs/btf_dump_test_case_*.c) \
@@ -834,9 +786,12 @@ $(OUTPUT)/xdp_features: xdp_features.c $(OUTPUT)/network_helpers.o $(OUTPUT)/xdp
$(Q)$(CC) $(CFLAGS) $(filter %.a %.o %.c,$^) $(LDLIBS) -o $@
# Make sure we are able to include and link libbpf against c++.
+CXXFLAGS += $(CFLAGS)
+CXXFLAGS := $(subst -D_GNU_SOURCE=,,$(CXXFLAGS))
+CXXFLAGS := $(subst -std=gnu11,-std=gnu++11,$(CXXFLAGS))
$(OUTPUT)/test_cpp: test_cpp.cpp $(OUTPUT)/test_core_extern.skel.h $(BPFOBJ)
$(call msg,CXX,,$@)
- $(Q)$(CXX) $(subst -D_GNU_SOURCE=,,$(CFLAGS)) $(filter %.a %.o %.cpp,$^) $(LDLIBS) -o $@
+ $(Q)$(CXX) $(CXXFLAGS) $(filter %.a %.o %.cpp,$^) $(LDLIBS) -o $@
# Benchmark runner
$(OUTPUT)/bench_%.o: benchs/bench_%.c bench.h $(BPFOBJ)
@@ -894,12 +849,9 @@ $(OUTPUT)/uprobe_multi: uprobe_multi.c uprobe_multi.ld
EXTRA_CLEAN := $(SCRATCH_DIR) $(HOST_SCRATCH_DIR) \
prog_tests/tests.h map_tests/tests.h verifier/tests.h \
- feature bpftool \
+ feature bpftool $(TEST_KMOD_TARGETS) \
$(addprefix $(OUTPUT)/,*.o *.d *.skel.h *.lskel.h *.subskel.h \
- no_alu32 cpuv4 bpf_gcc bpf_testmod.ko \
- bpf_test_no_cfi.ko \
- bpf_test_modorder_x.ko \
- bpf_test_modorder_y.ko \
+ no_alu32 cpuv4 bpf_gcc \
liburandom_read.so) \
$(OUTPUT)/FEATURE-DUMP.selftests
diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile b/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile
deleted file mode 100644
index 40b25b98ad1b..000000000000
--- a/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile
+++ /dev/null
@@ -1,19 +0,0 @@
-BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST)))))
-KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..)
-
-ifeq ($(V),1)
-Q =
-else
-Q = @
-endif
-
-MODULES = bpf_test_modorder_x.ko
-
-obj-m += bpf_test_modorder_x.o
-
-all:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules
-
-clean:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean
-
diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile b/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile
deleted file mode 100644
index 52c3ab9d84e2..000000000000
--- a/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile
+++ /dev/null
@@ -1,19 +0,0 @@
-BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST)))))
-KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..)
-
-ifeq ($(V),1)
-Q =
-else
-Q = @
-endif
-
-MODULES = bpf_test_modorder_y.ko
-
-obj-m += bpf_test_modorder_y.o
-
-all:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules
-
-clean:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean
-
diff --git a/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile b/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile
deleted file mode 100644
index ed5143b79edf..000000000000
--- a/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile
+++ /dev/null
@@ -1,19 +0,0 @@
-BPF_TEST_NO_CFI_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST)))))
-KDIR ?= $(abspath $(BPF_TEST_NO_CFI_DIR)/../../../../..)
-
-ifeq ($(V),1)
-Q =
-else
-Q = @
-endif
-
-MODULES = bpf_test_no_cfi.ko
-
-obj-m += bpf_test_no_cfi.o
-
-all:
- +$(Q)make -C $(KDIR) M=$(BPF_TEST_NO_CFI_DIR) modules
-
-clean:
- +$(Q)make -C $(KDIR) M=$(BPF_TEST_NO_CFI_DIR) clean
-
diff --git a/tools/testing/selftests/bpf/bpf_testmod/Makefile b/tools/testing/selftests/bpf/bpf_testmod/Makefile
deleted file mode 100644
index 15cb36c4483a..000000000000
--- a/tools/testing/selftests/bpf/bpf_testmod/Makefile
+++ /dev/null
@@ -1,20 +0,0 @@
-BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST)))))
-KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..)
-
-ifeq ($(V),1)
-Q =
-else
-Q = @
-endif
-
-MODULES = bpf_testmod.ko
-
-obj-m += bpf_testmod.o
-CFLAGS_bpf_testmod.o = -I$(src)
-
-all:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules
-
-clean:
- +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean
-
diff --git a/tools/testing/selftests/bpf/config b/tools/testing/selftests/bpf/config
index 4ca84c8d9116..c378d5d07e02 100644
--- a/tools/testing/selftests/bpf/config
+++ b/tools/testing/selftests/bpf/config
@@ -58,6 +58,7 @@ CONFIG_MPLS=y
CONFIG_MPLS_IPTUNNEL=y
CONFIG_MPLS_ROUTING=y
CONFIG_MPTCP=y
+CONFIG_NET_ACT_GACT=y
CONFIG_NET_ACT_SKBMOD=y
CONFIG_NET_CLS=y
CONFIG_NET_CLS_ACT=y
diff --git a/tools/testing/selftests/bpf/test_lpm_map.c b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c
index d98c72dc563e..d32e4edac930 100644
--- a/tools/testing/selftests/bpf/test_lpm_map.c
+++ b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c
@@ -20,10 +20,12 @@
#include <string.h>
#include <time.h>
#include <unistd.h>
+#include <endian.h>
#include <arpa/inet.h>
#include <sys/time.h>
#include <bpf/bpf.h>
+#include <test_maps.h>
#include "bpf_util.h"
@@ -33,6 +35,22 @@ struct tlpm_node {
uint8_t key[];
};
+struct lpm_trie_bytes_key {
+ union {
+ struct bpf_lpm_trie_key_hdr hdr;
+ __u32 prefixlen;
+ };
+ unsigned char data[8];
+};
+
+struct lpm_trie_int_key {
+ union {
+ struct bpf_lpm_trie_key_hdr hdr;
+ __u32 prefixlen;
+ };
+ unsigned int data;
+};
+
static struct tlpm_node *tlpm_match(struct tlpm_node *list,
const uint8_t *key,
size_t n_bits);
@@ -223,7 +241,7 @@ static void test_lpm_map(int keysize)
n_matches = 0;
n_matches_after_delete = 0;
n_nodes = 1 << 8;
- n_lookups = 1 << 16;
+ n_lookups = 1 << 9;
data = alloca(keysize);
memset(data, 0, keysize);
@@ -770,16 +788,385 @@ static void test_lpm_multi_thread(void)
close(map_fd);
}
-int main(void)
+static int lpm_trie_create(unsigned int key_size, unsigned int value_size, unsigned int max_entries)
+{
+ LIBBPF_OPTS(bpf_map_create_opts, opts);
+ int fd;
+
+ opts.map_flags = BPF_F_NO_PREALLOC;
+ fd = bpf_map_create(BPF_MAP_TYPE_LPM_TRIE, "lpm_trie", key_size, value_size, max_entries,
+ &opts);
+ CHECK(fd < 0, "bpf_map_create", "error %d\n", errno);
+
+ return fd;
+}
+
+static void test_lpm_trie_update_flags(void)
+{
+ struct lpm_trie_int_key key;
+ unsigned int value, got;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), 3);
+
+ /* invalid flags (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_F_LOCK);
+ CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err);
+
+ /* invalid flags (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST | BPF_EXIST);
+ CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err);
+
+ /* overwrite an empty qp-trie (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite empty qp-trie", "error %d\n", err);
+
+ /* add a new node */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add the same node as new node (Error) */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err != -EEXIST, "add new elem again", "error %d\n", err);
+
+ /* overwrite the existed node */
+ value = 4;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite the node */
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "update elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite a non-existent node which is the prefix of the first
+ * node (Error).
+ */
+ key.prefixlen = 8;
+ key.data = 0;
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err);
+
+ /* add a new node which is the prefix of the first node */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add another new node which will be the sibling of the first node */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 5;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite the third node */
+ value = 3;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* delete the second node to make it an intermediate node */
+ key.prefixlen = 8;
+ key.data = 0;
+ err = bpf_map_delete_elem(fd, &key);
+ CHECK(err, "del elem", "error %d\n", err);
+
+ /* overwrite the intermediate node (Error) */
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err);
+
+ close(fd);
+}
+
+static void test_lpm_trie_update_full_map(void)
+{
+ struct lpm_trie_int_key key;
+ int value, got;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), 3);
+
+ /* add a new node */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add new node */
+ key.prefixlen = 8;
+ key.data = 0;
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add new node */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* try to add more node (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 3;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err != -ENOSPC, "add to full trie", "error %d\n", err);
+
+ /* update the value of an existed node with BPF_EXIST */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 4;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* update the value of an existed node with BPF_ANY */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 5;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ close(fd);
+}
+
+static int cmp_str(const void *a, const void *b)
+{
+ const char *str_a = *(const char **)a, *str_b = *(const char **)b;
+
+ return strcmp(str_a, str_b);
+}
+
+/* Save strings in LPM trie. The trailing '\0' for each string will be
+ * accounted in the prefixlen. The strings returned during the iteration
+ * should be sorted as expected.
+ */
+static void test_lpm_trie_iterate_strs(void)
+{
+ static const char * const keys[] = {
+ "ab", "abO", "abc", "abo", "abS", "abcd",
+ };
+ const char *sorted_keys[ARRAY_SIZE(keys)];
+ struct lpm_trie_bytes_key key, next_key;
+ unsigned int value, got, i, j, len;
+ struct lpm_trie_bytes_key *cur;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), ARRAY_SIZE(keys));
+
+ for (i = 0; i < ARRAY_SIZE(keys); i++) {
+ unsigned int flags;
+
+ /* add i-th element */
+ flags = i % 2 ? BPF_NOEXIST : 0;
+ len = strlen(keys[i]);
+ /* include the trailing '\0' */
+ key.prefixlen = (len + 1) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ memcpy(key.data, keys[i], len);
+ value = i + 100;
+ err = bpf_map_update_elem(fd, &key, &value, flags);
+ CHECK(err, "add elem", "#%u error %d\n", i, err);
+
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "#%u error %d\n", i, err);
+ CHECK(got != value, "lookup elem", "#%u expect %u got %u\n", i, value, got);
+
+ /* re-add i-th element (Error) */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err != -EEXIST, "re-add elem", "#%u error %d\n", i, err);
+
+ /* Overwrite i-th element */
+ flags = i % 2 ? 0 : BPF_EXIST;
+ value = i;
+ err = bpf_map_update_elem(fd, &key, &value, flags);
+ CHECK(err, "update elem", "error %d\n", err);
+
+ /* Lookup #[0~i] elements */
+ for (j = 0; j <= i; j++) {
+ len = strlen(keys[j]);
+ key.prefixlen = (len + 1) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ memcpy(key.data, keys[j], len);
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "#%u/%u error %d\n", i, j, err);
+ CHECK(got != j, "lookup elem", "#%u/%u expect %u got %u\n",
+ i, j, value, got);
+ }
+ }
+
+ /* Add element to a full qp-trie (Error) */
+ key.prefixlen = sizeof(key.data) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, 0);
+ CHECK(err != -ENOSPC, "add to full qp-trie", "error %d\n", err);
+
+ /* Iterate sorted elements: no deletion */
+ memcpy(sorted_keys, keys, sizeof(keys));
+ qsort(sorted_keys, ARRAY_SIZE(sorted_keys), sizeof(sorted_keys[0]), cmp_str);
+ cur = NULL;
+ for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) {
+ len = strlen(sorted_keys[i]);
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != (len + 1) * 8, "iterate",
+ "#%u invalid len %u expect %u\n",
+ i, next_key.prefixlen, (len + 1) * 8);
+ CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate",
+ "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]);
+
+ cur = &next_key;
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "more element", "error %d\n", err);
+
+ /* Iterate sorted elements: delete the found key after each iteration */
+ cur = NULL;
+ for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) {
+ len = strlen(sorted_keys[i]);
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != (len + 1) * 8, "iterate",
+ "#%u invalid len %u expect %u\n",
+ i, next_key.prefixlen, (len + 1) * 8);
+ CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate",
+ "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]);
+
+ cur = &next_key;
+
+ err = bpf_map_delete_elem(fd, cur);
+ CHECK(err, "delete", "#%u error %d\n", i, err);
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "non-empty qp-trie", "error %d\n", err);
+
+ close(fd);
+}
+
+/* Use the fixed prefixlen (32) and save integers in LPM trie. The iteration of
+ * LPM trie will return these integers in big-endian order, therefore, convert
+ * these integers to big-endian before update. After each iteration, delete the
+ * found key (the smallest integer) and expect the next iteration will return
+ * the second smallest number.
+ */
+static void test_lpm_trie_iterate_ints(void)
+{
+ struct lpm_trie_int_key key, next_key;
+ unsigned int i, max_entries;
+ struct lpm_trie_int_key *cur;
+ unsigned int *data_set;
+ int fd, err;
+ bool value;
+
+ max_entries = 4096;
+ data_set = calloc(max_entries, sizeof(*data_set));
+ CHECK(!data_set, "malloc", "no mem\n");
+ for (i = 0; i < max_entries; i++)
+ data_set[i] = i;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), max_entries);
+ value = true;
+ for (i = 0; i < max_entries; i++) {
+ key.prefixlen = 32;
+ key.data = htobe32(data_set[i]);
+
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add elem", "#%u error %d\n", i, err);
+ }
+
+ cur = NULL;
+ for (i = 0; i < max_entries; i++) {
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != 32, "iterate", "#%u invalid len %u\n",
+ i, next_key.prefixlen);
+ CHECK(be32toh(next_key.data) != data_set[i], "iterate", "#%u got 0x%x exp 0x%x\n",
+ i, be32toh(next_key.data), data_set[i]);
+ cur = &next_key;
+
+ /*
+ * Delete the minimal key, the next call of bpf_get_next_key()
+ * will return the second minimal key.
+ */
+ err = bpf_map_delete_elem(fd, &next_key);
+ CHECK(err, "del elem", "#%u elem error %d\n", i, err);
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "more element", "error %d\n", err);
+
+ err = bpf_map_get_next_key(fd, NULL, &next_key);
+ CHECK(err != -ENOENT, "no-empty qp-trie", "error %d\n", err);
+
+ free(data_set);
+
+ close(fd);
+}
+
+void test_lpm_trie_map_basic_ops(void)
{
int i;
/* we want predictable, pseudo random tests */
srand(0xf00ba1);
- /* Use libbpf 1.0 API mode */
- libbpf_set_strict_mode(LIBBPF_STRICT_ALL);
-
test_lpm_basic();
test_lpm_order();
@@ -792,6 +1179,10 @@ int main(void)
test_lpm_get_next_key();
test_lpm_multi_thread();
- printf("test_lpm: OK\n");
- return 0;
+ test_lpm_trie_update_flags();
+ test_lpm_trie_update_full_map();
+ test_lpm_trie_iterate_strs();
+ test_lpm_trie_iterate_ints();
+
+ printf("%s: PASS\n", __func__);
}
diff --git a/tools/testing/selftests/bpf/map_tests/task_storage_map.c b/tools/testing/selftests/bpf/map_tests/task_storage_map.c
index 62971dbf2996..a4121d2248ac 100644
--- a/tools/testing/selftests/bpf/map_tests/task_storage_map.c
+++ b/tools/testing/selftests/bpf/map_tests/task_storage_map.c
@@ -78,8 +78,8 @@ void test_task_storage_map_stress_lookup(void)
CHECK(err, "open_and_load", "error %d\n", err);
/* Only for a fully preemptible kernel */
- if (!skel->kconfig->CONFIG_PREEMPT) {
- printf("%s SKIP (no CONFIG_PREEMPT)\n", __func__);
+ if (!skel->kconfig->CONFIG_PREEMPTION) {
+ printf("%s SKIP (no CONFIG_PREEMPTION)\n", __func__);
read_bpf_task_storage_busy__destroy(skel);
skips++;
return;
diff --git a/tools/testing/selftests/bpf/network_helpers.c b/tools/testing/selftests/bpf/network_helpers.c
index 27784946b01b..80844a5fb1fe 100644
--- a/tools/testing/selftests/bpf/network_helpers.c
+++ b/tools/testing/selftests/bpf/network_helpers.c
@@ -21,7 +21,7 @@
#include <linux/limits.h>
#include <linux/ip.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <netinet/tcp.h>
#include <net/if.h>
diff --git a/tools/testing/selftests/bpf/network_helpers.h b/tools/testing/selftests/bpf/network_helpers.h
index 5764155b6d25..ebec8a8d6f81 100644
--- a/tools/testing/selftests/bpf/network_helpers.h
+++ b/tools/testing/selftests/bpf/network_helpers.h
@@ -14,6 +14,7 @@ typedef __u16 __sum16;
#include <linux/sockios.h>
#include <linux/err.h>
#include <netinet/tcp.h>
+#include <netinet/udp.h>
#include <bpf/bpf_endian.h>
#include <net/if.h>
@@ -105,6 +106,45 @@ static __u16 csum_fold(__u32 csum)
return (__u16)~csum;
}
+static __wsum csum_partial(const void *buf, int len, __wsum sum)
+{
+ __u16 *p = (__u16 *)buf;
+ int num_u16 = len >> 1;
+ int i;
+
+ for (i = 0; i < num_u16; i++)
+ sum += p[i];
+
+ return sum;
+}
+
+static inline __sum16 build_ip_csum(struct iphdr *iph)
+{
+ __u32 sum = 0;
+ __u16 *p;
+
+ iph->check = 0;
+ p = (void *)iph;
+ sum = csum_partial(p, iph->ihl << 2, 0);
+
+ return csum_fold(sum);
+}
+
+/**
+ * csum_tcpudp_magic - compute IP pseudo-header checksum
+ *
+ * Compute the IPv4 pseudo header checksum. The helper can take a
+ * accumulated sum from the transport layer to accumulate it and directly
+ * return the transport layer
+ *
+ * @saddr: IP source address
+ * @daddr: IP dest address
+ * @len: IP data size
+ * @proto: transport layer protocol
+ * @csum: The accumulated partial sum to add to the computation
+ *
+ * Returns the folded sum
+ */
static inline __sum16 csum_tcpudp_magic(__be32 saddr, __be32 daddr,
__u32 len, __u8 proto,
__wsum csum)
@@ -120,6 +160,21 @@ static inline __sum16 csum_tcpudp_magic(__be32 saddr, __be32 daddr,
return csum_fold((__u32)s);
}
+/**
+ * csum_ipv6_magic - compute IPv6 pseudo-header checksum
+ *
+ * Compute the ipv6 pseudo header checksum. The helper can take a
+ * accumulated sum from the transport layer to accumulate it and directly
+ * return the transport layer
+ *
+ * @saddr: IPv6 source address
+ * @daddr: IPv6 dest address
+ * @len: IPv6 data size
+ * @proto: transport layer protocol
+ * @csum: The accumulated partial sum to add to the computation
+ *
+ * Returns the folded sum
+ */
static inline __sum16 csum_ipv6_magic(const struct in6_addr *saddr,
const struct in6_addr *daddr,
__u32 len, __u8 proto,
@@ -139,6 +194,47 @@ static inline __sum16 csum_ipv6_magic(const struct in6_addr *saddr,
return csum_fold((__u32)s);
}
+/**
+ * build_udp_v4_csum - compute UDP checksum for UDP over IPv4
+ *
+ * Compute the checksum to embed in UDP header, composed of the sum of IP
+ * pseudo-header checksum, UDP header checksum and UDP data checksum
+ * @iph IP header
+ * @udph UDP header, which must be immediately followed by UDP data
+ *
+ * Returns the total checksum
+ */
+
+static inline __sum16 build_udp_v4_csum(const struct iphdr *iph,
+ const struct udphdr *udph)
+{
+ unsigned long sum;
+
+ sum = csum_partial(udph, ntohs(udph->len), 0);
+ return csum_tcpudp_magic(iph->saddr, iph->daddr, ntohs(udph->len),
+ IPPROTO_UDP, sum);
+}
+
+/**
+ * build_udp_v6_csum - compute UDP checksum for UDP over IPv6
+ *
+ * Compute the checksum to embed in UDP header, composed of the sum of IPv6
+ * pseudo-header checksum, UDP header checksum and UDP data checksum
+ * @ip6h IPv6 header
+ * @udph UDP header, which must be immediately followed by UDP data
+ *
+ * Returns the total checksum
+ */
+static inline __sum16 build_udp_v6_csum(const struct ipv6hdr *ip6h,
+ const struct udphdr *udph)
+{
+ unsigned long sum;
+
+ sum = csum_partial(udph, ntohs(udph->len), 0);
+ return csum_ipv6_magic(&ip6h->saddr, &ip6h->daddr, ntohs(udph->len),
+ IPPROTO_UDP, sum);
+}
+
struct tmonitor_ctx;
#ifdef TRAFFIC_MONITOR
diff --git a/tools/testing/selftests/bpf/prog_tests/btf_distill.c b/tools/testing/selftests/bpf/prog_tests/btf_distill.c
index ca84726d5ac1..fb67ae195a73 100644
--- a/tools/testing/selftests/bpf/prog_tests/btf_distill.c
+++ b/tools/testing/selftests/bpf/prog_tests/btf_distill.c
@@ -385,7 +385,7 @@ static void test_distilled_base_missing_err(void)
"[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED");
btf5 = btf__new_empty();
if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf"))
- return;
+ goto cleanup;
btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */
VALIDATE_RAW_BTF(
btf5,
@@ -478,7 +478,7 @@ static void test_distilled_base_multi_err2(void)
"[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
btf5 = btf__new_empty();
if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf"))
- return;
+ goto cleanup;
btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */
btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [2] int */
VALIDATE_RAW_BTF(
@@ -601,6 +601,76 @@ cleanup:
btf__free(base);
}
+/* If a needed composite type, which is the member of composite type
+ * in the split BTF, has a different size in the base BTF we wish to
+ * relocate with, btf__relocate() should error out.
+ */
+static void test_distilled_base_embedded_err(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL, *btf5 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_struct(btf1, "s1", 4); /* [2] struct s1 { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] STRUCT 's1' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0");
+
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+
+ btf__add_struct(btf2, "with_embedded", 8); /* [3] struct with_embedded { */
+ btf__add_field(btf2, "e1", 2, 0, 0); /* struct s1 e1; */
+ /* } */
+
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] STRUCT 's1' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[3] STRUCT 'with_embedded' size=8 vlen=1\n"
+ "\t'e1' type_id=2 bits_offset=0");
+
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(2, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+
+ VALIDATE_RAW_BTF(
+ btf4,
+ "[1] STRUCT 's1' size=4 vlen=0",
+ "[2] STRUCT 'with_embedded' size=8 vlen=1\n"
+ "\t'e1' type_id=1 bits_offset=0");
+
+ btf5 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf"))
+ goto cleanup;
+
+ btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ /* struct with the same name but different size */
+ btf__add_struct(btf5, "s1", 8); /* [2] struct s1 { */
+ btf__add_field(btf5, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+
+ ASSERT_EQ(btf__relocate(btf4, btf5), -EINVAL, "relocate_split");
+cleanup:
+ btf__free(btf5);
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
void test_btf_distill(void)
{
if (test__start_subtest("distilled_base"))
@@ -613,6 +683,8 @@ void test_btf_distill(void)
test_distilled_base_multi_err();
if (test__start_subtest("distilled_base_multi_err2"))
test_distilled_base_multi_err2();
+ if (test__start_subtest("distilled_base_embedded_err"))
+ test_distilled_base_embedded_err();
if (test__start_subtest("distilled_base_vmlinux"))
test_distilled_base_vmlinux();
if (test__start_subtest("distilled_endianness"))
diff --git a/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c b/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c
new file mode 100644
index 000000000000..e1a90c10db8c
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c
@@ -0,0 +1,28 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <test_progs.h>
+#include "cgroup_skb_direct_packet_access.skel.h"
+
+void test_cgroup_skb_prog_run_direct_packet_access(void)
+{
+ int err;
+ struct cgroup_skb_direct_packet_access *skel;
+ char test_skb[64] = {};
+
+ LIBBPF_OPTS(bpf_test_run_opts, topts,
+ .data_in = test_skb,
+ .data_size_in = sizeof(test_skb),
+ );
+
+ skel = cgroup_skb_direct_packet_access__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "cgroup_skb_direct_packet_access__open_and_load"))
+ return;
+
+ err = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.direct_packet_access), &topts);
+ ASSERT_OK(err, "bpf_prog_test_run_opts err");
+ ASSERT_EQ(topts.retval, 1, "retval");
+
+ ASSERT_NEQ(skel->bss->data_end, 0, "data_end");
+
+ cgroup_skb_direct_packet_access__destroy(skel);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c
new file mode 100644
index 000000000000..7526de379081
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c
@@ -0,0 +1,107 @@
+// SPDX-License-Identifier: GPL-2.0
+#include "bpf/libbpf.h"
+#include "changes_pkt_data_freplace.skel.h"
+#include "changes_pkt_data.skel.h"
+#include <test_progs.h>
+
+static void print_verifier_log(const char *log)
+{
+ if (env.verbosity >= VERBOSE_VERY)
+ fprintf(stdout, "VERIFIER LOG:\n=============\n%s=============\n", log);
+}
+
+static void test_aux(const char *main_prog_name,
+ const char *to_be_replaced,
+ const char *replacement,
+ bool expect_load)
+{
+ struct changes_pkt_data_freplace *freplace = NULL;
+ struct bpf_program *freplace_prog = NULL;
+ struct bpf_program *main_prog = NULL;
+ LIBBPF_OPTS(bpf_object_open_opts, opts);
+ struct changes_pkt_data *main = NULL;
+ char log[16*1024];
+ int err;
+
+ opts.kernel_log_buf = log;
+ opts.kernel_log_size = sizeof(log);
+ if (env.verbosity >= VERBOSE_SUPER)
+ opts.kernel_log_level = 1 | 2 | 4;
+ main = changes_pkt_data__open_opts(&opts);
+ if (!ASSERT_OK_PTR(main, "changes_pkt_data__open"))
+ goto out;
+ main_prog = bpf_object__find_program_by_name(main->obj, main_prog_name);
+ if (!ASSERT_OK_PTR(main_prog, "main_prog"))
+ goto out;
+ bpf_program__set_autoload(main_prog, true);
+ err = changes_pkt_data__load(main);
+ print_verifier_log(log);
+ if (!ASSERT_OK(err, "changes_pkt_data__load"))
+ goto out;
+ freplace = changes_pkt_data_freplace__open_opts(&opts);
+ if (!ASSERT_OK_PTR(freplace, "changes_pkt_data_freplace__open"))
+ goto out;
+ freplace_prog = bpf_object__find_program_by_name(freplace->obj, replacement);
+ if (!ASSERT_OK_PTR(freplace_prog, "freplace_prog"))
+ goto out;
+ bpf_program__set_autoload(freplace_prog, true);
+ bpf_program__set_autoattach(freplace_prog, true);
+ bpf_program__set_attach_target(freplace_prog,
+ bpf_program__fd(main_prog),
+ to_be_replaced);
+ err = changes_pkt_data_freplace__load(freplace);
+ print_verifier_log(log);
+ if (expect_load) {
+ ASSERT_OK(err, "changes_pkt_data_freplace__load");
+ } else {
+ ASSERT_ERR(err, "changes_pkt_data_freplace__load");
+ ASSERT_HAS_SUBSTR(log, "Extension program changes packet data", "error log");
+ }
+
+out:
+ changes_pkt_data_freplace__destroy(freplace);
+ changes_pkt_data__destroy(main);
+}
+
+/* There are two global subprograms in both changes_pkt_data.skel.h:
+ * - one changes packet data;
+ * - another does not.
+ * It is ok to freplace subprograms that change packet data with those
+ * that either do or do not. It is only ok to freplace subprograms
+ * that do not change packet data with those that do not as well.
+ * The below tests check outcomes for each combination of such freplace.
+ * Also test a case when main subprogram itself is replaced and is a single
+ * subprogram in a program.
+ */
+void test_changes_pkt_data_freplace(void)
+{
+ struct {
+ const char *main;
+ const char *to_be_replaced;
+ bool changes;
+ } mains[] = {
+ { "main_with_subprogs", "changes_pkt_data", true },
+ { "main_with_subprogs", "does_not_change_pkt_data", false },
+ { "main_changes", "main_changes", true },
+ { "main_does_not_change", "main_does_not_change", false },
+ };
+ struct {
+ const char *func;
+ bool changes;
+ } replacements[] = {
+ { "changes_pkt_data", true },
+ { "does_not_change_pkt_data", false }
+ };
+ char buf[64];
+
+ for (int i = 0; i < ARRAY_SIZE(mains); ++i) {
+ for (int j = 0; j < ARRAY_SIZE(replacements); ++j) {
+ snprintf(buf, sizeof(buf), "%s_with_%s",
+ mains[i].to_be_replaced, replacements[j].func);
+ if (!test__start_subtest(buf))
+ continue;
+ test_aux(mains[i].main, mains[i].to_be_replaced, replacements[j].func,
+ mains[i].changes || !replacements[j].changes);
+ }
+ }
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/core_reloc.c b/tools/testing/selftests/bpf/prog_tests/core_reloc.c
index 1c682550e0e7..e10ea92c3fe2 100644
--- a/tools/testing/selftests/bpf/prog_tests/core_reloc.c
+++ b/tools/testing/selftests/bpf/prog_tests/core_reloc.c
@@ -2,7 +2,7 @@
#define _GNU_SOURCE
#include <test_progs.h>
#include "progs/core_reloc_types.h"
-#include "bpf_testmod/bpf_testmod.h"
+#include "test_kmods/bpf_testmod.h"
#include <linux/limits.h>
#include <sys/mman.h>
#include <sys/syscall.h>
diff --git a/tools/testing/selftests/bpf/prog_tests/fd_array.c b/tools/testing/selftests/bpf/prog_tests/fd_array.c
new file mode 100644
index 000000000000..a1d52e73fb16
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/fd_array.c
@@ -0,0 +1,441 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <test_progs.h>
+
+#include <linux/btf.h>
+#include <bpf/bpf.h>
+
+#include "../test_btf.h"
+
+static inline int new_map(void)
+{
+ const char *name = NULL;
+ __u32 max_entries = 1;
+ __u32 value_size = 8;
+ __u32 key_size = 4;
+
+ return bpf_map_create(BPF_MAP_TYPE_ARRAY, name,
+ key_size, value_size,
+ max_entries, NULL);
+}
+
+static int new_btf(void)
+{
+ struct btf_blob {
+ struct btf_header btf_hdr;
+ __u32 types[8];
+ __u32 str;
+ } raw_btf = {
+ .btf_hdr = {
+ .magic = BTF_MAGIC,
+ .version = BTF_VERSION,
+ .hdr_len = sizeof(struct btf_header),
+ .type_len = sizeof(raw_btf.types),
+ .str_off = offsetof(struct btf_blob, str) - offsetof(struct btf_blob, types),
+ .str_len = sizeof(raw_btf.str),
+ },
+ .types = {
+ /* long */
+ BTF_TYPE_INT_ENC(0, BTF_INT_SIGNED, 0, 64, 8), /* [1] */
+ /* unsigned long */
+ BTF_TYPE_INT_ENC(0, 0, 0, 64, 8), /* [2] */
+ },
+ };
+
+ return bpf_btf_load(&raw_btf, sizeof(raw_btf), NULL);
+}
+
+#define Close(FD) do { \
+ if ((FD) >= 0) { \
+ close(FD); \
+ FD = -1; \
+ } \
+} while(0)
+
+static bool map_exists(__u32 id)
+{
+ int fd;
+
+ fd = bpf_map_get_fd_by_id(id);
+ if (fd >= 0) {
+ close(fd);
+ return true;
+ }
+ return false;
+}
+
+static bool btf_exists(__u32 id)
+{
+ int fd;
+
+ fd = bpf_btf_get_fd_by_id(id);
+ if (fd >= 0) {
+ close(fd);
+ return true;
+ }
+ return false;
+}
+
+static inline int bpf_prog_get_map_ids(int prog_fd, __u32 *nr_map_ids, __u32 *map_ids)
+{
+ __u32 len = sizeof(struct bpf_prog_info);
+ struct bpf_prog_info info;
+ int err;
+
+ memset(&info, 0, len);
+ info.nr_map_ids = *nr_map_ids,
+ info.map_ids = ptr_to_u64(map_ids),
+
+ err = bpf_prog_get_info_by_fd(prog_fd, &info, &len);
+ if (!ASSERT_OK(err, "bpf_prog_get_info_by_fd"))
+ return -1;
+
+ *nr_map_ids = info.nr_map_ids;
+
+ return 0;
+}
+
+static int __load_test_prog(int map_fd, const int *fd_array, int fd_array_cnt)
+{
+ /* A trivial program which uses one map */
+ struct bpf_insn insns[] = {
+ BPF_LD_MAP_FD(BPF_REG_1, map_fd),
+ BPF_ST_MEM(BPF_DW, BPF_REG_10, -8, 0),
+ BPF_MOV64_REG(BPF_REG_2, BPF_REG_10),
+ BPF_ALU64_IMM(BPF_ADD, BPF_REG_2, -8),
+ BPF_RAW_INSN(BPF_JMP | BPF_CALL, 0, 0, 0, BPF_FUNC_map_lookup_elem),
+ BPF_MOV64_IMM(BPF_REG_0, 0),
+ BPF_EXIT_INSN(),
+ };
+ LIBBPF_OPTS(bpf_prog_load_opts, opts);
+
+ opts.fd_array = fd_array;
+ opts.fd_array_cnt = fd_array_cnt;
+
+ return bpf_prog_load(BPF_PROG_TYPE_XDP, NULL, "GPL", insns, ARRAY_SIZE(insns), &opts);
+}
+
+static int load_test_prog(const int *fd_array, int fd_array_cnt)
+{
+ int map_fd;
+ int ret;
+
+ map_fd = new_map();
+ if (!ASSERT_GE(map_fd, 0, "new_map"))
+ return map_fd;
+
+ ret = __load_test_prog(map_fd, fd_array, fd_array_cnt);
+ close(map_fd);
+ return ret;
+}
+
+static bool check_expected_map_ids(int prog_fd, int expected, __u32 *map_ids, __u32 *nr_map_ids)
+{
+ int err;
+
+ err = bpf_prog_get_map_ids(prog_fd, nr_map_ids, map_ids);
+ if (!ASSERT_OK(err, "bpf_prog_get_map_ids"))
+ return false;
+ if (!ASSERT_EQ(*nr_map_ids, expected, "unexpected nr_map_ids"))
+ return false;
+
+ return true;
+}
+
+/*
+ * Load a program, which uses one map. No fd_array maps are present.
+ * On return only one map is expected to be bound to prog.
+ */
+static void check_fd_array_cnt__no_fd_array(void)
+{
+ __u32 map_ids[16];
+ __u32 nr_map_ids;
+ int prog_fd = -1;
+
+ prog_fd = load_test_prog(NULL, 0);
+ if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD"))
+ return;
+ nr_map_ids = ARRAY_SIZE(map_ids);
+ check_expected_map_ids(prog_fd, 1, map_ids, &nr_map_ids);
+ close(prog_fd);
+}
+
+/*
+ * Load a program, which uses one map, and pass two extra, non-equal, maps in
+ * fd_array with fd_array_cnt=2. On return three maps are expected to be bound
+ * to the program.
+ */
+static void check_fd_array_cnt__fd_array_ok(void)
+{
+ int extra_fds[2] = { -1, -1 };
+ __u32 map_ids[16];
+ __u32 nr_map_ids;
+ int prog_fd = -1;
+
+ extra_fds[0] = new_map();
+ if (!ASSERT_GE(extra_fds[0], 0, "new_map"))
+ goto cleanup;
+ extra_fds[1] = new_map();
+ if (!ASSERT_GE(extra_fds[1], 0, "new_map"))
+ goto cleanup;
+ prog_fd = load_test_prog(extra_fds, 2);
+ if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD"))
+ goto cleanup;
+ nr_map_ids = ARRAY_SIZE(map_ids);
+ if (!check_expected_map_ids(prog_fd, 3, map_ids, &nr_map_ids))
+ goto cleanup;
+
+ /* maps should still exist when original file descriptors are closed */
+ Close(extra_fds[0]);
+ Close(extra_fds[1]);
+ if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map_ids[0] should exist"))
+ goto cleanup;
+ if (!ASSERT_EQ(map_exists(map_ids[1]), true, "map_ids[1] should exist"))
+ goto cleanup;
+
+ /* some fds might be invalid, so ignore return codes */
+cleanup:
+ Close(extra_fds[1]);
+ Close(extra_fds[0]);
+ Close(prog_fd);
+}
+
+/*
+ * Load a program with a few extra maps duplicated in the fd_array.
+ * After the load maps should only be referenced once.
+ */
+static void check_fd_array_cnt__duplicated_maps(void)
+{
+ int extra_fds[4] = { -1, -1, -1, -1 };
+ __u32 map_ids[16];
+ __u32 nr_map_ids;
+ int prog_fd = -1;
+
+ extra_fds[0] = extra_fds[2] = new_map();
+ if (!ASSERT_GE(extra_fds[0], 0, "new_map"))
+ goto cleanup;
+ extra_fds[1] = extra_fds[3] = new_map();
+ if (!ASSERT_GE(extra_fds[1], 0, "new_map"))
+ goto cleanup;
+ prog_fd = load_test_prog(extra_fds, 4);
+ if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD"))
+ goto cleanup;
+ nr_map_ids = ARRAY_SIZE(map_ids);
+ if (!check_expected_map_ids(prog_fd, 3, map_ids, &nr_map_ids))
+ goto cleanup;
+
+ /* maps should still exist when original file descriptors are closed */
+ Close(extra_fds[0]);
+ Close(extra_fds[1]);
+ if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map should exist"))
+ goto cleanup;
+ if (!ASSERT_EQ(map_exists(map_ids[1]), true, "map should exist"))
+ goto cleanup;
+
+ /* some fds might be invalid, so ignore return codes */
+cleanup:
+ Close(extra_fds[1]);
+ Close(extra_fds[0]);
+ Close(prog_fd);
+}
+
+/*
+ * Check that if maps which are referenced by a program are
+ * passed in fd_array, then they will be referenced only once
+ */
+static void check_fd_array_cnt__referenced_maps_in_fd_array(void)
+{
+ int extra_fds[1] = { -1 };
+ __u32 map_ids[16];
+ __u32 nr_map_ids;
+ int prog_fd = -1;
+
+ extra_fds[0] = new_map();
+ if (!ASSERT_GE(extra_fds[0], 0, "new_map"))
+ goto cleanup;
+ prog_fd = __load_test_prog(extra_fds[0], extra_fds, 1);
+ if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD"))
+ goto cleanup;
+ nr_map_ids = ARRAY_SIZE(map_ids);
+ if (!check_expected_map_ids(prog_fd, 1, map_ids, &nr_map_ids))
+ goto cleanup;
+
+ /* map should still exist when original file descriptor is closed */
+ Close(extra_fds[0]);
+ if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map should exist"))
+ goto cleanup;
+
+ /* some fds might be invalid, so ignore return codes */
+cleanup:
+ Close(extra_fds[0]);
+ Close(prog_fd);
+}
+
+static int get_btf_id_by_fd(int btf_fd, __u32 *id)
+{
+ struct bpf_btf_info info;
+ __u32 info_len = sizeof(info);
+ int err;
+
+ memset(&info, 0, info_len);
+ err = bpf_btf_get_info_by_fd(btf_fd, &info, &info_len);
+ if (err)
+ return err;
+ if (id)
+ *id = info.id;
+ return 0;
+}
+
+/*
+ * Check that fd_array operates properly for btfs. Namely, to check that
+ * passing a btf fd in fd_array increases its reference count, do the
+ * following:
+ * 1) Create a new btf, it's referenced only by a file descriptor, so refcnt=1
+ * 2) Load a BPF prog with fd_array[0] = btf_fd; now btf's refcnt=2
+ * 3) Close the btf_fd, now refcnt=1
+ * Wait and check that BTF stil exists.
+ */
+static void check_fd_array_cnt__referenced_btfs(void)
+{
+ int extra_fds[1] = { -1 };
+ int prog_fd = -1;
+ __u32 btf_id;
+ int tries;
+ int err;
+
+ extra_fds[0] = new_btf();
+ if (!ASSERT_GE(extra_fds[0], 0, "new_btf"))
+ goto cleanup;
+ prog_fd = load_test_prog(extra_fds, 1);
+ if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD"))
+ goto cleanup;
+
+ /* btf should still exist when original file descriptor is closed */
+ err = get_btf_id_by_fd(extra_fds[0], &btf_id);
+ if (!ASSERT_GE(err, 0, "get_btf_id_by_fd"))
+ goto cleanup;
+
+ Close(extra_fds[0]);
+
+ if (!ASSERT_GE(kern_sync_rcu(), 0, "kern_sync_rcu 1"))
+ goto cleanup;
+
+ if (!ASSERT_EQ(btf_exists(btf_id), true, "btf should exist"))
+ goto cleanup;
+
+ Close(prog_fd);
+
+ /* The program is freed by a workqueue, so no reliable
+ * way to sync, so just wait a bit (max ~1 second). */
+ for (tries = 100; tries >= 0; tries--) {
+ usleep(1000);
+
+ if (!btf_exists(btf_id))
+ break;
+
+ if (tries)
+ continue;
+
+ PRINT_FAIL("btf should have been freed");
+ }
+
+ /* some fds might be invalid, so ignore return codes */
+cleanup:
+ Close(extra_fds[0]);
+ Close(prog_fd);
+}
+
+/*
+ * Test that a program with trash in fd_array can't be loaded:
+ * only map and BTF file descriptors should be accepted.
+ */
+static void check_fd_array_cnt__fd_array_with_trash(void)
+{
+ int extra_fds[3] = { -1, -1, -1 };
+ int prog_fd = -1;
+
+ extra_fds[0] = new_map();
+ if (!ASSERT_GE(extra_fds[0], 0, "new_map"))
+ goto cleanup;
+ extra_fds[1] = new_btf();
+ if (!ASSERT_GE(extra_fds[1], 0, "new_btf"))
+ goto cleanup;
+
+ /* trash 1: not a file descriptor */
+ extra_fds[2] = 0xbeef;
+ prog_fd = load_test_prog(extra_fds, 3);
+ if (!ASSERT_EQ(prog_fd, -EBADF, "prog should have been rejected with -EBADF"))
+ goto cleanup;
+
+ /* trash 2: not a map or btf */
+ extra_fds[2] = socket(AF_INET, SOCK_STREAM, 0);
+ if (!ASSERT_GE(extra_fds[2], 0, "socket"))
+ goto cleanup;
+
+ prog_fd = load_test_prog(extra_fds, 3);
+ if (!ASSERT_EQ(prog_fd, -EINVAL, "prog should have been rejected with -EINVAL"))
+ goto cleanup;
+
+ /* Validate that the prog is ok if trash is removed */
+ Close(extra_fds[2]);
+ extra_fds[2] = new_btf();
+ if (!ASSERT_GE(extra_fds[2], 0, "new_btf"))
+ goto cleanup;
+
+ prog_fd = load_test_prog(extra_fds, 3);
+ if (!ASSERT_GE(prog_fd, 0, "prog should have been loaded"))
+ goto cleanup;
+
+ /* some fds might be invalid, so ignore return codes */
+cleanup:
+ Close(extra_fds[2]);
+ Close(extra_fds[1]);
+ Close(extra_fds[0]);
+}
+
+/*
+ * Test that a program with too big fd_array can't be loaded.
+ */
+static void check_fd_array_cnt__fd_array_too_big(void)
+{
+ int extra_fds[65];
+ int prog_fd = -1;
+ int i;
+
+ for (i = 0; i < 65; i++) {
+ extra_fds[i] = new_map();
+ if (!ASSERT_GE(extra_fds[i], 0, "new_map"))
+ goto cleanup_fds;
+ }
+
+ prog_fd = load_test_prog(extra_fds, 65);
+ ASSERT_EQ(prog_fd, -E2BIG, "prog should have been rejected with -E2BIG");
+
+cleanup_fds:
+ while (i > 0)
+ Close(extra_fds[--i]);
+}
+
+void test_fd_array_cnt(void)
+{
+ if (test__start_subtest("no-fd-array"))
+ check_fd_array_cnt__no_fd_array();
+
+ if (test__start_subtest("fd-array-ok"))
+ check_fd_array_cnt__fd_array_ok();
+
+ if (test__start_subtest("fd-array-dup-input"))
+ check_fd_array_cnt__duplicated_maps();
+
+ if (test__start_subtest("fd-array-ref-maps-in-array"))
+ check_fd_array_cnt__referenced_maps_in_fd_array();
+
+ if (test__start_subtest("fd-array-ref-btfs"))
+ check_fd_array_cnt__referenced_btfs();
+
+ if (test__start_subtest("fd-array-trash-input"))
+ check_fd_array_cnt__fd_array_with_trash();
+
+ if (test__start_subtest("fd-array-2big"))
+ check_fd_array_cnt__fd_array_too_big();
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/fill_link_info.c b/tools/testing/selftests/bpf/prog_tests/fill_link_info.c
index d50cbd8040d4..e59af2aa6601 100644
--- a/tools/testing/selftests/bpf/prog_tests/fill_link_info.c
+++ b/tools/testing/selftests/bpf/prog_tests/fill_link_info.c
@@ -171,6 +171,10 @@ static void test_kprobe_fill_link_info(struct test_fill_link_info *skel,
/* See also arch_adjust_kprobe_addr(). */
if (skel->kconfig->CONFIG_X86_KERNEL_IBT)
entry_offset = 4;
+ if (skel->kconfig->CONFIG_PPC64 &&
+ skel->kconfig->CONFIG_KPROBES_ON_FTRACE &&
+ !skel->kconfig->CONFIG_PPC_FTRACE_OUT_OF_LINE)
+ entry_offset = 4;
err = verify_perf_link_info(link_fd, type, kprobe_addr, 0, entry_offset);
ASSERT_OK(err, "verify_perf_link_info");
} else {
diff --git a/tools/testing/selftests/bpf/prog_tests/flow_dissector.c b/tools/testing/selftests/bpf/prog_tests/flow_dissector.c
index cfcc90cb7ffb..08bae13248c4 100644
--- a/tools/testing/selftests/bpf/prog_tests/flow_dissector.c
+++ b/tools/testing/selftests/bpf/prog_tests/flow_dissector.c
@@ -7,39 +7,14 @@
#include "bpf_flow.skel.h"
+#define TEST_NS "flow_dissector_ns"
#define FLOW_CONTINUE_SADDR 0x7f00007f /* 127.0.0.127 */
+#define TEST_NAME_MAX_LEN 64
#ifndef IP_MF
#define IP_MF 0x2000
#endif
-#define CHECK_FLOW_KEYS(desc, got, expected) \
- _CHECK(memcmp(&got, &expected, sizeof(got)) != 0, \
- desc, \
- topts.duration, \
- "nhoff=%u/%u " \
- "thoff=%u/%u " \
- "addr_proto=0x%x/0x%x " \
- "is_frag=%u/%u " \
- "is_first_frag=%u/%u " \
- "is_encap=%u/%u " \
- "ip_proto=0x%x/0x%x " \
- "n_proto=0x%x/0x%x " \
- "flow_label=0x%x/0x%x " \
- "sport=%u/%u " \
- "dport=%u/%u\n", \
- got.nhoff, expected.nhoff, \
- got.thoff, expected.thoff, \
- got.addr_proto, expected.addr_proto, \
- got.is_frag, expected.is_frag, \
- got.is_first_frag, expected.is_first_frag, \
- got.is_encap, expected.is_encap, \
- got.ip_proto, expected.ip_proto, \
- got.n_proto, expected.n_proto, \
- got.flow_label, expected.flow_label, \
- got.sport, expected.sport, \
- got.dport, expected.dport)
-
struct ipv4_pkt {
struct ethhdr eth;
struct iphdr iph;
@@ -89,6 +64,19 @@ struct dvlan_ipv6_pkt {
struct tcphdr tcp;
} __packed;
+struct gre_base_hdr {
+ __be16 flags;
+ __be16 protocol;
+} gre_base_hdr;
+
+struct gre_minimal_pkt {
+ struct ethhdr eth;
+ struct iphdr iph;
+ struct gre_base_hdr gre_hdr;
+ struct iphdr iph_inner;
+ struct tcphdr tcp;
+} __packed;
+
struct test {
const char *name;
union {
@@ -98,6 +86,7 @@ struct test {
struct ipv6_pkt ipv6;
struct ipv6_frag_pkt ipv6_frag;
struct dvlan_ipv6_pkt dvlan_ipv6;
+ struct gre_minimal_pkt gre_minimal;
} pkt;
struct bpf_flow_keys keys;
__u32 flags;
@@ -106,7 +95,6 @@ struct test {
#define VLAN_HLEN 4
-static __u32 duration;
struct test tests[] = {
{
.name = "ipv4",
@@ -444,8 +432,137 @@ struct test tests[] = {
},
.retval = BPF_FLOW_DISSECTOR_CONTINUE,
},
+ {
+ .name = "ip-gre",
+ .pkt.gre_minimal = {
+ .eth.h_proto = __bpf_constant_htons(ETH_P_IP),
+ .iph.ihl = 5,
+ .iph.protocol = IPPROTO_GRE,
+ .iph.tot_len = __bpf_constant_htons(MAGIC_BYTES),
+ .gre_hdr = {
+ .flags = 0,
+ .protocol = __bpf_constant_htons(ETH_P_IP),
+ },
+ .iph_inner.ihl = 5,
+ .iph_inner.protocol = IPPROTO_TCP,
+ .iph_inner.tot_len =
+ __bpf_constant_htons(MAGIC_BYTES -
+ sizeof(struct iphdr)),
+ .tcp.doff = 5,
+ .tcp.source = 80,
+ .tcp.dest = 8080,
+ },
+ .keys = {
+ .nhoff = ETH_HLEN,
+ .thoff = ETH_HLEN + sizeof(struct iphdr) * 2 +
+ sizeof(struct gre_base_hdr),
+ .addr_proto = ETH_P_IP,
+ .ip_proto = IPPROTO_TCP,
+ .n_proto = __bpf_constant_htons(ETH_P_IP),
+ .is_encap = true,
+ .sport = 80,
+ .dport = 8080,
+ },
+ .retval = BPF_OK,
+ },
+ {
+ .name = "ip-gre-no-encap",
+ .pkt.ipip = {
+ .eth.h_proto = __bpf_constant_htons(ETH_P_IP),
+ .iph.ihl = 5,
+ .iph.protocol = IPPROTO_GRE,
+ .iph.tot_len = __bpf_constant_htons(MAGIC_BYTES),
+ .iph_inner.ihl = 5,
+ .iph_inner.protocol = IPPROTO_TCP,
+ .iph_inner.tot_len =
+ __bpf_constant_htons(MAGIC_BYTES -
+ sizeof(struct iphdr)),
+ .tcp.doff = 5,
+ .tcp.source = 80,
+ .tcp.dest = 8080,
+ },
+ .keys = {
+ .flags = BPF_FLOW_DISSECTOR_F_STOP_AT_ENCAP,
+ .nhoff = ETH_HLEN,
+ .thoff = ETH_HLEN + sizeof(struct iphdr)
+ + sizeof(struct gre_base_hdr),
+ .addr_proto = ETH_P_IP,
+ .ip_proto = IPPROTO_GRE,
+ .n_proto = __bpf_constant_htons(ETH_P_IP),
+ .is_encap = true,
+ },
+ .flags = BPF_FLOW_DISSECTOR_F_STOP_AT_ENCAP,
+ .retval = BPF_OK,
+ },
};
+void serial_test_flow_dissector_namespace(void)
+{
+ struct bpf_flow *skel;
+ struct nstoken *ns;
+ int err, prog_fd;
+
+ skel = bpf_flow__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open/load skeleton"))
+ return;
+
+ prog_fd = bpf_program__fd(skel->progs._dissect);
+ if (!ASSERT_OK_FD(prog_fd, "get dissector fd"))
+ goto out_destroy_skel;
+
+ /* We must be able to attach a flow dissector to root namespace */
+ err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
+ if (!ASSERT_OK(err, "attach on root namespace ok"))
+ goto out_destroy_skel;
+
+ err = make_netns(TEST_NS);
+ if (!ASSERT_OK(err, "create non-root net namespace"))
+ goto out_destroy_skel;
+
+ /* We must not be able to additionally attach a flow dissector to a
+ * non-root net namespace
+ */
+ ns = open_netns(TEST_NS);
+ if (!ASSERT_OK_PTR(ns, "enter non-root net namespace"))
+ goto out_clean_ns;
+ err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
+ if (!ASSERT_ERR(err,
+ "refuse new flow dissector in non-root net namespace"))
+ bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
+ else
+ ASSERT_EQ(errno, EEXIST,
+ "refused because of already attached prog");
+ close_netns(ns);
+
+ /* If no flow dissector is attached to the root namespace, we must
+ * be able to attach one to a non-root net namespace
+ */
+ bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
+ ns = open_netns(TEST_NS);
+ ASSERT_OK_PTR(ns, "enter non-root net namespace");
+ err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
+ close_netns(ns);
+ ASSERT_OK(err, "accept new flow dissector in non-root net namespace");
+
+ /* If a flow dissector is attached to non-root net namespace, attaching
+ * a flow dissector to root namespace must fail
+ */
+ err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
+ if (!ASSERT_ERR(err, "refuse new flow dissector on root namespace"))
+ bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
+ else
+ ASSERT_EQ(errno, EEXIST,
+ "refused because of already attached prog");
+
+ ns = open_netns(TEST_NS);
+ bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
+ close_netns(ns);
+out_clean_ns:
+ remove_netns(TEST_NS);
+out_destroy_skel:
+ bpf_flow__destroy(skel);
+}
+
static int create_tap(const char *ifname)
{
struct ifreq ifr = {
@@ -533,22 +650,27 @@ static int init_prog_array(struct bpf_object *obj, struct bpf_map *prog_array)
return 0;
}
-static void run_tests_skb_less(int tap_fd, struct bpf_map *keys)
+static void run_tests_skb_less(int tap_fd, struct bpf_map *keys,
+ char *test_suffix)
{
+ char test_name[TEST_NAME_MAX_LEN];
int i, err, keys_fd;
keys_fd = bpf_map__fd(keys);
- if (CHECK(keys_fd < 0, "bpf_map__fd", "err %d\n", keys_fd))
+ if (!ASSERT_OK_FD(keys_fd, "bpf_map__fd"))
return;
for (i = 0; i < ARRAY_SIZE(tests); i++) {
/* Keep in sync with 'flags' from eth_get_headlen. */
__u32 eth_get_headlen_flags =
BPF_FLOW_DISSECTOR_F_PARSE_1ST_FRAG;
- LIBBPF_OPTS(bpf_test_run_opts, topts);
struct bpf_flow_keys flow_keys = {};
__u32 key = (__u32)(tests[i].keys.sport) << 16 |
tests[i].keys.dport;
+ snprintf(test_name, TEST_NAME_MAX_LEN, "%s-%s", tests[i].name,
+ test_suffix);
+ if (!test__start_subtest(test_name))
+ continue;
/* For skb-less case we can't pass input flags; run
* only the tests that have a matching set of flags.
@@ -558,78 +680,139 @@ static void run_tests_skb_less(int tap_fd, struct bpf_map *keys)
continue;
err = tx_tap(tap_fd, &tests[i].pkt, sizeof(tests[i].pkt));
- CHECK(err < 0, "tx_tap", "err %d errno %d\n", err, errno);
+ if (!ASSERT_EQ(err, sizeof(tests[i].pkt), "tx_tap"))
+ continue;
/* check the stored flow_keys only if BPF_OK expected */
if (tests[i].retval != BPF_OK)
continue;
err = bpf_map_lookup_elem(keys_fd, &key, &flow_keys);
- ASSERT_OK(err, "bpf_map_lookup_elem");
+ if (!ASSERT_OK(err, "bpf_map_lookup_elem"))
+ continue;
- CHECK_FLOW_KEYS(tests[i].name, flow_keys, tests[i].keys);
+ ASSERT_MEMEQ(&flow_keys, &tests[i].keys,
+ sizeof(struct bpf_flow_keys),
+ "returned flow keys");
err = bpf_map_delete_elem(keys_fd, &key);
ASSERT_OK(err, "bpf_map_delete_elem");
}
}
-static void test_skb_less_prog_attach(struct bpf_flow *skel, int tap_fd)
+void test_flow_dissector_skb_less_direct_attach(void)
{
- int err, prog_fd;
+ int err, prog_fd, tap_fd;
+ struct bpf_flow *skel;
+ struct netns_obj *ns;
- prog_fd = bpf_program__fd(skel->progs._dissect);
- if (CHECK(prog_fd < 0, "bpf_program__fd", "err %d\n", prog_fd))
+ ns = netns_new("flow_dissector_skb_less_indirect_attach_ns", true);
+ if (!ASSERT_OK_PTR(ns, "create and open netns"))
return;
+ skel = bpf_flow__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open/load skeleton"))
+ goto out_clean_ns;
+
+ err = init_prog_array(skel->obj, skel->maps.jmp_table);
+ if (!ASSERT_OK(err, "init_prog_array"))
+ goto out_destroy_skel;
+
+ prog_fd = bpf_program__fd(skel->progs._dissect);
+ if (!ASSERT_OK_FD(prog_fd, "bpf_program__fd"))
+ goto out_destroy_skel;
+
err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
- if (CHECK(err, "bpf_prog_attach", "err %d errno %d\n", err, errno))
- return;
+ if (!ASSERT_OK(err, "bpf_prog_attach"))
+ goto out_destroy_skel;
+
+ tap_fd = create_tap("tap0");
+ if (!ASSERT_OK_FD(tap_fd, "create_tap"))
+ goto out_destroy_skel;
+ err = ifup("tap0");
+ if (!ASSERT_OK(err, "ifup"))
+ goto out_close_tap;
- run_tests_skb_less(tap_fd, skel->maps.last_dissection);
+ run_tests_skb_less(tap_fd, skel->maps.last_dissection,
+ "non-skb-direct-attach");
err = bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
- CHECK(err, "bpf_prog_detach2", "err %d errno %d\n", err, errno);
+ ASSERT_OK(err, "bpf_prog_detach2");
+
+out_close_tap:
+ close(tap_fd);
+out_destroy_skel:
+ bpf_flow__destroy(skel);
+out_clean_ns:
+ netns_free(ns);
}
-static void test_skb_less_link_create(struct bpf_flow *skel, int tap_fd)
+void test_flow_dissector_skb_less_indirect_attach(void)
{
+ int err, net_fd, tap_fd;
+ struct bpf_flow *skel;
struct bpf_link *link;
- int err, net_fd;
+ struct netns_obj *ns;
- net_fd = open("/proc/self/ns/net", O_RDONLY);
- if (CHECK(net_fd < 0, "open(/proc/self/ns/net)", "err %d\n", errno))
+ ns = netns_new("flow_dissector_skb_less_indirect_attach_ns", true);
+ if (!ASSERT_OK_PTR(ns, "create and open netns"))
return;
+ skel = bpf_flow__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open/load skeleton"))
+ goto out_clean_ns;
+
+ net_fd = open("/proc/self/ns/net", O_RDONLY);
+ if (!ASSERT_OK_FD(net_fd, "open(/proc/self/ns/net"))
+ goto out_destroy_skel;
+
+ err = init_prog_array(skel->obj, skel->maps.jmp_table);
+ if (!ASSERT_OK(err, "init_prog_array"))
+ goto out_destroy_skel;
+
+ tap_fd = create_tap("tap0");
+ if (!ASSERT_OK_FD(tap_fd, "create_tap"))
+ goto out_close_ns;
+ err = ifup("tap0");
+ if (!ASSERT_OK(err, "ifup"))
+ goto out_close_tap;
+
link = bpf_program__attach_netns(skel->progs._dissect, net_fd);
if (!ASSERT_OK_PTR(link, "attach_netns"))
- goto out_close;
+ goto out_close_tap;
- run_tests_skb_less(tap_fd, skel->maps.last_dissection);
+ run_tests_skb_less(tap_fd, skel->maps.last_dissection,
+ "non-skb-indirect-attach");
err = bpf_link__destroy(link);
- CHECK(err, "bpf_link__destroy", "err %d\n", err);
-out_close:
+ ASSERT_OK(err, "bpf_link__destroy");
+
+out_close_tap:
+ close(tap_fd);
+out_close_ns:
close(net_fd);
+out_destroy_skel:
+ bpf_flow__destroy(skel);
+out_clean_ns:
+ netns_free(ns);
}
-void test_flow_dissector(void)
+void test_flow_dissector_skb(void)
{
- int i, err, prog_fd, keys_fd = -1, tap_fd;
+ char test_name[TEST_NAME_MAX_LEN];
struct bpf_flow *skel;
+ int i, err, prog_fd;
skel = bpf_flow__open_and_load();
- if (CHECK(!skel, "skel", "failed to open/load skeleton\n"))
+ if (!ASSERT_OK_PTR(skel, "open/load skeleton"))
return;
- prog_fd = bpf_program__fd(skel->progs._dissect);
- if (CHECK(prog_fd < 0, "bpf_program__fd", "err %d\n", prog_fd))
- goto out_destroy_skel;
- keys_fd = bpf_map__fd(skel->maps.last_dissection);
- if (CHECK(keys_fd < 0, "bpf_map__fd", "err %d\n", keys_fd))
- goto out_destroy_skel;
err = init_prog_array(skel->obj, skel->maps.jmp_table);
- if (CHECK(err, "init_prog_array", "err %d\n", err))
+ if (!ASSERT_OK(err, "init_prog_array"))
+ goto out_destroy_skel;
+
+ prog_fd = bpf_program__fd(skel->progs._dissect);
+ if (!ASSERT_OK_FD(prog_fd, "bpf_program__fd"))
goto out_destroy_skel;
for (i = 0; i < ARRAY_SIZE(tests); i++) {
@@ -641,6 +824,10 @@ void test_flow_dissector(void)
);
static struct bpf_flow_keys ctx = {};
+ snprintf(test_name, TEST_NAME_MAX_LEN, "%s-skb", tests[i].name);
+ if (!test__start_subtest(test_name))
+ continue;
+
if (tests[i].flags) {
topts.ctx_in = &ctx;
topts.ctx_size_in = sizeof(ctx);
@@ -656,26 +843,12 @@ void test_flow_dissector(void)
continue;
ASSERT_EQ(topts.data_size_out, sizeof(flow_keys),
"test_run data_size_out");
- CHECK_FLOW_KEYS(tests[i].name, flow_keys, tests[i].keys);
+ ASSERT_MEMEQ(&flow_keys, &tests[i].keys,
+ sizeof(struct bpf_flow_keys),
+ "returned flow keys");
}
- /* Do the same tests but for skb-less flow dissector.
- * We use a known path in the net/tun driver that calls
- * eth_get_headlen and we manually export bpf_flow_keys
- * via BPF map in this case.
- */
-
- tap_fd = create_tap("tap0");
- CHECK(tap_fd < 0, "create_tap", "tap_fd %d errno %d\n", tap_fd, errno);
- err = ifup("tap0");
- CHECK(err, "ifup", "err %d errno %d\n", err, errno);
-
- /* Test direct prog attachment */
- test_skb_less_prog_attach(skel, tap_fd);
- /* Test indirect prog attachment via link */
- test_skb_less_link_create(skel, tap_fd);
-
- close(tap_fd);
out_destroy_skel:
bpf_flow__destroy(skel);
}
+
diff --git a/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c b/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c
new file mode 100644
index 000000000000..3729fbfd3084
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c
@@ -0,0 +1,792 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#define _GNU_SOURCE
+#include <stdbool.h>
+#include <stdlib.h>
+#include <stdio.h>
+#include <bpf/bpf.h>
+#include <linux/bpf.h>
+#include <bpf/libbpf.h>
+#include <arpa/inet.h>
+#include <asm/byteorder.h>
+#include <netinet/udp.h>
+#include <poll.h>
+#include <string.h>
+#include <sys/ioctl.h>
+#include <sys/socket.h>
+#include <sys/time.h>
+#include <unistd.h>
+#include "test_progs.h"
+#include "network_helpers.h"
+#include "bpf_util.h"
+#include "bpf_flow.skel.h"
+
+#define CFG_PORT_INNER 8000
+#define CFG_PORT_GUE 6080
+#define SUBTEST_NAME_MAX_LEN 32
+#define TEST_NAME_MAX_LEN (32 + SUBTEST_NAME_MAX_LEN)
+#define MAX_SOURCE_PORTS 3
+#define TEST_PACKETS_COUNT 10
+#define TEST_PACKET_LEN 100
+#define TEST_PACKET_PATTERN 'a'
+#define TEST_IPV4 "192.168.0.1/32"
+#define TEST_IPV6 "100::a/128"
+#define TEST_TUNNEL_REMOTE "127.0.0.2"
+#define TEST_TUNNEL_LOCAL "127.0.0.1"
+
+#define INIT_ADDR4(addr4, port) \
+ { \
+ .sin_family = AF_INET, \
+ .sin_port = __constant_htons(port), \
+ .sin_addr.s_addr = __constant_htonl(addr4), \
+ }
+
+#define INIT_ADDR6(addr6, port) \
+ { \
+ .sin6_family = AF_INET6, \
+ .sin6_port = __constant_htons(port), \
+ .sin6_addr = addr6, \
+ }
+#define TEST_IN4_SRC_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK + 2, 0)
+#define TEST_IN4_DST_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK, CFG_PORT_INNER)
+#define TEST_OUT4_SRC_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK + 1, 0)
+#define TEST_OUT4_DST_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK, 0)
+
+#define TEST_IN6_SRC_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0)
+#define TEST_IN6_DST_ADDR_DEFAULT \
+ INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, CFG_PORT_INNER)
+#define TEST_OUT6_SRC_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0)
+#define TEST_OUT6_DST_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0)
+
+#define TEST_IN4_SRC_ADDR_DISSECT_CONTINUE INIT_ADDR4(INADDR_LOOPBACK + 126, 0)
+#define TEST_IN4_SRC_ADDR_IPIP INIT_ADDR4((in_addr_t)0x01010101, 0)
+#define TEST_IN4_DST_ADDR_IPIP INIT_ADDR4((in_addr_t)0xC0A80001, CFG_PORT_INNER)
+
+struct grehdr {
+ uint16_t unused;
+ uint16_t protocol;
+} __packed;
+
+struct guehdr {
+ union {
+ struct {
+#if defined(__LITTLE_ENDIAN_BITFIELD)
+ __u8 hlen : 5, control : 1, version : 2;
+#elif defined(__BIG_ENDIAN_BITFIELD)
+ __u8 version : 2, control : 1, hlen : 5;
+#else
+#error "Please fix <asm/byteorder.h>"
+#endif
+ __u8 proto_ctype;
+ __be16 flags;
+ };
+ __be32 word;
+ };
+};
+
+static char buf[ETH_DATA_LEN];
+
+struct test_configuration {
+ char name[SUBTEST_NAME_MAX_LEN];
+ int (*test_setup)(void);
+ void (*test_teardown)(void);
+ int source_ports[MAX_SOURCE_PORTS];
+ int cfg_l3_inner;
+ struct sockaddr_in in_saddr4;
+ struct sockaddr_in in_daddr4;
+ struct sockaddr_in6 in_saddr6;
+ struct sockaddr_in6 in_daddr6;
+ int cfg_l3_outer;
+ struct sockaddr_in out_saddr4;
+ struct sockaddr_in out_daddr4;
+ struct sockaddr_in6 out_saddr6;
+ struct sockaddr_in6 out_daddr6;
+ int cfg_encap_proto;
+ uint8_t cfg_dsfield_inner;
+ uint8_t cfg_dsfield_outer;
+ int cfg_l3_extra;
+ struct sockaddr_in extra_saddr4;
+ struct sockaddr_in extra_daddr4;
+ struct sockaddr_in6 extra_saddr6;
+ struct sockaddr_in6 extra_daddr6;
+};
+
+static unsigned long util_gettime(void)
+{
+ struct timeval tv;
+
+ gettimeofday(&tv, NULL);
+ return (tv.tv_sec * 1000) + (tv.tv_usec / 1000);
+}
+
+static void build_ipv4_header(void *header, uint8_t proto, uint32_t src,
+ uint32_t dst, int payload_len, uint8_t tos)
+{
+ struct iphdr *iph = header;
+
+ iph->ihl = 5;
+ iph->version = 4;
+ iph->tos = tos;
+ iph->ttl = 8;
+ iph->tot_len = htons(sizeof(*iph) + payload_len);
+ iph->id = htons(1337);
+ iph->protocol = proto;
+ iph->saddr = src;
+ iph->daddr = dst;
+ iph->check = build_ip_csum((void *)iph);
+}
+
+static void ipv6_set_dsfield(struct ipv6hdr *ip6h, uint8_t dsfield)
+{
+ uint16_t val, *ptr = (uint16_t *)ip6h;
+
+ val = ntohs(*ptr);
+ val &= 0xF00F;
+ val |= ((uint16_t)dsfield) << 4;
+ *ptr = htons(val);
+}
+
+static void build_ipv6_header(void *header, uint8_t proto,
+ const struct sockaddr_in6 *src,
+ const struct sockaddr_in6 *dst, int payload_len,
+ uint8_t dsfield)
+{
+ struct ipv6hdr *ip6h = header;
+
+ ip6h->version = 6;
+ ip6h->payload_len = htons(payload_len);
+ ip6h->nexthdr = proto;
+ ip6h->hop_limit = 8;
+ ipv6_set_dsfield(ip6h, dsfield);
+
+ memcpy(&ip6h->saddr, &src->sin6_addr, sizeof(ip6h->saddr));
+ memcpy(&ip6h->daddr, &dst->sin6_addr, sizeof(ip6h->daddr));
+}
+
+static void build_udp_header(void *header, int payload_len, uint16_t sport,
+ uint16_t dport, int family)
+{
+ struct udphdr *udph = header;
+ int len = sizeof(*udph) + payload_len;
+
+ udph->source = htons(sport);
+ udph->dest = htons(dport);
+ udph->len = htons(len);
+ udph->check = 0;
+ if (family == AF_INET)
+ udph->check = build_udp_v4_csum(header - sizeof(struct iphdr),
+ udph);
+ else
+ udph->check = build_udp_v6_csum(header - sizeof(struct ipv6hdr),
+ udph);
+}
+
+static void build_gue_header(void *header, uint8_t proto)
+{
+ struct guehdr *gueh = header;
+
+ gueh->proto_ctype = proto;
+}
+
+static void build_gre_header(void *header, uint16_t proto)
+{
+ struct grehdr *greh = header;
+
+ greh->protocol = htons(proto);
+}
+
+static int l3_length(int family)
+{
+ if (family == AF_INET)
+ return sizeof(struct iphdr);
+ else
+ return sizeof(struct ipv6hdr);
+}
+
+static int build_packet(const struct test_configuration *test, uint16_t sport)
+{
+ int ol3_len = 0, ol4_len = 0, il3_len = 0, il4_len = 0;
+ int el3_len = 0, packet_len;
+
+ memset(buf, 0, ETH_DATA_LEN);
+
+ if (test->cfg_l3_extra)
+ el3_len = l3_length(test->cfg_l3_extra);
+
+ /* calculate header offsets */
+ if (test->cfg_encap_proto) {
+ ol3_len = l3_length(test->cfg_l3_outer);
+
+ if (test->cfg_encap_proto == IPPROTO_GRE)
+ ol4_len = sizeof(struct grehdr);
+ else if (test->cfg_encap_proto == IPPROTO_UDP)
+ ol4_len = sizeof(struct udphdr) + sizeof(struct guehdr);
+ }
+
+ il3_len = l3_length(test->cfg_l3_inner);
+ il4_len = sizeof(struct udphdr);
+
+ packet_len = el3_len + ol3_len + ol4_len + il3_len + il4_len +
+ TEST_PACKET_LEN;
+ if (!ASSERT_LE(packet_len, sizeof(buf), "check packet size"))
+ return -1;
+
+ /*
+ * Fill packet from inside out, to calculate correct checksums.
+ * But create ip before udp headers, as udp uses ip for pseudo-sum.
+ */
+ memset(buf + el3_len + ol3_len + ol4_len + il3_len + il4_len,
+ TEST_PACKET_PATTERN, TEST_PACKET_LEN);
+
+ /* add zero byte for udp csum padding */
+ buf[el3_len + ol3_len + ol4_len + il3_len + il4_len + TEST_PACKET_LEN] =
+ 0;
+
+ switch (test->cfg_l3_inner) {
+ case PF_INET:
+ build_ipv4_header(buf + el3_len + ol3_len + ol4_len,
+ IPPROTO_UDP, test->in_saddr4.sin_addr.s_addr,
+ test->in_daddr4.sin_addr.s_addr,
+ il4_len + TEST_PACKET_LEN,
+ test->cfg_dsfield_inner);
+ break;
+ case PF_INET6:
+ build_ipv6_header(buf + el3_len + ol3_len + ol4_len,
+ IPPROTO_UDP, &test->in_saddr6,
+ &test->in_daddr6, il4_len + TEST_PACKET_LEN,
+ test->cfg_dsfield_inner);
+ break;
+ }
+
+ build_udp_header(buf + el3_len + ol3_len + ol4_len + il3_len,
+ TEST_PACKET_LEN, sport, CFG_PORT_INNER,
+ test->cfg_l3_inner);
+
+ if (!test->cfg_encap_proto)
+ return il3_len + il4_len + TEST_PACKET_LEN;
+
+ switch (test->cfg_l3_outer) {
+ case PF_INET:
+ build_ipv4_header(buf + el3_len, test->cfg_encap_proto,
+ test->out_saddr4.sin_addr.s_addr,
+ test->out_daddr4.sin_addr.s_addr,
+ ol4_len + il3_len + il4_len + TEST_PACKET_LEN,
+ test->cfg_dsfield_outer);
+ break;
+ case PF_INET6:
+ build_ipv6_header(buf + el3_len, test->cfg_encap_proto,
+ &test->out_saddr6, &test->out_daddr6,
+ ol4_len + il3_len + il4_len + TEST_PACKET_LEN,
+ test->cfg_dsfield_outer);
+ break;
+ }
+
+ switch (test->cfg_encap_proto) {
+ case IPPROTO_UDP:
+ build_gue_header(buf + el3_len + ol3_len + ol4_len -
+ sizeof(struct guehdr),
+ test->cfg_l3_inner == PF_INET ? IPPROTO_IPIP :
+ IPPROTO_IPV6);
+ build_udp_header(buf + el3_len + ol3_len,
+ sizeof(struct guehdr) + il3_len + il4_len +
+ TEST_PACKET_LEN,
+ sport, CFG_PORT_GUE, test->cfg_l3_outer);
+ break;
+ case IPPROTO_GRE:
+ build_gre_header(buf + el3_len + ol3_len,
+ test->cfg_l3_inner == PF_INET ? ETH_P_IP :
+ ETH_P_IPV6);
+ break;
+ }
+
+ switch (test->cfg_l3_extra) {
+ case PF_INET:
+ build_ipv4_header(buf,
+ test->cfg_l3_outer == PF_INET ? IPPROTO_IPIP :
+ IPPROTO_IPV6,
+ test->extra_saddr4.sin_addr.s_addr,
+ test->extra_daddr4.sin_addr.s_addr,
+ ol3_len + ol4_len + il3_len + il4_len +
+ TEST_PACKET_LEN,
+ 0);
+ break;
+ case PF_INET6:
+ build_ipv6_header(buf,
+ test->cfg_l3_outer == PF_INET ? IPPROTO_IPIP :
+ IPPROTO_IPV6,
+ &test->extra_saddr6, &test->extra_daddr6,
+ ol3_len + ol4_len + il3_len + il4_len +
+ TEST_PACKET_LEN,
+ 0);
+ break;
+ }
+
+ return el3_len + ol3_len + ol4_len + il3_len + il4_len +
+ TEST_PACKET_LEN;
+}
+
+/* sender transmits encapsulated over RAW or unencap'd over UDP */
+static int setup_tx(const struct test_configuration *test)
+{
+ int family, fd, ret;
+
+ if (test->cfg_l3_extra)
+ family = test->cfg_l3_extra;
+ else if (test->cfg_l3_outer)
+ family = test->cfg_l3_outer;
+ else
+ family = test->cfg_l3_inner;
+
+ fd = socket(family, SOCK_RAW, IPPROTO_RAW);
+ if (!ASSERT_OK_FD(fd, "setup tx socket"))
+ return fd;
+
+ if (test->cfg_l3_extra) {
+ if (test->cfg_l3_extra == PF_INET)
+ ret = connect(fd, (void *)&test->extra_daddr4,
+ sizeof(test->extra_daddr4));
+ else
+ ret = connect(fd, (void *)&test->extra_daddr6,
+ sizeof(test->extra_daddr6));
+ if (!ASSERT_OK(ret, "connect")) {
+ close(fd);
+ return ret;
+ }
+ } else if (test->cfg_l3_outer) {
+ /* connect to destination if not encapsulated */
+ if (test->cfg_l3_outer == PF_INET)
+ ret = connect(fd, (void *)&test->out_daddr4,
+ sizeof(test->out_daddr4));
+ else
+ ret = connect(fd, (void *)&test->out_daddr6,
+ sizeof(test->out_daddr6));
+ if (!ASSERT_OK(ret, "connect")) {
+ close(fd);
+ return ret;
+ }
+ } else {
+ /* otherwise using loopback */
+ if (test->cfg_l3_inner == PF_INET)
+ ret = connect(fd, (void *)&test->in_daddr4,
+ sizeof(test->in_daddr4));
+ else
+ ret = connect(fd, (void *)&test->in_daddr6,
+ sizeof(test->in_daddr6));
+ if (!ASSERT_OK(ret, "connect")) {
+ close(fd);
+ return ret;
+ }
+ }
+
+ return fd;
+}
+
+/* receiver reads unencapsulated UDP */
+static int setup_rx(const struct test_configuration *test)
+{
+ int fd, ret;
+
+ fd = socket(test->cfg_l3_inner, SOCK_DGRAM, 0);
+ if (!ASSERT_OK_FD(fd, "socket rx"))
+ return fd;
+
+ if (test->cfg_l3_inner == PF_INET)
+ ret = bind(fd, (void *)&test->in_daddr4,
+ sizeof(test->in_daddr4));
+ else
+ ret = bind(fd, (void *)&test->in_daddr6,
+ sizeof(test->in_daddr6));
+ if (!ASSERT_OK(ret, "bind rx")) {
+ close(fd);
+ return ret;
+ }
+
+ return fd;
+}
+
+static int do_tx(int fd, const char *pkt, int len)
+{
+ int ret;
+
+ ret = write(fd, pkt, len);
+ return ret != len;
+}
+
+static int do_poll(int fd, short events, int timeout)
+{
+ struct pollfd pfd;
+ int ret;
+
+ pfd.fd = fd;
+ pfd.events = events;
+
+ ret = poll(&pfd, 1, timeout);
+ return ret;
+}
+
+static int do_rx(int fd)
+{
+ char rbuf;
+ int ret, num = 0;
+
+ while (1) {
+ ret = recv(fd, &rbuf, 1, MSG_DONTWAIT);
+ if (ret == -1 && errno == EAGAIN)
+ break;
+ if (ret < 0)
+ return -1;
+ if (!ASSERT_EQ(rbuf, TEST_PACKET_PATTERN, "check pkt pattern"))
+ return -1;
+ num++;
+ }
+
+ return num;
+}
+
+static int run_test(const struct test_configuration *test,
+ int source_port_index)
+{
+ int fdt = -1, fdr = -1, len, tx = 0, rx = 0, err;
+ unsigned long tstop, tcur;
+
+ fdr = setup_rx(test);
+ fdt = setup_tx(test);
+ if (!ASSERT_OK_FD(fdr, "setup rx") || !ASSERT_OK_FD(fdt, "setup tx")) {
+ err = -1;
+ goto out_close_sockets;
+ }
+
+ len = build_packet(test,
+ (uint16_t)test->source_ports[source_port_index]);
+ if (!ASSERT_GT(len, 0, "build test packet"))
+ return -1;
+
+ tcur = util_gettime();
+ tstop = tcur;
+
+ while (tx < TEST_PACKETS_COUNT) {
+ if (!ASSERT_OK(do_tx(fdt, buf, len), "do_tx"))
+ break;
+ tx++;
+ err = do_rx(fdr);
+ if (!ASSERT_GE(err, 0, "do_rx"))
+ break;
+ rx += err;
+ }
+
+ /* read straggler packets, if any */
+ if (rx < tx) {
+ tstop = util_gettime() + 100;
+ while (rx < tx) {
+ tcur = util_gettime();
+ if (tcur >= tstop)
+ break;
+
+ err = do_poll(fdr, POLLIN, tstop - tcur);
+ if (err < 0)
+ break;
+ err = do_rx(fdr);
+ if (err >= 0)
+ rx += err;
+ }
+ }
+
+out_close_sockets:
+ close(fdt);
+ close(fdr);
+ return rx;
+}
+
+static int attach_and_configure_program(struct bpf_flow *skel)
+{
+ struct bpf_map *prog_array = skel->maps.jmp_table;
+ int main_prog_fd, sub_prog_fd, map_fd, i, err;
+ struct bpf_program *prog;
+ char prog_name[32];
+
+ main_prog_fd = bpf_program__fd(skel->progs._dissect);
+ if (main_prog_fd < 0)
+ return main_prog_fd;
+
+ err = bpf_prog_attach(main_prog_fd, 0, BPF_FLOW_DISSECTOR, 0);
+ if (err)
+ return err;
+
+ map_fd = bpf_map__fd(prog_array);
+ if (map_fd < 0)
+ return map_fd;
+
+ for (i = 0; i < bpf_map__max_entries(prog_array); i++) {
+ snprintf(prog_name, sizeof(prog_name), "flow_dissector_%d", i);
+
+ prog = bpf_object__find_program_by_name(skel->obj, prog_name);
+ if (!prog)
+ return -1;
+
+ sub_prog_fd = bpf_program__fd(prog);
+ if (sub_prog_fd < 0)
+ return -1;
+
+ err = bpf_map_update_elem(map_fd, &i, &sub_prog_fd, BPF_ANY);
+ if (err)
+ return -1;
+ }
+
+ return main_prog_fd;
+}
+
+static void detach_program(struct bpf_flow *skel, int prog_fd)
+{
+ bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR);
+}
+
+static int set_port_drop(int pf, bool multi_port)
+{
+ SYS(fail, "tc qdisc add dev lo ingress");
+ SYS(fail_delete_qdisc, "tc filter add %s %s %s %s %s %s %s %s %s %s",
+ "dev lo",
+ "parent FFFF:",
+ "protocol", pf == PF_INET6 ? "ipv6" : "ip",
+ "pref 1337",
+ "flower",
+ "ip_proto udp",
+ "src_port", multi_port ? "8-10" : "9",
+ "action drop");
+ return 0;
+
+fail_delete_qdisc:
+ SYS_NOFAIL("tc qdisc del dev lo ingress");
+fail:
+ return 1;
+}
+
+static void remove_filter(void)
+{
+ SYS_NOFAIL("tc filter del dev lo ingress");
+ SYS_NOFAIL("tc qdisc del dev lo ingress");
+}
+
+static int ipv4_setup(void)
+{
+ return set_port_drop(PF_INET, false);
+}
+
+static int ipv6_setup(void)
+{
+ return set_port_drop(PF_INET6, false);
+}
+
+static int port_range_setup(void)
+{
+ return set_port_drop(PF_INET, true);
+}
+
+static int set_addresses(void)
+{
+ SYS(out, "ip -4 addr add %s dev lo", TEST_IPV4);
+ SYS(out_remove_ipv4, "ip -6 addr add %s dev lo", TEST_IPV6);
+ return 0;
+out_remove_ipv4:
+ SYS_NOFAIL("ip -4 addr del %s dev lo", TEST_IPV4);
+out:
+ return -1;
+}
+
+static void unset_addresses(void)
+{
+ SYS_NOFAIL("ip -4 addr del %s dev lo", TEST_IPV4);
+ SYS_NOFAIL("ip -6 addr del %s dev lo", TEST_IPV6);
+}
+
+static int ipip_setup(void)
+{
+ if (!ASSERT_OK(set_addresses(), "configure addresses"))
+ return -1;
+ if (!ASSERT_OK(set_port_drop(PF_INET, false), "set filter"))
+ goto out_unset_addresses;
+ SYS(out_remove_filter,
+ "ip link add ipip_test type ipip remote %s local %s dev lo",
+ TEST_TUNNEL_REMOTE, TEST_TUNNEL_LOCAL);
+ SYS(out_clean_netif, "ip link set ipip_test up");
+ return 0;
+
+out_clean_netif:
+ SYS_NOFAIL("ip link del ipip_test");
+out_remove_filter:
+ remove_filter();
+out_unset_addresses:
+ unset_addresses();
+ return -1;
+}
+
+static void ipip_shutdown(void)
+{
+ SYS_NOFAIL("ip link del ipip_test");
+ remove_filter();
+ unset_addresses();
+}
+
+static int gre_setup(void)
+{
+ if (!ASSERT_OK(set_addresses(), "configure addresses"))
+ return -1;
+ if (!ASSERT_OK(set_port_drop(PF_INET, false), "set filter"))
+ goto out_unset_addresses;
+ SYS(out_remove_filter,
+ "ip link add gre_test type gre remote %s local %s dev lo",
+ TEST_TUNNEL_REMOTE, TEST_TUNNEL_LOCAL);
+ SYS(out_clean_netif, "ip link set gre_test up");
+ return 0;
+
+out_clean_netif:
+ SYS_NOFAIL("ip link del ipip_test");
+out_remove_filter:
+ remove_filter();
+out_unset_addresses:
+ unset_addresses();
+ return -1;
+}
+
+static void gre_shutdown(void)
+{
+ SYS_NOFAIL("ip link del gre_test");
+ remove_filter();
+ unset_addresses();
+}
+
+static const struct test_configuration tests_input[] = {
+ {
+ .name = "ipv4",
+ .test_setup = ipv4_setup,
+ .test_teardown = remove_filter,
+ .source_ports = { 8, 9, 10 },
+ .cfg_l3_inner = PF_INET,
+ .in_saddr4 = TEST_IN4_SRC_ADDR_DEFAULT,
+ .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT
+ },
+ {
+ .name = "ipv4_continue_dissect",
+ .test_setup = ipv4_setup,
+ .test_teardown = remove_filter,
+ .source_ports = { 8, 9, 10 },
+ .cfg_l3_inner = PF_INET,
+ .in_saddr4 = TEST_IN4_SRC_ADDR_DISSECT_CONTINUE,
+ .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT },
+ {
+ .name = "ipip",
+ .test_setup = ipip_setup,
+ .test_teardown = ipip_shutdown,
+ .source_ports = { 8, 9, 10 },
+ .cfg_l3_inner = PF_INET,
+ .in_saddr4 = TEST_IN4_SRC_ADDR_IPIP,
+ .in_daddr4 = TEST_IN4_DST_ADDR_IPIP,
+ .out_saddr4 = TEST_OUT4_SRC_ADDR_DEFAULT,
+ .out_daddr4 = TEST_OUT4_DST_ADDR_DEFAULT,
+ .cfg_l3_outer = PF_INET,
+ .cfg_encap_proto = IPPROTO_IPIP,
+
+ },
+ {
+ .name = "gre",
+ .test_setup = gre_setup,
+ .test_teardown = gre_shutdown,
+ .source_ports = { 8, 9, 10 },
+ .cfg_l3_inner = PF_INET,
+ .in_saddr4 = TEST_IN4_SRC_ADDR_IPIP,
+ .in_daddr4 = TEST_IN4_DST_ADDR_IPIP,
+ .out_saddr4 = TEST_OUT4_SRC_ADDR_DEFAULT,
+ .out_daddr4 = TEST_OUT4_DST_ADDR_DEFAULT,
+ .cfg_l3_outer = PF_INET,
+ .cfg_encap_proto = IPPROTO_GRE,
+ },
+ {
+ .name = "port_range",
+ .test_setup = port_range_setup,
+ .test_teardown = remove_filter,
+ .source_ports = { 7, 9, 11 },
+ .cfg_l3_inner = PF_INET,
+ .in_saddr4 = TEST_IN4_SRC_ADDR_DEFAULT,
+ .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT },
+ {
+ .name = "ipv6",
+ .test_setup = ipv6_setup,
+ .test_teardown = remove_filter,
+ .source_ports = { 8, 9, 10 },
+ .cfg_l3_inner = PF_INET6,
+ .in_saddr6 = TEST_IN6_SRC_ADDR_DEFAULT,
+ .in_daddr6 = TEST_IN6_DST_ADDR_DEFAULT
+ },
+};
+
+struct test_ctx {
+ struct bpf_flow *skel;
+ struct netns_obj *ns;
+ int prog_fd;
+};
+
+static int test_global_init(struct test_ctx *ctx)
+{
+ int err;
+
+ ctx->skel = bpf_flow__open_and_load();
+ if (!ASSERT_OK_PTR(ctx->skel, "open and load flow_dissector"))
+ return -1;
+
+ ctx->ns = netns_new("flow_dissector_classification", true);
+ if (!ASSERT_OK_PTR(ctx->ns, "switch ns"))
+ goto out_destroy_skel;
+
+ err = write_sysctl("/proc/sys/net/ipv4/conf/default/rp_filter", "0");
+ err |= write_sysctl("/proc/sys/net/ipv4/conf/all/rp_filter", "0");
+ err |= write_sysctl("/proc/sys/net/ipv4/conf/lo/rp_filter", "0");
+ if (!ASSERT_OK(err, "configure net tunables"))
+ goto out_clean_ns;
+
+ ctx->prog_fd = attach_and_configure_program(ctx->skel);
+ if (!ASSERT_OK_FD(ctx->prog_fd, "attach and configure program"))
+ goto out_clean_ns;
+ return 0;
+out_clean_ns:
+ netns_free(ctx->ns);
+out_destroy_skel:
+ bpf_flow__destroy(ctx->skel);
+ return -1;
+}
+
+static void test_global_shutdown(struct test_ctx *ctx)
+{
+ detach_program(ctx->skel, ctx->prog_fd);
+ netns_free(ctx->ns);
+ bpf_flow__destroy(ctx->skel);
+}
+
+void test_flow_dissector_classification(void)
+{
+ struct test_ctx ctx;
+ const struct test_configuration *test;
+ int i;
+
+ if (test_global_init(&ctx))
+ return;
+
+ for (i = 0; i < ARRAY_SIZE(tests_input); i++) {
+ if (!test__start_subtest(tests_input[i].name))
+ continue;
+ test = &tests_input[i];
+ /* All tests are expected to have one rx-ok port first,
+ * then a non-working rx port, and finally a rx-ok port
+ */
+ if (test->test_setup &&
+ !ASSERT_OK(test->test_setup(), "init filter"))
+ continue;
+
+ ASSERT_EQ(run_test(test, 0), TEST_PACKETS_COUNT,
+ "test first port");
+ ASSERT_EQ(run_test(test, 1), 0, "test second port");
+ ASSERT_EQ(run_test(test, 2), TEST_PACKETS_COUNT,
+ "test third port");
+ if (test->test_teardown)
+ test->test_teardown();
+ }
+ test_global_shutdown(&ctx);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/free_timer.c b/tools/testing/selftests/bpf/prog_tests/free_timer.c
new file mode 100644
index 000000000000..b7b77a6b2979
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/free_timer.c
@@ -0,0 +1,165 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (C) 2025. Huawei Technologies Co., Ltd */
+#define _GNU_SOURCE
+#include <unistd.h>
+#include <sys/syscall.h>
+#include <test_progs.h>
+
+#include "free_timer.skel.h"
+
+struct run_ctx {
+ struct bpf_program *start_prog;
+ struct bpf_program *overwrite_prog;
+ pthread_barrier_t notify;
+ int loop;
+ bool start;
+ bool stop;
+};
+
+static void start_threads(struct run_ctx *ctx)
+{
+ ctx->start = true;
+}
+
+static void stop_threads(struct run_ctx *ctx)
+{
+ ctx->stop = true;
+ /* Guarantee the order between ->stop and ->start */
+ __atomic_store_n(&ctx->start, true, __ATOMIC_RELEASE);
+}
+
+static int wait_for_start(struct run_ctx *ctx)
+{
+ while (!__atomic_load_n(&ctx->start, __ATOMIC_ACQUIRE))
+ usleep(10);
+
+ return ctx->stop;
+}
+
+static void *overwrite_timer_fn(void *arg)
+{
+ struct run_ctx *ctx = arg;
+ int loop, fd, err;
+ cpu_set_t cpuset;
+ long ret = 0;
+
+ /* Pin on CPU 0 */
+ CPU_ZERO(&cpuset);
+ CPU_SET(0, &cpuset);
+ pthread_setaffinity_np(pthread_self(), sizeof(cpuset), &cpuset);
+
+ /* Is the thread being stopped ? */
+ err = wait_for_start(ctx);
+ if (err)
+ return NULL;
+
+ fd = bpf_program__fd(ctx->overwrite_prog);
+ loop = ctx->loop;
+ while (loop-- > 0) {
+ LIBBPF_OPTS(bpf_test_run_opts, opts);
+
+ /* Wait for start thread to complete */
+ pthread_barrier_wait(&ctx->notify);
+
+ /* Overwrite timers */
+ err = bpf_prog_test_run_opts(fd, &opts);
+ if (err)
+ ret |= 1;
+ else if (opts.retval)
+ ret |= 2;
+
+ /* Notify start thread to start timers */
+ pthread_barrier_wait(&ctx->notify);
+ }
+
+ return (void *)ret;
+}
+
+static void *start_timer_fn(void *arg)
+{
+ struct run_ctx *ctx = arg;
+ int loop, fd, err;
+ cpu_set_t cpuset;
+ long ret = 0;
+
+ /* Pin on CPU 1 */
+ CPU_ZERO(&cpuset);
+ CPU_SET(1, &cpuset);
+ pthread_setaffinity_np(pthread_self(), sizeof(cpuset), &cpuset);
+
+ /* Is the thread being stopped ? */
+ err = wait_for_start(ctx);
+ if (err)
+ return NULL;
+
+ fd = bpf_program__fd(ctx->start_prog);
+ loop = ctx->loop;
+ while (loop-- > 0) {
+ LIBBPF_OPTS(bpf_test_run_opts, opts);
+
+ /* Run the prog to start timer */
+ err = bpf_prog_test_run_opts(fd, &opts);
+ if (err)
+ ret |= 4;
+ else if (opts.retval)
+ ret |= 8;
+
+ /* Notify overwrite thread to do overwrite */
+ pthread_barrier_wait(&ctx->notify);
+
+ /* Wait for overwrite thread to complete */
+ pthread_barrier_wait(&ctx->notify);
+ }
+
+ return (void *)ret;
+}
+
+void test_free_timer(void)
+{
+ struct free_timer *skel;
+ struct bpf_program *prog;
+ struct run_ctx ctx;
+ pthread_t tid[2];
+ void *ret;
+ int err;
+
+ skel = free_timer__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open_load"))
+ return;
+
+ memset(&ctx, 0, sizeof(ctx));
+
+ prog = bpf_object__find_program_by_name(skel->obj, "start_timer");
+ if (!ASSERT_OK_PTR(prog, "find start prog"))
+ goto out;
+ ctx.start_prog = prog;
+
+ prog = bpf_object__find_program_by_name(skel->obj, "overwrite_timer");
+ if (!ASSERT_OK_PTR(prog, "find overwrite prog"))
+ goto out;
+ ctx.overwrite_prog = prog;
+
+ pthread_barrier_init(&ctx.notify, NULL, 2);
+ ctx.loop = 10;
+
+ err = pthread_create(&tid[0], NULL, start_timer_fn, &ctx);
+ if (!ASSERT_OK(err, "create start_timer"))
+ goto out;
+
+ err = pthread_create(&tid[1], NULL, overwrite_timer_fn, &ctx);
+ if (!ASSERT_OK(err, "create overwrite_timer")) {
+ stop_threads(&ctx);
+ goto out;
+ }
+
+ start_threads(&ctx);
+
+ ret = NULL;
+ err = pthread_join(tid[0], &ret);
+ ASSERT_EQ(err | (long)ret, 0, "start_timer");
+ ret = NULL;
+ err = pthread_join(tid[1], &ret);
+ ASSERT_EQ(err | (long)ret, 0, "overwrite_timer");
+out:
+ free_timer__destroy(skel);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c b/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c
index 66ab1cae923e..e19ef509ebf8 100644
--- a/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c
+++ b/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c
@@ -397,6 +397,31 @@ cleanup:
kprobe_multi_session_cookie__destroy(skel);
}
+static void test_unique_match(void)
+{
+ LIBBPF_OPTS(bpf_kprobe_multi_opts, opts);
+ struct kprobe_multi *skel = NULL;
+ struct bpf_link *link = NULL;
+
+ skel = kprobe_multi__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "kprobe_multi__open_and_load"))
+ return;
+
+ opts.unique_match = true;
+ skel->bss->pid = getpid();
+ link = bpf_program__attach_kprobe_multi_opts(skel->progs.test_kprobe_manual,
+ "bpf_fentry_test*", &opts);
+ if (!ASSERT_ERR_PTR(link, "bpf_program__attach_kprobe_multi_opts"))
+ bpf_link__destroy(link);
+
+ link = bpf_program__attach_kprobe_multi_opts(skel->progs.test_kprobe_manual,
+ "bpf_fentry_test8*", &opts);
+ if (ASSERT_OK_PTR(link, "bpf_program__attach_kprobe_multi_opts"))
+ bpf_link__destroy(link);
+
+ kprobe_multi__destroy(skel);
+}
+
static size_t symbol_hash(long key, void *ctx __maybe_unused)
{
return str_hash((const char *) key);
@@ -765,5 +790,7 @@ void test_kprobe_multi_test(void)
test_session_skel_api();
if (test__start_subtest("session_cookie"))
test_session_cookie_skel_api();
+ if (test__start_subtest("unique_match"))
+ test_unique_match();
RUN_TESTS(kprobe_multi_verifier);
}
diff --git a/tools/testing/selftests/bpf/prog_tests/missed.c b/tools/testing/selftests/bpf/prog_tests/missed.c
index 70d90c43537c..ed8857ae914a 100644
--- a/tools/testing/selftests/bpf/prog_tests/missed.c
+++ b/tools/testing/selftests/bpf/prog_tests/missed.c
@@ -85,6 +85,7 @@ static void test_missed_kprobe_recursion(void)
ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test3)), 1, "test3_recursion_misses");
ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test4)), 1, "test4_recursion_misses");
ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test5)), 1, "test5_recursion_misses");
+ ASSERT_EQ(get_missed_count(bpf_program__fd(skel->progs.test6)), 1, "test6_recursion_misses");
cleanup:
missed_kprobe_recursion__destroy(skel);
diff --git a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
index 6fa19449297e..43676a9922dc 100644
--- a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
+++ b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
@@ -3,11 +3,14 @@
#include <test_progs.h>
#include "raw_tp_null.skel.h"
+#include "raw_tp_null_fail.skel.h"
void test_raw_tp_null(void)
{
struct raw_tp_null *skel;
+ RUN_TESTS(raw_tp_null_fail);
+
skel = raw_tp_null__open_and_load();
if (!ASSERT_OK_PTR(skel, "raw_tp_null__open_and_load"))
return;
diff --git a/tools/testing/selftests/bpf/prog_tests/socket_helpers.h b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h
new file mode 100644
index 000000000000..1bdfb79ef009
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h
@@ -0,0 +1,394 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+
+#ifndef __SOCKET_HELPERS__
+#define __SOCKET_HELPERS__
+
+#include <linux/vm_sockets.h>
+
+/* include/linux/net.h */
+#define SOCK_TYPE_MASK 0xf
+
+#define IO_TIMEOUT_SEC 30
+#define MAX_STRERR_LEN 256
+
+/* workaround for older vm_sockets.h */
+#ifndef VMADDR_CID_LOCAL
+#define VMADDR_CID_LOCAL 1
+#endif
+
+/* include/linux/cleanup.h */
+#define __get_and_null(p, nullvalue) \
+ ({ \
+ __auto_type __ptr = &(p); \
+ __auto_type __val = *__ptr; \
+ *__ptr = nullvalue; \
+ __val; \
+ })
+
+#define take_fd(fd) __get_and_null(fd, -EBADF)
+
+/* Wrappers that fail the test on error and report it. */
+
+#define _FAIL(errnum, fmt...) \
+ ({ \
+ error_at_line(0, (errnum), __func__, __LINE__, fmt); \
+ CHECK_FAIL(true); \
+ })
+#define FAIL(fmt...) _FAIL(0, fmt)
+#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt)
+#define FAIL_LIBBPF(err, msg) \
+ ({ \
+ char __buf[MAX_STRERR_LEN]; \
+ libbpf_strerror((err), __buf, sizeof(__buf)); \
+ FAIL("%s: %s", (msg), __buf); \
+ })
+
+
+#define xaccept_nonblock(fd, addr, len) \
+ ({ \
+ int __ret = \
+ accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \
+ if (__ret == -1) \
+ FAIL_ERRNO("accept"); \
+ __ret; \
+ })
+
+#define xbind(fd, addr, len) \
+ ({ \
+ int __ret = bind((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("bind"); \
+ __ret; \
+ })
+
+#define xclose(fd) \
+ ({ \
+ int __ret = close((fd)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("close"); \
+ __ret; \
+ })
+
+#define xconnect(fd, addr, len) \
+ ({ \
+ int __ret = connect((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("connect"); \
+ __ret; \
+ })
+
+#define xgetsockname(fd, addr, len) \
+ ({ \
+ int __ret = getsockname((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("getsockname"); \
+ __ret; \
+ })
+
+#define xgetsockopt(fd, level, name, val, len) \
+ ({ \
+ int __ret = getsockopt((fd), (level), (name), (val), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("getsockopt(" #name ")"); \
+ __ret; \
+ })
+
+#define xlisten(fd, backlog) \
+ ({ \
+ int __ret = listen((fd), (backlog)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("listen"); \
+ __ret; \
+ })
+
+#define xsetsockopt(fd, level, name, val, len) \
+ ({ \
+ int __ret = setsockopt((fd), (level), (name), (val), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("setsockopt(" #name ")"); \
+ __ret; \
+ })
+
+#define xsend(fd, buf, len, flags) \
+ ({ \
+ ssize_t __ret = send((fd), (buf), (len), (flags)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("send"); \
+ __ret; \
+ })
+
+#define xrecv_nonblock(fd, buf, len, flags) \
+ ({ \
+ ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \
+ IO_TIMEOUT_SEC); \
+ if (__ret == -1) \
+ FAIL_ERRNO("recv"); \
+ __ret; \
+ })
+
+#define xsocket(family, sotype, flags) \
+ ({ \
+ int __ret = socket(family, sotype, flags); \
+ if (__ret == -1) \
+ FAIL_ERRNO("socket"); \
+ __ret; \
+ })
+
+static inline void close_fd(int *fd)
+{
+ if (*fd >= 0)
+ xclose(*fd);
+}
+
+#define __close_fd __attribute__((cleanup(close_fd)))
+
+static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss)
+{
+ return (struct sockaddr *)ss;
+}
+
+static inline void init_addr_loopback4(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss));
+
+ addr4->sin_family = AF_INET;
+ addr4->sin_port = 0;
+ addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK);
+ *len = sizeof(*addr4);
+}
+
+static inline void init_addr_loopback6(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss));
+
+ addr6->sin6_family = AF_INET6;
+ addr6->sin6_port = 0;
+ addr6->sin6_addr = in6addr_loopback;
+ *len = sizeof(*addr6);
+}
+
+static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss));
+
+ addr->svm_family = AF_VSOCK;
+ addr->svm_port = VMADDR_PORT_ANY;
+ addr->svm_cid = VMADDR_CID_LOCAL;
+ *len = sizeof(*addr);
+}
+
+static inline void init_addr_loopback(int family, struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ switch (family) {
+ case AF_INET:
+ init_addr_loopback4(ss, len);
+ return;
+ case AF_INET6:
+ init_addr_loopback6(ss, len);
+ return;
+ case AF_VSOCK:
+ init_addr_loopback_vsock(ss, len);
+ return;
+ default:
+ FAIL("unsupported address family %d", family);
+ }
+}
+
+static inline int enable_reuseport(int s, int progfd)
+{
+ int err, one = 1;
+
+ err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one));
+ if (err)
+ return -1;
+ err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd,
+ sizeof(progfd));
+ if (err)
+ return -1;
+
+ return 0;
+}
+
+static inline int socket_loopback_reuseport(int family, int sotype, int progfd)
+{
+ struct sockaddr_storage addr;
+ socklen_t len = 0;
+ int err, s;
+
+ init_addr_loopback(family, &addr, &len);
+
+ s = xsocket(family, sotype, 0);
+ if (s == -1)
+ return -1;
+
+ if (progfd >= 0)
+ enable_reuseport(s, progfd);
+
+ err = xbind(s, sockaddr(&addr), len);
+ if (err)
+ goto close;
+
+ if (sotype & SOCK_DGRAM)
+ return s;
+
+ err = xlisten(s, SOMAXCONN);
+ if (err)
+ goto close;
+
+ return s;
+close:
+ xclose(s);
+ return -1;
+}
+
+static inline int socket_loopback(int family, int sotype)
+{
+ return socket_loopback_reuseport(family, sotype, -1);
+}
+
+static inline int poll_connect(int fd, unsigned int timeout_sec)
+{
+ struct timeval timeout = { .tv_sec = timeout_sec };
+ fd_set wfds;
+ int r, eval;
+ socklen_t esize = sizeof(eval);
+
+ FD_ZERO(&wfds);
+ FD_SET(fd, &wfds);
+
+ r = select(fd + 1, NULL, &wfds, NULL, &timeout);
+ if (r == 0)
+ errno = ETIME;
+ if (r != 1)
+ return -1;
+
+ if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0)
+ return -1;
+ if (eval != 0) {
+ errno = eval;
+ return -1;
+ }
+
+ return 0;
+}
+
+static inline int poll_read(int fd, unsigned int timeout_sec)
+{
+ struct timeval timeout = { .tv_sec = timeout_sec };
+ fd_set rfds;
+ int r;
+
+ FD_ZERO(&rfds);
+ FD_SET(fd, &rfds);
+
+ r = select(fd + 1, &rfds, NULL, NULL, &timeout);
+ if (r == 0)
+ errno = ETIME;
+
+ return r == 1 ? 0 : -1;
+}
+
+static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len,
+ unsigned int timeout_sec)
+{
+ if (poll_read(fd, timeout_sec))
+ return -1;
+
+ return accept(fd, addr, len);
+}
+
+static inline int recv_timeout(int fd, void *buf, size_t len, int flags,
+ unsigned int timeout_sec)
+{
+ if (poll_read(fd, timeout_sec))
+ return -1;
+
+ return recv(fd, buf, len, flags);
+}
+
+
+static inline int create_pair(int family, int sotype, int *p0, int *p1)
+{
+ __close_fd int s, c = -1, p = -1;
+ struct sockaddr_storage addr;
+ socklen_t len = sizeof(addr);
+ int err;
+
+ s = socket_loopback(family, sotype);
+ if (s < 0)
+ return s;
+
+ err = xgetsockname(s, sockaddr(&addr), &len);
+ if (err)
+ return err;
+
+ c = xsocket(family, sotype, 0);
+ if (c < 0)
+ return c;
+
+ err = connect(c, sockaddr(&addr), len);
+ if (err) {
+ if (errno != EINPROGRESS) {
+ FAIL_ERRNO("connect");
+ return err;
+ }
+
+ err = poll_connect(c, IO_TIMEOUT_SEC);
+ if (err) {
+ FAIL_ERRNO("poll_connect");
+ return err;
+ }
+ }
+
+ switch (sotype & SOCK_TYPE_MASK) {
+ case SOCK_DGRAM:
+ err = xgetsockname(c, sockaddr(&addr), &len);
+ if (err)
+ return err;
+
+ err = xconnect(s, sockaddr(&addr), len);
+ if (err)
+ return err;
+
+ *p0 = take_fd(s);
+ break;
+ case SOCK_STREAM:
+ case SOCK_SEQPACKET:
+ p = xaccept_nonblock(s, NULL, NULL);
+ if (p < 0)
+ return p;
+
+ *p0 = take_fd(p);
+ break;
+ default:
+ FAIL("Unsupported socket type %#x", sotype);
+ return -EOPNOTSUPP;
+ }
+
+ *p1 = take_fd(c);
+ return 0;
+}
+
+static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1,
+ int *p0, int *p1)
+{
+ int err;
+
+ err = create_pair(family, sotype, c0, p0);
+ if (err)
+ return err;
+
+ err = create_pair(family, sotype, c1, p1);
+ if (err) {
+ close(*c0);
+ close(*p0);
+ }
+
+ return err;
+}
+
+#endif // __SOCKET_HELPERS__
diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
index a2041f8e32eb..884ad87783d5 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
+++ b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
@@ -12,6 +12,7 @@
#include "test_sockmap_progs_query.skel.h"
#include "test_sockmap_pass_prog.skel.h"
#include "test_sockmap_drop_prog.skel.h"
+#include "test_sockmap_change_tail.skel.h"
#include "bpf_iter_sockmap.skel.h"
#include "sockmap_helpers.h"
@@ -108,6 +109,35 @@ out:
close(s);
}
+static void test_sockmap_vsock_delete_on_close(void)
+{
+ int err, c, p, map;
+ const int zero = 0;
+
+ err = create_pair(AF_VSOCK, SOCK_STREAM, &c, &p);
+ if (!ASSERT_OK(err, "create_pair(AF_VSOCK)"))
+ return;
+
+ map = bpf_map_create(BPF_MAP_TYPE_SOCKMAP, NULL, sizeof(int),
+ sizeof(int), 1, NULL);
+ if (!ASSERT_GE(map, 0, "bpf_map_create")) {
+ close(c);
+ goto out;
+ }
+
+ err = bpf_map_update_elem(map, &zero, &c, BPF_NOEXIST);
+ close(c);
+ if (!ASSERT_OK(err, "bpf_map_update"))
+ goto out;
+
+ err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST);
+ ASSERT_OK(err, "after close(), bpf_map_update");
+
+out:
+ close(p);
+ close(map);
+}
+
static void test_skmsg_helpers(enum bpf_map_type map_type)
{
struct test_skmsg_load_helpers *skel;
@@ -614,6 +644,54 @@ out:
test_sockmap_drop_prog__destroy(drop);
}
+static void test_sockmap_skb_verdict_change_tail(void)
+{
+ struct test_sockmap_change_tail *skel;
+ int err, map, verdict;
+ int c1, p1, sent, recvd;
+ int zero = 0;
+ char buf[2];
+
+ skel = test_sockmap_change_tail__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open_and_load"))
+ return;
+ verdict = bpf_program__fd(skel->progs.prog_skb_verdict);
+ map = bpf_map__fd(skel->maps.sock_map_rx);
+
+ err = bpf_prog_attach(verdict, map, BPF_SK_SKB_STREAM_VERDICT, 0);
+ if (!ASSERT_OK(err, "bpf_prog_attach"))
+ goto out;
+ err = create_pair(AF_INET, SOCK_STREAM, &c1, &p1);
+ if (!ASSERT_OK(err, "create_pair()"))
+ goto out;
+ err = bpf_map_update_elem(map, &zero, &c1, BPF_NOEXIST);
+ if (!ASSERT_OK(err, "bpf_map_update_elem(c1)"))
+ goto out_close;
+ sent = xsend(p1, "Tr", 2, 0);
+ ASSERT_EQ(sent, 2, "xsend(p1)");
+ recvd = recv(c1, buf, 2, 0);
+ ASSERT_EQ(recvd, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ sent = xsend(p1, "G", 1, 0);
+ ASSERT_EQ(sent, 1, "xsend(p1)");
+ recvd = recv(c1, buf, 2, 0);
+ ASSERT_EQ(recvd, 2, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ sent = xsend(p1, "E", 1, 0);
+ ASSERT_EQ(sent, 1, "xsend(p1)");
+ recvd = recv(c1, buf, 1, 0);
+ ASSERT_EQ(recvd, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+out_close:
+ close(c1);
+ close(p1);
+out:
+ test_sockmap_change_tail__destroy(skel);
+}
+
static void test_sockmap_skb_verdict_peek_helper(int map)
{
int err, c1, p1, zero = 0, sent, recvd, avail;
@@ -905,8 +983,10 @@ static void test_sockmap_same_sock(void)
err = socketpair(AF_UNIX, SOCK_STREAM, 0, stream);
ASSERT_OK(err, "socketpair(af_unix, sock_stream)");
- if (err)
+ if (err) {
+ close(tcp);
goto out;
+ }
for (i = 0; i < 2; i++) {
err = bpf_map_update_elem(map, &zero, &stream[0], BPF_ANY);
@@ -925,24 +1005,70 @@ static void test_sockmap_same_sock(void)
ASSERT_OK(err, "bpf_map_update_elem(tcp)");
}
+ close(tcp);
err = bpf_map_delete_elem(map, &zero);
- ASSERT_OK(err, "bpf_map_delete_elem(entry)");
+ ASSERT_ERR(err, "bpf_map_delete_elem(entry)");
close(stream[0]);
close(stream[1]);
out:
close(dgram);
- close(tcp);
close(udp);
test_sockmap_pass_prog__destroy(skel);
}
+static void test_sockmap_skb_verdict_vsock_poll(void)
+{
+ struct test_sockmap_pass_prog *skel;
+ int err, map, conn, peer;
+ struct bpf_program *prog;
+ struct bpf_link *link;
+ char buf = 'x';
+ int zero = 0;
+
+ skel = test_sockmap_pass_prog__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open_and_load"))
+ return;
+
+ if (create_pair(AF_VSOCK, SOCK_STREAM, &conn, &peer))
+ goto destroy;
+
+ prog = skel->progs.prog_skb_verdict;
+ map = bpf_map__fd(skel->maps.sock_map_rx);
+ link = bpf_program__attach_sockmap(prog, map);
+ if (!ASSERT_OK_PTR(link, "bpf_program__attach_sockmap"))
+ goto close;
+
+ err = bpf_map_update_elem(map, &zero, &conn, BPF_ANY);
+ if (!ASSERT_OK(err, "bpf_map_update_elem"))
+ goto detach;
+
+ if (xsend(peer, &buf, 1, 0) != 1)
+ goto detach;
+
+ err = poll_read(conn, IO_TIMEOUT_SEC);
+ if (!ASSERT_OK(err, "poll"))
+ goto detach;
+
+ if (xrecv_nonblock(conn, &buf, 1, 0) != 1)
+ FAIL("xrecv_nonblock");
+detach:
+ bpf_link__detach(link);
+close:
+ xclose(conn);
+ xclose(peer);
+destroy:
+ test_sockmap_pass_prog__destroy(skel);
+}
+
void test_sockmap_basic(void)
{
if (test__start_subtest("sockmap create_update_free"))
test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash create_update_free"))
test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKHASH);
+ if (test__start_subtest("sockmap vsock delete on close"))
+ test_sockmap_vsock_delete_on_close();
if (test__start_subtest("sockmap sk_msg load helpers"))
test_skmsg_helpers(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash sk_msg load helpers"))
@@ -981,6 +1107,8 @@ void test_sockmap_basic(void)
test_sockmap_skb_verdict_fionread(true);
if (test__start_subtest("sockmap skb_verdict fionread on drop"))
test_sockmap_skb_verdict_fionread(false);
+ if (test__start_subtest("sockmap skb_verdict change tail"))
+ test_sockmap_skb_verdict_change_tail();
if (test__start_subtest("sockmap skb_verdict msg_f_peek"))
test_sockmap_skb_verdict_peek();
if (test__start_subtest("sockmap skb_verdict msg_f_peek with link"))
@@ -997,4 +1125,6 @@ void test_sockmap_basic(void)
test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash sk_msg attach sockhash helpers with link"))
test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKHASH);
+ if (test__start_subtest("sockmap skb_verdict vsock poll"))
+ test_sockmap_skb_verdict_vsock_poll();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
index 38e35c72bdaa..3e5571dd578d 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
+++ b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
@@ -1,139 +1,12 @@
#ifndef __SOCKMAP_HELPERS__
#define __SOCKMAP_HELPERS__
-#include <linux/vm_sockets.h>
+#include "socket_helpers.h"
-/* include/linux/net.h */
-#define SOCK_TYPE_MASK 0xf
-
-#define IO_TIMEOUT_SEC 30
-#define MAX_STRERR_LEN 256
#define MAX_TEST_NAME 80
-/* workaround for older vm_sockets.h */
-#ifndef VMADDR_CID_LOCAL
-#define VMADDR_CID_LOCAL 1
-#endif
-
#define __always_unused __attribute__((__unused__))
-/* include/linux/cleanup.h */
-#define __get_and_null(p, nullvalue) \
- ({ \
- __auto_type __ptr = &(p); \
- __auto_type __val = *__ptr; \
- *__ptr = nullvalue; \
- __val; \
- })
-
-#define take_fd(fd) __get_and_null(fd, -EBADF)
-
-#define _FAIL(errnum, fmt...) \
- ({ \
- error_at_line(0, (errnum), __func__, __LINE__, fmt); \
- CHECK_FAIL(true); \
- })
-#define FAIL(fmt...) _FAIL(0, fmt)
-#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt)
-#define FAIL_LIBBPF(err, msg) \
- ({ \
- char __buf[MAX_STRERR_LEN]; \
- libbpf_strerror((err), __buf, sizeof(__buf)); \
- FAIL("%s: %s", (msg), __buf); \
- })
-
-/* Wrappers that fail the test on error and report it. */
-
-#define xaccept_nonblock(fd, addr, len) \
- ({ \
- int __ret = \
- accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \
- if (__ret == -1) \
- FAIL_ERRNO("accept"); \
- __ret; \
- })
-
-#define xbind(fd, addr, len) \
- ({ \
- int __ret = bind((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("bind"); \
- __ret; \
- })
-
-#define xclose(fd) \
- ({ \
- int __ret = close((fd)); \
- if (__ret == -1) \
- FAIL_ERRNO("close"); \
- __ret; \
- })
-
-#define xconnect(fd, addr, len) \
- ({ \
- int __ret = connect((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("connect"); \
- __ret; \
- })
-
-#define xgetsockname(fd, addr, len) \
- ({ \
- int __ret = getsockname((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("getsockname"); \
- __ret; \
- })
-
-#define xgetsockopt(fd, level, name, val, len) \
- ({ \
- int __ret = getsockopt((fd), (level), (name), (val), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("getsockopt(" #name ")"); \
- __ret; \
- })
-
-#define xlisten(fd, backlog) \
- ({ \
- int __ret = listen((fd), (backlog)); \
- if (__ret == -1) \
- FAIL_ERRNO("listen"); \
- __ret; \
- })
-
-#define xsetsockopt(fd, level, name, val, len) \
- ({ \
- int __ret = setsockopt((fd), (level), (name), (val), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("setsockopt(" #name ")"); \
- __ret; \
- })
-
-#define xsend(fd, buf, len, flags) \
- ({ \
- ssize_t __ret = send((fd), (buf), (len), (flags)); \
- if (__ret == -1) \
- FAIL_ERRNO("send"); \
- __ret; \
- })
-
-#define xrecv_nonblock(fd, buf, len, flags) \
- ({ \
- ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \
- IO_TIMEOUT_SEC); \
- if (__ret == -1) \
- FAIL_ERRNO("recv"); \
- __ret; \
- })
-
-#define xsocket(family, sotype, flags) \
- ({ \
- int __ret = socket(family, sotype, flags); \
- if (__ret == -1) \
- FAIL_ERRNO("socket"); \
- __ret; \
- })
-
#define xbpf_map_delete_elem(fd, key) \
({ \
int __ret = bpf_map_delete_elem((fd), (key)); \
@@ -193,130 +66,6 @@
__ret; \
})
-static inline void close_fd(int *fd)
-{
- if (*fd >= 0)
- xclose(*fd);
-}
-
-#define __close_fd __attribute__((cleanup(close_fd)))
-
-static inline int poll_connect(int fd, unsigned int timeout_sec)
-{
- struct timeval timeout = { .tv_sec = timeout_sec };
- fd_set wfds;
- int r, eval;
- socklen_t esize = sizeof(eval);
-
- FD_ZERO(&wfds);
- FD_SET(fd, &wfds);
-
- r = select(fd + 1, NULL, &wfds, NULL, &timeout);
- if (r == 0)
- errno = ETIME;
- if (r != 1)
- return -1;
-
- if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0)
- return -1;
- if (eval != 0) {
- errno = eval;
- return -1;
- }
-
- return 0;
-}
-
-static inline int poll_read(int fd, unsigned int timeout_sec)
-{
- struct timeval timeout = { .tv_sec = timeout_sec };
- fd_set rfds;
- int r;
-
- FD_ZERO(&rfds);
- FD_SET(fd, &rfds);
-
- r = select(fd + 1, &rfds, NULL, NULL, &timeout);
- if (r == 0)
- errno = ETIME;
-
- return r == 1 ? 0 : -1;
-}
-
-static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len,
- unsigned int timeout_sec)
-{
- if (poll_read(fd, timeout_sec))
- return -1;
-
- return accept(fd, addr, len);
-}
-
-static inline int recv_timeout(int fd, void *buf, size_t len, int flags,
- unsigned int timeout_sec)
-{
- if (poll_read(fd, timeout_sec))
- return -1;
-
- return recv(fd, buf, len, flags);
-}
-
-static inline void init_addr_loopback4(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss));
-
- addr4->sin_family = AF_INET;
- addr4->sin_port = 0;
- addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK);
- *len = sizeof(*addr4);
-}
-
-static inline void init_addr_loopback6(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss));
-
- addr6->sin6_family = AF_INET6;
- addr6->sin6_port = 0;
- addr6->sin6_addr = in6addr_loopback;
- *len = sizeof(*addr6);
-}
-
-static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss));
-
- addr->svm_family = AF_VSOCK;
- addr->svm_port = VMADDR_PORT_ANY;
- addr->svm_cid = VMADDR_CID_LOCAL;
- *len = sizeof(*addr);
-}
-
-static inline void init_addr_loopback(int family, struct sockaddr_storage *ss,
- socklen_t *len)
-{
- switch (family) {
- case AF_INET:
- init_addr_loopback4(ss, len);
- return;
- case AF_INET6:
- init_addr_loopback6(ss, len);
- return;
- case AF_VSOCK:
- init_addr_loopback_vsock(ss, len);
- return;
- default:
- FAIL("unsupported address family %d", family);
- }
-}
-
-static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss)
-{
- return (struct sockaddr *)ss;
-}
-
static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2)
{
u64 value;
@@ -334,136 +83,4 @@ static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2)
return xbpf_map_update_elem(sock_mapfd, &key, &value, BPF_NOEXIST);
}
-static inline int enable_reuseport(int s, int progfd)
-{
- int err, one = 1;
-
- err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one));
- if (err)
- return -1;
- err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd,
- sizeof(progfd));
- if (err)
- return -1;
-
- return 0;
-}
-
-static inline int socket_loopback_reuseport(int family, int sotype, int progfd)
-{
- struct sockaddr_storage addr;
- socklen_t len = 0;
- int err, s;
-
- init_addr_loopback(family, &addr, &len);
-
- s = xsocket(family, sotype, 0);
- if (s == -1)
- return -1;
-
- if (progfd >= 0)
- enable_reuseport(s, progfd);
-
- err = xbind(s, sockaddr(&addr), len);
- if (err)
- goto close;
-
- if (sotype & SOCK_DGRAM)
- return s;
-
- err = xlisten(s, SOMAXCONN);
- if (err)
- goto close;
-
- return s;
-close:
- xclose(s);
- return -1;
-}
-
-static inline int socket_loopback(int family, int sotype)
-{
- return socket_loopback_reuseport(family, sotype, -1);
-}
-
-static inline int create_pair(int family, int sotype, int *p0, int *p1)
-{
- __close_fd int s, c = -1, p = -1;
- struct sockaddr_storage addr;
- socklen_t len = sizeof(addr);
- int err;
-
- s = socket_loopback(family, sotype);
- if (s < 0)
- return s;
-
- err = xgetsockname(s, sockaddr(&addr), &len);
- if (err)
- return err;
-
- c = xsocket(family, sotype, 0);
- if (c < 0)
- return c;
-
- err = connect(c, sockaddr(&addr), len);
- if (err) {
- if (errno != EINPROGRESS) {
- FAIL_ERRNO("connect");
- return err;
- }
-
- err = poll_connect(c, IO_TIMEOUT_SEC);
- if (err) {
- FAIL_ERRNO("poll_connect");
- return err;
- }
- }
-
- switch (sotype & SOCK_TYPE_MASK) {
- case SOCK_DGRAM:
- err = xgetsockname(c, sockaddr(&addr), &len);
- if (err)
- return err;
-
- err = xconnect(s, sockaddr(&addr), len);
- if (err)
- return err;
-
- *p0 = take_fd(s);
- break;
- case SOCK_STREAM:
- case SOCK_SEQPACKET:
- p = xaccept_nonblock(s, NULL, NULL);
- if (p < 0)
- return p;
-
- *p0 = take_fd(p);
- break;
- default:
- FAIL("Unsupported socket type %#x", sotype);
- return -EOPNOTSUPP;
- }
-
- *p1 = take_fd(c);
- return 0;
-}
-
-static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1,
- int *p0, int *p1)
-{
- int err;
-
- err = create_pair(family, sotype, c0, p0);
- if (err)
- return err;
-
- err = create_pair(family, sotype, c1, p1);
- if (err) {
- close(*c0);
- close(*p0);
- }
-
- return err;
-}
-
#endif // __SOCKMAP_HELPERS__
diff --git a/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c b/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c
index 05d0e07da394..ba6b3ec1156a 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c
+++ b/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c
@@ -2,7 +2,7 @@
#include <test_progs.h>
#include "cgroup_helpers.h"
-#include <linux/tcp.h>
+#include <netinet/tcp.h>
#include <linux/netlink.h>
#include "sockopt_sk.skel.h"
diff --git a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
index 60f474d965a9..42e822ea352f 100644
--- a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
+++ b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
@@ -197,7 +197,7 @@ static void test_nodeadlock(void)
/* Unnecessary recursion and deadlock detection are reproducible
* in the preemptible kernel.
*/
- if (!skel->kconfig->CONFIG_PREEMPT) {
+ if (!skel->kconfig->CONFIG_PREEMPTION) {
test__skip();
goto done;
}
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c
new file mode 100644
index 000000000000..74752233e779
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c
@@ -0,0 +1,62 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <error.h>
+#include <test_progs.h>
+#include <linux/pkt_cls.h>
+
+#include "test_tc_change_tail.skel.h"
+#include "socket_helpers.h"
+
+#define LO_IFINDEX 1
+
+void test_tc_change_tail(void)
+{
+ LIBBPF_OPTS(bpf_tcx_opts, tcx_opts);
+ struct test_tc_change_tail *skel = NULL;
+ struct bpf_link *link;
+ int c1, p1;
+ char buf[2];
+ int ret;
+
+ skel = test_tc_change_tail__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "test_tc_change_tail__open_and_load"))
+ return;
+
+ link = bpf_program__attach_tcx(skel->progs.change_tail, LO_IFINDEX,
+ &tcx_opts);
+ if (!ASSERT_OK_PTR(link, "bpf_program__attach_tcx"))
+ goto destroy;
+
+ skel->links.change_tail = link;
+ ret = create_pair(AF_INET, SOCK_DGRAM, &c1, &p1);
+ if (!ASSERT_OK(ret, "create_pair"))
+ goto destroy;
+
+ ret = xsend(p1, "Tr", 2, 0);
+ ASSERT_EQ(ret, 2, "xsend(p1)");
+ ret = recv(c1, buf, 2, 0);
+ ASSERT_EQ(ret, 2, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ ret = xsend(p1, "G", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 2, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ ret = xsend(p1, "E", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 1, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+ ret = xsend(p1, "Z", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 1, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+ close(c1);
+ close(p1);
+destroy:
+ test_tc_change_tail__destroy(skel);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
index 151a4210028f..2461d183dee5 100644
--- a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
+++ b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
@@ -14,10 +14,16 @@
#include "netlink_helpers.h"
#include "tc_helpers.h"
+#define NETKIT_HEADROOM 32
+#define NETKIT_TAILROOM 8
+
#define MARK 42
#define PRIO 0xeb9f
#define ICMP_ECHO 8
+#define FLAG_ADJUST_ROOM (1 << 0)
+#define FLAG_SAME_NETNS (1 << 1)
+
struct icmphdr {
__u8 type;
__u8 code;
@@ -35,7 +41,7 @@ struct iplink_req {
};
static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
- bool same_netns, int scrub, int peer_scrub)
+ int scrub, int peer_scrub, __u32 flags)
{
struct rtnl_handle rth = { .fd = -1 };
struct iplink_req req = {};
@@ -63,6 +69,10 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
addattr32(&req.n, sizeof(req), IFLA_NETKIT_SCRUB, scrub);
addattr32(&req.n, sizeof(req), IFLA_NETKIT_PEER_SCRUB, peer_scrub);
addattr32(&req.n, sizeof(req), IFLA_NETKIT_MODE, mode);
+ if (flags & FLAG_ADJUST_ROOM) {
+ addattr16(&req.n, sizeof(req), IFLA_NETKIT_HEADROOM, NETKIT_HEADROOM);
+ addattr16(&req.n, sizeof(req), IFLA_NETKIT_TAILROOM, NETKIT_TAILROOM);
+ }
addattr_nest_end(&req.n, data);
addattr_nest_end(&req.n, linkinfo);
@@ -87,7 +97,7 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
" addr ee:ff:bb:cc:aa:dd"),
"set hwaddress");
}
- if (same_netns) {
+ if (flags & FLAG_SAME_NETNS) {
ASSERT_OK(system("ip link set dev " netkit_peer " up"),
"up peer");
ASSERT_OK(system("ip addr add dev " netkit_peer " 10.0.0.2/24"),
@@ -184,8 +194,8 @@ void serial_test_tc_netkit_basic(void)
int err, ifindex;
err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -299,8 +309,8 @@ static void serial_test_tc_netkit_multi_links_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -428,8 +438,8 @@ static void serial_test_tc_netkit_multi_opts_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -543,8 +553,8 @@ void serial_test_tc_netkit_device(void)
int err, ifindex, ifindex2;
err = create_netkit(NETKIT_L3, NETKIT_PASS, NETKIT_PASS,
- &ifindex, true, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS);
if (err)
return;
@@ -655,8 +665,8 @@ static void serial_test_tc_netkit_neigh_links_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -733,8 +743,8 @@ static void serial_test_tc_netkit_pkt_type_mode(int mode)
struct bpf_link *link;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, true, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS);
if (err)
return;
@@ -799,7 +809,7 @@ void serial_test_tc_netkit_pkt_type(void)
serial_test_tc_netkit_pkt_type_mode(NETKIT_L3);
}
-static void serial_test_tc_netkit_scrub_type(int scrub)
+static void serial_test_tc_netkit_scrub_type(int scrub, bool room)
{
LIBBPF_OPTS(bpf_netkit_opts, optl);
struct test_tc_link *skel;
@@ -807,7 +817,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub)
int err, ifindex;
err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, scrub, scrub);
+ &ifindex, scrub, scrub,
+ room ? FLAG_ADJUST_ROOM : 0);
if (err)
return;
@@ -842,6 +853,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub)
ASSERT_EQ(skel->bss->seen_tc8, true, "seen_tc8");
ASSERT_EQ(skel->bss->mark, scrub == NETKIT_SCRUB_NONE ? MARK : 0, "mark");
ASSERT_EQ(skel->bss->prio, scrub == NETKIT_SCRUB_NONE ? PRIO : 0, "prio");
+ ASSERT_EQ(skel->bss->headroom, room ? NETKIT_HEADROOM : 0, "headroom");
+ ASSERT_EQ(skel->bss->tailroom, room ? NETKIT_TAILROOM : 0, "tailroom");
cleanup:
test_tc_link__destroy(skel);
@@ -852,6 +865,6 @@ cleanup:
void serial_test_tc_netkit_scrub(void)
{
- serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT);
- serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE);
+ serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT, false);
+ serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE, true);
}
diff --git a/tools/testing/selftests/bpf/prog_tests/verifier.c b/tools/testing/selftests/bpf/prog_tests/verifier.c
index d9f65adb456b..8a0e1ff8a2dc 100644
--- a/tools/testing/selftests/bpf/prog_tests/verifier.c
+++ b/tools/testing/selftests/bpf/prog_tests/verifier.c
@@ -52,6 +52,8 @@
#include "verifier_map_ptr_mixing.skel.h"
#include "verifier_map_ret_val.skel.h"
#include "verifier_masking.skel.h"
+#include "verifier_may_goto_1.skel.h"
+#include "verifier_may_goto_2.skel.h"
#include "verifier_meta_access.skel.h"
#include "verifier_movsx.skel.h"
#include "verifier_mtu.skel.h"
@@ -98,6 +100,7 @@
#include "verifier_xdp_direct_packet_access.skel.h"
#include "verifier_bits_iter.skel.h"
#include "verifier_lsm.skel.h"
+#include "irq.skel.h"
#define MAX_ENTRIES 11
@@ -181,6 +184,8 @@ void test_verifier_map_ptr(void) { RUN(verifier_map_ptr); }
void test_verifier_map_ptr_mixing(void) { RUN(verifier_map_ptr_mixing); }
void test_verifier_map_ret_val(void) { RUN(verifier_map_ret_val); }
void test_verifier_masking(void) { RUN(verifier_masking); }
+void test_verifier_may_goto_1(void) { RUN(verifier_may_goto_1); }
+void test_verifier_may_goto_2(void) { RUN(verifier_may_goto_2); }
void test_verifier_meta_access(void) { RUN(verifier_meta_access); }
void test_verifier_movsx(void) { RUN(verifier_movsx); }
void test_verifier_netfilter_ctx(void) { RUN(verifier_netfilter_ctx); }
@@ -225,24 +230,8 @@ void test_verifier_xdp(void) { RUN(verifier_xdp); }
void test_verifier_xdp_direct_packet_access(void) { RUN(verifier_xdp_direct_packet_access); }
void test_verifier_bits_iter(void) { RUN(verifier_bits_iter); }
void test_verifier_lsm(void) { RUN(verifier_lsm); }
-
-void test_verifier_mtu(void)
-{
- __u64 caps = 0;
- int ret;
-
- /* In case CAP_BPF and CAP_PERFMON is not set */
- ret = cap_enable_effective(1ULL << CAP_BPF | 1ULL << CAP_NET_ADMIN, &caps);
- if (!ASSERT_OK(ret, "set_cap_bpf_cap_net_admin"))
- return;
- ret = cap_disable_effective(1ULL << CAP_SYS_ADMIN | 1ULL << CAP_PERFMON, NULL);
- if (!ASSERT_OK(ret, "disable_cap_sys_admin"))
- goto restore_cap;
- RUN(verifier_mtu);
-restore_cap:
- if (caps)
- cap_enable_effective(caps, NULL);
-}
+void test_irq(void) { RUN(irq); }
+void test_verifier_mtu(void) { RUN(verifier_mtu); }
static int init_test_val_map(struct bpf_object *obj, char *map_name)
{
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index 53d6ad8c2257..b2b2d85dbb1b 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -82,6 +82,8 @@ static void test_xdp_adjust_tail_grow2(void)
/* SKB_DATA_ALIGN(sizeof(struct skb_shared_info)) */
#if defined(__s390x__)
int tailroom = 512;
+#elif defined(__powerpc__)
+ int tailroom = 384;
#else
int tailroom = 320;
#endif
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c b/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c
index 6d8b54124cb3..fb952703653e 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c
@@ -17,7 +17,7 @@
#include "network_helpers.h"
#include <linux/if_bonding.h>
#include <linux/limits.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <uapi/linux/netdev.h>
#include "xdp_dummy.skel.h"
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
index e6a783c7f5db..937da9b7532a 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
@@ -2,6 +2,14 @@
#include <test_progs.h>
#include <network_helpers.h>
#include "test_xdp_context_test_run.skel.h"
+#include "test_xdp_meta.skel.h"
+
+#define TX_ADDR "10.0.0.1"
+#define RX_ADDR "10.0.0.2"
+#define RX_NAME "veth0"
+#define TX_NAME "veth1"
+#define TX_NETNS "xdp_context_tx"
+#define RX_NETNS "xdp_context_rx"
void test_xdp_context_error(int prog_fd, struct bpf_test_run_opts opts,
__u32 data_meta, __u32 data, __u32 data_end,
@@ -103,3 +111,82 @@ void test_xdp_context_test_run(void)
test_xdp_context_test_run__destroy(skel);
}
+
+void test_xdp_context_functional(void)
+{
+ LIBBPF_OPTS(bpf_tc_hook, tc_hook, .attach_point = BPF_TC_INGRESS);
+ LIBBPF_OPTS(bpf_tc_opts, tc_opts, .handle = 1, .priority = 1);
+ struct netns_obj *rx_ns = NULL, *tx_ns = NULL;
+ struct bpf_program *tc_prog, *xdp_prog;
+ struct test_xdp_meta *skel = NULL;
+ struct nstoken *nstoken = NULL;
+ int rx_ifindex;
+ int ret;
+
+ tx_ns = netns_new(TX_NETNS, false);
+ if (!ASSERT_OK_PTR(tx_ns, "create tx_ns"))
+ return;
+
+ rx_ns = netns_new(RX_NETNS, false);
+ if (!ASSERT_OK_PTR(rx_ns, "create rx_ns"))
+ goto close;
+
+ SYS(close, "ip link add " RX_NAME " netns " RX_NETNS
+ " type veth peer name " TX_NAME " netns " TX_NETNS);
+
+ nstoken = open_netns(RX_NETNS);
+ if (!ASSERT_OK_PTR(nstoken, "setns rx_ns"))
+ goto close;
+
+ SYS(close, "ip addr add " RX_ADDR "/24 dev " RX_NAME);
+ SYS(close, "ip link set dev " RX_NAME " up");
+
+ skel = test_xdp_meta__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open and load skeleton"))
+ goto close;
+
+ rx_ifindex = if_nametoindex(RX_NAME);
+ if (!ASSERT_GE(rx_ifindex, 0, "if_nametoindex rx"))
+ goto close;
+
+ tc_hook.ifindex = rx_ifindex;
+ ret = bpf_tc_hook_create(&tc_hook);
+ if (!ASSERT_OK(ret, "bpf_tc_hook_create"))
+ goto close;
+
+ tc_prog = bpf_object__find_program_by_name(skel->obj, "ing_cls");
+ if (!ASSERT_OK_PTR(tc_prog, "open ing_cls prog"))
+ goto close;
+
+ tc_opts.prog_fd = bpf_program__fd(tc_prog);
+ ret = bpf_tc_attach(&tc_hook, &tc_opts);
+ if (!ASSERT_OK(ret, "bpf_tc_attach"))
+ goto close;
+
+ xdp_prog = bpf_object__find_program_by_name(skel->obj, "ing_xdp");
+ if (!ASSERT_OK_PTR(xdp_prog, "open ing_xdp prog"))
+ goto close;
+
+ ret = bpf_xdp_attach(rx_ifindex,
+ bpf_program__fd(xdp_prog),
+ 0, NULL);
+ if (!ASSERT_GE(ret, 0, "bpf_xdp_attach"))
+ goto close;
+
+ close_netns(nstoken);
+
+ nstoken = open_netns(TX_NETNS);
+ if (!ASSERT_OK_PTR(nstoken, "setns tx_ns"))
+ goto close;
+
+ SYS(close, "ip addr add " TX_ADDR "/24 dev " TX_NAME);
+ SYS(close, "ip link set dev " TX_NAME " up");
+ ASSERT_OK(SYS_NOFAIL("ping -c 1 " RX_ADDR), "ping");
+
+close:
+ close_netns(nstoken);
+ test_xdp_meta__destroy(skel);
+ netns_free(rx_ns);
+ netns_free(tx_ns);
+}
+
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c b/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c
index bad0ea167be7..7dac044664ac 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c
@@ -7,10 +7,11 @@
#include <linux/if_link.h>
#include <linux/ipv6.h>
#include <linux/in6.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <bpf/bpf_endian.h>
#include <uapi/linux/netdev.h>
#include "test_xdp_do_redirect.skel.h"
+#include "xdp_dummy.skel.h"
struct udp_packet {
struct ethhdr eth;
@@ -246,3 +247,166 @@ out:
SYS_NOFAIL("ip netns del testns");
test_xdp_do_redirect__destroy(skel);
}
+
+#define NS_NB 3
+#define NS0 "NS0"
+#define NS1 "NS1"
+#define NS2 "NS2"
+#define IPV4_NETWORK "10.1.1"
+#define VETH1_INDEX 111
+#define VETH2_INDEX 222
+
+struct test_data {
+ struct netns_obj *ns[NS_NB];
+ u32 xdp_flags;
+};
+
+static void cleanup(struct test_data *data)
+{
+ int i;
+
+ for (i = 0; i < NS_NB; i++)
+ netns_free(data->ns[i]);
+}
+
+/**
+ * ping_setup -
+ * Create two veth peers and forward packets in-between using XDP
+ *
+ * ------------ ------------
+ * | NS1 | | NS2 |
+ * | veth0 | | veth0 |
+ * | 10.1.1.1 | | 10.1.1.2 |
+ * -----|------ ------|-----
+ * | |
+ * | |
+ * -----|-----------------------|-------
+ * | veth1 veth2 |
+ * | (id:111) (id:222) |
+ * | | | |
+ * | ----- xdp forwarding ----- |
+ * | |
+ * | NS0 |
+ * -------------------------------------
+ */
+static int ping_setup(struct test_data *data)
+{
+ int i;
+
+ data->ns[0] = netns_new(NS0, false);
+ if (!ASSERT_OK_PTR(data->ns[0], "create ns"))
+ return -1;
+
+ for (i = 1; i < NS_NB; i++) {
+ char ns_name[4] = {};
+
+ snprintf(ns_name, 4, "NS%d", i);
+ data->ns[i] = netns_new(ns_name, false);
+ if (!ASSERT_OK_PTR(data->ns[i], "create ns"))
+ goto fail;
+
+ SYS(fail,
+ "ip -n %s link add veth%d index %d%d%d type veth peer name veth0 netns %s",
+ NS0, i, i, i, i, ns_name);
+ SYS(fail, "ip -n %s link set veth%d up", NS0, i);
+
+ SYS(fail, "ip -n %s addr add %s.%d/24 dev veth0", ns_name, IPV4_NETWORK, i);
+ SYS(fail, "ip -n %s link set veth0 up", ns_name);
+ }
+
+ return 0;
+
+fail:
+ cleanup(data);
+ return -1;
+}
+
+static void ping_test(struct test_data *data)
+{
+ struct test_xdp_do_redirect *skel = NULL;
+ struct xdp_dummy *skel_dummy = NULL;
+ struct nstoken *nstoken = NULL;
+ int i, ret;
+
+ skel_dummy = xdp_dummy__open_and_load();
+ if (!ASSERT_OK_PTR(skel_dummy, "open and load xdp_dummy skeleton"))
+ goto close;
+
+ for (i = 1; i < NS_NB; i++) {
+ char ns_name[4] = {};
+
+ snprintf(ns_name, 4, "NS%d", i);
+ nstoken = open_netns(ns_name);
+ if (!ASSERT_OK_PTR(nstoken, "open ns"))
+ goto close;
+
+ ret = bpf_xdp_attach(if_nametoindex("veth0"),
+ bpf_program__fd(skel_dummy->progs.xdp_dummy_prog),
+ data->xdp_flags, NULL);
+ if (!ASSERT_GE(ret, 0, "bpf_xdp_attach dummy_prog"))
+ goto close;
+
+ close_netns(nstoken);
+ nstoken = NULL;
+ }
+
+ skel = test_xdp_do_redirect__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open and load skeleton"))
+ goto close;
+
+ nstoken = open_netns(NS0);
+ if (!ASSERT_OK_PTR(nstoken, "open NS0"))
+ goto close;
+
+ ret = bpf_xdp_attach(VETH2_INDEX,
+ bpf_program__fd(skel->progs.xdp_redirect_to_111),
+ data->xdp_flags, NULL);
+ if (!ASSERT_GE(ret, 0, "bpf_xdp_attach"))
+ goto close;
+
+ ret = bpf_xdp_attach(VETH1_INDEX,
+ bpf_program__fd(skel->progs.xdp_redirect_to_222),
+ data->xdp_flags, NULL);
+ if (!ASSERT_GE(ret, 0, "bpf_xdp_attach"))
+ goto close;
+
+ close_netns(nstoken);
+ nstoken = NULL;
+
+ nstoken = open_netns(NS1);
+ if (!ASSERT_OK_PTR(nstoken, "open NS1"))
+ goto close;
+
+ SYS(close, "ping -c 1 %s.2 > /dev/null", IPV4_NETWORK);
+
+close:
+ close_netns(nstoken);
+ xdp_dummy__destroy(skel_dummy);
+ test_xdp_do_redirect__destroy(skel);
+}
+
+
+static void xdp_redirect_ping(u32 xdp_flags)
+{
+ struct test_data data = {};
+
+ if (ping_setup(&data) < 0)
+ return;
+
+ data.xdp_flags = xdp_flags;
+ ping_test(&data);
+ cleanup(&data);
+}
+
+void test_xdp_index_redirect(void)
+{
+ if (test__start_subtest("noflag"))
+ xdp_redirect_ping(0);
+
+ if (test__start_subtest("drvflag"))
+ xdp_redirect_ping(XDP_FLAGS_DRV_MODE);
+
+ if (test__start_subtest("skbflag"))
+ xdp_redirect_ping(XDP_FLAGS_SKB_MODE);
+}
+
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c
index e1bf141d3401..3f9146d83d79 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c
@@ -3,7 +3,7 @@
#include <network_helpers.h>
#include <bpf/btf.h>
#include <linux/if_link.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <net/if.h>
#include <unistd.h>
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c b/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c
index c87ee2bf558c..3d47878ef6bf 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c
@@ -10,7 +10,7 @@
#include <linux/errqueue.h>
#include <linux/if_link.h>
#include <linux/net_tstamp.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <sys/mman.h>
#include <net/if.h>
#include <poll.h>
@@ -133,23 +133,6 @@ static void close_xsk(struct xsk *xsk)
munmap(xsk->umem_area, UMEM_SIZE);
}
-static void ip_csum(struct iphdr *iph)
-{
- __u32 sum = 0;
- __u16 *p;
- int i;
-
- iph->check = 0;
- p = (void *)iph;
- for (i = 0; i < sizeof(*iph) / sizeof(*p); i++)
- sum += p[i];
-
- while (sum >> 16)
- sum = (sum & 0xffff) + (sum >> 16);
-
- iph->check = ~sum;
-}
-
static int generate_packet(struct xsk *xsk, __u16 dst_port)
{
struct xsk_tx_metadata *meta;
@@ -192,7 +175,7 @@ static int generate_packet(struct xsk *xsk, __u16 dst_port)
iph->protocol = IPPROTO_UDP;
ASSERT_EQ(inet_pton(FAMILY, TX_ADDR, &iph->saddr), 1, "inet_pton(TX_ADDR)");
ASSERT_EQ(inet_pton(FAMILY, RX_ADDR, &iph->daddr), 1, "inet_pton(RX_ADDR)");
- ip_csum(iph);
+ iph->check = build_ip_csum(iph);
udph->source = htons(UDP_SOURCE_PORT);
udph->dest = htons(dst_port);
diff --git a/tools/testing/selftests/bpf/progs/bad_struct_ops.c b/tools/testing/selftests/bpf/progs/bad_struct_ops.c
index b7e175cd0af0..b3f77b4561c8 100644
--- a/tools/testing/selftests/bpf/progs/bad_struct_ops.c
+++ b/tools/testing/selftests/bpf/progs/bad_struct_ops.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/bpf_misc.h b/tools/testing/selftests/bpf/progs/bpf_misc.h
index eccaf955e394..f45f4352feeb 100644
--- a/tools/testing/selftests/bpf/progs/bpf_misc.h
+++ b/tools/testing/selftests/bpf/progs/bpf_misc.h
@@ -5,6 +5,10 @@
#define XSTR(s) STR(s)
#define STR(s) #s
+/* Expand a macro and then stringize the expansion */
+#define QUOTE(str) #str
+#define EXPAND_QUOTE(str) QUOTE(str)
+
/* This set of attributes controls behavior of the
* test_loader.c:test_loader__run_subtests().
*
@@ -106,6 +110,7 @@
* __arch_* Specify on which architecture the test case should be tested.
* Several __arch_* annotations could be specified at once.
* When test case is not run on current arch it is marked as skipped.
+ * __caps_unpriv Specify the capabilities that should be set when running the test.
*/
#define __msg(msg) __attribute__((btf_decl_tag("comment:test_expect_msg=" XSTR(__COUNTER__) "=" msg)))
#define __xlated(msg) __attribute__((btf_decl_tag("comment:test_expect_xlated=" XSTR(__COUNTER__) "=" msg)))
@@ -129,6 +134,13 @@
#define __arch_x86_64 __arch("X86_64")
#define __arch_arm64 __arch("ARM64")
#define __arch_riscv64 __arch("RISCV64")
+#define __caps_unpriv(caps) __attribute__((btf_decl_tag("comment:test_caps_unpriv=" EXPAND_QUOTE(caps))))
+
+/* Define common capabilities tested using __caps_unpriv */
+#define CAP_NET_ADMIN 12
+#define CAP_SYS_ADMIN 21
+#define CAP_PERFMON 38
+#define CAP_BPF 39
/* Convenience macro for use with 'asm volatile' blocks */
#define __naked __attribute__((naked))
diff --git a/tools/testing/selftests/bpf/progs/cb_refs.c b/tools/testing/selftests/bpf/progs/cb_refs.c
index 56c764df8196..5d6fc7f01ebb 100644
--- a/tools/testing/selftests/bpf/progs/cb_refs.c
+++ b/tools/testing/selftests/bpf/progs/cb_refs.c
@@ -2,7 +2,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
struct map_value {
struct prog_test_ref_kfunc __kptr *ptr;
diff --git a/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c b/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c
new file mode 100644
index 000000000000..e32b07d802bb
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c
@@ -0,0 +1,15 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include "vmlinux.h"
+#include <bpf/bpf_helpers.h>
+
+__u32 data_end;
+
+SEC("cgroup_skb/ingress")
+int direct_packet_access(struct __sk_buff *skb)
+{
+ data_end = skb->data_end;
+ return 1;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data.c b/tools/testing/selftests/bpf/progs/changes_pkt_data.c
new file mode 100644
index 000000000000..43cada48b28a
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/changes_pkt_data.c
@@ -0,0 +1,39 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+__noinline
+long changes_pkt_data(struct __sk_buff *sk)
+{
+ return bpf_skb_pull_data(sk, 0);
+}
+
+__noinline __weak
+long does_not_change_pkt_data(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+SEC("?tc")
+int main_with_subprogs(struct __sk_buff *sk)
+{
+ changes_pkt_data(sk);
+ does_not_change_pkt_data(sk);
+ return 0;
+}
+
+SEC("?tc")
+int main_changes(struct __sk_buff *sk)
+{
+ bpf_skb_pull_data(sk, 0);
+ return 0;
+}
+
+SEC("?tc")
+int main_does_not_change(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c
new file mode 100644
index 000000000000..f9a622705f1b
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c
@@ -0,0 +1,18 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+SEC("?freplace")
+long changes_pkt_data(struct __sk_buff *sk)
+{
+ return bpf_skb_pull_data(sk, 0);
+}
+
+SEC("?freplace")
+long does_not_change_pkt_data(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/dynptr_fail.c b/tools/testing/selftests/bpf/progs/dynptr_fail.c
index 8f36c9de7591..bd8f15229f5c 100644
--- a/tools/testing/selftests/bpf/progs/dynptr_fail.c
+++ b/tools/testing/selftests/bpf/progs/dynptr_fail.c
@@ -149,7 +149,7 @@ int ringbuf_release_uninit_dynptr(void *ctx)
/* A dynptr can't be used after it has been invalidated */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int use_after_invalid(void *ctx)
{
struct bpf_dynptr ptr;
@@ -192,7 +192,7 @@ done:
/* Can't add a dynptr to a map */
SEC("?raw_tp")
-__failure __msg("invalid indirect read from stack")
+__failure __msg("invalid read from stack")
int add_dynptr_to_map1(void *ctx)
{
struct bpf_dynptr ptr;
@@ -210,7 +210,7 @@ int add_dynptr_to_map1(void *ctx)
/* Can't add a struct with an embedded dynptr to a map */
SEC("?raw_tp")
-__failure __msg("invalid indirect read from stack")
+__failure __msg("invalid read from stack")
int add_dynptr_to_map2(void *ctx)
{
struct test_info x;
@@ -398,7 +398,7 @@ int data_slice_missing_null_check2(void *ctx)
* dynptr argument
*/
SEC("?raw_tp")
-__failure __msg("invalid indirect read from stack")
+__failure __msg("invalid read from stack")
int invalid_helper1(void *ctx)
{
struct bpf_dynptr ptr;
@@ -428,7 +428,7 @@ int invalid_helper2(void *ctx)
/* A bpf_dynptr is invalidated if it's been written into */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int invalid_write1(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1407,7 +1407,7 @@ int invalid_slice_rdwr_rdonly(struct __sk_buff *skb)
/* bpf_dynptr_adjust can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_adjust_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1420,7 +1420,7 @@ int dynptr_adjust_invalid(void *ctx)
/* bpf_dynptr_is_null can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_is_null_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1433,7 +1433,7 @@ int dynptr_is_null_invalid(void *ctx)
/* bpf_dynptr_is_rdonly can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_is_rdonly_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1446,7 +1446,7 @@ int dynptr_is_rdonly_invalid(void *ctx)
/* bpf_dynptr_size can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_size_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1459,7 +1459,7 @@ int dynptr_size_invalid(void *ctx)
/* Only initialized dynptrs can be cloned */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int clone_invalid1(void *ctx)
{
struct bpf_dynptr ptr1 = {};
@@ -1493,7 +1493,7 @@ int clone_invalid2(struct xdp_md *xdp)
/* Invalidating a dynptr should invalidate its clones */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate1(void *ctx)
{
struct bpf_dynptr clone;
@@ -1514,7 +1514,7 @@ int clone_invalidate1(void *ctx)
/* Invalidating a dynptr should invalidate its parent */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate2(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1535,7 +1535,7 @@ int clone_invalidate2(void *ctx)
/* Invalidating a dynptr should invalidate its siblings */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate3(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1723,7 +1723,7 @@ __noinline long global_call_bpf_dynptr(const struct bpf_dynptr *dynptr)
}
SEC("?raw_tp")
-__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
+__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr")
int test_dynptr_reg_type(void *ctx)
{
struct task_struct *current = NULL;
diff --git a/tools/testing/selftests/bpf/progs/epilogue_exit.c b/tools/testing/selftests/bpf/progs/epilogue_exit.c
index 33d3a57bee90..35fec7c75bef 100644
--- a/tools/testing/selftests/bpf/progs/epilogue_exit.c
+++ b/tools/testing/selftests/bpf/progs/epilogue_exit.c
@@ -4,8 +4,8 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/epilogue_tailcall.c b/tools/testing/selftests/bpf/progs/epilogue_tailcall.c
index 7275dd594de0..153514691ba4 100644
--- a/tools/testing/selftests/bpf/progs/epilogue_tailcall.c
+++ b/tools/testing/selftests/bpf/progs/epilogue_tailcall.c
@@ -4,8 +4,8 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/exceptions_fail.c b/tools/testing/selftests/bpf/progs/exceptions_fail.c
index fe0f3fa5aab6..8a0fdff89927 100644
--- a/tools/testing/selftests/bpf/progs/exceptions_fail.c
+++ b/tools/testing/selftests/bpf/progs/exceptions_fail.c
@@ -131,7 +131,7 @@ int reject_subprog_with_lock(void *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_rcu_read_lock-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_rcu_read_lock-ed region")
int reject_with_rcu_read_lock(void *ctx)
{
bpf_rcu_read_lock();
@@ -147,7 +147,7 @@ __noinline static int throwing_subprog(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_rcu_read_lock-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_rcu_read_lock-ed region")
int reject_subprog_with_rcu_read_lock(void *ctx)
{
bpf_rcu_read_lock();
diff --git a/tools/testing/selftests/bpf/progs/free_timer.c b/tools/testing/selftests/bpf/progs/free_timer.c
new file mode 100644
index 000000000000..4501ae8fc414
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/free_timer.c
@@ -0,0 +1,71 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (C) 2025. Huawei Technologies Co., Ltd */
+#include <linux/bpf.h>
+#include <time.h>
+#include <bpf/bpf_tracing.h>
+#include <bpf/bpf_helpers.h>
+
+#define MAX_ENTRIES 8
+
+struct map_value {
+ struct bpf_timer timer;
+};
+
+struct {
+ __uint(type, BPF_MAP_TYPE_HASH);
+ __type(key, int);
+ __type(value, struct map_value);
+ __uint(max_entries, MAX_ENTRIES);
+} map SEC(".maps");
+
+static int timer_cb(void *map, void *key, struct map_value *value)
+{
+ volatile int sum = 0;
+ int i;
+
+ bpf_for(i, 0, 1024 * 1024) sum += i;
+
+ return 0;
+}
+
+static int start_cb(int key)
+{
+ struct map_value *value;
+
+ value = bpf_map_lookup_elem(&map, (void *)&key);
+ if (!value)
+ return 0;
+
+ bpf_timer_init(&value->timer, &map, CLOCK_MONOTONIC);
+ bpf_timer_set_callback(&value->timer, timer_cb);
+ /* Hope 100us will be enough to wake-up and run the overwrite thread */
+ bpf_timer_start(&value->timer, 100000, BPF_F_TIMER_CPU_PIN);
+
+ return 0;
+}
+
+static int overwrite_cb(int key)
+{
+ struct map_value zero = {};
+
+ /* Free the timer which may run on other CPU */
+ bpf_map_update_elem(&map, (void *)&key, &zero, BPF_ANY);
+
+ return 0;
+}
+
+SEC("syscall")
+int BPF_PROG(start_timer)
+{
+ bpf_loop(MAX_ENTRIES, start_cb, NULL, 0);
+ return 0;
+}
+
+SEC("syscall")
+int BPF_PROG(overwrite_timer)
+{
+ bpf_loop(MAX_ENTRIES, overwrite_cb, NULL, 0);
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/irq.c b/tools/testing/selftests/bpf/progs/irq.c
new file mode 100644
index 000000000000..b0b53d980964
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/irq.c
@@ -0,0 +1,444 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#include <vmlinux.h>
+#include <bpf/bpf_helpers.h>
+#include "bpf_misc.h"
+#include "bpf_experimental.h"
+
+unsigned long global_flags;
+
+extern void bpf_local_irq_save(unsigned long *) __weak __ksym;
+extern void bpf_local_irq_restore(unsigned long *) __weak __ksym;
+extern int bpf_copy_from_user_str(void *dst, u32 dst__sz, const void *unsafe_ptr__ign, u64 flags) __weak __ksym;
+
+SEC("?tc")
+__failure __msg("arg#0 doesn't point to an irq flag on stack")
+int irq_save_bad_arg(struct __sk_buff *ctx)
+{
+ bpf_local_irq_save(&global_flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("arg#0 doesn't point to an irq flag on stack")
+int irq_restore_bad_arg(struct __sk_buff *ctx)
+{
+ bpf_local_irq_restore(&global_flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_2(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags2);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_3(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags2);
+ bpf_local_irq_save(&flags3);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_3_minus_2(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags2);
+ bpf_local_irq_save(&flags3);
+ bpf_local_irq_restore(&flags3);
+ bpf_local_irq_restore(&flags2);
+ return 0;
+}
+
+static __noinline void local_irq_save(unsigned long *flags)
+{
+ bpf_local_irq_save(flags);
+}
+
+static __noinline void local_irq_restore(unsigned long *flags)
+{
+ bpf_local_irq_restore(flags);
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_1_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags;
+
+ local_irq_save(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_2_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+
+ local_irq_save(&flags1);
+ local_irq_save(&flags2);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_3_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save(&flags1);
+ local_irq_save(&flags2);
+ local_irq_save(&flags3);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region")
+int irq_restore_missing_3_minus_2_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save(&flags1);
+ local_irq_save(&flags2);
+ local_irq_save(&flags3);
+ local_irq_restore(&flags3);
+ local_irq_restore(&flags2);
+ return 0;
+}
+
+SEC("?tc")
+__success
+int irq_balance(struct __sk_buff *ctx)
+{
+ unsigned long flags;
+
+ local_irq_save(&flags);
+ local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__success
+int irq_balance_n(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save(&flags1);
+ local_irq_save(&flags2);
+ local_irq_save(&flags3);
+ local_irq_restore(&flags3);
+ local_irq_restore(&flags2);
+ local_irq_restore(&flags1);
+ return 0;
+}
+
+static __noinline void local_irq_balance(void)
+{
+ unsigned long flags;
+
+ local_irq_save(&flags);
+ local_irq_restore(&flags);
+}
+
+static __noinline void local_irq_balance_n(void)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save(&flags1);
+ local_irq_save(&flags2);
+ local_irq_save(&flags3);
+ local_irq_restore(&flags3);
+ local_irq_restore(&flags2);
+ local_irq_restore(&flags1);
+}
+
+SEC("?tc")
+__success
+int irq_balance_subprog(struct __sk_buff *ctx)
+{
+ local_irq_balance();
+ return 0;
+}
+
+SEC("?fentry.s/" SYS_PREFIX "sys_getpgid")
+__failure __msg("sleepable helper bpf_copy_from_user#")
+int irq_sleepable_helper(void *ctx)
+{
+ unsigned long flags;
+ u32 data;
+
+ local_irq_save(&flags);
+ bpf_copy_from_user(&data, sizeof(data), NULL);
+ local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?fentry.s/" SYS_PREFIX "sys_getpgid")
+__failure __msg("kernel func bpf_copy_from_user_str is sleepable within IRQ-disabled region")
+int irq_sleepable_kfunc(void *ctx)
+{
+ unsigned long flags;
+ u32 data;
+
+ local_irq_save(&flags);
+ bpf_copy_from_user_str(&data, sizeof(data), NULL, 0);
+ local_irq_restore(&flags);
+ return 0;
+}
+
+int __noinline global_local_irq_balance(void)
+{
+ local_irq_balance_n();
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("global function calls are not allowed with IRQs disabled")
+int irq_global_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags;
+
+ bpf_local_irq_save(&flags);
+ global_local_irq_balance();
+ bpf_local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("cannot restore irq state out of order")
+int irq_restore_ooo(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags2);
+ bpf_local_irq_restore(&flags1);
+ bpf_local_irq_restore(&flags2);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("cannot restore irq state out of order")
+int irq_restore_ooo_3(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags2);
+ bpf_local_irq_restore(&flags2);
+ bpf_local_irq_save(&flags3);
+ bpf_local_irq_restore(&flags1);
+ bpf_local_irq_restore(&flags3);
+ return 0;
+}
+
+static __noinline void local_irq_save_3(unsigned long *flags1, unsigned long *flags2,
+ unsigned long *flags3)
+{
+ local_irq_save(flags1);
+ local_irq_save(flags2);
+ local_irq_save(flags3);
+}
+
+SEC("?tc")
+__success
+int irq_restore_3_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save_3(&flags1, &flags2, &flags3);
+ bpf_local_irq_restore(&flags3);
+ bpf_local_irq_restore(&flags2);
+ bpf_local_irq_restore(&flags1);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("cannot restore irq state out of order")
+int irq_restore_4_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+ unsigned long flags4;
+
+ local_irq_save_3(&flags1, &flags2, &flags3);
+ bpf_local_irq_restore(&flags3);
+ bpf_local_irq_save(&flags4);
+ bpf_local_irq_restore(&flags4);
+ bpf_local_irq_restore(&flags1);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("cannot restore irq state out of order")
+int irq_restore_ooo_3_subprog(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags2;
+ unsigned long flags3;
+
+ local_irq_save_3(&flags1, &flags2, &flags3);
+ bpf_local_irq_restore(&flags3);
+ bpf_local_irq_restore(&flags2);
+ bpf_local_irq_save(&flags3);
+ bpf_local_irq_restore(&flags1);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("expected an initialized")
+int irq_restore_invalid(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+ unsigned long flags = 0xfaceb00c;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("expected uninitialized")
+int irq_save_invalid(struct __sk_buff *ctx)
+{
+ unsigned long flags1;
+
+ bpf_local_irq_save(&flags1);
+ bpf_local_irq_save(&flags1);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("expected an initialized")
+int irq_restore_iter(struct __sk_buff *ctx)
+{
+ struct bpf_iter_num it;
+
+ bpf_iter_num_new(&it, 0, 42);
+ bpf_local_irq_restore((unsigned long *)&it);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("Unreleased reference id=1")
+int irq_save_iter(struct __sk_buff *ctx)
+{
+ struct bpf_iter_num it;
+
+ /* Ensure same sized slot has st->ref_obj_id set, so we reject based on
+ * slot_type != STACK_IRQ_FLAG...
+ */
+ _Static_assert(sizeof(it) == sizeof(unsigned long), "broken iterator size");
+
+ bpf_iter_num_new(&it, 0, 42);
+ bpf_local_irq_save((unsigned long *)&it);
+ bpf_local_irq_restore((unsigned long *)&it);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("expected an initialized")
+int irq_flag_overwrite(struct __sk_buff *ctx)
+{
+ unsigned long flags;
+
+ bpf_local_irq_save(&flags);
+ flags = 0xdeadbeef;
+ bpf_local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("expected an initialized")
+int irq_flag_overwrite_partial(struct __sk_buff *ctx)
+{
+ unsigned long flags;
+
+ bpf_local_irq_save(&flags);
+ *(((char *)&flags) + 1) = 0xff;
+ bpf_local_irq_restore(&flags);
+ return 0;
+}
+
+SEC("?tc")
+__failure __msg("cannot restore irq state out of order")
+int irq_ooo_refs_array(struct __sk_buff *ctx)
+{
+ unsigned long flags[4];
+ struct { int i; } *p;
+
+ /* refs=1 */
+ bpf_local_irq_save(&flags[0]);
+
+ /* refs=1,2 */
+ p = bpf_obj_new(typeof(*p));
+ if (!p) {
+ bpf_local_irq_restore(&flags[0]);
+ return 0;
+ }
+
+ /* refs=1,2,3 */
+ bpf_local_irq_save(&flags[1]);
+
+ /* refs=1,2,3,4 */
+ bpf_local_irq_save(&flags[2]);
+
+ /* Now when we remove ref=2, the verifier must not break the ordering in
+ * the refs array between 1,3,4. With an older implementation, the
+ * verifier would swap the last element with the removed element, but to
+ * maintain the stack property we need to use memmove.
+ */
+ bpf_obj_drop(p);
+
+ /* Save and restore to reset active_irq_id to 3, as the ordering is now
+ * refs=1,4,3. When restoring the linear scan will find prev_id in order
+ * as 3 instead of 4.
+ */
+ bpf_local_irq_save(&flags[3]);
+ bpf_local_irq_restore(&flags[3]);
+
+ /* With the incorrect implementation, we can release flags[1], flags[2],
+ * and flags[0], i.e. in the wrong order.
+ */
+ bpf_local_irq_restore(&flags[1]);
+ bpf_local_irq_restore(&flags[2]);
+ bpf_local_irq_restore(&flags[0]);
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/iters.c b/tools/testing/selftests/bpf/progs/iters.c
index ef70b88bccb2..190822b2f08b 100644
--- a/tools/testing/selftests/bpf/progs/iters.c
+++ b/tools/testing/selftests/bpf/progs/iters.c
@@ -524,11 +524,11 @@ int iter_subprog_iters(const void *ctx)
}
struct {
- __uint(type, BPF_MAP_TYPE_ARRAY);
+ __uint(type, BPF_MAP_TYPE_HASH);
__type(key, int);
__type(value, int);
__uint(max_entries, 1000);
-} arr_map SEC(".maps");
+} hash_map SEC(".maps");
SEC("?raw_tp")
__failure __msg("invalid mem access 'scalar'")
@@ -539,7 +539,7 @@ int iter_err_too_permissive1(const void *ctx)
MY_PID_GUARD();
- map_val = bpf_map_lookup_elem(&arr_map, &key);
+ map_val = bpf_map_lookup_elem(&hash_map, &key);
if (!map_val)
return 0;
@@ -561,12 +561,12 @@ int iter_err_too_permissive2(const void *ctx)
MY_PID_GUARD();
- map_val = bpf_map_lookup_elem(&arr_map, &key);
+ map_val = bpf_map_lookup_elem(&hash_map, &key);
if (!map_val)
return 0;
bpf_repeat(1000000) {
- map_val = bpf_map_lookup_elem(&arr_map, &key);
+ map_val = bpf_map_lookup_elem(&hash_map, &key);
}
*map_val = 123;
@@ -585,7 +585,7 @@ int iter_err_too_permissive3(const void *ctx)
MY_PID_GUARD();
bpf_repeat(1000000) {
- map_val = bpf_map_lookup_elem(&arr_map, &key);
+ map_val = bpf_map_lookup_elem(&hash_map, &key);
found = true;
}
@@ -606,7 +606,7 @@ int iter_tricky_but_fine(const void *ctx)
MY_PID_GUARD();
bpf_repeat(1000000) {
- map_val = bpf_map_lookup_elem(&arr_map, &key);
+ map_val = bpf_map_lookup_elem(&hash_map, &key);
if (map_val) {
found = true;
break;
@@ -1486,4 +1486,30 @@ int iter_subprog_check_stacksafe(const void *ctx)
return 0;
}
+struct bpf_iter_num global_it;
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_new_bad_arg(const void *ctx)
+{
+ bpf_iter_num_new(&global_it, 0, 1);
+ return 0;
+}
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_next_bad_arg(const void *ctx)
+{
+ bpf_iter_num_next(&global_it);
+ return 0;
+}
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_destroy_bad_arg(const void *ctx)
+{
+ bpf_iter_num_destroy(&global_it);
+ return 0;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/iters_state_safety.c b/tools/testing/selftests/bpf/progs/iters_state_safety.c
index d47e59aba6de..f41257eadbb2 100644
--- a/tools/testing/selftests/bpf/progs/iters_state_safety.c
+++ b/tools/testing/selftests/bpf/progs/iters_state_safety.c
@@ -73,7 +73,7 @@ int create_and_forget_to_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int destroy_without_creating_fail(void *ctx)
{
/* init with zeros to stop verifier complaining about uninit stack */
@@ -91,7 +91,7 @@ int destroy_without_creating_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int compromise_iter_w_direct_write_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -143,7 +143,7 @@ int compromise_iter_w_direct_write_and_skip_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int compromise_iter_w_helper_write_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -230,7 +230,7 @@ int valid_stack_reuse(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected uninitialized iter_num as arg #1")
+__failure __msg("expected uninitialized iter_num as arg #0")
int double_create_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -258,7 +258,7 @@ int double_create_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int double_destroy_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -284,7 +284,7 @@ int double_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int next_without_new_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -305,7 +305,7 @@ int next_without_new_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int next_after_destroy_fail(void *ctx)
{
struct bpf_iter_num iter;
diff --git a/tools/testing/selftests/bpf/progs/iters_testmod.c b/tools/testing/selftests/bpf/progs/iters_testmod.c
index df1d3db60b1b..9e4b45201e69 100644
--- a/tools/testing/selftests/bpf/progs/iters_testmod.c
+++ b/tools/testing/selftests/bpf/progs/iters_testmod.c
@@ -4,7 +4,7 @@
#include "bpf_experimental.h"
#include <bpf/bpf_helpers.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
index 4a176e6aede8..6543d5b6e0a9 100644
--- a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
+++ b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
@@ -79,7 +79,7 @@ int testmod_seq_truncated(const void *ctx)
SEC("?raw_tp")
__failure
-__msg("expected an initialized iter_testmod_seq as arg #2")
+__msg("expected an initialized iter_testmod_seq as arg #1")
int testmod_seq_getter_before_bad(const void *ctx)
{
struct bpf_iter_testmod_seq it;
@@ -89,7 +89,7 @@ int testmod_seq_getter_before_bad(const void *ctx)
SEC("?raw_tp")
__failure
-__msg("expected an initialized iter_testmod_seq as arg #2")
+__msg("expected an initialized iter_testmod_seq as arg #1")
int testmod_seq_getter_after_bad(const void *ctx)
{
struct bpf_iter_testmod_seq it;
diff --git a/tools/testing/selftests/bpf/progs/jit_probe_mem.c b/tools/testing/selftests/bpf/progs/jit_probe_mem.c
index f9789e668297..82190d79de37 100644
--- a/tools/testing/selftests/bpf/progs/jit_probe_mem.c
+++ b/tools/testing/selftests/bpf/progs/jit_probe_mem.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
static struct prog_test_ref_kfunc __kptr *v;
long total_sum = -1;
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c b/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c
index 7632d9ecb253..b9670e9a6e3d 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
SEC("tc")
int kfunc_destructive_test(void)
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_fail.c b/tools/testing/selftests/bpf/progs/kfunc_call_fail.c
index 08fae306539c..a1963497f0bf 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_fail.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_fail.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2021 Facebook */
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
struct syscall_test_args {
__u8 data[16];
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_race.c b/tools/testing/selftests/bpf/progs/kfunc_call_race.c
index d532af07decf..48f64827cd93 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_race.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_race.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
SEC("tc")
int kfunc_call_fail(struct __sk_buff *ctx)
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_test.c b/tools/testing/selftests/bpf/progs/kfunc_call_test.c
index f502f755f567..8b86113a0126 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_test.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_test.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2021 Facebook */
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
SEC("tc")
int kfunc_call_test4(struct __sk_buff *skb)
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c b/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c
index 2380c75e74ce..8e150e85b50d 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c
@@ -1,6 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
/* Copyright (c) 2021 Facebook */
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
extern const int bpf_prog_active __ksym;
int active_res = -1;
diff --git a/tools/testing/selftests/bpf/progs/local_kptr_stash.c b/tools/testing/selftests/bpf/progs/local_kptr_stash.c
index b092a72b2c9d..d736506a4c80 100644
--- a/tools/testing/selftests/bpf/progs/local_kptr_stash.c
+++ b/tools/testing/selftests/bpf/progs/local_kptr_stash.c
@@ -6,7 +6,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_core_read.h>
#include "../bpf_experimental.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
struct plain_local;
diff --git a/tools/testing/selftests/bpf/progs/map_kptr.c b/tools/testing/selftests/bpf/progs/map_kptr.c
index ab0ce1d01a4a..edaba481db9d 100644
--- a/tools/testing/selftests/bpf/progs/map_kptr.c
+++ b/tools/testing/selftests/bpf/progs/map_kptr.c
@@ -2,7 +2,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
struct map_value {
struct prog_test_ref_kfunc __kptr_untrusted *unref_ptr;
diff --git a/tools/testing/selftests/bpf/progs/map_kptr_fail.c b/tools/testing/selftests/bpf/progs/map_kptr_fail.c
index 450bb373b179..4c0ff01f1a96 100644
--- a/tools/testing/selftests/bpf/progs/map_kptr_fail.c
+++ b/tools/testing/selftests/bpf/progs/map_kptr_fail.c
@@ -4,7 +4,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_core_read.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
struct map_value {
char buf[8];
@@ -345,7 +345,7 @@ int reject_indirect_global_func_access(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("Unreleased reference id=5 alloc_insn=")
+__failure __msg("Unreleased reference id=4 alloc_insn=")
int kptr_xchg_ref_state(struct __sk_buff *ctx)
{
struct prog_test_ref_kfunc *p;
diff --git a/tools/testing/selftests/bpf/progs/missed_kprobe.c b/tools/testing/selftests/bpf/progs/missed_kprobe.c
index 7f9ef701f5de..51a4fe64c917 100644
--- a/tools/testing/selftests/bpf/progs/missed_kprobe.c
+++ b/tools/testing/selftests/bpf/progs/missed_kprobe.c
@@ -2,7 +2,7 @@
#include "vmlinux.h"
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c b/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c
index 8ea71cbd6c45..29c18d869ec1 100644
--- a/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c
+++ b/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c
@@ -2,7 +2,7 @@
#include "vmlinux.h"
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
@@ -46,3 +46,9 @@ int test5(struct pt_regs *ctx)
{
return 0;
}
+
+SEC("kprobe.session/bpf_kfunc_common_test")
+int test6(struct pt_regs *ctx)
+{
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/nested_acquire.c b/tools/testing/selftests/bpf/progs/nested_acquire.c
index 8e521a21d995..49ad7b9adf56 100644
--- a/tools/testing/selftests/bpf/progs/nested_acquire.c
+++ b/tools/testing/selftests/bpf/progs/nested_acquire.c
@@ -4,7 +4,7 @@
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_helpers.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/preempt_lock.c b/tools/testing/selftests/bpf/progs/preempt_lock.c
index 885377e83607..6c5797bf0ead 100644
--- a/tools/testing/selftests/bpf/progs/preempt_lock.c
+++ b/tools/testing/selftests/bpf/progs/preempt_lock.c
@@ -5,8 +5,10 @@
#include "bpf_misc.h"
#include "bpf_experimental.h"
+extern int bpf_copy_from_user_str(void *dst, u32 dst__sz, const void *unsafe_ptr__ign, u64 flags) __weak __ksym;
+
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_1(struct __sk_buff *ctx)
{
bpf_preempt_disable();
@@ -14,7 +16,7 @@ int preempt_lock_missing_1(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_2(struct __sk_buff *ctx)
{
bpf_preempt_disable();
@@ -23,7 +25,7 @@ int preempt_lock_missing_2(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_3(struct __sk_buff *ctx)
{
bpf_preempt_disable();
@@ -33,7 +35,7 @@ int preempt_lock_missing_3(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_3_minus_2(struct __sk_buff *ctx)
{
bpf_preempt_disable();
@@ -55,7 +57,7 @@ static __noinline void preempt_enable(void)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_1_subprog(struct __sk_buff *ctx)
{
preempt_disable();
@@ -63,7 +65,7 @@ int preempt_lock_missing_1_subprog(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_2_subprog(struct __sk_buff *ctx)
{
preempt_disable();
@@ -72,7 +74,7 @@ int preempt_lock_missing_2_subprog(struct __sk_buff *ctx)
}
SEC("?tc")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region")
int preempt_lock_missing_2_minus_1_subprog(struct __sk_buff *ctx)
{
preempt_disable();
@@ -113,6 +115,18 @@ int preempt_sleepable_helper(void *ctx)
return 0;
}
+SEC("?fentry.s/" SYS_PREFIX "sys_getpgid")
+__failure __msg("kernel func bpf_copy_from_user_str is sleepable within non-preemptible region")
+int preempt_sleepable_kfunc(void *ctx)
+{
+ u32 data;
+
+ bpf_preempt_disable();
+ bpf_copy_from_user_str(&data, sizeof(data), NULL, 0);
+ bpf_preempt_enable();
+ return 0;
+}
+
int __noinline preempt_global_subprog(void)
{
preempt_balance_subprog();
diff --git a/tools/testing/selftests/bpf/progs/pro_epilogue.c b/tools/testing/selftests/bpf/progs/pro_epilogue.c
index 44bc3f06b4b6..d97d6e07ef5c 100644
--- a/tools/testing/selftests/bpf/progs/pro_epilogue.c
+++ b/tools/testing/selftests/bpf/progs/pro_epilogue.c
@@ -4,8 +4,8 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c b/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c
index 3529e53be355..6048d79be48b 100644
--- a/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c
+++ b/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c
@@ -4,8 +4,8 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null.c b/tools/testing/selftests/bpf/progs/raw_tp_null.c
index 457f34c151e3..5927054b6dd9 100644
--- a/tools/testing/selftests/bpf/progs/raw_tp_null.c
+++ b/tools/testing/selftests/bpf/progs/raw_tp_null.c
@@ -3,6 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
+#include "bpf_misc.h"
char _license[] SEC("license") = "GPL";
@@ -17,16 +18,14 @@ int BPF_PROG(test_raw_tp_null, struct sk_buff *skb)
if (task->pid != tid)
return 0;
- i = i + skb->mark + 1;
- /* The compiler may move the NULL check before this deref, which causes
- * the load to fail as deref of scalar. Prevent that by using a barrier.
+ /* If dead code elimination kicks in, the increment +=2 will be
+ * removed. For raw_tp programs attaching to tracepoints in kernel
+ * modules, we mark input arguments as PTR_MAYBE_NULL, so branch
+ * prediction should never kick in.
*/
- barrier();
- /* If dead code elimination kicks in, the increment below will
- * be removed. For raw_tp programs, we mark input arguments as
- * PTR_MAYBE_NULL, so branch prediction should never kick in.
- */
- if (!skb)
- i += 2;
+ asm volatile ("%[i] += 1; if %[ctx] != 0 goto +1; %[i] += 2;"
+ : [i]"+r"(i)
+ : [ctx]"r"(skb)
+ : "memory");
return 0;
}
diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c
new file mode 100644
index 000000000000..38d669957bf1
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c
@@ -0,0 +1,24 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+
+#include <vmlinux.h>
+#include <bpf/bpf_tracing.h>
+#include "bpf_misc.h"
+
+char _license[] SEC("license") = "GPL";
+
+/* Ensure module parameter has PTR_MAYBE_NULL */
+SEC("tp_btf/bpf_testmod_test_raw_tp_null")
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
+int test_raw_tp_null_bpf_testmod_test_raw_tp_null_arg_1(void *ctx) {
+ asm volatile("r1 = *(u64 *)(r1 +0); r1 = *(u64 *)(r1 +0);" ::: __clobber_all);
+ return 0;
+}
+
+/* Check NULL marking */
+SEC("tp_btf/sched_pi_setprio")
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
+int test_raw_tp_null_sched_pi_setprio_arg_2(void *ctx) {
+ asm volatile("r1 = *(u64 *)(r1 +8); r1 = *(u64 *)(r1 +0);" ::: __clobber_all);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
index 76556e0b42b2..69da05bb6c63 100644
--- a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
+++ b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
@@ -4,7 +4,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-extern bool CONFIG_PREEMPT __kconfig __weak;
+extern bool CONFIG_PREEMPTION __kconfig __weak;
extern const int bpf_task_storage_busy __ksym;
char _license[] SEC("license") = "GPL";
@@ -24,7 +24,7 @@ int BPF_PROG(read_bpf_task_storage_busy)
{
int *value;
- if (!CONFIG_PREEMPT)
+ if (!CONFIG_PREEMPTION)
return 0;
if (bpf_get_current_pid_tgid() >> 32 != pid)
diff --git a/tools/testing/selftests/bpf/progs/sock_addr_kern.c b/tools/testing/selftests/bpf/progs/sock_addr_kern.c
index 8386bb15ccdc..84ad515eafd6 100644
--- a/tools/testing/selftests/bpf/progs/sock_addr_kern.c
+++ b/tools/testing/selftests/bpf/progs/sock_addr_kern.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Google LLC */
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
SEC("syscall")
int init_sock(struct init_sock_args *args)
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_detach.c b/tools/testing/selftests/bpf/progs/struct_ops_detach.c
index d7fdcabe7d90..284a5b008e0c 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_detach.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_detach.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c b/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c
index 3c822103bd40..d8cc99f5c2e2 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c
index b450f72e744a..ccab3935aa42 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c
index 6283099ec383..8b5515f4f724 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_module.c b/tools/testing/selftests/bpf/progs/struct_ops_module.c
index 4c56d4a9d9f4..71c420c3a5a6 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_module.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_module.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c b/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c
index 9efcc6e4d356..5b23ea817f1f 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c b/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c
index fa2021388485..5d0937fa07be 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c
@@ -2,7 +2,7 @@
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c
index 8ea57e5348ab..0e4d2ff63ab8 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c
index 1f55ec4cee37..58d5d8dc2235 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c
index f2f300d50988..31e58389bb8b 100644
--- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c
+++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c
@@ -3,7 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/syscall.c b/tools/testing/selftests/bpf/progs/syscall.c
index 0f4dfb770c32..b698cc62a371 100644
--- a/tools/testing/selftests/bpf/progs/syscall.c
+++ b/tools/testing/selftests/bpf/progs/syscall.c
@@ -76,9 +76,9 @@ static int btf_load(void)
.magic = BTF_MAGIC,
.version = BTF_VERSION,
.hdr_len = sizeof(struct btf_header),
- .type_len = sizeof(__u32) * 8,
- .str_off = sizeof(__u32) * 8,
- .str_len = sizeof(__u32),
+ .type_len = sizeof(raw_btf.types),
+ .str_off = offsetof(struct btf_blob, str) - offsetof(struct btf_blob, types),
+ .str_len = sizeof(raw_btf.str),
},
.types = {
/* long */
diff --git a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
index ea2dbb80f7b3..986829aaf73a 100644
--- a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
+++ b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
@@ -10,7 +10,7 @@ char _license[] SEC("license") = "GPL";
#define EBUSY 16
#endif
-extern bool CONFIG_PREEMPT __kconfig __weak;
+extern bool CONFIG_PREEMPTION __kconfig __weak;
int nr_get_errs = 0;
int nr_del_errs = 0;
@@ -29,7 +29,7 @@ int BPF_PROG(socket_post_create, struct socket *sock, int family, int type,
int ret, zero = 0;
int *value;
- if (!CONFIG_PREEMPT)
+ if (!CONFIG_PREEMPTION)
return 0;
task = bpf_get_current_task_btf();
diff --git a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
index d1a57f7d09bd..fe6249d99b31 100644
--- a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
+++ b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
@@ -11,6 +11,8 @@ int subprog_tc(struct __sk_buff *skb)
__sink(skb);
__sink(ret);
+ /* let verifier know that 'subprog_tc' can change pointers to skb->data */
+ bpf_skb_change_proto(skb, 0, 0);
return ret;
}
diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect.c b/tools/testing/selftests/bpf/progs/test_cls_redirect.c
index 683c8aaa63da..f344c6835e84 100644
--- a/tools/testing/selftests/bpf/progs/test_cls_redirect.c
+++ b/tools/testing/selftests/bpf/progs/test_cls_redirect.c
@@ -15,7 +15,7 @@
#include <linux/ipv6.h>
#include <linux/pkt_cls.h>
#include <linux/tcp.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_endian.h>
diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect.h b/tools/testing/selftests/bpf/progs/test_cls_redirect.h
index 233b089d1fba..eb55cb8a3dbd 100644
--- a/tools/testing/selftests/bpf/progs/test_cls_redirect.h
+++ b/tools/testing/selftests/bpf/progs/test_cls_redirect.h
@@ -10,7 +10,7 @@
#include <linux/in.h>
#include <linux/ip.h>
#include <linux/ipv6.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
/* offsetof() is used in static asserts, and the libbpf-redefined CO-RE
* friendly version breaks compilation for older clang versions <= 15
diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c b/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c
index 464515b824b9..d0f7670351e5 100644
--- a/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c
+++ b/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c
@@ -15,7 +15,7 @@
#include <linux/ipv6.h>
#include <linux/pkt_cls.h>
#include <linux/tcp.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_endian.h>
diff --git a/tools/testing/selftests/bpf/progs/test_fill_link_info.c b/tools/testing/selftests/bpf/progs/test_fill_link_info.c
index 6afa834756e9..fac33a14f200 100644
--- a/tools/testing/selftests/bpf/progs/test_fill_link_info.c
+++ b/tools/testing/selftests/bpf/progs/test_fill_link_info.c
@@ -6,13 +6,20 @@
#include <stdbool.h>
extern bool CONFIG_X86_KERNEL_IBT __kconfig __weak;
+extern bool CONFIG_PPC_FTRACE_OUT_OF_LINE __kconfig __weak;
+extern bool CONFIG_KPROBES_ON_FTRACE __kconfig __weak;
+extern bool CONFIG_PPC64 __kconfig __weak;
-/* This function is here to have CONFIG_X86_KERNEL_IBT
- * used and added to object BTF.
+/* This function is here to have CONFIG_X86_KERNEL_IBT,
+ * CONFIG_PPC_FTRACE_OUT_OF_LINE, CONFIG_KPROBES_ON_FTRACE,
+ * CONFIG_PPC6 used and added to object BTF.
*/
int unused(void)
{
- return CONFIG_X86_KERNEL_IBT ? 0 : 1;
+ return CONFIG_X86_KERNEL_IBT ||
+ CONFIG_PPC_FTRACE_OUT_OF_LINE ||
+ CONFIG_KPROBES_ON_FTRACE ||
+ CONFIG_PPC64 ? 0 : 1;
}
SEC("kprobe")
diff --git a/tools/testing/selftests/bpf/progs/test_global_func10.c b/tools/testing/selftests/bpf/progs/test_global_func10.c
index 5da001ca57a5..09d027bd3ea8 100644
--- a/tools/testing/selftests/bpf/progs/test_global_func10.c
+++ b/tools/testing/selftests/bpf/progs/test_global_func10.c
@@ -26,7 +26,7 @@ __noinline int foo(const struct Big *big)
}
SEC("cgroup_skb/ingress")
-__failure __msg("invalid indirect access to stack")
+__failure __msg("invalid read from stack")
int global_func10(struct __sk_buff *skb)
{
const struct Small small = {.x = skb->len };
diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
index e68667aec6a6..cd4d752bd089 100644
--- a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
+++ b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
@@ -45,7 +45,7 @@ int BPF_PROG(not_valid_dynptr, int cmd, union bpf_attr *attr, unsigned int size)
}
SEC("?lsm.s/bpf")
-__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
+__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr")
int BPF_PROG(not_ptr_to_stack, int cmd, union bpf_attr *attr, unsigned int size)
{
unsigned long val = 0;
diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c
index 7ac7e1de34d8..0ad1bf1ede8d 100644
--- a/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c
+++ b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c
@@ -4,7 +4,7 @@
#include <bpf/bpf_helpers.h>
#include "bpf_misc.h"
#include "bpf_kfuncs.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
SEC("tc")
int kfunc_dynptr_nullable_test1(struct __sk_buff *skb)
diff --git a/tools/testing/selftests/bpf/progs/test_module_attach.c b/tools/testing/selftests/bpf/progs/test_module_attach.c
index cc1a012d038f..fb07f5773888 100644
--- a/tools/testing/selftests/bpf/progs/test_module_attach.c
+++ b/tools/testing/selftests/bpf/progs/test_module_attach.c
@@ -5,7 +5,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_core_read.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
__u32 raw_tp_read_sz = 0;
diff --git a/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c
new file mode 100644
index 000000000000..2796dd8545eb
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c
@@ -0,0 +1,40 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 ByteDance */
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+struct {
+ __uint(type, BPF_MAP_TYPE_SOCKMAP);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, int);
+} sock_map_rx SEC(".maps");
+
+long change_tail_ret = 1;
+
+SEC("sk_skb")
+int prog_skb_verdict(struct __sk_buff *skb)
+{
+ char *data, *data_end;
+
+ bpf_skb_pull_data(skb, 1);
+ data = (char *)(unsigned long)skb->data;
+ data_end = (char *)(unsigned long)skb->data_end;
+
+ if (data + 1 > data_end)
+ return SK_PASS;
+
+ if (data[0] == 'T') { /* Trim the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, skb->len - 1, 0);
+ return SK_PASS;
+ } else if (data[0] == 'G') { /* Grow the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, skb->len + 1, 0);
+ return SK_PASS;
+ } else if (data[0] == 'E') { /* Error */
+ change_tail_ret = bpf_skb_change_tail(skb, 65535, 0);
+ return SK_PASS;
+ }
+ return SK_PASS;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/test_tc_change_tail.c b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c
new file mode 100644
index 000000000000..28edafe803f0
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c
@@ -0,0 +1,106 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include <linux/if_ether.h>
+#include <linux/in.h>
+#include <linux/ip.h>
+#include <linux/udp.h>
+#include <linux/pkt_cls.h>
+
+long change_tail_ret = 1;
+
+static __always_inline struct iphdr *parse_ip_header(struct __sk_buff *skb, int *ip_proto)
+{
+ void *data_end = (void *)(long)skb->data_end;
+ void *data = (void *)(long)skb->data;
+ struct ethhdr *eth = data;
+ struct iphdr *iph;
+
+ /* Verify Ethernet header */
+ if ((void *)(data + sizeof(*eth)) > data_end)
+ return NULL;
+
+ /* Skip Ethernet header to get to IP header */
+ iph = (void *)(data + sizeof(struct ethhdr));
+
+ /* Verify IP header */
+ if ((void *)(data + sizeof(struct ethhdr) + sizeof(*iph)) > data_end)
+ return NULL;
+
+ /* Basic IP header validation */
+ if (iph->version != 4) /* Only support IPv4 */
+ return NULL;
+
+ if (iph->ihl < 5) /* Minimum IP header length */
+ return NULL;
+
+ *ip_proto = iph->protocol;
+ return iph;
+}
+
+static __always_inline struct udphdr *parse_udp_header(struct __sk_buff *skb, struct iphdr *iph)
+{
+ void *data_end = (void *)(long)skb->data_end;
+ void *hdr = (void *)iph;
+ struct udphdr *udp;
+
+ /* Calculate UDP header position */
+ udp = hdr + (iph->ihl * 4);
+ hdr = (void *)udp;
+
+ /* Verify UDP header bounds */
+ if ((void *)(hdr + sizeof(*udp)) > data_end)
+ return NULL;
+
+ return udp;
+}
+
+SEC("tc/ingress")
+int change_tail(struct __sk_buff *skb)
+{
+ int len = skb->len;
+ struct udphdr *udp;
+ struct iphdr *iph;
+ void *data_end;
+ char *payload;
+ int ip_proto;
+
+ bpf_skb_pull_data(skb, len);
+
+ data_end = (void *)(long)skb->data_end;
+ iph = parse_ip_header(skb, &ip_proto);
+ if (!iph)
+ return TCX_PASS;
+
+ if (ip_proto != IPPROTO_UDP)
+ return TCX_PASS;
+
+ udp = parse_udp_header(skb, iph);
+ if (!udp)
+ return TCX_PASS;
+
+ payload = (char *)udp + (sizeof(struct udphdr));
+ if (payload + 1 > (char *)data_end)
+ return TCX_PASS;
+
+ if (payload[0] == 'T') { /* Trim the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, len - 1, 0);
+ if (!change_tail_ret)
+ bpf_skb_change_tail(skb, len, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'G') { /* Grow the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, len + 1, 0);
+ if (!change_tail_ret)
+ bpf_skb_change_tail(skb, len, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'E') { /* Error */
+ change_tail_ret = bpf_skb_change_tail(skb, 65535, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'Z') { /* Zero */
+ change_tail_ret = bpf_skb_change_tail(skb, 0, 0);
+ return TCX_PASS;
+ }
+ return TCX_DROP;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/test_tc_link.c b/tools/testing/selftests/bpf/progs/test_tc_link.c
index 10d825928499..630f12e51b07 100644
--- a/tools/testing/selftests/bpf/progs/test_tc_link.c
+++ b/tools/testing/selftests/bpf/progs/test_tc_link.c
@@ -8,6 +8,7 @@
#include <linux/if_packet.h>
#include <bpf/bpf_endian.h>
#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_core_read.h>
char LICENSE[] SEC("license") = "GPL";
@@ -27,6 +28,7 @@ bool seen_host;
bool seen_mcast;
int mark, prio;
+unsigned short headroom, tailroom;
SEC("tc/ingress")
int tc1(struct __sk_buff *skb)
@@ -104,11 +106,24 @@ out:
return TCX_PASS;
}
+struct sk_buff {
+ struct net_device *dev;
+};
+
+struct net_device {
+ unsigned short needed_headroom;
+ unsigned short needed_tailroom;
+};
+
SEC("tc/egress")
int tc8(struct __sk_buff *skb)
{
+ struct net_device *dev = BPF_CORE_READ((struct sk_buff *)skb, dev);
+
seen_tc8 = true;
mark = skb->mark;
prio = skb->priority;
+ headroom = BPF_CORE_READ(dev, needed_headroom);
+ tailroom = BPF_CORE_READ(dev, needed_tailroom);
return TCX_PASS;
}
diff --git a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
index 5aaf2b065f86..39ff06f2c834 100644
--- a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
+++ b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
@@ -3,15 +3,11 @@
#include "vmlinux.h"
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
#include "bpf_misc.h"
SEC("tp_btf/bpf_testmod_test_nullable_bare")
-/* This used to be a failure test, but raw_tp nullable arguments can now
- * directly be dereferenced, whether they have nullable annotation or not,
- * and don't need to be explicitly checked.
- */
-__success
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
int BPF_PROG(handle_tp_btf_nullable_bare1, struct bpf_testmod_test_read_ctx *nullable_ctx)
{
return nullable_ctx->len;
diff --git a/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c b/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c
index 81bb38d72ced..dc74d8cf9e3f 100644
--- a/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c
+++ b/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c
@@ -10,6 +10,8 @@ int _xdp_adjust_tail_grow(struct xdp_md *xdp)
/* SKB_DATA_ALIGN(sizeof(struct skb_shared_info)) */
#if defined(__TARGET_ARCH_s390)
int tailroom = 512;
+#elif defined(__TARGET_ARCH_powerpc)
+ int tailroom = 384;
#else
int tailroom = 320;
#endif
diff --git a/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c b/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c
index 3abf068b8446..5928ed0911ca 100644
--- a/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c
+++ b/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c
@@ -98,6 +98,18 @@ int xdp_count_pkts(struct xdp_md *xdp)
return XDP_DROP;
}
+SEC("xdp")
+int xdp_redirect_to_111(struct xdp_md *xdp)
+{
+ return bpf_redirect(111, 0);
+}
+
+SEC("xdp")
+int xdp_redirect_to_222(struct xdp_md *xdp)
+{
+ return bpf_redirect(222, 0);
+}
+
SEC("tc")
int tc_count_pkts(struct __sk_buff *skb)
{
diff --git a/tools/testing/selftests/bpf/progs/test_xdp_meta.c b/tools/testing/selftests/bpf/progs/test_xdp_meta.c
index a7c4a7d49fe6..fe2d71ae0e71 100644
--- a/tools/testing/selftests/bpf/progs/test_xdp_meta.c
+++ b/tools/testing/selftests/bpf/progs/test_xdp_meta.c
@@ -8,7 +8,7 @@
#define round_up(x, y) ((((x) - 1) | __round_mask(x, y)) + 1)
#define ctx_ptr(ctx, mem) (void *)(unsigned long)ctx->mem
-SEC("t")
+SEC("tc")
int ing_cls(struct __sk_buff *ctx)
{
__u8 *data, *data_meta, *data_end;
@@ -28,7 +28,7 @@ int ing_cls(struct __sk_buff *ctx)
return diff ? TC_ACT_SHOT : TC_ACT_OK;
}
-SEC("x")
+SEC("xdp")
int ing_xdp(struct xdp_md *ctx)
{
__u8 *data, *data_meta, *data_end;
diff --git a/tools/testing/selftests/bpf/progs/test_xdp_redirect.c b/tools/testing/selftests/bpf/progs/test_xdp_redirect.c
deleted file mode 100644
index b778cad45485..000000000000
--- a/tools/testing/selftests/bpf/progs/test_xdp_redirect.c
+++ /dev/null
@@ -1,26 +0,0 @@
-/* Copyright (c) 2017 VMware
- *
- * This program is free software; you can redistribute it and/or
- * modify it under the terms of version 2 of the GNU General Public
- * License as published by the Free Software Foundation.
- *
- * This program is distributed in the hope that it will be useful, but
- * WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- * General Public License for more details.
- */
-#include <linux/bpf.h>
-#include <bpf/bpf_helpers.h>
-
-SEC("redirect_to_111")
-int xdp_redirect_to_111(struct xdp_md *xdp)
-{
- return bpf_redirect(111, 0);
-}
-SEC("redirect_to_222")
-int xdp_redirect_to_222(struct xdp_md *xdp)
-{
- return bpf_redirect(222, 0);
-}
-
-char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/uninit_stack.c b/tools/testing/selftests/bpf/progs/uninit_stack.c
index 8a403470e557..046a204c8fc6 100644
--- a/tools/testing/selftests/bpf/progs/uninit_stack.c
+++ b/tools/testing/selftests/bpf/progs/uninit_stack.c
@@ -70,7 +70,8 @@ __naked int helper_uninit_to_misc(void *ctx)
r1 = r10; \
r1 += -128; \
r2 = 32; \
- call %[bpf_trace_printk]; \
+ r3 = 0; \
+ call %[bpf_probe_read_user]; \
/* Call to dummy() forces print_verifier_state(..., true), \
* thus showing the stack state, matched by __msg(). \
*/ \
@@ -79,7 +80,7 @@ __naked int helper_uninit_to_misc(void *ctx)
exit; \
"
:
- : __imm(bpf_trace_printk),
+ : __imm(bpf_probe_read_user),
__imm(dummy)
: __clobber_all);
}
diff --git a/tools/testing/selftests/bpf/progs/unsupported_ops.c b/tools/testing/selftests/bpf/progs/unsupported_ops.c
index 9180365a3568..8aa2e0dd624e 100644
--- a/tools/testing/selftests/bpf/progs/unsupported_ops.c
+++ b/tools/testing/selftests/bpf/progs/unsupported_ops.c
@@ -4,7 +4,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod.h"
+#include "../test_kmods/bpf_testmod.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_array_access.c b/tools/testing/selftests/bpf/progs/verifier_array_access.c
index 4195aa824ba5..29eb9568633f 100644
--- a/tools/testing/selftests/bpf/progs/verifier_array_access.c
+++ b/tools/testing/selftests/bpf/progs/verifier_array_access.c
@@ -29,6 +29,20 @@ struct {
} map_array_wo SEC(".maps");
struct {
+ __uint(type, BPF_MAP_TYPE_PERCPU_ARRAY);
+ __uint(max_entries, 2);
+ __type(key, __u32);
+ __type(value, struct test_val);
+} map_array_pcpu SEC(".maps");
+
+struct {
+ __uint(type, BPF_MAP_TYPE_ARRAY);
+ __uint(max_entries, 2);
+ __type(key, __u32);
+ __type(value, struct test_val);
+} map_array SEC(".maps");
+
+struct {
__uint(type, BPF_MAP_TYPE_HASH);
__uint(max_entries, 1);
__type(key, long long);
@@ -525,4 +539,178 @@ l0_%=: exit; \
: __clobber_all);
}
+SEC("socket")
+__description("valid map access into an array using constant without nullness")
+__success __retval(4) __log_level(2)
+__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}")
+unsigned int an_array_with_a_constant_no_nullness(void)
+{
+ /* Need 8-byte alignment for spill tracking */
+ __u32 __attribute__((aligned(8))) key = 1;
+ struct test_val *val;
+
+ val = bpf_map_lookup_elem(&map_array, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("valid multiple map access into an array using constant without nullness")
+__success __retval(8) __log_level(2)
+__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -16) = {{(0|r[0-9])}}")
+__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}")
+unsigned int multiple_array_with_a_constant_no_nullness(void)
+{
+ __u32 __attribute__((aligned(8))) key = 1;
+ __u32 __attribute__((aligned(8))) key2 = 0;
+ struct test_val *val, *val2;
+
+ val = bpf_map_lookup_elem(&map_array, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ val2 = bpf_map_lookup_elem(&map_array, &key2);
+ val2->index = offsetof(struct test_val, foo);
+
+ return val->index + val2->index;
+}
+
+SEC("socket")
+__description("valid map access into an array using natural aligned 32-bit constant 0 without nullness")
+__success __retval(4)
+unsigned int an_array_with_a_32bit_constant_0_no_nullness(void)
+{
+ /* Unlike the above tests, 32-bit zeroing is precisely tracked even
+ * if writes are not aligned to BPF_REG_SIZE. This tests that our
+ * STACK_ZERO handling functions.
+ */
+ struct test_val *val;
+ __u32 key = 0;
+
+ val = bpf_map_lookup_elem(&map_array, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("valid map access into a pcpu array using constant without nullness")
+__success __retval(4) __log_level(2)
+__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}")
+unsigned int a_pcpu_array_with_a_constant_no_nullness(void)
+{
+ __u32 __attribute__((aligned(8))) key = 1;
+ struct test_val *val;
+
+ val = bpf_map_lookup_elem(&map_array_pcpu, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("invalid map access into an array using constant without nullness")
+__failure __msg("R0 invalid mem access 'map_value_or_null'")
+unsigned int an_array_with_a_constant_no_nullness_out_of_bounds(void)
+{
+ /* Out of bounds */
+ __u32 __attribute__((aligned(8))) key = 3;
+ struct test_val *val;
+
+ val = bpf_map_lookup_elem(&map_array, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("invalid map access into an array using constant smaller than key_size")
+__failure __msg("R0 invalid mem access 'map_value_or_null'")
+unsigned int an_array_with_a_constant_too_small(void)
+{
+ __u32 __attribute__((aligned(8))) key;
+ struct test_val *val;
+
+ /* Mark entire key as STACK_MISC */
+ bpf_probe_read_user(&key, sizeof(key), NULL);
+
+ /* Spilling only the bottom byte results in a tnum const of 1.
+ * We want to check that the verifier rejects it, as the spill is < 4B.
+ */
+ *(__u8 *)&key = 1;
+ val = bpf_map_lookup_elem(&map_array, &key);
+
+ /* Should fail, as verifier cannot prove in-bound lookup */
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("invalid map access into an array using constant larger than key_size")
+__failure __msg("R0 invalid mem access 'map_value_or_null'")
+unsigned int an_array_with_a_constant_too_big(void)
+{
+ struct test_val *val;
+ __u64 key = 1;
+
+ /* Even if the constant value is < max_entries, if the spill size is
+ * larger than the key size, the set bits may not be where we expect them
+ * to be on different endian architectures.
+ */
+ val = bpf_map_lookup_elem(&map_array, &key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
+SEC("socket")
+__description("invalid elided lookup using const and non-const key")
+__failure __msg("R0 invalid mem access 'map_value_or_null'")
+unsigned int mixed_const_and_non_const_key_lookup(void)
+{
+ __u32 __attribute__((aligned(8))) key;
+ struct test_val *val;
+ __u32 rand;
+
+ rand = bpf_get_prandom_u32();
+ key = rand > 42 ? 1 : rand;
+ val = bpf_map_lookup_elem(&map_array, &key);
+
+ return val->index;
+}
+
+SEC("socket")
+__failure __msg("invalid read from stack R2 off=4096 size=4")
+__naked void key_lookup_at_invalid_fp(void)
+{
+ asm volatile (" \
+ r1 = %[map_array] ll; \
+ r2 = r10; \
+ r2 += 4096; \
+ call %[bpf_map_lookup_elem]; \
+ r0 = *(u64*)(r0 + 0); \
+ exit; \
+" :
+ : __imm(bpf_map_lookup_elem),
+ __imm_addr(map_array)
+ : __clobber_all);
+}
+
+volatile __u32 __attribute__((aligned(8))) global_key;
+
+SEC("socket")
+__description("invalid elided lookup using non-stack key")
+__failure __msg("R0 invalid mem access 'map_value_or_null'")
+unsigned int non_stack_key_lookup(void)
+{
+ struct test_val *val;
+
+ global_key = 1;
+ val = bpf_map_lookup_elem(&map_array, (void *)&global_key);
+ val->index = offsetof(struct test_val, foo);
+
+ return val->index;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_basic_stack.c b/tools/testing/selftests/bpf/progs/verifier_basic_stack.c
index 8d77cc5323d3..fb62e09f2114 100644
--- a/tools/testing/selftests/bpf/progs/verifier_basic_stack.c
+++ b/tools/testing/selftests/bpf/progs/verifier_basic_stack.c
@@ -28,7 +28,7 @@ __naked void stack_out_of_bounds(void)
SEC("socket")
__description("uninitialized stack1")
__success __log_level(4) __msg("stack depth 8")
-__failure_unpriv __msg_unpriv("invalid indirect read from stack")
+__failure_unpriv __msg_unpriv("invalid read from stack")
__naked void uninitialized_stack1(void)
{
asm volatile (" \
diff --git a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
index 7c881bca9af5..8bcddadfc4da 100644
--- a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
+++ b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
@@ -32,18 +32,18 @@ int BPF_PROG(no_destroy, struct bpf_iter_meta *meta, struct cgroup *cgrp)
SEC("iter/cgroup")
__description("uninitialized iter in ->next()")
-__failure __msg("expected an initialized iter_bits as arg #1")
+__failure __msg("expected an initialized iter_bits as arg #0")
int BPF_PROG(next_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
{
- struct bpf_iter_bits *it = NULL;
+ struct bpf_iter_bits it = {};
- bpf_iter_bits_next(it);
+ bpf_iter_bits_next(&it);
return 0;
}
SEC("iter/cgroup")
__description("uninitialized iter in ->destroy()")
-__failure __msg("expected an initialized iter_bits as arg #1")
+__failure __msg("expected an initialized iter_bits as arg #0")
int BPF_PROG(destroy_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
{
struct bpf_iter_bits it = {};
diff --git a/tools/testing/selftests/bpf/progs/verifier_bounds.c b/tools/testing/selftests/bpf/progs/verifier_bounds.c
index a0bb7fb40ea5..0eb33bb801b5 100644
--- a/tools/testing/selftests/bpf/progs/verifier_bounds.c
+++ b/tools/testing/selftests/bpf/progs/verifier_bounds.c
@@ -1200,4 +1200,138 @@ l0_%=: r0 = 0; \
: __clobber_all);
}
+SEC("tc")
+__description("multiply mixed sign bounds. test 1")
+__success __log_level(2)
+__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=umin=0x1bc16d5cd4927ee1,smax=umax=0x1bc16d674ec80000,smax32=0x7ffffeff,umax32=0xfffffeff,var_off=(0x1bc16d4000000000; 0x3ffffffeff))")
+__naked void mult_mixed0_sign(void)
+{
+ asm volatile (
+ "call %[bpf_get_prandom_u32];"
+ "r6 = r0;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= 0xf;"
+ "r6 -= 1000000000;"
+ "r7 &= 0xf;"
+ "r7 -= 2000000000;"
+ "r6 *= r7;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
+
+SEC("tc")
+__description("multiply mixed sign bounds. test 2")
+__success __log_level(2)
+__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=smin32=-100,smax=smax32=200)")
+__naked void mult_mixed1_sign(void)
+{
+ asm volatile (
+ "call %[bpf_get_prandom_u32];"
+ "r6 = r0;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= 0xf;"
+ "r6 -= 0xa;"
+ "r7 &= 0xf;"
+ "r7 -= 0x14;"
+ "r6 *= r7;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
+
+SEC("tc")
+__description("multiply negative bounds")
+__success __log_level(2)
+__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=umin=smin32=umin32=0x3ff280b0,smax=umax=smax32=umax32=0x3fff0001,var_off=(0x3ff00000; 0xf81ff))")
+__naked void mult_sign_bounds(void)
+{
+ asm volatile (
+ "r8 = 0x7fff;"
+ "call %[bpf_get_prandom_u32];"
+ "r6 = r0;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= 0xa;"
+ "r6 -= r8;"
+ "r7 &= 0xf;"
+ "r7 -= r8;"
+ "r6 *= r7;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
+
+SEC("tc")
+__description("multiply bounds that don't cross signed boundary")
+__success __log_level(2)
+__msg("r8 *= r6 {{.*}}; R6_w=scalar(smin=smin32=0,smax=umax=smax32=umax32=11,var_off=(0x0; 0xb)) R8_w=scalar(smin=0,smax=umax=0x7b96bb0a94a3a7cd,var_off=(0x0; 0x7fffffffffffffff))")
+__naked void mult_no_sign_crossing(void)
+{
+ asm volatile (
+ "r6 = 0xb;"
+ "r8 = 0xb3c3f8c99262687 ll;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= r7;"
+ "r8 *= r6;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
+
+SEC("tc")
+__description("multiplication overflow, result in unbounded reg. test 1")
+__success __log_level(2)
+__msg("r6 *= r7 {{.*}}; R6_w=scalar()")
+__naked void mult_unsign_ovf(void)
+{
+ asm volatile (
+ "r8 = 0x7ffffffffff ll;"
+ "call %[bpf_get_prandom_u32];"
+ "r6 = r0;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= 0x7fffffff;"
+ "r7 &= r8;"
+ "r6 *= r7;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
+
+SEC("tc")
+__description("multiplication overflow, result in unbounded reg. test 2")
+__success __log_level(2)
+__msg("r6 *= r7 {{.*}}; R6_w=scalar()")
+__naked void mult_sign_ovf(void)
+{
+ asm volatile (
+ "r8 = 0x7ffffffff ll;"
+ "call %[bpf_get_prandom_u32];"
+ "r6 = r0;"
+ "call %[bpf_get_prandom_u32];"
+ "r7 = r0;"
+ "r6 &= 0xa;"
+ "r6 -= r8;"
+ "r7 &= 0x7fffffff;"
+ "r6 *= r7;"
+ "exit"
+ :
+ : __imm(bpf_get_prandom_u32),
+ __imm(bpf_skb_store_bytes)
+ : __clobber_all);
+}
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
index a570e48b917a..28b939572cda 100644
--- a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
+++ b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
@@ -11,7 +11,7 @@ __success __retval(0)
__naked void btf_ctx_access_accept(void)
{
asm volatile (" \
- r2 = *(u32*)(r1 + 8); /* load 2nd argument value (int pointer) */\
+ r2 = *(u64 *)(r1 + 8); /* load 2nd argument value (int pointer) */\
r0 = 0; \
exit; \
" ::: __clobber_all);
@@ -23,7 +23,43 @@ __success __retval(0)
__naked void ctx_access_u32_pointer_accept(void)
{
asm volatile (" \
- r2 = *(u32*)(r1 + 0); /* load 1nd argument value (u32 pointer) */\
+ r2 = *(u64 *)(r1 + 0); /* load 1nd argument value (u32 pointer) */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u32")
+__failure __msg("size 4 must be 8")
+__naked void ctx_access_u32_pointer_reject_32(void)
+{
+ asm volatile (" \
+ r2 = *(u32 *)(r1 + 0); /* load 1st argument with narrow load */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u16")
+__failure __msg("size 2 must be 8")
+__naked void ctx_access_u32_pointer_reject_16(void)
+{
+ asm volatile (" \
+ r2 = *(u16 *)(r1 + 0); /* load 1st argument with narrow load */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u8")
+__failure __msg("size 1 must be 8")
+__naked void ctx_access_u32_pointer_reject_8(void)
+{
+ asm volatile (" \
+ r2 = *(u8 *)(r1 + 0); /* load 1st argument with narrow load */\
r0 = 0; \
exit; \
" ::: __clobber_all);
diff --git a/tools/testing/selftests/bpf/progs/verifier_const_or.c b/tools/testing/selftests/bpf/progs/verifier_const_or.c
index ba8922b2eebd..68c568c3c3a0 100644
--- a/tools/testing/selftests/bpf/progs/verifier_const_or.c
+++ b/tools/testing/selftests/bpf/progs/verifier_const_or.c
@@ -25,7 +25,7 @@ __naked void constant_should_keep_constant_type(void)
SEC("tracepoint")
__description("constant register |= constant should not bypass stack boundary checks")
-__failure __msg("invalid indirect access to stack R1 off=-48 size=58")
+__failure __msg("invalid write to stack R1 off=-48 size=58")
__naked void not_bypass_stack_boundary_checks_1(void)
{
asm volatile (" \
@@ -62,7 +62,7 @@ __naked void register_should_keep_constant_type(void)
SEC("tracepoint")
__description("constant register |= constant register should not bypass stack boundary checks")
-__failure __msg("invalid indirect access to stack R1 off=-48 size=58")
+__failure __msg("invalid write to stack R1 off=-48 size=58")
__naked void not_bypass_stack_boundary_checks_2(void)
{
asm volatile (" \
diff --git a/tools/testing/selftests/bpf/progs/verifier_d_path.c b/tools/testing/selftests/bpf/progs/verifier_d_path.c
index ec79cbcfde91..87e51a215558 100644
--- a/tools/testing/selftests/bpf/progs/verifier_d_path.c
+++ b/tools/testing/selftests/bpf/progs/verifier_d_path.c
@@ -11,7 +11,7 @@ __success __retval(0)
__naked void d_path_accept(void)
{
asm volatile (" \
- r1 = *(u32*)(r1 + 0); \
+ r1 = *(u64 *)(r1 + 0); \
r2 = r10; \
r2 += -8; \
r6 = 0; \
@@ -31,7 +31,7 @@ __failure __msg("helper call is not allowed in probe")
__naked void d_path_reject(void)
{
asm volatile (" \
- r1 = *(u32*)(r1 + 0); \
+ r1 = *(u64 *)(r1 + 0); \
r2 = r10; \
r2 += -8; \
r6 = 0; \
diff --git a/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c b/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c
index 50c6b22606f6..f2c54e4d89eb 100644
--- a/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c
+++ b/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c
@@ -67,7 +67,7 @@ SEC("socket")
__description("helper access to variable memory: stack, bitwise AND, zero included")
/* in privileged mode reads from uninitialized stack locations are permitted */
__success __failure_unpriv
-__msg_unpriv("invalid indirect read from stack R2 off -64+0 size 64")
+__msg_unpriv("invalid read from stack R2 off -64+0 size 64")
__retval(0)
__naked void stack_bitwise_and_zero_included(void)
{
@@ -100,7 +100,7 @@ __naked void stack_bitwise_and_zero_included(void)
SEC("tracepoint")
__description("helper access to variable memory: stack, bitwise AND + JMP, wrong max")
-__failure __msg("invalid indirect access to stack R1 off=-64 size=65")
+__failure __msg("invalid write to stack R1 off=-64 size=65")
__naked void bitwise_and_jmp_wrong_max(void)
{
asm volatile (" \
@@ -187,7 +187,7 @@ l0_%=: r0 = 0; \
SEC("tracepoint")
__description("helper access to variable memory: stack, JMP, bounds + offset")
-__failure __msg("invalid indirect access to stack R1 off=-64 size=65")
+__failure __msg("invalid write to stack R1 off=-64 size=65")
__naked void memory_stack_jmp_bounds_offset(void)
{
asm volatile (" \
@@ -211,7 +211,7 @@ l0_%=: r0 = 0; \
SEC("tracepoint")
__description("helper access to variable memory: stack, JMP, wrong max")
-__failure __msg("invalid indirect access to stack R1 off=-64 size=65")
+__failure __msg("invalid write to stack R1 off=-64 size=65")
__naked void memory_stack_jmp_wrong_max(void)
{
asm volatile (" \
@@ -260,7 +260,7 @@ SEC("socket")
__description("helper access to variable memory: stack, JMP, no min check")
/* in privileged mode reads from uninitialized stack locations are permitted */
__success __failure_unpriv
-__msg_unpriv("invalid indirect read from stack R2 off -64+0 size 64")
+__msg_unpriv("invalid read from stack R2 off -64+0 size 64")
__retval(0)
__naked void stack_jmp_no_min_check(void)
{
@@ -750,7 +750,7 @@ SEC("socket")
__description("helper access to variable memory: 8 bytes leak")
/* in privileged mode reads from uninitialized stack locations are permitted */
__success __failure_unpriv
-__msg_unpriv("invalid indirect read from stack R2 off -64+32 size 64")
+__msg_unpriv("invalid read from stack R2 off -64+32 size 64")
__retval(0)
__naked void variable_memory_8_bytes_leak(void)
{
diff --git a/tools/testing/selftests/bpf/progs/verifier_int_ptr.c b/tools/testing/selftests/bpf/progs/verifier_int_ptr.c
index 5f2efb895edb..59e34d558654 100644
--- a/tools/testing/selftests/bpf/progs/verifier_int_ptr.c
+++ b/tools/testing/selftests/bpf/progs/verifier_int_ptr.c
@@ -96,7 +96,7 @@ __naked void arg_ptr_to_long_misaligned(void)
SEC("cgroup/sysctl")
__description("arg pointer to long size < sizeof(long)")
-__failure __msg("invalid indirect access to stack R4 off=-4 size=8")
+__failure __msg("invalid write to stack R4 off=-4 size=8")
__naked void to_long_size_sizeof_long(void)
{
asm volatile (" \
diff --git a/tools/testing/selftests/bpf/progs/verifier_map_in_map.c b/tools/testing/selftests/bpf/progs/verifier_map_in_map.c
index 4eaab1468eb7..7d088ba99ea5 100644
--- a/tools/testing/selftests/bpf/progs/verifier_map_in_map.c
+++ b/tools/testing/selftests/bpf/progs/verifier_map_in_map.c
@@ -47,7 +47,7 @@ l0_%=: r0 = 0; \
SEC("xdp")
__description("map in map state pruning")
-__success __msg("processed 26 insns")
+__success __msg("processed 15 insns")
__log_level(2) __retval(0) __flag(BPF_F_TEST_STATE_FREQ)
__naked void map_in_map_state_pruning(void)
{
diff --git a/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c b/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c
new file mode 100644
index 000000000000..e81097c96fe2
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c
@@ -0,0 +1,97 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2025 Meta Platforms, Inc. and affiliates. */
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include "../../../include/linux/filter.h"
+#include "bpf_misc.h"
+
+SEC("raw_tp")
+__description("may_goto 0")
+__arch_x86_64
+__xlated("0: r0 = 1")
+__xlated("1: exit")
+__success
+__naked void may_goto_simple(void)
+{
+ asm volatile (
+ ".8byte %[may_goto];"
+ "r0 = 1;"
+ ".8byte %[may_goto];"
+ "exit;"
+ :
+ : __imm_insn(may_goto, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0))
+ : __clobber_all);
+}
+
+SEC("raw_tp")
+__description("batch 2 of may_goto 0")
+__arch_x86_64
+__xlated("0: r0 = 1")
+__xlated("1: exit")
+__success
+__naked void may_goto_batch_0(void)
+{
+ asm volatile (
+ ".8byte %[may_goto1];"
+ ".8byte %[may_goto1];"
+ "r0 = 1;"
+ ".8byte %[may_goto1];"
+ ".8byte %[may_goto1];"
+ "exit;"
+ :
+ : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0))
+ : __clobber_all);
+}
+
+SEC("raw_tp")
+__description("may_goto batch with offsets 2/1/0")
+__arch_x86_64
+__xlated("0: r0 = 1")
+__xlated("1: exit")
+__success
+__naked void may_goto_batch_1(void)
+{
+ asm volatile (
+ ".8byte %[may_goto1];"
+ ".8byte %[may_goto2];"
+ ".8byte %[may_goto3];"
+ "r0 = 1;"
+ ".8byte %[may_goto1];"
+ ".8byte %[may_goto2];"
+ ".8byte %[may_goto3];"
+ "exit;"
+ :
+ : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 2 /* offset */, 0)),
+ __imm_insn(may_goto2, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 1 /* offset */, 0)),
+ __imm_insn(may_goto3, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0))
+ : __clobber_all);
+}
+
+SEC("raw_tp")
+__description("may_goto batch with offsets 2/0")
+__arch_x86_64
+__xlated("0: *(u64 *)(r10 -8) = 8388608")
+__xlated("1: r11 = *(u64 *)(r10 -8)")
+__xlated("2: if r11 == 0x0 goto pc+3")
+__xlated("3: r11 -= 1")
+__xlated("4: *(u64 *)(r10 -8) = r11")
+__xlated("5: r0 = 1")
+__xlated("6: r0 = 2")
+__xlated("7: exit")
+__success
+__naked void may_goto_batch_2(void)
+{
+ asm volatile (
+ ".8byte %[may_goto1];"
+ ".8byte %[may_goto3];"
+ "r0 = 1;"
+ "r0 = 2;"
+ "exit;"
+ :
+ : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 2 /* offset */, 0)),
+ __imm_insn(may_goto3, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0))
+ : __clobber_all);
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c b/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c
new file mode 100644
index 000000000000..b891faf50660
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c
@@ -0,0 +1,28 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2025 Meta Platforms, Inc. and affiliates. */
+
+#include "bpf_misc.h"
+#include "bpf_experimental.h"
+
+int gvar;
+
+SEC("raw_tp")
+__description("C code with may_goto 0")
+__success
+int may_goto_c_code(void)
+{
+ int i, tmp[3];
+
+ for (i = 0; i < 3 && can_loop; i++)
+ tmp[i] = 0;
+
+ for (i = 0; i < 3 && can_loop; i++)
+ tmp[i] = gvar - i;
+
+ for (i = 0; i < 3 && can_loop; i++)
+ gvar += tmp[i];
+
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_mtu.c b/tools/testing/selftests/bpf/progs/verifier_mtu.c
index 70c7600a26a0..256956ea1ac5 100644
--- a/tools/testing/selftests/bpf/progs/verifier_mtu.c
+++ b/tools/testing/selftests/bpf/progs/verifier_mtu.c
@@ -6,7 +6,9 @@
SEC("tc/ingress")
__description("uninit/mtu: write rejected")
-__failure __msg("invalid indirect read from stack")
+__success
+__caps_unpriv(CAP_BPF|CAP_NET_ADMIN)
+__failure_unpriv __msg_unpriv("invalid read from stack")
int tc_uninit_mtu(struct __sk_buff *ctx)
{
__u32 mtu;
diff --git a/tools/testing/selftests/bpf/progs/verifier_raw_stack.c b/tools/testing/selftests/bpf/progs/verifier_raw_stack.c
index 7cc83acac727..c689665e07b9 100644
--- a/tools/testing/selftests/bpf/progs/verifier_raw_stack.c
+++ b/tools/testing/selftests/bpf/progs/verifier_raw_stack.c
@@ -236,7 +236,7 @@ __naked void load_bytes_spilled_regs_data(void)
SEC("tc")
__description("raw_stack: skb_load_bytes, invalid access 1")
-__failure __msg("invalid indirect access to stack R3 off=-513 size=8")
+__failure __msg("invalid write to stack R3 off=-513 size=8")
__naked void load_bytes_invalid_access_1(void)
{
asm volatile (" \
@@ -255,7 +255,7 @@ __naked void load_bytes_invalid_access_1(void)
SEC("tc")
__description("raw_stack: skb_load_bytes, invalid access 2")
-__failure __msg("invalid indirect access to stack R3 off=-1 size=8")
+__failure __msg("invalid write to stack R3 off=-1 size=8")
__naked void load_bytes_invalid_access_2(void)
{
asm volatile (" \
diff --git a/tools/testing/selftests/bpf/progs/verifier_sock.c b/tools/testing/selftests/bpf/progs/verifier_sock.c
index d3e70e38e442..0d5e56dffabb 100644
--- a/tools/testing/selftests/bpf/progs/verifier_sock.c
+++ b/tools/testing/selftests/bpf/progs/verifier_sock.c
@@ -50,6 +50,13 @@ struct {
__uint(map_flags, BPF_F_NO_PREALLOC);
} sk_storage_map SEC(".maps");
+struct {
+ __uint(type, BPF_MAP_TYPE_PROG_ARRAY);
+ __uint(max_entries, 1);
+ __uint(key_size, sizeof(__u32));
+ __uint(value_size, sizeof(__u32));
+} jmp_table SEC(".maps");
+
SEC("cgroup/skb")
__description("skb->sk: no NULL check")
__failure __msg("invalid mem access 'sock_common_or_null'")
@@ -1037,4 +1044,53 @@ __naked void sock_create_read_src_port(void)
: __clobber_all);
}
+__noinline
+long skb_pull_data2(struct __sk_buff *sk, __u32 len)
+{
+ return bpf_skb_pull_data(sk, len);
+}
+
+__noinline
+long skb_pull_data1(struct __sk_buff *sk, __u32 len)
+{
+ return skb_pull_data2(sk, len);
+}
+
+/* global function calls bpf_skb_pull_data(), which invalidates packet
+ * pointers established before global function call.
+ */
+SEC("tc")
+__failure __msg("invalid mem access")
+int invalidate_pkt_pointers_from_global_func(struct __sk_buff *sk)
+{
+ int *p = (void *)(long)sk->data;
+
+ if ((void *)(p + 1) > (void *)(long)sk->data_end)
+ return TCX_DROP;
+ skb_pull_data1(sk, 0);
+ *p = 42; /* this is unsafe */
+ return TCX_PASS;
+}
+
+__noinline
+int tail_call(struct __sk_buff *sk)
+{
+ bpf_tail_call_static(sk, &jmp_table, 0);
+ return 0;
+}
+
+/* Tail calls invalidate packet pointers. */
+SEC("tc")
+__failure __msg("invalid mem access")
+int invalidate_pkt_pointers_by_tail_call(struct __sk_buff *sk)
+{
+ int *p = (void *)(long)sk->data;
+
+ if ((void *)(p + 1) > (void *)(long)sk->data_end)
+ return TCX_DROP;
+ tail_call(sk);
+ *p = 42; /* this is unsafe */
+ return TCX_PASS;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
index 671d9f415dbf..1e5a511e8494 100644
--- a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
+++ b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
@@ -1244,4 +1244,39 @@ __naked void old_stack_misc_vs_cur_ctx_ptr(void)
: __clobber_all);
}
+SEC("socket")
+__description("stack_noperfmon: reject read of invalid slots")
+__success
+__caps_unpriv(CAP_BPF)
+__failure_unpriv __msg_unpriv("invalid read from stack off -8+1 size 8")
+__naked void stack_noperfmon_reject_invalid_read(void)
+{
+ asm volatile (" \
+ r2 = 1; \
+ r6 = r10; \
+ r6 += -8; \
+ *(u8 *)(r6 + 0) = r2; \
+ r2 = *(u64 *)(r6 + 0); \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("socket")
+__description("stack_noperfmon: narrow spill onto 64-bit scalar spilled slots")
+__success
+__caps_unpriv(CAP_BPF)
+__success_unpriv
+__naked void stack_noperfmon_spill_32bit_onto_64bit_slot(void)
+{
+ asm volatile(" \
+ r0 = 0; \
+ *(u64 *)(r10 - 8) = r0; \
+ *(u32 *)(r10 - 8) = r0; \
+ exit; \
+" :
+ :
+ : __clobber_all);
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_spin_lock.c b/tools/testing/selftests/bpf/progs/verifier_spin_lock.c
index 3f679de73229..d9d7b05cf6d2 100644
--- a/tools/testing/selftests/bpf/progs/verifier_spin_lock.c
+++ b/tools/testing/selftests/bpf/progs/verifier_spin_lock.c
@@ -187,7 +187,7 @@ l0_%=: r6 = r0; \
SEC("cgroup/skb")
__description("spin_lock: test6 missing unlock")
-__failure __msg("BPF_EXIT instruction cannot be used inside bpf_spin_lock-ed region")
+__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_spin_lock-ed region")
__failure_unpriv __msg_unpriv("")
__naked void spin_lock_test6_missing_unlock(void)
{
@@ -530,4 +530,30 @@ l1_%=: exit; \
: __clobber_all);
}
+SEC("tc")
+__description("spin_lock: loop within a locked region")
+__success __failure_unpriv __msg_unpriv("")
+__retval(0)
+int bpf_loop_inside_locked_region(void)
+{
+ const int zero = 0;
+ struct val *val;
+ int i, j = 0;
+
+ val = bpf_map_lookup_elem(&map_spin_lock, &zero);
+ if (!val)
+ return -1;
+
+ bpf_spin_lock(&val->l);
+ bpf_for(i, 0, 10) {
+ j++;
+ /* Silence "unused variable" warnings. */
+ if (j == 10)
+ break;
+ }
+ bpf_spin_unlock(&val->l);
+
+ return 0;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_unpriv.c b/tools/testing/selftests/bpf/progs/verifier_unpriv.c
index 7ea535bfbacd..a4a5e2071604 100644
--- a/tools/testing/selftests/bpf/progs/verifier_unpriv.c
+++ b/tools/testing/selftests/bpf/progs/verifier_unpriv.c
@@ -199,7 +199,7 @@ __naked void pass_pointer_to_helper_function(void)
SEC("socket")
__description("unpriv: indirectly pass pointer on stack to helper function")
__success __failure_unpriv
-__msg_unpriv("invalid indirect read from stack R2 off -8+0 size 8")
+__msg_unpriv("invalid read from stack R2 off -8+0 size 8")
__retval(0)
__naked void on_stack_to_helper_function(void)
{
diff --git a/tools/testing/selftests/bpf/progs/verifier_var_off.c b/tools/testing/selftests/bpf/progs/verifier_var_off.c
index c810f4f6f479..1d36d01b746e 100644
--- a/tools/testing/selftests/bpf/progs/verifier_var_off.c
+++ b/tools/testing/selftests/bpf/progs/verifier_var_off.c
@@ -203,7 +203,7 @@ __naked void stack_write_clobbers_spilled_regs(void)
SEC("sockops")
__description("indirect variable-offset stack access, unbounded")
-__failure __msg("invalid unbounded variable-offset indirect access to stack R4")
+__failure __msg("invalid unbounded variable-offset write to stack R4")
__naked void variable_offset_stack_access_unbounded(void)
{
asm volatile (" \
@@ -236,7 +236,7 @@ l0_%=: r0 = 0; \
SEC("lwt_in")
__description("indirect variable-offset stack access, max out of bound")
-__failure __msg("invalid variable-offset indirect access to stack R2")
+__failure __msg("invalid variable-offset read from stack R2")
__naked void access_max_out_of_bound(void)
{
asm volatile (" \
@@ -269,7 +269,7 @@ __naked void access_max_out_of_bound(void)
*/
SEC("socket")
__description("indirect variable-offset stack access, zero-sized, max out of bound")
-__failure __msg("invalid variable-offset indirect access to stack R1")
+__failure __msg("invalid variable-offset write to stack R1")
__naked void zero_sized_access_max_out_of_bound(void)
{
asm volatile (" \
@@ -294,7 +294,7 @@ __naked void zero_sized_access_max_out_of_bound(void)
SEC("lwt_in")
__description("indirect variable-offset stack access, min out of bound")
-__failure __msg("invalid variable-offset indirect access to stack R2")
+__failure __msg("invalid variable-offset read from stack R2")
__naked void access_min_out_of_bound(void)
{
asm volatile (" \
diff --git a/tools/testing/selftests/bpf/progs/wq.c b/tools/testing/selftests/bpf/progs/wq.c
index f8d3ae0c29ae..2f1ba08c293e 100644
--- a/tools/testing/selftests/bpf/progs/wq.c
+++ b/tools/testing/selftests/bpf/progs/wq.c
@@ -5,7 +5,7 @@
#include "bpf_experimental.h"
#include <bpf/bpf_helpers.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/wq_failures.c b/tools/testing/selftests/bpf/progs/wq_failures.c
index 25b51a72fe0f..4240211a1900 100644
--- a/tools/testing/selftests/bpf/progs/wq_failures.c
+++ b/tools/testing/selftests/bpf/progs/wq_failures.c
@@ -5,7 +5,7 @@
#include "bpf_experimental.h"
#include <bpf/bpf_helpers.h>
#include "bpf_misc.h"
-#include "../bpf_testmod/bpf_testmod_kfunc.h"
+#include "../test_kmods/bpf_testmod_kfunc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/sdt.h b/tools/testing/selftests/bpf/sdt.h
index ca0162b4dc57..1fcfa5160231 100644
--- a/tools/testing/selftests/bpf/sdt.h
+++ b/tools/testing/selftests/bpf/sdt.h
@@ -102,6 +102,8 @@
# define STAP_SDT_ARG_CONSTRAINT nZr
# elif defined __arm__
# define STAP_SDT_ARG_CONSTRAINT g
+# elif defined __loongarch__
+# define STAP_SDT_ARG_CONSTRAINT nmr
# else
# define STAP_SDT_ARG_CONSTRAINT nor
# endif
diff --git a/tools/testing/selftests/bpf/test_bpftool_synctypes.py b/tools/testing/selftests/bpf/test_bpftool_synctypes.py
index 0ed67b6b31dd..238121fda5b6 100755
--- a/tools/testing/selftests/bpf/test_bpftool_synctypes.py
+++ b/tools/testing/selftests/bpf/test_bpftool_synctypes.py
@@ -66,7 +66,7 @@ class ArrayParser(BlockParser):
def __init__(self, reader, array_name):
self.array_name = array_name
- self.start_marker = re.compile(f'(static )?const bool {self.array_name}\[.*\] = {{\n')
+ self.start_marker = re.compile(fr'(static )?const bool {self.array_name}\[.*\] = {{\n')
super().__init__(reader)
def search_block(self):
@@ -80,7 +80,7 @@ class ArrayParser(BlockParser):
Parse a block and return data as a dictionary. Items to extract must be
on separate lines in the file.
"""
- pattern = re.compile('\[(BPF_\w*)\]\s*= (true|false),?$')
+ pattern = re.compile(r'\[(BPF_\w*)\]\s*= (true|false),?$')
entries = set()
while True:
line = self.reader.readline()
@@ -178,7 +178,7 @@ class FileExtractor(object):
@enum_name: name of the enum to parse
"""
start_marker = re.compile(f'enum {enum_name} {{\n')
- pattern = re.compile('^\s*(BPF_\w+),?(\s+/\*.*\*/)?$')
+ pattern = re.compile(r'^\s*(BPF_\w+),?(\s+/\*.*\*/)?$')
end_marker = re.compile('^};')
parser = BlockParser(self.reader)
parser.search_block(start_marker)
@@ -226,8 +226,8 @@ class FileExtractor(object):
@block_name: name of the blog to parse, 'TYPE' in the example
"""
- start_marker = re.compile(f'\*{block_name}\* := {{')
- pattern = re.compile('\*\*([\w/-]+)\*\*')
+ start_marker = re.compile(fr'\*{block_name}\* := {{')
+ pattern = re.compile(r'\*\*([\w/-]+)\*\*')
end_marker = re.compile('}\n')
return self.__get_description_list(start_marker, pattern, end_marker)
@@ -245,8 +245,8 @@ class FileExtractor(object):
@block_name: name of the blog to parse, 'TYPE' in the example
"""
- start_marker = re.compile(f'"\s*{block_name} := {{')
- pattern = re.compile('([\w/]+) [|}]')
+ start_marker = re.compile(fr'"\s*{block_name} := {{')
+ pattern = re.compile(r'([\w/]+) [|}]')
end_marker = re.compile('}')
return self.__get_description_list(start_marker, pattern, end_marker)
@@ -264,8 +264,8 @@ class FileExtractor(object):
@macro: macro starting the block, 'HELP_SPEC_OPTIONS' in the example
"""
- start_marker = re.compile(f'"\s*{macro}\s*" [|}}]')
- pattern = re.compile('([\w-]+) ?(?:\||}[ }\]])')
+ start_marker = re.compile(fr'"\s*{macro}\s*" [|}}]')
+ pattern = re.compile(r'([\w-]+) ?(?:\||}[ }\]])')
end_marker = re.compile('}\\\\n')
return self.__get_description_list(start_marker, pattern, end_marker)
@@ -283,8 +283,8 @@ class FileExtractor(object):
@block_name: name of the blog to parse, 'TYPE' in the example
"""
- start_marker = re.compile(f'local {block_name}=\'')
- pattern = re.compile('(?:.*=\')?([\w/]+)')
+ start_marker = re.compile(fr'local {block_name}=\'')
+ pattern = re.compile(r'(?:.*=\')?([\w/]+)')
end_marker = re.compile('\'$')
return self.__get_description_list(start_marker, pattern, end_marker)
@@ -316,7 +316,7 @@ class MainHeaderFileExtractor(SourceFileExtractor):
{'-p', '-d', '--pretty', '--debug', '--json', '-j'}
"""
start_marker = re.compile(f'"OPTIONS :=')
- pattern = re.compile('([\w-]+) ?(?:\||}[ }\]"])')
+ pattern = re.compile(r'([\w-]+) ?(?:\||}[ }\]"])')
end_marker = re.compile('#define')
parser = InlineListParser(self.reader)
@@ -338,8 +338,8 @@ class ManSubstitutionsExtractor(SourceFileExtractor):
{'-p', '-d', '--pretty', '--debug', '--json', '-j'}
"""
- start_marker = re.compile('\|COMMON_OPTIONS\| replace:: {')
- pattern = re.compile('\*\*([\w/-]+)\*\*')
+ start_marker = re.compile(r'\|COMMON_OPTIONS\| replace:: {')
+ pattern = re.compile(r'\*\*([\w/-]+)\*\*')
end_marker = re.compile('}$')
parser = InlineListParser(self.reader)
diff --git a/tools/testing/selftests/bpf/test_flow_dissector.c b/tools/testing/selftests/bpf/test_flow_dissector.c
deleted file mode 100644
index 571cc076dd7d..000000000000
--- a/tools/testing/selftests/bpf/test_flow_dissector.c
+++ /dev/null
@@ -1,780 +0,0 @@
-// SPDX-License-Identifier: GPL-2.0
-/*
- * Inject packets with all sorts of encapsulation into the kernel.
- *
- * IPv4/IPv6 outer layer 3
- * GRE/GUE/BARE outer layer 4, where bare is IPIP/SIT/IPv4-in-IPv6/..
- * IPv4/IPv6 inner layer 3
- */
-
-#define _GNU_SOURCE
-
-#include <stddef.h>
-#include <arpa/inet.h>
-#include <asm/byteorder.h>
-#include <error.h>
-#include <errno.h>
-#include <linux/if_packet.h>
-#include <linux/if_ether.h>
-#include <linux/ipv6.h>
-#include <netinet/ip.h>
-#include <netinet/in.h>
-#include <netinet/udp.h>
-#include <poll.h>
-#include <stdbool.h>
-#include <stdlib.h>
-#include <stdio.h>
-#include <string.h>
-#include <sys/ioctl.h>
-#include <sys/socket.h>
-#include <sys/stat.h>
-#include <sys/time.h>
-#include <sys/types.h>
-#include <unistd.h>
-
-#define CFG_PORT_INNER 8000
-
-/* Add some protocol definitions that do not exist in userspace */
-
-struct grehdr {
- uint16_t unused;
- uint16_t protocol;
-} __attribute__((packed));
-
-struct guehdr {
- union {
- struct {
-#if defined(__LITTLE_ENDIAN_BITFIELD)
- __u8 hlen:5,
- control:1,
- version:2;
-#elif defined (__BIG_ENDIAN_BITFIELD)
- __u8 version:2,
- control:1,
- hlen:5;
-#else
-#error "Please fix <asm/byteorder.h>"
-#endif
- __u8 proto_ctype;
- __be16 flags;
- };
- __be32 word;
- };
-};
-
-static uint8_t cfg_dsfield_inner;
-static uint8_t cfg_dsfield_outer;
-static uint8_t cfg_encap_proto;
-static bool cfg_expect_failure = false;
-static int cfg_l3_extra = AF_UNSPEC; /* optional SIT prefix */
-static int cfg_l3_inner = AF_UNSPEC;
-static int cfg_l3_outer = AF_UNSPEC;
-static int cfg_num_pkt = 10;
-static int cfg_num_secs = 0;
-static char cfg_payload_char = 'a';
-static int cfg_payload_len = 100;
-static int cfg_port_gue = 6080;
-static bool cfg_only_rx;
-static bool cfg_only_tx;
-static int cfg_src_port = 9;
-
-static char buf[ETH_DATA_LEN];
-
-#define INIT_ADDR4(name, addr4, port) \
- static struct sockaddr_in name = { \
- .sin_family = AF_INET, \
- .sin_port = __constant_htons(port), \
- .sin_addr.s_addr = __constant_htonl(addr4), \
- };
-
-#define INIT_ADDR6(name, addr6, port) \
- static struct sockaddr_in6 name = { \
- .sin6_family = AF_INET6, \
- .sin6_port = __constant_htons(port), \
- .sin6_addr = addr6, \
- };
-
-INIT_ADDR4(in_daddr4, INADDR_LOOPBACK, CFG_PORT_INNER)
-INIT_ADDR4(in_saddr4, INADDR_LOOPBACK + 2, 0)
-INIT_ADDR4(out_daddr4, INADDR_LOOPBACK, 0)
-INIT_ADDR4(out_saddr4, INADDR_LOOPBACK + 1, 0)
-INIT_ADDR4(extra_daddr4, INADDR_LOOPBACK, 0)
-INIT_ADDR4(extra_saddr4, INADDR_LOOPBACK + 1, 0)
-
-INIT_ADDR6(in_daddr6, IN6ADDR_LOOPBACK_INIT, CFG_PORT_INNER)
-INIT_ADDR6(in_saddr6, IN6ADDR_LOOPBACK_INIT, 0)
-INIT_ADDR6(out_daddr6, IN6ADDR_LOOPBACK_INIT, 0)
-INIT_ADDR6(out_saddr6, IN6ADDR_LOOPBACK_INIT, 0)
-INIT_ADDR6(extra_daddr6, IN6ADDR_LOOPBACK_INIT, 0)
-INIT_ADDR6(extra_saddr6, IN6ADDR_LOOPBACK_INIT, 0)
-
-static unsigned long util_gettime(void)
-{
- struct timeval tv;
-
- gettimeofday(&tv, NULL);
- return (tv.tv_sec * 1000) + (tv.tv_usec / 1000);
-}
-
-static void util_printaddr(const char *msg, struct sockaddr *addr)
-{
- unsigned long off = 0;
- char nbuf[INET6_ADDRSTRLEN];
-
- switch (addr->sa_family) {
- case PF_INET:
- off = __builtin_offsetof(struct sockaddr_in, sin_addr);
- break;
- case PF_INET6:
- off = __builtin_offsetof(struct sockaddr_in6, sin6_addr);
- break;
- default:
- error(1, 0, "printaddr: unsupported family %u\n",
- addr->sa_family);
- }
-
- if (!inet_ntop(addr->sa_family, ((void *) addr) + off, nbuf,
- sizeof(nbuf)))
- error(1, errno, "inet_ntop");
-
- fprintf(stderr, "%s: %s\n", msg, nbuf);
-}
-
-static unsigned long add_csum_hword(const uint16_t *start, int num_u16)
-{
- unsigned long sum = 0;
- int i;
-
- for (i = 0; i < num_u16; i++)
- sum += start[i];
-
- return sum;
-}
-
-static uint16_t build_ip_csum(const uint16_t *start, int num_u16,
- unsigned long sum)
-{
- sum += add_csum_hword(start, num_u16);
-
- while (sum >> 16)
- sum = (sum & 0xffff) + (sum >> 16);
-
- return ~sum;
-}
-
-static void build_ipv4_header(void *header, uint8_t proto,
- uint32_t src, uint32_t dst,
- int payload_len, uint8_t tos)
-{
- struct iphdr *iph = header;
-
- iph->ihl = 5;
- iph->version = 4;
- iph->tos = tos;
- iph->ttl = 8;
- iph->tot_len = htons(sizeof(*iph) + payload_len);
- iph->id = htons(1337);
- iph->protocol = proto;
- iph->saddr = src;
- iph->daddr = dst;
- iph->check = build_ip_csum((void *) iph, iph->ihl << 1, 0);
-}
-
-static void ipv6_set_dsfield(struct ipv6hdr *ip6h, uint8_t dsfield)
-{
- uint16_t val, *ptr = (uint16_t *)ip6h;
-
- val = ntohs(*ptr);
- val &= 0xF00F;
- val |= ((uint16_t) dsfield) << 4;
- *ptr = htons(val);
-}
-
-static void build_ipv6_header(void *header, uint8_t proto,
- struct sockaddr_in6 *src,
- struct sockaddr_in6 *dst,
- int payload_len, uint8_t dsfield)
-{
- struct ipv6hdr *ip6h = header;
-
- ip6h->version = 6;
- ip6h->payload_len = htons(payload_len);
- ip6h->nexthdr = proto;
- ip6h->hop_limit = 8;
- ipv6_set_dsfield(ip6h, dsfield);
-
- memcpy(&ip6h->saddr, &src->sin6_addr, sizeof(ip6h->saddr));
- memcpy(&ip6h->daddr, &dst->sin6_addr, sizeof(ip6h->daddr));
-}
-
-static uint16_t build_udp_v4_csum(const struct iphdr *iph,
- const struct udphdr *udph,
- int num_words)
-{
- unsigned long pseudo_sum;
- int num_u16 = sizeof(iph->saddr); /* halfwords: twice byte len */
-
- pseudo_sum = add_csum_hword((void *) &iph->saddr, num_u16);
- pseudo_sum += htons(IPPROTO_UDP);
- pseudo_sum += udph->len;
- return build_ip_csum((void *) udph, num_words, pseudo_sum);
-}
-
-static uint16_t build_udp_v6_csum(const struct ipv6hdr *ip6h,
- const struct udphdr *udph,
- int num_words)
-{
- unsigned long pseudo_sum;
- int num_u16 = sizeof(ip6h->saddr); /* halfwords: twice byte len */
-
- pseudo_sum = add_csum_hword((void *) &ip6h->saddr, num_u16);
- pseudo_sum += htons(ip6h->nexthdr);
- pseudo_sum += ip6h->payload_len;
- return build_ip_csum((void *) udph, num_words, pseudo_sum);
-}
-
-static void build_udp_header(void *header, int payload_len,
- uint16_t dport, int family)
-{
- struct udphdr *udph = header;
- int len = sizeof(*udph) + payload_len;
-
- udph->source = htons(cfg_src_port);
- udph->dest = htons(dport);
- udph->len = htons(len);
- udph->check = 0;
- if (family == AF_INET)
- udph->check = build_udp_v4_csum(header - sizeof(struct iphdr),
- udph, len >> 1);
- else
- udph->check = build_udp_v6_csum(header - sizeof(struct ipv6hdr),
- udph, len >> 1);
-}
-
-static void build_gue_header(void *header, uint8_t proto)
-{
- struct guehdr *gueh = header;
-
- gueh->proto_ctype = proto;
-}
-
-static void build_gre_header(void *header, uint16_t proto)
-{
- struct grehdr *greh = header;
-
- greh->protocol = htons(proto);
-}
-
-static int l3_length(int family)
-{
- if (family == AF_INET)
- return sizeof(struct iphdr);
- else
- return sizeof(struct ipv6hdr);
-}
-
-static int build_packet(void)
-{
- int ol3_len = 0, ol4_len = 0, il3_len = 0, il4_len = 0;
- int el3_len = 0;
-
- if (cfg_l3_extra)
- el3_len = l3_length(cfg_l3_extra);
-
- /* calculate header offsets */
- if (cfg_encap_proto) {
- ol3_len = l3_length(cfg_l3_outer);
-
- if (cfg_encap_proto == IPPROTO_GRE)
- ol4_len = sizeof(struct grehdr);
- else if (cfg_encap_proto == IPPROTO_UDP)
- ol4_len = sizeof(struct udphdr) + sizeof(struct guehdr);
- }
-
- il3_len = l3_length(cfg_l3_inner);
- il4_len = sizeof(struct udphdr);
-
- if (el3_len + ol3_len + ol4_len + il3_len + il4_len + cfg_payload_len >=
- sizeof(buf))
- error(1, 0, "packet too large\n");
-
- /*
- * Fill packet from inside out, to calculate correct checksums.
- * But create ip before udp headers, as udp uses ip for pseudo-sum.
- */
- memset(buf + el3_len + ol3_len + ol4_len + il3_len + il4_len,
- cfg_payload_char, cfg_payload_len);
-
- /* add zero byte for udp csum padding */
- buf[el3_len + ol3_len + ol4_len + il3_len + il4_len + cfg_payload_len] = 0;
-
- switch (cfg_l3_inner) {
- case PF_INET:
- build_ipv4_header(buf + el3_len + ol3_len + ol4_len,
- IPPROTO_UDP,
- in_saddr4.sin_addr.s_addr,
- in_daddr4.sin_addr.s_addr,
- il4_len + cfg_payload_len,
- cfg_dsfield_inner);
- break;
- case PF_INET6:
- build_ipv6_header(buf + el3_len + ol3_len + ol4_len,
- IPPROTO_UDP,
- &in_saddr6, &in_daddr6,
- il4_len + cfg_payload_len,
- cfg_dsfield_inner);
- break;
- }
-
- build_udp_header(buf + el3_len + ol3_len + ol4_len + il3_len,
- cfg_payload_len, CFG_PORT_INNER, cfg_l3_inner);
-
- if (!cfg_encap_proto)
- return il3_len + il4_len + cfg_payload_len;
-
- switch (cfg_l3_outer) {
- case PF_INET:
- build_ipv4_header(buf + el3_len, cfg_encap_proto,
- out_saddr4.sin_addr.s_addr,
- out_daddr4.sin_addr.s_addr,
- ol4_len + il3_len + il4_len + cfg_payload_len,
- cfg_dsfield_outer);
- break;
- case PF_INET6:
- build_ipv6_header(buf + el3_len, cfg_encap_proto,
- &out_saddr6, &out_daddr6,
- ol4_len + il3_len + il4_len + cfg_payload_len,
- cfg_dsfield_outer);
- break;
- }
-
- switch (cfg_encap_proto) {
- case IPPROTO_UDP:
- build_gue_header(buf + el3_len + ol3_len + ol4_len -
- sizeof(struct guehdr),
- cfg_l3_inner == PF_INET ? IPPROTO_IPIP
- : IPPROTO_IPV6);
- build_udp_header(buf + el3_len + ol3_len,
- sizeof(struct guehdr) + il3_len + il4_len +
- cfg_payload_len,
- cfg_port_gue, cfg_l3_outer);
- break;
- case IPPROTO_GRE:
- build_gre_header(buf + el3_len + ol3_len,
- cfg_l3_inner == PF_INET ? ETH_P_IP
- : ETH_P_IPV6);
- break;
- }
-
- switch (cfg_l3_extra) {
- case PF_INET:
- build_ipv4_header(buf,
- cfg_l3_outer == PF_INET ? IPPROTO_IPIP
- : IPPROTO_IPV6,
- extra_saddr4.sin_addr.s_addr,
- extra_daddr4.sin_addr.s_addr,
- ol3_len + ol4_len + il3_len + il4_len +
- cfg_payload_len, 0);
- break;
- case PF_INET6:
- build_ipv6_header(buf,
- cfg_l3_outer == PF_INET ? IPPROTO_IPIP
- : IPPROTO_IPV6,
- &extra_saddr6, &extra_daddr6,
- ol3_len + ol4_len + il3_len + il4_len +
- cfg_payload_len, 0);
- break;
- }
-
- return el3_len + ol3_len + ol4_len + il3_len + il4_len +
- cfg_payload_len;
-}
-
-/* sender transmits encapsulated over RAW or unencap'd over UDP */
-static int setup_tx(void)
-{
- int family, fd, ret;
-
- if (cfg_l3_extra)
- family = cfg_l3_extra;
- else if (cfg_l3_outer)
- family = cfg_l3_outer;
- else
- family = cfg_l3_inner;
-
- fd = socket(family, SOCK_RAW, IPPROTO_RAW);
- if (fd == -1)
- error(1, errno, "socket tx");
-
- if (cfg_l3_extra) {
- if (cfg_l3_extra == PF_INET)
- ret = connect(fd, (void *) &extra_daddr4,
- sizeof(extra_daddr4));
- else
- ret = connect(fd, (void *) &extra_daddr6,
- sizeof(extra_daddr6));
- if (ret)
- error(1, errno, "connect tx");
- } else if (cfg_l3_outer) {
- /* connect to destination if not encapsulated */
- if (cfg_l3_outer == PF_INET)
- ret = connect(fd, (void *) &out_daddr4,
- sizeof(out_daddr4));
- else
- ret = connect(fd, (void *) &out_daddr6,
- sizeof(out_daddr6));
- if (ret)
- error(1, errno, "connect tx");
- } else {
- /* otherwise using loopback */
- if (cfg_l3_inner == PF_INET)
- ret = connect(fd, (void *) &in_daddr4,
- sizeof(in_daddr4));
- else
- ret = connect(fd, (void *) &in_daddr6,
- sizeof(in_daddr6));
- if (ret)
- error(1, errno, "connect tx");
- }
-
- return fd;
-}
-
-/* receiver reads unencapsulated UDP */
-static int setup_rx(void)
-{
- int fd, ret;
-
- fd = socket(cfg_l3_inner, SOCK_DGRAM, 0);
- if (fd == -1)
- error(1, errno, "socket rx");
-
- if (cfg_l3_inner == PF_INET)
- ret = bind(fd, (void *) &in_daddr4, sizeof(in_daddr4));
- else
- ret = bind(fd, (void *) &in_daddr6, sizeof(in_daddr6));
- if (ret)
- error(1, errno, "bind rx");
-
- return fd;
-}
-
-static int do_tx(int fd, const char *pkt, int len)
-{
- int ret;
-
- ret = write(fd, pkt, len);
- if (ret == -1)
- error(1, errno, "send");
- if (ret != len)
- error(1, errno, "send: len (%d < %d)\n", ret, len);
-
- return 1;
-}
-
-static int do_poll(int fd, short events, int timeout)
-{
- struct pollfd pfd;
- int ret;
-
- pfd.fd = fd;
- pfd.events = events;
-
- ret = poll(&pfd, 1, timeout);
- if (ret == -1)
- error(1, errno, "poll");
- if (ret && !(pfd.revents & POLLIN))
- error(1, errno, "poll: unexpected event 0x%x\n", pfd.revents);
-
- return ret;
-}
-
-static int do_rx(int fd)
-{
- char rbuf;
- int ret, num = 0;
-
- while (1) {
- ret = recv(fd, &rbuf, 1, MSG_DONTWAIT);
- if (ret == -1 && errno == EAGAIN)
- break;
- if (ret == -1)
- error(1, errno, "recv");
- if (rbuf != cfg_payload_char)
- error(1, 0, "recv: payload mismatch");
- num++;
- }
-
- return num;
-}
-
-static int do_main(void)
-{
- unsigned long tstop, treport, tcur;
- int fdt = -1, fdr = -1, len, tx = 0, rx = 0;
-
- if (!cfg_only_tx)
- fdr = setup_rx();
- if (!cfg_only_rx)
- fdt = setup_tx();
-
- len = build_packet();
-
- tcur = util_gettime();
- treport = tcur + 1000;
- tstop = tcur + (cfg_num_secs * 1000);
-
- while (1) {
- if (!cfg_only_rx)
- tx += do_tx(fdt, buf, len);
-
- if (!cfg_only_tx)
- rx += do_rx(fdr);
-
- if (cfg_num_secs) {
- tcur = util_gettime();
- if (tcur >= tstop)
- break;
- if (tcur >= treport) {
- fprintf(stderr, "pkts: tx=%u rx=%u\n", tx, rx);
- tx = 0;
- rx = 0;
- treport = tcur + 1000;
- }
- } else {
- if (tx == cfg_num_pkt)
- break;
- }
- }
-
- /* read straggler packets, if any */
- if (rx < tx) {
- tstop = util_gettime() + 100;
- while (rx < tx) {
- tcur = util_gettime();
- if (tcur >= tstop)
- break;
-
- do_poll(fdr, POLLIN, tstop - tcur);
- rx += do_rx(fdr);
- }
- }
-
- fprintf(stderr, "pkts: tx=%u rx=%u\n", tx, rx);
-
- if (fdr != -1 && close(fdr))
- error(1, errno, "close rx");
- if (fdt != -1 && close(fdt))
- error(1, errno, "close tx");
-
- /*
- * success (== 0) only if received all packets
- * unless failure is expected, in which case none must arrive.
- */
- if (cfg_expect_failure)
- return rx != 0;
- else
- return rx != tx;
-}
-
-
-static void __attribute__((noreturn)) usage(const char *filepath)
-{
- fprintf(stderr, "Usage: %s [-e gre|gue|bare|none] [-i 4|6] [-l len] "
- "[-O 4|6] [-o 4|6] [-n num] [-t secs] [-R] [-T] "
- "[-s <osrc> [-d <odst>] [-S <isrc>] [-D <idst>] "
- "[-x <otos>] [-X <itos>] [-f <isport>] [-F]\n",
- filepath);
- exit(1);
-}
-
-static void parse_addr(int family, void *addr, const char *optarg)
-{
- int ret;
-
- ret = inet_pton(family, optarg, addr);
- if (ret == -1)
- error(1, errno, "inet_pton");
- if (ret == 0)
- error(1, 0, "inet_pton: bad string");
-}
-
-static void parse_addr4(struct sockaddr_in *addr, const char *optarg)
-{
- parse_addr(AF_INET, &addr->sin_addr, optarg);
-}
-
-static void parse_addr6(struct sockaddr_in6 *addr, const char *optarg)
-{
- parse_addr(AF_INET6, &addr->sin6_addr, optarg);
-}
-
-static int parse_protocol_family(const char *filepath, const char *optarg)
-{
- if (!strcmp(optarg, "4"))
- return PF_INET;
- if (!strcmp(optarg, "6"))
- return PF_INET6;
-
- usage(filepath);
-}
-
-static void parse_opts(int argc, char **argv)
-{
- int c;
-
- while ((c = getopt(argc, argv, "d:D:e:f:Fhi:l:n:o:O:Rs:S:t:Tx:X:")) != -1) {
- switch (c) {
- case 'd':
- if (cfg_l3_outer == AF_UNSPEC)
- error(1, 0, "-d must be preceded by -o");
- if (cfg_l3_outer == AF_INET)
- parse_addr4(&out_daddr4, optarg);
- else
- parse_addr6(&out_daddr6, optarg);
- break;
- case 'D':
- if (cfg_l3_inner == AF_UNSPEC)
- error(1, 0, "-D must be preceded by -i");
- if (cfg_l3_inner == AF_INET)
- parse_addr4(&in_daddr4, optarg);
- else
- parse_addr6(&in_daddr6, optarg);
- break;
- case 'e':
- if (!strcmp(optarg, "gre"))
- cfg_encap_proto = IPPROTO_GRE;
- else if (!strcmp(optarg, "gue"))
- cfg_encap_proto = IPPROTO_UDP;
- else if (!strcmp(optarg, "bare"))
- cfg_encap_proto = IPPROTO_IPIP;
- else if (!strcmp(optarg, "none"))
- cfg_encap_proto = IPPROTO_IP; /* == 0 */
- else
- usage(argv[0]);
- break;
- case 'f':
- cfg_src_port = strtol(optarg, NULL, 0);
- break;
- case 'F':
- cfg_expect_failure = true;
- break;
- case 'h':
- usage(argv[0]);
- break;
- case 'i':
- if (!strcmp(optarg, "4"))
- cfg_l3_inner = PF_INET;
- else if (!strcmp(optarg, "6"))
- cfg_l3_inner = PF_INET6;
- else
- usage(argv[0]);
- break;
- case 'l':
- cfg_payload_len = strtol(optarg, NULL, 0);
- break;
- case 'n':
- cfg_num_pkt = strtol(optarg, NULL, 0);
- break;
- case 'o':
- cfg_l3_outer = parse_protocol_family(argv[0], optarg);
- break;
- case 'O':
- cfg_l3_extra = parse_protocol_family(argv[0], optarg);
- break;
- case 'R':
- cfg_only_rx = true;
- break;
- case 's':
- if (cfg_l3_outer == AF_INET)
- parse_addr4(&out_saddr4, optarg);
- else
- parse_addr6(&out_saddr6, optarg);
- break;
- case 'S':
- if (cfg_l3_inner == AF_INET)
- parse_addr4(&in_saddr4, optarg);
- else
- parse_addr6(&in_saddr6, optarg);
- break;
- case 't':
- cfg_num_secs = strtol(optarg, NULL, 0);
- break;
- case 'T':
- cfg_only_tx = true;
- break;
- case 'x':
- cfg_dsfield_outer = strtol(optarg, NULL, 0);
- break;
- case 'X':
- cfg_dsfield_inner = strtol(optarg, NULL, 0);
- break;
- }
- }
-
- if (cfg_only_rx && cfg_only_tx)
- error(1, 0, "options: cannot combine rx-only and tx-only");
-
- if (cfg_encap_proto && cfg_l3_outer == AF_UNSPEC)
- error(1, 0, "options: must specify outer with encap");
- else if ((!cfg_encap_proto) && cfg_l3_outer != AF_UNSPEC)
- error(1, 0, "options: cannot combine no-encap and outer");
- else if ((!cfg_encap_proto) && cfg_l3_extra != AF_UNSPEC)
- error(1, 0, "options: cannot combine no-encap and extra");
-
- if (cfg_l3_inner == AF_UNSPEC)
- cfg_l3_inner = AF_INET6;
- if (cfg_l3_inner == AF_INET6 && cfg_encap_proto == IPPROTO_IPIP)
- cfg_encap_proto = IPPROTO_IPV6;
-
- /* RFC 6040 4.2:
- * on decap, if outer encountered congestion (CE == 0x3),
- * but inner cannot encode ECN (NoECT == 0x0), then drop packet.
- */
- if (((cfg_dsfield_outer & 0x3) == 0x3) &&
- ((cfg_dsfield_inner & 0x3) == 0x0))
- cfg_expect_failure = true;
-}
-
-static void print_opts(void)
-{
- if (cfg_l3_inner == PF_INET6) {
- util_printaddr("inner.dest6", (void *) &in_daddr6);
- util_printaddr("inner.source6", (void *) &in_saddr6);
- } else {
- util_printaddr("inner.dest4", (void *) &in_daddr4);
- util_printaddr("inner.source4", (void *) &in_saddr4);
- }
-
- if (!cfg_l3_outer)
- return;
-
- fprintf(stderr, "encap proto: %u\n", cfg_encap_proto);
-
- if (cfg_l3_outer == PF_INET6) {
- util_printaddr("outer.dest6", (void *) &out_daddr6);
- util_printaddr("outer.source6", (void *) &out_saddr6);
- } else {
- util_printaddr("outer.dest4", (void *) &out_daddr4);
- util_printaddr("outer.source4", (void *) &out_saddr4);
- }
-
- if (!cfg_l3_extra)
- return;
-
- if (cfg_l3_outer == PF_INET6) {
- util_printaddr("extra.dest6", (void *) &extra_daddr6);
- util_printaddr("extra.source6", (void *) &extra_saddr6);
- } else {
- util_printaddr("extra.dest4", (void *) &extra_daddr4);
- util_printaddr("extra.source4", (void *) &extra_saddr4);
- }
-
-}
-
-int main(int argc, char **argv)
-{
- parse_opts(argc, argv);
- print_opts();
- return do_main();
-}
diff --git a/tools/testing/selftests/bpf/test_flow_dissector.sh b/tools/testing/selftests/bpf/test_flow_dissector.sh
deleted file mode 100755
index 4b298863797a..000000000000
--- a/tools/testing/selftests/bpf/test_flow_dissector.sh
+++ /dev/null
@@ -1,178 +0,0 @@
-#!/bin/bash
-# SPDX-License-Identifier: GPL-2.0
-#
-# Load BPF flow dissector and verify it correctly dissects traffic
-
-BPF_FILE="bpf_flow.bpf.o"
-export TESTNAME=test_flow_dissector
-unmount=0
-
-# Kselftest framework requirement - SKIP code is 4.
-ksft_skip=4
-
-msg="skip all tests:"
-if [ $UID != 0 ]; then
- echo $msg please run this as root >&2
- exit $ksft_skip
-fi
-
-# This test needs to be run in a network namespace with in_netns.sh. Check if
-# this is the case and run it with in_netns.sh if it is being run in the root
-# namespace.
-if [[ -z $(ip netns identify $$) ]]; then
- err=0
- if bpftool="$(which bpftool)"; then
- echo "Testing global flow dissector..."
-
- $bpftool prog loadall $BPF_FILE /sys/fs/bpf/flow \
- type flow_dissector
-
- if ! unshare --net $bpftool prog attach pinned \
- /sys/fs/bpf/flow/_dissect flow_dissector; then
- echo "Unexpected unsuccessful attach in namespace" >&2
- err=1
- fi
-
- $bpftool prog attach pinned /sys/fs/bpf/flow/_dissect \
- flow_dissector
-
- if unshare --net $bpftool prog attach pinned \
- /sys/fs/bpf/flow/_dissect flow_dissector; then
- echo "Unexpected successful attach in namespace" >&2
- err=1
- fi
-
- if ! $bpftool prog detach pinned \
- /sys/fs/bpf/flow/_dissect flow_dissector; then
- echo "Failed to detach flow dissector" >&2
- err=1
- fi
-
- rm -rf /sys/fs/bpf/flow
- else
- echo "Skipping root flow dissector test, bpftool not found" >&2
- fi
-
- # Run the rest of the tests in a net namespace.
- ../net/in_netns.sh "$0" "$@"
- err=$(( $err + $? ))
-
- if (( $err == 0 )); then
- echo "selftests: $TESTNAME [PASS]";
- else
- echo "selftests: $TESTNAME [FAILED]";
- fi
-
- exit $err
-fi
-
-# Determine selftest success via shell exit code
-exit_handler()
-{
- set +e
-
- # Cleanup
- tc filter del dev lo ingress pref 1337 2> /dev/null
- tc qdisc del dev lo ingress 2> /dev/null
- ./flow_dissector_load -d 2> /dev/null
- if [ $unmount -ne 0 ]; then
- umount bpffs 2> /dev/null
- fi
-}
-
-# Exit script immediately (well catched by trap handler) if any
-# program/thing exits with a non-zero status.
-set -e
-
-# (Use 'trap -l' to list meaning of numbers)
-trap exit_handler 0 2 3 6 9
-
-# Mount BPF file system
-if /bin/mount | grep /sys/fs/bpf > /dev/null; then
- echo "bpffs already mounted"
-else
- echo "bpffs not mounted. Mounting..."
- unmount=1
- /bin/mount bpffs /sys/fs/bpf -t bpf
-fi
-
-# Attach BPF program
-./flow_dissector_load -p $BPF_FILE -s _dissect
-
-# Setup
-tc qdisc add dev lo ingress
-echo 0 > /proc/sys/net/ipv4/conf/default/rp_filter
-echo 0 > /proc/sys/net/ipv4/conf/all/rp_filter
-echo 0 > /proc/sys/net/ipv4/conf/lo/rp_filter
-
-echo "Testing IPv4..."
-# Drops all IP/UDP packets coming from port 9
-tc filter add dev lo parent ffff: protocol ip pref 1337 flower ip_proto \
- udp src_port 9 action drop
-
-# Send 10 IPv4/UDP packets from port 8. Filter should not drop any.
-./test_flow_dissector -i 4 -f 8
-# Send 10 IPv4/UDP packets from port 9. Filter should drop all.
-./test_flow_dissector -i 4 -f 9 -F
-# Send 10 IPv4/UDP packets from port 10. Filter should not drop any.
-./test_flow_dissector -i 4 -f 10
-
-echo "Testing IPv4 from 127.0.0.127 (fallback to generic dissector)..."
-# Send 10 IPv4/UDP packets from port 8. Filter should not drop any.
-./test_flow_dissector -i 4 -S 127.0.0.127 -f 8
-# Send 10 IPv4/UDP packets from port 9. Filter should drop all.
-./test_flow_dissector -i 4 -S 127.0.0.127 -f 9 -F
-# Send 10 IPv4/UDP packets from port 10. Filter should not drop any.
-./test_flow_dissector -i 4 -S 127.0.0.127 -f 10
-
-echo "Testing IPIP..."
-# Send 10 IPv4/IPv4/UDP packets from port 8. Filter should not drop any.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 8
-# Send 10 IPv4/IPv4/UDP packets from port 9. Filter should drop all.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 9 -F
-# Send 10 IPv4/IPv4/UDP packets from port 10. Filter should not drop any.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 10
-
-echo "Testing IPv4 + GRE..."
-# Send 10 IPv4/GRE/IPv4/UDP packets from port 8. Filter should not drop any.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 8
-# Send 10 IPv4/GRE/IPv4/UDP packets from port 9. Filter should drop all.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 9 -F
-# Send 10 IPv4/GRE/IPv4/UDP packets from port 10. Filter should not drop any.
-./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \
- -D 192.168.0.1 -S 1.1.1.1 -f 10
-
-tc filter del dev lo ingress pref 1337
-
-echo "Testing port range..."
-# Drops all IP/UDP packets coming from port 8-10
-tc filter add dev lo parent ffff: protocol ip pref 1337 flower ip_proto \
- udp src_port 8-10 action drop
-
-# Send 10 IPv4/UDP packets from port 7. Filter should not drop any.
-./test_flow_dissector -i 4 -f 7
-# Send 10 IPv4/UDP packets from port 9. Filter should drop all.
-./test_flow_dissector -i 4 -f 9 -F
-# Send 10 IPv4/UDP packets from port 11. Filter should not drop any.
-./test_flow_dissector -i 4 -f 11
-
-tc filter del dev lo ingress pref 1337
-
-echo "Testing IPv6..."
-# Drops all IPv6/UDP packets coming from port 9
-tc filter add dev lo parent ffff: protocol ipv6 pref 1337 flower ip_proto \
- udp src_port 9 action drop
-
-# Send 10 IPv6/UDP packets from port 8. Filter should not drop any.
-./test_flow_dissector -i 6 -f 8
-# Send 10 IPv6/UDP packets from port 9. Filter should drop all.
-./test_flow_dissector -i 6 -f 9 -F
-# Send 10 IPv6/UDP packets from port 10. Filter should not drop any.
-./test_flow_dissector -i 6 -f 10
-
-exit 0
diff --git a/tools/testing/selftests/bpf/bpf_testmod/.gitignore b/tools/testing/selftests/bpf/test_kmods/.gitignore
index ded513777281..ded513777281 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/.gitignore
+++ b/tools/testing/selftests/bpf/test_kmods/.gitignore
diff --git a/tools/testing/selftests/bpf/test_kmods/Makefile b/tools/testing/selftests/bpf/test_kmods/Makefile
new file mode 100644
index 000000000000..d4e50c4509c9
--- /dev/null
+++ b/tools/testing/selftests/bpf/test_kmods/Makefile
@@ -0,0 +1,21 @@
+TEST_KMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST)))))
+KDIR ?= $(abspath $(TEST_KMOD_DIR)/../../../../..)
+
+ifeq ($(V),1)
+Q =
+else
+Q = @
+endif
+
+MODULES = bpf_testmod.ko bpf_test_no_cfi.ko bpf_test_modorder_x.ko \
+ bpf_test_modorder_y.ko
+
+$(foreach m,$(MODULES),$(eval obj-m += $(m:.ko=.o)))
+
+CFLAGS_bpf_testmod.o = -I$(src)
+
+all:
+ $(Q)$(MAKE) -C $(KDIR) M=$(TEST_KMOD_DIR) modules
+
+clean:
+ $(Q)$(MAKE) -C $(KDIR) M=$(TEST_KMOD_DIR) clean
diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_x/bpf_test_modorder_x.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_x.c
index 0cc747fa912f..0cc747fa912f 100644
--- a/tools/testing/selftests/bpf/bpf_test_modorder_x/bpf_test_modorder_x.c
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_x.c
diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_y/bpf_test_modorder_y.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_y.c
index c627ee085d13..c627ee085d13 100644
--- a/tools/testing/selftests/bpf/bpf_test_modorder_y/bpf_test_modorder_y.c
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_y.c
diff --git a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_no_cfi.c
index 948eb3962732..948eb3962732 100644
--- a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_no_cfi.c
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod-events.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod-events.h
index aeef86b3da74..aeef86b3da74 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod-events.h
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod-events.h
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.c
index cc9dde507aba..cc9dde507aba 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.c
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.h
index 356803d1c10e..356803d1c10e 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.h
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.h
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod_kfunc.h
index b58817938deb..b58817938deb 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h
+++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod_kfunc.h
diff --git a/tools/testing/selftests/bpf/test_loader.c b/tools/testing/selftests/bpf/test_loader.c
index 3e9b009580d4..53b06647cf57 100644
--- a/tools/testing/selftests/bpf/test_loader.c
+++ b/tools/testing/selftests/bpf/test_loader.c
@@ -36,6 +36,7 @@
#define TEST_TAG_ARCH "comment:test_arch="
#define TEST_TAG_JITED_PFX "comment:test_jited="
#define TEST_TAG_JITED_PFX_UNPRIV "comment:test_jited_unpriv="
+#define TEST_TAG_CAPS_UNPRIV "comment:test_caps_unpriv="
/* Warning: duplicated in bpf_misc.h */
#define POINTER_VALUE 0xcafe4all
@@ -74,6 +75,7 @@ struct test_subspec {
struct expected_msgs jited;
int retval;
bool execute;
+ __u64 caps;
};
struct test_spec {
@@ -276,6 +278,37 @@ static int parse_int(const char *str, int *val, const char *name)
return 0;
}
+static int parse_caps(const char *str, __u64 *val, const char *name)
+{
+ int cap_flag = 0;
+ char *token = NULL, *saveptr = NULL;
+
+ char *str_cpy = strdup(str);
+ if (str_cpy == NULL) {
+ PRINT_FAIL("Memory allocation failed\n");
+ return -EINVAL;
+ }
+
+ token = strtok_r(str_cpy, "|", &saveptr);
+ while (token != NULL) {
+ errno = 0;
+ if (!strncmp("CAP_", token, sizeof("CAP_") - 1)) {
+ PRINT_FAIL("define %s constant in bpf_misc.h, failed to parse caps\n", token);
+ return -EINVAL;
+ }
+ cap_flag = strtol(token, NULL, 10);
+ if (!cap_flag || errno) {
+ PRINT_FAIL("failed to parse caps %s\n", name);
+ return -EINVAL;
+ }
+ *val |= (1ULL << cap_flag);
+ token = strtok_r(NULL, "|", &saveptr);
+ }
+
+ free(str_cpy);
+ return 0;
+}
+
static int parse_retval(const char *str, int *val, const char *name)
{
struct {
@@ -541,6 +574,12 @@ static int parse_test_spec(struct test_loader *tester,
jit_on_next_line = true;
} else if (str_has_pfx(s, TEST_BTF_PATH)) {
spec->btf_custom_path = s + sizeof(TEST_BTF_PATH) - 1;
+ } else if (str_has_pfx(s, TEST_TAG_CAPS_UNPRIV)) {
+ val = s + sizeof(TEST_TAG_CAPS_UNPRIV) - 1;
+ err = parse_caps(val, &spec->unpriv.caps, "test caps");
+ if (err)
+ goto cleanup;
+ spec->mode_mask |= UNPRIV;
}
}
@@ -917,6 +956,13 @@ void run_subtest(struct test_loader *tester,
test__end_subtest();
return;
}
+ if (subspec->caps) {
+ err = cap_enable_effective(subspec->caps, NULL);
+ if (err) {
+ PRINT_FAIL("failed to set capabilities: %i, %s\n", err, strerror(err));
+ goto subtest_cleanup;
+ }
+ }
}
/* Implicitly reset to NULL if next test case doesn't specify */
diff --git a/tools/testing/selftests/bpf/test_progs.c b/tools/testing/selftests/bpf/test_progs.c
index 6088d8222d59..c9e745d49493 100644
--- a/tools/testing/selftests/bpf/test_progs.c
+++ b/tools/testing/selftests/bpf/test_progs.c
@@ -1282,6 +1282,21 @@ void crash_handler(int signum)
backtrace_symbols_fd(bt, sz, STDERR_FILENO);
}
+void hexdump(const char *prefix, const void *buf, size_t len)
+{
+ for (int i = 0; i < len; i++) {
+ if (!(i % 16)) {
+ if (i)
+ fprintf(stdout, "\n");
+ fprintf(stdout, "%s", prefix);
+ }
+ if (i && !(i % 8) && (i % 16))
+ fprintf(stdout, "\t");
+ fprintf(stdout, "%02X ", ((uint8_t *)(buf))[i]);
+ }
+ fprintf(stdout, "\n");
+}
+
static void sigint_handler(int signum)
{
int i;
diff --git a/tools/testing/selftests/bpf/test_progs.h b/tools/testing/selftests/bpf/test_progs.h
index 74de33ae37e5..404d0d4915d5 100644
--- a/tools/testing/selftests/bpf/test_progs.h
+++ b/tools/testing/selftests/bpf/test_progs.h
@@ -185,6 +185,7 @@ void test__end_subtest(void);
void test__skip(void);
void test__fail(void);
int test__join_cgroup(const char *path);
+void hexdump(const char *prefix, const void *buf, size_t len);
#define PRINT_FAIL(format...) \
({ \
@@ -344,6 +345,20 @@ int test__join_cgroup(const char *path);
___ok; \
})
+#define ASSERT_MEMEQ(actual, expected, len, name) ({ \
+ static int duration = 0; \
+ const void *__act = actual; \
+ const void *__exp = expected; \
+ int __len = len; \
+ bool ___ok = memcmp(__act, __exp, __len) == 0; \
+ CHECK(!___ok, (name), "unexpected memory mismatch\n"); \
+ fprintf(stdout, "actual:\n"); \
+ hexdump("\t", __act, __len); \
+ fprintf(stdout, "expected:\n"); \
+ hexdump("\t", __exp, __len); \
+ ___ok; \
+})
+
#define ASSERT_OK(res, name) ({ \
static int duration = 0; \
long long ___res = (res); \
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index e5c7ecbe57e3..fd2da2234cc9 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -1579,8 +1579,12 @@ static void test_txmsg_redir(int cgrp, struct sockmap_options *opt)
static void test_txmsg_redir_wait_sndmem(int cgrp, struct sockmap_options *opt)
{
- txmsg_redir = 1;
opt->tx_wait_mem = true;
+ txmsg_redir = 1;
+ test_send_large(opt, cgrp);
+
+ txmsg_redir = 1;
+ txmsg_apply = 4097;
test_send_large(opt, cgrp);
opt->tx_wait_mem = false;
}
diff --git a/tools/testing/selftests/bpf/test_tc_tunnel.sh b/tools/testing/selftests/bpf/test_tc_tunnel.sh
index 7989ec608454..cb55a908bb0d 100755
--- a/tools/testing/selftests/bpf/test_tc_tunnel.sh
+++ b/tools/testing/selftests/bpf/test_tc_tunnel.sh
@@ -305,6 +305,7 @@ else
client_connect
verify_data
server_listen
+ wait_for_port ${port} ${netcat_opt}
fi
# serverside, use BPF for decap
diff --git a/tools/testing/selftests/bpf/test_xdp_meta.sh b/tools/testing/selftests/bpf/test_xdp_meta.sh
deleted file mode 100755
index 2740322c1878..000000000000
--- a/tools/testing/selftests/bpf/test_xdp_meta.sh
+++ /dev/null
@@ -1,58 +0,0 @@
-#!/bin/sh
-
-BPF_FILE="test_xdp_meta.bpf.o"
-# Kselftest framework requirement - SKIP code is 4.
-readonly KSFT_SKIP=4
-readonly NS1="ns1-$(mktemp -u XXXXXX)"
-readonly NS2="ns2-$(mktemp -u XXXXXX)"
-
-cleanup()
-{
- if [ "$?" = "0" ]; then
- echo "selftests: test_xdp_meta [PASS]";
- else
- echo "selftests: test_xdp_meta [FAILED]";
- fi
-
- set +e
- ip link del veth1 2> /dev/null
- ip netns del ${NS1} 2> /dev/null
- ip netns del ${NS2} 2> /dev/null
-}
-
-ip link set dev lo xdp off 2>/dev/null > /dev/null
-if [ $? -ne 0 ];then
- echo "selftests: [SKIP] Could not run test without the ip xdp support"
- exit $KSFT_SKIP
-fi
-set -e
-
-ip netns add ${NS1}
-ip netns add ${NS2}
-
-trap cleanup 0 2 3 6 9
-
-ip link add veth1 type veth peer name veth2
-
-ip link set veth1 netns ${NS1}
-ip link set veth2 netns ${NS2}
-
-ip netns exec ${NS1} ip addr add 10.1.1.11/24 dev veth1
-ip netns exec ${NS2} ip addr add 10.1.1.22/24 dev veth2
-
-ip netns exec ${NS1} tc qdisc add dev veth1 clsact
-ip netns exec ${NS2} tc qdisc add dev veth2 clsact
-
-ip netns exec ${NS1} tc filter add dev veth1 ingress bpf da obj ${BPF_FILE} sec t
-ip netns exec ${NS2} tc filter add dev veth2 ingress bpf da obj ${BPF_FILE} sec t
-
-ip netns exec ${NS1} ip link set dev veth1 xdp obj ${BPF_FILE} sec x
-ip netns exec ${NS2} ip link set dev veth2 xdp obj ${BPF_FILE} sec x
-
-ip netns exec ${NS1} ip link set dev veth1 up
-ip netns exec ${NS2} ip link set dev veth2 up
-
-ip netns exec ${NS1} ping -c 1 10.1.1.22
-ip netns exec ${NS2} ping -c 1 10.1.1.11
-
-exit 0
diff --git a/tools/testing/selftests/bpf/test_xdp_redirect.sh b/tools/testing/selftests/bpf/test_xdp_redirect.sh
deleted file mode 100755
index 0746a4fde9d3..000000000000
--- a/tools/testing/selftests/bpf/test_xdp_redirect.sh
+++ /dev/null
@@ -1,79 +0,0 @@
-#!/bin/bash
-# Create 2 namespaces with two veth peers, and
-# forward packets in-between using generic XDP
-#
-# NS1(veth11) NS2(veth22)
-# | |
-# | |
-# (veth1, ------ (veth2,
-# id:111) id:222)
-# | xdp forwarding |
-# ------------------
-
-readonly NS1="ns1-$(mktemp -u XXXXXX)"
-readonly NS2="ns2-$(mktemp -u XXXXXX)"
-ret=0
-
-setup()
-{
-
- local xdpmode=$1
-
- ip netns add ${NS1}
- ip netns add ${NS2}
-
- ip link add veth1 index 111 type veth peer name veth11 netns ${NS1}
- ip link add veth2 index 222 type veth peer name veth22 netns ${NS2}
-
- ip link set veth1 up
- ip link set veth2 up
- ip -n ${NS1} link set dev veth11 up
- ip -n ${NS2} link set dev veth22 up
-
- ip -n ${NS1} addr add 10.1.1.11/24 dev veth11
- ip -n ${NS2} addr add 10.1.1.22/24 dev veth22
-}
-
-cleanup()
-{
- ip link del veth1 2> /dev/null
- ip link del veth2 2> /dev/null
- ip netns del ${NS1} 2> /dev/null
- ip netns del ${NS2} 2> /dev/null
-}
-
-test_xdp_redirect()
-{
- local xdpmode=$1
-
- setup
-
- ip link set dev veth1 $xdpmode off &> /dev/null
- if [ $? -ne 0 ];then
- echo "selftests: test_xdp_redirect $xdpmode [SKIP]"
- return 0
- fi
-
- ip -n ${NS1} link set veth11 $xdpmode obj xdp_dummy.bpf.o sec xdp &> /dev/null
- ip -n ${NS2} link set veth22 $xdpmode obj xdp_dummy.bpf.o sec xdp &> /dev/null
- ip link set dev veth1 $xdpmode obj test_xdp_redirect.bpf.o sec redirect_to_222 &> /dev/null
- ip link set dev veth2 $xdpmode obj test_xdp_redirect.bpf.o sec redirect_to_111 &> /dev/null
-
- if ip netns exec ${NS1} ping -c 1 10.1.1.22 &> /dev/null &&
- ip netns exec ${NS2} ping -c 1 10.1.1.11 &> /dev/null; then
- echo "selftests: test_xdp_redirect $xdpmode [PASS]";
- else
- ret=1
- echo "selftests: test_xdp_redirect $xdpmode [FAILED]";
- fi
-
- cleanup
-}
-
-set -e
-trap cleanup 2 3 6 9
-
-test_xdp_redirect xdpgeneric
-test_xdp_redirect xdpdrv
-
-exit $ret
diff --git a/tools/testing/selftests/bpf/trace_helpers.c b/tools/testing/selftests/bpf/trace_helpers.c
index 2d742fdac6b9..81943c6254e6 100644
--- a/tools/testing/selftests/bpf/trace_helpers.c
+++ b/tools/testing/selftests/bpf/trace_helpers.c
@@ -293,6 +293,10 @@ static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *st
return 0;
}
#else
+# ifndef PROCMAP_QUERY_VMA_EXECUTABLE
+# define PROCMAP_QUERY_VMA_EXECUTABLE 0x04
+# endif
+
static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *start, size_t *offset, int *flags)
{
return -EOPNOTSUPP;
diff --git a/tools/testing/selftests/bpf/verifier/calls.c b/tools/testing/selftests/bpf/verifier/calls.c
index 7afc2619ab14..18596ae0b0c1 100644
--- a/tools/testing/selftests/bpf/verifier/calls.c
+++ b/tools/testing/selftests/bpf/verifier/calls.c
@@ -2252,7 +2252,7 @@
BPF_EXIT_INSN(),
},
.fixup_map_hash_48b = { 7 },
- .errstr_unpriv = "invalid indirect read from stack R2 off -8+0 size 8",
+ .errstr_unpriv = "invalid read from stack R2 off -8+0 size 8",
.result_unpriv = REJECT,
/* in privileged mode reads from uninitialized stack locations are permitted */
.result = ACCEPT,
diff --git a/tools/testing/selftests/bpf/verifier/map_kptr.c b/tools/testing/selftests/bpf/verifier/map_kptr.c
index f420c0312aa0..4b39f8472f9b 100644
--- a/tools/testing/selftests/bpf/verifier/map_kptr.c
+++ b/tools/testing/selftests/bpf/verifier/map_kptr.c
@@ -373,7 +373,7 @@
.prog_type = BPF_PROG_TYPE_SCHED_CLS,
.fixup_map_kptr = { 1 },
.result = REJECT,
- .errstr = "Unreleased reference id=5 alloc_insn=20",
+ .errstr = "Unreleased reference id=4 alloc_insn=20",
.fixup_kfunc_btf_id = {
{ "bpf_kfunc_call_test_acquire", 15 },
}
diff --git a/tools/testing/selftests/bpf/veristat.c b/tools/testing/selftests/bpf/veristat.c
index e12ef953fba8..06af5029885b 100644
--- a/tools/testing/selftests/bpf/veristat.c
+++ b/tools/testing/selftests/bpf/veristat.c
@@ -21,11 +21,20 @@
#include <gelf.h>
#include <float.h>
#include <math.h>
+#include <limits.h>
#ifndef ARRAY_SIZE
#define ARRAY_SIZE(arr) (sizeof(arr) / sizeof((arr)[0]))
#endif
+#ifndef max
+#define max(a, b) ((a) > (b) ? (a) : (b))
+#endif
+
+#ifndef min
+#define min(a, b) ((a) < (b) ? (a) : (b))
+#endif
+
enum stat_id {
VERDICT,
DURATION,
@@ -34,6 +43,11 @@ enum stat_id {
PEAK_STATES,
MAX_STATES_PER_INSN,
MARK_READ_MAX_LEN,
+ SIZE,
+ JITED_SIZE,
+ STACK,
+ PROG_TYPE,
+ ATTACH_TYPE,
FILE_NAME,
PROG_NAME,
@@ -203,7 +217,8 @@ const char argp_program_doc[] =
"\n"
"USAGE: veristat <obj-file> [<obj-file>...]\n"
" OR: veristat -C <baseline.csv> <comparison.csv>\n"
-" OR: veristat -R <results.csv>\n";
+" OR: veristat -R <results.csv>\n"
+" OR: veristat -vl2 <to_analyze.bpf.o>\n";
enum {
OPT_LOG_FIXED = 1000,
@@ -215,7 +230,7 @@ static const struct argp_option opts[] = {
{ "version", 'V', NULL, 0, "Print version" },
{ "verbose", 'v', NULL, 0, "Verbose mode" },
{ "debug", 'd', NULL, 0, "Debug mode (turns on libbpf debug logging)" },
- { "log-level", 'l', "LEVEL", 0, "Verifier log level (default 0 for normal mode, 1 for verbose mode)" },
+ { "log-level", 'l', "LEVEL", 0, "Verifier log level (default 0 for normal mode, 1 for verbose mode, 2 for full verification log)" },
{ "log-fixed", OPT_LOG_FIXED, NULL, 0, "Disable verifier log rotation" },
{ "log-size", OPT_LOG_SIZE, "BYTES", 0, "Customize verifier log size (default to 16MB)" },
{ "top-n", 'n', "N", 0, "Emit only up to first N results." },
@@ -640,19 +655,21 @@ cleanup:
}
static const struct stat_specs default_output_spec = {
- .spec_cnt = 7,
+ .spec_cnt = 8,
.ids = {
FILE_NAME, PROG_NAME, VERDICT, DURATION,
- TOTAL_INSNS, TOTAL_STATES, PEAK_STATES,
+ TOTAL_INSNS, TOTAL_STATES, SIZE, JITED_SIZE
},
};
static const struct stat_specs default_csv_output_spec = {
- .spec_cnt = 9,
+ .spec_cnt = 14,
.ids = {
FILE_NAME, PROG_NAME, VERDICT, DURATION,
TOTAL_INSNS, TOTAL_STATES, PEAK_STATES,
MAX_STATES_PER_INSN, MARK_READ_MAX_LEN,
+ SIZE, JITED_SIZE, PROG_TYPE, ATTACH_TYPE,
+ STACK,
},
};
@@ -688,6 +705,11 @@ static struct stat_def {
[PEAK_STATES] = { "Peak states", {"peak_states"}, },
[MAX_STATES_PER_INSN] = { "Max states per insn", {"max_states_per_insn"}, },
[MARK_READ_MAX_LEN] = { "Max mark read length", {"max_mark_read_len", "mark_read"}, },
+ [SIZE] = { "Program size", {"prog_size"}, },
+ [JITED_SIZE] = { "Jited size", {"prog_size_jited"}, },
+ [STACK] = {"Stack depth", {"stack_depth", "stack"}, },
+ [PROG_TYPE] = { "Program type", {"prog_type"}, },
+ [ATTACH_TYPE] = { "Attach type", {"attach_type", }, },
};
static bool parse_stat_id_var(const char *name, size_t len, int *id,
@@ -835,7 +857,8 @@ static char verif_log_buf[64 * 1024];
static int parse_verif_log(char * const buf, size_t buf_sz, struct verif_stats *s)
{
const char *cur;
- int pos, lines;
+ int pos, lines, sub_stack, cnt = 0;
+ char *state = NULL, *token, stack[512];
buf[buf_sz - 1] = '\0';
@@ -853,15 +876,22 @@ static int parse_verif_log(char * const buf, size_t buf_sz, struct verif_stats *
if (1 == sscanf(cur, "verification time %ld usec\n", &s->stats[DURATION]))
continue;
- if (6 == sscanf(cur, "processed %ld insns (limit %*d) max_states_per_insn %ld total_states %ld peak_states %ld mark_read %ld",
+ if (5 == sscanf(cur, "processed %ld insns (limit %*d) max_states_per_insn %ld total_states %ld peak_states %ld mark_read %ld",
&s->stats[TOTAL_INSNS],
&s->stats[MAX_STATES_PER_INSN],
&s->stats[TOTAL_STATES],
&s->stats[PEAK_STATES],
&s->stats[MARK_READ_MAX_LEN]))
continue;
- }
+ if (1 == sscanf(cur, "stack depth %511s", stack))
+ continue;
+ }
+ while ((token = strtok_r(cnt++ ? NULL : stack, "+", &state))) {
+ if (sscanf(token, "%d", &sub_stack) == 0)
+ break;
+ s->stats[STACK] += sub_stack;
+ }
return 0;
}
@@ -884,7 +914,7 @@ static int line_cnt_cmp(const void *a, const void *b)
const struct line_cnt *b_cnt = (const struct line_cnt *)b;
if (a_cnt->cnt != b_cnt->cnt)
- return a_cnt->cnt < b_cnt->cnt ? -1 : 1;
+ return a_cnt->cnt > b_cnt->cnt ? -1 : 1;
return strcmp(a_cnt->line, b_cnt->line);
}
@@ -1032,6 +1062,41 @@ static int guess_prog_type_by_ctx_name(const char *ctx_name,
return -ESRCH;
}
+/* Make sure only target program is referenced from struct_ops map,
+ * otherwise libbpf would automatically set autocreate for all
+ * referenced programs.
+ * See libbpf.c:bpf_object_adjust_struct_ops_autoload.
+ */
+static void mask_unrelated_struct_ops_progs(struct bpf_object *obj,
+ struct bpf_map *map,
+ struct bpf_program *prog)
+{
+ struct btf *btf = bpf_object__btf(obj);
+ const struct btf_type *t, *mt;
+ struct btf_member *m;
+ int i, moff;
+ size_t data_sz, ptr_sz = sizeof(void *);
+ void *data;
+
+ t = btf__type_by_id(btf, bpf_map__btf_value_type_id(map));
+ if (!btf_is_struct(t))
+ return;
+
+ data = bpf_map__initial_value(map, &data_sz);
+ for (i = 0; i < btf_vlen(t); i++) {
+ m = &btf_members(t)[i];
+ mt = btf__type_by_id(btf, m->type);
+ if (!btf_is_ptr(mt))
+ continue;
+ moff = m->offset / 8;
+ if (moff + ptr_sz > data_sz)
+ continue;
+ if (memcmp(data + moff, &prog, ptr_sz) == 0)
+ continue;
+ memset(data + moff, 0, ptr_sz);
+ }
+}
+
static void fixup_obj(struct bpf_object *obj, struct bpf_program *prog, const char *filename)
{
struct bpf_map *map;
@@ -1047,6 +1112,9 @@ static void fixup_obj(struct bpf_object *obj, struct bpf_program *prog, const ch
case BPF_MAP_TYPE_INODE_STORAGE:
case BPF_MAP_TYPE_CGROUP_STORAGE:
break;
+ case BPF_MAP_TYPE_STRUCT_OPS:
+ mask_unrelated_struct_ops_progs(obj, map, prog);
+ break;
default:
if (bpf_map__max_entries(map) == 0)
bpf_map__set_max_entries(map, 1);
@@ -1146,8 +1214,11 @@ static int process_prog(const char *filename, struct bpf_object *obj, struct bpf
char *buf;
int buf_sz, log_level;
struct verif_stats *stats;
+ struct bpf_prog_info info;
+ __u32 info_len = sizeof(info);
int err = 0;
void *tmp;
+ int fd;
if (!should_process_file_prog(base_filename, bpf_program__name(prog))) {
env.progs_skipped++;
@@ -1196,6 +1267,15 @@ static int process_prog(const char *filename, struct bpf_object *obj, struct bpf
stats->file_name = strdup(base_filename);
stats->prog_name = strdup(bpf_program__name(prog));
stats->stats[VERDICT] = err == 0; /* 1 - success, 0 - failure */
+ stats->stats[SIZE] = bpf_program__insn_cnt(prog);
+ stats->stats[PROG_TYPE] = bpf_program__type(prog);
+ stats->stats[ATTACH_TYPE] = bpf_program__expected_attach_type(prog);
+
+ memset(&info, 0, info_len);
+ fd = bpf_program__fd(prog);
+ if (fd > 0 && bpf_prog_get_info_by_fd(fd, &info, &info_len) == 0)
+ stats->stats[JITED_SIZE] = info.jited_prog_len;
+
parse_verif_log(buf, buf_sz, stats);
if (env.verbose) {
@@ -1309,6 +1389,11 @@ static int cmp_stat(const struct verif_stats *s1, const struct verif_stats *s2,
case PROG_NAME:
cmp = strcmp(s1->prog_name, s2->prog_name);
break;
+ case ATTACH_TYPE:
+ case PROG_TYPE:
+ case SIZE:
+ case JITED_SIZE:
+ case STACK:
case VERDICT:
case DURATION:
case TOTAL_INSNS:
@@ -1523,12 +1608,27 @@ static void prepare_value(const struct verif_stats *s, enum stat_id id,
else
*str = s->stats[VERDICT] ? "success" : "failure";
break;
+ case ATTACH_TYPE:
+ if (!s)
+ *str = "N/A";
+ else
+ *str = libbpf_bpf_attach_type_str(s->stats[ATTACH_TYPE]) ?: "N/A";
+ break;
+ case PROG_TYPE:
+ if (!s)
+ *str = "N/A";
+ else
+ *str = libbpf_bpf_prog_type_str(s->stats[PROG_TYPE]) ?: "N/A";
+ break;
case DURATION:
case TOTAL_INSNS:
case TOTAL_STATES:
case PEAK_STATES:
case MAX_STATES_PER_INSN:
case MARK_READ_MAX_LEN:
+ case STACK:
+ case SIZE:
+ case JITED_SIZE:
*val = s ? s->stats[id] : 0;
break;
default:
@@ -1612,7 +1712,10 @@ static int parse_stat_value(const char *str, enum stat_id id, struct verif_stats
case TOTAL_STATES:
case PEAK_STATES:
case MAX_STATES_PER_INSN:
- case MARK_READ_MAX_LEN: {
+ case MARK_READ_MAX_LEN:
+ case SIZE:
+ case JITED_SIZE:
+ case STACK: {
long val;
int err, n;
@@ -1625,6 +1728,42 @@ static int parse_stat_value(const char *str, enum stat_id id, struct verif_stats
st->stats[id] = val;
break;
}
+ case PROG_TYPE: {
+ enum bpf_prog_type prog_type = 0;
+ const char *type;
+
+ while ((type = libbpf_bpf_prog_type_str(prog_type))) {
+ if (strcmp(type, str) == 0) {
+ st->stats[id] = prog_type;
+ break;
+ }
+ prog_type++;
+ }
+
+ if (!type) {
+ fprintf(stderr, "Unrecognized prog type %s\n", str);
+ return -EINVAL;
+ }
+ break;
+ }
+ case ATTACH_TYPE: {
+ enum bpf_attach_type attach_type = 0;
+ const char *type;
+
+ while ((type = libbpf_bpf_attach_type_str(attach_type))) {
+ if (strcmp(type, str) == 0) {
+ st->stats[id] = attach_type;
+ break;
+ }
+ attach_type++;
+ }
+
+ if (!type) {
+ fprintf(stderr, "Unrecognized attach type %s\n", str);
+ return -EINVAL;
+ }
+ break;
+ }
default:
fprintf(stderr, "Unrecognized stat #%d\n", id);
return -EINVAL;
diff --git a/tools/testing/selftests/bpf/xdp_hw_metadata.c b/tools/testing/selftests/bpf/xdp_hw_metadata.c
index 6f9956eed797..6f7b15d6c6ed 100644
--- a/tools/testing/selftests/bpf/xdp_hw_metadata.c
+++ b/tools/testing/selftests/bpf/xdp_hw_metadata.c
@@ -27,7 +27,7 @@
#include <linux/errqueue.h>
#include <linux/if_link.h>
#include <linux/net_tstamp.h>
-#include <linux/udp.h>
+#include <netinet/udp.h>
#include <linux/sockios.h>
#include <linux/if_xdp.h>
#include <sys/mman.h>
@@ -79,7 +79,7 @@ static int open_xsk(int ifindex, struct xsk *xsk, __u32 queue_id)
.fill_size = XSK_RING_PROD__DEFAULT_NUM_DESCS,
.comp_size = XSK_RING_CONS__DEFAULT_NUM_DESCS,
.frame_size = XSK_UMEM__DEFAULT_FRAME_SIZE,
- .flags = XSK_UMEM__DEFAULT_FLAGS,
+ .flags = XDP_UMEM_TX_METADATA_LEN,
.tx_metadata_len = sizeof(struct xsk_tx_metadata),
};
__u32 idx = 0;
@@ -551,6 +551,7 @@ static void hwtstamp_enable(const char *ifname)
{
struct hwtstamp_config cfg = {
.rx_filter = HWTSTAMP_FILTER_ALL,
+ .tx_type = HWTSTAMP_TX_ON,
};
hwtstamp_ioctl(SIOCGHWTSTAMP, ifname, &saved_hwtstamp_cfg);
diff --git a/tools/testing/selftests/cgroup/test_cpuset_prs.sh b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
index 03c1bdaed2c3..400a696a0d21 100755
--- a/tools/testing/selftests/cgroup/test_cpuset_prs.sh
+++ b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
@@ -86,15 +86,15 @@ echo "" > test/cpuset.cpus
#
# If isolated CPUs have been reserved at boot time (as shown in
-# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-7
+# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-8
# that will be used by this script for testing purpose. If not, some of
-# the tests may fail incorrectly. These isolated CPUs will also be removed
-# before being compared with the expected results.
+# the tests may fail incorrectly. These pre-isolated CPUs should stay in
+# an isolated state throughout the testing process for now.
#
BOOT_ISOLCPUS=$(cat $CGROUP2/cpuset.cpus.isolated)
if [[ -n "$BOOT_ISOLCPUS" ]]
then
- [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 7 ]] &&
+ [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 8 ]] &&
skip_test "Pre-isolated CPUs ($BOOT_ISOLCPUS) overlap CPUs to be tested"
echo "Pre-isolated CPUs: $BOOT_ISOLCPUS"
fi
@@ -684,14 +684,18 @@ check_isolcpus()
fi
#
+ # Appending pre-isolated CPUs
+ # Even though CPU #8 isn't used for testing, it can't be pre-isolated
+ # to make appending those CPUs easier.
+ #
+ [[ -n "$BOOT_ISOLCPUS" ]] && {
+ EXPECT_VAL=${EXPECT_VAL:+${EXPECT_VAL},}${BOOT_ISOLCPUS}
+ EXPECT_VAL2=${EXPECT_VAL2:+${EXPECT_VAL2},}${BOOT_ISOLCPUS}
+ }
+
+ #
# Check cpuset.cpus.isolated cpumask
#
- if [[ -z "$BOOT_ISOLCPUS" ]]
- then
- ISOLCPUS=$(cat $ISCPUS)
- else
- ISOLCPUS=$(cat $ISCPUS | sed -e "s/,*$BOOT_ISOLCPUS//")
- fi
[[ "$EXPECT_VAL2" != "$ISOLCPUS" ]] && {
# Take a 50ms pause and try again
pause 0.05
@@ -731,8 +735,6 @@ check_isolcpus()
fi
done
[[ "$ISOLCPUS" = *- ]] && ISOLCPUS=${ISOLCPUS}$LASTISOLCPU
- [[ -n "BOOT_ISOLCPUS" ]] &&
- ISOLCPUS=$(echo $ISOLCPUS | sed -e "s/,*$BOOT_ISOLCPUS//")
[[ "$EXPECT_VAL" = "$ISOLCPUS" ]]
}
@@ -836,8 +838,11 @@ run_state_test()
# if available
[[ -n "$ICPUS" ]] && {
check_isolcpus $ICPUS
- [[ $? -ne 0 ]] && test_fail $I "isolated CPU" \
- "Expect $ICPUS, get $ISOLCPUS instead"
+ [[ $? -ne 0 ]] && {
+ [[ -n "$BOOT_ISOLCPUS" ]] && ICPUS=${ICPUS},${BOOT_ISOLCPUS}
+ test_fail $I "isolated CPU" \
+ "Expect $ICPUS, get $ISOLCPUS instead"
+ }
}
reset_cgroup_states
#
diff --git a/tools/testing/selftests/coredump/Makefile b/tools/testing/selftests/coredump/Makefile
new file mode 100644
index 000000000000..ed210037b29d
--- /dev/null
+++ b/tools/testing/selftests/coredump/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0-only
+CFLAGS = $(KHDR_INCLUDES)
+
+TEST_GEN_PROGS := stackdump_test
+TEST_FILES := stackdump
+
+include ../lib.mk
diff --git a/tools/testing/selftests/coredump/README.rst b/tools/testing/selftests/coredump/README.rst
new file mode 100644
index 000000000000..164a7aa181c8
--- /dev/null
+++ b/tools/testing/selftests/coredump/README.rst
@@ -0,0 +1,50 @@
+coredump selftest
+=================
+
+Background context
+------------------
+
+`coredump` is a feature which dumps a process's memory space when the process terminates
+unexpectedly (e.g. due to segmentation fault), which can be useful for debugging. By default,
+`coredump` dumps the memory to the file named `core`, but this behavior can be changed by writing a
+different file name to `/proc/sys/kernel/core_pattern`. Furthermore, `coredump` can be piped to a
+user-space program by writing the pipe symbol (`|`) followed by the command to be executed to
+`/proc/sys/kernel/core_pattern`. For the full description, see `man 5 core`.
+
+The piped user program may be interested in reading the stack pointers of the crashed process. The
+crashed process's stack pointers can be read from `procfs`: it is the `kstkesp` field in
+`/proc/$PID/stat`. See `man 5 proc` for all the details.
+
+The problem
+-----------
+While a thread is active, the stack pointer is unsafe to read and therefore the `kstkesp` field
+reads zero. But when the thread is dead (e.g. during a coredump), this field should have valid
+value.
+
+However, this was broken in the past and `kstkesp` was zero even during coredump:
+
+* commit 0a1eb2d474ed ("fs/proc: Stop reporting eip and esp in /proc/PID/stat") changed kstkesp to
+ always be zero
+
+* commit fd7d56270b52 ("fs/proc: Report eip/esp in /prod/PID/stat for coredumping") fixed it for the
+ coredumping thread. However, other threads in a coredumping process still had the problem.
+
+* commit cb8f381f1613 ("fs/proc/array.c: allow reporting eip/esp for all coredumping threads") fixed
+ for all threads in a coredumping process.
+
+* commit 92307383082d ("coredump: Don't perform any cleanups before dumping core") broke it again
+ for the other threads in a coredumping process.
+
+The problem has been fixed now, but considering the history, it may appear again in the future.
+
+The goal of this test
+---------------------
+This test detects problem with reading `kstkesp` during coredump by doing the following:
+
+#. Tell the kernel to execute the "stackdump" script when a coredump happens. This script
+ reads the stack pointers of all threads of crashed processes.
+
+#. Spawn a child process who creates some threads and then crashes.
+
+#. Read the output from the "stackdump" script, and make sure all stack pointer values are
+ non-zero.
diff --git a/tools/testing/selftests/coredump/stackdump b/tools/testing/selftests/coredump/stackdump
new file mode 100755
index 000000000000..96714ce42d12
--- /dev/null
+++ b/tools/testing/selftests/coredump/stackdump
@@ -0,0 +1,14 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+
+CRASH_PROGRAM_ID=$1
+STACKDUMP_FILE=$2
+
+TMP=$(mktemp)
+
+for t in /proc/$CRASH_PROGRAM_ID/task/*; do
+ tid=$(basename $t)
+ cat /proc/$tid/stat | awk '{print $29}' >> $TMP
+done
+
+mv $TMP $STACKDUMP_FILE
diff --git a/tools/testing/selftests/coredump/stackdump_test.c b/tools/testing/selftests/coredump/stackdump_test.c
new file mode 100644
index 000000000000..137b2364a082
--- /dev/null
+++ b/tools/testing/selftests/coredump/stackdump_test.c
@@ -0,0 +1,151 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <fcntl.h>
+#include <libgen.h>
+#include <linux/limits.h>
+#include <pthread.h>
+#include <string.h>
+#include <sys/resource.h>
+#include <unistd.h>
+
+#include "../kselftest_harness.h"
+
+#define STACKDUMP_FILE "stack_values"
+#define STACKDUMP_SCRIPT "stackdump"
+#define NUM_THREAD_SPAWN 128
+
+static void *do_nothing(void *)
+{
+ while (1)
+ pause();
+}
+
+static void crashing_child(void)
+{
+ pthread_t thread;
+ int i;
+
+ for (i = 0; i < NUM_THREAD_SPAWN; ++i)
+ pthread_create(&thread, NULL, do_nothing, NULL);
+
+ /* crash on purpose */
+ i = *(int *)NULL;
+}
+
+FIXTURE(coredump)
+{
+ char original_core_pattern[256];
+};
+
+FIXTURE_SETUP(coredump)
+{
+ char buf[PATH_MAX];
+ FILE *file;
+ char *dir;
+ int ret;
+
+ file = fopen("/proc/sys/kernel/core_pattern", "r");
+ ASSERT_NE(NULL, file);
+
+ ret = fread(self->original_core_pattern, 1, sizeof(self->original_core_pattern), file);
+ ASSERT_TRUE(ret || feof(file));
+ ASSERT_LT(ret, sizeof(self->original_core_pattern));
+
+ self->original_core_pattern[ret] = '\0';
+
+ ret = fclose(file);
+ ASSERT_EQ(0, ret);
+}
+
+FIXTURE_TEARDOWN(coredump)
+{
+ const char *reason;
+ FILE *file;
+ int ret;
+
+ unlink(STACKDUMP_FILE);
+
+ file = fopen("/proc/sys/kernel/core_pattern", "w");
+ if (!file) {
+ reason = "Unable to open core_pattern";
+ goto fail;
+ }
+
+ ret = fprintf(file, "%s", self->original_core_pattern);
+ if (ret < 0) {
+ reason = "Unable to write to core_pattern";
+ goto fail;
+ }
+
+ ret = fclose(file);
+ if (ret) {
+ reason = "Unable to close core_pattern";
+ goto fail;
+ }
+
+ return;
+fail:
+ /* This should never happen */
+ fprintf(stderr, "Failed to cleanup stackdump test: %s\n", reason);
+}
+
+TEST_F(coredump, stackdump)
+{
+ struct sigaction action = {};
+ unsigned long long stack;
+ char *test_dir, *line;
+ size_t line_length;
+ char buf[PATH_MAX];
+ int ret, i;
+ FILE *file;
+ pid_t pid;
+
+ /*
+ * Step 1: Setup core_pattern so that the stackdump script is executed when the child
+ * process crashes
+ */
+ ret = readlink("/proc/self/exe", buf, sizeof(buf));
+ ASSERT_NE(-1, ret);
+ ASSERT_LT(ret, sizeof(buf));
+ buf[ret] = '\0';
+
+ test_dir = dirname(buf);
+
+ file = fopen("/proc/sys/kernel/core_pattern", "w");
+ ASSERT_NE(NULL, file);
+
+ ret = fprintf(file, "|%1$s/%2$s %%P %1$s/%3$s", test_dir, STACKDUMP_SCRIPT, STACKDUMP_FILE);
+ ASSERT_LT(0, ret);
+
+ ret = fclose(file);
+ ASSERT_EQ(0, ret);
+
+ /* Step 2: Create a process who spawns some threads then crashes */
+ pid = fork();
+ ASSERT_TRUE(pid >= 0);
+ if (pid == 0)
+ crashing_child();
+
+ /*
+ * Step 3: Wait for the stackdump script to write the stack pointers to the stackdump file
+ */
+ for (i = 0; i < 10; ++i) {
+ file = fopen(STACKDUMP_FILE, "r");
+ if (file)
+ break;
+ sleep(1);
+ }
+ ASSERT_NE(file, NULL);
+
+ /* Step 4: Make sure all stack pointer values are non-zero */
+ for (i = 0; -1 != getline(&line, &line_length, file); ++i) {
+ stack = strtoull(line, NULL, 10);
+ ASSERT_NE(stack, 0);
+ }
+
+ ASSERT_EQ(i, 1 + NUM_THREAD_SPAWN);
+
+ fclose(file);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/cpufreq/.gitignore b/tools/testing/selftests/cpufreq/.gitignore
new file mode 100644
index 000000000000..67604e91e068
--- /dev/null
+++ b/tools/testing/selftests/cpufreq/.gitignore
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0-only
+cpufreq_selftest.*
diff --git a/tools/testing/selftests/cpufreq/Makefile b/tools/testing/selftests/cpufreq/Makefile
index c86ca8342222..9b2ccb10b0cf 100644
--- a/tools/testing/selftests/cpufreq/Makefile
+++ b/tools/testing/selftests/cpufreq/Makefile
@@ -3,6 +3,7 @@ all:
TEST_PROGS := main.sh
TEST_FILES := cpu.sh cpufreq.sh governor.sh module.sh special-tests.sh
+EXTRA_CLEAN := cpufreq_selftest.dmesg_cpufreq.txt cpufreq_selftest.dmesg_full.txt cpufreq_selftest.txt
include ../lib.mk
diff --git a/tools/testing/selftests/damon/Makefile b/tools/testing/selftests/damon/Makefile
index 5b2a6a5dd1af..812f656260fb 100644
--- a/tools/testing/selftests/damon/Makefile
+++ b/tools/testing/selftests/damon/Makefile
@@ -6,7 +6,7 @@ TEST_GEN_FILES += debugfs_target_ids_read_before_terminate_race
TEST_GEN_FILES += debugfs_target_ids_pid_leak
TEST_GEN_FILES += access_memory access_memory_even
-TEST_FILES = _chk_dependency.sh _debugfs_common.sh
+TEST_FILES = _chk_dependency.sh _debugfs_common.sh _damon_sysfs.py
# functionality tests
TEST_PROGS = debugfs_attrs.sh debugfs_schemes.sh debugfs_target_ids.sh
diff --git a/tools/testing/selftests/drivers/net/Makefile b/tools/testing/selftests/drivers/net/Makefile
index 0fec8f9801ad..137470bdee0c 100644
--- a/tools/testing/selftests/drivers/net/Makefile
+++ b/tools/testing/selftests/drivers/net/Makefile
@@ -1,15 +1,18 @@
# SPDX-License-Identifier: GPL-2.0
TEST_INCLUDES := $(wildcard lib/py/*.py) \
+ $(wildcard lib/sh/*.sh) \
../../net/net_helper.sh \
../../net/lib.sh \
TEST_PROGS := \
netcons_basic.sh \
+ netcons_overflow.sh \
ping.py \
queues.py \
stats.py \
shaper.py \
+ hds.py \
# end of TEST_PROGS
include ../../lib.mk
diff --git a/tools/testing/selftests/drivers/net/bonding/Makefile b/tools/testing/selftests/drivers/net/bonding/Makefile
index 03a089165d3f..2b10854e4b1e 100644
--- a/tools/testing/selftests/drivers/net/bonding/Makefile
+++ b/tools/testing/selftests/drivers/net/bonding/Makefile
@@ -10,7 +10,7 @@ TEST_PROGS := \
mode-2-recovery-updelay.sh \
bond_options.sh \
bond-eth-type-change.sh \
- bond_macvlan.sh
+ bond_macvlan_ipvlan.sh
TEST_FILES := \
lag_lib.sh \
diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh
deleted file mode 100755
index b609fb6231f4..000000000000
--- a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh
+++ /dev/null
@@ -1,99 +0,0 @@
-#!/bin/bash
-# SPDX-License-Identifier: GPL-2.0
-#
-# Test macvlan over balance-alb
-
-lib_dir=$(dirname "$0")
-source ${lib_dir}/bond_topo_2d1c.sh
-
-m1_ns="m1-$(mktemp -u XXXXXX)"
-m2_ns="m1-$(mktemp -u XXXXXX)"
-m1_ip4="192.0.2.11"
-m1_ip6="2001:db8::11"
-m2_ip4="192.0.2.12"
-m2_ip6="2001:db8::12"
-
-cleanup()
-{
- ip -n ${m1_ns} link del macv0
- ip netns del ${m1_ns}
- ip -n ${m2_ns} link del macv0
- ip netns del ${m2_ns}
-
- client_destroy
- server_destroy
- gateway_destroy
-}
-
-check_connection()
-{
- local ns=${1}
- local target=${2}
- local message=${3:-"macvlan_over_bond"}
- RET=0
-
-
- ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null
- check_err $? "ping failed"
- log_test "$mode: $message"
-}
-
-macvlan_over_bond()
-{
- local param="$1"
- RET=0
-
- # setup new bond mode
- bond_reset "${param}"
-
- ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge
- ip -n ${s_ns} link set macv0 netns ${m1_ns}
- ip -n ${m1_ns} link set dev macv0 up
- ip -n ${m1_ns} addr add ${m1_ip4}/24 dev macv0
- ip -n ${m1_ns} addr add ${m1_ip6}/24 dev macv0
-
- ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge
- ip -n ${s_ns} link set macv0 netns ${m2_ns}
- ip -n ${m2_ns} link set dev macv0 up
- ip -n ${m2_ns} addr add ${m2_ip4}/24 dev macv0
- ip -n ${m2_ns} addr add ${m2_ip6}/24 dev macv0
-
- sleep 2
-
- check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server"
- check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server"
- check_connection "${c_ns}" "${m1_ip4}" "IPv4: client->macvlan_1"
- check_connection "${c_ns}" "${m1_ip6}" "IPv6: client->macvlan_1"
- check_connection "${c_ns}" "${m2_ip4}" "IPv4: client->macvlan_2"
- check_connection "${c_ns}" "${m2_ip6}" "IPv6: client->macvlan_2"
- check_connection "${m1_ns}" "${m2_ip4}" "IPv4: macvlan_1->macvlan_2"
- check_connection "${m1_ns}" "${m2_ip6}" "IPv6: macvlan_1->macvlan_2"
-
-
- sleep 5
-
- check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client"
- check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client"
- check_connection "${m1_ns}" "${c_ip4}" "IPv4: macvlan_1->client"
- check_connection "${m1_ns}" "${c_ip6}" "IPv6: macvlan_1->client"
- check_connection "${m2_ns}" "${c_ip4}" "IPv4: macvlan_2->client"
- check_connection "${m2_ns}" "${c_ip6}" "IPv6: macvlan_2->client"
- check_connection "${m2_ns}" "${m1_ip4}" "IPv4: macvlan_2->macvlan_2"
- check_connection "${m2_ns}" "${m1_ip6}" "IPv6: macvlan_2->macvlan_2"
-
- ip -n ${c_ns} neigh flush dev eth0
-}
-
-trap cleanup EXIT
-
-setup_prepare
-ip netns add ${m1_ns}
-ip netns add ${m2_ns}
-
-modes="active-backup balance-tlb balance-alb"
-
-for mode in $modes; do
- macvlan_over_bond "mode $mode"
-done
-
-exit $EXIT_STATUS
diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh
new file mode 100755
index 000000000000..c4711272fe45
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh
@@ -0,0 +1,96 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# Test macvlan/ipvlan over bond
+
+lib_dir=$(dirname "$0")
+source ${lib_dir}/bond_topo_2d1c.sh
+
+xvlan1_ns="xvlan1-$(mktemp -u XXXXXX)"
+xvlan2_ns="xvlan2-$(mktemp -u XXXXXX)"
+xvlan1_ip4="192.0.2.11"
+xvlan1_ip6="2001:db8::11"
+xvlan2_ip4="192.0.2.12"
+xvlan2_ip6="2001:db8::12"
+
+cleanup()
+{
+ client_destroy
+ server_destroy
+ gateway_destroy
+
+ ip netns del ${xvlan1_ns}
+ ip netns del ${xvlan2_ns}
+}
+
+check_connection()
+{
+ local ns=${1}
+ local target=${2}
+ local message=${3}
+ RET=0
+
+ ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null
+ check_err $? "ping failed"
+ log_test "${bond_mode}/${xvlan_type}_${xvlan_mode}: ${message}"
+}
+
+xvlan_over_bond()
+{
+ local param="$1"
+ local xvlan_type="$2"
+ local xvlan_mode="$3"
+ RET=0
+
+ # setup new bond mode
+ bond_reset "${param}"
+
+ ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode}
+ ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan1_ns}
+ ip -n ${xvlan1_ns} link set dev ${xvlan_type}0 up
+ ip -n ${xvlan1_ns} addr add ${xvlan1_ip4}/24 dev ${xvlan_type}0
+ ip -n ${xvlan1_ns} addr add ${xvlan1_ip6}/24 dev ${xvlan_type}0
+
+ ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode}
+ ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan2_ns}
+ ip -n ${xvlan2_ns} link set dev ${xvlan_type}0 up
+ ip -n ${xvlan2_ns} addr add ${xvlan2_ip4}/24 dev ${xvlan_type}0
+ ip -n ${xvlan2_ns} addr add ${xvlan2_ip6}/24 dev ${xvlan_type}0
+
+ sleep 2
+
+ check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server"
+ check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server"
+ check_connection "${c_ns}" "${xvlan1_ip4}" "IPv4: client->${xvlan_type}_1"
+ check_connection "${c_ns}" "${xvlan1_ip6}" "IPv6: client->${xvlan_type}_1"
+ check_connection "${c_ns}" "${xvlan2_ip4}" "IPv4: client->${xvlan_type}_2"
+ check_connection "${c_ns}" "${xvlan2_ip6}" "IPv6: client->${xvlan_type}_2"
+ check_connection "${xvlan1_ns}" "${xvlan2_ip4}" "IPv4: ${xvlan_type}_1->${xvlan_type}_2"
+ check_connection "${xvlan1_ns}" "${xvlan2_ip6}" "IPv6: ${xvlan_type}_1->${xvlan_type}_2"
+
+ check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client"
+ check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client"
+ check_connection "${xvlan1_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_1->client"
+ check_connection "${xvlan1_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_1->client"
+ check_connection "${xvlan2_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_2->client"
+ check_connection "${xvlan2_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_2->client"
+ check_connection "${xvlan2_ns}" "${xvlan1_ip4}" "IPv4: ${xvlan_type}_2->${xvlan_type}_1"
+ check_connection "${xvlan2_ns}" "${xvlan1_ip6}" "IPv6: ${xvlan_type}_2->${xvlan_type}_1"
+
+ ip -n ${c_ns} neigh flush dev eth0
+}
+
+trap cleanup EXIT
+
+setup_prepare
+ip netns add ${xvlan1_ns}
+ip netns add ${xvlan2_ns}
+
+bond_modes="active-backup balance-tlb balance-alb"
+
+for bond_mode in ${bond_modes}; do
+ xvlan_over_bond "mode ${bond_mode}" macvlan bridge
+ xvlan_over_bond "mode ${bond_mode}" ipvlan l2
+done
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/drivers/net/bonding/config b/tools/testing/selftests/drivers/net/bonding/config
index 899d7fb6ea8e..dad4e5fda4db 100644
--- a/tools/testing/selftests/drivers/net/bonding/config
+++ b/tools/testing/selftests/drivers/net/bonding/config
@@ -3,6 +3,7 @@ CONFIG_BRIDGE=y
CONFIG_DUMMY=y
CONFIG_IPV6=y
CONFIG_MACVLAN=y
+CONFIG_IPVLAN=y
CONFIG_NET_ACT_GACT=y
CONFIG_NET_CLS_FLOWER=y
CONFIG_NET_SCH_INGRESS=y
diff --git a/tools/testing/selftests/drivers/net/hds.py b/tools/testing/selftests/drivers/net/hds.py
new file mode 100755
index 000000000000..394971b25c0b
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/hds.py
@@ -0,0 +1,120 @@
+#!/usr/bin/env python3
+# SPDX-License-Identifier: GPL-2.0
+
+import errno
+from lib.py import ksft_run, ksft_exit, ksft_eq, ksft_raises, KsftSkipEx
+from lib.py import EthtoolFamily, NlError
+from lib.py import NetDrvEnv
+
+def get_hds(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+def get_hds_thresh(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+
+def set_hds_enable(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'enabled'})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("disabling of HDS not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+ ksft_eq('enabled', rings['tcp-data-split'])
+
+def set_hds_disable(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'disabled'})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("disabling of HDS not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+ ksft_eq('disabled', rings['tcp-data-split'])
+
+def set_hds_thresh_zero(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': 0})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("hds-thresh-set not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+
+ ksft_eq(0, rings['hds-thresh'])
+
+def set_hds_thresh_max(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': rings['hds-thresh-max']})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("hds-thresh-set not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ ksft_eq(rings['hds-thresh'], rings['hds-thresh-max'])
+
+def set_hds_thresh_gt(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+ if 'hds-thresh-max' not in rings:
+ raise KsftSkipEx('hds-thresh-max not defined by device')
+ hds_gt = rings['hds-thresh-max'] + 1
+ with ksft_raises(NlError) as e:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': hds_gt})
+ ksft_eq(e.exception.nl_msg.error, -errno.EINVAL)
+
+def main() -> None:
+ with NetDrvEnv(__file__, queue_count=3) as cfg:
+ ksft_run([get_hds,
+ get_hds_thresh,
+ set_hds_disable,
+ set_hds_enable,
+ set_hds_thresh_zero,
+ set_hds_thresh_max,
+ set_hds_thresh_gt],
+ args=(cfg, EthtoolFamily()))
+ ksft_exit()
+
+if __name__ == "__main__":
+ main()
diff --git a/tools/testing/selftests/drivers/net/hw/ncdevmem.c b/tools/testing/selftests/drivers/net/hw/ncdevmem.c
index 8e502a1f8f9b..19a6969643f4 100644
--- a/tools/testing/selftests/drivers/net/hw/ncdevmem.c
+++ b/tools/testing/selftests/drivers/net/hw/ncdevmem.c
@@ -619,9 +619,6 @@ int do_server(struct memory_buffer *mem)
fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n",
page_aligned_frags, non_page_aligned_frags);
- fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n",
- page_aligned_frags, non_page_aligned_frags);
-
cleanup:
free(tmp_mem);
diff --git a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
index 05b6fbb3fcdd..ad192fef3117 100755
--- a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
+++ b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
@@ -21,9 +21,9 @@ def _enable_pp_allocation_fail():
if not os.path.exists("/sys/kernel/debug/fail_function"):
raise KsftSkipEx("Kernel built without function error injection (or DebugFS)")
- if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"):
+ if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"):
with open("/sys/kernel/debug/fail_function/inject", "w") as fp:
- fp.write("page_pool_alloc_pages\n")
+ fp.write("page_pool_alloc_netmems\n")
_write_fail_config({
"verbose": 0,
@@ -37,7 +37,7 @@ def _disable_pp_allocation_fail():
if not os.path.exists("/sys/kernel/debug/fail_function"):
return
- if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"):
+ if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"):
with open("/sys/kernel/debug/fail_function/inject", "w") as fp:
fp.write("\n")
diff --git a/tools/testing/selftests/drivers/net/hw/rss_ctx.py b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
index 0b49ce7ae678..ca8a7edff3dd 100755
--- a/tools/testing/selftests/drivers/net/hw/rss_ctx.py
+++ b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
@@ -3,7 +3,8 @@
import datetime
import random
-from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt
+import re
+from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt, ksft_true
from lib.py import NetDrvEpEnv
from lib.py import EthtoolFamily, NetdevFamily
from lib.py import KsftSkipEx, KsftFailEx
@@ -96,6 +97,13 @@ def _send_traffic_check(cfg, port, name, params):
f"traffic on inactive queues ({name}): " + str(cnts))
+def _ntuple_rule_check(cfg, rule_id, ctx_id):
+ """Check that ntuple rule references RSS context ID"""
+ text = ethtool(f"-n {cfg.ifname} rule {rule_id}").stdout
+ pattern = f"RSS Context (ID: )?{ctx_id}"
+ ksft_true(re.search(pattern, text), "RSS context not referenced in ntuple rule")
+
+
def test_rss_key_indir(cfg):
"""Test basics like updating the main RSS key and indirection table."""
@@ -459,6 +467,8 @@ def test_rss_context(cfg, ctx_cnt=1, create_with_cfg=None):
ntuple = ethtool_create(cfg, "-N", flow)
defer(ethtool, f"-N {cfg.ifname} delete {ntuple}")
+ _ntuple_rule_check(cfg, ntuple, ctx_id)
+
for i in range(ctx_cnt):
_send_traffic_check(cfg, ports[i], f"context {i}",
{ 'target': (2+i*2, 3+i*2),
diff --git a/tools/testing/selftests/drivers/net/lib/py/env.py b/tools/testing/selftests/drivers/net/lib/py/env.py
index 1ea9bb695e94..987e452d3a45 100644
--- a/tools/testing/selftests/drivers/net/lib/py/env.py
+++ b/tools/testing/selftests/drivers/net/lib/py/env.py
@@ -5,7 +5,7 @@ import time
from pathlib import Path
from lib.py import KsftSkipEx, KsftXfailEx
from lib.py import ksft_setup
-from lib.py import cmd, ethtool, ip
+from lib.py import cmd, ethtool, ip, CmdExitFailure
from lib.py import NetNS, NetdevSimDev
from .remote import Remote
@@ -48,6 +48,7 @@ class NetDrvEnv:
else:
self._ns = NetdevSimDev(**kwargs)
self.dev = self._ns.nsims[0].dev
+ self.ifname = self.dev['ifname']
self.ifindex = self.dev['ifindex']
def __enter__(self):
@@ -234,7 +235,12 @@ class NetDrvEpEnv:
Good drivers will tell us via ethtool what their sync period is.
"""
if self._stats_settle_time is None:
- data = ethtool("-c " + self.ifname, json=True)[0]
+ data = {}
+ try:
+ data = ethtool("-c " + self.ifname, json=True)[0]
+ except CmdExitFailure as e:
+ if "Operation not supported" not in e.cmd.stderr:
+ raise
self._stats_settle_time = 0.025 + \
data.get('stats-block-usecs', 0) / 1000 / 1000
diff --git a/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh
new file mode 100644
index 000000000000..3acaba41ac7b
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh
@@ -0,0 +1,225 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+
+# This file contains functions and helpers to support the netconsole
+# selftests
+#
+# Author: Breno Leitao <leitao@debian.org>
+
+set -euo pipefail
+
+LIBDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
+
+SRCIF="" # to be populated later
+SRCIP=192.0.2.1
+DSTIF="" # to be populated later
+DSTIP=192.0.2.2
+
+PORT="6666"
+MSG="netconsole selftest"
+USERDATA_KEY="key"
+USERDATA_VALUE="value"
+TARGET=$(mktemp -u netcons_XXXXX)
+DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk)
+NETCONS_CONFIGFS="/sys/kernel/config/netconsole"
+NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}"
+# NAMESPACE will be populated by setup_ns with a random value
+NAMESPACE=""
+
+# IDs for netdevsim
+NSIM_DEV_1_ID=$((256 + RANDOM % 256))
+NSIM_DEV_2_ID=$((512 + RANDOM % 256))
+NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device"
+
+# Used to create and delete namespaces
+source "${LIBDIR}"/../../../../net/lib.sh
+source "${LIBDIR}"/../../../../net/net_helper.sh
+
+# Create netdevsim interfaces
+create_ifaces() {
+
+ echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW"
+ echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW"
+ udevadm settle 2> /dev/null || true
+
+ local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID"
+ local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID"
+
+ # These are global variables
+ SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \
+ -path "$NSIM1"/net -exec basename {} \;)
+ DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \
+ -path "$NSIM2"/net -exec basename {} \;)
+}
+
+link_ifaces() {
+ local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device"
+ local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex)
+ local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex)
+
+ exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}"
+ exec {INITNS_FD}</proc/self/ns/net
+
+ # Bind the dst interface to namespace
+ ip link set "${DSTIF}" netns "${NAMESPACE}"
+
+ # Linking one device to the other one (on the other namespace}
+ if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK
+ then
+ echo "linking netdevsim1 with netdevsim2 should succeed"
+ cleanup
+ exit "${ksft_skip}"
+ fi
+}
+
+function configure_ip() {
+ # Configure the IPs for both interfaces
+ ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}"
+ ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up
+
+ ip addr add "${SRCIP}"/24 dev "${SRCIF}"
+ ip link set "${SRCIF}" up
+}
+
+function set_network() {
+ # setup_ns function is coming from lib.sh
+ setup_ns NAMESPACE
+
+ # Create both interfaces, and assign the destination to a different
+ # namespace
+ create_ifaces
+
+ # Link both interfaces back to back
+ link_ifaces
+
+ configure_ip
+}
+
+function create_dynamic_target() {
+ DSTMAC=$(ip netns exec "${NAMESPACE}" \
+ ip link show "${DSTIF}" | awk '/ether/ {print $2}')
+
+ # Create a dynamic target
+ mkdir "${NETCONS_PATH}"
+
+ echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip
+ echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip
+ echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac
+ echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name
+
+ echo 1 > "${NETCONS_PATH}"/enabled
+}
+
+function cleanup() {
+ local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device"
+
+ # delete netconsole dynamic reconfiguration
+ echo 0 > "${NETCONS_PATH}"/enabled
+ # Remove all the keys that got created during the selftest
+ find "${NETCONS_PATH}/userdata/" -mindepth 1 -type d -delete
+ # Remove the configfs entry
+ rmdir "${NETCONS_PATH}"
+
+ # Delete netdevsim devices
+ echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL"
+ echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL"
+
+ # this is coming from lib.sh
+ cleanup_all_ns
+
+ # Restoring printk configurations
+ echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk
+}
+
+function set_user_data() {
+ if [[ ! -d "${NETCONS_PATH}""/userdata" ]]
+ then
+ echo "Userdata path not available in ${NETCONS_PATH}/userdata"
+ exit "${ksft_skip}"
+ fi
+
+ KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}"
+ mkdir -p "${KEY_PATH}"
+ VALUE_PATH="${KEY_PATH}""/value"
+ echo "${USERDATA_VALUE}" > "${VALUE_PATH}"
+}
+
+function listen_port_and_save_to() {
+ local OUTPUT=${1}
+ # Just wait for 2 seconds
+ timeout 2 ip netns exec "${NAMESPACE}" \
+ socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}"
+}
+
+function validate_result() {
+ local TMPFILENAME="$1"
+
+ # TMPFILENAME will contain something like:
+ # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM
+ # key=value
+
+ # Check if the file exists
+ if [ ! -f "$TMPFILENAME" ]; then
+ echo "FAIL: File was not generated." >&2
+ exit "${ksft_fail}"
+ fi
+
+ if ! grep -q "${MSG}" "${TMPFILENAME}"; then
+ echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2
+ cat "${TMPFILENAME}" >&2
+ exit "${ksft_fail}"
+ fi
+
+ if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then
+ echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2
+ cat "${TMPFILENAME}" >&2
+ exit "${ksft_fail}"
+ fi
+
+ # Delete the file once it is validated, otherwise keep it
+ # for debugging purposes
+ rm "${TMPFILENAME}"
+ exit "${ksft_pass}"
+}
+
+function check_for_dependencies() {
+ if [ "$(id -u)" -ne 0 ]; then
+ echo "This test must be run as root" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which socat > /dev/null ; then
+ echo "SKIP: socat(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which ip > /dev/null ; then
+ echo "SKIP: ip(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which udevadm > /dev/null ; then
+ echo "SKIP: udevadm(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then
+ echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if [ ! -d "${NETCONS_CONFIGFS}" ]; then
+ echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ip link show "${DSTIF}" 2> /dev/null; then
+ echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then
+ echo "SKIP: IPs already in use. Skipping it" >&2
+ exit "${ksft_skip}"
+ fi
+}
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
index b79542a4dcc7..4a11bf1d514a 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
@@ -12,6 +12,7 @@ ALL_TESTS="
bridge_rif_remaster_port
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
index e28f978104f3..b8bbe94f4736 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
@@ -10,6 +10,7 @@ ALL_TESTS="
lag_rif_nomaster_addr
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
index 6318cfa6434c..d1a9d379eaf3 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
@@ -10,6 +10,7 @@ ALL_TESTS="
lag_rif_nomaster_addr
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
index 0c47faff9274..c068e6c2a580 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
@@ -22,20 +22,34 @@ SB_ITC=0
h1_create()
{
simple_if_init $h1 192.0.1.1/24
+ tc qdisc add dev $h1 clsact
+
+ # Add egress filter on $h1 that will guarantee that the packet sent,
+ # will be the only packet being passed to the device.
+ tc filter add dev $h1 egress pref 2 handle 102 matchall action drop
}
h1_destroy()
{
+ tc filter del dev $h1 egress pref 2 handle 102 matchall action drop
+ tc qdisc del dev $h1 clsact
simple_if_fini $h1 192.0.1.1/24
}
h2_create()
{
simple_if_init $h2 192.0.1.2/24
+ tc qdisc add dev $h2 clsact
+
+ # Add egress filter on $h2 that will guarantee that the packet sent,
+ # will be the only packet being passed to the device.
+ tc filter add dev $h2 egress pref 1 handle 101 matchall action drop
}
h2_destroy()
{
+ tc filter del dev $h2 egress pref 1 handle 101 matchall action drop
+ tc qdisc del dev $h2 clsact
simple_if_fini $h2 192.0.1.2/24
}
@@ -101,6 +115,11 @@ port_pool_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \
@@ -109,11 +128,6 @@ port_pool_test()
devlink sb occupancy snapshot $DEVLINK_DEV
RET=0
- max_occ=$(sb_occ_pool_check $dl_port1 $SB_POOL_ING $exp_max_occ)
- check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress pool"
-
- RET=0
max_occ=$(sb_occ_pool_check $dl_port2 $SB_POOL_ING $exp_max_occ)
check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress pool"
@@ -122,6 +136,11 @@ port_pool_test()
max_occ=$(sb_occ_pool_check $cpu_dl_port $SB_POOL_EGR_CPU $exp_max_occ)
check_err $? "Expected ePool($SB_POOL_EGR_CPU) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress pool"
+
+ tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
}
port_tc_ip_test()
@@ -129,6 +148,11 @@ port_tc_ip_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \
@@ -139,17 +163,17 @@ port_tc_ip_test()
RET=0
max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress TC - IP packet"
-
- RET=0
- max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
- check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress TC - IP packet"
RET=0
max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_IP $exp_max_occ)
check_err $? "Expected egress TC($SB_ITC_CPU_IP) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress TC - IP packet"
+
+ tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
}
port_tc_arp_test()
@@ -157,6 +181,9 @@ port_tc_arp_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol arp pref 1 handle 101 flower \
+ src_mac $h1mac action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -A 192.0.1.1 -t arp -q
@@ -166,17 +193,15 @@ port_tc_arp_test()
RET=0
max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress TC - ARP packet"
-
- RET=0
- max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
- check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress TC - ARP packet"
RET=0
max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_ARP $exp_max_occ)
check_err $? "Expected egress TC($SB_ITC_IP2ME) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress TC - ARP packet"
+
+ tc filter del dev $h1 egress protocol arp pref 1 handle 101 flower \
+ src_mac $h1mac action pass
}
setup_prepare()
diff --git a/tools/testing/selftests/drivers/net/netcons_basic.sh b/tools/testing/selftests/drivers/net/netcons_basic.sh
index b175f4d966e5..fe765da498e8 100755
--- a/tools/testing/selftests/drivers/net/netcons_basic.sh
+++ b/tools/testing/selftests/drivers/net/netcons_basic.sh
@@ -18,224 +18,8 @@ set -euo pipefail
SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
-# Simple script to test dynamic targets in netconsole
-SRCIF="" # to be populated later
-SRCIP=192.0.2.1
-DSTIF="" # to be populated later
-DSTIP=192.0.2.2
+source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh
-PORT="6666"
-MSG="netconsole selftest"
-USERDATA_KEY="key"
-USERDATA_VALUE="value"
-TARGET=$(mktemp -u netcons_XXXXX)
-DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk)
-NETCONS_CONFIGFS="/sys/kernel/config/netconsole"
-NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}"
-KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}"
-# NAMESPACE will be populated by setup_ns with a random value
-NAMESPACE=""
-
-# IDs for netdevsim
-NSIM_DEV_1_ID=$((256 + RANDOM % 256))
-NSIM_DEV_2_ID=$((512 + RANDOM % 256))
-NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device"
-
-# Used to create and delete namespaces
-source "${SCRIPTDIR}"/../../net/lib.sh
-source "${SCRIPTDIR}"/../../net/net_helper.sh
-
-# Create netdevsim interfaces
-create_ifaces() {
-
- echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW"
- echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW"
- udevadm settle 2> /dev/null || true
-
- local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID"
- local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID"
-
- # These are global variables
- SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \
- -path "$NSIM1"/net -exec basename {} \;)
- DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \
- -path "$NSIM2"/net -exec basename {} \;)
-}
-
-link_ifaces() {
- local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device"
- local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex)
- local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex)
-
- exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}"
- exec {INITNS_FD}</proc/self/ns/net
-
- # Bind the dst interface to namespace
- ip link set "${DSTIF}" netns "${NAMESPACE}"
-
- # Linking one device to the other one (on the other namespace}
- if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK
- then
- echo "linking netdevsim1 with netdevsim2 should succeed"
- cleanup
- exit "${ksft_skip}"
- fi
-}
-
-function configure_ip() {
- # Configure the IPs for both interfaces
- ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}"
- ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up
-
- ip addr add "${SRCIP}"/24 dev "${SRCIF}"
- ip link set "${SRCIF}" up
-}
-
-function set_network() {
- # setup_ns function is coming from lib.sh
- setup_ns NAMESPACE
-
- # Create both interfaces, and assign the destination to a different
- # namespace
- create_ifaces
-
- # Link both interfaces back to back
- link_ifaces
-
- configure_ip
-}
-
-function create_dynamic_target() {
- DSTMAC=$(ip netns exec "${NAMESPACE}" \
- ip link show "${DSTIF}" | awk '/ether/ {print $2}')
-
- # Create a dynamic target
- mkdir "${NETCONS_PATH}"
-
- echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip
- echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip
- echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac
- echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name
-
- echo 1 > "${NETCONS_PATH}"/enabled
-}
-
-function cleanup() {
- local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device"
-
- # delete netconsole dynamic reconfiguration
- echo 0 > "${NETCONS_PATH}"/enabled
- # Remove key
- rmdir "${KEY_PATH}"
- # Remove the configfs entry
- rmdir "${NETCONS_PATH}"
-
- # Delete netdevsim devices
- echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL"
- echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL"
-
- # this is coming from lib.sh
- cleanup_all_ns
-
- # Restoring printk configurations
- echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk
-}
-
-function set_user_data() {
- if [[ ! -d "${NETCONS_PATH}""/userdata" ]]
- then
- echo "Userdata path not available in ${NETCONS_PATH}/userdata"
- exit "${ksft_skip}"
- fi
-
- mkdir -p "${KEY_PATH}"
- VALUE_PATH="${KEY_PATH}""/value"
- echo "${USERDATA_VALUE}" > "${VALUE_PATH}"
-}
-
-function listen_port_and_save_to() {
- local OUTPUT=${1}
- # Just wait for 2 seconds
- timeout 2 ip netns exec "${NAMESPACE}" \
- socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}"
-}
-
-function validate_result() {
- local TMPFILENAME="$1"
-
- # TMPFILENAME will contain something like:
- # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM
- # key=value
-
- # Check if the file exists
- if [ ! -f "$TMPFILENAME" ]; then
- echo "FAIL: File was not generated." >&2
- exit "${ksft_fail}"
- fi
-
- if ! grep -q "${MSG}" "${TMPFILENAME}"; then
- echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2
- cat "${TMPFILENAME}" >&2
- exit "${ksft_fail}"
- fi
-
- if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then
- echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2
- cat "${TMPFILENAME}" >&2
- exit "${ksft_fail}"
- fi
-
- # Delete the file once it is validated, otherwise keep it
- # for debugging purposes
- rm "${TMPFILENAME}"
- exit "${ksft_pass}"
-}
-
-function check_for_dependencies() {
- if [ "$(id -u)" -ne 0 ]; then
- echo "This test must be run as root" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which socat > /dev/null ; then
- echo "SKIP: socat(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which ip > /dev/null ; then
- echo "SKIP: ip(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which udevadm > /dev/null ; then
- echo "SKIP: udevadm(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then
- echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2
- exit "${ksft_skip}"
- fi
-
- if [ ! -d "${NETCONS_CONFIGFS}" ]; then
- echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2
- exit "${ksft_skip}"
- fi
-
- if ip link show "${DSTIF}" 2> /dev/null; then
- echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2
- exit "${ksft_skip}"
- fi
-
- if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then
- echo "SKIP: IPs already in use. Skipping it" >&2
- exit "${ksft_skip}"
- fi
-}
-
-# ========== #
-# Start here #
-# ========== #
modprobe netdevsim 2> /dev/null || true
modprobe netconsole 2> /dev/null || true
diff --git a/tools/testing/selftests/drivers/net/netcons_overflow.sh b/tools/testing/selftests/drivers/net/netcons_overflow.sh
new file mode 100755
index 000000000000..29bad56448a2
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/netcons_overflow.sh
@@ -0,0 +1,67 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+
+# This test verifies that users can successfully create up to
+# MAX_USERDATA_ITEMS userdata entries without encountering any failures.
+#
+# Additionally, it tests for expected failure when attempting to exceed this
+# maximum limit.
+#
+# Author: Breno Leitao <leitao@debian.org>
+
+set -euo pipefail
+
+SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
+
+source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh
+# This is coming from netconsole code. Check for it in drivers/net/netconsole.c
+MAX_USERDATA_ITEMS=16
+
+# Function to create userdata entries
+function create_userdata_max_entries() {
+ # All these keys should be created without any error
+ for i in $(seq $MAX_USERDATA_ITEMS)
+ do
+ # USERDATA_KEY is used by set_user_data
+ USERDATA_KEY="key"${i}
+ set_user_data
+ done
+}
+
+# Function to verify the entry limit
+function verify_entry_limit() {
+ # Allowing the test to fail without exiting, since the next command
+ # will fail
+ set +e
+ mkdir "${NETCONS_PATH}/userdata/key_that_will_fail" 2> /dev/null
+ ret="$?"
+ set -e
+ if [ "$ret" -eq 0 ];
+ then
+ echo "Adding more than ${MAX_USERDATA_ITEMS} entries in userdata should fail, but it didn't" >&2
+ ls "${NETCONS_PATH}/userdata/" >&2
+ exit "${ksft_fail}"
+ fi
+}
+
+# ========== #
+# Start here #
+# ========== #
+
+modprobe netdevsim 2> /dev/null || true
+modprobe netconsole 2> /dev/null || true
+
+# Check for basic system dependency and exit if not found
+check_for_dependencies
+
+# Remove the namespace, interfaces and netconsole target on exit
+trap cleanup EXIT
+# Create one namespace and two interfaces
+set_network
+# Create a dynamic target for netconsole
+create_dynamic_target
+# populate the maximum number of supported keys in userdata
+create_userdata_max_entries
+# Verify an additional entry is not allowed
+verify_entry_limit
+exit "${ksft_pass}"
diff --git a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
index fd13c8cfb7a8..b411fe66510f 100755
--- a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
+++ b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
@@ -58,9 +58,12 @@ for root in mq mqprio; do
ethtool -L $NDEV combined 4
n_child_assert 4 "One real queue, rest default"
- # Graft some
- tcq replace parent 100:1 handle 204:
- n_child_assert 3 "Grafted"
+ # Remove real one
+ tcq del parent 100:4 handle 204:
+
+ # Replace default with pfifo
+ tcq replace parent 100:1 handle 205: pfifo limit 1000
+ n_child_assert 3 "Deleting real one, replacing default one with pfifo"
ethtool -L $NDEV combined 1
n_child_assert 1 "Grafted, one"
diff --git a/tools/testing/selftests/drivers/net/queues.py b/tools/testing/selftests/drivers/net/queues.py
index 30f29096e27c..38303da957ee 100755
--- a/tools/testing/selftests/drivers/net/queues.py
+++ b/tools/testing/selftests/drivers/net/queues.py
@@ -1,32 +1,37 @@
#!/usr/bin/env python3
# SPDX-License-Identifier: GPL-2.0
-from lib.py import ksft_run, ksft_exit, ksft_eq, KsftSkipEx
-from lib.py import EthtoolFamily, NetdevFamily
+from lib.py import ksft_disruptive, ksft_exit, ksft_run
+from lib.py import ksft_eq, ksft_raises, KsftSkipEx
+from lib.py import EthtoolFamily, NetdevFamily, NlError
from lib.py import NetDrvEnv
-from lib.py import cmd
+from lib.py import cmd, defer, ip
+import errno
import glob
-def sys_get_queues(ifname) -> int:
- folders = glob.glob(f'/sys/class/net/{ifname}/queues/rx-*')
+def sys_get_queues(ifname, qtype='rx') -> int:
+ folders = glob.glob(f'/sys/class/net/{ifname}/queues/{qtype}-*')
return len(folders)
-def nl_get_queues(cfg, nl):
+def nl_get_queues(cfg, nl, qtype='rx'):
queues = nl.queue_get({'ifindex': cfg.ifindex}, dump=True)
if queues:
- return len([q for q in queues if q['type'] == 'rx'])
+ return len([q for q in queues if q['type'] == qtype])
return None
def get_queues(cfg, nl) -> None:
- queues = nl_get_queues(cfg, nl)
- if not queues:
- raise KsftSkipEx('queue-get not supported by device')
+ snl = NetdevFamily(recv_size=4096)
- expected = sys_get_queues(cfg.dev['ifname'])
- ksft_eq(queues, expected)
+ for qtype in ['rx', 'tx']:
+ queues = nl_get_queues(cfg, snl, qtype)
+ if not queues:
+ raise KsftSkipEx('queue-get not supported by device')
+
+ expected = sys_get_queues(cfg.dev['ifname'], qtype)
+ ksft_eq(queues, expected)
def addremove_queues(cfg, nl) -> None:
@@ -56,9 +61,27 @@ def addremove_queues(cfg, nl) -> None:
ksft_eq(queues, expected)
+@ksft_disruptive
+def check_down(cfg, nl) -> None:
+ # Check the NAPI IDs before interface goes down and hides them
+ napis = nl.napi_get({'ifindex': cfg.ifindex}, dump=True)
+
+ ip(f"link set dev {cfg.dev['ifname']} down")
+ defer(ip, f"link set dev {cfg.dev['ifname']} up")
+
+ with ksft_raises(NlError) as cm:
+ nl.queue_get({'ifindex': cfg.ifindex, 'id': 0, 'type': 'rx'})
+ ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT)
+
+ if napis:
+ with ksft_raises(NlError) as cm:
+ nl.napi_get({'id': napis[0]['id']})
+ ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT)
+
+
def main() -> None:
- with NetDrvEnv(__file__, queue_count=3) as cfg:
- ksft_run([get_queues, addremove_queues], args=(cfg, NetdevFamily()))
+ with NetDrvEnv(__file__, queue_count=100) as cfg:
+ ksft_run([get_queues, addremove_queues, check_down], args=(cfg, NetdevFamily()))
ksft_exit()
diff --git a/tools/testing/selftests/drivers/net/stats.py b/tools/testing/selftests/drivers/net/stats.py
index 63e3c045a3b2..efcc1e10575b 100755
--- a/tools/testing/selftests/drivers/net/stats.py
+++ b/tools/testing/selftests/drivers/net/stats.py
@@ -2,12 +2,15 @@
# SPDX-License-Identifier: GPL-2.0
import errno
+import subprocess
+import time
from lib.py import ksft_run, ksft_exit, ksft_pr
-from lib.py import ksft_ge, ksft_eq, ksft_in, ksft_true, ksft_raises, KsftSkipEx, KsftXfailEx
+from lib.py import ksft_ge, ksft_eq, ksft_is, ksft_in, ksft_lt, ksft_true, ksft_raises
+from lib.py import KsftSkipEx, KsftXfailEx
from lib.py import ksft_disruptive
from lib.py import EthtoolFamily, NetdevFamily, RtnlFamily, NlError
from lib.py import NetDrvEnv
-from lib.py import ip, defer
+from lib.py import cmd, ip, defer
ethnl = EthtoolFamily()
netfam = NetdevFamily()
@@ -110,6 +113,23 @@ def qstat_by_ifindex(cfg) -> None:
ksft_ge(triple[1][key], triple[0][key], comment="bad key: " + key)
ksft_ge(triple[2][key], triple[1][key], comment="bad key: " + key)
+ # Sanity check the dumps
+ queues = NetdevFamily(recv_size=4096).qstats_get({"scope": "queue"}, dump=True)
+ # Reformat the output into {ifindex: {rx: [id, id, ...], tx: [id, id, ...]}}
+ parsed = {}
+ for entry in queues:
+ ifindex = entry["ifindex"]
+ if ifindex not in parsed:
+ parsed[ifindex] = {"rx":[], "tx": []}
+ parsed[ifindex][entry["queue-type"]].append(entry['queue-id'])
+ # Now, validate
+ for ifindex, queues in parsed.items():
+ for qtype in ['rx', 'tx']:
+ ksft_eq(len(queues[qtype]), len(set(queues[qtype])),
+ comment="repeated queue keys")
+ ksft_eq(len(queues[qtype]), max(queues[qtype]) + 1,
+ comment="missing queue keys")
+
# Test invalid dumps
# 0 is invalid
with ksft_raises(NlError) as cm:
@@ -157,10 +177,95 @@ def check_down(cfg) -> None:
netfam.qstats_get({"ifindex": cfg.ifindex, "scope": "queue"}, dump=True)
+def __run_inf_loop(body):
+ body = body.strip()
+ if body[-1] != ';':
+ body += ';'
+
+ return subprocess.Popen(f"while true; do {body} done", shell=True,
+ stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+
+
+def __stats_increase_sanely(old, new) -> None:
+ for k in old.keys():
+ ksft_ge(new[k], old[k])
+ ksft_lt(new[k] - old[k], 1 << 31, comment="likely wrapping error")
+
+
+def procfs_hammer(cfg) -> None:
+ """
+ Reading stats via procfs only holds the RCU lock, which is not an exclusive
+ lock, make sure drivers can handle parallel reads of stats.
+ """
+ one = __run_inf_loop("cat /proc/net/dev")
+ defer(one.kill)
+ two = __run_inf_loop("cat /proc/net/dev")
+ defer(two.kill)
+
+ time.sleep(1)
+ # Make sure the processes are running
+ ksft_is(one.poll(), None)
+ ksft_is(two.poll(), None)
+
+ rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ time.sleep(2)
+ rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ __stats_increase_sanely(rtstat1, rtstat2)
+ # defers will kill the loops
+
+
+@ksft_disruptive
+def procfs_downup_hammer(cfg) -> None:
+ """
+ Reading stats via procfs only holds the RCU lock, drivers often try
+ to sleep when reading the stats, or don't protect against races.
+ """
+ # Max out the queues, we'll flip between max and 1
+ channels = ethnl.channels_get({'header': {'dev-index': cfg.ifindex}})
+ if channels['combined-count'] == 0:
+ rx_type = 'rx'
+ else:
+ rx_type = 'combined'
+ cur_queue_cnt = channels[f'{rx_type}-count']
+ max_queue_cnt = channels[f'{rx_type}-max']
+
+ cmd(f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}")
+ defer(cmd, f"ethtool -L {cfg.ifname} {rx_type} {cur_queue_cnt}")
+
+ # Real test stats
+ stats = __run_inf_loop("cat /proc/net/dev")
+ defer(stats.kill)
+
+ ipset = f"ip link set dev {cfg.ifname}"
+ defer(ip, f"link set dev {cfg.ifname} up")
+ # The "echo -n 1" lets us count iterations below
+ updown = f"{ipset} down; sleep 0.05; {ipset} up; sleep 0.05; " + \
+ f"ethtool -L {cfg.ifname} {rx_type} 1; " + \
+ f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}; " + \
+ "echo -n 1"
+ updown = __run_inf_loop(updown)
+ kill_updown = defer(updown.kill)
+
+ time.sleep(1)
+ # Make sure the processes are running
+ ksft_is(stats.poll(), None)
+ ksft_is(updown.poll(), None)
+
+ rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ # We're looking for crashes, give it extra time
+ time.sleep(9)
+ rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ __stats_increase_sanely(rtstat1, rtstat2)
+
+ kill_updown.exec()
+ stdout, _ = updown.communicate(timeout=5)
+ ksft_pr("completed up/down cycles:", len(stdout.decode('utf-8')))
+
+
def main() -> None:
- with NetDrvEnv(__file__) as cfg:
+ with NetDrvEnv(__file__, queue_count=100) as cfg:
ksft_run([check_pause, check_fec, pkt_byte_sum, qstat_by_ifindex,
- check_down],
+ check_down, procfs_hammer, procfs_downup_hammer],
args=(cfg, ))
ksft_exit()
diff --git a/tools/testing/selftests/exec/.gitignore b/tools/testing/selftests/exec/.gitignore
index a0dc5d4bf733..7f3d1ae762ec 100644
--- a/tools/testing/selftests/exec/.gitignore
+++ b/tools/testing/selftests/exec/.gitignore
@@ -9,9 +9,13 @@ execveat.ephemeral
execveat.denatured
non-regular
null-argv
+/check-exec
+/false
+/inc
/load_address.*
!load_address.c
/recursion-depth
+/set-exec
xxxxxxxx*
pipe
S_I*.test
diff --git a/tools/testing/selftests/exec/Makefile b/tools/testing/selftests/exec/Makefile
index ba012bc5aab9..45a3cfc435cf 100644
--- a/tools/testing/selftests/exec/Makefile
+++ b/tools/testing/selftests/exec/Makefile
@@ -1,26 +1,33 @@
# SPDX-License-Identifier: GPL-2.0
CFLAGS = -Wall
CFLAGS += -Wno-nonnull
+CFLAGS += $(KHDR_INCLUDES)
+
+LDLIBS += -lcap
ALIGNS := 0x1000 0x200000 0x1000000
ALIGN_PIES := $(patsubst %,load_address.%,$(ALIGNS))
ALIGN_STATIC_PIES := $(patsubst %,load_address.static.%,$(ALIGNS))
ALIGNMENT_TESTS := $(ALIGN_PIES) $(ALIGN_STATIC_PIES)
-TEST_PROGS := binfmt_script.py
+TEST_PROGS := binfmt_script.py check-exec-tests.sh
TEST_GEN_PROGS := execveat non-regular $(ALIGNMENT_TESTS)
+TEST_GEN_PROGS_EXTENDED := false inc set-exec script-exec.inc script-noexec.inc
TEST_GEN_FILES := execveat.symlink execveat.denatured script subdir
# Makefile is a run-time dependency, since it's accessed by the execveat test
TEST_FILES := Makefile
TEST_GEN_PROGS += recursion-depth
TEST_GEN_PROGS += null-argv
+TEST_GEN_PROGS += check-exec
EXTRA_CLEAN := $(OUTPUT)/subdir.moved $(OUTPUT)/execveat.moved $(OUTPUT)/xxxxx* \
$(OUTPUT)/S_I*.test
include ../lib.mk
+CHECK_EXEC_SAMPLES := $(top_srcdir)/samples/check-exec
+
$(OUTPUT)/subdir:
mkdir -p $@
$(OUTPUT)/script: Makefile
@@ -38,3 +45,13 @@ $(OUTPUT)/load_address.0x%: load_address.c
$(OUTPUT)/load_address.static.0x%: load_address.c
$(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \
-fPIE -static-pie $< -o $@
+$(OUTPUT)/false: false.c
+ $(CC) $(CFLAGS) $(LDFLAGS) -static $< -o $@
+$(OUTPUT)/inc: $(CHECK_EXEC_SAMPLES)/inc.c
+ $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@
+$(OUTPUT)/set-exec: $(CHECK_EXEC_SAMPLES)/set-exec.c
+ $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@
+$(OUTPUT)/script-exec.inc: $(CHECK_EXEC_SAMPLES)/script-exec.inc
+ cp $< $@
+$(OUTPUT)/script-noexec.inc: $(CHECK_EXEC_SAMPLES)/script-noexec.inc
+ cp $< $@
diff --git a/tools/testing/selftests/exec/check-exec-tests.sh b/tools/testing/selftests/exec/check-exec-tests.sh
new file mode 100755
index 000000000000..87102906ae3c
--- /dev/null
+++ b/tools/testing/selftests/exec/check-exec-tests.sh
@@ -0,0 +1,205 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# Test the "inc" interpreter.
+#
+# See include/uapi/linux/securebits.h, include/uapi/linux/fcntl.h and
+# samples/check-exec/inc.c
+#
+# Copyright © 2024 Microsoft Corporation
+
+set -u -e -o pipefail
+
+EXPECTED_OUTPUT="1"
+exec 2>/dev/null
+
+DIR="$(dirname $(readlink -f "$0"))"
+source "${DIR}"/../kselftest/ktap_helpers.sh
+
+exec_direct() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Updates PATH for `env` to execute the `inc` interpreter.
+ out="$(PATH="." "$@" "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for direct file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for direct file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_indirect() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Script passed as argument.
+ out="$("$@" ./inc "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for indirect file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for indirect file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_stdin_reg() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Executing stdin must be allowed if the related file is executable.
+ out="$("$@" ./inc -i < "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for stdin regular file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for stdin regular file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_stdin_pipe() {
+ local expect="$1"
+ shift
+ local ret=0
+ local out
+
+ # A pipe is not executable.
+ out="$(cat script-exec.inc | "$@" ./inc -i)" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for stdin pipe execution: ${ret}"
+ return 1
+ fi
+}
+
+exec_argument() {
+ local expect="$1"
+ local ret=0
+ shift
+ local out
+
+ # Script not coming from a file must not be executed.
+ out="$("$@" ./inc -c "$(< script-exec.inc)")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for arbitrary argument execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for arbitrary argument execution: ${out}"
+ return 1
+ fi
+}
+
+exec_interactive() {
+ exec_stdin_pipe "$@"
+ exec_argument "$@"
+}
+
+ktap_test() {
+ ktap_test_result "$*" "$@"
+}
+
+ktap_print_header
+ktap_set_plan 28
+
+# Without secbit configuration, nothing is changed.
+
+ktap_print_msg "By default, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc
+ktap_test exec_indirect 0 script-exec.inc
+
+ktap_print_msg "By default, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc
+
+ktap_print_msg "By default, non-executable scripts are allowed to be interpreted, but not directly executed."
+# We get 126 because of direct execution by Bash.
+ktap_test exec_direct 126 script-noexec.inc
+ktap_test exec_indirect 0 script-noexec.inc
+
+ktap_print_msg "By default, non-executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-noexec.inc
+
+ktap_print_msg "By default, interactive commands are allowed to be interpreted."
+ktap_test exec_interactive 0
+
+# With only file restriction: protect non-malicious users from inadvertent errors (e.g. python ~/Downloads/*.py).
+
+ktap_print_msg "With -f, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -f --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, non-executable scripts are not allowed to be executed nor interpreted."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -f --
+ktap_test exec_indirect 1 script-noexec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, non-executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-noexec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, interactive commands are allowed to be interpreted."
+ktap_test exec_interactive 0 ./set-exec -f --
+
+# With only denied interactive commands: check or monitor script content (e.g. with LSM).
+
+ktap_print_msg "With -i, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -i --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, non-executable scripts are allowed to be interpreted, but not directly executed."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -i --
+ktap_test exec_indirect 0 script-noexec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, non-executable stdin is not allowed to be interpreted."
+ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, interactive commands are not allowed to be interpreted."
+ktap_test exec_interactive 1 ./set-exec -i --
+
+# With both file restriction and denied interactive commands: only allow executable scripts.
+
+ktap_print_msg "With -fi, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -fi --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, non-executable scripts are not allowed to be interpreted nor executed."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -fi --
+ktap_test exec_indirect 1 script-noexec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, non-executable stdin is not allowed to be interpreted."
+ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, interactive commands are not allowed to be interpreted."
+ktap_test exec_interactive 1 ./set-exec -fi --
+
+ktap_finished
diff --git a/tools/testing/selftests/exec/check-exec.c b/tools/testing/selftests/exec/check-exec.c
new file mode 100644
index 000000000000..4d3f4525e1e1
--- /dev/null
+++ b/tools/testing/selftests/exec/check-exec.c
@@ -0,0 +1,456 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Test execveat(2) with AT_EXECVE_CHECK, and prctl(2) with
+ * SECBIT_EXEC_RESTRICT_FILE, SECBIT_EXEC_DENY_INTERACTIVE, and their locked
+ * counterparts.
+ *
+ * Copyright © 2018-2020 ANSSI
+ * Copyright © 2024 Microsoft Corporation
+ *
+ * Author: Mickaël Salaün <mic@digikod.net>
+ */
+
+#include <asm-generic/unistd.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <linux/prctl.h>
+#include <linux/securebits.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <sys/capability.h>
+#include <sys/mount.h>
+#include <sys/prctl.h>
+#include <sys/socket.h>
+#include <sys/stat.h>
+#include <sys/sysmacros.h>
+#include <unistd.h>
+
+/* Defines AT_EXECVE_CHECK without type conflicts. */
+#define _ASM_GENERIC_FCNTL_H
+#include <linux/fcntl.h>
+
+#include "../kselftest_harness.h"
+
+static void drop_privileges(struct __test_metadata *const _metadata)
+{
+ const unsigned int noroot = SECBIT_NOROOT | SECBIT_NOROOT_LOCKED;
+ cap_t cap_p;
+
+ if ((cap_get_secbits() & noroot) != noroot)
+ EXPECT_EQ(0, cap_set_secbits(noroot));
+
+ cap_p = cap_get_proc();
+ EXPECT_NE(NULL, cap_p);
+ EXPECT_NE(-1, cap_clear(cap_p));
+
+ /*
+ * Drops everything, especially CAP_SETPCAP, CAP_DAC_OVERRIDE, and
+ * CAP_DAC_READ_SEARCH.
+ */
+ EXPECT_NE(-1, cap_set_proc(cap_p));
+ EXPECT_NE(-1, cap_free(cap_p));
+}
+
+static int test_secbits_set(const unsigned int secbits)
+{
+ int err;
+
+ err = prctl(PR_SET_SECUREBITS, secbits);
+ if (err)
+ return errno;
+ return 0;
+}
+
+FIXTURE(access)
+{
+ int memfd, pipefd;
+ int pipe_fds[2], socket_fds[2];
+};
+
+FIXTURE_VARIANT(access)
+{
+ const bool mount_exec;
+ const bool file_exec;
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_exec_file_exec) {
+ /* clang-format on */
+ .mount_exec = true,
+ .file_exec = true,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_exec_file_noexec) {
+ /* clang-format on */
+ .mount_exec = true,
+ .file_exec = false,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_noexec_file_exec) {
+ /* clang-format on */
+ .mount_exec = false,
+ .file_exec = true,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_noexec_file_noexec) {
+ /* clang-format on */
+ .mount_exec = false,
+ .file_exec = false,
+};
+
+static const char binary_path[] = "./false";
+static const char workdir_path[] = "./test-mount";
+static const char reg_file_path[] = "./test-mount/regular_file";
+static const char dir_path[] = "./test-mount/directory";
+static const char block_dev_path[] = "./test-mount/block_device";
+static const char char_dev_path[] = "./test-mount/character_device";
+static const char fifo_path[] = "./test-mount/fifo";
+
+FIXTURE_SETUP(access)
+{
+ int procfd_path_size;
+ static const char path_template[] = "/proc/self/fd/%d";
+ char procfd_path[sizeof(path_template) + 10];
+
+ /* Makes sure we are not already restricted nor locked. */
+ EXPECT_EQ(0, test_secbits_set(0));
+
+ /*
+ * Cleans previous workspace if any error previously happened (don't
+ * check errors).
+ */
+ umount(workdir_path);
+ rmdir(workdir_path);
+
+ /* Creates a clean mount point. */
+ ASSERT_EQ(0, mkdir(workdir_path, 00700));
+ ASSERT_EQ(0, mount("test", workdir_path, "tmpfs",
+ MS_MGC_VAL | (variant->mount_exec ? 0 : MS_NOEXEC),
+ "mode=0700,size=9m"));
+
+ /* Creates a regular file. */
+ ASSERT_EQ(0, mknod(reg_file_path,
+ S_IFREG | (variant->file_exec ? 0700 : 0600), 0));
+ /* Creates a directory. */
+ ASSERT_EQ(0, mkdir(dir_path, variant->file_exec ? 0700 : 0600));
+ /* Creates a character device: /dev/null. */
+ ASSERT_EQ(0, mknod(char_dev_path, S_IFCHR | 0400, makedev(1, 3)));
+ /* Creates a block device: /dev/loop0 */
+ ASSERT_EQ(0, mknod(block_dev_path, S_IFBLK | 0400, makedev(7, 0)));
+ /* Creates a fifo. */
+ ASSERT_EQ(0, mknod(fifo_path, S_IFIFO | 0600, 0));
+
+ /* Creates a regular file without user mount point. */
+ self->memfd = memfd_create("test-exec-probe", MFD_CLOEXEC);
+ ASSERT_LE(0, self->memfd);
+ /* Sets mode, which must be ignored by the exec check. */
+ ASSERT_EQ(0, fchmod(self->memfd, variant->file_exec ? 0700 : 0600));
+
+ /* Creates a pipefs file descriptor. */
+ ASSERT_EQ(0, pipe(self->pipe_fds));
+ procfd_path_size = snprintf(procfd_path, sizeof(procfd_path),
+ path_template, self->pipe_fds[0]);
+ ASSERT_LT(procfd_path_size, sizeof(procfd_path));
+ self->pipefd = open(procfd_path, O_RDWR | O_CLOEXEC);
+ ASSERT_LE(0, self->pipefd);
+ ASSERT_EQ(0, fchmod(self->pipefd, variant->file_exec ? 0700 : 0600));
+
+ /* Creates a socket file descriptor. */
+ ASSERT_EQ(0, socketpair(AF_UNIX, SOCK_DGRAM | SOCK_CLOEXEC, 0,
+ self->socket_fds));
+}
+
+FIXTURE_TEARDOWN_PARENT(access)
+{
+ /* There is no need to unlink the test files. */
+ EXPECT_EQ(0, umount(workdir_path));
+ EXPECT_EQ(0, rmdir(workdir_path));
+}
+
+static void fill_exec_fd(struct __test_metadata *_metadata, const int fd_out)
+{
+ char buf[1024];
+ size_t len;
+ int fd_in;
+
+ fd_in = open(binary_path, O_CLOEXEC | O_RDONLY);
+ ASSERT_LE(0, fd_in);
+ /* Cannot use copy_file_range(2) because of EXDEV. */
+ len = read(fd_in, buf, sizeof(buf));
+ EXPECT_LE(0, len);
+ while (len > 0) {
+ EXPECT_EQ(len, write(fd_out, buf, len))
+ {
+ TH_LOG("Failed to write: %s (%d)", strerror(errno),
+ errno);
+ }
+ len = read(fd_in, buf, sizeof(buf));
+ EXPECT_LE(0, len);
+ }
+ EXPECT_EQ(0, close(fd_in));
+}
+
+static void fill_exec_path(struct __test_metadata *_metadata,
+ const char *const path)
+{
+ int fd_out;
+
+ fd_out = open(path, O_CLOEXEC | O_WRONLY);
+ ASSERT_LE(0, fd_out)
+ {
+ TH_LOG("Failed to open %s: %s", path, strerror(errno));
+ }
+ fill_exec_fd(_metadata, fd_out);
+ EXPECT_EQ(0, close(fd_out));
+}
+
+static void test_exec_fd(struct __test_metadata *_metadata, const int fd,
+ const int err_code)
+{
+ char *const argv[] = { "", NULL };
+ int access_ret, access_errno;
+
+ /*
+ * If we really execute fd, filled with the "false" binary, the current
+ * thread will exits with an error, which will be interpreted by the
+ * test framework as an error. With AT_EXECVE_CHECK, we only check a
+ * potential successful execution.
+ */
+ access_ret =
+ execveat(fd, "", argv, NULL, AT_EMPTY_PATH | AT_EXECVE_CHECK);
+ access_errno = errno;
+ if (err_code) {
+ EXPECT_EQ(-1, access_ret);
+ EXPECT_EQ(err_code, access_errno)
+ {
+ TH_LOG("Wrong error for execveat(2): %s (%d)",
+ strerror(access_errno), errno);
+ }
+ } else {
+ EXPECT_EQ(0, access_ret)
+ {
+ TH_LOG("Access denied: %s", strerror(access_errno));
+ }
+ }
+}
+
+static void test_exec_path(struct __test_metadata *_metadata,
+ const char *const path, const int err_code)
+{
+ int flags = O_CLOEXEC;
+ int fd;
+
+ /* Do not block on pipes. */
+ if (path == fifo_path)
+ flags |= O_NONBLOCK;
+
+ fd = open(path, flags | O_RDONLY);
+ ASSERT_LE(0, fd)
+ {
+ TH_LOG("Failed to open %s: %s", path, strerror(errno));
+ }
+ test_exec_fd(_metadata, fd, err_code);
+ EXPECT_EQ(0, close(fd));
+}
+
+/* Tests that we don't get ENOEXEC. */
+TEST_F(access, regular_file_empty)
+{
+ const int exec = variant->mount_exec && variant->file_exec;
+
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+}
+
+TEST_F(access, regular_file_elf)
+{
+ const int exec = variant->mount_exec && variant->file_exec;
+
+ fill_exec_path(_metadata, reg_file_path);
+
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+}
+
+/* Tests that we don't get ENOEXEC. */
+TEST_F(access, memfd_empty)
+{
+ const int exec = variant->file_exec;
+
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+}
+
+TEST_F(access, memfd_elf)
+{
+ const int exec = variant->file_exec;
+
+ fill_exec_fd(_metadata, self->memfd);
+
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+}
+
+TEST_F(access, non_regular_files)
+{
+ test_exec_path(_metadata, dir_path, EACCES);
+ test_exec_path(_metadata, block_dev_path, EACCES);
+ test_exec_path(_metadata, char_dev_path, EACCES);
+ test_exec_path(_metadata, fifo_path, EACCES);
+ test_exec_fd(_metadata, self->socket_fds[0], EACCES);
+ test_exec_fd(_metadata, self->pipefd, EACCES);
+}
+
+/* clang-format off */
+FIXTURE(secbits) {};
+/* clang-format on */
+
+FIXTURE_VARIANT(secbits)
+{
+ const bool is_privileged;
+ const int error;
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(secbits, priv) {
+ /* clang-format on */
+ .is_privileged = true,
+ .error = 0,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(secbits, unpriv) {
+ /* clang-format on */
+ .is_privileged = false,
+ .error = EPERM,
+};
+
+FIXTURE_SETUP(secbits)
+{
+ /* Makes sure no exec bits are set. */
+ EXPECT_EQ(0, test_secbits_set(0));
+ EXPECT_EQ(0, prctl(PR_GET_SECUREBITS));
+
+ if (!variant->is_privileged)
+ drop_privileges(_metadata);
+}
+
+FIXTURE_TEARDOWN(secbits)
+{
+}
+
+TEST_F(secbits, legacy)
+{
+ EXPECT_EQ(variant->error, test_secbits_set(0));
+}
+
+#define CHILD(...) \
+ do { \
+ pid_t child = vfork(); \
+ EXPECT_LE(0, child); \
+ if (child == 0) { \
+ __VA_ARGS__; \
+ _exit(0); \
+ } \
+ } while (0)
+
+TEST_F(secbits, exec)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+
+ secbits &= ~(SECBIT_EXEC_RESTRICT_FILE | SECBIT_EXEC_DENY_INTERACTIVE);
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+}
+
+TEST_F(secbits, check_locked_set)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock set but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, check_locked_unset)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock unset but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, restrict_locked_set)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock set but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, restrict_locked_unset)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock unset but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/exec/config b/tools/testing/selftests/exec/config
new file mode 100644
index 000000000000..c308079867b3
--- /dev/null
+++ b/tools/testing/selftests/exec/config
@@ -0,0 +1,2 @@
+CONFIG_BLK_DEV=y
+CONFIG_BLK_DEV_LOOP=y
diff --git a/tools/testing/selftests/exec/execveat.c b/tools/testing/selftests/exec/execveat.c
index 071e03532cba..8fb7395fd35b 100644
--- a/tools/testing/selftests/exec/execveat.c
+++ b/tools/testing/selftests/exec/execveat.c
@@ -23,9 +23,11 @@
#include "../kselftest.h"
-#define TESTS_EXPECTED 51
+#define TESTS_EXPECTED 54
#define TEST_NAME_LEN (PATH_MAX * 4)
+#define CHECK_COMM "CHECK_COMM"
+
static char longpath[2 * PATH_MAX] = "";
static char *envp[] = { "IN_TEST=yes", NULL, NULL };
static char *argv[] = { "execveat", "99", NULL };
@@ -237,6 +239,29 @@ static int check_execveat_pathmax(int root_dfd, const char *src, int is_script)
return fail;
}
+static int check_execveat_comm(int fd, char *argv0, char *expected)
+{
+ char buf[128], *old_env, *old_argv0;
+ int ret;
+
+ snprintf(buf, sizeof(buf), CHECK_COMM "=%s", expected);
+
+ old_env = envp[1];
+ envp[1] = buf;
+
+ old_argv0 = argv[0];
+ argv[0] = argv0;
+
+ ksft_print_msg("Check execveat(AT_EMPTY_PATH)'s comm is %s\n",
+ expected);
+ ret = check_execveat_invoked_rc(fd, "", AT_EMPTY_PATH, 0, 0);
+
+ envp[1] = old_env;
+ argv[0] = old_argv0;
+
+ return ret;
+}
+
static int run_tests(void)
{
int fail = 0;
@@ -389,6 +414,14 @@ static int run_tests(void)
fail += check_execveat_pathmax(root_dfd, "execveat", 0);
fail += check_execveat_pathmax(root_dfd, "script", 1);
+
+ /* /proc/pid/comm gives filename by default */
+ fail += check_execveat_comm(fd, "sentinel", "execveat");
+ /* /proc/pid/comm gives argv[0] when invoked via link */
+ fail += check_execveat_comm(fd_symlink, "sentinel", "execveat");
+ /* /proc/pid/comm gives filename if NULL is passed */
+ fail += check_execveat_comm(fd, NULL, "execveat");
+
return fail;
}
@@ -415,9 +448,13 @@ int main(int argc, char **argv)
int ii;
int rc;
const char *verbose = getenv("VERBOSE");
+ const char *check_comm = getenv(CHECK_COMM);
- if (argc >= 2) {
- /* If we are invoked with an argument, don't run tests. */
+ if (argc >= 2 || check_comm) {
+ /*
+ * If we are invoked with an argument, or no arguments but a
+ * command to check, don't run tests.
+ */
const char *in_test = getenv("IN_TEST");
if (verbose) {
@@ -426,6 +463,38 @@ int main(int argc, char **argv)
ksft_print_msg("\t[%d]='%s\n'", ii, argv[ii]);
}
+ /* If the tests wanted us to check the command, do so. */
+ if (check_comm) {
+ /* TASK_COMM_LEN == 16 */
+ char buf[32];
+ int fd, ret;
+
+ fd = open("/proc/self/comm", O_RDONLY);
+ if (fd < 0) {
+ ksft_perror("open() comm failed");
+ exit(1);
+ }
+
+ ret = read(fd, buf, sizeof(buf));
+ if (ret < 0) {
+ ksft_perror("read() comm failed");
+ close(fd);
+ exit(1);
+ }
+ close(fd);
+
+ // trim off the \n
+ buf[ret-1] = 0;
+
+ if (strcmp(buf, check_comm)) {
+ ksft_print_msg("bad comm, got: %s expected: %s\n",
+ buf, check_comm);
+ exit(1);
+ }
+
+ exit(0);
+ }
+
/* Check expected environment transferred. */
if (!in_test || strcmp(in_test, "yes") != 0) {
ksft_print_msg("no IN_TEST=yes in env\n");
diff --git a/tools/testing/selftests/exec/false.c b/tools/testing/selftests/exec/false.c
new file mode 100644
index 000000000000..104383ec3a79
--- /dev/null
+++ b/tools/testing/selftests/exec/false.c
@@ -0,0 +1,5 @@
+// SPDX-License-Identifier: GPL-2.0
+int main(void)
+{
+ return 1;
+}
diff --git a/tools/testing/selftests/nsfs/.gitignore b/tools/testing/selftests/filesystems/nsfs/.gitignore
index ed79ebdf286e..92a8249006d1 100644
--- a/tools/testing/selftests/nsfs/.gitignore
+++ b/tools/testing/selftests/filesystems/nsfs/.gitignore
@@ -1,3 +1,4 @@
# SPDX-License-Identifier: GPL-2.0-only
owner
pidns
+iterate_mntns
diff --git a/tools/testing/selftests/nsfs/Makefile b/tools/testing/selftests/filesystems/nsfs/Makefile
index dd9bd50b7b93..231aaa7dfd95 100644
--- a/tools/testing/selftests/nsfs/Makefile
+++ b/tools/testing/selftests/filesystems/nsfs/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0-only
-TEST_GEN_PROGS := owner pidns
+TEST_GEN_PROGS := owner pidns iterate_mntns
CFLAGS := -Wall -Werror
-include ../lib.mk
+include ../../lib.mk
diff --git a/tools/testing/selftests/nsfs/config b/tools/testing/selftests/filesystems/nsfs/config
index 598d0a225fc9..598d0a225fc9 100644
--- a/tools/testing/selftests/nsfs/config
+++ b/tools/testing/selftests/filesystems/nsfs/config
diff --git a/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c
new file mode 100644
index 000000000000..457cf76f3c5f
--- /dev/null
+++ b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c
@@ -0,0 +1,149 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "../../kselftest_harness.h"
+
+#define MNT_NS_COUNT 11
+#define MNT_NS_LAST_INDEX 10
+
+struct mnt_ns_info {
+ __u32 size;
+ __u32 nr_mounts;
+ __u64 mnt_ns_id;
+};
+
+#define MNT_NS_INFO_SIZE_VER0 16 /* size of first published struct */
+
+/* Get information about namespace. */
+#define NS_MNT_GET_INFO _IOR(0xb7, 10, struct mnt_ns_info)
+/* Get next namespace. */
+#define NS_MNT_GET_NEXT _IOR(0xb7, 11, struct mnt_ns_info)
+/* Get previous namespace. */
+#define NS_MNT_GET_PREV _IOR(0xb7, 12, struct mnt_ns_info)
+
+FIXTURE(iterate_mount_namespaces) {
+ int fd_mnt_ns[MNT_NS_COUNT];
+ __u64 mnt_ns_id[MNT_NS_COUNT];
+};
+
+FIXTURE_SETUP(iterate_mount_namespaces)
+{
+ for (int i = 0; i < MNT_NS_COUNT; i++)
+ self->fd_mnt_ns[i] = -EBADF;
+
+ /*
+ * Creating a new user namespace let's us guarantee that we only see
+ * mount namespaces that we did actually create.
+ */
+ ASSERT_EQ(unshare(CLONE_NEWUSER), 0);
+
+ for (int i = 0; i < MNT_NS_COUNT; i++) {
+ struct mnt_ns_info info = {};
+
+ ASSERT_EQ(unshare(CLONE_NEWNS), 0);
+ self->fd_mnt_ns[i] = open("/proc/self/ns/mnt", O_RDONLY | O_CLOEXEC);
+ ASSERT_GE(self->fd_mnt_ns[i], 0);
+ ASSERT_EQ(ioctl(self->fd_mnt_ns[i], NS_MNT_GET_INFO, &info), 0);
+ self->mnt_ns_id[i] = info.mnt_ns_id;
+ }
+}
+
+FIXTURE_TEARDOWN(iterate_mount_namespaces)
+{
+ for (int i = 0; i < MNT_NS_COUNT; i++) {
+ if (self->fd_mnt_ns[i] < 0)
+ continue;
+ ASSERT_EQ(close(self->fd_mnt_ns[i]), 0);
+ }
+}
+
+TEST_F(iterate_mount_namespaces, iterate_all_forward)
+{
+ int fd_mnt_ns_cur, count = 0;
+
+ fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[0], F_DUPFD_CLOEXEC);
+ ASSERT_GE(fd_mnt_ns_cur, 0);
+
+ for (;; count++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_next;
+
+ fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info);
+ if (fd_mnt_ns_next < 0 && errno == ENOENT)
+ break;
+ ASSERT_GE(fd_mnt_ns_next, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_next;
+ }
+ ASSERT_EQ(count, MNT_NS_LAST_INDEX);
+}
+
+TEST_F(iterate_mount_namespaces, iterate_all_backwards)
+{
+ int fd_mnt_ns_cur, count = 0;
+
+ fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[MNT_NS_LAST_INDEX], F_DUPFD_CLOEXEC);
+ ASSERT_GE(fd_mnt_ns_cur, 0);
+
+ for (;; count++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_prev;
+
+ fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info);
+ if (fd_mnt_ns_prev < 0 && errno == ENOENT)
+ break;
+ ASSERT_GE(fd_mnt_ns_prev, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_prev;
+ }
+ ASSERT_EQ(count, MNT_NS_LAST_INDEX);
+}
+
+TEST_F(iterate_mount_namespaces, iterate_forward)
+{
+ int fd_mnt_ns_cur;
+
+ ASSERT_EQ(setns(self->fd_mnt_ns[0], CLONE_NEWNS), 0);
+
+ fd_mnt_ns_cur = self->fd_mnt_ns[0];
+ for (int i = 1; i < MNT_NS_COUNT; i++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_next;
+
+ fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info);
+ ASSERT_GE(fd_mnt_ns_next, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_next;
+ ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]);
+ }
+}
+
+TEST_F(iterate_mount_namespaces, iterate_backward)
+{
+ int fd_mnt_ns_cur;
+
+ ASSERT_EQ(setns(self->fd_mnt_ns[MNT_NS_LAST_INDEX], CLONE_NEWNS), 0);
+
+ fd_mnt_ns_cur = self->fd_mnt_ns[MNT_NS_LAST_INDEX];
+ for (int i = MNT_NS_LAST_INDEX - 1; i >= 0; i--) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_prev;
+
+ fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info);
+ ASSERT_GE(fd_mnt_ns_prev, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_prev;
+ ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]);
+ }
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/nsfs/owner.c b/tools/testing/selftests/filesystems/nsfs/owner.c
index 96a976c74550..96a976c74550 100644
--- a/tools/testing/selftests/nsfs/owner.c
+++ b/tools/testing/selftests/filesystems/nsfs/owner.c
diff --git a/tools/testing/selftests/nsfs/pidns.c b/tools/testing/selftests/filesystems/nsfs/pidns.c
index e3c772c6a7c7..e3c772c6a7c7 100644
--- a/tools/testing/selftests/nsfs/pidns.c
+++ b/tools/testing/selftests/filesystems/nsfs/pidns.c
diff --git a/tools/testing/selftests/filesystems/statmount/.gitignore b/tools/testing/selftests/filesystems/statmount/.gitignore
index 82a4846cbc4b..973363ad66a2 100644
--- a/tools/testing/selftests/filesystems/statmount/.gitignore
+++ b/tools/testing/selftests/filesystems/statmount/.gitignore
@@ -1,2 +1,3 @@
# SPDX-License-Identifier: GPL-2.0-only
+statmount_test_ns
/*_test
diff --git a/tools/testing/selftests/filesystems/statmount/Makefile b/tools/testing/selftests/filesystems/statmount/Makefile
index 3af3136e35a4..14ee91a41650 100644
--- a/tools/testing/selftests/filesystems/statmount/Makefile
+++ b/tools/testing/selftests/filesystems/statmount/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0-or-later
CFLAGS += -Wall -O2 -g $(KHDR_INCLUDES)
-TEST_GEN_PROGS := statmount_test statmount_test_ns
+TEST_GEN_PROGS := statmount_test statmount_test_ns listmount_test
include ../../lib.mk
diff --git a/tools/testing/selftests/filesystems/statmount/listmount_test.c b/tools/testing/selftests/filesystems/statmount/listmount_test.c
new file mode 100644
index 000000000000..15f0834f7557
--- /dev/null
+++ b/tools/testing/selftests/filesystems/statmount/listmount_test.c
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "statmount.h"
+#include "../../kselftest_harness.h"
+
+#ifndef LISTMOUNT_REVERSE
+#define LISTMOUNT_REVERSE (1 << 0) /* List later mounts first */
+#endif
+
+#define LISTMNT_BUFFER 10
+
+/* Check that all mount ids are in increasing order. */
+TEST(listmount_forward)
+{
+ uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0;
+
+ for (;;) {
+ ssize_t nr_mounts;
+
+ nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id,
+ list, LISTMNT_BUFFER, 0);
+ ASSERT_GE(nr_mounts, 0);
+ if (nr_mounts == 0)
+ break;
+
+ for (size_t cur = 0; cur < nr_mounts; cur++) {
+ if (cur < nr_mounts - 1)
+ ASSERT_LT(list[cur], list[cur + 1]);
+ last_mnt_id = list[cur];
+ }
+ }
+}
+
+/* Check that all mount ids are in decreasing order. */
+TEST(listmount_backward)
+{
+ uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0;
+
+ for (;;) {
+ ssize_t nr_mounts;
+
+ nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id,
+ list, LISTMNT_BUFFER, LISTMOUNT_REVERSE);
+ ASSERT_GE(nr_mounts, 0);
+ if (nr_mounts == 0)
+ break;
+
+ for (size_t cur = 0; cur < nr_mounts; cur++) {
+ if (cur < nr_mounts - 1)
+ ASSERT_GT(list[cur], list[cur + 1]);
+ last_mnt_id = list[cur];
+ }
+ }
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/ftrace/Makefile b/tools/testing/selftests/ftrace/Makefile
index a1e955d2de4c..49d96bb16355 100644
--- a/tools/testing/selftests/ftrace/Makefile
+++ b/tools/testing/selftests/ftrace/Makefile
@@ -6,4 +6,6 @@ TEST_PROGS := ftracetest-ktap
TEST_FILES := test.d settings
EXTRA_CLEAN := $(OUTPUT)/logs/*
+TEST_GEN_PROGS = poll
+
include ../lib.mk
diff --git a/tools/testing/selftests/ftrace/poll.c b/tools/testing/selftests/ftrace/poll.c
new file mode 100644
index 000000000000..53258f7515e7
--- /dev/null
+++ b/tools/testing/selftests/ftrace/poll.c
@@ -0,0 +1,74 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Simple poll on a file.
+ *
+ * Copyright (c) 2024 Google LLC.
+ */
+
+#include <errno.h>
+#include <fcntl.h>
+#include <poll.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <unistd.h>
+
+#define BUFSIZE 4096
+
+/*
+ * Usage:
+ * poll [-I|-P] [-t timeout] FILE
+ */
+int main(int argc, char *argv[])
+{
+ struct pollfd pfd = {.events = POLLIN};
+ char buf[BUFSIZE];
+ int timeout = -1;
+ int ret, opt;
+
+ while ((opt = getopt(argc, argv, "IPt:")) != -1) {
+ switch (opt) {
+ case 'I':
+ pfd.events = POLLIN;
+ break;
+ case 'P':
+ pfd.events = POLLPRI;
+ break;
+ case 't':
+ timeout = atoi(optarg);
+ break;
+ default:
+ fprintf(stderr, "Usage: %s [-I|-P] [-t timeout] FILE\n",
+ argv[0]);
+ return -1;
+ }
+ }
+ if (optind >= argc) {
+ fprintf(stderr, "Error: Polling file is not specified\n");
+ return -1;
+ }
+
+ pfd.fd = open(argv[optind], O_RDONLY);
+ if (pfd.fd < 0) {
+ fprintf(stderr, "failed to open %s", argv[optind]);
+ perror("open");
+ return -1;
+ }
+
+ /* Reset poll by read if POLLIN is specified. */
+ if (pfd.events & POLLIN)
+ do {} while (read(pfd.fd, buf, BUFSIZE) == BUFSIZE);
+
+ ret = poll(&pfd, 1, timeout);
+ if (ret < 0 && errno != EINTR) {
+ perror("poll");
+ return -1;
+ }
+ close(pfd.fd);
+
+ /* If timeout happned (ret == 0), exit code is 1 */
+ if (ret == 0)
+ return 1;
+
+ return 0;
+}
diff --git a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
index 35e8d47d6072..8a7ce647a60d 100644
--- a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
+++ b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
@@ -15,11 +15,11 @@ find_alternate_gid() {
tac /etc/group | grep -v ":$original_gid:" | head -1 | cut -d: -f3
}
-mount_tracefs_with_options() {
+remount_tracefs_with_options() {
local mount_point="$1"
local options="$2"
- mount -t tracefs -o "$options" nodev "$mount_point"
+ mount -t tracefs -o "remount,$options" nodev "$mount_point"
setup
}
@@ -81,7 +81,7 @@ test_gid_mount_option() {
# Unmount existing tracefs instance and mount with new GID
unmount_tracefs "$mount_point"
- mount_tracefs_with_options "$mount_point" "$new_options"
+ remount_tracefs_with_options "$mount_point" "$new_options"
check_gid "$mount_point" "$other_group"
@@ -92,7 +92,7 @@ test_gid_mount_option() {
# Unmount and remount with the original GID
unmount_tracefs "$mount_point"
- mount_tracefs_with_options "$mount_point" "$mount_options"
+ remount_tracefs_with_options "$mount_point" "$mount_options"
check_gid "$mount_point" "$original_group"
}
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc
new file mode 100644
index 000000000000..b4ad09237e2a
--- /dev/null
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc
@@ -0,0 +1,19 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+# description: Generic dynamic event - Repeating add/remove fprobe events
+# requires: dynamic_events "f[:[<group>/][<event>]] <func-name>[%return] [<args>]":README
+
+echo 0 > events/enable
+echo > dynamic_events
+
+PLACE=$FUNCTION_FORK
+REPEAT_TIMES=64
+
+for i in `seq 1 $REPEAT_TIMES`; do
+ echo "f:myevent $PLACE" >> dynamic_events
+ grep -q myevent dynamic_events
+ test -d events/fprobes/myevent
+ echo > dynamic_events
+done
+
+clear_trace
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
index a275decdc880..86c76679c56e 100644
--- a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
@@ -6,8 +6,10 @@
echo 0 > events/enable
echo > dynamic_events
+REALBIN=`readlink -f /bin/sh`
+
echo 'cat /proc/$$/maps' | /bin/sh | \
- grep "r-xp .*/bin/.*sh$" | \
+ grep "r-xp .*${REALBIN}$" | \
awk '{printf "p:myevent %s:0x%s\n", $6,$3 }' >> uprobe_events
grep -q myevent uprobe_events
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
index 61877d166451..c9425a34fae3 100644
--- a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
@@ -16,9 +16,7 @@ aarch64)
REG=%r0 ;;
esac
-check_error 'f^100 vfs_read' # MAXACT_NO_KPROBE
-check_error 'f^1a111 vfs_read' # BAD_MAXACT
-check_error 'f^100000 vfs_read' # MAXACT_TOO_BIG
+check_error 'f^100 vfs_read' # BAD_MAXACT
check_error 'f ^non_exist_func' # BAD_PROBE_ADDR (enoent)
check_error 'f ^vfs_read+10' # BAD_PROBE_ADDR
diff --git a/tools/testing/selftests/ftrace/test.d/event/event-mod.tc b/tools/testing/selftests/ftrace/test.d/event/event-mod.tc
new file mode 100644
index 000000000000..175243cd9ab7
--- /dev/null
+++ b/tools/testing/selftests/ftrace/test.d/event/event-mod.tc
@@ -0,0 +1,191 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+# description: event tracing - enable/disable with module event
+# requires: set_event "Can enable module events via: :mod:":README
+# flags: instance
+
+rmmod trace-events-sample ||:
+if ! modprobe trace-events-sample ; then
+ echo "No trace-events sample module - please make CONFIG_SAMPLE_TRACE_EVENTS=m"
+ exit_unresolved;
+fi
+trap "rmmod trace-events-sample" EXIT
+
+# Set events for the module
+echo ":mod:trace-events-sample" > set_event
+
+test_all_enabled() {
+
+ # Check if more than one is enabled
+ grep -q sample-trace:foo_bar set_event
+ grep -q sample-trace:foo_bar_with_cond set_event
+ grep -q sample-trace:foo_bar_with_fn set_event
+
+ # All of them should be enabled. Check via the enable file
+ val=`cat events/sample-trace/enable`
+ if [ $val -ne 1 ]; then
+ exit_fail
+ fi
+}
+
+clear_events() {
+ echo > set_event
+ val=`cat events/enable`
+ if [ "$val" != "0" ]; then
+ exit_fail
+ fi
+ count=`cat set_event | wc -l`
+ if [ $count -ne 0 ]; then
+ exit_fail
+ fi
+}
+
+test_all_enabled
+
+echo clear all events
+echo 0 > events/enable
+
+echo Confirm the events are disabled
+val=`cat events/sample-trace/enable`
+if [ $val -ne 0 ]; then
+ exit_fail
+fi
+
+echo And the set_event file is empty
+
+cnt=`wc -l set_event`
+if [ $cnt -ne 0 ]; then
+ exit_fail
+fi
+
+echo now enable all events
+echo 1 > events/enable
+
+echo Confirm the events are enabled again
+val=`cat events/sample-trace/enable`
+if [ $val -ne 1 ]; then
+ exit_fail
+fi
+
+echo disable just the module events
+echo '!:mod:trace-events-sample' >> set_event
+
+echo Should have mix of events enabled
+val=`cat events/enable`
+if [ "$val" != "X" ]; then
+ exit_fail
+fi
+
+echo Confirm the module events are disabled
+val=`cat events/sample-trace/enable`
+if [ $val -ne 0 ]; then
+ exit_fail
+fi
+
+echo 0 > events/enable
+
+echo now enable the system events
+echo 'sample-trace:mod:trace-events-sample' > set_event
+
+test_all_enabled
+
+echo clear all events
+echo 0 > events/enable
+
+echo Confirm the events are disabled
+val=`cat events/sample-trace/enable`
+if [ $val -ne 0 ]; then
+ exit_fail
+fi
+
+echo Test enabling foo_bar only
+echo 'foo_bar:mod:trace-events-sample' > set_event
+
+grep -q sample-trace:foo_bar set_event
+
+echo make sure nothing is found besides foo_bar
+if grep -q -v sample-trace:foo_bar set_event ; then
+ exit_fail
+fi
+
+echo Append another using the system and event name
+echo 'sample-trace:foo_bar_with_cond:mod:trace-events-sample' >> set_event
+
+grep -q sample-trace:foo_bar set_event
+grep -q sample-trace:foo_bar_with_cond set_event
+
+count=`cat set_event | wc -l`
+
+if [ $count -ne 2 ]; then
+ exit_fail
+fi
+
+clear_events
+
+rmmod trace-events-sample
+
+echo ':mod:trace-events-sample' > set_event
+
+echo make sure that the module shows up, and '-' is converted to '_'
+grep -q '\*:\*:mod:trace_events_sample' set_event
+
+modprobe trace-events-sample
+
+test_all_enabled
+
+clear_events
+
+rmmod trace-events-sample
+
+echo Enable just the system events
+echo 'sample-trace:mod:trace-events-sample' > set_event
+grep -q 'sample-trace:mod:trace_events_sample' set_event
+
+modprobe trace-events-sample
+
+test_all_enabled
+
+clear_events
+
+rmmod trace-events-sample
+
+echo Enable event with just event name
+echo 'foo_bar:mod:trace-events-sample' > set_event
+grep -q 'foo_bar:mod:trace_events_sample' set_event
+
+echo Enable another event with both system and event name
+echo 'sample-trace:foo_bar_with_cond:mod:trace-events-sample' >> set_event
+grep -q 'sample-trace:foo_bar_with_cond:mod:trace_events_sample' set_event
+echo Make sure the other event was still there
+grep -q 'foo_bar:mod:trace_events_sample' set_event
+
+modprobe trace-events-sample
+
+echo There should be no :mod: cached events
+if grep -q ':mod:' set_event; then
+ exit_fail
+fi
+
+echo two events should be enabled
+count=`cat set_event | wc -l`
+if [ $count -ne 2 ]; then
+ exit_fail
+fi
+
+echo only two events should be enabled
+val=`cat events/sample-trace/enable`
+if [ "$val" != "X" ]; then
+ exit_fail
+fi
+
+val=`cat events/sample-trace/foo_bar/enable`
+if [ "$val" != "1" ]; then
+ exit_fail
+fi
+
+val=`cat events/sample-trace/foo_bar_with_cond/enable`
+if [ "$val" != "1" ]; then
+ exit_fail
+fi
+
+clear_trace
diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
index a16c6a6f6055..8f1c58f0c239 100644
--- a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
+++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
@@ -111,7 +111,7 @@ check_error 'p vfs_read $arg* ^$arg*' # DOUBLE_ARGS
if !grep -q 'kernel return probes support:' README; then
check_error 'r vfs_read ^$arg*' # NOFENTRY_ARGS
fi
-check_error 'p vfs_read+8 ^$arg*' # NOFENTRY_ARGS
+check_error 'p vfs_read+20 ^$arg*' # NOFENTRY_ARGS
check_error 'p vfs_read ^hoge' # NO_BTFARG
check_error 'p kfree ^$arg10' # NO_BTFARG (exceed the number of parameters)
check_error 'r kfree ^$retval' # NO_RETVAL
diff --git a/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc b/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc
new file mode 100644
index 000000000000..8d275e3238d9
--- /dev/null
+++ b/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc
@@ -0,0 +1,74 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+# description: event trigger - test poll wait on histogram
+# requires: set_event events/sched/sched_process_free/trigger events/sched/sched_process_free/hist
+# flags: instance
+
+POLL=${FTRACETEST_ROOT}/poll
+
+if [ ! -x ${POLL} ]; then
+ echo "poll program is not compiled!"
+ exit_unresolved
+fi
+
+EVENT=events/sched/sched_process_free/
+
+# Check poll ops is supported. Before implementing poll on hist file, it
+# returns soon with POLLIN | POLLOUT, but not POLLPRI.
+
+# This must wait >1 sec and return 1 (timeout).
+set +e
+${POLL} -I -t 1000 ${EVENT}/hist
+ret=$?
+set -e
+if [ ${ret} != 1 ]; then
+ echo "poll on hist file is not supported"
+ exit_unsupported
+fi
+
+# Test POLLIN
+echo > trace
+echo 'hist:key=comm if comm =="sleep"' > ${EVENT}/trigger
+echo 1 > ${EVENT}/enable
+
+# This sleep command will exit after 2 seconds.
+sleep 2 &
+BGPID=$!
+# if timeout happens, poll returns 1.
+${POLL} -I -t 4000 ${EVENT}/hist
+echo 0 > tracing_on
+
+if [ -d /proc/${BGPID} ]; then
+ echo "poll exits too soon"
+ kill -KILL ${BGPID} ||:
+ exit_fail
+fi
+
+if ! grep -qw "sleep" trace; then
+ echo "poll exits before event happens"
+ exit_fail
+fi
+
+# Test POLLPRI
+echo > trace
+echo 1 > tracing_on
+
+# This sleep command will exit after 2 seconds.
+sleep 2 &
+BGPID=$!
+# if timeout happens, poll returns 1.
+${POLL} -P -t 4000 ${EVENT}/hist
+echo 0 > tracing_on
+
+if [ -d /proc/${BGPID} ]; then
+ echo "poll exits too soon"
+ kill -KILL ${BGPID} ||:
+ exit_fail
+fi
+
+if ! grep -qw "sleep" trace; then
+ echo "poll exits before event happens"
+ exit_fail
+fi
+
+exit_pass
diff --git a/tools/testing/selftests/hid/.gitignore b/tools/testing/selftests/hid/.gitignore
index 746c62361f77..933f483815b2 100644
--- a/tools/testing/selftests/hid/.gitignore
+++ b/tools/testing/selftests/hid/.gitignore
@@ -1,5 +1,6 @@
bpftool
*.skel.h
+/host-tools
/tools
hid_bpf
hidraw
diff --git a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
index e5db897586bb..531228b849da 100644
--- a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
+++ b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
@@ -22,6 +22,9 @@
#define HID_REQ_SET_IDLE HID_REQ_SET_IDLE___not_used
#define HID_REQ_SET_PROTOCOL HID_REQ_SET_PROTOCOL___not_used
+/* do not define kfunc through vmlinux.h as this messes up our custom hack */
+#define BPF_NO_KFUNC_PROTOTYPES
+
#include "vmlinux.h"
#undef hid_bpf_ctx
@@ -91,31 +94,31 @@ struct hid_bpf_ops {
/* following are kfuncs exported by HID for HID-BPF */
extern __u8 *hid_bpf_get_data(struct hid_bpf_ctx *ctx,
unsigned int offset,
- const size_t __sz) __ksym;
-extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __ksym;
-extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __ksym;
+ const size_t __sz) __weak __ksym;
+extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __weak __ksym;
+extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __weak __ksym;
extern int hid_bpf_hw_request(struct hid_bpf_ctx *ctx,
__u8 *data,
size_t buf__sz,
enum hid_report_type type,
- enum hid_class_request reqtype) __ksym;
+ enum hid_class_request reqtype) __weak __ksym;
extern int hid_bpf_hw_output_report(struct hid_bpf_ctx *ctx,
- __u8 *buf, size_t buf__sz) __ksym;
+ __u8 *buf, size_t buf__sz) __weak __ksym;
extern int hid_bpf_input_report(struct hid_bpf_ctx *ctx,
enum hid_report_type type,
__u8 *data,
- size_t buf__sz) __ksym;
+ size_t buf__sz) __weak __ksym;
extern int hid_bpf_try_input_report(struct hid_bpf_ctx *ctx,
enum hid_report_type type,
__u8 *data,
- size_t buf__sz) __ksym;
+ size_t buf__sz) __weak __ksym;
/* bpf_wq implementation */
extern int bpf_wq_init(struct bpf_wq *wq, void *p__map, unsigned int flags) __weak __ksym;
extern int bpf_wq_start(struct bpf_wq *wq, unsigned int flags) __weak __ksym;
extern int bpf_wq_set_callback_impl(struct bpf_wq *wq,
int (callback_fn)(void *map, int *key, void *wq),
- unsigned int flags__k, void *aux__ign) __ksym;
+ unsigned int flags__k, void *aux__ign) __weak __ksym;
#define bpf_wq_set_callback(timer, cb, flags) \
bpf_wq_set_callback_impl(timer, cb, flags, NULL)
diff --git a/tools/testing/selftests/hid/run-hid-tools-tests.sh b/tools/testing/selftests/hid/run-hid-tools-tests.sh
index bdae8464da86..af1682a53c27 100755
--- a/tools/testing/selftests/hid/run-hid-tools-tests.sh
+++ b/tools/testing/selftests/hid/run-hid-tools-tests.sh
@@ -2,24 +2,26 @@
# SPDX-License-Identifier: GPL-2.0
# Runs tests for the HID subsystem
+KSELFTEST_SKIP_TEST=4
+
if ! command -v python3 > /dev/null 2>&1; then
echo "hid-tools: [SKIP] python3 not installed"
- exit 77
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import pytest" > /dev/null 2>&1; then
- echo "hid: [SKIP/ pytest module not installed"
- exit 77
+ echo "hid: [SKIP] pytest module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import pytest_tap" > /dev/null 2>&1; then
- echo "hid: [SKIP/ pytest_tap module not installed"
- exit 77
+ echo "hid: [SKIP] pytest_tap module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import hidtools" > /dev/null 2>&1; then
- echo "hid: [SKIP/ hid-tools module not installed"
- exit 77
+ echo "hid: [SKIP] hid-tools module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
TARGET=${TARGET:=.}
diff --git a/tools/testing/selftests/iommu/iommufd_fail_nth.c b/tools/testing/selftests/iommu/iommufd_fail_nth.c
index 22f6fd5f0f74..64b1f8e1b0cf 100644
--- a/tools/testing/selftests/iommu/iommufd_fail_nth.c
+++ b/tools/testing/selftests/iommu/iommufd_fail_nth.c
@@ -615,7 +615,12 @@ TEST_FAIL_NTH(basic_fail_nth, access_pin_domain)
/* device.c */
TEST_FAIL_NTH(basic_fail_nth, device)
{
+ struct iommu_hwpt_selftest data = {
+ .iotlb = IOMMU_TEST_IOTLB_DEFAULT,
+ };
struct iommu_test_hw_info info;
+ uint32_t fault_id, fault_fd;
+ uint32_t fault_hwpt_id;
uint32_t ioas_id;
uint32_t ioas_id2;
uint32_t stdev_id;
@@ -678,6 +683,15 @@ TEST_FAIL_NTH(basic_fail_nth, device)
if (_test_cmd_vdevice_alloc(self->fd, viommu_id, idev_id, 0, &vdev_id))
return -1;
+ if (_test_ioctl_fault_alloc(self->fd, &fault_id, &fault_fd))
+ return -1;
+ close(fault_fd);
+
+ if (_test_cmd_hwpt_alloc(self->fd, idev_id, hwpt_id, fault_id,
+ IOMMU_HWPT_FAULT_ID_VALID, &fault_hwpt_id,
+ IOMMU_HWPT_DATA_SELFTEST, &data, sizeof(data)))
+ return -1;
+
return 0;
}
diff --git a/tools/testing/selftests/ipc/msgque.c b/tools/testing/selftests/ipc/msgque.c
index c75ea4094870..e9dbb84c100a 100644
--- a/tools/testing/selftests/ipc/msgque.c
+++ b/tools/testing/selftests/ipc/msgque.c
@@ -194,7 +194,7 @@ int fill_msgque(struct msgque_data *msgque)
int main(int argc, char **argv)
{
- int msg, pid, err;
+ int err;
struct msgque_data msgque;
if (getuid() != 0)
diff --git a/tools/testing/selftests/kselftest.h b/tools/testing/selftests/kselftest.h
index 29fedf609611..cdf91b0ca40f 100644
--- a/tools/testing/selftests/kselftest.h
+++ b/tools/testing/selftests/kselftest.h
@@ -18,7 +18,8 @@
* ksft_print_msg(fmt, ...);
* ksft_perror(msg);
*
- * and finally report the pass/fail/skip/xfail state of the test with one of:
+ * and finally report the pass/fail/skip/xfail/xpass state of the test
+ * with one of:
*
* ksft_test_result(condition, fmt, ...);
* ksft_test_result_report(result, fmt, ...);
@@ -26,6 +27,7 @@
* ksft_test_result_fail(fmt, ...);
* ksft_test_result_skip(fmt, ...);
* ksft_test_result_xfail(fmt, ...);
+ * ksft_test_result_xpass(fmt, ...);
* ksft_test_result_error(fmt, ...);
* ksft_test_result_code(exit_code, test_name, fmt, ...);
*
@@ -147,6 +149,11 @@ static inline void ksft_set_plan(unsigned int plan)
static inline void ksft_print_cnts(void)
{
+ if (ksft_cnt.ksft_xskip > 0)
+ printf(
+ "# %u skipped test(s) detected. Consider enabling relevant config options to improve coverage.\n",
+ ksft_cnt.ksft_xskip
+ );
if (ksft_plan != ksft_test_num())
printf("# Planned tests != run tests (%u != %u)\n",
ksft_plan, ksft_test_num());
@@ -227,6 +234,20 @@ static inline __printf(1, 2) void ksft_test_result_xfail(const char *msg, ...)
va_end(args);
}
+static inline __printf(1, 2) void ksft_test_result_xpass(const char *msg, ...)
+{
+ int saved_errno = errno;
+ va_list args;
+
+ ksft_cnt.ksft_xpass++;
+
+ va_start(args, msg);
+ printf("ok %u # XPASS ", ksft_test_num());
+ errno = saved_errno;
+ vprintf(msg, args);
+ va_end(args);
+}
+
static inline __printf(1, 2) void ksft_test_result_skip(const char *msg, ...)
{
int saved_errno = errno;
@@ -318,6 +339,9 @@ void ksft_test_result_code(int exit_code, const char *test_name,
case KSFT_XFAIL: \
ksft_test_result_xfail(fmt, ##__VA_ARGS__); \
break; \
+ case KSFT_XPASS: \
+ ksft_test_result_xpass(fmt, ##__VA_ARGS__); \
+ break; \
case KSFT_SKIP: \
ksft_test_result_skip(fmt, ##__VA_ARGS__); \
break; \
@@ -403,7 +427,7 @@ static inline __noreturn __printf(1, 2) void ksft_exit_skip(const char *msg, ...
*/
if (ksft_plan || ksft_test_num()) {
ksft_cnt.ksft_xskip++;
- printf("ok %d # SKIP ", 1 + ksft_test_num());
+ printf("ok %u # SKIP ", 1 + ksft_test_num());
} else {
printf("1..0 # SKIP ");
}
diff --git a/tools/testing/selftests/kselftest/ksft.py b/tools/testing/selftests/kselftest/ksft.py
index bf215790a89d..0e030837fc17 100644
--- a/tools/testing/selftests/kselftest/ksft.py
+++ b/tools/testing/selftests/kselftest/ksft.py
@@ -27,6 +27,9 @@ def set_plan(num_tests):
def print_cnts():
+ if ksft_cnt['skip'] > 0:
+ print(f"# {ksft_cnt['skip']} skipped test(s) detected. Consider enabling relevant config options to improve coverage.")
+
print(
f"# Totals: pass:{ksft_cnt['pass']} fail:{ksft_cnt['fail']} xfail:0 xpass:0 skip:{ksft_cnt['skip']} error:0"
)
diff --git a/tools/testing/selftests/kselftest/ktap_helpers.sh b/tools/testing/selftests/kselftest/ktap_helpers.sh
index 79a125eb24c2..32dbfe9da2c4 100644
--- a/tools/testing/selftests/kselftest/ktap_helpers.sh
+++ b/tools/testing/selftests/kselftest/ktap_helpers.sh
@@ -7,6 +7,7 @@
KTAP_TESTNO=1
KTAP_CNT_PASS=0
KTAP_CNT_FAIL=0
+KTAP_CNT_XFAIL=0
KTAP_CNT_SKIP=0
KSFT_PASS=0
@@ -40,7 +41,7 @@ ktap_skip_all() {
__ktap_test() {
result="$1"
description="$2"
- directive="$3" # optional
+ directive="${3:-}" # optional
local directive_str=
[ ! -z "$directive" ] && directive_str="# $directive"
@@ -69,6 +70,16 @@ ktap_test_skip() {
KTAP_CNT_SKIP=$((KTAP_CNT_SKIP+1))
}
+ktap_test_xfail() {
+ description="$1"
+
+ result="ok"
+ directive="XFAIL"
+ __ktap_test "$result" "$description" "$directive"
+
+ KTAP_CNT_XFAIL=$((KTAP_CNT_XFAIL+1))
+}
+
ktap_test_fail() {
description="$1"
@@ -99,7 +110,7 @@ ktap_exit_fail_msg() {
ktap_finished() {
ktap_print_totals
- if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP)) -eq "$KSFT_NUM_TESTS" ]; then
+ if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP + KTAP_CNT_XFAIL)) -eq "$KSFT_NUM_TESTS" ]; then
exit "$KSFT_PASS"
else
exit "$KSFT_FAIL"
@@ -107,5 +118,9 @@ ktap_finished() {
}
ktap_print_totals() {
- echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:0 xpass:0 skip:$KTAP_CNT_SKIP error:0"
+ if [ "$KTAP_CNT_SKIP" -gt 0 ]; then
+ echo "# $KTAP_CNT_SKIP skipped test(s) detected. " \
+ "Consider enabling relevant config options to improve coverage."
+ fi
+ echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:$KTAP_CNT_XFAIL xpass:0 skip:$KTAP_CNT_SKIP error:0"
}
diff --git a/tools/testing/selftests/kselftest_harness.h b/tools/testing/selftests/kselftest_harness.h
index a5a72415e37b..666c9fde76da 100644
--- a/tools/testing/selftests/kselftest_harness.h
+++ b/tools/testing/selftests/kselftest_harness.h
@@ -760,33 +760,33 @@
/* Report with actual signedness to avoid weird output. */ \
switch (is_signed_type(__exp) * 2 + is_signed_type(__seen)) { \
case 0: { \
- unsigned long long __exp_print = (uintptr_t)__exp; \
- unsigned long long __seen_print = (uintptr_t)__seen; \
- __TH_LOG("Expected %s (%llu) %s %s (%llu)", \
+ uintmax_t __exp_print = (uintmax_t)__exp; \
+ uintmax_t __seen_print = (uintmax_t)__seen; \
+ __TH_LOG("Expected %s (%ju) %s %s (%ju)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 1: { \
- unsigned long long __exp_print = (uintptr_t)__exp; \
- long long __seen_print = (intptr_t)__seen; \
- __TH_LOG("Expected %s (%llu) %s %s (%lld)", \
+ uintmax_t __exp_print = (uintmax_t)__exp; \
+ intmax_t __seen_print = (intmax_t)__seen; \
+ __TH_LOG("Expected %s (%ju) %s %s (%jd)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 2: { \
- long long __exp_print = (intptr_t)__exp; \
- unsigned long long __seen_print = (uintptr_t)__seen; \
- __TH_LOG("Expected %s (%lld) %s %s (%llu)", \
+ intmax_t __exp_print = (intmax_t)__exp; \
+ uintmax_t __seen_print = (uintmax_t)__seen; \
+ __TH_LOG("Expected %s (%jd) %s %s (%ju)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 3: { \
- long long __exp_print = (intptr_t)__exp; \
- long long __seen_print = (intptr_t)__seen; \
- __TH_LOG("Expected %s (%lld) %s %s (%lld)", \
+ intmax_t __exp_print = (intmax_t)__exp; \
+ intmax_t __seen_print = (intmax_t)__seen; \
+ __TH_LOG("Expected %s (%jd) %s %s (%jd)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
diff --git a/tools/testing/selftests/kvm/aarch64/set_id_regs.c b/tools/testing/selftests/kvm/aarch64/set_id_regs.c
index a79b7f18452d..3a97c160b5fe 100644
--- a/tools/testing/selftests/kvm/aarch64/set_id_regs.c
+++ b/tools/testing/selftests/kvm/aarch64/set_id_regs.c
@@ -152,7 +152,6 @@ static const struct reg_ftr_bits ftr_id_aa64mmfr0_el1[] = {
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGENDEL0, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, SNSMEM, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGEND, 0),
- REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, ASIDBITS, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, PARANGE, 0),
REG_FTR_END,
};
diff --git a/tools/testing/selftests/kvm/s390x/ucontrol_test.c b/tools/testing/selftests/kvm/s390x/ucontrol_test.c
index 0c112319dab1..135ee22856cf 100644
--- a/tools/testing/selftests/kvm/s390x/ucontrol_test.c
+++ b/tools/testing/selftests/kvm/s390x/ucontrol_test.c
@@ -210,10 +210,13 @@ TEST_F(uc_kvm, uc_attr_mem_limit)
struct kvm_device_attr attr = {
.group = KVM_S390_VM_MEM_CTRL,
.attr = KVM_S390_VM_MEM_LIMIT_SIZE,
- .addr = (unsigned long)&limit,
+ .addr = (u64)&limit,
};
int rc;
+ rc = ioctl(self->vm_fd, KVM_HAS_DEVICE_ATTR, &attr);
+ EXPECT_EQ(0, rc);
+
rc = ioctl(self->vm_fd, KVM_GET_DEVICE_ATTR, &attr);
EXPECT_EQ(0, rc);
EXPECT_EQ(~0UL, limit);
@@ -635,4 +638,171 @@ TEST_F(uc_kvm, uc_skey)
uc_assert_diag44(self);
}
+static char uc_flic_b[PAGE_SIZE];
+static struct kvm_s390_io_adapter uc_flic_ioa = { .id = 0 };
+static struct kvm_s390_io_adapter_req uc_flic_ioam = { .id = 0 };
+static struct kvm_s390_ais_req uc_flic_asim = { .isc = 0 };
+static struct kvm_s390_ais_all uc_flic_asima = { .simm = 0 };
+static struct uc_flic_attr_test {
+ char *name;
+ struct kvm_device_attr a;
+ int hasrc;
+ int geterrno;
+ int seterrno;
+} uc_flic_attr_tests[] = {
+ {
+ .name = "KVM_DEV_FLIC_GET_ALL_IRQS",
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_GET_ALL_IRQS,
+ .addr = (u64)&uc_flic_b,
+ .attr = PAGE_SIZE,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ENQUEUE",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_ENQUEUE, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_CLEAR_IRQS",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_CLEAR_IRQS, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ADAPTER_REGISTER",
+ .geterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_ADAPTER_REGISTER,
+ .addr = (u64)&uc_flic_ioa,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ADAPTER_MODIFY",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_ADAPTER_MODIFY,
+ .addr = (u64)&uc_flic_ioam,
+ .attr = sizeof(uc_flic_ioam),
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_CLEAR_IO_IRQ",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_CLEAR_IO_IRQ,
+ .attr = 32,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AISM",
+ .geterrno = EINVAL,
+ .seterrno = ENOTSUP,
+ .a = {
+ .group = KVM_DEV_FLIC_AISM,
+ .addr = (u64)&uc_flic_asim,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AIRQ_INJECT",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_AIRQ_INJECT, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AISM_ALL",
+ .geterrno = ENOTSUP,
+ .seterrno = ENOTSUP,
+ .a = {
+ .group = KVM_DEV_FLIC_AISM_ALL,
+ .addr = (u64)&uc_flic_asima,
+ .attr = sizeof(uc_flic_asima),
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_APF_ENABLE",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_APF_ENABLE, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_APF_DISABLE_WAIT",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_APF_DISABLE_WAIT, },
+ },
+};
+
+TEST_F(uc_kvm, uc_flic_attrs)
+{
+ struct kvm_create_device cd = { .type = KVM_DEV_TYPE_FLIC };
+ struct kvm_device_attr attr;
+ u64 value;
+ int rc, i;
+
+ rc = ioctl(self->vm_fd, KVM_CREATE_DEVICE, &cd);
+ ASSERT_EQ(0, rc) TH_LOG("create device failed with err %s (%i)",
+ strerror(errno), errno);
+
+ for (i = 0; i < ARRAY_SIZE(uc_flic_attr_tests); i++) {
+ TH_LOG("test %s", uc_flic_attr_tests[i].name);
+ attr = (struct kvm_device_attr) {
+ .group = uc_flic_attr_tests[i].a.group,
+ .attr = uc_flic_attr_tests[i].a.attr,
+ .addr = uc_flic_attr_tests[i].a.addr,
+ };
+ if (attr.addr == 0)
+ attr.addr = (u64)&value;
+
+ rc = ioctl(cd.fd, KVM_HAS_DEVICE_ATTR, &attr);
+ EXPECT_EQ(uc_flic_attr_tests[i].hasrc, !!rc)
+ TH_LOG("expected dev attr missing %s",
+ uc_flic_attr_tests[i].name);
+
+ rc = ioctl(cd.fd, KVM_GET_DEVICE_ATTR, &attr);
+ EXPECT_EQ(!!uc_flic_attr_tests[i].geterrno, !!rc)
+ TH_LOG("get dev attr rc not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ if (uc_flic_attr_tests[i].geterrno)
+ EXPECT_EQ(uc_flic_attr_tests[i].geterrno, errno)
+ TH_LOG("get dev attr errno not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+
+ rc = ioctl(cd.fd, KVM_SET_DEVICE_ATTR, &attr);
+ EXPECT_EQ(!!uc_flic_attr_tests[i].seterrno, !!rc)
+ TH_LOG("set sev attr rc not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ if (uc_flic_attr_tests[i].seterrno)
+ EXPECT_EQ(uc_flic_attr_tests[i].seterrno, errno)
+ TH_LOG("set dev attr errno not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ }
+
+ close(cd.fd);
+}
+
+TEST_F(uc_kvm, uc_set_gsi_routing)
+{
+ struct kvm_irq_routing *routing = kvm_gsi_routing_create();
+ struct kvm_irq_routing_entry ue = {
+ .type = KVM_IRQ_ROUTING_S390_ADAPTER,
+ .gsi = 1,
+ .u.adapter = (struct kvm_irq_routing_s390_adapter) {
+ .ind_addr = 0,
+ },
+ };
+ int rc;
+
+ routing->entries[0] = ue;
+ routing->nr = 1;
+ rc = ioctl(self->vm_fd, KVM_SET_GSI_ROUTING, routing);
+ ASSERT_EQ(-1, rc) TH_LOG("err %s (%i)", strerror(errno), errno);
+ ASSERT_EQ(EINVAL, errno) TH_LOG("err %s (%i)", strerror(errno), errno);
+}
+
TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/Makefile b/tools/testing/selftests/landlock/Makefile
index 348e2dbdb4e0..5cb0828f0514 100644
--- a/tools/testing/selftests/landlock/Makefile
+++ b/tools/testing/selftests/landlock/Makefile
@@ -10,14 +10,14 @@ src_test := $(wildcard *_test.c)
TEST_GEN_PROGS := $(src_test:.c=)
-TEST_GEN_PROGS_EXTENDED := true
+TEST_GEN_PROGS_EXTENDED := true sandbox-and-launch wait-pipe
# Short targets:
-$(TEST_GEN_PROGS): LDLIBS += -lcap
+$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread
$(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static
include ../lib.mk
# Targets with $(OUTPUT)/ prefix:
-$(TEST_GEN_PROGS): LDLIBS += -lcap
+$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread
$(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static
diff --git a/tools/testing/selftests/landlock/common.h b/tools/testing/selftests/landlock/common.h
index 61056fa074bb..a604ea5d8297 100644
--- a/tools/testing/selftests/landlock/common.h
+++ b/tools/testing/selftests/landlock/common.h
@@ -9,17 +9,15 @@
#include <arpa/inet.h>
#include <errno.h>
-#include <linux/landlock.h>
#include <linux/securebits.h>
#include <sys/capability.h>
#include <sys/socket.h>
-#include <sys/syscall.h>
-#include <sys/types.h>
#include <sys/un.h>
#include <sys/wait.h>
#include <unistd.h>
#include "../kselftest_harness.h"
+#include "wrappers.h"
#define TMP_DIR "tmp"
@@ -30,33 +28,8 @@
/* TEST_F_FORK() should not be used for new tests. */
#define TEST_F_FORK(fixture_name, test_name) TEST_F(fixture_name, test_name)
-#ifndef landlock_create_ruleset
-static inline int
-landlock_create_ruleset(const struct landlock_ruleset_attr *const attr,
- const size_t size, const __u32 flags)
-{
- return syscall(__NR_landlock_create_ruleset, attr, size, flags);
-}
-#endif
-
-#ifndef landlock_add_rule
-static inline int landlock_add_rule(const int ruleset_fd,
- const enum landlock_rule_type rule_type,
- const void *const rule_attr,
- const __u32 flags)
-{
- return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr,
- flags);
-}
-#endif
-
-#ifndef landlock_restrict_self
-static inline int landlock_restrict_self(const int ruleset_fd,
- const __u32 flags)
-{
- return syscall(__NR_landlock_restrict_self, ruleset_fd, flags);
-}
-#endif
+static const char bin_sandbox_and_launch[] = "./sandbox-and-launch";
+static const char bin_wait_pipe[] = "./wait-pipe";
static void _init_caps(struct __test_metadata *const _metadata, bool drop_all)
{
@@ -250,11 +223,6 @@ struct service_fixture {
};
};
-static pid_t __maybe_unused sys_gettid(void)
-{
- return syscall(__NR_gettid);
-}
-
static void __maybe_unused set_unix_address(struct service_fixture *const srv,
const unsigned short index)
{
diff --git a/tools/testing/selftests/landlock/fs_test.c b/tools/testing/selftests/landlock/fs_test.c
index 6788762188fe..2af86bd796ba 100644
--- a/tools/testing/selftests/landlock/fs_test.c
+++ b/tools/testing/selftests/landlock/fs_test.c
@@ -37,6 +37,10 @@
#include <linux/fs.h>
#include <linux/mount.h>
+/* Defines AT_EXECVE_CHECK without type conflicts. */
+#define _ASM_GENERIC_FCNTL_H
+#include <linux/fcntl.h>
+
#include "common.h"
#ifndef renameat2
@@ -59,7 +63,7 @@ int open_tree(int dfd, const char *filename, unsigned int flags)
#define RENAME_EXCHANGE (1 << 1)
#endif
-#define BINARY_PATH "./true"
+static const char bin_true[] = "./true";
/* Paths (sibling number and depth) */
static const char dir_s1d1[] = TMP_DIR "/s1d1";
@@ -85,6 +89,9 @@ static const char file1_s3d1[] = TMP_DIR "/s3d1/f1";
/* dir_s3d2 is a mount point. */
static const char dir_s3d2[] = TMP_DIR "/s3d1/s3d2";
static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3";
+static const char file1_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3/f1";
+static const char dir_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4";
+static const char file1_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4/f1";
/*
* layout1 hierarchy:
@@ -108,8 +115,11 @@ static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3";
* │   └── f2
* └── s3d1
*    ├── f1
- * └── s3d2
- * └── s3d3
+ * └── s3d2 [mount point]
+ *    ├── s3d3
+ *    │ └── f1
+ *    └── s3d4
+ *    └── f1
*/
static bool fgrep(FILE *const inf, const char *const str)
@@ -358,7 +368,8 @@ static void create_layout1(struct __test_metadata *const _metadata)
ASSERT_EQ(0, mount_opt(&mnt_tmp, dir_s3d2));
clear_cap(_metadata, CAP_SYS_ADMIN);
- ASSERT_EQ(0, mkdir(dir_s3d3, 0700));
+ create_file(_metadata, file1_s3d3);
+ create_file(_metadata, file1_s3d4);
}
static void remove_layout1(struct __test_metadata *const _metadata)
@@ -378,7 +389,8 @@ static void remove_layout1(struct __test_metadata *const _metadata)
EXPECT_EQ(0, remove_path(dir_s2d2));
EXPECT_EQ(0, remove_path(file1_s3d1));
- EXPECT_EQ(0, remove_path(dir_s3d3));
+ EXPECT_EQ(0, remove_path(file1_s3d3));
+ EXPECT_EQ(0, remove_path(file1_s3d4));
set_cap(_metadata, CAP_SYS_ADMIN);
umount(dir_s3d2);
clear_cap(_metadata, CAP_SYS_ADMIN);
@@ -1957,8 +1969,8 @@ TEST_F_FORK(layout1, relative_chroot_chdir)
test_relative_path(_metadata, REL_CHROOT_CHDIR);
}
-static void copy_binary(struct __test_metadata *const _metadata,
- const char *const dst_path)
+static void copy_file(struct __test_metadata *const _metadata,
+ const char *const src_path, const char *const dst_path)
{
int dst_fd, src_fd;
struct stat statbuf;
@@ -1968,11 +1980,10 @@ static void copy_binary(struct __test_metadata *const _metadata,
{
TH_LOG("Failed to open \"%s\": %s", dst_path, strerror(errno));
}
- src_fd = open(BINARY_PATH, O_RDONLY | O_CLOEXEC);
+ src_fd = open(src_path, O_RDONLY | O_CLOEXEC);
ASSERT_LE(0, src_fd)
{
- TH_LOG("Failed to open \"" BINARY_PATH "\": %s",
- strerror(errno));
+ TH_LOG("Failed to open \"%s\": %s", src_path, strerror(errno));
}
ASSERT_EQ(0, fstat(src_fd, &statbuf));
ASSERT_EQ(statbuf.st_size,
@@ -2003,11 +2014,26 @@ static void test_execute(struct __test_metadata *const _metadata, const int err,
ASSERT_EQ(1, WIFEXITED(status));
ASSERT_EQ(err ? 2 : 0, WEXITSTATUS(status))
{
- TH_LOG("Unexpected return code for \"%s\": %s", path,
- strerror(errno));
+ TH_LOG("Unexpected return code for \"%s\"", path);
};
}
+static void test_check_exec(struct __test_metadata *const _metadata,
+ const int err, const char *const path)
+{
+ int ret;
+ char *const argv[] = { (char *)path, NULL };
+
+ ret = execveat(AT_FDCWD, path, argv, NULL,
+ AT_EMPTY_PATH | AT_EXECVE_CHECK);
+ if (err) {
+ EXPECT_EQ(-1, ret);
+ EXPECT_EQ(errno, err);
+ } else {
+ EXPECT_EQ(0, ret);
+ }
+}
+
TEST_F_FORK(layout1, execute)
{
const struct rule rules[] = {
@@ -2021,9 +2047,13 @@ TEST_F_FORK(layout1, execute)
create_ruleset(_metadata, rules[0].access, rules);
ASSERT_LE(0, ruleset_fd);
- copy_binary(_metadata, file1_s1d1);
- copy_binary(_metadata, file1_s1d2);
- copy_binary(_metadata, file1_s1d3);
+ copy_file(_metadata, bin_true, file1_s1d1);
+ copy_file(_metadata, bin_true, file1_s1d2);
+ copy_file(_metadata, bin_true, file1_s1d3);
+
+ /* Checks before file1_s1d1 being denied. */
+ test_execute(_metadata, 0, file1_s1d1);
+ test_check_exec(_metadata, 0, file1_s1d1);
enforce_ruleset(_metadata, ruleset_fd);
ASSERT_EQ(0, close(ruleset_fd));
@@ -2031,14 +2061,94 @@ TEST_F_FORK(layout1, execute)
ASSERT_EQ(0, test_open(dir_s1d1, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d1, O_RDONLY));
test_execute(_metadata, EACCES, file1_s1d1);
+ test_check_exec(_metadata, EACCES, file1_s1d1);
ASSERT_EQ(0, test_open(dir_s1d2, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d2, O_RDONLY));
test_execute(_metadata, 0, file1_s1d2);
+ test_check_exec(_metadata, 0, file1_s1d2);
ASSERT_EQ(0, test_open(dir_s1d3, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d3, O_RDONLY));
test_execute(_metadata, 0, file1_s1d3);
+ test_check_exec(_metadata, 0, file1_s1d3);
+}
+
+TEST_F_FORK(layout1, umount_sandboxer)
+{
+ int pipe_child[2], pipe_parent[2];
+ char buf_parent;
+ pid_t child;
+ int status;
+
+ copy_file(_metadata, bin_sandbox_and_launch, file1_s3d3);
+ ASSERT_EQ(0, pipe2(pipe_child, 0));
+ ASSERT_EQ(0, pipe2(pipe_parent, 0));
+
+ child = fork();
+ ASSERT_LE(0, child);
+ if (child == 0) {
+ char pipe_child_str[12], pipe_parent_str[12];
+ char *const argv[] = { (char *)file1_s3d3,
+ (char *)bin_wait_pipe, pipe_child_str,
+ pipe_parent_str, NULL };
+
+ /* Passes the pipe FDs to the executed binary and its child. */
+ EXPECT_EQ(0, close(pipe_child[0]));
+ EXPECT_EQ(0, close(pipe_parent[1]));
+ snprintf(pipe_child_str, sizeof(pipe_child_str), "%d",
+ pipe_child[1]);
+ snprintf(pipe_parent_str, sizeof(pipe_parent_str), "%d",
+ pipe_parent[0]);
+
+ /*
+ * We need bin_sandbox_and_launch (copied inside the mount as
+ * file1_s3d3) to execute bin_wait_pipe (outside the mount) to
+ * make sure the mount point will not be EBUSY because of
+ * file1_s3d3 being in use. This avoids a potential race
+ * condition between the following read() and umount() calls.
+ */
+ ASSERT_EQ(0, execve(argv[0], argv, NULL))
+ {
+ TH_LOG("Failed to execute \"%s\": %s", argv[0],
+ strerror(errno));
+ };
+ _exit(1);
+ return;
+ }
+
+ EXPECT_EQ(0, close(pipe_child[1]));
+ EXPECT_EQ(0, close(pipe_parent[0]));
+
+ /* Waits for the child to sandbox itself. */
+ EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1));
+
+ /* Tests that the sandboxer is tied to its mount point. */
+ set_cap(_metadata, CAP_SYS_ADMIN);
+ EXPECT_EQ(-1, umount(dir_s3d2));
+ EXPECT_EQ(EBUSY, errno);
+ clear_cap(_metadata, CAP_SYS_ADMIN);
+
+ /* Signals the child to launch a grandchild. */
+ EXPECT_EQ(1, write(pipe_parent[1], ".", 1));
+
+ /* Waits for the grandchild. */
+ EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1));
+
+ /* Tests that the domain's sandboxer is not tied to its mount point. */
+ set_cap(_metadata, CAP_SYS_ADMIN);
+ EXPECT_EQ(0, umount(dir_s3d2))
+ {
+ TH_LOG("Failed to umount \"%s\": %s", dir_s3d2,
+ strerror(errno));
+ };
+ clear_cap(_metadata, CAP_SYS_ADMIN);
+
+ /* Signals the grandchild to terminate. */
+ EXPECT_EQ(1, write(pipe_parent[1], ".", 1));
+ ASSERT_EQ(child, waitpid(child, &status, 0));
+ ASSERT_EQ(1, WIFEXITED(status));
+ ASSERT_EQ(0, WEXITSTATUS(status));
}
TEST_F_FORK(layout1, link)
@@ -2444,6 +2554,44 @@ TEST_F_FORK(layout1, refer_mount_root_deny)
EXPECT_EQ(0, close(root_fd));
}
+TEST_F_FORK(layout1, refer_part_mount_tree_is_allowed)
+{
+ const struct rule layer1[] = {
+ {
+ /* Parent mount point. */
+ .path = dir_s3d1,
+ .access = LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG,
+ },
+ {
+ /*
+ * Removing the source file is allowed because its
+ * access rights are already a superset of the
+ * destination.
+ */
+ .path = dir_s3d4,
+ .access = LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG |
+ LANDLOCK_ACCESS_FS_REMOVE_FILE,
+ },
+ {},
+ };
+ int ruleset_fd;
+
+ ASSERT_EQ(0, unlink(file1_s3d3));
+ ruleset_fd = create_ruleset(_metadata,
+ LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG |
+ LANDLOCK_ACCESS_FS_REMOVE_FILE,
+ layer1);
+
+ ASSERT_LE(0, ruleset_fd);
+ enforce_ruleset(_metadata, ruleset_fd);
+ ASSERT_EQ(0, close(ruleset_fd));
+
+ ASSERT_EQ(0, rename(file1_s3d4, file1_s3d3));
+}
+
TEST_F_FORK(layout1, reparent_link)
{
const struct rule layer1[] = {
diff --git a/tools/testing/selftests/landlock/ptrace_test.c b/tools/testing/selftests/landlock/ptrace_test.c
index a19db4d0b3bd..8f31b673ff2d 100644
--- a/tools/testing/selftests/landlock/ptrace_test.c
+++ b/tools/testing/selftests/landlock/ptrace_test.c
@@ -22,8 +22,6 @@
/* Copied from security/yama/yama_lsm.c */
#define YAMA_SCOPE_DISABLED 0
#define YAMA_SCOPE_RELATIONAL 1
-#define YAMA_SCOPE_CAPABILITY 2
-#define YAMA_SCOPE_NO_ATTACH 3
static void create_domain(struct __test_metadata *const _metadata)
{
diff --git a/tools/testing/selftests/landlock/sandbox-and-launch.c b/tools/testing/selftests/landlock/sandbox-and-launch.c
new file mode 100644
index 000000000000..3e32e1a51ac5
--- /dev/null
+++ b/tools/testing/selftests/landlock/sandbox-and-launch.c
@@ -0,0 +1,82 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Sandbox itself and execute another program (in a different mount point).
+ *
+ * Used by layout1.umount_sandboxer from fs_test.c
+ *
+ * Copyright © 2024-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <errno.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <sys/prctl.h>
+#include <unistd.h>
+
+#include "wrappers.h"
+
+int main(int argc, char *argv[])
+{
+ struct landlock_ruleset_attr ruleset_attr = {
+ .scoped = LANDLOCK_SCOPE_SIGNAL,
+ };
+ int pipe_child, pipe_parent, ruleset_fd;
+ char buf;
+
+ /*
+ * The first argument must be the file descriptor number of a pipe.
+ * The second argument must be the program to execute.
+ */
+ if (argc != 4) {
+ fprintf(stderr, "Wrong number of arguments (not three)\n");
+ return 1;
+ }
+
+ pipe_child = atoi(argv[2]);
+ pipe_parent = atoi(argv[3]);
+
+ ruleset_fd =
+ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+ if (ruleset_fd < 0) {
+ perror("Failed to create ruleset");
+ return 1;
+ }
+
+ if (prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0)) {
+ perror("Failed to call prctl()");
+ return 1;
+ }
+
+ if (landlock_restrict_self(ruleset_fd, 0)) {
+ perror("Failed to restrict self");
+ return 1;
+ }
+
+ if (close(ruleset_fd)) {
+ perror("Failed to close ruleset");
+ return 1;
+ }
+
+ /* Signals that we are sandboxed. */
+ errno = 0;
+ if (write(pipe_child, ".", 1) != 1) {
+ perror("Failed to write to the second argument");
+ return 1;
+ }
+
+ /* Waits for the parent to try to umount. */
+ if (read(pipe_parent, &buf, 1) != 1) {
+ perror("Failed to write to the third argument");
+ return 1;
+ }
+
+ /* Shifts arguments. */
+ argv[0] = argv[1];
+ argv[1] = argv[2];
+ argv[2] = argv[3];
+ argv[3] = NULL;
+ execve(argv[0], argv, NULL);
+ perror("Failed to execute the provided binary");
+ return 1;
+}
diff --git a/tools/testing/selftests/landlock/wait-pipe.c b/tools/testing/selftests/landlock/wait-pipe.c
new file mode 100644
index 000000000000..0dbcd260a0fa
--- /dev/null
+++ b/tools/testing/selftests/landlock/wait-pipe.c
@@ -0,0 +1,42 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Write in a pipe and wait.
+ *
+ * Used by layout1.umount_sandboxer from fs_test.c
+ *
+ * Copyright © 2024-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <stdio.h>
+#include <stdlib.h>
+#include <unistd.h>
+
+int main(int argc, char *argv[])
+{
+ int pipe_child, pipe_parent;
+ char buf;
+
+ /* The first argument must be the file descriptor number of a pipe. */
+ if (argc != 3) {
+ fprintf(stderr, "Wrong number of arguments (not two)\n");
+ return 1;
+ }
+
+ pipe_child = atoi(argv[1]);
+ pipe_parent = atoi(argv[2]);
+
+ /* Signals that we are waiting. */
+ if (write(pipe_child, ".", 1) != 1) {
+ perror("Failed to write to first argument");
+ return 1;
+ }
+
+ /* Waits for the parent do its test. */
+ if (read(pipe_parent, &buf, 1) != 1) {
+ perror("Failed to write to the second argument");
+ return 1;
+ }
+
+ return 0;
+}
diff --git a/tools/testing/selftests/landlock/wrappers.h b/tools/testing/selftests/landlock/wrappers.h
new file mode 100644
index 000000000000..65548323e45d
--- /dev/null
+++ b/tools/testing/selftests/landlock/wrappers.h
@@ -0,0 +1,47 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Syscall wrappers
+ *
+ * Copyright © 2017-2020 Mickaël Salaün <mic@digikod.net>
+ * Copyright © 2019-2020 ANSSI
+ * Copyright © 2021-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <linux/landlock.h>
+#include <sys/syscall.h>
+#include <sys/types.h>
+#include <unistd.h>
+
+#ifndef landlock_create_ruleset
+static inline int
+landlock_create_ruleset(const struct landlock_ruleset_attr *const attr,
+ const size_t size, const __u32 flags)
+{
+ return syscall(__NR_landlock_create_ruleset, attr, size, flags);
+}
+#endif
+
+#ifndef landlock_add_rule
+static inline int landlock_add_rule(const int ruleset_fd,
+ const enum landlock_rule_type rule_type,
+ const void *const rule_attr,
+ const __u32 flags)
+{
+ return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr,
+ flags);
+}
+#endif
+
+#ifndef landlock_restrict_self
+static inline int landlock_restrict_self(const int ruleset_fd,
+ const __u32 flags)
+{
+ return syscall(__NR_landlock_restrict_self, ruleset_fd, flags);
+}
+#endif
+
+static inline pid_t sys_gettid(void)
+{
+ return syscall(__NR_gettid);
+}
diff --git a/tools/testing/selftests/livepatch/test-callbacks.sh b/tools/testing/selftests/livepatch/test-callbacks.sh
index 37bbc3fb2780..2a03deb26a12 100755
--- a/tools/testing/selftests/livepatch/test-callbacks.sh
+++ b/tools/testing/selftests/livepatch/test-callbacks.sh
@@ -259,7 +259,7 @@ $MOD_TARGET: ${MOD_TARGET}_init
% insmod test_modules/$MOD_LIVEPATCH.ko pre_patch_ret=-19
livepatch: enabling patch '$MOD_LIVEPATCH'
livepatch: '$MOD_LIVEPATCH': initializing patching transition
-test_klp_callbacks_demo: pre_patch_callback: vmlinux
+$MOD_LIVEPATCH: pre_patch_callback: vmlinux
livepatch: pre-patch callback failed for object 'vmlinux'
livepatch: failed to enable patch '$MOD_LIVEPATCH'
livepatch: '$MOD_LIVEPATCH': canceling patching transition, going to unpatch
diff --git a/tools/testing/selftests/livepatch/test-sysfs.sh b/tools/testing/selftests/livepatch/test-sysfs.sh
index 2c91428d2997..58fe1d96997c 100755
--- a/tools/testing/selftests/livepatch/test-sysfs.sh
+++ b/tools/testing/selftests/livepatch/test-sysfs.sh
@@ -5,6 +5,8 @@
. $(dirname $0)/functions.sh
MOD_LIVEPATCH=test_klp_livepatch
+MOD_LIVEPATCH2=test_klp_callbacks_demo
+MOD_LIVEPATCH3=test_klp_syscall
setup_config
@@ -19,6 +21,8 @@ check_sysfs_rights "$MOD_LIVEPATCH" "enabled" "-rw-r--r--"
check_sysfs_value "$MOD_LIVEPATCH" "enabled" "1"
check_sysfs_rights "$MOD_LIVEPATCH" "force" "--w-------"
check_sysfs_rights "$MOD_LIVEPATCH" "replace" "-r--r--r--"
+check_sysfs_rights "$MOD_LIVEPATCH" "stack_order" "-r--r--r--"
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
check_sysfs_rights "$MOD_LIVEPATCH" "transition" "-r--r--r--"
check_sysfs_value "$MOD_LIVEPATCH" "transition" "0"
check_sysfs_rights "$MOD_LIVEPATCH" "vmlinux/patched" "-r--r--r--"
@@ -131,4 +135,71 @@ livepatch: '$MOD_LIVEPATCH': completing unpatching transition
livepatch: '$MOD_LIVEPATCH': unpatching complete
% rmmod $MOD_LIVEPATCH"
+start_test "sysfs test stack_order value"
+
+load_lp $MOD_LIVEPATCH
+
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
+
+load_lp $MOD_LIVEPATCH2
+
+check_sysfs_value "$MOD_LIVEPATCH2" "stack_order" "2"
+
+load_lp $MOD_LIVEPATCH3
+
+check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "3"
+
+disable_lp $MOD_LIVEPATCH2
+unload_lp $MOD_LIVEPATCH2
+
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
+check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "2"
+
+disable_lp $MOD_LIVEPATCH3
+unload_lp $MOD_LIVEPATCH3
+
+disable_lp $MOD_LIVEPATCH
+unload_lp $MOD_LIVEPATCH
+
+check_result "% insmod test_modules/$MOD_LIVEPATCH.ko
+livepatch: enabling patch '$MOD_LIVEPATCH'
+livepatch: '$MOD_LIVEPATCH': initializing patching transition
+livepatch: '$MOD_LIVEPATCH': starting patching transition
+livepatch: '$MOD_LIVEPATCH': completing patching transition
+livepatch: '$MOD_LIVEPATCH': patching complete
+% insmod test_modules/$MOD_LIVEPATCH2.ko
+livepatch: enabling patch '$MOD_LIVEPATCH2'
+livepatch: '$MOD_LIVEPATCH2': initializing patching transition
+$MOD_LIVEPATCH2: pre_patch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': starting patching transition
+livepatch: '$MOD_LIVEPATCH2': completing patching transition
+$MOD_LIVEPATCH2: post_patch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': patching complete
+% insmod test_modules/$MOD_LIVEPATCH3.ko
+livepatch: enabling patch '$MOD_LIVEPATCH3'
+livepatch: '$MOD_LIVEPATCH3': initializing patching transition
+livepatch: '$MOD_LIVEPATCH3': starting patching transition
+livepatch: '$MOD_LIVEPATCH3': completing patching transition
+livepatch: '$MOD_LIVEPATCH3': patching complete
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH2/enabled
+livepatch: '$MOD_LIVEPATCH2': initializing unpatching transition
+$MOD_LIVEPATCH2: pre_unpatch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH2': completing unpatching transition
+$MOD_LIVEPATCH2: post_unpatch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': unpatching complete
+% rmmod $MOD_LIVEPATCH2
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH3/enabled
+livepatch: '$MOD_LIVEPATCH3': initializing unpatching transition
+livepatch: '$MOD_LIVEPATCH3': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH3': completing unpatching transition
+livepatch: '$MOD_LIVEPATCH3': unpatching complete
+% rmmod $MOD_LIVEPATCH3
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH/enabled
+livepatch: '$MOD_LIVEPATCH': initializing unpatching transition
+livepatch: '$MOD_LIVEPATCH': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH': completing unpatching transition
+livepatch: '$MOD_LIVEPATCH': unpatching complete
+% rmmod $MOD_LIVEPATCH"
+
exit 0
diff --git a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
index 66dec47e3ca3..732e89fe99c0 100644
--- a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
+++ b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
@@ -56,16 +56,15 @@ TEST(flags_zero_lsm_set_self_attr)
TEST(flags_overset_lsm_set_self_attr)
{
const long page_size = sysconf(_SC_PAGESIZE);
- char *ctx = calloc(page_size, 1);
+ struct lsm_ctx *ctx = calloc(page_size, 1);
__u32 size = page_size;
- struct lsm_ctx *tctx = (struct lsm_ctx *)ctx;
ASSERT_NE(NULL, ctx);
if (attr_lsm_count()) {
- ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, tctx, &size,
+ ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, ctx, &size,
0));
}
- ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, tctx,
+ ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, ctx,
size, 0));
free(ctx);
diff --git a/tools/testing/selftests/media_tests/regression_test.txt b/tools/testing/selftests/media_tests/regression_test.txt
index 2627367681f7..9d0fcd98c085 100644
--- a/tools/testing/selftests/media_tests/regression_test.txt
+++ b/tools/testing/selftests/media_tests/regression_test.txt
@@ -1,5 +1,5 @@
Testing for regressions in Media Controller API register, ioctl, syscall,
-and unregister paths. There have a few problems that result in user-after
+and unregister paths. There have a few problems that result in use-after
free on media_device, media_devnode, and cdev pointers when the driver is
unbound while ioctl is in progress.
@@ -15,11 +15,11 @@ Build media_device_test
cd tools/testing/selftests/media_tests
make
-Regressions test for cdev user-after free error on /dev/mediaX when driver
+Regressions test for cdev use-after-free error on /dev/mediaX when driver
is unbound:
Start media_device_test to regression test media devnode dynamic alloc
-and cdev user-after-free fixes. This opens media dev files and sits in
+and cdev use-after-free fixes. This opens media dev files and sits in
a loop running media ioctl MEDIA_IOC_DEVICE_INFO command once every 10
seconds. The idea is when device file goes away, media devnode and cdev
should stick around until this test exits.
@@ -40,4 +40,4 @@ keep ioctls going while bind/unbind runs.
Copy bind_unbind_sample.txt and make changes to specify the driver name
and number to run bind and unbind. Start the bind_unbind.sh
-Run dmesg looking for any user-after free errors or mutex lock errors.
+Run dmesg looking for any use-after-free errors or mutex lock errors.
diff --git a/tools/testing/selftests/memfd/memfd_test.c b/tools/testing/selftests/memfd/memfd_test.c
index 95af2d78fd31..c0c53451a16d 100644
--- a/tools/testing/selftests/memfd/memfd_test.c
+++ b/tools/testing/selftests/memfd/memfd_test.c
@@ -9,6 +9,7 @@
#include <fcntl.h>
#include <linux/memfd.h>
#include <sched.h>
+#include <stdbool.h>
#include <stdio.h>
#include <stdlib.h>
#include <signal.h>
@@ -281,6 +282,24 @@ static void *mfd_assert_mmap_shared(int fd)
return p;
}
+static void *mfd_assert_mmap_read_shared(int fd)
+{
+ void *p;
+
+ p = mmap(NULL,
+ mfd_def_size,
+ PROT_READ,
+ MAP_SHARED,
+ fd,
+ 0);
+ if (p == MAP_FAILED) {
+ printf("mmap() failed: %m\n");
+ abort();
+ }
+
+ return p;
+}
+
static void *mfd_assert_mmap_private(int fd)
{
void *p;
@@ -979,6 +998,30 @@ static void test_seal_future_write(void)
close(fd);
}
+static void test_seal_write_map_read_shared(void)
+{
+ int fd;
+ void *p;
+
+ printf("%s SEAL-WRITE-MAP-READ\n", memfd_str);
+
+ fd = mfd_assert_new("kern_memfd_seal_write_map_read",
+ mfd_def_size,
+ MFD_CLOEXEC | MFD_ALLOW_SEALING);
+
+ mfd_assert_add_seals(fd, F_SEAL_WRITE);
+ mfd_assert_has_seals(fd, F_SEAL_WRITE);
+
+ p = mfd_assert_mmap_read_shared(fd);
+
+ mfd_assert_read(fd);
+ mfd_assert_read_shared(fd);
+ mfd_fail_write(fd);
+
+ munmap(p, mfd_def_size);
+ close(fd);
+}
+
/*
* Test SEAL_SHRINK
* Test whether SEAL_SHRINK actually prevents shrinking
@@ -1557,6 +1600,11 @@ static void test_share_fork(char *banner, char *b_suffix)
close(fd);
}
+static bool pid_ns_supported(void)
+{
+ return access("/proc/self/ns/pid", F_OK) == 0;
+}
+
int main(int argc, char **argv)
{
pid_t pid;
@@ -1587,12 +1635,17 @@ int main(int argc, char **argv)
test_seal_write();
test_seal_future_write();
+ test_seal_write_map_read_shared();
test_seal_shrink();
test_seal_grow();
test_seal_resize();
- test_sysctl_simple();
- test_sysctl_nested();
+ if (pid_ns_supported()) {
+ test_sysctl_simple();
+ test_sysctl_nested();
+ } else {
+ printf("PID namespaces are not supported; skipping sysctl tests\n");
+ }
test_share_dup("SHARE-DUP", "");
test_share_mmap("SHARE-MMAP", "");
diff --git a/tools/testing/selftests/mm/cow.c b/tools/testing/selftests/mm/cow.c
index 32c6ccc2a6be..1238e1c5aae1 100644
--- a/tools/testing/selftests/mm/cow.c
+++ b/tools/testing/selftests/mm/cow.c
@@ -758,7 +758,7 @@ static void do_run_with_base_page(test_fn fn, bool swapout)
}
/* Populate a base page. */
- memset(mem, 0, pagesize);
+ memset(mem, 1, pagesize);
if (swapout) {
madvise(mem, pagesize, MADV_PAGEOUT);
@@ -824,12 +824,12 @@ static void do_run_with_thp(test_fn fn, enum thp_run thp_run, size_t thpsize)
* Try to populate a THP. Touch the first sub-page and test if
* we get the last sub-page populated automatically.
*/
- mem[0] = 0;
+ mem[0] = 1;
if (!pagemap_is_populated(pagemap_fd, mem + thpsize - pagesize)) {
ksft_test_result_skip("Did not get a THP populated\n");
goto munmap;
}
- memset(mem, 0, thpsize);
+ memset(mem, 1, thpsize);
size = thpsize;
switch (thp_run) {
@@ -1012,7 +1012,7 @@ static void run_with_hugetlb(test_fn fn, const char *desc, size_t hugetlbsize)
}
/* Populate an huge page. */
- memset(mem, 0, hugetlbsize);
+ memset(mem, 1, hugetlbsize);
/*
* We need a total of two hugetlb pages to handle COW/unsharing
diff --git a/tools/testing/selftests/mm/hugetlb_dio.c b/tools/testing/selftests/mm/hugetlb_dio.c
index 432d5af15e66..db63abe5ee5e 100644
--- a/tools/testing/selftests/mm/hugetlb_dio.c
+++ b/tools/testing/selftests/mm/hugetlb_dio.c
@@ -76,19 +76,15 @@ void run_dio_using_hugetlb(unsigned int start_off, unsigned int end_off)
/* Get the free huge pages after unmap*/
free_hpage_a = get_free_hugepages();
+ ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
+ ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
+
/*
* If the no. of free hugepages before allocation and after unmap does
* not match - that means there could still be a page which is pinned.
*/
- if (free_hpage_a != free_hpage_b) {
- ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
- ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
- ksft_test_result_fail(": Huge pages not freed!\n");
- } else {
- ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
- ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
- ksft_test_result_pass(": Huge pages freed successfully !\n");
- }
+ ksft_test_result(free_hpage_a == free_hpage_b,
+ "free huge pages from %u-%u\n", start_off, end_off);
}
int main(void)
diff --git a/tools/testing/selftests/net/Makefile b/tools/testing/selftests/net/Makefile
index cb2fc601de66..73ee88d6b043 100644
--- a/tools/testing/selftests/net/Makefile
+++ b/tools/testing/selftests/net/Makefile
@@ -32,6 +32,7 @@ TEST_PROGS += ioam6.sh
TEST_PROGS += gro.sh
TEST_PROGS += gre_gso.sh
TEST_PROGS += cmsg_so_mark.sh
+TEST_PROGS += cmsg_so_priority.sh
TEST_PROGS += cmsg_time.sh cmsg_ipv6.sh
TEST_PROGS += netns-name.sh
TEST_PROGS += nl_netdev.py
@@ -95,6 +96,7 @@ TEST_PROGS += test_bridge_backup_port.sh
TEST_PROGS += fdb_flush.sh fdb_notify.sh
TEST_PROGS += fq_band_pktlimit.sh
TEST_PROGS += vlan_hw_filter.sh
+TEST_PROGS += vlan_bridge_binding.sh
TEST_PROGS += bpf_offload.py
TEST_PROGS += ipv6_route_update_soft_lockup.sh
TEST_PROGS += busy_poll_test.sh
diff --git a/tools/testing/selftests/net/busy_poller.c b/tools/testing/selftests/net/busy_poller.c
index 99b0e8c17fca..04c7ff577bb8 100644
--- a/tools/testing/selftests/net/busy_poller.c
+++ b/tools/testing/selftests/net/busy_poller.c
@@ -54,16 +54,16 @@ struct epoll_params {
#define EPIOCGPARAMS _IOR(EPOLL_IOC_TYPE, 0x02, struct epoll_params)
#endif
-static uint32_t cfg_port = 8000;
+static uint16_t cfg_port = 8000;
static struct in_addr cfg_bind_addr = { .s_addr = INADDR_ANY };
static char *cfg_outfile;
static int cfg_max_events = 8;
-static int cfg_ifindex;
+static uint32_t cfg_ifindex;
/* busy poll params */
static uint32_t cfg_busy_poll_usecs;
-static uint32_t cfg_busy_poll_budget;
-static uint32_t cfg_prefer_busy_poll;
+static uint16_t cfg_busy_poll_budget;
+static uint8_t cfg_prefer_busy_poll;
/* IRQ params */
static uint32_t cfg_defer_hard_irqs;
@@ -79,6 +79,7 @@ static void usage(const char *filepath)
static void parse_opts(int argc, char **argv)
{
+ unsigned long long tmp;
int ret;
int c;
@@ -86,31 +87,40 @@ static void parse_opts(int argc, char **argv)
usage(argv[0]);
while ((c = getopt(argc, argv, "p:m:b:u:P:g:o:d:r:s:i:")) != -1) {
+ /* most options take integer values, except o and b, so reduce
+ * code duplication a bit for the common case by calling
+ * strtoull here and leave bounds checking and casting per
+ * option below.
+ */
+ if (c != 'o' && c != 'b')
+ tmp = strtoull(optarg, NULL, 0);
+
switch (c) {
case 'u':
- cfg_busy_poll_usecs = strtoul(optarg, NULL, 0);
- if (cfg_busy_poll_usecs == ULONG_MAX ||
- cfg_busy_poll_usecs > UINT32_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT32_MAX)
error(1, ERANGE, "busy_poll_usecs too large");
+
+ cfg_busy_poll_usecs = (uint32_t)tmp;
break;
case 'P':
- cfg_prefer_busy_poll = strtoul(optarg, NULL, 0);
- if (cfg_prefer_busy_poll == ULONG_MAX ||
- cfg_prefer_busy_poll > 1)
+ if (tmp == ULLONG_MAX || tmp > 1)
error(1, ERANGE,
"prefer busy poll should be 0 or 1");
+
+ cfg_prefer_busy_poll = (uint8_t)tmp;
break;
case 'g':
- cfg_busy_poll_budget = strtoul(optarg, NULL, 0);
- if (cfg_busy_poll_budget == ULONG_MAX ||
- cfg_busy_poll_budget > UINT16_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT16_MAX)
error(1, ERANGE,
"busy poll budget must be [0, UINT16_MAX]");
+
+ cfg_busy_poll_budget = (uint16_t)tmp;
break;
case 'p':
- cfg_port = strtoul(optarg, NULL, 0);
- if (cfg_port > UINT16_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT16_MAX)
error(1, ERANGE, "port must be <= 65535");
+
+ cfg_port = (uint16_t)tmp;
break;
case 'b':
ret = inet_aton(optarg, &cfg_bind_addr);
@@ -124,41 +134,39 @@ static void parse_opts(int argc, char **argv)
error(1, 0, "outfile invalid");
break;
case 'm':
- cfg_max_events = strtol(optarg, NULL, 0);
-
- if (cfg_max_events == LONG_MIN ||
- cfg_max_events == LONG_MAX ||
- cfg_max_events <= 0)
+ if (tmp == ULLONG_MAX || tmp > INT_MAX)
error(1, ERANGE,
- "max events must be > 0 and < LONG_MAX");
+ "max events must be > 0 and <= INT_MAX");
+
+ cfg_max_events = (int)tmp;
break;
case 'd':
- cfg_defer_hard_irqs = strtoul(optarg, NULL, 0);
-
- if (cfg_defer_hard_irqs == ULONG_MAX ||
- cfg_defer_hard_irqs > INT32_MAX)
+ if (tmp == ULLONG_MAX || tmp > INT32_MAX)
error(1, ERANGE,
"defer_hard_irqs must be <= INT32_MAX");
+
+ cfg_defer_hard_irqs = (uint32_t)tmp;
break;
case 'r':
- cfg_gro_flush_timeout = strtoull(optarg, NULL, 0);
-
- if (cfg_gro_flush_timeout == ULLONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT64_MAX)
error(1, ERANGE,
- "gro_flush_timeout must be < ULLONG_MAX");
+ "gro_flush_timeout must be < UINT64_MAX");
+
+ cfg_gro_flush_timeout = (uint64_t)tmp;
break;
case 's':
- cfg_irq_suspend_timeout = strtoull(optarg, NULL, 0);
-
- if (cfg_irq_suspend_timeout == ULLONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT64_MAX)
error(1, ERANGE,
"irq_suspend_timeout must be < ULLONG_MAX");
+
+ cfg_irq_suspend_timeout = (uint64_t)tmp;
break;
case 'i':
- cfg_ifindex = strtoul(optarg, NULL, 0);
- if (cfg_ifindex == ULONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > INT_MAX)
error(1, ERANGE,
- "ifindex must be < ULONG_MAX");
+ "ifindex must be <= INT_MAX");
+
+ cfg_ifindex = (int)tmp;
break;
}
}
@@ -215,7 +223,7 @@ static void setup_queue(void)
struct netdev_napi_set_req *set_req = NULL;
struct ynl_sock *ys;
struct ynl_error yerr;
- uint32_t napi_id;
+ uint32_t napi_id = 0;
ys = ynl_sock_create(&ynl_netdev_family, &yerr);
if (!ys)
@@ -277,8 +285,8 @@ static void run_poller(void)
* here
*/
epoll_params.busy_poll_usecs = cfg_busy_poll_usecs;
- epoll_params.busy_poll_budget = (uint16_t)cfg_busy_poll_budget;
- epoll_params.prefer_busy_poll = (uint8_t)cfg_prefer_busy_poll;
+ epoll_params.busy_poll_budget = cfg_busy_poll_budget;
+ epoll_params.prefer_busy_poll = cfg_prefer_busy_poll;
epoll_params.__pad = 0;
val = 1;
@@ -342,5 +350,9 @@ int main(int argc, char *argv[])
parse_opts(argc, argv);
setup_queue();
run_poller();
+
+ if (cfg_outfile)
+ free(cfg_outfile);
+
return 0;
}
diff --git a/tools/testing/selftests/net/cmsg_sender.c b/tools/testing/selftests/net/cmsg_sender.c
index 876c2db02a63..bc314382e4e1 100644
--- a/tools/testing/selftests/net/cmsg_sender.c
+++ b/tools/testing/selftests/net/cmsg_sender.c
@@ -59,6 +59,7 @@ struct options {
unsigned int proto;
} sock;
struct option_cmsg_u32 mark;
+ struct option_cmsg_u32 priority;
struct {
bool ena;
unsigned int delay;
@@ -97,6 +98,8 @@ static void __attribute__((noreturn)) cs_usage(const char *bin)
"\n"
"\t\t-m val Set SO_MARK with given value\n"
"\t\t-M val Set SO_MARK via setsockopt\n"
+ "\t\t-P val Set SO_PRIORITY via setsockopt\n"
+ "\t\t-Q val Set SO_PRIORITY via cmsg\n"
"\t\t-d val Set SO_TXTIME with given delay (usec)\n"
"\t\t-t Enable time stamp reporting\n"
"\t\t-f val Set don't fragment via cmsg\n"
@@ -115,7 +118,7 @@ static void cs_parse_args(int argc, char *argv[])
{
int o;
- while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:")) != -1) {
+ while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:Q:")) != -1) {
switch (o) {
case 's':
opt.silent_send = true;
@@ -148,6 +151,10 @@ static void cs_parse_args(int argc, char *argv[])
opt.mark.ena = true;
opt.mark.val = atoi(optarg);
break;
+ case 'Q':
+ opt.priority.ena = true;
+ opt.priority.val = atoi(optarg);
+ break;
case 'M':
opt.sockopt.mark = atoi(optarg);
break;
@@ -253,6 +260,8 @@ cs_write_cmsg(int fd, struct msghdr *msg, char *cbuf, size_t cbuf_sz)
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_SOCKET, SO_MARK, &opt.mark);
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
+ SOL_SOCKET, SO_PRIORITY, &opt.priority);
+ ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_IPV6, IPV6_DONTFRAG, &opt.v6.dontfrag);
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_IPV6, IPV6_TCLASS, &opt.v6.tclass);
diff --git a/tools/testing/selftests/net/cmsg_so_priority.sh b/tools/testing/selftests/net/cmsg_so_priority.sh
new file mode 100755
index 000000000000..ee07d8653262
--- /dev/null
+++ b/tools/testing/selftests/net/cmsg_so_priority.sh
@@ -0,0 +1,151 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+source lib.sh
+
+readonly KSFT_SKIP=4
+
+IP4=192.0.2.1/24
+TGT4=192.0.2.2
+TGT4_RAW=192.0.2.3
+IP6=2001:db8::1/64
+TGT6=2001:db8::2
+TGT6_RAW=2001:db8::3
+PORT=1234
+TOTAL_TESTS=0
+FAILED_TESTS=0
+
+if ! command -v jq &> /dev/null; then
+ echo "SKIP cmsg_so_priroity.sh test: jq is not installed." >&2
+ exit "$KSFT_SKIP"
+fi
+
+check_result() {
+ ((TOTAL_TESTS++))
+ if [ "$1" -ne 0 ]; then
+ ((FAILED_TESTS++))
+ fi
+}
+
+cleanup()
+{
+ cleanup_ns $NS
+}
+
+trap cleanup EXIT
+
+setup_ns NS
+
+create_filter() {
+ local handle=$1
+ local vlan_prio=$2
+ local ip_type=$3
+ local proto=$4
+ local dst_ip=$5
+ local ip_proto
+
+ if [[ "$proto" == "u" ]]; then
+ ip_proto="udp"
+ elif [[ "$ip_type" == "ipv4" && "$proto" == "i" ]]; then
+ ip_proto="icmp"
+ elif [[ "$ip_type" == "ipv6" && "$proto" == "i" ]]; then
+ ip_proto="icmpv6"
+ fi
+
+ tc -n $NS filter add dev dummy1 \
+ egress pref 1 handle "$handle" proto 802.1q \
+ flower vlan_prio "$vlan_prio" vlan_ethtype "$ip_type" \
+ dst_ip "$dst_ip" ${ip_proto:+ip_proto $ip_proto} \
+ action pass
+}
+
+ip -n $NS link set dev lo up
+ip -n $NS link add name dummy1 up type dummy
+
+ip -n $NS link add link dummy1 name dummy1.10 up type vlan id 10 \
+ egress-qos-map 0:0 1:1 2:2 3:3 4:4 5:5 6:6 7:7
+
+ip -n $NS address add $IP4 dev dummy1.10
+ip -n $NS address add $IP6 dev dummy1.10 nodad
+
+ip netns exec $NS sysctl -wq net.ipv4.ping_group_range='0 2147483647'
+
+ip -n $NS neigh add $TGT4 lladdr 00:11:22:33:44:55 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT6 lladdr 00:11:22:33:44:55 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT4_RAW lladdr 00:11:22:33:44:66 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT6_RAW lladdr 00:11:22:33:44:66 nud permanent \
+ dev dummy1.10
+
+tc -n $NS qdisc add dev dummy1 clsact
+
+FILTER_COUNTER=10
+
+for i in 4 6; do
+ for proto in u i r; do
+ echo "Test IPV$i, prot: $proto"
+ for priority in {0..7}; do
+ if [[ $i == 4 && $proto == "r" ]]; then
+ TGT=$TGT4_RAW
+ elif [[ $i == 6 && $proto == "r" ]]; then
+ TGT=$TGT6_RAW
+ elif [ $i == 4 ]; then
+ TGT=$TGT4
+ else
+ TGT=$TGT6
+ fi
+
+ handle="${FILTER_COUNTER}${priority}"
+
+ create_filter $handle $priority ipv$i $proto $TGT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+
+ if [[ $pkts == 0 ]]; then
+ check_result 0
+ else
+ echo "prio $priority: expected 0, got $pkts"
+ check_result 1
+ fi
+
+ ip netns exec $NS ./cmsg_sender -$i -Q $priority \
+ -p $proto $TGT $PORT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+ if [[ $pkts == 1 ]]; then
+ check_result 0
+ else
+ echo "prio $priority -Q: expected 1, got $pkts"
+ check_result 1
+ fi
+
+ ip netns exec $NS ./cmsg_sender -$i -P $priority \
+ -p $proto $TGT $PORT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+ if [[ $pkts == 2 ]]; then
+ check_result 0
+ else
+ echo "prio $priority -P: expected 2, got $pkts"
+ check_result 1
+ fi
+ done
+ FILTER_COUNTER=$((FILTER_COUNTER + 10))
+ done
+done
+
+if [ $FAILED_TESTS -ne 0 ]; then
+ echo "FAIL - $FAILED_TESTS/$TOTAL_TESTS tests failed"
+ exit 1
+else
+ echo "OK - All $TOTAL_TESTS tests passed"
+ exit 0
+fi
diff --git a/tools/testing/selftests/net/cmsg_time.sh b/tools/testing/selftests/net/cmsg_time.sh
index 1d7e756644bc..478af0aefa97 100755
--- a/tools/testing/selftests/net/cmsg_time.sh
+++ b/tools/testing/selftests/net/cmsg_time.sh
@@ -34,13 +34,28 @@ BAD=0
TOTAL=0
check_result() {
+ local ret=$1
+ local got=$2
+ local exp=$3
+ local case=$4
+ local xfail=$5
+ local xf=
+ local inc=
+
+ if [ "$xfail" == "xfail" ]; then
+ xf="(XFAIL)"
+ inc=0
+ else
+ inc=1
+ fi
+
((TOTAL++))
- if [ $1 -ne 0 ]; then
- echo " Case $4 returned $1, expected 0"
- ((BAD++))
+ if [ $ret -ne 0 ]; then
+ echo " Case $case returned $ret, expected 0 $xf"
+ ((BAD+=inc))
elif [ "$2" != "$3" ]; then
- echo " Case $4 returned '$2', expected '$3'"
- ((BAD++))
+ echo " Case $case returned '$got', expected '$exp' $xf"
+ ((BAD+=inc))
fi
}
@@ -66,14 +81,14 @@ for i in "-4 $TGT4" "-6 $TGT6"; do
awk '/SND/ { if ($3 > 1000) print "OK"; }')
check_result $? "$ts" "OK" "$prot - TXTIME abs"
- [ "$KSFT_MACHINE_SLOW" = yes ] && delay=8000 || delay=1000
+ [ "$KSFT_MACHINE_SLOW" = yes ] && xfail=xfail
- ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d $delay |
+ ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d 1000 |
awk '/SND/ {snd=$3}
/SCHED/ {sch=$3}
- END { if (snd - sch > '$((delay/2))') print "OK";
- else print snd, "-", sch, "<", '$((delay/2))'; }')
- check_result $? "$ts" "OK" "$prot - TXTIME rel"
+ END { if (snd - sch > 500) print "OK";
+ else print snd, "-", sch, "<", 500; }')
+ check_result $? "$ts" "OK" "$prot - TXTIME rel" $xfail
done
done
diff --git a/tools/testing/selftests/net/fdb_notify.sh b/tools/testing/selftests/net/fdb_notify.sh
index c03151e7791c..c159230c9b62 100755
--- a/tools/testing/selftests/net/fdb_notify.sh
+++ b/tools/testing/selftests/net/fdb_notify.sh
@@ -49,7 +49,7 @@ test_dup_vxlan_self()
{
ip_link_add br up type bridge vlan_filtering 1
ip_link_add vx up type vxlan id 2000 dstport 4789
- ip_link_master vx br
+ ip_link_set_master vx br
do_test_dup add "vxlan" dev vx self dst 192.0.2.1
do_test_dup del "vxlan" dev vx self dst 192.0.2.1
@@ -59,7 +59,7 @@ test_dup_vxlan_master()
{
ip_link_add br up type bridge vlan_filtering 1
ip_link_add vx up type vxlan id 2000 dstport 4789
- ip_link_master vx br
+ ip_link_set_master vx br
do_test_dup add "vxlan master" dev vx master
do_test_dup del "vxlan master" dev vx master
@@ -79,7 +79,7 @@ test_dup_macvlan_master()
ip_link_add br up type bridge vlan_filtering 1
ip_link_add dd up type dummy
ip_link_add mv up link dd type macvlan mode passthru
- ip_link_master mv br
+ ip_link_set_master mv br
do_test_dup add "macvlan master" dev mv self
do_test_dup del "macvlan master" dev mv self
diff --git a/tools/testing/selftests/net/fib_rule_tests.sh b/tools/testing/selftests/net/fib_rule_tests.sh
index 1d58b3b87465..847936363a12 100755
--- a/tools/testing/selftests/net/fib_rule_tests.sh
+++ b/tools/testing/selftests/net/fib_rule_tests.sh
@@ -291,6 +291,37 @@ fib_rule6_test()
"$getnomatch" "iif dscp redirect to table" \
"iif dscp no redirect to table"
fi
+
+ fib_check_iproute_support "flowlabel" "flowlabel"
+ if [ $? -eq 0 ]; then
+ match="flowlabel 0xfffff"
+ getmatch="flowlabel 0xfffff"
+ getnomatch="flowlabel 0xf"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "flowlabel redirect to table" \
+ "flowlabel no redirect to table"
+
+ match="flowlabel 0xfffff"
+ getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff"
+ getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "iif flowlabel redirect to table" \
+ "iif flowlabel no redirect to table"
+
+ match="flowlabel 0x08000/0x08000"
+ getmatch="flowlabel 0xfffff"
+ getnomatch="flowlabel 0xf7fff"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "flowlabel masked redirect to table" \
+ "flowlabel masked no redirect to table"
+
+ match="flowlabel 0x08000/0x08000"
+ getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff"
+ getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf7fff"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "iif flowlabel masked redirect to table" \
+ "iif flowlabel masked no redirect to table"
+ fi
}
fib_rule6_vrf_test()
diff --git a/tools/testing/selftests/net/forwarding/Makefile b/tools/testing/selftests/net/forwarding/Makefile
index 7d885cff8d79..00bde7b6f39e 100644
--- a/tools/testing/selftests/net/forwarding/Makefile
+++ b/tools/testing/selftests/net/forwarding/Makefile
@@ -105,6 +105,7 @@ TEST_PROGS = bridge_fdb_learning_limit.sh \
vxlan_bridge_1q_port_8472_ipv6.sh \
vxlan_bridge_1q_port_8472.sh \
vxlan_bridge_1q.sh \
+ vxlan_reserved.sh \
vxlan_symmetric_ipv6.sh \
vxlan_symmetric.sh
diff --git a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
index 1c8a26046589..2b5700b61ffa 100755
--- a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
+++ b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
@@ -1,7 +1,7 @@
#!/bin/bash
# SPDX-License-Identifier: GPL-2.0
-ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding"
+ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding pvid_change"
NUM_NETIFS=4
source lib.sh
@@ -77,12 +77,16 @@ cleanup()
ping_ipv4()
{
- ping_test $h1 192.0.2.2
+ local msg=$1
+
+ ping_test $h1 192.0.2.2 "$msg"
}
ping_ipv6()
{
- ping6_test $h1 2001:db8:1::2
+ local msg=$1
+
+ ping6_test $h1 2001:db8:1::2 "$msg"
}
learning()
@@ -95,6 +99,21 @@ flooding()
flood_test $swp2 $h1 $h2
}
+pvid_change()
+{
+ # Test that the changing of the VLAN-aware PVID does not affect
+ # VLAN-unaware forwarding
+ bridge vlan add vid 3 dev $swp1 pvid untagged
+
+ ping_ipv4 " with bridge port $swp1 PVID changed"
+ ping_ipv6 " with bridge port $swp1 PVID changed"
+
+ bridge vlan del vid 3 dev $swp1
+
+ ping_ipv4 " with bridge port $swp1 PVID deleted"
+ ping_ipv6 " with bridge port $swp1 PVID deleted"
+}
+
trap cleanup EXIT
setup_prepare
diff --git a/tools/testing/selftests/net/forwarding/lib.sh b/tools/testing/selftests/net/forwarding/lib.sh
index 7337f398f9cc..8de80acf249e 100644
--- a/tools/testing/selftests/net/forwarding/lib.sh
+++ b/tools/testing/selftests/net/forwarding/lib.sh
@@ -68,6 +68,7 @@ declare -A NETIFS=(
: "${REQUIRE_JQ:=yes}"
: "${REQUIRE_MZ:=yes}"
: "${REQUIRE_MTOOLS:=no}"
+: "${REQUIRE_TEAMD:=no}"
# Whether to override MAC addresses on interfaces participating in the test.
: "${STABLE_MAC_ADDRS:=no}"
@@ -321,6 +322,9 @@ fi
if [[ "$REQUIRE_MZ" = "yes" ]]; then
require_command $MZ
fi
+if [[ "$REQUIRE_TEAMD" = "yes" ]]; then
+ require_command $TEAMD
+fi
if [[ "$REQUIRE_MTOOLS" = "yes" ]]; then
# https://github.com/troglobit/mtools
require_command msend
@@ -932,13 +936,6 @@ packets_rate()
echo $(((t1 - t0) / interval))
}
-mac_get()
-{
- local if_name=$1
-
- ip -j link show dev $if_name | jq -r '.[]["address"]'
-}
-
ether_addr_to_u64()
{
local addr="$1"
diff --git a/tools/testing/selftests/net/forwarding/local_termination.sh b/tools/testing/selftests/net/forwarding/local_termination.sh
index c35548767756..ecd34f364125 100755
--- a/tools/testing/selftests/net/forwarding/local_termination.sh
+++ b/tools/testing/selftests/net/forwarding/local_termination.sh
@@ -7,7 +7,6 @@ ALL_TESTS="standalone vlan_unaware_bridge vlan_aware_bridge test_vlan \
NUM_NETIFS=2
PING_COUNT=1
REQUIRE_MTOOLS=yes
-REQUIRE_MZ=no
source lib.sh
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
index fe4d7c906a70..a20d22d1df36 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
@@ -49,6 +49,7 @@ ALL_TESTS="
test_mirror_gretap_second
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=6
source lib.sh
source mirror_lib.sh
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
index 1261e6f46e34..ff7049582d35 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
@@ -53,6 +53,7 @@ ALL_TESTS="
test_mirror_gretap_second
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=6
source lib.sh
source mirror_lib.sh
diff --git a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
index e064b946e821..16583a470ec3 100755
--- a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
+++ b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
@@ -109,6 +109,7 @@ ALL_TESTS="
ping_ipv4
ping_ipv6
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=8
source lib.sh
diff --git a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
index f05ffe213c46..2a4cd1af1b85 100755
--- a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
+++ b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
@@ -76,6 +76,7 @@
ping_ipv4
ping_ipv6
"}
+REQUIRE_TEAMD="yes"
NUM_NETIFS=8
: ${lib_dir:=.}
source $lib_dir/lib.sh
diff --git a/tools/testing/selftests/net/forwarding/vxlan_reserved.sh b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh
new file mode 100755
index 000000000000..46c31794b91b
--- /dev/null
+++ b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh
@@ -0,0 +1,352 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+# +--------------------+
+# | H1 (vrf) |
+# | + $h1 |
+# | | 192.0.2.1/28 |
+# +----|---------------+
+# |
+# +----|--------------------------------+
+# | SW | |
+# | +--|------------------------------+ |
+# | | + $swp1 BR1 (802.1d) | |
+# | | | |
+# | | + vx1 (vxlan) | |
+# | | local 192.0.2.17 | |
+# | | id 1000 dstport $VXPORT | |
+# | +---------------------------------+ |
+# | |
+# | 192.0.2.32/28 via 192.0.2.18 |
+# | |
+# | + $rp1 |
+# | | 192.0.2.17/28 |
+# +--|----------------------------------+
+# |
+# +--|----------------------------------+
+# | | |
+# | + $rp2 |
+# | 192.0.2.18/28 |
+# | |
+# | VRP2 (vrf) |
+# +-------------------------------------+
+
+: ${VXPORT:=4789}
+: ${ALL_TESTS:="
+ default_test
+ plain_test
+ reserved_0_test
+ reserved_10_test
+ reserved_31_test
+ reserved_56_test
+ reserved_63_test
+ "}
+
+NUM_NETIFS=4
+source lib.sh
+
+h1_create()
+{
+ simple_if_init $h1 192.0.2.1/28
+ defer simple_if_fini $h1 192.0.2.1/28
+
+ tc qdisc add dev $h1 clsact
+ defer tc qdisc del dev $h1 clsact
+
+ tc filter add dev $h1 ingress pref 77 \
+ prot ip flower skip_hw ip_proto icmp action drop
+ defer tc filter del dev $h1 ingress pref 77
+}
+
+switch_create()
+{
+ ip_link_add br1 type bridge vlan_filtering 0 mcast_snooping 0
+ # Make sure the bridge uses the MAC address of the local port and not
+ # that of the VxLAN's device.
+ ip_link_set_addr br1 $(mac_get $swp1)
+ ip_link_set_up br1
+
+ ip_link_set_up $rp1
+ ip_addr_add $rp1 192.0.2.17/28
+ ip_route_add 192.0.2.32/28 nexthop via 192.0.2.18
+
+ ip_link_set_master $swp1 br1
+ ip_link_set_up $swp1
+}
+
+vrp2_create()
+{
+ simple_if_init $rp2 192.0.2.18/28
+ defer simple_if_fini $rp2 192.0.2.18/28
+}
+
+setup_prepare()
+{
+ h1=${NETIFS[p1]}
+ swp1=${NETIFS[p2]}
+
+ rp1=${NETIFS[p3]}
+ rp2=${NETIFS[p4]}
+
+ vrf_prepare
+ defer vrf_cleanup
+
+ forwarding_enable
+ defer forwarding_restore
+
+ h1_create
+ switch_create
+
+ vrp2_create
+}
+
+vxlan_header_bytes()
+{
+ local vni=$1; shift
+ local -a extra_bits=("$@")
+ local -a bits
+ local i
+
+ for ((i=0; i < 64; i++)); do
+ bits[i]=0
+ done
+
+ # Bit 4 is the I flag and is always on.
+ bits[4]=1
+
+ for i in ${extra_bits[@]}; do
+ bits[i]=1
+ done
+
+ # Bits 32..55 carry the VNI
+ local mask=0x800000
+ for ((i=0; i < 24; i++)); do
+ bits[$((i + 32))]=$(((vni & mask) != 0))
+ ((mask >>= 1))
+ done
+
+ local bytes
+ for ((i=0; i < 8; i++)); do
+ local byte=0
+ local j
+ for ((j=0; j < 8; j++)); do
+ local bit=${bits[8 * i + j]}
+ ((byte += bit << (7 - j)))
+ done
+ bytes+=$(printf %02x $byte):
+ done
+
+ echo ${bytes%:}
+}
+
+neg_bytes()
+{
+ local bytes=$1; shift
+
+ local -A neg=([0]=f [1]=e [2]=d [3]=c [4]=b [5]=a [6]=9 [7]=8
+ [8]=7 [9]=6 [a]=5 [b]=4 [c]=3 [d]=2 [e]=1 [f]=0 [:]=:)
+ local out
+ local i
+
+ for ((i=0; i < ${#bytes}; i++)); do
+ local c=${bytes:$i:1}
+ out+=${neg[$c]}
+ done
+ echo $out
+}
+
+vxlan_ping_do()
+{
+ local count=$1; shift
+ local dev=$1; shift
+ local next_hop_mac=$1; shift
+ local dest_ip=$1; shift
+ local dest_mac=$1; shift
+ local vni=$1; shift
+ local reserved_bits=$1; shift
+
+ local vxlan_header=$(vxlan_header_bytes $vni $reserved_bits)
+
+ $MZ $dev -c $count -d 100msec -q \
+ -b $next_hop_mac -B $dest_ip \
+ -t udp sp=23456,dp=$VXPORT,p=$(:
+ )"$vxlan_header:"$( : VXLAN
+ )"$dest_mac:"$( : ETH daddr
+ )"00:11:22:33:44:55:"$( : ETH saddr
+ )"08:00:"$( : ETH type
+ )"45:"$( : IP version + IHL
+ )"00:"$( : IP TOS
+ )"00:54:"$( : IP total length
+ )"99:83:"$( : IP identification
+ )"40:00:"$( : IP flags + frag off
+ )"40:"$( : IP TTL
+ )"01:"$( : IP proto
+ )"00:00:"$( : IP header csum
+ )"$(ipv4_to_bytes 192.0.2.3):"$( : IP saddr
+ )"$(ipv4_to_bytes 192.0.2.1):"$( : IP daddr
+ )"08:"$( : ICMP type
+ )"00:"$( : ICMP code
+ )"8b:f2:"$( : ICMP csum
+ )"1f:6a:"$( : ICMP request identifier
+ )"00:01:"$( : ICMP request seq. number
+ )"4f:ff:c5:5b:00:00:00:00:"$( : ICMP payload
+ )"6d:74:0b:00:00:00:00:00:"$( :
+ )"10:11:12:13:14:15:16:17:"$( :
+ )"18:19:1a:1b:1c:1d:1e:1f:"$( :
+ )"20:21:22:23:24:25:26:27:"$( :
+ )"28:29:2a:2b:2c:2d:2e:2f:"$( :
+ )"30:31:32:33:34:35:36:37"
+}
+
+vxlan_device_add()
+{
+ ip_link_add vx1 up type vxlan id 1000 \
+ local 192.0.2.17 dstport "$VXPORT" \
+ nolearning noudpcsum tos inherit ttl 100 "$@"
+ ip_link_set_master vx1 br1
+}
+
+vxlan_all_reserved_bits()
+{
+ local i
+
+ for ((i=0; i < 64; i++)); do
+ if ((i == 4 || i >= 32 && i < 56)); then
+ continue
+ fi
+ echo $i
+ done
+}
+
+vxlan_ping_vanilla()
+{
+ vxlan_ping_do 10 $rp2 $(mac_get $rp1) 192.0.2.17 $(mac_get $h1) 1000
+}
+
+vxlan_ping_reserved()
+{
+ for bit in $(vxlan_all_reserved_bits); do
+ vxlan_ping_do 1 $rp2 $(mac_get $rp1) \
+ 192.0.2.17 $(mac_get $h1) 1000 "$bit"
+ ((n++))
+ done
+}
+
+vxlan_ping_test()
+{
+ local what=$1; shift
+ local get_stat=$1; shift
+ local expect=$1; shift
+
+ RET=0
+
+ local t0=$($get_stat)
+
+ "$@"
+ check_err $? "Failure when running $@"
+
+ local t1=$($get_stat)
+ local delta=$((t1 - t0))
+
+ ((expect == delta))
+ check_err $? "Expected to capture $expect packets, got $delta."
+
+ log_test "$what"
+}
+
+__default_test_do()
+{
+ local n_allowed_bits=$1; shift
+ local what=$1; shift
+
+ vxlan_ping_test "$what: clean packets" \
+ "tc_rule_stats_get $h1 77 ingress" \
+ 10 vxlan_ping_vanilla
+
+ local t0=$(link_stats_get vx1 rx errors)
+ vxlan_ping_test "$what: mangled packets" \
+ "tc_rule_stats_get $h1 77 ingress" \
+ $n_allowed_bits vxlan_ping_reserved
+ local t1=$(link_stats_get vx1 rx errors)
+
+ RET=0
+ local expect=$((39 - n_allowed_bits))
+ local delta=$((t1 - t0))
+ ((expect == delta))
+ check_err $? "Expected $expect error packets, got $delta."
+ log_test "$what: drops reported"
+}
+
+default_test_do()
+{
+ vxlan_device_add
+ __default_test_do 0 "Default"
+}
+
+default_test()
+{
+ in_defer_scope \
+ default_test_do
+}
+
+plain_test_do()
+{
+ vxlan_device_add reserved_bits 0xf7ffffff000000ff
+ __default_test_do 0 "reserved_bits 0xf7ffffff000000ff"
+}
+
+plain_test()
+{
+ in_defer_scope \
+ plain_test_do
+}
+
+reserved_test()
+{
+ local bit=$1; shift
+
+ local allowed_bytes=$(vxlan_header_bytes 0xffffff $bit)
+ local reserved_bytes=$(neg_bytes $allowed_bytes)
+ local reserved_bits=${reserved_bytes//:/}
+
+ vxlan_device_add reserved_bits 0x$reserved_bits
+ __default_test_do 1 "reserved_bits 0x$reserved_bits"
+}
+
+reserved_0_test()
+{
+ in_defer_scope \
+ reserved_test 0
+}
+
+reserved_10_test()
+{
+ in_defer_scope \
+ reserved_test 10
+}
+
+reserved_31_test()
+{
+ in_defer_scope \
+ reserved_test 31
+}
+
+reserved_56_test()
+{
+ in_defer_scope \
+ reserved_test 56
+}
+
+reserved_63_test()
+{
+ in_defer_scope \
+ reserved_test 63
+}
+
+trap cleanup EXIT
+
+setup_prepare
+setup_wait
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/ipsec.c b/tools/testing/selftests/net/ipsec.c
index be4a30a0d02a..9b44a091802c 100644
--- a/tools/testing/selftests/net/ipsec.c
+++ b/tools/testing/selftests/net/ipsec.c
@@ -227,7 +227,8 @@ static int rtattr_pack(struct nlmsghdr *nh, size_t req_sz,
attr->rta_len = RTA_LENGTH(size);
attr->rta_type = rta_type;
- memcpy(RTA_DATA(attr), payload, size);
+ if (payload)
+ memcpy(RTA_DATA(attr), payload, size);
return 0;
}
diff --git a/tools/testing/selftests/net/lib.sh b/tools/testing/selftests/net/lib.sh
index 8994fec1c38f..0bd9a038a1f0 100644
--- a/tools/testing/selftests/net/lib.sh
+++ b/tools/testing/selftests/net/lib.sh
@@ -435,6 +435,13 @@ xfail_on_veth()
fi
}
+mac_get()
+{
+ local if_name=$1
+
+ ip -j link show dev $if_name | jq -r '.[]["address"]'
+}
+
kill_process()
{
local pid=$1; shift
@@ -451,7 +458,7 @@ ip_link_add()
defer ip link del dev "$name"
}
-ip_link_master()
+ip_link_set_master()
{
local member=$1; shift
local master=$1; shift
@@ -459,3 +466,62 @@ ip_link_master()
ip link set dev "$member" master "$master"
defer ip link set dev "$member" nomaster
}
+
+ip_link_set_addr()
+{
+ local name=$1; shift
+ local addr=$1; shift
+
+ local old_addr=$(mac_get "$name")
+ ip link set dev "$name" address "$addr"
+ defer ip link set dev "$name" address "$old_addr"
+}
+
+ip_link_is_up()
+{
+ local name=$1; shift
+
+ local state=$(ip -j link show "$name" |
+ jq -r '(.[].flags[] | select(. == "UP")) // "DOWN"')
+ [[ $state == "UP" ]]
+}
+
+ip_link_set_up()
+{
+ local name=$1; shift
+
+ if ! ip_link_is_up "$name"; then
+ ip link set dev "$name" up
+ defer ip link set dev "$name" down
+ fi
+}
+
+ip_link_set_down()
+{
+ local name=$1; shift
+
+ if ip_link_is_up "$name"; then
+ ip link set dev "$name" down
+ defer ip link set dev "$name" up
+ fi
+}
+
+ip_addr_add()
+{
+ local name=$1; shift
+
+ ip addr add dev "$name" "$@"
+ defer ip addr del dev "$name" "$@"
+}
+
+ip_route_add()
+{
+ ip route add "$@"
+ defer ip route del "$@"
+}
+
+bridge_vlan_add()
+{
+ bridge vlan add "$@"
+ defer bridge vlan del "$@"
+}
diff --git a/tools/testing/selftests/net/lib/py/ksft.py b/tools/testing/selftests/net/lib/py/ksft.py
index 477ae76de93d..3efe005436cd 100644
--- a/tools/testing/selftests/net/lib/py/ksft.py
+++ b/tools/testing/selftests/net/lib/py/ksft.py
@@ -71,6 +71,11 @@ def ksft_in(a, b, comment=""):
_fail("Check failed", a, "not in", b, comment)
+def ksft_is(a, b, comment=""):
+ if a is not b:
+ _fail("Check failed", a, "is not", b, comment)
+
+
def ksft_ge(a, b, comment=""):
if a < b:
_fail("Check failed", a, "<", b, comment)
diff --git a/tools/testing/selftests/net/lib/py/utils.py b/tools/testing/selftests/net/lib/py/utils.py
index 72590c3f90f1..9e3bcddcf3e8 100644
--- a/tools/testing/selftests/net/lib/py/utils.py
+++ b/tools/testing/selftests/net/lib/py/utils.py
@@ -10,7 +10,9 @@ import time
class CmdExitFailure(Exception):
- pass
+ def __init__(self, msg, cmd_obj):
+ super().__init__(msg)
+ self.cmd = cmd_obj
class cmd:
@@ -48,7 +50,7 @@ class cmd:
if len(stderr) > 0 and stderr[-1] == "\n":
stderr = stderr[:-1]
raise CmdExitFailure("Command failed: %s\nSTDOUT: %s\nSTDERR: %s" %
- (self.proc.args, stdout, stderr))
+ (self.proc.args, stdout, stderr), self)
class bkg(cmd):
diff --git a/tools/testing/selftests/net/lib/py/ynl.py b/tools/testing/selftests/net/lib/py/ynl.py
index a0d689d58c57..ad1e36baee2a 100644
--- a/tools/testing/selftests/net/lib/py/ynl.py
+++ b/tools/testing/selftests/net/lib/py/ynl.py
@@ -13,14 +13,14 @@ try:
SPEC_PATH = KSFT_DIR / "net/lib/specs"
sys.path.append(tools_full_path.as_posix())
- from net.lib.ynl.lib import YnlFamily, NlError
+ from net.lib.ynl.pyynl.lib import YnlFamily, NlError
else:
# Running in tree
tools_full_path = KSRC / "tools"
SPEC_PATH = KSRC / "Documentation/netlink/specs"
sys.path.append(tools_full_path.as_posix())
- from net.ynl.lib import YnlFamily, NlError
+ from net.ynl.pyynl.lib import YnlFamily, NlError
except ModuleNotFoundError as e:
ksft_pr("Failed importing `ynl` library from kernel sources")
ksft_pr(str(e))
@@ -32,23 +32,23 @@ except ModuleNotFoundError as e:
# Set schema='' to avoid jsonschema validation, it's slow
#
class EthtoolFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('ethtool.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class RtnlFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('rt_link.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class NetdevFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('netdev.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class NetshaperFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('net_shaper.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.c b/tools/testing/selftests/net/mptcp/mptcp_connect.c
index 4209b9569039..414addef9a45 100644
--- a/tools/testing/selftests/net/mptcp/mptcp_connect.c
+++ b/tools/testing/selftests/net/mptcp/mptcp_connect.c
@@ -25,6 +25,8 @@
#include <sys/types.h>
#include <sys/mman.h>
+#include <arpa/inet.h>
+
#include <netdb.h>
#include <netinet/in.h>
@@ -1211,23 +1213,42 @@ static void parse_setsock_options(const char *name)
exit(1);
}
-void xdisconnect(int fd, int addrlen)
+void xdisconnect(int fd)
{
- struct sockaddr_storage empty;
+ socklen_t addrlen = sizeof(struct sockaddr_storage);
+ struct sockaddr_storage addr, empty;
int msec_sleep = 10;
- int queued = 1;
- int i;
+ void *raw_addr;
+ int i, cmdlen;
+ char cmd[128];
+
+ /* get the local address and convert it to string */
+ if (getsockname(fd, (struct sockaddr *)&addr, &addrlen) < 0)
+ xerror("getsockname");
+
+ if (addr.ss_family == AF_INET)
+ raw_addr = &(((struct sockaddr_in *)&addr)->sin_addr);
+ else if (addr.ss_family == AF_INET6)
+ raw_addr = &(((struct sockaddr_in6 *)&addr)->sin6_addr);
+ else
+ xerror("bad family");
+
+ strcpy(cmd, "ss -M | grep -q ");
+ cmdlen = strlen(cmd);
+ if (!inet_ntop(addr.ss_family, raw_addr, &cmd[cmdlen],
+ sizeof(cmd) - cmdlen))
+ xerror("inet_ntop");
shutdown(fd, SHUT_WR);
- /* while until the pending data is completely flushed, the later
+ /*
+ * wait until the pending data is completely flushed and all
+ * the MPTCP sockets reached the closed status.
* disconnect will bypass/ignore/drop any pending data.
*/
for (i = 0; ; i += msec_sleep) {
- if (ioctl(fd, SIOCOUTQ, &queued) < 0)
- xerror("can't query out socket queue: %d", errno);
-
- if (!queued)
+ /* closed socket are not listed by 'ss' */
+ if (system(cmd) != 0)
break;
if (i > poll_timeout)
@@ -1281,9 +1302,9 @@ again:
return ret;
if (cfg_truncate > 0) {
- xdisconnect(fd, peer->ai_addrlen);
+ xdisconnect(fd);
} else if (--cfg_repeat > 0) {
- xdisconnect(fd, peer->ai_addrlen);
+ xdisconnect(fd);
/* the socket could be unblocking at this point, we need the
* connect to be blocking
diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.sh b/tools/testing/selftests/net/mptcp/mptcp_connect.sh
index b48b4e56826a..5e3c56253274 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_connect.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_connect.sh
@@ -137,7 +137,7 @@ TEST_GROUP=""
#shellcheck disable=SC2317
cleanup()
{
- rm -f "$cin_disconnect" "$cout_disconnect"
+ rm -f "$cin_disconnect"
rm -f "$cin" "$cout"
rm -f "$sin" "$sout"
rm -f "$capout"
@@ -155,7 +155,6 @@ cin=$(mktemp)
cout=$(mktemp)
capout=$(mktemp)
cin_disconnect="$cin".disconnect
-cout_disconnect="$cout".disconnect
trap cleanup EXIT
mptcp_lib_ns_init ns1 ns2 ns3 ns4
@@ -445,12 +444,8 @@ do_transfer()
printf "(duration %05sms) " "${duration}"
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
mptcp_lib_pr_fail "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
- cat /tmp/${listener_ns}.out
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
- [ ${listener_ns} != ${connector_ns} ] && cat /tmp/${connector_ns}.out
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
echo
cat "$capout"
@@ -587,7 +582,7 @@ make_file()
mptcp_lib_make_file $name 1024 $ksize
dd if=/dev/urandom conv=notrunc of="$name" oflag=append bs=1 count=$rem 2> /dev/null
- echo "Created $name (size $(du -b "$name")) containing data sent by $who"
+ echo "Created $name (size $(stat -c "%s" "$name") B) containing data sent by $who"
}
run_tests_lo()
diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh
index c07e2bd3a315..13a3b68181ee 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_join.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh
@@ -1039,13 +1039,8 @@ do_transfer()
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
fail_test "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
- cat /tmp/${listener_ns}.out
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
- cat /tmp/${connector_ns}.out
-
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
return 1
fi
diff --git a/tools/testing/selftests/net/mptcp/mptcp_lib.sh b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
index 975d4d4c862a..051e289d7967 100644
--- a/tools/testing/selftests/net/mptcp/mptcp_lib.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
@@ -107,6 +107,27 @@ mptcp_lib_pr_info() {
mptcp_lib_print_info "INFO: ${*}"
}
+# $1-2: listener/connector ns ; $3 port ; $4-5 listener/connector stat file
+mptcp_lib_pr_err_stats() {
+ local lns="${1}"
+ local cns="${2}"
+ local port="${3}"
+ local lstat="${4}"
+ local cstat="${5}"
+
+ echo -en "${MPTCP_LIB_COLOR_RED}"
+ {
+ printf "\nnetns %s (listener) socket stat for %d:\n" "${lns}" "${port}"
+ ip netns exec "${lns}" ss -Menitam -o "sport = :${port}"
+ cat "${lstat}"
+
+ printf "\nnetns %s (connector) socket stat for %d:\n" "${cns}" "${port}"
+ ip netns exec "${cns}" ss -Menitam -o "dport = :${port}"
+ [ "${lstat}" != "${cstat}" ] && cat "${cstat}"
+ } 1>&2
+ echo -en "${MPTCP_LIB_COLOR_RESET}"
+}
+
# SELFTESTS_MPTCP_LIB_EXPECT_ALL_FEATURES env var can be set when validating all
# features using the last version of the kernel and the selftests to make sure
# a test is not being skipped by mistake.
diff --git a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
index 5e8d5b83e2d0..418a903c3a4d 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
@@ -169,6 +169,11 @@ do_transfer()
cmsg+=",TCPINQ"
fi
+ NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \
+ nstat -n
+ NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \
+ nstat -n
+
timeout ${timeout_test} \
ip netns exec ${listener_ns} \
$mptcp_connect -t ${timeout_poll} -l -M 1 -p $port -s ${srv_proto} -c "${cmsg}" \
@@ -189,14 +194,16 @@ do_transfer()
wait $spid
local rets=$?
+ NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \
+ nstat | grep Tcp > /tmp/${listener_ns}.out
+ NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \
+ nstat | grep Tcp > /tmp/${connector_ns}.out
+
print_title "Transfer ${ip:2}"
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
mptcp_lib_pr_fail "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
-
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
mptcp_lib_result_fail "transfer ${ip}"
diff --git a/tools/testing/selftests/net/mptcp/simult_flows.sh b/tools/testing/selftests/net/mptcp/simult_flows.sh
index 8fa77c8e9b65..9c2a415976cb 100755
--- a/tools/testing/selftests/net/mptcp/simult_flows.sh
+++ b/tools/testing/selftests/net/mptcp/simult_flows.sh
@@ -155,6 +155,11 @@ do_transfer()
sleep 1
fi
+ NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \
+ nstat -n
+ NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \
+ nstat -n
+
timeout ${timeout_test} \
ip netns exec ${ns3} \
./mptcp_connect -jt ${timeout_poll} -l -p $port -T $max_time \
@@ -180,25 +185,27 @@ do_transfer()
kill ${cappid_connector}
fi
+ NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \
+ nstat | grep Tcp > /tmp/${ns3}.out
+ NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \
+ nstat | grep Tcp > /tmp/${ns1}.out
+
cmp $sin $cout > /dev/null 2>&1
local cmps=$?
cmp $cin $sout > /dev/null 2>&1
local cmpc=$?
- printf "%-16s" " max $max_time "
if [ $retc -eq 0 ] && [ $rets -eq 0 ] && \
[ $cmpc -eq 0 ] && [ $cmps -eq 0 ]; then
+ printf "%-16s" " max $max_time "
mptcp_lib_pr_ok
cat "$capout"
return 0
fi
- mptcp_lib_pr_fail
- echo "client exit code $retc, server $rets" 1>&2
- echo -e "\nnetns ${ns3} socket stat for $port:" 1>&2
- ip netns exec ${ns3} ss -nita 1>&2 -o "sport = :$port"
- echo -e "\nnetns ${ns1} socket stat for $port:" 1>&2
- ip netns exec ${ns1} ss -nita 1>&2 -o "dport = :$port"
+ mptcp_lib_pr_fail "client exit code $retc, server $rets"
+ mptcp_lib_pr_err_stats "${ns3}" "${ns1}" "${port}" \
+ "/tmp/${ns3}.out" "/tmp/${ns1}.out"
ls -l $sin $cout
ls -l $cin $sout
diff --git a/tools/testing/selftests/net/netfilter/rpath.sh b/tools/testing/selftests/net/netfilter/rpath.sh
index 4485fd7675ed..86ec4e68594d 100755
--- a/tools/testing/selftests/net/netfilter/rpath.sh
+++ b/tools/testing/selftests/net/netfilter/rpath.sh
@@ -61,9 +61,20 @@ ip -net "$ns2" a a 192.168.42.1/24 dev d0
ip -net "$ns1" a a fec0:42::2/64 dev v0 nodad
ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
+# avoid neighbor lookups and enable martian IPv6 pings
+ns2_hwaddr=$(ip -net "$ns2" link show dev v0 | \
+ sed -n 's, *link/ether \([^ ]*\) .*,\1,p')
+ns1_hwaddr=$(ip -net "$ns1" link show dev v0 | \
+ sed -n 's, *link/ether \([^ ]*\) .*,\1,p')
+ip -net "$ns1" neigh add fec0:42::1 lladdr "$ns2_hwaddr" nud permanent dev v0
+ip -net "$ns1" neigh add fec0:23::1 lladdr "$ns2_hwaddr" nud permanent dev v0
+ip -net "$ns2" neigh add fec0:42::2 lladdr "$ns1_hwaddr" nud permanent dev d0
+ip -net "$ns2" neigh add fec0:23::2 lladdr "$ns1_hwaddr" nud permanent dev v0
+
# firewall matches to test
[ -n "$iptables" ] && {
common='-t raw -A PREROUTING -s 192.168.0.0/16'
+ common+=' -p icmp --icmp-type echo-request'
if ! ip netns exec "$ns2" "$iptables" $common -m rpfilter;then
echo "Cannot add rpfilter rule"
exit $ksft_skip
@@ -72,6 +83,7 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
}
[ -n "$ip6tables" ] && {
common='-t raw -A PREROUTING -s fec0::/16'
+ common+=' -p icmpv6 --icmpv6-type echo-request'
if ! ip netns exec "$ns2" "$ip6tables" $common -m rpfilter;then
echo "Cannot add rpfilter rule"
exit $ksft_skip
@@ -82,8 +94,10 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
table inet t {
chain c {
type filter hook prerouting priority raw;
- ip saddr 192.168.0.0/16 fib saddr . iif oif exists counter
- ip6 saddr fec0::/16 fib saddr . iif oif exists counter
+ ip saddr 192.168.0.0/16 icmp type echo-request \
+ fib saddr . iif oif exists counter
+ ip6 saddr fec0::/16 icmpv6 type echo-request \
+ fib saddr . iif oif exists counter
}
}
EOF
diff --git a/tools/testing/selftests/net/nl_netdev.py b/tools/testing/selftests/net/nl_netdev.py
index 93d9d914529b..93e8cb671c3d 100755
--- a/tools/testing/selftests/net/nl_netdev.py
+++ b/tools/testing/selftests/net/nl_netdev.py
@@ -18,6 +18,23 @@ def lo_check(nf) -> None:
ksft_eq(len(lo_info['xdp-rx-metadata-features']), 0)
+def napi_list_check(nf) -> None:
+ with NetdevSimDev(queue_count=100) as nsimdev:
+ nsim = nsimdev.nsims[0]
+
+ ip(f"link set dev {nsim.ifname} up")
+
+ napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True)
+ ksft_eq(len(napis), 100)
+
+ for q in [50, 0, 99]:
+ for i in range(4):
+ nsim.dfs_write("queue_reset", f"{q} {i}")
+ napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True)
+ ksft_eq(len(napis), 100,
+ comment=f"queue count after reset queue {q} mode {i}")
+
+
def page_pool_check(nf) -> None:
with NetdevSimDev() as nsimdev:
nsim = nsimdev.nsims[0]
@@ -89,7 +106,7 @@ def page_pool_check(nf) -> None:
def main() -> None:
nf = NetdevFamily()
- ksft_run([empty_check, lo_check, page_pool_check],
+ ksft_run([empty_check, lo_check, page_pool_check, napi_list_check],
args=(nf, ))
ksft_exit()
diff --git a/tools/testing/selftests/net/openvswitch/openvswitch.sh b/tools/testing/selftests/net/openvswitch/openvswitch.sh
index cc0bfae2bafa..960e1ab4dd04 100755
--- a/tools/testing/selftests/net/openvswitch/openvswitch.sh
+++ b/tools/testing/selftests/net/openvswitch/openvswitch.sh
@@ -171,8 +171,10 @@ ovs_add_netns_and_veths () {
ovs_add_if "$1" "$2" "$4" -u || return 1
fi
- [ $TRACING -eq 1 ] && ovs_netns_spawn_daemon "$1" "$ns" \
- tcpdump -i any -s 65535
+ if [ $TRACING -eq 1 ]; then
+ ovs_netns_spawn_daemon "$1" "$3" tcpdump -l -i any -s 6553
+ ovs_wait grep -q "listening on any" ${ovs_dir}/stderr
+ fi
return 0
}
diff --git a/tools/testing/selftests/net/packetdrill/ksft_runner.sh b/tools/testing/selftests/net/packetdrill/ksft_runner.sh
index 4071c133f29e..e15c43b7359b 100755
--- a/tools/testing/selftests/net/packetdrill/ksft_runner.sh
+++ b/tools/testing/selftests/net/packetdrill/ksft_runner.sh
@@ -23,7 +23,7 @@ if [ $# -ne 1 ]; then
ktap_exit_fail_msg "usage: $0 <script>"
exit "$KSFT_FAIL"
fi
-script="$1"
+script="$(basename $1)"
if [ -z "$(which packetdrill)" ]; then
ktap_skip_all "packetdrill not found in PATH"
@@ -31,16 +31,30 @@ if [ -z "$(which packetdrill)" ]; then
fi
declare -a optargs
+failfunc=ktap_test_fail
+
if [[ -n "${KSFT_MACHINE_SLOW}" ]]; then
optargs+=('--tolerance_usecs=14000')
+
+ # xfail tests that are known flaky with dbg config, not fixable.
+ # still run them for coverage (and expect 100% pass without dbg).
+ declare -ar xfail_list=(
+ "tcp_fast_recovery_prr-ss.*.pkt"
+ "tcp_timestamping.*.pkt"
+ "tcp_user_timeout_user-timeout-probe.pkt"
+ "tcp_zerocopy_epoll_.*.pkt"
+ "tcp_tcp_info_tcp-info-*-limited.pkt"
+ )
+ readonly xfail_regex="^($(printf '%s|' "${xfail_list[@]}"))$"
+ [[ "$script" =~ ${xfail_regex} ]] && failfunc=ktap_test_xfail
fi
ktap_print_header
ktap_set_plan 2
-unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $(basename $script) > /dev/null \
- && ktap_test_pass "ipv4" || ktap_test_fail "ipv4"
-unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $(basename $script) > /dev/null \
- && ktap_test_pass "ipv6" || ktap_test_fail "ipv6"
+unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $script > /dev/null \
+ && ktap_test_pass "ipv4" || $failfunc "ipv4"
+unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $script > /dev/null \
+ && ktap_test_pass "ipv6" || $failfunc "ipv6"
ktap_finished
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt
new file mode 100644
index 000000000000..38535701656e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt
@@ -0,0 +1,18 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking accept.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+ +0...0.200 accept(3, ..., ...) = 4
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 257
+
+ +.1 write(4, ..., 2000) = 2000
+ +0 > P. 1:2001(2000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt
new file mode 100644
index 000000000000..3692ef102381
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt
@@ -0,0 +1,13 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking connect.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+
+ +.1...0.200 connect(3, ..., ...) = 0
+
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.1 < S. 0:0(0) ack 1 win 5792 <mss 1460,nop,wscale 2,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt
new file mode 100644
index 000000000000..914eabab367a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt
@@ -0,0 +1,29 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking read.
+--tolerance_usecs=10000
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+
+ +0...0.100 read(4, ..., 2000) = 2000
+ +.1 < P. 1:2001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 2001
+
+ +.1...0.200 read(4, ..., 2000) = 2000
+ +.1 < P. 2001:4001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 4001
+
+ +.1 < P. 4001:6001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 6001
+ +0...0.000 read(4, ..., 1000) = 1000
+ +0...0.000 read(4, ..., 1000) = 1000
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt
new file mode 100644
index 000000000000..cec5a0725d95
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt
@@ -0,0 +1,35 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking write.
+--tolerance_usecs=10000
+
+`./defaults.sh
+./set_sysctls.py /proc/sys/net/ipv4/tcp_min_tso_segs=10
+`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 50000 <mss 1000,nop,wscale 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 50000
+ +0 accept(3, ..., ...) = 4
+
+// Kernel doubles our value -> sk->sk_sndbuf is set to 42000
+ +0 setsockopt(4, SOL_SOCKET, SO_SNDBUF, [21000], 4) = 0
+ +0 getsockopt(4, SOL_SOCKET, SO_SNDBUF, [42000], [4]) = 0
+
+// A write of 60000 does not block.
+ +0...0.300 write(4, ..., 61000) = 61000 // this write() blocks
+
+ +.1 < . 1:1(0) ack 10001 win 50000
+
+ +.1 < . 1:1(0) ack 30001 win 50000
+
+// This ACK should wakeup the write(). An ACK of 35001 does not.
+ +.1 < . 1:1(0) ack 36001 win 50000
+
+// Reset to sysctls defaults.
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt
new file mode 100644
index 000000000000..8514d6bdbb6d
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt
@@ -0,0 +1,23 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test basic connection teardown where local process closes first:
+// the local process calls close() first, so we send a FIN, and receive an ACK.
+// Then we receive a FIN and ACK it.
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +.01...0.011 connect(3, ..., ...) = 0
+ +0 > S 0:0(0) <...>
+ +0 < S. 0:0(0) ack 1 win 32768 <mss 1000,nop,wscale 6,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+ +0 write(3, ..., 1000) = 1000
+ +0 > P. 1:1001(1000) ack 1
+ +0 < . 1:1(0) ack 1001 win 257
+
+ +0 close(3) = 0
+ +0 > F. 1001:1001(0) ack 1
+ +0 < . 1:1(0) ack 1002 win 257
+
+ +0 < F. 1:1(0) ack 1002 win 257
+ +0 > . 1002:1002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt
new file mode 100644
index 000000000000..04103134bd99
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test to make sure no RST is being sent when close()
+// is called on a socket with SYN_SENT state.
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <...>
+
+// Application decideds to close the socket in SYN_SENT state
+// Make sure no RST is sent after close().
+ +0 close(3) = 0
+
+// Receive syn-ack to trigger the send side packet examination:
+// If a RESET were sent right after close(), it would have failed with
+// a mismatched timestamp.
+ +.1 < S. 0:0(0) ack 1 win 32000 <mss 1460,nop,wscale 7>
+ +0 > R 1:1(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt
new file mode 100644
index 000000000000..5f3a2914213a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify behavior for the sequence: remote side sends FIN, then we close().
+// Since the remote side (client) closes first, we test our LAST_ACK code path.
+
+`./defaults.sh`
+
+// Initialize a server socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +0 < . 1:1(0) ack 1 win 257
+
+ +0 accept(3, ..., ...) = 4
+
+// Client closes first.
+ +.01 < F. 1:1(0) ack 1 win 257
+ +0 > . 1:1(0) ack 2
+
+// App notices that client closed.
+ +0 read(4, ..., 1000) = 0
+
+// Then we close.
+ +.01 close(4) = 0
+ +0 > F. 1:1(0) ack 2
+
+// Client ACKs our FIN.
+ +.01 < . 2:2(0) ack 2 win 257
+
+// Verify that we send RST in response to any incoming segments
+// (because the kernel no longer has any record of this socket).
+ +.01 < . 2:2(0) ack 2 win 257
+ +0 > R 2:2(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt
new file mode 100644
index 000000000000..643baf3267cf
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test ECN: verify that Linux TCP ECN sending code uses ECT0 (not ECT1).
+//
+`./defaults.sh
+sysctl -q net.ipv4.tcp_ecn=1 # fully enabled
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
+
+// ECN handshake: send EW flags in SYN packet, E flag in SYN-ACK response
++.002 ... 0.004 connect(4, ..., ...) = 0
+
+ +0 > SEW 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
++.002 < SE. 0:0(0) ack 1 win 32767 <mss 1000,nop,wscale 6,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+// Write 1 MSS.
++.002 write(4, ..., 1000) = 1000
+// Send 1 MSS with ect0.
+ +0 > [ect0] P. 1:1001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt
new file mode 100644
index 000000000000..f95b9b3c9fa1
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt
@@ -0,0 +1,38 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk. The large chunk itself should be packetized as
+// usual.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write another 10040B chunk with no coalescing options.
+ +0 send(4, ..., 10400, MSG_EOR) = 10400
+
+// Write a 2KB chunk. This chunk should not be appended to the packets created
+// the previous chunk.
+ +0 write(4, ..., 2000) = 2000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:20801(10800) ack 1
++.001 < . 1:1(0) ack 20801 win 514
+// This 2KB packet should be sent alone.
+ +0 > P. 20801:22801(2000) ack 1
++.001 < . 1:1(0) ack 22801 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt
new file mode 100644
index 000000000000..2ff66075288e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt
@@ -0,0 +1,72 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk. Also, when packets are retransmitted, they
+// will not be coalesce into the same skb.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write 10 400B chunks with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+// The 9 remaining 400B chunks should be sent as individual packets.
+ +0 > P. 10801:11201(400) ack 1
+ +0 > P. 11201:11601(400) ack 1
+ +0 > P. 11601:12001(400) ack 1
+ +0 > P. 12001:12401(400) ack 1
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
+ +0 > P. 13201:13601(400) ack 1
+ +0 > P. 13601:14001(400) ack 1
+ +0 > P. 14001:14401(400) ack 1
+// The last 10KB chunk should be sent separately.
+ +0 > P. 14401:24401(10000) ack 1
+
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 11201 win 514
++.001 < . 1:1(0) ack 11601 win 514
++.001 < . 1:1(0) ack 12001 win 514 <sack 13201:14401,nop,nop>
+// TCP should fill the hole but no coalescing should happen, and all
+// retransmissions should be sent out as individual packets.
+
+// Note : This is timeout based retransmit.
+// Do not put +0 here or flakes will come back.
++.004~+.008 > P. 12001:12401(400) ack 1
+
++.001 < . 1:1(0) ack 12401 win 514 <sack 13201:14401,nop,nop>
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
++.001 < . 1:1(0) ack 12801 win 514 <sack 13201:14401,nop,nop>
++.001 < . 1:1(0) ack 14401 win 514
++.001 < . 1:1(0) ack 24401 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt
new file mode 100644
index 000000000000..77039c5aac39
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write a 400B chunk with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+ +0 > P. 10801:20801(10000) ack 1
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 20801 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt
new file mode 100644
index 000000000000..dd5a06250595
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk even though we have 10 back-to-back small
+// writes.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write 10 400B chunks with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+// The 9 remaining 400B chunks should be sent as individual packets.
+ +0 > P. 10801:11201(400) ack 1
+ +0 > P. 11201:11601(400) ack 1
+ +0 > P. 11601:12001(400) ack 1
+ +0 > P. 12001:12401(400) ack 1
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
+ +0 > P. 13201:13601(400) ack 1
+ +0 > P. 13601:14001(400) ack 1
+ +0 > P. 14001:14401(400) ack 1
+// The last 10KB chunk should be sent separately.
+ +0 > P. 14401:24401(10000) ack 1
+
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 11201 win 514
++.001 < . 1:1(0) ack 11601 win 514
++.001 < . 1:1(0) ack 12001 win 514
++.001 < . 1:1(0) ack 12401 win 514
++.001 < . 1:1(0) ack 12801 win 514
++.001 < . 1:1(0) ack 13201 win 514
++.001 < . 1:1(0) ack 13601 win 514
++.001 < . 1:1(0) ack 14001 win 514
++.001 < . 1:1(0) ack 14401 win 514
++.001 < . 1:1(0) ack 24401 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt
new file mode 100644
index 000000000000..0d3c8077e830
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt
@@ -0,0 +1,72 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation.
+// In this variant we test a simple case where in-flight == ssthresh
+// all the way through recovery, so during fast recovery we send one segment
+// for each segment SACKed/ACKed.
+
+// Set up config.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+// RTT 100ms
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 10 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1:1001.
+ +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:4001,nop,nop>
+// Enter fast recovery.
+ +0 > . 1:1001(1000) ack 1
+ +.01 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd
+assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh
+}%
+
+// Write some more, which we will send 1 MSS at a time,
+// as in-flight segments are SACKed or ACKed.
+ +.01 write(4, ..., 7000) = 7000
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:5001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:6001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:7001,nop,nop>
+ +0 > . 12001:13001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:8001,nop,nop>
+ +0 > . 13001:14001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:9001,nop,nop>
+ +0 > . 14001:15001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:10001,nop,nop>
+ +0 > . 15001:16001(1000) ack 1
+
+ +.02 < . 1:1(0) ack 10001 win 320
+ +0 > P. 16001:17001(1000) ack 1
+// Leave fast recovery.
+ +.01 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd
+assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh
+}%
+
+ +.03 < . 1:1(0) ack 12001 win 320
+ +.02 < . 1:1(0) ack 14001 win 320
+ +.02 < . 1:1(0) ack 16001 win 320
+ +.02 < . 1:1(0) ack 17001 win 320
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt
new file mode 100644
index 000000000000..7842a10b6967
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt
@@ -0,0 +1,50 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation. The sender sends 20 packets. Packet
+// 1 to 4, and 11 to 16 are dropped.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write 20 data segments.
+ +0 write(4, ..., 20000) = 20000
+ +0 > P. 1:10001(10000) ack 1
+
+// Receive first DUPACK, entering PRR part
+ +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+// Enter PRR CRB
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:11001,nop,nop>
+ +0 > . 12001:13001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:12001,nop,nop>
+ +0 > . 13001:14001(1000) ack 1
+// Enter PRR slow start
+ +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:12001,nop,nop>
+ +0 > P. 14001:16001(2000) ack 1
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:12001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 > . 16001:17001(1000) ack 1
+// inflight reaches ssthresh, goes into packet conservation mode
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:13001,nop,nop>
+ +0 > . 17001:18001(1000) ack 1
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:14001,nop,nop>
+ +0 > . 18001:19001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt
new file mode 100644
index 000000000000..b66d7644c3b6
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation. The sender sends 20 packets. Packet
+// 1 to 4 are lost. The sender writes another 10 packets.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 20 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1,2,3,4
+ +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop>
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+
+// Receiver ACKs all data.
+ +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 2001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 3001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 10001 win 320
+
+// Writes another 10 packets, which the ssthresh*mss amount
+// should be sent right away
+ +.01 write(4, ..., 10000) = 10000
+ +0 > . 10001:17001(7000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt
new file mode 100644
index 000000000000..8e87bfecabb5
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt
@@ -0,0 +1,41 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation.
+// In this variant we verify that the sender uses SACK info on an ACK
+// below snd_una.
+
+// Set up config.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 8>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+// RTT 10ms
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 10 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1:1001,4001:5001,7001:8001.
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001 8001:9001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
+
++.012 < . 1:1(0) ack 4001 win 320 <sack 8001:9001,nop,nop>
+ +0 > . 4001:7001(3000) ack 1
+
+ +0 write(4, ..., 10000) = 10000
+
+// The following ACK was reordered - delayed so that it arrives with
+// an ACK field below snd_una. Here we check that the newly-SACKed
+// 2MSS at 5001:7001 cause us to send out 2 more MSS.
++.002 < . 1:1(0) ack 3001 win 320 <sack 5001:7001,nop,nop>
+ +0 > . 7001:8001(1000) ack 1
+ +0 > . 10001:11001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt
new file mode 100644
index 000000000000..96b01eb5b7a4
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt
@@ -0,0 +1,53 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test RFC 3042 "Limited Transmit": "sending a new data segment in
+// response to each of the first two duplicate acknowledgments that
+// arrive at the sender".
+// This variation tests a receiver that doesn't support SACK.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write some data, and send the initial congestion window.
+ +0 write(4, ..., 15000) = 15000
+ +0 > P. 1:10001(10000) ack 1
+
+// Limited transmit: on first dupack, send a new data segment.
+ +.11 < . 1:1(0) ack 1 win 320
+ +0 > . 10001:11001(1000) ack 1
+
+// Limited transmit: on second dupack, send a new data segment.
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 > . 11001:12001(1000) ack 1
+
+// It turned out to be reordering, not loss.
+// We have one packet newly acked (1001:3001 were DUP-ACK'd)
+// So we revert state back to Open. Slow start cwnd from 10 to 11
+// and send 11 - 9 = 2 packets
+ +.01 < . 1:1(0) ack 3001 win 320
+ +0 > P. 12001:14001(2000) ack 1
+
+ +.02 < . 1:1(0) ack 5001 win 320
+ +0 > P. 14001:15001(1000) ack 1
+
+// Client gradually ACKs all data.
+ +.02 < . 1:1(0) ack 7001 win 320
+ +.02 < . 1:1(0) ack 9001 win 320
+ +.02 < . 1:1(0) ack 11001 win 320
+ +.02 < . 1:1(0) ack 13001 win 320
+ +.02 < . 1:1(0) ack 15001 win 320
+
+// Clean up.
+ +.17 close(4) = 0
+ +0 > F. 15001:15001(0) ack 1
+ +.1 < F. 1:1(0) ack 15002 win 257
+ +0 > . 15002:15002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt
new file mode 100644
index 000000000000..642da51ec3a4
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt
@@ -0,0 +1,50 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test RFC 3042 "Limited Transmit": "sending a new data segment in
+// response to each of the first two duplicate acknowledgments that
+// arrive at the sender".
+// This variation tests a receiver that supports SACK.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write some data, and send the initial congestion window.
+ +0 write(4, ..., 15000) = 15000
+ +0 > P. 1:10001(10000) ack 1
+
+// Limited transmit: on first dupack, send a new data segment.
+ +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
+
+// Limited transmit: on second dupack, send a new data segment.
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
+
+// It turned out to be reordering, not loss.
+ +.01 < . 1:1(0) ack 3001 win 320
+ +0 > P. 12001:14001(2000) ack 1
+
+ +.02 < . 1:1(0) ack 5001 win 320
+ +0 > P. 14001:15001(1000) ack 1
+
+// Client gradually ACKs all data.
+ +.02 < . 1:1(0) ack 7001 win 320
+ +.02 < . 1:1(0) ack 9001 win 320
+ +.02 < . 1:1(0) ack 11001 win 320
+ +.02 < . 1:1(0) ack 13001 win 320
+ +.02 < . 1:1(0) ack 15001 win 320
+
+// Clean up.
+ +.17 close(4) = 0
+ +0 > F. 15001:15001(0) ack 1
+ +.1 < F. 1:1(0) ack 15002 win 257
+ +0 > . 15002:15002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt
new file mode 100644
index 000000000000..7adae7a9ef4a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt
@@ -0,0 +1,40 @@
+// SPDX-License-Identifier: GPL-2.0
+// This is a test inspired by an Android client app using SSL. This
+// test verifies using TCP_NODELAY would save application latency
+// (Perhaps even better with TCP_NAGLE).
+//
+`./defaults.sh
+ethtool -K tun0 tso off gso off
+./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
+ +0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+ +0 connect(4, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < S. 0:0(0) ack 1 win 5792 <mss 974,nop,nop,sackOK,nop,wscale 7>
+ +0 > . 1:1(0) ack 1
+
+// SSL handshake (resumed session)
+ +0 write(4, ..., 517) = 517
+ +0 > P. 1:518(517) ack 1
+ +.1 < . 1:1(0) ack 518 win 229
+
+ +0 < P. 1:144(143) ack 1 win 229
+ +0 > . 518:518(0) ack 144
+ +0 read(4, ..., 1000) = 143
+
+// Application POST header (51B) and body (2002B)
+ +0 write(4, ..., 51) = 51
+ +0 > P. 518:569(51) ack 144
+ +.03 write(4, ..., 2002) = 2002
+ +0 > . 569:1543(974) ack 144
+ +0 > P. 1543:2517(974) ack 144
+// Without disabling Nagle, this packet will not happen until the remote ACK.
+ +0 > P. 2517:2571(54) ack 144
+
+ +.1 < . 1:1(0) ack 2571 win 229
+
+// Reset sysctls
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt
new file mode 100644
index 000000000000..fa9c01813996
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test the MSG_MORE flag will correctly corks the tiny writes
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+// Disable Nagle by default on this socket.
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+// Test the basic case: MSG_MORE overwrites TCP_NODELAY and enables Nagle.
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 40}], msg_flags=0}, MSG_MORE) = 40
+ +.21~+.215 > P. 1:41(40) ack 1
+ +.01 < . 1:1(0) ack 41 win 257
+
+// Test unsetting MSG_MORE releases the packet
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 100}], msg_flags=0}, MSG_MORE) = 100
++.005 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 160}], msg_flags=0}, MSG_MORE) = 160
+ +.01 sendmsg(4, {msg_name(...)=...,
+ msg_iov(3)=[{..., 100}, {..., 200}, {..., 195}],
+ msg_flags=0}, MSG_MORE) = 495
++.008 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 5}], msg_flags=0}, 0) = 5
+ +0 > P. 41:801(760) ack 1
+ +.02 < . 1:1(0) ack 801 win 257
+
+
+// Test >MSS write will unleash MSS packets but hold on the remaining data.
+ +.1 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 3100}], msg_flags=0}, MSG_MORE) = 3100
+ +0 > . 801:3801(3000) ack 1
++.003 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 50}], msg_flags=0}, MSG_MORE) = 50
+
+ +.01 < . 1:1(0) ack 2801 win 257
+// Err... we relase the remaining right after the ACK? note that PUSH is reset
+ +0 > . 3801:3951(150) ack 1
+
+// Test we'll hold on the subsequent writes when inflight (3801:3951) > 0
++.001 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 1}], msg_flags=0}, MSG_MORE) = 1
++.002 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 2}], msg_flags=0}, MSG_MORE) = 2
++.003 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 3}], msg_flags=0}, MSG_MORE) = 3
++.004 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 4}], msg_flags=0}, MSG_MORE) = 4
+ +.02 < . 1:1(0) ack 3951 win 257
+ +0 > . 3951:3961(10) ack 1
+ +.02 < . 1:1(0) ack 3961 win 257
+
+
+// Test the case a MSG_MORE send followed by a write flushes the data
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 20}], msg_flags=0}, MSG_MORE) = 20
+ +.05 write(4, ..., 20) = 20
+ +0 > P. 3961:4001(40) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt
new file mode 100644
index 000000000000..0ddec5f7dc1a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP_CORK and TCP_NODELAY sockopt behavior
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+// Set TCP_CORK sockopt to hold small packets
+ +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0
+
+ +0 write(4, ..., 40) = 40
+ +.05 write(4, ..., 40) = 40
+
+// Unset TCP_CORK should push pending bytes out
+ +.01 setsockopt(4, SOL_TCP, TCP_CORK, [0], 4) = 0
+ +0 > P. 1:81(80) ack 1
+ +.01 < . 1:1(0) ack 81 win 257
+
+// Set TCP_CORK sockopt to hold small packets
+ +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0
+
+ +0 write(4, ..., 40) = 40
+ +.05 write(4, ..., 40) = 40
+
+// Set TCP_NODELAY sockopt should push pending bytes out
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+ +0 > P. 81:161(80) ack 1
+ +.01 < . 1:1(0) ack 161 win 257
+
+// Set MSG_MORE to hold small packets
+ +0 send(4, ..., 40, MSG_MORE) = 40
+ +.05 send(4, ..., 40, MSG_MORE) = 40
+
+// Set TCP_NODELAY sockopt should push pending bytes out
+ +.01 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+ +0 > . 161:241(80) ack 1
+ +.01 < . 1:1(0) ack 241 win 257
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt
new file mode 100644
index 000000000000..310ef31518da
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt
@@ -0,0 +1,37 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify that setsockopt calls that force a route refresh do not
+// cause problems matching SACKs with packets in the write queue.
+// This variant tests IP_TOS.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_IP, IP_MTU_DISCOVER, [IP_PMTUDISC_DONT], 1) = 0
+ +0...0.010 connect(3, ..., ...) = 0
+
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 65535 <mss 1460,nop,wscale 2,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+ +.01 write(3, ..., 5840) = 5840
+ +0 > P. 1:5841(5840) ack 1
+ +.01 < . 1:1(0) ack 5841 win 65535
+
+ +.01 write(3, ..., 5840) = 5840
+ +0 > P. 5841:11681(5840) ack 1
+ +.01 < . 1:1(0) ack 11681 win 65535
+
+ +.01 write(3, ..., 14600) = 14600
+ +0 > P. 11681:26281(14600) ack 1
+
+// Try the socket option that we know can force a route refresh.
+ +0 setsockopt(3, SOL_IP, IP_TOS, [4], 1) = 0
+// Then revert to avoid routing/mangling/etc implications of that setting.
+ +0 setsockopt(3, SOL_IP, IP_TOS, [0], 1) = 0
+
+// Verify that we do not retransmit the SACKed segments.
+ +.01 < . 1:1(0) ack 13141 win 65535 <sack 16061:17521 20441:26281,nop,nop>
+ +0 > . 13141:16061(2920) ack 1
+ +0 > P. 17521:20441(2920) ack 1
+ +.01 < . 1:1(0) ack 26281 win 65535
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt
new file mode 100644
index 000000000000..f185e1ac57ea
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt
@@ -0,0 +1,64 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests non-FACK SACK with SACKs coming in the order
+// 2 6 8 3 9, to test what happens when we get a new SACKed range
+// (for packet 3) that is on the right of an existing SACKed range
+// (for packet 2).
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+ +.1 < . 1:1(0) ack 1 win 257 <sack 2001:3001,nop,nop>
++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001,nop,nop>
++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001 8001:9001,nop,nop>
+
+// 3 SACKed packets, so we enter Fast Recovery.
+ +0 > . 1:1001(1000) ack 1
+ +0 %{ assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state }%
+ +0 %{ assert tcpi_lost == 6, tcpi_lost }%
+
+// SACK for 3001:4001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
++.007 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:9001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+ +0 %{ assert tcpi_reordering == 6, tcpi_reordering }% // 8001:9001 -> 3001:4001 is 6
+
+// SACK for 9001:10001.
+ +.01 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+
+// ACK for 1:1001 as packets from t=0.303 arrive.
++.083 < . 1:1(0) ack 1001 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 4,tcpi_lost }%
+
+// ACK for 1:4001 as packets from t=0.310 arrive.
++.017 < . 1:1(0) ack 4001 win 257 <sack 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 3,tcpi_lost }%
+
+// ACK for 1:7001 as packets from t=0.320 arrive.
+ +.01 < . 1:1(0) ack 7001 win 257 <sack 8001:10001,nop,nop>
+
+// ACK for all data as packets from t=0.403 arrive.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt
new file mode 100644
index 000000000000..0093b4973934
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests the case where we mark packets 0-4 lost, then
+// get a SACK for 3, and then a SACK for 4.
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// SACK for 7001:8001. Using RACK we delay the fast retransmit.
+ +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop>
+// RACK reordering timer
++.027 > . 1:1001(1000) ack 1
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_lost == 7, tcpi_lost # RACK thinks 1:7001 are lost
+assert tcpi_reordering == 3, tcpi_reordering
+}%
+
+// SACK for 3001:4001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:4001 7001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 6, tcpi_lost # since 3001:4001 is no longer lost
+assert tcpi_reordering == 5, tcpi_reordering # 7001:8001 -> 3001:4001
+}%
+
+// SACK for 4001:5001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
+// It uses the RFC3517 algorithm to mark 1:3001 lost
+// because >=3 higher-sequence packets are SACKed.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:8001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 5,tcpi_lost # SACK/RFC3517 thinks 1:3001 are lost
+}%
+
+// SACK for 8001:9001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:9001,nop,nop>
+
+// SACK for 9001:10001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:10001,nop,nop>
+ +0 > . 5001:6001(1000) ack 1
+
+// To simplify clean-up, say we get an ACK for all data.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt
new file mode 100644
index 000000000000..980a832dc81c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt
@@ -0,0 +1,62 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests the case where we mark packets 0-4 lost, then
+// get a SACK for 5, and then a SACK for 6.
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// SACK for 7001:8001. Using RACK we delay a fast retransmit.
+ +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop>
++.027 > . 1:1001(1000) ack 1
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_lost == 7,tcpi_lost # RACK thinks 1:7001 are lost
+assert tcpi_reordering == 3, tcpi_reordering
+}%
+
+// SACK for 5001:6001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:6001 7001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 6, tcpi_lost
+assert tcpi_reordering == 3, tcpi_reordering # 7001:8001 -> 5001:6001 is 3
+}%
+
+// SACK for 6001:7001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:8001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+
+// SACK for 8001:9001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:9001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+
+// SACK for 9001:10001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:10001,nop,nop>
+ +0 > . 4001:5001(1000) ack 1
+
+// To simplify clean-up, say we get an ACK for all data.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt
new file mode 100644
index 000000000000..6740859a1360
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt
@@ -0,0 +1,26 @@
+// SPDX-License-Identifier: GPL-2.0
+// Simplest possible test of open() and then sendfile().
+// We write some zeroes into a file (since packetdrill expects payloads
+// to be all zeroes) and then open() the file, then use sendfile()
+// and verify that the correct number of zeroes goes out.
+
+`./defaults.sh
+/bin/rm -f /tmp/testfile
+/bin/dd bs=1 count=5 if=/dev/zero of=/tmp/testfile status=none
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +0 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+ +0 open("/tmp/testfile", O_RDONLY) = 5
+ +0 sendfile(4, 5, [0], 5) = 5
+ +0 > P. 1:6(5) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt
new file mode 100644
index 000000000000..0cbd43253236
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0
+`./defaults.sh`
+
+// Initialize a server socket
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 setsockopt(3, SOL_IP, IP_FREEBIND, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Connection should get accepted
+ +0 < S 0:0(0) win 32972 <mss 1460,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <...>
+ +0 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+
+ +0 pipe([5, 6]) = 0
+ +0 < U. 1:101(100) ack 1 win 257 urg 100
+ +0 splice(4, NULL, 6, NULL, 99, 0) = 99
+ +0 splice(4, NULL, 6, NULL, 1, 0) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt
new file mode 100644
index 000000000000..8940726a3ec2
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt
@@ -0,0 +1,42 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP fastopen behavior with NULL as buffer pointer, but a non-zero
+// buffer length.
+`./defaults.sh
+./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0`
+
+// Cache warmup: send a Fast Open cookie request
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(3, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation is now in progress)
++0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8,FO,nop,nop>
++0 < S. 123:123(0) ack 1 win 14600 <mss 1460,nop,nop,sackOK,nop,wscale 6,FO abcd1234,nop,nop>
++0 > . 1:1(0) ack 1
++0 close(3) = 0
++0 > F. 1:1(0) ack 1
++0 < F. 1:1(0) ack 2 win 92
++0 > . 2:2(0) ack 2
+
+// Test with MSG_FASTOPEN without TCP_FASTOPEN_CONNECT.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
++0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 sendto(4, NULL, 1, MSG_FASTOPEN, ..., ...) = -1
++0 close(4) = 0
+
+// Test with TCP_FASTOPEN_CONNECT without MSG_FASTOPEN.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 5
++0 fcntl(5, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(5, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(5, ..., ...) = 0
++0 sendto(5, NULL, 1, 0, ..., ...) = -1
++0 close(5) = 0
+
+// Test with both TCP_FASTOPEN_CONNECT and MSG_FASTOPEN.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 6
++0 fcntl(6, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(6, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(6, ..., ...) = 0
++0 sendto(6, NULL, 1, MSG_FASTOPEN, ..., ...) = -1
++0 close(6) = 0
+
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt
new file mode 100644
index 000000000000..b2b2cdf27e20
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt
@@ -0,0 +1,30 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we correctly skip zero-length IOVs.
+`./defaults.sh`
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_ZEROCOPY, [1], 4) = 0
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 40}, {..., 0}, {..., 20}],
+ msg_flags=0}, 0) = 60
+ +0 > P. 1:61(60) ack 1
+ +.01 < . 1:1(0) ack 61 win 257
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 0}, {..., 0}, {..., 0}],
+ msg_flags=0}, MSG_ZEROCOPY) = 0
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 10}, {..., 0}, {..., 50}],
+ msg_flags=0}, MSG_ZEROCOPY) = 60
+ +0 > P. 61:121(60) ack 1
+ +.01 < . 1:1(0) ack 121 win 257
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt
new file mode 100644
index 000000000000..59f5903f285c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test kernel behavior with NULL as buffer pointer
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.2 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, NULL, 1000) = -1 EFAULT (Bad address)
+ +0 send(4, NULL, 1000, 0) = -1 EFAULT (Bad address)
+ +0 sendto(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address)
+
+ +0 < . 1:1001(1000) ack 1 win 200
+ +0 read(4, NULL, 1000) = -1 EFAULT (Bad address)
+ +0 recv(4, NULL, 1000, 0) = -1 EFAULT (Bad address)
+ +0 recvfrom(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt
new file mode 100644
index 000000000000..d7fdb43a8e89
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tcpi_last_data_recv for active session
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
++0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
++0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
++.030 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8>
++0 > . 1:1(0) ack 1
+
++1 %{ assert 990 <= tcpi_last_data_recv <= 1010, tcpi_last_data_recv }%
+
++0 < . 1:1001(1000) ack 1 win 300
++0 > . 1:1(0) ack 1001
+
++0 %{ assert tcpi_last_data_recv <= 10, tcpi_last_data_recv }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt
new file mode 100644
index 000000000000..a9bcd46f6cb6
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt
@@ -0,0 +1,54 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test rwnd limited time in tcp_info for client side.
+
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+
+// Server advertises 0 receive window.
+ +.01 < S. 0:0(0) ack 1 win 0 <mss 1000,nop,nop,sackOK>
+
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+
+// Make sure that initial rwnd limited time is 0.
+ +0 %{ assert tcpi_rwnd_limited == 0, tcpi_rwnd_limited }%
+
+// Receive window limited time starts here.
+ +0 write(3, ..., 1000) = 1000
+
+// Check that rwnd limited time in tcp_info is around 0.1s.
+ +.1 %{ assert 98000 <= tcpi_rwnd_limited <= 110000, tcpi_rwnd_limited }%
+
+// Server opens the receive window.
+ +.1 < . 1:1(0) ack 1 win 2000
+
+// Check that rwnd limited time in tcp_info is around 0.2s.
+ +0 %{ assert 198000 <= tcpi_rwnd_limited <= 210000, tcpi_rwnd_limited }%
+
+ +0 > P. 1:1001(1000) ack 1
+
+// Server advertises a very small receive window.
+ +.03 < . 1:1(0) ack 1001 win 10
+
+// Receive window limited time starts again.
+ +0 write(3, ..., 1000) = 1000
+
+// Server opens the receive window again.
+ +.1 < . 1:1(0) ack 1001 win 2000
+// Check that rwnd limited time in tcp_info is around 0.3s
+// and busy time is 0.3 + 0.03 (server opened small window temporarily).
+ +0 %{ assert 298000 <= tcpi_rwnd_limited <= 310000, tcpi_rwnd_limited;\
+ assert 328000 <= tcpi_busy_time <= 340000, tcpi_busy_time;\
+}%
+
+ +0 > P. 1001:2001(1000) ack 1
+ +.02 < . 1:1(0) ack 2001 win 2000
+ +0 %{ assert 348000 <= tcpi_busy_time <= 360000, tcpi_busy_time }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt
new file mode 100644
index 000000000000..f0de2acd0f8e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt
@@ -0,0 +1,38 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test send-buffer-limited time in tcp_info for client side.
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8>
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+ +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [10000], 4) = 0
+ +0 getsockopt(3, SOL_SOCKET, SO_SNDBUF, [20000], [4]) = 0
+
+ +.09...0.14 write(3, ..., 150000) = 150000
+
+ +.01 < . 1:1(0) ack 10001 win 10000
+
+ +.01 < . 1:1(0) ack 30001 win 10000
+
+// cwnd goes from 40(60KB) to 80(120KB), and that we hit the tiny sndbuf limit 10KB
+ +.01 < . 1:1(0) ack 70001 win 10000
+
+ +.02 < . 1:1(0) ack 95001 win 10000
+ +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited; \
+ assert 49000 <= tcpi_busy_time <= 52000, tcpi_busy_time; \
+ assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }%
+
+// This ack frees up enough buffer so we are no longer
+// buffer limited (socket flag SOCK_NOSPACE is cleared)
+ +.02 < . 1:1(0) ack 150001 win 10000
+ +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited;\
+ assert 69000 <= tcpi_busy_time <= 73000, tcpi_busy_time;\
+ assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt
new file mode 100644
index 000000000000..2087ec0c746a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt
@@ -0,0 +1,92 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that tx timestamping sends timestamps only for
+// the last byte of each sendmsg.
+`./defaults.sh
+`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+// Establish connection and verify that there was no error.
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 20000 <mss 1000,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+
+ +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+ +0 write(3, ..., 11000) = 11000
+ +0 > P. 1:10001(10000) ack 1
+ +.01 < . 1:1(0) ack 10001 win 4000
+ +0 > P. 10001:11001(1000) ack 1
+ +.01 < . 1:1(0) ack 11001 win 4000
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the last byte should be received almost immediately
+// once 10001 is acked at t=20ms.
+// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...)
+// is called after when SYN is acked. So, we expect the last byte of the first
+// chunk to have a timestamp key of 10999 (i.e., 11000 - 1).
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the last byte should be received almost immediately
+// once 10001 is acked at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the last byte should be received at t=30ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt
new file mode 100644
index 000000000000..876024a31110
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt
@@ -0,0 +1,91 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tx timestamping for partial writes (IPv4).
+`./defaults.sh
+`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+// Establish connection and verify that there was no error.
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 2000 <mss 1000,sackOK,TS val 700 ecr 100,nop,wscale 7>
+ +0 > . 1:1(0) ack 1 <nop,nop,TS val 200 ecr 700>
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+
+ +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [1000], 4) = 0
+ +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+// We have a partial write.
+ +0 write(3, ..., 10000) = 2964
+ +0 > . 1:989(988) ack 1 <nop,nop,TS val 110 ecr 700>
+ +0 > P. 989:1977(988) ack 1 <nop,nop,TS val 110 ecr 700>
+ +.01 < . 1:1(0) ack 1977 win 92 <nop,nop,TS val 800 ecr 200>
+ +0 > P. 1977:2965(988) ack 1 <nop,nop,TS val 114 ecr 800>
+ +.01 < . 1:1(0) ack 2965 win 92 <nop,nop,TS val 800 ecr 200>
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately
+// after the first ack at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the first chunk should be received almost immediately
+// after the first ack at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the first chunk should be received after the last ack at
+// t=30ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt
new file mode 100644
index 000000000000..84d94780e6be
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt
@@ -0,0 +1,145 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tx timestamping for server-side (IPv4).
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+ +0 setsockopt(4, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+// Write two 2KB chunks.
+// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...)
+// is called after when SYN is acked. So, we expect the last byte of the first
+// and the second chunks to have timestamp keys of 1999 (i.e., 2000 - 1) and
+// 3999 (i.e., 4000 - 1) respectively.
+ +0 write(4, ..., 2000) = 2000
+ +0 write(4, ..., 2000) = 2000
+ +0 > P. 1:2001(2000) ack 1
+ +0 > P. 2001:4001(2000) ack 1
+ +.01 < . 1:1(0) ack 2001 win 514
+ +.01 < . 1:1(0) ack 4001 win 514
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately
+// after write at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the first chunk should be received almost immediately
+// after write at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SCHED for the second chunk should be received almost immediately
+// after that at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the second chunk should be received almost immediately
+// after that at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the first chunk should be received at t=20ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the second chunk should be received at t=30ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt
new file mode 100644
index 000000000000..e61424a7bd0a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt
@@ -0,0 +1,23 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we send FIN packet with correct TSval
+--tcp_ts_tick_usecs=1000
+--tolerance_usecs=7000
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+ +1 close(4) = 0
+// Check that FIN TSval is updated properly, one second has passed since last sent packet.
+ +0 > F. 1:1(0) ack 1 <nop,nop,TS val 1200 ecr 200>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt
new file mode 100644
index 000000000000..174ce9a1bfc0
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we reject TS val updates on a packet with invalid ACK sequence
+
+`./defaults.sh
+`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +.1 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+// bad packet with high tsval (its ACK sequence is above our sndnxt)
+ +0 < F. 1:1(0) ack 9999 win 20000 <nop,nop,TS val 200000 ecr 100>
+
+
+ +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100>
+ +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt
new file mode 100644
index 000000000000..2e3b3bb7493a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we send RST packet with correct TSval
+--tcp_ts_tick_usecs=1000
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+ +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100>
+ +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201>
+
+ +1 close(4) = 0
+// Check that RST TSval is updated properly, one second has passed since last sent packet.
+ +0 > R. 1:1(0) ack 1001 <nop,nop,TS val 1200 ecr 201>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt
new file mode 100644
index 000000000000..183051ba0cae
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt
@@ -0,0 +1,37 @@
+// SPDX-License-Identifier: GPL-2.0
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+
+ +0 < S 0:0(0) win 0 <mss 1460>
+ +0 > S. 0:0(0) ack 1 <mss 1460>
+
+ +.1 < . 1:1(0) ack 1 win 65530
+ +0 accept(3, ..., ...) = 4
+
+ +0 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0
+ +0 write(4, ..., 24) = 24
+ +0 > P. 1:25(24) ack 1
+ +.1 < . 1:1(0) ack 25 win 65530
+ +0 %{ assert tcpi_probes == 0, tcpi_probes; \
+ assert tcpi_backoff == 0, tcpi_backoff }%
+
+// install a qdisc dropping all packets
+ +0 `tc qdisc delete dev tun0 root 2>/dev/null ; tc qdisc add dev tun0 root pfifo limit 0`
+ +0 write(4, ..., 24) = 24
+ // When qdisc is congested we retry every 500ms
+ // (TCP_RESOURCE_PROBE_INTERVAL) and therefore
+ // we retry 6 times before hitting 3s timeout.
+ // First verify that the connection is alive:
++3.250 write(4, ..., 24) = 24
+ // Now verify that shortly after that the socket is dead:
+ +.100 write(4, ..., 24) = -1 ETIMEDOUT (Connection timed out)
+
+ +0 %{ assert tcpi_probes == 6, tcpi_probes; \
+ assert tcpi_backoff == 0, tcpi_backoff }%
+ +0 close(4) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt
new file mode 100644
index 000000000000..2efe02bfba9c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt
@@ -0,0 +1,32 @@
+// SPDX-License-Identifier: GPL-2.0
+`./defaults.sh`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK>
+ +.1 < . 1:1(0) ack 1 win 32792
+
+
+ +0 accept(3, ..., ...) = 4
+
+// Okay, we received nothing, and decide to close this idle socket.
+// We set TCP_USER_TIMEOUT to 3 seconds because really it is not worth
+// trying hard to cleanly close this flow, at the price of keeping
+// a TCP structure in kernel for about 1 minute !
+ +2 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0
+ +0 close(4) = 0
+
+ +0 > F. 1:1(0) ack 1
+ +.3~+.400 > F. 1:1(0) ack 1
+ +.3~+.400 > F. 1:1(0) ack 1
+ +.6~+.800 > F. 1:1(0) ack 1
+
+// We finally receive something from the peer, but it is way too late
+// Our socket vanished because TCP_USER_TIMEOUT was really small
+ +0 < . 1:2(1) ack 1 win 32792
+ +0 > R 1:1(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt
new file mode 100644
index 000000000000..8bd60226ccfc
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt
@@ -0,0 +1,24 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify that established connections drop a segment without the ACK flag set.
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,nop,nop>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK>
+ +.01 < . 1:1(0) ack 1 win 20000
+ +0 accept(3, ..., ...) = 4
+
+// Receive a segment with no flags set, verify that it's not enqueued.
+ +.01 < - 1:1001(1000) win 20000
+ +0 ioctl(4, SIOCINQ, [0]) = 0
+
+// Receive a segment with ACK flag set, verify that it is enqueued.
+ +.01 < . 1:1001(1000) ack 1 win 20000
+ +0 ioctl(4, SIOCINQ, [1000]) = 0
diff --git a/tools/testing/selftests/net/tls.c b/tools/testing/selftests/net/tls.c
index 1a706d03bb6b..9a85f93c33d8 100644
--- a/tools/testing/selftests/net/tls.c
+++ b/tools/testing/selftests/net/tls.c
@@ -44,9 +44,11 @@ struct tls_crypto_info_keys {
};
static void tls_crypto_info_init(uint16_t tls_version, uint16_t cipher_type,
- struct tls_crypto_info_keys *tls12)
+ struct tls_crypto_info_keys *tls12,
+ char key_generation)
{
- memset(tls12, 0, sizeof(*tls12));
+ memset(tls12, key_generation, sizeof(*tls12));
+ memset(tls12, 0, sizeof(struct tls_crypto_info));
switch (cipher_type) {
case TLS_CIPHER_CHACHA20_POLY1305:
@@ -275,7 +277,7 @@ TEST_F(tls_basic, recseq_wrap)
if (self->notls)
SKIP(return, "no TLS support");
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0);
memset(&tls12.aes128.rec_seq, 0xff, sizeof(tls12.aes128.rec_seq));
ASSERT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
@@ -391,7 +393,7 @@ FIXTURE_SETUP(tls)
SKIP(return, "Unsupported cipher in FIPS mode");
tls_crypto_info_init(variant->tls_version, variant->cipher_type,
- &tls12);
+ &tls12, 0);
ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls);
@@ -1175,7 +1177,7 @@ TEST_F(tls, bidir)
struct tls_crypto_info_keys tls12;
tls_crypto_info_init(variant->tls_version, variant->cipher_type,
- &tls12);
+ &tls12, 0);
ret = setsockopt(self->fd, SOL_TLS, TLS_RX, &tls12,
tls12.len);
@@ -1614,7 +1616,7 @@ TEST_F(tls, getsockopt)
EXPECT_EQ(get.crypto_info.cipher_type, variant->cipher_type);
/* get the full crypto_info */
- tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect, 0);
len = expect.len;
memrnd(&get, sizeof(get));
EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &get, &len), 0);
@@ -1668,6 +1670,464 @@ TEST_F(tls, recv_efault)
EXPECT_EQ(memcmp(rec2, recv_mem + 9, ret - 9), 0);
}
+#define TLS_RECORD_TYPE_HANDSHAKE 0x16
+/* key_update, length 1, update_not_requested */
+static const char key_update_msg[] = "\x18\x00\x00\x01\x00";
+static void tls_send_keyupdate(struct __test_metadata *_metadata, int fd)
+{
+ size_t len = sizeof(key_update_msg);
+
+ EXPECT_EQ(tls_send_cmsg(fd, TLS_RECORD_TYPE_HANDSHAKE,
+ (char *)key_update_msg, len, 0),
+ len);
+}
+
+static void tls_recv_keyupdate(struct __test_metadata *_metadata, int fd, int flags)
+{
+ char buf[100];
+
+ EXPECT_EQ(tls_recv_cmsg(_metadata, fd, TLS_RECORD_TYPE_HANDSHAKE, buf, sizeof(buf), flags),
+ sizeof(key_update_msg));
+ EXPECT_EQ(memcmp(buf, key_update_msg, sizeof(key_update_msg)), 0);
+}
+
+/* set the key to 0 then 1 for RX, immediately to 1 for TX */
+TEST_F(tls_basic, rekey_rx)
+{
+ struct tls_crypto_info_keys tls12_0, tls12_1;
+ char const *test_str = "test_message";
+ int send_len = strlen(test_str) + 1;
+ char buf[20];
+ int ret;
+
+ if (self->notls)
+ return;
+
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_0, 0);
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_1, 1);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_0, tls12_0.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len);
+ EXPECT_EQ(ret, 0);
+
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str, send_len), 0);
+}
+
+/* set the key to 0 then 1 for TX, immediately to 1 for RX */
+TEST_F(tls_basic, rekey_tx)
+{
+ struct tls_crypto_info_keys tls12_0, tls12_1;
+ char const *test_str = "test_message";
+ int send_len = strlen(test_str) + 1;
+ char buf[20];
+ int ret;
+
+ if (self->notls)
+ return;
+
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_0, 0);
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_1, 1);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_0, tls12_0.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len);
+ EXPECT_EQ(ret, 0);
+
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str, send_len), 0);
+}
+
+TEST_F(tls, rekey)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ char const *test_str_2 = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* initial send/recv */
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* send after rekey */
+ send_len = strlen(test_str_2) + 1;
+ EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* recv blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* recv non-blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ /* recv after rekey */
+ EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1);
+ EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0);
+}
+
+TEST_F(tls, rekey_fail)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ char const *test_str_2 = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ /* initial send/recv */
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+
+ if (variant->tls_version != TLS_1_3_VERSION) {
+ /* just check that rekey is not supported and return */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EBUSY);
+ return;
+ }
+
+ /* successful update */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* invalid update: change of version */
+ tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* invalid update (RX socket): change of version */
+ tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* invalid update: change of cipher */
+ if (variant->cipher_type == TLS_CIPHER_AES_GCM_256)
+ tls_crypto_info_init(variant->tls_version, TLS_CIPHER_CHACHA20_POLY1305, &tls12, 1);
+ else
+ tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_256, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* send after rekey, the invalid updates shouldn't have an effect */
+ send_len = strlen(test_str_2) + 1;
+ EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* recv blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* recv non-blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ /* recv after rekey */
+ EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1);
+ EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0);
+}
+
+TEST_F(tls, rekey_peek)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, MSG_PEEK), -1);
+
+ /* peek KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+}
+
+TEST_F(tls, splice_rekey)
+{
+ int send_len = TLS_PAYLOAD_MAX_LEN / 2;
+ char mem_send[TLS_PAYLOAD_MAX_LEN];
+ char mem_recv[TLS_PAYLOAD_MAX_LEN];
+ struct tls_crypto_info_keys tls12;
+ int p[2];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ memrnd(mem_send, sizeof(mem_send));
+
+ ASSERT_GE(pipe(p), 0);
+ EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0);
+
+ /* can't splice the KeyUpdate */
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* peek KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* can't splice before updating the key */
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0);
+}
+
+TEST_F(tls, rekey_peek_splice)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+ char mem_recv[TLS_PAYLOAD_MAX_LEN];
+ int p[2];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ ASSERT_GE(pipe(p), 0);
+
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_recv, test_str_1, send_len), 0);
+}
+
+TEST_F(tls, rekey_getsockopt)
+{
+ struct tls_crypto_info_keys tls12;
+ struct tls_crypto_info_keys tls12_get;
+ socklen_t len;
+
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+}
+
+TEST_F(tls, rekey_poll_pending)
+{
+ char const *test_str = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ struct pollfd pfd = { };
+ int send_len;
+ int ret;
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* send immediately after rekey */
+ send_len = strlen(test_str) + 1;
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+
+ /* key hasn't been updated, expect cfd to be non-readable */
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 0), 0);
+
+ ret = fork();
+ ASSERT_GE(ret, 0);
+
+ if (ret) {
+ int pid2, status;
+
+ /* wait before installing the new key */
+ sleep(1);
+
+ /* update RX key while poll() is sleeping */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ pid2 = wait(&status);
+ EXPECT_EQ(pid2, ret);
+ EXPECT_EQ(status, 0);
+ } else {
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 5000), 1);
+
+ exit(!__test_passed(_metadata));
+ }
+}
+
+TEST_F(tls, rekey_poll_delay)
+{
+ char const *test_str = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ struct pollfd pfd = { };
+ int send_len;
+ int ret;
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ ret = fork();
+ ASSERT_GE(ret, 0);
+
+ if (ret) {
+ int pid2, status;
+
+ /* wait before installing the new key */
+ sleep(1);
+
+ /* update RX key while poll() is sleeping */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ sleep(1);
+ send_len = strlen(test_str) + 1;
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+
+ pid2 = wait(&status);
+ EXPECT_EQ(pid2, ret);
+ EXPECT_EQ(status, 0);
+ } else {
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 5000), 1);
+ exit(!__test_passed(_metadata));
+ }
+}
+
FIXTURE(tls_err)
{
int fd, cfd;
@@ -1696,7 +2156,7 @@ FIXTURE_SETUP(tls_err)
int ret;
tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_128,
- &tls12);
+ &tls12, 0);
ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls);
ulp_sock_pair(_metadata, &self->fd2, &self->cfd2, &self->notls);
@@ -2118,7 +2578,7 @@ TEST(tls_v6ops) {
int sfd, ret, fd;
socklen_t len, len2;
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0);
addr.sin6_family = AF_INET6;
addr.sin6_addr = in6addr_any;
@@ -2177,7 +2637,7 @@ TEST(prequeue) {
len = sizeof(addr);
memrnd(buf, sizeof(buf));
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12, 0);
addr.sin_family = AF_INET;
addr.sin_addr.s_addr = htonl(INADDR_ANY);
diff --git a/tools/testing/selftests/net/udpgso_bench.sh b/tools/testing/selftests/net/udpgso_bench.sh
index 640bc43452fa..88fa1d53ba2b 100755
--- a/tools/testing/selftests/net/udpgso_bench.sh
+++ b/tools/testing/selftests/net/udpgso_bench.sh
@@ -92,6 +92,9 @@ run_udp() {
echo "udp"
run_in_netns ${args}
+ echo "udp sendmmsg"
+ run_in_netns ${args} -m
+
echo "udp gso"
run_in_netns ${args} -S 0
diff --git a/tools/testing/selftests/net/vlan_bridge_binding.sh b/tools/testing/selftests/net/vlan_bridge_binding.sh
new file mode 100755
index 000000000000..e7cb8c678bde
--- /dev/null
+++ b/tools/testing/selftests/net/vlan_bridge_binding.sh
@@ -0,0 +1,256 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+source lib.sh
+
+ALL_TESTS="
+ test_binding_on
+ test_binding_off
+ test_binding_toggle_on
+ test_binding_toggle_off
+ test_binding_toggle_on_when_upper_down
+ test_binding_toggle_off_when_upper_down
+ test_binding_toggle_on_when_lower_down
+ test_binding_toggle_off_when_lower_down
+"
+
+setup_prepare()
+{
+ local port
+
+ ip_link_add br up type bridge vlan_filtering 1
+
+ for port in d1 d2 d3; do
+ ip_link_add $port type veth peer name r$port
+ ip_link_set_up $port
+ ip_link_set_up r$port
+ ip_link_set_master $port br
+ done
+
+ bridge_vlan_add vid 11 dev br self
+ bridge_vlan_add vid 11 dev d1 master
+
+ bridge_vlan_add vid 12 dev br self
+ bridge_vlan_add vid 12 dev d2 master
+
+ bridge_vlan_add vid 13 dev br self
+ bridge_vlan_add vid 13 dev d1 master
+ bridge_vlan_add vid 13 dev d2 master
+
+ bridge_vlan_add vid 14 dev br self
+ bridge_vlan_add vid 14 dev d1 master
+ bridge_vlan_add vid 14 dev d2 master
+ bridge_vlan_add vid 14 dev d3 master
+}
+
+operstate_is()
+{
+ local dev=$1; shift
+ local expect=$1; shift
+
+ local operstate=$(ip -j link show $dev | jq -r .[].operstate)
+ if [[ $operstate == UP ]]; then
+ operstate=1
+ elif [[ $operstate == DOWN || $operstate == LOWERLAYERDOWN ]]; then
+ operstate=0
+ fi
+ echo -n $operstate
+ [[ $operstate == $expect ]]
+}
+
+check_operstate()
+{
+ local dev=$1; shift
+ local expect=$1; shift
+ local operstate
+
+ operstate=$(busywait 1000 \
+ operstate_is "$dev" "$expect")
+ check_err $? "Got operstate of $operstate, expected $expect"
+}
+
+add_one_vlan()
+{
+ local link=$1; shift
+ local id=$1; shift
+
+ ip_link_add $link.$id link $link type vlan id $id "$@"
+}
+
+add_vlans()
+{
+ add_one_vlan br 11 "$@"
+ add_one_vlan br 12 "$@"
+ add_one_vlan br 13 "$@"
+ add_one_vlan br 14 "$@"
+}
+
+set_vlans()
+{
+ ip link set dev br.11 "$@"
+ ip link set dev br.12 "$@"
+ ip link set dev br.13 "$@"
+ ip link set dev br.14 "$@"
+}
+
+down_netdevs()
+{
+ local dev
+
+ for dev in "$@"; do
+ ip_link_set_down $dev
+ done
+}
+
+check_operstates()
+{
+ local opst_11=$1; shift
+ local opst_12=$1; shift
+ local opst_13=$1; shift
+ local opst_14=$1; shift
+
+ check_operstate br.11 $opst_11
+ check_operstate br.12 $opst_12
+ check_operstate br.13 $opst_13
+ check_operstate br.14 $opst_14
+}
+
+do_test_binding()
+{
+ local inject=$1; shift
+ local what=$1; shift
+ local opsts_d1=$1; shift
+ local opsts_d2=$1; shift
+ local opsts_d12=$1; shift
+ local opsts_d123=$1; shift
+
+ RET=0
+
+ defer_scope_push
+ down_netdevs d1
+ $inject
+ check_operstates $opsts_d1
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d2
+ $inject
+ check_operstates $opsts_d2
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d1 d2
+ $inject
+ check_operstates $opsts_d12
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d1 d2 d3
+ $inject
+ check_operstates $opsts_d123
+ defer_scope_pop
+
+ log_test "Test bridge_binding $what"
+}
+
+do_test_binding_on()
+{
+ local inject=$1; shift
+ local what=$1; shift
+
+ do_test_binding "$inject" "$what" \
+ "0 1 1 1" \
+ "1 0 1 1" \
+ "0 0 0 1" \
+ "0 0 0 0"
+}
+
+do_test_binding_off()
+{
+ local inject=$1; shift
+ local what=$1; shift
+
+ do_test_binding "$inject" "$what" \
+ "1 1 1 1" \
+ "1 1 1 1" \
+ "1 1 1 1" \
+ "0 0 0 0"
+}
+
+test_binding_on()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ do_test_binding_on : "on"
+}
+
+test_binding_off()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ do_test_binding_off : "off"
+}
+
+test_binding_toggle_on()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ set_vlans type vlan bridge_binding on
+ do_test_binding_on : "off->on"
+}
+
+test_binding_toggle_off()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ set_vlans type vlan bridge_binding off
+ do_test_binding_off : "on->off"
+}
+
+dfr_set_binding_on()
+{
+ set_vlans type vlan bridge_binding on
+ defer set_vlans type vlan bridge_binding off
+}
+
+dfr_set_binding_off()
+{
+ set_vlans type vlan bridge_binding off
+ defer set_vlans type vlan bridge_binding on
+}
+
+test_binding_toggle_on_when_lower_down()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ do_test_binding_on dfr_set_binding_on "off->on when lower down"
+}
+
+test_binding_toggle_off_when_lower_down()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ do_test_binding_off dfr_set_binding_off "on->off when lower down"
+}
+
+test_binding_toggle_on_when_upper_down()
+{
+ add_vlans bridge_binding off
+ set_vlans type vlan bridge_binding on
+ set_vlans up
+ do_test_binding_on : "off->on when upper down"
+}
+
+test_binding_toggle_off_when_upper_down()
+{
+ add_vlans bridge_binding on
+ set_vlans type vlan bridge_binding off
+ set_vlans up
+ do_test_binding_off : "on->off when upper down"
+}
+
+trap defer_scopes_cleanup EXIT
+setup_prepare
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/ynl.mk b/tools/testing/selftests/net/ynl.mk
index d43afe243779..12e7cae251be 100644
--- a/tools/testing/selftests/net/ynl.mk
+++ b/tools/testing/selftests/net/ynl.mk
@@ -31,7 +31,8 @@ $(OUTPUT)/libynl.a: $(YNL_SPECS) $(OUTPUT)/.libynl-$(YNL_GENS_HASH).sig
$(Q)cp $(top_srcdir)/tools/net/ynl/libynl.a $(OUTPUT)/libynl.a
EXTRA_CLEAN += \
- $(top_srcdir)/tools/net/ynl/lib/__pycache__ \
+ $(top_srcdir)/tools/net/ynl/pyynl/__pycache__ \
+ $(top_srcdir)/tools/net/ynl/pyynl/lib/__pycache__ \
$(top_srcdir)/tools/net/ynl/lib/*.[ado] \
$(OUTPUT)/.libynl-*.sig \
$(OUTPUT)/libynl.a
diff --git a/tools/testing/selftests/nolibc/Makefile b/tools/testing/selftests/nolibc/Makefile
index e92e0b885861..7d14a7c0cb62 100644
--- a/tools/testing/selftests/nolibc/Makefile
+++ b/tools/testing/selftests/nolibc/Makefile
@@ -43,6 +43,7 @@ cc-option = $(call __cc-option, $(CC),$(CLANG_CROSS_FLAGS),$(1),$(2))
# configure default variants for target kernel supported architectures
XARCH_powerpc = ppc
XARCH_mips = mips32le
+XARCH_riscv = riscv64
XARCH = $(or $(XARCH_$(ARCH)),$(ARCH))
# map from user input variants to their kernel supported architectures
@@ -51,6 +52,8 @@ ARCH_ppc64 = powerpc
ARCH_ppc64le = powerpc
ARCH_mips32le = mips
ARCH_mips32be = mips
+ARCH_riscv32 = riscv
+ARCH_riscv64 = riscv
ARCH := $(or $(ARCH_$(XARCH)),$(XARCH))
# kernel image names by architecture
@@ -65,6 +68,8 @@ IMAGE_ppc = vmlinux
IMAGE_ppc64 = vmlinux
IMAGE_ppc64le = arch/powerpc/boot/zImage
IMAGE_riscv = arch/riscv/boot/Image
+IMAGE_riscv32 = arch/riscv/boot/Image
+IMAGE_riscv64 = arch/riscv/boot/Image
IMAGE_s390 = arch/s390/boot/bzImage
IMAGE_loongarch = arch/loongarch/boot/vmlinuz.efi
IMAGE = $(objtree)/$(IMAGE_$(XARCH))
@@ -82,6 +87,8 @@ DEFCONFIG_ppc = pmac32_defconfig
DEFCONFIG_ppc64 = powernv_be_defconfig
DEFCONFIG_ppc64le = powernv_defconfig
DEFCONFIG_riscv = defconfig
+DEFCONFIG_riscv32 = rv32_defconfig
+DEFCONFIG_riscv64 = defconfig
DEFCONFIG_s390 = defconfig
DEFCONFIG_loongarch = defconfig
DEFCONFIG = $(DEFCONFIG_$(XARCH))
@@ -104,6 +111,8 @@ QEMU_ARCH_ppc = ppc
QEMU_ARCH_ppc64 = ppc64
QEMU_ARCH_ppc64le = ppc64
QEMU_ARCH_riscv = riscv64
+QEMU_ARCH_riscv32 = riscv32
+QEMU_ARCH_riscv64 = riscv64
QEMU_ARCH_s390 = s390x
QEMU_ARCH_loongarch = loongarch64
QEMU_ARCH = $(QEMU_ARCH_$(XARCH))
@@ -130,6 +139,8 @@ QEMU_ARGS_ppc = -M g3beige -append "console=ttyS0 panic=-1 $(TEST:%=NOLIB
QEMU_ARGS_ppc64 = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_ppc64le = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_riscv = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
+QEMU_ARGS_riscv32 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
+QEMU_ARGS_riscv64 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_s390 = -M s390-ccw-virtio -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_loongarch = -M virt -append "console=ttyS0,115200 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS = -m 1G $(QEMU_ARGS_$(XARCH)) $(QEMU_ARGS_BIOS) $(QEMU_ARGS_EXTRA)
diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c
index 6fba7025c5e3..0e0e3b48a8c3 100644
--- a/tools/testing/selftests/nolibc/nolibc-test.c
+++ b/tools/testing/selftests/nolibc/nolibc-test.c
@@ -302,7 +302,10 @@ int expect_syszr(int expr, int llen)
{
int ret = 0;
- if (expr) {
+ if (errno == ENOSYS) {
+ llen += printf(" = ENOSYS");
+ result(llen, SKIPPED);
+ } else if (expr) {
ret = 1;
llen += printf(" = %d %s ", expr, errorname(errno));
result(llen, FAIL);
@@ -342,7 +345,10 @@ int expect_sysne(int expr, int llen, int val)
{
int ret = 0;
- if (expr == val) {
+ if (errno == ENOSYS) {
+ llen += printf(" = ENOSYS");
+ result(llen, SKIPPED);
+ } else if (expr == val) {
ret = 1;
llen += printf(" = %d %s ", expr, errorname(errno));
result(llen, FAIL);
@@ -367,7 +373,9 @@ int expect_syserr2(int expr, int expret, int experr1, int experr2, int llen)
int _errno = errno;
llen += printf(" = %d %s ", expr, errorname(_errno));
- if (expr != expret || (_errno != experr1 && _errno != experr2)) {
+ if (errno == ENOSYS) {
+ result(llen, SKIPPED);
+ } else if (expr != expret || (_errno != experr1 && _errno != experr2)) {
ret = 1;
if (experr2 == 0)
llen += printf(" != (%d %s) ", expret, errorname(experr1));
@@ -1229,19 +1237,20 @@ int run_stdlib(int min, int max)
static int expect_vfprintf(int llen, int c, const char *expected, const char *fmt, ...)
{
- int ret, fd;
+ int ret, pipefd[2];
ssize_t w, r;
char buf[100];
FILE *memfile;
va_list args;
- fd = open("/tmp", O_TMPFILE | O_EXCL | O_RDWR, 0600);
- if (fd == -1) {
- result(llen, SKIPPED);
- return 0;
+ ret = pipe(pipefd);
+ if (ret == -1) {
+ llen += printf(" pipe() != %s", strerror(errno));
+ result(llen, FAIL);
+ return 1;
}
- memfile = fdopen(fd, "w+");
+ memfile = fdopen(pipefd[1], "w");
if (!memfile) {
result(llen, FAIL);
return 1;
@@ -1257,13 +1266,10 @@ static int expect_vfprintf(int llen, int c, const char *expected, const char *fm
return 1;
}
- fflush(memfile);
- lseek(fd, 0, SEEK_SET);
-
- r = read(fd, buf, sizeof(buf) - 1);
-
fclose(memfile);
+ r = read(pipefd[0], buf, sizeof(buf) - 1);
+
if (r != w) {
llen += printf(" written(%d) != read(%d)", (int)w, (int)r);
result(llen, FAIL);
@@ -1323,7 +1329,8 @@ static int run_protection(int min __attribute__((unused)),
int max __attribute__((unused)))
{
pid_t pid;
- int llen = 0, status;
+ int llen = 0, ret;
+ siginfo_t siginfo = {};
struct rlimit rlimit = { 0, 0 };
llen += printf("0 -fstackprotector ");
@@ -1361,10 +1368,11 @@ static int run_protection(int min __attribute__((unused)),
return 1;
default:
- pid = waitpid(pid, &status, 0);
+ ret = waitid(P_PID, pid, &siginfo, WEXITED);
- if (pid == -1 || !WIFSIGNALED(status) || WTERMSIG(status) != SIGABRT) {
- llen += printf("waitpid()");
+ if (ret != 0 || siginfo.si_signo != SIGCHLD ||
+ siginfo.si_code != CLD_KILLED || siginfo.si_status != SIGABRT) {
+ llen += printf("waitid()");
result(llen, FAIL);
return 1;
}
diff --git a/tools/testing/selftests/nolibc/run-tests.sh b/tools/testing/selftests/nolibc/run-tests.sh
index e7ecda4ae796..9c5160c53881 100755
--- a/tools/testing/selftests/nolibc/run-tests.sh
+++ b/tools/testing/selftests/nolibc/run-tests.sh
@@ -17,7 +17,7 @@ perform_download=0
test_mode=system
werror=1
llvm=
-archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv s390 loongarch"
+archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv32 riscv64 s390 loongarch"
TEMP=$(getopt -o 'j:d:c:b:a:m:pelh' -n "$0" -- "$@")
@@ -143,6 +143,13 @@ test_arch() {
arch=$1
ct_arch=$(crosstool_arch "$arch")
ct_abi=$(crosstool_abi "$1")
+
+ if [ ! -d "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/." ]; then
+ echo "No toolchain found in ${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}."
+ echo "Did you install the toolchains or set the correct arch ? Rerun with -h for help."
+ return 1
+ fi
+
cross_compile=$(realpath "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/${ct_arch}-${ct_abi}-")
build_dir="${build_location}/${arch}"
if [ "$werror" -ne 0 ]; then
diff --git a/tools/testing/selftests/pid_namespace/.gitignore b/tools/testing/selftests/pid_namespace/.gitignore
index 93ab9d7e5b7e..5118f0f3edf4 100644
--- a/tools/testing/selftests/pid_namespace/.gitignore
+++ b/tools/testing/selftests/pid_namespace/.gitignore
@@ -1 +1,2 @@
+pid_max
regression_enomem
diff --git a/tools/testing/selftests/pid_namespace/Makefile b/tools/testing/selftests/pid_namespace/Makefile
index 9286a1d22cd3..b972f55d07ae 100644
--- a/tools/testing/selftests/pid_namespace/Makefile
+++ b/tools/testing/selftests/pid_namespace/Makefile
@@ -1,7 +1,7 @@
# SPDX-License-Identifier: GPL-2.0
CFLAGS += -g $(KHDR_INCLUDES)
-TEST_GEN_PROGS = regression_enomem
+TEST_GEN_PROGS = regression_enomem pid_max
LOCAL_HDRS += $(selfdir)/pidfd/pidfd.h
diff --git a/tools/testing/selftests/pid_namespace/pid_max.c b/tools/testing/selftests/pid_namespace/pid_max.c
new file mode 100644
index 000000000000..51c414faabb0
--- /dev/null
+++ b/tools/testing/selftests/pid_namespace/pid_max.c
@@ -0,0 +1,358 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#define _GNU_SOURCE
+#include <assert.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <linux/types.h>
+#include <sched.h>
+#include <signal.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <syscall.h>
+#include <sys/wait.h>
+
+#include "../kselftest_harness.h"
+#include "../pidfd/pidfd.h"
+
+#define __STACK_SIZE (8 * 1024 * 1024)
+static pid_t do_clone(int (*fn)(void *), void *arg, int flags)
+{
+ char *stack;
+ pid_t ret;
+
+ stack = malloc(__STACK_SIZE);
+ if (!stack)
+ return -ENOMEM;
+
+#ifdef __ia64__
+ ret = __clone2(fn, stack, __STACK_SIZE, flags | SIGCHLD, arg);
+#else
+ ret = clone(fn, stack + __STACK_SIZE, flags | SIGCHLD, arg);
+#endif
+ free(stack);
+ return ret;
+}
+
+static int pid_max_cb(void *data)
+{
+ int fd, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return -1;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return -1;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return -1;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return -1;
+ }
+
+ for (int i = 0; i < 501; i++) {
+ pid = fork();
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+ wait_for_pid(pid);
+ if (pid > 500) {
+ fprintf(stderr, "Managed to create pid number beyond limit\n");
+ return -1;
+ }
+ }
+
+ return 0;
+}
+
+static int pid_max_nested_inner(void *data)
+{
+ int fret = -1;
+ pid_t pids[2];
+ int fd, i, ret;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ pids[0] = fork();
+ if (pids[0] < 0) {
+ fprintf(stderr, "Failed to create first new process\n");
+ return fret;
+ }
+
+ if (pids[0] == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[1] = fork();
+ wait_for_pid(pids[0]);
+ if (pids[1] >= 0) {
+ if (pids[1] == 0)
+ exit(EXIT_SUCCESS);
+ wait_for_pid(pids[1]);
+
+ fprintf(stderr, "Managed to create process even though ancestor pid namespace had a limit\n");
+ return fret;
+ }
+
+ /* Now make sure that we wrap pids at 400. */
+ for (i = 0; i < 510; i++) {
+ pid_t pid;
+
+ pid = fork();
+ if (pid < 0)
+ return fret;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ wait_for_pid(pid);
+ if (pid >= 500) {
+ fprintf(stderr, "Managed to create process with pid %d beyond configured limit\n", pid);
+ return fret;
+ }
+ }
+
+ return 0;
+}
+
+static int pid_max_nested_outer(void *data)
+{
+ int fret = -1, nr_procs = 400;
+ pid_t pids[1000];
+ int fd, i, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "400", sizeof("400") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ /*
+ * Create 397 processes. This leaves room for do_clone() (398) and
+ * one more 399. So creating another process needs to fail.
+ */
+ for (nr_procs = 0; nr_procs < 396; nr_procs++) {
+ pid = fork();
+ if (pid < 0)
+ goto reap;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[nr_procs] = pid;
+ }
+
+ pid = do_clone(pid_max_nested_inner, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ if (pid < 0) {
+ fprintf(stderr, "%m - Failed to clone nested pidns\n");
+ goto reap;
+ }
+
+ if (wait_for_pid(pid)) {
+ fprintf(stderr, "%m - Nested pid_max failed\n");
+ goto reap;
+ }
+
+ fret = 0;
+
+reap:
+ for (int i = 0; i < nr_procs; i++)
+ wait_for_pid(pids[i]);
+
+ return fret;
+}
+
+static int pid_max_nested_limit_inner(void *data)
+{
+ int fret = -1, nr_procs = 400;
+ int fd, ret;
+ pid_t pid;
+ pid_t pids[1000];
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ for (nr_procs = 0; nr_procs < 500; nr_procs++) {
+ pid = fork();
+ if (pid < 0)
+ break;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[nr_procs] = pid;
+ }
+
+ if (nr_procs >= 400) {
+ fprintf(stderr, "Managed to create processes beyond the configured outer limit\n");
+ goto reap;
+ }
+
+ fret = 0;
+
+reap:
+ for (int i = 0; i < nr_procs; i++)
+ wait_for_pid(pids[i]);
+
+ return fret;
+}
+
+static int pid_max_nested_limit_outer(void *data)
+{
+ int fd, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return -1;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return -1;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return -1;
+ }
+
+ ret = write(fd, "400", sizeof("400") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return -1;
+ }
+
+ pid = do_clone(pid_max_nested_limit_inner, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ if (pid < 0) {
+ fprintf(stderr, "%m - Failed to clone nested pidns\n");
+ return -1;
+ }
+
+ if (wait_for_pid(pid)) {
+ fprintf(stderr, "%m - Nested pid_max failed\n");
+ return -1;
+ }
+
+ return 0;
+}
+
+TEST(pid_max_simple)
+{
+ pid_t pid;
+
+
+ pid = do_clone(pid_max_cb, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST(pid_max_nested_limit)
+{
+ pid_t pid;
+
+ pid = do_clone(pid_max_nested_limit_outer, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST(pid_max_nested)
+{
+ pid_t pid;
+
+ pid = do_clone(pid_max_nested_outer, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/.gitignore b/tools/testing/selftests/pidfd/.gitignore
index 973198a3ec3d..bf92481f925c 100644
--- a/tools/testing/selftests/pidfd/.gitignore
+++ b/tools/testing/selftests/pidfd/.gitignore
@@ -6,3 +6,5 @@ pidfd_wait
pidfd_fdinfo_test
pidfd_getfd_test
pidfd_setns_test
+pidfd_file_handle_test
+pidfd_bind_mount
diff --git a/tools/testing/selftests/pidfd/Makefile b/tools/testing/selftests/pidfd/Makefile
index d731e3e76d5b..301343a11b62 100644
--- a/tools/testing/selftests/pidfd/Makefile
+++ b/tools/testing/selftests/pidfd/Makefile
@@ -2,7 +2,8 @@
CFLAGS += -g $(KHDR_INCLUDES) -pthread -Wall
TEST_GEN_PROGS := pidfd_test pidfd_fdinfo_test pidfd_open_test \
- pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test
+ pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test \
+ pidfd_file_handle_test pidfd_bind_mount
include ../lib.mk
diff --git a/tools/testing/selftests/pidfd/pidfd.h b/tools/testing/selftests/pidfd/pidfd.h
index 88d6830ee004..0b96ac4b8ce5 100644
--- a/tools/testing/selftests/pidfd/pidfd.h
+++ b/tools/testing/selftests/pidfd/pidfd.h
@@ -12,11 +12,11 @@
#include <stdlib.h>
#include <string.h>
#include <syscall.h>
-#include <sys/mount.h>
#include <sys/types.h>
#include <sys/wait.h>
#include "../kselftest.h"
+#include "../clone3/clone3_selftests.h"
#ifndef P_PIDFD
#define P_PIDFD 3
@@ -68,6 +68,11 @@
#define PIDFD_SKIP 3
#define PIDFD_XFAIL 4
+static inline int sys_waitid(int which, pid_t pid, siginfo_t *info, int options)
+{
+ return syscall(__NR_waitid, which, pid, info, options, NULL);
+}
+
static inline int wait_for_pid(pid_t pid)
{
int status, ret;
@@ -114,4 +119,37 @@ static inline int sys_memfd_create(const char *name, unsigned int flags)
return syscall(__NR_memfd_create, name, flags);
}
+static inline pid_t create_child(int *pidfd, unsigned flags)
+{
+ struct __clone_args args = {
+ .flags = CLONE_PIDFD | flags,
+ .exit_signal = SIGCHLD,
+ .pidfd = ptr_to_u64(pidfd),
+ };
+
+ return sys_clone3(&args, sizeof(struct __clone_args));
+}
+
+static inline ssize_t read_nointr(int fd, void *buf, size_t count)
+{
+ ssize_t ret;
+
+ do {
+ ret = read(fd, buf, count);
+ } while (ret < 0 && errno == EINTR);
+
+ return ret;
+}
+
+static inline ssize_t write_nointr(int fd, const void *buf, size_t count)
+{
+ ssize_t ret;
+
+ do {
+ ret = write(fd, buf, count);
+ } while (ret < 0 && errno == EINTR);
+
+ return ret;
+}
+
#endif /* __PIDFD_H */
diff --git a/tools/testing/selftests/pidfd/pidfd_bind_mount.c b/tools/testing/selftests/pidfd/pidfd_bind_mount.c
new file mode 100644
index 000000000000..7822dd080258
--- /dev/null
+++ b/tools/testing/selftests/pidfd/pidfd_bind_mount.c
@@ -0,0 +1,188 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <limits.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <linux/fs.h>
+#include <sys/ioctl.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "pidfd.h"
+#include "../kselftest_harness.h"
+
+#ifndef __NR_open_tree
+ #if defined __alpha__
+ #define __NR_open_tree 538
+ #elif defined _MIPS_SIM
+ #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */
+ #define __NR_open_tree 4428
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */
+ #define __NR_open_tree 6428
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */
+ #define __NR_open_tree 5428
+ #endif
+ #elif defined __ia64__
+ #define __NR_open_tree (428 + 1024)
+ #else
+ #define __NR_open_tree 428
+ #endif
+#endif
+
+#ifndef __NR_move_mount
+ #if defined __alpha__
+ #define __NR_move_mount 539
+ #elif defined _MIPS_SIM
+ #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */
+ #define __NR_move_mount 4429
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */
+ #define __NR_move_mount 6429
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */
+ #define __NR_move_mount 5429
+ #endif
+ #elif defined __ia64__
+ #define __NR_move_mount (428 + 1024)
+ #else
+ #define __NR_move_mount 429
+ #endif
+#endif
+
+#ifndef MOVE_MOUNT_F_EMPTY_PATH
+#define MOVE_MOUNT_F_EMPTY_PATH 0x00000004 /* Empty from path permitted */
+#endif
+
+#ifndef MOVE_MOUNT_F_EMPTY_PATH
+#define MOVE_MOUNT_T_EMPTY_PATH 0x00000040 /* Empty to path permitted */
+#endif
+
+static inline int sys_move_mount(int from_dfd, const char *from_pathname,
+ int to_dfd, const char *to_pathname,
+ unsigned int flags)
+{
+ return syscall(__NR_move_mount, from_dfd, from_pathname, to_dfd,
+ to_pathname, flags);
+}
+
+#ifndef OPEN_TREE_CLONE
+#define OPEN_TREE_CLONE 1
+#endif
+
+#ifndef OPEN_TREE_CLOEXEC
+#define OPEN_TREE_CLOEXEC O_CLOEXEC
+#endif
+
+#ifndef AT_RECURSIVE
+#define AT_RECURSIVE 0x8000 /* Apply to the entire subtree */
+#endif
+
+static inline int sys_open_tree(int dfd, const char *filename, unsigned int flags)
+{
+ return syscall(__NR_open_tree, dfd, filename, flags);
+}
+
+FIXTURE(pidfd_bind_mount) {
+ char template[PATH_MAX];
+ int fd_tmp;
+ int pidfd;
+ struct stat st1;
+ struct stat st2;
+ __u32 gen1;
+ __u32 gen2;
+ bool must_unmount;
+};
+
+FIXTURE_SETUP(pidfd_bind_mount)
+{
+ self->fd_tmp = -EBADF;
+ self->must_unmount = false;
+ ASSERT_EQ(unshare(CLONE_NEWNS), 0);
+ ASSERT_LE(snprintf(self->template, PATH_MAX, "%s", P_tmpdir "/pidfd_bind_mount_XXXXXX"), PATH_MAX);
+ self->fd_tmp = mkstemp(self->template);
+ ASSERT_GE(self->fd_tmp, 0);
+ self->pidfd = sys_pidfd_open(getpid(), 0);
+ ASSERT_GE(self->pidfd, 0);
+ ASSERT_GE(fstat(self->pidfd, &self->st1), 0);
+ ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen1), 0);
+}
+
+FIXTURE_TEARDOWN(pidfd_bind_mount)
+{
+ ASSERT_EQ(close(self->fd_tmp), 0);
+ if (self->must_unmount)
+ ASSERT_EQ(umount2(self->template, 0), 0);
+ ASSERT_EQ(unlink(self->template), 0);
+}
+
+/*
+ * Test that a detached mount can be created for a pidfd and then
+ * attached to the filesystem hierarchy.
+ */
+TEST_F(pidfd_bind_mount, bind_mount)
+{
+ int fd_tree;
+
+ fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH);
+ ASSERT_GE(fd_tree, 0);
+
+ ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0);
+ self->must_unmount = true;
+
+ ASSERT_EQ(close(fd_tree), 0);
+}
+
+/* Test that a pidfd can be reopened through procfs. */
+TEST_F(pidfd_bind_mount, reopen)
+{
+ int pidfd;
+ char proc_path[PATH_MAX];
+
+ sprintf(proc_path, "/proc/self/fd/%d", self->pidfd);
+ pidfd = open(proc_path, O_RDONLY | O_NOCTTY | O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_GE(fstat(self->pidfd, &self->st2), 0);
+ ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen2), 0);
+
+ ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino);
+ ASSERT_TRUE(self->gen1 == self->gen2);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+/*
+ * Test that a detached mount can be created for a pidfd and then
+ * attached to the filesystem hierarchy and reopened.
+ */
+TEST_F(pidfd_bind_mount, bind_mount_reopen)
+{
+ int fd_tree, fd_pidfd_mnt;
+
+ fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH);
+ ASSERT_GE(fd_tree, 0);
+
+ ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0);
+ self->must_unmount = true;
+
+ fd_pidfd_mnt = openat(-EBADF, self->template, O_RDONLY | O_NOCTTY | O_CLOEXEC);
+ ASSERT_GE(fd_pidfd_mnt, 0);
+
+ ASSERT_GE(fstat(fd_tree, &self->st2), 0);
+ ASSERT_EQ(ioctl(fd_pidfd_mnt, FS_IOC_GETVERSION, &self->gen2), 0);
+
+ ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino);
+ ASSERT_TRUE(self->gen1 == self->gen2);
+
+ ASSERT_EQ(close(fd_tree), 0);
+ ASSERT_EQ(close(fd_pidfd_mnt), 0);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/pidfd_file_handle_test.c b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c
new file mode 100644
index 000000000000..439b9c6c0457
--- /dev/null
+++ b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c
@@ -0,0 +1,503 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#define _GNU_SOURCE
+#include <errno.h>
+#include <fcntl.h>
+#include <limits.h>
+#include <linux/types.h>
+#include <poll.h>
+#include <sched.h>
+#include <signal.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <syscall.h>
+#include <sys/prctl.h>
+#include <sys/wait.h>
+#include <unistd.h>
+#include <sys/socket.h>
+#include <linux/kcmp.h>
+#include <sys/stat.h>
+
+#include "pidfd.h"
+#include "../kselftest_harness.h"
+
+FIXTURE(file_handle)
+{
+ pid_t pid;
+ int pidfd;
+
+ pid_t child_pid1;
+ int child_pidfd1;
+
+ pid_t child_pid2;
+ int child_pidfd2;
+
+ pid_t child_pid3;
+ int child_pidfd3;
+};
+
+FIXTURE_SETUP(file_handle)
+{
+ int ret;
+ int ipc_sockets[2];
+ char c;
+
+ self->pid = getpid();
+ self->pidfd = sys_pidfd_open(self->pid, 0);
+ ASSERT_GE(self->pidfd, 0);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid1 = create_child(&self->child_pidfd1, CLONE_NEWUSER);
+ EXPECT_GE(self->child_pid1, 0);
+
+ if (self->child_pid1 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid2 = create_child(&self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID);
+ EXPECT_GE(self->child_pid2, 0);
+
+ if (self->child_pid2 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid3 = create_child(&self->child_pidfd3, CLONE_NEWUSER | CLONE_NEWPID);
+ EXPECT_GE(self->child_pid3, 0);
+
+ if (self->child_pid3 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+}
+
+FIXTURE_TEARDOWN(file_handle)
+{
+ EXPECT_EQ(close(self->pidfd), 0);
+
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd1, SIGKILL, NULL, 0), 0);
+ if (self->child_pidfd1 >= 0)
+ EXPECT_EQ(0, close(self->child_pidfd1));
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0);
+
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd2, SIGKILL, NULL, 0), 0);
+ if (self->child_pidfd2 >= 0)
+ EXPECT_EQ(0, close(self->child_pidfd2));
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0);
+
+ if (self->child_pidfd3 >= 0) {
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(0, close(self->child_pidfd3));
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+ }
+}
+
+/*
+ * Test that we can decode a pidfs file handle in the same pid
+ * namespace.
+ */
+TEST_F(file_handle, file_handle_same_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd1, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd1, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we can decode a pidfs file handle from a child pid
+ * namespace.
+ */
+TEST_F(file_handle, file_handle_child_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we fail to decode a pidfs file handle from an ancestor
+ * child pid namespace.
+ */
+TEST_F(file_handle, file_handle_foreign_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ pid_t pid;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->pidfd, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(setns(self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID), 0);
+
+ pid = fork();
+ ASSERT_GE(pid, 0);
+
+ if (pid == 0) {
+ int pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ if (pidfd >= 0) {
+ TH_LOG("Managed to open pidfd outside of the caller's pid namespace hierarchy");
+ _exit(1);
+ }
+ _exit(0);
+ }
+
+ ASSERT_EQ(wait_for_pid(pid), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we can decode a pidfs file handle of a process that has
+ * exited but not been reaped.
+ */
+TEST_F(file_handle, pid_has_exited)
+{
+ int mnt_id, pidfd, child_pidfd3;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ child_pidfd3 = self->child_pidfd3;
+ self->child_pidfd3 = -EBADF;
+ EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(close(child_pidfd3), 0);
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED | WNOWAIT), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+}
+
+/*
+ * Test that we fail to decode a pidfs file handle of a process that has
+ * already been reaped.
+ */
+TEST_F(file_handle, pid_has_been_reaped)
+{
+ int mnt_id, pidfd, child_pidfd3;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ child_pidfd3 = self->child_pidfd3;
+ self->child_pidfd3 = -EBADF;
+ EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(close(child_pidfd3), 0);
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_LT(pidfd, 0);
+}
+
+/*
+ * Test valid flags to open a pidfd file handle. Note, that
+ * PIDFD_NONBLOCK is defined as O_NONBLOCK and O_NONBLOCK is an alias to
+ * O_NDELAY. Also note that PIDFD_THREAD is an alias for O_EXCL.
+ */
+TEST_F(file_handle, open_by_handle_at_valid_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh,
+ O_RDONLY |
+ O_WRONLY |
+ O_RDWR |
+ O_NONBLOCK |
+ O_NDELAY |
+ O_CLOEXEC |
+ O_EXCL);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+/*
+ * Test that invalid flags passed to open a pidfd file handle are
+ * rejected.
+ */
+TEST_F(file_handle, open_by_handle_at_invalid_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ static const struct invalid_pidfs_file_handle_flags {
+ int oflag;
+ const char *oflag_name;
+ } invalid_pidfs_file_handle_flags[] = {
+ { FASYNC, "FASYNC" },
+ { O_CREAT, "O_CREAT" },
+ { O_NOCTTY, "O_NOCTTY" },
+ { O_CREAT, "O_CREAT" },
+ { O_TRUNC, "O_TRUNC" },
+ { O_APPEND, "O_APPEND" },
+ { O_SYNC, "O_SYNC" },
+ { O_DSYNC, "O_DSYNC" },
+ { O_DIRECT, "O_DIRECT" },
+ { O_DIRECTORY, "O_DIRECTORY" },
+ { O_NOFOLLOW, "O_NOFOLLOW" },
+ { O_NOATIME, "O_NOATIME" },
+ { O_PATH, "O_PATH" },
+ { O_TMPFILE, "O_TMPFILE" },
+ /*
+ * O_LARGEFILE is added implicitly by
+ * open_by_handle_at() so pidfs simply masks it off.
+ */
+ };
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ for (int i = 0; i < ARRAY_SIZE(invalid_pidfs_file_handle_flags); i++) {
+ pidfd = open_by_handle_at(self->pidfd, fh, invalid_pidfs_file_handle_flags[i].oflag);
+ ASSERT_LT(pidfd, 0) {
+ TH_LOG("open_by_handle_at() succeeded with invalid flags: %s", invalid_pidfs_file_handle_flags[i].oflag_name);
+ }
+ }
+}
+
+/* Test that lookup fails. */
+TEST_F(file_handle, lookup_must_fail)
+{
+ int mnt_id;
+ struct file_handle *fh;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, AT_EMPTY_PATH), 0);
+ ASSERT_EQ(errno, ENOTDIR);
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, 0), 0);
+ ASSERT_EQ(errno, ENOTDIR);
+}
+
+#ifndef AT_HANDLE_CONNECTABLE
+#define AT_HANDLE_CONNECTABLE 0x002
+#endif
+
+/*
+ * Test that AT_HANDLE_CONNECTABLE is rejected. Connectable file handles
+ * don't make sense for pidfs. Note that currently AT_HANDLE_CONNECTABLE
+ * is rejected because it is incompatible with AT_EMPTY_PATH which is
+ * required with pidfds as we don't support lookup.
+ */
+TEST_F(file_handle, invalid_name_to_handle_at_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_CONNECTABLE), 0);
+}
+
+#ifndef AT_HANDLE_FID
+#define AT_HANDLE_FID 0x200
+#endif
+
+/*
+ * Test that a request with AT_HANDLE_FID always leads to decodable file
+ * handle as pidfs always provides export operations.
+ */
+TEST_F(file_handle, valid_name_to_handle_at_flags)
+{
+ int mnt_id, pidfd;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_FID), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/pidfd_setns_test.c b/tools/testing/selftests/pidfd/pidfd_setns_test.c
index 7c2a4349170a..222f8131283b 100644
--- a/tools/testing/selftests/pidfd/pidfd_setns_test.c
+++ b/tools/testing/selftests/pidfd/pidfd_setns_test.c
@@ -19,7 +19,6 @@
#include <linux/ioctl.h>
#include "pidfd.h"
-#include "../clone3/clone3_selftests.h"
#include "../kselftest_harness.h"
#ifndef PIDFS_IOCTL_MAGIC
@@ -118,22 +117,6 @@ FIXTURE(current_nsset)
int child_pidfd_derived_nsfds2[PIDFD_NS_MAX];
};
-static int sys_waitid(int which, pid_t pid, int options)
-{
- return syscall(__NR_waitid, which, pid, NULL, options, NULL);
-}
-
-pid_t create_child(int *pidfd, unsigned flags)
-{
- struct __clone_args args = {
- .flags = CLONE_PIDFD | flags,
- .exit_signal = SIGCHLD,
- .pidfd = ptr_to_u64(pidfd),
- };
-
- return sys_clone3(&args, sizeof(struct clone_args));
-}
-
static bool switch_timens(void)
{
int fd, ret;
@@ -150,28 +133,6 @@ static bool switch_timens(void)
return ret == 0;
}
-static ssize_t read_nointr(int fd, void *buf, size_t count)
-{
- ssize_t ret;
-
- do {
- ret = read(fd, buf, count);
- } while (ret < 0 && errno == EINTR);
-
- return ret;
-}
-
-static ssize_t write_nointr(int fd, const void *buf, size_t count)
-{
- ssize_t ret;
-
- do {
- ret = write(fd, buf, count);
- } while (ret < 0 && errno == EINTR);
-
- return ret;
-}
-
FIXTURE_SETUP(current_nsset)
{
int i, proc_fd, ret;
@@ -229,7 +190,7 @@ FIXTURE_SETUP(current_nsset)
_exit(EXIT_SUCCESS);
}
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED | WNOWAIT), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED | WNOWAIT), 0);
self->pidfd = sys_pidfd_open(self->pid, 0);
EXPECT_GE(self->pidfd, 0) {
@@ -432,9 +393,9 @@ FIXTURE_TEARDOWN(current_nsset)
EXPECT_EQ(0, close(self->child_pidfd1));
if (self->child_pidfd2 >= 0)
EXPECT_EQ(0, close(self->child_pidfd2));
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED), 0);
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, WEXITED), 0);
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0);
}
static int preserve_ns(const int pid, const char *ns)
diff --git a/tools/testing/selftests/pidfd/pidfd_wait.c b/tools/testing/selftests/pidfd/pidfd_wait.c
index 0dcb8365ddc3..1e2d49751cde 100644
--- a/tools/testing/selftests/pidfd/pidfd_wait.c
+++ b/tools/testing/selftests/pidfd/pidfd_wait.c
@@ -26,22 +26,11 @@
#define SKIP(s, ...) XFAIL(s, ##__VA_ARGS__)
#endif
-static pid_t sys_clone3(struct clone_args *args)
-{
- return syscall(__NR_clone3, args, sizeof(struct clone_args));
-}
-
-static int sys_waitid(int which, pid_t pid, siginfo_t *info, int options,
- struct rusage *ru)
-{
- return syscall(__NR_waitid, which, pid, info, options, ru);
-}
-
TEST(wait_simple)
{
int pidfd = -1;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.pidfd = ptr_to_u64(&pidfd),
.flags = CLONE_PIDFD | CLONE_PARENT_SETTID,
@@ -55,7 +44,7 @@ TEST(wait_simple)
pidfd = open("/proc/self", O_DIRECTORY | O_RDONLY | O_CLOEXEC);
ASSERT_GE(pidfd, 0);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_NE(pid, 0);
EXPECT_EQ(close(pidfd), 0);
pidfd = -1;
@@ -63,18 +52,18 @@ TEST(wait_simple)
pidfd = open("/dev/null", O_RDONLY | O_CLOEXEC);
ASSERT_GE(pidfd, 0);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_NE(pid, 0);
EXPECT_EQ(close(pidfd), 0);
pidfd = -1;
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0)
exit(EXIT_SUCCESS);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_GE(pid, 0);
ASSERT_EQ(WIFEXITED(info.si_status), true);
ASSERT_EQ(WEXITSTATUS(info.si_status), 0);
@@ -89,7 +78,7 @@ TEST(wait_states)
{
int pidfd = -1;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.pidfd = ptr_to_u64(&pidfd),
.flags = CLONE_PIDFD | CLONE_PARENT_SETTID,
@@ -102,7 +91,7 @@ TEST(wait_states)
};
ASSERT_EQ(pipe(pfd), 0);
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0) {
@@ -117,28 +106,28 @@ TEST(wait_states)
}
close(pfd[0]);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED), 0);
ASSERT_EQ(write(pfd[1], "C", 1), 1);
close(pfd[1]);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_CONTINUED);
ASSERT_EQ(info.si_pid, parent_tid);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGKILL, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_KILLED);
ASSERT_EQ(info.si_pid, parent_tid);
@@ -151,7 +140,7 @@ TEST(wait_nonblock)
int pidfd;
unsigned int flags = 0;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.flags = CLONE_PARENT_SETTID,
.exit_signal = SIGCHLD,
@@ -173,12 +162,12 @@ TEST(wait_nonblock)
SKIP(return, "Skipping PIDFD_NONBLOCK test");
}
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_LT(ret, 0);
ASSERT_EQ(errno, ECHILD);
EXPECT_EQ(close(pidfd), 0);
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0) {
@@ -201,7 +190,7 @@ TEST(wait_nonblock)
* Callers need to see EAGAIN/EWOULDBLOCK with non-blocking pidfd when
* child processes exist but none have exited.
*/
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_LT(ret, 0);
ASSERT_EQ(errno, EAGAIN);
@@ -210,19 +199,19 @@ TEST(wait_nonblock)
* WNOHANG raised explicitly when child processes exist but none have
* exited.
*/
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG);
ASSERT_EQ(ret, 0);
ASSERT_EQ(fcntl(pidfd, F_SETFL, (flags & ~O_NONBLOCK)), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_EXITED);
ASSERT_EQ(info.si_pid, parent_tid);
diff --git a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
index 580fcac0a09f..b71ef8a493ed 100644
--- a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
+++ b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
@@ -20,7 +20,7 @@ static int test_gettimeofday(void)
gettimeofday(&tv_end, NULL);
}
- timersub(&tv_start, &tv_end, &tv_diff);
+ timersub(&tv_end, &tv_start, &tv_diff);
printf("time = %.6f\n", tv_diff.tv_sec + (tv_diff.tv_usec) * 1e-6);
diff --git a/tools/testing/selftests/powerpc/include/pkeys.h b/tools/testing/selftests/powerpc/include/pkeys.h
index 51729d9a7111..3a0129467de6 100644
--- a/tools/testing/selftests/powerpc/include/pkeys.h
+++ b/tools/testing/selftests/powerpc/include/pkeys.h
@@ -35,10 +35,18 @@
#define __NR_pkey_alloc 384
#define __NR_pkey_free 385
+#ifndef NT_PPC_PKEY
+#define NT_PPC_PKEY 0x110
+#endif
+
#define PKEY_BITS_PER_PKEY 2
#define NR_PKEYS 32
#define PKEY_BITS_MASK ((1UL << PKEY_BITS_PER_PKEY) - 1)
+#define AMR_BITS_PER_PKEY 2
+#define PKEY_REG_BITS (sizeof(u64) * 8)
+#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+
inline unsigned long pkeyreg_get(void)
{
return mfspr(SPRN_AMR);
diff --git a/tools/testing/selftests/powerpc/ptrace/core-pkey.c b/tools/testing/selftests/powerpc/ptrace/core-pkey.c
index f6da4cb30cd6..f061434af452 100644
--- a/tools/testing/selftests/powerpc/ptrace/core-pkey.c
+++ b/tools/testing/selftests/powerpc/ptrace/core-pkey.c
@@ -16,26 +16,7 @@
#include <unistd.h>
#include "ptrace.h"
#include "child.h"
-
-#ifndef __NR_pkey_alloc
-#define __NR_pkey_alloc 384
-#endif
-
-#ifndef __NR_pkey_free
-#define __NR_pkey_free 385
-#endif
-
-#ifndef NT_PPC_PKEY
-#define NT_PPC_PKEY 0x110
-#endif
-
-#ifndef PKEY_DISABLE_EXECUTE
-#define PKEY_DISABLE_EXECUTE 0x4
-#endif
-
-#define AMR_BITS_PER_PKEY 2
-#define PKEY_REG_BITS (sizeof(u64) * 8)
-#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+#include "pkeys.h"
#define CORE_FILE_LIMIT (5 * 1024 * 1024) /* 5 MB should be enough */
@@ -61,16 +42,6 @@ struct shared_info {
time_t core_time;
};
-static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights)
-{
- return syscall(__NR_pkey_alloc, flags, init_access_rights);
-}
-
-static int sys_pkey_free(int pkey)
-{
- return syscall(__NR_pkey_free, pkey);
-}
-
static int increase_core_file_limit(void)
{
struct rlimit rlim;
diff --git a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
index d89474377f11..fc633014424f 100644
--- a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
+++ b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
@@ -7,26 +7,7 @@
*/
#include "ptrace.h"
#include "child.h"
-
-#ifndef __NR_pkey_alloc
-#define __NR_pkey_alloc 384
-#endif
-
-#ifndef __NR_pkey_free
-#define __NR_pkey_free 385
-#endif
-
-#ifndef NT_PPC_PKEY
-#define NT_PPC_PKEY 0x110
-#endif
-
-#ifndef PKEY_DISABLE_EXECUTE
-#define PKEY_DISABLE_EXECUTE 0x4
-#endif
-
-#define AMR_BITS_PER_PKEY 2
-#define PKEY_REG_BITS (sizeof(u64) * 8)
-#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+#include "pkeys.h"
static const char user_read[] = "[User Read (Running)]";
static const char user_write[] = "[User Write (Running)]";
@@ -61,11 +42,6 @@ struct shared_info {
unsigned long invalid_uamor;
};
-static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights)
-{
- return syscall(__NR_pkey_alloc, flags, init_access_rights);
-}
-
static int child(struct shared_info *info)
{
unsigned long reg;
diff --git a/tools/testing/selftests/powerpc/vphn/test-vphn.c b/tools/testing/selftests/powerpc/vphn/test-vphn.c
index 81d3069ffb84..f348f54914a9 100644
--- a/tools/testing/selftests/powerpc/vphn/test-vphn.c
+++ b/tools/testing/selftests/powerpc/vphn/test-vphn.c
@@ -275,7 +275,7 @@ static struct test {
}
},
{
- /* Parse a 32-bit value split accross two consecutives 64-bit
+ /* Parse a 32-bit value split across two consecutives 64-bit
* input values.
*/
"vphn: 16-bit value followed by 2 x 32-bit values",
diff --git a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
index 134cdef5a6e0..48a8052d5dae 100755
--- a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
+++ b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
@@ -181,10 +181,11 @@ done
# Function to check for presence of a file on the specified system.
# Complain if the system cannot be reached, and retry after a wait.
-# Currently just waits forever if a machine disappears.
+# Currently just waits 15 minutes if a machine disappears.
#
# Usage: checkremotefile system pathname
checkremotefile () {
+ local nsshfails=0
local ret
local sleeptime=60
@@ -195,6 +196,11 @@ checkremotefile () {
if test "$ret" -eq 255
then
echo " ---" ssh failure to $1 checking for file $2, retry after $sleeptime seconds. `date` | tee -a "$oldrun/remote-log"
+ nsshfails=$((nsshfails+1))
+ if ((nsshfails > 15))
+ then
+ return 255
+ fi
elif test "$ret" -eq 0
then
return 0
@@ -268,12 +274,23 @@ echo All batches started. `date` | tee -a "$oldrun/remote-log"
for i in $systems
do
echo " ---" Waiting for $i `date` | tee -a "$oldrun/remote-log"
- while checkremotefile "$i" "$resdir/$ds/remote.run"
+ while :
do
+ checkremotefile "$i" "$resdir/$ds/remote.run"
+ ret=$?
+ if test "$ret" -eq 1
+ then
+ echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log"
+ ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - )
+ break;
+ fi
+ if test "$ret" -eq 255
+ then
+ echo System $i persistent ssh failure, lost results `date` | tee -a "$oldrun/remote-log"
+ break;
+ fi
sleep 30
done
- echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log"
- ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - )
done
( kvm-end-run-stats.sh "$oldrun" "$starttime"; echo $? > $T/exitcode ) | tee -a "$oldrun/remote-log"
diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
index 8e50bfd4b710..90318591dae2 100644
--- a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
+++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
@@ -5,3 +5,4 @@ rcutree.gp_cleanup_delay=3
rcutree.kthread_prio=2
threadirqs
rcutree.use_softirq=0
+rcutorture.preempt_duration=10
diff --git a/tools/testing/selftests/resctrl/Makefile b/tools/testing/selftests/resctrl/Makefile
index f408bd6bfc3d..984534cfbf1b 100644
--- a/tools/testing/selftests/resctrl/Makefile
+++ b/tools/testing/selftests/resctrl/Makefile
@@ -8,5 +8,6 @@ TEST_GEN_PROGS := resctrl_tests
LOCAL_HDRS += $(wildcard *.h)
include ../lib.mk
+CFLAGS += -I$(top_srcdir)/tools/include
$(OUTPUT)/resctrl_tests: $(wildcard *.c)
diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c
index 3bbf3042fb06..d09e693dc739 100644
--- a/tools/testing/selftests/resctrl/cmt_test.c
+++ b/tools/testing/selftests/resctrl/cmt_test.c
@@ -169,8 +169,8 @@ static int cmt_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results(&param, span, n);
- if (ret && (get_vendor() == ARCH_INTEL))
- ksft_print_msg("Intel CMT may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n");
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c
index 536d9089d2f6..c7e9adc0368f 100644
--- a/tools/testing/selftests/resctrl/mba_test.c
+++ b/tools/testing/selftests/resctrl/mba_test.c
@@ -201,6 +201,8 @@ static int mba_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results();
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c
index 315b2ef3b3bc..84d8bc250539 100644
--- a/tools/testing/selftests/resctrl/mbm_test.c
+++ b/tools/testing/selftests/resctrl/mbm_test.c
@@ -160,8 +160,8 @@ static int mbm_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results(param.fill_buf ? param.fill_buf->buf_size : 0);
- if (ret && (get_vendor() == ARCH_INTEL))
- ksft_print_msg("Intel MBM may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n");
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h
index dab1953fc7a0..cd3adfc14969 100644
--- a/tools/testing/selftests/resctrl/resctrl.h
+++ b/tools/testing/selftests/resctrl/resctrl.h
@@ -11,6 +11,7 @@
#include <signal.h>
#include <dirent.h>
#include <stdbool.h>
+#include <ctype.h>
#include <sys/stat.h>
#include <sys/ioctl.h>
#include <sys/mount.h>
@@ -21,6 +22,7 @@
#include <sys/eventfd.h>
#include <asm/unistd.h>
#include <linux/perf_event.h>
+#include <linux/compiler.h>
#include "../kselftest.h"
#define MB (1024 * 1024)
@@ -156,8 +158,11 @@ struct perf_event_read {
*/
extern volatile int *value_sink;
+extern int snc_unreliable;
+
extern char llc_occup_path[1024];
+int snc_nodes_per_l3_cache(void);
int get_vendor(void);
bool check_resctrlfs_support(void);
int filter_dmesg(void);
@@ -198,6 +203,7 @@ void ctrlc_handler(int signum, siginfo_t *info, void *ptr);
int signal_handler_register(const struct resctrl_test *test);
void signal_handler_unregister(void);
unsigned int count_bits(unsigned long n);
+int snc_kernel_support(void);
void perf_event_attr_initialize(struct perf_event_attr *pea, __u64 config);
void perf_event_initialize_read_format(struct perf_event_read *pe_read);
diff --git a/tools/testing/selftests/resctrl/resctrl_tests.c b/tools/testing/selftests/resctrl/resctrl_tests.c
index 3335af815b21..5154ffd821c4 100644
--- a/tools/testing/selftests/resctrl/resctrl_tests.c
+++ b/tools/testing/selftests/resctrl/resctrl_tests.c
@@ -118,7 +118,7 @@ static bool test_vendor_specific_check(const struct resctrl_test *test)
static void run_single_test(const struct resctrl_test *test, const struct user_params *uparams)
{
- int ret;
+ int ret, snc_mode;
if (test->disabled)
return;
@@ -128,8 +128,15 @@ static void run_single_test(const struct resctrl_test *test, const struct user_p
return;
}
+ snc_mode = snc_nodes_per_l3_cache();
+
ksft_print_msg("Starting %s test ...\n", test->name);
+ if (snc_mode == 1 && snc_unreliable && get_vendor() == ARCH_INTEL) {
+ ksft_test_result_skip("SNC detection unreliable due to offline CPUs. Test results may not be accurate if SNC enabled.\n");
+ return;
+ }
+
if (test_prepare(test)) {
ksft_exit_fail_msg("Abnormal failure when preparing for the test\n");
return;
diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c
index d38d6dd90be4..195f04c4d158 100644
--- a/tools/testing/selftests/resctrl/resctrlfs.c
+++ b/tools/testing/selftests/resctrl/resctrlfs.c
@@ -13,6 +13,8 @@
#include "resctrl.h"
+int snc_unreliable;
+
static int find_resctrl_mount(char *buffer)
{
FILE *mounts;
@@ -157,6 +159,98 @@ int get_domain_id(const char *resource, int cpu_no, int *domain_id)
}
/*
+ * Count number of CPUs in a /sys bitmap
+ */
+static unsigned int count_sys_bitmap_bits(char *name)
+{
+ FILE *fp = fopen(name, "r");
+ int count = 0, c;
+
+ if (!fp)
+ return 0;
+
+ while ((c = fgetc(fp)) != EOF) {
+ if (!isxdigit(c))
+ continue;
+ switch (c) {
+ case 'f':
+ count++;
+ fallthrough;
+ case '7': case 'b': case 'd': case 'e':
+ count++;
+ fallthrough;
+ case '3': case '5': case '6': case '9': case 'a': case 'c':
+ count++;
+ fallthrough;
+ case '1': case '2': case '4': case '8':
+ count++;
+ break;
+ }
+ }
+ fclose(fp);
+
+ return count;
+}
+
+static bool cpus_offline_empty(void)
+{
+ char offline_cpus_str[64];
+ FILE *fp;
+
+ fp = fopen("/sys/devices/system/cpu/offline", "r");
+ if (!fp) {
+ ksft_perror("Could not open /sys/devices/system/cpu/offline");
+ return 0;
+ }
+
+ if (fscanf(fp, "%63s", offline_cpus_str) < 0) {
+ if (!errno) {
+ fclose(fp);
+ return 1;
+ }
+ ksft_perror("Could not read /sys/devices/system/cpu/offline");
+ }
+
+ fclose(fp);
+
+ return 0;
+}
+
+/*
+ * Detect SNC by comparing #CPUs in node0 with #CPUs sharing LLC with CPU0.
+ * If any CPUs are offline declare the detection as unreliable.
+ */
+int snc_nodes_per_l3_cache(void)
+{
+ int node_cpus, cache_cpus;
+ static int snc_mode;
+
+ if (!snc_mode) {
+ snc_mode = 1;
+ if (!cpus_offline_empty()) {
+ ksft_print_msg("Runtime SNC detection unreliable due to offline CPUs.\n");
+ ksft_print_msg("Setting SNC mode to disabled.\n");
+ snc_unreliable = 1;
+ return snc_mode;
+ }
+ node_cpus = count_sys_bitmap_bits("/sys/devices/system/node/node0/cpumap");
+ cache_cpus = count_sys_bitmap_bits("/sys/devices/system/cpu/cpu0/cache/index3/shared_cpu_map");
+
+ if (!node_cpus || !cache_cpus) {
+ ksft_print_msg("Could not determine Sub-NUMA Cluster mode.\n");
+ snc_unreliable = 1;
+ return snc_mode;
+ }
+ snc_mode = cache_cpus / node_cpus;
+
+ if (snc_mode > 1)
+ ksft_print_msg("SNC-%d mode discovered.\n", snc_mode);
+ }
+
+ return snc_mode;
+}
+
+/*
* get_cache_size - Get cache size for a specified CPU
* @cpu_no: CPU number
* @cache_type: Cache level L2/L3
@@ -211,6 +305,17 @@ int get_cache_size(int cpu_no, const char *cache_type, unsigned long *cache_size
break;
}
+ /*
+ * The amount of cache represented by each bit in the masks
+ * in the schemata file is reduced by a factor equal to SNC
+ * nodes per L3 cache.
+ * E.g. on a SNC-2 system with a 100MB L3 cache a test that
+ * allocates memory from its local SNC node (default behavior
+ * without using libnuma) will only see 50 MB llc_occupancy
+ * with a fully populated L3 mask in the schemata file.
+ */
+ if (cache_num == 3)
+ *cache_size /= snc_nodes_per_l3_cache();
return 0;
}
@@ -852,3 +957,35 @@ unsigned int count_bits(unsigned long n)
return count;
}
+
+/**
+ * snc_kernel_support - Check for existence of mon_sub_L3_00 file that indicates
+ * SNC resctrl support on the kernel side.
+ *
+ * Return: 0 if not supported, 1 if SNC is disabled or SNC discovery is
+ * unreliable or SNC is both enabled and supported.
+ */
+int snc_kernel_support(void)
+{
+ char node_path[PATH_MAX];
+ struct stat statbuf;
+ int ret;
+
+ ret = snc_nodes_per_l3_cache();
+ /*
+ * If SNC is disabled then its kernel support isn't important. If SNC
+ * got disabled because the discovery process was unreliable the
+ * snc_unreliable variable was set. It can be used to verify the SNC
+ * discovery reliability elsewhere in the selftest.
+ */
+ if (ret == 1)
+ return ret;
+
+ snprintf(node_path, sizeof(node_path), "%s/%s", RESCTRL_PATH,
+ "mon_data/mon_L3_00/mon_sub_L3_00");
+
+ if (!stat(node_path, &statbuf))
+ return 1;
+
+ return 0;
+}
diff --git a/tools/testing/selftests/ring-buffer/map_test.c b/tools/testing/selftests/ring-buffer/map_test.c
index d10a847130fb..a58f520f2f41 100644
--- a/tools/testing/selftests/ring-buffer/map_test.c
+++ b/tools/testing/selftests/ring-buffer/map_test.c
@@ -233,12 +233,18 @@ TEST_F(map, data_mmap)
ASSERT_NE(data, MAP_FAILED);
munmap(data, data_len);
- /* Overflow the available subbufs by 1 */
+ /* Offset within ring-buffer bounds, mapping size overflow */
meta_len += desc->meta->subbuf_size * 2;
data = mmap(NULL, data_len, PROT_READ, MAP_SHARED,
desc->cpu_fd, meta_len);
ASSERT_EQ(data, MAP_FAILED);
+ /* Offset outside ring-buffer bounds */
+ data_len = desc->meta->subbuf_size * desc->meta->nr_subbufs;
+ data = mmap(NULL, data_len, PROT_READ, MAP_SHARED,
+ desc->cpu_fd, data_len + (desc->meta->subbuf_size * 2));
+ ASSERT_EQ(data, MAP_FAILED);
+
/* Verify meta-page padding */
if (desc->meta->meta_page_size > getpagesize()) {
data_len = desc->meta->meta_page_size;
diff --git a/tools/testing/selftests/riscv/abi/pointer_masking.c b/tools/testing/selftests/riscv/abi/pointer_masking.c
index dee41b7ee3e3..059d2e87eb1f 100644
--- a/tools/testing/selftests/riscv/abi/pointer_masking.c
+++ b/tools/testing/selftests/riscv/abi/pointer_masking.c
@@ -185,8 +185,20 @@ static void test_fork_exec(void)
}
}
+static bool pwrite_wrapper(int fd, void *buf, size_t count, const char *msg)
+{
+ int ret = pwrite(fd, buf, count, 0);
+
+ if (ret != count) {
+ ksft_perror(msg);
+ return false;
+ }
+ return true;
+}
+
static void test_tagged_addr_abi_sysctl(void)
{
+ char *err_pwrite_msg = "failed to write to /proc/sys/abi/tagged_addr_disabled\n";
char value;
int fd;
@@ -200,14 +212,18 @@ static void test_tagged_addr_abi_sysctl(void)
}
value = '1';
- pwrite(fd, &value, 1, 0);
- ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL,
- "sysctl disabled\n");
+ if (!pwrite_wrapper(fd, &value, 1, "write '1'"))
+ ksft_test_result_fail(err_pwrite_msg);
+ else
+ ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL,
+ "sysctl disabled\n");
value = '0';
- pwrite(fd, &value, 1, 0);
- ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0,
- "sysctl enabled\n");
+ if (!pwrite_wrapper(fd, &value, 1, "write '0'"))
+ ksft_test_result_fail(err_pwrite_msg);
+ else
+ ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0,
+ "sysctl enabled\n");
set_tagged_addr_ctrl(0, false);
diff --git a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c b/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
index 1dd94197da30..6174ffe016dc 100644
--- a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
+++ b/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
@@ -25,6 +25,8 @@ int main(void)
unsigned long vl;
char *datap, *tmp;
+ ksft_set_plan(1);
+
datap = malloc(MAX_VSIZE);
if (!datap) {
ksft_test_result_fail("fail to allocate memory for size = %d\n", MAX_VSIZE);
@@ -63,6 +65,8 @@ int main(void)
}
free(datap);
+
+ ksft_test_result_pass("tests for v_initval_nolibc pass\n");
ksft_exit_pass();
return 0;
}
diff --git a/tools/testing/selftests/riscv/vector/vstate_prctl.c b/tools/testing/selftests/riscv/vector/vstate_prctl.c
index 895177f6bf4c..40b3bffcbb40 100644
--- a/tools/testing/selftests/riscv/vector/vstate_prctl.c
+++ b/tools/testing/selftests/riscv/vector/vstate_prctl.c
@@ -76,6 +76,8 @@ int main(void)
long flag, expected;
long rc;
+ ksft_set_plan(1);
+
pair.key = RISCV_HWPROBE_KEY_IMA_EXT_0;
rc = riscv_hwprobe(&pair, 1, 0, NULL, 0);
if (rc < 0) {
diff --git a/tools/testing/selftests/rseq/rseq.c b/tools/testing/selftests/rseq/rseq.c
index 5b9772cdf265..f6156790c3b4 100644
--- a/tools/testing/selftests/rseq/rseq.c
+++ b/tools/testing/selftests/rseq/rseq.c
@@ -61,7 +61,6 @@ unsigned int rseq_size = -1U;
unsigned int rseq_flags;
static int rseq_ownership;
-static int rseq_reg_success; /* At least one rseq registration has succeded. */
/* Allocate a large area for the TLS. */
#define RSEQ_THREAD_AREA_ALLOC_SIZE 1024
@@ -152,14 +151,27 @@ int rseq_register_current_thread(void)
}
rc = sys_rseq(&__rseq_abi, get_rseq_min_alloc_size(), 0, RSEQ_SIG);
if (rc) {
- if (RSEQ_READ_ONCE(rseq_reg_success)) {
+ /*
+ * After at least one thread has registered successfully
+ * (rseq_size > 0), the registration of other threads should
+ * never fail.
+ */
+ if (RSEQ_READ_ONCE(rseq_size) > 0) {
/* Incoherent success/failure within process. */
abort();
}
return -1;
}
assert(rseq_current_cpu_raw() >= 0);
- RSEQ_WRITE_ONCE(rseq_reg_success, 1);
+
+ /*
+ * The first thread to register sets the rseq_size to mimic the libc
+ * behavior.
+ */
+ if (RSEQ_READ_ONCE(rseq_size) == 0) {
+ RSEQ_WRITE_ONCE(rseq_size, get_rseq_kernel_feature_size());
+ }
+
return 0;
}
@@ -235,12 +247,18 @@ void rseq_init(void)
return;
}
rseq_ownership = 1;
- if (!rseq_available()) {
- rseq_size = 0;
- return;
- }
+
+ /* Calculate the offset of the rseq area from the thread pointer. */
rseq_offset = (void *)&__rseq_abi - rseq_thread_pointer();
+
+ /* rseq flags are deprecated, always set to 0. */
rseq_flags = 0;
+
+ /*
+ * Set the size to 0 until at least one thread registers to mimic the
+ * libc behavior.
+ */
+ rseq_size = 0;
}
static __attribute__((destructor))
diff --git a/tools/testing/selftests/rseq/rseq.h b/tools/testing/selftests/rseq/rseq.h
index 4e217b620e0c..062d10925a10 100644
--- a/tools/testing/selftests/rseq/rseq.h
+++ b/tools/testing/selftests/rseq/rseq.h
@@ -60,7 +60,14 @@
extern ptrdiff_t rseq_offset;
/*
- * Size of the registered rseq area. 0 if the registration was
+ * The rseq ABI is composed of extensible feature fields. The extensions
+ * are done by appending additional fields at the end of the structure.
+ * The rseq_size defines the size of the active feature set which can be
+ * used by the application for the current rseq registration. Features
+ * starting at offset >= rseq_size are inactive and should not be used.
+ *
+ * The rseq_size is the intersection between the available allocation
+ * size for the rseq area and the feature size supported by the kernel.
* unsuccessful.
*/
extern unsigned int rseq_size;
diff --git a/tools/testing/selftests/run_kselftest.sh b/tools/testing/selftests/run_kselftest.sh
index a28c1416cb89..50e03eefe7ac 100755
--- a/tools/testing/selftests/run_kselftest.sh
+++ b/tools/testing/selftests/run_kselftest.sh
@@ -21,7 +21,7 @@ usage()
cat <<EOF
Usage: $0 [OPTIONS]
-s | --summary Print summary with detailed log in output.log (conflict with -p)
- -p | --per_test_log Print test log in /tmp with each test name (conflict with -s)
+ -p | --per-test-log Print test log in /tmp with each test name (conflict with -s)
-t | --test COLLECTION:TEST Run TEST from COLLECTION
-c | --collection COLLECTION Run all tests from COLLECTION
-l | --list List the available collection:test entries
diff --git a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
index 37d9bf6fb745..6f4c3f5a1c5d 100644
--- a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
+++ b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
@@ -20,7 +20,7 @@ s32 BPF_STRUCT_OPS(ddsp_bogus_dsq_fail_select_cpu, struct task_struct *p,
* If we dispatch to a bogus DSQ that will fall back to the
* builtin global DSQ, we fail gracefully.
*/
- scx_bpf_dispatch_vtime(p, 0xcafef00d, SCX_SLICE_DFL,
+ scx_bpf_dsq_insert_vtime(p, 0xcafef00d, SCX_SLICE_DFL,
p->scx.dsq_vtime, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
index dffc97d9cdf1..e4a55027778f 100644
--- a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
+++ b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
@@ -17,8 +17,8 @@ s32 BPF_STRUCT_OPS(ddsp_vtimelocal_fail_select_cpu, struct task_struct *p,
if (cpu >= 0) {
/* Shouldn't be allowed to vtime dispatch to a builtin DSQ. */
- scx_bpf_dispatch_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL,
- p->scx.dsq_vtime, 0);
+ scx_bpf_dsq_insert_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL,
+ p->scx.dsq_vtime, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
index 6a7db1502c29..fbda6bf54671 100644
--- a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
+++ b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
@@ -43,9 +43,12 @@ void BPF_STRUCT_OPS(dsp_local_on_dispatch, s32 cpu, struct task_struct *prev)
if (!p)
return;
- target = bpf_get_prandom_u32() % nr_cpus;
+ if (p->nr_cpus_allowed == nr_cpus)
+ target = bpf_get_prandom_u32() % nr_cpus;
+ else
+ target = scx_bpf_task_cpu(p);
- scx_bpf_dispatch(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0);
bpf_task_release(p);
}
diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.c b/tools/testing/selftests/sched_ext/dsp_local_on.c
index 472851b56854..0ff27e57fe43 100644
--- a/tools/testing/selftests/sched_ext/dsp_local_on.c
+++ b/tools/testing/selftests/sched_ext/dsp_local_on.c
@@ -34,9 +34,10 @@ static enum scx_test_status run(void *ctx)
/* Just sleeping is fine, plenty of scheduling events happening */
sleep(1);
- SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_ERROR));
bpf_link__destroy(link);
+ SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_UNREG));
+
return SCX_TEST_PASS;
}
@@ -50,7 +51,7 @@ static void cleanup(void *ctx)
struct scx_test dsp_local_on = {
.name = "dsp_local_on",
.description = "Verify we can directly dispatch tasks to a local DSQs "
- "from osp.dispatch()",
+ "from ops.dispatch()",
.setup = setup,
.run = run,
.cleanup = cleanup,
diff --git a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
index 1efb50d61040..a7cf868d5e31 100644
--- a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
+++ b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
@@ -31,7 +31,7 @@ void BPF_STRUCT_OPS(enq_select_cpu_fails_enqueue, struct task_struct *p,
/* Can only call from ops.select_cpu() */
scx_bpf_select_cpu_dfl(p, 0, 0, &found);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
}
SEC(".struct_ops.link")
diff --git a/tools/testing/selftests/sched_ext/exit.bpf.c b/tools/testing/selftests/sched_ext/exit.bpf.c
index d75d4faf07f6..4bc36182d3ff 100644
--- a/tools/testing/selftests/sched_ext/exit.bpf.c
+++ b/tools/testing/selftests/sched_ext/exit.bpf.c
@@ -33,7 +33,7 @@ void BPF_STRUCT_OPS(exit_enqueue, struct task_struct *p, u64 enq_flags)
if (exit_point == EXIT_ENQUEUE)
EXIT_CLEANLY();
- scx_bpf_dispatch(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
}
void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p)
@@ -41,7 +41,7 @@ void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p)
if (exit_point == EXIT_DISPATCH)
EXIT_CLEANLY();
- scx_bpf_consume(DSQ_ID);
+ scx_bpf_dsq_move_to_local(DSQ_ID);
}
void BPF_STRUCT_OPS(exit_enable, struct task_struct *p)
diff --git a/tools/testing/selftests/sched_ext/maximal.bpf.c b/tools/testing/selftests/sched_ext/maximal.bpf.c
index 4d4cd8d966db..430f5e13bf55 100644
--- a/tools/testing/selftests/sched_ext/maximal.bpf.c
+++ b/tools/testing/selftests/sched_ext/maximal.bpf.c
@@ -12,6 +12,8 @@
char _license[] SEC("license") = "GPL";
+#define DSQ_ID 0
+
s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu,
u64 wake_flags)
{
@@ -20,7 +22,7 @@ s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu,
void BPF_STRUCT_OPS(maximal_enqueue, struct task_struct *p, u64 enq_flags)
{
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
}
void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags)
@@ -28,7 +30,7 @@ void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags)
void BPF_STRUCT_OPS(maximal_dispatch, s32 cpu, struct task_struct *prev)
{
- scx_bpf_consume(SCX_DSQ_GLOBAL);
+ scx_bpf_dsq_move_to_local(DSQ_ID);
}
void BPF_STRUCT_OPS(maximal_runnable, struct task_struct *p, u64 enq_flags)
@@ -123,7 +125,7 @@ void BPF_STRUCT_OPS(maximal_cgroup_set_weight, struct cgroup *cgrp, u32 weight)
s32 BPF_STRUCT_OPS_SLEEPABLE(maximal_init)
{
- return 0;
+ return scx_bpf_create_dsq(DSQ_ID, -1);
}
void BPF_STRUCT_OPS(maximal_exit, struct scx_exit_info *info)
diff --git a/tools/testing/selftests/sched_ext/runner.c b/tools/testing/selftests/sched_ext/runner.c
index eab48c7ff309..aa2d7d32dda9 100644
--- a/tools/testing/selftests/sched_ext/runner.c
+++ b/tools/testing/selftests/sched_ext/runner.c
@@ -22,11 +22,12 @@ const char help_fmt[] =
"\n"
" -t TEST Only run tests whose name includes this string\n"
" -s Include print output for skipped tests\n"
+" -l List all available tests\n"
" -q Don't print the test descriptions during run\n"
" -h Display this help and exit\n";
static volatile int exit_req;
-static bool quiet, print_skipped;
+static bool quiet, print_skipped, list;
#define MAX_SCX_TESTS 2048
@@ -133,7 +134,7 @@ int main(int argc, char **argv)
libbpf_set_strict_mode(LIBBPF_STRICT_ALL);
- while ((opt = getopt(argc, argv, "qst:h")) != -1) {
+ while ((opt = getopt(argc, argv, "qslt:h")) != -1) {
switch (opt) {
case 'q':
quiet = true;
@@ -141,6 +142,9 @@ int main(int argc, char **argv)
case 's':
print_skipped = true;
break;
+ case 'l':
+ list = true;
+ break;
case 't':
filter = optarg;
break;
@@ -154,6 +158,13 @@ int main(int argc, char **argv)
enum scx_test_status status;
struct scx_test *test = &__scx_tests[i];
+ if (list) {
+ printf("%s\n", test->name);
+ if (i == (__scx_num_tests - 1))
+ return 0;
+ continue;
+ }
+
if (filter && should_skip_test(test, filter)) {
/*
* Printing the skipped tests and their preambles can
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
index f171ac470970..13d0f5be788d 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
@@ -30,7 +30,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_enqueue, struct task_struct *p,
}
scx_bpf_put_idle_cpumask(idle_mask);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
}
SEC(".struct_ops.link")
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
index 9efdbb7da928..815f1d5d61ac 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
@@ -67,7 +67,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_enqueue, struct task_struct *p,
saw_local = true;
}
- scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, enq_flags);
}
s32 BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_init_task,
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
index 59bfc4f36167..4bb99699e920 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
@@ -29,7 +29,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_select_cpu, struct task_struct *p,
cpu = prev_cpu;
dispatch:
- scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
index 3bbd5fcdfb18..2a75de11b2cf 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
@@ -18,7 +18,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_bad_dsq_select_cpu, struct task_struct *p
s32 prev_cpu, u64 wake_flags)
{
/* Dispatching to a random DSQ should fail. */
- scx_bpf_dispatch(p, 0xcafef00d, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, 0xcafef00d, SCX_SLICE_DFL, 0);
return prev_cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
index 0fda57fe0ecf..99d075695c97 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
@@ -18,8 +18,8 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_dbl_dsp_select_cpu, struct task_struct *p
s32 prev_cpu, u64 wake_flags)
{
/* Dispatching twice in a row is disallowed. */
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
return prev_cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
index e6c67bcf5e6e..bfcb96cd4954 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
@@ -2,8 +2,8 @@
/*
* A scheduler that validates that enqueue flags are properly stored and
* applied at dispatch time when a task is directly dispatched from
- * ops.select_cpu(). We validate this by using scx_bpf_dispatch_vtime(), and
- * making the test a very basic vtime scheduler.
+ * ops.select_cpu(). We validate this by using scx_bpf_dsq_insert_vtime(),
+ * and making the test a very basic vtime scheduler.
*
* Copyright (c) 2024 Meta Platforms, Inc. and affiliates.
* Copyright (c) 2024 David Vernet <dvernet@meta.com>
@@ -47,13 +47,13 @@ s32 BPF_STRUCT_OPS(select_cpu_vtime_select_cpu, struct task_struct *p,
cpu = prev_cpu;
scx_bpf_test_and_clear_cpu_idle(cpu);
ddsp:
- scx_bpf_dispatch_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0);
+ scx_bpf_dsq_insert_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0);
return cpu;
}
void BPF_STRUCT_OPS(select_cpu_vtime_dispatch, s32 cpu, struct task_struct *p)
{
- if (scx_bpf_consume(VTIME_DSQ))
+ if (scx_bpf_dsq_move_to_local(VTIME_DSQ))
consumed = true;
}
diff --git a/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py
new file mode 100755
index 000000000000..0f44a6199495
--- /dev/null
+++ b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py
@@ -0,0 +1,21 @@
+#!/usr/bin/env python3
+# SPDX-License-Identifier: GPL-2.0
+#
+# Script that checks that SFQ rejects a limit of 1 at the kernel
+# level. We can't use iproute2's tc because it does not accept a limit
+# of 1.
+
+import sys
+import os
+
+from pyroute2 import IPRoute
+from pyroute2.netlink.exceptions import NetlinkError
+
+ip = IPRoute()
+ifidx = ip.link_lookup(ifname=sys.argv[1])
+
+try:
+ ip.tc('add', 'sfq', ifidx, limit=1)
+ sys.exit(1)
+except NetlinkError:
+ sys.exit(0)
diff --git a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
index 996448afe31b..91d120548bf5 100644
--- a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
+++ b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
@@ -78,10 +78,10 @@
"setup": [
"$TC qdisc add dev $DEV1 ingress"
],
- "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0xff",
+ "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0x1f",
"expExitCode": "0",
"verifyCmd": "$TC filter get dev $DEV1 parent ffff: handle 1 protocol ip prio 1 flow",
- "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 255 baseclass",
+ "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 31 baseclass",
"matchCount": "1",
"teardown": [
"$TC qdisc del dev $DEV1 ingress"
diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
index 16d51936b385..50e8d72781cb 100644
--- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
+++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
@@ -208,5 +208,25 @@
"teardown": [
"$TC qdisc del dev $DUMMY handle 1: root"
]
+ },
+ {
+ "id": "4d6f",
+ "name": "Check that limit of 1 is rejected",
+ "category": [
+ "qdisc",
+ "sfq"
+ ],
+ "plugins": {
+ "requires": "nsPlugin"
+ },
+ "setup": [
+ ],
+ "cmdUnderTest": "./scripts/sfq_rejects_limit_1.py $DUMMY",
+ "expExitCode": "0",
+ "verifyCmd": "$TC qdisc show dev $DUMMY",
+ "matchPattern": "sfq",
+ "matchCount": "0",
+ "teardown": [
+ ]
}
]
diff --git a/tools/testing/selftests/timers/clocksource-switch.c b/tools/testing/selftests/timers/clocksource-switch.c
index c5264594064c..83faa4e354e3 100644
--- a/tools/testing/selftests/timers/clocksource-switch.c
+++ b/tools/testing/selftests/timers/clocksource-switch.c
@@ -156,8 +156,8 @@ int main(int argc, char **argv)
/* Check everything is sane before we start switching asynchronously */
if (do_sanity_check) {
for (i = 0; i < count; i++) {
- printf("Validating clocksource %s\n",
- clocksource_list[i]);
+ ksft_print_msg("Validating clocksource %s\n",
+ clocksource_list[i]);
if (change_clocksource(clocksource_list[i])) {
status = -1;
goto out;
@@ -169,7 +169,7 @@ int main(int argc, char **argv)
}
}
- printf("Running Asynchronous Switching Tests...\n");
+ ksft_print_msg("Running Asynchronous Switching Tests...\n");
pid = fork();
if (!pid)
return run_tests(runtime);
diff --git a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
index b5c3ddb90942..02ecfe687dc2 100644
--- a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
+++ b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
@@ -23,45 +23,56 @@
#include <sys/mount.h>
#include <unistd.h>
+#include "../kselftest.h"
+
int main(void)
{
int fd;
+ // Setting up kselftest framework
+ ksft_print_header();
+ ksft_set_plan(1);
+
+ // Check if test is run as root
+ if (geteuid()) {
+ ksft_exit_skip("This test needs root to run!\n");
+ return 1;
+ }
+
if (unshare(CLONE_NEWNS) == -1) {
if (errno == ENOSYS || errno == EPERM) {
- fprintf(stderr, "error: unshare, errno %d\n", errno);
- return 4;
+ ksft_exit_skip("unshare() error: unshare, errno %d\n", errno);
+ } else {
+ ksft_exit_fail_msg("unshare() error: unshare, errno %d\n", errno);
}
- fprintf(stderr, "error: unshare, errno %d\n", errno);
- return 1;
}
+
if (mount(NULL, "/", NULL, MS_PRIVATE|MS_REC, NULL) == -1) {
- fprintf(stderr, "error: mount '/', errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("mount() error: Root filesystem private mount: Fail %d\n", errno);
}
/* Our heroes: 1 root inode, 1 O_TMPFILE inode, 1 permanent inode. */
if (mount(NULL, "/tmp", "tmpfs", 0, "nr_inodes=3") == -1) {
- fprintf(stderr, "error: mount tmpfs, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("mount() error: Mounting tmpfs on /tmp: Fail %d\n", errno);
}
fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600);
if (fd == -1) {
- fprintf(stderr, "error: open 1, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("openat() error: Open first temporary file: Fail %d\n", errno);
}
+
if (linkat(fd, "", AT_FDCWD, "/tmp/1", AT_EMPTY_PATH) == -1) {
- fprintf(stderr, "error: linkat, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("linkat() error: Linking the temporary file: Fail %d\n", errno);
+ /* Ensure fd is closed on failure */
+ close(fd);
}
close(fd);
fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600);
if (fd == -1) {
- fprintf(stderr, "error: open 2, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("openat() error: Opening the second temporary file: Fail %d\n", errno);
}
-
+ ksft_test_result_pass(" ");
+ ksft_exit_pass();
return 0;
}
diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c
index 28f35620c499..2fe5e983cb22 100644
--- a/tools/testing/selftests/vDSO/parse_vdso.c
+++ b/tools/testing/selftests/vDSO/parse_vdso.c
@@ -53,6 +53,7 @@ static struct vdso_info
/* Symbol table */
ELF(Sym) *symtab;
const char *symstrings;
+ ELF(Word) *gnu_hash;
ELF_HASH_ENTRY *bucket, *chain;
ELF_HASH_ENTRY nbucket, nchain;
@@ -81,6 +82,16 @@ static unsigned long elf_hash(const char *name)
return h;
}
+static uint32_t gnu_hash(const char *name)
+{
+ const unsigned char *s = (void *)name;
+ uint32_t h = 5381;
+
+ for (; *s; s++)
+ h += h * 32 + *s;
+ return h;
+}
+
void vdso_init_from_sysinfo_ehdr(uintptr_t base)
{
size_t i;
@@ -123,6 +134,7 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
*/
ELF_HASH_ENTRY *hash = 0;
vdso_info.symstrings = 0;
+ vdso_info.gnu_hash = 0;
vdso_info.symtab = 0;
vdso_info.versym = 0;
vdso_info.verdef = 0;
@@ -143,6 +155,11 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
((uintptr_t)dyn[i].d_un.d_ptr
+ vdso_info.load_offset);
break;
+ case DT_GNU_HASH:
+ vdso_info.gnu_hash =
+ (ELF(Word) *)((uintptr_t)dyn[i].d_un.d_ptr +
+ vdso_info.load_offset);
+ break;
case DT_VERSYM:
vdso_info.versym = (ELF(Versym) *)
((uintptr_t)dyn[i].d_un.d_ptr
@@ -155,17 +172,27 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
break;
}
}
- if (!vdso_info.symstrings || !vdso_info.symtab || !hash)
+ if (!vdso_info.symstrings || !vdso_info.symtab ||
+ (!hash && !vdso_info.gnu_hash))
return; /* Failed */
if (!vdso_info.verdef)
vdso_info.versym = 0;
/* Parse the hash table header. */
- vdso_info.nbucket = hash[0];
- vdso_info.nchain = hash[1];
- vdso_info.bucket = &hash[2];
- vdso_info.chain = &hash[vdso_info.nbucket + 2];
+ if (vdso_info.gnu_hash) {
+ vdso_info.nbucket = vdso_info.gnu_hash[0];
+ /* The bucket array is located after the header (4 uint32) and the bloom
+ * filter (size_t array of gnu_hash[2] elements).
+ */
+ vdso_info.bucket = vdso_info.gnu_hash + 4 +
+ sizeof(size_t) / 4 * vdso_info.gnu_hash[2];
+ } else {
+ vdso_info.nbucket = hash[0];
+ vdso_info.nchain = hash[1];
+ vdso_info.bucket = &hash[2];
+ vdso_info.chain = &hash[vdso_info.nbucket + 2];
+ }
/* That's all we need. */
vdso_info.valid = true;
@@ -209,6 +236,26 @@ static bool vdso_match_version(ELF(Versym) ver,
&& !strcmp(name, vdso_info.symstrings + aux->vda_name);
}
+static bool check_sym(ELF(Sym) *sym, ELF(Word) i, const char *name,
+ const char *version, unsigned long ver_hash)
+{
+ /* Check for a defined global or weak function w/ right name. */
+ if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC)
+ return false;
+ if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL &&
+ ELF64_ST_BIND(sym->st_info) != STB_WEAK)
+ return false;
+ if (strcmp(name, vdso_info.symstrings + sym->st_name))
+ return false;
+
+ /* Check symbol version. */
+ if (vdso_info.versym &&
+ !vdso_match_version(vdso_info.versym[i], version, ver_hash))
+ return false;
+
+ return true;
+}
+
void *vdso_sym(const char *version, const char *name)
{
unsigned long ver_hash;
@@ -216,29 +263,36 @@ void *vdso_sym(const char *version, const char *name)
return 0;
ver_hash = elf_hash(version);
- ELF(Word) chain = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket];
-
- for (; chain != STN_UNDEF; chain = vdso_info.chain[chain]) {
- ELF(Sym) *sym = &vdso_info.symtab[chain];
-
- /* Check for a defined global or weak function w/ right name. */
- if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC)
- continue;
- if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL &&
- ELF64_ST_BIND(sym->st_info) != STB_WEAK)
- continue;
- if (sym->st_shndx == SHN_UNDEF)
- continue;
- if (strcmp(name, vdso_info.symstrings + sym->st_name))
- continue;
-
- /* Check symbol version. */
- if (vdso_info.versym
- && !vdso_match_version(vdso_info.versym[chain],
- version, ver_hash))
- continue;
-
- return (void *)(vdso_info.load_offset + sym->st_value);
+ ELF(Word) i;
+
+ if (vdso_info.gnu_hash) {
+ uint32_t h1 = gnu_hash(name), h2, *hashval;
+
+ i = vdso_info.bucket[h1 % vdso_info.nbucket];
+ if (i == 0)
+ return 0;
+ h1 |= 1;
+ hashval = vdso_info.bucket + vdso_info.nbucket +
+ (i - vdso_info.gnu_hash[1]);
+ for (;; i++) {
+ ELF(Sym) *sym = &vdso_info.symtab[i];
+ h2 = *hashval++;
+ if (h1 == (h2 | 1) &&
+ check_sym(sym, i, name, version, ver_hash))
+ return (void *)(vdso_info.load_offset +
+ sym->st_value);
+ if (h2 & 1)
+ break;
+ }
+ } else {
+ i = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket];
+ for (; i; i = vdso_info.chain[i]) {
+ ELF(Sym) *sym = &vdso_info.symtab[i];
+ if (sym->st_shndx != SHN_UNDEF &&
+ check_sym(sym, i, name, version, ver_hash))
+ return (void *)(vdso_info.load_offset +
+ sym->st_value);
+ }
}
return 0;
diff --git a/tools/testing/selftests/zram/.gitignore b/tools/testing/selftests/zram/.gitignore
new file mode 100644
index 000000000000..088cd9bad87a
--- /dev/null
+++ b/tools/testing/selftests/zram/.gitignore
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0-only
+err.log
diff --git a/tools/testing/shared/linux/maple_tree.h b/tools/testing/shared/linux/maple_tree.h
index 06c89bdcc515..f67d47d32857 100644
--- a/tools/testing/shared/linux/maple_tree.h
+++ b/tools/testing/shared/linux/maple_tree.h
@@ -2,6 +2,6 @@
#define atomic_t int32_t
#define atomic_inc(x) uatomic_inc(x)
#define atomic_read(x) uatomic_read(x)
-#define atomic_set(x, y) do {} while (0)
+#define atomic_set(x, y) uatomic_set(x, y)
#define U8_MAX UCHAR_MAX
#include "../../../../include/linux/maple_tree.h"
diff --git a/tools/testing/vma/linux/atomic.h b/tools/testing/vma/linux/atomic.h
index e01f66f98982..3e1b6adc027b 100644
--- a/tools/testing/vma/linux/atomic.h
+++ b/tools/testing/vma/linux/atomic.h
@@ -6,7 +6,7 @@
#define atomic_t int32_t
#define atomic_inc(x) uatomic_inc(x)
#define atomic_read(x) uatomic_read(x)
-#define atomic_set(x, y) do {} while (0)
+#define atomic_set(x, y) uatomic_set(x, y)
#define U8_MAX UCHAR_MAX
#endif /* _LINUX_ATOMIC_H */
diff --git a/tools/testing/vma/vma.c b/tools/testing/vma/vma.c
index 8fab5e13c7c3..9bcf1736bf18 100644
--- a/tools/testing/vma/vma.c
+++ b/tools/testing/vma/vma.c
@@ -89,7 +89,7 @@ static struct vm_area_struct *alloc_and_link_vma(struct mm_struct *mm,
* begun. Linking to the tree will have caused this to be incremented,
* which means we will get a false positive otherwise.
*/
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
return vma;
}
@@ -214,7 +214,7 @@ static bool vma_write_started(struct vm_area_struct *vma)
int seq = vma->vm_lock_seq;
/* We reset after each check. */
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
/* The vma_start_write() stub simply increments this value. */
return seq > -1;
diff --git a/tools/testing/vma/vma_internal.h b/tools/testing/vma/vma_internal.h
index e76ff579e1fd..1d9fc97b8e80 100644
--- a/tools/testing/vma/vma_internal.h
+++ b/tools/testing/vma/vma_internal.h
@@ -241,7 +241,7 @@ struct vm_area_struct {
* counter reuse can only lead to occasional unnecessary use of the
* slowpath.
*/
- int vm_lock_seq;
+ unsigned int vm_lock_seq;
struct vma_lock *vm_lock;
#endif
@@ -416,7 +416,7 @@ static inline bool vma_lock_alloc(struct vm_area_struct *vma)
return false;
init_rwsem(&vma->vm_lock->lock);
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
return true;
}
diff --git a/tools/testing/vsock/README b/tools/testing/vsock/README
index 84ee217ba8ee..680ce666ceb5 100644
--- a/tools/testing/vsock/README
+++ b/tools/testing/vsock/README
@@ -36,6 +36,21 @@ Invoke test binaries in both directions as follows:
--control-port=1234 \
--peer-cid=3
+Some tests are designed to produce kernel memory leaks. Leaks detection,
+however, is deferred to Kernel Memory Leak Detector. It is recommended to enable
+kmemleak (CONFIG_DEBUG_KMEMLEAK=y) and explicitly trigger a scan after each test
+suite run, e.g.
+
+ # echo clear > /sys/kernel/debug/kmemleak
+ # $TEST_BINARY ...
+ # echo "wait for any grace periods" && sleep 2
+ # echo scan > /sys/kernel/debug/kmemleak
+ # echo "wait for kmemleak" && sleep 5
+ # echo scan > /sys/kernel/debug/kmemleak
+ # cat /sys/kernel/debug/kmemleak
+
+For more information see Documentation/dev-tools/kmemleak.rst.
+
vsock_perf utility
-------------------
'vsock_perf' is a simple tool to measure vsock performance. It works in
diff --git a/tools/testing/vsock/control.c b/tools/testing/vsock/control.c
index d2deb4b15b94..0066e0324d35 100644
--- a/tools/testing/vsock/control.c
+++ b/tools/testing/vsock/control.c
@@ -27,6 +27,7 @@
#include "timeout.h"
#include "control.h"
+#include "util.h"
static int control_fd = -1;
@@ -50,7 +51,6 @@ void control_init(const char *control_host,
for (ai = result; ai; ai = ai->ai_next) {
int fd;
- int val = 1;
fd = socket(ai->ai_family, ai->ai_socktype, ai->ai_protocol);
if (fd < 0)
@@ -65,11 +65,8 @@ void control_init(const char *control_host,
break;
}
- if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR,
- &val, sizeof(val)) < 0) {
- perror("setsockopt");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_REUSEADDR, 1,
+ "setsockopt SO_REUSEADDR");
if (bind(fd, ai->ai_addr, ai->ai_addrlen) < 0)
goto next;
diff --git a/tools/testing/vsock/msg_zerocopy_common.c b/tools/testing/vsock/msg_zerocopy_common.c
index 5a4bdf7b5132..8622e5a0f8b7 100644
--- a/tools/testing/vsock/msg_zerocopy_common.c
+++ b/tools/testing/vsock/msg_zerocopy_common.c
@@ -14,16 +14,6 @@
#include "msg_zerocopy_common.h"
-void enable_so_zerocopy(int fd)
-{
- int val = 1;
-
- if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) {
- perror("setsockopt");
- exit(EXIT_FAILURE);
- }
-}
-
void vsock_recv_completion(int fd, const bool *zerocopied)
{
struct sock_extended_err *serr;
diff --git a/tools/testing/vsock/msg_zerocopy_common.h b/tools/testing/vsock/msg_zerocopy_common.h
index 3763c5ccedb9..ad14139e93ca 100644
--- a/tools/testing/vsock/msg_zerocopy_common.h
+++ b/tools/testing/vsock/msg_zerocopy_common.h
@@ -12,7 +12,6 @@
#define VSOCK_RECVERR 1
#endif
-void enable_so_zerocopy(int fd);
void vsock_recv_completion(int fd, const bool *zerocopied);
#endif /* MSG_ZEROCOPY_COMMON_H */
diff --git a/tools/testing/vsock/util.c b/tools/testing/vsock/util.c
index a3d448a075e3..7058dc614c25 100644
--- a/tools/testing/vsock/util.c
+++ b/tools/testing/vsock/util.c
@@ -401,7 +401,7 @@ void recv_buf(int fd, void *buf, size_t len, int flags, ssize_t expected_ret)
*/
void send_byte(int fd, int expected_ret, int flags)
{
- const uint8_t byte = 'A';
+ static const uint8_t byte = 'A';
send_buf(fd, &byte, sizeof(byte), flags, expected_ret);
}
@@ -420,7 +420,7 @@ void recv_byte(int fd, int expected_ret, int flags)
recv_buf(fd, &byte, sizeof(byte), flags, expected_ret);
if (byte != 'A') {
- fprintf(stderr, "unexpected byte read %c\n", byte);
+ fprintf(stderr, "unexpected byte read 0x%02x\n", byte);
exit(EXIT_FAILURE);
}
}
@@ -486,8 +486,7 @@ void list_tests(const struct test_case *test_cases)
exit(EXIT_FAILURE);
}
-void skip_test(struct test_case *test_cases, size_t test_cases_len,
- const char *test_id_str)
+static unsigned long parse_test_id(const char *test_id_str, size_t test_cases_len)
{
unsigned long test_id;
char *endptr = NULL;
@@ -505,9 +504,35 @@ void skip_test(struct test_case *test_cases, size_t test_cases_len,
exit(EXIT_FAILURE);
}
+ return test_id;
+}
+
+void skip_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str)
+{
+ unsigned long test_id = parse_test_id(test_id_str, test_cases_len);
test_cases[test_id].skip = true;
}
+void pick_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str)
+{
+ static bool skip_all = true;
+ unsigned long test_id;
+
+ if (skip_all) {
+ unsigned long i;
+
+ for (i = 0; i < test_cases_len; ++i)
+ test_cases[i].skip = true;
+
+ skip_all = false;
+ }
+
+ test_id = parse_test_id(test_id_str, test_cases_len);
+ test_cases[test_id].skip = false;
+}
+
unsigned long hash_djb2(const void *data, size_t len)
{
unsigned long hash = 5381;
@@ -651,3 +676,145 @@ void free_test_iovec(const struct iovec *test_iovec,
free(iovec);
}
+
+/* Set "unsigned long long" socket option and check that it's indeed set */
+void setsockopt_ull_check(int fd, int level, int optname,
+ unsigned long long val, char const *errmsg)
+{
+ unsigned long long chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ chkval = ~val; /* just make storage != val */
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (chkval != val) {
+ fprintf(stderr, "value mismatch: set %llu got %llu\n", val,
+ chkval);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %llu\n", errmsg, val);
+ exit(EXIT_FAILURE);
+;
+}
+
+/* Set "int" socket option and check that it's indeed set */
+void setsockopt_int_check(int fd, int level, int optname, int val,
+ char const *errmsg)
+{
+ int chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ chkval = ~val; /* just make storage != val */
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (chkval != val) {
+ fprintf(stderr, "value mismatch: set %d got %d\n", val, chkval);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %d\n", errmsg, val);
+ exit(EXIT_FAILURE);
+}
+
+static void mem_invert(unsigned char *mem, size_t size)
+{
+ size_t i;
+
+ for (i = 0; i < size; i++)
+ mem[i] = ~mem[i];
+}
+
+/* Set "timeval" socket option and check that it's indeed set */
+void setsockopt_timeval_check(int fd, int level, int optname,
+ struct timeval val, char const *errmsg)
+{
+ struct timeval chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ /* just make storage != val */
+ chkval = val;
+ mem_invert((unsigned char *)&chkval, sizeof(chkval));
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (memcmp(&chkval, &val, sizeof(val)) != 0) {
+ fprintf(stderr, "value mismatch: set %ld:%ld got %ld:%ld\n",
+ val.tv_sec, val.tv_usec, chkval.tv_sec, chkval.tv_usec);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %ld:%ld\n", errmsg, val.tv_sec, val.tv_usec);
+ exit(EXIT_FAILURE);
+}
+
+void enable_so_zerocopy_check(int fd)
+{
+ setsockopt_int_check(fd, SOL_SOCKET, SO_ZEROCOPY, 1,
+ "setsockopt SO_ZEROCOPY");
+}
diff --git a/tools/testing/vsock/util.h b/tools/testing/vsock/util.h
index fff22d4a14c0..e62f46b2b92a 100644
--- a/tools/testing/vsock/util.h
+++ b/tools/testing/vsock/util.h
@@ -62,10 +62,19 @@ void run_tests(const struct test_case *test_cases,
void list_tests(const struct test_case *test_cases);
void skip_test(struct test_case *test_cases, size_t test_cases_len,
const char *test_id_str);
+void pick_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str);
unsigned long hash_djb2(const void *data, size_t len);
size_t iovec_bytes(const struct iovec *iov, size_t iovnum);
unsigned long iovec_hash_djb2(const struct iovec *iov, size_t iovnum);
struct iovec *alloc_test_iovec(const struct iovec *test_iovec, int iovnum);
void free_test_iovec(const struct iovec *test_iovec,
struct iovec *iovec, int iovnum);
+void setsockopt_ull_check(int fd, int level, int optname,
+ unsigned long long val, char const *errmsg);
+void setsockopt_int_check(int fd, int level, int optname, int val,
+ char const *errmsg);
+void setsockopt_timeval_check(int fd, int level, int optname,
+ struct timeval val, char const *errmsg);
+void enable_so_zerocopy_check(int fd);
#endif /* UTIL_H */
diff --git a/tools/testing/vsock/vsock_perf.c b/tools/testing/vsock/vsock_perf.c
index 4e8578f815e0..75971ac708c9 100644
--- a/tools/testing/vsock/vsock_perf.c
+++ b/tools/testing/vsock/vsock_perf.c
@@ -33,7 +33,7 @@
static unsigned int port = DEFAULT_PORT;
static unsigned long buf_size_bytes = DEFAULT_BUF_SIZE_BYTES;
-static unsigned long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES;
+static unsigned long long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES;
static bool zerocopy;
static void error(const char *s)
@@ -133,7 +133,7 @@ static float get_gbps(unsigned long bits, time_t ns_delta)
((float)ns_delta / NSEC_PER_SEC);
}
-static void run_receiver(unsigned long rcvlowat_bytes)
+static void run_receiver(int rcvlowat_bytes)
{
unsigned int read_cnt;
time_t rx_begin_ns;
@@ -162,8 +162,8 @@ static void run_receiver(unsigned long rcvlowat_bytes)
printf("Run as receiver\n");
printf("Listen port %u\n", port);
printf("RX buffer %lu bytes\n", buf_size_bytes);
- printf("vsock buffer %lu bytes\n", vsock_buf_bytes);
- printf("SO_RCVLOWAT %lu bytes\n", rcvlowat_bytes);
+ printf("vsock buffer %llu bytes\n", vsock_buf_bytes);
+ printf("SO_RCVLOWAT %d bytes\n", rcvlowat_bytes);
fd = socket(AF_VSOCK, SOCK_STREAM, 0);
@@ -251,6 +251,16 @@ static void run_receiver(unsigned long rcvlowat_bytes)
close(fd);
}
+static void enable_so_zerocopy(int fd)
+{
+ int val = 1;
+
+ if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) {
+ perror("setsockopt");
+ exit(EXIT_FAILURE);
+ }
+}
+
static void run_sender(int peer_cid, unsigned long to_send_bytes)
{
time_t tx_begin_ns;
@@ -439,7 +449,7 @@ static long strtolx(const char *arg)
int main(int argc, char **argv)
{
unsigned long to_send_bytes = DEFAULT_TO_SEND_BYTES;
- unsigned long rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES;
+ int rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES;
int peer_cid = -1;
bool sender = false;
diff --git a/tools/testing/vsock/vsock_test.c b/tools/testing/vsock/vsock_test.c
index 8d38dbf8f41f..1eebbc0d5f61 100644
--- a/tools/testing/vsock/vsock_test.c
+++ b/tools/testing/vsock/vsock_test.c
@@ -22,12 +22,17 @@
#include <signal.h>
#include <sys/ioctl.h>
#include <linux/sockios.h>
+#include <linux/time64.h>
#include "vsock_test_zerocopy.h"
#include "timeout.h"
#include "control.h"
#include "util.h"
+/* Basic messages for control_writeulong(), control_readulong() */
+#define CONTROL_CONTINUE 1
+#define CONTROL_DONE 0
+
static void test_stream_connection_reset(const struct test_opts *opts)
{
union {
@@ -429,7 +434,7 @@ static void test_seqpacket_msg_bounds_client(const struct test_opts *opts)
static void test_seqpacket_msg_bounds_server(const struct test_opts *opts)
{
- unsigned long sock_buf_size;
+ unsigned long long sock_buf_size;
unsigned long remote_hash;
unsigned long curr_hash;
int fd;
@@ -444,17 +449,13 @@ static void test_seqpacket_msg_bounds_server(const struct test_opts *opts)
sock_buf_size = SOCK_BUF_SIZE;
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE,
- &sock_buf_size, sizeof(sock_buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)");
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
- &sock_buf_size, sizeof(sock_buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
/* Ready to receive data. */
control_writeln("SRVREADY");
@@ -563,7 +564,7 @@ static time_t current_nsec(void)
exit(EXIT_FAILURE);
}
- return (ts.tv_sec * 1000000000ULL) + ts.tv_nsec;
+ return (ts.tv_sec * NSEC_PER_SEC) + ts.tv_nsec;
}
#define RCVTIMEO_TIMEOUT_SEC 1
@@ -586,10 +587,8 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts)
tv.tv_sec = RCVTIMEO_TIMEOUT_SEC;
tv.tv_usec = 0;
- if (setsockopt(fd, SOL_SOCKET, SO_RCVTIMEO, (void *)&tv, sizeof(tv)) == -1) {
- perror("setsockopt(SO_RCVTIMEO)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_timeval_check(fd, SOL_SOCKET, SO_RCVTIMEO, tv,
+ "setsockopt(SO_RCVTIMEO)");
read_enter_ns = current_nsec();
@@ -605,7 +604,7 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts)
}
read_overhead_ns = current_nsec() - read_enter_ns -
- 1000000000ULL * RCVTIMEO_TIMEOUT_SEC;
+ NSEC_PER_SEC * RCVTIMEO_TIMEOUT_SEC;
if (read_overhead_ns > READ_OVERHEAD_NSEC) {
fprintf(stderr,
@@ -634,7 +633,8 @@ static void test_seqpacket_timeout_server(const struct test_opts *opts)
static void test_seqpacket_bigmsg_client(const struct test_opts *opts)
{
- unsigned long sock_buf_size;
+ unsigned long long sock_buf_size;
+ size_t buf_size;
socklen_t len;
void *data;
int fd;
@@ -655,13 +655,20 @@ static void test_seqpacket_bigmsg_client(const struct test_opts *opts)
sock_buf_size++;
- data = malloc(sock_buf_size);
+ /* size_t can be < unsigned long long */
+ buf_size = (size_t)sock_buf_size;
+ if (buf_size != sock_buf_size) {
+ fprintf(stderr, "Returned BUFFER_SIZE too large\n");
+ exit(EXIT_FAILURE);
+ }
+
+ data = malloc(buf_size);
if (!data) {
perror("malloc");
exit(EXIT_FAILURE);
}
- send_buf(fd, data, sock_buf_size, 0, -EMSGSIZE);
+ send_buf(fd, data, buf_size, 0, -EMSGSIZE);
control_writeln("CLISENT");
@@ -835,7 +842,7 @@ static void test_stream_poll_rcvlowat_server(const struct test_opts *opts)
static void test_stream_poll_rcvlowat_client(const struct test_opts *opts)
{
- unsigned long lowat_val = RCVLOWAT_BUF_SIZE;
+ int lowat_val = RCVLOWAT_BUF_SIZE;
char buf[RCVLOWAT_BUF_SIZE];
struct pollfd fds;
short poll_flags;
@@ -847,11 +854,8 @@ static void test_stream_poll_rcvlowat_client(const struct test_opts *opts)
exit(EXIT_FAILURE);
}
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &lowat_val, sizeof(lowat_val))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ lowat_val, "setsockopt(SO_RCVLOWAT)");
control_expectln("SRVSENT");
@@ -1357,9 +1361,10 @@ static void test_stream_rcvlowat_def_cred_upd_client(const struct test_opts *opt
static void test_stream_credit_update_test(const struct test_opts *opts,
bool low_rx_bytes_test)
{
- size_t recv_buf_size;
+ int recv_buf_size;
struct pollfd fds;
size_t buf_size;
+ unsigned long long sock_buf_size;
void *buf;
int fd;
@@ -1371,11 +1376,12 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
buf_size = RCVLOWAT_CREDIT_UPD_BUF_SIZE;
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
- &buf_size, sizeof(buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
- exit(EXIT_FAILURE);
- }
+ /* size_t can be < unsigned long long */
+ sock_buf_size = buf_size;
+
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
if (low_rx_bytes_test) {
/* Set new SO_RCVLOWAT here. This enables sending credit
@@ -1384,11 +1390,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
*/
recv_buf_size = 1 + VIRTIO_VSOCK_MAX_PKT_BUF_SIZE;
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &recv_buf_size, sizeof(recv_buf_size))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ recv_buf_size, "setsockopt(SO_RCVLOWAT)");
}
/* Send one dummy byte here, because 'setsockopt()' above also
@@ -1430,11 +1433,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
recv_buf_size++;
/* Updating SO_RCVLOWAT will send credit update. */
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &recv_buf_size, sizeof(recv_buf_size))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ recv_buf_size, "setsockopt(SO_RCVLOWAT)");
}
fds.fd = fd;
@@ -1478,6 +1478,236 @@ static void test_stream_cred_upd_on_set_rcvlowat(const struct test_opts *opts)
test_stream_credit_update_test(opts, false);
}
+/* The goal of test leak_acceptq is to stress the race between connect() and
+ * close(listener). Implementation of client/server loops boils down to:
+ *
+ * client server
+ * ------ ------
+ * write(CONTINUE)
+ * expect(CONTINUE)
+ * listen()
+ * write(LISTENING)
+ * expect(LISTENING)
+ * connect() close()
+ */
+#define ACCEPTQ_LEAK_RACE_TIMEOUT 2 /* seconds */
+
+static void test_stream_leak_acceptq_client(const struct test_opts *opts)
+{
+ time_t tout;
+ int fd;
+
+ tout = current_nsec() + ACCEPTQ_LEAK_RACE_TIMEOUT * NSEC_PER_SEC;
+ do {
+ control_writeulong(CONTROL_CONTINUE);
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd >= 0)
+ close(fd);
+ } while (current_nsec() < tout);
+
+ control_writeulong(CONTROL_DONE);
+}
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_leak_acceptq_server(const struct test_opts *opts)
+{
+ int fd;
+
+ while (control_readulong() == CONTROL_CONTINUE) {
+ fd = vsock_stream_listen(VMADDR_CID_ANY, opts->peer_port);
+ control_writeln("LISTENING");
+ close(fd);
+ }
+}
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_msgzcopy_leak_errq_client(const struct test_opts *opts)
+{
+ struct pollfd fds = { 0 };
+ int fd;
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd < 0) {
+ perror("connect");
+ exit(EXIT_FAILURE);
+ }
+
+ enable_so_zerocopy_check(fd);
+ send_byte(fd, 1, MSG_ZEROCOPY);
+
+ fds.fd = fd;
+ fds.events = 0;
+ if (poll(&fds, 1, -1) < 0) {
+ perror("poll");
+ exit(EXIT_FAILURE);
+ }
+
+ close(fd);
+}
+
+static void test_stream_msgzcopy_leak_errq_server(const struct test_opts *opts)
+{
+ int fd;
+
+ fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ if (fd < 0) {
+ perror("accept");
+ exit(EXIT_FAILURE);
+ }
+
+ recv_byte(fd, 1, 0);
+ vsock_wait_remote_close(fd);
+ close(fd);
+}
+
+/* Test msgzcopy_leak_zcskb is meant to exercise sendmsg() error handling path,
+ * that might leak an skb. The idea is to fail virtio_transport_init_zcopy_skb()
+ * by hitting net.core.optmem_max limit in sock_omalloc(), specifically
+ *
+ * vsock_connectible_sendmsg
+ * virtio_transport_stream_enqueue
+ * virtio_transport_send_pkt_info
+ * virtio_transport_init_zcopy_skb
+ * . msg_zerocopy_realloc
+ * . msg_zerocopy_alloc
+ * . sock_omalloc
+ * . sk_omem_alloc + size > sysctl_optmem_max
+ * return -ENOMEM
+ *
+ * We abuse the implementation detail of net/socket.c:____sys_sendmsg().
+ * sk_omem_alloc can be precisely bumped by sock_kmalloc(), as it is used to
+ * fetch user-provided control data.
+ *
+ * While this approach works for now, it relies on assumptions regarding the
+ * implementation and configuration (for example, order of net.core.optmem_max
+ * can not exceed MAX_PAGE_ORDER), which may not hold in the future. A more
+ * resilient testing could be implemented by leveraging the Fault injection
+ * framework (CONFIG_FAULT_INJECTION), e.g.
+ *
+ * client# echo N > /sys/kernel/debug/failslab/ignore-gfp-wait
+ * client# echo 0 > /sys/kernel/debug/failslab/verbose
+ *
+ * void client(const struct test_opts *opts)
+ * {
+ * char buf[16];
+ * int f, s, i;
+ *
+ * f = open("/proc/self/fail-nth", O_WRONLY);
+ *
+ * for (i = 1; i < 32; i++) {
+ * control_writeulong(CONTROL_CONTINUE);
+ *
+ * s = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ * enable_so_zerocopy_check(s);
+ *
+ * sprintf(buf, "%d", i);
+ * write(f, buf, strlen(buf));
+ *
+ * send(s, &(char){ 0 }, 1, MSG_ZEROCOPY);
+ *
+ * write(f, "0", 1);
+ * close(s);
+ * }
+ *
+ * control_writeulong(CONTROL_DONE);
+ * close(f);
+ * }
+ *
+ * void server(const struct test_opts *opts)
+ * {
+ * int fd;
+ *
+ * while (control_readulong() == CONTROL_CONTINUE) {
+ * fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ * vsock_wait_remote_close(fd);
+ * close(fd);
+ * }
+ * }
+ *
+ * Refer to Documentation/fault-injection/fault-injection.rst.
+ */
+#define MAX_PAGE_ORDER 10 /* usually */
+#define PAGE_SIZE 4096
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_msgzcopy_leak_zcskb_client(const struct test_opts *opts)
+{
+ size_t optmem_max, ctl_len, chunk_size;
+ struct msghdr msg = { 0 };
+ struct iovec iov;
+ char *chunk;
+ int fd, res;
+ FILE *f;
+
+ f = fopen("/proc/sys/net/core/optmem_max", "r");
+ if (!f) {
+ perror("fopen(optmem_max)");
+ exit(EXIT_FAILURE);
+ }
+
+ if (fscanf(f, "%zu", &optmem_max) != 1) {
+ fprintf(stderr, "fscanf(optmem_max) failed\n");
+ exit(EXIT_FAILURE);
+ }
+
+ fclose(f);
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd < 0) {
+ perror("connect");
+ exit(EXIT_FAILURE);
+ }
+
+ enable_so_zerocopy_check(fd);
+
+ ctl_len = optmem_max - 1;
+ if (ctl_len > PAGE_SIZE << MAX_PAGE_ORDER) {
+ fprintf(stderr, "Try with net.core.optmem_max = 100000\n");
+ exit(EXIT_FAILURE);
+ }
+
+ chunk_size = CMSG_SPACE(ctl_len);
+ chunk = malloc(chunk_size);
+ if (!chunk) {
+ perror("malloc");
+ exit(EXIT_FAILURE);
+ }
+ memset(chunk, 0, chunk_size);
+
+ iov.iov_base = &(char){ 0 };
+ iov.iov_len = 1;
+
+ msg.msg_iov = &iov;
+ msg.msg_iovlen = 1;
+ msg.msg_control = chunk;
+ msg.msg_controllen = ctl_len;
+
+ errno = 0;
+ res = sendmsg(fd, &msg, MSG_ZEROCOPY);
+ if (res >= 0 || errno != ENOMEM) {
+ fprintf(stderr, "Expected ENOMEM, got errno=%d res=%d\n",
+ errno, res);
+ exit(EXIT_FAILURE);
+ }
+
+ close(fd);
+}
+
+static void test_stream_msgzcopy_leak_zcskb_server(const struct test_opts *opts)
+{
+ int fd;
+
+ fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ if (fd < 0) {
+ perror("accept");
+ exit(EXIT_FAILURE);
+ }
+
+ vsock_wait_remote_close(fd);
+ close(fd);
+}
+
static struct test_case test_cases[] = {
{
.name = "SOCK_STREAM connection reset",
@@ -1608,6 +1838,21 @@ static struct test_case test_cases[] = {
.run_client = test_seqpacket_unsent_bytes_client,
.run_server = test_seqpacket_unsent_bytes_server,
},
+ {
+ .name = "SOCK_STREAM leak accept queue",
+ .run_client = test_stream_leak_acceptq_client,
+ .run_server = test_stream_leak_acceptq_server,
+ },
+ {
+ .name = "SOCK_STREAM MSG_ZEROCOPY leak MSG_ERRQUEUE",
+ .run_client = test_stream_msgzcopy_leak_errq_client,
+ .run_server = test_stream_msgzcopy_leak_errq_server,
+ },
+ {
+ .name = "SOCK_STREAM MSG_ZEROCOPY leak completion skb",
+ .run_client = test_stream_msgzcopy_leak_zcskb_client,
+ .run_server = test_stream_msgzcopy_leak_zcskb_server,
+ },
{},
};
@@ -1649,6 +1894,11 @@ static const struct option longopts[] = {
.val = 's',
},
{
+ .name = "pick",
+ .has_arg = required_argument,
+ .val = 't',
+ },
+ {
.name = "help",
.has_arg = no_argument,
.val = '?',
@@ -1685,6 +1935,8 @@ static void usage(void)
" --peer-cid <cid> CID of the other side\n"
" --peer-port <port> AF_VSOCK port used for the test [default: %d]\n"
" --list List of tests that will be executed\n"
+ " --pick <test_id> Test ID to execute selectively;\n"
+ " use multiple --pick options to select more tests\n"
" --skip <test_id> Test ID to skip;\n"
" use multiple --skip options to skip more tests\n",
DEFAULT_PEER_PORT
@@ -1741,6 +1993,10 @@ int main(int argc, char **argv)
skip_test(test_cases, ARRAY_SIZE(test_cases) - 1,
optarg);
break;
+ case 't':
+ pick_test(test_cases, ARRAY_SIZE(test_cases) - 1,
+ optarg);
+ break;
case '?':
default:
usage();
diff --git a/tools/testing/vsock/vsock_test_zerocopy.c b/tools/testing/vsock/vsock_test_zerocopy.c
index 04c376b6937f..9d9a6cb9614a 100644
--- a/tools/testing/vsock/vsock_test_zerocopy.c
+++ b/tools/testing/vsock/vsock_test_zerocopy.c
@@ -162,7 +162,7 @@ static void test_client(const struct test_opts *opts,
}
if (test_data->so_zerocopy)
- enable_so_zerocopy(fd);
+ enable_so_zerocopy_check(fd);
iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt);
diff --git a/tools/testing/vsock/vsock_uring_test.c b/tools/testing/vsock/vsock_uring_test.c
index 6c3e6f70c457..5c3078969659 100644
--- a/tools/testing/vsock/vsock_uring_test.c
+++ b/tools/testing/vsock/vsock_uring_test.c
@@ -73,7 +73,7 @@ static void vsock_io_uring_client(const struct test_opts *opts,
}
if (msg_zerocopy)
- enable_so_zerocopy(fd);
+ enable_so_zerocopy_check(fd);
iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt);
diff --git a/tools/tracing/rtla/src/timerlat_hist.c b/tools/tracing/rtla/src/timerlat_hist.c
index 8b66387e5f35..4403cc4eba30 100644
--- a/tools/tracing/rtla/src/timerlat_hist.c
+++ b/tools/tracing/rtla/src/timerlat_hist.c
@@ -282,6 +282,21 @@ static void timerlat_hist_header(struct osnoise_tool *tool)
}
/*
+ * format_summary_value - format a line of summary value (min, max or avg)
+ * of hist data
+ */
+static void format_summary_value(struct trace_seq *seq,
+ int count,
+ unsigned long long val,
+ bool avg)
+{
+ if (count)
+ trace_seq_printf(seq, "%9llu ", avg ? val / count : val);
+ else
+ trace_seq_printf(seq, "%9c ", '-');
+}
+
+/*
* timerlat_print_summary - print the summary of the hist data to the output
*/
static void
@@ -328,29 +343,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_irq);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].min_irq,
+ false);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_thread);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].min_thread,
+ false);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_user);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].min_user,
+ false);
}
trace_seq_printf(trace->seq, "\n");
@@ -364,29 +373,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_irq / data->hist[cpu].irq_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].sum_irq,
+ true);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_thread / data->hist[cpu].thread_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].sum_thread,
+ true);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_user / data->hist[cpu].user_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].sum_user,
+ true);
}
trace_seq_printf(trace->seq, "\n");
@@ -400,29 +403,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_irq);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].max_irq,
+ false);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_thread);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].max_thread,
+ false);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_user);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].max_user,
+ false);
}
trace_seq_printf(trace->seq, "\n");
trace_seq_do_printf(trace->seq);
@@ -506,16 +503,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "min: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_irq);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.min_irq,
+ false);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_thread);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.min_thread,
+ false);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_user);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.min_user,
+ false);
trace_seq_printf(trace->seq, "\n");
@@ -523,16 +526,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "avg: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_irq / sum.irq_count);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.sum_irq,
+ true);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_thread / sum.thread_count);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.sum_thread,
+ true);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_user / sum.user_count);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.sum_user,
+ true);
trace_seq_printf(trace->seq, "\n");
@@ -540,16 +549,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "max: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_irq);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.max_irq,
+ false);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_thread);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.max_thread,
+ false);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_user);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.max_user,
+ false);
trace_seq_printf(trace->seq, "\n");
trace_seq_do_printf(trace->seq);