diff options
Diffstat (limited to 'tools/testing')
664 files changed, 20623 insertions, 4906 deletions
diff --git a/tools/testing/cxl/cxl_core_exports.c b/tools/testing/cxl/cxl_core_exports.c index 077e6883921d..f088792a8925 100644 --- a/tools/testing/cxl/cxl_core_exports.c +++ b/tools/testing/cxl/cxl_core_exports.c @@ -4,4 +4,4 @@ #include "cxl.h" /* Exporting of cxl_core symbols that are only used by cxl_test */ -EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, CXL); +EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, "CXL"); diff --git a/tools/testing/cxl/test/cxl.c b/tools/testing/cxl/test/cxl.c index 050725afa45d..cc8948f49117 100644 --- a/tools/testing/cxl/test/cxl.c +++ b/tools/testing/cxl/test/cxl.c @@ -725,7 +725,7 @@ static void default_mock_decoder(struct cxl_decoder *cxld) cxld->reset = mock_decoder_reset; } -static int first_decoder(struct device *dev, void *data) +static int first_decoder(struct device *dev, const void *data) { struct cxl_decoder *cxld; @@ -1531,5 +1531,5 @@ MODULE_PARM_DESC(interleave_arithmetic, "Modulo:0, XOR:1"); module_init(cxl_test_init); module_exit(cxl_test_exit); MODULE_LICENSE("GPL v2"); -MODULE_IMPORT_NS(ACPI); -MODULE_IMPORT_NS(CXL); +MODULE_IMPORT_NS("ACPI"); +MODULE_IMPORT_NS("CXL"); diff --git a/tools/testing/cxl/test/mem.c b/tools/testing/cxl/test/mem.c index 71916e0e1546..8d731bd63988 100644 --- a/tools/testing/cxl/test/mem.c +++ b/tools/testing/cxl/test/mem.c @@ -401,6 +401,10 @@ struct cxl_test_gen_media gen_media = { .channel = 1, .rank = 30, }, + .component_id = { 0x3, 0x74, 0xc5, 0x8, 0x9a, 0x1a, 0xb, 0xfc, 0xd2, 0x7e, 0x2f, 0x31, 0x9b, 0x3c, 0x81, 0x4d }, + .cme_threshold_ev_flags = 3, + .cme_count = { 33, 0, 0 }, + .sub_type = 0x2, }, }; @@ -429,6 +433,11 @@ struct cxl_test_dram dram = { .bank_group = 5, .bank = 2, .column = {0xDE, 0xAD}, + .component_id = { 0x1, 0x74, 0xc5, 0x8, 0x9a, 0x1a, 0xb, 0xfc, 0xd2, 0x7e, 0x2f, 0x31, 0x9b, 0x3c, 0x81, 0x4d }, + .sub_channel = 8, + .cme_threshold_ev_flags = 2, + .cvme_count = { 14, 0, 0 }, + .sub_type = 0x5, }, }; @@ -456,7 +465,10 @@ struct cxl_test_mem_module mem_module = { .dirty_shutdown_cnt = { 0xde, 0xad, 0xbe, 0xef }, .cor_vol_err_cnt = { 0xde, 0xad, 0xbe, 0xef }, .cor_per_err_cnt = { 0xde, 0xad, 0xbe, 0xef }, - } + }, + /* .validity_flags = <set below> */ + .component_id = { 0x2, 0x74, 0xc5, 0x8, 0x9a, 0x1a, 0xb, 0xfc, 0xd2, 0x7e, 0x2f, 0x31, 0x9b, 0x3c, 0x81, 0x4d }, + .event_sub_type = 0x3, }, }; @@ -478,13 +490,18 @@ static int mock_set_timestamp(struct cxl_dev_state *cxlds, static void cxl_mock_add_event_logs(struct mock_event_store *mes) { - put_unaligned_le16(CXL_GMER_VALID_CHANNEL | CXL_GMER_VALID_RANK, + put_unaligned_le16(CXL_GMER_VALID_CHANNEL | CXL_GMER_VALID_RANK | + CXL_GMER_VALID_COMPONENT | CXL_GMER_VALID_COMPONENT_ID_FORMAT, &gen_media.rec.media_hdr.validity_flags); put_unaligned_le16(CXL_DER_VALID_CHANNEL | CXL_DER_VALID_BANK_GROUP | - CXL_DER_VALID_BANK | CXL_DER_VALID_COLUMN, + CXL_DER_VALID_BANK | CXL_DER_VALID_COLUMN | CXL_DER_VALID_SUB_CHANNEL | + CXL_DER_VALID_COMPONENT | CXL_DER_VALID_COMPONENT_ID_FORMAT, &dram.rec.media_hdr.validity_flags); + put_unaligned_le16(CXL_MMER_VALID_COMPONENT | CXL_MMER_VALID_COMPONENT_ID_FORMAT, + &mem_module.rec.validity_flags); + mes_add_event(mes, CXL_EVENT_TYPE_INFO, &maint_needed); mes_add_event(mes, CXL_EVENT_TYPE_INFO, (struct cxl_event_record_raw *)&gen_media); @@ -1679,4 +1696,4 @@ static struct platform_driver cxl_mock_mem_driver = { module_platform_driver(cxl_mock_mem_driver); MODULE_LICENSE("GPL v2"); -MODULE_IMPORT_NS(CXL); +MODULE_IMPORT_NS("CXL"); diff --git a/tools/testing/cxl/test/mock.c b/tools/testing/cxl/test/mock.c index f4ce96cc11d4..af2594e4f35d 100644 --- a/tools/testing/cxl/test/mock.c +++ b/tools/testing/cxl/test/mock.c @@ -76,7 +76,7 @@ int __wrap_acpi_table_parse_cedt(enum acpi_cedt_type id, return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, ACPI); +EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, "ACPI"); acpi_status __wrap_acpi_evaluate_integer(acpi_handle handle, acpi_string pathname, @@ -147,7 +147,7 @@ struct cxl_hdm *__wrap_devm_cxl_setup_hdm(struct cxl_port *port, return cxlhdm; } -EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, "CXL"); int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port) { @@ -162,7 +162,7 @@ int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port) return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, "CXL"); int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm, struct cxl_endpoint_dvsec_info *info) @@ -179,7 +179,7 @@ int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm, return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, "CXL"); int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port) { @@ -194,7 +194,7 @@ int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port) return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, "CXL"); int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds) { @@ -209,7 +209,7 @@ int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds) return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, "CXL"); int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds, struct cxl_hdm *cxlhdm, @@ -226,23 +226,23 @@ int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds, return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, "CXL"); -int __wrap_cxl_dvsec_rr_decode(struct device *dev, struct cxl_port *port, +int __wrap_cxl_dvsec_rr_decode(struct cxl_dev_state *cxlds, struct cxl_endpoint_dvsec_info *info) { int rc = 0, index; struct cxl_mock_ops *ops = get_cxl_mock_ops(&index); - if (ops && ops->is_mock_dev(dev)) + if (ops && ops->is_mock_dev(cxlds->dev)) rc = 0; else - rc = cxl_dvsec_rr_decode(dev, port, info); + rc = cxl_dvsec_rr_decode(cxlds, info); put_cxl_mock_ops(index); return rc; } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, "CXL"); struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port, struct device *dport_dev, @@ -266,7 +266,7 @@ struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port, return dport; } -EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, "CXL"); resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev, struct cxl_dport *dport) @@ -283,7 +283,7 @@ resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev, return component_reg_phys; } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, "CXL"); void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port) { @@ -297,7 +297,7 @@ void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port) cxl_endpoint_parse_cdat(port); put_cxl_mock_ops(index); } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, "CXL"); void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device *host) { @@ -309,8 +309,8 @@ void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device put_cxl_mock_ops(index); } -EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, CXL); +EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, "CXL"); MODULE_LICENSE("GPL v2"); -MODULE_IMPORT_NS(ACPI); -MODULE_IMPORT_NS(CXL); +MODULE_IMPORT_NS("ACPI"); +MODULE_IMPORT_NS("CXL"); diff --git a/tools/testing/ktest/examples/include/defaults.conf b/tools/testing/ktest/examples/include/defaults.conf index 63a1a83f4f0b..f6d8517a471e 100644 --- a/tools/testing/ktest/examples/include/defaults.conf +++ b/tools/testing/ktest/examples/include/defaults.conf @@ -46,7 +46,7 @@ CLEAR_LOG = 1 SSH_USER = root -# For accesing the machine, we will ssh to root@machine. +# For accessing the machine, we will ssh to root@machine. SSH := ssh ${SSH_USER}@${MACHINE} # Update this. The default here is ktest will ssh to the target box diff --git a/tools/testing/ktest/ktest.pl b/tools/testing/ktest/ktest.pl index dacad94e2be4..8c8da966c641 100755 --- a/tools/testing/ktest/ktest.pl +++ b/tools/testing/ktest/ktest.pl @@ -1245,7 +1245,7 @@ sub __read_config { # Config variables are only active while reading the # config and can be defined anywhere. They also ignore # TEST_START and DEFAULTS, but are skipped if they are in - # on of these sections that have SKIP defined. + # one of these sections that have SKIP defined. # The save variable can be # defined multiple times and the new one simply overrides # the previous one. @@ -2419,6 +2419,11 @@ sub get_version { return if ($have_version); doprint "$make kernelrelease ... "; $version = `$make -s kernelrelease | tail -1`; + if (!length($version)) { + run_command "$make allnoconfig" or return 0; + doprint "$make kernelrelease ... "; + $version = `$make -s kernelrelease | tail -1`; + } chomp($version); doprint "$version\n"; $have_version = 1; @@ -2960,8 +2965,6 @@ sub run_bisect_test { my $failed = 0; my $result; - my $output; - my $ret; $in_bisect = 1; diff --git a/tools/testing/kunit/configs/all_tests.config b/tools/testing/kunit/configs/all_tests.config index b3b00269a52a..b0049be00c70 100644 --- a/tools/testing/kunit/configs/all_tests.config +++ b/tools/testing/kunit/configs/all_tests.config @@ -38,9 +38,6 @@ CONFIG_IWLWIFI=y CONFIG_DAMON=y CONFIG_DAMON_VADDR=y CONFIG_DAMON_PADDR=y -CONFIG_DEBUG_FS=y -CONFIG_DAMON_DBGFS=y -CONFIG_DAMON_DBGFS_DEPRECATED=y CONFIG_REGMAP_BUILD=y diff --git a/tools/testing/kunit/kunit.py b/tools/testing/kunit/kunit.py index 676fa99a8b19..7f9ae55fd6d5 100755 --- a/tools/testing/kunit/kunit.py +++ b/tools/testing/kunit/kunit.py @@ -312,7 +312,16 @@ def massage_argv(argv: Sequence[str]) -> Sequence[str]: return list(map(massage_arg, argv)) def get_default_jobs() -> int: - return len(os.sched_getaffinity(0)) + if sys.version_info >= (3, 13): + if (ncpu := os.process_cpu_count()) is not None: + return ncpu + raise RuntimeError("os.process_cpu_count() returned None") + # See https://github.com/python/cpython/blob/b61fece/Lib/os.py#L1175-L1186. + if sys.platform != "darwin": + return len(os.sched_getaffinity(0)) + if (ncpu := os.cpu_count()) is not None: + return ncpu + raise RuntimeError("os.cpu_count() returned None") def add_common_opts(parser: argparse.ArgumentParser) -> None: parser.add_argument('--build_dir', diff --git a/tools/testing/kunit/kunit_kernel.py b/tools/testing/kunit/kunit_kernel.py index e76d7894b6c5..d30f90eae9a4 100644 --- a/tools/testing/kunit/kunit_kernel.py +++ b/tools/testing/kunit/kunit_kernel.py @@ -125,6 +125,9 @@ class LinuxSourceTreeOperationsQemu(LinuxSourceTreeOperations): '-append', ' '.join(params + [self._kernel_command_line]), '-no-reboot', '-nographic', + '-accel', 'kvm', + '-accel', 'hvf', + '-accel', 'tcg', '-serial', self._serial] + self._extra_qemu_params # Note: shlex.join() does what we want, but requires python 3.8+. print('Running tests with:\n$', ' '.join(shlex.quote(arg) for arg in qemu_command)) diff --git a/tools/testing/kunit/qemu_configs/arm64.py b/tools/testing/kunit/qemu_configs/arm64.py index d3ff27024755..5c44d3a87e6d 100644 --- a/tools/testing/kunit/qemu_configs/arm64.py +++ b/tools/testing/kunit/qemu_configs/arm64.py @@ -9,4 +9,4 @@ CONFIG_SERIAL_AMBA_PL011_CONSOLE=y''', qemu_arch='aarch64', kernel_path='arch/arm64/boot/Image.gz', kernel_command_line='console=ttyAMA0', - extra_qemu_params=['-machine', 'virt', '-cpu', 'max,pauth-impdef=on']) + extra_qemu_params=['-machine', 'virt', '-cpu', 'max']) diff --git a/tools/testing/nvdimm/test/ndtest.c b/tools/testing/nvdimm/test/ndtest.c index 892e990c034a..68a064ce598c 100644 --- a/tools/testing/nvdimm/test/ndtest.c +++ b/tools/testing/nvdimm/test/ndtest.c @@ -883,7 +883,7 @@ static const struct platform_device_id ndtest_id[] = { static struct platform_driver ndtest_driver = { .probe = ndtest_probe, - .remove_new = ndtest_remove, + .remove = ndtest_remove, .driver = { .name = KBUILD_MODNAME, }, diff --git a/tools/testing/radix-tree/multiorder.c b/tools/testing/radix-tree/multiorder.c index cffaf2245d4f..eaff1b036989 100644 --- a/tools/testing/radix-tree/multiorder.c +++ b/tools/testing/radix-tree/multiorder.c @@ -227,6 +227,7 @@ static void *load_creator(void *ptr) unsigned long index = (3 << RADIX_TREE_MAP_SHIFT) - (1 << order); item_insert_order(tree, index, order); + xa_set_mark(tree, index, XA_MARK_1); item_delete_rcu(tree, index); } } @@ -242,8 +243,11 @@ static void *load_worker(void *ptr) rcu_register_thread(); while (!stop_iteration) { + unsigned long find_index = (2 << RADIX_TREE_MAP_SHIFT) + 1; struct item *item = xa_load(ptr, index); assert(!xa_is_internal(item)); + item = xa_find(ptr, &find_index, index, XA_MARK_1); + assert(!xa_is_internal(item)); } rcu_unregister_thread(); diff --git a/tools/testing/selftests/Makefile b/tools/testing/selftests/Makefile index 2401e973c359..8daac70c2f9d 100644 --- a/tools/testing/selftests/Makefile +++ b/tools/testing/selftests/Makefile @@ -18,6 +18,7 @@ TARGETS += devices/error_logs TARGETS += devices/probe TARGETS += dmabuf-heaps TARGETS += drivers/dma-buf +TARGETS += drivers/ntsync TARGETS += drivers/s390x/uvdevice TARGETS += drivers/net TARGETS += drivers/net/bonding @@ -72,6 +73,7 @@ TARGETS += net/packetdrill TARGETS += net/rds TARGETS += net/tcp_ao TARGETS += nsfs +TARGETS += pci_endpoint TARGETS += pcie_bwctrl TARGETS += perf_events TARGETS += pidfd diff --git a/tools/testing/selftests/acct/acct_syscall.c b/tools/testing/selftests/acct/acct_syscall.c index e44e8fe1f4a3..87c044fb9293 100644 --- a/tools/testing/selftests/acct/acct_syscall.c +++ b/tools/testing/selftests/acct/acct_syscall.c @@ -24,7 +24,7 @@ int main(void) // Check if test is run a root if (geteuid()) { - ksft_test_result_skip("This test needs root to run!\n"); + ksft_exit_skip("This test needs root to run!\n"); return 1; } diff --git a/tools/testing/selftests/alsa/Makefile b/tools/testing/selftests/alsa/Makefile index 944279160fed..8dab90ad22bb 100644 --- a/tools/testing/selftests/alsa/Makefile +++ b/tools/testing/selftests/alsa/Makefile @@ -27,5 +27,5 @@ include ../lib.mk $(OUTPUT)/libatest.so: conf.c alsa-local.h $(CC) $(CFLAGS) -shared -fPIC $< $(LDLIBS) -o $@ -$(OUTPUT)/%: %.c $(TEST_GEN_PROGS_EXTENDED) alsa-local.h +$(OUTPUT)/%: %.c $(OUTPUT)/libatest.so alsa-local.h $(CC) $(CFLAGS) $< $(LDLIBS) -latest -o $@ diff --git a/tools/testing/selftests/arm64/abi/hwcap.c b/tools/testing/selftests/arm64/abi/hwcap.c index 0029ed9c5c9a..35f521e5f41c 100644 --- a/tools/testing/selftests/arm64/abi/hwcap.c +++ b/tools/testing/selftests/arm64/abi/hwcap.c @@ -46,6 +46,12 @@ static void atomics_sigill(void) asm volatile(".inst 0xb82003ff" : : : ); } +static void cmpbr_sigill(void) +{ + /* Not implemented, too complicated and unreliable anyway */ +} + + static void crc32_sigill(void) { /* CRC32W W0, W0, W1 */ @@ -82,6 +88,18 @@ static void f8fma_sigill(void) asm volatile(".inst 0xec0fc00"); } +static void f8mm4_sigill(void) +{ + /* FMMLA V0.4SH, V0.16B, V0.16B */ + asm volatile(".inst 0x6e00ec00"); +} + +static void f8mm8_sigill(void) +{ + /* FMMLA V0.4S, V0.16B, V0.16B */ + asm volatile(".inst 0x6e80ec00"); +} + static void faminmax_sigill(void) { /* FAMIN V0.4H, V0.4H, V0.4H */ @@ -98,6 +116,12 @@ static void fpmr_sigill(void) asm volatile("mrs x0, S3_3_C4_C4_2" : : : "x0"); } +static void fprcvt_sigill(void) +{ + /* FCVTAS S0, H0 */ + asm volatile(".inst 0x1efa0000"); +} + static void gcs_sigill(void) { unsigned long *gcspr; @@ -226,6 +250,42 @@ static void sme2p1_sigill(void) asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); } +static void sme2p2_sigill(void) +{ + /* SMSTART SM */ + asm volatile("msr S0_3_C4_C3_3, xzr" : : : ); + + /* UXTB Z0.D, P0/Z, Z0.D */ + asm volatile(".inst 0x4c1a000" : : : ); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + +static void sme_aes_sigill(void) +{ + /* SMSTART SM */ + asm volatile("msr S0_3_C4_C3_3, xzr" : : : ); + + /* AESD z0.b, z0.b, z0.b */ + asm volatile(".inst 0x4522e400" : : : "z0"); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + +static void sme_sbitperm_sigill(void) +{ + /* SMSTART SM */ + asm volatile("msr S0_3_C4_C3_3, xzr" : : : ); + + /* BDEP Z0.B, Z0.B, Z0.B */ + asm volatile(".inst 0x4500b400" : : : "z0"); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + static void smei16i32_sigill(void) { /* SMSTART */ @@ -339,8 +399,44 @@ static void smesf8fma_sigill(void) /* SMSTART */ asm volatile("msr S0_3_C4_C7_3, xzr" : : : ); - /* FMLALB V0.8H, V0.16B, V0.16B */ - asm volatile(".inst 0xec0fc00"); + /* FMLALB Z0.8H, Z0.B, Z0.B */ + asm volatile(".inst 0x64205000"); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + +static void smesfexpa_sigill(void) +{ + /* SMSTART */ + asm volatile("msr S0_3_C4_C7_3, xzr" : : : ); + + /* FEXPA Z0.D, Z0.D */ + asm volatile(".inst 0x04e0b800"); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + +static void smesmop4_sigill(void) +{ + /* SMSTART */ + asm volatile("msr S0_3_C4_C7_3, xzr" : : : ); + + /* SMOP4A ZA0.S, Z0.B, { Z0.B - Z1.B } */ + asm volatile(".inst 0x80108000"); + + /* SMSTOP */ + asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); +} + +static void smestmop_sigill(void) +{ + /* SMSTART */ + asm volatile("msr S0_3_C4_C7_3, xzr" : : : ); + + /* STMOPA ZA0.S, { Z0.H - Z1.H }, Z0.H, Z20[0] */ + asm volatile(".inst 0x80408008"); /* SMSTOP */ asm volatile("msr S0_3_C4_C6_3, xzr" : : : ); @@ -364,18 +460,42 @@ static void sve2p1_sigill(void) asm volatile(".inst 0x65000000" : : : "z0"); } +static void sve2p2_sigill(void) +{ + /* NOT Z0.D, P0/Z, Z0.D */ + asm volatile(".inst 0x4cea000" : : : "z0"); +} + static void sveaes_sigill(void) { /* AESD z0.b, z0.b, z0.b */ asm volatile(".inst 0x4522e400" : : : "z0"); } +static void sveaes2_sigill(void) +{ + /* AESD {Z0.B - Z1.B }, { Z0.B - Z1.B }, Z0.Q */ + asm volatile(".inst 0x4522ec00" : : : "z0"); +} + static void sveb16b16_sigill(void) { /* BFADD Z0.H, Z0.H, Z0.H */ asm volatile(".inst 0x65000000" : : : ); } +static void svebfscale_sigill(void) +{ + /* BFSCALE Z0.H, P0/M, Z0.H, Z0.H */ + asm volatile(".inst 0x65098000" : : : "z0"); +} + +static void svef16mm_sigill(void) +{ + /* FMMLA Z0.S, Z0.H, Z0.H */ + asm volatile(".inst 0x6420e400"); +} + static void svepmull_sigill(void) { /* PMULLB Z0.Q, Z0.D, Z0.D */ @@ -394,6 +514,12 @@ static void svesha3_sigill(void) asm volatile(".inst 0x4203800" : : : "z0"); } +static void sveeltperm_sigill(void) +{ + /* COMPACT Z0.B, P0, Z0.B */ + asm volatile(".inst 0x5218000" : : : "x0"); +} + static void svesm4_sigill(void) { /* SM4E Z0.S, Z0.S, Z0.S */ @@ -470,6 +596,13 @@ static const struct hwcap_data { .sigill_fn = aes_sigill, }, { + .name = "CMPBR", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_CMPBR, + .cpuinfo = "cmpbr", + .sigill_fn = cmpbr_sigill, + }, + { .name = "CRC32", .at_hwcap = AT_HWCAP, .hwcap_bit = HWCAP_CRC32, @@ -524,6 +657,20 @@ static const struct hwcap_data { .sigill_fn = f8fma_sigill, }, { + .name = "F8MM8", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_F8MM8, + .cpuinfo = "f8mm8", + .sigill_fn = f8mm8_sigill, + }, + { + .name = "F8MM4", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_F8MM4, + .cpuinfo = "f8mm4", + .sigill_fn = f8mm4_sigill, + }, + { .name = "FAMINMAX", .at_hwcap = AT_HWCAP2, .hwcap_bit = HWCAP2_FAMINMAX, @@ -546,6 +693,13 @@ static const struct hwcap_data { .sigill_reliable = true, }, { + .name = "FPRCVT", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_FPRCVT, + .cpuinfo = "fprcvt", + .sigill_fn = fprcvt_sigill, + }, + { .name = "GCS", .at_hwcap = AT_HWCAP, .hwcap_bit = HWCAP_GCS, @@ -692,6 +846,20 @@ static const struct hwcap_data { .sigill_fn = sme2p1_sigill, }, { + .name = "SME 2.2", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME2P2, + .cpuinfo = "sme2p2", + .sigill_fn = sme2p2_sigill, + }, + { + .name = "SME AES", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME_AES, + .cpuinfo = "smeaes", + .sigill_fn = sme_aes_sigill, + }, + { .name = "SME I16I32", .at_hwcap = AT_HWCAP2, .hwcap_bit = HWCAP2_SME_I16I32, @@ -741,6 +909,13 @@ static const struct hwcap_data { .sigill_fn = smelutv2_sigill, }, { + .name = "SME SBITPERM", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME_SBITPERM, + .cpuinfo = "smesbitperm", + .sigill_fn = sme_sbitperm_sigill, + }, + { .name = "SME SF8FMA", .at_hwcap = AT_HWCAP2, .hwcap_bit = HWCAP2_SME_SF8FMA, @@ -762,6 +937,27 @@ static const struct hwcap_data { .sigill_fn = smesf8dp4_sigill, }, { + .name = "SME SFEXPA", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME_SFEXPA, + .cpuinfo = "smesfexpa", + .sigill_fn = smesfexpa_sigill, + }, + { + .name = "SME SMOP4", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME_SMOP4, + .cpuinfo = "smesmop4", + .sigill_fn = smesmop4_sigill, + }, + { + .name = "SME STMOP", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SME_STMOP, + .cpuinfo = "smestmop", + .sigill_fn = smestmop_sigill, + }, + { .name = "SVE", .at_hwcap = AT_HWCAP, .hwcap_bit = HWCAP_SVE, @@ -784,6 +980,13 @@ static const struct hwcap_data { .sigill_fn = sve2p1_sigill, }, { + .name = "SVE 2.2", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SVE2P2, + .cpuinfo = "sve2p2", + .sigill_fn = sve2p2_sigill, + }, + { .name = "SVE AES", .at_hwcap = AT_HWCAP2, .hwcap_bit = HWCAP2_SVEAES, @@ -791,6 +994,34 @@ static const struct hwcap_data { .sigill_fn = sveaes_sigill, }, { + .name = "SVE AES2", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SVE_AES2, + .cpuinfo = "sveaes2", + .sigill_fn = sveaes2_sigill, + }, + { + .name = "SVE BFSCALE", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SVE_BFSCALE, + .cpuinfo = "svebfscale", + .sigill_fn = svebfscale_sigill, + }, + { + .name = "SVE ELTPERM", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SVE_ELTPERM, + .cpuinfo = "sveeltperm", + .sigill_fn = sveeltperm_sigill, + }, + { + .name = "SVE F16MM", + .at_hwcap = AT_HWCAP, + .hwcap_bit = HWCAP_SVE_F16MM, + .cpuinfo = "svef16mm", + .sigill_fn = svef16mm_sigill, + }, + { .name = "SVE2 B16B16", .at_hwcap = AT_HWCAP2, .hwcap_bit = HWCAP2_SVE_B16B16, diff --git a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S index df3230fdac39..66ab2e0bae5f 100644 --- a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S +++ b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S @@ -81,32 +81,31 @@ do_syscall: stp x27, x28, [sp, #96] // Set SVCR if we're doing SME - cbz x1, 1f + cbz x1, load_gpr adrp x2, svcr_in ldr x2, [x2, :lo12:svcr_in] msr S3_3_C4_C2_2, x2 -1: // Load ZA and ZT0 if enabled - uses x12 as scratch due to SME LDR - tbz x2, #SVCR_ZA_SHIFT, 1f + tbz x2, #SVCR_ZA_SHIFT, load_gpr mov w12, #0 ldr x2, =za_in -2: _ldr_za 12, 2 +1: _ldr_za 12, 2 add x2, x2, x1 add x12, x12, #1 cmp x1, x12 - bne 2b + bne 1b // ZT0 mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1 ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \ #ID_AA64SMFR0_EL1_SMEver_WIDTH - cbz x2, 1f + cbz x2, load_gpr adrp x2, zt_in add x2, x2, :lo12:zt_in _ldr_zt 2 -1: +load_gpr: // Load GPRs x8-x28, and save our SP/FP for later comparison ldr x2, =gpr_in add x2, x2, #64 @@ -125,9 +124,9 @@ do_syscall: str x30, [x2], #8 // LR // Load FPRs if we're not doing neither SVE nor streaming SVE - cbnz x0, 1f + cbnz x0, check_sve_in ldr x2, =svcr_in - tbnz x2, #SVCR_SM_SHIFT, 1f + tbnz x2, #SVCR_SM_SHIFT, check_sve_in ldr x2, =fpr_in ldp q0, q1, [x2] @@ -148,8 +147,8 @@ do_syscall: ldp q30, q31, [x2, #16 * 30] b 2f -1: +check_sve_in: // Load the SVE registers if we're doing SVE/SME ldr x2, =z_in @@ -256,32 +255,31 @@ do_syscall: stp q30, q31, [x2, #16 * 30] // Save SVCR if we're doing SME - cbz x1, 1f + cbz x1, check_sve_out mrs x2, S3_3_C4_C2_2 adrp x3, svcr_out str x2, [x3, :lo12:svcr_out] -1: // Save ZA if it's enabled - uses x12 as scratch due to SME STR - tbz x2, #SVCR_ZA_SHIFT, 1f + tbz x2, #SVCR_ZA_SHIFT, check_sve_out mov w12, #0 ldr x2, =za_out -2: _str_za 12, 2 +1: _str_za 12, 2 add x2, x2, x1 add x12, x12, #1 cmp x1, x12 - bne 2b + bne 1b // ZT0 mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1 ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \ #ID_AA64SMFR0_EL1_SMEver_WIDTH - cbz x2, 1f + cbz x2, check_sve_out adrp x2, zt_out add x2, x2, :lo12:zt_out _str_zt 2 -1: +check_sve_out: // Save the SVE state if we have some cbz x0, 1f diff --git a/tools/testing/selftests/arm64/fp/kernel-test.c b/tools/testing/selftests/arm64/fp/kernel-test.c index 859345379044..348e8bef62c7 100644 --- a/tools/testing/selftests/arm64/fp/kernel-test.c +++ b/tools/testing/selftests/arm64/fp/kernel-test.c @@ -46,8 +46,7 @@ static void handle_kick_signal(int sig, siginfo_t *info, void *context) } static char *drivers[] = { - "crct10dif-arm64-ce", - /* "crct10dif-arm64-neon", - Same priority as generic */ + "crct10dif-arm64", "sha1-ce", "sha224-arm64", "sha224-arm64-neon", diff --git a/tools/testing/selftests/bpf/.gitignore b/tools/testing/selftests/bpf/.gitignore index c2a1842c3d8b..e2a2c46c008b 100644 --- a/tools/testing/selftests/bpf/.gitignore +++ b/tools/testing/selftests/bpf/.gitignore @@ -5,7 +5,6 @@ bpf-syscall* test_verifier test_maps test_lru_map -test_lpm_map test_tag FEATURE-DUMP.libbpf FEATURE-DUMP.selftests @@ -19,7 +18,6 @@ feature urandom_read test_sockmap test_lirc_mode2_user -test_flow_dissector flow_dissector_load test_tcpnotify_user test_libbpf diff --git a/tools/testing/selftests/bpf/Makefile b/tools/testing/selftests/bpf/Makefile index 6ad3b1ba1920..87551628e112 100644 --- a/tools/testing/selftests/bpf/Makefile +++ b/tools/testing/selftests/bpf/Makefile @@ -41,7 +41,7 @@ srctree := $(patsubst %/,%,$(dir $(srctree))) srctree := $(patsubst %/,%,$(dir $(srctree))) endif -CFLAGS += -g $(OPT_FLAGS) -rdynamic \ +CFLAGS += -g $(OPT_FLAGS) -rdynamic -std=gnu11 \ -Wall -Werror -fno-omit-frame-pointer \ $(GENFLAGS) $(SAN_CFLAGS) $(LIBELF_CFLAGS) \ -I$(CURDIR) -I$(INCLUDE_DIR) -I$(GENDIR) -I$(LIBDIR) \ @@ -54,21 +54,6 @@ PCAP_LIBS := $(shell $(PKG_CONFIG) --libs libpcap 2>/dev/null) LDLIBS += $(PCAP_LIBS) CFLAGS += $(PCAP_CFLAGS) -# The following tests perform type punning and they may break strict -# aliasing rules, which are exploited by both GCC and clang by default -# while optimizing. This can lead to broken programs. -progs/bind4_prog.c-CFLAGS := -fno-strict-aliasing -progs/bind6_prog.c-CFLAGS := -fno-strict-aliasing -progs/dynptr_fail.c-CFLAGS := -fno-strict-aliasing -progs/linked_list_fail.c-CFLAGS := -fno-strict-aliasing -progs/map_kptr_fail.c-CFLAGS := -fno-strict-aliasing -progs/syscall.c-CFLAGS := -fno-strict-aliasing -progs/test_pkt_md_access.c-CFLAGS := -fno-strict-aliasing -progs/test_sk_lookup.c-CFLAGS := -fno-strict-aliasing -progs/timer_crash.c-CFLAGS := -fno-strict-aliasing -progs/test_global_func9.c-CFLAGS := -fno-strict-aliasing -progs/verifier_nocsr.c-CFLAGS := -fno-strict-aliasing - # Some utility functions use LLVM libraries jit_disasm_helpers.c-CFLAGS = $(LLVM_CFLAGS) @@ -83,7 +68,7 @@ CLANG_CPUV4 := 1 endif # Order correspond to 'make run_tests' order -TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_lpm_map test_progs \ +TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_progs \ test_sockmap \ test_tcpnotify_user test_sysctl \ test_progs-no_alu32 @@ -103,18 +88,6 @@ progs/btf_dump_test_case_packing.c-bpf_gcc-CFLAGS := -Wno-error progs/btf_dump_test_case_padding.c-bpf_gcc-CFLAGS := -Wno-error progs/btf_dump_test_case_syntax.c-bpf_gcc-CFLAGS := -Wno-error -# The following tests do type-punning, via the __imm_insn macro, from -# `struct bpf_insn' to long and then uses the value. This triggers an -# "is used uninitialized" warning in GCC due to strict-aliasing -# rules. -progs/verifier_ref_tracking.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_unpriv.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_cgroup_storage.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_ld_ind.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_map_ret_val.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_spill_fill.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_subprog_precision.c-bpf_gcc-CFLAGS := -fno-strict-aliasing -progs/verifier_uninit.c-bpf_gcc-CFLAGS := -fno-strict-aliasing endif ifneq ($(CLANG_CPUV4),) @@ -127,13 +100,10 @@ TEST_FILES = xsk_prereqs.sh $(wildcard progs/btf_dump_test_case_*.c) # Order correspond to 'make run_tests' order TEST_PROGS := test_kmod.sh \ - test_xdp_redirect.sh \ test_xdp_redirect_multi.sh \ - test_xdp_meta.sh \ test_tunnel.sh \ test_lwt_seg6local.sh \ test_lirc_mode2.sh \ - test_flow_dissector.sh \ test_xdp_vlan_mode_generic.sh \ test_xdp_vlan_mode_native.sh \ test_lwt_ip_encap.sh \ @@ -151,17 +121,16 @@ TEST_PROGS_EXTENDED := with_addr.sh \ with_tunnels.sh ima_setup.sh verify_sig_setup.sh \ test_xdp_vlan.sh test_bpftool.py +TEST_KMODS := bpf_testmod.ko bpf_test_no_cfi.ko bpf_test_modorder_x.ko \ + bpf_test_modorder_y.ko +TEST_KMOD_TARGETS = $(addprefix $(OUTPUT)/,$(TEST_KMODS)) + # Compile but not part of 'make run_tests' TEST_GEN_PROGS_EXTENDED = \ bench \ - bpf_testmod.ko \ - bpf_test_modorder_x.ko \ - bpf_test_modorder_y.ko \ - bpf_test_no_cfi.ko \ flow_dissector_load \ runqslower \ test_cpp \ - test_flow_dissector \ test_lirc_mode2_user \ veristat \ xdp_features \ @@ -184,8 +153,9 @@ override define CLEAN $(Q)$(RM) -r $(TEST_GEN_PROGS) $(Q)$(RM) -r $(TEST_GEN_PROGS_EXTENDED) $(Q)$(RM) -r $(TEST_GEN_FILES) + $(Q)$(RM) -r $(TEST_KMODS) $(Q)$(RM) -r $(EXTRA_CLEAN) - $(Q)$(MAKE) -C bpf_testmod clean + $(Q)$(MAKE) -C test_kmods clean $(Q)$(MAKE) docs-clean endef @@ -203,9 +173,9 @@ ifeq ($(shell expr $(MAKE_VERSION) \>= 4.4), 1) $(let OUTPUT,$(OUTPUT)/,\ $(eval include ../../../build/Makefile.feature)) else -OUTPUT := $(OUTPUT)/ +override OUTPUT := $(OUTPUT)/ $(eval include ../../../build/Makefile.feature) -OUTPUT := $(patsubst %/,%,$(OUTPUT)) +override OUTPUT := $(patsubst %/,%,$(OUTPUT)) endif endif @@ -251,7 +221,7 @@ endif # to build individual tests. # NOTE: Semicolon at the end is critical to override lib.mk's default static # rule for binaries. -$(notdir $(TEST_GEN_PROGS) \ +$(notdir $(TEST_GEN_PROGS) $(TEST_KMODS) \ $(TEST_GEN_PROGS_EXTENDED)): %: $(OUTPUT)/% ; # sort removes libbpf duplicates when not cross-building @@ -305,37 +275,19 @@ $(OUTPUT)/sign-file: ../../../../scripts/sign-file.c $< -o $@ \ $(shell $(PKG_CONFIG) --libs libcrypto 2> /dev/null || echo -lcrypto) -$(OUTPUT)/bpf_testmod.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_testmod/Makefile bpf_testmod/*.[ch]) - $(call msg,MOD,,$@) - $(Q)$(RM) bpf_testmod/bpf_testmod.ko # force re-compilation - $(Q)$(MAKE) $(submake_extras) -C bpf_testmod \ - RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \ - EXTRA_CFLAGS='' EXTRA_LDFLAGS='' - $(Q)cp bpf_testmod/bpf_testmod.ko $@ - -$(OUTPUT)/bpf_test_no_cfi.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_no_cfi/Makefile bpf_test_no_cfi/*.[ch]) - $(call msg,MOD,,$@) - $(Q)$(RM) bpf_test_no_cfi/bpf_test_no_cfi.ko # force re-compilation - $(Q)$(MAKE) $(submake_extras) -C bpf_test_no_cfi \ - RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \ +# This should really be a grouped target, but make versions before 4.3 don't +# support that for regular rules. However, pattern matching rules are implicitly +# treated as grouped even with older versions of make, so as a workaround, the +# subst() turns the rule into a pattern matching rule +$(addprefix test_kmods/,$(subst .ko,%ko,$(TEST_KMODS))): $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard test_kmods/Makefile test_kmods/*.[ch]) + $(Q)$(RM) test_kmods/*.ko test_kmods/*.mod.o # force re-compilation + $(Q)$(MAKE) $(submake_extras) -C test_kmods \ + RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \ EXTRA_CFLAGS='' EXTRA_LDFLAGS='' - $(Q)cp bpf_test_no_cfi/bpf_test_no_cfi.ko $@ -$(OUTPUT)/bpf_test_modorder_x.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_modorder_x/Makefile bpf_test_modorder_x/*.[ch]) +$(TEST_KMOD_TARGETS): $(addprefix test_kmods/,$(TEST_KMODS)) $(call msg,MOD,,$@) - $(Q)$(RM) bpf_test_modorder_x/bpf_test_modorder_x.ko # force re-compilation - $(Q)$(MAKE) $(submake_extras) -C bpf_test_modorder_x \ - RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \ - EXTRA_CFLAGS='' EXTRA_LDFLAGS='' - $(Q)cp bpf_test_modorder_x/bpf_test_modorder_x.ko $@ - -$(OUTPUT)/bpf_test_modorder_y.ko: $(VMLINUX_BTF) $(RESOLVE_BTFIDS) $(wildcard bpf_test_modorder_y/Makefile bpf_test_modorder_y/*.[ch]) - $(call msg,MOD,,$@) - $(Q)$(RM) bpf_test_modorder_y/bpf_test_modorder_y.ko # force re-compilation - $(Q)$(MAKE) $(submake_extras) -C bpf_test_modorder_y \ - RESOLVE_BTFIDS=$(RESOLVE_BTFIDS) \ - EXTRA_CFLAGS='' EXTRA_LDFLAGS='' - $(Q)cp bpf_test_modorder_y/bpf_test_modorder_y.ko $@ + $(Q)cp test_kmods/$(@F) $@ DEFAULT_BPFTOOL := $(HOST_SCRATCH_DIR)/sbin/bpftool @@ -480,10 +432,10 @@ $(shell $(1) $(2) -dM -E - </dev/null | grep -E 'MIPS(EL|EB)|_MIPS_SZ(PTR|LONG) endef # Determine target endianness. -IS_LITTLE_ENDIAN = $(shell $(CC) -dM -E - </dev/null | \ +IS_LITTLE_ENDIAN := $(shell $(CC) -dM -E - </dev/null | \ grep 'define __BYTE_ORDER__ __ORDER_LITTLE_ENDIAN__') -MENDIAN=$(if $(IS_LITTLE_ENDIAN),-mlittle-endian,-mbig-endian) -BPF_TARGET_ENDIAN=$(if $(IS_LITTLE_ENDIAN),--target=bpfel,--target=bpfeb) +MENDIAN:=$(if $(IS_LITTLE_ENDIAN),-mlittle-endian,-mbig-endian) +BPF_TARGET_ENDIAN:=$(if $(IS_LITTLE_ENDIAN),--target=bpfel,--target=bpfeb) ifneq ($(CROSS_COMPILE),) CLANG_TARGET_ARCH = --target=$(notdir $(CROSS_COMPILE:%-=%)) @@ -493,6 +445,8 @@ CLANG_SYS_INCLUDES = $(call get_sys_includes,$(CLANG),$(CLANG_TARGET_ARCH)) BPF_CFLAGS = -g -Wall -Werror -D__TARGET_ARCH_$(SRCARCH) $(MENDIAN) \ -I$(INCLUDE_DIR) -I$(CURDIR) -I$(APIDIR) \ -I$(abspath $(OUTPUT)/../usr/include) \ + -std=gnu11 \ + -fno-strict-aliasing \ -Wno-compare-distinct-pointer-types # TODO: enable me -Wsign-compare @@ -760,14 +714,12 @@ TRUNNER_EXTRA_SOURCES := test_progs.c \ json_writer.c \ flow_dissector_load.h \ ip_check_defrag_frags.h -TRUNNER_EXTRA_FILES := $(OUTPUT)/urandom_read $(OUTPUT)/bpf_testmod.ko \ - $(OUTPUT)/bpf_test_no_cfi.ko \ - $(OUTPUT)/bpf_test_modorder_x.ko \ - $(OUTPUT)/bpf_test_modorder_y.ko \ +TRUNNER_EXTRA_FILES := $(OUTPUT)/urandom_read \ $(OUTPUT)/liburandom_read.so \ $(OUTPUT)/xdp_synproxy \ $(OUTPUT)/sign-file \ $(OUTPUT)/uprobe_multi \ + $(TEST_KMOD_TARGETS) \ ima_setup.sh \ verify_sig_setup.sh \ $(wildcard progs/btf_dump_test_case_*.c) \ @@ -834,9 +786,12 @@ $(OUTPUT)/xdp_features: xdp_features.c $(OUTPUT)/network_helpers.o $(OUTPUT)/xdp $(Q)$(CC) $(CFLAGS) $(filter %.a %.o %.c,$^) $(LDLIBS) -o $@ # Make sure we are able to include and link libbpf against c++. +CXXFLAGS += $(CFLAGS) +CXXFLAGS := $(subst -D_GNU_SOURCE=,,$(CXXFLAGS)) +CXXFLAGS := $(subst -std=gnu11,-std=gnu++11,$(CXXFLAGS)) $(OUTPUT)/test_cpp: test_cpp.cpp $(OUTPUT)/test_core_extern.skel.h $(BPFOBJ) $(call msg,CXX,,$@) - $(Q)$(CXX) $(subst -D_GNU_SOURCE=,,$(CFLAGS)) $(filter %.a %.o %.cpp,$^) $(LDLIBS) -o $@ + $(Q)$(CXX) $(CXXFLAGS) $(filter %.a %.o %.cpp,$^) $(LDLIBS) -o $@ # Benchmark runner $(OUTPUT)/bench_%.o: benchs/bench_%.c bench.h $(BPFOBJ) @@ -894,12 +849,9 @@ $(OUTPUT)/uprobe_multi: uprobe_multi.c uprobe_multi.ld EXTRA_CLEAN := $(SCRATCH_DIR) $(HOST_SCRATCH_DIR) \ prog_tests/tests.h map_tests/tests.h verifier/tests.h \ - feature bpftool \ + feature bpftool $(TEST_KMOD_TARGETS) \ $(addprefix $(OUTPUT)/,*.o *.d *.skel.h *.lskel.h *.subskel.h \ - no_alu32 cpuv4 bpf_gcc bpf_testmod.ko \ - bpf_test_no_cfi.ko \ - bpf_test_modorder_x.ko \ - bpf_test_modorder_y.ko \ + no_alu32 cpuv4 bpf_gcc \ liburandom_read.so) \ $(OUTPUT)/FEATURE-DUMP.selftests diff --git a/tools/testing/selftests/bpf/Makefile.docs b/tools/testing/selftests/bpf/Makefile.docs index eb6a4fea8c79..f7f9e7088bb3 100644 --- a/tools/testing/selftests/bpf/Makefile.docs +++ b/tools/testing/selftests/bpf/Makefile.docs @@ -7,12 +7,6 @@ INSTALL ?= install RM ?= rm -f RMDIR ?= rmdir --ignore-fail-on-non-empty -ifeq ($(V),1) - Q = -else - Q = @ -endif - prefix ?= /usr/local mandir ?= $(prefix)/man man2dir = $(mandir)/man2 diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile b/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile deleted file mode 100644 index 40b25b98ad1b..000000000000 --- a/tools/testing/selftests/bpf/bpf_test_modorder_x/Makefile +++ /dev/null @@ -1,19 +0,0 @@ -BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST))))) -KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..) - -ifeq ($(V),1) -Q = -else -Q = @ -endif - -MODULES = bpf_test_modorder_x.ko - -obj-m += bpf_test_modorder_x.o - -all: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules - -clean: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean - diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile b/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile deleted file mode 100644 index 52c3ab9d84e2..000000000000 --- a/tools/testing/selftests/bpf/bpf_test_modorder_y/Makefile +++ /dev/null @@ -1,19 +0,0 @@ -BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST))))) -KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..) - -ifeq ($(V),1) -Q = -else -Q = @ -endif - -MODULES = bpf_test_modorder_y.ko - -obj-m += bpf_test_modorder_y.o - -all: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules - -clean: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean - diff --git a/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile b/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile deleted file mode 100644 index ed5143b79edf..000000000000 --- a/tools/testing/selftests/bpf/bpf_test_no_cfi/Makefile +++ /dev/null @@ -1,19 +0,0 @@ -BPF_TEST_NO_CFI_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST))))) -KDIR ?= $(abspath $(BPF_TEST_NO_CFI_DIR)/../../../../..) - -ifeq ($(V),1) -Q = -else -Q = @ -endif - -MODULES = bpf_test_no_cfi.ko - -obj-m += bpf_test_no_cfi.o - -all: - +$(Q)make -C $(KDIR) M=$(BPF_TEST_NO_CFI_DIR) modules - -clean: - +$(Q)make -C $(KDIR) M=$(BPF_TEST_NO_CFI_DIR) clean - diff --git a/tools/testing/selftests/bpf/bpf_testmod/Makefile b/tools/testing/selftests/bpf/bpf_testmod/Makefile deleted file mode 100644 index 15cb36c4483a..000000000000 --- a/tools/testing/selftests/bpf/bpf_testmod/Makefile +++ /dev/null @@ -1,20 +0,0 @@ -BPF_TESTMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST))))) -KDIR ?= $(abspath $(BPF_TESTMOD_DIR)/../../../../..) - -ifeq ($(V),1) -Q = -else -Q = @ -endif - -MODULES = bpf_testmod.ko - -obj-m += bpf_testmod.o -CFLAGS_bpf_testmod.o = -I$(src) - -all: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) modules - -clean: - +$(Q)make -C $(KDIR) M=$(BPF_TESTMOD_DIR) clean - diff --git a/tools/testing/selftests/bpf/config b/tools/testing/selftests/bpf/config index 4ca84c8d9116..c378d5d07e02 100644 --- a/tools/testing/selftests/bpf/config +++ b/tools/testing/selftests/bpf/config @@ -58,6 +58,7 @@ CONFIG_MPLS=y CONFIG_MPLS_IPTUNNEL=y CONFIG_MPLS_ROUTING=y CONFIG_MPTCP=y +CONFIG_NET_ACT_GACT=y CONFIG_NET_ACT_SKBMOD=y CONFIG_NET_CLS=y CONFIG_NET_CLS_ACT=y diff --git a/tools/testing/selftests/bpf/test_lpm_map.c b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c index d98c72dc563e..d32e4edac930 100644 --- a/tools/testing/selftests/bpf/test_lpm_map.c +++ b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c @@ -20,10 +20,12 @@ #include <string.h> #include <time.h> #include <unistd.h> +#include <endian.h> #include <arpa/inet.h> #include <sys/time.h> #include <bpf/bpf.h> +#include <test_maps.h> #include "bpf_util.h" @@ -33,6 +35,22 @@ struct tlpm_node { uint8_t key[]; }; +struct lpm_trie_bytes_key { + union { + struct bpf_lpm_trie_key_hdr hdr; + __u32 prefixlen; + }; + unsigned char data[8]; +}; + +struct lpm_trie_int_key { + union { + struct bpf_lpm_trie_key_hdr hdr; + __u32 prefixlen; + }; + unsigned int data; +}; + static struct tlpm_node *tlpm_match(struct tlpm_node *list, const uint8_t *key, size_t n_bits); @@ -223,7 +241,7 @@ static void test_lpm_map(int keysize) n_matches = 0; n_matches_after_delete = 0; n_nodes = 1 << 8; - n_lookups = 1 << 16; + n_lookups = 1 << 9; data = alloca(keysize); memset(data, 0, keysize); @@ -770,16 +788,385 @@ static void test_lpm_multi_thread(void) close(map_fd); } -int main(void) +static int lpm_trie_create(unsigned int key_size, unsigned int value_size, unsigned int max_entries) +{ + LIBBPF_OPTS(bpf_map_create_opts, opts); + int fd; + + opts.map_flags = BPF_F_NO_PREALLOC; + fd = bpf_map_create(BPF_MAP_TYPE_LPM_TRIE, "lpm_trie", key_size, value_size, max_entries, + &opts); + CHECK(fd < 0, "bpf_map_create", "error %d\n", errno); + + return fd; +} + +static void test_lpm_trie_update_flags(void) +{ + struct lpm_trie_int_key key; + unsigned int value, got; + int fd, err; + + fd = lpm_trie_create(sizeof(key), sizeof(value), 3); + + /* invalid flags (Error) */ + key.prefixlen = 32; + key.data = 0; + value = 0; + err = bpf_map_update_elem(fd, &key, &value, BPF_F_LOCK); + CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err); + + /* invalid flags (Error) */ + key.prefixlen = 32; + key.data = 0; + value = 0; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST | BPF_EXIST); + CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err); + + /* overwrite an empty qp-trie (Error) */ + key.prefixlen = 32; + key.data = 0; + value = 2; + err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST); + CHECK(err != -ENOENT, "overwrite empty qp-trie", "error %d\n", err); + + /* add a new node */ + key.prefixlen = 16; + key.data = 0; + value = 1; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* add the same node as new node (Error) */ + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err != -EEXIST, "add new elem again", "error %d\n", err); + + /* overwrite the existed node */ + value = 4; + err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST); + CHECK(err, "overwrite elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* overwrite the node */ + value = 1; + err = bpf_map_update_elem(fd, &key, &value, BPF_ANY); + CHECK(err, "update elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* overwrite a non-existent node which is the prefix of the first + * node (Error). + */ + key.prefixlen = 8; + key.data = 0; + value = 2; + err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST); + CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err); + + /* add a new node which is the prefix of the first node */ + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup key", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* add another new node which will be the sibling of the first node */ + key.prefixlen = 9; + key.data = htobe32(1 << 23); + value = 5; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup key", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* overwrite the third node */ + value = 3; + err = bpf_map_update_elem(fd, &key, &value, BPF_ANY); + CHECK(err, "overwrite elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup key", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* delete the second node to make it an intermediate node */ + key.prefixlen = 8; + key.data = 0; + err = bpf_map_delete_elem(fd, &key); + CHECK(err, "del elem", "error %d\n", err); + + /* overwrite the intermediate node (Error) */ + value = 2; + err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST); + CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err); + + close(fd); +} + +static void test_lpm_trie_update_full_map(void) +{ + struct lpm_trie_int_key key; + int value, got; + int fd, err; + + fd = lpm_trie_create(sizeof(key), sizeof(value), 3); + + /* add a new node */ + key.prefixlen = 16; + key.data = 0; + value = 0; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* add new node */ + key.prefixlen = 8; + key.data = 0; + value = 1; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* add new node */ + key.prefixlen = 9; + key.data = htobe32(1 << 23); + value = 2; + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add new elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* try to add more node (Error) */ + key.prefixlen = 32; + key.data = 0; + value = 3; + err = bpf_map_update_elem(fd, &key, &value, BPF_ANY); + CHECK(err != -ENOSPC, "add to full trie", "error %d\n", err); + + /* update the value of an existed node with BPF_EXIST */ + key.prefixlen = 16; + key.data = 0; + value = 4; + err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST); + CHECK(err, "overwrite elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + /* update the value of an existed node with BPF_ANY */ + key.prefixlen = 9; + key.data = htobe32(1 << 23); + value = 5; + err = bpf_map_update_elem(fd, &key, &value, BPF_ANY); + CHECK(err, "overwrite elem", "error %d\n", err); + got = 0; + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "error %d\n", err); + CHECK(got != value, "check value", "got %d exp %d\n", got, value); + + close(fd); +} + +static int cmp_str(const void *a, const void *b) +{ + const char *str_a = *(const char **)a, *str_b = *(const char **)b; + + return strcmp(str_a, str_b); +} + +/* Save strings in LPM trie. The trailing '\0' for each string will be + * accounted in the prefixlen. The strings returned during the iteration + * should be sorted as expected. + */ +static void test_lpm_trie_iterate_strs(void) +{ + static const char * const keys[] = { + "ab", "abO", "abc", "abo", "abS", "abcd", + }; + const char *sorted_keys[ARRAY_SIZE(keys)]; + struct lpm_trie_bytes_key key, next_key; + unsigned int value, got, i, j, len; + struct lpm_trie_bytes_key *cur; + int fd, err; + + fd = lpm_trie_create(sizeof(key), sizeof(value), ARRAY_SIZE(keys)); + + for (i = 0; i < ARRAY_SIZE(keys); i++) { + unsigned int flags; + + /* add i-th element */ + flags = i % 2 ? BPF_NOEXIST : 0; + len = strlen(keys[i]); + /* include the trailing '\0' */ + key.prefixlen = (len + 1) * 8; + memset(key.data, 0, sizeof(key.data)); + memcpy(key.data, keys[i], len); + value = i + 100; + err = bpf_map_update_elem(fd, &key, &value, flags); + CHECK(err, "add elem", "#%u error %d\n", i, err); + + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "#%u error %d\n", i, err); + CHECK(got != value, "lookup elem", "#%u expect %u got %u\n", i, value, got); + + /* re-add i-th element (Error) */ + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err != -EEXIST, "re-add elem", "#%u error %d\n", i, err); + + /* Overwrite i-th element */ + flags = i % 2 ? 0 : BPF_EXIST; + value = i; + err = bpf_map_update_elem(fd, &key, &value, flags); + CHECK(err, "update elem", "error %d\n", err); + + /* Lookup #[0~i] elements */ + for (j = 0; j <= i; j++) { + len = strlen(keys[j]); + key.prefixlen = (len + 1) * 8; + memset(key.data, 0, sizeof(key.data)); + memcpy(key.data, keys[j], len); + err = bpf_map_lookup_elem(fd, &key, &got); + CHECK(err, "lookup elem", "#%u/%u error %d\n", i, j, err); + CHECK(got != j, "lookup elem", "#%u/%u expect %u got %u\n", + i, j, value, got); + } + } + + /* Add element to a full qp-trie (Error) */ + key.prefixlen = sizeof(key.data) * 8; + memset(key.data, 0, sizeof(key.data)); + value = 0; + err = bpf_map_update_elem(fd, &key, &value, 0); + CHECK(err != -ENOSPC, "add to full qp-trie", "error %d\n", err); + + /* Iterate sorted elements: no deletion */ + memcpy(sorted_keys, keys, sizeof(keys)); + qsort(sorted_keys, ARRAY_SIZE(sorted_keys), sizeof(sorted_keys[0]), cmp_str); + cur = NULL; + for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) { + len = strlen(sorted_keys[i]); + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err, "iterate", "#%u error %d\n", i, err); + CHECK(next_key.prefixlen != (len + 1) * 8, "iterate", + "#%u invalid len %u expect %u\n", + i, next_key.prefixlen, (len + 1) * 8); + CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate", + "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]); + + cur = &next_key; + } + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err != -ENOENT, "more element", "error %d\n", err); + + /* Iterate sorted elements: delete the found key after each iteration */ + cur = NULL; + for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) { + len = strlen(sorted_keys[i]); + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err, "iterate", "#%u error %d\n", i, err); + CHECK(next_key.prefixlen != (len + 1) * 8, "iterate", + "#%u invalid len %u expect %u\n", + i, next_key.prefixlen, (len + 1) * 8); + CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate", + "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]); + + cur = &next_key; + + err = bpf_map_delete_elem(fd, cur); + CHECK(err, "delete", "#%u error %d\n", i, err); + } + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err != -ENOENT, "non-empty qp-trie", "error %d\n", err); + + close(fd); +} + +/* Use the fixed prefixlen (32) and save integers in LPM trie. The iteration of + * LPM trie will return these integers in big-endian order, therefore, convert + * these integers to big-endian before update. After each iteration, delete the + * found key (the smallest integer) and expect the next iteration will return + * the second smallest number. + */ +static void test_lpm_trie_iterate_ints(void) +{ + struct lpm_trie_int_key key, next_key; + unsigned int i, max_entries; + struct lpm_trie_int_key *cur; + unsigned int *data_set; + int fd, err; + bool value; + + max_entries = 4096; + data_set = calloc(max_entries, sizeof(*data_set)); + CHECK(!data_set, "malloc", "no mem\n"); + for (i = 0; i < max_entries; i++) + data_set[i] = i; + + fd = lpm_trie_create(sizeof(key), sizeof(value), max_entries); + value = true; + for (i = 0; i < max_entries; i++) { + key.prefixlen = 32; + key.data = htobe32(data_set[i]); + + err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST); + CHECK(err, "add elem", "#%u error %d\n", i, err); + } + + cur = NULL; + for (i = 0; i < max_entries; i++) { + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err, "iterate", "#%u error %d\n", i, err); + CHECK(next_key.prefixlen != 32, "iterate", "#%u invalid len %u\n", + i, next_key.prefixlen); + CHECK(be32toh(next_key.data) != data_set[i], "iterate", "#%u got 0x%x exp 0x%x\n", + i, be32toh(next_key.data), data_set[i]); + cur = &next_key; + + /* + * Delete the minimal key, the next call of bpf_get_next_key() + * will return the second minimal key. + */ + err = bpf_map_delete_elem(fd, &next_key); + CHECK(err, "del elem", "#%u elem error %d\n", i, err); + } + err = bpf_map_get_next_key(fd, cur, &next_key); + CHECK(err != -ENOENT, "more element", "error %d\n", err); + + err = bpf_map_get_next_key(fd, NULL, &next_key); + CHECK(err != -ENOENT, "no-empty qp-trie", "error %d\n", err); + + free(data_set); + + close(fd); +} + +void test_lpm_trie_map_basic_ops(void) { int i; /* we want predictable, pseudo random tests */ srand(0xf00ba1); - /* Use libbpf 1.0 API mode */ - libbpf_set_strict_mode(LIBBPF_STRICT_ALL); - test_lpm_basic(); test_lpm_order(); @@ -792,6 +1179,10 @@ int main(void) test_lpm_get_next_key(); test_lpm_multi_thread(); - printf("test_lpm: OK\n"); - return 0; + test_lpm_trie_update_flags(); + test_lpm_trie_update_full_map(); + test_lpm_trie_iterate_strs(); + test_lpm_trie_iterate_ints(); + + printf("%s: PASS\n", __func__); } diff --git a/tools/testing/selftests/bpf/map_tests/map_in_map_batch_ops.c b/tools/testing/selftests/bpf/map_tests/map_in_map_batch_ops.c index 66191ae9863c..79c3ccadb962 100644 --- a/tools/testing/selftests/bpf/map_tests/map_in_map_batch_ops.c +++ b/tools/testing/selftests/bpf/map_tests/map_in_map_batch_ops.c @@ -120,11 +120,12 @@ static void validate_fetch_results(int outer_map_fd, static void fetch_and_validate(int outer_map_fd, struct bpf_map_batch_opts *opts, - __u32 batch_size, bool delete_entries) + __u32 batch_size, bool delete_entries, + bool has_holes) { - __u32 *fetched_keys, *fetched_values, total_fetched = 0; - __u32 batch_key = 0, fetch_count, step_size; - int err, max_entries = OUTER_MAP_ENTRIES; + int err, max_entries = OUTER_MAP_ENTRIES - !!has_holes; + __u32 *fetched_keys, *fetched_values, total_fetched = 0, i; + __u32 batch_key = 0, fetch_count, step_size = batch_size; __u32 value_size = sizeof(__u32); /* Total entries needs to be fetched */ @@ -134,9 +135,8 @@ static void fetch_and_validate(int outer_map_fd, "Memory allocation failed for fetched_keys or fetched_values", "error=%s\n", strerror(errno)); - for (step_size = batch_size; - step_size <= max_entries; - step_size += batch_size) { + /* hash map may not always return full batch */ + for (i = 0; i < OUTER_MAP_ENTRIES; i++) { fetch_count = step_size; err = delete_entries ? bpf_map_lookup_and_delete_batch(outer_map_fd, @@ -155,6 +155,7 @@ static void fetch_and_validate(int outer_map_fd, if (err && errno == ENOSPC) { /* Fetch again with higher batch size */ total_fetched = 0; + step_size += batch_size; continue; } @@ -184,18 +185,19 @@ static void fetch_and_validate(int outer_map_fd, } static void _map_in_map_batch_ops(enum bpf_map_type outer_map_type, - enum bpf_map_type inner_map_type) + enum bpf_map_type inner_map_type, + bool has_holes) { + __u32 max_entries = OUTER_MAP_ENTRIES - !!has_holes; __u32 *outer_map_keys, *inner_map_fds; - __u32 max_entries = OUTER_MAP_ENTRIES; LIBBPF_OPTS(bpf_map_batch_opts, opts); __u32 value_size = sizeof(__u32); int batch_size[2] = {5, 10}; __u32 map_index, op_index; int outer_map_fd, ret; - outer_map_keys = calloc(max_entries, value_size); - inner_map_fds = calloc(max_entries, value_size); + outer_map_keys = calloc(OUTER_MAP_ENTRIES, value_size); + inner_map_fds = calloc(OUTER_MAP_ENTRIES, value_size); CHECK((!outer_map_keys || !inner_map_fds), "Memory allocation failed for outer_map_keys or inner_map_fds", "error=%s\n", strerror(errno)); @@ -209,6 +211,24 @@ static void _map_in_map_batch_ops(enum bpf_map_type outer_map_type, ((outer_map_type == BPF_MAP_TYPE_ARRAY_OF_MAPS) ? 9 : 1000) - map_index; + /* This condition is only meaningful for array of maps. + * + * max_entries == OUTER_MAP_ENTRIES - 1 if it is true. Say + * max_entries is short for n, then outer_map_keys looks like: + * + * [n, n-1, ... 2, 1] + * + * We change it to + * + * [n, n-1, ... 2, 0] + * + * So it will leave key 1 as a hole. It will serve to test the + * correctness when batch on an array: a "non-exist" key might be + * actually allocated and returned from key iteration. + */ + if (has_holes) + outer_map_keys[max_entries - 1]--; + /* batch operation - map_update */ ret = bpf_map_update_batch(outer_map_fd, outer_map_keys, inner_map_fds, &max_entries, &opts); @@ -219,15 +239,17 @@ static void _map_in_map_batch_ops(enum bpf_map_type outer_map_type, /* batch operation - map_lookup */ for (op_index = 0; op_index < 2; ++op_index) fetch_and_validate(outer_map_fd, &opts, - batch_size[op_index], false); + batch_size[op_index], false, + has_holes); /* batch operation - map_lookup_delete */ if (outer_map_type == BPF_MAP_TYPE_HASH_OF_MAPS) fetch_and_validate(outer_map_fd, &opts, - max_entries, true /*delete*/); + max_entries, true /*delete*/, + has_holes); /* close all map fds */ - for (map_index = 0; map_index < max_entries; map_index++) + for (map_index = 0; map_index < OUTER_MAP_ENTRIES; map_index++) close(inner_map_fds[map_index]); close(outer_map_fd); @@ -237,16 +259,20 @@ static void _map_in_map_batch_ops(enum bpf_map_type outer_map_type, void test_map_in_map_batch_ops_array(void) { - _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_ARRAY); + _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_ARRAY, false); printf("%s:PASS with inner ARRAY map\n", __func__); - _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_HASH); + _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_HASH, false); printf("%s:PASS with inner HASH map\n", __func__); + _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_ARRAY, true); + printf("%s:PASS with inner ARRAY map with holes\n", __func__); + _map_in_map_batch_ops(BPF_MAP_TYPE_ARRAY_OF_MAPS, BPF_MAP_TYPE_HASH, true); + printf("%s:PASS with inner HASH map with holes\n", __func__); } void test_map_in_map_batch_ops_hash(void) { - _map_in_map_batch_ops(BPF_MAP_TYPE_HASH_OF_MAPS, BPF_MAP_TYPE_ARRAY); + _map_in_map_batch_ops(BPF_MAP_TYPE_HASH_OF_MAPS, BPF_MAP_TYPE_ARRAY, false); printf("%s:PASS with inner ARRAY map\n", __func__); - _map_in_map_batch_ops(BPF_MAP_TYPE_HASH_OF_MAPS, BPF_MAP_TYPE_HASH); + _map_in_map_batch_ops(BPF_MAP_TYPE_HASH_OF_MAPS, BPF_MAP_TYPE_HASH, false); printf("%s:PASS with inner HASH map\n", __func__); } diff --git a/tools/testing/selftests/bpf/map_tests/task_storage_map.c b/tools/testing/selftests/bpf/map_tests/task_storage_map.c index 62971dbf2996..a4121d2248ac 100644 --- a/tools/testing/selftests/bpf/map_tests/task_storage_map.c +++ b/tools/testing/selftests/bpf/map_tests/task_storage_map.c @@ -78,8 +78,8 @@ void test_task_storage_map_stress_lookup(void) CHECK(err, "open_and_load", "error %d\n", err); /* Only for a fully preemptible kernel */ - if (!skel->kconfig->CONFIG_PREEMPT) { - printf("%s SKIP (no CONFIG_PREEMPT)\n", __func__); + if (!skel->kconfig->CONFIG_PREEMPTION) { + printf("%s SKIP (no CONFIG_PREEMPTION)\n", __func__); read_bpf_task_storage_busy__destroy(skel); skips++; return; diff --git a/tools/testing/selftests/bpf/network_helpers.c b/tools/testing/selftests/bpf/network_helpers.c index 27784946b01b..80844a5fb1fe 100644 --- a/tools/testing/selftests/bpf/network_helpers.c +++ b/tools/testing/selftests/bpf/network_helpers.c @@ -21,7 +21,7 @@ #include <linux/limits.h> #include <linux/ip.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <netinet/tcp.h> #include <net/if.h> diff --git a/tools/testing/selftests/bpf/network_helpers.h b/tools/testing/selftests/bpf/network_helpers.h index 5764155b6d25..ebec8a8d6f81 100644 --- a/tools/testing/selftests/bpf/network_helpers.h +++ b/tools/testing/selftests/bpf/network_helpers.h @@ -14,6 +14,7 @@ typedef __u16 __sum16; #include <linux/sockios.h> #include <linux/err.h> #include <netinet/tcp.h> +#include <netinet/udp.h> #include <bpf/bpf_endian.h> #include <net/if.h> @@ -105,6 +106,45 @@ static __u16 csum_fold(__u32 csum) return (__u16)~csum; } +static __wsum csum_partial(const void *buf, int len, __wsum sum) +{ + __u16 *p = (__u16 *)buf; + int num_u16 = len >> 1; + int i; + + for (i = 0; i < num_u16; i++) + sum += p[i]; + + return sum; +} + +static inline __sum16 build_ip_csum(struct iphdr *iph) +{ + __u32 sum = 0; + __u16 *p; + + iph->check = 0; + p = (void *)iph; + sum = csum_partial(p, iph->ihl << 2, 0); + + return csum_fold(sum); +} + +/** + * csum_tcpudp_magic - compute IP pseudo-header checksum + * + * Compute the IPv4 pseudo header checksum. The helper can take a + * accumulated sum from the transport layer to accumulate it and directly + * return the transport layer + * + * @saddr: IP source address + * @daddr: IP dest address + * @len: IP data size + * @proto: transport layer protocol + * @csum: The accumulated partial sum to add to the computation + * + * Returns the folded sum + */ static inline __sum16 csum_tcpudp_magic(__be32 saddr, __be32 daddr, __u32 len, __u8 proto, __wsum csum) @@ -120,6 +160,21 @@ static inline __sum16 csum_tcpudp_magic(__be32 saddr, __be32 daddr, return csum_fold((__u32)s); } +/** + * csum_ipv6_magic - compute IPv6 pseudo-header checksum + * + * Compute the ipv6 pseudo header checksum. The helper can take a + * accumulated sum from the transport layer to accumulate it and directly + * return the transport layer + * + * @saddr: IPv6 source address + * @daddr: IPv6 dest address + * @len: IPv6 data size + * @proto: transport layer protocol + * @csum: The accumulated partial sum to add to the computation + * + * Returns the folded sum + */ static inline __sum16 csum_ipv6_magic(const struct in6_addr *saddr, const struct in6_addr *daddr, __u32 len, __u8 proto, @@ -139,6 +194,47 @@ static inline __sum16 csum_ipv6_magic(const struct in6_addr *saddr, return csum_fold((__u32)s); } +/** + * build_udp_v4_csum - compute UDP checksum for UDP over IPv4 + * + * Compute the checksum to embed in UDP header, composed of the sum of IP + * pseudo-header checksum, UDP header checksum and UDP data checksum + * @iph IP header + * @udph UDP header, which must be immediately followed by UDP data + * + * Returns the total checksum + */ + +static inline __sum16 build_udp_v4_csum(const struct iphdr *iph, + const struct udphdr *udph) +{ + unsigned long sum; + + sum = csum_partial(udph, ntohs(udph->len), 0); + return csum_tcpudp_magic(iph->saddr, iph->daddr, ntohs(udph->len), + IPPROTO_UDP, sum); +} + +/** + * build_udp_v6_csum - compute UDP checksum for UDP over IPv6 + * + * Compute the checksum to embed in UDP header, composed of the sum of IPv6 + * pseudo-header checksum, UDP header checksum and UDP data checksum + * @ip6h IPv6 header + * @udph UDP header, which must be immediately followed by UDP data + * + * Returns the total checksum + */ +static inline __sum16 build_udp_v6_csum(const struct ipv6hdr *ip6h, + const struct udphdr *udph) +{ + unsigned long sum; + + sum = csum_partial(udph, ntohs(udph->len), 0); + return csum_ipv6_magic(&ip6h->saddr, &ip6h->daddr, ntohs(udph->len), + IPPROTO_UDP, sum); +} + struct tmonitor_ctx; #ifdef TRAFFIC_MONITOR diff --git a/tools/testing/selftests/bpf/prog_tests/btf_distill.c b/tools/testing/selftests/bpf/prog_tests/btf_distill.c index ca84726d5ac1..fb67ae195a73 100644 --- a/tools/testing/selftests/bpf/prog_tests/btf_distill.c +++ b/tools/testing/selftests/bpf/prog_tests/btf_distill.c @@ -385,7 +385,7 @@ static void test_distilled_base_missing_err(void) "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED"); btf5 = btf__new_empty(); if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf")) - return; + goto cleanup; btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */ VALIDATE_RAW_BTF( btf5, @@ -478,7 +478,7 @@ static void test_distilled_base_multi_err2(void) "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED"); btf5 = btf__new_empty(); if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf")) - return; + goto cleanup; btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */ btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [2] int */ VALIDATE_RAW_BTF( @@ -601,6 +601,76 @@ cleanup: btf__free(base); } +/* If a needed composite type, which is the member of composite type + * in the split BTF, has a different size in the base BTF we wish to + * relocate with, btf__relocate() should error out. + */ +static void test_distilled_base_embedded_err(void) +{ + struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL, *btf5 = NULL; + + btf1 = btf__new_empty(); + if (!ASSERT_OK_PTR(btf1, "empty_main_btf")) + return; + + btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */ + btf__add_struct(btf1, "s1", 4); /* [2] struct s1 { */ + btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */ + /* } */ + VALIDATE_RAW_BTF( + btf1, + "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED", + "[2] STRUCT 's1' size=4 vlen=1\n" + "\t'f1' type_id=1 bits_offset=0"); + + btf2 = btf__new_empty_split(btf1); + if (!ASSERT_OK_PTR(btf2, "empty_split_btf")) + goto cleanup; + + btf__add_struct(btf2, "with_embedded", 8); /* [3] struct with_embedded { */ + btf__add_field(btf2, "e1", 2, 0, 0); /* struct s1 e1; */ + /* } */ + + VALIDATE_RAW_BTF( + btf2, + "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED", + "[2] STRUCT 's1' size=4 vlen=1\n" + "\t'f1' type_id=1 bits_offset=0", + "[3] STRUCT 'with_embedded' size=8 vlen=1\n" + "\t'e1' type_id=2 bits_offset=0"); + + if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4), + "distilled_base") || + !ASSERT_OK_PTR(btf3, "distilled_base") || + !ASSERT_OK_PTR(btf4, "distilled_split") || + !ASSERT_EQ(2, btf__type_cnt(btf3), "distilled_base_type_cnt")) + goto cleanup; + + VALIDATE_RAW_BTF( + btf4, + "[1] STRUCT 's1' size=4 vlen=0", + "[2] STRUCT 'with_embedded' size=8 vlen=1\n" + "\t'e1' type_id=1 bits_offset=0"); + + btf5 = btf__new_empty(); + if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf")) + goto cleanup; + + btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */ + /* struct with the same name but different size */ + btf__add_struct(btf5, "s1", 8); /* [2] struct s1 { */ + btf__add_field(btf5, "f1", 1, 0, 0); /* int f1; */ + /* } */ + + ASSERT_EQ(btf__relocate(btf4, btf5), -EINVAL, "relocate_split"); +cleanup: + btf__free(btf5); + btf__free(btf4); + btf__free(btf3); + btf__free(btf2); + btf__free(btf1); +} + void test_btf_distill(void) { if (test__start_subtest("distilled_base")) @@ -613,6 +683,8 @@ void test_btf_distill(void) test_distilled_base_multi_err(); if (test__start_subtest("distilled_base_multi_err2")) test_distilled_base_multi_err2(); + if (test__start_subtest("distilled_base_embedded_err")) + test_distilled_base_embedded_err(); if (test__start_subtest("distilled_base_vmlinux")) test_distilled_base_vmlinux(); if (test__start_subtest("distilled_endianness")) diff --git a/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c b/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c new file mode 100644 index 000000000000..e1a90c10db8c --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/cgroup_skb_direct_packet_access.c @@ -0,0 +1,28 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <test_progs.h> +#include "cgroup_skb_direct_packet_access.skel.h" + +void test_cgroup_skb_prog_run_direct_packet_access(void) +{ + int err; + struct cgroup_skb_direct_packet_access *skel; + char test_skb[64] = {}; + + LIBBPF_OPTS(bpf_test_run_opts, topts, + .data_in = test_skb, + .data_size_in = sizeof(test_skb), + ); + + skel = cgroup_skb_direct_packet_access__open_and_load(); + if (!ASSERT_OK_PTR(skel, "cgroup_skb_direct_packet_access__open_and_load")) + return; + + err = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.direct_packet_access), &topts); + ASSERT_OK(err, "bpf_prog_test_run_opts err"); + ASSERT_EQ(topts.retval, 1, "retval"); + + ASSERT_NEQ(skel->bss->data_end, 0, "data_end"); + + cgroup_skb_direct_packet_access__destroy(skel); +} diff --git a/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c new file mode 100644 index 000000000000..7526de379081 --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c @@ -0,0 +1,107 @@ +// SPDX-License-Identifier: GPL-2.0 +#include "bpf/libbpf.h" +#include "changes_pkt_data_freplace.skel.h" +#include "changes_pkt_data.skel.h" +#include <test_progs.h> + +static void print_verifier_log(const char *log) +{ + if (env.verbosity >= VERBOSE_VERY) + fprintf(stdout, "VERIFIER LOG:\n=============\n%s=============\n", log); +} + +static void test_aux(const char *main_prog_name, + const char *to_be_replaced, + const char *replacement, + bool expect_load) +{ + struct changes_pkt_data_freplace *freplace = NULL; + struct bpf_program *freplace_prog = NULL; + struct bpf_program *main_prog = NULL; + LIBBPF_OPTS(bpf_object_open_opts, opts); + struct changes_pkt_data *main = NULL; + char log[16*1024]; + int err; + + opts.kernel_log_buf = log; + opts.kernel_log_size = sizeof(log); + if (env.verbosity >= VERBOSE_SUPER) + opts.kernel_log_level = 1 | 2 | 4; + main = changes_pkt_data__open_opts(&opts); + if (!ASSERT_OK_PTR(main, "changes_pkt_data__open")) + goto out; + main_prog = bpf_object__find_program_by_name(main->obj, main_prog_name); + if (!ASSERT_OK_PTR(main_prog, "main_prog")) + goto out; + bpf_program__set_autoload(main_prog, true); + err = changes_pkt_data__load(main); + print_verifier_log(log); + if (!ASSERT_OK(err, "changes_pkt_data__load")) + goto out; + freplace = changes_pkt_data_freplace__open_opts(&opts); + if (!ASSERT_OK_PTR(freplace, "changes_pkt_data_freplace__open")) + goto out; + freplace_prog = bpf_object__find_program_by_name(freplace->obj, replacement); + if (!ASSERT_OK_PTR(freplace_prog, "freplace_prog")) + goto out; + bpf_program__set_autoload(freplace_prog, true); + bpf_program__set_autoattach(freplace_prog, true); + bpf_program__set_attach_target(freplace_prog, + bpf_program__fd(main_prog), + to_be_replaced); + err = changes_pkt_data_freplace__load(freplace); + print_verifier_log(log); + if (expect_load) { + ASSERT_OK(err, "changes_pkt_data_freplace__load"); + } else { + ASSERT_ERR(err, "changes_pkt_data_freplace__load"); + ASSERT_HAS_SUBSTR(log, "Extension program changes packet data", "error log"); + } + +out: + changes_pkt_data_freplace__destroy(freplace); + changes_pkt_data__destroy(main); +} + +/* There are two global subprograms in both changes_pkt_data.skel.h: + * - one changes packet data; + * - another does not. + * It is ok to freplace subprograms that change packet data with those + * that either do or do not. It is only ok to freplace subprograms + * that do not change packet data with those that do not as well. + * The below tests check outcomes for each combination of such freplace. + * Also test a case when main subprogram itself is replaced and is a single + * subprogram in a program. + */ +void test_changes_pkt_data_freplace(void) +{ + struct { + const char *main; + const char *to_be_replaced; + bool changes; + } mains[] = { + { "main_with_subprogs", "changes_pkt_data", true }, + { "main_with_subprogs", "does_not_change_pkt_data", false }, + { "main_changes", "main_changes", true }, + { "main_does_not_change", "main_does_not_change", false }, + }; + struct { + const char *func; + bool changes; + } replacements[] = { + { "changes_pkt_data", true }, + { "does_not_change_pkt_data", false } + }; + char buf[64]; + + for (int i = 0; i < ARRAY_SIZE(mains); ++i) { + for (int j = 0; j < ARRAY_SIZE(replacements); ++j) { + snprintf(buf, sizeof(buf), "%s_with_%s", + mains[i].to_be_replaced, replacements[j].func); + if (!test__start_subtest(buf)) + continue; + test_aux(mains[i].main, mains[i].to_be_replaced, replacements[j].func, + mains[i].changes || !replacements[j].changes); + } + } +} diff --git a/tools/testing/selftests/bpf/prog_tests/core_reloc.c b/tools/testing/selftests/bpf/prog_tests/core_reloc.c index 1c682550e0e7..e10ea92c3fe2 100644 --- a/tools/testing/selftests/bpf/prog_tests/core_reloc.c +++ b/tools/testing/selftests/bpf/prog_tests/core_reloc.c @@ -2,7 +2,7 @@ #define _GNU_SOURCE #include <test_progs.h> #include "progs/core_reloc_types.h" -#include "bpf_testmod/bpf_testmod.h" +#include "test_kmods/bpf_testmod.h" #include <linux/limits.h> #include <sys/mman.h> #include <sys/syscall.h> diff --git a/tools/testing/selftests/bpf/prog_tests/fd_array.c b/tools/testing/selftests/bpf/prog_tests/fd_array.c new file mode 100644 index 000000000000..a1d52e73fb16 --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/fd_array.c @@ -0,0 +1,441 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <test_progs.h> + +#include <linux/btf.h> +#include <bpf/bpf.h> + +#include "../test_btf.h" + +static inline int new_map(void) +{ + const char *name = NULL; + __u32 max_entries = 1; + __u32 value_size = 8; + __u32 key_size = 4; + + return bpf_map_create(BPF_MAP_TYPE_ARRAY, name, + key_size, value_size, + max_entries, NULL); +} + +static int new_btf(void) +{ + struct btf_blob { + struct btf_header btf_hdr; + __u32 types[8]; + __u32 str; + } raw_btf = { + .btf_hdr = { + .magic = BTF_MAGIC, + .version = BTF_VERSION, + .hdr_len = sizeof(struct btf_header), + .type_len = sizeof(raw_btf.types), + .str_off = offsetof(struct btf_blob, str) - offsetof(struct btf_blob, types), + .str_len = sizeof(raw_btf.str), + }, + .types = { + /* long */ + BTF_TYPE_INT_ENC(0, BTF_INT_SIGNED, 0, 64, 8), /* [1] */ + /* unsigned long */ + BTF_TYPE_INT_ENC(0, 0, 0, 64, 8), /* [2] */ + }, + }; + + return bpf_btf_load(&raw_btf, sizeof(raw_btf), NULL); +} + +#define Close(FD) do { \ + if ((FD) >= 0) { \ + close(FD); \ + FD = -1; \ + } \ +} while(0) + +static bool map_exists(__u32 id) +{ + int fd; + + fd = bpf_map_get_fd_by_id(id); + if (fd >= 0) { + close(fd); + return true; + } + return false; +} + +static bool btf_exists(__u32 id) +{ + int fd; + + fd = bpf_btf_get_fd_by_id(id); + if (fd >= 0) { + close(fd); + return true; + } + return false; +} + +static inline int bpf_prog_get_map_ids(int prog_fd, __u32 *nr_map_ids, __u32 *map_ids) +{ + __u32 len = sizeof(struct bpf_prog_info); + struct bpf_prog_info info; + int err; + + memset(&info, 0, len); + info.nr_map_ids = *nr_map_ids, + info.map_ids = ptr_to_u64(map_ids), + + err = bpf_prog_get_info_by_fd(prog_fd, &info, &len); + if (!ASSERT_OK(err, "bpf_prog_get_info_by_fd")) + return -1; + + *nr_map_ids = info.nr_map_ids; + + return 0; +} + +static int __load_test_prog(int map_fd, const int *fd_array, int fd_array_cnt) +{ + /* A trivial program which uses one map */ + struct bpf_insn insns[] = { + BPF_LD_MAP_FD(BPF_REG_1, map_fd), + BPF_ST_MEM(BPF_DW, BPF_REG_10, -8, 0), + BPF_MOV64_REG(BPF_REG_2, BPF_REG_10), + BPF_ALU64_IMM(BPF_ADD, BPF_REG_2, -8), + BPF_RAW_INSN(BPF_JMP | BPF_CALL, 0, 0, 0, BPF_FUNC_map_lookup_elem), + BPF_MOV64_IMM(BPF_REG_0, 0), + BPF_EXIT_INSN(), + }; + LIBBPF_OPTS(bpf_prog_load_opts, opts); + + opts.fd_array = fd_array; + opts.fd_array_cnt = fd_array_cnt; + + return bpf_prog_load(BPF_PROG_TYPE_XDP, NULL, "GPL", insns, ARRAY_SIZE(insns), &opts); +} + +static int load_test_prog(const int *fd_array, int fd_array_cnt) +{ + int map_fd; + int ret; + + map_fd = new_map(); + if (!ASSERT_GE(map_fd, 0, "new_map")) + return map_fd; + + ret = __load_test_prog(map_fd, fd_array, fd_array_cnt); + close(map_fd); + return ret; +} + +static bool check_expected_map_ids(int prog_fd, int expected, __u32 *map_ids, __u32 *nr_map_ids) +{ + int err; + + err = bpf_prog_get_map_ids(prog_fd, nr_map_ids, map_ids); + if (!ASSERT_OK(err, "bpf_prog_get_map_ids")) + return false; + if (!ASSERT_EQ(*nr_map_ids, expected, "unexpected nr_map_ids")) + return false; + + return true; +} + +/* + * Load a program, which uses one map. No fd_array maps are present. + * On return only one map is expected to be bound to prog. + */ +static void check_fd_array_cnt__no_fd_array(void) +{ + __u32 map_ids[16]; + __u32 nr_map_ids; + int prog_fd = -1; + + prog_fd = load_test_prog(NULL, 0); + if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD")) + return; + nr_map_ids = ARRAY_SIZE(map_ids); + check_expected_map_ids(prog_fd, 1, map_ids, &nr_map_ids); + close(prog_fd); +} + +/* + * Load a program, which uses one map, and pass two extra, non-equal, maps in + * fd_array with fd_array_cnt=2. On return three maps are expected to be bound + * to the program. + */ +static void check_fd_array_cnt__fd_array_ok(void) +{ + int extra_fds[2] = { -1, -1 }; + __u32 map_ids[16]; + __u32 nr_map_ids; + int prog_fd = -1; + + extra_fds[0] = new_map(); + if (!ASSERT_GE(extra_fds[0], 0, "new_map")) + goto cleanup; + extra_fds[1] = new_map(); + if (!ASSERT_GE(extra_fds[1], 0, "new_map")) + goto cleanup; + prog_fd = load_test_prog(extra_fds, 2); + if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD")) + goto cleanup; + nr_map_ids = ARRAY_SIZE(map_ids); + if (!check_expected_map_ids(prog_fd, 3, map_ids, &nr_map_ids)) + goto cleanup; + + /* maps should still exist when original file descriptors are closed */ + Close(extra_fds[0]); + Close(extra_fds[1]); + if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map_ids[0] should exist")) + goto cleanup; + if (!ASSERT_EQ(map_exists(map_ids[1]), true, "map_ids[1] should exist")) + goto cleanup; + + /* some fds might be invalid, so ignore return codes */ +cleanup: + Close(extra_fds[1]); + Close(extra_fds[0]); + Close(prog_fd); +} + +/* + * Load a program with a few extra maps duplicated in the fd_array. + * After the load maps should only be referenced once. + */ +static void check_fd_array_cnt__duplicated_maps(void) +{ + int extra_fds[4] = { -1, -1, -1, -1 }; + __u32 map_ids[16]; + __u32 nr_map_ids; + int prog_fd = -1; + + extra_fds[0] = extra_fds[2] = new_map(); + if (!ASSERT_GE(extra_fds[0], 0, "new_map")) + goto cleanup; + extra_fds[1] = extra_fds[3] = new_map(); + if (!ASSERT_GE(extra_fds[1], 0, "new_map")) + goto cleanup; + prog_fd = load_test_prog(extra_fds, 4); + if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD")) + goto cleanup; + nr_map_ids = ARRAY_SIZE(map_ids); + if (!check_expected_map_ids(prog_fd, 3, map_ids, &nr_map_ids)) + goto cleanup; + + /* maps should still exist when original file descriptors are closed */ + Close(extra_fds[0]); + Close(extra_fds[1]); + if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map should exist")) + goto cleanup; + if (!ASSERT_EQ(map_exists(map_ids[1]), true, "map should exist")) + goto cleanup; + + /* some fds might be invalid, so ignore return codes */ +cleanup: + Close(extra_fds[1]); + Close(extra_fds[0]); + Close(prog_fd); +} + +/* + * Check that if maps which are referenced by a program are + * passed in fd_array, then they will be referenced only once + */ +static void check_fd_array_cnt__referenced_maps_in_fd_array(void) +{ + int extra_fds[1] = { -1 }; + __u32 map_ids[16]; + __u32 nr_map_ids; + int prog_fd = -1; + + extra_fds[0] = new_map(); + if (!ASSERT_GE(extra_fds[0], 0, "new_map")) + goto cleanup; + prog_fd = __load_test_prog(extra_fds[0], extra_fds, 1); + if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD")) + goto cleanup; + nr_map_ids = ARRAY_SIZE(map_ids); + if (!check_expected_map_ids(prog_fd, 1, map_ids, &nr_map_ids)) + goto cleanup; + + /* map should still exist when original file descriptor is closed */ + Close(extra_fds[0]); + if (!ASSERT_EQ(map_exists(map_ids[0]), true, "map should exist")) + goto cleanup; + + /* some fds might be invalid, so ignore return codes */ +cleanup: + Close(extra_fds[0]); + Close(prog_fd); +} + +static int get_btf_id_by_fd(int btf_fd, __u32 *id) +{ + struct bpf_btf_info info; + __u32 info_len = sizeof(info); + int err; + + memset(&info, 0, info_len); + err = bpf_btf_get_info_by_fd(btf_fd, &info, &info_len); + if (err) + return err; + if (id) + *id = info.id; + return 0; +} + +/* + * Check that fd_array operates properly for btfs. Namely, to check that + * passing a btf fd in fd_array increases its reference count, do the + * following: + * 1) Create a new btf, it's referenced only by a file descriptor, so refcnt=1 + * 2) Load a BPF prog with fd_array[0] = btf_fd; now btf's refcnt=2 + * 3) Close the btf_fd, now refcnt=1 + * Wait and check that BTF stil exists. + */ +static void check_fd_array_cnt__referenced_btfs(void) +{ + int extra_fds[1] = { -1 }; + int prog_fd = -1; + __u32 btf_id; + int tries; + int err; + + extra_fds[0] = new_btf(); + if (!ASSERT_GE(extra_fds[0], 0, "new_btf")) + goto cleanup; + prog_fd = load_test_prog(extra_fds, 1); + if (!ASSERT_GE(prog_fd, 0, "BPF_PROG_LOAD")) + goto cleanup; + + /* btf should still exist when original file descriptor is closed */ + err = get_btf_id_by_fd(extra_fds[0], &btf_id); + if (!ASSERT_GE(err, 0, "get_btf_id_by_fd")) + goto cleanup; + + Close(extra_fds[0]); + + if (!ASSERT_GE(kern_sync_rcu(), 0, "kern_sync_rcu 1")) + goto cleanup; + + if (!ASSERT_EQ(btf_exists(btf_id), true, "btf should exist")) + goto cleanup; + + Close(prog_fd); + + /* The program is freed by a workqueue, so no reliable + * way to sync, so just wait a bit (max ~1 second). */ + for (tries = 100; tries >= 0; tries--) { + usleep(1000); + + if (!btf_exists(btf_id)) + break; + + if (tries) + continue; + + PRINT_FAIL("btf should have been freed"); + } + + /* some fds might be invalid, so ignore return codes */ +cleanup: + Close(extra_fds[0]); + Close(prog_fd); +} + +/* + * Test that a program with trash in fd_array can't be loaded: + * only map and BTF file descriptors should be accepted. + */ +static void check_fd_array_cnt__fd_array_with_trash(void) +{ + int extra_fds[3] = { -1, -1, -1 }; + int prog_fd = -1; + + extra_fds[0] = new_map(); + if (!ASSERT_GE(extra_fds[0], 0, "new_map")) + goto cleanup; + extra_fds[1] = new_btf(); + if (!ASSERT_GE(extra_fds[1], 0, "new_btf")) + goto cleanup; + + /* trash 1: not a file descriptor */ + extra_fds[2] = 0xbeef; + prog_fd = load_test_prog(extra_fds, 3); + if (!ASSERT_EQ(prog_fd, -EBADF, "prog should have been rejected with -EBADF")) + goto cleanup; + + /* trash 2: not a map or btf */ + extra_fds[2] = socket(AF_INET, SOCK_STREAM, 0); + if (!ASSERT_GE(extra_fds[2], 0, "socket")) + goto cleanup; + + prog_fd = load_test_prog(extra_fds, 3); + if (!ASSERT_EQ(prog_fd, -EINVAL, "prog should have been rejected with -EINVAL")) + goto cleanup; + + /* Validate that the prog is ok if trash is removed */ + Close(extra_fds[2]); + extra_fds[2] = new_btf(); + if (!ASSERT_GE(extra_fds[2], 0, "new_btf")) + goto cleanup; + + prog_fd = load_test_prog(extra_fds, 3); + if (!ASSERT_GE(prog_fd, 0, "prog should have been loaded")) + goto cleanup; + + /* some fds might be invalid, so ignore return codes */ +cleanup: + Close(extra_fds[2]); + Close(extra_fds[1]); + Close(extra_fds[0]); +} + +/* + * Test that a program with too big fd_array can't be loaded. + */ +static void check_fd_array_cnt__fd_array_too_big(void) +{ + int extra_fds[65]; + int prog_fd = -1; + int i; + + for (i = 0; i < 65; i++) { + extra_fds[i] = new_map(); + if (!ASSERT_GE(extra_fds[i], 0, "new_map")) + goto cleanup_fds; + } + + prog_fd = load_test_prog(extra_fds, 65); + ASSERT_EQ(prog_fd, -E2BIG, "prog should have been rejected with -E2BIG"); + +cleanup_fds: + while (i > 0) + Close(extra_fds[--i]); +} + +void test_fd_array_cnt(void) +{ + if (test__start_subtest("no-fd-array")) + check_fd_array_cnt__no_fd_array(); + + if (test__start_subtest("fd-array-ok")) + check_fd_array_cnt__fd_array_ok(); + + if (test__start_subtest("fd-array-dup-input")) + check_fd_array_cnt__duplicated_maps(); + + if (test__start_subtest("fd-array-ref-maps-in-array")) + check_fd_array_cnt__referenced_maps_in_fd_array(); + + if (test__start_subtest("fd-array-ref-btfs")) + check_fd_array_cnt__referenced_btfs(); + + if (test__start_subtest("fd-array-trash-input")) + check_fd_array_cnt__fd_array_with_trash(); + + if (test__start_subtest("fd-array-2big")) + check_fd_array_cnt__fd_array_too_big(); +} diff --git a/tools/testing/selftests/bpf/prog_tests/fill_link_info.c b/tools/testing/selftests/bpf/prog_tests/fill_link_info.c index d50cbd8040d4..e59af2aa6601 100644 --- a/tools/testing/selftests/bpf/prog_tests/fill_link_info.c +++ b/tools/testing/selftests/bpf/prog_tests/fill_link_info.c @@ -171,6 +171,10 @@ static void test_kprobe_fill_link_info(struct test_fill_link_info *skel, /* See also arch_adjust_kprobe_addr(). */ if (skel->kconfig->CONFIG_X86_KERNEL_IBT) entry_offset = 4; + if (skel->kconfig->CONFIG_PPC64 && + skel->kconfig->CONFIG_KPROBES_ON_FTRACE && + !skel->kconfig->CONFIG_PPC_FTRACE_OUT_OF_LINE) + entry_offset = 4; err = verify_perf_link_info(link_fd, type, kprobe_addr, 0, entry_offset); ASSERT_OK(err, "verify_perf_link_info"); } else { diff --git a/tools/testing/selftests/bpf/prog_tests/flow_dissector.c b/tools/testing/selftests/bpf/prog_tests/flow_dissector.c index cfcc90cb7ffb..08bae13248c4 100644 --- a/tools/testing/selftests/bpf/prog_tests/flow_dissector.c +++ b/tools/testing/selftests/bpf/prog_tests/flow_dissector.c @@ -7,39 +7,14 @@ #include "bpf_flow.skel.h" +#define TEST_NS "flow_dissector_ns" #define FLOW_CONTINUE_SADDR 0x7f00007f /* 127.0.0.127 */ +#define TEST_NAME_MAX_LEN 64 #ifndef IP_MF #define IP_MF 0x2000 #endif -#define CHECK_FLOW_KEYS(desc, got, expected) \ - _CHECK(memcmp(&got, &expected, sizeof(got)) != 0, \ - desc, \ - topts.duration, \ - "nhoff=%u/%u " \ - "thoff=%u/%u " \ - "addr_proto=0x%x/0x%x " \ - "is_frag=%u/%u " \ - "is_first_frag=%u/%u " \ - "is_encap=%u/%u " \ - "ip_proto=0x%x/0x%x " \ - "n_proto=0x%x/0x%x " \ - "flow_label=0x%x/0x%x " \ - "sport=%u/%u " \ - "dport=%u/%u\n", \ - got.nhoff, expected.nhoff, \ - got.thoff, expected.thoff, \ - got.addr_proto, expected.addr_proto, \ - got.is_frag, expected.is_frag, \ - got.is_first_frag, expected.is_first_frag, \ - got.is_encap, expected.is_encap, \ - got.ip_proto, expected.ip_proto, \ - got.n_proto, expected.n_proto, \ - got.flow_label, expected.flow_label, \ - got.sport, expected.sport, \ - got.dport, expected.dport) - struct ipv4_pkt { struct ethhdr eth; struct iphdr iph; @@ -89,6 +64,19 @@ struct dvlan_ipv6_pkt { struct tcphdr tcp; } __packed; +struct gre_base_hdr { + __be16 flags; + __be16 protocol; +} gre_base_hdr; + +struct gre_minimal_pkt { + struct ethhdr eth; + struct iphdr iph; + struct gre_base_hdr gre_hdr; + struct iphdr iph_inner; + struct tcphdr tcp; +} __packed; + struct test { const char *name; union { @@ -98,6 +86,7 @@ struct test { struct ipv6_pkt ipv6; struct ipv6_frag_pkt ipv6_frag; struct dvlan_ipv6_pkt dvlan_ipv6; + struct gre_minimal_pkt gre_minimal; } pkt; struct bpf_flow_keys keys; __u32 flags; @@ -106,7 +95,6 @@ struct test { #define VLAN_HLEN 4 -static __u32 duration; struct test tests[] = { { .name = "ipv4", @@ -444,8 +432,137 @@ struct test tests[] = { }, .retval = BPF_FLOW_DISSECTOR_CONTINUE, }, + { + .name = "ip-gre", + .pkt.gre_minimal = { + .eth.h_proto = __bpf_constant_htons(ETH_P_IP), + .iph.ihl = 5, + .iph.protocol = IPPROTO_GRE, + .iph.tot_len = __bpf_constant_htons(MAGIC_BYTES), + .gre_hdr = { + .flags = 0, + .protocol = __bpf_constant_htons(ETH_P_IP), + }, + .iph_inner.ihl = 5, + .iph_inner.protocol = IPPROTO_TCP, + .iph_inner.tot_len = + __bpf_constant_htons(MAGIC_BYTES - + sizeof(struct iphdr)), + .tcp.doff = 5, + .tcp.source = 80, + .tcp.dest = 8080, + }, + .keys = { + .nhoff = ETH_HLEN, + .thoff = ETH_HLEN + sizeof(struct iphdr) * 2 + + sizeof(struct gre_base_hdr), + .addr_proto = ETH_P_IP, + .ip_proto = IPPROTO_TCP, + .n_proto = __bpf_constant_htons(ETH_P_IP), + .is_encap = true, + .sport = 80, + .dport = 8080, + }, + .retval = BPF_OK, + }, + { + .name = "ip-gre-no-encap", + .pkt.ipip = { + .eth.h_proto = __bpf_constant_htons(ETH_P_IP), + .iph.ihl = 5, + .iph.protocol = IPPROTO_GRE, + .iph.tot_len = __bpf_constant_htons(MAGIC_BYTES), + .iph_inner.ihl = 5, + .iph_inner.protocol = IPPROTO_TCP, + .iph_inner.tot_len = + __bpf_constant_htons(MAGIC_BYTES - + sizeof(struct iphdr)), + .tcp.doff = 5, + .tcp.source = 80, + .tcp.dest = 8080, + }, + .keys = { + .flags = BPF_FLOW_DISSECTOR_F_STOP_AT_ENCAP, + .nhoff = ETH_HLEN, + .thoff = ETH_HLEN + sizeof(struct iphdr) + + sizeof(struct gre_base_hdr), + .addr_proto = ETH_P_IP, + .ip_proto = IPPROTO_GRE, + .n_proto = __bpf_constant_htons(ETH_P_IP), + .is_encap = true, + }, + .flags = BPF_FLOW_DISSECTOR_F_STOP_AT_ENCAP, + .retval = BPF_OK, + }, }; +void serial_test_flow_dissector_namespace(void) +{ + struct bpf_flow *skel; + struct nstoken *ns; + int err, prog_fd; + + skel = bpf_flow__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open/load skeleton")) + return; + + prog_fd = bpf_program__fd(skel->progs._dissect); + if (!ASSERT_OK_FD(prog_fd, "get dissector fd")) + goto out_destroy_skel; + + /* We must be able to attach a flow dissector to root namespace */ + err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0); + if (!ASSERT_OK(err, "attach on root namespace ok")) + goto out_destroy_skel; + + err = make_netns(TEST_NS); + if (!ASSERT_OK(err, "create non-root net namespace")) + goto out_destroy_skel; + + /* We must not be able to additionally attach a flow dissector to a + * non-root net namespace + */ + ns = open_netns(TEST_NS); + if (!ASSERT_OK_PTR(ns, "enter non-root net namespace")) + goto out_clean_ns; + err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0); + if (!ASSERT_ERR(err, + "refuse new flow dissector in non-root net namespace")) + bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); + else + ASSERT_EQ(errno, EEXIST, + "refused because of already attached prog"); + close_netns(ns); + + /* If no flow dissector is attached to the root namespace, we must + * be able to attach one to a non-root net namespace + */ + bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); + ns = open_netns(TEST_NS); + ASSERT_OK_PTR(ns, "enter non-root net namespace"); + err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0); + close_netns(ns); + ASSERT_OK(err, "accept new flow dissector in non-root net namespace"); + + /* If a flow dissector is attached to non-root net namespace, attaching + * a flow dissector to root namespace must fail + */ + err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0); + if (!ASSERT_ERR(err, "refuse new flow dissector on root namespace")) + bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); + else + ASSERT_EQ(errno, EEXIST, + "refused because of already attached prog"); + + ns = open_netns(TEST_NS); + bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); + close_netns(ns); +out_clean_ns: + remove_netns(TEST_NS); +out_destroy_skel: + bpf_flow__destroy(skel); +} + static int create_tap(const char *ifname) { struct ifreq ifr = { @@ -533,22 +650,27 @@ static int init_prog_array(struct bpf_object *obj, struct bpf_map *prog_array) return 0; } -static void run_tests_skb_less(int tap_fd, struct bpf_map *keys) +static void run_tests_skb_less(int tap_fd, struct bpf_map *keys, + char *test_suffix) { + char test_name[TEST_NAME_MAX_LEN]; int i, err, keys_fd; keys_fd = bpf_map__fd(keys); - if (CHECK(keys_fd < 0, "bpf_map__fd", "err %d\n", keys_fd)) + if (!ASSERT_OK_FD(keys_fd, "bpf_map__fd")) return; for (i = 0; i < ARRAY_SIZE(tests); i++) { /* Keep in sync with 'flags' from eth_get_headlen. */ __u32 eth_get_headlen_flags = BPF_FLOW_DISSECTOR_F_PARSE_1ST_FRAG; - LIBBPF_OPTS(bpf_test_run_opts, topts); struct bpf_flow_keys flow_keys = {}; __u32 key = (__u32)(tests[i].keys.sport) << 16 | tests[i].keys.dport; + snprintf(test_name, TEST_NAME_MAX_LEN, "%s-%s", tests[i].name, + test_suffix); + if (!test__start_subtest(test_name)) + continue; /* For skb-less case we can't pass input flags; run * only the tests that have a matching set of flags. @@ -558,78 +680,139 @@ static void run_tests_skb_less(int tap_fd, struct bpf_map *keys) continue; err = tx_tap(tap_fd, &tests[i].pkt, sizeof(tests[i].pkt)); - CHECK(err < 0, "tx_tap", "err %d errno %d\n", err, errno); + if (!ASSERT_EQ(err, sizeof(tests[i].pkt), "tx_tap")) + continue; /* check the stored flow_keys only if BPF_OK expected */ if (tests[i].retval != BPF_OK) continue; err = bpf_map_lookup_elem(keys_fd, &key, &flow_keys); - ASSERT_OK(err, "bpf_map_lookup_elem"); + if (!ASSERT_OK(err, "bpf_map_lookup_elem")) + continue; - CHECK_FLOW_KEYS(tests[i].name, flow_keys, tests[i].keys); + ASSERT_MEMEQ(&flow_keys, &tests[i].keys, + sizeof(struct bpf_flow_keys), + "returned flow keys"); err = bpf_map_delete_elem(keys_fd, &key); ASSERT_OK(err, "bpf_map_delete_elem"); } } -static void test_skb_less_prog_attach(struct bpf_flow *skel, int tap_fd) +void test_flow_dissector_skb_less_direct_attach(void) { - int err, prog_fd; + int err, prog_fd, tap_fd; + struct bpf_flow *skel; + struct netns_obj *ns; - prog_fd = bpf_program__fd(skel->progs._dissect); - if (CHECK(prog_fd < 0, "bpf_program__fd", "err %d\n", prog_fd)) + ns = netns_new("flow_dissector_skb_less_indirect_attach_ns", true); + if (!ASSERT_OK_PTR(ns, "create and open netns")) return; + skel = bpf_flow__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open/load skeleton")) + goto out_clean_ns; + + err = init_prog_array(skel->obj, skel->maps.jmp_table); + if (!ASSERT_OK(err, "init_prog_array")) + goto out_destroy_skel; + + prog_fd = bpf_program__fd(skel->progs._dissect); + if (!ASSERT_OK_FD(prog_fd, "bpf_program__fd")) + goto out_destroy_skel; + err = bpf_prog_attach(prog_fd, 0, BPF_FLOW_DISSECTOR, 0); - if (CHECK(err, "bpf_prog_attach", "err %d errno %d\n", err, errno)) - return; + if (!ASSERT_OK(err, "bpf_prog_attach")) + goto out_destroy_skel; + + tap_fd = create_tap("tap0"); + if (!ASSERT_OK_FD(tap_fd, "create_tap")) + goto out_destroy_skel; + err = ifup("tap0"); + if (!ASSERT_OK(err, "ifup")) + goto out_close_tap; - run_tests_skb_less(tap_fd, skel->maps.last_dissection); + run_tests_skb_less(tap_fd, skel->maps.last_dissection, + "non-skb-direct-attach"); err = bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); - CHECK(err, "bpf_prog_detach2", "err %d errno %d\n", err, errno); + ASSERT_OK(err, "bpf_prog_detach2"); + +out_close_tap: + close(tap_fd); +out_destroy_skel: + bpf_flow__destroy(skel); +out_clean_ns: + netns_free(ns); } -static void test_skb_less_link_create(struct bpf_flow *skel, int tap_fd) +void test_flow_dissector_skb_less_indirect_attach(void) { + int err, net_fd, tap_fd; + struct bpf_flow *skel; struct bpf_link *link; - int err, net_fd; + struct netns_obj *ns; - net_fd = open("/proc/self/ns/net", O_RDONLY); - if (CHECK(net_fd < 0, "open(/proc/self/ns/net)", "err %d\n", errno)) + ns = netns_new("flow_dissector_skb_less_indirect_attach_ns", true); + if (!ASSERT_OK_PTR(ns, "create and open netns")) return; + skel = bpf_flow__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open/load skeleton")) + goto out_clean_ns; + + net_fd = open("/proc/self/ns/net", O_RDONLY); + if (!ASSERT_OK_FD(net_fd, "open(/proc/self/ns/net")) + goto out_destroy_skel; + + err = init_prog_array(skel->obj, skel->maps.jmp_table); + if (!ASSERT_OK(err, "init_prog_array")) + goto out_destroy_skel; + + tap_fd = create_tap("tap0"); + if (!ASSERT_OK_FD(tap_fd, "create_tap")) + goto out_close_ns; + err = ifup("tap0"); + if (!ASSERT_OK(err, "ifup")) + goto out_close_tap; + link = bpf_program__attach_netns(skel->progs._dissect, net_fd); if (!ASSERT_OK_PTR(link, "attach_netns")) - goto out_close; + goto out_close_tap; - run_tests_skb_less(tap_fd, skel->maps.last_dissection); + run_tests_skb_less(tap_fd, skel->maps.last_dissection, + "non-skb-indirect-attach"); err = bpf_link__destroy(link); - CHECK(err, "bpf_link__destroy", "err %d\n", err); -out_close: + ASSERT_OK(err, "bpf_link__destroy"); + +out_close_tap: + close(tap_fd); +out_close_ns: close(net_fd); +out_destroy_skel: + bpf_flow__destroy(skel); +out_clean_ns: + netns_free(ns); } -void test_flow_dissector(void) +void test_flow_dissector_skb(void) { - int i, err, prog_fd, keys_fd = -1, tap_fd; + char test_name[TEST_NAME_MAX_LEN]; struct bpf_flow *skel; + int i, err, prog_fd; skel = bpf_flow__open_and_load(); - if (CHECK(!skel, "skel", "failed to open/load skeleton\n")) + if (!ASSERT_OK_PTR(skel, "open/load skeleton")) return; - prog_fd = bpf_program__fd(skel->progs._dissect); - if (CHECK(prog_fd < 0, "bpf_program__fd", "err %d\n", prog_fd)) - goto out_destroy_skel; - keys_fd = bpf_map__fd(skel->maps.last_dissection); - if (CHECK(keys_fd < 0, "bpf_map__fd", "err %d\n", keys_fd)) - goto out_destroy_skel; err = init_prog_array(skel->obj, skel->maps.jmp_table); - if (CHECK(err, "init_prog_array", "err %d\n", err)) + if (!ASSERT_OK(err, "init_prog_array")) + goto out_destroy_skel; + + prog_fd = bpf_program__fd(skel->progs._dissect); + if (!ASSERT_OK_FD(prog_fd, "bpf_program__fd")) goto out_destroy_skel; for (i = 0; i < ARRAY_SIZE(tests); i++) { @@ -641,6 +824,10 @@ void test_flow_dissector(void) ); static struct bpf_flow_keys ctx = {}; + snprintf(test_name, TEST_NAME_MAX_LEN, "%s-skb", tests[i].name); + if (!test__start_subtest(test_name)) + continue; + if (tests[i].flags) { topts.ctx_in = &ctx; topts.ctx_size_in = sizeof(ctx); @@ -656,26 +843,12 @@ void test_flow_dissector(void) continue; ASSERT_EQ(topts.data_size_out, sizeof(flow_keys), "test_run data_size_out"); - CHECK_FLOW_KEYS(tests[i].name, flow_keys, tests[i].keys); + ASSERT_MEMEQ(&flow_keys, &tests[i].keys, + sizeof(struct bpf_flow_keys), + "returned flow keys"); } - /* Do the same tests but for skb-less flow dissector. - * We use a known path in the net/tun driver that calls - * eth_get_headlen and we manually export bpf_flow_keys - * via BPF map in this case. - */ - - tap_fd = create_tap("tap0"); - CHECK(tap_fd < 0, "create_tap", "tap_fd %d errno %d\n", tap_fd, errno); - err = ifup("tap0"); - CHECK(err, "ifup", "err %d errno %d\n", err, errno); - - /* Test direct prog attachment */ - test_skb_less_prog_attach(skel, tap_fd); - /* Test indirect prog attachment via link */ - test_skb_less_link_create(skel, tap_fd); - - close(tap_fd); out_destroy_skel: bpf_flow__destroy(skel); } + diff --git a/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c b/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c new file mode 100644 index 000000000000..80b153d3ddec --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/flow_dissector_classification.c @@ -0,0 +1,797 @@ +// SPDX-License-Identifier: GPL-2.0 + +#define _GNU_SOURCE +#include <stdbool.h> +#include <stdlib.h> +#include <stdio.h> +#include <bpf/bpf.h> +#include <linux/bpf.h> +#include <bpf/libbpf.h> +#include <arpa/inet.h> +#include <asm/byteorder.h> +#include <netinet/udp.h> +#include <poll.h> +#include <string.h> +#include <sys/ioctl.h> +#include <sys/socket.h> +#include <sys/time.h> +#include <unistd.h> +#include "test_progs.h" +#include "network_helpers.h" +#include "bpf_util.h" +#include "bpf_flow.skel.h" + +#define CFG_PORT_INNER 8000 +#define CFG_PORT_GUE 6080 +#define SUBTEST_NAME_MAX_LEN 32 +#define TEST_NAME_MAX_LEN (32 + SUBTEST_NAME_MAX_LEN) +#define MAX_SOURCE_PORTS 3 +#define TEST_PACKETS_COUNT 10 +#define TEST_PACKET_LEN 100 +#define TEST_PACKET_PATTERN 'a' +#define TEST_IPV4 "192.168.0.1/32" +#define TEST_IPV6 "100::a/128" +#define TEST_TUNNEL_REMOTE "127.0.0.2" +#define TEST_TUNNEL_LOCAL "127.0.0.1" + +#define INIT_ADDR4(addr4, port) \ + { \ + .sin_family = AF_INET, \ + .sin_port = __constant_htons(port), \ + .sin_addr.s_addr = __constant_htonl(addr4), \ + } + +#define INIT_ADDR6(addr6, port) \ + { \ + .sin6_family = AF_INET6, \ + .sin6_port = __constant_htons(port), \ + .sin6_addr = addr6, \ + } +#define TEST_IN4_SRC_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK + 2, 0) +#define TEST_IN4_DST_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK, CFG_PORT_INNER) +#define TEST_OUT4_SRC_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK + 1, 0) +#define TEST_OUT4_DST_ADDR_DEFAULT INIT_ADDR4(INADDR_LOOPBACK, 0) + +#define TEST_IN6_SRC_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0) +#define TEST_IN6_DST_ADDR_DEFAULT \ + INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, CFG_PORT_INNER) +#define TEST_OUT6_SRC_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0) +#define TEST_OUT6_DST_ADDR_DEFAULT INIT_ADDR6(IN6ADDR_LOOPBACK_INIT, 0) + +#define TEST_IN4_SRC_ADDR_DISSECT_CONTINUE INIT_ADDR4(INADDR_LOOPBACK + 126, 0) +#define TEST_IN4_SRC_ADDR_IPIP INIT_ADDR4((in_addr_t)0x01010101, 0) +#define TEST_IN4_DST_ADDR_IPIP INIT_ADDR4((in_addr_t)0xC0A80001, CFG_PORT_INNER) + +struct grehdr { + uint16_t unused; + uint16_t protocol; +} __packed; + +struct guehdr { + union { + struct { +#if defined(__LITTLE_ENDIAN_BITFIELD) + __u8 hlen : 5, control : 1, version : 2; +#elif defined(__BIG_ENDIAN_BITFIELD) + __u8 version : 2, control : 1, hlen : 5; +#else +#error "Please fix <asm/byteorder.h>" +#endif + __u8 proto_ctype; + __be16 flags; + }; + __be32 word; + }; +}; + +static char buf[ETH_DATA_LEN]; + +struct test_configuration { + char name[SUBTEST_NAME_MAX_LEN]; + int (*test_setup)(void); + void (*test_teardown)(void); + int source_ports[MAX_SOURCE_PORTS]; + int cfg_l3_inner; + struct sockaddr_in in_saddr4; + struct sockaddr_in in_daddr4; + struct sockaddr_in6 in_saddr6; + struct sockaddr_in6 in_daddr6; + int cfg_l3_outer; + struct sockaddr_in out_saddr4; + struct sockaddr_in out_daddr4; + struct sockaddr_in6 out_saddr6; + struct sockaddr_in6 out_daddr6; + int cfg_encap_proto; + uint8_t cfg_dsfield_inner; + uint8_t cfg_dsfield_outer; + int cfg_l3_extra; + struct sockaddr_in extra_saddr4; + struct sockaddr_in extra_daddr4; + struct sockaddr_in6 extra_saddr6; + struct sockaddr_in6 extra_daddr6; +}; + +static unsigned long util_gettime(void) +{ + struct timeval tv; + + gettimeofday(&tv, NULL); + return (tv.tv_sec * 1000) + (tv.tv_usec / 1000); +} + +static void build_ipv4_header(void *header, uint8_t proto, uint32_t src, + uint32_t dst, int payload_len, uint8_t tos) +{ + struct iphdr *iph = header; + + iph->ihl = 5; + iph->version = 4; + iph->tos = tos; + iph->ttl = 8; + iph->tot_len = htons(sizeof(*iph) + payload_len); + iph->id = htons(1337); + iph->protocol = proto; + iph->saddr = src; + iph->daddr = dst; + iph->check = build_ip_csum((void *)iph); +} + +static void ipv6_set_dsfield(struct ipv6hdr *ip6h, uint8_t dsfield) +{ + uint16_t val, *ptr = (uint16_t *)ip6h; + + val = ntohs(*ptr); + val &= 0xF00F; + val |= ((uint16_t)dsfield) << 4; + *ptr = htons(val); +} + +static void build_ipv6_header(void *header, uint8_t proto, + const struct sockaddr_in6 *src, + const struct sockaddr_in6 *dst, int payload_len, + uint8_t dsfield) +{ + struct ipv6hdr *ip6h = header; + + ip6h->version = 6; + ip6h->payload_len = htons(payload_len); + ip6h->nexthdr = proto; + ip6h->hop_limit = 8; + ipv6_set_dsfield(ip6h, dsfield); + + memcpy(&ip6h->saddr, &src->sin6_addr, sizeof(ip6h->saddr)); + memcpy(&ip6h->daddr, &dst->sin6_addr, sizeof(ip6h->daddr)); +} + +static void build_udp_header(void *header, int payload_len, uint16_t sport, + uint16_t dport, int family) +{ + struct udphdr *udph = header; + int len = sizeof(*udph) + payload_len; + + udph->source = htons(sport); + udph->dest = htons(dport); + udph->len = htons(len); + udph->check = 0; + if (family == AF_INET) + udph->check = build_udp_v4_csum(header - sizeof(struct iphdr), + udph); + else + udph->check = build_udp_v6_csum(header - sizeof(struct ipv6hdr), + udph); +} + +static void build_gue_header(void *header, uint8_t proto) +{ + struct guehdr *gueh = header; + + gueh->proto_ctype = proto; +} + +static void build_gre_header(void *header, uint16_t proto) +{ + struct grehdr *greh = header; + + greh->protocol = htons(proto); +} + +static int l3_length(int family) +{ + if (family == AF_INET) + return sizeof(struct iphdr); + else + return sizeof(struct ipv6hdr); +} + +static int build_packet(const struct test_configuration *test, uint16_t sport) +{ + int ol3_len = 0, ol4_len = 0, il3_len = 0, il4_len = 0; + int el3_len = 0, packet_len; + + memset(buf, 0, ETH_DATA_LEN); + + if (test->cfg_l3_extra) + el3_len = l3_length(test->cfg_l3_extra); + + /* calculate header offsets */ + if (test->cfg_encap_proto) { + ol3_len = l3_length(test->cfg_l3_outer); + + if (test->cfg_encap_proto == IPPROTO_GRE) + ol4_len = sizeof(struct grehdr); + else if (test->cfg_encap_proto == IPPROTO_UDP) + ol4_len = sizeof(struct udphdr) + sizeof(struct guehdr); + } + + il3_len = l3_length(test->cfg_l3_inner); + il4_len = sizeof(struct udphdr); + + packet_len = el3_len + ol3_len + ol4_len + il3_len + il4_len + + TEST_PACKET_LEN; + if (!ASSERT_LE(packet_len, sizeof(buf), "check packet size")) + return -1; + + /* + * Fill packet from inside out, to calculate correct checksums. + * But create ip before udp headers, as udp uses ip for pseudo-sum. + */ + memset(buf + el3_len + ol3_len + ol4_len + il3_len + il4_len, + TEST_PACKET_PATTERN, TEST_PACKET_LEN); + + /* add zero byte for udp csum padding */ + buf[el3_len + ol3_len + ol4_len + il3_len + il4_len + TEST_PACKET_LEN] = + 0; + + switch (test->cfg_l3_inner) { + case PF_INET: + build_ipv4_header(buf + el3_len + ol3_len + ol4_len, + IPPROTO_UDP, test->in_saddr4.sin_addr.s_addr, + test->in_daddr4.sin_addr.s_addr, + il4_len + TEST_PACKET_LEN, + test->cfg_dsfield_inner); + break; + case PF_INET6: + build_ipv6_header(buf + el3_len + ol3_len + ol4_len, + IPPROTO_UDP, &test->in_saddr6, + &test->in_daddr6, il4_len + TEST_PACKET_LEN, + test->cfg_dsfield_inner); + break; + } + + build_udp_header(buf + el3_len + ol3_len + ol4_len + il3_len, + TEST_PACKET_LEN, sport, CFG_PORT_INNER, + test->cfg_l3_inner); + + if (!test->cfg_encap_proto) + return il3_len + il4_len + TEST_PACKET_LEN; + + switch (test->cfg_l3_outer) { + case PF_INET: + build_ipv4_header(buf + el3_len, test->cfg_encap_proto, + test->out_saddr4.sin_addr.s_addr, + test->out_daddr4.sin_addr.s_addr, + ol4_len + il3_len + il4_len + TEST_PACKET_LEN, + test->cfg_dsfield_outer); + break; + case PF_INET6: + build_ipv6_header(buf + el3_len, test->cfg_encap_proto, + &test->out_saddr6, &test->out_daddr6, + ol4_len + il3_len + il4_len + TEST_PACKET_LEN, + test->cfg_dsfield_outer); + break; + } + + switch (test->cfg_encap_proto) { + case IPPROTO_UDP: + build_gue_header(buf + el3_len + ol3_len + ol4_len - + sizeof(struct guehdr), + test->cfg_l3_inner == PF_INET ? IPPROTO_IPIP : + IPPROTO_IPV6); + build_udp_header(buf + el3_len + ol3_len, + sizeof(struct guehdr) + il3_len + il4_len + + TEST_PACKET_LEN, + sport, CFG_PORT_GUE, test->cfg_l3_outer); + break; + case IPPROTO_GRE: + build_gre_header(buf + el3_len + ol3_len, + test->cfg_l3_inner == PF_INET ? ETH_P_IP : + ETH_P_IPV6); + break; + } + + switch (test->cfg_l3_extra) { + case PF_INET: + build_ipv4_header(buf, + test->cfg_l3_outer == PF_INET ? IPPROTO_IPIP : + IPPROTO_IPV6, + test->extra_saddr4.sin_addr.s_addr, + test->extra_daddr4.sin_addr.s_addr, + ol3_len + ol4_len + il3_len + il4_len + + TEST_PACKET_LEN, + 0); + break; + case PF_INET6: + build_ipv6_header(buf, + test->cfg_l3_outer == PF_INET ? IPPROTO_IPIP : + IPPROTO_IPV6, + &test->extra_saddr6, &test->extra_daddr6, + ol3_len + ol4_len + il3_len + il4_len + + TEST_PACKET_LEN, + 0); + break; + } + + return el3_len + ol3_len + ol4_len + il3_len + il4_len + + TEST_PACKET_LEN; +} + +/* sender transmits encapsulated over RAW or unencap'd over UDP */ +static int setup_tx(const struct test_configuration *test) +{ + int family, fd, ret; + + if (test->cfg_l3_extra) + family = test->cfg_l3_extra; + else if (test->cfg_l3_outer) + family = test->cfg_l3_outer; + else + family = test->cfg_l3_inner; + + fd = socket(family, SOCK_RAW, IPPROTO_RAW); + if (!ASSERT_OK_FD(fd, "setup tx socket")) + return fd; + + if (test->cfg_l3_extra) { + if (test->cfg_l3_extra == PF_INET) + ret = connect(fd, (void *)&test->extra_daddr4, + sizeof(test->extra_daddr4)); + else + ret = connect(fd, (void *)&test->extra_daddr6, + sizeof(test->extra_daddr6)); + if (!ASSERT_OK(ret, "connect")) { + close(fd); + return ret; + } + } else if (test->cfg_l3_outer) { + /* connect to destination if not encapsulated */ + if (test->cfg_l3_outer == PF_INET) + ret = connect(fd, (void *)&test->out_daddr4, + sizeof(test->out_daddr4)); + else + ret = connect(fd, (void *)&test->out_daddr6, + sizeof(test->out_daddr6)); + if (!ASSERT_OK(ret, "connect")) { + close(fd); + return ret; + } + } else { + /* otherwise using loopback */ + if (test->cfg_l3_inner == PF_INET) + ret = connect(fd, (void *)&test->in_daddr4, + sizeof(test->in_daddr4)); + else + ret = connect(fd, (void *)&test->in_daddr6, + sizeof(test->in_daddr6)); + if (!ASSERT_OK(ret, "connect")) { + close(fd); + return ret; + } + } + + return fd; +} + +/* receiver reads unencapsulated UDP */ +static int setup_rx(const struct test_configuration *test) +{ + int fd, ret; + + fd = socket(test->cfg_l3_inner, SOCK_DGRAM, 0); + if (!ASSERT_OK_FD(fd, "socket rx")) + return fd; + + if (test->cfg_l3_inner == PF_INET) + ret = bind(fd, (void *)&test->in_daddr4, + sizeof(test->in_daddr4)); + else + ret = bind(fd, (void *)&test->in_daddr6, + sizeof(test->in_daddr6)); + if (!ASSERT_OK(ret, "bind rx")) { + close(fd); + return ret; + } + + return fd; +} + +static int do_tx(int fd, const char *pkt, int len) +{ + int ret; + + ret = write(fd, pkt, len); + return ret != len; +} + +static int do_poll(int fd, short events, int timeout) +{ + struct pollfd pfd; + int ret; + + pfd.fd = fd; + pfd.events = events; + + ret = poll(&pfd, 1, timeout); + return ret; +} + +static int do_rx(int fd) +{ + char rbuf; + int ret, num = 0; + + while (1) { + ret = recv(fd, &rbuf, 1, MSG_DONTWAIT); + if (ret == -1 && errno == EAGAIN) + break; + if (ret < 0) + return -1; + if (!ASSERT_EQ(rbuf, TEST_PACKET_PATTERN, "check pkt pattern")) + return -1; + num++; + } + + return num; +} + +static int run_test(const struct test_configuration *test, + int source_port_index) +{ + int fdt = -1, fdr = -1, len, tx = 0, rx = 0, err; + unsigned long tstop, tcur; + + fdr = setup_rx(test); + fdt = setup_tx(test); + if (!ASSERT_OK_FD(fdr, "setup rx") || !ASSERT_OK_FD(fdt, "setup tx")) { + err = -1; + goto out_close_sockets; + } + + len = build_packet(test, + (uint16_t)test->source_ports[source_port_index]); + if (!ASSERT_GT(len, 0, "build test packet")) + return -1; + + tcur = util_gettime(); + tstop = tcur; + + while (tx < TEST_PACKETS_COUNT) { + if (!ASSERT_OK(do_tx(fdt, buf, len), "do_tx")) + break; + tx++; + err = do_rx(fdr); + if (!ASSERT_GE(err, 0, "do_rx")) + break; + rx += err; + } + + /* read straggler packets, if any */ + if (rx < tx) { + tstop = util_gettime() + 100; + while (rx < tx) { + tcur = util_gettime(); + if (tcur >= tstop) + break; + + err = do_poll(fdr, POLLIN, tstop - tcur); + if (err < 0) + break; + err = do_rx(fdr); + if (err >= 0) + rx += err; + } + } + +out_close_sockets: + close(fdt); + close(fdr); + return rx; +} + +static int attach_and_configure_program(struct bpf_flow *skel) +{ + struct bpf_map *prog_array = skel->maps.jmp_table; + int main_prog_fd, sub_prog_fd, map_fd, i, err; + struct bpf_program *prog; + char prog_name[32]; + + main_prog_fd = bpf_program__fd(skel->progs._dissect); + if (main_prog_fd < 0) + return main_prog_fd; + + err = bpf_prog_attach(main_prog_fd, 0, BPF_FLOW_DISSECTOR, 0); + if (err) + return err; + + map_fd = bpf_map__fd(prog_array); + if (map_fd < 0) + return map_fd; + + for (i = 0; i < bpf_map__max_entries(prog_array); i++) { + snprintf(prog_name, sizeof(prog_name), "flow_dissector_%d", i); + + prog = bpf_object__find_program_by_name(skel->obj, prog_name); + if (!prog) + return -1; + + sub_prog_fd = bpf_program__fd(prog); + if (sub_prog_fd < 0) + return -1; + + err = bpf_map_update_elem(map_fd, &i, &sub_prog_fd, BPF_ANY); + if (err) + return -1; + } + + return main_prog_fd; +} + +static void detach_program(struct bpf_flow *skel, int prog_fd) +{ + bpf_prog_detach2(prog_fd, 0, BPF_FLOW_DISSECTOR); +} + +static int set_port_drop(int pf, bool multi_port) +{ + char dst_port[16]; + + snprintf(dst_port, sizeof(dst_port), "%d", CFG_PORT_INNER); + + SYS(fail, "tc qdisc add dev lo ingress"); + SYS(fail_delete_qdisc, "tc filter add %s %s %s %s %s %s %s %s %s %s %s %s", + "dev lo", + "parent FFFF:", + "protocol", pf == PF_INET6 ? "ipv6" : "ip", + "pref 1337", + "flower", + "ip_proto udp", + "src_port", multi_port ? "8-10" : "9", + "dst_port", dst_port, + "action drop"); + return 0; + +fail_delete_qdisc: + SYS_NOFAIL("tc qdisc del dev lo ingress"); +fail: + return 1; +} + +static void remove_filter(void) +{ + SYS_NOFAIL("tc filter del dev lo ingress"); + SYS_NOFAIL("tc qdisc del dev lo ingress"); +} + +static int ipv4_setup(void) +{ + return set_port_drop(PF_INET, false); +} + +static int ipv6_setup(void) +{ + return set_port_drop(PF_INET6, false); +} + +static int port_range_setup(void) +{ + return set_port_drop(PF_INET, true); +} + +static int set_addresses(void) +{ + SYS(out, "ip -4 addr add %s dev lo", TEST_IPV4); + SYS(out_remove_ipv4, "ip -6 addr add %s dev lo", TEST_IPV6); + return 0; +out_remove_ipv4: + SYS_NOFAIL("ip -4 addr del %s dev lo", TEST_IPV4); +out: + return -1; +} + +static void unset_addresses(void) +{ + SYS_NOFAIL("ip -4 addr del %s dev lo", TEST_IPV4); + SYS_NOFAIL("ip -6 addr del %s dev lo", TEST_IPV6); +} + +static int ipip_setup(void) +{ + if (!ASSERT_OK(set_addresses(), "configure addresses")) + return -1; + if (!ASSERT_OK(set_port_drop(PF_INET, false), "set filter")) + goto out_unset_addresses; + SYS(out_remove_filter, + "ip link add ipip_test type ipip remote %s local %s dev lo", + TEST_TUNNEL_REMOTE, TEST_TUNNEL_LOCAL); + SYS(out_clean_netif, "ip link set ipip_test up"); + return 0; + +out_clean_netif: + SYS_NOFAIL("ip link del ipip_test"); +out_remove_filter: + remove_filter(); +out_unset_addresses: + unset_addresses(); + return -1; +} + +static void ipip_shutdown(void) +{ + SYS_NOFAIL("ip link del ipip_test"); + remove_filter(); + unset_addresses(); +} + +static int gre_setup(void) +{ + if (!ASSERT_OK(set_addresses(), "configure addresses")) + return -1; + if (!ASSERT_OK(set_port_drop(PF_INET, false), "set filter")) + goto out_unset_addresses; + SYS(out_remove_filter, + "ip link add gre_test type gre remote %s local %s dev lo", + TEST_TUNNEL_REMOTE, TEST_TUNNEL_LOCAL); + SYS(out_clean_netif, "ip link set gre_test up"); + return 0; + +out_clean_netif: + SYS_NOFAIL("ip link del ipip_test"); +out_remove_filter: + remove_filter(); +out_unset_addresses: + unset_addresses(); + return -1; +} + +static void gre_shutdown(void) +{ + SYS_NOFAIL("ip link del gre_test"); + remove_filter(); + unset_addresses(); +} + +static const struct test_configuration tests_input[] = { + { + .name = "ipv4", + .test_setup = ipv4_setup, + .test_teardown = remove_filter, + .source_ports = { 8, 9, 10 }, + .cfg_l3_inner = PF_INET, + .in_saddr4 = TEST_IN4_SRC_ADDR_DEFAULT, + .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT + }, + { + .name = "ipv4_continue_dissect", + .test_setup = ipv4_setup, + .test_teardown = remove_filter, + .source_ports = { 8, 9, 10 }, + .cfg_l3_inner = PF_INET, + .in_saddr4 = TEST_IN4_SRC_ADDR_DISSECT_CONTINUE, + .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT }, + { + .name = "ipip", + .test_setup = ipip_setup, + .test_teardown = ipip_shutdown, + .source_ports = { 8, 9, 10 }, + .cfg_l3_inner = PF_INET, + .in_saddr4 = TEST_IN4_SRC_ADDR_IPIP, + .in_daddr4 = TEST_IN4_DST_ADDR_IPIP, + .out_saddr4 = TEST_OUT4_SRC_ADDR_DEFAULT, + .out_daddr4 = TEST_OUT4_DST_ADDR_DEFAULT, + .cfg_l3_outer = PF_INET, + .cfg_encap_proto = IPPROTO_IPIP, + + }, + { + .name = "gre", + .test_setup = gre_setup, + .test_teardown = gre_shutdown, + .source_ports = { 8, 9, 10 }, + .cfg_l3_inner = PF_INET, + .in_saddr4 = TEST_IN4_SRC_ADDR_IPIP, + .in_daddr4 = TEST_IN4_DST_ADDR_IPIP, + .out_saddr4 = TEST_OUT4_SRC_ADDR_DEFAULT, + .out_daddr4 = TEST_OUT4_DST_ADDR_DEFAULT, + .cfg_l3_outer = PF_INET, + .cfg_encap_proto = IPPROTO_GRE, + }, + { + .name = "port_range", + .test_setup = port_range_setup, + .test_teardown = remove_filter, + .source_ports = { 7, 9, 11 }, + .cfg_l3_inner = PF_INET, + .in_saddr4 = TEST_IN4_SRC_ADDR_DEFAULT, + .in_daddr4 = TEST_IN4_DST_ADDR_DEFAULT }, + { + .name = "ipv6", + .test_setup = ipv6_setup, + .test_teardown = remove_filter, + .source_ports = { 8, 9, 10 }, + .cfg_l3_inner = PF_INET6, + .in_saddr6 = TEST_IN6_SRC_ADDR_DEFAULT, + .in_daddr6 = TEST_IN6_DST_ADDR_DEFAULT + }, +}; + +struct test_ctx { + struct bpf_flow *skel; + struct netns_obj *ns; + int prog_fd; +}; + +static int test_global_init(struct test_ctx *ctx) +{ + int err; + + ctx->skel = bpf_flow__open_and_load(); + if (!ASSERT_OK_PTR(ctx->skel, "open and load flow_dissector")) + return -1; + + ctx->ns = netns_new("flow_dissector_classification", true); + if (!ASSERT_OK_PTR(ctx->ns, "switch ns")) + goto out_destroy_skel; + + err = write_sysctl("/proc/sys/net/ipv4/conf/default/rp_filter", "0"); + err |= write_sysctl("/proc/sys/net/ipv4/conf/all/rp_filter", "0"); + err |= write_sysctl("/proc/sys/net/ipv4/conf/lo/rp_filter", "0"); + if (!ASSERT_OK(err, "configure net tunables")) + goto out_clean_ns; + + ctx->prog_fd = attach_and_configure_program(ctx->skel); + if (!ASSERT_OK_FD(ctx->prog_fd, "attach and configure program")) + goto out_clean_ns; + return 0; +out_clean_ns: + netns_free(ctx->ns); +out_destroy_skel: + bpf_flow__destroy(ctx->skel); + return -1; +} + +static void test_global_shutdown(struct test_ctx *ctx) +{ + detach_program(ctx->skel, ctx->prog_fd); + netns_free(ctx->ns); + bpf_flow__destroy(ctx->skel); +} + +void test_flow_dissector_classification(void) +{ + struct test_ctx ctx; + const struct test_configuration *test; + int i; + + if (test_global_init(&ctx)) + return; + + for (i = 0; i < ARRAY_SIZE(tests_input); i++) { + if (!test__start_subtest(tests_input[i].name)) + continue; + test = &tests_input[i]; + /* All tests are expected to have one rx-ok port first, + * then a non-working rx port, and finally a rx-ok port + */ + if (test->test_setup && + !ASSERT_OK(test->test_setup(), "init filter")) + continue; + + ASSERT_EQ(run_test(test, 0), TEST_PACKETS_COUNT, + "test first port"); + ASSERT_EQ(run_test(test, 1), 0, "test second port"); + ASSERT_EQ(run_test(test, 2), TEST_PACKETS_COUNT, + "test third port"); + if (test->test_teardown) + test->test_teardown(); + } + test_global_shutdown(&ctx); +} diff --git a/tools/testing/selftests/bpf/prog_tests/free_timer.c b/tools/testing/selftests/bpf/prog_tests/free_timer.c new file mode 100644 index 000000000000..b7b77a6b2979 --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/free_timer.c @@ -0,0 +1,165 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (C) 2025. Huawei Technologies Co., Ltd */ +#define _GNU_SOURCE +#include <unistd.h> +#include <sys/syscall.h> +#include <test_progs.h> + +#include "free_timer.skel.h" + +struct run_ctx { + struct bpf_program *start_prog; + struct bpf_program *overwrite_prog; + pthread_barrier_t notify; + int loop; + bool start; + bool stop; +}; + +static void start_threads(struct run_ctx *ctx) +{ + ctx->start = true; +} + +static void stop_threads(struct run_ctx *ctx) +{ + ctx->stop = true; + /* Guarantee the order between ->stop and ->start */ + __atomic_store_n(&ctx->start, true, __ATOMIC_RELEASE); +} + +static int wait_for_start(struct run_ctx *ctx) +{ + while (!__atomic_load_n(&ctx->start, __ATOMIC_ACQUIRE)) + usleep(10); + + return ctx->stop; +} + +static void *overwrite_timer_fn(void *arg) +{ + struct run_ctx *ctx = arg; + int loop, fd, err; + cpu_set_t cpuset; + long ret = 0; + + /* Pin on CPU 0 */ + CPU_ZERO(&cpuset); + CPU_SET(0, &cpuset); + pthread_setaffinity_np(pthread_self(), sizeof(cpuset), &cpuset); + + /* Is the thread being stopped ? */ + err = wait_for_start(ctx); + if (err) + return NULL; + + fd = bpf_program__fd(ctx->overwrite_prog); + loop = ctx->loop; + while (loop-- > 0) { + LIBBPF_OPTS(bpf_test_run_opts, opts); + + /* Wait for start thread to complete */ + pthread_barrier_wait(&ctx->notify); + + /* Overwrite timers */ + err = bpf_prog_test_run_opts(fd, &opts); + if (err) + ret |= 1; + else if (opts.retval) + ret |= 2; + + /* Notify start thread to start timers */ + pthread_barrier_wait(&ctx->notify); + } + + return (void *)ret; +} + +static void *start_timer_fn(void *arg) +{ + struct run_ctx *ctx = arg; + int loop, fd, err; + cpu_set_t cpuset; + long ret = 0; + + /* Pin on CPU 1 */ + CPU_ZERO(&cpuset); + CPU_SET(1, &cpuset); + pthread_setaffinity_np(pthread_self(), sizeof(cpuset), &cpuset); + + /* Is the thread being stopped ? */ + err = wait_for_start(ctx); + if (err) + return NULL; + + fd = bpf_program__fd(ctx->start_prog); + loop = ctx->loop; + while (loop-- > 0) { + LIBBPF_OPTS(bpf_test_run_opts, opts); + + /* Run the prog to start timer */ + err = bpf_prog_test_run_opts(fd, &opts); + if (err) + ret |= 4; + else if (opts.retval) + ret |= 8; + + /* Notify overwrite thread to do overwrite */ + pthread_barrier_wait(&ctx->notify); + + /* Wait for overwrite thread to complete */ + pthread_barrier_wait(&ctx->notify); + } + + return (void *)ret; +} + +void test_free_timer(void) +{ + struct free_timer *skel; + struct bpf_program *prog; + struct run_ctx ctx; + pthread_t tid[2]; + void *ret; + int err; + + skel = free_timer__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open_load")) + return; + + memset(&ctx, 0, sizeof(ctx)); + + prog = bpf_object__find_program_by_name(skel->obj, "start_timer"); + if (!ASSERT_OK_PTR(prog, "find start prog")) + goto out; + ctx.start_prog = prog; + + prog = bpf_object__find_program_by_name(skel->obj, "overwrite_timer"); + if (!ASSERT_OK_PTR(prog, "find overwrite prog")) + goto out; + ctx.overwrite_prog = prog; + + pthread_barrier_init(&ctx.notify, NULL, 2); + ctx.loop = 10; + + err = pthread_create(&tid[0], NULL, start_timer_fn, &ctx); + if (!ASSERT_OK(err, "create start_timer")) + goto out; + + err = pthread_create(&tid[1], NULL, overwrite_timer_fn, &ctx); + if (!ASSERT_OK(err, "create overwrite_timer")) { + stop_threads(&ctx); + goto out; + } + + start_threads(&ctx); + + ret = NULL; + err = pthread_join(tid[0], &ret); + ASSERT_EQ(err | (long)ret, 0, "start_timer"); + ret = NULL; + err = pthread_join(tid[1], &ret); + ASSERT_EQ(err | (long)ret, 0, "overwrite_timer"); +out: + free_timer__destroy(skel); +} diff --git a/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c b/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c index 66ab1cae923e..e19ef509ebf8 100644 --- a/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c +++ b/tools/testing/selftests/bpf/prog_tests/kprobe_multi_test.c @@ -397,6 +397,31 @@ cleanup: kprobe_multi_session_cookie__destroy(skel); } +static void test_unique_match(void) +{ + LIBBPF_OPTS(bpf_kprobe_multi_opts, opts); + struct kprobe_multi *skel = NULL; + struct bpf_link *link = NULL; + + skel = kprobe_multi__open_and_load(); + if (!ASSERT_OK_PTR(skel, "kprobe_multi__open_and_load")) + return; + + opts.unique_match = true; + skel->bss->pid = getpid(); + link = bpf_program__attach_kprobe_multi_opts(skel->progs.test_kprobe_manual, + "bpf_fentry_test*", &opts); + if (!ASSERT_ERR_PTR(link, "bpf_program__attach_kprobe_multi_opts")) + bpf_link__destroy(link); + + link = bpf_program__attach_kprobe_multi_opts(skel->progs.test_kprobe_manual, + "bpf_fentry_test8*", &opts); + if (ASSERT_OK_PTR(link, "bpf_program__attach_kprobe_multi_opts")) + bpf_link__destroy(link); + + kprobe_multi__destroy(skel); +} + static size_t symbol_hash(long key, void *ctx __maybe_unused) { return str_hash((const char *) key); @@ -765,5 +790,7 @@ void test_kprobe_multi_test(void) test_session_skel_api(); if (test__start_subtest("session_cookie")) test_session_cookie_skel_api(); + if (test__start_subtest("unique_match")) + test_unique_match(); RUN_TESTS(kprobe_multi_verifier); } diff --git a/tools/testing/selftests/bpf/prog_tests/missed.c b/tools/testing/selftests/bpf/prog_tests/missed.c index 70d90c43537c..ed8857ae914a 100644 --- a/tools/testing/selftests/bpf/prog_tests/missed.c +++ b/tools/testing/selftests/bpf/prog_tests/missed.c @@ -85,6 +85,7 @@ static void test_missed_kprobe_recursion(void) ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test3)), 1, "test3_recursion_misses"); ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test4)), 1, "test4_recursion_misses"); ASSERT_GE(get_missed_count(bpf_program__fd(skel->progs.test5)), 1, "test5_recursion_misses"); + ASSERT_EQ(get_missed_count(bpf_program__fd(skel->progs.test6)), 1, "test6_recursion_misses"); cleanup: missed_kprobe_recursion__destroy(skel); diff --git a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c index 6fa19449297e..43676a9922dc 100644 --- a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c +++ b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c @@ -3,11 +3,14 @@ #include <test_progs.h> #include "raw_tp_null.skel.h" +#include "raw_tp_null_fail.skel.h" void test_raw_tp_null(void) { struct raw_tp_null *skel; + RUN_TESTS(raw_tp_null_fail); + skel = raw_tp_null__open_and_load(); if (!ASSERT_OK_PTR(skel, "raw_tp_null__open_and_load")) return; diff --git a/tools/testing/selftests/bpf/prog_tests/socket_helpers.h b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h new file mode 100644 index 000000000000..1bdfb79ef009 --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h @@ -0,0 +1,394 @@ +/* SPDX-License-Identifier: GPL-2.0 */ + +#ifndef __SOCKET_HELPERS__ +#define __SOCKET_HELPERS__ + +#include <linux/vm_sockets.h> + +/* include/linux/net.h */ +#define SOCK_TYPE_MASK 0xf + +#define IO_TIMEOUT_SEC 30 +#define MAX_STRERR_LEN 256 + +/* workaround for older vm_sockets.h */ +#ifndef VMADDR_CID_LOCAL +#define VMADDR_CID_LOCAL 1 +#endif + +/* include/linux/cleanup.h */ +#define __get_and_null(p, nullvalue) \ + ({ \ + __auto_type __ptr = &(p); \ + __auto_type __val = *__ptr; \ + *__ptr = nullvalue; \ + __val; \ + }) + +#define take_fd(fd) __get_and_null(fd, -EBADF) + +/* Wrappers that fail the test on error and report it. */ + +#define _FAIL(errnum, fmt...) \ + ({ \ + error_at_line(0, (errnum), __func__, __LINE__, fmt); \ + CHECK_FAIL(true); \ + }) +#define FAIL(fmt...) _FAIL(0, fmt) +#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt) +#define FAIL_LIBBPF(err, msg) \ + ({ \ + char __buf[MAX_STRERR_LEN]; \ + libbpf_strerror((err), __buf, sizeof(__buf)); \ + FAIL("%s: %s", (msg), __buf); \ + }) + + +#define xaccept_nonblock(fd, addr, len) \ + ({ \ + int __ret = \ + accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \ + if (__ret == -1) \ + FAIL_ERRNO("accept"); \ + __ret; \ + }) + +#define xbind(fd, addr, len) \ + ({ \ + int __ret = bind((fd), (addr), (len)); \ + if (__ret == -1) \ + FAIL_ERRNO("bind"); \ + __ret; \ + }) + +#define xclose(fd) \ + ({ \ + int __ret = close((fd)); \ + if (__ret == -1) \ + FAIL_ERRNO("close"); \ + __ret; \ + }) + +#define xconnect(fd, addr, len) \ + ({ \ + int __ret = connect((fd), (addr), (len)); \ + if (__ret == -1) \ + FAIL_ERRNO("connect"); \ + __ret; \ + }) + +#define xgetsockname(fd, addr, len) \ + ({ \ + int __ret = getsockname((fd), (addr), (len)); \ + if (__ret == -1) \ + FAIL_ERRNO("getsockname"); \ + __ret; \ + }) + +#define xgetsockopt(fd, level, name, val, len) \ + ({ \ + int __ret = getsockopt((fd), (level), (name), (val), (len)); \ + if (__ret == -1) \ + FAIL_ERRNO("getsockopt(" #name ")"); \ + __ret; \ + }) + +#define xlisten(fd, backlog) \ + ({ \ + int __ret = listen((fd), (backlog)); \ + if (__ret == -1) \ + FAIL_ERRNO("listen"); \ + __ret; \ + }) + +#define xsetsockopt(fd, level, name, val, len) \ + ({ \ + int __ret = setsockopt((fd), (level), (name), (val), (len)); \ + if (__ret == -1) \ + FAIL_ERRNO("setsockopt(" #name ")"); \ + __ret; \ + }) + +#define xsend(fd, buf, len, flags) \ + ({ \ + ssize_t __ret = send((fd), (buf), (len), (flags)); \ + if (__ret == -1) \ + FAIL_ERRNO("send"); \ + __ret; \ + }) + +#define xrecv_nonblock(fd, buf, len, flags) \ + ({ \ + ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \ + IO_TIMEOUT_SEC); \ + if (__ret == -1) \ + FAIL_ERRNO("recv"); \ + __ret; \ + }) + +#define xsocket(family, sotype, flags) \ + ({ \ + int __ret = socket(family, sotype, flags); \ + if (__ret == -1) \ + FAIL_ERRNO("socket"); \ + __ret; \ + }) + +static inline void close_fd(int *fd) +{ + if (*fd >= 0) + xclose(*fd); +} + +#define __close_fd __attribute__((cleanup(close_fd))) + +static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss) +{ + return (struct sockaddr *)ss; +} + +static inline void init_addr_loopback4(struct sockaddr_storage *ss, + socklen_t *len) +{ + struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss)); + + addr4->sin_family = AF_INET; + addr4->sin_port = 0; + addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK); + *len = sizeof(*addr4); +} + +static inline void init_addr_loopback6(struct sockaddr_storage *ss, + socklen_t *len) +{ + struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss)); + + addr6->sin6_family = AF_INET6; + addr6->sin6_port = 0; + addr6->sin6_addr = in6addr_loopback; + *len = sizeof(*addr6); +} + +static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss, + socklen_t *len) +{ + struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss)); + + addr->svm_family = AF_VSOCK; + addr->svm_port = VMADDR_PORT_ANY; + addr->svm_cid = VMADDR_CID_LOCAL; + *len = sizeof(*addr); +} + +static inline void init_addr_loopback(int family, struct sockaddr_storage *ss, + socklen_t *len) +{ + switch (family) { + case AF_INET: + init_addr_loopback4(ss, len); + return; + case AF_INET6: + init_addr_loopback6(ss, len); + return; + case AF_VSOCK: + init_addr_loopback_vsock(ss, len); + return; + default: + FAIL("unsupported address family %d", family); + } +} + +static inline int enable_reuseport(int s, int progfd) +{ + int err, one = 1; + + err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one)); + if (err) + return -1; + err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd, + sizeof(progfd)); + if (err) + return -1; + + return 0; +} + +static inline int socket_loopback_reuseport(int family, int sotype, int progfd) +{ + struct sockaddr_storage addr; + socklen_t len = 0; + int err, s; + + init_addr_loopback(family, &addr, &len); + + s = xsocket(family, sotype, 0); + if (s == -1) + return -1; + + if (progfd >= 0) + enable_reuseport(s, progfd); + + err = xbind(s, sockaddr(&addr), len); + if (err) + goto close; + + if (sotype & SOCK_DGRAM) + return s; + + err = xlisten(s, SOMAXCONN); + if (err) + goto close; + + return s; +close: + xclose(s); + return -1; +} + +static inline int socket_loopback(int family, int sotype) +{ + return socket_loopback_reuseport(family, sotype, -1); +} + +static inline int poll_connect(int fd, unsigned int timeout_sec) +{ + struct timeval timeout = { .tv_sec = timeout_sec }; + fd_set wfds; + int r, eval; + socklen_t esize = sizeof(eval); + + FD_ZERO(&wfds); + FD_SET(fd, &wfds); + + r = select(fd + 1, NULL, &wfds, NULL, &timeout); + if (r == 0) + errno = ETIME; + if (r != 1) + return -1; + + if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0) + return -1; + if (eval != 0) { + errno = eval; + return -1; + } + + return 0; +} + +static inline int poll_read(int fd, unsigned int timeout_sec) +{ + struct timeval timeout = { .tv_sec = timeout_sec }; + fd_set rfds; + int r; + + FD_ZERO(&rfds); + FD_SET(fd, &rfds); + + r = select(fd + 1, &rfds, NULL, NULL, &timeout); + if (r == 0) + errno = ETIME; + + return r == 1 ? 0 : -1; +} + +static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len, + unsigned int timeout_sec) +{ + if (poll_read(fd, timeout_sec)) + return -1; + + return accept(fd, addr, len); +} + +static inline int recv_timeout(int fd, void *buf, size_t len, int flags, + unsigned int timeout_sec) +{ + if (poll_read(fd, timeout_sec)) + return -1; + + return recv(fd, buf, len, flags); +} + + +static inline int create_pair(int family, int sotype, int *p0, int *p1) +{ + __close_fd int s, c = -1, p = -1; + struct sockaddr_storage addr; + socklen_t len = sizeof(addr); + int err; + + s = socket_loopback(family, sotype); + if (s < 0) + return s; + + err = xgetsockname(s, sockaddr(&addr), &len); + if (err) + return err; + + c = xsocket(family, sotype, 0); + if (c < 0) + return c; + + err = connect(c, sockaddr(&addr), len); + if (err) { + if (errno != EINPROGRESS) { + FAIL_ERRNO("connect"); + return err; + } + + err = poll_connect(c, IO_TIMEOUT_SEC); + if (err) { + FAIL_ERRNO("poll_connect"); + return err; + } + } + + switch (sotype & SOCK_TYPE_MASK) { + case SOCK_DGRAM: + err = xgetsockname(c, sockaddr(&addr), &len); + if (err) + return err; + + err = xconnect(s, sockaddr(&addr), len); + if (err) + return err; + + *p0 = take_fd(s); + break; + case SOCK_STREAM: + case SOCK_SEQPACKET: + p = xaccept_nonblock(s, NULL, NULL); + if (p < 0) + return p; + + *p0 = take_fd(p); + break; + default: + FAIL("Unsupported socket type %#x", sotype); + return -EOPNOTSUPP; + } + + *p1 = take_fd(c); + return 0; +} + +static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1, + int *p0, int *p1) +{ + int err; + + err = create_pair(family, sotype, c0, p0); + if (err) + return err; + + err = create_pair(family, sotype, c1, p1); + if (err) { + close(*c0); + close(*p0); + } + + return err; +} + +#endif // __SOCKET_HELPERS__ diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c index a2041f8e32eb..1e3e4392dcca 100644 --- a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c +++ b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c @@ -12,6 +12,7 @@ #include "test_sockmap_progs_query.skel.h" #include "test_sockmap_pass_prog.skel.h" #include "test_sockmap_drop_prog.skel.h" +#include "test_sockmap_change_tail.skel.h" #include "bpf_iter_sockmap.skel.h" #include "sockmap_helpers.h" @@ -108,6 +109,39 @@ out: close(s); } +static void test_sockmap_vsock_delete_on_close(void) +{ + int map, c, p, err, zero = 0; + + map = bpf_map_create(BPF_MAP_TYPE_SOCKMAP, NULL, sizeof(int), + sizeof(int), 1, NULL); + if (!ASSERT_OK_FD(map, "bpf_map_create")) + return; + + err = create_pair(AF_VSOCK, SOCK_STREAM, &c, &p); + if (!ASSERT_OK(err, "create_pair")) + goto close_map; + + if (xbpf_map_update_elem(map, &zero, &c, BPF_NOEXIST)) + goto close_socks; + + xclose(c); + xclose(p); + + err = create_pair(AF_VSOCK, SOCK_STREAM, &c, &p); + if (!ASSERT_OK(err, "create_pair")) + goto close_map; + + err = bpf_map_update_elem(map, &zero, &c, BPF_NOEXIST); + ASSERT_OK(err, "after close(), bpf_map_update"); + +close_socks: + xclose(c); + xclose(p); +close_map: + xclose(map); +} + static void test_skmsg_helpers(enum bpf_map_type map_type) { struct test_skmsg_load_helpers *skel; @@ -492,8 +526,8 @@ static void test_sockmap_skb_verdict_shutdown(void) if (!ASSERT_EQ(err, 1, "epoll_wait(fd)")) goto out_close; - n = recv(c1, &b, 1, SOCK_NONBLOCK); - ASSERT_EQ(n, 0, "recv_timeout(fin)"); + n = recv(c1, &b, 1, MSG_DONTWAIT); + ASSERT_EQ(n, 0, "recv(fin)"); out_close: close(c1); close(p1); @@ -501,57 +535,6 @@ out: test_sockmap_pass_prog__destroy(skel); } -static void test_sockmap_stream_pass(void) -{ - int zero = 0, sent, recvd; - int verdict, parser; - int err, map; - int c = -1, p = -1; - struct test_sockmap_pass_prog *pass = NULL; - char snd[256] = "0123456789"; - char rcv[256] = "0"; - - pass = test_sockmap_pass_prog__open_and_load(); - verdict = bpf_program__fd(pass->progs.prog_skb_verdict); - parser = bpf_program__fd(pass->progs.prog_skb_parser); - map = bpf_map__fd(pass->maps.sock_map_rx); - - err = bpf_prog_attach(parser, map, BPF_SK_SKB_STREAM_PARSER, 0); - if (!ASSERT_OK(err, "bpf_prog_attach stream parser")) - goto out; - - err = bpf_prog_attach(verdict, map, BPF_SK_SKB_STREAM_VERDICT, 0); - if (!ASSERT_OK(err, "bpf_prog_attach stream verdict")) - goto out; - - err = create_pair(AF_INET, SOCK_STREAM, &c, &p); - if (err) - goto out; - - /* sk_data_ready of 'p' will be replaced by strparser handler */ - err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST); - if (!ASSERT_OK(err, "bpf_map_update_elem(p)")) - goto out_close; - - /* - * as 'prog_skb_parser' return the original skb len and - * 'prog_skb_verdict' return SK_PASS, the kernel will just - * pass it through to original socket 'p' - */ - sent = xsend(c, snd, sizeof(snd), 0); - ASSERT_EQ(sent, sizeof(snd), "xsend(c)"); - - recvd = recv_timeout(p, rcv, sizeof(rcv), SOCK_NONBLOCK, - IO_TIMEOUT_SEC); - ASSERT_EQ(recvd, sizeof(rcv), "recv_timeout(p)"); - -out_close: - close(c); - close(p); - -out: - test_sockmap_pass_prog__destroy(pass); -} static void test_sockmap_skb_verdict_fionread(bool pass_prog) { @@ -598,7 +581,7 @@ static void test_sockmap_skb_verdict_fionread(bool pass_prog) ASSERT_EQ(avail, expected, "ioctl(FIONREAD)"); /* On DROP test there will be no data to read */ if (pass_prog) { - recvd = recv_timeout(c1, &buf, sizeof(buf), SOCK_NONBLOCK, IO_TIMEOUT_SEC); + recvd = recv_timeout(c1, &buf, sizeof(buf), MSG_DONTWAIT, IO_TIMEOUT_SEC); ASSERT_EQ(recvd, sizeof(buf), "recv_timeout(c0)"); } @@ -614,6 +597,54 @@ out: test_sockmap_drop_prog__destroy(drop); } +static void test_sockmap_skb_verdict_change_tail(void) +{ + struct test_sockmap_change_tail *skel; + int err, map, verdict; + int c1, p1, sent, recvd; + int zero = 0; + char buf[2]; + + skel = test_sockmap_change_tail__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open_and_load")) + return; + verdict = bpf_program__fd(skel->progs.prog_skb_verdict); + map = bpf_map__fd(skel->maps.sock_map_rx); + + err = bpf_prog_attach(verdict, map, BPF_SK_SKB_STREAM_VERDICT, 0); + if (!ASSERT_OK(err, "bpf_prog_attach")) + goto out; + err = create_pair(AF_INET, SOCK_STREAM, &c1, &p1); + if (!ASSERT_OK(err, "create_pair()")) + goto out; + err = bpf_map_update_elem(map, &zero, &c1, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(c1)")) + goto out_close; + sent = xsend(p1, "Tr", 2, 0); + ASSERT_EQ(sent, 2, "xsend(p1)"); + recvd = recv(c1, buf, 2, 0); + ASSERT_EQ(recvd, 1, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret"); + + sent = xsend(p1, "G", 1, 0); + ASSERT_EQ(sent, 1, "xsend(p1)"); + recvd = recv(c1, buf, 2, 0); + ASSERT_EQ(recvd, 2, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret"); + + sent = xsend(p1, "E", 1, 0); + ASSERT_EQ(sent, 1, "xsend(p1)"); + recvd = recv(c1, buf, 1, 0); + ASSERT_EQ(recvd, 1, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret"); + +out_close: + close(c1); + close(p1); +out: + test_sockmap_change_tail__destroy(skel); +} + static void test_sockmap_skb_verdict_peek_helper(int map) { int err, c1, p1, zero = 0, sent, recvd, avail; @@ -905,8 +936,10 @@ static void test_sockmap_same_sock(void) err = socketpair(AF_UNIX, SOCK_STREAM, 0, stream); ASSERT_OK(err, "socketpair(af_unix, sock_stream)"); - if (err) + if (err) { + close(tcp); goto out; + } for (i = 0; i < 2; i++) { err = bpf_map_update_elem(map, &zero, &stream[0], BPF_ANY); @@ -925,24 +958,98 @@ static void test_sockmap_same_sock(void) ASSERT_OK(err, "bpf_map_update_elem(tcp)"); } + close(tcp); err = bpf_map_delete_elem(map, &zero); - ASSERT_OK(err, "bpf_map_delete_elem(entry)"); + ASSERT_ERR(err, "bpf_map_delete_elem(entry)"); close(stream[0]); close(stream[1]); out: close(dgram); - close(tcp); close(udp); test_sockmap_pass_prog__destroy(skel); } +static void test_sockmap_skb_verdict_vsock_poll(void) +{ + struct test_sockmap_pass_prog *skel; + int err, map, conn, peer; + struct bpf_program *prog; + struct bpf_link *link; + char buf = 'x'; + int zero = 0; + + skel = test_sockmap_pass_prog__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open_and_load")) + return; + + if (create_pair(AF_VSOCK, SOCK_STREAM, &conn, &peer)) + goto destroy; + + prog = skel->progs.prog_skb_verdict; + map = bpf_map__fd(skel->maps.sock_map_rx); + link = bpf_program__attach_sockmap(prog, map); + if (!ASSERT_OK_PTR(link, "bpf_program__attach_sockmap")) + goto close; + + err = bpf_map_update_elem(map, &zero, &conn, BPF_ANY); + if (!ASSERT_OK(err, "bpf_map_update_elem")) + goto detach; + + if (xsend(peer, &buf, 1, 0) != 1) + goto detach; + + err = poll_read(conn, IO_TIMEOUT_SEC); + if (!ASSERT_OK(err, "poll")) + goto detach; + + if (xrecv_nonblock(conn, &buf, 1, 0) != 1) + FAIL("xrecv_nonblock"); +detach: + bpf_link__detach(link); +close: + xclose(conn); + xclose(peer); +destroy: + test_sockmap_pass_prog__destroy(skel); +} + +static void test_sockmap_vsock_unconnected(void) +{ + struct sockaddr_storage addr; + int map, s, zero = 0; + socklen_t alen; + + map = bpf_map_create(BPF_MAP_TYPE_SOCKMAP, NULL, sizeof(int), + sizeof(int), 1, NULL); + if (!ASSERT_OK_FD(map, "bpf_map_create")) + return; + + s = xsocket(AF_VSOCK, SOCK_STREAM, 0); + if (s < 0) + goto close_map; + + /* Fail connect(), but trigger transport assignment. */ + init_addr_loopback(AF_VSOCK, &addr, &alen); + if (!ASSERT_ERR(connect(s, sockaddr(&addr), alen), "connect")) + goto close_sock; + + ASSERT_ERR(bpf_map_update_elem(map, &zero, &s, BPF_ANY), "map_update"); + +close_sock: + xclose(s); +close_map: + xclose(map); +} + void test_sockmap_basic(void) { if (test__start_subtest("sockmap create_update_free")) test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKMAP); if (test__start_subtest("sockhash create_update_free")) test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKHASH); + if (test__start_subtest("sockmap vsock delete on close")) + test_sockmap_vsock_delete_on_close(); if (test__start_subtest("sockmap sk_msg load helpers")) test_skmsg_helpers(BPF_MAP_TYPE_SOCKMAP); if (test__start_subtest("sockhash sk_msg load helpers")) @@ -975,12 +1082,12 @@ void test_sockmap_basic(void) test_sockmap_progs_query(BPF_SK_SKB_VERDICT); if (test__start_subtest("sockmap skb_verdict shutdown")) test_sockmap_skb_verdict_shutdown(); - if (test__start_subtest("sockmap stream parser and verdict pass")) - test_sockmap_stream_pass(); if (test__start_subtest("sockmap skb_verdict fionread")) test_sockmap_skb_verdict_fionread(true); if (test__start_subtest("sockmap skb_verdict fionread on drop")) test_sockmap_skb_verdict_fionread(false); + if (test__start_subtest("sockmap skb_verdict change tail")) + test_sockmap_skb_verdict_change_tail(); if (test__start_subtest("sockmap skb_verdict msg_f_peek")) test_sockmap_skb_verdict_peek(); if (test__start_subtest("sockmap skb_verdict msg_f_peek with link")) @@ -997,4 +1104,8 @@ void test_sockmap_basic(void) test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKMAP); if (test__start_subtest("sockhash sk_msg attach sockhash helpers with link")) test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKHASH); + if (test__start_subtest("sockmap skb_verdict vsock poll")) + test_sockmap_skb_verdict_vsock_poll(); + if (test__start_subtest("sockmap vsock unconnected")) + test_sockmap_vsock_unconnected(); } diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h index 38e35c72bdaa..3e5571dd578d 100644 --- a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h +++ b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h @@ -1,139 +1,12 @@ #ifndef __SOCKMAP_HELPERS__ #define __SOCKMAP_HELPERS__ -#include <linux/vm_sockets.h> +#include "socket_helpers.h" -/* include/linux/net.h */ -#define SOCK_TYPE_MASK 0xf - -#define IO_TIMEOUT_SEC 30 -#define MAX_STRERR_LEN 256 #define MAX_TEST_NAME 80 -/* workaround for older vm_sockets.h */ -#ifndef VMADDR_CID_LOCAL -#define VMADDR_CID_LOCAL 1 -#endif - #define __always_unused __attribute__((__unused__)) -/* include/linux/cleanup.h */ -#define __get_and_null(p, nullvalue) \ - ({ \ - __auto_type __ptr = &(p); \ - __auto_type __val = *__ptr; \ - *__ptr = nullvalue; \ - __val; \ - }) - -#define take_fd(fd) __get_and_null(fd, -EBADF) - -#define _FAIL(errnum, fmt...) \ - ({ \ - error_at_line(0, (errnum), __func__, __LINE__, fmt); \ - CHECK_FAIL(true); \ - }) -#define FAIL(fmt...) _FAIL(0, fmt) -#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt) -#define FAIL_LIBBPF(err, msg) \ - ({ \ - char __buf[MAX_STRERR_LEN]; \ - libbpf_strerror((err), __buf, sizeof(__buf)); \ - FAIL("%s: %s", (msg), __buf); \ - }) - -/* Wrappers that fail the test on error and report it. */ - -#define xaccept_nonblock(fd, addr, len) \ - ({ \ - int __ret = \ - accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \ - if (__ret == -1) \ - FAIL_ERRNO("accept"); \ - __ret; \ - }) - -#define xbind(fd, addr, len) \ - ({ \ - int __ret = bind((fd), (addr), (len)); \ - if (__ret == -1) \ - FAIL_ERRNO("bind"); \ - __ret; \ - }) - -#define xclose(fd) \ - ({ \ - int __ret = close((fd)); \ - if (__ret == -1) \ - FAIL_ERRNO("close"); \ - __ret; \ - }) - -#define xconnect(fd, addr, len) \ - ({ \ - int __ret = connect((fd), (addr), (len)); \ - if (__ret == -1) \ - FAIL_ERRNO("connect"); \ - __ret; \ - }) - -#define xgetsockname(fd, addr, len) \ - ({ \ - int __ret = getsockname((fd), (addr), (len)); \ - if (__ret == -1) \ - FAIL_ERRNO("getsockname"); \ - __ret; \ - }) - -#define xgetsockopt(fd, level, name, val, len) \ - ({ \ - int __ret = getsockopt((fd), (level), (name), (val), (len)); \ - if (__ret == -1) \ - FAIL_ERRNO("getsockopt(" #name ")"); \ - __ret; \ - }) - -#define xlisten(fd, backlog) \ - ({ \ - int __ret = listen((fd), (backlog)); \ - if (__ret == -1) \ - FAIL_ERRNO("listen"); \ - __ret; \ - }) - -#define xsetsockopt(fd, level, name, val, len) \ - ({ \ - int __ret = setsockopt((fd), (level), (name), (val), (len)); \ - if (__ret == -1) \ - FAIL_ERRNO("setsockopt(" #name ")"); \ - __ret; \ - }) - -#define xsend(fd, buf, len, flags) \ - ({ \ - ssize_t __ret = send((fd), (buf), (len), (flags)); \ - if (__ret == -1) \ - FAIL_ERRNO("send"); \ - __ret; \ - }) - -#define xrecv_nonblock(fd, buf, len, flags) \ - ({ \ - ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \ - IO_TIMEOUT_SEC); \ - if (__ret == -1) \ - FAIL_ERRNO("recv"); \ - __ret; \ - }) - -#define xsocket(family, sotype, flags) \ - ({ \ - int __ret = socket(family, sotype, flags); \ - if (__ret == -1) \ - FAIL_ERRNO("socket"); \ - __ret; \ - }) - #define xbpf_map_delete_elem(fd, key) \ ({ \ int __ret = bpf_map_delete_elem((fd), (key)); \ @@ -193,130 +66,6 @@ __ret; \ }) -static inline void close_fd(int *fd) -{ - if (*fd >= 0) - xclose(*fd); -} - -#define __close_fd __attribute__((cleanup(close_fd))) - -static inline int poll_connect(int fd, unsigned int timeout_sec) -{ - struct timeval timeout = { .tv_sec = timeout_sec }; - fd_set wfds; - int r, eval; - socklen_t esize = sizeof(eval); - - FD_ZERO(&wfds); - FD_SET(fd, &wfds); - - r = select(fd + 1, NULL, &wfds, NULL, &timeout); - if (r == 0) - errno = ETIME; - if (r != 1) - return -1; - - if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0) - return -1; - if (eval != 0) { - errno = eval; - return -1; - } - - return 0; -} - -static inline int poll_read(int fd, unsigned int timeout_sec) -{ - struct timeval timeout = { .tv_sec = timeout_sec }; - fd_set rfds; - int r; - - FD_ZERO(&rfds); - FD_SET(fd, &rfds); - - r = select(fd + 1, &rfds, NULL, NULL, &timeout); - if (r == 0) - errno = ETIME; - - return r == 1 ? 0 : -1; -} - -static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len, - unsigned int timeout_sec) -{ - if (poll_read(fd, timeout_sec)) - return -1; - - return accept(fd, addr, len); -} - -static inline int recv_timeout(int fd, void *buf, size_t len, int flags, - unsigned int timeout_sec) -{ - if (poll_read(fd, timeout_sec)) - return -1; - - return recv(fd, buf, len, flags); -} - -static inline void init_addr_loopback4(struct sockaddr_storage *ss, - socklen_t *len) -{ - struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss)); - - addr4->sin_family = AF_INET; - addr4->sin_port = 0; - addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK); - *len = sizeof(*addr4); -} - -static inline void init_addr_loopback6(struct sockaddr_storage *ss, - socklen_t *len) -{ - struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss)); - - addr6->sin6_family = AF_INET6; - addr6->sin6_port = 0; - addr6->sin6_addr = in6addr_loopback; - *len = sizeof(*addr6); -} - -static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss, - socklen_t *len) -{ - struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss)); - - addr->svm_family = AF_VSOCK; - addr->svm_port = VMADDR_PORT_ANY; - addr->svm_cid = VMADDR_CID_LOCAL; - *len = sizeof(*addr); -} - -static inline void init_addr_loopback(int family, struct sockaddr_storage *ss, - socklen_t *len) -{ - switch (family) { - case AF_INET: - init_addr_loopback4(ss, len); - return; - case AF_INET6: - init_addr_loopback6(ss, len); - return; - case AF_VSOCK: - init_addr_loopback_vsock(ss, len); - return; - default: - FAIL("unsupported address family %d", family); - } -} - -static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss) -{ - return (struct sockaddr *)ss; -} - static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2) { u64 value; @@ -334,136 +83,4 @@ static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2) return xbpf_map_update_elem(sock_mapfd, &key, &value, BPF_NOEXIST); } -static inline int enable_reuseport(int s, int progfd) -{ - int err, one = 1; - - err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one)); - if (err) - return -1; - err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd, - sizeof(progfd)); - if (err) - return -1; - - return 0; -} - -static inline int socket_loopback_reuseport(int family, int sotype, int progfd) -{ - struct sockaddr_storage addr; - socklen_t len = 0; - int err, s; - - init_addr_loopback(family, &addr, &len); - - s = xsocket(family, sotype, 0); - if (s == -1) - return -1; - - if (progfd >= 0) - enable_reuseport(s, progfd); - - err = xbind(s, sockaddr(&addr), len); - if (err) - goto close; - - if (sotype & SOCK_DGRAM) - return s; - - err = xlisten(s, SOMAXCONN); - if (err) - goto close; - - return s; -close: - xclose(s); - return -1; -} - -static inline int socket_loopback(int family, int sotype) -{ - return socket_loopback_reuseport(family, sotype, -1); -} - -static inline int create_pair(int family, int sotype, int *p0, int *p1) -{ - __close_fd int s, c = -1, p = -1; - struct sockaddr_storage addr; - socklen_t len = sizeof(addr); - int err; - - s = socket_loopback(family, sotype); - if (s < 0) - return s; - - err = xgetsockname(s, sockaddr(&addr), &len); - if (err) - return err; - - c = xsocket(family, sotype, 0); - if (c < 0) - return c; - - err = connect(c, sockaddr(&addr), len); - if (err) { - if (errno != EINPROGRESS) { - FAIL_ERRNO("connect"); - return err; - } - - err = poll_connect(c, IO_TIMEOUT_SEC); - if (err) { - FAIL_ERRNO("poll_connect"); - return err; - } - } - - switch (sotype & SOCK_TYPE_MASK) { - case SOCK_DGRAM: - err = xgetsockname(c, sockaddr(&addr), &len); - if (err) - return err; - - err = xconnect(s, sockaddr(&addr), len); - if (err) - return err; - - *p0 = take_fd(s); - break; - case SOCK_STREAM: - case SOCK_SEQPACKET: - p = xaccept_nonblock(s, NULL, NULL); - if (p < 0) - return p; - - *p0 = take_fd(p); - break; - default: - FAIL("Unsupported socket type %#x", sotype); - return -EOPNOTSUPP; - } - - *p1 = take_fd(c); - return 0; -} - -static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1, - int *p0, int *p1) -{ - int err; - - err = create_pair(family, sotype, c0, p0); - if (err) - return err; - - err = create_pair(family, sotype, c1, p1); - if (err) { - close(*c0); - close(*p0); - } - - return err; -} - #endif // __SOCKMAP_HELPERS__ diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_strp.c b/tools/testing/selftests/bpf/prog_tests/sockmap_strp.c new file mode 100644 index 000000000000..621b3b71888e --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/sockmap_strp.c @@ -0,0 +1,454 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <error.h> +#include <netinet/tcp.h> +#include <test_progs.h> +#include "sockmap_helpers.h" +#include "test_skmsg_load_helpers.skel.h" +#include "test_sockmap_strp.skel.h" + +#define STRP_PKT_HEAD_LEN 4 +#define STRP_PKT_BODY_LEN 6 +#define STRP_PKT_FULL_LEN (STRP_PKT_HEAD_LEN + STRP_PKT_BODY_LEN) + +static const char packet[STRP_PKT_FULL_LEN] = "head+body\0"; +static const int test_packet_num = 100; + +/* Current implementation of tcp_bpf_recvmsg_parser() invokes data_ready + * with sk held if an skb exists in sk_receive_queue. Then for the + * data_ready implementation of strparser, it will delay the read + * operation if sk is held and EAGAIN is returned. + */ +static int sockmap_strp_consume_pre_data(int p) +{ + int recvd; + bool retried = false; + char rcv[10]; + +retry: + errno = 0; + recvd = recv_timeout(p, rcv, sizeof(rcv), 0, 1); + if (recvd < 0 && errno == EAGAIN && retried == false) { + /* On the first call, EAGAIN will certainly be returned. + * A 1-second wait is enough for the workqueue to finish. + */ + sleep(1); + retried = true; + goto retry; + } + + if (!ASSERT_EQ(recvd, STRP_PKT_FULL_LEN, "recv error or truncated data") || + !ASSERT_OK(memcmp(packet, rcv, STRP_PKT_FULL_LEN), + "data mismatch")) + return -1; + return 0; +} + +static struct test_sockmap_strp *sockmap_strp_init(int *out_map, bool pass, + bool need_parser) +{ + struct test_sockmap_strp *strp = NULL; + int verdict, parser; + int err; + + strp = test_sockmap_strp__open_and_load(); + *out_map = bpf_map__fd(strp->maps.sock_map); + + if (need_parser) + parser = bpf_program__fd(strp->progs.prog_skb_parser_partial); + else + parser = bpf_program__fd(strp->progs.prog_skb_parser); + + if (pass) + verdict = bpf_program__fd(strp->progs.prog_skb_verdict_pass); + else + verdict = bpf_program__fd(strp->progs.prog_skb_verdict); + + err = bpf_prog_attach(parser, *out_map, BPF_SK_SKB_STREAM_PARSER, 0); + if (!ASSERT_OK(err, "bpf_prog_attach stream parser")) + goto err; + + err = bpf_prog_attach(verdict, *out_map, BPF_SK_SKB_STREAM_VERDICT, 0); + if (!ASSERT_OK(err, "bpf_prog_attach stream verdict")) + goto err; + + return strp; +err: + test_sockmap_strp__destroy(strp); + return NULL; +} + +/* Dispatch packets to different socket by packet size: + * + * ------ ------ + * | pkt4 || pkt1 |... > remote socket + * ------ ------ / ------ ------ + * | pkt8 | pkt7 |... + * ------ ------ \ ------ ------ + * | pkt3 || pkt2 |... > local socket + * ------ ------ + */ +static void test_sockmap_strp_dispatch_pkt(int family, int sotype) +{ + int i, j, zero = 0, one = 1, recvd; + int err, map; + int c0 = -1, p0 = -1, c1 = -1, p1 = -1; + struct test_sockmap_strp *strp = NULL; + int test_cnt = 6; + char rcv[10]; + struct { + char data[7]; + int data_len; + int send_cnt; + int *receiver; + } send_dir[2] = { + /* data expected to deliver to local */ + {"llllll", 6, 0, &p0}, + /* data expected to deliver to remote */ + {"rrrrr", 5, 0, &c1} + }; + + strp = sockmap_strp_init(&map, false, false); + if (!ASSERT_TRUE(strp, "sockmap_strp_init")) + return; + + err = create_socket_pairs(family, sotype, &c0, &c1, &p0, &p1); + if (!ASSERT_OK(err, "create_socket_pairs()")) + goto out; + + err = bpf_map_update_elem(map, &zero, &p0, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(p0)")) + goto out_close; + + err = bpf_map_update_elem(map, &one, &p1, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(p1)")) + goto out_close; + + err = setsockopt(c1, IPPROTO_TCP, TCP_NODELAY, &zero, sizeof(zero)); + if (!ASSERT_OK(err, "setsockopt(TCP_NODELAY)")) + goto out_close; + + /* deliver data with data size greater than 5 to local */ + strp->data->verdict_max_size = 5; + + for (i = 0; i < test_cnt; i++) { + int d = i % 2; + + xsend(c0, send_dir[d].data, send_dir[d].data_len, 0); + send_dir[d].send_cnt++; + } + + for (i = 0; i < 2; i++) { + for (j = 0; j < send_dir[i].send_cnt; j++) { + int expected = send_dir[i].data_len; + + recvd = recv_timeout(*send_dir[i].receiver, rcv, + expected, MSG_DONTWAIT, + IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, expected, "recv_timeout()")) + goto out_close; + if (!ASSERT_OK(memcmp(send_dir[i].data, rcv, recvd), + "data mismatch")) + goto out_close; + } + } +out_close: + close(c0); + close(c1); + close(p0); + close(p1); +out: + test_sockmap_strp__destroy(strp); +} + +/* We have multiple packets in one skb + * ------------ ------------ ------------ + * | packet1 | packet2 | ... + * ------------ ------------ ------------ + */ +static void test_sockmap_strp_multiple_pkt(int family, int sotype) +{ + int i, zero = 0; + int sent, recvd, total; + int err, map; + int c = -1, p = -1; + struct test_sockmap_strp *strp = NULL; + char *snd = NULL, *rcv = NULL; + + strp = sockmap_strp_init(&map, true, true); + if (!ASSERT_TRUE(strp, "sockmap_strp_init")) + return; + + err = create_pair(family, sotype, &c, &p); + if (err) + goto out; + + err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(zero, p)")) + goto out_close; + + /* construct multiple packets in one buffer */ + total = test_packet_num * STRP_PKT_FULL_LEN; + snd = malloc(total); + rcv = malloc(total + 1); + if (!ASSERT_TRUE(snd, "malloc(snd)") || + !ASSERT_TRUE(rcv, "malloc(rcv)")) + goto out_close; + + for (i = 0; i < test_packet_num; i++) { + memcpy(snd + i * STRP_PKT_FULL_LEN, + packet, STRP_PKT_FULL_LEN); + } + + sent = xsend(c, snd, total, 0); + if (!ASSERT_EQ(sent, total, "xsend(c)")) + goto out_close; + + /* try to recv one more byte to avoid truncation check */ + recvd = recv_timeout(p, rcv, total + 1, MSG_DONTWAIT, IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, total, "recv(rcv)")) + goto out_close; + + /* we sent TCP segment with multiple encapsulation + * then check whether packets are handled correctly + */ + if (!ASSERT_OK(memcmp(snd, rcv, total), "data mismatch")) + goto out_close; + +out_close: + close(c); + close(p); + if (snd) + free(snd); + if (rcv) + free(rcv); +out: + test_sockmap_strp__destroy(strp); +} + +/* Test strparser with partial read */ +static void test_sockmap_strp_partial_read(int family, int sotype) +{ + int zero = 0, recvd, off; + int err, map; + int c = -1, p = -1; + struct test_sockmap_strp *strp = NULL; + char rcv[STRP_PKT_FULL_LEN + 1] = "0"; + + strp = sockmap_strp_init(&map, true, true); + if (!ASSERT_TRUE(strp, "sockmap_strp_init")) + return; + + err = create_pair(family, sotype, &c, &p); + if (err) + goto out; + + /* sk_data_ready of 'p' will be replaced by strparser handler */ + err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(zero, p)")) + goto out_close; + + /* 1.1 send partial head, 1 byte header left */ + off = STRP_PKT_HEAD_LEN - 1; + xsend(c, packet, off, 0); + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, 1); + if (!ASSERT_EQ(-1, recvd, "partial head sent, expected no data")) + goto out_close; + + /* 1.2 send remaining head and body */ + xsend(c, packet + off, STRP_PKT_FULL_LEN - off, 0); + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, STRP_PKT_FULL_LEN, "expected full data")) + goto out_close; + + /* 2.1 send partial head, 1 byte header left */ + off = STRP_PKT_HEAD_LEN - 1; + xsend(c, packet, off, 0); + + /* 2.2 send remaining head and partial body, 1 byte body left */ + xsend(c, packet + off, STRP_PKT_FULL_LEN - off - 1, 0); + off = STRP_PKT_FULL_LEN - 1; + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, 1); + if (!ASSERT_EQ(-1, recvd, "partial body sent, expected no data")) + goto out_close; + + /* 2.3 send remaining body */ + xsend(c, packet + off, STRP_PKT_FULL_LEN - off, 0); + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, STRP_PKT_FULL_LEN, "expected full data")) + goto out_close; + +out_close: + close(c); + close(p); + +out: + test_sockmap_strp__destroy(strp); +} + +/* Test simple socket read/write with strparser + FIONREAD */ +static void test_sockmap_strp_pass(int family, int sotype, bool fionread) +{ + int zero = 0, pkt_size = STRP_PKT_FULL_LEN, sent, recvd, avail; + int err, map; + int c = -1, p = -1; + int test_cnt = 10, i; + struct test_sockmap_strp *strp = NULL; + char rcv[STRP_PKT_FULL_LEN + 1] = "0"; + + strp = sockmap_strp_init(&map, true, true); + if (!ASSERT_TRUE(strp, "sockmap_strp_init")) + return; + + err = create_pair(family, sotype, &c, &p); + if (err) + goto out; + + /* inject some data before bpf process, it should be read + * correctly because we check sk_receive_queue in + * tcp_bpf_recvmsg_parser(). + */ + sent = xsend(c, packet, pkt_size, 0); + if (!ASSERT_EQ(sent, pkt_size, "xsend(pre-data)")) + goto out_close; + + /* sk_data_ready of 'p' will be replaced by strparser handler */ + err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(p)")) + goto out_close; + + /* consume previous data we injected */ + if (sockmap_strp_consume_pre_data(p)) + goto out_close; + + /* Previously, we encountered issues such as deadlocks and + * sequence errors that resulted in the inability to read + * continuously. Therefore, we perform multiple iterations + * of testing here. + */ + for (i = 0; i < test_cnt; i++) { + sent = xsend(c, packet, pkt_size, 0); + if (!ASSERT_EQ(sent, pkt_size, "xsend(c)")) + goto out_close; + + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, + IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, pkt_size, "recv_timeout(p)") || + !ASSERT_OK(memcmp(packet, rcv, pkt_size), + "memcmp, data mismatch")) + goto out_close; + } + + if (fionread) { + sent = xsend(c, packet, pkt_size, 0); + if (!ASSERT_EQ(sent, pkt_size, "second xsend(c)")) + goto out_close; + + err = ioctl(p, FIONREAD, &avail); + if (!ASSERT_OK(err, "ioctl(FIONREAD) error") || + !ASSERT_EQ(avail, pkt_size, "ioctl(FIONREAD)")) + goto out_close; + + recvd = recv_timeout(p, rcv, sizeof(rcv), MSG_DONTWAIT, + IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, pkt_size, "second recv_timeout(p)") || + !ASSERT_OK(memcmp(packet, rcv, pkt_size), + "second memcmp, data mismatch")) + goto out_close; + } + +out_close: + close(c); + close(p); + +out: + test_sockmap_strp__destroy(strp); +} + +/* Test strparser with verdict mode */ +static void test_sockmap_strp_verdict(int family, int sotype) +{ + int zero = 0, one = 1, sent, recvd, off; + int err, map; + int c0 = -1, p0 = -1, c1 = -1, p1 = -1; + struct test_sockmap_strp *strp = NULL; + char rcv[STRP_PKT_FULL_LEN + 1] = "0"; + + strp = sockmap_strp_init(&map, false, true); + if (!ASSERT_TRUE(strp, "sockmap_strp_init")) + return; + + /* We simulate a reverse proxy server. + * When p0 receives data from c0, we forward it to c1. + * From c1's perspective, it will consider this data + * as being sent by p1. + */ + err = create_socket_pairs(family, sotype, &c0, &c1, &p0, &p1); + if (!ASSERT_OK(err, "create_socket_pairs()")) + goto out; + + err = bpf_map_update_elem(map, &zero, &p0, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(p0)")) + goto out_close; + + err = bpf_map_update_elem(map, &one, &p1, BPF_NOEXIST); + if (!ASSERT_OK(err, "bpf_map_update_elem(p1)")) + goto out_close; + + sent = xsend(c0, packet, STRP_PKT_FULL_LEN, 0); + if (!ASSERT_EQ(sent, STRP_PKT_FULL_LEN, "xsend(c0)")) + goto out_close; + + recvd = recv_timeout(c1, rcv, sizeof(rcv), MSG_DONTWAIT, + IO_TIMEOUT_SEC); + if (!ASSERT_EQ(recvd, STRP_PKT_FULL_LEN, "recv_timeout(c1)") || + !ASSERT_OK(memcmp(packet, rcv, STRP_PKT_FULL_LEN), + "received data does not match the sent data")) + goto out_close; + + /* send again to ensure the stream is functioning correctly. */ + sent = xsend(c0, packet, STRP_PKT_FULL_LEN, 0); + if (!ASSERT_EQ(sent, STRP_PKT_FULL_LEN, "second xsend(c0)")) + goto out_close; + + /* partial read */ + off = STRP_PKT_FULL_LEN / 2; + recvd = recv_timeout(c1, rcv, off, MSG_DONTWAIT, + IO_TIMEOUT_SEC); + recvd += recv_timeout(c1, rcv + off, sizeof(rcv) - off, MSG_DONTWAIT, + IO_TIMEOUT_SEC); + + if (!ASSERT_EQ(recvd, STRP_PKT_FULL_LEN, "partial recv_timeout(c1)") || + !ASSERT_OK(memcmp(packet, rcv, STRP_PKT_FULL_LEN), + "partial received data does not match the sent data")) + goto out_close; + +out_close: + close(c0); + close(c1); + close(p0); + close(p1); +out: + test_sockmap_strp__destroy(strp); +} + +void test_sockmap_strp(void) +{ + if (test__start_subtest("sockmap strp tcp pass")) + test_sockmap_strp_pass(AF_INET, SOCK_STREAM, false); + if (test__start_subtest("sockmap strp tcp v6 pass")) + test_sockmap_strp_pass(AF_INET6, SOCK_STREAM, false); + if (test__start_subtest("sockmap strp tcp pass fionread")) + test_sockmap_strp_pass(AF_INET, SOCK_STREAM, true); + if (test__start_subtest("sockmap strp tcp v6 pass fionread")) + test_sockmap_strp_pass(AF_INET6, SOCK_STREAM, true); + if (test__start_subtest("sockmap strp tcp verdict")) + test_sockmap_strp_verdict(AF_INET, SOCK_STREAM); + if (test__start_subtest("sockmap strp tcp v6 verdict")) + test_sockmap_strp_verdict(AF_INET6, SOCK_STREAM); + if (test__start_subtest("sockmap strp tcp partial read")) + test_sockmap_strp_partial_read(AF_INET, SOCK_STREAM); + if (test__start_subtest("sockmap strp tcp multiple packets")) + test_sockmap_strp_multiple_pkt(AF_INET, SOCK_STREAM); + if (test__start_subtest("sockmap strp tcp dispatch")) + test_sockmap_strp_dispatch_pkt(AF_INET, SOCK_STREAM); +} diff --git a/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c b/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c index 05d0e07da394..ba6b3ec1156a 100644 --- a/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c +++ b/tools/testing/selftests/bpf/prog_tests/sockopt_sk.c @@ -2,7 +2,7 @@ #include <test_progs.h> #include "cgroup_helpers.h" -#include <linux/tcp.h> +#include <netinet/tcp.h> #include <linux/netlink.h> #include "sockopt_sk.skel.h" diff --git a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c index 60f474d965a9..42e822ea352f 100644 --- a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c +++ b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c @@ -197,7 +197,7 @@ static void test_nodeadlock(void) /* Unnecessary recursion and deadlock detection are reproducible * in the preemptible kernel. */ - if (!skel->kconfig->CONFIG_PREEMPT) { + if (!skel->kconfig->CONFIG_PREEMPTION) { test__skip(); goto done; } diff --git a/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c new file mode 100644 index 000000000000..74752233e779 --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c @@ -0,0 +1,62 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <error.h> +#include <test_progs.h> +#include <linux/pkt_cls.h> + +#include "test_tc_change_tail.skel.h" +#include "socket_helpers.h" + +#define LO_IFINDEX 1 + +void test_tc_change_tail(void) +{ + LIBBPF_OPTS(bpf_tcx_opts, tcx_opts); + struct test_tc_change_tail *skel = NULL; + struct bpf_link *link; + int c1, p1; + char buf[2]; + int ret; + + skel = test_tc_change_tail__open_and_load(); + if (!ASSERT_OK_PTR(skel, "test_tc_change_tail__open_and_load")) + return; + + link = bpf_program__attach_tcx(skel->progs.change_tail, LO_IFINDEX, + &tcx_opts); + if (!ASSERT_OK_PTR(link, "bpf_program__attach_tcx")) + goto destroy; + + skel->links.change_tail = link; + ret = create_pair(AF_INET, SOCK_DGRAM, &c1, &p1); + if (!ASSERT_OK(ret, "create_pair")) + goto destroy; + + ret = xsend(p1, "Tr", 2, 0); + ASSERT_EQ(ret, 2, "xsend(p1)"); + ret = recv(c1, buf, 2, 0); + ASSERT_EQ(ret, 2, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret"); + + ret = xsend(p1, "G", 1, 0); + ASSERT_EQ(ret, 1, "xsend(p1)"); + ret = recv(c1, buf, 2, 0); + ASSERT_EQ(ret, 1, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret"); + + ret = xsend(p1, "E", 1, 0); + ASSERT_EQ(ret, 1, "xsend(p1)"); + ret = recv(c1, buf, 1, 0); + ASSERT_EQ(ret, 1, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret"); + + ret = xsend(p1, "Z", 1, 0); + ASSERT_EQ(ret, 1, "xsend(p1)"); + ret = recv(c1, buf, 1, 0); + ASSERT_EQ(ret, 1, "recv(c1)"); + ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret"); + + close(c1); + close(p1); +destroy: + test_tc_change_tail__destroy(skel); +} diff --git a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c index 151a4210028f..2461d183dee5 100644 --- a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c +++ b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c @@ -14,10 +14,16 @@ #include "netlink_helpers.h" #include "tc_helpers.h" +#define NETKIT_HEADROOM 32 +#define NETKIT_TAILROOM 8 + #define MARK 42 #define PRIO 0xeb9f #define ICMP_ECHO 8 +#define FLAG_ADJUST_ROOM (1 << 0) +#define FLAG_SAME_NETNS (1 << 1) + struct icmphdr { __u8 type; __u8 code; @@ -35,7 +41,7 @@ struct iplink_req { }; static int create_netkit(int mode, int policy, int peer_policy, int *ifindex, - bool same_netns, int scrub, int peer_scrub) + int scrub, int peer_scrub, __u32 flags) { struct rtnl_handle rth = { .fd = -1 }; struct iplink_req req = {}; @@ -63,6 +69,10 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex, addattr32(&req.n, sizeof(req), IFLA_NETKIT_SCRUB, scrub); addattr32(&req.n, sizeof(req), IFLA_NETKIT_PEER_SCRUB, peer_scrub); addattr32(&req.n, sizeof(req), IFLA_NETKIT_MODE, mode); + if (flags & FLAG_ADJUST_ROOM) { + addattr16(&req.n, sizeof(req), IFLA_NETKIT_HEADROOM, NETKIT_HEADROOM); + addattr16(&req.n, sizeof(req), IFLA_NETKIT_TAILROOM, NETKIT_TAILROOM); + } addattr_nest_end(&req.n, data); addattr_nest_end(&req.n, linkinfo); @@ -87,7 +97,7 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex, " addr ee:ff:bb:cc:aa:dd"), "set hwaddress"); } - if (same_netns) { + if (flags & FLAG_SAME_NETNS) { ASSERT_OK(system("ip link set dev " netkit_peer " up"), "up peer"); ASSERT_OK(system("ip addr add dev " netkit_peer " 10.0.0.2/24"), @@ -184,8 +194,8 @@ void serial_test_tc_netkit_basic(void) int err, ifindex; err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS, - &ifindex, false, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, 0); if (err) return; @@ -299,8 +309,8 @@ static void serial_test_tc_netkit_multi_links_target(int mode, int target) int err, ifindex; err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS, - &ifindex, false, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, 0); if (err) return; @@ -428,8 +438,8 @@ static void serial_test_tc_netkit_multi_opts_target(int mode, int target) int err, ifindex; err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS, - &ifindex, false, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, 0); if (err) return; @@ -543,8 +553,8 @@ void serial_test_tc_netkit_device(void) int err, ifindex, ifindex2; err = create_netkit(NETKIT_L3, NETKIT_PASS, NETKIT_PASS, - &ifindex, true, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS); if (err) return; @@ -655,8 +665,8 @@ static void serial_test_tc_netkit_neigh_links_target(int mode, int target) int err, ifindex; err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS, - &ifindex, false, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, 0); if (err) return; @@ -733,8 +743,8 @@ static void serial_test_tc_netkit_pkt_type_mode(int mode) struct bpf_link *link; err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS, - &ifindex, true, NETKIT_SCRUB_DEFAULT, - NETKIT_SCRUB_DEFAULT); + &ifindex, NETKIT_SCRUB_DEFAULT, + NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS); if (err) return; @@ -799,7 +809,7 @@ void serial_test_tc_netkit_pkt_type(void) serial_test_tc_netkit_pkt_type_mode(NETKIT_L3); } -static void serial_test_tc_netkit_scrub_type(int scrub) +static void serial_test_tc_netkit_scrub_type(int scrub, bool room) { LIBBPF_OPTS(bpf_netkit_opts, optl); struct test_tc_link *skel; @@ -807,7 +817,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub) int err, ifindex; err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS, - &ifindex, false, scrub, scrub); + &ifindex, scrub, scrub, + room ? FLAG_ADJUST_ROOM : 0); if (err) return; @@ -842,6 +853,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub) ASSERT_EQ(skel->bss->seen_tc8, true, "seen_tc8"); ASSERT_EQ(skel->bss->mark, scrub == NETKIT_SCRUB_NONE ? MARK : 0, "mark"); ASSERT_EQ(skel->bss->prio, scrub == NETKIT_SCRUB_NONE ? PRIO : 0, "prio"); + ASSERT_EQ(skel->bss->headroom, room ? NETKIT_HEADROOM : 0, "headroom"); + ASSERT_EQ(skel->bss->tailroom, room ? NETKIT_TAILROOM : 0, "tailroom"); cleanup: test_tc_link__destroy(skel); @@ -852,6 +865,6 @@ cleanup: void serial_test_tc_netkit_scrub(void) { - serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT); - serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE); + serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT, false); + serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE, true); } diff --git a/tools/testing/selftests/bpf/prog_tests/verifier.c b/tools/testing/selftests/bpf/prog_tests/verifier.c index d9f65adb456b..8a0e1ff8a2dc 100644 --- a/tools/testing/selftests/bpf/prog_tests/verifier.c +++ b/tools/testing/selftests/bpf/prog_tests/verifier.c @@ -52,6 +52,8 @@ #include "verifier_map_ptr_mixing.skel.h" #include "verifier_map_ret_val.skel.h" #include "verifier_masking.skel.h" +#include "verifier_may_goto_1.skel.h" +#include "verifier_may_goto_2.skel.h" #include "verifier_meta_access.skel.h" #include "verifier_movsx.skel.h" #include "verifier_mtu.skel.h" @@ -98,6 +100,7 @@ #include "verifier_xdp_direct_packet_access.skel.h" #include "verifier_bits_iter.skel.h" #include "verifier_lsm.skel.h" +#include "irq.skel.h" #define MAX_ENTRIES 11 @@ -181,6 +184,8 @@ void test_verifier_map_ptr(void) { RUN(verifier_map_ptr); } void test_verifier_map_ptr_mixing(void) { RUN(verifier_map_ptr_mixing); } void test_verifier_map_ret_val(void) { RUN(verifier_map_ret_val); } void test_verifier_masking(void) { RUN(verifier_masking); } +void test_verifier_may_goto_1(void) { RUN(verifier_may_goto_1); } +void test_verifier_may_goto_2(void) { RUN(verifier_may_goto_2); } void test_verifier_meta_access(void) { RUN(verifier_meta_access); } void test_verifier_movsx(void) { RUN(verifier_movsx); } void test_verifier_netfilter_ctx(void) { RUN(verifier_netfilter_ctx); } @@ -225,24 +230,8 @@ void test_verifier_xdp(void) { RUN(verifier_xdp); } void test_verifier_xdp_direct_packet_access(void) { RUN(verifier_xdp_direct_packet_access); } void test_verifier_bits_iter(void) { RUN(verifier_bits_iter); } void test_verifier_lsm(void) { RUN(verifier_lsm); } - -void test_verifier_mtu(void) -{ - __u64 caps = 0; - int ret; - - /* In case CAP_BPF and CAP_PERFMON is not set */ - ret = cap_enable_effective(1ULL << CAP_BPF | 1ULL << CAP_NET_ADMIN, &caps); - if (!ASSERT_OK(ret, "set_cap_bpf_cap_net_admin")) - return; - ret = cap_disable_effective(1ULL << CAP_SYS_ADMIN | 1ULL << CAP_PERFMON, NULL); - if (!ASSERT_OK(ret, "disable_cap_sys_admin")) - goto restore_cap; - RUN(verifier_mtu); -restore_cap: - if (caps) - cap_enable_effective(caps, NULL); -} +void test_irq(void) { RUN(irq); } +void test_verifier_mtu(void) { RUN(verifier_mtu); } static int init_test_val_map(struct bpf_object *obj, char *map_name) { diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c index 53d6ad8c2257..b2b2d85dbb1b 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c @@ -82,6 +82,8 @@ static void test_xdp_adjust_tail_grow2(void) /* SKB_DATA_ALIGN(sizeof(struct skb_shared_info)) */ #if defined(__s390x__) int tailroom = 512; +#elif defined(__powerpc__) + int tailroom = 384; #else int tailroom = 320; #endif diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c b/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c index 6d8b54124cb3..fb952703653e 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_bonding.c @@ -17,7 +17,7 @@ #include "network_helpers.h" #include <linux/if_bonding.h> #include <linux/limits.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <uapi/linux/netdev.h> #include "xdp_dummy.skel.h" diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c index e6a783c7f5db..937da9b7532a 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c @@ -2,6 +2,14 @@ #include <test_progs.h> #include <network_helpers.h> #include "test_xdp_context_test_run.skel.h" +#include "test_xdp_meta.skel.h" + +#define TX_ADDR "10.0.0.1" +#define RX_ADDR "10.0.0.2" +#define RX_NAME "veth0" +#define TX_NAME "veth1" +#define TX_NETNS "xdp_context_tx" +#define RX_NETNS "xdp_context_rx" void test_xdp_context_error(int prog_fd, struct bpf_test_run_opts opts, __u32 data_meta, __u32 data, __u32 data_end, @@ -103,3 +111,82 @@ void test_xdp_context_test_run(void) test_xdp_context_test_run__destroy(skel); } + +void test_xdp_context_functional(void) +{ + LIBBPF_OPTS(bpf_tc_hook, tc_hook, .attach_point = BPF_TC_INGRESS); + LIBBPF_OPTS(bpf_tc_opts, tc_opts, .handle = 1, .priority = 1); + struct netns_obj *rx_ns = NULL, *tx_ns = NULL; + struct bpf_program *tc_prog, *xdp_prog; + struct test_xdp_meta *skel = NULL; + struct nstoken *nstoken = NULL; + int rx_ifindex; + int ret; + + tx_ns = netns_new(TX_NETNS, false); + if (!ASSERT_OK_PTR(tx_ns, "create tx_ns")) + return; + + rx_ns = netns_new(RX_NETNS, false); + if (!ASSERT_OK_PTR(rx_ns, "create rx_ns")) + goto close; + + SYS(close, "ip link add " RX_NAME " netns " RX_NETNS + " type veth peer name " TX_NAME " netns " TX_NETNS); + + nstoken = open_netns(RX_NETNS); + if (!ASSERT_OK_PTR(nstoken, "setns rx_ns")) + goto close; + + SYS(close, "ip addr add " RX_ADDR "/24 dev " RX_NAME); + SYS(close, "ip link set dev " RX_NAME " up"); + + skel = test_xdp_meta__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open and load skeleton")) + goto close; + + rx_ifindex = if_nametoindex(RX_NAME); + if (!ASSERT_GE(rx_ifindex, 0, "if_nametoindex rx")) + goto close; + + tc_hook.ifindex = rx_ifindex; + ret = bpf_tc_hook_create(&tc_hook); + if (!ASSERT_OK(ret, "bpf_tc_hook_create")) + goto close; + + tc_prog = bpf_object__find_program_by_name(skel->obj, "ing_cls"); + if (!ASSERT_OK_PTR(tc_prog, "open ing_cls prog")) + goto close; + + tc_opts.prog_fd = bpf_program__fd(tc_prog); + ret = bpf_tc_attach(&tc_hook, &tc_opts); + if (!ASSERT_OK(ret, "bpf_tc_attach")) + goto close; + + xdp_prog = bpf_object__find_program_by_name(skel->obj, "ing_xdp"); + if (!ASSERT_OK_PTR(xdp_prog, "open ing_xdp prog")) + goto close; + + ret = bpf_xdp_attach(rx_ifindex, + bpf_program__fd(xdp_prog), + 0, NULL); + if (!ASSERT_GE(ret, 0, "bpf_xdp_attach")) + goto close; + + close_netns(nstoken); + + nstoken = open_netns(TX_NETNS); + if (!ASSERT_OK_PTR(nstoken, "setns tx_ns")) + goto close; + + SYS(close, "ip addr add " TX_ADDR "/24 dev " TX_NAME); + SYS(close, "ip link set dev " TX_NAME " up"); + ASSERT_OK(SYS_NOFAIL("ping -c 1 " RX_ADDR), "ping"); + +close: + close_netns(nstoken); + test_xdp_meta__destroy(skel); + netns_free(rx_ns); + netns_free(tx_ns); +} + diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_cpumap_attach.c b/tools/testing/selftests/bpf/prog_tests/xdp_cpumap_attach.c index c7f74f068e78..df27535995af 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_cpumap_attach.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_cpumap_attach.c @@ -52,10 +52,10 @@ static void test_xdp_with_cpumap_helpers(void) ASSERT_EQ(info.id, val.bpf_prog.id, "Match program id to cpumap entry prog_id"); /* send a packet to trigger any potential bugs in there */ - char data[10] = {}; + char data[ETH_HLEN] = {}; DECLARE_LIBBPF_OPTS(bpf_test_run_opts, opts, .data_in = &data, - .data_size_in = 10, + .data_size_in = sizeof(data), .flags = BPF_F_TEST_XDP_LIVE_FRAMES, .repeat = 1, ); diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_devmap_attach.c b/tools/testing/selftests/bpf/prog_tests/xdp_devmap_attach.c index 27ffed17d4be..461ab18705d5 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_devmap_attach.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_devmap_attach.c @@ -23,7 +23,7 @@ static void test_xdp_with_devmap_helpers(void) __u32 len = sizeof(info); int err, dm_fd, dm_fd_redir, map_fd; struct nstoken *nstoken = NULL; - char data[10] = {}; + char data[ETH_HLEN] = {}; __u32 idx = 0; SYS(out_close, "ip netns add %s", TEST_NS); @@ -58,7 +58,7 @@ static void test_xdp_with_devmap_helpers(void) /* send a packet to trigger any potential bugs in there */ DECLARE_LIBBPF_OPTS(bpf_test_run_opts, opts, .data_in = &data, - .data_size_in = 10, + .data_size_in = sizeof(data), .flags = BPF_F_TEST_XDP_LIVE_FRAMES, .repeat = 1, ); @@ -158,7 +158,7 @@ static void test_xdp_with_devmap_helpers_veth(void) struct nstoken *nstoken = NULL; __u32 len = sizeof(info); int err, dm_fd, dm_fd_redir, map_fd, ifindex_dst; - char data[10] = {}; + char data[ETH_HLEN] = {}; __u32 idx = 0; SYS(out_close, "ip netns add %s", TEST_NS); @@ -208,7 +208,7 @@ static void test_xdp_with_devmap_helpers_veth(void) /* send a packet to trigger any potential bugs in there */ DECLARE_LIBBPF_OPTS(bpf_test_run_opts, opts, .data_in = &data, - .data_size_in = 10, + .data_size_in = sizeof(data), .flags = BPF_F_TEST_XDP_LIVE_FRAMES, .repeat = 1, ); diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c b/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c index bad0ea167be7..7dac044664ac 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_do_redirect.c @@ -7,10 +7,11 @@ #include <linux/if_link.h> #include <linux/ipv6.h> #include <linux/in6.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <bpf/bpf_endian.h> #include <uapi/linux/netdev.h> #include "test_xdp_do_redirect.skel.h" +#include "xdp_dummy.skel.h" struct udp_packet { struct ethhdr eth; @@ -246,3 +247,166 @@ out: SYS_NOFAIL("ip netns del testns"); test_xdp_do_redirect__destroy(skel); } + +#define NS_NB 3 +#define NS0 "NS0" +#define NS1 "NS1" +#define NS2 "NS2" +#define IPV4_NETWORK "10.1.1" +#define VETH1_INDEX 111 +#define VETH2_INDEX 222 + +struct test_data { + struct netns_obj *ns[NS_NB]; + u32 xdp_flags; +}; + +static void cleanup(struct test_data *data) +{ + int i; + + for (i = 0; i < NS_NB; i++) + netns_free(data->ns[i]); +} + +/** + * ping_setup - + * Create two veth peers and forward packets in-between using XDP + * + * ------------ ------------ + * | NS1 | | NS2 | + * | veth0 | | veth0 | + * | 10.1.1.1 | | 10.1.1.2 | + * -----|------ ------|----- + * | | + * | | + * -----|-----------------------|------- + * | veth1 veth2 | + * | (id:111) (id:222) | + * | | | | + * | ----- xdp forwarding ----- | + * | | + * | NS0 | + * ------------------------------------- + */ +static int ping_setup(struct test_data *data) +{ + int i; + + data->ns[0] = netns_new(NS0, false); + if (!ASSERT_OK_PTR(data->ns[0], "create ns")) + return -1; + + for (i = 1; i < NS_NB; i++) { + char ns_name[4] = {}; + + snprintf(ns_name, 4, "NS%d", i); + data->ns[i] = netns_new(ns_name, false); + if (!ASSERT_OK_PTR(data->ns[i], "create ns")) + goto fail; + + SYS(fail, + "ip -n %s link add veth%d index %d%d%d type veth peer name veth0 netns %s", + NS0, i, i, i, i, ns_name); + SYS(fail, "ip -n %s link set veth%d up", NS0, i); + + SYS(fail, "ip -n %s addr add %s.%d/24 dev veth0", ns_name, IPV4_NETWORK, i); + SYS(fail, "ip -n %s link set veth0 up", ns_name); + } + + return 0; + +fail: + cleanup(data); + return -1; +} + +static void ping_test(struct test_data *data) +{ + struct test_xdp_do_redirect *skel = NULL; + struct xdp_dummy *skel_dummy = NULL; + struct nstoken *nstoken = NULL; + int i, ret; + + skel_dummy = xdp_dummy__open_and_load(); + if (!ASSERT_OK_PTR(skel_dummy, "open and load xdp_dummy skeleton")) + goto close; + + for (i = 1; i < NS_NB; i++) { + char ns_name[4] = {}; + + snprintf(ns_name, 4, "NS%d", i); + nstoken = open_netns(ns_name); + if (!ASSERT_OK_PTR(nstoken, "open ns")) + goto close; + + ret = bpf_xdp_attach(if_nametoindex("veth0"), + bpf_program__fd(skel_dummy->progs.xdp_dummy_prog), + data->xdp_flags, NULL); + if (!ASSERT_GE(ret, 0, "bpf_xdp_attach dummy_prog")) + goto close; + + close_netns(nstoken); + nstoken = NULL; + } + + skel = test_xdp_do_redirect__open_and_load(); + if (!ASSERT_OK_PTR(skel, "open and load skeleton")) + goto close; + + nstoken = open_netns(NS0); + if (!ASSERT_OK_PTR(nstoken, "open NS0")) + goto close; + + ret = bpf_xdp_attach(VETH2_INDEX, + bpf_program__fd(skel->progs.xdp_redirect_to_111), + data->xdp_flags, NULL); + if (!ASSERT_GE(ret, 0, "bpf_xdp_attach")) + goto close; + + ret = bpf_xdp_attach(VETH1_INDEX, + bpf_program__fd(skel->progs.xdp_redirect_to_222), + data->xdp_flags, NULL); + if (!ASSERT_GE(ret, 0, "bpf_xdp_attach")) + goto close; + + close_netns(nstoken); + nstoken = NULL; + + nstoken = open_netns(NS1); + if (!ASSERT_OK_PTR(nstoken, "open NS1")) + goto close; + + SYS(close, "ping -c 1 %s.2 > /dev/null", IPV4_NETWORK); + +close: + close_netns(nstoken); + xdp_dummy__destroy(skel_dummy); + test_xdp_do_redirect__destroy(skel); +} + + +static void xdp_redirect_ping(u32 xdp_flags) +{ + struct test_data data = {}; + + if (ping_setup(&data) < 0) + return; + + data.xdp_flags = xdp_flags; + ping_test(&data); + cleanup(&data); +} + +void test_xdp_index_redirect(void) +{ + if (test__start_subtest("noflag")) + xdp_redirect_ping(0); + + if (test__start_subtest("drvflag")) + xdp_redirect_ping(XDP_FLAGS_DRV_MODE); + + if (test__start_subtest("skbflag")) + xdp_redirect_ping(XDP_FLAGS_SKB_MODE); +} + diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c index e1bf141d3401..3f9146d83d79 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c @@ -3,7 +3,7 @@ #include <network_helpers.h> #include <bpf/btf.h> #include <linux/if_link.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <net/if.h> #include <unistd.h> diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c b/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c index c87ee2bf558c..3d47878ef6bf 100644 --- a/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c +++ b/tools/testing/selftests/bpf/prog_tests/xdp_metadata.c @@ -10,7 +10,7 @@ #include <linux/errqueue.h> #include <linux/if_link.h> #include <linux/net_tstamp.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <sys/mman.h> #include <net/if.h> #include <poll.h> @@ -133,23 +133,6 @@ static void close_xsk(struct xsk *xsk) munmap(xsk->umem_area, UMEM_SIZE); } -static void ip_csum(struct iphdr *iph) -{ - __u32 sum = 0; - __u16 *p; - int i; - - iph->check = 0; - p = (void *)iph; - for (i = 0; i < sizeof(*iph) / sizeof(*p); i++) - sum += p[i]; - - while (sum >> 16) - sum = (sum & 0xffff) + (sum >> 16); - - iph->check = ~sum; -} - static int generate_packet(struct xsk *xsk, __u16 dst_port) { struct xsk_tx_metadata *meta; @@ -192,7 +175,7 @@ static int generate_packet(struct xsk *xsk, __u16 dst_port) iph->protocol = IPPROTO_UDP; ASSERT_EQ(inet_pton(FAMILY, TX_ADDR, &iph->saddr), 1, "inet_pton(TX_ADDR)"); ASSERT_EQ(inet_pton(FAMILY, RX_ADDR, &iph->daddr), 1, "inet_pton(RX_ADDR)"); - ip_csum(iph); + iph->check = build_ip_csum(iph); udph->source = htons(UDP_SOURCE_PORT); udph->dest = htons(dst_port); diff --git a/tools/testing/selftests/bpf/progs/bad_struct_ops.c b/tools/testing/selftests/bpf/progs/bad_struct_ops.c index b7e175cd0af0..b3f77b4561c8 100644 --- a/tools/testing/selftests/bpf/progs/bad_struct_ops.c +++ b/tools/testing/selftests/bpf/progs/bad_struct_ops.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/bpf_misc.h b/tools/testing/selftests/bpf/progs/bpf_misc.h index eccaf955e394..f45f4352feeb 100644 --- a/tools/testing/selftests/bpf/progs/bpf_misc.h +++ b/tools/testing/selftests/bpf/progs/bpf_misc.h @@ -5,6 +5,10 @@ #define XSTR(s) STR(s) #define STR(s) #s +/* Expand a macro and then stringize the expansion */ +#define QUOTE(str) #str +#define EXPAND_QUOTE(str) QUOTE(str) + /* This set of attributes controls behavior of the * test_loader.c:test_loader__run_subtests(). * @@ -106,6 +110,7 @@ * __arch_* Specify on which architecture the test case should be tested. * Several __arch_* annotations could be specified at once. * When test case is not run on current arch it is marked as skipped. + * __caps_unpriv Specify the capabilities that should be set when running the test. */ #define __msg(msg) __attribute__((btf_decl_tag("comment:test_expect_msg=" XSTR(__COUNTER__) "=" msg))) #define __xlated(msg) __attribute__((btf_decl_tag("comment:test_expect_xlated=" XSTR(__COUNTER__) "=" msg))) @@ -129,6 +134,13 @@ #define __arch_x86_64 __arch("X86_64") #define __arch_arm64 __arch("ARM64") #define __arch_riscv64 __arch("RISCV64") +#define __caps_unpriv(caps) __attribute__((btf_decl_tag("comment:test_caps_unpriv=" EXPAND_QUOTE(caps)))) + +/* Define common capabilities tested using __caps_unpriv */ +#define CAP_NET_ADMIN 12 +#define CAP_SYS_ADMIN 21 +#define CAP_PERFMON 38 +#define CAP_BPF 39 /* Convenience macro for use with 'asm volatile' blocks */ #define __naked __attribute__((naked)) diff --git a/tools/testing/selftests/bpf/progs/cb_refs.c b/tools/testing/selftests/bpf/progs/cb_refs.c index 56c764df8196..5d6fc7f01ebb 100644 --- a/tools/testing/selftests/bpf/progs/cb_refs.c +++ b/tools/testing/selftests/bpf/progs/cb_refs.c @@ -2,7 +2,7 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" struct map_value { struct prog_test_ref_kfunc __kptr *ptr; diff --git a/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c b/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c new file mode 100644 index 000000000000..e32b07d802bb --- /dev/null +++ b/tools/testing/selftests/bpf/progs/cgroup_skb_direct_packet_access.c @@ -0,0 +1,15 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include "vmlinux.h" +#include <bpf/bpf_helpers.h> + +__u32 data_end; + +SEC("cgroup_skb/ingress") +int direct_packet_access(struct __sk_buff *skb) +{ + data_end = skb->data_end; + return 1; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data.c b/tools/testing/selftests/bpf/progs/changes_pkt_data.c new file mode 100644 index 000000000000..43cada48b28a --- /dev/null +++ b/tools/testing/selftests/bpf/progs/changes_pkt_data.c @@ -0,0 +1,39 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> + +__noinline +long changes_pkt_data(struct __sk_buff *sk) +{ + return bpf_skb_pull_data(sk, 0); +} + +__noinline __weak +long does_not_change_pkt_data(struct __sk_buff *sk) +{ + return 0; +} + +SEC("?tc") +int main_with_subprogs(struct __sk_buff *sk) +{ + changes_pkt_data(sk); + does_not_change_pkt_data(sk); + return 0; +} + +SEC("?tc") +int main_changes(struct __sk_buff *sk) +{ + bpf_skb_pull_data(sk, 0); + return 0; +} + +SEC("?tc") +int main_does_not_change(struct __sk_buff *sk) +{ + return 0; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c new file mode 100644 index 000000000000..f9a622705f1b --- /dev/null +++ b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c @@ -0,0 +1,18 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> + +SEC("?freplace") +long changes_pkt_data(struct __sk_buff *sk) +{ + return bpf_skb_pull_data(sk, 0); +} + +SEC("?freplace") +long does_not_change_pkt_data(struct __sk_buff *sk) +{ + return 0; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/dynptr_fail.c b/tools/testing/selftests/bpf/progs/dynptr_fail.c index 8f36c9de7591..bd8f15229f5c 100644 --- a/tools/testing/selftests/bpf/progs/dynptr_fail.c +++ b/tools/testing/selftests/bpf/progs/dynptr_fail.c @@ -149,7 +149,7 @@ int ringbuf_release_uninit_dynptr(void *ctx) /* A dynptr can't be used after it has been invalidated */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #3") +__failure __msg("Expected an initialized dynptr as arg #2") int use_after_invalid(void *ctx) { struct bpf_dynptr ptr; @@ -192,7 +192,7 @@ done: /* Can't add a dynptr to a map */ SEC("?raw_tp") -__failure __msg("invalid indirect read from stack") +__failure __msg("invalid read from stack") int add_dynptr_to_map1(void *ctx) { struct bpf_dynptr ptr; @@ -210,7 +210,7 @@ int add_dynptr_to_map1(void *ctx) /* Can't add a struct with an embedded dynptr to a map */ SEC("?raw_tp") -__failure __msg("invalid indirect read from stack") +__failure __msg("invalid read from stack") int add_dynptr_to_map2(void *ctx) { struct test_info x; @@ -398,7 +398,7 @@ int data_slice_missing_null_check2(void *ctx) * dynptr argument */ SEC("?raw_tp") -__failure __msg("invalid indirect read from stack") +__failure __msg("invalid read from stack") int invalid_helper1(void *ctx) { struct bpf_dynptr ptr; @@ -428,7 +428,7 @@ int invalid_helper2(void *ctx) /* A bpf_dynptr is invalidated if it's been written into */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int invalid_write1(void *ctx) { struct bpf_dynptr ptr; @@ -1407,7 +1407,7 @@ int invalid_slice_rdwr_rdonly(struct __sk_buff *skb) /* bpf_dynptr_adjust can only be called on initialized dynptrs */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int dynptr_adjust_invalid(void *ctx) { struct bpf_dynptr ptr = {}; @@ -1420,7 +1420,7 @@ int dynptr_adjust_invalid(void *ctx) /* bpf_dynptr_is_null can only be called on initialized dynptrs */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int dynptr_is_null_invalid(void *ctx) { struct bpf_dynptr ptr = {}; @@ -1433,7 +1433,7 @@ int dynptr_is_null_invalid(void *ctx) /* bpf_dynptr_is_rdonly can only be called on initialized dynptrs */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int dynptr_is_rdonly_invalid(void *ctx) { struct bpf_dynptr ptr = {}; @@ -1446,7 +1446,7 @@ int dynptr_is_rdonly_invalid(void *ctx) /* bpf_dynptr_size can only be called on initialized dynptrs */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int dynptr_size_invalid(void *ctx) { struct bpf_dynptr ptr = {}; @@ -1459,7 +1459,7 @@ int dynptr_size_invalid(void *ctx) /* Only initialized dynptrs can be cloned */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #1") +__failure __msg("Expected an initialized dynptr as arg #0") int clone_invalid1(void *ctx) { struct bpf_dynptr ptr1 = {}; @@ -1493,7 +1493,7 @@ int clone_invalid2(struct xdp_md *xdp) /* Invalidating a dynptr should invalidate its clones */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #3") +__failure __msg("Expected an initialized dynptr as arg #2") int clone_invalidate1(void *ctx) { struct bpf_dynptr clone; @@ -1514,7 +1514,7 @@ int clone_invalidate1(void *ctx) /* Invalidating a dynptr should invalidate its parent */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #3") +__failure __msg("Expected an initialized dynptr as arg #2") int clone_invalidate2(void *ctx) { struct bpf_dynptr ptr; @@ -1535,7 +1535,7 @@ int clone_invalidate2(void *ctx) /* Invalidating a dynptr should invalidate its siblings */ SEC("?raw_tp") -__failure __msg("Expected an initialized dynptr as arg #3") +__failure __msg("Expected an initialized dynptr as arg #2") int clone_invalidate3(void *ctx) { struct bpf_dynptr ptr; @@ -1723,7 +1723,7 @@ __noinline long global_call_bpf_dynptr(const struct bpf_dynptr *dynptr) } SEC("?raw_tp") -__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr") +__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr") int test_dynptr_reg_type(void *ctx) { struct task_struct *current = NULL; diff --git a/tools/testing/selftests/bpf/progs/epilogue_exit.c b/tools/testing/selftests/bpf/progs/epilogue_exit.c index 33d3a57bee90..35fec7c75bef 100644 --- a/tools/testing/selftests/bpf/progs/epilogue_exit.c +++ b/tools/testing/selftests/bpf/progs/epilogue_exit.c @@ -4,8 +4,8 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/epilogue_tailcall.c b/tools/testing/selftests/bpf/progs/epilogue_tailcall.c index 7275dd594de0..153514691ba4 100644 --- a/tools/testing/selftests/bpf/progs/epilogue_tailcall.c +++ b/tools/testing/selftests/bpf/progs/epilogue_tailcall.c @@ -4,8 +4,8 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/exceptions_fail.c b/tools/testing/selftests/bpf/progs/exceptions_fail.c index fe0f3fa5aab6..8a0fdff89927 100644 --- a/tools/testing/selftests/bpf/progs/exceptions_fail.c +++ b/tools/testing/selftests/bpf/progs/exceptions_fail.c @@ -131,7 +131,7 @@ int reject_subprog_with_lock(void *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_rcu_read_lock-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_rcu_read_lock-ed region") int reject_with_rcu_read_lock(void *ctx) { bpf_rcu_read_lock(); @@ -147,7 +147,7 @@ __noinline static int throwing_subprog(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_rcu_read_lock-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_rcu_read_lock-ed region") int reject_subprog_with_rcu_read_lock(void *ctx) { bpf_rcu_read_lock(); diff --git a/tools/testing/selftests/bpf/progs/find_vma.c b/tools/testing/selftests/bpf/progs/find_vma.c index 38034fb82530..02b82774469c 100644 --- a/tools/testing/selftests/bpf/progs/find_vma.c +++ b/tools/testing/selftests/bpf/progs/find_vma.c @@ -25,7 +25,7 @@ static long check_vma(struct task_struct *task, struct vm_area_struct *vma, { if (vma->vm_file) bpf_probe_read_kernel_str(d_iname, DNAME_INLINE_LEN - 1, - vma->vm_file->f_path.dentry->d_iname); + vma->vm_file->f_path.dentry->d_shortname.string); /* check for VM_EXEC */ if (vma->vm_flags & VM_EXEC) diff --git a/tools/testing/selftests/bpf/progs/free_timer.c b/tools/testing/selftests/bpf/progs/free_timer.c new file mode 100644 index 000000000000..4501ae8fc414 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/free_timer.c @@ -0,0 +1,71 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (C) 2025. Huawei Technologies Co., Ltd */ +#include <linux/bpf.h> +#include <time.h> +#include <bpf/bpf_tracing.h> +#include <bpf/bpf_helpers.h> + +#define MAX_ENTRIES 8 + +struct map_value { + struct bpf_timer timer; +}; + +struct { + __uint(type, BPF_MAP_TYPE_HASH); + __type(key, int); + __type(value, struct map_value); + __uint(max_entries, MAX_ENTRIES); +} map SEC(".maps"); + +static int timer_cb(void *map, void *key, struct map_value *value) +{ + volatile int sum = 0; + int i; + + bpf_for(i, 0, 1024 * 1024) sum += i; + + return 0; +} + +static int start_cb(int key) +{ + struct map_value *value; + + value = bpf_map_lookup_elem(&map, (void *)&key); + if (!value) + return 0; + + bpf_timer_init(&value->timer, &map, CLOCK_MONOTONIC); + bpf_timer_set_callback(&value->timer, timer_cb); + /* Hope 100us will be enough to wake-up and run the overwrite thread */ + bpf_timer_start(&value->timer, 100000, BPF_F_TIMER_CPU_PIN); + + return 0; +} + +static int overwrite_cb(int key) +{ + struct map_value zero = {}; + + /* Free the timer which may run on other CPU */ + bpf_map_update_elem(&map, (void *)&key, &zero, BPF_ANY); + + return 0; +} + +SEC("syscall") +int BPF_PROG(start_timer) +{ + bpf_loop(MAX_ENTRIES, start_cb, NULL, 0); + return 0; +} + +SEC("syscall") +int BPF_PROG(overwrite_timer) +{ + bpf_loop(MAX_ENTRIES, overwrite_cb, NULL, 0); + return 0; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/irq.c b/tools/testing/selftests/bpf/progs/irq.c new file mode 100644 index 000000000000..b0b53d980964 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/irq.c @@ -0,0 +1,444 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ +#include <vmlinux.h> +#include <bpf/bpf_helpers.h> +#include "bpf_misc.h" +#include "bpf_experimental.h" + +unsigned long global_flags; + +extern void bpf_local_irq_save(unsigned long *) __weak __ksym; +extern void bpf_local_irq_restore(unsigned long *) __weak __ksym; +extern int bpf_copy_from_user_str(void *dst, u32 dst__sz, const void *unsafe_ptr__ign, u64 flags) __weak __ksym; + +SEC("?tc") +__failure __msg("arg#0 doesn't point to an irq flag on stack") +int irq_save_bad_arg(struct __sk_buff *ctx) +{ + bpf_local_irq_save(&global_flags); + return 0; +} + +SEC("?tc") +__failure __msg("arg#0 doesn't point to an irq flag on stack") +int irq_restore_bad_arg(struct __sk_buff *ctx) +{ + bpf_local_irq_restore(&global_flags); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_2(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags2); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_3(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags2); + bpf_local_irq_save(&flags3); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_3_minus_2(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags2); + bpf_local_irq_save(&flags3); + bpf_local_irq_restore(&flags3); + bpf_local_irq_restore(&flags2); + return 0; +} + +static __noinline void local_irq_save(unsigned long *flags) +{ + bpf_local_irq_save(flags); +} + +static __noinline void local_irq_restore(unsigned long *flags) +{ + bpf_local_irq_restore(flags); +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_1_subprog(struct __sk_buff *ctx) +{ + unsigned long flags; + + local_irq_save(&flags); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_2_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + + local_irq_save(&flags1); + local_irq_save(&flags2); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_3_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save(&flags1); + local_irq_save(&flags2); + local_irq_save(&flags3); + return 0; +} + +SEC("?tc") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_local_irq_save-ed region") +int irq_restore_missing_3_minus_2_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save(&flags1); + local_irq_save(&flags2); + local_irq_save(&flags3); + local_irq_restore(&flags3); + local_irq_restore(&flags2); + return 0; +} + +SEC("?tc") +__success +int irq_balance(struct __sk_buff *ctx) +{ + unsigned long flags; + + local_irq_save(&flags); + local_irq_restore(&flags); + return 0; +} + +SEC("?tc") +__success +int irq_balance_n(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save(&flags1); + local_irq_save(&flags2); + local_irq_save(&flags3); + local_irq_restore(&flags3); + local_irq_restore(&flags2); + local_irq_restore(&flags1); + return 0; +} + +static __noinline void local_irq_balance(void) +{ + unsigned long flags; + + local_irq_save(&flags); + local_irq_restore(&flags); +} + +static __noinline void local_irq_balance_n(void) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save(&flags1); + local_irq_save(&flags2); + local_irq_save(&flags3); + local_irq_restore(&flags3); + local_irq_restore(&flags2); + local_irq_restore(&flags1); +} + +SEC("?tc") +__success +int irq_balance_subprog(struct __sk_buff *ctx) +{ + local_irq_balance(); + return 0; +} + +SEC("?fentry.s/" SYS_PREFIX "sys_getpgid") +__failure __msg("sleepable helper bpf_copy_from_user#") +int irq_sleepable_helper(void *ctx) +{ + unsigned long flags; + u32 data; + + local_irq_save(&flags); + bpf_copy_from_user(&data, sizeof(data), NULL); + local_irq_restore(&flags); + return 0; +} + +SEC("?fentry.s/" SYS_PREFIX "sys_getpgid") +__failure __msg("kernel func bpf_copy_from_user_str is sleepable within IRQ-disabled region") +int irq_sleepable_kfunc(void *ctx) +{ + unsigned long flags; + u32 data; + + local_irq_save(&flags); + bpf_copy_from_user_str(&data, sizeof(data), NULL, 0); + local_irq_restore(&flags); + return 0; +} + +int __noinline global_local_irq_balance(void) +{ + local_irq_balance_n(); + return 0; +} + +SEC("?tc") +__failure __msg("global function calls are not allowed with IRQs disabled") +int irq_global_subprog(struct __sk_buff *ctx) +{ + unsigned long flags; + + bpf_local_irq_save(&flags); + global_local_irq_balance(); + bpf_local_irq_restore(&flags); + return 0; +} + +SEC("?tc") +__failure __msg("cannot restore irq state out of order") +int irq_restore_ooo(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags2); + bpf_local_irq_restore(&flags1); + bpf_local_irq_restore(&flags2); + return 0; +} + +SEC("?tc") +__failure __msg("cannot restore irq state out of order") +int irq_restore_ooo_3(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags2); + bpf_local_irq_restore(&flags2); + bpf_local_irq_save(&flags3); + bpf_local_irq_restore(&flags1); + bpf_local_irq_restore(&flags3); + return 0; +} + +static __noinline void local_irq_save_3(unsigned long *flags1, unsigned long *flags2, + unsigned long *flags3) +{ + local_irq_save(flags1); + local_irq_save(flags2); + local_irq_save(flags3); +} + +SEC("?tc") +__success +int irq_restore_3_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save_3(&flags1, &flags2, &flags3); + bpf_local_irq_restore(&flags3); + bpf_local_irq_restore(&flags2); + bpf_local_irq_restore(&flags1); + return 0; +} + +SEC("?tc") +__failure __msg("cannot restore irq state out of order") +int irq_restore_4_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + unsigned long flags4; + + local_irq_save_3(&flags1, &flags2, &flags3); + bpf_local_irq_restore(&flags3); + bpf_local_irq_save(&flags4); + bpf_local_irq_restore(&flags4); + bpf_local_irq_restore(&flags1); + return 0; +} + +SEC("?tc") +__failure __msg("cannot restore irq state out of order") +int irq_restore_ooo_3_subprog(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags2; + unsigned long flags3; + + local_irq_save_3(&flags1, &flags2, &flags3); + bpf_local_irq_restore(&flags3); + bpf_local_irq_restore(&flags2); + bpf_local_irq_save(&flags3); + bpf_local_irq_restore(&flags1); + return 0; +} + +SEC("?tc") +__failure __msg("expected an initialized") +int irq_restore_invalid(struct __sk_buff *ctx) +{ + unsigned long flags1; + unsigned long flags = 0xfaceb00c; + + bpf_local_irq_save(&flags1); + bpf_local_irq_restore(&flags); + return 0; +} + +SEC("?tc") +__failure __msg("expected uninitialized") +int irq_save_invalid(struct __sk_buff *ctx) +{ + unsigned long flags1; + + bpf_local_irq_save(&flags1); + bpf_local_irq_save(&flags1); + return 0; +} + +SEC("?tc") +__failure __msg("expected an initialized") +int irq_restore_iter(struct __sk_buff *ctx) +{ + struct bpf_iter_num it; + + bpf_iter_num_new(&it, 0, 42); + bpf_local_irq_restore((unsigned long *)&it); + return 0; +} + +SEC("?tc") +__failure __msg("Unreleased reference id=1") +int irq_save_iter(struct __sk_buff *ctx) +{ + struct bpf_iter_num it; + + /* Ensure same sized slot has st->ref_obj_id set, so we reject based on + * slot_type != STACK_IRQ_FLAG... + */ + _Static_assert(sizeof(it) == sizeof(unsigned long), "broken iterator size"); + + bpf_iter_num_new(&it, 0, 42); + bpf_local_irq_save((unsigned long *)&it); + bpf_local_irq_restore((unsigned long *)&it); + return 0; +} + +SEC("?tc") +__failure __msg("expected an initialized") +int irq_flag_overwrite(struct __sk_buff *ctx) +{ + unsigned long flags; + + bpf_local_irq_save(&flags); + flags = 0xdeadbeef; + bpf_local_irq_restore(&flags); + return 0; +} + +SEC("?tc") +__failure __msg("expected an initialized") +int irq_flag_overwrite_partial(struct __sk_buff *ctx) +{ + unsigned long flags; + + bpf_local_irq_save(&flags); + *(((char *)&flags) + 1) = 0xff; + bpf_local_irq_restore(&flags); + return 0; +} + +SEC("?tc") +__failure __msg("cannot restore irq state out of order") +int irq_ooo_refs_array(struct __sk_buff *ctx) +{ + unsigned long flags[4]; + struct { int i; } *p; + + /* refs=1 */ + bpf_local_irq_save(&flags[0]); + + /* refs=1,2 */ + p = bpf_obj_new(typeof(*p)); + if (!p) { + bpf_local_irq_restore(&flags[0]); + return 0; + } + + /* refs=1,2,3 */ + bpf_local_irq_save(&flags[1]); + + /* refs=1,2,3,4 */ + bpf_local_irq_save(&flags[2]); + + /* Now when we remove ref=2, the verifier must not break the ordering in + * the refs array between 1,3,4. With an older implementation, the + * verifier would swap the last element with the removed element, but to + * maintain the stack property we need to use memmove. + */ + bpf_obj_drop(p); + + /* Save and restore to reset active_irq_id to 3, as the ordering is now + * refs=1,4,3. When restoring the linear scan will find prev_id in order + * as 3 instead of 4. + */ + bpf_local_irq_save(&flags[3]); + bpf_local_irq_restore(&flags[3]); + + /* With the incorrect implementation, we can release flags[1], flags[2], + * and flags[0], i.e. in the wrong order. + */ + bpf_local_irq_restore(&flags[1]); + bpf_local_irq_restore(&flags[2]); + bpf_local_irq_restore(&flags[0]); + return 0; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/iters.c b/tools/testing/selftests/bpf/progs/iters.c index ef70b88bccb2..190822b2f08b 100644 --- a/tools/testing/selftests/bpf/progs/iters.c +++ b/tools/testing/selftests/bpf/progs/iters.c @@ -524,11 +524,11 @@ int iter_subprog_iters(const void *ctx) } struct { - __uint(type, BPF_MAP_TYPE_ARRAY); + __uint(type, BPF_MAP_TYPE_HASH); __type(key, int); __type(value, int); __uint(max_entries, 1000); -} arr_map SEC(".maps"); +} hash_map SEC(".maps"); SEC("?raw_tp") __failure __msg("invalid mem access 'scalar'") @@ -539,7 +539,7 @@ int iter_err_too_permissive1(const void *ctx) MY_PID_GUARD(); - map_val = bpf_map_lookup_elem(&arr_map, &key); + map_val = bpf_map_lookup_elem(&hash_map, &key); if (!map_val) return 0; @@ -561,12 +561,12 @@ int iter_err_too_permissive2(const void *ctx) MY_PID_GUARD(); - map_val = bpf_map_lookup_elem(&arr_map, &key); + map_val = bpf_map_lookup_elem(&hash_map, &key); if (!map_val) return 0; bpf_repeat(1000000) { - map_val = bpf_map_lookup_elem(&arr_map, &key); + map_val = bpf_map_lookup_elem(&hash_map, &key); } *map_val = 123; @@ -585,7 +585,7 @@ int iter_err_too_permissive3(const void *ctx) MY_PID_GUARD(); bpf_repeat(1000000) { - map_val = bpf_map_lookup_elem(&arr_map, &key); + map_val = bpf_map_lookup_elem(&hash_map, &key); found = true; } @@ -606,7 +606,7 @@ int iter_tricky_but_fine(const void *ctx) MY_PID_GUARD(); bpf_repeat(1000000) { - map_val = bpf_map_lookup_elem(&arr_map, &key); + map_val = bpf_map_lookup_elem(&hash_map, &key); if (map_val) { found = true; break; @@ -1486,4 +1486,30 @@ int iter_subprog_check_stacksafe(const void *ctx) return 0; } +struct bpf_iter_num global_it; + +SEC("raw_tp") +__failure __msg("arg#0 expected pointer to an iterator on stack") +int iter_new_bad_arg(const void *ctx) +{ + bpf_iter_num_new(&global_it, 0, 1); + return 0; +} + +SEC("raw_tp") +__failure __msg("arg#0 expected pointer to an iterator on stack") +int iter_next_bad_arg(const void *ctx) +{ + bpf_iter_num_next(&global_it); + return 0; +} + +SEC("raw_tp") +__failure __msg("arg#0 expected pointer to an iterator on stack") +int iter_destroy_bad_arg(const void *ctx) +{ + bpf_iter_num_destroy(&global_it); + return 0; +} + char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/iters_state_safety.c b/tools/testing/selftests/bpf/progs/iters_state_safety.c index d47e59aba6de..f41257eadbb2 100644 --- a/tools/testing/selftests/bpf/progs/iters_state_safety.c +++ b/tools/testing/selftests/bpf/progs/iters_state_safety.c @@ -73,7 +73,7 @@ int create_and_forget_to_destroy_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int destroy_without_creating_fail(void *ctx) { /* init with zeros to stop verifier complaining about uninit stack */ @@ -91,7 +91,7 @@ int destroy_without_creating_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int compromise_iter_w_direct_write_fail(void *ctx) { struct bpf_iter_num iter; @@ -143,7 +143,7 @@ int compromise_iter_w_direct_write_and_skip_destroy_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int compromise_iter_w_helper_write_fail(void *ctx) { struct bpf_iter_num iter; @@ -230,7 +230,7 @@ int valid_stack_reuse(void *ctx) } SEC("?raw_tp") -__failure __msg("expected uninitialized iter_num as arg #1") +__failure __msg("expected uninitialized iter_num as arg #0") int double_create_fail(void *ctx) { struct bpf_iter_num iter; @@ -258,7 +258,7 @@ int double_create_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int double_destroy_fail(void *ctx) { struct bpf_iter_num iter; @@ -284,7 +284,7 @@ int double_destroy_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int next_without_new_fail(void *ctx) { struct bpf_iter_num iter; @@ -305,7 +305,7 @@ int next_without_new_fail(void *ctx) } SEC("?raw_tp") -__failure __msg("expected an initialized iter_num as arg #1") +__failure __msg("expected an initialized iter_num as arg #0") int next_after_destroy_fail(void *ctx) { struct bpf_iter_num iter; diff --git a/tools/testing/selftests/bpf/progs/iters_testmod.c b/tools/testing/selftests/bpf/progs/iters_testmod.c index df1d3db60b1b..9e4b45201e69 100644 --- a/tools/testing/selftests/bpf/progs/iters_testmod.c +++ b/tools/testing/selftests/bpf/progs/iters_testmod.c @@ -4,7 +4,7 @@ #include "bpf_experimental.h" #include <bpf/bpf_helpers.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c index 4a176e6aede8..6543d5b6e0a9 100644 --- a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c +++ b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c @@ -79,7 +79,7 @@ int testmod_seq_truncated(const void *ctx) SEC("?raw_tp") __failure -__msg("expected an initialized iter_testmod_seq as arg #2") +__msg("expected an initialized iter_testmod_seq as arg #1") int testmod_seq_getter_before_bad(const void *ctx) { struct bpf_iter_testmod_seq it; @@ -89,7 +89,7 @@ int testmod_seq_getter_before_bad(const void *ctx) SEC("?raw_tp") __failure -__msg("expected an initialized iter_testmod_seq as arg #2") +__msg("expected an initialized iter_testmod_seq as arg #1") int testmod_seq_getter_after_bad(const void *ctx) { struct bpf_iter_testmod_seq it; diff --git a/tools/testing/selftests/bpf/progs/jit_probe_mem.c b/tools/testing/selftests/bpf/progs/jit_probe_mem.c index f9789e668297..82190d79de37 100644 --- a/tools/testing/selftests/bpf/progs/jit_probe_mem.c +++ b/tools/testing/selftests/bpf/progs/jit_probe_mem.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" static struct prog_test_ref_kfunc __kptr *v; long total_sum = -1; diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c b/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c index 7632d9ecb253..b9670e9a6e3d 100644 --- a/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c +++ b/tools/testing/selftests/bpf/progs/kfunc_call_destructive.c @@ -1,7 +1,7 @@ // SPDX-License-Identifier: GPL-2.0 #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" SEC("tc") int kfunc_destructive_test(void) diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_fail.c b/tools/testing/selftests/bpf/progs/kfunc_call_fail.c index 08fae306539c..a1963497f0bf 100644 --- a/tools/testing/selftests/bpf/progs/kfunc_call_fail.c +++ b/tools/testing/selftests/bpf/progs/kfunc_call_fail.c @@ -2,7 +2,7 @@ /* Copyright (c) 2021 Facebook */ #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" struct syscall_test_args { __u8 data[16]; diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_race.c b/tools/testing/selftests/bpf/progs/kfunc_call_race.c index d532af07decf..48f64827cd93 100644 --- a/tools/testing/selftests/bpf/progs/kfunc_call_race.c +++ b/tools/testing/selftests/bpf/progs/kfunc_call_race.c @@ -1,7 +1,7 @@ // SPDX-License-Identifier: GPL-2.0 #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" SEC("tc") int kfunc_call_fail(struct __sk_buff *ctx) diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_test.c b/tools/testing/selftests/bpf/progs/kfunc_call_test.c index f502f755f567..8b86113a0126 100644 --- a/tools/testing/selftests/bpf/progs/kfunc_call_test.c +++ b/tools/testing/selftests/bpf/progs/kfunc_call_test.c @@ -2,7 +2,7 @@ /* Copyright (c) 2021 Facebook */ #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" SEC("tc") int kfunc_call_test4(struct __sk_buff *skb) diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c b/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c index 2380c75e74ce..8e150e85b50d 100644 --- a/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c +++ b/tools/testing/selftests/bpf/progs/kfunc_call_test_subprog.c @@ -1,6 +1,6 @@ // SPDX-License-Identifier: GPL-2.0 /* Copyright (c) 2021 Facebook */ -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" extern const int bpf_prog_active __ksym; int active_res = -1; diff --git a/tools/testing/selftests/bpf/progs/local_kptr_stash.c b/tools/testing/selftests/bpf/progs/local_kptr_stash.c index b092a72b2c9d..d736506a4c80 100644 --- a/tools/testing/selftests/bpf/progs/local_kptr_stash.c +++ b/tools/testing/selftests/bpf/progs/local_kptr_stash.c @@ -6,7 +6,7 @@ #include <bpf/bpf_helpers.h> #include <bpf/bpf_core_read.h> #include "../bpf_experimental.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" struct plain_local; diff --git a/tools/testing/selftests/bpf/progs/map_kptr.c b/tools/testing/selftests/bpf/progs/map_kptr.c index ab0ce1d01a4a..edaba481db9d 100644 --- a/tools/testing/selftests/bpf/progs/map_kptr.c +++ b/tools/testing/selftests/bpf/progs/map_kptr.c @@ -2,7 +2,7 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" struct map_value { struct prog_test_ref_kfunc __kptr_untrusted *unref_ptr; diff --git a/tools/testing/selftests/bpf/progs/map_kptr_fail.c b/tools/testing/selftests/bpf/progs/map_kptr_fail.c index 450bb373b179..4c0ff01f1a96 100644 --- a/tools/testing/selftests/bpf/progs/map_kptr_fail.c +++ b/tools/testing/selftests/bpf/progs/map_kptr_fail.c @@ -4,7 +4,7 @@ #include <bpf/bpf_helpers.h> #include <bpf/bpf_core_read.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" struct map_value { char buf[8]; @@ -345,7 +345,7 @@ int reject_indirect_global_func_access(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("Unreleased reference id=5 alloc_insn=") +__failure __msg("Unreleased reference id=4 alloc_insn=") int kptr_xchg_ref_state(struct __sk_buff *ctx) { struct prog_test_ref_kfunc *p; diff --git a/tools/testing/selftests/bpf/progs/missed_kprobe.c b/tools/testing/selftests/bpf/progs/missed_kprobe.c index 7f9ef701f5de..51a4fe64c917 100644 --- a/tools/testing/selftests/bpf/progs/missed_kprobe.c +++ b/tools/testing/selftests/bpf/progs/missed_kprobe.c @@ -2,7 +2,7 @@ #include "vmlinux.h" #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c b/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c index 8ea71cbd6c45..29c18d869ec1 100644 --- a/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c +++ b/tools/testing/selftests/bpf/progs/missed_kprobe_recursion.c @@ -2,7 +2,7 @@ #include "vmlinux.h" #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; @@ -46,3 +46,9 @@ int test5(struct pt_regs *ctx) { return 0; } + +SEC("kprobe.session/bpf_kfunc_common_test") +int test6(struct pt_regs *ctx) +{ + return 0; +} diff --git a/tools/testing/selftests/bpf/progs/nested_acquire.c b/tools/testing/selftests/bpf/progs/nested_acquire.c index 8e521a21d995..49ad7b9adf56 100644 --- a/tools/testing/selftests/bpf/progs/nested_acquire.c +++ b/tools/testing/selftests/bpf/progs/nested_acquire.c @@ -4,7 +4,7 @@ #include <bpf/bpf_tracing.h> #include <bpf/bpf_helpers.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/preempt_lock.c b/tools/testing/selftests/bpf/progs/preempt_lock.c index 885377e83607..6c5797bf0ead 100644 --- a/tools/testing/selftests/bpf/progs/preempt_lock.c +++ b/tools/testing/selftests/bpf/progs/preempt_lock.c @@ -5,8 +5,10 @@ #include "bpf_misc.h" #include "bpf_experimental.h" +extern int bpf_copy_from_user_str(void *dst, u32 dst__sz, const void *unsafe_ptr__ign, u64 flags) __weak __ksym; + SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_1(struct __sk_buff *ctx) { bpf_preempt_disable(); @@ -14,7 +16,7 @@ int preempt_lock_missing_1(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_2(struct __sk_buff *ctx) { bpf_preempt_disable(); @@ -23,7 +25,7 @@ int preempt_lock_missing_2(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_3(struct __sk_buff *ctx) { bpf_preempt_disable(); @@ -33,7 +35,7 @@ int preempt_lock_missing_3(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_3_minus_2(struct __sk_buff *ctx) { bpf_preempt_disable(); @@ -55,7 +57,7 @@ static __noinline void preempt_enable(void) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_1_subprog(struct __sk_buff *ctx) { preempt_disable(); @@ -63,7 +65,7 @@ int preempt_lock_missing_1_subprog(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_2_subprog(struct __sk_buff *ctx) { preempt_disable(); @@ -72,7 +74,7 @@ int preempt_lock_missing_2_subprog(struct __sk_buff *ctx) } SEC("?tc") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_preempt_disable-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_preempt_disable-ed region") int preempt_lock_missing_2_minus_1_subprog(struct __sk_buff *ctx) { preempt_disable(); @@ -113,6 +115,18 @@ int preempt_sleepable_helper(void *ctx) return 0; } +SEC("?fentry.s/" SYS_PREFIX "sys_getpgid") +__failure __msg("kernel func bpf_copy_from_user_str is sleepable within non-preemptible region") +int preempt_sleepable_kfunc(void *ctx) +{ + u32 data; + + bpf_preempt_disable(); + bpf_copy_from_user_str(&data, sizeof(data), NULL, 0); + bpf_preempt_enable(); + return 0; +} + int __noinline preempt_global_subprog(void) { preempt_balance_subprog(); diff --git a/tools/testing/selftests/bpf/progs/pro_epilogue.c b/tools/testing/selftests/bpf/progs/pro_epilogue.c index 44bc3f06b4b6..d97d6e07ef5c 100644 --- a/tools/testing/selftests/bpf/progs/pro_epilogue.c +++ b/tools/testing/selftests/bpf/progs/pro_epilogue.c @@ -4,8 +4,8 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c b/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c index 3529e53be355..6048d79be48b 100644 --- a/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c +++ b/tools/testing/selftests/bpf/progs/pro_epilogue_goto_start.c @@ -4,8 +4,8 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null.c b/tools/testing/selftests/bpf/progs/raw_tp_null.c index 457f34c151e3..5927054b6dd9 100644 --- a/tools/testing/selftests/bpf/progs/raw_tp_null.c +++ b/tools/testing/selftests/bpf/progs/raw_tp_null.c @@ -3,6 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> +#include "bpf_misc.h" char _license[] SEC("license") = "GPL"; @@ -17,16 +18,14 @@ int BPF_PROG(test_raw_tp_null, struct sk_buff *skb) if (task->pid != tid) return 0; - i = i + skb->mark + 1; - /* The compiler may move the NULL check before this deref, which causes - * the load to fail as deref of scalar. Prevent that by using a barrier. + /* If dead code elimination kicks in, the increment +=2 will be + * removed. For raw_tp programs attaching to tracepoints in kernel + * modules, we mark input arguments as PTR_MAYBE_NULL, so branch + * prediction should never kick in. */ - barrier(); - /* If dead code elimination kicks in, the increment below will - * be removed. For raw_tp programs, we mark input arguments as - * PTR_MAYBE_NULL, so branch prediction should never kick in. - */ - if (!skb) - i += 2; + asm volatile ("%[i] += 1; if %[ctx] != 0 goto +1; %[i] += 2;" + : [i]"+r"(i) + : [ctx]"r"(skb) + : "memory"); return 0; } diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c new file mode 100644 index 000000000000..38d669957bf1 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c @@ -0,0 +1,24 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ + +#include <vmlinux.h> +#include <bpf/bpf_tracing.h> +#include "bpf_misc.h" + +char _license[] SEC("license") = "GPL"; + +/* Ensure module parameter has PTR_MAYBE_NULL */ +SEC("tp_btf/bpf_testmod_test_raw_tp_null") +__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'") +int test_raw_tp_null_bpf_testmod_test_raw_tp_null_arg_1(void *ctx) { + asm volatile("r1 = *(u64 *)(r1 +0); r1 = *(u64 *)(r1 +0);" ::: __clobber_all); + return 0; +} + +/* Check NULL marking */ +SEC("tp_btf/sched_pi_setprio") +__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'") +int test_raw_tp_null_sched_pi_setprio_arg_2(void *ctx) { + asm volatile("r1 = *(u64 *)(r1 +8); r1 = *(u64 *)(r1 +0);" ::: __clobber_all); + return 0; +} diff --git a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c index 76556e0b42b2..69da05bb6c63 100644 --- a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c +++ b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c @@ -4,7 +4,7 @@ #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -extern bool CONFIG_PREEMPT __kconfig __weak; +extern bool CONFIG_PREEMPTION __kconfig __weak; extern const int bpf_task_storage_busy __ksym; char _license[] SEC("license") = "GPL"; @@ -24,7 +24,7 @@ int BPF_PROG(read_bpf_task_storage_busy) { int *value; - if (!CONFIG_PREEMPT) + if (!CONFIG_PREEMPTION) return 0; if (bpf_get_current_pid_tgid() >> 32 != pid) diff --git a/tools/testing/selftests/bpf/progs/sock_addr_kern.c b/tools/testing/selftests/bpf/progs/sock_addr_kern.c index 8386bb15ccdc..84ad515eafd6 100644 --- a/tools/testing/selftests/bpf/progs/sock_addr_kern.c +++ b/tools/testing/selftests/bpf/progs/sock_addr_kern.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Google LLC */ #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" SEC("syscall") int init_sock(struct init_sock_args *args) diff --git a/tools/testing/selftests/bpf/progs/struct_ops_detach.c b/tools/testing/selftests/bpf/progs/struct_ops_detach.c index d7fdcabe7d90..284a5b008e0c 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_detach.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_detach.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ #include <vmlinux.h> #include <bpf/bpf_helpers.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c b/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c index 3c822103bd40..d8cc99f5c2e2 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_forgotten_cb.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ #include <vmlinux.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c index b450f72e744a..ccab3935aa42 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ #include <vmlinux.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c index 6283099ec383..8b5515f4f724 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_maybe_null_fail.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ #include <vmlinux.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_module.c b/tools/testing/selftests/bpf/progs/struct_ops_module.c index 4c56d4a9d9f4..71c420c3a5a6 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_module.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_module.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c b/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c index 9efcc6e4d356..5b23ea817f1f 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_multi_pages.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c b/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c index fa2021388485..5d0937fa07be 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_nulled_out_cb.c @@ -2,7 +2,7 @@ /* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */ #include <vmlinux.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c index 8ea57e5348ab..0e4d2ff63ab8 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c index 1f55ec4cee37..58d5d8dc2235 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_fail.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c index f2f300d50988..31e58389bb8b 100644 --- a/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c +++ b/tools/testing/selftests/bpf/progs/struct_ops_private_stack_recur.c @@ -3,7 +3,7 @@ #include <vmlinux.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/syscall.c b/tools/testing/selftests/bpf/progs/syscall.c index 0f4dfb770c32..b698cc62a371 100644 --- a/tools/testing/selftests/bpf/progs/syscall.c +++ b/tools/testing/selftests/bpf/progs/syscall.c @@ -76,9 +76,9 @@ static int btf_load(void) .magic = BTF_MAGIC, .version = BTF_VERSION, .hdr_len = sizeof(struct btf_header), - .type_len = sizeof(__u32) * 8, - .str_off = sizeof(__u32) * 8, - .str_len = sizeof(__u32), + .type_len = sizeof(raw_btf.types), + .str_off = offsetof(struct btf_blob, str) - offsetof(struct btf_blob, types), + .str_len = sizeof(raw_btf.str), }, .types = { /* long */ diff --git a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c index ea2dbb80f7b3..986829aaf73a 100644 --- a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c +++ b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c @@ -10,7 +10,7 @@ char _license[] SEC("license") = "GPL"; #define EBUSY 16 #endif -extern bool CONFIG_PREEMPT __kconfig __weak; +extern bool CONFIG_PREEMPTION __kconfig __weak; int nr_get_errs = 0; int nr_del_errs = 0; @@ -29,7 +29,7 @@ int BPF_PROG(socket_post_create, struct socket *sock, int family, int type, int ret, zero = 0; int *value; - if (!CONFIG_PREEMPT) + if (!CONFIG_PREEMPTION) return 0; task = bpf_get_current_task_btf(); diff --git a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c index d1a57f7d09bd..fe6249d99b31 100644 --- a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c +++ b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c @@ -11,6 +11,8 @@ int subprog_tc(struct __sk_buff *skb) __sink(skb); __sink(ret); + /* let verifier know that 'subprog_tc' can change pointers to skb->data */ + bpf_skb_change_proto(skb, 0, 0); return ret; } diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect.c b/tools/testing/selftests/bpf/progs/test_cls_redirect.c index 683c8aaa63da..f344c6835e84 100644 --- a/tools/testing/selftests/bpf/progs/test_cls_redirect.c +++ b/tools/testing/selftests/bpf/progs/test_cls_redirect.c @@ -15,7 +15,7 @@ #include <linux/ipv6.h> #include <linux/pkt_cls.h> #include <linux/tcp.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_endian.h> diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect.h b/tools/testing/selftests/bpf/progs/test_cls_redirect.h index 233b089d1fba..eb55cb8a3dbd 100644 --- a/tools/testing/selftests/bpf/progs/test_cls_redirect.h +++ b/tools/testing/selftests/bpf/progs/test_cls_redirect.h @@ -10,7 +10,7 @@ #include <linux/in.h> #include <linux/ip.h> #include <linux/ipv6.h> -#include <linux/udp.h> +#include <netinet/udp.h> /* offsetof() is used in static asserts, and the libbpf-redefined CO-RE * friendly version breaks compilation for older clang versions <= 15 diff --git a/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c b/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c index 464515b824b9..d0f7670351e5 100644 --- a/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c +++ b/tools/testing/selftests/bpf/progs/test_cls_redirect_dynptr.c @@ -15,7 +15,7 @@ #include <linux/ipv6.h> #include <linux/pkt_cls.h> #include <linux/tcp.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <bpf/bpf_helpers.h> #include <bpf/bpf_endian.h> diff --git a/tools/testing/selftests/bpf/progs/test_fill_link_info.c b/tools/testing/selftests/bpf/progs/test_fill_link_info.c index 6afa834756e9..fac33a14f200 100644 --- a/tools/testing/selftests/bpf/progs/test_fill_link_info.c +++ b/tools/testing/selftests/bpf/progs/test_fill_link_info.c @@ -6,13 +6,20 @@ #include <stdbool.h> extern bool CONFIG_X86_KERNEL_IBT __kconfig __weak; +extern bool CONFIG_PPC_FTRACE_OUT_OF_LINE __kconfig __weak; +extern bool CONFIG_KPROBES_ON_FTRACE __kconfig __weak; +extern bool CONFIG_PPC64 __kconfig __weak; -/* This function is here to have CONFIG_X86_KERNEL_IBT - * used and added to object BTF. +/* This function is here to have CONFIG_X86_KERNEL_IBT, + * CONFIG_PPC_FTRACE_OUT_OF_LINE, CONFIG_KPROBES_ON_FTRACE, + * CONFIG_PPC6 used and added to object BTF. */ int unused(void) { - return CONFIG_X86_KERNEL_IBT ? 0 : 1; + return CONFIG_X86_KERNEL_IBT || + CONFIG_PPC_FTRACE_OUT_OF_LINE || + CONFIG_KPROBES_ON_FTRACE || + CONFIG_PPC64 ? 0 : 1; } SEC("kprobe") diff --git a/tools/testing/selftests/bpf/progs/test_global_func10.c b/tools/testing/selftests/bpf/progs/test_global_func10.c index 5da001ca57a5..09d027bd3ea8 100644 --- a/tools/testing/selftests/bpf/progs/test_global_func10.c +++ b/tools/testing/selftests/bpf/progs/test_global_func10.c @@ -26,7 +26,7 @@ __noinline int foo(const struct Big *big) } SEC("cgroup_skb/ingress") -__failure __msg("invalid indirect access to stack") +__failure __msg("invalid read from stack") int global_func10(struct __sk_buff *skb) { const struct Small small = {.x = skb->len }; diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c index e68667aec6a6..cd4d752bd089 100644 --- a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c +++ b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c @@ -45,7 +45,7 @@ int BPF_PROG(not_valid_dynptr, int cmd, union bpf_attr *attr, unsigned int size) } SEC("?lsm.s/bpf") -__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr") +__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr") int BPF_PROG(not_ptr_to_stack, int cmd, union bpf_attr *attr, unsigned int size) { unsigned long val = 0; diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c index 7ac7e1de34d8..0ad1bf1ede8d 100644 --- a/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c +++ b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c @@ -4,7 +4,7 @@ #include <bpf/bpf_helpers.h> #include "bpf_misc.h" #include "bpf_kfuncs.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" SEC("tc") int kfunc_dynptr_nullable_test1(struct __sk_buff *skb) diff --git a/tools/testing/selftests/bpf/progs/test_module_attach.c b/tools/testing/selftests/bpf/progs/test_module_attach.c index cc1a012d038f..fb07f5773888 100644 --- a/tools/testing/selftests/bpf/progs/test_module_attach.c +++ b/tools/testing/selftests/bpf/progs/test_module_attach.c @@ -5,7 +5,7 @@ #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> #include <bpf/bpf_core_read.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" __u32 raw_tp_read_sz = 0; diff --git a/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c new file mode 100644 index 000000000000..2796dd8545eb --- /dev/null +++ b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c @@ -0,0 +1,40 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (c) 2024 ByteDance */ +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> + +struct { + __uint(type, BPF_MAP_TYPE_SOCKMAP); + __uint(max_entries, 1); + __type(key, int); + __type(value, int); +} sock_map_rx SEC(".maps"); + +long change_tail_ret = 1; + +SEC("sk_skb") +int prog_skb_verdict(struct __sk_buff *skb) +{ + char *data, *data_end; + + bpf_skb_pull_data(skb, 1); + data = (char *)(unsigned long)skb->data; + data_end = (char *)(unsigned long)skb->data_end; + + if (data + 1 > data_end) + return SK_PASS; + + if (data[0] == 'T') { /* Trim the packet */ + change_tail_ret = bpf_skb_change_tail(skb, skb->len - 1, 0); + return SK_PASS; + } else if (data[0] == 'G') { /* Grow the packet */ + change_tail_ret = bpf_skb_change_tail(skb, skb->len + 1, 0); + return SK_PASS; + } else if (data[0] == 'E') { /* Error */ + change_tail_ret = bpf_skb_change_tail(skb, 65535, 0); + return SK_PASS; + } + return SK_PASS; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/test_sockmap_strp.c b/tools/testing/selftests/bpf/progs/test_sockmap_strp.c new file mode 100644 index 000000000000..dde3d5bec515 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/test_sockmap_strp.c @@ -0,0 +1,53 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include <bpf/bpf_endian.h> +int verdict_max_size = 10000; +struct { + __uint(type, BPF_MAP_TYPE_SOCKMAP); + __uint(max_entries, 20); + __type(key, int); + __type(value, int); +} sock_map SEC(".maps"); + +SEC("sk_skb/stream_verdict") +int prog_skb_verdict(struct __sk_buff *skb) +{ + __u32 one = 1; + + if (skb->len > verdict_max_size) + return SK_PASS; + + return bpf_sk_redirect_map(skb, &sock_map, one, 0); +} + +SEC("sk_skb/stream_verdict") +int prog_skb_verdict_pass(struct __sk_buff *skb) +{ + return SK_PASS; +} + +SEC("sk_skb/stream_parser") +int prog_skb_parser(struct __sk_buff *skb) +{ + return skb->len; +} + +SEC("sk_skb/stream_parser") +int prog_skb_parser_partial(struct __sk_buff *skb) +{ + /* agreement with the test program on a 4-byte size header + * and 6-byte body. + */ + if (skb->len < 4) { + /* need more header to determine full length */ + return 0; + } + /* return full length decoded from header. + * the return value may be larger than skb->len which + * means framework must wait body coming. + */ + return 10; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/test_tc_change_tail.c b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c new file mode 100644 index 000000000000..28edafe803f0 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c @@ -0,0 +1,106 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include <linux/if_ether.h> +#include <linux/in.h> +#include <linux/ip.h> +#include <linux/udp.h> +#include <linux/pkt_cls.h> + +long change_tail_ret = 1; + +static __always_inline struct iphdr *parse_ip_header(struct __sk_buff *skb, int *ip_proto) +{ + void *data_end = (void *)(long)skb->data_end; + void *data = (void *)(long)skb->data; + struct ethhdr *eth = data; + struct iphdr *iph; + + /* Verify Ethernet header */ + if ((void *)(data + sizeof(*eth)) > data_end) + return NULL; + + /* Skip Ethernet header to get to IP header */ + iph = (void *)(data + sizeof(struct ethhdr)); + + /* Verify IP header */ + if ((void *)(data + sizeof(struct ethhdr) + sizeof(*iph)) > data_end) + return NULL; + + /* Basic IP header validation */ + if (iph->version != 4) /* Only support IPv4 */ + return NULL; + + if (iph->ihl < 5) /* Minimum IP header length */ + return NULL; + + *ip_proto = iph->protocol; + return iph; +} + +static __always_inline struct udphdr *parse_udp_header(struct __sk_buff *skb, struct iphdr *iph) +{ + void *data_end = (void *)(long)skb->data_end; + void *hdr = (void *)iph; + struct udphdr *udp; + + /* Calculate UDP header position */ + udp = hdr + (iph->ihl * 4); + hdr = (void *)udp; + + /* Verify UDP header bounds */ + if ((void *)(hdr + sizeof(*udp)) > data_end) + return NULL; + + return udp; +} + +SEC("tc/ingress") +int change_tail(struct __sk_buff *skb) +{ + int len = skb->len; + struct udphdr *udp; + struct iphdr *iph; + void *data_end; + char *payload; + int ip_proto; + + bpf_skb_pull_data(skb, len); + + data_end = (void *)(long)skb->data_end; + iph = parse_ip_header(skb, &ip_proto); + if (!iph) + return TCX_PASS; + + if (ip_proto != IPPROTO_UDP) + return TCX_PASS; + + udp = parse_udp_header(skb, iph); + if (!udp) + return TCX_PASS; + + payload = (char *)udp + (sizeof(struct udphdr)); + if (payload + 1 > (char *)data_end) + return TCX_PASS; + + if (payload[0] == 'T') { /* Trim the packet */ + change_tail_ret = bpf_skb_change_tail(skb, len - 1, 0); + if (!change_tail_ret) + bpf_skb_change_tail(skb, len, 0); + return TCX_PASS; + } else if (payload[0] == 'G') { /* Grow the packet */ + change_tail_ret = bpf_skb_change_tail(skb, len + 1, 0); + if (!change_tail_ret) + bpf_skb_change_tail(skb, len, 0); + return TCX_PASS; + } else if (payload[0] == 'E') { /* Error */ + change_tail_ret = bpf_skb_change_tail(skb, 65535, 0); + return TCX_PASS; + } else if (payload[0] == 'Z') { /* Zero */ + change_tail_ret = bpf_skb_change_tail(skb, 0, 0); + return TCX_PASS; + } + return TCX_DROP; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/test_tc_link.c b/tools/testing/selftests/bpf/progs/test_tc_link.c index 10d825928499..630f12e51b07 100644 --- a/tools/testing/selftests/bpf/progs/test_tc_link.c +++ b/tools/testing/selftests/bpf/progs/test_tc_link.c @@ -8,6 +8,7 @@ #include <linux/if_packet.h> #include <bpf/bpf_endian.h> #include <bpf/bpf_helpers.h> +#include <bpf/bpf_core_read.h> char LICENSE[] SEC("license") = "GPL"; @@ -27,6 +28,7 @@ bool seen_host; bool seen_mcast; int mark, prio; +unsigned short headroom, tailroom; SEC("tc/ingress") int tc1(struct __sk_buff *skb) @@ -104,11 +106,24 @@ out: return TCX_PASS; } +struct sk_buff { + struct net_device *dev; +}; + +struct net_device { + unsigned short needed_headroom; + unsigned short needed_tailroom; +}; + SEC("tc/egress") int tc8(struct __sk_buff *skb) { + struct net_device *dev = BPF_CORE_READ((struct sk_buff *)skb, dev); + seen_tc8 = true; mark = skb->mark; prio = skb->priority; + headroom = BPF_CORE_READ(dev, needed_headroom); + tailroom = BPF_CORE_READ(dev, needed_tailroom); return TCX_PASS; } diff --git a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c index 5aaf2b065f86..39ff06f2c834 100644 --- a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c +++ b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c @@ -3,15 +3,11 @@ #include "vmlinux.h" #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" #include "bpf_misc.h" SEC("tp_btf/bpf_testmod_test_nullable_bare") -/* This used to be a failure test, but raw_tp nullable arguments can now - * directly be dereferenced, whether they have nullable annotation or not, - * and don't need to be explicitly checked. - */ -__success +__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'") int BPF_PROG(handle_tp_btf_nullable_bare1, struct bpf_testmod_test_read_ctx *nullable_ctx) { return nullable_ctx->len; diff --git a/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c b/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c index 81bb38d72ced..dc74d8cf9e3f 100644 --- a/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c +++ b/tools/testing/selftests/bpf/progs/test_xdp_adjust_tail_grow.c @@ -10,6 +10,8 @@ int _xdp_adjust_tail_grow(struct xdp_md *xdp) /* SKB_DATA_ALIGN(sizeof(struct skb_shared_info)) */ #if defined(__TARGET_ARCH_s390) int tailroom = 512; +#elif defined(__TARGET_ARCH_powerpc) + int tailroom = 384; #else int tailroom = 320; #endif diff --git a/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c b/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c index 3abf068b8446..5928ed0911ca 100644 --- a/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c +++ b/tools/testing/selftests/bpf/progs/test_xdp_do_redirect.c @@ -98,6 +98,18 @@ int xdp_count_pkts(struct xdp_md *xdp) return XDP_DROP; } +SEC("xdp") +int xdp_redirect_to_111(struct xdp_md *xdp) +{ + return bpf_redirect(111, 0); +} + +SEC("xdp") +int xdp_redirect_to_222(struct xdp_md *xdp) +{ + return bpf_redirect(222, 0); +} + SEC("tc") int tc_count_pkts(struct __sk_buff *skb) { diff --git a/tools/testing/selftests/bpf/progs/test_xdp_meta.c b/tools/testing/selftests/bpf/progs/test_xdp_meta.c index a7c4a7d49fe6..fe2d71ae0e71 100644 --- a/tools/testing/selftests/bpf/progs/test_xdp_meta.c +++ b/tools/testing/selftests/bpf/progs/test_xdp_meta.c @@ -8,7 +8,7 @@ #define round_up(x, y) ((((x) - 1) | __round_mask(x, y)) + 1) #define ctx_ptr(ctx, mem) (void *)(unsigned long)ctx->mem -SEC("t") +SEC("tc") int ing_cls(struct __sk_buff *ctx) { __u8 *data, *data_meta, *data_end; @@ -28,7 +28,7 @@ int ing_cls(struct __sk_buff *ctx) return diff ? TC_ACT_SHOT : TC_ACT_OK; } -SEC("x") +SEC("xdp") int ing_xdp(struct xdp_md *ctx) { __u8 *data, *data_meta, *data_end; diff --git a/tools/testing/selftests/bpf/progs/test_xdp_redirect.c b/tools/testing/selftests/bpf/progs/test_xdp_redirect.c deleted file mode 100644 index b778cad45485..000000000000 --- a/tools/testing/selftests/bpf/progs/test_xdp_redirect.c +++ /dev/null @@ -1,26 +0,0 @@ -/* Copyright (c) 2017 VMware - * - * This program is free software; you can redistribute it and/or - * modify it under the terms of version 2 of the GNU General Public - * License as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but - * WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU - * General Public License for more details. - */ -#include <linux/bpf.h> -#include <bpf/bpf_helpers.h> - -SEC("redirect_to_111") -int xdp_redirect_to_111(struct xdp_md *xdp) -{ - return bpf_redirect(111, 0); -} -SEC("redirect_to_222") -int xdp_redirect_to_222(struct xdp_md *xdp) -{ - return bpf_redirect(222, 0); -} - -char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/uninit_stack.c b/tools/testing/selftests/bpf/progs/uninit_stack.c index 8a403470e557..046a204c8fc6 100644 --- a/tools/testing/selftests/bpf/progs/uninit_stack.c +++ b/tools/testing/selftests/bpf/progs/uninit_stack.c @@ -70,7 +70,8 @@ __naked int helper_uninit_to_misc(void *ctx) r1 = r10; \ r1 += -128; \ r2 = 32; \ - call %[bpf_trace_printk]; \ + r3 = 0; \ + call %[bpf_probe_read_user]; \ /* Call to dummy() forces print_verifier_state(..., true), \ * thus showing the stack state, matched by __msg(). \ */ \ @@ -79,7 +80,7 @@ __naked int helper_uninit_to_misc(void *ctx) exit; \ " : - : __imm(bpf_trace_printk), + : __imm(bpf_probe_read_user), __imm(dummy) : __clobber_all); } diff --git a/tools/testing/selftests/bpf/progs/unsupported_ops.c b/tools/testing/selftests/bpf/progs/unsupported_ops.c index 9180365a3568..8aa2e0dd624e 100644 --- a/tools/testing/selftests/bpf/progs/unsupported_ops.c +++ b/tools/testing/selftests/bpf/progs/unsupported_ops.c @@ -4,7 +4,7 @@ #include <vmlinux.h> #include <bpf/bpf_tracing.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod.h" +#include "../test_kmods/bpf_testmod.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_array_access.c b/tools/testing/selftests/bpf/progs/verifier_array_access.c index 4195aa824ba5..0a187ff725cc 100644 --- a/tools/testing/selftests/bpf/progs/verifier_array_access.c +++ b/tools/testing/selftests/bpf/progs/verifier_array_access.c @@ -29,6 +29,20 @@ struct { } map_array_wo SEC(".maps"); struct { + __uint(type, BPF_MAP_TYPE_PERCPU_ARRAY); + __uint(max_entries, 2); + __type(key, __u32); + __type(value, struct test_val); +} map_array_pcpu SEC(".maps"); + +struct { + __uint(type, BPF_MAP_TYPE_ARRAY); + __uint(max_entries, 2); + __type(key, __u32); + __type(value, struct test_val); +} map_array SEC(".maps"); + +struct { __uint(type, BPF_MAP_TYPE_HASH); __uint(max_entries, 1); __type(key, long long); @@ -525,4 +539,193 @@ l0_%=: exit; \ : __clobber_all); } +SEC("socket") +__description("valid map access into an array using constant without nullness") +__success __retval(4) __log_level(2) +__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}") +unsigned int an_array_with_a_constant_no_nullness(void) +{ + /* Need 8-byte alignment for spill tracking */ + __u32 __attribute__((aligned(8))) key = 1; + struct test_val *val; + + val = bpf_map_lookup_elem(&map_array, &key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("valid multiple map access into an array using constant without nullness") +__success __retval(8) __log_level(2) +__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -16) = {{(0|r[0-9])}}") +__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}") +unsigned int multiple_array_with_a_constant_no_nullness(void) +{ + __u32 __attribute__((aligned(8))) key = 1; + __u32 __attribute__((aligned(8))) key2 = 0; + struct test_val *val, *val2; + + val = bpf_map_lookup_elem(&map_array, &key); + val->index = offsetof(struct test_val, foo); + + val2 = bpf_map_lookup_elem(&map_array, &key2); + val2->index = offsetof(struct test_val, foo); + + return val->index + val2->index; +} + +SEC("socket") +__description("valid map access into an array using natural aligned 32-bit constant 0 without nullness") +__success __retval(4) +unsigned int an_array_with_a_32bit_constant_0_no_nullness(void) +{ + /* Unlike the above tests, 32-bit zeroing is precisely tracked even + * if writes are not aligned to BPF_REG_SIZE. This tests that our + * STACK_ZERO handling functions. + */ + struct test_val *val; + __u32 key = 0; + + val = bpf_map_lookup_elem(&map_array, &key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("valid map access into a pcpu array using constant without nullness") +__success __retval(4) __log_level(2) +__msg("mark_precise: frame0: regs= stack=-8 before {{[0-9]}}: ({{[a-f0-9]+}}) *(u32 *)(r10 -8) = {{(1|r[0-9])}}") +unsigned int a_pcpu_array_with_a_constant_no_nullness(void) +{ + __u32 __attribute__((aligned(8))) key = 1; + struct test_val *val; + + val = bpf_map_lookup_elem(&map_array_pcpu, &key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("invalid map access into an array using constant without nullness") +__failure __msg("R0 invalid mem access 'map_value_or_null'") +unsigned int an_array_with_a_constant_no_nullness_out_of_bounds(void) +{ + /* Out of bounds */ + __u32 __attribute__((aligned(8))) key = 3; + struct test_val *val; + + val = bpf_map_lookup_elem(&map_array, &key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("invalid map access into an array using constant smaller than key_size") +__failure __msg("R0 invalid mem access 'map_value_or_null'") +unsigned int an_array_with_a_constant_too_small(void) +{ + __u32 __attribute__((aligned(8))) key; + struct test_val *val; + + /* Mark entire key as STACK_MISC */ + bpf_probe_read_user(&key, sizeof(key), NULL); + + /* Spilling only the bottom byte results in a tnum const of 1. + * We want to check that the verifier rejects it, as the spill is < 4B. + */ + *(__u8 *)&key = 1; + val = bpf_map_lookup_elem(&map_array, &key); + + /* Should fail, as verifier cannot prove in-bound lookup */ + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("invalid map access into an array using constant larger than key_size") +__failure __msg("R0 invalid mem access 'map_value_or_null'") +unsigned int an_array_with_a_constant_too_big(void) +{ + struct test_val *val; + __u64 key = 1; + + /* Even if the constant value is < max_entries, if the spill size is + * larger than the key size, the set bits may not be where we expect them + * to be on different endian architectures. + */ + val = bpf_map_lookup_elem(&map_array, &key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("invalid elided lookup using const and non-const key") +__failure __msg("R0 invalid mem access 'map_value_or_null'") +unsigned int mixed_const_and_non_const_key_lookup(void) +{ + __u32 __attribute__((aligned(8))) key; + struct test_val *val; + __u32 rand; + + rand = bpf_get_prandom_u32(); + key = rand > 42 ? 1 : rand; + val = bpf_map_lookup_elem(&map_array, &key); + + return val->index; +} + +SEC("socket") +__failure __msg("invalid read from stack R2 off=4096 size=4") +__naked void key_lookup_at_invalid_fp(void) +{ + asm volatile (" \ + r1 = %[map_array] ll; \ + r2 = r10; \ + r2 += 4096; \ + call %[bpf_map_lookup_elem]; \ + r0 = *(u64*)(r0 + 0); \ + exit; \ +" : + : __imm(bpf_map_lookup_elem), + __imm_addr(map_array) + : __clobber_all); +} + +volatile __u32 __attribute__((aligned(8))) global_key; + +SEC("socket") +__description("invalid elided lookup using non-stack key") +__failure __msg("R0 invalid mem access 'map_value_or_null'") +unsigned int non_stack_key_lookup(void) +{ + struct test_val *val; + + global_key = 1; + val = bpf_map_lookup_elem(&map_array, (void *)&global_key); + val->index = offsetof(struct test_val, foo); + + return val->index; +} + +SEC("socket") +__description("doesn't reject UINT64_MAX as s64 for irrelevant maps") +__success __retval(42) +unsigned int doesnt_reject_irrelevant_maps(void) +{ + __u64 key = 0xFFFFFFFFFFFFFFFF; + struct test_val *val; + + val = bpf_map_lookup_elem(&map_hash_48b, &key); + if (val) + return val->index; + + return 42; +} + char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_basic_stack.c b/tools/testing/selftests/bpf/progs/verifier_basic_stack.c index 8d77cc5323d3..fb62e09f2114 100644 --- a/tools/testing/selftests/bpf/progs/verifier_basic_stack.c +++ b/tools/testing/selftests/bpf/progs/verifier_basic_stack.c @@ -28,7 +28,7 @@ __naked void stack_out_of_bounds(void) SEC("socket") __description("uninitialized stack1") __success __log_level(4) __msg("stack depth 8") -__failure_unpriv __msg_unpriv("invalid indirect read from stack") +__failure_unpriv __msg_unpriv("invalid read from stack") __naked void uninitialized_stack1(void) { asm volatile (" \ diff --git a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c index 7c881bca9af5..8bcddadfc4da 100644 --- a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c +++ b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c @@ -32,18 +32,18 @@ int BPF_PROG(no_destroy, struct bpf_iter_meta *meta, struct cgroup *cgrp) SEC("iter/cgroup") __description("uninitialized iter in ->next()") -__failure __msg("expected an initialized iter_bits as arg #1") +__failure __msg("expected an initialized iter_bits as arg #0") int BPF_PROG(next_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp) { - struct bpf_iter_bits *it = NULL; + struct bpf_iter_bits it = {}; - bpf_iter_bits_next(it); + bpf_iter_bits_next(&it); return 0; } SEC("iter/cgroup") __description("uninitialized iter in ->destroy()") -__failure __msg("expected an initialized iter_bits as arg #1") +__failure __msg("expected an initialized iter_bits as arg #0") int BPF_PROG(destroy_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp) { struct bpf_iter_bits it = {}; diff --git a/tools/testing/selftests/bpf/progs/verifier_bounds.c b/tools/testing/selftests/bpf/progs/verifier_bounds.c index a0bb7fb40ea5..0eb33bb801b5 100644 --- a/tools/testing/selftests/bpf/progs/verifier_bounds.c +++ b/tools/testing/selftests/bpf/progs/verifier_bounds.c @@ -1200,4 +1200,138 @@ l0_%=: r0 = 0; \ : __clobber_all); } +SEC("tc") +__description("multiply mixed sign bounds. test 1") +__success __log_level(2) +__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=umin=0x1bc16d5cd4927ee1,smax=umax=0x1bc16d674ec80000,smax32=0x7ffffeff,umax32=0xfffffeff,var_off=(0x1bc16d4000000000; 0x3ffffffeff))") +__naked void mult_mixed0_sign(void) +{ + asm volatile ( + "call %[bpf_get_prandom_u32];" + "r6 = r0;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= 0xf;" + "r6 -= 1000000000;" + "r7 &= 0xf;" + "r7 -= 2000000000;" + "r6 *= r7;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} + +SEC("tc") +__description("multiply mixed sign bounds. test 2") +__success __log_level(2) +__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=smin32=-100,smax=smax32=200)") +__naked void mult_mixed1_sign(void) +{ + asm volatile ( + "call %[bpf_get_prandom_u32];" + "r6 = r0;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= 0xf;" + "r6 -= 0xa;" + "r7 &= 0xf;" + "r7 -= 0x14;" + "r6 *= r7;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} + +SEC("tc") +__description("multiply negative bounds") +__success __log_level(2) +__msg("r6 *= r7 {{.*}}; R6_w=scalar(smin=umin=smin32=umin32=0x3ff280b0,smax=umax=smax32=umax32=0x3fff0001,var_off=(0x3ff00000; 0xf81ff))") +__naked void mult_sign_bounds(void) +{ + asm volatile ( + "r8 = 0x7fff;" + "call %[bpf_get_prandom_u32];" + "r6 = r0;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= 0xa;" + "r6 -= r8;" + "r7 &= 0xf;" + "r7 -= r8;" + "r6 *= r7;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} + +SEC("tc") +__description("multiply bounds that don't cross signed boundary") +__success __log_level(2) +__msg("r8 *= r6 {{.*}}; R6_w=scalar(smin=smin32=0,smax=umax=smax32=umax32=11,var_off=(0x0; 0xb)) R8_w=scalar(smin=0,smax=umax=0x7b96bb0a94a3a7cd,var_off=(0x0; 0x7fffffffffffffff))") +__naked void mult_no_sign_crossing(void) +{ + asm volatile ( + "r6 = 0xb;" + "r8 = 0xb3c3f8c99262687 ll;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= r7;" + "r8 *= r6;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} + +SEC("tc") +__description("multiplication overflow, result in unbounded reg. test 1") +__success __log_level(2) +__msg("r6 *= r7 {{.*}}; R6_w=scalar()") +__naked void mult_unsign_ovf(void) +{ + asm volatile ( + "r8 = 0x7ffffffffff ll;" + "call %[bpf_get_prandom_u32];" + "r6 = r0;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= 0x7fffffff;" + "r7 &= r8;" + "r6 *= r7;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} + +SEC("tc") +__description("multiplication overflow, result in unbounded reg. test 2") +__success __log_level(2) +__msg("r6 *= r7 {{.*}}; R6_w=scalar()") +__naked void mult_sign_ovf(void) +{ + asm volatile ( + "r8 = 0x7ffffffff ll;" + "call %[bpf_get_prandom_u32];" + "r6 = r0;" + "call %[bpf_get_prandom_u32];" + "r7 = r0;" + "r6 &= 0xa;" + "r6 -= r8;" + "r7 &= 0x7fffffff;" + "r6 *= r7;" + "exit" + : + : __imm(bpf_get_prandom_u32), + __imm(bpf_skb_store_bytes) + : __clobber_all); +} char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c index a570e48b917a..28b939572cda 100644 --- a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c +++ b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c @@ -11,7 +11,7 @@ __success __retval(0) __naked void btf_ctx_access_accept(void) { asm volatile (" \ - r2 = *(u32*)(r1 + 8); /* load 2nd argument value (int pointer) */\ + r2 = *(u64 *)(r1 + 8); /* load 2nd argument value (int pointer) */\ r0 = 0; \ exit; \ " ::: __clobber_all); @@ -23,7 +23,43 @@ __success __retval(0) __naked void ctx_access_u32_pointer_accept(void) { asm volatile (" \ - r2 = *(u32*)(r1 + 0); /* load 1nd argument value (u32 pointer) */\ + r2 = *(u64 *)(r1 + 0); /* load 1nd argument value (u32 pointer) */\ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + +SEC("fentry/bpf_fentry_test9") +__description("btf_ctx_access u32 pointer reject u32") +__failure __msg("size 4 must be 8") +__naked void ctx_access_u32_pointer_reject_32(void) +{ + asm volatile (" \ + r2 = *(u32 *)(r1 + 0); /* load 1st argument with narrow load */\ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + +SEC("fentry/bpf_fentry_test9") +__description("btf_ctx_access u32 pointer reject u16") +__failure __msg("size 2 must be 8") +__naked void ctx_access_u32_pointer_reject_16(void) +{ + asm volatile (" \ + r2 = *(u16 *)(r1 + 0); /* load 1st argument with narrow load */\ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + +SEC("fentry/bpf_fentry_test9") +__description("btf_ctx_access u32 pointer reject u8") +__failure __msg("size 1 must be 8") +__naked void ctx_access_u32_pointer_reject_8(void) +{ + asm volatile (" \ + r2 = *(u8 *)(r1 + 0); /* load 1st argument with narrow load */\ r0 = 0; \ exit; \ " ::: __clobber_all); diff --git a/tools/testing/selftests/bpf/progs/verifier_const_or.c b/tools/testing/selftests/bpf/progs/verifier_const_or.c index ba8922b2eebd..68c568c3c3a0 100644 --- a/tools/testing/selftests/bpf/progs/verifier_const_or.c +++ b/tools/testing/selftests/bpf/progs/verifier_const_or.c @@ -25,7 +25,7 @@ __naked void constant_should_keep_constant_type(void) SEC("tracepoint") __description("constant register |= constant should not bypass stack boundary checks") -__failure __msg("invalid indirect access to stack R1 off=-48 size=58") +__failure __msg("invalid write to stack R1 off=-48 size=58") __naked void not_bypass_stack_boundary_checks_1(void) { asm volatile (" \ @@ -62,7 +62,7 @@ __naked void register_should_keep_constant_type(void) SEC("tracepoint") __description("constant register |= constant register should not bypass stack boundary checks") -__failure __msg("invalid indirect access to stack R1 off=-48 size=58") +__failure __msg("invalid write to stack R1 off=-48 size=58") __naked void not_bypass_stack_boundary_checks_2(void) { asm volatile (" \ diff --git a/tools/testing/selftests/bpf/progs/verifier_d_path.c b/tools/testing/selftests/bpf/progs/verifier_d_path.c index ec79cbcfde91..87e51a215558 100644 --- a/tools/testing/selftests/bpf/progs/verifier_d_path.c +++ b/tools/testing/selftests/bpf/progs/verifier_d_path.c @@ -11,7 +11,7 @@ __success __retval(0) __naked void d_path_accept(void) { asm volatile (" \ - r1 = *(u32*)(r1 + 0); \ + r1 = *(u64 *)(r1 + 0); \ r2 = r10; \ r2 += -8; \ r6 = 0; \ @@ -31,7 +31,7 @@ __failure __msg("helper call is not allowed in probe") __naked void d_path_reject(void) { asm volatile (" \ - r1 = *(u32*)(r1 + 0); \ + r1 = *(u64 *)(r1 + 0); \ r2 = r10; \ r2 += -8; \ r6 = 0; \ diff --git a/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c b/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c index 50c6b22606f6..f2c54e4d89eb 100644 --- a/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c +++ b/tools/testing/selftests/bpf/progs/verifier_helper_access_var_len.c @@ -67,7 +67,7 @@ SEC("socket") __description("helper access to variable memory: stack, bitwise AND, zero included") /* in privileged mode reads from uninitialized stack locations are permitted */ __success __failure_unpriv -__msg_unpriv("invalid indirect read from stack R2 off -64+0 size 64") +__msg_unpriv("invalid read from stack R2 off -64+0 size 64") __retval(0) __naked void stack_bitwise_and_zero_included(void) { @@ -100,7 +100,7 @@ __naked void stack_bitwise_and_zero_included(void) SEC("tracepoint") __description("helper access to variable memory: stack, bitwise AND + JMP, wrong max") -__failure __msg("invalid indirect access to stack R1 off=-64 size=65") +__failure __msg("invalid write to stack R1 off=-64 size=65") __naked void bitwise_and_jmp_wrong_max(void) { asm volatile (" \ @@ -187,7 +187,7 @@ l0_%=: r0 = 0; \ SEC("tracepoint") __description("helper access to variable memory: stack, JMP, bounds + offset") -__failure __msg("invalid indirect access to stack R1 off=-64 size=65") +__failure __msg("invalid write to stack R1 off=-64 size=65") __naked void memory_stack_jmp_bounds_offset(void) { asm volatile (" \ @@ -211,7 +211,7 @@ l0_%=: r0 = 0; \ SEC("tracepoint") __description("helper access to variable memory: stack, JMP, wrong max") -__failure __msg("invalid indirect access to stack R1 off=-64 size=65") +__failure __msg("invalid write to stack R1 off=-64 size=65") __naked void memory_stack_jmp_wrong_max(void) { asm volatile (" \ @@ -260,7 +260,7 @@ SEC("socket") __description("helper access to variable memory: stack, JMP, no min check") /* in privileged mode reads from uninitialized stack locations are permitted */ __success __failure_unpriv -__msg_unpriv("invalid indirect read from stack R2 off -64+0 size 64") +__msg_unpriv("invalid read from stack R2 off -64+0 size 64") __retval(0) __naked void stack_jmp_no_min_check(void) { @@ -750,7 +750,7 @@ SEC("socket") __description("helper access to variable memory: 8 bytes leak") /* in privileged mode reads from uninitialized stack locations are permitted */ __success __failure_unpriv -__msg_unpriv("invalid indirect read from stack R2 off -64+32 size 64") +__msg_unpriv("invalid read from stack R2 off -64+32 size 64") __retval(0) __naked void variable_memory_8_bytes_leak(void) { diff --git a/tools/testing/selftests/bpf/progs/verifier_int_ptr.c b/tools/testing/selftests/bpf/progs/verifier_int_ptr.c index 5f2efb895edb..59e34d558654 100644 --- a/tools/testing/selftests/bpf/progs/verifier_int_ptr.c +++ b/tools/testing/selftests/bpf/progs/verifier_int_ptr.c @@ -96,7 +96,7 @@ __naked void arg_ptr_to_long_misaligned(void) SEC("cgroup/sysctl") __description("arg pointer to long size < sizeof(long)") -__failure __msg("invalid indirect access to stack R4 off=-4 size=8") +__failure __msg("invalid write to stack R4 off=-4 size=8") __naked void to_long_size_sizeof_long(void) { asm volatile (" \ diff --git a/tools/testing/selftests/bpf/progs/verifier_map_in_map.c b/tools/testing/selftests/bpf/progs/verifier_map_in_map.c index 4eaab1468eb7..7d088ba99ea5 100644 --- a/tools/testing/selftests/bpf/progs/verifier_map_in_map.c +++ b/tools/testing/selftests/bpf/progs/verifier_map_in_map.c @@ -47,7 +47,7 @@ l0_%=: r0 = 0; \ SEC("xdp") __description("map in map state pruning") -__success __msg("processed 26 insns") +__success __msg("processed 15 insns") __log_level(2) __retval(0) __flag(BPF_F_TEST_STATE_FREQ) __naked void map_in_map_state_pruning(void) { diff --git a/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c b/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c new file mode 100644 index 000000000000..e81097c96fe2 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/verifier_may_goto_1.c @@ -0,0 +1,97 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (c) 2025 Meta Platforms, Inc. and affiliates. */ + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include "../../../include/linux/filter.h" +#include "bpf_misc.h" + +SEC("raw_tp") +__description("may_goto 0") +__arch_x86_64 +__xlated("0: r0 = 1") +__xlated("1: exit") +__success +__naked void may_goto_simple(void) +{ + asm volatile ( + ".8byte %[may_goto];" + "r0 = 1;" + ".8byte %[may_goto];" + "exit;" + : + : __imm_insn(may_goto, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0)) + : __clobber_all); +} + +SEC("raw_tp") +__description("batch 2 of may_goto 0") +__arch_x86_64 +__xlated("0: r0 = 1") +__xlated("1: exit") +__success +__naked void may_goto_batch_0(void) +{ + asm volatile ( + ".8byte %[may_goto1];" + ".8byte %[may_goto1];" + "r0 = 1;" + ".8byte %[may_goto1];" + ".8byte %[may_goto1];" + "exit;" + : + : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0)) + : __clobber_all); +} + +SEC("raw_tp") +__description("may_goto batch with offsets 2/1/0") +__arch_x86_64 +__xlated("0: r0 = 1") +__xlated("1: exit") +__success +__naked void may_goto_batch_1(void) +{ + asm volatile ( + ".8byte %[may_goto1];" + ".8byte %[may_goto2];" + ".8byte %[may_goto3];" + "r0 = 1;" + ".8byte %[may_goto1];" + ".8byte %[may_goto2];" + ".8byte %[may_goto3];" + "exit;" + : + : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 2 /* offset */, 0)), + __imm_insn(may_goto2, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 1 /* offset */, 0)), + __imm_insn(may_goto3, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0)) + : __clobber_all); +} + +SEC("raw_tp") +__description("may_goto batch with offsets 2/0") +__arch_x86_64 +__xlated("0: *(u64 *)(r10 -8) = 8388608") +__xlated("1: r11 = *(u64 *)(r10 -8)") +__xlated("2: if r11 == 0x0 goto pc+3") +__xlated("3: r11 -= 1") +__xlated("4: *(u64 *)(r10 -8) = r11") +__xlated("5: r0 = 1") +__xlated("6: r0 = 2") +__xlated("7: exit") +__success +__naked void may_goto_batch_2(void) +{ + asm volatile ( + ".8byte %[may_goto1];" + ".8byte %[may_goto3];" + "r0 = 1;" + "r0 = 2;" + "exit;" + : + : __imm_insn(may_goto1, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 2 /* offset */, 0)), + __imm_insn(may_goto3, BPF_RAW_INSN(BPF_JMP | BPF_JCOND, 0, 0, 0 /* offset */, 0)) + : __clobber_all); +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c b/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c new file mode 100644 index 000000000000..b891faf50660 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/verifier_may_goto_2.c @@ -0,0 +1,28 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright (c) 2025 Meta Platforms, Inc. and affiliates. */ + +#include "bpf_misc.h" +#include "bpf_experimental.h" + +int gvar; + +SEC("raw_tp") +__description("C code with may_goto 0") +__success +int may_goto_c_code(void) +{ + int i, tmp[3]; + + for (i = 0; i < 3 && can_loop; i++) + tmp[i] = 0; + + for (i = 0; i < 3 && can_loop; i++) + tmp[i] = gvar - i; + + for (i = 0; i < 3 && can_loop; i++) + gvar += tmp[i]; + + return 0; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_mtu.c b/tools/testing/selftests/bpf/progs/verifier_mtu.c index 70c7600a26a0..256956ea1ac5 100644 --- a/tools/testing/selftests/bpf/progs/verifier_mtu.c +++ b/tools/testing/selftests/bpf/progs/verifier_mtu.c @@ -6,7 +6,9 @@ SEC("tc/ingress") __description("uninit/mtu: write rejected") -__failure __msg("invalid indirect read from stack") +__success +__caps_unpriv(CAP_BPF|CAP_NET_ADMIN) +__failure_unpriv __msg_unpriv("invalid read from stack") int tc_uninit_mtu(struct __sk_buff *ctx) { __u32 mtu; diff --git a/tools/testing/selftests/bpf/progs/verifier_raw_stack.c b/tools/testing/selftests/bpf/progs/verifier_raw_stack.c index 7cc83acac727..c689665e07b9 100644 --- a/tools/testing/selftests/bpf/progs/verifier_raw_stack.c +++ b/tools/testing/selftests/bpf/progs/verifier_raw_stack.c @@ -236,7 +236,7 @@ __naked void load_bytes_spilled_regs_data(void) SEC("tc") __description("raw_stack: skb_load_bytes, invalid access 1") -__failure __msg("invalid indirect access to stack R3 off=-513 size=8") +__failure __msg("invalid write to stack R3 off=-513 size=8") __naked void load_bytes_invalid_access_1(void) { asm volatile (" \ @@ -255,7 +255,7 @@ __naked void load_bytes_invalid_access_1(void) SEC("tc") __description("raw_stack: skb_load_bytes, invalid access 2") -__failure __msg("invalid indirect access to stack R3 off=-1 size=8") +__failure __msg("invalid write to stack R3 off=-1 size=8") __naked void load_bytes_invalid_access_2(void) { asm volatile (" \ diff --git a/tools/testing/selftests/bpf/progs/verifier_sock.c b/tools/testing/selftests/bpf/progs/verifier_sock.c index d3e70e38e442..0d5e56dffabb 100644 --- a/tools/testing/selftests/bpf/progs/verifier_sock.c +++ b/tools/testing/selftests/bpf/progs/verifier_sock.c @@ -50,6 +50,13 @@ struct { __uint(map_flags, BPF_F_NO_PREALLOC); } sk_storage_map SEC(".maps"); +struct { + __uint(type, BPF_MAP_TYPE_PROG_ARRAY); + __uint(max_entries, 1); + __uint(key_size, sizeof(__u32)); + __uint(value_size, sizeof(__u32)); +} jmp_table SEC(".maps"); + SEC("cgroup/skb") __description("skb->sk: no NULL check") __failure __msg("invalid mem access 'sock_common_or_null'") @@ -1037,4 +1044,53 @@ __naked void sock_create_read_src_port(void) : __clobber_all); } +__noinline +long skb_pull_data2(struct __sk_buff *sk, __u32 len) +{ + return bpf_skb_pull_data(sk, len); +} + +__noinline +long skb_pull_data1(struct __sk_buff *sk, __u32 len) +{ + return skb_pull_data2(sk, len); +} + +/* global function calls bpf_skb_pull_data(), which invalidates packet + * pointers established before global function call. + */ +SEC("tc") +__failure __msg("invalid mem access") +int invalidate_pkt_pointers_from_global_func(struct __sk_buff *sk) +{ + int *p = (void *)(long)sk->data; + + if ((void *)(p + 1) > (void *)(long)sk->data_end) + return TCX_DROP; + skb_pull_data1(sk, 0); + *p = 42; /* this is unsafe */ + return TCX_PASS; +} + +__noinline +int tail_call(struct __sk_buff *sk) +{ + bpf_tail_call_static(sk, &jmp_table, 0); + return 0; +} + +/* Tail calls invalidate packet pointers. */ +SEC("tc") +__failure __msg("invalid mem access") +int invalidate_pkt_pointers_by_tail_call(struct __sk_buff *sk) +{ + int *p = (void *)(long)sk->data; + + if ((void *)(p + 1) > (void *)(long)sk->data_end) + return TCX_DROP; + tail_call(sk); + *p = 42; /* this is unsafe */ + return TCX_PASS; +} + char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c index 671d9f415dbf..1e5a511e8494 100644 --- a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c +++ b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c @@ -1244,4 +1244,39 @@ __naked void old_stack_misc_vs_cur_ctx_ptr(void) : __clobber_all); } +SEC("socket") +__description("stack_noperfmon: reject read of invalid slots") +__success +__caps_unpriv(CAP_BPF) +__failure_unpriv __msg_unpriv("invalid read from stack off -8+1 size 8") +__naked void stack_noperfmon_reject_invalid_read(void) +{ + asm volatile (" \ + r2 = 1; \ + r6 = r10; \ + r6 += -8; \ + *(u8 *)(r6 + 0) = r2; \ + r2 = *(u64 *)(r6 + 0); \ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + +SEC("socket") +__description("stack_noperfmon: narrow spill onto 64-bit scalar spilled slots") +__success +__caps_unpriv(CAP_BPF) +__success_unpriv +__naked void stack_noperfmon_spill_32bit_onto_64bit_slot(void) +{ + asm volatile(" \ + r0 = 0; \ + *(u64 *)(r10 - 8) = r0; \ + *(u32 *)(r10 - 8) = r0; \ + exit; \ +" : + : + : __clobber_all); +} + char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_spin_lock.c b/tools/testing/selftests/bpf/progs/verifier_spin_lock.c index 3f679de73229..d9d7b05cf6d2 100644 --- a/tools/testing/selftests/bpf/progs/verifier_spin_lock.c +++ b/tools/testing/selftests/bpf/progs/verifier_spin_lock.c @@ -187,7 +187,7 @@ l0_%=: r6 = r0; \ SEC("cgroup/skb") __description("spin_lock: test6 missing unlock") -__failure __msg("BPF_EXIT instruction cannot be used inside bpf_spin_lock-ed region") +__failure __msg("BPF_EXIT instruction in main prog cannot be used inside bpf_spin_lock-ed region") __failure_unpriv __msg_unpriv("") __naked void spin_lock_test6_missing_unlock(void) { @@ -530,4 +530,30 @@ l1_%=: exit; \ : __clobber_all); } +SEC("tc") +__description("spin_lock: loop within a locked region") +__success __failure_unpriv __msg_unpriv("") +__retval(0) +int bpf_loop_inside_locked_region(void) +{ + const int zero = 0; + struct val *val; + int i, j = 0; + + val = bpf_map_lookup_elem(&map_spin_lock, &zero); + if (!val) + return -1; + + bpf_spin_lock(&val->l); + bpf_for(i, 0, 10) { + j++; + /* Silence "unused variable" warnings. */ + if (j == 10) + break; + } + bpf_spin_unlock(&val->l); + + return 0; +} + char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_unpriv.c b/tools/testing/selftests/bpf/progs/verifier_unpriv.c index 7ea535bfbacd..a4a5e2071604 100644 --- a/tools/testing/selftests/bpf/progs/verifier_unpriv.c +++ b/tools/testing/selftests/bpf/progs/verifier_unpriv.c @@ -199,7 +199,7 @@ __naked void pass_pointer_to_helper_function(void) SEC("socket") __description("unpriv: indirectly pass pointer on stack to helper function") __success __failure_unpriv -__msg_unpriv("invalid indirect read from stack R2 off -8+0 size 8") +__msg_unpriv("invalid read from stack R2 off -8+0 size 8") __retval(0) __naked void on_stack_to_helper_function(void) { diff --git a/tools/testing/selftests/bpf/progs/verifier_var_off.c b/tools/testing/selftests/bpf/progs/verifier_var_off.c index c810f4f6f479..1d36d01b746e 100644 --- a/tools/testing/selftests/bpf/progs/verifier_var_off.c +++ b/tools/testing/selftests/bpf/progs/verifier_var_off.c @@ -203,7 +203,7 @@ __naked void stack_write_clobbers_spilled_regs(void) SEC("sockops") __description("indirect variable-offset stack access, unbounded") -__failure __msg("invalid unbounded variable-offset indirect access to stack R4") +__failure __msg("invalid unbounded variable-offset write to stack R4") __naked void variable_offset_stack_access_unbounded(void) { asm volatile (" \ @@ -236,7 +236,7 @@ l0_%=: r0 = 0; \ SEC("lwt_in") __description("indirect variable-offset stack access, max out of bound") -__failure __msg("invalid variable-offset indirect access to stack R2") +__failure __msg("invalid variable-offset read from stack R2") __naked void access_max_out_of_bound(void) { asm volatile (" \ @@ -269,7 +269,7 @@ __naked void access_max_out_of_bound(void) */ SEC("socket") __description("indirect variable-offset stack access, zero-sized, max out of bound") -__failure __msg("invalid variable-offset indirect access to stack R1") +__failure __msg("invalid variable-offset write to stack R1") __naked void zero_sized_access_max_out_of_bound(void) { asm volatile (" \ @@ -294,7 +294,7 @@ __naked void zero_sized_access_max_out_of_bound(void) SEC("lwt_in") __description("indirect variable-offset stack access, min out of bound") -__failure __msg("invalid variable-offset indirect access to stack R2") +__failure __msg("invalid variable-offset read from stack R2") __naked void access_min_out_of_bound(void) { asm volatile (" \ diff --git a/tools/testing/selftests/bpf/progs/wq.c b/tools/testing/selftests/bpf/progs/wq.c index f8d3ae0c29ae..2f1ba08c293e 100644 --- a/tools/testing/selftests/bpf/progs/wq.c +++ b/tools/testing/selftests/bpf/progs/wq.c @@ -5,7 +5,7 @@ #include "bpf_experimental.h" #include <bpf/bpf_helpers.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/wq_failures.c b/tools/testing/selftests/bpf/progs/wq_failures.c index 25b51a72fe0f..4240211a1900 100644 --- a/tools/testing/selftests/bpf/progs/wq_failures.c +++ b/tools/testing/selftests/bpf/progs/wq_failures.c @@ -5,7 +5,7 @@ #include "bpf_experimental.h" #include <bpf/bpf_helpers.h> #include "bpf_misc.h" -#include "../bpf_testmod/bpf_testmod_kfunc.h" +#include "../test_kmods/bpf_testmod_kfunc.h" char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/sdt.h b/tools/testing/selftests/bpf/sdt.h index ca0162b4dc57..1fcfa5160231 100644 --- a/tools/testing/selftests/bpf/sdt.h +++ b/tools/testing/selftests/bpf/sdt.h @@ -102,6 +102,8 @@ # define STAP_SDT_ARG_CONSTRAINT nZr # elif defined __arm__ # define STAP_SDT_ARG_CONSTRAINT g +# elif defined __loongarch__ +# define STAP_SDT_ARG_CONSTRAINT nmr # else # define STAP_SDT_ARG_CONSTRAINT nor # endif diff --git a/tools/testing/selftests/bpf/test_bpftool_synctypes.py b/tools/testing/selftests/bpf/test_bpftool_synctypes.py index 0ed67b6b31dd..238121fda5b6 100755 --- a/tools/testing/selftests/bpf/test_bpftool_synctypes.py +++ b/tools/testing/selftests/bpf/test_bpftool_synctypes.py @@ -66,7 +66,7 @@ class ArrayParser(BlockParser): def __init__(self, reader, array_name): self.array_name = array_name - self.start_marker = re.compile(f'(static )?const bool {self.array_name}\[.*\] = {{\n') + self.start_marker = re.compile(fr'(static )?const bool {self.array_name}\[.*\] = {{\n') super().__init__(reader) def search_block(self): @@ -80,7 +80,7 @@ class ArrayParser(BlockParser): Parse a block and return data as a dictionary. Items to extract must be on separate lines in the file. """ - pattern = re.compile('\[(BPF_\w*)\]\s*= (true|false),?$') + pattern = re.compile(r'\[(BPF_\w*)\]\s*= (true|false),?$') entries = set() while True: line = self.reader.readline() @@ -178,7 +178,7 @@ class FileExtractor(object): @enum_name: name of the enum to parse """ start_marker = re.compile(f'enum {enum_name} {{\n') - pattern = re.compile('^\s*(BPF_\w+),?(\s+/\*.*\*/)?$') + pattern = re.compile(r'^\s*(BPF_\w+),?(\s+/\*.*\*/)?$') end_marker = re.compile('^};') parser = BlockParser(self.reader) parser.search_block(start_marker) @@ -226,8 +226,8 @@ class FileExtractor(object): @block_name: name of the blog to parse, 'TYPE' in the example """ - start_marker = re.compile(f'\*{block_name}\* := {{') - pattern = re.compile('\*\*([\w/-]+)\*\*') + start_marker = re.compile(fr'\*{block_name}\* := {{') + pattern = re.compile(r'\*\*([\w/-]+)\*\*') end_marker = re.compile('}\n') return self.__get_description_list(start_marker, pattern, end_marker) @@ -245,8 +245,8 @@ class FileExtractor(object): @block_name: name of the blog to parse, 'TYPE' in the example """ - start_marker = re.compile(f'"\s*{block_name} := {{') - pattern = re.compile('([\w/]+) [|}]') + start_marker = re.compile(fr'"\s*{block_name} := {{') + pattern = re.compile(r'([\w/]+) [|}]') end_marker = re.compile('}') return self.__get_description_list(start_marker, pattern, end_marker) @@ -264,8 +264,8 @@ class FileExtractor(object): @macro: macro starting the block, 'HELP_SPEC_OPTIONS' in the example """ - start_marker = re.compile(f'"\s*{macro}\s*" [|}}]') - pattern = re.compile('([\w-]+) ?(?:\||}[ }\]])') + start_marker = re.compile(fr'"\s*{macro}\s*" [|}}]') + pattern = re.compile(r'([\w-]+) ?(?:\||}[ }\]])') end_marker = re.compile('}\\\\n') return self.__get_description_list(start_marker, pattern, end_marker) @@ -283,8 +283,8 @@ class FileExtractor(object): @block_name: name of the blog to parse, 'TYPE' in the example """ - start_marker = re.compile(f'local {block_name}=\'') - pattern = re.compile('(?:.*=\')?([\w/]+)') + start_marker = re.compile(fr'local {block_name}=\'') + pattern = re.compile(r'(?:.*=\')?([\w/]+)') end_marker = re.compile('\'$') return self.__get_description_list(start_marker, pattern, end_marker) @@ -316,7 +316,7 @@ class MainHeaderFileExtractor(SourceFileExtractor): {'-p', '-d', '--pretty', '--debug', '--json', '-j'} """ start_marker = re.compile(f'"OPTIONS :=') - pattern = re.compile('([\w-]+) ?(?:\||}[ }\]"])') + pattern = re.compile(r'([\w-]+) ?(?:\||}[ }\]"])') end_marker = re.compile('#define') parser = InlineListParser(self.reader) @@ -338,8 +338,8 @@ class ManSubstitutionsExtractor(SourceFileExtractor): {'-p', '-d', '--pretty', '--debug', '--json', '-j'} """ - start_marker = re.compile('\|COMMON_OPTIONS\| replace:: {') - pattern = re.compile('\*\*([\w/-]+)\*\*') + start_marker = re.compile(r'\|COMMON_OPTIONS\| replace:: {') + pattern = re.compile(r'\*\*([\w/-]+)\*\*') end_marker = re.compile('}$') parser = InlineListParser(self.reader) diff --git a/tools/testing/selftests/bpf/test_flow_dissector.c b/tools/testing/selftests/bpf/test_flow_dissector.c deleted file mode 100644 index 571cc076dd7d..000000000000 --- a/tools/testing/selftests/bpf/test_flow_dissector.c +++ /dev/null @@ -1,780 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0 -/* - * Inject packets with all sorts of encapsulation into the kernel. - * - * IPv4/IPv6 outer layer 3 - * GRE/GUE/BARE outer layer 4, where bare is IPIP/SIT/IPv4-in-IPv6/.. - * IPv4/IPv6 inner layer 3 - */ - -#define _GNU_SOURCE - -#include <stddef.h> -#include <arpa/inet.h> -#include <asm/byteorder.h> -#include <error.h> -#include <errno.h> -#include <linux/if_packet.h> -#include <linux/if_ether.h> -#include <linux/ipv6.h> -#include <netinet/ip.h> -#include <netinet/in.h> -#include <netinet/udp.h> -#include <poll.h> -#include <stdbool.h> -#include <stdlib.h> -#include <stdio.h> -#include <string.h> -#include <sys/ioctl.h> -#include <sys/socket.h> -#include <sys/stat.h> -#include <sys/time.h> -#include <sys/types.h> -#include <unistd.h> - -#define CFG_PORT_INNER 8000 - -/* Add some protocol definitions that do not exist in userspace */ - -struct grehdr { - uint16_t unused; - uint16_t protocol; -} __attribute__((packed)); - -struct guehdr { - union { - struct { -#if defined(__LITTLE_ENDIAN_BITFIELD) - __u8 hlen:5, - control:1, - version:2; -#elif defined (__BIG_ENDIAN_BITFIELD) - __u8 version:2, - control:1, - hlen:5; -#else -#error "Please fix <asm/byteorder.h>" -#endif - __u8 proto_ctype; - __be16 flags; - }; - __be32 word; - }; -}; - -static uint8_t cfg_dsfield_inner; -static uint8_t cfg_dsfield_outer; -static uint8_t cfg_encap_proto; -static bool cfg_expect_failure = false; -static int cfg_l3_extra = AF_UNSPEC; /* optional SIT prefix */ -static int cfg_l3_inner = AF_UNSPEC; -static int cfg_l3_outer = AF_UNSPEC; -static int cfg_num_pkt = 10; -static int cfg_num_secs = 0; -static char cfg_payload_char = 'a'; -static int cfg_payload_len = 100; -static int cfg_port_gue = 6080; -static bool cfg_only_rx; -static bool cfg_only_tx; -static int cfg_src_port = 9; - -static char buf[ETH_DATA_LEN]; - -#define INIT_ADDR4(name, addr4, port) \ - static struct sockaddr_in name = { \ - .sin_family = AF_INET, \ - .sin_port = __constant_htons(port), \ - .sin_addr.s_addr = __constant_htonl(addr4), \ - }; - -#define INIT_ADDR6(name, addr6, port) \ - static struct sockaddr_in6 name = { \ - .sin6_family = AF_INET6, \ - .sin6_port = __constant_htons(port), \ - .sin6_addr = addr6, \ - }; - -INIT_ADDR4(in_daddr4, INADDR_LOOPBACK, CFG_PORT_INNER) -INIT_ADDR4(in_saddr4, INADDR_LOOPBACK + 2, 0) -INIT_ADDR4(out_daddr4, INADDR_LOOPBACK, 0) -INIT_ADDR4(out_saddr4, INADDR_LOOPBACK + 1, 0) -INIT_ADDR4(extra_daddr4, INADDR_LOOPBACK, 0) -INIT_ADDR4(extra_saddr4, INADDR_LOOPBACK + 1, 0) - -INIT_ADDR6(in_daddr6, IN6ADDR_LOOPBACK_INIT, CFG_PORT_INNER) -INIT_ADDR6(in_saddr6, IN6ADDR_LOOPBACK_INIT, 0) -INIT_ADDR6(out_daddr6, IN6ADDR_LOOPBACK_INIT, 0) -INIT_ADDR6(out_saddr6, IN6ADDR_LOOPBACK_INIT, 0) -INIT_ADDR6(extra_daddr6, IN6ADDR_LOOPBACK_INIT, 0) -INIT_ADDR6(extra_saddr6, IN6ADDR_LOOPBACK_INIT, 0) - -static unsigned long util_gettime(void) -{ - struct timeval tv; - - gettimeofday(&tv, NULL); - return (tv.tv_sec * 1000) + (tv.tv_usec / 1000); -} - -static void util_printaddr(const char *msg, struct sockaddr *addr) -{ - unsigned long off = 0; - char nbuf[INET6_ADDRSTRLEN]; - - switch (addr->sa_family) { - case PF_INET: - off = __builtin_offsetof(struct sockaddr_in, sin_addr); - break; - case PF_INET6: - off = __builtin_offsetof(struct sockaddr_in6, sin6_addr); - break; - default: - error(1, 0, "printaddr: unsupported family %u\n", - addr->sa_family); - } - - if (!inet_ntop(addr->sa_family, ((void *) addr) + off, nbuf, - sizeof(nbuf))) - error(1, errno, "inet_ntop"); - - fprintf(stderr, "%s: %s\n", msg, nbuf); -} - -static unsigned long add_csum_hword(const uint16_t *start, int num_u16) -{ - unsigned long sum = 0; - int i; - - for (i = 0; i < num_u16; i++) - sum += start[i]; - - return sum; -} - -static uint16_t build_ip_csum(const uint16_t *start, int num_u16, - unsigned long sum) -{ - sum += add_csum_hword(start, num_u16); - - while (sum >> 16) - sum = (sum & 0xffff) + (sum >> 16); - - return ~sum; -} - -static void build_ipv4_header(void *header, uint8_t proto, - uint32_t src, uint32_t dst, - int payload_len, uint8_t tos) -{ - struct iphdr *iph = header; - - iph->ihl = 5; - iph->version = 4; - iph->tos = tos; - iph->ttl = 8; - iph->tot_len = htons(sizeof(*iph) + payload_len); - iph->id = htons(1337); - iph->protocol = proto; - iph->saddr = src; - iph->daddr = dst; - iph->check = build_ip_csum((void *) iph, iph->ihl << 1, 0); -} - -static void ipv6_set_dsfield(struct ipv6hdr *ip6h, uint8_t dsfield) -{ - uint16_t val, *ptr = (uint16_t *)ip6h; - - val = ntohs(*ptr); - val &= 0xF00F; - val |= ((uint16_t) dsfield) << 4; - *ptr = htons(val); -} - -static void build_ipv6_header(void *header, uint8_t proto, - struct sockaddr_in6 *src, - struct sockaddr_in6 *dst, - int payload_len, uint8_t dsfield) -{ - struct ipv6hdr *ip6h = header; - - ip6h->version = 6; - ip6h->payload_len = htons(payload_len); - ip6h->nexthdr = proto; - ip6h->hop_limit = 8; - ipv6_set_dsfield(ip6h, dsfield); - - memcpy(&ip6h->saddr, &src->sin6_addr, sizeof(ip6h->saddr)); - memcpy(&ip6h->daddr, &dst->sin6_addr, sizeof(ip6h->daddr)); -} - -static uint16_t build_udp_v4_csum(const struct iphdr *iph, - const struct udphdr *udph, - int num_words) -{ - unsigned long pseudo_sum; - int num_u16 = sizeof(iph->saddr); /* halfwords: twice byte len */ - - pseudo_sum = add_csum_hword((void *) &iph->saddr, num_u16); - pseudo_sum += htons(IPPROTO_UDP); - pseudo_sum += udph->len; - return build_ip_csum((void *) udph, num_words, pseudo_sum); -} - -static uint16_t build_udp_v6_csum(const struct ipv6hdr *ip6h, - const struct udphdr *udph, - int num_words) -{ - unsigned long pseudo_sum; - int num_u16 = sizeof(ip6h->saddr); /* halfwords: twice byte len */ - - pseudo_sum = add_csum_hword((void *) &ip6h->saddr, num_u16); - pseudo_sum += htons(ip6h->nexthdr); - pseudo_sum += ip6h->payload_len; - return build_ip_csum((void *) udph, num_words, pseudo_sum); -} - -static void build_udp_header(void *header, int payload_len, - uint16_t dport, int family) -{ - struct udphdr *udph = header; - int len = sizeof(*udph) + payload_len; - - udph->source = htons(cfg_src_port); - udph->dest = htons(dport); - udph->len = htons(len); - udph->check = 0; - if (family == AF_INET) - udph->check = build_udp_v4_csum(header - sizeof(struct iphdr), - udph, len >> 1); - else - udph->check = build_udp_v6_csum(header - sizeof(struct ipv6hdr), - udph, len >> 1); -} - -static void build_gue_header(void *header, uint8_t proto) -{ - struct guehdr *gueh = header; - - gueh->proto_ctype = proto; -} - -static void build_gre_header(void *header, uint16_t proto) -{ - struct grehdr *greh = header; - - greh->protocol = htons(proto); -} - -static int l3_length(int family) -{ - if (family == AF_INET) - return sizeof(struct iphdr); - else - return sizeof(struct ipv6hdr); -} - -static int build_packet(void) -{ - int ol3_len = 0, ol4_len = 0, il3_len = 0, il4_len = 0; - int el3_len = 0; - - if (cfg_l3_extra) - el3_len = l3_length(cfg_l3_extra); - - /* calculate header offsets */ - if (cfg_encap_proto) { - ol3_len = l3_length(cfg_l3_outer); - - if (cfg_encap_proto == IPPROTO_GRE) - ol4_len = sizeof(struct grehdr); - else if (cfg_encap_proto == IPPROTO_UDP) - ol4_len = sizeof(struct udphdr) + sizeof(struct guehdr); - } - - il3_len = l3_length(cfg_l3_inner); - il4_len = sizeof(struct udphdr); - - if (el3_len + ol3_len + ol4_len + il3_len + il4_len + cfg_payload_len >= - sizeof(buf)) - error(1, 0, "packet too large\n"); - - /* - * Fill packet from inside out, to calculate correct checksums. - * But create ip before udp headers, as udp uses ip for pseudo-sum. - */ - memset(buf + el3_len + ol3_len + ol4_len + il3_len + il4_len, - cfg_payload_char, cfg_payload_len); - - /* add zero byte for udp csum padding */ - buf[el3_len + ol3_len + ol4_len + il3_len + il4_len + cfg_payload_len] = 0; - - switch (cfg_l3_inner) { - case PF_INET: - build_ipv4_header(buf + el3_len + ol3_len + ol4_len, - IPPROTO_UDP, - in_saddr4.sin_addr.s_addr, - in_daddr4.sin_addr.s_addr, - il4_len + cfg_payload_len, - cfg_dsfield_inner); - break; - case PF_INET6: - build_ipv6_header(buf + el3_len + ol3_len + ol4_len, - IPPROTO_UDP, - &in_saddr6, &in_daddr6, - il4_len + cfg_payload_len, - cfg_dsfield_inner); - break; - } - - build_udp_header(buf + el3_len + ol3_len + ol4_len + il3_len, - cfg_payload_len, CFG_PORT_INNER, cfg_l3_inner); - - if (!cfg_encap_proto) - return il3_len + il4_len + cfg_payload_len; - - switch (cfg_l3_outer) { - case PF_INET: - build_ipv4_header(buf + el3_len, cfg_encap_proto, - out_saddr4.sin_addr.s_addr, - out_daddr4.sin_addr.s_addr, - ol4_len + il3_len + il4_len + cfg_payload_len, - cfg_dsfield_outer); - break; - case PF_INET6: - build_ipv6_header(buf + el3_len, cfg_encap_proto, - &out_saddr6, &out_daddr6, - ol4_len + il3_len + il4_len + cfg_payload_len, - cfg_dsfield_outer); - break; - } - - switch (cfg_encap_proto) { - case IPPROTO_UDP: - build_gue_header(buf + el3_len + ol3_len + ol4_len - - sizeof(struct guehdr), - cfg_l3_inner == PF_INET ? IPPROTO_IPIP - : IPPROTO_IPV6); - build_udp_header(buf + el3_len + ol3_len, - sizeof(struct guehdr) + il3_len + il4_len + - cfg_payload_len, - cfg_port_gue, cfg_l3_outer); - break; - case IPPROTO_GRE: - build_gre_header(buf + el3_len + ol3_len, - cfg_l3_inner == PF_INET ? ETH_P_IP - : ETH_P_IPV6); - break; - } - - switch (cfg_l3_extra) { - case PF_INET: - build_ipv4_header(buf, - cfg_l3_outer == PF_INET ? IPPROTO_IPIP - : IPPROTO_IPV6, - extra_saddr4.sin_addr.s_addr, - extra_daddr4.sin_addr.s_addr, - ol3_len + ol4_len + il3_len + il4_len + - cfg_payload_len, 0); - break; - case PF_INET6: - build_ipv6_header(buf, - cfg_l3_outer == PF_INET ? IPPROTO_IPIP - : IPPROTO_IPV6, - &extra_saddr6, &extra_daddr6, - ol3_len + ol4_len + il3_len + il4_len + - cfg_payload_len, 0); - break; - } - - return el3_len + ol3_len + ol4_len + il3_len + il4_len + - cfg_payload_len; -} - -/* sender transmits encapsulated over RAW or unencap'd over UDP */ -static int setup_tx(void) -{ - int family, fd, ret; - - if (cfg_l3_extra) - family = cfg_l3_extra; - else if (cfg_l3_outer) - family = cfg_l3_outer; - else - family = cfg_l3_inner; - - fd = socket(family, SOCK_RAW, IPPROTO_RAW); - if (fd == -1) - error(1, errno, "socket tx"); - - if (cfg_l3_extra) { - if (cfg_l3_extra == PF_INET) - ret = connect(fd, (void *) &extra_daddr4, - sizeof(extra_daddr4)); - else - ret = connect(fd, (void *) &extra_daddr6, - sizeof(extra_daddr6)); - if (ret) - error(1, errno, "connect tx"); - } else if (cfg_l3_outer) { - /* connect to destination if not encapsulated */ - if (cfg_l3_outer == PF_INET) - ret = connect(fd, (void *) &out_daddr4, - sizeof(out_daddr4)); - else - ret = connect(fd, (void *) &out_daddr6, - sizeof(out_daddr6)); - if (ret) - error(1, errno, "connect tx"); - } else { - /* otherwise using loopback */ - if (cfg_l3_inner == PF_INET) - ret = connect(fd, (void *) &in_daddr4, - sizeof(in_daddr4)); - else - ret = connect(fd, (void *) &in_daddr6, - sizeof(in_daddr6)); - if (ret) - error(1, errno, "connect tx"); - } - - return fd; -} - -/* receiver reads unencapsulated UDP */ -static int setup_rx(void) -{ - int fd, ret; - - fd = socket(cfg_l3_inner, SOCK_DGRAM, 0); - if (fd == -1) - error(1, errno, "socket rx"); - - if (cfg_l3_inner == PF_INET) - ret = bind(fd, (void *) &in_daddr4, sizeof(in_daddr4)); - else - ret = bind(fd, (void *) &in_daddr6, sizeof(in_daddr6)); - if (ret) - error(1, errno, "bind rx"); - - return fd; -} - -static int do_tx(int fd, const char *pkt, int len) -{ - int ret; - - ret = write(fd, pkt, len); - if (ret == -1) - error(1, errno, "send"); - if (ret != len) - error(1, errno, "send: len (%d < %d)\n", ret, len); - - return 1; -} - -static int do_poll(int fd, short events, int timeout) -{ - struct pollfd pfd; - int ret; - - pfd.fd = fd; - pfd.events = events; - - ret = poll(&pfd, 1, timeout); - if (ret == -1) - error(1, errno, "poll"); - if (ret && !(pfd.revents & POLLIN)) - error(1, errno, "poll: unexpected event 0x%x\n", pfd.revents); - - return ret; -} - -static int do_rx(int fd) -{ - char rbuf; - int ret, num = 0; - - while (1) { - ret = recv(fd, &rbuf, 1, MSG_DONTWAIT); - if (ret == -1 && errno == EAGAIN) - break; - if (ret == -1) - error(1, errno, "recv"); - if (rbuf != cfg_payload_char) - error(1, 0, "recv: payload mismatch"); - num++; - } - - return num; -} - -static int do_main(void) -{ - unsigned long tstop, treport, tcur; - int fdt = -1, fdr = -1, len, tx = 0, rx = 0; - - if (!cfg_only_tx) - fdr = setup_rx(); - if (!cfg_only_rx) - fdt = setup_tx(); - - len = build_packet(); - - tcur = util_gettime(); - treport = tcur + 1000; - tstop = tcur + (cfg_num_secs * 1000); - - while (1) { - if (!cfg_only_rx) - tx += do_tx(fdt, buf, len); - - if (!cfg_only_tx) - rx += do_rx(fdr); - - if (cfg_num_secs) { - tcur = util_gettime(); - if (tcur >= tstop) - break; - if (tcur >= treport) { - fprintf(stderr, "pkts: tx=%u rx=%u\n", tx, rx); - tx = 0; - rx = 0; - treport = tcur + 1000; - } - } else { - if (tx == cfg_num_pkt) - break; - } - } - - /* read straggler packets, if any */ - if (rx < tx) { - tstop = util_gettime() + 100; - while (rx < tx) { - tcur = util_gettime(); - if (tcur >= tstop) - break; - - do_poll(fdr, POLLIN, tstop - tcur); - rx += do_rx(fdr); - } - } - - fprintf(stderr, "pkts: tx=%u rx=%u\n", tx, rx); - - if (fdr != -1 && close(fdr)) - error(1, errno, "close rx"); - if (fdt != -1 && close(fdt)) - error(1, errno, "close tx"); - - /* - * success (== 0) only if received all packets - * unless failure is expected, in which case none must arrive. - */ - if (cfg_expect_failure) - return rx != 0; - else - return rx != tx; -} - - -static void __attribute__((noreturn)) usage(const char *filepath) -{ - fprintf(stderr, "Usage: %s [-e gre|gue|bare|none] [-i 4|6] [-l len] " - "[-O 4|6] [-o 4|6] [-n num] [-t secs] [-R] [-T] " - "[-s <osrc> [-d <odst>] [-S <isrc>] [-D <idst>] " - "[-x <otos>] [-X <itos>] [-f <isport>] [-F]\n", - filepath); - exit(1); -} - -static void parse_addr(int family, void *addr, const char *optarg) -{ - int ret; - - ret = inet_pton(family, optarg, addr); - if (ret == -1) - error(1, errno, "inet_pton"); - if (ret == 0) - error(1, 0, "inet_pton: bad string"); -} - -static void parse_addr4(struct sockaddr_in *addr, const char *optarg) -{ - parse_addr(AF_INET, &addr->sin_addr, optarg); -} - -static void parse_addr6(struct sockaddr_in6 *addr, const char *optarg) -{ - parse_addr(AF_INET6, &addr->sin6_addr, optarg); -} - -static int parse_protocol_family(const char *filepath, const char *optarg) -{ - if (!strcmp(optarg, "4")) - return PF_INET; - if (!strcmp(optarg, "6")) - return PF_INET6; - - usage(filepath); -} - -static void parse_opts(int argc, char **argv) -{ - int c; - - while ((c = getopt(argc, argv, "d:D:e:f:Fhi:l:n:o:O:Rs:S:t:Tx:X:")) != -1) { - switch (c) { - case 'd': - if (cfg_l3_outer == AF_UNSPEC) - error(1, 0, "-d must be preceded by -o"); - if (cfg_l3_outer == AF_INET) - parse_addr4(&out_daddr4, optarg); - else - parse_addr6(&out_daddr6, optarg); - break; - case 'D': - if (cfg_l3_inner == AF_UNSPEC) - error(1, 0, "-D must be preceded by -i"); - if (cfg_l3_inner == AF_INET) - parse_addr4(&in_daddr4, optarg); - else - parse_addr6(&in_daddr6, optarg); - break; - case 'e': - if (!strcmp(optarg, "gre")) - cfg_encap_proto = IPPROTO_GRE; - else if (!strcmp(optarg, "gue")) - cfg_encap_proto = IPPROTO_UDP; - else if (!strcmp(optarg, "bare")) - cfg_encap_proto = IPPROTO_IPIP; - else if (!strcmp(optarg, "none")) - cfg_encap_proto = IPPROTO_IP; /* == 0 */ - else - usage(argv[0]); - break; - case 'f': - cfg_src_port = strtol(optarg, NULL, 0); - break; - case 'F': - cfg_expect_failure = true; - break; - case 'h': - usage(argv[0]); - break; - case 'i': - if (!strcmp(optarg, "4")) - cfg_l3_inner = PF_INET; - else if (!strcmp(optarg, "6")) - cfg_l3_inner = PF_INET6; - else - usage(argv[0]); - break; - case 'l': - cfg_payload_len = strtol(optarg, NULL, 0); - break; - case 'n': - cfg_num_pkt = strtol(optarg, NULL, 0); - break; - case 'o': - cfg_l3_outer = parse_protocol_family(argv[0], optarg); - break; - case 'O': - cfg_l3_extra = parse_protocol_family(argv[0], optarg); - break; - case 'R': - cfg_only_rx = true; - break; - case 's': - if (cfg_l3_outer == AF_INET) - parse_addr4(&out_saddr4, optarg); - else - parse_addr6(&out_saddr6, optarg); - break; - case 'S': - if (cfg_l3_inner == AF_INET) - parse_addr4(&in_saddr4, optarg); - else - parse_addr6(&in_saddr6, optarg); - break; - case 't': - cfg_num_secs = strtol(optarg, NULL, 0); - break; - case 'T': - cfg_only_tx = true; - break; - case 'x': - cfg_dsfield_outer = strtol(optarg, NULL, 0); - break; - case 'X': - cfg_dsfield_inner = strtol(optarg, NULL, 0); - break; - } - } - - if (cfg_only_rx && cfg_only_tx) - error(1, 0, "options: cannot combine rx-only and tx-only"); - - if (cfg_encap_proto && cfg_l3_outer == AF_UNSPEC) - error(1, 0, "options: must specify outer with encap"); - else if ((!cfg_encap_proto) && cfg_l3_outer != AF_UNSPEC) - error(1, 0, "options: cannot combine no-encap and outer"); - else if ((!cfg_encap_proto) && cfg_l3_extra != AF_UNSPEC) - error(1, 0, "options: cannot combine no-encap and extra"); - - if (cfg_l3_inner == AF_UNSPEC) - cfg_l3_inner = AF_INET6; - if (cfg_l3_inner == AF_INET6 && cfg_encap_proto == IPPROTO_IPIP) - cfg_encap_proto = IPPROTO_IPV6; - - /* RFC 6040 4.2: - * on decap, if outer encountered congestion (CE == 0x3), - * but inner cannot encode ECN (NoECT == 0x0), then drop packet. - */ - if (((cfg_dsfield_outer & 0x3) == 0x3) && - ((cfg_dsfield_inner & 0x3) == 0x0)) - cfg_expect_failure = true; -} - -static void print_opts(void) -{ - if (cfg_l3_inner == PF_INET6) { - util_printaddr("inner.dest6", (void *) &in_daddr6); - util_printaddr("inner.source6", (void *) &in_saddr6); - } else { - util_printaddr("inner.dest4", (void *) &in_daddr4); - util_printaddr("inner.source4", (void *) &in_saddr4); - } - - if (!cfg_l3_outer) - return; - - fprintf(stderr, "encap proto: %u\n", cfg_encap_proto); - - if (cfg_l3_outer == PF_INET6) { - util_printaddr("outer.dest6", (void *) &out_daddr6); - util_printaddr("outer.source6", (void *) &out_saddr6); - } else { - util_printaddr("outer.dest4", (void *) &out_daddr4); - util_printaddr("outer.source4", (void *) &out_saddr4); - } - - if (!cfg_l3_extra) - return; - - if (cfg_l3_outer == PF_INET6) { - util_printaddr("extra.dest6", (void *) &extra_daddr6); - util_printaddr("extra.source6", (void *) &extra_saddr6); - } else { - util_printaddr("extra.dest4", (void *) &extra_daddr4); - util_printaddr("extra.source4", (void *) &extra_saddr4); - } - -} - -int main(int argc, char **argv) -{ - parse_opts(argc, argv); - print_opts(); - return do_main(); -} diff --git a/tools/testing/selftests/bpf/test_flow_dissector.sh b/tools/testing/selftests/bpf/test_flow_dissector.sh deleted file mode 100755 index 4b298863797a..000000000000 --- a/tools/testing/selftests/bpf/test_flow_dissector.sh +++ /dev/null @@ -1,178 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 -# -# Load BPF flow dissector and verify it correctly dissects traffic - -BPF_FILE="bpf_flow.bpf.o" -export TESTNAME=test_flow_dissector -unmount=0 - -# Kselftest framework requirement - SKIP code is 4. -ksft_skip=4 - -msg="skip all tests:" -if [ $UID != 0 ]; then - echo $msg please run this as root >&2 - exit $ksft_skip -fi - -# This test needs to be run in a network namespace with in_netns.sh. Check if -# this is the case and run it with in_netns.sh if it is being run in the root -# namespace. -if [[ -z $(ip netns identify $$) ]]; then - err=0 - if bpftool="$(which bpftool)"; then - echo "Testing global flow dissector..." - - $bpftool prog loadall $BPF_FILE /sys/fs/bpf/flow \ - type flow_dissector - - if ! unshare --net $bpftool prog attach pinned \ - /sys/fs/bpf/flow/_dissect flow_dissector; then - echo "Unexpected unsuccessful attach in namespace" >&2 - err=1 - fi - - $bpftool prog attach pinned /sys/fs/bpf/flow/_dissect \ - flow_dissector - - if unshare --net $bpftool prog attach pinned \ - /sys/fs/bpf/flow/_dissect flow_dissector; then - echo "Unexpected successful attach in namespace" >&2 - err=1 - fi - - if ! $bpftool prog detach pinned \ - /sys/fs/bpf/flow/_dissect flow_dissector; then - echo "Failed to detach flow dissector" >&2 - err=1 - fi - - rm -rf /sys/fs/bpf/flow - else - echo "Skipping root flow dissector test, bpftool not found" >&2 - fi - - # Run the rest of the tests in a net namespace. - ../net/in_netns.sh "$0" "$@" - err=$(( $err + $? )) - - if (( $err == 0 )); then - echo "selftests: $TESTNAME [PASS]"; - else - echo "selftests: $TESTNAME [FAILED]"; - fi - - exit $err -fi - -# Determine selftest success via shell exit code -exit_handler() -{ - set +e - - # Cleanup - tc filter del dev lo ingress pref 1337 2> /dev/null - tc qdisc del dev lo ingress 2> /dev/null - ./flow_dissector_load -d 2> /dev/null - if [ $unmount -ne 0 ]; then - umount bpffs 2> /dev/null - fi -} - -# Exit script immediately (well catched by trap handler) if any -# program/thing exits with a non-zero status. -set -e - -# (Use 'trap -l' to list meaning of numbers) -trap exit_handler 0 2 3 6 9 - -# Mount BPF file system -if /bin/mount | grep /sys/fs/bpf > /dev/null; then - echo "bpffs already mounted" -else - echo "bpffs not mounted. Mounting..." - unmount=1 - /bin/mount bpffs /sys/fs/bpf -t bpf -fi - -# Attach BPF program -./flow_dissector_load -p $BPF_FILE -s _dissect - -# Setup -tc qdisc add dev lo ingress -echo 0 > /proc/sys/net/ipv4/conf/default/rp_filter -echo 0 > /proc/sys/net/ipv4/conf/all/rp_filter -echo 0 > /proc/sys/net/ipv4/conf/lo/rp_filter - -echo "Testing IPv4..." -# Drops all IP/UDP packets coming from port 9 -tc filter add dev lo parent ffff: protocol ip pref 1337 flower ip_proto \ - udp src_port 9 action drop - -# Send 10 IPv4/UDP packets from port 8. Filter should not drop any. -./test_flow_dissector -i 4 -f 8 -# Send 10 IPv4/UDP packets from port 9. Filter should drop all. -./test_flow_dissector -i 4 -f 9 -F -# Send 10 IPv4/UDP packets from port 10. Filter should not drop any. -./test_flow_dissector -i 4 -f 10 - -echo "Testing IPv4 from 127.0.0.127 (fallback to generic dissector)..." -# Send 10 IPv4/UDP packets from port 8. Filter should not drop any. -./test_flow_dissector -i 4 -S 127.0.0.127 -f 8 -# Send 10 IPv4/UDP packets from port 9. Filter should drop all. -./test_flow_dissector -i 4 -S 127.0.0.127 -f 9 -F -# Send 10 IPv4/UDP packets from port 10. Filter should not drop any. -./test_flow_dissector -i 4 -S 127.0.0.127 -f 10 - -echo "Testing IPIP..." -# Send 10 IPv4/IPv4/UDP packets from port 8. Filter should not drop any. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 8 -# Send 10 IPv4/IPv4/UDP packets from port 9. Filter should drop all. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 9 -F -# Send 10 IPv4/IPv4/UDP packets from port 10. Filter should not drop any. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e bare -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 10 - -echo "Testing IPv4 + GRE..." -# Send 10 IPv4/GRE/IPv4/UDP packets from port 8. Filter should not drop any. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 8 -# Send 10 IPv4/GRE/IPv4/UDP packets from port 9. Filter should drop all. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 9 -F -# Send 10 IPv4/GRE/IPv4/UDP packets from port 10. Filter should not drop any. -./with_addr.sh ./with_tunnels.sh ./test_flow_dissector -o 4 -e gre -i 4 \ - -D 192.168.0.1 -S 1.1.1.1 -f 10 - -tc filter del dev lo ingress pref 1337 - -echo "Testing port range..." -# Drops all IP/UDP packets coming from port 8-10 -tc filter add dev lo parent ffff: protocol ip pref 1337 flower ip_proto \ - udp src_port 8-10 action drop - -# Send 10 IPv4/UDP packets from port 7. Filter should not drop any. -./test_flow_dissector -i 4 -f 7 -# Send 10 IPv4/UDP packets from port 9. Filter should drop all. -./test_flow_dissector -i 4 -f 9 -F -# Send 10 IPv4/UDP packets from port 11. Filter should not drop any. -./test_flow_dissector -i 4 -f 11 - -tc filter del dev lo ingress pref 1337 - -echo "Testing IPv6..." -# Drops all IPv6/UDP packets coming from port 9 -tc filter add dev lo parent ffff: protocol ipv6 pref 1337 flower ip_proto \ - udp src_port 9 action drop - -# Send 10 IPv6/UDP packets from port 8. Filter should not drop any. -./test_flow_dissector -i 6 -f 8 -# Send 10 IPv6/UDP packets from port 9. Filter should drop all. -./test_flow_dissector -i 6 -f 9 -F -# Send 10 IPv6/UDP packets from port 10. Filter should not drop any. -./test_flow_dissector -i 6 -f 10 - -exit 0 diff --git a/tools/testing/selftests/bpf/bpf_testmod/.gitignore b/tools/testing/selftests/bpf/test_kmods/.gitignore index ded513777281..ded513777281 100644 --- a/tools/testing/selftests/bpf/bpf_testmod/.gitignore +++ b/tools/testing/selftests/bpf/test_kmods/.gitignore diff --git a/tools/testing/selftests/bpf/test_kmods/Makefile b/tools/testing/selftests/bpf/test_kmods/Makefile new file mode 100644 index 000000000000..d4e50c4509c9 --- /dev/null +++ b/tools/testing/selftests/bpf/test_kmods/Makefile @@ -0,0 +1,21 @@ +TEST_KMOD_DIR := $(realpath $(dir $(abspath $(lastword $(MAKEFILE_LIST))))) +KDIR ?= $(abspath $(TEST_KMOD_DIR)/../../../../..) + +ifeq ($(V),1) +Q = +else +Q = @ +endif + +MODULES = bpf_testmod.ko bpf_test_no_cfi.ko bpf_test_modorder_x.ko \ + bpf_test_modorder_y.ko + +$(foreach m,$(MODULES),$(eval obj-m += $(m:.ko=.o))) + +CFLAGS_bpf_testmod.o = -I$(src) + +all: + $(Q)$(MAKE) -C $(KDIR) M=$(TEST_KMOD_DIR) modules + +clean: + $(Q)$(MAKE) -C $(KDIR) M=$(TEST_KMOD_DIR) clean diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_x/bpf_test_modorder_x.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_x.c index 0cc747fa912f..0cc747fa912f 100644 --- a/tools/testing/selftests/bpf/bpf_test_modorder_x/bpf_test_modorder_x.c +++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_x.c diff --git a/tools/testing/selftests/bpf/bpf_test_modorder_y/bpf_test_modorder_y.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_y.c index c627ee085d13..c627ee085d13 100644 --- a/tools/testing/selftests/bpf/bpf_test_modorder_y/bpf_test_modorder_y.c +++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_modorder_y.c diff --git a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c b/tools/testing/selftests/bpf/test_kmods/bpf_test_no_cfi.c index 948eb3962732..948eb3962732 100644 --- a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c +++ b/tools/testing/selftests/bpf/test_kmods/bpf_test_no_cfi.c diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod-events.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod-events.h index aeef86b3da74..aeef86b3da74 100644 --- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod-events.h +++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod-events.h diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.c index cc9dde507aba..cc9dde507aba 100644 --- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c +++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.c diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.h index 356803d1c10e..356803d1c10e 100644 --- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.h +++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod.h diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h b/tools/testing/selftests/bpf/test_kmods/bpf_testmod_kfunc.h index b58817938deb..b58817938deb 100644 --- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h +++ b/tools/testing/selftests/bpf/test_kmods/bpf_testmod_kfunc.h diff --git a/tools/testing/selftests/bpf/test_loader.c b/tools/testing/selftests/bpf/test_loader.c index 3e9b009580d4..53b06647cf57 100644 --- a/tools/testing/selftests/bpf/test_loader.c +++ b/tools/testing/selftests/bpf/test_loader.c @@ -36,6 +36,7 @@ #define TEST_TAG_ARCH "comment:test_arch=" #define TEST_TAG_JITED_PFX "comment:test_jited=" #define TEST_TAG_JITED_PFX_UNPRIV "comment:test_jited_unpriv=" +#define TEST_TAG_CAPS_UNPRIV "comment:test_caps_unpriv=" /* Warning: duplicated in bpf_misc.h */ #define POINTER_VALUE 0xcafe4all @@ -74,6 +75,7 @@ struct test_subspec { struct expected_msgs jited; int retval; bool execute; + __u64 caps; }; struct test_spec { @@ -276,6 +278,37 @@ static int parse_int(const char *str, int *val, const char *name) return 0; } +static int parse_caps(const char *str, __u64 *val, const char *name) +{ + int cap_flag = 0; + char *token = NULL, *saveptr = NULL; + + char *str_cpy = strdup(str); + if (str_cpy == NULL) { + PRINT_FAIL("Memory allocation failed\n"); + return -EINVAL; + } + + token = strtok_r(str_cpy, "|", &saveptr); + while (token != NULL) { + errno = 0; + if (!strncmp("CAP_", token, sizeof("CAP_") - 1)) { + PRINT_FAIL("define %s constant in bpf_misc.h, failed to parse caps\n", token); + return -EINVAL; + } + cap_flag = strtol(token, NULL, 10); + if (!cap_flag || errno) { + PRINT_FAIL("failed to parse caps %s\n", name); + return -EINVAL; + } + *val |= (1ULL << cap_flag); + token = strtok_r(NULL, "|", &saveptr); + } + + free(str_cpy); + return 0; +} + static int parse_retval(const char *str, int *val, const char *name) { struct { @@ -541,6 +574,12 @@ static int parse_test_spec(struct test_loader *tester, jit_on_next_line = true; } else if (str_has_pfx(s, TEST_BTF_PATH)) { spec->btf_custom_path = s + sizeof(TEST_BTF_PATH) - 1; + } else if (str_has_pfx(s, TEST_TAG_CAPS_UNPRIV)) { + val = s + sizeof(TEST_TAG_CAPS_UNPRIV) - 1; + err = parse_caps(val, &spec->unpriv.caps, "test caps"); + if (err) + goto cleanup; + spec->mode_mask |= UNPRIV; } } @@ -917,6 +956,13 @@ void run_subtest(struct test_loader *tester, test__end_subtest(); return; } + if (subspec->caps) { + err = cap_enable_effective(subspec->caps, NULL); + if (err) { + PRINT_FAIL("failed to set capabilities: %i, %s\n", err, strerror(err)); + goto subtest_cleanup; + } + } } /* Implicitly reset to NULL if next test case doesn't specify */ diff --git a/tools/testing/selftests/bpf/test_progs.c b/tools/testing/selftests/bpf/test_progs.c index 6088d8222d59..c9e745d49493 100644 --- a/tools/testing/selftests/bpf/test_progs.c +++ b/tools/testing/selftests/bpf/test_progs.c @@ -1282,6 +1282,21 @@ void crash_handler(int signum) backtrace_symbols_fd(bt, sz, STDERR_FILENO); } +void hexdump(const char *prefix, const void *buf, size_t len) +{ + for (int i = 0; i < len; i++) { + if (!(i % 16)) { + if (i) + fprintf(stdout, "\n"); + fprintf(stdout, "%s", prefix); + } + if (i && !(i % 8) && (i % 16)) + fprintf(stdout, "\t"); + fprintf(stdout, "%02X ", ((uint8_t *)(buf))[i]); + } + fprintf(stdout, "\n"); +} + static void sigint_handler(int signum) { int i; diff --git a/tools/testing/selftests/bpf/test_progs.h b/tools/testing/selftests/bpf/test_progs.h index 74de33ae37e5..404d0d4915d5 100644 --- a/tools/testing/selftests/bpf/test_progs.h +++ b/tools/testing/selftests/bpf/test_progs.h @@ -185,6 +185,7 @@ void test__end_subtest(void); void test__skip(void); void test__fail(void); int test__join_cgroup(const char *path); +void hexdump(const char *prefix, const void *buf, size_t len); #define PRINT_FAIL(format...) \ ({ \ @@ -344,6 +345,20 @@ int test__join_cgroup(const char *path); ___ok; \ }) +#define ASSERT_MEMEQ(actual, expected, len, name) ({ \ + static int duration = 0; \ + const void *__act = actual; \ + const void *__exp = expected; \ + int __len = len; \ + bool ___ok = memcmp(__act, __exp, __len) == 0; \ + CHECK(!___ok, (name), "unexpected memory mismatch\n"); \ + fprintf(stdout, "actual:\n"); \ + hexdump("\t", __act, __len); \ + fprintf(stdout, "expected:\n"); \ + hexdump("\t", __exp, __len); \ + ___ok; \ +}) + #define ASSERT_OK(res, name) ({ \ static int duration = 0; \ long long ___res = (res); \ diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c index e5c7ecbe57e3..fd2da2234cc9 100644 --- a/tools/testing/selftests/bpf/test_sockmap.c +++ b/tools/testing/selftests/bpf/test_sockmap.c @@ -1579,8 +1579,12 @@ static void test_txmsg_redir(int cgrp, struct sockmap_options *opt) static void test_txmsg_redir_wait_sndmem(int cgrp, struct sockmap_options *opt) { - txmsg_redir = 1; opt->tx_wait_mem = true; + txmsg_redir = 1; + test_send_large(opt, cgrp); + + txmsg_redir = 1; + txmsg_apply = 4097; test_send_large(opt, cgrp); opt->tx_wait_mem = false; } diff --git a/tools/testing/selftests/bpf/test_tc_tunnel.sh b/tools/testing/selftests/bpf/test_tc_tunnel.sh index 7989ec608454..cb55a908bb0d 100755 --- a/tools/testing/selftests/bpf/test_tc_tunnel.sh +++ b/tools/testing/selftests/bpf/test_tc_tunnel.sh @@ -305,6 +305,7 @@ else client_connect verify_data server_listen + wait_for_port ${port} ${netcat_opt} fi # serverside, use BPF for decap diff --git a/tools/testing/selftests/bpf/test_xdp_meta.sh b/tools/testing/selftests/bpf/test_xdp_meta.sh deleted file mode 100755 index 2740322c1878..000000000000 --- a/tools/testing/selftests/bpf/test_xdp_meta.sh +++ /dev/null @@ -1,58 +0,0 @@ -#!/bin/sh - -BPF_FILE="test_xdp_meta.bpf.o" -# Kselftest framework requirement - SKIP code is 4. -readonly KSFT_SKIP=4 -readonly NS1="ns1-$(mktemp -u XXXXXX)" -readonly NS2="ns2-$(mktemp -u XXXXXX)" - -cleanup() -{ - if [ "$?" = "0" ]; then - echo "selftests: test_xdp_meta [PASS]"; - else - echo "selftests: test_xdp_meta [FAILED]"; - fi - - set +e - ip link del veth1 2> /dev/null - ip netns del ${NS1} 2> /dev/null - ip netns del ${NS2} 2> /dev/null -} - -ip link set dev lo xdp off 2>/dev/null > /dev/null -if [ $? -ne 0 ];then - echo "selftests: [SKIP] Could not run test without the ip xdp support" - exit $KSFT_SKIP -fi -set -e - -ip netns add ${NS1} -ip netns add ${NS2} - -trap cleanup 0 2 3 6 9 - -ip link add veth1 type veth peer name veth2 - -ip link set veth1 netns ${NS1} -ip link set veth2 netns ${NS2} - -ip netns exec ${NS1} ip addr add 10.1.1.11/24 dev veth1 -ip netns exec ${NS2} ip addr add 10.1.1.22/24 dev veth2 - -ip netns exec ${NS1} tc qdisc add dev veth1 clsact -ip netns exec ${NS2} tc qdisc add dev veth2 clsact - -ip netns exec ${NS1} tc filter add dev veth1 ingress bpf da obj ${BPF_FILE} sec t -ip netns exec ${NS2} tc filter add dev veth2 ingress bpf da obj ${BPF_FILE} sec t - -ip netns exec ${NS1} ip link set dev veth1 xdp obj ${BPF_FILE} sec x -ip netns exec ${NS2} ip link set dev veth2 xdp obj ${BPF_FILE} sec x - -ip netns exec ${NS1} ip link set dev veth1 up -ip netns exec ${NS2} ip link set dev veth2 up - -ip netns exec ${NS1} ping -c 1 10.1.1.22 -ip netns exec ${NS2} ping -c 1 10.1.1.11 - -exit 0 diff --git a/tools/testing/selftests/bpf/test_xdp_redirect.sh b/tools/testing/selftests/bpf/test_xdp_redirect.sh deleted file mode 100755 index 0746a4fde9d3..000000000000 --- a/tools/testing/selftests/bpf/test_xdp_redirect.sh +++ /dev/null @@ -1,79 +0,0 @@ -#!/bin/bash -# Create 2 namespaces with two veth peers, and -# forward packets in-between using generic XDP -# -# NS1(veth11) NS2(veth22) -# | | -# | | -# (veth1, ------ (veth2, -# id:111) id:222) -# | xdp forwarding | -# ------------------ - -readonly NS1="ns1-$(mktemp -u XXXXXX)" -readonly NS2="ns2-$(mktemp -u XXXXXX)" -ret=0 - -setup() -{ - - local xdpmode=$1 - - ip netns add ${NS1} - ip netns add ${NS2} - - ip link add veth1 index 111 type veth peer name veth11 netns ${NS1} - ip link add veth2 index 222 type veth peer name veth22 netns ${NS2} - - ip link set veth1 up - ip link set veth2 up - ip -n ${NS1} link set dev veth11 up - ip -n ${NS2} link set dev veth22 up - - ip -n ${NS1} addr add 10.1.1.11/24 dev veth11 - ip -n ${NS2} addr add 10.1.1.22/24 dev veth22 -} - -cleanup() -{ - ip link del veth1 2> /dev/null - ip link del veth2 2> /dev/null - ip netns del ${NS1} 2> /dev/null - ip netns del ${NS2} 2> /dev/null -} - -test_xdp_redirect() -{ - local xdpmode=$1 - - setup - - ip link set dev veth1 $xdpmode off &> /dev/null - if [ $? -ne 0 ];then - echo "selftests: test_xdp_redirect $xdpmode [SKIP]" - return 0 - fi - - ip -n ${NS1} link set veth11 $xdpmode obj xdp_dummy.bpf.o sec xdp &> /dev/null - ip -n ${NS2} link set veth22 $xdpmode obj xdp_dummy.bpf.o sec xdp &> /dev/null - ip link set dev veth1 $xdpmode obj test_xdp_redirect.bpf.o sec redirect_to_222 &> /dev/null - ip link set dev veth2 $xdpmode obj test_xdp_redirect.bpf.o sec redirect_to_111 &> /dev/null - - if ip netns exec ${NS1} ping -c 1 10.1.1.22 &> /dev/null && - ip netns exec ${NS2} ping -c 1 10.1.1.11 &> /dev/null; then - echo "selftests: test_xdp_redirect $xdpmode [PASS]"; - else - ret=1 - echo "selftests: test_xdp_redirect $xdpmode [FAILED]"; - fi - - cleanup -} - -set -e -trap cleanup 2 3 6 9 - -test_xdp_redirect xdpgeneric -test_xdp_redirect xdpdrv - -exit $ret diff --git a/tools/testing/selftests/bpf/trace_helpers.c b/tools/testing/selftests/bpf/trace_helpers.c index 2d742fdac6b9..81943c6254e6 100644 --- a/tools/testing/selftests/bpf/trace_helpers.c +++ b/tools/testing/selftests/bpf/trace_helpers.c @@ -293,6 +293,10 @@ static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *st return 0; } #else +# ifndef PROCMAP_QUERY_VMA_EXECUTABLE +# define PROCMAP_QUERY_VMA_EXECUTABLE 0x04 +# endif + static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *start, size_t *offset, int *flags) { return -EOPNOTSUPP; diff --git a/tools/testing/selftests/bpf/verifier/calls.c b/tools/testing/selftests/bpf/verifier/calls.c index 7afc2619ab14..18596ae0b0c1 100644 --- a/tools/testing/selftests/bpf/verifier/calls.c +++ b/tools/testing/selftests/bpf/verifier/calls.c @@ -2252,7 +2252,7 @@ BPF_EXIT_INSN(), }, .fixup_map_hash_48b = { 7 }, - .errstr_unpriv = "invalid indirect read from stack R2 off -8+0 size 8", + .errstr_unpriv = "invalid read from stack R2 off -8+0 size 8", .result_unpriv = REJECT, /* in privileged mode reads from uninitialized stack locations are permitted */ .result = ACCEPT, diff --git a/tools/testing/selftests/bpf/verifier/map_kptr.c b/tools/testing/selftests/bpf/verifier/map_kptr.c index f420c0312aa0..4b39f8472f9b 100644 --- a/tools/testing/selftests/bpf/verifier/map_kptr.c +++ b/tools/testing/selftests/bpf/verifier/map_kptr.c @@ -373,7 +373,7 @@ .prog_type = BPF_PROG_TYPE_SCHED_CLS, .fixup_map_kptr = { 1 }, .result = REJECT, - .errstr = "Unreleased reference id=5 alloc_insn=20", + .errstr = "Unreleased reference id=4 alloc_insn=20", .fixup_kfunc_btf_id = { { "bpf_kfunc_call_test_acquire", 15 }, } diff --git a/tools/testing/selftests/bpf/veristat.c b/tools/testing/selftests/bpf/veristat.c index e12ef953fba8..06af5029885b 100644 --- a/tools/testing/selftests/bpf/veristat.c +++ b/tools/testing/selftests/bpf/veristat.c @@ -21,11 +21,20 @@ #include <gelf.h> #include <float.h> #include <math.h> +#include <limits.h> #ifndef ARRAY_SIZE #define ARRAY_SIZE(arr) (sizeof(arr) / sizeof((arr)[0])) #endif +#ifndef max +#define max(a, b) ((a) > (b) ? (a) : (b)) +#endif + +#ifndef min +#define min(a, b) ((a) < (b) ? (a) : (b)) +#endif + enum stat_id { VERDICT, DURATION, @@ -34,6 +43,11 @@ enum stat_id { PEAK_STATES, MAX_STATES_PER_INSN, MARK_READ_MAX_LEN, + SIZE, + JITED_SIZE, + STACK, + PROG_TYPE, + ATTACH_TYPE, FILE_NAME, PROG_NAME, @@ -203,7 +217,8 @@ const char argp_program_doc[] = "\n" "USAGE: veristat <obj-file> [<obj-file>...]\n" " OR: veristat -C <baseline.csv> <comparison.csv>\n" -" OR: veristat -R <results.csv>\n"; +" OR: veristat -R <results.csv>\n" +" OR: veristat -vl2 <to_analyze.bpf.o>\n"; enum { OPT_LOG_FIXED = 1000, @@ -215,7 +230,7 @@ static const struct argp_option opts[] = { { "version", 'V', NULL, 0, "Print version" }, { "verbose", 'v', NULL, 0, "Verbose mode" }, { "debug", 'd', NULL, 0, "Debug mode (turns on libbpf debug logging)" }, - { "log-level", 'l', "LEVEL", 0, "Verifier log level (default 0 for normal mode, 1 for verbose mode)" }, + { "log-level", 'l', "LEVEL", 0, "Verifier log level (default 0 for normal mode, 1 for verbose mode, 2 for full verification log)" }, { "log-fixed", OPT_LOG_FIXED, NULL, 0, "Disable verifier log rotation" }, { "log-size", OPT_LOG_SIZE, "BYTES", 0, "Customize verifier log size (default to 16MB)" }, { "top-n", 'n', "N", 0, "Emit only up to first N results." }, @@ -640,19 +655,21 @@ cleanup: } static const struct stat_specs default_output_spec = { - .spec_cnt = 7, + .spec_cnt = 8, .ids = { FILE_NAME, PROG_NAME, VERDICT, DURATION, - TOTAL_INSNS, TOTAL_STATES, PEAK_STATES, + TOTAL_INSNS, TOTAL_STATES, SIZE, JITED_SIZE }, }; static const struct stat_specs default_csv_output_spec = { - .spec_cnt = 9, + .spec_cnt = 14, .ids = { FILE_NAME, PROG_NAME, VERDICT, DURATION, TOTAL_INSNS, TOTAL_STATES, PEAK_STATES, MAX_STATES_PER_INSN, MARK_READ_MAX_LEN, + SIZE, JITED_SIZE, PROG_TYPE, ATTACH_TYPE, + STACK, }, }; @@ -688,6 +705,11 @@ static struct stat_def { [PEAK_STATES] = { "Peak states", {"peak_states"}, }, [MAX_STATES_PER_INSN] = { "Max states per insn", {"max_states_per_insn"}, }, [MARK_READ_MAX_LEN] = { "Max mark read length", {"max_mark_read_len", "mark_read"}, }, + [SIZE] = { "Program size", {"prog_size"}, }, + [JITED_SIZE] = { "Jited size", {"prog_size_jited"}, }, + [STACK] = {"Stack depth", {"stack_depth", "stack"}, }, + [PROG_TYPE] = { "Program type", {"prog_type"}, }, + [ATTACH_TYPE] = { "Attach type", {"attach_type", }, }, }; static bool parse_stat_id_var(const char *name, size_t len, int *id, @@ -835,7 +857,8 @@ static char verif_log_buf[64 * 1024]; static int parse_verif_log(char * const buf, size_t buf_sz, struct verif_stats *s) { const char *cur; - int pos, lines; + int pos, lines, sub_stack, cnt = 0; + char *state = NULL, *token, stack[512]; buf[buf_sz - 1] = '\0'; @@ -853,15 +876,22 @@ static int parse_verif_log(char * const buf, size_t buf_sz, struct verif_stats * if (1 == sscanf(cur, "verification time %ld usec\n", &s->stats[DURATION])) continue; - if (6 == sscanf(cur, "processed %ld insns (limit %*d) max_states_per_insn %ld total_states %ld peak_states %ld mark_read %ld", + if (5 == sscanf(cur, "processed %ld insns (limit %*d) max_states_per_insn %ld total_states %ld peak_states %ld mark_read %ld", &s->stats[TOTAL_INSNS], &s->stats[MAX_STATES_PER_INSN], &s->stats[TOTAL_STATES], &s->stats[PEAK_STATES], &s->stats[MARK_READ_MAX_LEN])) continue; - } + if (1 == sscanf(cur, "stack depth %511s", stack)) + continue; + } + while ((token = strtok_r(cnt++ ? NULL : stack, "+", &state))) { + if (sscanf(token, "%d", &sub_stack) == 0) + break; + s->stats[STACK] += sub_stack; + } return 0; } @@ -884,7 +914,7 @@ static int line_cnt_cmp(const void *a, const void *b) const struct line_cnt *b_cnt = (const struct line_cnt *)b; if (a_cnt->cnt != b_cnt->cnt) - return a_cnt->cnt < b_cnt->cnt ? -1 : 1; + return a_cnt->cnt > b_cnt->cnt ? -1 : 1; return strcmp(a_cnt->line, b_cnt->line); } @@ -1032,6 +1062,41 @@ static int guess_prog_type_by_ctx_name(const char *ctx_name, return -ESRCH; } +/* Make sure only target program is referenced from struct_ops map, + * otherwise libbpf would automatically set autocreate for all + * referenced programs. + * See libbpf.c:bpf_object_adjust_struct_ops_autoload. + */ +static void mask_unrelated_struct_ops_progs(struct bpf_object *obj, + struct bpf_map *map, + struct bpf_program *prog) +{ + struct btf *btf = bpf_object__btf(obj); + const struct btf_type *t, *mt; + struct btf_member *m; + int i, moff; + size_t data_sz, ptr_sz = sizeof(void *); + void *data; + + t = btf__type_by_id(btf, bpf_map__btf_value_type_id(map)); + if (!btf_is_struct(t)) + return; + + data = bpf_map__initial_value(map, &data_sz); + for (i = 0; i < btf_vlen(t); i++) { + m = &btf_members(t)[i]; + mt = btf__type_by_id(btf, m->type); + if (!btf_is_ptr(mt)) + continue; + moff = m->offset / 8; + if (moff + ptr_sz > data_sz) + continue; + if (memcmp(data + moff, &prog, ptr_sz) == 0) + continue; + memset(data + moff, 0, ptr_sz); + } +} + static void fixup_obj(struct bpf_object *obj, struct bpf_program *prog, const char *filename) { struct bpf_map *map; @@ -1047,6 +1112,9 @@ static void fixup_obj(struct bpf_object *obj, struct bpf_program *prog, const ch case BPF_MAP_TYPE_INODE_STORAGE: case BPF_MAP_TYPE_CGROUP_STORAGE: break; + case BPF_MAP_TYPE_STRUCT_OPS: + mask_unrelated_struct_ops_progs(obj, map, prog); + break; default: if (bpf_map__max_entries(map) == 0) bpf_map__set_max_entries(map, 1); @@ -1146,8 +1214,11 @@ static int process_prog(const char *filename, struct bpf_object *obj, struct bpf char *buf; int buf_sz, log_level; struct verif_stats *stats; + struct bpf_prog_info info; + __u32 info_len = sizeof(info); int err = 0; void *tmp; + int fd; if (!should_process_file_prog(base_filename, bpf_program__name(prog))) { env.progs_skipped++; @@ -1196,6 +1267,15 @@ static int process_prog(const char *filename, struct bpf_object *obj, struct bpf stats->file_name = strdup(base_filename); stats->prog_name = strdup(bpf_program__name(prog)); stats->stats[VERDICT] = err == 0; /* 1 - success, 0 - failure */ + stats->stats[SIZE] = bpf_program__insn_cnt(prog); + stats->stats[PROG_TYPE] = bpf_program__type(prog); + stats->stats[ATTACH_TYPE] = bpf_program__expected_attach_type(prog); + + memset(&info, 0, info_len); + fd = bpf_program__fd(prog); + if (fd > 0 && bpf_prog_get_info_by_fd(fd, &info, &info_len) == 0) + stats->stats[JITED_SIZE] = info.jited_prog_len; + parse_verif_log(buf, buf_sz, stats); if (env.verbose) { @@ -1309,6 +1389,11 @@ static int cmp_stat(const struct verif_stats *s1, const struct verif_stats *s2, case PROG_NAME: cmp = strcmp(s1->prog_name, s2->prog_name); break; + case ATTACH_TYPE: + case PROG_TYPE: + case SIZE: + case JITED_SIZE: + case STACK: case VERDICT: case DURATION: case TOTAL_INSNS: @@ -1523,12 +1608,27 @@ static void prepare_value(const struct verif_stats *s, enum stat_id id, else *str = s->stats[VERDICT] ? "success" : "failure"; break; + case ATTACH_TYPE: + if (!s) + *str = "N/A"; + else + *str = libbpf_bpf_attach_type_str(s->stats[ATTACH_TYPE]) ?: "N/A"; + break; + case PROG_TYPE: + if (!s) + *str = "N/A"; + else + *str = libbpf_bpf_prog_type_str(s->stats[PROG_TYPE]) ?: "N/A"; + break; case DURATION: case TOTAL_INSNS: case TOTAL_STATES: case PEAK_STATES: case MAX_STATES_PER_INSN: case MARK_READ_MAX_LEN: + case STACK: + case SIZE: + case JITED_SIZE: *val = s ? s->stats[id] : 0; break; default: @@ -1612,7 +1712,10 @@ static int parse_stat_value(const char *str, enum stat_id id, struct verif_stats case TOTAL_STATES: case PEAK_STATES: case MAX_STATES_PER_INSN: - case MARK_READ_MAX_LEN: { + case MARK_READ_MAX_LEN: + case SIZE: + case JITED_SIZE: + case STACK: { long val; int err, n; @@ -1625,6 +1728,42 @@ static int parse_stat_value(const char *str, enum stat_id id, struct verif_stats st->stats[id] = val; break; } + case PROG_TYPE: { + enum bpf_prog_type prog_type = 0; + const char *type; + + while ((type = libbpf_bpf_prog_type_str(prog_type))) { + if (strcmp(type, str) == 0) { + st->stats[id] = prog_type; + break; + } + prog_type++; + } + + if (!type) { + fprintf(stderr, "Unrecognized prog type %s\n", str); + return -EINVAL; + } + break; + } + case ATTACH_TYPE: { + enum bpf_attach_type attach_type = 0; + const char *type; + + while ((type = libbpf_bpf_attach_type_str(attach_type))) { + if (strcmp(type, str) == 0) { + st->stats[id] = attach_type; + break; + } + attach_type++; + } + + if (!type) { + fprintf(stderr, "Unrecognized attach type %s\n", str); + return -EINVAL; + } + break; + } default: fprintf(stderr, "Unrecognized stat #%d\n", id); return -EINVAL; diff --git a/tools/testing/selftests/bpf/xdp_hw_metadata.c b/tools/testing/selftests/bpf/xdp_hw_metadata.c index 6f9956eed797..6f7b15d6c6ed 100644 --- a/tools/testing/selftests/bpf/xdp_hw_metadata.c +++ b/tools/testing/selftests/bpf/xdp_hw_metadata.c @@ -27,7 +27,7 @@ #include <linux/errqueue.h> #include <linux/if_link.h> #include <linux/net_tstamp.h> -#include <linux/udp.h> +#include <netinet/udp.h> #include <linux/sockios.h> #include <linux/if_xdp.h> #include <sys/mman.h> @@ -79,7 +79,7 @@ static int open_xsk(int ifindex, struct xsk *xsk, __u32 queue_id) .fill_size = XSK_RING_PROD__DEFAULT_NUM_DESCS, .comp_size = XSK_RING_CONS__DEFAULT_NUM_DESCS, .frame_size = XSK_UMEM__DEFAULT_FRAME_SIZE, - .flags = XSK_UMEM__DEFAULT_FLAGS, + .flags = XDP_UMEM_TX_METADATA_LEN, .tx_metadata_len = sizeof(struct xsk_tx_metadata), }; __u32 idx = 0; @@ -551,6 +551,7 @@ static void hwtstamp_enable(const char *ifname) { struct hwtstamp_config cfg = { .rx_filter = HWTSTAMP_FILTER_ALL, + .tx_type = HWTSTAMP_TX_ON, }; hwtstamp_ioctl(SIOCGHWTSTAMP, ifname, &saved_hwtstamp_cfg); diff --git a/tools/testing/selftests/cgroup/test_cpuset_prs.sh b/tools/testing/selftests/cgroup/test_cpuset_prs.sh index 03c1bdaed2c3..400a696a0d21 100755 --- a/tools/testing/selftests/cgroup/test_cpuset_prs.sh +++ b/tools/testing/selftests/cgroup/test_cpuset_prs.sh @@ -86,15 +86,15 @@ echo "" > test/cpuset.cpus # # If isolated CPUs have been reserved at boot time (as shown in -# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-7 +# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-8 # that will be used by this script for testing purpose. If not, some of -# the tests may fail incorrectly. These isolated CPUs will also be removed -# before being compared with the expected results. +# the tests may fail incorrectly. These pre-isolated CPUs should stay in +# an isolated state throughout the testing process for now. # BOOT_ISOLCPUS=$(cat $CGROUP2/cpuset.cpus.isolated) if [[ -n "$BOOT_ISOLCPUS" ]] then - [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 7 ]] && + [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 8 ]] && skip_test "Pre-isolated CPUs ($BOOT_ISOLCPUS) overlap CPUs to be tested" echo "Pre-isolated CPUs: $BOOT_ISOLCPUS" fi @@ -684,14 +684,18 @@ check_isolcpus() fi # + # Appending pre-isolated CPUs + # Even though CPU #8 isn't used for testing, it can't be pre-isolated + # to make appending those CPUs easier. + # + [[ -n "$BOOT_ISOLCPUS" ]] && { + EXPECT_VAL=${EXPECT_VAL:+${EXPECT_VAL},}${BOOT_ISOLCPUS} + EXPECT_VAL2=${EXPECT_VAL2:+${EXPECT_VAL2},}${BOOT_ISOLCPUS} + } + + # # Check cpuset.cpus.isolated cpumask # - if [[ -z "$BOOT_ISOLCPUS" ]] - then - ISOLCPUS=$(cat $ISCPUS) - else - ISOLCPUS=$(cat $ISCPUS | sed -e "s/,*$BOOT_ISOLCPUS//") - fi [[ "$EXPECT_VAL2" != "$ISOLCPUS" ]] && { # Take a 50ms pause and try again pause 0.05 @@ -731,8 +735,6 @@ check_isolcpus() fi done [[ "$ISOLCPUS" = *- ]] && ISOLCPUS=${ISOLCPUS}$LASTISOLCPU - [[ -n "BOOT_ISOLCPUS" ]] && - ISOLCPUS=$(echo $ISOLCPUS | sed -e "s/,*$BOOT_ISOLCPUS//") [[ "$EXPECT_VAL" = "$ISOLCPUS" ]] } @@ -836,8 +838,11 @@ run_state_test() # if available [[ -n "$ICPUS" ]] && { check_isolcpus $ICPUS - [[ $? -ne 0 ]] && test_fail $I "isolated CPU" \ - "Expect $ICPUS, get $ISOLCPUS instead" + [[ $? -ne 0 ]] && { + [[ -n "$BOOT_ISOLCPUS" ]] && ICPUS=${ICPUS},${BOOT_ISOLCPUS} + test_fail $I "isolated CPU" \ + "Expect $ICPUS, get $ISOLCPUS instead" + } } reset_cgroup_states # diff --git a/tools/testing/selftests/cgroup/test_cpuset_v1_hp.sh b/tools/testing/selftests/cgroup/test_cpuset_v1_hp.sh index 3f45512fb512..7406c24be1ac 100755 --- a/tools/testing/selftests/cgroup/test_cpuset_v1_hp.sh +++ b/tools/testing/selftests/cgroup/test_cpuset_v1_hp.sh @@ -1,4 +1,4 @@ -#!/bin/sh +#!/bin/bash # SPDX-License-Identifier: GPL-2.0 # # Test the special cpuset v1 hotplug case where a cpuset become empty of diff --git a/tools/testing/selftests/coredump/Makefile b/tools/testing/selftests/coredump/Makefile new file mode 100644 index 000000000000..ed210037b29d --- /dev/null +++ b/tools/testing/selftests/coredump/Makefile @@ -0,0 +1,7 @@ +# SPDX-License-Identifier: GPL-2.0-only +CFLAGS = $(KHDR_INCLUDES) + +TEST_GEN_PROGS := stackdump_test +TEST_FILES := stackdump + +include ../lib.mk diff --git a/tools/testing/selftests/coredump/README.rst b/tools/testing/selftests/coredump/README.rst new file mode 100644 index 000000000000..164a7aa181c8 --- /dev/null +++ b/tools/testing/selftests/coredump/README.rst @@ -0,0 +1,50 @@ +coredump selftest +================= + +Background context +------------------ + +`coredump` is a feature which dumps a process's memory space when the process terminates +unexpectedly (e.g. due to segmentation fault), which can be useful for debugging. By default, +`coredump` dumps the memory to the file named `core`, but this behavior can be changed by writing a +different file name to `/proc/sys/kernel/core_pattern`. Furthermore, `coredump` can be piped to a +user-space program by writing the pipe symbol (`|`) followed by the command to be executed to +`/proc/sys/kernel/core_pattern`. For the full description, see `man 5 core`. + +The piped user program may be interested in reading the stack pointers of the crashed process. The +crashed process's stack pointers can be read from `procfs`: it is the `kstkesp` field in +`/proc/$PID/stat`. See `man 5 proc` for all the details. + +The problem +----------- +While a thread is active, the stack pointer is unsafe to read and therefore the `kstkesp` field +reads zero. But when the thread is dead (e.g. during a coredump), this field should have valid +value. + +However, this was broken in the past and `kstkesp` was zero even during coredump: + +* commit 0a1eb2d474ed ("fs/proc: Stop reporting eip and esp in /proc/PID/stat") changed kstkesp to + always be zero + +* commit fd7d56270b52 ("fs/proc: Report eip/esp in /prod/PID/stat for coredumping") fixed it for the + coredumping thread. However, other threads in a coredumping process still had the problem. + +* commit cb8f381f1613 ("fs/proc/array.c: allow reporting eip/esp for all coredumping threads") fixed + for all threads in a coredumping process. + +* commit 92307383082d ("coredump: Don't perform any cleanups before dumping core") broke it again + for the other threads in a coredumping process. + +The problem has been fixed now, but considering the history, it may appear again in the future. + +The goal of this test +--------------------- +This test detects problem with reading `kstkesp` during coredump by doing the following: + +#. Tell the kernel to execute the "stackdump" script when a coredump happens. This script + reads the stack pointers of all threads of crashed processes. + +#. Spawn a child process who creates some threads and then crashes. + +#. Read the output from the "stackdump" script, and make sure all stack pointer values are + non-zero. diff --git a/tools/testing/selftests/coredump/stackdump b/tools/testing/selftests/coredump/stackdump new file mode 100755 index 000000000000..96714ce42d12 --- /dev/null +++ b/tools/testing/selftests/coredump/stackdump @@ -0,0 +1,14 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 + +CRASH_PROGRAM_ID=$1 +STACKDUMP_FILE=$2 + +TMP=$(mktemp) + +for t in /proc/$CRASH_PROGRAM_ID/task/*; do + tid=$(basename $t) + cat /proc/$tid/stat | awk '{print $29}' >> $TMP +done + +mv $TMP $STACKDUMP_FILE diff --git a/tools/testing/selftests/coredump/stackdump_test.c b/tools/testing/selftests/coredump/stackdump_test.c new file mode 100644 index 000000000000..137b2364a082 --- /dev/null +++ b/tools/testing/selftests/coredump/stackdump_test.c @@ -0,0 +1,151 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <fcntl.h> +#include <libgen.h> +#include <linux/limits.h> +#include <pthread.h> +#include <string.h> +#include <sys/resource.h> +#include <unistd.h> + +#include "../kselftest_harness.h" + +#define STACKDUMP_FILE "stack_values" +#define STACKDUMP_SCRIPT "stackdump" +#define NUM_THREAD_SPAWN 128 + +static void *do_nothing(void *) +{ + while (1) + pause(); +} + +static void crashing_child(void) +{ + pthread_t thread; + int i; + + for (i = 0; i < NUM_THREAD_SPAWN; ++i) + pthread_create(&thread, NULL, do_nothing, NULL); + + /* crash on purpose */ + i = *(int *)NULL; +} + +FIXTURE(coredump) +{ + char original_core_pattern[256]; +}; + +FIXTURE_SETUP(coredump) +{ + char buf[PATH_MAX]; + FILE *file; + char *dir; + int ret; + + file = fopen("/proc/sys/kernel/core_pattern", "r"); + ASSERT_NE(NULL, file); + + ret = fread(self->original_core_pattern, 1, sizeof(self->original_core_pattern), file); + ASSERT_TRUE(ret || feof(file)); + ASSERT_LT(ret, sizeof(self->original_core_pattern)); + + self->original_core_pattern[ret] = '\0'; + + ret = fclose(file); + ASSERT_EQ(0, ret); +} + +FIXTURE_TEARDOWN(coredump) +{ + const char *reason; + FILE *file; + int ret; + + unlink(STACKDUMP_FILE); + + file = fopen("/proc/sys/kernel/core_pattern", "w"); + if (!file) { + reason = "Unable to open core_pattern"; + goto fail; + } + + ret = fprintf(file, "%s", self->original_core_pattern); + if (ret < 0) { + reason = "Unable to write to core_pattern"; + goto fail; + } + + ret = fclose(file); + if (ret) { + reason = "Unable to close core_pattern"; + goto fail; + } + + return; +fail: + /* This should never happen */ + fprintf(stderr, "Failed to cleanup stackdump test: %s\n", reason); +} + +TEST_F(coredump, stackdump) +{ + struct sigaction action = {}; + unsigned long long stack; + char *test_dir, *line; + size_t line_length; + char buf[PATH_MAX]; + int ret, i; + FILE *file; + pid_t pid; + + /* + * Step 1: Setup core_pattern so that the stackdump script is executed when the child + * process crashes + */ + ret = readlink("/proc/self/exe", buf, sizeof(buf)); + ASSERT_NE(-1, ret); + ASSERT_LT(ret, sizeof(buf)); + buf[ret] = '\0'; + + test_dir = dirname(buf); + + file = fopen("/proc/sys/kernel/core_pattern", "w"); + ASSERT_NE(NULL, file); + + ret = fprintf(file, "|%1$s/%2$s %%P %1$s/%3$s", test_dir, STACKDUMP_SCRIPT, STACKDUMP_FILE); + ASSERT_LT(0, ret); + + ret = fclose(file); + ASSERT_EQ(0, ret); + + /* Step 2: Create a process who spawns some threads then crashes */ + pid = fork(); + ASSERT_TRUE(pid >= 0); + if (pid == 0) + crashing_child(); + + /* + * Step 3: Wait for the stackdump script to write the stack pointers to the stackdump file + */ + for (i = 0; i < 10; ++i) { + file = fopen(STACKDUMP_FILE, "r"); + if (file) + break; + sleep(1); + } + ASSERT_NE(file, NULL); + + /* Step 4: Make sure all stack pointer values are non-zero */ + for (i = 0; -1 != getline(&line, &line_length, file); ++i) { + stack = strtoull(line, NULL, 10); + ASSERT_NE(stack, 0); + } + + ASSERT_EQ(i, 1 + NUM_THREAD_SPAWN); + + fclose(file); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/cpufreq/.gitignore b/tools/testing/selftests/cpufreq/.gitignore new file mode 100644 index 000000000000..67604e91e068 --- /dev/null +++ b/tools/testing/selftests/cpufreq/.gitignore @@ -0,0 +1,2 @@ +# SPDX-License-Identifier: GPL-2.0-only +cpufreq_selftest.* diff --git a/tools/testing/selftests/cpufreq/Makefile b/tools/testing/selftests/cpufreq/Makefile index c86ca8342222..9b2ccb10b0cf 100644 --- a/tools/testing/selftests/cpufreq/Makefile +++ b/tools/testing/selftests/cpufreq/Makefile @@ -3,6 +3,7 @@ all: TEST_PROGS := main.sh TEST_FILES := cpu.sh cpufreq.sh governor.sh module.sh special-tests.sh +EXTRA_CLEAN := cpufreq_selftest.dmesg_cpufreq.txt cpufreq_selftest.dmesg_full.txt cpufreq_selftest.txt include ../lib.mk diff --git a/tools/testing/selftests/damon/.gitignore b/tools/testing/selftests/damon/.gitignore index 2ab675fecb6b..2f0297657c81 100644 --- a/tools/testing/selftests/damon/.gitignore +++ b/tools/testing/selftests/damon/.gitignore @@ -1,6 +1,3 @@ # SPDX-License-Identifier: GPL-2.0-only -huge_count_read_write -debugfs_target_ids_read_before_terminate_race -debugfs_target_ids_pid_leak access_memory access_memory_even diff --git a/tools/testing/selftests/damon/Makefile b/tools/testing/selftests/damon/Makefile index 5b2a6a5dd1af..ecbf07afc6dd 100644 --- a/tools/testing/selftests/damon/Makefile +++ b/tools/testing/selftests/damon/Makefile @@ -1,15 +1,11 @@ # SPDX-License-Identifier: GPL-2.0 # Makefile for damon selftests -TEST_GEN_FILES += huge_count_read_write -TEST_GEN_FILES += debugfs_target_ids_read_before_terminate_race -TEST_GEN_FILES += debugfs_target_ids_pid_leak TEST_GEN_FILES += access_memory access_memory_even -TEST_FILES = _chk_dependency.sh _debugfs_common.sh +TEST_FILES = _chk_dependency.sh _damon_sysfs.py # functionality tests -TEST_PROGS = debugfs_attrs.sh debugfs_schemes.sh debugfs_target_ids.sh TEST_PROGS += sysfs.sh TEST_PROGS += sysfs_update_schemes_tried_regions_wss_estimation.py TEST_PROGS += damos_quota.py damos_quota_goal.py damos_apply_interval.py @@ -17,11 +13,6 @@ TEST_PROGS += damos_tried_regions.py damon_nr_regions.py TEST_PROGS += reclaim.sh lru_sort.sh # regression tests (reproducers of previously found bugs) -TEST_PROGS += debugfs_empty_targets.sh debugfs_huge_count_read_write.sh -TEST_PROGS += debugfs_duplicate_context_creation.sh -TEST_PROGS += debugfs_rm_non_contexts.sh -TEST_PROGS += debugfs_target_ids_read_before_terminate_race.sh -TEST_PROGS += debugfs_target_ids_pid_leak.sh TEST_PROGS += sysfs_update_removed_scheme_dir.sh TEST_PROGS += sysfs_update_schemes_tried_regions_hang.py diff --git a/tools/testing/selftests/damon/config b/tools/testing/selftests/damon/config index 0daf38974eb0..a68a9fead5dc 100644 --- a/tools/testing/selftests/damon/config +++ b/tools/testing/selftests/damon/config @@ -1,6 +1,5 @@ CONFIG_DAMON=y CONFIG_DAMON_SYSFS=y -CONFIG_DAMON_DBGFS=y CONFIG_DAMON_PADDR=y CONFIG_DAMON_VADDR=y CONFIG_DAMON_RECLAIM=y diff --git a/tools/testing/selftests/damon/debugfs_attrs.sh b/tools/testing/selftests/damon/debugfs_attrs.sh deleted file mode 100755 index 902e312bca89..000000000000 --- a/tools/testing/selftests/damon/debugfs_attrs.sh +++ /dev/null @@ -1,17 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test attrs file -# =============== - -file="$DBGFS/attrs" -orig_content=$(cat "$file") - -test_write_succ "$file" "1 2 3 4 5" "$orig_content" "valid input" -test_write_fail "$file" "1 2 3 4" "$orig_content" "no enough fields" -test_write_fail "$file" "1 2 3 5 4" "$orig_content" \ - "min_nr_regions > max_nr_regions" -test_content "$file" "$orig_content" "1 2 3 4 5" "successfully written" -echo "$orig_content" > "$file" diff --git a/tools/testing/selftests/damon/debugfs_duplicate_context_creation.sh b/tools/testing/selftests/damon/debugfs_duplicate_context_creation.sh deleted file mode 100755 index bd6c22d96ead..000000000000 --- a/tools/testing/selftests/damon/debugfs_duplicate_context_creation.sh +++ /dev/null @@ -1,27 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test duplicated context creation -# ================================ - -if ! echo foo > "$DBGFS/mk_contexts" -then - echo "context creation failed" - exit 1 -fi - -if echo foo > "$DBGFS/mk_contexts" 2> /dev/null -then - echo "duplicate context creation success" - exit 1 -fi - -if ! echo foo > "$DBGFS/rm_contexts" -then - echo "context deletion failed" - exit 1 -fi - -exit 0 diff --git a/tools/testing/selftests/damon/debugfs_empty_targets.sh b/tools/testing/selftests/damon/debugfs_empty_targets.sh deleted file mode 100755 index effbea33dc16..000000000000 --- a/tools/testing/selftests/damon/debugfs_empty_targets.sh +++ /dev/null @@ -1,21 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test empty targets case -# ======================= - -orig_target_ids=$(cat "$DBGFS/target_ids") -echo "" > "$DBGFS/target_ids" - -if [ -f "$DBGFS/monitor_on_DEPRECATED" ] -then - monitor_on_file="$DBGFS/monitor_on_DEPRECATED" -else - monitor_on_file="$DBGFS/monitor_on" -fi - -orig_monitor_on=$(cat "$monitor_on_file") -test_write_fail "$monitor_on_file" "on" "orig_monitor_on" "empty target ids" -echo "$orig_target_ids" > "$DBGFS/target_ids" diff --git a/tools/testing/selftests/damon/debugfs_huge_count_read_write.sh b/tools/testing/selftests/damon/debugfs_huge_count_read_write.sh deleted file mode 100755 index 922cadac2950..000000000000 --- a/tools/testing/selftests/damon/debugfs_huge_count_read_write.sh +++ /dev/null @@ -1,22 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test huge count read write -# ========================== - -dmesg -C - -for file in "$DBGFS/"* -do - ./huge_count_read_write "$file" -done - -if dmesg | grep -q WARNING -then - dmesg - exit 1 -else - exit 0 -fi diff --git a/tools/testing/selftests/damon/debugfs_rm_non_contexts.sh b/tools/testing/selftests/damon/debugfs_rm_non_contexts.sh deleted file mode 100755 index f3ffeb1343cf..000000000000 --- a/tools/testing/selftests/damon/debugfs_rm_non_contexts.sh +++ /dev/null @@ -1,19 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test putting non-ctx files/dirs to rm_contexts file -# =================================================== - -dmesg -C - -for file in "$DBGFS/"* -do - (echo "$(basename "$f")" > "$DBGFS/rm_contexts") &> /dev/null - if dmesg | grep -q BUG - then - dmesg - exit 1 - fi -done diff --git a/tools/testing/selftests/damon/debugfs_schemes.sh b/tools/testing/selftests/damon/debugfs_schemes.sh deleted file mode 100755 index 5b39ab44731c..000000000000 --- a/tools/testing/selftests/damon/debugfs_schemes.sh +++ /dev/null @@ -1,19 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test schemes file -# ================= - -file="$DBGFS/schemes" -orig_content=$(cat "$file") - -test_write_succ "$file" "1 2 3 4 5 6 4 0 0 0 1 2 3 1 100 3 2 1" \ - "$orig_content" "valid input" -test_write_fail "$file" "1 2 -3 4 5 6 3 0 0 0 1 2 3 1 100 3 2 1" "$orig_content" "multi lines" -test_write_succ "$file" "" "$orig_content" "disabling" -test_write_fail "$file" "2 1 2 1 10 1 3 10 1 1 1 1 1 1 1 1 2 3" \ - "$orig_content" "wrong condition ranges" -echo "$orig_content" > "$file" diff --git a/tools/testing/selftests/damon/debugfs_target_ids.sh b/tools/testing/selftests/damon/debugfs_target_ids.sh deleted file mode 100755 index 49aeabdb0aae..000000000000 --- a/tools/testing/selftests/damon/debugfs_target_ids.sh +++ /dev/null @@ -1,19 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -source _debugfs_common.sh - -# Test target_ids file -# ==================== - -file="$DBGFS/target_ids" -orig_content=$(cat "$file") - -test_write_succ "$file" "1 2 3 4" "$orig_content" "valid input" -test_write_succ "$file" "1 2 abc 4" "$orig_content" "still valid input" -test_content "$file" "$orig_content" "1 2" "non-integer was there" -test_write_succ "$file" "abc 2 3" "$orig_content" "the file allows wrong input" -test_content "$file" "$orig_content" "" "wrong input written" -test_write_succ "$file" "" "$orig_content" "empty input" -test_content "$file" "$orig_content" "" "empty input written" -echo "$orig_content" > "$file" diff --git a/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.c b/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.c deleted file mode 100644 index 0cc2eef7d142..000000000000 --- a/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.c +++ /dev/null @@ -1,68 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0 -/* - * Author: SeongJae Park <sj@kernel.org> - */ - -#define _GNU_SOURCE - -#include <fcntl.h> -#include <stdbool.h> -#include <stdint.h> -#include <stdio.h> -#include <stdlib.h> -#include <sys/types.h> -#include <sys/wait.h> -#include <sys/time.h> -#include <unistd.h> - -#define DBGFS_TARGET_IDS "/sys/kernel/debug/damon/target_ids" - -static void write_targetid_exit(void) -{ - int target_ids_fd = open(DBGFS_TARGET_IDS, O_RDWR); - char pid_str[128]; - - snprintf(pid_str, sizeof(pid_str), "%d", getpid()); - write(target_ids_fd, pid_str, sizeof(pid_str)); - close(target_ids_fd); - exit(0); -} - -unsigned long msec_timestamp(void) -{ - struct timeval tv; - - gettimeofday(&tv, NULL); - return tv.tv_sec * 1000UL + tv.tv_usec / 1000; -} - -int main(int argc, char *argv[]) -{ - unsigned long start_ms; - int time_to_run, nr_forks = 0; - - if (argc != 2) { - fprintf(stderr, "Usage: %s <msecs to run>\n", argv[0]); - exit(1); - } - time_to_run = atoi(argv[1]); - - start_ms = msec_timestamp(); - while (true) { - int pid = fork(); - - if (pid < 0) { - fprintf(stderr, "fork() failed\n"); - exit(1); - } - if (pid == 0) - write_targetid_exit(); - wait(NULL); - nr_forks++; - - if (msec_timestamp() - start_ms > time_to_run) - break; - } - printf("%d\n", nr_forks); - return 0; -} diff --git a/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.sh b/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.sh deleted file mode 100755 index 31fe33c2b032..000000000000 --- a/tools/testing/selftests/damon/debugfs_target_ids_pid_leak.sh +++ /dev/null @@ -1,22 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -before=$(grep "^pid " /proc/slabinfo | awk '{print $2}') - -nr_leaks=$(./debugfs_target_ids_pid_leak 1000) -expected_after_max=$((before + nr_leaks / 2)) - -after=$(grep "^pid " /proc/slabinfo | awk '{print $2}') - -echo > /sys/kernel/debug/damon/target_ids - -echo "tried $nr_leaks pid leak" -echo "number of active pid slabs: $before -> $after" -echo "(up to $expected_after_max expected)" -if [ $after -gt $expected_after_max ] -then - echo "maybe pids are leaking" - exit 1 -else - exit 0 -fi diff --git a/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.c b/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.c deleted file mode 100644 index b06f52a8ce2d..000000000000 --- a/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.c +++ /dev/null @@ -1,80 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0 -/* - * Author: SeongJae Park <sj@kernel.org> - */ -#define _GNU_SOURCE - -#include <fcntl.h> -#include <stdbool.h> -#include <stdint.h> -#include <stdio.h> -#include <stdlib.h> -#include <sys/types.h> -#include <sys/wait.h> -#include <time.h> -#include <unistd.h> - -#define DBGFS_MONITOR_ON "/sys/kernel/debug/damon/monitor_on_DEPRECATED" -#define DBGFS_TARGET_IDS "/sys/kernel/debug/damon/target_ids" - -static void turn_damon_on_exit(void) -{ - int target_ids_fd = open(DBGFS_TARGET_IDS, O_RDWR); - int monitor_on_fd = open(DBGFS_MONITOR_ON, O_RDWR); - char pid_str[128]; - - snprintf(pid_str, sizeof(pid_str), "%d", getpid()); - write(target_ids_fd, pid_str, sizeof(pid_str)); - write(monitor_on_fd, "on\n", 3); - close(target_ids_fd); - close(monitor_on_fd); - usleep(1000); - exit(0); -} - -static void try_race(void) -{ - int target_ids_fd = open(DBGFS_TARGET_IDS, O_RDWR); - int pid = fork(); - int buf[256]; - - if (pid < 0) { - fprintf(stderr, "fork() failed\n"); - exit(1); - } - if (pid == 0) - turn_damon_on_exit(); - while (true) { - int status; - - read(target_ids_fd, buf, sizeof(buf)); - if (waitpid(-1, &status, WNOHANG) == pid) - break; - } - close(target_ids_fd); -} - -static inline uint64_t ts_to_ms(struct timespec *ts) -{ - return (uint64_t)ts->tv_sec * 1000 + (uint64_t)ts->tv_nsec / 1000000; -} - -int main(int argc, char *argv[]) -{ - struct timespec start_time, now; - int runtime_ms; - - if (argc != 2) { - fprintf(stderr, "Usage: %s <runtime in ms>\n", argv[0]); - exit(1); - } - runtime_ms = atoi(argv[1]); - clock_gettime(CLOCK_MONOTONIC, &start_time); - while (true) { - try_race(); - clock_gettime(CLOCK_MONOTONIC, &now); - if (ts_to_ms(&now) - ts_to_ms(&start_time) > runtime_ms) - break; - } - return 0; -} diff --git a/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.sh b/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.sh deleted file mode 100755 index fc793c4c9aea..000000000000 --- a/tools/testing/selftests/damon/debugfs_target_ids_read_before_terminate_race.sh +++ /dev/null @@ -1,14 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 - -dmesg -C - -./debugfs_target_ids_read_before_terminate_race 5000 - -if dmesg | grep -q dbgfs_target_ids_read -then - dmesg - exit 1 -else - exit 0 -fi diff --git a/tools/testing/selftests/damon/huge_count_read_write.c b/tools/testing/selftests/damon/huge_count_read_write.c deleted file mode 100644 index 53e69a669668..000000000000 --- a/tools/testing/selftests/damon/huge_count_read_write.c +++ /dev/null @@ -1,46 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0 -/* - * Author: SeongJae Park <sj@kernel.org> - */ - -#include <fcntl.h> -#include <stdlib.h> -#include <unistd.h> -#include <stdio.h> - -#pragma GCC diagnostic push -#if __GNUC__ >= 11 && __GNUC_MINOR__ >= 1 -/* Ignore read(2) overflow and write(2) overread compile warnings */ -#pragma GCC diagnostic ignored "-Wstringop-overread" -#pragma GCC diagnostic ignored "-Wstringop-overflow" -#endif - -void write_read_with_huge_count(char *file) -{ - int filedesc = open(file, O_RDWR); - char buf[256]; - int ret; - - printf("%s %s\n", __func__, file); - if (filedesc < 0) { - fprintf(stderr, "failed opening %s\n", file); - exit(1); - } - - write(filedesc, "", 0xfffffffful); - ret = read(filedesc, buf, 0xfffffffful); - close(filedesc); -} - -#pragma GCC diagnostic pop - -int main(int argc, char *argv[]) -{ - if (argc != 2) { - fprintf(stderr, "Usage: %s <file>\n", argv[0]); - exit(1); - } - write_read_with_huge_count(argv[1]); - - return 0; -} diff --git a/tools/testing/selftests/drivers/net/Makefile b/tools/testing/selftests/drivers/net/Makefile index 0fec8f9801ad..137470bdee0c 100644 --- a/tools/testing/selftests/drivers/net/Makefile +++ b/tools/testing/selftests/drivers/net/Makefile @@ -1,15 +1,18 @@ # SPDX-License-Identifier: GPL-2.0 TEST_INCLUDES := $(wildcard lib/py/*.py) \ + $(wildcard lib/sh/*.sh) \ ../../net/net_helper.sh \ ../../net/lib.sh \ TEST_PROGS := \ netcons_basic.sh \ + netcons_overflow.sh \ ping.py \ queues.py \ stats.py \ shaper.py \ + hds.py \ # end of TEST_PROGS include ../../lib.mk diff --git a/tools/testing/selftests/drivers/net/bonding/Makefile b/tools/testing/selftests/drivers/net/bonding/Makefile index 03a089165d3f..2b10854e4b1e 100644 --- a/tools/testing/selftests/drivers/net/bonding/Makefile +++ b/tools/testing/selftests/drivers/net/bonding/Makefile @@ -10,7 +10,7 @@ TEST_PROGS := \ mode-2-recovery-updelay.sh \ bond_options.sh \ bond-eth-type-change.sh \ - bond_macvlan.sh + bond_macvlan_ipvlan.sh TEST_FILES := \ lag_lib.sh \ diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh deleted file mode 100755 index b609fb6231f4..000000000000 --- a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh +++ /dev/null @@ -1,99 +0,0 @@ -#!/bin/bash -# SPDX-License-Identifier: GPL-2.0 -# -# Test macvlan over balance-alb - -lib_dir=$(dirname "$0") -source ${lib_dir}/bond_topo_2d1c.sh - -m1_ns="m1-$(mktemp -u XXXXXX)" -m2_ns="m1-$(mktemp -u XXXXXX)" -m1_ip4="192.0.2.11" -m1_ip6="2001:db8::11" -m2_ip4="192.0.2.12" -m2_ip6="2001:db8::12" - -cleanup() -{ - ip -n ${m1_ns} link del macv0 - ip netns del ${m1_ns} - ip -n ${m2_ns} link del macv0 - ip netns del ${m2_ns} - - client_destroy - server_destroy - gateway_destroy -} - -check_connection() -{ - local ns=${1} - local target=${2} - local message=${3:-"macvlan_over_bond"} - RET=0 - - - ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null - check_err $? "ping failed" - log_test "$mode: $message" -} - -macvlan_over_bond() -{ - local param="$1" - RET=0 - - # setup new bond mode - bond_reset "${param}" - - ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge - ip -n ${s_ns} link set macv0 netns ${m1_ns} - ip -n ${m1_ns} link set dev macv0 up - ip -n ${m1_ns} addr add ${m1_ip4}/24 dev macv0 - ip -n ${m1_ns} addr add ${m1_ip6}/24 dev macv0 - - ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge - ip -n ${s_ns} link set macv0 netns ${m2_ns} - ip -n ${m2_ns} link set dev macv0 up - ip -n ${m2_ns} addr add ${m2_ip4}/24 dev macv0 - ip -n ${m2_ns} addr add ${m2_ip6}/24 dev macv0 - - sleep 2 - - check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server" - check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server" - check_connection "${c_ns}" "${m1_ip4}" "IPv4: client->macvlan_1" - check_connection "${c_ns}" "${m1_ip6}" "IPv6: client->macvlan_1" - check_connection "${c_ns}" "${m2_ip4}" "IPv4: client->macvlan_2" - check_connection "${c_ns}" "${m2_ip6}" "IPv6: client->macvlan_2" - check_connection "${m1_ns}" "${m2_ip4}" "IPv4: macvlan_1->macvlan_2" - check_connection "${m1_ns}" "${m2_ip6}" "IPv6: macvlan_1->macvlan_2" - - - sleep 5 - - check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client" - check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client" - check_connection "${m1_ns}" "${c_ip4}" "IPv4: macvlan_1->client" - check_connection "${m1_ns}" "${c_ip6}" "IPv6: macvlan_1->client" - check_connection "${m2_ns}" "${c_ip4}" "IPv4: macvlan_2->client" - check_connection "${m2_ns}" "${c_ip6}" "IPv6: macvlan_2->client" - check_connection "${m2_ns}" "${m1_ip4}" "IPv4: macvlan_2->macvlan_2" - check_connection "${m2_ns}" "${m1_ip6}" "IPv6: macvlan_2->macvlan_2" - - ip -n ${c_ns} neigh flush dev eth0 -} - -trap cleanup EXIT - -setup_prepare -ip netns add ${m1_ns} -ip netns add ${m2_ns} - -modes="active-backup balance-tlb balance-alb" - -for mode in $modes; do - macvlan_over_bond "mode $mode" -done - -exit $EXIT_STATUS diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh new file mode 100755 index 000000000000..c4711272fe45 --- /dev/null +++ b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh @@ -0,0 +1,96 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 +# +# Test macvlan/ipvlan over bond + +lib_dir=$(dirname "$0") +source ${lib_dir}/bond_topo_2d1c.sh + +xvlan1_ns="xvlan1-$(mktemp -u XXXXXX)" +xvlan2_ns="xvlan2-$(mktemp -u XXXXXX)" +xvlan1_ip4="192.0.2.11" +xvlan1_ip6="2001:db8::11" +xvlan2_ip4="192.0.2.12" +xvlan2_ip6="2001:db8::12" + +cleanup() +{ + client_destroy + server_destroy + gateway_destroy + + ip netns del ${xvlan1_ns} + ip netns del ${xvlan2_ns} +} + +check_connection() +{ + local ns=${1} + local target=${2} + local message=${3} + RET=0 + + ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null + check_err $? "ping failed" + log_test "${bond_mode}/${xvlan_type}_${xvlan_mode}: ${message}" +} + +xvlan_over_bond() +{ + local param="$1" + local xvlan_type="$2" + local xvlan_mode="$3" + RET=0 + + # setup new bond mode + bond_reset "${param}" + + ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode} + ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan1_ns} + ip -n ${xvlan1_ns} link set dev ${xvlan_type}0 up + ip -n ${xvlan1_ns} addr add ${xvlan1_ip4}/24 dev ${xvlan_type}0 + ip -n ${xvlan1_ns} addr add ${xvlan1_ip6}/24 dev ${xvlan_type}0 + + ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode} + ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan2_ns} + ip -n ${xvlan2_ns} link set dev ${xvlan_type}0 up + ip -n ${xvlan2_ns} addr add ${xvlan2_ip4}/24 dev ${xvlan_type}0 + ip -n ${xvlan2_ns} addr add ${xvlan2_ip6}/24 dev ${xvlan_type}0 + + sleep 2 + + check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server" + check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server" + check_connection "${c_ns}" "${xvlan1_ip4}" "IPv4: client->${xvlan_type}_1" + check_connection "${c_ns}" "${xvlan1_ip6}" "IPv6: client->${xvlan_type}_1" + check_connection "${c_ns}" "${xvlan2_ip4}" "IPv4: client->${xvlan_type}_2" + check_connection "${c_ns}" "${xvlan2_ip6}" "IPv6: client->${xvlan_type}_2" + check_connection "${xvlan1_ns}" "${xvlan2_ip4}" "IPv4: ${xvlan_type}_1->${xvlan_type}_2" + check_connection "${xvlan1_ns}" "${xvlan2_ip6}" "IPv6: ${xvlan_type}_1->${xvlan_type}_2" + + check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client" + check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client" + check_connection "${xvlan1_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_1->client" + check_connection "${xvlan1_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_1->client" + check_connection "${xvlan2_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_2->client" + check_connection "${xvlan2_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_2->client" + check_connection "${xvlan2_ns}" "${xvlan1_ip4}" "IPv4: ${xvlan_type}_2->${xvlan_type}_1" + check_connection "${xvlan2_ns}" "${xvlan1_ip6}" "IPv6: ${xvlan_type}_2->${xvlan_type}_1" + + ip -n ${c_ns} neigh flush dev eth0 +} + +trap cleanup EXIT + +setup_prepare +ip netns add ${xvlan1_ns} +ip netns add ${xvlan2_ns} + +bond_modes="active-backup balance-tlb balance-alb" + +for bond_mode in ${bond_modes}; do + xvlan_over_bond "mode ${bond_mode}" macvlan bridge + xvlan_over_bond "mode ${bond_mode}" ipvlan l2 +done + +exit $EXIT_STATUS diff --git a/tools/testing/selftests/drivers/net/bonding/config b/tools/testing/selftests/drivers/net/bonding/config index 899d7fb6ea8e..dad4e5fda4db 100644 --- a/tools/testing/selftests/drivers/net/bonding/config +++ b/tools/testing/selftests/drivers/net/bonding/config @@ -3,6 +3,7 @@ CONFIG_BRIDGE=y CONFIG_DUMMY=y CONFIG_IPV6=y CONFIG_MACVLAN=y +CONFIG_IPVLAN=y CONFIG_NET_ACT_GACT=y CONFIG_NET_CLS_FLOWER=y CONFIG_NET_SCH_INGRESS=y diff --git a/tools/testing/selftests/drivers/net/hds.py b/tools/testing/selftests/drivers/net/hds.py new file mode 100755 index 000000000000..873f5219e41d --- /dev/null +++ b/tools/testing/selftests/drivers/net/hds.py @@ -0,0 +1,259 @@ +#!/usr/bin/env python3 +# SPDX-License-Identifier: GPL-2.0 + +import errno +import os +from lib.py import ksft_run, ksft_exit, ksft_eq, ksft_raises, KsftSkipEx +from lib.py import CmdExitFailure, EthtoolFamily, NlError +from lib.py import NetDrvEnv +from lib.py import defer, ethtool, ip + + +def _get_hds_mode(cfg, netnl) -> str: + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'tcp-data-split' not in rings: + raise KsftSkipEx('tcp-data-split not supported by device') + return rings['tcp-data-split'] + + +def _xdp_onoff(cfg): + test_dir = os.path.dirname(os.path.realpath(__file__)) + prog = test_dir + "/../../net/lib/xdp_dummy.bpf.o" + ip("link set dev %s xdp obj %s sec xdp" % + (cfg.ifname, prog)) + ip("link set dev %s xdp off" % cfg.ifname) + + +def _ioctl_ringparam_modify(cfg, netnl) -> None: + """ + Helper for performing a hopefully unimportant IOCTL SET. + IOCTL does not support HDS, so it should not affect the HDS config. + """ + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + + if 'tx' not in rings: + raise KsftSkipEx('setting Tx ring size not supported') + + try: + ethtool(f"--disable-netlink -G {cfg.ifname} tx {rings['tx'] // 2}") + except CmdExitFailure as e: + ethtool(f"--disable-netlink -G {cfg.ifname} tx {rings['tx'] * 2}") + defer(ethtool, f"-G {cfg.ifname} tx {rings['tx']}") + + +def get_hds(cfg, netnl) -> None: + _get_hds_mode(cfg, netnl) + + +def get_hds_thresh(cfg, netnl) -> None: + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'hds-thresh' not in rings: + raise KsftSkipEx('hds-thresh not supported by device') + +def set_hds_enable(cfg, netnl) -> None: + try: + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'enabled'}) + except NlError as e: + if e.error == errno.EINVAL: + raise KsftSkipEx("disabling of HDS not supported by the device") + elif e.error == errno.EOPNOTSUPP: + raise KsftSkipEx("ring-set not supported by the device") + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'tcp-data-split' not in rings: + raise KsftSkipEx('tcp-data-split not supported by device') + + ksft_eq('enabled', rings['tcp-data-split']) + +def set_hds_disable(cfg, netnl) -> None: + try: + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'disabled'}) + except NlError as e: + if e.error == errno.EINVAL: + raise KsftSkipEx("disabling of HDS not supported by the device") + elif e.error == errno.EOPNOTSUPP: + raise KsftSkipEx("ring-set not supported by the device") + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'tcp-data-split' not in rings: + raise KsftSkipEx('tcp-data-split not supported by device') + + ksft_eq('disabled', rings['tcp-data-split']) + +def set_hds_thresh_zero(cfg, netnl) -> None: + try: + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': 0}) + except NlError as e: + if e.error == errno.EINVAL: + raise KsftSkipEx("hds-thresh-set not supported by the device") + elif e.error == errno.EOPNOTSUPP: + raise KsftSkipEx("ring-set not supported by the device") + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'hds-thresh' not in rings: + raise KsftSkipEx('hds-thresh not supported by device') + + ksft_eq(0, rings['hds-thresh']) + +def set_hds_thresh_max(cfg, netnl) -> None: + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'hds-thresh' not in rings: + raise KsftSkipEx('hds-thresh not supported by device') + try: + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': rings['hds-thresh-max']}) + except NlError as e: + if e.error == errno.EINVAL: + raise KsftSkipEx("hds-thresh-set not supported by the device") + elif e.error == errno.EOPNOTSUPP: + raise KsftSkipEx("ring-set not supported by the device") + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + ksft_eq(rings['hds-thresh'], rings['hds-thresh-max']) + +def set_hds_thresh_gt(cfg, netnl) -> None: + try: + rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}}) + except NlError as e: + raise KsftSkipEx('ring-get not supported by device') + if 'hds-thresh' not in rings: + raise KsftSkipEx('hds-thresh not supported by device') + if 'hds-thresh-max' not in rings: + raise KsftSkipEx('hds-thresh-max not defined by device') + hds_gt = rings['hds-thresh-max'] + 1 + with ksft_raises(NlError) as e: + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': hds_gt}) + ksft_eq(e.exception.nl_msg.error, -errno.EINVAL) + + +def set_xdp(cfg, netnl) -> None: + """ + Enable single-buffer XDP on the device. + When HDS is in "auto" / UNKNOWN mode, XDP installation should work. + """ + mode = _get_hds_mode(cfg, netnl) + if mode == 'enabled': + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + _xdp_onoff(cfg) + + +def enabled_set_xdp(cfg, netnl) -> None: + """ + Enable single-buffer XDP on the device. + When HDS is in "enabled" mode, XDP installation should not work. + """ + _get_hds_mode(cfg, netnl) + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'enabled'}) + + defer(netnl.rings_set, {'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + with ksft_raises(CmdExitFailure) as e: + _xdp_onoff(cfg) + + +def set_xdp(cfg, netnl) -> None: + """ + Enable single-buffer XDP on the device. + When HDS is in "auto" / UNKNOWN mode, XDP installation should work. + """ + mode = _get_hds_mode(cfg, netnl) + if mode == 'enabled': + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + _xdp_onoff(cfg) + + +def enabled_set_xdp(cfg, netnl) -> None: + """ + Enable single-buffer XDP on the device. + When HDS is in "enabled" mode, XDP installation should not work. + """ + _get_hds_mode(cfg, netnl) # Trigger skip if not supported + + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'enabled'}) + defer(netnl.rings_set, {'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + with ksft_raises(CmdExitFailure) as e: + _xdp_onoff(cfg) + + +def ioctl(cfg, netnl) -> None: + mode1 = _get_hds_mode(cfg, netnl) + _ioctl_ringparam_modify(cfg, netnl) + mode2 = _get_hds_mode(cfg, netnl) + + ksft_eq(mode1, mode2) + + +def ioctl_set_xdp(cfg, netnl) -> None: + """ + Like set_xdp(), but we perturb the settings via the legacy ioctl. + """ + mode = _get_hds_mode(cfg, netnl) + if mode == 'enabled': + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + _ioctl_ringparam_modify(cfg, netnl) + + _xdp_onoff(cfg) + + +def ioctl_enabled_set_xdp(cfg, netnl) -> None: + """ + Enable single-buffer XDP on the device. + When HDS is in "enabled" mode, XDP installation should not work. + """ + _get_hds_mode(cfg, netnl) # Trigger skip if not supported + + netnl.rings_set({'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'enabled'}) + defer(netnl.rings_set, {'header': {'dev-index': cfg.ifindex}, + 'tcp-data-split': 'unknown'}) + + with ksft_raises(CmdExitFailure) as e: + _xdp_onoff(cfg) + + +def main() -> None: + with NetDrvEnv(__file__, queue_count=3) as cfg: + ksft_run([get_hds, + get_hds_thresh, + set_hds_disable, + set_hds_enable, + set_hds_thresh_zero, + set_hds_thresh_max, + set_hds_thresh_gt, + set_xdp, + enabled_set_xdp, + ioctl, + ioctl_set_xdp, + ioctl_enabled_set_xdp], + args=(cfg, EthtoolFamily())) + ksft_exit() + +if __name__ == "__main__": + main() diff --git a/tools/testing/selftests/drivers/net/hw/ncdevmem.c b/tools/testing/selftests/drivers/net/hw/ncdevmem.c index 8e502a1f8f9b..19a6969643f4 100644 --- a/tools/testing/selftests/drivers/net/hw/ncdevmem.c +++ b/tools/testing/selftests/drivers/net/hw/ncdevmem.c @@ -619,9 +619,6 @@ int do_server(struct memory_buffer *mem) fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n", page_aligned_frags, non_page_aligned_frags); - fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n", - page_aligned_frags, non_page_aligned_frags); - cleanup: free(tmp_mem); diff --git a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py index 05b6fbb3fcdd..ad192fef3117 100755 --- a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py +++ b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py @@ -21,9 +21,9 @@ def _enable_pp_allocation_fail(): if not os.path.exists("/sys/kernel/debug/fail_function"): raise KsftSkipEx("Kernel built without function error injection (or DebugFS)") - if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"): + if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"): with open("/sys/kernel/debug/fail_function/inject", "w") as fp: - fp.write("page_pool_alloc_pages\n") + fp.write("page_pool_alloc_netmems\n") _write_fail_config({ "verbose": 0, @@ -37,7 +37,7 @@ def _disable_pp_allocation_fail(): if not os.path.exists("/sys/kernel/debug/fail_function"): return - if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"): + if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"): with open("/sys/kernel/debug/fail_function/inject", "w") as fp: fp.write("\n") diff --git a/tools/testing/selftests/drivers/net/hw/rss_ctx.py b/tools/testing/selftests/drivers/net/hw/rss_ctx.py index 0b49ce7ae678..319aaa004c40 100755 --- a/tools/testing/selftests/drivers/net/hw/rss_ctx.py +++ b/tools/testing/selftests/drivers/net/hw/rss_ctx.py @@ -3,7 +3,8 @@ import datetime import random -from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt +import re +from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt, ksft_true from lib.py import NetDrvEpEnv from lib.py import EthtoolFamily, NetdevFamily from lib.py import KsftSkipEx, KsftFailEx @@ -96,6 +97,13 @@ def _send_traffic_check(cfg, port, name, params): f"traffic on inactive queues ({name}): " + str(cnts)) +def _ntuple_rule_check(cfg, rule_id, ctx_id): + """Check that ntuple rule references RSS context ID""" + text = ethtool(f"-n {cfg.ifname} rule {rule_id}").stdout + pattern = f"RSS Context (ID: )?{ctx_id}" + ksft_true(re.search(pattern, text), "RSS context not referenced in ntuple rule") + + def test_rss_key_indir(cfg): """Test basics like updating the main RSS key and indirection table.""" @@ -244,6 +252,7 @@ def test_rss_queue_reconfigure(cfg, main_ctx=True): try: # this targets queue 4, which doesn't exist ntuple2 = ethtool_create(cfg, "-N", flow) + defer(ethtool, f"-N {cfg.ifname} delete {ntuple2}") except CmdExitFailure: pass else: @@ -251,7 +260,13 @@ def test_rss_queue_reconfigure(cfg, main_ctx=True): # change the table to target queues 0 and 2 ethtool(f"-X {cfg.ifname} {ctx_ref} weight 1 0 1 0") # ntuple rule therefore targets queues 1 and 3 - ntuple2 = ethtool_create(cfg, "-N", flow) + try: + ntuple2 = ethtool_create(cfg, "-N", flow) + except CmdExitFailure: + ksft_pr("Driver does not support rss + queue offset") + return + + defer(ethtool, f"-N {cfg.ifname} delete {ntuple2}") # should replace existing filter ksft_eq(ntuple, ntuple2) _send_traffic_check(cfg, port, ctx_ref, { 'target': (1, 3), @@ -459,6 +474,8 @@ def test_rss_context(cfg, ctx_cnt=1, create_with_cfg=None): ntuple = ethtool_create(cfg, "-N", flow) defer(ethtool, f"-N {cfg.ifname} delete {ntuple}") + _ntuple_rule_check(cfg, ntuple, ctx_id) + for i in range(ctx_cnt): _send_traffic_check(cfg, ports[i], f"context {i}", { 'target': (2+i*2, 3+i*2), diff --git a/tools/testing/selftests/drivers/net/lib/py/env.py b/tools/testing/selftests/drivers/net/lib/py/env.py index 1ea9bb695e94..987e452d3a45 100644 --- a/tools/testing/selftests/drivers/net/lib/py/env.py +++ b/tools/testing/selftests/drivers/net/lib/py/env.py @@ -5,7 +5,7 @@ import time from pathlib import Path from lib.py import KsftSkipEx, KsftXfailEx from lib.py import ksft_setup -from lib.py import cmd, ethtool, ip +from lib.py import cmd, ethtool, ip, CmdExitFailure from lib.py import NetNS, NetdevSimDev from .remote import Remote @@ -48,6 +48,7 @@ class NetDrvEnv: else: self._ns = NetdevSimDev(**kwargs) self.dev = self._ns.nsims[0].dev + self.ifname = self.dev['ifname'] self.ifindex = self.dev['ifindex'] def __enter__(self): @@ -234,7 +235,12 @@ class NetDrvEpEnv: Good drivers will tell us via ethtool what their sync period is. """ if self._stats_settle_time is None: - data = ethtool("-c " + self.ifname, json=True)[0] + data = {} + try: + data = ethtool("-c " + self.ifname, json=True)[0] + except CmdExitFailure as e: + if "Operation not supported" not in e.cmd.stderr: + raise self._stats_settle_time = 0.025 + \ data.get('stats-block-usecs', 0) / 1000 / 1000 diff --git a/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh new file mode 100644 index 000000000000..3acaba41ac7b --- /dev/null +++ b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh @@ -0,0 +1,225 @@ +#!/usr/bin/env bash +# SPDX-License-Identifier: GPL-2.0 + +# This file contains functions and helpers to support the netconsole +# selftests +# +# Author: Breno Leitao <leitao@debian.org> + +set -euo pipefail + +LIBDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")") + +SRCIF="" # to be populated later +SRCIP=192.0.2.1 +DSTIF="" # to be populated later +DSTIP=192.0.2.2 + +PORT="6666" +MSG="netconsole selftest" +USERDATA_KEY="key" +USERDATA_VALUE="value" +TARGET=$(mktemp -u netcons_XXXXX) +DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk) +NETCONS_CONFIGFS="/sys/kernel/config/netconsole" +NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}" +# NAMESPACE will be populated by setup_ns with a random value +NAMESPACE="" + +# IDs for netdevsim +NSIM_DEV_1_ID=$((256 + RANDOM % 256)) +NSIM_DEV_2_ID=$((512 + RANDOM % 256)) +NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device" + +# Used to create and delete namespaces +source "${LIBDIR}"/../../../../net/lib.sh +source "${LIBDIR}"/../../../../net/net_helper.sh + +# Create netdevsim interfaces +create_ifaces() { + + echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW" + echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW" + udevadm settle 2> /dev/null || true + + local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID" + local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID" + + # These are global variables + SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \ + -path "$NSIM1"/net -exec basename {} \;) + DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \ + -path "$NSIM2"/net -exec basename {} \;) +} + +link_ifaces() { + local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device" + local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex) + local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex) + + exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}" + exec {INITNS_FD}</proc/self/ns/net + + # Bind the dst interface to namespace + ip link set "${DSTIF}" netns "${NAMESPACE}" + + # Linking one device to the other one (on the other namespace} + if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK + then + echo "linking netdevsim1 with netdevsim2 should succeed" + cleanup + exit "${ksft_skip}" + fi +} + +function configure_ip() { + # Configure the IPs for both interfaces + ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}" + ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up + + ip addr add "${SRCIP}"/24 dev "${SRCIF}" + ip link set "${SRCIF}" up +} + +function set_network() { + # setup_ns function is coming from lib.sh + setup_ns NAMESPACE + + # Create both interfaces, and assign the destination to a different + # namespace + create_ifaces + + # Link both interfaces back to back + link_ifaces + + configure_ip +} + +function create_dynamic_target() { + DSTMAC=$(ip netns exec "${NAMESPACE}" \ + ip link show "${DSTIF}" | awk '/ether/ {print $2}') + + # Create a dynamic target + mkdir "${NETCONS_PATH}" + + echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip + echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip + echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac + echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name + + echo 1 > "${NETCONS_PATH}"/enabled +} + +function cleanup() { + local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device" + + # delete netconsole dynamic reconfiguration + echo 0 > "${NETCONS_PATH}"/enabled + # Remove all the keys that got created during the selftest + find "${NETCONS_PATH}/userdata/" -mindepth 1 -type d -delete + # Remove the configfs entry + rmdir "${NETCONS_PATH}" + + # Delete netdevsim devices + echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL" + echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL" + + # this is coming from lib.sh + cleanup_all_ns + + # Restoring printk configurations + echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk +} + +function set_user_data() { + if [[ ! -d "${NETCONS_PATH}""/userdata" ]] + then + echo "Userdata path not available in ${NETCONS_PATH}/userdata" + exit "${ksft_skip}" + fi + + KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}" + mkdir -p "${KEY_PATH}" + VALUE_PATH="${KEY_PATH}""/value" + echo "${USERDATA_VALUE}" > "${VALUE_PATH}" +} + +function listen_port_and_save_to() { + local OUTPUT=${1} + # Just wait for 2 seconds + timeout 2 ip netns exec "${NAMESPACE}" \ + socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}" +} + +function validate_result() { + local TMPFILENAME="$1" + + # TMPFILENAME will contain something like: + # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM + # key=value + + # Check if the file exists + if [ ! -f "$TMPFILENAME" ]; then + echo "FAIL: File was not generated." >&2 + exit "${ksft_fail}" + fi + + if ! grep -q "${MSG}" "${TMPFILENAME}"; then + echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2 + cat "${TMPFILENAME}" >&2 + exit "${ksft_fail}" + fi + + if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then + echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2 + cat "${TMPFILENAME}" >&2 + exit "${ksft_fail}" + fi + + # Delete the file once it is validated, otherwise keep it + # for debugging purposes + rm "${TMPFILENAME}" + exit "${ksft_pass}" +} + +function check_for_dependencies() { + if [ "$(id -u)" -ne 0 ]; then + echo "This test must be run as root" >&2 + exit "${ksft_skip}" + fi + + if ! which socat > /dev/null ; then + echo "SKIP: socat(1) is not available" >&2 + exit "${ksft_skip}" + fi + + if ! which ip > /dev/null ; then + echo "SKIP: ip(1) is not available" >&2 + exit "${ksft_skip}" + fi + + if ! which udevadm > /dev/null ; then + echo "SKIP: udevadm(1) is not available" >&2 + exit "${ksft_skip}" + fi + + if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then + echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2 + exit "${ksft_skip}" + fi + + if [ ! -d "${NETCONS_CONFIGFS}" ]; then + echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2 + exit "${ksft_skip}" + fi + + if ip link show "${DSTIF}" 2> /dev/null; then + echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2 + exit "${ksft_skip}" + fi + + if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then + echo "SKIP: IPs already in use. Skipping it" >&2 + exit "${ksft_skip}" + fi +} diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh index b79542a4dcc7..4a11bf1d514a 100755 --- a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh +++ b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh @@ -12,6 +12,7 @@ ALL_TESTS=" bridge_rif_remaster_port " +REQUIRE_TEAMD="yes" NUM_NETIFS=2 source $lib_dir/lib.sh source $lib_dir/devlink_lib.sh diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh index e28f978104f3..b8bbe94f4736 100755 --- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh +++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh @@ -10,6 +10,7 @@ ALL_TESTS=" lag_rif_nomaster_addr " +REQUIRE_TEAMD="yes" NUM_NETIFS=2 source $lib_dir/lib.sh source $lib_dir/devlink_lib.sh diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh index 6318cfa6434c..d1a9d379eaf3 100755 --- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh +++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh @@ -10,6 +10,7 @@ ALL_TESTS=" lag_rif_nomaster_addr " +REQUIRE_TEAMD="yes" NUM_NETIFS=2 source $lib_dir/lib.sh source $lib_dir/devlink_lib.sh diff --git a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh index 0c47faff9274..c068e6c2a580 100755 --- a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh +++ b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh @@ -22,20 +22,34 @@ SB_ITC=0 h1_create() { simple_if_init $h1 192.0.1.1/24 + tc qdisc add dev $h1 clsact + + # Add egress filter on $h1 that will guarantee that the packet sent, + # will be the only packet being passed to the device. + tc filter add dev $h1 egress pref 2 handle 102 matchall action drop } h1_destroy() { + tc filter del dev $h1 egress pref 2 handle 102 matchall action drop + tc qdisc del dev $h1 clsact simple_if_fini $h1 192.0.1.1/24 } h2_create() { simple_if_init $h2 192.0.1.2/24 + tc qdisc add dev $h2 clsact + + # Add egress filter on $h2 that will guarantee that the packet sent, + # will be the only packet being passed to the device. + tc filter add dev $h2 egress pref 1 handle 101 matchall action drop } h2_destroy() { + tc filter del dev $h2 egress pref 1 handle 101 matchall action drop + tc qdisc del dev $h2 clsact simple_if_fini $h2 192.0.1.2/24 } @@ -101,6 +115,11 @@ port_pool_test() local exp_max_occ=$(devlink_cell_size_get) local max_occ + tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \ + src_mac $h1mac dst_mac $h2mac \ + src_ip 192.0.1.1 dst_ip 192.0.1.2 \ + action pass + devlink sb occupancy clearmax $DEVLINK_DEV $MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \ @@ -109,11 +128,6 @@ port_pool_test() devlink sb occupancy snapshot $DEVLINK_DEV RET=0 - max_occ=$(sb_occ_pool_check $dl_port1 $SB_POOL_ING $exp_max_occ) - check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ" - log_test "physical port's($h1) ingress pool" - - RET=0 max_occ=$(sb_occ_pool_check $dl_port2 $SB_POOL_ING $exp_max_occ) check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ" log_test "physical port's($h2) ingress pool" @@ -122,6 +136,11 @@ port_pool_test() max_occ=$(sb_occ_pool_check $cpu_dl_port $SB_POOL_EGR_CPU $exp_max_occ) check_err $? "Expected ePool($SB_POOL_EGR_CPU) max occupancy to be $exp_max_occ, but got $max_occ" log_test "CPU port's egress pool" + + tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \ + src_mac $h1mac dst_mac $h2mac \ + src_ip 192.0.1.1 dst_ip 192.0.1.2 \ + action pass } port_tc_ip_test() @@ -129,6 +148,11 @@ port_tc_ip_test() local exp_max_occ=$(devlink_cell_size_get) local max_occ + tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \ + src_mac $h1mac dst_mac $h2mac \ + src_ip 192.0.1.1 dst_ip 192.0.1.2 \ + action pass + devlink sb occupancy clearmax $DEVLINK_DEV $MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \ @@ -139,17 +163,17 @@ port_tc_ip_test() RET=0 max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ) check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ" - log_test "physical port's($h1) ingress TC - IP packet" - - RET=0 - max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ) - check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ" log_test "physical port's($h2) ingress TC - IP packet" RET=0 max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_IP $exp_max_occ) check_err $? "Expected egress TC($SB_ITC_CPU_IP) max occupancy to be $exp_max_occ, but got $max_occ" log_test "CPU port's egress TC - IP packet" + + tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \ + src_mac $h1mac dst_mac $h2mac \ + src_ip 192.0.1.1 dst_ip 192.0.1.2 \ + action pass } port_tc_arp_test() @@ -157,6 +181,9 @@ port_tc_arp_test() local exp_max_occ=$(devlink_cell_size_get) local max_occ + tc filter add dev $h1 egress protocol arp pref 1 handle 101 flower \ + src_mac $h1mac action pass + devlink sb occupancy clearmax $DEVLINK_DEV $MZ $h1 -c 1 -p 10 -a $h1mac -A 192.0.1.1 -t arp -q @@ -166,17 +193,15 @@ port_tc_arp_test() RET=0 max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ) check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ" - log_test "physical port's($h1) ingress TC - ARP packet" - - RET=0 - max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ) - check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ" log_test "physical port's($h2) ingress TC - ARP packet" RET=0 max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_ARP $exp_max_occ) check_err $? "Expected egress TC($SB_ITC_IP2ME) max occupancy to be $exp_max_occ, but got $max_occ" log_test "CPU port's egress TC - ARP packet" + + tc filter del dev $h1 egress protocol arp pref 1 handle 101 flower \ + src_mac $h1mac action pass } setup_prepare() diff --git a/tools/testing/selftests/drivers/net/netcons_basic.sh b/tools/testing/selftests/drivers/net/netcons_basic.sh index b175f4d966e5..fe765da498e8 100755 --- a/tools/testing/selftests/drivers/net/netcons_basic.sh +++ b/tools/testing/selftests/drivers/net/netcons_basic.sh @@ -18,224 +18,8 @@ set -euo pipefail SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")") -# Simple script to test dynamic targets in netconsole -SRCIF="" # to be populated later -SRCIP=192.0.2.1 -DSTIF="" # to be populated later -DSTIP=192.0.2.2 +source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh -PORT="6666" -MSG="netconsole selftest" -USERDATA_KEY="key" -USERDATA_VALUE="value" -TARGET=$(mktemp -u netcons_XXXXX) -DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk) -NETCONS_CONFIGFS="/sys/kernel/config/netconsole" -NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}" -KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}" -# NAMESPACE will be populated by setup_ns with a random value -NAMESPACE="" - -# IDs for netdevsim -NSIM_DEV_1_ID=$((256 + RANDOM % 256)) -NSIM_DEV_2_ID=$((512 + RANDOM % 256)) -NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device" - -# Used to create and delete namespaces -source "${SCRIPTDIR}"/../../net/lib.sh -source "${SCRIPTDIR}"/../../net/net_helper.sh - -# Create netdevsim interfaces -create_ifaces() { - - echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW" - echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW" - udevadm settle 2> /dev/null || true - - local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID" - local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID" - - # These are global variables - SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \ - -path "$NSIM1"/net -exec basename {} \;) - DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \ - -path "$NSIM2"/net -exec basename {} \;) -} - -link_ifaces() { - local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device" - local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex) - local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex) - - exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}" - exec {INITNS_FD}</proc/self/ns/net - - # Bind the dst interface to namespace - ip link set "${DSTIF}" netns "${NAMESPACE}" - - # Linking one device to the other one (on the other namespace} - if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK - then - echo "linking netdevsim1 with netdevsim2 should succeed" - cleanup - exit "${ksft_skip}" - fi -} - -function configure_ip() { - # Configure the IPs for both interfaces - ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}" - ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up - - ip addr add "${SRCIP}"/24 dev "${SRCIF}" - ip link set "${SRCIF}" up -} - -function set_network() { - # setup_ns function is coming from lib.sh - setup_ns NAMESPACE - - # Create both interfaces, and assign the destination to a different - # namespace - create_ifaces - - # Link both interfaces back to back - link_ifaces - - configure_ip -} - -function create_dynamic_target() { - DSTMAC=$(ip netns exec "${NAMESPACE}" \ - ip link show "${DSTIF}" | awk '/ether/ {print $2}') - - # Create a dynamic target - mkdir "${NETCONS_PATH}" - - echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip - echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip - echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac - echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name - - echo 1 > "${NETCONS_PATH}"/enabled -} - -function cleanup() { - local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device" - - # delete netconsole dynamic reconfiguration - echo 0 > "${NETCONS_PATH}"/enabled - # Remove key - rmdir "${KEY_PATH}" - # Remove the configfs entry - rmdir "${NETCONS_PATH}" - - # Delete netdevsim devices - echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL" - echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL" - - # this is coming from lib.sh - cleanup_all_ns - - # Restoring printk configurations - echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk -} - -function set_user_data() { - if [[ ! -d "${NETCONS_PATH}""/userdata" ]] - then - echo "Userdata path not available in ${NETCONS_PATH}/userdata" - exit "${ksft_skip}" - fi - - mkdir -p "${KEY_PATH}" - VALUE_PATH="${KEY_PATH}""/value" - echo "${USERDATA_VALUE}" > "${VALUE_PATH}" -} - -function listen_port_and_save_to() { - local OUTPUT=${1} - # Just wait for 2 seconds - timeout 2 ip netns exec "${NAMESPACE}" \ - socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}" -} - -function validate_result() { - local TMPFILENAME="$1" - - # TMPFILENAME will contain something like: - # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM - # key=value - - # Check if the file exists - if [ ! -f "$TMPFILENAME" ]; then - echo "FAIL: File was not generated." >&2 - exit "${ksft_fail}" - fi - - if ! grep -q "${MSG}" "${TMPFILENAME}"; then - echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2 - cat "${TMPFILENAME}" >&2 - exit "${ksft_fail}" - fi - - if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then - echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2 - cat "${TMPFILENAME}" >&2 - exit "${ksft_fail}" - fi - - # Delete the file once it is validated, otherwise keep it - # for debugging purposes - rm "${TMPFILENAME}" - exit "${ksft_pass}" -} - -function check_for_dependencies() { - if [ "$(id -u)" -ne 0 ]; then - echo "This test must be run as root" >&2 - exit "${ksft_skip}" - fi - - if ! which socat > /dev/null ; then - echo "SKIP: socat(1) is not available" >&2 - exit "${ksft_skip}" - fi - - if ! which ip > /dev/null ; then - echo "SKIP: ip(1) is not available" >&2 - exit "${ksft_skip}" - fi - - if ! which udevadm > /dev/null ; then - echo "SKIP: udevadm(1) is not available" >&2 - exit "${ksft_skip}" - fi - - if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then - echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2 - exit "${ksft_skip}" - fi - - if [ ! -d "${NETCONS_CONFIGFS}" ]; then - echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2 - exit "${ksft_skip}" - fi - - if ip link show "${DSTIF}" 2> /dev/null; then - echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2 - exit "${ksft_skip}" - fi - - if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then - echo "SKIP: IPs already in use. Skipping it" >&2 - exit "${ksft_skip}" - fi -} - -# ========== # -# Start here # -# ========== # modprobe netdevsim 2> /dev/null || true modprobe netconsole 2> /dev/null || true diff --git a/tools/testing/selftests/drivers/net/netcons_overflow.sh b/tools/testing/selftests/drivers/net/netcons_overflow.sh new file mode 100755 index 000000000000..29bad56448a2 --- /dev/null +++ b/tools/testing/selftests/drivers/net/netcons_overflow.sh @@ -0,0 +1,67 @@ +#!/usr/bin/env bash +# SPDX-License-Identifier: GPL-2.0 + +# This test verifies that users can successfully create up to +# MAX_USERDATA_ITEMS userdata entries without encountering any failures. +# +# Additionally, it tests for expected failure when attempting to exceed this +# maximum limit. +# +# Author: Breno Leitao <leitao@debian.org> + +set -euo pipefail + +SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")") + +source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh +# This is coming from netconsole code. Check for it in drivers/net/netconsole.c +MAX_USERDATA_ITEMS=16 + +# Function to create userdata entries +function create_userdata_max_entries() { + # All these keys should be created without any error + for i in $(seq $MAX_USERDATA_ITEMS) + do + # USERDATA_KEY is used by set_user_data + USERDATA_KEY="key"${i} + set_user_data + done +} + +# Function to verify the entry limit +function verify_entry_limit() { + # Allowing the test to fail without exiting, since the next command + # will fail + set +e + mkdir "${NETCONS_PATH}/userdata/key_that_will_fail" 2> /dev/null + ret="$?" + set -e + if [ "$ret" -eq 0 ]; + then + echo "Adding more than ${MAX_USERDATA_ITEMS} entries in userdata should fail, but it didn't" >&2 + ls "${NETCONS_PATH}/userdata/" >&2 + exit "${ksft_fail}" + fi +} + +# ========== # +# Start here # +# ========== # + +modprobe netdevsim 2> /dev/null || true +modprobe netconsole 2> /dev/null || true + +# Check for basic system dependency and exit if not found +check_for_dependencies + +# Remove the namespace, interfaces and netconsole target on exit +trap cleanup EXIT +# Create one namespace and two interfaces +set_network +# Create a dynamic target for netconsole +create_dynamic_target +# populate the maximum number of supported keys in userdata +create_userdata_max_entries +# Verify an additional entry is not allowed +verify_entry_limit +exit "${ksft_pass}" diff --git a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh index fd13c8cfb7a8..b411fe66510f 100755 --- a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh +++ b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh @@ -58,9 +58,12 @@ for root in mq mqprio; do ethtool -L $NDEV combined 4 n_child_assert 4 "One real queue, rest default" - # Graft some - tcq replace parent 100:1 handle 204: - n_child_assert 3 "Grafted" + # Remove real one + tcq del parent 100:4 handle 204: + + # Replace default with pfifo + tcq replace parent 100:1 handle 205: pfifo limit 1000 + n_child_assert 3 "Deleting real one, replacing default one with pfifo" ethtool -L $NDEV combined 1 n_child_assert 1 "Grafted, one" diff --git a/tools/testing/selftests/drivers/net/netdevsim/udp_tunnel_nic.sh b/tools/testing/selftests/drivers/net/netdevsim/udp_tunnel_nic.sh index 384cfa3d38a6..92c2f0376c08 100755 --- a/tools/testing/selftests/drivers/net/netdevsim/udp_tunnel_nic.sh +++ b/tools/testing/selftests/drivers/net/netdevsim/udp_tunnel_nic.sh @@ -142,7 +142,7 @@ function pre_ethtool { } function check_table { - local path=$NSIM_DEV_DFS/ports/$port/udp_ports_table$1 + local path=$NSIM_DEV_DFS/ports/$port/udp_ports/table$1 local -n expected=$2 local last=$3 @@ -212,7 +212,7 @@ function check_tables { } function print_table { - local path=$NSIM_DEV_DFS/ports/$port/udp_ports_table$1 + local path=$NSIM_DEV_DFS/ports/$port/udp_ports/table$1 read -a have < $path tree $NSIM_DEV_DFS/ @@ -641,7 +641,7 @@ for port in 0 1; do NSIM_NETDEV=`get_netdev_name old_netdevs` ip link set dev $NSIM_NETDEV up - echo 110 > $NSIM_DEV_DFS/ports/$port/udp_ports_inject_error + echo 110 > $NSIM_DEV_DFS/ports/$port/udp_ports/inject_error msg="1 - create VxLANs v6" exp0=( 0 0 0 0 ) @@ -663,7 +663,7 @@ for port in 0 1; do new_geneve gnv0 20000 msg="2 - destroy GENEVE" - echo 2 > $NSIM_DEV_DFS/ports/$port/udp_ports_inject_error + echo 2 > $NSIM_DEV_DFS/ports/$port/udp_ports/inject_error exp1=( `mke 20000 2` 0 0 0 ) del_dev gnv0 @@ -764,7 +764,7 @@ for port in 0 1; do msg="create VxLANs v4" new_vxlan vxlan0 10000 $NSIM_NETDEV - echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports_reset + echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports/reset check_tables msg="NIC device goes down" @@ -775,7 +775,7 @@ for port in 0 1; do fi check_tables - echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports_reset + echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports/reset check_tables msg="NIC device goes up again" @@ -789,7 +789,7 @@ for port in 0 1; do del_dev vxlan0 check_tables - echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports_reset + echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports/reset check_tables msg="destroy NIC" @@ -896,7 +896,7 @@ msg="vacate VxLAN in overflow table" exp0=( `mke 10000 1` `mke 10004 1` 0 `mke 10003 1` ) del_dev vxlan2 -echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports_reset +echo 1 > $NSIM_DEV_DFS/ports/$port/udp_ports/reset check_tables msg="tunnels destroyed 2" diff --git a/tools/testing/selftests/drivers/net/queues.py b/tools/testing/selftests/drivers/net/queues.py index 30f29096e27c..8a518905a9f9 100755 --- a/tools/testing/selftests/drivers/net/queues.py +++ b/tools/testing/selftests/drivers/net/queues.py @@ -1,32 +1,37 @@ #!/usr/bin/env python3 # SPDX-License-Identifier: GPL-2.0 -from lib.py import ksft_run, ksft_exit, ksft_eq, KsftSkipEx -from lib.py import EthtoolFamily, NetdevFamily +from lib.py import ksft_disruptive, ksft_exit, ksft_run +from lib.py import ksft_eq, ksft_raises, KsftSkipEx +from lib.py import EthtoolFamily, NetdevFamily, NlError from lib.py import NetDrvEnv -from lib.py import cmd +from lib.py import cmd, defer, ip +import errno import glob -def sys_get_queues(ifname) -> int: - folders = glob.glob(f'/sys/class/net/{ifname}/queues/rx-*') +def sys_get_queues(ifname, qtype='rx') -> int: + folders = glob.glob(f'/sys/class/net/{ifname}/queues/{qtype}-*') return len(folders) -def nl_get_queues(cfg, nl): +def nl_get_queues(cfg, nl, qtype='rx'): queues = nl.queue_get({'ifindex': cfg.ifindex}, dump=True) if queues: - return len([q for q in queues if q['type'] == 'rx']) + return len([q for q in queues if q['type'] == qtype]) return None def get_queues(cfg, nl) -> None: - queues = nl_get_queues(cfg, nl) - if not queues: - raise KsftSkipEx('queue-get not supported by device') + snl = NetdevFamily(recv_size=4096) - expected = sys_get_queues(cfg.dev['ifname']) - ksft_eq(queues, expected) + for qtype in ['rx', 'tx']: + queues = nl_get_queues(cfg, snl, qtype) + if not queues: + raise KsftSkipEx('queue-get not supported by device') + + expected = sys_get_queues(cfg.dev['ifname'], qtype) + ksft_eq(queues, expected) def addremove_queues(cfg, nl) -> None: @@ -40,10 +45,9 @@ def addremove_queues(cfg, nl) -> None: netnl = EthtoolFamily() channels = netnl.channels_get({'header': {'dev-index': cfg.ifindex}}) - if channels['combined-count'] == 0: - rx_type = 'rx' - else: - rx_type = 'combined' + rx_type = 'rx' + if channels.get('combined-count', 0) > 0: + rx_type = 'combined' expected = curr_queues - 1 cmd(f"ethtool -L {cfg.dev['ifname']} {rx_type} {expected}", timeout=10) @@ -56,9 +60,27 @@ def addremove_queues(cfg, nl) -> None: ksft_eq(queues, expected) +@ksft_disruptive +def check_down(cfg, nl) -> None: + # Check the NAPI IDs before interface goes down and hides them + napis = nl.napi_get({'ifindex': cfg.ifindex}, dump=True) + + ip(f"link set dev {cfg.dev['ifname']} down") + defer(ip, f"link set dev {cfg.dev['ifname']} up") + + with ksft_raises(NlError) as cm: + nl.queue_get({'ifindex': cfg.ifindex, 'id': 0, 'type': 'rx'}) + ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT) + + if napis: + with ksft_raises(NlError) as cm: + nl.napi_get({'id': napis[0]['id']}) + ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT) + + def main() -> None: - with NetDrvEnv(__file__, queue_count=3) as cfg: - ksft_run([get_queues, addremove_queues], args=(cfg, NetdevFamily())) + with NetDrvEnv(__file__, queue_count=100) as cfg: + ksft_run([get_queues, addremove_queues, check_down], args=(cfg, NetdevFamily())) ksft_exit() diff --git a/tools/testing/selftests/drivers/net/stats.py b/tools/testing/selftests/drivers/net/stats.py index 63e3c045a3b2..efcc1e10575b 100755 --- a/tools/testing/selftests/drivers/net/stats.py +++ b/tools/testing/selftests/drivers/net/stats.py @@ -2,12 +2,15 @@ # SPDX-License-Identifier: GPL-2.0 import errno +import subprocess +import time from lib.py import ksft_run, ksft_exit, ksft_pr -from lib.py import ksft_ge, ksft_eq, ksft_in, ksft_true, ksft_raises, KsftSkipEx, KsftXfailEx +from lib.py import ksft_ge, ksft_eq, ksft_is, ksft_in, ksft_lt, ksft_true, ksft_raises +from lib.py import KsftSkipEx, KsftXfailEx from lib.py import ksft_disruptive from lib.py import EthtoolFamily, NetdevFamily, RtnlFamily, NlError from lib.py import NetDrvEnv -from lib.py import ip, defer +from lib.py import cmd, ip, defer ethnl = EthtoolFamily() netfam = NetdevFamily() @@ -110,6 +113,23 @@ def qstat_by_ifindex(cfg) -> None: ksft_ge(triple[1][key], triple[0][key], comment="bad key: " + key) ksft_ge(triple[2][key], triple[1][key], comment="bad key: " + key) + # Sanity check the dumps + queues = NetdevFamily(recv_size=4096).qstats_get({"scope": "queue"}, dump=True) + # Reformat the output into {ifindex: {rx: [id, id, ...], tx: [id, id, ...]}} + parsed = {} + for entry in queues: + ifindex = entry["ifindex"] + if ifindex not in parsed: + parsed[ifindex] = {"rx":[], "tx": []} + parsed[ifindex][entry["queue-type"]].append(entry['queue-id']) + # Now, validate + for ifindex, queues in parsed.items(): + for qtype in ['rx', 'tx']: + ksft_eq(len(queues[qtype]), len(set(queues[qtype])), + comment="repeated queue keys") + ksft_eq(len(queues[qtype]), max(queues[qtype]) + 1, + comment="missing queue keys") + # Test invalid dumps # 0 is invalid with ksft_raises(NlError) as cm: @@ -157,10 +177,95 @@ def check_down(cfg) -> None: netfam.qstats_get({"ifindex": cfg.ifindex, "scope": "queue"}, dump=True) +def __run_inf_loop(body): + body = body.strip() + if body[-1] != ';': + body += ';' + + return subprocess.Popen(f"while true; do {body} done", shell=True, + stdout=subprocess.PIPE, stderr=subprocess.PIPE) + + +def __stats_increase_sanely(old, new) -> None: + for k in old.keys(): + ksft_ge(new[k], old[k]) + ksft_lt(new[k] - old[k], 1 << 31, comment="likely wrapping error") + + +def procfs_hammer(cfg) -> None: + """ + Reading stats via procfs only holds the RCU lock, which is not an exclusive + lock, make sure drivers can handle parallel reads of stats. + """ + one = __run_inf_loop("cat /proc/net/dev") + defer(one.kill) + two = __run_inf_loop("cat /proc/net/dev") + defer(two.kill) + + time.sleep(1) + # Make sure the processes are running + ksft_is(one.poll(), None) + ksft_is(two.poll(), None) + + rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64'] + time.sleep(2) + rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64'] + __stats_increase_sanely(rtstat1, rtstat2) + # defers will kill the loops + + +@ksft_disruptive +def procfs_downup_hammer(cfg) -> None: + """ + Reading stats via procfs only holds the RCU lock, drivers often try + to sleep when reading the stats, or don't protect against races. + """ + # Max out the queues, we'll flip between max and 1 + channels = ethnl.channels_get({'header': {'dev-index': cfg.ifindex}}) + if channels['combined-count'] == 0: + rx_type = 'rx' + else: + rx_type = 'combined' + cur_queue_cnt = channels[f'{rx_type}-count'] + max_queue_cnt = channels[f'{rx_type}-max'] + + cmd(f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}") + defer(cmd, f"ethtool -L {cfg.ifname} {rx_type} {cur_queue_cnt}") + + # Real test stats + stats = __run_inf_loop("cat /proc/net/dev") + defer(stats.kill) + + ipset = f"ip link set dev {cfg.ifname}" + defer(ip, f"link set dev {cfg.ifname} up") + # The "echo -n 1" lets us count iterations below + updown = f"{ipset} down; sleep 0.05; {ipset} up; sleep 0.05; " + \ + f"ethtool -L {cfg.ifname} {rx_type} 1; " + \ + f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}; " + \ + "echo -n 1" + updown = __run_inf_loop(updown) + kill_updown = defer(updown.kill) + + time.sleep(1) + # Make sure the processes are running + ksft_is(stats.poll(), None) + ksft_is(updown.poll(), None) + + rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64'] + # We're looking for crashes, give it extra time + time.sleep(9) + rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64'] + __stats_increase_sanely(rtstat1, rtstat2) + + kill_updown.exec() + stdout, _ = updown.communicate(timeout=5) + ksft_pr("completed up/down cycles:", len(stdout.decode('utf-8'))) + + def main() -> None: - with NetDrvEnv(__file__) as cfg: + with NetDrvEnv(__file__, queue_count=100) as cfg: ksft_run([check_pause, check_fec, pkt_byte_sum, qstat_by_ifindex, - check_down], + check_down, procfs_hammer, procfs_downup_hammer], args=(cfg, )) ksft_exit() diff --git a/tools/testing/selftests/drivers/ntsync/.gitignore b/tools/testing/selftests/drivers/ntsync/.gitignore new file mode 100644 index 000000000000..848573a3d3ea --- /dev/null +++ b/tools/testing/selftests/drivers/ntsync/.gitignore @@ -0,0 +1 @@ +ntsync diff --git a/tools/testing/selftests/drivers/ntsync/Makefile b/tools/testing/selftests/drivers/ntsync/Makefile new file mode 100644 index 000000000000..dbf2b055c0b2 --- /dev/null +++ b/tools/testing/selftests/drivers/ntsync/Makefile @@ -0,0 +1,7 @@ +# SPDX-LICENSE-IDENTIFIER: GPL-2.0-only +TEST_GEN_PROGS := ntsync + +CFLAGS += $(KHDR_INCLUDES) +LDLIBS += -lpthread + +include ../../lib.mk diff --git a/tools/testing/selftests/drivers/ntsync/config b/tools/testing/selftests/drivers/ntsync/config new file mode 100644 index 000000000000..60539c826d06 --- /dev/null +++ b/tools/testing/selftests/drivers/ntsync/config @@ -0,0 +1 @@ +CONFIG_WINESYNC=y diff --git a/tools/testing/selftests/drivers/ntsync/ntsync.c b/tools/testing/selftests/drivers/ntsync/ntsync.c new file mode 100644 index 000000000000..3aad311574c4 --- /dev/null +++ b/tools/testing/selftests/drivers/ntsync/ntsync.c @@ -0,0 +1,1343 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +/* + * Various unit tests for the "ntsync" synchronization primitive driver. + * + * Copyright (C) 2021-2022 Elizabeth Figura <zfigura@codeweavers.com> + */ + +#define _GNU_SOURCE +#include <sys/ioctl.h> +#include <sys/stat.h> +#include <fcntl.h> +#include <time.h> +#include <pthread.h> +#include <linux/ntsync.h> +#include "../../kselftest_harness.h" + +static int read_sem_state(int sem, __u32 *count, __u32 *max) +{ + struct ntsync_sem_args args; + int ret; + + memset(&args, 0xcc, sizeof(args)); + ret = ioctl(sem, NTSYNC_IOC_SEM_READ, &args); + *count = args.count; + *max = args.max; + return ret; +} + +#define check_sem_state(sem, count, max) \ + ({ \ + __u32 __count, __max; \ + int ret = read_sem_state((sem), &__count, &__max); \ + EXPECT_EQ(0, ret); \ + EXPECT_EQ((count), __count); \ + EXPECT_EQ((max), __max); \ + }) + +static int release_sem(int sem, __u32 *count) +{ + return ioctl(sem, NTSYNC_IOC_SEM_RELEASE, count); +} + +static int read_mutex_state(int mutex, __u32 *count, __u32 *owner) +{ + struct ntsync_mutex_args args; + int ret; + + memset(&args, 0xcc, sizeof(args)); + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_READ, &args); + *count = args.count; + *owner = args.owner; + return ret; +} + +#define check_mutex_state(mutex, count, owner) \ + ({ \ + __u32 __count, __owner; \ + int ret = read_mutex_state((mutex), &__count, &__owner); \ + EXPECT_EQ(0, ret); \ + EXPECT_EQ((count), __count); \ + EXPECT_EQ((owner), __owner); \ + }) + +static int unlock_mutex(int mutex, __u32 owner, __u32 *count) +{ + struct ntsync_mutex_args args; + int ret; + + args.owner = owner; + args.count = 0xdeadbeef; + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_UNLOCK, &args); + *count = args.count; + return ret; +} + +static int read_event_state(int event, __u32 *signaled, __u32 *manual) +{ + struct ntsync_event_args args; + int ret; + + memset(&args, 0xcc, sizeof(args)); + ret = ioctl(event, NTSYNC_IOC_EVENT_READ, &args); + *signaled = args.signaled; + *manual = args.manual; + return ret; +} + +#define check_event_state(event, signaled, manual) \ + ({ \ + __u32 __signaled, __manual; \ + int ret = read_event_state((event), &__signaled, &__manual); \ + EXPECT_EQ(0, ret); \ + EXPECT_EQ((signaled), __signaled); \ + EXPECT_EQ((manual), __manual); \ + }) + +static int wait_objs(int fd, unsigned long request, __u32 count, + const int *objs, __u32 owner, int alert, __u32 *index) +{ + struct ntsync_wait_args args = {0}; + struct timespec timeout; + int ret; + + clock_gettime(CLOCK_MONOTONIC, &timeout); + + args.timeout = timeout.tv_sec * 1000000000 + timeout.tv_nsec; + args.count = count; + args.objs = (uintptr_t)objs; + args.owner = owner; + args.index = 0xdeadbeef; + args.alert = alert; + ret = ioctl(fd, request, &args); + *index = args.index; + return ret; +} + +static int wait_any(int fd, __u32 count, const int *objs, __u32 owner, __u32 *index) +{ + return wait_objs(fd, NTSYNC_IOC_WAIT_ANY, count, objs, owner, 0, index); +} + +static int wait_all(int fd, __u32 count, const int *objs, __u32 owner, __u32 *index) +{ + return wait_objs(fd, NTSYNC_IOC_WAIT_ALL, count, objs, owner, 0, index); +} + +static int wait_any_alert(int fd, __u32 count, const int *objs, + __u32 owner, int alert, __u32 *index) +{ + return wait_objs(fd, NTSYNC_IOC_WAIT_ANY, + count, objs, owner, alert, index); +} + +static int wait_all_alert(int fd, __u32 count, const int *objs, + __u32 owner, int alert, __u32 *index) +{ + return wait_objs(fd, NTSYNC_IOC_WAIT_ALL, + count, objs, owner, alert, index); +} + +TEST(semaphore_state) +{ + struct ntsync_sem_args sem_args; + struct timespec timeout; + __u32 count, index; + int fd, ret, sem; + + clock_gettime(CLOCK_MONOTONIC, &timeout); + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 3; + sem_args.max = 2; + sem = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_EQ(-1, sem); + EXPECT_EQ(EINVAL, errno); + + sem_args.count = 2; + sem_args.max = 2; + sem = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, sem); + check_sem_state(sem, 2, 2); + + count = 0; + ret = release_sem(sem, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, count); + check_sem_state(sem, 2, 2); + + count = 1; + ret = release_sem(sem, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOVERFLOW, errno); + check_sem_state(sem, 2, 2); + + ret = wait_any(fd, 1, &sem, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(sem, 1, 2); + + ret = wait_any(fd, 1, &sem, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(sem, 0, 2); + + ret = wait_any(fd, 1, &sem, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + count = 3; + ret = release_sem(sem, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOVERFLOW, errno); + check_sem_state(sem, 0, 2); + + count = 2; + ret = release_sem(sem, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + check_sem_state(sem, 2, 2); + + ret = wait_any(fd, 1, &sem, 123, &index); + EXPECT_EQ(0, ret); + ret = wait_any(fd, 1, &sem, 123, &index); + EXPECT_EQ(0, ret); + + count = 1; + ret = release_sem(sem, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + check_sem_state(sem, 1, 2); + + count = ~0u; + ret = release_sem(sem, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOVERFLOW, errno); + check_sem_state(sem, 1, 2); + + close(sem); + + close(fd); +} + +TEST(mutex_state) +{ + struct ntsync_mutex_args mutex_args; + __u32 owner, count, index; + struct timespec timeout; + int fd, ret, mutex; + + clock_gettime(CLOCK_MONOTONIC, &timeout); + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + mutex_args.owner = 123; + mutex_args.count = 0; + mutex = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_EQ(-1, mutex); + EXPECT_EQ(EINVAL, errno); + + mutex_args.owner = 0; + mutex_args.count = 2; + mutex = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_EQ(-1, mutex); + EXPECT_EQ(EINVAL, errno); + + mutex_args.owner = 123; + mutex_args.count = 2; + mutex = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, mutex); + check_mutex_state(mutex, 2, 123); + + ret = unlock_mutex(mutex, 0, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EINVAL, errno); + + ret = unlock_mutex(mutex, 456, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EPERM, errno); + check_mutex_state(mutex, 2, 123); + + ret = unlock_mutex(mutex, 123, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, count); + check_mutex_state(mutex, 1, 123); + + ret = unlock_mutex(mutex, 123, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, count); + check_mutex_state(mutex, 0, 0); + + ret = unlock_mutex(mutex, 123, &count); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EPERM, errno); + + ret = wait_any(fd, 1, &mutex, 456, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_mutex_state(mutex, 1, 456); + + ret = wait_any(fd, 1, &mutex, 456, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_mutex_state(mutex, 2, 456); + + ret = unlock_mutex(mutex, 456, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, count); + check_mutex_state(mutex, 1, 456); + + ret = wait_any(fd, 1, &mutex, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + owner = 0; + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EINVAL, errno); + + owner = 123; + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EPERM, errno); + check_mutex_state(mutex, 1, 456); + + owner = 456; + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(0, ret); + + memset(&mutex_args, 0xcc, sizeof(mutex_args)); + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_READ, &mutex_args); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(0, mutex_args.count); + EXPECT_EQ(0, mutex_args.owner); + + memset(&mutex_args, 0xcc, sizeof(mutex_args)); + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_READ, &mutex_args); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(0, mutex_args.count); + EXPECT_EQ(0, mutex_args.owner); + + ret = wait_any(fd, 1, &mutex, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(0, index); + check_mutex_state(mutex, 1, 123); + + owner = 123; + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(0, ret); + + memset(&mutex_args, 0xcc, sizeof(mutex_args)); + ret = ioctl(mutex, NTSYNC_IOC_MUTEX_READ, &mutex_args); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(0, mutex_args.count); + EXPECT_EQ(0, mutex_args.owner); + + ret = wait_any(fd, 1, &mutex, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(0, index); + check_mutex_state(mutex, 1, 123); + + close(mutex); + + mutex_args.owner = 0; + mutex_args.count = 0; + mutex = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, mutex); + check_mutex_state(mutex, 0, 0); + + ret = wait_any(fd, 1, &mutex, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_mutex_state(mutex, 1, 123); + + close(mutex); + + mutex_args.owner = 123; + mutex_args.count = ~0u; + mutex = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, mutex); + check_mutex_state(mutex, ~0u, 123); + + ret = wait_any(fd, 1, &mutex, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + close(mutex); + + close(fd); +} + +TEST(manual_event_state) +{ + struct ntsync_event_args event_args; + __u32 index, signaled; + int fd, event, ret; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + event_args.manual = 1; + event_args.signaled = 0; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + check_event_state(event, 0, 1); + + signaled = 0xdeadbeef; + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(event, 1, 1); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + check_event_state(event, 1, 1); + + ret = wait_any(fd, 1, &event, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_event_state(event, 1, 1); + + signaled = 0xdeadbeef; + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + check_event_state(event, 0, 1); + + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(event, 0, 1); + + ret = wait_any(fd, 1, &event, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + + ret = ioctl(event, NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + check_event_state(event, 0, 1); + + ret = ioctl(event, NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(event, 0, 1); + + close(event); + + close(fd); +} + +TEST(auto_event_state) +{ + struct ntsync_event_args event_args; + __u32 index, signaled; + int fd, event, ret; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + event_args.manual = 0; + event_args.signaled = 1; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + + check_event_state(event, 1, 0); + + signaled = 0xdeadbeef; + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + check_event_state(event, 1, 0); + + ret = wait_any(fd, 1, &event, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_event_state(event, 0, 0); + + signaled = 0xdeadbeef; + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(event, 0, 0); + + ret = wait_any(fd, 1, &event, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + + ret = ioctl(event, NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + check_event_state(event, 0, 0); + + ret = ioctl(event, NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(event, 0, 0); + + close(event); + + close(fd); +} + +TEST(test_wait_any) +{ + int objs[NTSYNC_MAX_WAIT_COUNT + 1], fd, ret; + struct ntsync_mutex_args mutex_args = {0}; + struct ntsync_sem_args sem_args = {0}; + __u32 owner, index, count, i; + struct timespec timeout; + + clock_gettime(CLOCK_MONOTONIC, &timeout); + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 2; + sem_args.max = 3; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + mutex_args.owner = 0; + mutex_args.count = 0; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, objs[1]); + + ret = wait_any(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 1, 3); + check_mutex_state(objs[1], 0, 0); + + ret = wait_any(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 0, 0); + + ret = wait_any(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, index); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 1, 123); + + count = 1; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + + ret = wait_any(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 1, 123); + + ret = wait_any(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, index); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 2, 123); + + ret = wait_any(fd, 2, objs, 456, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + owner = 123; + ret = ioctl(objs[1], NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(0, ret); + + ret = wait_any(fd, 2, objs, 456, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + EXPECT_EQ(1, index); + + ret = wait_any(fd, 2, objs, 456, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, index); + + close(objs[1]); + + /* test waiting on the same object twice */ + + count = 2; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + + objs[1] = objs[0]; + ret = wait_any(fd, 2, objs, 456, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 1, 3); + + ret = wait_any(fd, 0, NULL, 456, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + for (i = 1; i < NTSYNC_MAX_WAIT_COUNT + 1; ++i) + objs[i] = objs[0]; + + ret = wait_any(fd, NTSYNC_MAX_WAIT_COUNT, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = wait_any(fd, NTSYNC_MAX_WAIT_COUNT + 1, objs, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EINVAL, errno); + + ret = wait_any(fd, -1, objs, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EINVAL, errno); + + close(objs[0]); + + close(fd); +} + +TEST(test_wait_all) +{ + struct ntsync_event_args event_args = {0}; + struct ntsync_mutex_args mutex_args = {0}; + struct ntsync_sem_args sem_args = {0}; + __u32 owner, index, count; + int objs[2], fd, ret; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 2; + sem_args.max = 3; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + mutex_args.owner = 0; + mutex_args.count = 0; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, objs[1]); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 1, 3); + check_mutex_state(objs[1], 1, 123); + + ret = wait_all(fd, 2, objs, 456, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + check_sem_state(objs[0], 1, 3); + check_mutex_state(objs[1], 1, 123); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 2, 123); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + check_sem_state(objs[0], 0, 3); + check_mutex_state(objs[1], 2, 123); + + count = 3; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 2, 3); + check_mutex_state(objs[1], 3, 123); + + owner = 123; + ret = ioctl(objs[1], NTSYNC_IOC_MUTEX_KILL, &owner); + EXPECT_EQ(0, ret); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EOWNERDEAD, errno); + check_sem_state(objs[0], 1, 3); + check_mutex_state(objs[1], 1, 123); + + close(objs[1]); + + event_args.manual = true; + event_args.signaled = true; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, objs[1]); + + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + check_sem_state(objs[0], 0, 3); + check_event_state(objs[1], 1, 1); + + close(objs[1]); + + /* test waiting on the same object twice */ + objs[1] = objs[0]; + ret = wait_all(fd, 2, objs, 123, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(EINVAL, errno); + + close(objs[0]); + + close(fd); +} + +struct wake_args { + int fd; + int obj; +}; + +struct wait_args { + int fd; + unsigned long request; + struct ntsync_wait_args *args; + int ret; + int err; +}; + +static void *wait_thread(void *arg) +{ + struct wait_args *args = arg; + + args->ret = ioctl(args->fd, args->request, args->args); + args->err = errno; + return NULL; +} + +static __u64 get_abs_timeout(unsigned int ms) +{ + struct timespec timeout; + clock_gettime(CLOCK_MONOTONIC, &timeout); + return (timeout.tv_sec * 1000000000) + timeout.tv_nsec + (ms * 1000000); +} + +static int wait_for_thread(pthread_t thread, unsigned int ms) +{ + struct timespec timeout; + + clock_gettime(CLOCK_REALTIME, &timeout); + timeout.tv_nsec += ms * 1000000; + timeout.tv_sec += (timeout.tv_nsec / 1000000000); + timeout.tv_nsec %= 1000000000; + return pthread_timedjoin_np(thread, NULL, &timeout); +} + +TEST(wake_any) +{ + struct ntsync_event_args event_args = {0}; + struct ntsync_mutex_args mutex_args = {0}; + struct ntsync_wait_args wait_args = {0}; + struct ntsync_sem_args sem_args = {0}; + struct wait_args thread_args; + __u32 count, index, signaled; + int objs[2], fd, ret; + pthread_t thread; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 0; + sem_args.max = 3; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + mutex_args.owner = 123; + mutex_args.count = 1; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, objs[1]); + + /* test waking the semaphore */ + + wait_args.timeout = get_abs_timeout(1000); + wait_args.objs = (uintptr_t)objs; + wait_args.count = 2; + wait_args.owner = 456; + wait_args.index = 0xdeadbeef; + thread_args.fd = fd; + thread_args.args = &wait_args; + thread_args.request = NTSYNC_IOC_WAIT_ANY; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + count = 1; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + check_sem_state(objs[0], 0, 3); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(0, wait_args.index); + + /* test waking the mutex */ + + /* first grab it again for owner 123 */ + ret = wait_any(fd, 1, &objs[1], 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + wait_args.timeout = get_abs_timeout(1000); + wait_args.owner = 456; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = unlock_mutex(objs[1], 123, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, count); + + ret = pthread_tryjoin_np(thread, NULL); + EXPECT_EQ(EBUSY, ret); + + ret = unlock_mutex(objs[1], 123, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, mutex_args.count); + check_mutex_state(objs[1], 1, 456); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(1, wait_args.index); + + close(objs[1]); + + /* test waking events */ + + event_args.manual = false; + event_args.signaled = false; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, objs[1]); + + wait_args.timeout = get_abs_timeout(1000); + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(objs[1], NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(objs[1], 0, 0); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(1, wait_args.index); + + wait_args.timeout = get_abs_timeout(1000); + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(objs[1], NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(objs[1], 0, 0); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(1, wait_args.index); + + close(objs[1]); + + event_args.manual = true; + event_args.signaled = false; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, objs[1]); + + wait_args.timeout = get_abs_timeout(1000); + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(objs[1], NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(objs[1], 1, 1); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(1, wait_args.index); + + ret = ioctl(objs[1], NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + + wait_args.timeout = get_abs_timeout(1000); + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(objs[1], NTSYNC_IOC_EVENT_PULSE, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + check_event_state(objs[1], 0, 1); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(1, wait_args.index); + + /* delete an object while it's being waited on */ + + wait_args.timeout = get_abs_timeout(200); + wait_args.owner = 123; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + close(objs[0]); + close(objs[1]); + + ret = wait_for_thread(thread, 200); + EXPECT_EQ(0, ret); + EXPECT_EQ(-1, thread_args.ret); + EXPECT_EQ(ETIMEDOUT, thread_args.err); + + close(fd); +} + +TEST(wake_all) +{ + struct ntsync_event_args manual_event_args = {0}; + struct ntsync_event_args auto_event_args = {0}; + struct ntsync_mutex_args mutex_args = {0}; + struct ntsync_wait_args wait_args = {0}; + struct ntsync_sem_args sem_args = {0}; + struct wait_args thread_args; + __u32 count, index, signaled; + int objs[4], fd, ret; + pthread_t thread; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 0; + sem_args.max = 3; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + mutex_args.owner = 123; + mutex_args.count = 1; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, objs[1]); + + manual_event_args.manual = true; + manual_event_args.signaled = true; + objs[2] = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &manual_event_args); + EXPECT_LE(0, objs[2]); + + auto_event_args.manual = false; + auto_event_args.signaled = true; + objs[3] = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &auto_event_args); + EXPECT_EQ(0, objs[3]); + + wait_args.timeout = get_abs_timeout(1000); + wait_args.objs = (uintptr_t)objs; + wait_args.count = 4; + wait_args.owner = 456; + thread_args.fd = fd; + thread_args.args = &wait_args; + thread_args.request = NTSYNC_IOC_WAIT_ALL; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + count = 1; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + + ret = pthread_tryjoin_np(thread, NULL); + EXPECT_EQ(EBUSY, ret); + + check_sem_state(objs[0], 1, 3); + + ret = wait_any(fd, 1, &objs[0], 123, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = unlock_mutex(objs[1], 123, &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, count); + + ret = pthread_tryjoin_np(thread, NULL); + EXPECT_EQ(EBUSY, ret); + + check_mutex_state(objs[1], 0, 0); + + ret = ioctl(objs[2], NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + + count = 2; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, count); + check_sem_state(objs[0], 2, 3); + + ret = ioctl(objs[3], NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, signaled); + + ret = ioctl(objs[2], NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + + ret = ioctl(objs[3], NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, signaled); + + check_sem_state(objs[0], 1, 3); + check_mutex_state(objs[1], 1, 456); + check_event_state(objs[2], 1, 1); + check_event_state(objs[3], 0, 0); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + + /* delete an object while it's being waited on */ + + wait_args.timeout = get_abs_timeout(200); + wait_args.owner = 123; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + close(objs[0]); + close(objs[1]); + close(objs[2]); + close(objs[3]); + + ret = wait_for_thread(thread, 200); + EXPECT_EQ(0, ret); + EXPECT_EQ(-1, thread_args.ret); + EXPECT_EQ(ETIMEDOUT, thread_args.err); + + close(fd); +} + +TEST(alert_any) +{ + struct ntsync_event_args event_args = {0}; + struct ntsync_wait_args wait_args = {0}; + struct ntsync_sem_args sem_args = {0}; + __u32 index, count, signaled; + struct wait_args thread_args; + int objs[2], event, fd, ret; + pthread_t thread; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 0; + sem_args.max = 2; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + sem_args.count = 1; + sem_args.max = 2; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[1]); + + event_args.manual = true; + event_args.signaled = true; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + + ret = wait_any_alert(fd, 0, NULL, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + + ret = wait_any_alert(fd, 0, NULL, 123, event, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + + ret = wait_any_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(1, index); + + ret = wait_any_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, index); + + /* test wakeup via alert */ + + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + + wait_args.timeout = get_abs_timeout(1000); + wait_args.objs = (uintptr_t)objs; + wait_args.count = 2; + wait_args.owner = 123; + wait_args.index = 0xdeadbeef; + wait_args.alert = event; + thread_args.fd = fd; + thread_args.args = &wait_args; + thread_args.request = NTSYNC_IOC_WAIT_ANY; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(2, wait_args.index); + + close(event); + + /* test with an auto-reset event */ + + event_args.manual = false; + event_args.signaled = true; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + + count = 1; + ret = release_sem(objs[0], &count); + EXPECT_EQ(0, ret); + + ret = wait_any_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = wait_any_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, index); + + ret = wait_any_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + close(event); + + close(objs[0]); + close(objs[1]); + + close(fd); +} + +TEST(alert_all) +{ + struct ntsync_event_args event_args = {0}; + struct ntsync_wait_args wait_args = {0}; + struct ntsync_sem_args sem_args = {0}; + struct wait_args thread_args; + __u32 index, count, signaled; + int objs[2], event, fd, ret; + pthread_t thread; + + fd = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd); + + sem_args.count = 2; + sem_args.max = 2; + objs[0] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[0]); + + sem_args.count = 1; + sem_args.max = 2; + objs[1] = ioctl(fd, NTSYNC_IOC_CREATE_SEM, &sem_args); + EXPECT_LE(0, objs[1]); + + event_args.manual = true; + event_args.signaled = true; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + + ret = wait_all_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = wait_all_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, index); + + /* test wakeup via alert */ + + ret = ioctl(event, NTSYNC_IOC_EVENT_RESET, &signaled); + EXPECT_EQ(0, ret); + + wait_args.timeout = get_abs_timeout(1000); + wait_args.objs = (uintptr_t)objs; + wait_args.count = 2; + wait_args.owner = 123; + wait_args.index = 0xdeadbeef; + wait_args.alert = event; + thread_args.fd = fd; + thread_args.args = &wait_args; + thread_args.request = NTSYNC_IOC_WAIT_ALL; + ret = pthread_create(&thread, NULL, wait_thread, &thread_args); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(ETIMEDOUT, ret); + + ret = ioctl(event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + + ret = wait_for_thread(thread, 100); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, thread_args.ret); + EXPECT_EQ(2, wait_args.index); + + close(event); + + /* test with an auto-reset event */ + + event_args.manual = false; + event_args.signaled = true; + event = ioctl(fd, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, event); + + count = 2; + ret = release_sem(objs[1], &count); + EXPECT_EQ(0, ret); + + ret = wait_all_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(0, index); + + ret = wait_all_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(0, ret); + EXPECT_EQ(2, index); + + ret = wait_all_alert(fd, 2, objs, 123, event, &index); + EXPECT_EQ(-1, ret); + EXPECT_EQ(ETIMEDOUT, errno); + + close(event); + + close(objs[0]); + close(objs[1]); + + close(fd); +} + +#define STRESS_LOOPS 10000 +#define STRESS_THREADS 4 + +static unsigned int stress_counter; +static int stress_device, stress_start_event, stress_mutex; + +static void *stress_thread(void *arg) +{ + struct ntsync_wait_args wait_args = {0}; + __u32 index, count, i; + int ret; + + wait_args.timeout = UINT64_MAX; + wait_args.count = 1; + wait_args.objs = (uintptr_t)&stress_start_event; + wait_args.owner = gettid(); + wait_args.index = 0xdeadbeef; + + ioctl(stress_device, NTSYNC_IOC_WAIT_ANY, &wait_args); + + wait_args.objs = (uintptr_t)&stress_mutex; + + for (i = 0; i < STRESS_LOOPS; ++i) { + ioctl(stress_device, NTSYNC_IOC_WAIT_ANY, &wait_args); + + ++stress_counter; + + unlock_mutex(stress_mutex, wait_args.owner, &count); + } + + return NULL; +} + +TEST(stress_wait) +{ + struct ntsync_event_args event_args; + struct ntsync_mutex_args mutex_args; + pthread_t threads[STRESS_THREADS]; + __u32 signaled, i; + int ret; + + stress_device = open("/dev/ntsync", O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, stress_device); + + mutex_args.owner = 0; + mutex_args.count = 0; + stress_mutex = ioctl(stress_device, NTSYNC_IOC_CREATE_MUTEX, &mutex_args); + EXPECT_LE(0, stress_mutex); + + event_args.manual = 1; + event_args.signaled = 0; + stress_start_event = ioctl(stress_device, NTSYNC_IOC_CREATE_EVENT, &event_args); + EXPECT_LE(0, stress_start_event); + + for (i = 0; i < STRESS_THREADS; ++i) + pthread_create(&threads[i], NULL, stress_thread, NULL); + + ret = ioctl(stress_start_event, NTSYNC_IOC_EVENT_SET, &signaled); + EXPECT_EQ(0, ret); + + for (i = 0; i < STRESS_THREADS; ++i) { + ret = pthread_join(threads[i], NULL); + EXPECT_EQ(0, ret); + } + + EXPECT_EQ(STRESS_LOOPS * STRESS_THREADS, stress_counter); + + close(stress_start_event); + close(stress_mutex); + close(stress_device); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/efivarfs/efivarfs.sh b/tools/testing/selftests/efivarfs/efivarfs.sh index d374878cc0ba..c62544b966ae 100755 --- a/tools/testing/selftests/efivarfs/efivarfs.sh +++ b/tools/testing/selftests/efivarfs/efivarfs.sh @@ -76,11 +76,11 @@ test_create_empty() : > $file - if [ ! -e $file ]; then - echo "$file can not be created without writing" >&2 + if [ -e $file ]; then + echo "$file can be created without writing" >&2 + file_cleanup $file exit 1 fi - file_cleanup $file } test_create_read() @@ -89,10 +89,13 @@ test_create_read() ./create-read $file if [ $? -ne 0 ]; then echo "create and read $file failed" + exit 1 + fi + if [ -e $file ]; then + echo "file still exists and should not" file_cleanup $file exit 1 fi - file_cleanup $file } test_delete() @@ -202,6 +205,158 @@ test_invalid_filenames() exit $ret } +test_no_set_size() +{ + local attrs='\x07\x00\x00\x00' + local file=$efivarfs_mount/$FUNCNAME-$test_guid + local ret=0 + + printf "$attrs\x00" > $file + [ -e $file -a -s $file ] || exit 1 + chattr -i $file + : > $file + if [ $? != 0 ]; then + echo "variable file failed to accept truncation" + ret=1 + elif [ -e $file -a ! -s $file ]; then + echo "file can be truncated to zero size" + ret=1 + fi + rm $file || exit 1 + + exit $ret +} + +setup_test_multiple() +{ + ## + # we're going to do multi-threaded tests, so create a set of + # pipes for synchronization. We use pipes 1..3 to start the + # stalled shell job and pipes 4..6 as indicators that the job + # has started. If you need more than 3 jobs the two +3's below + # need increasing + ## + + declare -ag p + + # empty is because arrays number from 0 but jobs number from 1 + p[0]="" + + for f in 1 2 3 4 5 6; do + p[$f]=/tmp/efivarfs_pipe${f} + mknod ${p[$f]} p + done + + declare -g var=$efivarfs_mount/test_multiple-$test_guid + + cleanup() { + for f in ${p[@]}; do + rm -f ${f} + done + if [ -e $var ]; then + file_cleanup $var + fi + } + trap cleanup exit + + waitstart() { + cat ${p[$[$1+3]]} > /dev/null + } + + waitpipe() { + echo 1 > ${p[$[$1+3]]} + cat ${p[$1]} > /dev/null + } + + endjob() { + echo 1 > ${p[$1]} + wait -n %$1 + } +} + +test_multiple_zero_size() +{ + ## + # check for remove on last close, set up three threads all + # holding the variable (one write and two reads) and then + # close them sequentially (waiting for completion) and check + # the state of the variable + ## + + { waitpipe 1; echo 1; } > $var 2> /dev/null & + waitstart 1 + # zero length file should exist + [ -e $var ] || exit 1 + # second and third delayed close + { waitpipe 2; } < $var & + waitstart 2 + { waitpipe 3; } < $var & + waitstart 3 + # close first fd + endjob 1 + # var should only be deleted on last close + [ -e $var ] || exit 1 + # close second fd + endjob 2 + [ -e $var ] || exit 1 + # file should go on last close + endjob 3 + [ ! -e $var ] || exit 1 +} + +test_multiple_create() +{ + ## + # set multiple threads to access the variable but delay + # the final write to check the close of 2 and 3. The + # final write should succeed in creating the variable + ## + { waitpipe 1; printf '\x07\x00\x00\x00\x54'; } > $var & + waitstart 1 + [ -e $var -a ! -s $var ] || exit 1 + { waitpipe 2; } < $var & + waitstart 2 + { waitpipe 3; } < $var & + waitstart 3 + # close second and third fds + endjob 2 + # var should only be created (have size) on last close + [ -e $var -a ! -s $var ] || exit 1 + endjob 3 + [ -e $var -a ! -s $var ] || exit 1 + # close first fd + endjob 1 + # variable should still exist + [ -s $var ] || exit 1 + file_cleanup $var +} + +test_multiple_delete_on_write() { + ## + # delete the variable on final write; seqencing similar + # to test_multiple_create() + ## + printf '\x07\x00\x00\x00\x54' > $var + chattr -i $var + { waitpipe 1; printf '\x07\x00\x00\x00'; } > $var & + waitstart 1 + [ -e $var -a -s $var ] || exit 1 + { waitpipe 2; } < $var & + waitstart 2 + { waitpipe 3; } < $var & + waitstart 3 + # close first fd; write should set variable size to zero + endjob 1 + # var should only be deleted on last close + [ -e $var -a ! -s $var ] || exit 1 + endjob 2 + [ -e $var ] || exit 1 + # close last fd + endjob 3 + # variable should now be removed + [ ! -e $var ] || exit 1 +} + check_prereqs rc=0 @@ -214,5 +369,10 @@ run_test test_zero_size_delete run_test test_open_unlink run_test test_valid_filenames run_test test_invalid_filenames +run_test test_no_set_size +setup_test_multiple +run_test test_multiple_zero_size +run_test test_multiple_create +run_test test_multiple_delete_on_write exit $rc diff --git a/tools/testing/selftests/exec/.gitignore b/tools/testing/selftests/exec/.gitignore index a0dc5d4bf733..7f3d1ae762ec 100644 --- a/tools/testing/selftests/exec/.gitignore +++ b/tools/testing/selftests/exec/.gitignore @@ -9,9 +9,13 @@ execveat.ephemeral execveat.denatured non-regular null-argv +/check-exec +/false +/inc /load_address.* !load_address.c /recursion-depth +/set-exec xxxxxxxx* pipe S_I*.test diff --git a/tools/testing/selftests/exec/Makefile b/tools/testing/selftests/exec/Makefile index ba012bc5aab9..45a3cfc435cf 100644 --- a/tools/testing/selftests/exec/Makefile +++ b/tools/testing/selftests/exec/Makefile @@ -1,26 +1,33 @@ # SPDX-License-Identifier: GPL-2.0 CFLAGS = -Wall CFLAGS += -Wno-nonnull +CFLAGS += $(KHDR_INCLUDES) + +LDLIBS += -lcap ALIGNS := 0x1000 0x200000 0x1000000 ALIGN_PIES := $(patsubst %,load_address.%,$(ALIGNS)) ALIGN_STATIC_PIES := $(patsubst %,load_address.static.%,$(ALIGNS)) ALIGNMENT_TESTS := $(ALIGN_PIES) $(ALIGN_STATIC_PIES) -TEST_PROGS := binfmt_script.py +TEST_PROGS := binfmt_script.py check-exec-tests.sh TEST_GEN_PROGS := execveat non-regular $(ALIGNMENT_TESTS) +TEST_GEN_PROGS_EXTENDED := false inc set-exec script-exec.inc script-noexec.inc TEST_GEN_FILES := execveat.symlink execveat.denatured script subdir # Makefile is a run-time dependency, since it's accessed by the execveat test TEST_FILES := Makefile TEST_GEN_PROGS += recursion-depth TEST_GEN_PROGS += null-argv +TEST_GEN_PROGS += check-exec EXTRA_CLEAN := $(OUTPUT)/subdir.moved $(OUTPUT)/execveat.moved $(OUTPUT)/xxxxx* \ $(OUTPUT)/S_I*.test include ../lib.mk +CHECK_EXEC_SAMPLES := $(top_srcdir)/samples/check-exec + $(OUTPUT)/subdir: mkdir -p $@ $(OUTPUT)/script: Makefile @@ -38,3 +45,13 @@ $(OUTPUT)/load_address.0x%: load_address.c $(OUTPUT)/load_address.static.0x%: load_address.c $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \ -fPIE -static-pie $< -o $@ +$(OUTPUT)/false: false.c + $(CC) $(CFLAGS) $(LDFLAGS) -static $< -o $@ +$(OUTPUT)/inc: $(CHECK_EXEC_SAMPLES)/inc.c + $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@ +$(OUTPUT)/set-exec: $(CHECK_EXEC_SAMPLES)/set-exec.c + $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@ +$(OUTPUT)/script-exec.inc: $(CHECK_EXEC_SAMPLES)/script-exec.inc + cp $< $@ +$(OUTPUT)/script-noexec.inc: $(CHECK_EXEC_SAMPLES)/script-noexec.inc + cp $< $@ diff --git a/tools/testing/selftests/exec/check-exec-tests.sh b/tools/testing/selftests/exec/check-exec-tests.sh new file mode 100755 index 000000000000..87102906ae3c --- /dev/null +++ b/tools/testing/selftests/exec/check-exec-tests.sh @@ -0,0 +1,205 @@ +#!/usr/bin/env bash +# SPDX-License-Identifier: GPL-2.0 +# +# Test the "inc" interpreter. +# +# See include/uapi/linux/securebits.h, include/uapi/linux/fcntl.h and +# samples/check-exec/inc.c +# +# Copyright © 2024 Microsoft Corporation + +set -u -e -o pipefail + +EXPECTED_OUTPUT="1" +exec 2>/dev/null + +DIR="$(dirname $(readlink -f "$0"))" +source "${DIR}"/../kselftest/ktap_helpers.sh + +exec_direct() { + local expect="$1" + local script="$2" + shift 2 + local ret=0 + local out + + # Updates PATH for `env` to execute the `inc` interpreter. + out="$(PATH="." "$@" "${script}")" || ret=$? + + if [[ ${ret} -ne ${expect} ]]; then + echo "ERROR: Wrong expectation for direct file execution: ${ret}" + return 1 + fi + if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then + echo "ERROR: Wrong output for direct file execution: ${out}" + return 1 + fi +} + +exec_indirect() { + local expect="$1" + local script="$2" + shift 2 + local ret=0 + local out + + # Script passed as argument. + out="$("$@" ./inc "${script}")" || ret=$? + + if [[ ${ret} -ne ${expect} ]]; then + echo "ERROR: Wrong expectation for indirect file execution: ${ret}" + return 1 + fi + if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then + echo "ERROR: Wrong output for indirect file execution: ${out}" + return 1 + fi +} + +exec_stdin_reg() { + local expect="$1" + local script="$2" + shift 2 + local ret=0 + local out + + # Executing stdin must be allowed if the related file is executable. + out="$("$@" ./inc -i < "${script}")" || ret=$? + + if [[ ${ret} -ne ${expect} ]]; then + echo "ERROR: Wrong expectation for stdin regular file execution: ${ret}" + return 1 + fi + if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then + echo "ERROR: Wrong output for stdin regular file execution: ${out}" + return 1 + fi +} + +exec_stdin_pipe() { + local expect="$1" + shift + local ret=0 + local out + + # A pipe is not executable. + out="$(cat script-exec.inc | "$@" ./inc -i)" || ret=$? + + if [[ ${ret} -ne ${expect} ]]; then + echo "ERROR: Wrong expectation for stdin pipe execution: ${ret}" + return 1 + fi +} + +exec_argument() { + local expect="$1" + local ret=0 + shift + local out + + # Script not coming from a file must not be executed. + out="$("$@" ./inc -c "$(< script-exec.inc)")" || ret=$? + + if [[ ${ret} -ne ${expect} ]]; then + echo "ERROR: Wrong expectation for arbitrary argument execution: ${ret}" + return 1 + fi + if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then + echo "ERROR: Wrong output for arbitrary argument execution: ${out}" + return 1 + fi +} + +exec_interactive() { + exec_stdin_pipe "$@" + exec_argument "$@" +} + +ktap_test() { + ktap_test_result "$*" "$@" +} + +ktap_print_header +ktap_set_plan 28 + +# Without secbit configuration, nothing is changed. + +ktap_print_msg "By default, executable scripts are allowed to be interpreted and executed." +ktap_test exec_direct 0 script-exec.inc +ktap_test exec_indirect 0 script-exec.inc + +ktap_print_msg "By default, executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-exec.inc + +ktap_print_msg "By default, non-executable scripts are allowed to be interpreted, but not directly executed." +# We get 126 because of direct execution by Bash. +ktap_test exec_direct 126 script-noexec.inc +ktap_test exec_indirect 0 script-noexec.inc + +ktap_print_msg "By default, non-executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-noexec.inc + +ktap_print_msg "By default, interactive commands are allowed to be interpreted." +ktap_test exec_interactive 0 + +# With only file restriction: protect non-malicious users from inadvertent errors (e.g. python ~/Downloads/*.py). + +ktap_print_msg "With -f, executable scripts are allowed to be interpreted and executed." +ktap_test exec_direct 0 script-exec.inc ./set-exec -f -- +ktap_test exec_indirect 0 script-exec.inc ./set-exec -f -- + +ktap_print_msg "With -f, executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -f -- + +ktap_print_msg "With -f, non-executable scripts are not allowed to be executed nor interpreted." +# Direct execution of non-executable script is alwayse denied by the kernel. +ktap_test exec_direct 1 script-noexec.inc ./set-exec -f -- +ktap_test exec_indirect 1 script-noexec.inc ./set-exec -f -- + +ktap_print_msg "With -f, non-executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-noexec.inc ./set-exec -f -- + +ktap_print_msg "With -f, interactive commands are allowed to be interpreted." +ktap_test exec_interactive 0 ./set-exec -f -- + +# With only denied interactive commands: check or monitor script content (e.g. with LSM). + +ktap_print_msg "With -i, executable scripts are allowed to be interpreted and executed." +ktap_test exec_direct 0 script-exec.inc ./set-exec -i -- +ktap_test exec_indirect 0 script-exec.inc ./set-exec -i -- + +ktap_print_msg "With -i, executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -i -- + +ktap_print_msg "With -i, non-executable scripts are allowed to be interpreted, but not directly executed." +# Direct execution of non-executable script is alwayse denied by the kernel. +ktap_test exec_direct 1 script-noexec.inc ./set-exec -i -- +ktap_test exec_indirect 0 script-noexec.inc ./set-exec -i -- + +ktap_print_msg "With -i, non-executable stdin is not allowed to be interpreted." +ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -i -- + +ktap_print_msg "With -i, interactive commands are not allowed to be interpreted." +ktap_test exec_interactive 1 ./set-exec -i -- + +# With both file restriction and denied interactive commands: only allow executable scripts. + +ktap_print_msg "With -fi, executable scripts are allowed to be interpreted and executed." +ktap_test exec_direct 0 script-exec.inc ./set-exec -fi -- +ktap_test exec_indirect 0 script-exec.inc ./set-exec -fi -- + +ktap_print_msg "With -fi, executable stdin is allowed to be interpreted." +ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -fi -- + +ktap_print_msg "With -fi, non-executable scripts are not allowed to be interpreted nor executed." +# Direct execution of non-executable script is alwayse denied by the kernel. +ktap_test exec_direct 1 script-noexec.inc ./set-exec -fi -- +ktap_test exec_indirect 1 script-noexec.inc ./set-exec -fi -- + +ktap_print_msg "With -fi, non-executable stdin is not allowed to be interpreted." +ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -fi -- + +ktap_print_msg "With -fi, interactive commands are not allowed to be interpreted." +ktap_test exec_interactive 1 ./set-exec -fi -- + +ktap_finished diff --git a/tools/testing/selftests/exec/check-exec.c b/tools/testing/selftests/exec/check-exec.c new file mode 100644 index 000000000000..55bce47e56b7 --- /dev/null +++ b/tools/testing/selftests/exec/check-exec.c @@ -0,0 +1,463 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + * Test execveat(2) with AT_EXECVE_CHECK, and prctl(2) with + * SECBIT_EXEC_RESTRICT_FILE, SECBIT_EXEC_DENY_INTERACTIVE, and their locked + * counterparts. + * + * Copyright © 2018-2020 ANSSI + * Copyright © 2024 Microsoft Corporation + * + * Author: Mickaël Salaün <mic@digikod.net> + */ + +#include <asm-generic/unistd.h> +#include <errno.h> +#include <fcntl.h> +#include <linux/prctl.h> +#include <linux/securebits.h> +#include <stdio.h> +#include <stdlib.h> +#include <sys/capability.h> +#include <sys/mount.h> +#include <sys/prctl.h> +#include <sys/socket.h> +#include <sys/stat.h> +#include <sys/syscall.h> +#include <sys/sysmacros.h> +#include <unistd.h> + +/* Defines AT_EXECVE_CHECK without type conflicts. */ +#define _ASM_GENERIC_FCNTL_H +#include <linux/fcntl.h> + +#include "../kselftest_harness.h" + +static int sys_execveat(int dirfd, const char *pathname, char *const argv[], + char *const envp[], int flags) +{ + return syscall(__NR_execveat, dirfd, pathname, argv, envp, flags); +} + +static void drop_privileges(struct __test_metadata *const _metadata) +{ + const unsigned int noroot = SECBIT_NOROOT | SECBIT_NOROOT_LOCKED; + cap_t cap_p; + + if ((cap_get_secbits() & noroot) != noroot) + EXPECT_EQ(0, cap_set_secbits(noroot)); + + cap_p = cap_get_proc(); + EXPECT_NE(NULL, cap_p); + EXPECT_NE(-1, cap_clear(cap_p)); + + /* + * Drops everything, especially CAP_SETPCAP, CAP_DAC_OVERRIDE, and + * CAP_DAC_READ_SEARCH. + */ + EXPECT_NE(-1, cap_set_proc(cap_p)); + EXPECT_NE(-1, cap_free(cap_p)); +} + +static int test_secbits_set(const unsigned int secbits) +{ + int err; + + err = prctl(PR_SET_SECUREBITS, secbits); + if (err) + return errno; + return 0; +} + +FIXTURE(access) +{ + int memfd, pipefd; + int pipe_fds[2], socket_fds[2]; +}; + +FIXTURE_VARIANT(access) +{ + const bool mount_exec; + const bool file_exec; +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(access, mount_exec_file_exec) { + /* clang-format on */ + .mount_exec = true, + .file_exec = true, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(access, mount_exec_file_noexec) { + /* clang-format on */ + .mount_exec = true, + .file_exec = false, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(access, mount_noexec_file_exec) { + /* clang-format on */ + .mount_exec = false, + .file_exec = true, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(access, mount_noexec_file_noexec) { + /* clang-format on */ + .mount_exec = false, + .file_exec = false, +}; + +static const char binary_path[] = "./false"; +static const char workdir_path[] = "./test-mount"; +static const char reg_file_path[] = "./test-mount/regular_file"; +static const char dir_path[] = "./test-mount/directory"; +static const char block_dev_path[] = "./test-mount/block_device"; +static const char char_dev_path[] = "./test-mount/character_device"; +static const char fifo_path[] = "./test-mount/fifo"; + +FIXTURE_SETUP(access) +{ + int procfd_path_size; + static const char path_template[] = "/proc/self/fd/%d"; + char procfd_path[sizeof(path_template) + 10]; + + /* Makes sure we are not already restricted nor locked. */ + EXPECT_EQ(0, test_secbits_set(0)); + + /* + * Cleans previous workspace if any error previously happened (don't + * check errors). + */ + umount(workdir_path); + rmdir(workdir_path); + + /* Creates a clean mount point. */ + ASSERT_EQ(0, mkdir(workdir_path, 00700)); + ASSERT_EQ(0, mount("test", workdir_path, "tmpfs", + MS_MGC_VAL | (variant->mount_exec ? 0 : MS_NOEXEC), + "mode=0700,size=9m")); + + /* Creates a regular file. */ + ASSERT_EQ(0, mknod(reg_file_path, + S_IFREG | (variant->file_exec ? 0700 : 0600), 0)); + /* Creates a directory. */ + ASSERT_EQ(0, mkdir(dir_path, variant->file_exec ? 0700 : 0600)); + /* Creates a character device: /dev/null. */ + ASSERT_EQ(0, mknod(char_dev_path, S_IFCHR | 0400, makedev(1, 3))); + /* Creates a block device: /dev/loop0 */ + ASSERT_EQ(0, mknod(block_dev_path, S_IFBLK | 0400, makedev(7, 0))); + /* Creates a fifo. */ + ASSERT_EQ(0, mknod(fifo_path, S_IFIFO | 0600, 0)); + + /* Creates a regular file without user mount point. */ + self->memfd = memfd_create("test-exec-probe", MFD_CLOEXEC); + ASSERT_LE(0, self->memfd); + /* Sets mode, which must be ignored by the exec check. */ + ASSERT_EQ(0, fchmod(self->memfd, variant->file_exec ? 0700 : 0600)); + + /* Creates a pipefs file descriptor. */ + ASSERT_EQ(0, pipe(self->pipe_fds)); + procfd_path_size = snprintf(procfd_path, sizeof(procfd_path), + path_template, self->pipe_fds[0]); + ASSERT_LT(procfd_path_size, sizeof(procfd_path)); + self->pipefd = open(procfd_path, O_RDWR | O_CLOEXEC); + ASSERT_LE(0, self->pipefd); + ASSERT_EQ(0, fchmod(self->pipefd, variant->file_exec ? 0700 : 0600)); + + /* Creates a socket file descriptor. */ + ASSERT_EQ(0, socketpair(AF_UNIX, SOCK_DGRAM | SOCK_CLOEXEC, 0, + self->socket_fds)); +} + +FIXTURE_TEARDOWN_PARENT(access) +{ + /* There is no need to unlink the test files. */ + EXPECT_EQ(0, umount(workdir_path)); + EXPECT_EQ(0, rmdir(workdir_path)); +} + +static void fill_exec_fd(struct __test_metadata *_metadata, const int fd_out) +{ + char buf[1024]; + size_t len; + int fd_in; + + fd_in = open(binary_path, O_CLOEXEC | O_RDONLY); + ASSERT_LE(0, fd_in); + /* Cannot use copy_file_range(2) because of EXDEV. */ + len = read(fd_in, buf, sizeof(buf)); + EXPECT_LE(0, len); + while (len > 0) { + EXPECT_EQ(len, write(fd_out, buf, len)) + { + TH_LOG("Failed to write: %s (%d)", strerror(errno), + errno); + } + len = read(fd_in, buf, sizeof(buf)); + EXPECT_LE(0, len); + } + EXPECT_EQ(0, close(fd_in)); +} + +static void fill_exec_path(struct __test_metadata *_metadata, + const char *const path) +{ + int fd_out; + + fd_out = open(path, O_CLOEXEC | O_WRONLY); + ASSERT_LE(0, fd_out) + { + TH_LOG("Failed to open %s: %s", path, strerror(errno)); + } + fill_exec_fd(_metadata, fd_out); + EXPECT_EQ(0, close(fd_out)); +} + +static void test_exec_fd(struct __test_metadata *_metadata, const int fd, + const int err_code) +{ + char *const argv[] = { "", NULL }; + int access_ret, access_errno; + + /* + * If we really execute fd, filled with the "false" binary, the current + * thread will exits with an error, which will be interpreted by the + * test framework as an error. With AT_EXECVE_CHECK, we only check a + * potential successful execution. + */ + access_ret = sys_execveat(fd, "", argv, NULL, + AT_EMPTY_PATH | AT_EXECVE_CHECK); + access_errno = errno; + if (err_code) { + EXPECT_EQ(-1, access_ret); + EXPECT_EQ(err_code, access_errno) + { + TH_LOG("Wrong error for execveat(2): %s (%d)", + strerror(access_errno), errno); + } + } else { + EXPECT_EQ(0, access_ret) + { + TH_LOG("Access denied: %s", strerror(access_errno)); + } + } +} + +static void test_exec_path(struct __test_metadata *_metadata, + const char *const path, const int err_code) +{ + int flags = O_CLOEXEC; + int fd; + + /* Do not block on pipes. */ + if (path == fifo_path) + flags |= O_NONBLOCK; + + fd = open(path, flags | O_RDONLY); + ASSERT_LE(0, fd) + { + TH_LOG("Failed to open %s: %s", path, strerror(errno)); + } + test_exec_fd(_metadata, fd, err_code); + EXPECT_EQ(0, close(fd)); +} + +/* Tests that we don't get ENOEXEC. */ +TEST_F(access, regular_file_empty) +{ + const int exec = variant->mount_exec && variant->file_exec; + + test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES); + + drop_privileges(_metadata); + test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES); +} + +TEST_F(access, regular_file_elf) +{ + const int exec = variant->mount_exec && variant->file_exec; + + fill_exec_path(_metadata, reg_file_path); + + test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES); + + drop_privileges(_metadata); + test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES); +} + +/* Tests that we don't get ENOEXEC. */ +TEST_F(access, memfd_empty) +{ + const int exec = variant->file_exec; + + test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES); + + drop_privileges(_metadata); + test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES); +} + +TEST_F(access, memfd_elf) +{ + const int exec = variant->file_exec; + + fill_exec_fd(_metadata, self->memfd); + + test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES); + + drop_privileges(_metadata); + test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES); +} + +TEST_F(access, non_regular_files) +{ + test_exec_path(_metadata, dir_path, EACCES); + test_exec_path(_metadata, block_dev_path, EACCES); + test_exec_path(_metadata, char_dev_path, EACCES); + test_exec_path(_metadata, fifo_path, EACCES); + test_exec_fd(_metadata, self->socket_fds[0], EACCES); + test_exec_fd(_metadata, self->pipefd, EACCES); +} + +/* clang-format off */ +FIXTURE(secbits) {}; +/* clang-format on */ + +FIXTURE_VARIANT(secbits) +{ + const bool is_privileged; + const int error; +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(secbits, priv) { + /* clang-format on */ + .is_privileged = true, + .error = 0, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(secbits, unpriv) { + /* clang-format on */ + .is_privileged = false, + .error = EPERM, +}; + +FIXTURE_SETUP(secbits) +{ + /* Makes sure no exec bits are set. */ + EXPECT_EQ(0, test_secbits_set(0)); + EXPECT_EQ(0, prctl(PR_GET_SECUREBITS)); + + if (!variant->is_privileged) + drop_privileges(_metadata); +} + +FIXTURE_TEARDOWN(secbits) +{ +} + +TEST_F(secbits, legacy) +{ + EXPECT_EQ(variant->error, test_secbits_set(0)); +} + +#define CHILD(...) \ + do { \ + pid_t child = vfork(); \ + EXPECT_LE(0, child); \ + if (child == 0) { \ + __VA_ARGS__; \ + _exit(0); \ + } \ + } while (0) + +TEST_F(secbits, exec) +{ + unsigned int secbits = prctl(PR_GET_SECUREBITS); + + secbits |= SECBIT_EXEC_RESTRICT_FILE; + EXPECT_EQ(0, test_secbits_set(secbits)); + EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)); + CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS))); + + secbits |= SECBIT_EXEC_DENY_INTERACTIVE; + EXPECT_EQ(0, test_secbits_set(secbits)); + EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)); + CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS))); + + secbits &= ~(SECBIT_EXEC_RESTRICT_FILE | SECBIT_EXEC_DENY_INTERACTIVE); + EXPECT_EQ(0, test_secbits_set(secbits)); + EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)); + CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS))); +} + +TEST_F(secbits, check_locked_set) +{ + unsigned int secbits = prctl(PR_GET_SECUREBITS); + + secbits |= SECBIT_EXEC_RESTRICT_FILE; + EXPECT_EQ(0, test_secbits_set(secbits)); + secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED; + EXPECT_EQ(0, test_secbits_set(secbits)); + + /* Checks lock set but unchanged. */ + EXPECT_EQ(variant->error, test_secbits_set(secbits)); + CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits))); + + secbits &= ~SECBIT_EXEC_RESTRICT_FILE; + EXPECT_EQ(EPERM, test_secbits_set(0)); + CHILD(EXPECT_EQ(EPERM, test_secbits_set(0))); +} + +TEST_F(secbits, check_locked_unset) +{ + unsigned int secbits = prctl(PR_GET_SECUREBITS); + + secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED; + EXPECT_EQ(0, test_secbits_set(secbits)); + + /* Checks lock unset but unchanged. */ + EXPECT_EQ(variant->error, test_secbits_set(secbits)); + CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits))); + + secbits &= ~SECBIT_EXEC_RESTRICT_FILE; + EXPECT_EQ(EPERM, test_secbits_set(0)); + CHILD(EXPECT_EQ(EPERM, test_secbits_set(0))); +} + +TEST_F(secbits, restrict_locked_set) +{ + unsigned int secbits = prctl(PR_GET_SECUREBITS); + + secbits |= SECBIT_EXEC_DENY_INTERACTIVE; + EXPECT_EQ(0, test_secbits_set(secbits)); + secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED; + EXPECT_EQ(0, test_secbits_set(secbits)); + + /* Checks lock set but unchanged. */ + EXPECT_EQ(variant->error, test_secbits_set(secbits)); + CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits))); + + secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE; + EXPECT_EQ(EPERM, test_secbits_set(0)); + CHILD(EXPECT_EQ(EPERM, test_secbits_set(0))); +} + +TEST_F(secbits, restrict_locked_unset) +{ + unsigned int secbits = prctl(PR_GET_SECUREBITS); + + secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED; + EXPECT_EQ(0, test_secbits_set(secbits)); + + /* Checks lock unset but unchanged. */ + EXPECT_EQ(variant->error, test_secbits_set(secbits)); + CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits))); + + secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE; + EXPECT_EQ(EPERM, test_secbits_set(0)); + CHILD(EXPECT_EQ(EPERM, test_secbits_set(0))); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/exec/config b/tools/testing/selftests/exec/config new file mode 100644 index 000000000000..c308079867b3 --- /dev/null +++ b/tools/testing/selftests/exec/config @@ -0,0 +1,2 @@ +CONFIG_BLK_DEV=y +CONFIG_BLK_DEV_LOOP=y diff --git a/tools/testing/selftests/exec/execveat.c b/tools/testing/selftests/exec/execveat.c index 071e03532cba..8fb7395fd35b 100644 --- a/tools/testing/selftests/exec/execveat.c +++ b/tools/testing/selftests/exec/execveat.c @@ -23,9 +23,11 @@ #include "../kselftest.h" -#define TESTS_EXPECTED 51 +#define TESTS_EXPECTED 54 #define TEST_NAME_LEN (PATH_MAX * 4) +#define CHECK_COMM "CHECK_COMM" + static char longpath[2 * PATH_MAX] = ""; static char *envp[] = { "IN_TEST=yes", NULL, NULL }; static char *argv[] = { "execveat", "99", NULL }; @@ -237,6 +239,29 @@ static int check_execveat_pathmax(int root_dfd, const char *src, int is_script) return fail; } +static int check_execveat_comm(int fd, char *argv0, char *expected) +{ + char buf[128], *old_env, *old_argv0; + int ret; + + snprintf(buf, sizeof(buf), CHECK_COMM "=%s", expected); + + old_env = envp[1]; + envp[1] = buf; + + old_argv0 = argv[0]; + argv[0] = argv0; + + ksft_print_msg("Check execveat(AT_EMPTY_PATH)'s comm is %s\n", + expected); + ret = check_execveat_invoked_rc(fd, "", AT_EMPTY_PATH, 0, 0); + + envp[1] = old_env; + argv[0] = old_argv0; + + return ret; +} + static int run_tests(void) { int fail = 0; @@ -389,6 +414,14 @@ static int run_tests(void) fail += check_execveat_pathmax(root_dfd, "execveat", 0); fail += check_execveat_pathmax(root_dfd, "script", 1); + + /* /proc/pid/comm gives filename by default */ + fail += check_execveat_comm(fd, "sentinel", "execveat"); + /* /proc/pid/comm gives argv[0] when invoked via link */ + fail += check_execveat_comm(fd_symlink, "sentinel", "execveat"); + /* /proc/pid/comm gives filename if NULL is passed */ + fail += check_execveat_comm(fd, NULL, "execveat"); + return fail; } @@ -415,9 +448,13 @@ int main(int argc, char **argv) int ii; int rc; const char *verbose = getenv("VERBOSE"); + const char *check_comm = getenv(CHECK_COMM); - if (argc >= 2) { - /* If we are invoked with an argument, don't run tests. */ + if (argc >= 2 || check_comm) { + /* + * If we are invoked with an argument, or no arguments but a + * command to check, don't run tests. + */ const char *in_test = getenv("IN_TEST"); if (verbose) { @@ -426,6 +463,38 @@ int main(int argc, char **argv) ksft_print_msg("\t[%d]='%s\n'", ii, argv[ii]); } + /* If the tests wanted us to check the command, do so. */ + if (check_comm) { + /* TASK_COMM_LEN == 16 */ + char buf[32]; + int fd, ret; + + fd = open("/proc/self/comm", O_RDONLY); + if (fd < 0) { + ksft_perror("open() comm failed"); + exit(1); + } + + ret = read(fd, buf, sizeof(buf)); + if (ret < 0) { + ksft_perror("read() comm failed"); + close(fd); + exit(1); + } + close(fd); + + // trim off the \n + buf[ret-1] = 0; + + if (strcmp(buf, check_comm)) { + ksft_print_msg("bad comm, got: %s expected: %s\n", + buf, check_comm); + exit(1); + } + + exit(0); + } + /* Check expected environment transferred. */ if (!in_test || strcmp(in_test, "yes") != 0) { ksft_print_msg("no IN_TEST=yes in env\n"); diff --git a/tools/testing/selftests/exec/false.c b/tools/testing/selftests/exec/false.c new file mode 100644 index 000000000000..104383ec3a79 --- /dev/null +++ b/tools/testing/selftests/exec/false.c @@ -0,0 +1,5 @@ +// SPDX-License-Identifier: GPL-2.0 +int main(void) +{ + return 1; +} diff --git a/tools/testing/selftests/nsfs/.gitignore b/tools/testing/selftests/filesystems/nsfs/.gitignore index ed79ebdf286e..92a8249006d1 100644 --- a/tools/testing/selftests/nsfs/.gitignore +++ b/tools/testing/selftests/filesystems/nsfs/.gitignore @@ -1,3 +1,4 @@ # SPDX-License-Identifier: GPL-2.0-only owner pidns +iterate_mntns diff --git a/tools/testing/selftests/nsfs/Makefile b/tools/testing/selftests/filesystems/nsfs/Makefile index dd9bd50b7b93..231aaa7dfd95 100644 --- a/tools/testing/selftests/nsfs/Makefile +++ b/tools/testing/selftests/filesystems/nsfs/Makefile @@ -1,6 +1,6 @@ # SPDX-License-Identifier: GPL-2.0-only -TEST_GEN_PROGS := owner pidns +TEST_GEN_PROGS := owner pidns iterate_mntns CFLAGS := -Wall -Werror -include ../lib.mk +include ../../lib.mk diff --git a/tools/testing/selftests/nsfs/config b/tools/testing/selftests/filesystems/nsfs/config index 598d0a225fc9..598d0a225fc9 100644 --- a/tools/testing/selftests/nsfs/config +++ b/tools/testing/selftests/filesystems/nsfs/config diff --git a/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c new file mode 100644 index 000000000000..457cf76f3c5f --- /dev/null +++ b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c @@ -0,0 +1,149 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +// Copyright (c) 2024 Christian Brauner <brauner@kernel.org> + +#define _GNU_SOURCE +#include <fcntl.h> +#include <sched.h> +#include <stdio.h> +#include <string.h> +#include <sys/stat.h> +#include <sys/mount.h> +#include <unistd.h> + +#include "../../kselftest_harness.h" + +#define MNT_NS_COUNT 11 +#define MNT_NS_LAST_INDEX 10 + +struct mnt_ns_info { + __u32 size; + __u32 nr_mounts; + __u64 mnt_ns_id; +}; + +#define MNT_NS_INFO_SIZE_VER0 16 /* size of first published struct */ + +/* Get information about namespace. */ +#define NS_MNT_GET_INFO _IOR(0xb7, 10, struct mnt_ns_info) +/* Get next namespace. */ +#define NS_MNT_GET_NEXT _IOR(0xb7, 11, struct mnt_ns_info) +/* Get previous namespace. */ +#define NS_MNT_GET_PREV _IOR(0xb7, 12, struct mnt_ns_info) + +FIXTURE(iterate_mount_namespaces) { + int fd_mnt_ns[MNT_NS_COUNT]; + __u64 mnt_ns_id[MNT_NS_COUNT]; +}; + +FIXTURE_SETUP(iterate_mount_namespaces) +{ + for (int i = 0; i < MNT_NS_COUNT; i++) + self->fd_mnt_ns[i] = -EBADF; + + /* + * Creating a new user namespace let's us guarantee that we only see + * mount namespaces that we did actually create. + */ + ASSERT_EQ(unshare(CLONE_NEWUSER), 0); + + for (int i = 0; i < MNT_NS_COUNT; i++) { + struct mnt_ns_info info = {}; + + ASSERT_EQ(unshare(CLONE_NEWNS), 0); + self->fd_mnt_ns[i] = open("/proc/self/ns/mnt", O_RDONLY | O_CLOEXEC); + ASSERT_GE(self->fd_mnt_ns[i], 0); + ASSERT_EQ(ioctl(self->fd_mnt_ns[i], NS_MNT_GET_INFO, &info), 0); + self->mnt_ns_id[i] = info.mnt_ns_id; + } +} + +FIXTURE_TEARDOWN(iterate_mount_namespaces) +{ + for (int i = 0; i < MNT_NS_COUNT; i++) { + if (self->fd_mnt_ns[i] < 0) + continue; + ASSERT_EQ(close(self->fd_mnt_ns[i]), 0); + } +} + +TEST_F(iterate_mount_namespaces, iterate_all_forward) +{ + int fd_mnt_ns_cur, count = 0; + + fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[0], F_DUPFD_CLOEXEC); + ASSERT_GE(fd_mnt_ns_cur, 0); + + for (;; count++) { + struct mnt_ns_info info = {}; + int fd_mnt_ns_next; + + fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info); + if (fd_mnt_ns_next < 0 && errno == ENOENT) + break; + ASSERT_GE(fd_mnt_ns_next, 0); + ASSERT_EQ(close(fd_mnt_ns_cur), 0); + fd_mnt_ns_cur = fd_mnt_ns_next; + } + ASSERT_EQ(count, MNT_NS_LAST_INDEX); +} + +TEST_F(iterate_mount_namespaces, iterate_all_backwards) +{ + int fd_mnt_ns_cur, count = 0; + + fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[MNT_NS_LAST_INDEX], F_DUPFD_CLOEXEC); + ASSERT_GE(fd_mnt_ns_cur, 0); + + for (;; count++) { + struct mnt_ns_info info = {}; + int fd_mnt_ns_prev; + + fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info); + if (fd_mnt_ns_prev < 0 && errno == ENOENT) + break; + ASSERT_GE(fd_mnt_ns_prev, 0); + ASSERT_EQ(close(fd_mnt_ns_cur), 0); + fd_mnt_ns_cur = fd_mnt_ns_prev; + } + ASSERT_EQ(count, MNT_NS_LAST_INDEX); +} + +TEST_F(iterate_mount_namespaces, iterate_forward) +{ + int fd_mnt_ns_cur; + + ASSERT_EQ(setns(self->fd_mnt_ns[0], CLONE_NEWNS), 0); + + fd_mnt_ns_cur = self->fd_mnt_ns[0]; + for (int i = 1; i < MNT_NS_COUNT; i++) { + struct mnt_ns_info info = {}; + int fd_mnt_ns_next; + + fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info); + ASSERT_GE(fd_mnt_ns_next, 0); + ASSERT_EQ(close(fd_mnt_ns_cur), 0); + fd_mnt_ns_cur = fd_mnt_ns_next; + ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]); + } +} + +TEST_F(iterate_mount_namespaces, iterate_backward) +{ + int fd_mnt_ns_cur; + + ASSERT_EQ(setns(self->fd_mnt_ns[MNT_NS_LAST_INDEX], CLONE_NEWNS), 0); + + fd_mnt_ns_cur = self->fd_mnt_ns[MNT_NS_LAST_INDEX]; + for (int i = MNT_NS_LAST_INDEX - 1; i >= 0; i--) { + struct mnt_ns_info info = {}; + int fd_mnt_ns_prev; + + fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info); + ASSERT_GE(fd_mnt_ns_prev, 0); + ASSERT_EQ(close(fd_mnt_ns_cur), 0); + fd_mnt_ns_cur = fd_mnt_ns_prev; + ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]); + } +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/nsfs/owner.c b/tools/testing/selftests/filesystems/nsfs/owner.c index 96a976c74550..96a976c74550 100644 --- a/tools/testing/selftests/nsfs/owner.c +++ b/tools/testing/selftests/filesystems/nsfs/owner.c diff --git a/tools/testing/selftests/nsfs/pidns.c b/tools/testing/selftests/filesystems/nsfs/pidns.c index e3c772c6a7c7..e3c772c6a7c7 100644 --- a/tools/testing/selftests/nsfs/pidns.c +++ b/tools/testing/selftests/filesystems/nsfs/pidns.c diff --git a/tools/testing/selftests/filesystems/statmount/.gitignore b/tools/testing/selftests/filesystems/statmount/.gitignore index 82a4846cbc4b..973363ad66a2 100644 --- a/tools/testing/selftests/filesystems/statmount/.gitignore +++ b/tools/testing/selftests/filesystems/statmount/.gitignore @@ -1,2 +1,3 @@ # SPDX-License-Identifier: GPL-2.0-only +statmount_test_ns /*_test diff --git a/tools/testing/selftests/filesystems/statmount/Makefile b/tools/testing/selftests/filesystems/statmount/Makefile index 3af3136e35a4..14ee91a41650 100644 --- a/tools/testing/selftests/filesystems/statmount/Makefile +++ b/tools/testing/selftests/filesystems/statmount/Makefile @@ -1,6 +1,6 @@ # SPDX-License-Identifier: GPL-2.0-or-later CFLAGS += -Wall -O2 -g $(KHDR_INCLUDES) -TEST_GEN_PROGS := statmount_test statmount_test_ns +TEST_GEN_PROGS := statmount_test statmount_test_ns listmount_test include ../../lib.mk diff --git a/tools/testing/selftests/filesystems/statmount/listmount_test.c b/tools/testing/selftests/filesystems/statmount/listmount_test.c new file mode 100644 index 000000000000..15f0834f7557 --- /dev/null +++ b/tools/testing/selftests/filesystems/statmount/listmount_test.c @@ -0,0 +1,66 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +// Copyright (c) 2024 Christian Brauner <brauner@kernel.org> + +#define _GNU_SOURCE +#include <fcntl.h> +#include <sched.h> +#include <stdio.h> +#include <string.h> +#include <sys/stat.h> +#include <sys/mount.h> +#include <unistd.h> + +#include "statmount.h" +#include "../../kselftest_harness.h" + +#ifndef LISTMOUNT_REVERSE +#define LISTMOUNT_REVERSE (1 << 0) /* List later mounts first */ +#endif + +#define LISTMNT_BUFFER 10 + +/* Check that all mount ids are in increasing order. */ +TEST(listmount_forward) +{ + uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0; + + for (;;) { + ssize_t nr_mounts; + + nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id, + list, LISTMNT_BUFFER, 0); + ASSERT_GE(nr_mounts, 0); + if (nr_mounts == 0) + break; + + for (size_t cur = 0; cur < nr_mounts; cur++) { + if (cur < nr_mounts - 1) + ASSERT_LT(list[cur], list[cur + 1]); + last_mnt_id = list[cur]; + } + } +} + +/* Check that all mount ids are in decreasing order. */ +TEST(listmount_backward) +{ + uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0; + + for (;;) { + ssize_t nr_mounts; + + nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id, + list, LISTMNT_BUFFER, LISTMOUNT_REVERSE); + ASSERT_GE(nr_mounts, 0); + if (nr_mounts == 0) + break; + + for (size_t cur = 0; cur < nr_mounts; cur++) { + if (cur < nr_mounts - 1) + ASSERT_GT(list[cur], list[cur + 1]); + last_mnt_id = list[cur]; + } + } +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/filesystems/statmount/statmount_test.c b/tools/testing/selftests/filesystems/statmount/statmount_test.c index 8eb6aa606a0d..46d289611ce8 100644 --- a/tools/testing/selftests/filesystems/statmount/statmount_test.c +++ b/tools/testing/selftests/filesystems/statmount/statmount_test.c @@ -383,6 +383,10 @@ static void test_statmount_mnt_point(void) return; } + if (!(sm->mask & STATMOUNT_MNT_POINT)) { + ksft_test_result_fail("missing STATMOUNT_MNT_POINT in mask\n"); + return; + } if (strcmp(sm->str + sm->mnt_point, "/") != 0) { ksft_test_result_fail("unexpected mount point: '%s' != '/'\n", sm->str + sm->mnt_point); @@ -408,6 +412,10 @@ static void test_statmount_mnt_root(void) strerror(errno)); return; } + if (!(sm->mask & STATMOUNT_MNT_ROOT)) { + ksft_test_result_fail("missing STATMOUNT_MNT_ROOT in mask\n"); + return; + } mnt_root = sm->str + sm->mnt_root; last_root = strrchr(mnt_root, '/'); if (last_root) @@ -437,6 +445,10 @@ static void test_statmount_fs_type(void) strerror(errno)); return; } + if (!(sm->mask & STATMOUNT_FS_TYPE)) { + ksft_test_result_fail("missing STATMOUNT_FS_TYPE in mask\n"); + return; + } fs_type = sm->str + sm->fs_type; for (s = known_fs; s != NULL; s++) { if (strcmp(fs_type, *s) == 0) @@ -464,6 +476,11 @@ static void test_statmount_mnt_opts(void) return; } + if (!(sm->mask & STATMOUNT_MNT_BASIC)) { + ksft_test_result_fail("missing STATMOUNT_MNT_BASIC in mask\n"); + return; + } + while (getline(&line, &len, f_mountinfo) != -1) { int i; char *p, *p2; @@ -514,7 +531,10 @@ static void test_statmount_mnt_opts(void) if (p2) *p2 = '\0'; - statmount_opts = sm->str + sm->mnt_opts; + if (sm->mask & STATMOUNT_MNT_OPTS) + statmount_opts = sm->str + sm->mnt_opts; + else + statmount_opts = ""; if (strcmp(statmount_opts, p) != 0) ksft_test_result_fail( "unexpected mount options: '%s' != '%s'\n", diff --git a/tools/testing/selftests/ftrace/Makefile b/tools/testing/selftests/ftrace/Makefile index a1e955d2de4c..49d96bb16355 100644 --- a/tools/testing/selftests/ftrace/Makefile +++ b/tools/testing/selftests/ftrace/Makefile @@ -6,4 +6,6 @@ TEST_PROGS := ftracetest-ktap TEST_FILES := test.d settings EXTRA_CLEAN := $(OUTPUT)/logs/* +TEST_GEN_PROGS = poll + include ../lib.mk diff --git a/tools/testing/selftests/ftrace/poll.c b/tools/testing/selftests/ftrace/poll.c new file mode 100644 index 000000000000..53258f7515e7 --- /dev/null +++ b/tools/testing/selftests/ftrace/poll.c @@ -0,0 +1,74 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + * Simple poll on a file. + * + * Copyright (c) 2024 Google LLC. + */ + +#include <errno.h> +#include <fcntl.h> +#include <poll.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <unistd.h> + +#define BUFSIZE 4096 + +/* + * Usage: + * poll [-I|-P] [-t timeout] FILE + */ +int main(int argc, char *argv[]) +{ + struct pollfd pfd = {.events = POLLIN}; + char buf[BUFSIZE]; + int timeout = -1; + int ret, opt; + + while ((opt = getopt(argc, argv, "IPt:")) != -1) { + switch (opt) { + case 'I': + pfd.events = POLLIN; + break; + case 'P': + pfd.events = POLLPRI; + break; + case 't': + timeout = atoi(optarg); + break; + default: + fprintf(stderr, "Usage: %s [-I|-P] [-t timeout] FILE\n", + argv[0]); + return -1; + } + } + if (optind >= argc) { + fprintf(stderr, "Error: Polling file is not specified\n"); + return -1; + } + + pfd.fd = open(argv[optind], O_RDONLY); + if (pfd.fd < 0) { + fprintf(stderr, "failed to open %s", argv[optind]); + perror("open"); + return -1; + } + + /* Reset poll by read if POLLIN is specified. */ + if (pfd.events & POLLIN) + do {} while (read(pfd.fd, buf, BUFSIZE) == BUFSIZE); + + ret = poll(&pfd, 1, timeout); + if (ret < 0 && errno != EINTR) { + perror("poll"); + return -1; + } + close(pfd.fd); + + /* If timeout happned (ret == 0), exit code is 1 */ + if (ret == 0) + return 1; + + return 0; +} diff --git a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc index 35e8d47d6072..8a7ce647a60d 100644 --- a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc +++ b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc @@ -15,11 +15,11 @@ find_alternate_gid() { tac /etc/group | grep -v ":$original_gid:" | head -1 | cut -d: -f3 } -mount_tracefs_with_options() { +remount_tracefs_with_options() { local mount_point="$1" local options="$2" - mount -t tracefs -o "$options" nodev "$mount_point" + mount -t tracefs -o "remount,$options" nodev "$mount_point" setup } @@ -81,7 +81,7 @@ test_gid_mount_option() { # Unmount existing tracefs instance and mount with new GID unmount_tracefs "$mount_point" - mount_tracefs_with_options "$mount_point" "$new_options" + remount_tracefs_with_options "$mount_point" "$new_options" check_gid "$mount_point" "$other_group" @@ -92,7 +92,7 @@ test_gid_mount_option() { # Unmount and remount with the original GID unmount_tracefs "$mount_point" - mount_tracefs_with_options "$mount_point" "$mount_options" + remount_tracefs_with_options "$mount_point" "$mount_options" check_gid "$mount_point" "$original_group" } diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe.tc index dc25bcf4f9e2..73f6c6fcecab 100644 --- a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe.tc +++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe.tc @@ -7,12 +7,42 @@ echo 0 > events/enable echo > dynamic_events PLACE=$FUNCTION_FORK +PLACE2="kmem_cache_free" +PLACE3="schedule_timeout" + +# Some functions may have BPF programs attached, therefore +# count already enabled_functions before tests start +ocnt=`cat enabled_functions | wc -l` echo "f:myevent1 $PLACE" >> dynamic_events + +# Make sure the event is attached and is the only one +grep -q $PLACE enabled_functions +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $((ocnt + 1)) ]; then + exit_fail +fi + echo "f:myevent2 $PLACE%return" >> dynamic_events +# It should till be the only attached function +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $((ocnt + 1)) ]; then + exit_fail +fi + +# add another event +echo "f:myevent3 $PLACE2" >> dynamic_events + +grep -q $PLACE2 enabled_functions +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $((ocnt + 2)) ]; then + exit_fail +fi + grep -q myevent1 dynamic_events grep -q myevent2 dynamic_events +grep -q myevent3 dynamic_events test -d events/fprobes/myevent1 test -d events/fprobes/myevent2 @@ -21,6 +51,34 @@ echo "-:myevent2" >> dynamic_events grep -q myevent1 dynamic_events ! grep -q myevent2 dynamic_events +# should still have 2 left +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $((ocnt + 2)) ]; then + exit_fail +fi + echo > dynamic_events +# Should have none left +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $ocnt ]; then + exit_fail +fi + +echo "f:myevent4 $PLACE" >> dynamic_events + +# Should only have one enabled +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $((ocnt + 1)) ]; then + exit_fail +fi + +echo > dynamic_events + +# Should have none left +cnt=`cat enabled_functions | wc -l` +if [ $cnt -ne $ocnt ]; then + exit_fail +fi + clear_trace diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc new file mode 100644 index 000000000000..b4ad09237e2a --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc @@ -0,0 +1,19 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: Generic dynamic event - Repeating add/remove fprobe events +# requires: dynamic_events "f[:[<group>/][<event>]] <func-name>[%return] [<args>]":README + +echo 0 > events/enable +echo > dynamic_events + +PLACE=$FUNCTION_FORK +REPEAT_TIMES=64 + +for i in `seq 1 $REPEAT_TIMES`; do + echo "f:myevent $PLACE" >> dynamic_events + grep -q myevent dynamic_events + test -d events/fprobes/myevent + echo > dynamic_events +done + +clear_trace diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc index a275decdc880..86c76679c56e 100644 --- a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc +++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc @@ -6,8 +6,10 @@ echo 0 > events/enable echo > dynamic_events +REALBIN=`readlink -f /bin/sh` + echo 'cat /proc/$$/maps' | /bin/sh | \ - grep "r-xp .*/bin/.*sh$" | \ + grep "r-xp .*${REALBIN}$" | \ awk '{printf "p:myevent %s:0x%s\n", $6,$3 }' >> uprobe_events grep -q myevent uprobe_events diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc index 61877d166451..c9425a34fae3 100644 --- a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc +++ b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc @@ -16,9 +16,7 @@ aarch64) REG=%r0 ;; esac -check_error 'f^100 vfs_read' # MAXACT_NO_KPROBE -check_error 'f^1a111 vfs_read' # BAD_MAXACT -check_error 'f^100000 vfs_read' # MAXACT_TOO_BIG +check_error 'f^100 vfs_read' # BAD_MAXACT check_error 'f ^non_exist_func' # BAD_PROBE_ADDR (enoent) check_error 'f ^vfs_read+10' # BAD_PROBE_ADDR diff --git a/tools/testing/selftests/ftrace/test.d/event/event-mod.tc b/tools/testing/selftests/ftrace/test.d/event/event-mod.tc new file mode 100644 index 000000000000..175243cd9ab7 --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/event/event-mod.tc @@ -0,0 +1,191 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: event tracing - enable/disable with module event +# requires: set_event "Can enable module events via: :mod:":README +# flags: instance + +rmmod trace-events-sample ||: +if ! modprobe trace-events-sample ; then + echo "No trace-events sample module - please make CONFIG_SAMPLE_TRACE_EVENTS=m" + exit_unresolved; +fi +trap "rmmod trace-events-sample" EXIT + +# Set events for the module +echo ":mod:trace-events-sample" > set_event + +test_all_enabled() { + + # Check if more than one is enabled + grep -q sample-trace:foo_bar set_event + grep -q sample-trace:foo_bar_with_cond set_event + grep -q sample-trace:foo_bar_with_fn set_event + + # All of them should be enabled. Check via the enable file + val=`cat events/sample-trace/enable` + if [ $val -ne 1 ]; then + exit_fail + fi +} + +clear_events() { + echo > set_event + val=`cat events/enable` + if [ "$val" != "0" ]; then + exit_fail + fi + count=`cat set_event | wc -l` + if [ $count -ne 0 ]; then + exit_fail + fi +} + +test_all_enabled + +echo clear all events +echo 0 > events/enable + +echo Confirm the events are disabled +val=`cat events/sample-trace/enable` +if [ $val -ne 0 ]; then + exit_fail +fi + +echo And the set_event file is empty + +cnt=`wc -l set_event` +if [ $cnt -ne 0 ]; then + exit_fail +fi + +echo now enable all events +echo 1 > events/enable + +echo Confirm the events are enabled again +val=`cat events/sample-trace/enable` +if [ $val -ne 1 ]; then + exit_fail +fi + +echo disable just the module events +echo '!:mod:trace-events-sample' >> set_event + +echo Should have mix of events enabled +val=`cat events/enable` +if [ "$val" != "X" ]; then + exit_fail +fi + +echo Confirm the module events are disabled +val=`cat events/sample-trace/enable` +if [ $val -ne 0 ]; then + exit_fail +fi + +echo 0 > events/enable + +echo now enable the system events +echo 'sample-trace:mod:trace-events-sample' > set_event + +test_all_enabled + +echo clear all events +echo 0 > events/enable + +echo Confirm the events are disabled +val=`cat events/sample-trace/enable` +if [ $val -ne 0 ]; then + exit_fail +fi + +echo Test enabling foo_bar only +echo 'foo_bar:mod:trace-events-sample' > set_event + +grep -q sample-trace:foo_bar set_event + +echo make sure nothing is found besides foo_bar +if grep -q -v sample-trace:foo_bar set_event ; then + exit_fail +fi + +echo Append another using the system and event name +echo 'sample-trace:foo_bar_with_cond:mod:trace-events-sample' >> set_event + +grep -q sample-trace:foo_bar set_event +grep -q sample-trace:foo_bar_with_cond set_event + +count=`cat set_event | wc -l` + +if [ $count -ne 2 ]; then + exit_fail +fi + +clear_events + +rmmod trace-events-sample + +echo ':mod:trace-events-sample' > set_event + +echo make sure that the module shows up, and '-' is converted to '_' +grep -q '\*:\*:mod:trace_events_sample' set_event + +modprobe trace-events-sample + +test_all_enabled + +clear_events + +rmmod trace-events-sample + +echo Enable just the system events +echo 'sample-trace:mod:trace-events-sample' > set_event +grep -q 'sample-trace:mod:trace_events_sample' set_event + +modprobe trace-events-sample + +test_all_enabled + +clear_events + +rmmod trace-events-sample + +echo Enable event with just event name +echo 'foo_bar:mod:trace-events-sample' > set_event +grep -q 'foo_bar:mod:trace_events_sample' set_event + +echo Enable another event with both system and event name +echo 'sample-trace:foo_bar_with_cond:mod:trace-events-sample' >> set_event +grep -q 'sample-trace:foo_bar_with_cond:mod:trace_events_sample' set_event +echo Make sure the other event was still there +grep -q 'foo_bar:mod:trace_events_sample' set_event + +modprobe trace-events-sample + +echo There should be no :mod: cached events +if grep -q ':mod:' set_event; then + exit_fail +fi + +echo two events should be enabled +count=`cat set_event | wc -l` +if [ $count -ne 2 ]; then + exit_fail +fi + +echo only two events should be enabled +val=`cat events/sample-trace/enable` +if [ "$val" != "X" ]; then + exit_fail +fi + +val=`cat events/sample-trace/foo_bar/enable` +if [ "$val" != "1" ]; then + exit_fail +fi + +val=`cat events/sample-trace/foo_bar_with_cond/enable` +if [ "$val" != "1" ]; then + exit_fail +fi + +clear_trace diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc index a16c6a6f6055..8f1c58f0c239 100644 --- a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc +++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc @@ -111,7 +111,7 @@ check_error 'p vfs_read $arg* ^$arg*' # DOUBLE_ARGS if !grep -q 'kernel return probes support:' README; then check_error 'r vfs_read ^$arg*' # NOFENTRY_ARGS fi -check_error 'p vfs_read+8 ^$arg*' # NOFENTRY_ARGS +check_error 'p vfs_read+20 ^$arg*' # NOFENTRY_ARGS check_error 'p vfs_read ^hoge' # NO_BTFARG check_error 'p kfree ^$arg10' # NO_BTFARG (exceed the number of parameters) check_error 'r kfree ^$retval' # NO_RETVAL diff --git a/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc b/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc new file mode 100644 index 000000000000..8d275e3238d9 --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/trigger/trigger-hist-poll.tc @@ -0,0 +1,74 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: event trigger - test poll wait on histogram +# requires: set_event events/sched/sched_process_free/trigger events/sched/sched_process_free/hist +# flags: instance + +POLL=${FTRACETEST_ROOT}/poll + +if [ ! -x ${POLL} ]; then + echo "poll program is not compiled!" + exit_unresolved +fi + +EVENT=events/sched/sched_process_free/ + +# Check poll ops is supported. Before implementing poll on hist file, it +# returns soon with POLLIN | POLLOUT, but not POLLPRI. + +# This must wait >1 sec and return 1 (timeout). +set +e +${POLL} -I -t 1000 ${EVENT}/hist +ret=$? +set -e +if [ ${ret} != 1 ]; then + echo "poll on hist file is not supported" + exit_unsupported +fi + +# Test POLLIN +echo > trace +echo 'hist:key=comm if comm =="sleep"' > ${EVENT}/trigger +echo 1 > ${EVENT}/enable + +# This sleep command will exit after 2 seconds. +sleep 2 & +BGPID=$! +# if timeout happens, poll returns 1. +${POLL} -I -t 4000 ${EVENT}/hist +echo 0 > tracing_on + +if [ -d /proc/${BGPID} ]; then + echo "poll exits too soon" + kill -KILL ${BGPID} ||: + exit_fail +fi + +if ! grep -qw "sleep" trace; then + echo "poll exits before event happens" + exit_fail +fi + +# Test POLLPRI +echo > trace +echo 1 > tracing_on + +# This sleep command will exit after 2 seconds. +sleep 2 & +BGPID=$! +# if timeout happens, poll returns 1. +${POLL} -P -t 4000 ${EVENT}/hist +echo 0 > tracing_on + +if [ -d /proc/${BGPID} ]; then + echo "poll exits too soon" + kill -KILL ${BGPID} ||: + exit_fail +fi + +if ! grep -qw "sleep" trace; then + echo "poll exits before event happens" + exit_fail +fi + +exit_pass diff --git a/tools/testing/selftests/gpio/gpio-sim.sh b/tools/testing/selftests/gpio/gpio-sim.sh index 6fb66a687f17..bbc29ed9c60a 100755 --- a/tools/testing/selftests/gpio/gpio-sim.sh +++ b/tools/testing/selftests/gpio/gpio-sim.sh @@ -46,12 +46,6 @@ remove_chip() { rmdir $CONFIGFS_DIR/$CHIP || fail "Unable to remove the chip" } -configfs_cleanup() { - for CHIP in `ls $CONFIGFS_DIR/`; do - remove_chip $CHIP - done -} - create_chip() { local CHIP=$1 @@ -105,6 +99,13 @@ disable_chip() { echo 0 > $CONFIGFS_DIR/$CHIP/live || fail "Unable to disable the chip" } +configfs_cleanup() { + for CHIP in `ls $CONFIGFS_DIR/`; do + disable_chip $CHIP + remove_chip $CHIP + done +} + configfs_chip_name() { local CHIP=$1 local BANK=$2 @@ -181,6 +182,7 @@ create_chip chip create_bank chip bank enable_chip chip test -n `cat $CONFIGFS_DIR/chip/bank/chip_name` || fail "chip_name doesn't work" +disable_chip chip remove_chip chip echo "1.2. chip_name returns 'none' if the chip is still pending" @@ -195,6 +197,7 @@ create_chip chip create_bank chip bank enable_chip chip test -n `cat $CONFIGFS_DIR/chip/dev_name` || fail "dev_name doesn't work" +disable_chip chip remove_chip chip echo "2. Creating and configuring simulated chips" @@ -204,6 +207,7 @@ create_chip chip create_bank chip bank enable_chip chip test "`get_chip_num_lines chip bank`" = "1" || fail "default number of lines is not 1" +disable_chip chip remove_chip chip echo "2.2. Number of lines can be specified" @@ -212,6 +216,7 @@ create_bank chip bank set_num_lines chip bank 16 enable_chip chip test "`get_chip_num_lines chip bank`" = "16" || fail "number of lines is not 16" +disable_chip chip remove_chip chip echo "2.3. Label can be set" @@ -220,6 +225,7 @@ create_bank chip bank set_label chip bank foobar enable_chip chip test "`get_chip_label chip bank`" = "foobar" || fail "label is incorrect" +disable_chip chip remove_chip chip echo "2.4. Label can be left empty" @@ -227,6 +233,7 @@ create_chip chip create_bank chip bank enable_chip chip test -z "`cat $CONFIGFS_DIR/chip/bank/label`" || fail "label is not empty" +disable_chip chip remove_chip chip echo "2.5. Line names can be configured" @@ -238,6 +245,7 @@ set_line_name chip bank 2 bar enable_chip chip test "`get_line_name chip bank 0`" = "foo" || fail "line name is incorrect" test "`get_line_name chip bank 2`" = "bar" || fail "line name is incorrect" +disable_chip chip remove_chip chip echo "2.6. Line config can remain unused if offset is greater than number of lines" @@ -248,6 +256,7 @@ set_line_name chip bank 5 foobar enable_chip chip test "`get_line_name chip bank 0`" = "" || fail "line name is incorrect" test "`get_line_name chip bank 1`" = "" || fail "line name is incorrect" +disable_chip chip remove_chip chip echo "2.7. Line configfs directory names are sanitized" @@ -267,6 +276,7 @@ for CHIP in $CHIPS; do enable_chip $CHIP done for CHIP in $CHIPS; do + disable_chip $CHIP remove_chip $CHIP done @@ -278,6 +288,7 @@ echo foobar > $CONFIGFS_DIR/chip/bank/label 2> /dev/null && \ fail "Setting label of a live chip should fail" echo 8 > $CONFIGFS_DIR/chip/bank/num_lines 2> /dev/null && \ fail "Setting number of lines of a live chip should fail" +disable_chip chip remove_chip chip echo "2.10. Can't create line items when chip is live" @@ -285,6 +296,7 @@ create_chip chip create_bank chip bank enable_chip chip mkdir $CONFIGFS_DIR/chip/bank/line0 2> /dev/null && fail "Creating line item should fail" +disable_chip chip remove_chip chip echo "2.11. Probe errors are propagated to user-space" @@ -316,6 +328,7 @@ mkdir -p $CONFIGFS_DIR/chip/bank/line4/hog enable_chip chip $BASE_DIR/gpio-mockup-cdev -s 1 /dev/`configfs_chip_name chip bank` 4 2> /dev/null && \ fail "Setting the value of a hogged line shouldn't succeed" +disable_chip chip remove_chip chip echo "3. Controlling simulated chips" @@ -331,6 +344,7 @@ test "$?" = "1" || fail "pull set incorrectly" sysfs_set_pull chip bank 0 pull-down $BASE_DIR/gpio-mockup-cdev /dev/`configfs_chip_name chip bank` 1 test "$?" = "0" || fail "pull set incorrectly" +disable_chip chip remove_chip chip echo "3.2. Pull can be read from sysfs" @@ -344,6 +358,7 @@ SYSFS_PATH=/sys/devices/platform/$DEVNAME/$CHIPNAME/sim_gpio0/pull test `cat $SYSFS_PATH` = "pull-down" || fail "reading the pull failed" sysfs_set_pull chip bank 0 pull-up test `cat $SYSFS_PATH` = "pull-up" || fail "reading the pull failed" +disable_chip chip remove_chip chip echo "3.3. Incorrect input in sysfs is rejected" @@ -355,6 +370,7 @@ DEVNAME=`configfs_dev_name chip` CHIPNAME=`configfs_chip_name chip bank` SYSFS_PATH="/sys/devices/platform/$DEVNAME/$CHIPNAME/sim_gpio0/pull" echo foobar > $SYSFS_PATH 2> /dev/null && fail "invalid input not detected" +disable_chip chip remove_chip chip echo "3.4. Can't write to value" @@ -365,6 +381,7 @@ DEVNAME=`configfs_dev_name chip` CHIPNAME=`configfs_chip_name chip bank` SYSFS_PATH="/sys/devices/platform/$DEVNAME/$CHIPNAME/sim_gpio0/value" echo 1 > $SYSFS_PATH 2> /dev/null && fail "writing to 'value' succeeded unexpectedly" +disable_chip chip remove_chip chip echo "4. Simulated GPIO chips are functional" @@ -382,6 +399,7 @@ $BASE_DIR/gpio-mockup-cdev -s 1 /dev/`configfs_chip_name chip bank` 0 & sleep 0.1 # FIXME Any better way? test `cat $SYSFS_PATH` = "1" || fail "incorrect value read from sysfs" kill $! +disable_chip chip remove_chip chip echo "4.2. Bias settings work correctly" @@ -394,6 +412,7 @@ CHIPNAME=`configfs_chip_name chip bank` SYSFS_PATH="/sys/devices/platform/$DEVNAME/$CHIPNAME/sim_gpio0/value" $BASE_DIR/gpio-mockup-cdev -b pull-up /dev/`configfs_chip_name chip bank` 0 test `cat $SYSFS_PATH` = "1" || fail "bias setting does not work" +disable_chip chip remove_chip chip echo "GPIO $MODULE test PASS" diff --git a/tools/testing/selftests/hid/.gitignore b/tools/testing/selftests/hid/.gitignore index 746c62361f77..933f483815b2 100644 --- a/tools/testing/selftests/hid/.gitignore +++ b/tools/testing/selftests/hid/.gitignore @@ -1,5 +1,6 @@ bpftool *.skel.h +/host-tools /tools hid_bpf hidraw diff --git a/tools/testing/selftests/hid/Makefile b/tools/testing/selftests/hid/Makefile index 0336353bd15f..2839d2612ce3 100644 --- a/tools/testing/selftests/hid/Makefile +++ b/tools/testing/selftests/hid/Makefile @@ -43,10 +43,8 @@ TEST_GEN_PROGS = hid_bpf hidraw # $3 - target (assumed to be file); only file name will be emitted; # $4 - optional extra arg, emitted as-is, if provided. ifeq ($(V),1) -Q = msg = else -Q = @ msg = @printf ' %-8s%s %s%s\n' "$(1)" "$(if $(2), [$(2)])" "$(notdir $(3))" "$(if $(4), $(4))"; MAKEFLAGS += --no-print-directory submake_extras := feature_display=0 diff --git a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h index e5db897586bb..531228b849da 100644 --- a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h +++ b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h @@ -22,6 +22,9 @@ #define HID_REQ_SET_IDLE HID_REQ_SET_IDLE___not_used #define HID_REQ_SET_PROTOCOL HID_REQ_SET_PROTOCOL___not_used +/* do not define kfunc through vmlinux.h as this messes up our custom hack */ +#define BPF_NO_KFUNC_PROTOTYPES + #include "vmlinux.h" #undef hid_bpf_ctx @@ -91,31 +94,31 @@ struct hid_bpf_ops { /* following are kfuncs exported by HID for HID-BPF */ extern __u8 *hid_bpf_get_data(struct hid_bpf_ctx *ctx, unsigned int offset, - const size_t __sz) __ksym; -extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __ksym; -extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __ksym; + const size_t __sz) __weak __ksym; +extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __weak __ksym; +extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __weak __ksym; extern int hid_bpf_hw_request(struct hid_bpf_ctx *ctx, __u8 *data, size_t buf__sz, enum hid_report_type type, - enum hid_class_request reqtype) __ksym; + enum hid_class_request reqtype) __weak __ksym; extern int hid_bpf_hw_output_report(struct hid_bpf_ctx *ctx, - __u8 *buf, size_t buf__sz) __ksym; + __u8 *buf, size_t buf__sz) __weak __ksym; extern int hid_bpf_input_report(struct hid_bpf_ctx *ctx, enum hid_report_type type, __u8 *data, - size_t buf__sz) __ksym; + size_t buf__sz) __weak __ksym; extern int hid_bpf_try_input_report(struct hid_bpf_ctx *ctx, enum hid_report_type type, __u8 *data, - size_t buf__sz) __ksym; + size_t buf__sz) __weak __ksym; /* bpf_wq implementation */ extern int bpf_wq_init(struct bpf_wq *wq, void *p__map, unsigned int flags) __weak __ksym; extern int bpf_wq_start(struct bpf_wq *wq, unsigned int flags) __weak __ksym; extern int bpf_wq_set_callback_impl(struct bpf_wq *wq, int (callback_fn)(void *map, int *key, void *wq), - unsigned int flags__k, void *aux__ign) __ksym; + unsigned int flags__k, void *aux__ign) __weak __ksym; #define bpf_wq_set_callback(timer, cb, flags) \ bpf_wq_set_callback_impl(timer, cb, flags, NULL) diff --git a/tools/testing/selftests/hid/run-hid-tools-tests.sh b/tools/testing/selftests/hid/run-hid-tools-tests.sh index bdae8464da86..af1682a53c27 100755 --- a/tools/testing/selftests/hid/run-hid-tools-tests.sh +++ b/tools/testing/selftests/hid/run-hid-tools-tests.sh @@ -2,24 +2,26 @@ # SPDX-License-Identifier: GPL-2.0 # Runs tests for the HID subsystem +KSELFTEST_SKIP_TEST=4 + if ! command -v python3 > /dev/null 2>&1; then echo "hid-tools: [SKIP] python3 not installed" - exit 77 + exit $KSELFTEST_SKIP_TEST fi if ! python3 -c "import pytest" > /dev/null 2>&1; then - echo "hid: [SKIP/ pytest module not installed" - exit 77 + echo "hid: [SKIP] pytest module not installed" + exit $KSELFTEST_SKIP_TEST fi if ! python3 -c "import pytest_tap" > /dev/null 2>&1; then - echo "hid: [SKIP/ pytest_tap module not installed" - exit 77 + echo "hid: [SKIP] pytest_tap module not installed" + exit $KSELFTEST_SKIP_TEST fi if ! python3 -c "import hidtools" > /dev/null 2>&1; then - echo "hid: [SKIP/ hid-tools module not installed" - exit 77 + echo "hid: [SKIP] hid-tools module not installed" + exit $KSELFTEST_SKIP_TEST fi TARGET=${TARGET:=.} diff --git a/tools/testing/selftests/iommu/iommufd_fail_nth.c b/tools/testing/selftests/iommu/iommufd_fail_nth.c index 22f6fd5f0f74..64b1f8e1b0cf 100644 --- a/tools/testing/selftests/iommu/iommufd_fail_nth.c +++ b/tools/testing/selftests/iommu/iommufd_fail_nth.c @@ -615,7 +615,12 @@ TEST_FAIL_NTH(basic_fail_nth, access_pin_domain) /* device.c */ TEST_FAIL_NTH(basic_fail_nth, device) { + struct iommu_hwpt_selftest data = { + .iotlb = IOMMU_TEST_IOTLB_DEFAULT, + }; struct iommu_test_hw_info info; + uint32_t fault_id, fault_fd; + uint32_t fault_hwpt_id; uint32_t ioas_id; uint32_t ioas_id2; uint32_t stdev_id; @@ -678,6 +683,15 @@ TEST_FAIL_NTH(basic_fail_nth, device) if (_test_cmd_vdevice_alloc(self->fd, viommu_id, idev_id, 0, &vdev_id)) return -1; + if (_test_ioctl_fault_alloc(self->fd, &fault_id, &fault_fd)) + return -1; + close(fault_fd); + + if (_test_cmd_hwpt_alloc(self->fd, idev_id, hwpt_id, fault_id, + IOMMU_HWPT_FAULT_ID_VALID, &fault_hwpt_id, + IOMMU_HWPT_DATA_SELFTEST, &data, sizeof(data))) + return -1; + return 0; } diff --git a/tools/testing/selftests/ipc/msgque.c b/tools/testing/selftests/ipc/msgque.c index c75ea4094870..e9dbb84c100a 100644 --- a/tools/testing/selftests/ipc/msgque.c +++ b/tools/testing/selftests/ipc/msgque.c @@ -194,7 +194,7 @@ int fill_msgque(struct msgque_data *msgque) int main(int argc, char **argv) { - int msg, pid, err; + int err; struct msgque_data msgque; if (getuid() != 0) diff --git a/tools/testing/selftests/kselftest.h b/tools/testing/selftests/kselftest.h index 29fedf609611..cdf91b0ca40f 100644 --- a/tools/testing/selftests/kselftest.h +++ b/tools/testing/selftests/kselftest.h @@ -18,7 +18,8 @@ * ksft_print_msg(fmt, ...); * ksft_perror(msg); * - * and finally report the pass/fail/skip/xfail state of the test with one of: + * and finally report the pass/fail/skip/xfail/xpass state of the test + * with one of: * * ksft_test_result(condition, fmt, ...); * ksft_test_result_report(result, fmt, ...); @@ -26,6 +27,7 @@ * ksft_test_result_fail(fmt, ...); * ksft_test_result_skip(fmt, ...); * ksft_test_result_xfail(fmt, ...); + * ksft_test_result_xpass(fmt, ...); * ksft_test_result_error(fmt, ...); * ksft_test_result_code(exit_code, test_name, fmt, ...); * @@ -147,6 +149,11 @@ static inline void ksft_set_plan(unsigned int plan) static inline void ksft_print_cnts(void) { + if (ksft_cnt.ksft_xskip > 0) + printf( + "# %u skipped test(s) detected. Consider enabling relevant config options to improve coverage.\n", + ksft_cnt.ksft_xskip + ); if (ksft_plan != ksft_test_num()) printf("# Planned tests != run tests (%u != %u)\n", ksft_plan, ksft_test_num()); @@ -227,6 +234,20 @@ static inline __printf(1, 2) void ksft_test_result_xfail(const char *msg, ...) va_end(args); } +static inline __printf(1, 2) void ksft_test_result_xpass(const char *msg, ...) +{ + int saved_errno = errno; + va_list args; + + ksft_cnt.ksft_xpass++; + + va_start(args, msg); + printf("ok %u # XPASS ", ksft_test_num()); + errno = saved_errno; + vprintf(msg, args); + va_end(args); +} + static inline __printf(1, 2) void ksft_test_result_skip(const char *msg, ...) { int saved_errno = errno; @@ -318,6 +339,9 @@ void ksft_test_result_code(int exit_code, const char *test_name, case KSFT_XFAIL: \ ksft_test_result_xfail(fmt, ##__VA_ARGS__); \ break; \ + case KSFT_XPASS: \ + ksft_test_result_xpass(fmt, ##__VA_ARGS__); \ + break; \ case KSFT_SKIP: \ ksft_test_result_skip(fmt, ##__VA_ARGS__); \ break; \ @@ -403,7 +427,7 @@ static inline __noreturn __printf(1, 2) void ksft_exit_skip(const char *msg, ... */ if (ksft_plan || ksft_test_num()) { ksft_cnt.ksft_xskip++; - printf("ok %d # SKIP ", 1 + ksft_test_num()); + printf("ok %u # SKIP ", 1 + ksft_test_num()); } else { printf("1..0 # SKIP "); } diff --git a/tools/testing/selftests/kselftest/ksft.py b/tools/testing/selftests/kselftest/ksft.py index bf215790a89d..0e030837fc17 100644 --- a/tools/testing/selftests/kselftest/ksft.py +++ b/tools/testing/selftests/kselftest/ksft.py @@ -27,6 +27,9 @@ def set_plan(num_tests): def print_cnts(): + if ksft_cnt['skip'] > 0: + print(f"# {ksft_cnt['skip']} skipped test(s) detected. Consider enabling relevant config options to improve coverage.") + print( f"# Totals: pass:{ksft_cnt['pass']} fail:{ksft_cnt['fail']} xfail:0 xpass:0 skip:{ksft_cnt['skip']} error:0" ) diff --git a/tools/testing/selftests/kselftest/ktap_helpers.sh b/tools/testing/selftests/kselftest/ktap_helpers.sh index 79a125eb24c2..32dbfe9da2c4 100644 --- a/tools/testing/selftests/kselftest/ktap_helpers.sh +++ b/tools/testing/selftests/kselftest/ktap_helpers.sh @@ -7,6 +7,7 @@ KTAP_TESTNO=1 KTAP_CNT_PASS=0 KTAP_CNT_FAIL=0 +KTAP_CNT_XFAIL=0 KTAP_CNT_SKIP=0 KSFT_PASS=0 @@ -40,7 +41,7 @@ ktap_skip_all() { __ktap_test() { result="$1" description="$2" - directive="$3" # optional + directive="${3:-}" # optional local directive_str= [ ! -z "$directive" ] && directive_str="# $directive" @@ -69,6 +70,16 @@ ktap_test_skip() { KTAP_CNT_SKIP=$((KTAP_CNT_SKIP+1)) } +ktap_test_xfail() { + description="$1" + + result="ok" + directive="XFAIL" + __ktap_test "$result" "$description" "$directive" + + KTAP_CNT_XFAIL=$((KTAP_CNT_XFAIL+1)) +} + ktap_test_fail() { description="$1" @@ -99,7 +110,7 @@ ktap_exit_fail_msg() { ktap_finished() { ktap_print_totals - if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP)) -eq "$KSFT_NUM_TESTS" ]; then + if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP + KTAP_CNT_XFAIL)) -eq "$KSFT_NUM_TESTS" ]; then exit "$KSFT_PASS" else exit "$KSFT_FAIL" @@ -107,5 +118,9 @@ ktap_finished() { } ktap_print_totals() { - echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:0 xpass:0 skip:$KTAP_CNT_SKIP error:0" + if [ "$KTAP_CNT_SKIP" -gt 0 ]; then + echo "# $KTAP_CNT_SKIP skipped test(s) detected. " \ + "Consider enabling relevant config options to improve coverage." + fi + echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:$KTAP_CNT_XFAIL xpass:0 skip:$KTAP_CNT_SKIP error:0" } diff --git a/tools/testing/selftests/kselftest_harness.h b/tools/testing/selftests/kselftest_harness.h index a5a72415e37b..666c9fde76da 100644 --- a/tools/testing/selftests/kselftest_harness.h +++ b/tools/testing/selftests/kselftest_harness.h @@ -760,33 +760,33 @@ /* Report with actual signedness to avoid weird output. */ \ switch (is_signed_type(__exp) * 2 + is_signed_type(__seen)) { \ case 0: { \ - unsigned long long __exp_print = (uintptr_t)__exp; \ - unsigned long long __seen_print = (uintptr_t)__seen; \ - __TH_LOG("Expected %s (%llu) %s %s (%llu)", \ + uintmax_t __exp_print = (uintmax_t)__exp; \ + uintmax_t __seen_print = (uintmax_t)__seen; \ + __TH_LOG("Expected %s (%ju) %s %s (%ju)", \ _expected_str, __exp_print, #_t, \ _seen_str, __seen_print); \ break; \ } \ case 1: { \ - unsigned long long __exp_print = (uintptr_t)__exp; \ - long long __seen_print = (intptr_t)__seen; \ - __TH_LOG("Expected %s (%llu) %s %s (%lld)", \ + uintmax_t __exp_print = (uintmax_t)__exp; \ + intmax_t __seen_print = (intmax_t)__seen; \ + __TH_LOG("Expected %s (%ju) %s %s (%jd)", \ _expected_str, __exp_print, #_t, \ _seen_str, __seen_print); \ break; \ } \ case 2: { \ - long long __exp_print = (intptr_t)__exp; \ - unsigned long long __seen_print = (uintptr_t)__seen; \ - __TH_LOG("Expected %s (%lld) %s %s (%llu)", \ + intmax_t __exp_print = (intmax_t)__exp; \ + uintmax_t __seen_print = (uintmax_t)__seen; \ + __TH_LOG("Expected %s (%jd) %s %s (%ju)", \ _expected_str, __exp_print, #_t, \ _seen_str, __seen_print); \ break; \ } \ case 3: { \ - long long __exp_print = (intptr_t)__exp; \ - long long __seen_print = (intptr_t)__seen; \ - __TH_LOG("Expected %s (%lld) %s %s (%lld)", \ + intmax_t __exp_print = (intmax_t)__exp; \ + intmax_t __seen_print = (intmax_t)__seen; \ + __TH_LOG("Expected %s (%jd) %s %s (%jd)", \ _expected_str, __exp_print, #_t, \ _seen_str, __seen_print); \ break; \ diff --git a/tools/testing/selftests/kvm/.gitignore b/tools/testing/selftests/kvm/.gitignore index 7f57abf936e7..1d41a046a7bf 100644 --- a/tools/testing/selftests/kvm/.gitignore +++ b/tools/testing/selftests/kvm/.gitignore @@ -9,3 +9,4 @@ !config !settings !Makefile +!Makefile.kvm
\ No newline at end of file diff --git a/tools/testing/selftests/kvm/Makefile b/tools/testing/selftests/kvm/Makefile index 41593d2e7de9..20af35a91d6f 100644 --- a/tools/testing/selftests/kvm/Makefile +++ b/tools/testing/selftests/kvm/Makefile @@ -1,347 +1,16 @@ # SPDX-License-Identifier: GPL-2.0-only -include ../../../build/Build.include - -all: - top_srcdir = ../../../.. include $(top_srcdir)/scripts/subarch.include ARCH ?= $(SUBARCH) -ifeq ($(ARCH),x86) - ARCH_DIR := x86_64 -else ifeq ($(ARCH),arm64) - ARCH_DIR := aarch64 -else ifeq ($(ARCH),s390) - ARCH_DIR := s390x -else - ARCH_DIR := $(ARCH) -endif - -LIBKVM += lib/assert.c -LIBKVM += lib/elf.c -LIBKVM += lib/guest_modes.c -LIBKVM += lib/io.c -LIBKVM += lib/kvm_util.c -LIBKVM += lib/memstress.c -LIBKVM += lib/guest_sprintf.c -LIBKVM += lib/rbtree.c -LIBKVM += lib/sparsebit.c -LIBKVM += lib/test_util.c -LIBKVM += lib/ucall_common.c -LIBKVM += lib/userfaultfd_util.c - -LIBKVM_STRING += lib/string_override.c - -LIBKVM_x86_64 += lib/x86_64/apic.c -LIBKVM_x86_64 += lib/x86_64/handlers.S -LIBKVM_x86_64 += lib/x86_64/hyperv.c -LIBKVM_x86_64 += lib/x86_64/memstress.c -LIBKVM_x86_64 += lib/x86_64/pmu.c -LIBKVM_x86_64 += lib/x86_64/processor.c -LIBKVM_x86_64 += lib/x86_64/sev.c -LIBKVM_x86_64 += lib/x86_64/svm.c -LIBKVM_x86_64 += lib/x86_64/ucall.c -LIBKVM_x86_64 += lib/x86_64/vmx.c - -LIBKVM_aarch64 += lib/aarch64/gic.c -LIBKVM_aarch64 += lib/aarch64/gic_v3.c -LIBKVM_aarch64 += lib/aarch64/gic_v3_its.c -LIBKVM_aarch64 += lib/aarch64/handlers.S -LIBKVM_aarch64 += lib/aarch64/processor.c -LIBKVM_aarch64 += lib/aarch64/spinlock.c -LIBKVM_aarch64 += lib/aarch64/ucall.c -LIBKVM_aarch64 += lib/aarch64/vgic.c - -LIBKVM_s390x += lib/s390x/diag318_test_handler.c -LIBKVM_s390x += lib/s390x/processor.c -LIBKVM_s390x += lib/s390x/ucall.c -LIBKVM_s390x += lib/s390x/facility.c - -LIBKVM_riscv += lib/riscv/handlers.S -LIBKVM_riscv += lib/riscv/processor.c -LIBKVM_riscv += lib/riscv/ucall.c - -# Non-compiled test targets -TEST_PROGS_x86_64 += x86_64/nx_huge_pages_test.sh - -# Compiled test targets -TEST_GEN_PROGS_x86_64 = x86_64/cpuid_test -TEST_GEN_PROGS_x86_64 += x86_64/cr4_cpuid_sync_test -TEST_GEN_PROGS_x86_64 += x86_64/dirty_log_page_splitting_test -TEST_GEN_PROGS_x86_64 += x86_64/feature_msrs_test -TEST_GEN_PROGS_x86_64 += x86_64/exit_on_emulation_failure_test -TEST_GEN_PROGS_x86_64 += x86_64/fix_hypercall_test -TEST_GEN_PROGS_x86_64 += x86_64/hwcr_msr_test -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_clock -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_cpuid -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_evmcs -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_extended_hypercalls -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_features -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_ipi -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_svm_test -TEST_GEN_PROGS_x86_64 += x86_64/hyperv_tlb_flush -TEST_GEN_PROGS_x86_64 += x86_64/kvm_clock_test -TEST_GEN_PROGS_x86_64 += x86_64/kvm_pv_test -TEST_GEN_PROGS_x86_64 += x86_64/monitor_mwait_test -TEST_GEN_PROGS_x86_64 += x86_64/nested_exceptions_test -TEST_GEN_PROGS_x86_64 += x86_64/platform_info_test -TEST_GEN_PROGS_x86_64 += x86_64/pmu_counters_test -TEST_GEN_PROGS_x86_64 += x86_64/pmu_event_filter_test -TEST_GEN_PROGS_x86_64 += x86_64/private_mem_conversions_test -TEST_GEN_PROGS_x86_64 += x86_64/private_mem_kvm_exits_test -TEST_GEN_PROGS_x86_64 += x86_64/set_boot_cpu_id -TEST_GEN_PROGS_x86_64 += x86_64/set_sregs_test -TEST_GEN_PROGS_x86_64 += x86_64/smaller_maxphyaddr_emulation_test -TEST_GEN_PROGS_x86_64 += x86_64/smm_test -TEST_GEN_PROGS_x86_64 += x86_64/state_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_preemption_timer_test -TEST_GEN_PROGS_x86_64 += x86_64/svm_vmcall_test -TEST_GEN_PROGS_x86_64 += x86_64/svm_int_ctl_test -TEST_GEN_PROGS_x86_64 += x86_64/svm_nested_shutdown_test -TEST_GEN_PROGS_x86_64 += x86_64/svm_nested_soft_inject_test -TEST_GEN_PROGS_x86_64 += x86_64/tsc_scaling_sync -TEST_GEN_PROGS_x86_64 += x86_64/sync_regs_test -TEST_GEN_PROGS_x86_64 += x86_64/ucna_injection_test -TEST_GEN_PROGS_x86_64 += x86_64/userspace_io_test -TEST_GEN_PROGS_x86_64 += x86_64/userspace_msr_exit_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_apic_access_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_close_while_nested_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_dirty_log_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_exception_with_invalid_guest_state -TEST_GEN_PROGS_x86_64 += x86_64/vmx_msrs_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_invalid_nested_guest_state -TEST_GEN_PROGS_x86_64 += x86_64/vmx_set_nested_state_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_tsc_adjust_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_nested_tsc_scaling_test -TEST_GEN_PROGS_x86_64 += x86_64/apic_bus_clock_test -TEST_GEN_PROGS_x86_64 += x86_64/xapic_ipi_test -TEST_GEN_PROGS_x86_64 += x86_64/xapic_state_test -TEST_GEN_PROGS_x86_64 += x86_64/xcr0_cpuid_test -TEST_GEN_PROGS_x86_64 += x86_64/xss_msr_test -TEST_GEN_PROGS_x86_64 += x86_64/debug_regs -TEST_GEN_PROGS_x86_64 += x86_64/tsc_msrs_test -TEST_GEN_PROGS_x86_64 += x86_64/vmx_pmu_caps_test -TEST_GEN_PROGS_x86_64 += x86_64/xen_shinfo_test -TEST_GEN_PROGS_x86_64 += x86_64/xen_vmcall_test -TEST_GEN_PROGS_x86_64 += x86_64/sev_init2_tests -TEST_GEN_PROGS_x86_64 += x86_64/sev_migrate_tests -TEST_GEN_PROGS_x86_64 += x86_64/sev_smoke_test -TEST_GEN_PROGS_x86_64 += x86_64/amx_test -TEST_GEN_PROGS_x86_64 += x86_64/max_vcpuid_cap_test -TEST_GEN_PROGS_x86_64 += x86_64/triple_fault_event_test -TEST_GEN_PROGS_x86_64 += x86_64/recalc_apic_map_test -TEST_GEN_PROGS_x86_64 += access_tracking_perf_test -TEST_GEN_PROGS_x86_64 += coalesced_io_test -TEST_GEN_PROGS_x86_64 += demand_paging_test -TEST_GEN_PROGS_x86_64 += dirty_log_test -TEST_GEN_PROGS_x86_64 += dirty_log_perf_test -TEST_GEN_PROGS_x86_64 += guest_memfd_test -TEST_GEN_PROGS_x86_64 += guest_print_test -TEST_GEN_PROGS_x86_64 += hardware_disable_test -TEST_GEN_PROGS_x86_64 += kvm_create_max_vcpus -TEST_GEN_PROGS_x86_64 += kvm_page_table_test -TEST_GEN_PROGS_x86_64 += max_guest_memory_test -TEST_GEN_PROGS_x86_64 += memslot_modification_stress_test -TEST_GEN_PROGS_x86_64 += memslot_perf_test -TEST_GEN_PROGS_x86_64 += rseq_test -TEST_GEN_PROGS_x86_64 += set_memory_region_test -TEST_GEN_PROGS_x86_64 += steal_time -TEST_GEN_PROGS_x86_64 += kvm_binary_stats_test -TEST_GEN_PROGS_x86_64 += system_counter_offset_test -TEST_GEN_PROGS_x86_64 += pre_fault_memory_test - -# Compiled outputs used by test targets -TEST_GEN_PROGS_EXTENDED_x86_64 += x86_64/nx_huge_pages_test - -TEST_GEN_PROGS_aarch64 += aarch64/aarch32_id_regs -TEST_GEN_PROGS_aarch64 += aarch64/arch_timer_edge_cases -TEST_GEN_PROGS_aarch64 += aarch64/debug-exceptions -TEST_GEN_PROGS_aarch64 += aarch64/hypercalls -TEST_GEN_PROGS_aarch64 += aarch64/mmio_abort -TEST_GEN_PROGS_aarch64 += aarch64/page_fault_test -TEST_GEN_PROGS_aarch64 += aarch64/psci_test -TEST_GEN_PROGS_aarch64 += aarch64/set_id_regs -TEST_GEN_PROGS_aarch64 += aarch64/smccc_filter -TEST_GEN_PROGS_aarch64 += aarch64/vcpu_width_config -TEST_GEN_PROGS_aarch64 += aarch64/vgic_init -TEST_GEN_PROGS_aarch64 += aarch64/vgic_irq -TEST_GEN_PROGS_aarch64 += aarch64/vgic_lpi_stress -TEST_GEN_PROGS_aarch64 += aarch64/vpmu_counter_access -TEST_GEN_PROGS_aarch64 += aarch64/no-vgic-v3 -TEST_GEN_PROGS_aarch64 += access_tracking_perf_test -TEST_GEN_PROGS_aarch64 += arch_timer -TEST_GEN_PROGS_aarch64 += coalesced_io_test -TEST_GEN_PROGS_aarch64 += demand_paging_test -TEST_GEN_PROGS_aarch64 += dirty_log_test -TEST_GEN_PROGS_aarch64 += dirty_log_perf_test -TEST_GEN_PROGS_aarch64 += guest_print_test -TEST_GEN_PROGS_aarch64 += get-reg-list -TEST_GEN_PROGS_aarch64 += kvm_create_max_vcpus -TEST_GEN_PROGS_aarch64 += kvm_page_table_test -TEST_GEN_PROGS_aarch64 += memslot_modification_stress_test -TEST_GEN_PROGS_aarch64 += memslot_perf_test -TEST_GEN_PROGS_aarch64 += rseq_test -TEST_GEN_PROGS_aarch64 += set_memory_region_test -TEST_GEN_PROGS_aarch64 += steal_time -TEST_GEN_PROGS_aarch64 += kvm_binary_stats_test - -TEST_GEN_PROGS_s390x = s390x/memop -TEST_GEN_PROGS_s390x += s390x/resets -TEST_GEN_PROGS_s390x += s390x/sync_regs_test -TEST_GEN_PROGS_s390x += s390x/tprot -TEST_GEN_PROGS_s390x += s390x/cmma_test -TEST_GEN_PROGS_s390x += s390x/debug_test -TEST_GEN_PROGS_s390x += s390x/cpumodel_subfuncs_test -TEST_GEN_PROGS_s390x += s390x/shared_zeropage_test -TEST_GEN_PROGS_s390x += s390x/ucontrol_test -TEST_GEN_PROGS_s390x += demand_paging_test -TEST_GEN_PROGS_s390x += dirty_log_test -TEST_GEN_PROGS_s390x += guest_print_test -TEST_GEN_PROGS_s390x += kvm_create_max_vcpus -TEST_GEN_PROGS_s390x += kvm_page_table_test -TEST_GEN_PROGS_s390x += rseq_test -TEST_GEN_PROGS_s390x += set_memory_region_test -TEST_GEN_PROGS_s390x += kvm_binary_stats_test - -TEST_GEN_PROGS_riscv += riscv/sbi_pmu_test -TEST_GEN_PROGS_riscv += riscv/ebreak_test -TEST_GEN_PROGS_riscv += arch_timer -TEST_GEN_PROGS_riscv += coalesced_io_test -TEST_GEN_PROGS_riscv += demand_paging_test -TEST_GEN_PROGS_riscv += dirty_log_test -TEST_GEN_PROGS_riscv += get-reg-list -TEST_GEN_PROGS_riscv += guest_print_test -TEST_GEN_PROGS_riscv += kvm_binary_stats_test -TEST_GEN_PROGS_riscv += kvm_create_max_vcpus -TEST_GEN_PROGS_riscv += kvm_page_table_test -TEST_GEN_PROGS_riscv += set_memory_region_test -TEST_GEN_PROGS_riscv += steal_time - -SPLIT_TESTS += arch_timer -SPLIT_TESTS += get-reg-list - -TEST_PROGS += $(TEST_PROGS_$(ARCH_DIR)) -TEST_GEN_PROGS += $(TEST_GEN_PROGS_$(ARCH_DIR)) -TEST_GEN_PROGS_EXTENDED += $(TEST_GEN_PROGS_EXTENDED_$(ARCH_DIR)) -LIBKVM += $(LIBKVM_$(ARCH_DIR)) - -OVERRIDE_TARGETS = 1 - -# lib.mak defines $(OUTPUT), prepends $(OUTPUT)/ to $(TEST_GEN_PROGS), and most -# importantly defines, i.e. overwrites, $(CC) (unless `make -e` or `make CC=`, -# which causes the environment variable to override the makefile). -include ../lib.mk - -INSTALL_HDR_PATH = $(top_srcdir)/usr -LINUX_HDR_PATH = $(INSTALL_HDR_PATH)/include/ -LINUX_TOOL_INCLUDE = $(top_srcdir)/tools/include +ifeq ($(ARCH),$(filter $(ARCH),arm64 s390 riscv x86 x86_64)) +# Top-level selftests allows ARCH=x86_64 :-( ifeq ($(ARCH),x86_64) -LINUX_TOOL_ARCH_INCLUDE = $(top_srcdir)/tools/arch/x86/include -else -LINUX_TOOL_ARCH_INCLUDE = $(top_srcdir)/tools/arch/$(ARCH)/include + ARCH := x86 endif -CFLAGS += -Wall -Wstrict-prototypes -Wuninitialized -O2 -g -std=gnu99 \ - -Wno-gnu-variable-sized-type-not-at-end -MD -MP -DCONFIG_64BIT \ - -fno-builtin-memcmp -fno-builtin-memcpy \ - -fno-builtin-memset -fno-builtin-strnlen \ - -fno-stack-protector -fno-PIE -fno-strict-aliasing \ - -I$(LINUX_TOOL_INCLUDE) -I$(LINUX_TOOL_ARCH_INCLUDE) \ - -I$(LINUX_HDR_PATH) -Iinclude -I$(<D) -Iinclude/$(ARCH_DIR) \ - -I ../rseq -I.. $(EXTRA_CFLAGS) $(KHDR_INCLUDES) -ifeq ($(ARCH),s390) - CFLAGS += -march=z10 -endif -ifeq ($(ARCH),x86) -ifeq ($(shell echo "void foo(void) { }" | $(CC) -march=x86-64-v2 -x c - -c -o /dev/null 2>/dev/null; echo "$$?"),0) - CFLAGS += -march=x86-64-v2 -endif -endif -ifeq ($(ARCH),arm64) -tools_dir := $(top_srcdir)/tools -arm64_tools_dir := $(tools_dir)/arch/arm64/tools/ - -ifneq ($(abs_objdir),) -arm64_hdr_outdir := $(abs_objdir)/tools/ +include Makefile.kvm else -arm64_hdr_outdir := $(tools_dir)/ -endif - -GEN_HDRS := $(arm64_hdr_outdir)arch/arm64/include/generated/ -CFLAGS += -I$(GEN_HDRS) - -$(GEN_HDRS): $(wildcard $(arm64_tools_dir)/*) - $(MAKE) -C $(arm64_tools_dir) OUTPUT=$(arm64_hdr_outdir) +# Empty targets for unsupported architectures +all: +clean: endif - -no-pie-option := $(call try-run, echo 'int main(void) { return 0; }' | \ - $(CC) -Werror $(CFLAGS) -no-pie -x c - -o "$$TMP", -no-pie) - -# On s390, build the testcases KVM-enabled -pgste-option = $(call try-run, echo 'int main(void) { return 0; }' | \ - $(CC) -Werror -Wl$(comma)--s390-pgste -x c - -o "$$TMP",-Wl$(comma)--s390-pgste) - -LDLIBS += -ldl -LDFLAGS += -pthread $(no-pie-option) $(pgste-option) - -LIBKVM_C := $(filter %.c,$(LIBKVM)) -LIBKVM_S := $(filter %.S,$(LIBKVM)) -LIBKVM_C_OBJ := $(patsubst %.c, $(OUTPUT)/%.o, $(LIBKVM_C)) -LIBKVM_S_OBJ := $(patsubst %.S, $(OUTPUT)/%.o, $(LIBKVM_S)) -LIBKVM_STRING_OBJ := $(patsubst %.c, $(OUTPUT)/%.o, $(LIBKVM_STRING)) -LIBKVM_OBJS = $(LIBKVM_C_OBJ) $(LIBKVM_S_OBJ) $(LIBKVM_STRING_OBJ) -SPLIT_TEST_GEN_PROGS := $(patsubst %, $(OUTPUT)/%, $(SPLIT_TESTS)) -SPLIT_TEST_GEN_OBJ := $(patsubst %, $(OUTPUT)/$(ARCH_DIR)/%.o, $(SPLIT_TESTS)) - -TEST_GEN_OBJ = $(patsubst %, %.o, $(TEST_GEN_PROGS)) -TEST_GEN_OBJ += $(patsubst %, %.o, $(TEST_GEN_PROGS_EXTENDED)) -TEST_DEP_FILES = $(patsubst %.o, %.d, $(TEST_GEN_OBJ)) -TEST_DEP_FILES += $(patsubst %.o, %.d, $(LIBKVM_OBJS)) -TEST_DEP_FILES += $(patsubst %.o, %.d, $(SPLIT_TEST_GEN_OBJ)) --include $(TEST_DEP_FILES) - -$(shell mkdir -p $(sort $(OUTPUT)/$(ARCH_DIR) $(dir $(LIBKVM_C_OBJ) $(LIBKVM_S_OBJ)))) - -$(filter-out $(SPLIT_TEST_GEN_PROGS), $(TEST_GEN_PROGS)) \ -$(TEST_GEN_PROGS_EXTENDED): %: %.o - $(CC) $(CFLAGS) $(CPPFLAGS) $(LDFLAGS) $(TARGET_ARCH) $< $(LIBKVM_OBJS) $(LDLIBS) -o $@ -$(TEST_GEN_OBJ): $(OUTPUT)/%.o: %.c - $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ - -$(SPLIT_TEST_GEN_PROGS): $(OUTPUT)/%: $(OUTPUT)/%.o $(OUTPUT)/$(ARCH_DIR)/%.o - $(CC) $(CFLAGS) $(CPPFLAGS) $(LDFLAGS) $(TARGET_ARCH) $^ $(LDLIBS) -o $@ -$(SPLIT_TEST_GEN_OBJ): $(OUTPUT)/$(ARCH_DIR)/%.o: $(ARCH_DIR)/%.c - $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ - -EXTRA_CLEAN += $(GEN_HDRS) \ - $(LIBKVM_OBJS) \ - $(SPLIT_TEST_GEN_OBJ) \ - $(TEST_DEP_FILES) \ - $(TEST_GEN_OBJ) \ - cscope.* - -$(LIBKVM_C_OBJ): $(OUTPUT)/%.o: %.c $(GEN_HDRS) - $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ - -$(LIBKVM_S_OBJ): $(OUTPUT)/%.o: %.S $(GEN_HDRS) - $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ - -# Compile the string overrides as freestanding to prevent the compiler from -# generating self-referential code, e.g. without "freestanding" the compiler may -# "optimize" memcmp() by invoking memcmp(), thus causing infinite recursion. -$(LIBKVM_STRING_OBJ): $(OUTPUT)/%.o: %.c - $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c -ffreestanding $< -o $@ - -$(shell mkdir -p $(sort $(dir $(TEST_GEN_PROGS)))) -$(SPLIT_TEST_GEN_OBJ): $(GEN_HDRS) -$(TEST_GEN_PROGS): $(LIBKVM_OBJS) -$(TEST_GEN_PROGS_EXTENDED): $(LIBKVM_OBJS) -$(TEST_GEN_OBJ): $(GEN_HDRS) - -cscope: include_paths = $(LINUX_TOOL_INCLUDE) $(LINUX_HDR_PATH) include lib .. -cscope: - $(RM) cscope.* - (find $(include_paths) -name '*.h' \ - -exec realpath --relative-base=$(PWD) {} \;; \ - find . -name '*.c' \ - -exec realpath --relative-base=$(PWD) {} \;) | sort -u > cscope.files - cscope -b diff --git a/tools/testing/selftests/kvm/Makefile.kvm b/tools/testing/selftests/kvm/Makefile.kvm new file mode 100644 index 000000000000..4277b983cace --- /dev/null +++ b/tools/testing/selftests/kvm/Makefile.kvm @@ -0,0 +1,330 @@ +# SPDX-License-Identifier: GPL-2.0-only +include ../../../build/Build.include + +all: + +LIBKVM += lib/assert.c +LIBKVM += lib/elf.c +LIBKVM += lib/guest_modes.c +LIBKVM += lib/io.c +LIBKVM += lib/kvm_util.c +LIBKVM += lib/memstress.c +LIBKVM += lib/guest_sprintf.c +LIBKVM += lib/rbtree.c +LIBKVM += lib/sparsebit.c +LIBKVM += lib/test_util.c +LIBKVM += lib/ucall_common.c +LIBKVM += lib/userfaultfd_util.c + +LIBKVM_STRING += lib/string_override.c + +LIBKVM_x86 += lib/x86/apic.c +LIBKVM_x86 += lib/x86/handlers.S +LIBKVM_x86 += lib/x86/hyperv.c +LIBKVM_x86 += lib/x86/memstress.c +LIBKVM_x86 += lib/x86/pmu.c +LIBKVM_x86 += lib/x86/processor.c +LIBKVM_x86 += lib/x86/sev.c +LIBKVM_x86 += lib/x86/svm.c +LIBKVM_x86 += lib/x86/ucall.c +LIBKVM_x86 += lib/x86/vmx.c + +LIBKVM_arm64 += lib/arm64/gic.c +LIBKVM_arm64 += lib/arm64/gic_v3.c +LIBKVM_arm64 += lib/arm64/gic_v3_its.c +LIBKVM_arm64 += lib/arm64/handlers.S +LIBKVM_arm64 += lib/arm64/processor.c +LIBKVM_arm64 += lib/arm64/spinlock.c +LIBKVM_arm64 += lib/arm64/ucall.c +LIBKVM_arm64 += lib/arm64/vgic.c + +LIBKVM_s390 += lib/s390/diag318_test_handler.c +LIBKVM_s390 += lib/s390/processor.c +LIBKVM_s390 += lib/s390/ucall.c +LIBKVM_s390 += lib/s390/facility.c + +LIBKVM_riscv += lib/riscv/handlers.S +LIBKVM_riscv += lib/riscv/processor.c +LIBKVM_riscv += lib/riscv/ucall.c + +# Non-compiled test targets +TEST_PROGS_x86 += x86/nx_huge_pages_test.sh + +# Compiled test targets +TEST_GEN_PROGS_x86 = x86/cpuid_test +TEST_GEN_PROGS_x86 += x86/cr4_cpuid_sync_test +TEST_GEN_PROGS_x86 += x86/dirty_log_page_splitting_test +TEST_GEN_PROGS_x86 += x86/feature_msrs_test +TEST_GEN_PROGS_x86 += x86/exit_on_emulation_failure_test +TEST_GEN_PROGS_x86 += x86/fix_hypercall_test +TEST_GEN_PROGS_x86 += x86/hwcr_msr_test +TEST_GEN_PROGS_x86 += x86/hyperv_clock +TEST_GEN_PROGS_x86 += x86/hyperv_cpuid +TEST_GEN_PROGS_x86 += x86/hyperv_evmcs +TEST_GEN_PROGS_x86 += x86/hyperv_extended_hypercalls +TEST_GEN_PROGS_x86 += x86/hyperv_features +TEST_GEN_PROGS_x86 += x86/hyperv_ipi +TEST_GEN_PROGS_x86 += x86/hyperv_svm_test +TEST_GEN_PROGS_x86 += x86/hyperv_tlb_flush +TEST_GEN_PROGS_x86 += x86/kvm_clock_test +TEST_GEN_PROGS_x86 += x86/kvm_pv_test +TEST_GEN_PROGS_x86 += x86/monitor_mwait_test +TEST_GEN_PROGS_x86 += x86/nested_exceptions_test +TEST_GEN_PROGS_x86 += x86/platform_info_test +TEST_GEN_PROGS_x86 += x86/pmu_counters_test +TEST_GEN_PROGS_x86 += x86/pmu_event_filter_test +TEST_GEN_PROGS_x86 += x86/private_mem_conversions_test +TEST_GEN_PROGS_x86 += x86/private_mem_kvm_exits_test +TEST_GEN_PROGS_x86 += x86/set_boot_cpu_id +TEST_GEN_PROGS_x86 += x86/set_sregs_test +TEST_GEN_PROGS_x86 += x86/smaller_maxphyaddr_emulation_test +TEST_GEN_PROGS_x86 += x86/smm_test +TEST_GEN_PROGS_x86 += x86/state_test +TEST_GEN_PROGS_x86 += x86/vmx_preemption_timer_test +TEST_GEN_PROGS_x86 += x86/svm_vmcall_test +TEST_GEN_PROGS_x86 += x86/svm_int_ctl_test +TEST_GEN_PROGS_x86 += x86/svm_nested_shutdown_test +TEST_GEN_PROGS_x86 += x86/svm_nested_soft_inject_test +TEST_GEN_PROGS_x86 += x86/tsc_scaling_sync +TEST_GEN_PROGS_x86 += x86/sync_regs_test +TEST_GEN_PROGS_x86 += x86/ucna_injection_test +TEST_GEN_PROGS_x86 += x86/userspace_io_test +TEST_GEN_PROGS_x86 += x86/userspace_msr_exit_test +TEST_GEN_PROGS_x86 += x86/vmx_apic_access_test +TEST_GEN_PROGS_x86 += x86/vmx_close_while_nested_test +TEST_GEN_PROGS_x86 += x86/vmx_dirty_log_test +TEST_GEN_PROGS_x86 += x86/vmx_exception_with_invalid_guest_state +TEST_GEN_PROGS_x86 += x86/vmx_msrs_test +TEST_GEN_PROGS_x86 += x86/vmx_invalid_nested_guest_state +TEST_GEN_PROGS_x86 += x86/vmx_set_nested_state_test +TEST_GEN_PROGS_x86 += x86/vmx_tsc_adjust_test +TEST_GEN_PROGS_x86 += x86/vmx_nested_tsc_scaling_test +TEST_GEN_PROGS_x86 += x86/apic_bus_clock_test +TEST_GEN_PROGS_x86 += x86/xapic_ipi_test +TEST_GEN_PROGS_x86 += x86/xapic_state_test +TEST_GEN_PROGS_x86 += x86/xcr0_cpuid_test +TEST_GEN_PROGS_x86 += x86/xss_msr_test +TEST_GEN_PROGS_x86 += x86/debug_regs +TEST_GEN_PROGS_x86 += x86/tsc_msrs_test +TEST_GEN_PROGS_x86 += x86/vmx_pmu_caps_test +TEST_GEN_PROGS_x86 += x86/xen_shinfo_test +TEST_GEN_PROGS_x86 += x86/xen_vmcall_test +TEST_GEN_PROGS_x86 += x86/sev_init2_tests +TEST_GEN_PROGS_x86 += x86/sev_migrate_tests +TEST_GEN_PROGS_x86 += x86/sev_smoke_test +TEST_GEN_PROGS_x86 += x86/amx_test +TEST_GEN_PROGS_x86 += x86/max_vcpuid_cap_test +TEST_GEN_PROGS_x86 += x86/triple_fault_event_test +TEST_GEN_PROGS_x86 += x86/recalc_apic_map_test +TEST_GEN_PROGS_x86 += access_tracking_perf_test +TEST_GEN_PROGS_x86 += coalesced_io_test +TEST_GEN_PROGS_x86 += demand_paging_test +TEST_GEN_PROGS_x86 += dirty_log_test +TEST_GEN_PROGS_x86 += dirty_log_perf_test +TEST_GEN_PROGS_x86 += guest_memfd_test +TEST_GEN_PROGS_x86 += guest_print_test +TEST_GEN_PROGS_x86 += hardware_disable_test +TEST_GEN_PROGS_x86 += kvm_create_max_vcpus +TEST_GEN_PROGS_x86 += kvm_page_table_test +TEST_GEN_PROGS_x86 += memslot_modification_stress_test +TEST_GEN_PROGS_x86 += memslot_perf_test +TEST_GEN_PROGS_x86 += mmu_stress_test +TEST_GEN_PROGS_x86 += rseq_test +TEST_GEN_PROGS_x86 += set_memory_region_test +TEST_GEN_PROGS_x86 += steal_time +TEST_GEN_PROGS_x86 += kvm_binary_stats_test +TEST_GEN_PROGS_x86 += system_counter_offset_test +TEST_GEN_PROGS_x86 += pre_fault_memory_test + +# Compiled outputs used by test targets +TEST_GEN_PROGS_EXTENDED_x86 += x86/nx_huge_pages_test + +TEST_GEN_PROGS_arm64 += arm64/aarch32_id_regs +TEST_GEN_PROGS_arm64 += arm64/arch_timer_edge_cases +TEST_GEN_PROGS_arm64 += arm64/debug-exceptions +TEST_GEN_PROGS_arm64 += arm64/hypercalls +TEST_GEN_PROGS_arm64 += arm64/mmio_abort +TEST_GEN_PROGS_arm64 += arm64/page_fault_test +TEST_GEN_PROGS_arm64 += arm64/psci_test +TEST_GEN_PROGS_arm64 += arm64/set_id_regs +TEST_GEN_PROGS_arm64 += arm64/smccc_filter +TEST_GEN_PROGS_arm64 += arm64/vcpu_width_config +TEST_GEN_PROGS_arm64 += arm64/vgic_init +TEST_GEN_PROGS_arm64 += arm64/vgic_irq +TEST_GEN_PROGS_arm64 += arm64/vgic_lpi_stress +TEST_GEN_PROGS_arm64 += arm64/vpmu_counter_access +TEST_GEN_PROGS_arm64 += arm64/no-vgic-v3 +TEST_GEN_PROGS_arm64 += access_tracking_perf_test +TEST_GEN_PROGS_arm64 += arch_timer +TEST_GEN_PROGS_arm64 += coalesced_io_test +TEST_GEN_PROGS_arm64 += demand_paging_test +TEST_GEN_PROGS_arm64 += dirty_log_test +TEST_GEN_PROGS_arm64 += dirty_log_perf_test +TEST_GEN_PROGS_arm64 += guest_print_test +TEST_GEN_PROGS_arm64 += get-reg-list +TEST_GEN_PROGS_arm64 += kvm_create_max_vcpus +TEST_GEN_PROGS_arm64 += kvm_page_table_test +TEST_GEN_PROGS_arm64 += memslot_modification_stress_test +TEST_GEN_PROGS_arm64 += memslot_perf_test +TEST_GEN_PROGS_arm64 += mmu_stress_test +TEST_GEN_PROGS_arm64 += rseq_test +TEST_GEN_PROGS_arm64 += set_memory_region_test +TEST_GEN_PROGS_arm64 += steal_time +TEST_GEN_PROGS_arm64 += kvm_binary_stats_test + +TEST_GEN_PROGS_s390 = s390/memop +TEST_GEN_PROGS_s390 += s390/resets +TEST_GEN_PROGS_s390 += s390/sync_regs_test +TEST_GEN_PROGS_s390 += s390/tprot +TEST_GEN_PROGS_s390 += s390/cmma_test +TEST_GEN_PROGS_s390 += s390/debug_test +TEST_GEN_PROGS_s390 += s390/cpumodel_subfuncs_test +TEST_GEN_PROGS_s390 += s390/shared_zeropage_test +TEST_GEN_PROGS_s390 += s390/ucontrol_test +TEST_GEN_PROGS_s390 += demand_paging_test +TEST_GEN_PROGS_s390 += dirty_log_test +TEST_GEN_PROGS_s390 += guest_print_test +TEST_GEN_PROGS_s390 += kvm_create_max_vcpus +TEST_GEN_PROGS_s390 += kvm_page_table_test +TEST_GEN_PROGS_s390 += rseq_test +TEST_GEN_PROGS_s390 += set_memory_region_test +TEST_GEN_PROGS_s390 += kvm_binary_stats_test + +TEST_GEN_PROGS_riscv += riscv/sbi_pmu_test +TEST_GEN_PROGS_riscv += riscv/ebreak_test +TEST_GEN_PROGS_riscv += arch_timer +TEST_GEN_PROGS_riscv += coalesced_io_test +TEST_GEN_PROGS_riscv += demand_paging_test +TEST_GEN_PROGS_riscv += dirty_log_test +TEST_GEN_PROGS_riscv += get-reg-list +TEST_GEN_PROGS_riscv += guest_print_test +TEST_GEN_PROGS_riscv += kvm_binary_stats_test +TEST_GEN_PROGS_riscv += kvm_create_max_vcpus +TEST_GEN_PROGS_riscv += kvm_page_table_test +TEST_GEN_PROGS_riscv += set_memory_region_test +TEST_GEN_PROGS_riscv += steal_time + +SPLIT_TESTS += arch_timer +SPLIT_TESTS += get-reg-list + +TEST_PROGS += $(TEST_PROGS_$(ARCH)) +TEST_GEN_PROGS += $(TEST_GEN_PROGS_$(ARCH)) +TEST_GEN_PROGS_EXTENDED += $(TEST_GEN_PROGS_EXTENDED_$(ARCH)) +LIBKVM += $(LIBKVM_$(ARCH)) + +OVERRIDE_TARGETS = 1 + +# lib.mak defines $(OUTPUT), prepends $(OUTPUT)/ to $(TEST_GEN_PROGS), and most +# importantly defines, i.e. overwrites, $(CC) (unless `make -e` or `make CC=`, +# which causes the environment variable to override the makefile). +include ../lib.mk + +INSTALL_HDR_PATH = $(top_srcdir)/usr +LINUX_HDR_PATH = $(INSTALL_HDR_PATH)/include/ +LINUX_TOOL_INCLUDE = $(top_srcdir)/tools/include +LINUX_TOOL_ARCH_INCLUDE = $(top_srcdir)/tools/arch/$(ARCH)/include +CFLAGS += -Wall -Wstrict-prototypes -Wuninitialized -O2 -g -std=gnu99 \ + -Wno-gnu-variable-sized-type-not-at-end -MD -MP -DCONFIG_64BIT \ + -fno-builtin-memcmp -fno-builtin-memcpy \ + -fno-builtin-memset -fno-builtin-strnlen \ + -fno-stack-protector -fno-PIE -fno-strict-aliasing \ + -I$(LINUX_TOOL_INCLUDE) -I$(LINUX_TOOL_ARCH_INCLUDE) \ + -I$(LINUX_HDR_PATH) -Iinclude -I$(<D) -Iinclude/$(ARCH) \ + -I ../rseq -I.. $(EXTRA_CFLAGS) $(KHDR_INCLUDES) +ifeq ($(ARCH),s390) + CFLAGS += -march=z10 +endif +ifeq ($(ARCH),x86) +ifeq ($(shell echo "void foo(void) { }" | $(CC) -march=x86-64-v2 -x c - -c -o /dev/null 2>/dev/null; echo "$$?"),0) + CFLAGS += -march=x86-64-v2 +endif +endif +ifeq ($(ARCH),arm64) +tools_dir := $(top_srcdir)/tools +arm64_tools_dir := $(tools_dir)/arch/arm64/tools/ + +ifneq ($(abs_objdir),) +arm64_hdr_outdir := $(abs_objdir)/tools/ +else +arm64_hdr_outdir := $(tools_dir)/ +endif + +GEN_HDRS := $(arm64_hdr_outdir)arch/arm64/include/generated/ +CFLAGS += -I$(GEN_HDRS) + +$(GEN_HDRS): $(wildcard $(arm64_tools_dir)/*) + $(MAKE) -C $(arm64_tools_dir) OUTPUT=$(arm64_hdr_outdir) +endif + +no-pie-option := $(call try-run, echo 'int main(void) { return 0; }' | \ + $(CC) -Werror $(CFLAGS) -no-pie -x c - -o "$$TMP", -no-pie) + +# On s390, build the testcases KVM-enabled +pgste-option = $(call try-run, echo 'int main(void) { return 0; }' | \ + $(CC) -Werror -Wl$(comma)--s390-pgste -x c - -o "$$TMP",-Wl$(comma)--s390-pgste) + +LDLIBS += -ldl +LDFLAGS += -pthread $(no-pie-option) $(pgste-option) + +LIBKVM_C := $(filter %.c,$(LIBKVM)) +LIBKVM_S := $(filter %.S,$(LIBKVM)) +LIBKVM_C_OBJ := $(patsubst %.c, $(OUTPUT)/%.o, $(LIBKVM_C)) +LIBKVM_S_OBJ := $(patsubst %.S, $(OUTPUT)/%.o, $(LIBKVM_S)) +LIBKVM_STRING_OBJ := $(patsubst %.c, $(OUTPUT)/%.o, $(LIBKVM_STRING)) +LIBKVM_OBJS = $(LIBKVM_C_OBJ) $(LIBKVM_S_OBJ) $(LIBKVM_STRING_OBJ) +SPLIT_TEST_GEN_PROGS := $(patsubst %, $(OUTPUT)/%, $(SPLIT_TESTS)) +SPLIT_TEST_GEN_OBJ := $(patsubst %, $(OUTPUT)/$(ARCH)/%.o, $(SPLIT_TESTS)) + +TEST_GEN_OBJ = $(patsubst %, %.o, $(TEST_GEN_PROGS)) +TEST_GEN_OBJ += $(patsubst %, %.o, $(TEST_GEN_PROGS_EXTENDED)) +TEST_DEP_FILES = $(patsubst %.o, %.d, $(TEST_GEN_OBJ)) +TEST_DEP_FILES += $(patsubst %.o, %.d, $(LIBKVM_OBJS)) +TEST_DEP_FILES += $(patsubst %.o, %.d, $(SPLIT_TEST_GEN_OBJ)) +-include $(TEST_DEP_FILES) + +$(shell mkdir -p $(sort $(OUTPUT)/$(ARCH) $(dir $(LIBKVM_C_OBJ) $(LIBKVM_S_OBJ)))) + +$(filter-out $(SPLIT_TEST_GEN_PROGS), $(TEST_GEN_PROGS)) \ +$(TEST_GEN_PROGS_EXTENDED): %: %.o + $(CC) $(CFLAGS) $(CPPFLAGS) $(LDFLAGS) $(TARGET_ARCH) $< $(LIBKVM_OBJS) $(LDLIBS) -o $@ +$(TEST_GEN_OBJ): $(OUTPUT)/%.o: %.c + $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ + +$(SPLIT_TEST_GEN_PROGS): $(OUTPUT)/%: $(OUTPUT)/%.o $(OUTPUT)/$(ARCH)/%.o + $(CC) $(CFLAGS) $(CPPFLAGS) $(LDFLAGS) $(TARGET_ARCH) $^ $(LDLIBS) -o $@ +$(SPLIT_TEST_GEN_OBJ): $(OUTPUT)/$(ARCH)/%.o: $(ARCH)/%.c + $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ + +EXTRA_CLEAN += $(GEN_HDRS) \ + $(LIBKVM_OBJS) \ + $(SPLIT_TEST_GEN_OBJ) \ + $(TEST_DEP_FILES) \ + $(TEST_GEN_OBJ) \ + cscope.* + +$(LIBKVM_C_OBJ): $(OUTPUT)/%.o: %.c $(GEN_HDRS) + $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ + +$(LIBKVM_S_OBJ): $(OUTPUT)/%.o: %.S $(GEN_HDRS) + $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c $< -o $@ + +# Compile the string overrides as freestanding to prevent the compiler from +# generating self-referential code, e.g. without "freestanding" the compiler may +# "optimize" memcmp() by invoking memcmp(), thus causing infinite recursion. +$(LIBKVM_STRING_OBJ): $(OUTPUT)/%.o: %.c + $(CC) $(CFLAGS) $(CPPFLAGS) $(TARGET_ARCH) -c -ffreestanding $< -o $@ + +$(shell mkdir -p $(sort $(dir $(TEST_GEN_PROGS)))) +$(SPLIT_TEST_GEN_OBJ): $(GEN_HDRS) +$(TEST_GEN_PROGS): $(LIBKVM_OBJS) +$(TEST_GEN_PROGS_EXTENDED): $(LIBKVM_OBJS) +$(TEST_GEN_OBJ): $(GEN_HDRS) + +cscope: include_paths = $(LINUX_TOOL_INCLUDE) $(LINUX_HDR_PATH) include lib .. +cscope: + $(RM) cscope.* + (find $(include_paths) -name '*.h' \ + -exec realpath --relative-base=$(PWD) {} \;; \ + find . -name '*.c' \ + -exec realpath --relative-base=$(PWD) {} \;) | sort -u > cscope.files + cscope -b diff --git a/tools/testing/selftests/kvm/aarch64/aarch32_id_regs.c b/tools/testing/selftests/kvm/arm64/aarch32_id_regs.c index 8e5bd07a3727..cef8f7323ceb 100644 --- a/tools/testing/selftests/kvm/aarch64/aarch32_id_regs.c +++ b/tools/testing/selftests/kvm/arm64/aarch32_id_regs.c @@ -97,7 +97,7 @@ static void test_user_raz_wi(struct kvm_vcpu *vcpu) uint64_t reg_id = raz_wi_reg_ids[i]; uint64_t val; - vcpu_get_reg(vcpu, reg_id, &val); + val = vcpu_get_reg(vcpu, reg_id); TEST_ASSERT_EQ(val, 0); /* @@ -106,7 +106,7 @@ static void test_user_raz_wi(struct kvm_vcpu *vcpu) */ vcpu_set_reg(vcpu, reg_id, BAD_ID_REG_VAL); - vcpu_get_reg(vcpu, reg_id, &val); + val = vcpu_get_reg(vcpu, reg_id); TEST_ASSERT_EQ(val, 0); } } @@ -126,14 +126,14 @@ static void test_user_raz_invariant(struct kvm_vcpu *vcpu) uint64_t reg_id = raz_invariant_reg_ids[i]; uint64_t val; - vcpu_get_reg(vcpu, reg_id, &val); + val = vcpu_get_reg(vcpu, reg_id); TEST_ASSERT_EQ(val, 0); r = __vcpu_set_reg(vcpu, reg_id, BAD_ID_REG_VAL); TEST_ASSERT(r < 0 && errno == EINVAL, "unexpected KVM_SET_ONE_REG error: r=%d, errno=%d", r, errno); - vcpu_get_reg(vcpu, reg_id, &val); + val = vcpu_get_reg(vcpu, reg_id); TEST_ASSERT_EQ(val, 0); } } @@ -144,10 +144,10 @@ static bool vcpu_aarch64_only(struct kvm_vcpu *vcpu) { uint64_t val, el0; - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1), &val); + val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1)); el0 = FIELD_GET(ARM64_FEATURE_MASK(ID_AA64PFR0_EL1_EL0), val); - return el0 == ID_AA64PFR0_EL1_ELx_64BIT_ONLY; + return el0 == ID_AA64PFR0_EL1_EL0_IMP; } int main(void) diff --git a/tools/testing/selftests/kvm/aarch64/arch_timer.c b/tools/testing/selftests/kvm/arm64/arch_timer.c index eeba1cc87ff8..eeba1cc87ff8 100644 --- a/tools/testing/selftests/kvm/aarch64/arch_timer.c +++ b/tools/testing/selftests/kvm/arm64/arch_timer.c diff --git a/tools/testing/selftests/kvm/aarch64/arch_timer_edge_cases.c b/tools/testing/selftests/kvm/arm64/arch_timer_edge_cases.c index a36a7e2db434..a36a7e2db434 100644 --- a/tools/testing/selftests/kvm/aarch64/arch_timer_edge_cases.c +++ b/tools/testing/selftests/kvm/arm64/arch_timer_edge_cases.c diff --git a/tools/testing/selftests/kvm/aarch64/debug-exceptions.c b/tools/testing/selftests/kvm/arm64/debug-exceptions.c index ff7a949fc96a..c7fb55c9135b 100644 --- a/tools/testing/selftests/kvm/aarch64/debug-exceptions.c +++ b/tools/testing/selftests/kvm/arm64/debug-exceptions.c @@ -501,7 +501,7 @@ void test_single_step_from_userspace(int test_cnt) TEST_ASSERT(ss_enable, "Unexpected KVM_EXIT_DEBUG"); /* Check if the current pc is expected. */ - vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc), &pc); + pc = vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc)); TEST_ASSERT(!test_pc || pc == test_pc, "Unexpected pc 0x%lx (expected 0x%lx)", pc, test_pc); @@ -583,7 +583,7 @@ int main(int argc, char *argv[]) uint64_t aa64dfr0; vm = vm_create_with_one_vcpu(&vcpu, guest_code); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64DFR0_EL1), &aa64dfr0); + aa64dfr0 = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64DFR0_EL1)); __TEST_REQUIRE(debug_version(aa64dfr0) >= 6, "Armv8 debug architecture not supported."); kvm_vm_free(vm); diff --git a/tools/testing/selftests/kvm/aarch64/get-reg-list.c b/tools/testing/selftests/kvm/arm64/get-reg-list.c index d43fb3f49050..d43fb3f49050 100644 --- a/tools/testing/selftests/kvm/aarch64/get-reg-list.c +++ b/tools/testing/selftests/kvm/arm64/get-reg-list.c diff --git a/tools/testing/selftests/kvm/aarch64/hypercalls.c b/tools/testing/selftests/kvm/arm64/hypercalls.c index 9d192ce0078d..ec54ec7726e9 100644 --- a/tools/testing/selftests/kvm/aarch64/hypercalls.c +++ b/tools/testing/selftests/kvm/arm64/hypercalls.c @@ -173,7 +173,7 @@ static void test_fw_regs_before_vm_start(struct kvm_vcpu *vcpu) const struct kvm_fw_reg_info *reg_info = &fw_reg_info[i]; /* First 'read' should be an upper limit of the features supported */ - vcpu_get_reg(vcpu, reg_info->reg, &val); + val = vcpu_get_reg(vcpu, reg_info->reg); TEST_ASSERT(val == FW_REG_ULIMIT_VAL(reg_info->max_feat_bit), "Expected all the features to be set for reg: 0x%lx; expected: 0x%lx; read: 0x%lx", reg_info->reg, FW_REG_ULIMIT_VAL(reg_info->max_feat_bit), val); @@ -184,7 +184,7 @@ static void test_fw_regs_before_vm_start(struct kvm_vcpu *vcpu) "Failed to clear all the features of reg: 0x%lx; ret: %d", reg_info->reg, errno); - vcpu_get_reg(vcpu, reg_info->reg, &val); + val = vcpu_get_reg(vcpu, reg_info->reg); TEST_ASSERT(val == 0, "Expected all the features to be cleared for reg: 0x%lx", reg_info->reg); @@ -214,7 +214,7 @@ static void test_fw_regs_after_vm_start(struct kvm_vcpu *vcpu) * Before starting the VM, the test clears all the bits. * Check if that's still the case. */ - vcpu_get_reg(vcpu, reg_info->reg, &val); + val = vcpu_get_reg(vcpu, reg_info->reg); TEST_ASSERT(val == 0, "Expected all the features to be cleared for reg: 0x%lx", reg_info->reg); diff --git a/tools/testing/selftests/kvm/aarch64/mmio_abort.c b/tools/testing/selftests/kvm/arm64/mmio_abort.c index 8b7a80a51b1c..8b7a80a51b1c 100644 --- a/tools/testing/selftests/kvm/aarch64/mmio_abort.c +++ b/tools/testing/selftests/kvm/arm64/mmio_abort.c diff --git a/tools/testing/selftests/kvm/aarch64/no-vgic-v3.c b/tools/testing/selftests/kvm/arm64/no-vgic-v3.c index 58304bbc2036..ebd70430c89d 100644 --- a/tools/testing/selftests/kvm/aarch64/no-vgic-v3.c +++ b/tools/testing/selftests/kvm/arm64/no-vgic-v3.c @@ -164,7 +164,7 @@ int main(int argc, char *argv[]) uint64_t pfr0; vm = vm_create_with_one_vcpu(&vcpu, NULL); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1), &pfr0); + pfr0 = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1)); __TEST_REQUIRE(FIELD_GET(ARM64_FEATURE_MASK(ID_AA64PFR0_EL1_GIC), pfr0), "GICv3 not supported."); kvm_vm_free(vm); diff --git a/tools/testing/selftests/kvm/aarch64/page_fault_test.c b/tools/testing/selftests/kvm/arm64/page_fault_test.c index ec33a8f9c908..ec33a8f9c908 100644 --- a/tools/testing/selftests/kvm/aarch64/page_fault_test.c +++ b/tools/testing/selftests/kvm/arm64/page_fault_test.c diff --git a/tools/testing/selftests/kvm/aarch64/psci_test.c b/tools/testing/selftests/kvm/arm64/psci_test.c index eaa7655fefc1..ab491ee9e5f7 100644 --- a/tools/testing/selftests/kvm/aarch64/psci_test.c +++ b/tools/testing/selftests/kvm/arm64/psci_test.c @@ -111,8 +111,8 @@ static void assert_vcpu_reset(struct kvm_vcpu *vcpu) { uint64_t obs_pc, obs_x0; - vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc), &obs_pc); - vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.regs[0]), &obs_x0); + obs_pc = vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc)); + obs_x0 = vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.regs[0])); TEST_ASSERT(obs_pc == CPU_ON_ENTRY_ADDR, "unexpected target cpu pc: %lx (expected: %lx)", @@ -152,7 +152,7 @@ static void host_test_cpu_on(void) */ vcpu_power_off(target); - vcpu_get_reg(target, KVM_ARM64_SYS_REG(SYS_MPIDR_EL1), &target_mpidr); + target_mpidr = vcpu_get_reg(target, KVM_ARM64_SYS_REG(SYS_MPIDR_EL1)); vcpu_args_set(source, 1, target_mpidr & MPIDR_HWID_BITMASK); enter_guest(source); @@ -244,7 +244,7 @@ static void host_test_system_off2(void) setup_vm(guest_test_system_off2, &source, &target); - vcpu_get_reg(target, KVM_REG_ARM_PSCI_VERSION, &psci_version); + psci_version = vcpu_get_reg(target, KVM_REG_ARM_PSCI_VERSION); TEST_ASSERT(psci_version >= PSCI_VERSION(1, 3), "Unexpected PSCI version %lu.%lu", diff --git a/tools/testing/selftests/kvm/aarch64/set_id_regs.c b/tools/testing/selftests/kvm/arm64/set_id_regs.c index a79b7f18452d..217541fe6536 100644 --- a/tools/testing/selftests/kvm/aarch64/set_id_regs.c +++ b/tools/testing/selftests/kvm/arm64/set_id_regs.c @@ -152,7 +152,6 @@ static const struct reg_ftr_bits ftr_id_aa64mmfr0_el1[] = { REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGENDEL0, 0), REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, SNSMEM, 0), REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGEND, 0), - REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, ASIDBITS, 0), REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, PARANGE, 0), REG_FTR_END, }; @@ -346,7 +345,7 @@ static uint64_t test_reg_set_success(struct kvm_vcpu *vcpu, uint64_t reg, uint64_t mask = ftr_bits->mask; uint64_t val, new_val, ftr; - vcpu_get_reg(vcpu, reg, &val); + val = vcpu_get_reg(vcpu, reg); ftr = (val & mask) >> shift; ftr = get_safe_value(ftr_bits, ftr); @@ -356,7 +355,7 @@ static uint64_t test_reg_set_success(struct kvm_vcpu *vcpu, uint64_t reg, val |= ftr; vcpu_set_reg(vcpu, reg, val); - vcpu_get_reg(vcpu, reg, &new_val); + new_val = vcpu_get_reg(vcpu, reg); TEST_ASSERT_EQ(new_val, val); return new_val; @@ -370,7 +369,7 @@ static void test_reg_set_fail(struct kvm_vcpu *vcpu, uint64_t reg, uint64_t val, old_val, ftr; int r; - vcpu_get_reg(vcpu, reg, &val); + val = vcpu_get_reg(vcpu, reg); ftr = (val & mask) >> shift; ftr = get_invalid_value(ftr_bits, ftr); @@ -384,7 +383,7 @@ static void test_reg_set_fail(struct kvm_vcpu *vcpu, uint64_t reg, TEST_ASSERT(r < 0 && errno == EINVAL, "Unexpected KVM_SET_ONE_REG error: r=%d, errno=%d", r, errno); - vcpu_get_reg(vcpu, reg, &val); + val = vcpu_get_reg(vcpu, reg); TEST_ASSERT_EQ(val, old_val); } @@ -471,7 +470,7 @@ static void test_user_set_mpam_reg(struct kvm_vcpu *vcpu) } /* Get the id register value */ - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1), &val); + val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1)); /* Try to set MPAM=0. This should always be possible. */ val &= ~ID_AA64PFR0_EL1_MPAM_MASK; @@ -508,7 +507,7 @@ static void test_user_set_mpam_reg(struct kvm_vcpu *vcpu) } /* Get the id register value */ - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR1_EL1), &val); + val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR1_EL1)); /* Try to set MPAM_frac=0. This should always be possible. */ val &= ~ID_AA64PFR1_EL1_MPAM_frac_MASK; @@ -576,7 +575,7 @@ static void test_clidr(struct kvm_vcpu *vcpu) uint64_t clidr; int level; - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_CLIDR_EL1), &clidr); + clidr = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_CLIDR_EL1)); /* find the first empty level in the cache hierarchy */ for (level = 1; level < 7; level++) { @@ -601,7 +600,7 @@ static void test_ctr(struct kvm_vcpu *vcpu) { u64 ctr; - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_CTR_EL0), &ctr); + ctr = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_CTR_EL0)); ctr &= ~CTR_EL0_DIC_MASK; if (ctr & CTR_EL0_IminLine_MASK) ctr--; @@ -617,7 +616,7 @@ static void test_vcpu_ftr_id_regs(struct kvm_vcpu *vcpu) test_clidr(vcpu); test_ctr(vcpu); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_MPIDR_EL1), &val); + val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_MPIDR_EL1)); val++; vcpu_set_reg(vcpu, KVM_ARM64_SYS_REG(SYS_MPIDR_EL1), val); @@ -630,7 +629,7 @@ static void test_assert_id_reg_unchanged(struct kvm_vcpu *vcpu, uint32_t encodin size_t idx = encoding_to_range_idx(encoding); uint64_t observed; - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(encoding), &observed); + observed = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(encoding)); TEST_ASSERT_EQ(test_reg_vals[idx], observed); } @@ -665,9 +664,9 @@ int main(void) vm = vm_create_with_one_vcpu(&vcpu, guest_code); /* Check for AARCH64 only system */ - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1), &val); + val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64PFR0_EL1)); el0 = FIELD_GET(ARM64_FEATURE_MASK(ID_AA64PFR0_EL1_EL0), val); - aarch64_only = (el0 == ID_AA64PFR0_EL1_ELx_64BIT_ONLY); + aarch64_only = (el0 == ID_AA64PFR0_EL1_EL0_IMP); ksft_print_header(); diff --git a/tools/testing/selftests/kvm/aarch64/smccc_filter.c b/tools/testing/selftests/kvm/arm64/smccc_filter.c index 2d189f3da228..2d189f3da228 100644 --- a/tools/testing/selftests/kvm/aarch64/smccc_filter.c +++ b/tools/testing/selftests/kvm/arm64/smccc_filter.c diff --git a/tools/testing/selftests/kvm/aarch64/vcpu_width_config.c b/tools/testing/selftests/kvm/arm64/vcpu_width_config.c index 80b74c6f152b..80b74c6f152b 100644 --- a/tools/testing/selftests/kvm/aarch64/vcpu_width_config.c +++ b/tools/testing/selftests/kvm/arm64/vcpu_width_config.c diff --git a/tools/testing/selftests/kvm/aarch64/vgic_init.c b/tools/testing/selftests/kvm/arm64/vgic_init.c index b3b5fb0ff0a9..b3b5fb0ff0a9 100644 --- a/tools/testing/selftests/kvm/aarch64/vgic_init.c +++ b/tools/testing/selftests/kvm/arm64/vgic_init.c diff --git a/tools/testing/selftests/kvm/aarch64/vgic_irq.c b/tools/testing/selftests/kvm/arm64/vgic_irq.c index f4ac28d53747..f4ac28d53747 100644 --- a/tools/testing/selftests/kvm/aarch64/vgic_irq.c +++ b/tools/testing/selftests/kvm/arm64/vgic_irq.c diff --git a/tools/testing/selftests/kvm/aarch64/vgic_lpi_stress.c b/tools/testing/selftests/kvm/arm64/vgic_lpi_stress.c index fc4fe52fb6f8..fc4fe52fb6f8 100644 --- a/tools/testing/selftests/kvm/aarch64/vgic_lpi_stress.c +++ b/tools/testing/selftests/kvm/arm64/vgic_lpi_stress.c diff --git a/tools/testing/selftests/kvm/aarch64/vpmu_counter_access.c b/tools/testing/selftests/kvm/arm64/vpmu_counter_access.c index f9c0c86d7e85..f16b3b27e32e 100644 --- a/tools/testing/selftests/kvm/aarch64/vpmu_counter_access.c +++ b/tools/testing/selftests/kvm/arm64/vpmu_counter_access.c @@ -440,8 +440,7 @@ static void create_vpmu_vm(void *guest_code) "Failed to create vgic-v3, skipping"); /* Make sure that PMUv3 support is indicated in the ID register */ - vcpu_get_reg(vpmu_vm.vcpu, - KVM_ARM64_SYS_REG(SYS_ID_AA64DFR0_EL1), &dfr0); + dfr0 = vcpu_get_reg(vpmu_vm.vcpu, KVM_ARM64_SYS_REG(SYS_ID_AA64DFR0_EL1)); pmuver = FIELD_GET(ARM64_FEATURE_MASK(ID_AA64DFR0_EL1_PMUVer), dfr0); TEST_ASSERT(pmuver != ID_AA64DFR0_EL1_PMUVer_IMP_DEF && pmuver >= ID_AA64DFR0_EL1_PMUVer_IMP, @@ -484,7 +483,7 @@ static void test_create_vpmu_vm_with_pmcr_n(uint64_t pmcr_n, bool expect_fail) create_vpmu_vm(guest_code); vcpu = vpmu_vm.vcpu; - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0), &pmcr_orig); + pmcr_orig = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0)); pmcr = pmcr_orig; /* @@ -493,7 +492,7 @@ static void test_create_vpmu_vm_with_pmcr_n(uint64_t pmcr_n, bool expect_fail) */ set_pmcr_n(&pmcr, pmcr_n); vcpu_set_reg(vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0), pmcr); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0), &pmcr); + pmcr = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0)); if (expect_fail) TEST_ASSERT(pmcr_orig == pmcr, @@ -521,7 +520,7 @@ static void run_access_test(uint64_t pmcr_n) vcpu = vpmu_vm.vcpu; /* Save the initial sp to restore them later to run the guest again */ - vcpu_get_reg(vcpu, ARM64_CORE_REG(sp_el1), &sp); + sp = vcpu_get_reg(vcpu, ARM64_CORE_REG(sp_el1)); run_vcpu(vcpu, pmcr_n); @@ -572,12 +571,12 @@ static void run_pmregs_validity_test(uint64_t pmcr_n) * Test if the 'set' and 'clr' variants of the registers * are initialized based on the number of valid counters. */ - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(set_reg_id), ®_val); + reg_val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(set_reg_id)); TEST_ASSERT((reg_val & (~valid_counters_mask)) == 0, "Initial read of set_reg: 0x%llx has unimplemented counters enabled: 0x%lx", KVM_ARM64_SYS_REG(set_reg_id), reg_val); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(clr_reg_id), ®_val); + reg_val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(clr_reg_id)); TEST_ASSERT((reg_val & (~valid_counters_mask)) == 0, "Initial read of clr_reg: 0x%llx has unimplemented counters enabled: 0x%lx", KVM_ARM64_SYS_REG(clr_reg_id), reg_val); @@ -589,12 +588,12 @@ static void run_pmregs_validity_test(uint64_t pmcr_n) */ vcpu_set_reg(vcpu, KVM_ARM64_SYS_REG(set_reg_id), max_counters_mask); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(set_reg_id), ®_val); + reg_val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(set_reg_id)); TEST_ASSERT((reg_val & (~valid_counters_mask)) == 0, "Read of set_reg: 0x%llx has unimplemented counters enabled: 0x%lx", KVM_ARM64_SYS_REG(set_reg_id), reg_val); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(clr_reg_id), ®_val); + reg_val = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(clr_reg_id)); TEST_ASSERT((reg_val & (~valid_counters_mask)) == 0, "Read of clr_reg: 0x%llx has unimplemented counters enabled: 0x%lx", KVM_ARM64_SYS_REG(clr_reg_id), reg_val); @@ -625,7 +624,7 @@ static uint64_t get_pmcr_n_limit(void) uint64_t pmcr; create_vpmu_vm(guest_code); - vcpu_get_reg(vpmu_vm.vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0), &pmcr); + pmcr = vcpu_get_reg(vpmu_vm.vcpu, KVM_ARM64_SYS_REG(SYS_PMCR_EL0)); destroy_vpmu_vm(); return get_pmcr_n(pmcr); } diff --git a/tools/testing/selftests/kvm/dirty_log_perf_test.c b/tools/testing/selftests/kvm/dirty_log_perf_test.c index 9f24303acb8c..e79817bd0e29 100644 --- a/tools/testing/selftests/kvm/dirty_log_perf_test.c +++ b/tools/testing/selftests/kvm/dirty_log_perf_test.c @@ -21,7 +21,7 @@ #include "ucall_common.h" #ifdef __aarch64__ -#include "aarch64/vgic.h" +#include "arm64/vgic.h" static int gic_fd; diff --git a/tools/testing/selftests/kvm/include/aarch64/arch_timer.h b/tools/testing/selftests/kvm/include/arm64/arch_timer.h index bf461de34785..bf461de34785 100644 --- a/tools/testing/selftests/kvm/include/aarch64/arch_timer.h +++ b/tools/testing/selftests/kvm/include/arm64/arch_timer.h diff --git a/tools/testing/selftests/kvm/include/aarch64/delay.h b/tools/testing/selftests/kvm/include/arm64/delay.h index 329e4f5079ea..329e4f5079ea 100644 --- a/tools/testing/selftests/kvm/include/aarch64/delay.h +++ b/tools/testing/selftests/kvm/include/arm64/delay.h diff --git a/tools/testing/selftests/kvm/include/aarch64/gic.h b/tools/testing/selftests/kvm/include/arm64/gic.h index baeb3c859389..baeb3c859389 100644 --- a/tools/testing/selftests/kvm/include/aarch64/gic.h +++ b/tools/testing/selftests/kvm/include/arm64/gic.h diff --git a/tools/testing/selftests/kvm/include/aarch64/gic_v3.h b/tools/testing/selftests/kvm/include/arm64/gic_v3.h index a76615fa39a1..a76615fa39a1 100644 --- a/tools/testing/selftests/kvm/include/aarch64/gic_v3.h +++ b/tools/testing/selftests/kvm/include/arm64/gic_v3.h diff --git a/tools/testing/selftests/kvm/include/aarch64/gic_v3_its.h b/tools/testing/selftests/kvm/include/arm64/gic_v3_its.h index 3722ed9c8f96..3722ed9c8f96 100644 --- a/tools/testing/selftests/kvm/include/aarch64/gic_v3_its.h +++ b/tools/testing/selftests/kvm/include/arm64/gic_v3_its.h diff --git a/tools/testing/selftests/kvm/include/aarch64/kvm_util_arch.h b/tools/testing/selftests/kvm/include/arm64/kvm_util_arch.h index e43a57d99b56..e43a57d99b56 100644 --- a/tools/testing/selftests/kvm/include/aarch64/kvm_util_arch.h +++ b/tools/testing/selftests/kvm/include/arm64/kvm_util_arch.h diff --git a/tools/testing/selftests/kvm/include/aarch64/processor.h b/tools/testing/selftests/kvm/include/arm64/processor.h index 1e8d0d531fbd..1e8d0d531fbd 100644 --- a/tools/testing/selftests/kvm/include/aarch64/processor.h +++ b/tools/testing/selftests/kvm/include/arm64/processor.h diff --git a/tools/testing/selftests/kvm/include/aarch64/spinlock.h b/tools/testing/selftests/kvm/include/arm64/spinlock.h index cf0984106d14..cf0984106d14 100644 --- a/tools/testing/selftests/kvm/include/aarch64/spinlock.h +++ b/tools/testing/selftests/kvm/include/arm64/spinlock.h diff --git a/tools/testing/selftests/kvm/include/aarch64/ucall.h b/tools/testing/selftests/kvm/include/arm64/ucall.h index 4ec801f37f00..4ec801f37f00 100644 --- a/tools/testing/selftests/kvm/include/aarch64/ucall.h +++ b/tools/testing/selftests/kvm/include/arm64/ucall.h diff --git a/tools/testing/selftests/kvm/include/aarch64/vgic.h b/tools/testing/selftests/kvm/include/arm64/vgic.h index c481d0c00a5d..c481d0c00a5d 100644 --- a/tools/testing/selftests/kvm/include/aarch64/vgic.h +++ b/tools/testing/selftests/kvm/include/arm64/vgic.h diff --git a/tools/testing/selftests/kvm/include/kvm_util.h b/tools/testing/selftests/kvm/include/kvm_util.h index bc7c242480d6..4c4e5a847f67 100644 --- a/tools/testing/selftests/kvm/include/kvm_util.h +++ b/tools/testing/selftests/kvm/include/kvm_util.h @@ -702,16 +702,22 @@ static inline int __vcpu_set_reg(struct kvm_vcpu *vcpu, uint64_t id, uint64_t va return __vcpu_ioctl(vcpu, KVM_SET_ONE_REG, ®); } -static inline void vcpu_get_reg(struct kvm_vcpu *vcpu, uint64_t id, void *addr) +static inline uint64_t vcpu_get_reg(struct kvm_vcpu *vcpu, uint64_t id) { - struct kvm_one_reg reg = { .id = id, .addr = (uint64_t)addr }; + uint64_t val; + struct kvm_one_reg reg = { .id = id, .addr = (uint64_t)&val }; + + TEST_ASSERT(KVM_REG_SIZE(id) <= sizeof(val), "Reg %lx too big", id); vcpu_ioctl(vcpu, KVM_GET_ONE_REG, ®); + return val; } static inline void vcpu_set_reg(struct kvm_vcpu *vcpu, uint64_t id, uint64_t val) { struct kvm_one_reg reg = { .id = id, .addr = (uint64_t)&val }; + TEST_ASSERT(KVM_REG_SIZE(id) <= sizeof(val), "Reg %lx too big", id); + vcpu_ioctl(vcpu, KVM_SET_ONE_REG, ®); } diff --git a/tools/testing/selftests/kvm/include/s390x/debug_print.h b/tools/testing/selftests/kvm/include/s390/debug_print.h index 1bf275631cc6..1bf275631cc6 100644 --- a/tools/testing/selftests/kvm/include/s390x/debug_print.h +++ b/tools/testing/selftests/kvm/include/s390/debug_print.h diff --git a/tools/testing/selftests/kvm/include/s390x/diag318_test_handler.h b/tools/testing/selftests/kvm/include/s390/diag318_test_handler.h index b0ed71302722..b0ed71302722 100644 --- a/tools/testing/selftests/kvm/include/s390x/diag318_test_handler.h +++ b/tools/testing/selftests/kvm/include/s390/diag318_test_handler.h diff --git a/tools/testing/selftests/kvm/include/s390x/facility.h b/tools/testing/selftests/kvm/include/s390/facility.h index 00a1ced6538b..00a1ced6538b 100644 --- a/tools/testing/selftests/kvm/include/s390x/facility.h +++ b/tools/testing/selftests/kvm/include/s390/facility.h diff --git a/tools/testing/selftests/kvm/include/s390x/kvm_util_arch.h b/tools/testing/selftests/kvm/include/s390/kvm_util_arch.h index e43a57d99b56..e43a57d99b56 100644 --- a/tools/testing/selftests/kvm/include/s390x/kvm_util_arch.h +++ b/tools/testing/selftests/kvm/include/s390/kvm_util_arch.h diff --git a/tools/testing/selftests/kvm/include/s390x/processor.h b/tools/testing/selftests/kvm/include/s390/processor.h index 33fef6fd9617..33fef6fd9617 100644 --- a/tools/testing/selftests/kvm/include/s390x/processor.h +++ b/tools/testing/selftests/kvm/include/s390/processor.h diff --git a/tools/testing/selftests/kvm/include/s390x/sie.h b/tools/testing/selftests/kvm/include/s390/sie.h index 160acd4a1db9..160acd4a1db9 100644 --- a/tools/testing/selftests/kvm/include/s390x/sie.h +++ b/tools/testing/selftests/kvm/include/s390/sie.h diff --git a/tools/testing/selftests/kvm/include/s390x/ucall.h b/tools/testing/selftests/kvm/include/s390/ucall.h index 8035a872a351..8035a872a351 100644 --- a/tools/testing/selftests/kvm/include/s390x/ucall.h +++ b/tools/testing/selftests/kvm/include/s390/ucall.h diff --git a/tools/testing/selftests/kvm/include/x86_64/apic.h b/tools/testing/selftests/kvm/include/x86/apic.h index 51990094effd..80fe9f69b38d 100644 --- a/tools/testing/selftests/kvm/include/x86_64/apic.h +++ b/tools/testing/selftests/kvm/include/x86/apic.h @@ -1,7 +1,5 @@ /* SPDX-License-Identifier: GPL-2.0-only */ /* - * tools/testing/selftests/kvm/include/x86_64/apic.h - * * Copyright (C) 2021, Google LLC. */ diff --git a/tools/testing/selftests/kvm/include/x86_64/evmcs.h b/tools/testing/selftests/kvm/include/x86/evmcs.h index 901caf0e0939..5a74bb30e2f8 100644 --- a/tools/testing/selftests/kvm/include/x86_64/evmcs.h +++ b/tools/testing/selftests/kvm/include/x86/evmcs.h @@ -1,9 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0 */ /* - * tools/testing/selftests/kvm/include/x86_64/evmcs.h - * * Copyright (C) 2018, Red Hat, Inc. - * */ #ifndef SELFTEST_KVM_EVMCS_H diff --git a/tools/testing/selftests/kvm/include/x86_64/hyperv.h b/tools/testing/selftests/kvm/include/x86/hyperv.h index 6849e2552f1b..f13e532be240 100644 --- a/tools/testing/selftests/kvm/include/x86_64/hyperv.h +++ b/tools/testing/selftests/kvm/include/x86/hyperv.h @@ -1,9 +1,6 @@ /* SPDX-License-Identifier: GPL-2.0 */ /* - * tools/testing/selftests/kvm/include/x86_64/hyperv.h - * * Copyright (C) 2021, Red Hat, Inc. - * */ #ifndef SELFTEST_KVM_HYPERV_H diff --git a/tools/testing/selftests/kvm/include/x86_64/kvm_util_arch.h b/tools/testing/selftests/kvm/include/x86/kvm_util_arch.h index 972bb1c4ab4c..972bb1c4ab4c 100644 --- a/tools/testing/selftests/kvm/include/x86_64/kvm_util_arch.h +++ b/tools/testing/selftests/kvm/include/x86/kvm_util_arch.h diff --git a/tools/testing/selftests/kvm/include/x86_64/mce.h b/tools/testing/selftests/kvm/include/x86/mce.h index 6119321f3f5d..295f2d554754 100644 --- a/tools/testing/selftests/kvm/include/x86_64/mce.h +++ b/tools/testing/selftests/kvm/include/x86/mce.h @@ -1,7 +1,5 @@ /* SPDX-License-Identifier: GPL-2.0-only */ /* - * tools/testing/selftests/kvm/include/x86_64/mce.h - * * Copyright (C) 2022, Google LLC. */ diff --git a/tools/testing/selftests/kvm/include/x86_64/pmu.h b/tools/testing/selftests/kvm/include/x86/pmu.h index 3c10c4dc0ae8..3c10c4dc0ae8 100644 --- a/tools/testing/selftests/kvm/include/x86_64/pmu.h +++ b/tools/testing/selftests/kvm/include/x86/pmu.h diff --git a/tools/testing/selftests/kvm/include/x86_64/processor.h b/tools/testing/selftests/kvm/include/x86/processor.h index 645200e95f89..d60da8966772 100644 --- a/tools/testing/selftests/kvm/include/x86_64/processor.h +++ b/tools/testing/selftests/kvm/include/x86/processor.h @@ -1,7 +1,5 @@ /* SPDX-License-Identifier: GPL-2.0-only */ /* - * tools/testing/selftests/kvm/include/x86_64/processor.h - * * Copyright (C) 2018, Google LLC. */ @@ -29,6 +27,8 @@ extern uint64_t guest_tsc_khz; #define MAX_NR_CPUID_ENTRIES 100 #endif +#define NONCANONICAL 0xaaaaaaaaaaaaaaaaull + /* Forced emulation prefix, used to invoke the emulator unconditionally. */ #define KVM_FEP "ud2; .byte 'k', 'v', 'm';" @@ -571,6 +571,11 @@ static inline void set_cr4(uint64_t val) __asm__ __volatile__("mov %0, %%cr4" : : "r" (val) : "memory"); } +static inline void set_idt(const struct desc_ptr *idt_desc) +{ + __asm__ __volatile__("lidt %0"::"m"(*idt_desc)); +} + static inline u64 xgetbv(u32 index) { u32 eax, edx; @@ -1012,10 +1017,19 @@ static inline struct kvm_cpuid2 *allocate_kvm_cpuid2(int nr_entries) void vcpu_init_cpuid(struct kvm_vcpu *vcpu, const struct kvm_cpuid2 *cpuid); +static inline void vcpu_get_cpuid(struct kvm_vcpu *vcpu) +{ + vcpu_ioctl(vcpu, KVM_GET_CPUID2, vcpu->cpuid); +} + static inline struct kvm_cpuid_entry2 *__vcpu_get_cpuid_entry(struct kvm_vcpu *vcpu, uint32_t function, uint32_t index) { + TEST_ASSERT(vcpu->cpuid, "Must do vcpu_init_cpuid() first (or equivalent)"); + + vcpu_get_cpuid(vcpu); + return (struct kvm_cpuid_entry2 *)get_cpuid_entry(vcpu->cpuid, function, index); } @@ -1036,7 +1050,7 @@ static inline int __vcpu_set_cpuid(struct kvm_vcpu *vcpu) return r; /* On success, refresh the cache to pick up adjustments made by KVM. */ - vcpu_ioctl(vcpu, KVM_GET_CPUID2, vcpu->cpuid); + vcpu_get_cpuid(vcpu); return 0; } @@ -1046,12 +1060,7 @@ static inline void vcpu_set_cpuid(struct kvm_vcpu *vcpu) vcpu_ioctl(vcpu, KVM_SET_CPUID2, vcpu->cpuid); /* Refresh the cache to pick up adjustments made by KVM. */ - vcpu_ioctl(vcpu, KVM_GET_CPUID2, vcpu->cpuid); -} - -static inline void vcpu_get_cpuid(struct kvm_vcpu *vcpu) -{ - vcpu_ioctl(vcpu, KVM_GET_CPUID2, vcpu->cpuid); + vcpu_get_cpuid(vcpu); } void vcpu_set_cpuid_property(struct kvm_vcpu *vcpu, diff --git a/tools/testing/selftests/kvm/include/x86_64/sev.h b/tools/testing/selftests/kvm/include/x86/sev.h index 82c11c81a956..82c11c81a956 100644 --- a/tools/testing/selftests/kvm/include/x86_64/sev.h +++ b/tools/testing/selftests/kvm/include/x86/sev.h diff --git a/tools/testing/selftests/kvm/include/x86_64/svm.h b/tools/testing/selftests/kvm/include/x86/svm.h index 4803e1056055..29cffd0a9181 100644 --- a/tools/testing/selftests/kvm/include/x86_64/svm.h +++ b/tools/testing/selftests/kvm/include/x86/svm.h @@ -1,10 +1,4 @@ /* SPDX-License-Identifier: GPL-2.0 */ -/* - * tools/testing/selftests/kvm/include/x86_64/svm.h - * This is a copy of arch/x86/include/asm/svm.h - * - */ - #ifndef SELFTEST_KVM_SVM_H #define SELFTEST_KVM_SVM_H diff --git a/tools/testing/selftests/kvm/include/x86_64/svm_util.h b/tools/testing/selftests/kvm/include/x86/svm_util.h index 044f0f872ba9..b74c6dcddcbd 100644 --- a/tools/testing/selftests/kvm/include/x86_64/svm_util.h +++ b/tools/testing/selftests/kvm/include/x86/svm_util.h @@ -1,8 +1,5 @@ /* SPDX-License-Identifier: GPL-2.0-only */ /* - * tools/testing/selftests/kvm/include/x86_64/svm_utils.h - * Header for nested SVM testing - * * Copyright (C) 2020, Red Hat, Inc. */ diff --git a/tools/testing/selftests/kvm/include/x86_64/ucall.h b/tools/testing/selftests/kvm/include/x86/ucall.h index d3825dcc3cd9..d3825dcc3cd9 100644 --- a/tools/testing/selftests/kvm/include/x86_64/ucall.h +++ b/tools/testing/selftests/kvm/include/x86/ucall.h diff --git a/tools/testing/selftests/kvm/include/x86_64/vmx.h b/tools/testing/selftests/kvm/include/x86/vmx.h index 5f0c0a29c556..edb3c391b982 100644 --- a/tools/testing/selftests/kvm/include/x86_64/vmx.h +++ b/tools/testing/selftests/kvm/include/x86/vmx.h @@ -1,7 +1,5 @@ /* SPDX-License-Identifier: GPL-2.0-only */ /* - * tools/testing/selftests/kvm/include/x86_64/vmx.h - * * Copyright (C) 2018, Google LLC. */ diff --git a/tools/testing/selftests/kvm/lib/aarch64/gic.c b/tools/testing/selftests/kvm/lib/arm64/gic.c index 7abbf8866512..7abbf8866512 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/gic.c +++ b/tools/testing/selftests/kvm/lib/arm64/gic.c diff --git a/tools/testing/selftests/kvm/lib/aarch64/gic_private.h b/tools/testing/selftests/kvm/lib/arm64/gic_private.h index d24e9ecc96c6..d24e9ecc96c6 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/gic_private.h +++ b/tools/testing/selftests/kvm/lib/arm64/gic_private.h diff --git a/tools/testing/selftests/kvm/lib/aarch64/gic_v3.c b/tools/testing/selftests/kvm/lib/arm64/gic_v3.c index 66d05506f78b..66d05506f78b 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/gic_v3.c +++ b/tools/testing/selftests/kvm/lib/arm64/gic_v3.c diff --git a/tools/testing/selftests/kvm/lib/aarch64/gic_v3_its.c b/tools/testing/selftests/kvm/lib/arm64/gic_v3_its.c index 09f270545646..09f270545646 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/gic_v3_its.c +++ b/tools/testing/selftests/kvm/lib/arm64/gic_v3_its.c diff --git a/tools/testing/selftests/kvm/lib/aarch64/handlers.S b/tools/testing/selftests/kvm/lib/arm64/handlers.S index 0e443eadfac6..0e443eadfac6 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/handlers.S +++ b/tools/testing/selftests/kvm/lib/arm64/handlers.S diff --git a/tools/testing/selftests/kvm/lib/aarch64/processor.c b/tools/testing/selftests/kvm/lib/arm64/processor.c index 698e34f39241..7ba3aa3755f3 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/processor.c +++ b/tools/testing/selftests/kvm/lib/arm64/processor.c @@ -281,8 +281,8 @@ void aarch64_vcpu_setup(struct kvm_vcpu *vcpu, struct kvm_vcpu_init *init) */ vcpu_set_reg(vcpu, KVM_ARM64_SYS_REG(SYS_CPACR_EL1), 3 << 20); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_SCTLR_EL1), &sctlr_el1); - vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_TCR_EL1), &tcr_el1); + sctlr_el1 = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_SCTLR_EL1)); + tcr_el1 = vcpu_get_reg(vcpu, KVM_ARM64_SYS_REG(SYS_TCR_EL1)); /* Configure base granule size */ switch (vm->mode) { @@ -360,8 +360,8 @@ void vcpu_arch_dump(FILE *stream, struct kvm_vcpu *vcpu, uint8_t indent) { uint64_t pstate, pc; - vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pstate), &pstate); - vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc), &pc); + pstate = vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pstate)); + pc = vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc)); fprintf(stream, "%*spstate: 0x%.16lx pc: 0x%.16lx\n", indent, "", pstate, pc); diff --git a/tools/testing/selftests/kvm/lib/aarch64/spinlock.c b/tools/testing/selftests/kvm/lib/arm64/spinlock.c index a076e780be5d..a076e780be5d 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/spinlock.c +++ b/tools/testing/selftests/kvm/lib/arm64/spinlock.c diff --git a/tools/testing/selftests/kvm/lib/aarch64/ucall.c b/tools/testing/selftests/kvm/lib/arm64/ucall.c index ddab0ce89d4d..ddab0ce89d4d 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/ucall.c +++ b/tools/testing/selftests/kvm/lib/arm64/ucall.c diff --git a/tools/testing/selftests/kvm/lib/aarch64/vgic.c b/tools/testing/selftests/kvm/lib/arm64/vgic.c index 4427f43f73ea..4427f43f73ea 100644 --- a/tools/testing/selftests/kvm/lib/aarch64/vgic.c +++ b/tools/testing/selftests/kvm/lib/arm64/vgic.c diff --git a/tools/testing/selftests/kvm/lib/kvm_util.c b/tools/testing/selftests/kvm/lib/kvm_util.c index 480e3a40d197..33fefeb3ca44 100644 --- a/tools/testing/selftests/kvm/lib/kvm_util.c +++ b/tools/testing/selftests/kvm/lib/kvm_util.c @@ -1648,7 +1648,8 @@ int _vcpu_run(struct kvm_vcpu *vcpu) rc = __vcpu_run(vcpu); } while (rc == -1 && errno == EINTR); - assert_on_unhandled_exception(vcpu); + if (!rc) + assert_on_unhandled_exception(vcpu); return rc; } diff --git a/tools/testing/selftests/kvm/lib/riscv/processor.c b/tools/testing/selftests/kvm/lib/riscv/processor.c index 6ae47b3d6b25..dd663bcf0cc0 100644 --- a/tools/testing/selftests/kvm/lib/riscv/processor.c +++ b/tools/testing/selftests/kvm/lib/riscv/processor.c @@ -221,39 +221,39 @@ void vcpu_arch_dump(FILE *stream, struct kvm_vcpu *vcpu, uint8_t indent) { struct kvm_riscv_core core; - vcpu_get_reg(vcpu, RISCV_CORE_REG(mode), &core.mode); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.pc), &core.regs.pc); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.ra), &core.regs.ra); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.sp), &core.regs.sp); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.gp), &core.regs.gp); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.tp), &core.regs.tp); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t0), &core.regs.t0); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t1), &core.regs.t1); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t2), &core.regs.t2); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s0), &core.regs.s0); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s1), &core.regs.s1); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a0), &core.regs.a0); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a1), &core.regs.a1); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a2), &core.regs.a2); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a3), &core.regs.a3); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a4), &core.regs.a4); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a5), &core.regs.a5); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a6), &core.regs.a6); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a7), &core.regs.a7); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s2), &core.regs.s2); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s3), &core.regs.s3); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s4), &core.regs.s4); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s5), &core.regs.s5); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s6), &core.regs.s6); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s7), &core.regs.s7); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s8), &core.regs.s8); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s9), &core.regs.s9); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s10), &core.regs.s10); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s11), &core.regs.s11); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t3), &core.regs.t3); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t4), &core.regs.t4); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t5), &core.regs.t5); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t6), &core.regs.t6); + core.mode = vcpu_get_reg(vcpu, RISCV_CORE_REG(mode)); + core.regs.pc = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.pc)); + core.regs.ra = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.ra)); + core.regs.sp = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.sp)); + core.regs.gp = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.gp)); + core.regs.tp = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.tp)); + core.regs.t0 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t0)); + core.regs.t1 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t1)); + core.regs.t2 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t2)); + core.regs.s0 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s0)); + core.regs.s1 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s1)); + core.regs.a0 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a0)); + core.regs.a1 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a1)); + core.regs.a2 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a2)); + core.regs.a3 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a3)); + core.regs.a4 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a4)); + core.regs.a5 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a5)); + core.regs.a6 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a6)); + core.regs.a7 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.a7)); + core.regs.s2 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s2)); + core.regs.s3 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s3)); + core.regs.s4 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s4)); + core.regs.s5 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s5)); + core.regs.s6 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s6)); + core.regs.s7 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s7)); + core.regs.s8 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s8)); + core.regs.s9 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s9)); + core.regs.s10 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s10)); + core.regs.s11 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.s11)); + core.regs.t3 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t3)); + core.regs.t4 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t4)); + core.regs.t5 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t5)); + core.regs.t6 = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.t6)); fprintf(stream, " MODE: 0x%lx\n", core.mode); diff --git a/tools/testing/selftests/kvm/lib/s390x/diag318_test_handler.c b/tools/testing/selftests/kvm/lib/s390/diag318_test_handler.c index 2c432fa164f1..2c432fa164f1 100644 --- a/tools/testing/selftests/kvm/lib/s390x/diag318_test_handler.c +++ b/tools/testing/selftests/kvm/lib/s390/diag318_test_handler.c diff --git a/tools/testing/selftests/kvm/lib/s390x/facility.c b/tools/testing/selftests/kvm/lib/s390/facility.c index d540812d911a..d540812d911a 100644 --- a/tools/testing/selftests/kvm/lib/s390x/facility.c +++ b/tools/testing/selftests/kvm/lib/s390/facility.c diff --git a/tools/testing/selftests/kvm/lib/s390x/processor.c b/tools/testing/selftests/kvm/lib/s390/processor.c index 20cfe970e3e3..20cfe970e3e3 100644 --- a/tools/testing/selftests/kvm/lib/s390x/processor.c +++ b/tools/testing/selftests/kvm/lib/s390/processor.c diff --git a/tools/testing/selftests/kvm/lib/s390x/ucall.c b/tools/testing/selftests/kvm/lib/s390/ucall.c index cca98734653d..cca98734653d 100644 --- a/tools/testing/selftests/kvm/lib/s390x/ucall.c +++ b/tools/testing/selftests/kvm/lib/s390/ucall.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/apic.c b/tools/testing/selftests/kvm/lib/x86/apic.c index 89153a333e83..89153a333e83 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/apic.c +++ b/tools/testing/selftests/kvm/lib/x86/apic.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/handlers.S b/tools/testing/selftests/kvm/lib/x86/handlers.S index 7629819734af..7629819734af 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/handlers.S +++ b/tools/testing/selftests/kvm/lib/x86/handlers.S diff --git a/tools/testing/selftests/kvm/lib/x86_64/hyperv.c b/tools/testing/selftests/kvm/lib/x86/hyperv.c index 15bc8cd583aa..15bc8cd583aa 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/hyperv.c +++ b/tools/testing/selftests/kvm/lib/x86/hyperv.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/memstress.c b/tools/testing/selftests/kvm/lib/x86/memstress.c index d61e623afc8c..7f5d62a65c68 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/memstress.c +++ b/tools/testing/selftests/kvm/lib/x86/memstress.c @@ -1,6 +1,6 @@ // SPDX-License-Identifier: GPL-2.0 /* - * x86_64-specific extensions to memstress.c. + * x86-specific extensions to memstress.c. * * Copyright (C) 2022, Google, Inc. */ diff --git a/tools/testing/selftests/kvm/lib/x86_64/pmu.c b/tools/testing/selftests/kvm/lib/x86/pmu.c index f31f0427c17c..f31f0427c17c 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/pmu.c +++ b/tools/testing/selftests/kvm/lib/x86/pmu.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/processor.c b/tools/testing/selftests/kvm/lib/x86/processor.c index 636b29ba8985..bd5a802fa7a5 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/processor.c +++ b/tools/testing/selftests/kvm/lib/x86/processor.c @@ -1,7 +1,5 @@ // SPDX-License-Identifier: GPL-2.0-only /* - * tools/testing/selftests/kvm/lib/x86_64/processor.c - * * Copyright (C) 2018, Google LLC. */ diff --git a/tools/testing/selftests/kvm/lib/x86_64/sev.c b/tools/testing/selftests/kvm/lib/x86/sev.c index e9535ee20b7f..e9535ee20b7f 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/sev.c +++ b/tools/testing/selftests/kvm/lib/x86/sev.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/svm.c b/tools/testing/selftests/kvm/lib/x86/svm.c index 5495a92dfd5a..d239c2097391 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/svm.c +++ b/tools/testing/selftests/kvm/lib/x86/svm.c @@ -1,6 +1,5 @@ // SPDX-License-Identifier: GPL-2.0-only /* - * tools/testing/selftests/kvm/lib/x86_64/svm.c * Helpers used for nested SVM testing * Largely inspired from KVM unit test svm.c * diff --git a/tools/testing/selftests/kvm/lib/x86_64/ucall.c b/tools/testing/selftests/kvm/lib/x86/ucall.c index 1265cecc7dd1..1265cecc7dd1 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/ucall.c +++ b/tools/testing/selftests/kvm/lib/x86/ucall.c diff --git a/tools/testing/selftests/kvm/lib/x86_64/vmx.c b/tools/testing/selftests/kvm/lib/x86/vmx.c index d7ac122820bf..d4d1208dd023 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/vmx.c +++ b/tools/testing/selftests/kvm/lib/x86/vmx.c @@ -1,7 +1,5 @@ // SPDX-License-Identifier: GPL-2.0-only /* - * tools/testing/selftests/kvm/lib/x86_64/vmx.c - * * Copyright (C) 2018, Google LLC. */ diff --git a/tools/testing/selftests/kvm/max_guest_memory_test.c b/tools/testing/selftests/kvm/mmu_stress_test.c index 0b9678858b6d..d9c76b4c0d88 100644 --- a/tools/testing/selftests/kvm/max_guest_memory_test.c +++ b/tools/testing/selftests/kvm/mmu_stress_test.c @@ -15,16 +15,62 @@ #include "test_util.h" #include "guest_modes.h" #include "processor.h" +#include "ucall_common.h" + +static bool mprotect_ro_done; static void guest_code(uint64_t start_gpa, uint64_t end_gpa, uint64_t stride) { uint64_t gpa; + int i; - for (;;) { + for (i = 0; i < 2; i++) { for (gpa = start_gpa; gpa < end_gpa; gpa += stride) - *((volatile uint64_t *)gpa) = gpa; - GUEST_SYNC(0); + vcpu_arch_put_guest(*((volatile uint64_t *)gpa), gpa); + GUEST_SYNC(i); } + + for (gpa = start_gpa; gpa < end_gpa; gpa += stride) + *((volatile uint64_t *)gpa); + GUEST_SYNC(2); + + /* + * Write to the region while mprotect(PROT_READ) is underway. Keep + * looping until the memory is guaranteed to be read-only, otherwise + * vCPUs may complete their writes and advance to the next stage + * prematurely. + * + * For architectures that support skipping the faulting instruction, + * generate the store via inline assembly to ensure the exact length + * of the instruction is known and stable (vcpu_arch_put_guest() on + * fixed-length architectures should work, but the cost of paranoia + * is low in this case). For x86, hand-code the exact opcode so that + * there is no room for variability in the generated instruction. + */ + do { + for (gpa = start_gpa; gpa < end_gpa; gpa += stride) +#ifdef __x86_64__ + asm volatile(".byte 0x48,0x89,0x00" :: "a"(gpa) : "memory"); /* mov %rax, (%rax) */ +#elif defined(__aarch64__) + asm volatile("str %0, [%0]" :: "r" (gpa) : "memory"); +#else + vcpu_arch_put_guest(*((volatile uint64_t *)gpa), gpa); +#endif + } while (!READ_ONCE(mprotect_ro_done)); + + /* + * Only architectures that write the entire range can explicitly sync, + * as other architectures will be stuck on the write fault. + */ +#if defined(__x86_64__) || defined(__aarch64__) + GUEST_SYNC(3); +#endif + + for (gpa = start_gpa; gpa < end_gpa; gpa += stride) + vcpu_arch_put_guest(*((volatile uint64_t *)gpa), gpa); + GUEST_SYNC(4); + + GUEST_ASSERT(0); } struct vcpu_info { @@ -51,34 +97,100 @@ static void rendezvous_with_boss(void) } } -static void run_vcpu(struct kvm_vcpu *vcpu) +static void assert_sync_stage(struct kvm_vcpu *vcpu, int stage) +{ + struct ucall uc; + + TEST_ASSERT_EQ(get_ucall(vcpu, &uc), UCALL_SYNC); + TEST_ASSERT_EQ(uc.args[1], stage); +} + +static void run_vcpu(struct kvm_vcpu *vcpu, int stage) { vcpu_run(vcpu); - TEST_ASSERT_EQ(get_ucall(vcpu, NULL), UCALL_SYNC); + assert_sync_stage(vcpu, stage); } static void *vcpu_worker(void *data) { + struct kvm_sregs __maybe_unused sregs; struct vcpu_info *info = data; struct kvm_vcpu *vcpu = info->vcpu; struct kvm_vm *vm = vcpu->vm; - struct kvm_sregs sregs; + int r; vcpu_args_set(vcpu, 3, info->start_gpa, info->end_gpa, vm->page_size); rendezvous_with_boss(); - run_vcpu(vcpu); + /* Stage 0, write all of guest memory. */ + run_vcpu(vcpu, 0); rendezvous_with_boss(); - vcpu_sregs_get(vcpu, &sregs); #ifdef __x86_64__ + vcpu_sregs_get(vcpu, &sregs); /* Toggle CR0.WP to trigger a MMU context reset. */ sregs.cr0 ^= X86_CR0_WP; -#endif vcpu_sregs_set(vcpu, &sregs); +#endif rendezvous_with_boss(); - run_vcpu(vcpu); + /* Stage 1, re-write all of guest memory. */ + run_vcpu(vcpu, 1); + rendezvous_with_boss(); + + /* Stage 2, read all of guest memory, which is now read-only. */ + run_vcpu(vcpu, 2); + + /* + * Stage 3, write guest memory and verify KVM returns -EFAULT for once + * the mprotect(PROT_READ) lands. Only architectures that support + * validating *all* of guest memory sync for this stage, as vCPUs will + * be stuck on the faulting instruction for other architectures. Go to + * stage 3 without a rendezvous + */ + do { + r = _vcpu_run(vcpu); + } while (!r); + TEST_ASSERT(r == -1 && errno == EFAULT, + "Expected EFAULT on write to RO memory, got r = %d, errno = %d", r, errno); + +#if defined(__x86_64__) || defined(__aarch64__) + /* + * Verify *all* writes from the guest hit EFAULT due to the VMA now + * being read-only. x86 and arm64 only at this time as skipping the + * instruction that hits the EFAULT requires advancing the program + * counter, which is arch specific and relies on inline assembly. + */ +#ifdef __x86_64__ + vcpu->run->kvm_valid_regs = KVM_SYNC_X86_REGS; +#endif + for (;;) { + r = _vcpu_run(vcpu); + if (!r) + break; + TEST_ASSERT_EQ(errno, EFAULT); +#if defined(__x86_64__) + WRITE_ONCE(vcpu->run->kvm_dirty_regs, KVM_SYNC_X86_REGS); + vcpu->run->s.regs.regs.rip += 3; +#elif defined(__aarch64__) + vcpu_set_reg(vcpu, ARM64_CORE_REG(regs.pc), + vcpu_get_reg(vcpu, ARM64_CORE_REG(regs.pc)) + 4); +#endif + + } + assert_sync_stage(vcpu, 3); +#endif /* __x86_64__ || __aarch64__ */ + rendezvous_with_boss(); + + /* + * Stage 4. Run to completion, waiting for mprotect(PROT_WRITE) to + * make the memory writable again. + */ + do { + r = _vcpu_run(vcpu); + } while (r && errno == EFAULT); + TEST_ASSERT_EQ(r, 0); + assert_sync_stage(vcpu, 4); rendezvous_with_boss(); return NULL; @@ -161,7 +273,7 @@ int main(int argc, char *argv[]) const uint64_t start_gpa = SZ_4G; const int first_slot = 1; - struct timespec time_start, time_run1, time_reset, time_run2; + struct timespec time_start, time_run1, time_reset, time_run2, time_ro, time_rw; uint64_t max_gpa, gpa, slot_size, max_mem, i; int max_slots, slot, opt, fd; bool hugepages = false; @@ -209,7 +321,13 @@ int main(int argc, char *argv[]) vcpus = malloc(nr_vcpus * sizeof(*vcpus)); TEST_ASSERT(vcpus, "Failed to allocate vCPU array"); - vm = vm_create_with_vcpus(nr_vcpus, guest_code, vcpus); + vm = __vm_create_with_vcpus(VM_SHAPE_DEFAULT, nr_vcpus, +#ifdef __x86_64__ + max_mem / SZ_1G, +#else + max_mem / vm_guest_mode_params[VM_MODE_DEFAULT].page_size, +#endif + guest_code, vcpus); max_gpa = vm->max_gfn << vm->page_shift; TEST_ASSERT(max_gpa > (4 * slot_size), "MAXPHYADDR <4gb "); @@ -259,14 +377,28 @@ int main(int argc, char *argv[]) rendezvous_with_vcpus(&time_reset, "reset"); rendezvous_with_vcpus(&time_run2, "run 2"); + mprotect(mem, slot_size, PROT_READ); + usleep(10); + mprotect_ro_done = true; + sync_global_to_guest(vm, mprotect_ro_done); + + rendezvous_with_vcpus(&time_ro, "mprotect RO"); + mprotect(mem, slot_size, PROT_READ | PROT_WRITE); + rendezvous_with_vcpus(&time_rw, "mprotect RW"); + + time_rw = timespec_sub(time_rw, time_ro); + time_ro = timespec_sub(time_ro, time_run2); time_run2 = timespec_sub(time_run2, time_reset); - time_reset = timespec_sub(time_reset, time_run1); + time_reset = timespec_sub(time_reset, time_run1); time_run1 = timespec_sub(time_run1, time_start); - pr_info("run1 = %ld.%.9lds, reset = %ld.%.9lds, run2 = %ld.%.9lds\n", + pr_info("run1 = %ld.%.9lds, reset = %ld.%.9lds, run2 = %ld.%.9lds, " + "ro = %ld.%.9lds, rw = %ld.%.9lds\n", time_run1.tv_sec, time_run1.tv_nsec, time_reset.tv_sec, time_reset.tv_nsec, - time_run2.tv_sec, time_run2.tv_nsec); + time_run2.tv_sec, time_run2.tv_nsec, + time_ro.tv_sec, time_ro.tv_nsec, + time_rw.tv_sec, time_rw.tv_nsec); /* * Delete even numbered slots (arbitrary) and unmap the first half of diff --git a/tools/testing/selftests/kvm/riscv/arch_timer.c b/tools/testing/selftests/kvm/riscv/arch_timer.c index 2c792228ac0b..9e370800a6a2 100644 --- a/tools/testing/selftests/kvm/riscv/arch_timer.c +++ b/tools/testing/selftests/kvm/riscv/arch_timer.c @@ -93,7 +93,7 @@ struct kvm_vm *test_vm_create(void) vcpu_init_vector_tables(vcpus[i]); /* Initialize guest timer frequency. */ - vcpu_get_reg(vcpus[0], RISCV_TIMER_REG(frequency), &timer_freq); + timer_freq = vcpu_get_reg(vcpus[0], RISCV_TIMER_REG(frequency)); sync_global_to_guest(vm, timer_freq); pr_debug("timer_freq: %lu\n", timer_freq); diff --git a/tools/testing/selftests/kvm/riscv/ebreak_test.c b/tools/testing/selftests/kvm/riscv/ebreak_test.c index 0e0712854953..cfed6c727bfc 100644 --- a/tools/testing/selftests/kvm/riscv/ebreak_test.c +++ b/tools/testing/selftests/kvm/riscv/ebreak_test.c @@ -60,7 +60,7 @@ int main(void) TEST_ASSERT_KVM_EXIT_REASON(vcpu, KVM_EXIT_DEBUG); - vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.pc), &pc); + pc = vcpu_get_reg(vcpu, RISCV_CORE_REG(regs.pc)); TEST_ASSERT_EQ(pc, LABEL_ADDRESS(sw_bp_1)); /* skip sw_bp_1 */ diff --git a/tools/testing/selftests/kvm/riscv/get-reg-list.c b/tools/testing/selftests/kvm/riscv/get-reg-list.c index 4bc1051848e5..8515921dfdbf 100644 --- a/tools/testing/selftests/kvm/riscv/get-reg-list.c +++ b/tools/testing/selftests/kvm/riscv/get-reg-list.c @@ -52,6 +52,8 @@ bool filter_reg(__u64 reg) case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_SVINVAL: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_SVNAPOT: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_SVPBMT: + case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_SVVPTC: + case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZABHA: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZACAS: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZAWRS: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZBA: @@ -71,6 +73,7 @@ bool filter_reg(__u64 reg) case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZFHMIN: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICBOM: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICBOZ: + case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICCRSE: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICNTR: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICOND: case KVM_REG_RISCV_ISA_EXT | KVM_REG_RISCV_ISA_SINGLE | KVM_RISCV_ISA_EXT_ZICSR: @@ -112,6 +115,7 @@ bool filter_reg(__u64 reg) case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_HSM: case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_PMU: case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_DBCN: + case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_SUSP: case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_STA: case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_EXPERIMENTAL: case KVM_REG_RISCV_SBI_EXT | KVM_REG_RISCV_SBI_SINGLE | KVM_RISCV_SBI_EXT_VENDOR: @@ -429,6 +433,8 @@ static const char *isa_ext_single_id_to_str(__u64 reg_off) KVM_ISA_EXT_ARR(SVINVAL), KVM_ISA_EXT_ARR(SVNAPOT), KVM_ISA_EXT_ARR(SVPBMT), + KVM_ISA_EXT_ARR(SVVPTC), + KVM_ISA_EXT_ARR(ZABHA), KVM_ISA_EXT_ARR(ZACAS), KVM_ISA_EXT_ARR(ZAWRS), KVM_ISA_EXT_ARR(ZBA), @@ -448,6 +454,7 @@ static const char *isa_ext_single_id_to_str(__u64 reg_off) KVM_ISA_EXT_ARR(ZFHMIN), KVM_ISA_EXT_ARR(ZICBOM), KVM_ISA_EXT_ARR(ZICBOZ), + KVM_ISA_EXT_ARR(ZICCRSE), KVM_ISA_EXT_ARR(ZICNTR), KVM_ISA_EXT_ARR(ZICOND), KVM_ISA_EXT_ARR(ZICSR), @@ -535,10 +542,11 @@ static const char *sbi_ext_single_id_to_str(__u64 reg_off) KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_SRST), KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_HSM), KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_PMU), + KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_DBCN), + KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_SUSP), KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_STA), KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_EXPERIMENTAL), KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_VENDOR), - KVM_SBI_EXT_ARR(KVM_RISCV_SBI_EXT_DBCN), }; if (reg_off >= ARRAY_SIZE(kvm_sbi_ext_reg_name)) @@ -949,6 +957,7 @@ KVM_SBI_EXT_SUBLIST_CONFIG(base, BASE); KVM_SBI_EXT_SUBLIST_CONFIG(sta, STA); KVM_SBI_EXT_SIMPLE_CONFIG(pmu, PMU); KVM_SBI_EXT_SIMPLE_CONFIG(dbcn, DBCN); +KVM_SBI_EXT_SIMPLE_CONFIG(susp, SUSP); KVM_ISA_EXT_SUBLIST_CONFIG(aia, AIA); KVM_ISA_EXT_SUBLIST_CONFIG(fp_f, FP_F); @@ -964,6 +973,8 @@ KVM_ISA_EXT_SIMPLE_CONFIG(svadu, SVADU); KVM_ISA_EXT_SIMPLE_CONFIG(svinval, SVINVAL); KVM_ISA_EXT_SIMPLE_CONFIG(svnapot, SVNAPOT); KVM_ISA_EXT_SIMPLE_CONFIG(svpbmt, SVPBMT); +KVM_ISA_EXT_SIMPLE_CONFIG(svvptc, SVVPTC); +KVM_ISA_EXT_SIMPLE_CONFIG(zabha, ZABHA); KVM_ISA_EXT_SIMPLE_CONFIG(zacas, ZACAS); KVM_ISA_EXT_SIMPLE_CONFIG(zawrs, ZAWRS); KVM_ISA_EXT_SIMPLE_CONFIG(zba, ZBA); @@ -983,6 +994,7 @@ KVM_ISA_EXT_SIMPLE_CONFIG(zfh, ZFH); KVM_ISA_EXT_SIMPLE_CONFIG(zfhmin, ZFHMIN); KVM_ISA_EXT_SUBLIST_CONFIG(zicbom, ZICBOM); KVM_ISA_EXT_SUBLIST_CONFIG(zicboz, ZICBOZ); +KVM_ISA_EXT_SIMPLE_CONFIG(ziccrse, ZICCRSE); KVM_ISA_EXT_SIMPLE_CONFIG(zicntr, ZICNTR); KVM_ISA_EXT_SIMPLE_CONFIG(zicond, ZICOND); KVM_ISA_EXT_SIMPLE_CONFIG(zicsr, ZICSR); @@ -1017,6 +1029,7 @@ struct vcpu_reg_list *vcpu_configs[] = { &config_sbi_sta, &config_sbi_pmu, &config_sbi_dbcn, + &config_sbi_susp, &config_aia, &config_fp_f, &config_fp_d, @@ -1031,6 +1044,8 @@ struct vcpu_reg_list *vcpu_configs[] = { &config_svinval, &config_svnapot, &config_svpbmt, + &config_svvptc, + &config_zabha, &config_zacas, &config_zawrs, &config_zba, @@ -1050,6 +1065,7 @@ struct vcpu_reg_list *vcpu_configs[] = { &config_zfhmin, &config_zicbom, &config_zicboz, + &config_ziccrse, &config_zicntr, &config_zicond, &config_zicsr, diff --git a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c index f299cbfd23ca..f45c0ecc902d 100644 --- a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c +++ b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c @@ -608,7 +608,7 @@ static void test_vm_events_overflow(void *guest_code) vcpu_init_vector_tables(vcpu); /* Initialize guest timer frequency. */ - vcpu_get_reg(vcpu, RISCV_TIMER_REG(frequency), &timer_freq); + timer_freq = vcpu_get_reg(vcpu, RISCV_TIMER_REG(frequency)); sync_global_to_guest(vm, timer_freq); run_vcpu(vcpu); diff --git a/tools/testing/selftests/kvm/s390x/cmma_test.c b/tools/testing/selftests/kvm/s390/cmma_test.c index e32dd59703a0..85cc8c18d6e7 100644 --- a/tools/testing/selftests/kvm/s390x/cmma_test.c +++ b/tools/testing/selftests/kvm/s390/cmma_test.c @@ -444,7 +444,7 @@ static void assert_no_pages_cmma_dirty(struct kvm_vm *vm) ); } -static void test_get_inital_dirty(void) +static void test_get_initial_dirty(void) { struct kvm_vm *vm = create_vm_two_memslots(); struct kvm_vcpu *vcpu; @@ -651,7 +651,7 @@ struct testdef { } testlist[] = { { "migration mode and dirty tracking", test_migration_mode }, { "GET_CMMA_BITS: basic calls", test_get_cmma_basic }, - { "GET_CMMA_BITS: all pages are dirty initally", test_get_inital_dirty }, + { "GET_CMMA_BITS: all pages are dirty initially", test_get_initial_dirty }, { "GET_CMMA_BITS: holes are skipped", test_get_skip_holes }, }; diff --git a/tools/testing/selftests/kvm/s390x/config b/tools/testing/selftests/kvm/s390/config index 23270f2d679f..23270f2d679f 100644 --- a/tools/testing/selftests/kvm/s390x/config +++ b/tools/testing/selftests/kvm/s390/config diff --git a/tools/testing/selftests/kvm/s390x/cpumodel_subfuncs_test.c b/tools/testing/selftests/kvm/s390/cpumodel_subfuncs_test.c index 27255880dabd..27255880dabd 100644 --- a/tools/testing/selftests/kvm/s390x/cpumodel_subfuncs_test.c +++ b/tools/testing/selftests/kvm/s390/cpumodel_subfuncs_test.c diff --git a/tools/testing/selftests/kvm/s390x/debug_test.c b/tools/testing/selftests/kvm/s390/debug_test.c index ad8095968601..ad8095968601 100644 --- a/tools/testing/selftests/kvm/s390x/debug_test.c +++ b/tools/testing/selftests/kvm/s390/debug_test.c diff --git a/tools/testing/selftests/kvm/s390x/memop.c b/tools/testing/selftests/kvm/s390/memop.c index 4374b4cd2a80..4374b4cd2a80 100644 --- a/tools/testing/selftests/kvm/s390x/memop.c +++ b/tools/testing/selftests/kvm/s390/memop.c diff --git a/tools/testing/selftests/kvm/s390x/resets.c b/tools/testing/selftests/kvm/s390/resets.c index 357943f2bea8..b58f75b381e5 100644 --- a/tools/testing/selftests/kvm/s390x/resets.c +++ b/tools/testing/selftests/kvm/s390/resets.c @@ -61,7 +61,7 @@ static void test_one_reg(struct kvm_vcpu *vcpu, uint64_t id, uint64_t value) { uint64_t eval_reg; - vcpu_get_reg(vcpu, id, &eval_reg); + eval_reg = vcpu_get_reg(vcpu, id); TEST_ASSERT(eval_reg == value, "value == 0x%lx", value); } diff --git a/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c b/tools/testing/selftests/kvm/s390/shared_zeropage_test.c index bba0d9a6dcc8..bba0d9a6dcc8 100644 --- a/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c +++ b/tools/testing/selftests/kvm/s390/shared_zeropage_test.c diff --git a/tools/testing/selftests/kvm/s390x/sync_regs_test.c b/tools/testing/selftests/kvm/s390/sync_regs_test.c index 53def355ccba..53def355ccba 100644 --- a/tools/testing/selftests/kvm/s390x/sync_regs_test.c +++ b/tools/testing/selftests/kvm/s390/sync_regs_test.c diff --git a/tools/testing/selftests/kvm/s390x/tprot.c b/tools/testing/selftests/kvm/s390/tprot.c index 12d5e1cb62e3..12d5e1cb62e3 100644 --- a/tools/testing/selftests/kvm/s390x/tprot.c +++ b/tools/testing/selftests/kvm/s390/tprot.c diff --git a/tools/testing/selftests/kvm/s390x/ucontrol_test.c b/tools/testing/selftests/kvm/s390/ucontrol_test.c index 0c112319dab1..d265b34c54be 100644 --- a/tools/testing/selftests/kvm/s390x/ucontrol_test.c +++ b/tools/testing/selftests/kvm/s390/ucontrol_test.c @@ -88,10 +88,6 @@ asm("test_skey_asm:\n" " ahi %r0,1\n" " st %r1,0(%r5,%r6)\n" - " iske %r1,%r6\n" - " ahi %r0,1\n" - " diag 0,0,0x44\n" - " sske %r1,%r6\n" " xgr %r1,%r1\n" " iske %r1,%r6\n" @@ -210,10 +206,13 @@ TEST_F(uc_kvm, uc_attr_mem_limit) struct kvm_device_attr attr = { .group = KVM_S390_VM_MEM_CTRL, .attr = KVM_S390_VM_MEM_LIMIT_SIZE, - .addr = (unsigned long)&limit, + .addr = (u64)&limit, }; int rc; + rc = ioctl(self->vm_fd, KVM_HAS_DEVICE_ATTR, &attr); + EXPECT_EQ(0, rc); + rc = ioctl(self->vm_fd, KVM_GET_DEVICE_ATTR, &attr); EXPECT_EQ(0, rc); EXPECT_EQ(~0UL, limit); @@ -456,10 +455,14 @@ TEST_F(uc_kvm, uc_no_user_region) }; ASSERT_EQ(-1, ioctl(self->vm_fd, KVM_SET_USER_MEMORY_REGION, ®ion)); - ASSERT_EQ(EINVAL, errno); + ASSERT_TRUE(errno == EEXIST || errno == EINVAL) + TH_LOG("errno %s (%i) not expected for ioctl KVM_SET_USER_MEMORY_REGION", + strerror(errno), errno); ASSERT_EQ(-1, ioctl(self->vm_fd, KVM_SET_USER_MEMORY_REGION2, ®ion2)); - ASSERT_EQ(EINVAL, errno); + ASSERT_TRUE(errno == EEXIST || errno == EINVAL) + TH_LOG("errno %s (%i) not expected for ioctl KVM_SET_USER_MEMORY_REGION2", + strerror(errno), errno); } TEST_F(uc_kvm, uc_map_unmap) @@ -593,7 +596,9 @@ TEST_F(uc_kvm, uc_skey) ASSERT_EQ(true, uc_handle_exit(self)); ASSERT_EQ(1, sync_regs->gprs[0]); - /* ISKE */ + /* SSKE + ISKE */ + sync_regs->gprs[1] = skeyvalue; + run->kvm_dirty_regs |= KVM_SYNC_GPRS; ASSERT_EQ(0, uc_run_once(self)); /* @@ -605,21 +610,11 @@ TEST_F(uc_kvm, uc_skey) TEST_ASSERT_EQ(0, sie_block->ictl & (ICTL_ISKE | ICTL_SSKE | ICTL_RRBE)); TEST_ASSERT_EQ(KVM_EXIT_S390_SIEIC, self->run->exit_reason); TEST_ASSERT_EQ(ICPT_INST, sie_block->icptcode); - TEST_REQUIRE(sie_block->ipa != 0xb229); + TEST_REQUIRE(sie_block->ipa != 0xb22b); - /* ISKE contd. */ + /* SSKE + ISKE contd. */ ASSERT_EQ(false, uc_handle_exit(self)); ASSERT_EQ(2, sync_regs->gprs[0]); - /* assert initial skey (ACC = 0, R & C = 1) */ - ASSERT_EQ(0x06, sync_regs->gprs[1]); - uc_assert_diag44(self); - - /* SSKE + ISKE */ - sync_regs->gprs[1] = skeyvalue; - run->kvm_dirty_regs |= KVM_SYNC_GPRS; - ASSERT_EQ(0, uc_run_once(self)); - ASSERT_EQ(false, uc_handle_exit(self)); - ASSERT_EQ(3, sync_regs->gprs[0]); ASSERT_EQ(skeyvalue, sync_regs->gprs[1]); uc_assert_diag44(self); @@ -628,11 +623,178 @@ TEST_F(uc_kvm, uc_skey) run->kvm_dirty_regs |= KVM_SYNC_GPRS; ASSERT_EQ(0, uc_run_once(self)); ASSERT_EQ(false, uc_handle_exit(self)); - ASSERT_EQ(4, sync_regs->gprs[0]); + ASSERT_EQ(3, sync_regs->gprs[0]); /* assert R reset but rest of skey unchanged */ ASSERT_EQ(skeyvalue & 0xfa, sync_regs->gprs[1]); ASSERT_EQ(0, sync_regs->gprs[1] & 0x04); uc_assert_diag44(self); } +static char uc_flic_b[PAGE_SIZE]; +static struct kvm_s390_io_adapter uc_flic_ioa = { .id = 0 }; +static struct kvm_s390_io_adapter_req uc_flic_ioam = { .id = 0 }; +static struct kvm_s390_ais_req uc_flic_asim = { .isc = 0 }; +static struct kvm_s390_ais_all uc_flic_asima = { .simm = 0 }; +static struct uc_flic_attr_test { + char *name; + struct kvm_device_attr a; + int hasrc; + int geterrno; + int seterrno; +} uc_flic_attr_tests[] = { + { + .name = "KVM_DEV_FLIC_GET_ALL_IRQS", + .seterrno = EINVAL, + .a = { + .group = KVM_DEV_FLIC_GET_ALL_IRQS, + .addr = (u64)&uc_flic_b, + .attr = PAGE_SIZE, + }, + }, + { + .name = "KVM_DEV_FLIC_ENQUEUE", + .geterrno = EINVAL, + .a = { .group = KVM_DEV_FLIC_ENQUEUE, }, + }, + { + .name = "KVM_DEV_FLIC_CLEAR_IRQS", + .geterrno = EINVAL, + .a = { .group = KVM_DEV_FLIC_CLEAR_IRQS, }, + }, + { + .name = "KVM_DEV_FLIC_ADAPTER_REGISTER", + .geterrno = EINVAL, + .a = { + .group = KVM_DEV_FLIC_ADAPTER_REGISTER, + .addr = (u64)&uc_flic_ioa, + }, + }, + { + .name = "KVM_DEV_FLIC_ADAPTER_MODIFY", + .geterrno = EINVAL, + .seterrno = EINVAL, + .a = { + .group = KVM_DEV_FLIC_ADAPTER_MODIFY, + .addr = (u64)&uc_flic_ioam, + .attr = sizeof(uc_flic_ioam), + }, + }, + { + .name = "KVM_DEV_FLIC_CLEAR_IO_IRQ", + .geterrno = EINVAL, + .seterrno = EINVAL, + .a = { + .group = KVM_DEV_FLIC_CLEAR_IO_IRQ, + .attr = 32, + }, + }, + { + .name = "KVM_DEV_FLIC_AISM", + .geterrno = EINVAL, + .seterrno = ENOTSUP, + .a = { + .group = KVM_DEV_FLIC_AISM, + .addr = (u64)&uc_flic_asim, + }, + }, + { + .name = "KVM_DEV_FLIC_AIRQ_INJECT", + .geterrno = EINVAL, + .a = { .group = KVM_DEV_FLIC_AIRQ_INJECT, }, + }, + { + .name = "KVM_DEV_FLIC_AISM_ALL", + .geterrno = ENOTSUP, + .seterrno = ENOTSUP, + .a = { + .group = KVM_DEV_FLIC_AISM_ALL, + .addr = (u64)&uc_flic_asima, + .attr = sizeof(uc_flic_asima), + }, + }, + { + .name = "KVM_DEV_FLIC_APF_ENABLE", + .geterrno = EINVAL, + .seterrno = EINVAL, + .a = { .group = KVM_DEV_FLIC_APF_ENABLE, }, + }, + { + .name = "KVM_DEV_FLIC_APF_DISABLE_WAIT", + .geterrno = EINVAL, + .seterrno = EINVAL, + .a = { .group = KVM_DEV_FLIC_APF_DISABLE_WAIT, }, + }, +}; + +TEST_F(uc_kvm, uc_flic_attrs) +{ + struct kvm_create_device cd = { .type = KVM_DEV_TYPE_FLIC }; + struct kvm_device_attr attr; + u64 value; + int rc, i; + + rc = ioctl(self->vm_fd, KVM_CREATE_DEVICE, &cd); + ASSERT_EQ(0, rc) TH_LOG("create device failed with err %s (%i)", + strerror(errno), errno); + + for (i = 0; i < ARRAY_SIZE(uc_flic_attr_tests); i++) { + TH_LOG("test %s", uc_flic_attr_tests[i].name); + attr = (struct kvm_device_attr) { + .group = uc_flic_attr_tests[i].a.group, + .attr = uc_flic_attr_tests[i].a.attr, + .addr = uc_flic_attr_tests[i].a.addr, + }; + if (attr.addr == 0) + attr.addr = (u64)&value; + + rc = ioctl(cd.fd, KVM_HAS_DEVICE_ATTR, &attr); + EXPECT_EQ(uc_flic_attr_tests[i].hasrc, !!rc) + TH_LOG("expected dev attr missing %s", + uc_flic_attr_tests[i].name); + + rc = ioctl(cd.fd, KVM_GET_DEVICE_ATTR, &attr); + EXPECT_EQ(!!uc_flic_attr_tests[i].geterrno, !!rc) + TH_LOG("get dev attr rc not expected on %s %s (%i)", + uc_flic_attr_tests[i].name, + strerror(errno), errno); + if (uc_flic_attr_tests[i].geterrno) + EXPECT_EQ(uc_flic_attr_tests[i].geterrno, errno) + TH_LOG("get dev attr errno not expected on %s %s (%i)", + uc_flic_attr_tests[i].name, + strerror(errno), errno); + + rc = ioctl(cd.fd, KVM_SET_DEVICE_ATTR, &attr); + EXPECT_EQ(!!uc_flic_attr_tests[i].seterrno, !!rc) + TH_LOG("set sev attr rc not expected on %s %s (%i)", + uc_flic_attr_tests[i].name, + strerror(errno), errno); + if (uc_flic_attr_tests[i].seterrno) + EXPECT_EQ(uc_flic_attr_tests[i].seterrno, errno) + TH_LOG("set dev attr errno not expected on %s %s (%i)", + uc_flic_attr_tests[i].name, + strerror(errno), errno); + } + + close(cd.fd); +} + +TEST_F(uc_kvm, uc_set_gsi_routing) +{ + struct kvm_irq_routing *routing = kvm_gsi_routing_create(); + struct kvm_irq_routing_entry ue = { + .type = KVM_IRQ_ROUTING_S390_ADAPTER, + .gsi = 1, + .u.adapter = (struct kvm_irq_routing_s390_adapter) { + .ind_addr = 0, + }, + }; + int rc; + + routing->entries[0] = ue; + routing->nr = 1; + rc = ioctl(self->vm_fd, KVM_SET_GSI_ROUTING, routing); + ASSERT_EQ(-1, rc) TH_LOG("err %s (%i)", strerror(errno), errno); + ASSERT_EQ(EINVAL, errno) TH_LOG("err %s (%i)", strerror(errno), errno); +} + TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/kvm/set_memory_region_test.c b/tools/testing/selftests/kvm/set_memory_region_test.c index a8267628e9ed..bc440d5aba57 100644 --- a/tools/testing/selftests/kvm/set_memory_region_test.c +++ b/tools/testing/selftests/kvm/set_memory_region_test.c @@ -17,9 +17,9 @@ #include <processor.h> /* - * s390x needs at least 1MB alignment, and the x86_64 MOVE/DELETE tests need a - * 2MB sized and aligned region so that the initial region corresponds to - * exactly one large page. + * s390 needs at least 1MB alignment, and the x86 MOVE/DELETE tests need a 2MB + * sized and aligned region so that the initial region corresponds to exactly + * one large page. */ #define MEM_REGION_SIZE 0x200000 @@ -235,7 +235,7 @@ static void guest_code_delete_memory_region(void) * in the guest will never succeed, and so isn't an option. */ memset(&idt, 0, sizeof(idt)); - __asm__ __volatile__("lidt %0" :: "m"(idt)); + set_idt(&idt); GUEST_SYNC(0); @@ -553,6 +553,56 @@ static void test_add_overlapping_private_memory_regions(void) close(memfd); kvm_vm_free(vm); } + +static void guest_code_mmio_during_vectoring(void) +{ + const struct desc_ptr idt_desc = { + .address = MEM_REGION_GPA, + .size = 0xFFF, + }; + + set_idt(&idt_desc); + + /* Generate a #GP by dereferencing a non-canonical address */ + *((uint8_t *)NONCANONICAL) = 0x1; + + GUEST_ASSERT(0); +} + +/* + * This test points the IDT descriptor base to an MMIO address. It should cause + * a KVM internal error when an event occurs in the guest. + */ +static void test_mmio_during_vectoring(void) +{ + struct kvm_vcpu *vcpu; + struct kvm_run *run; + struct kvm_vm *vm; + u64 expected_gpa; + + pr_info("Testing MMIO during vectoring error handling\n"); + + vm = vm_create_with_one_vcpu(&vcpu, guest_code_mmio_during_vectoring); + virt_map(vm, MEM_REGION_GPA, MEM_REGION_GPA, 1); + + run = vcpu->run; + + vcpu_run(vcpu); + TEST_ASSERT_KVM_EXIT_REASON(vcpu, KVM_EXIT_INTERNAL_ERROR); + TEST_ASSERT(run->internal.suberror == KVM_INTERNAL_ERROR_DELIVERY_EV, + "Unexpected suberror = %d", vcpu->run->internal.suberror); + TEST_ASSERT(run->internal.ndata != 4, "Unexpected internal error data array size = %d", + run->internal.ndata); + + /* The reported GPA should be IDT base + offset of the GP vector */ + expected_gpa = MEM_REGION_GPA + GP_VECTOR * sizeof(struct idt_entry); + + TEST_ASSERT(run->internal.data[3] == expected_gpa, + "Unexpected GPA = %llx (expected %lx)", + vcpu->run->internal.data[3], expected_gpa); + + kvm_vm_free(vm); +} #endif int main(int argc, char *argv[]) @@ -568,6 +618,7 @@ int main(int argc, char *argv[]) * KVM_RUN fails with ENOEXEC or EFAULT. */ test_zero_memory_regions(); + test_mmio_during_vectoring(); #endif test_invalid_memory_region_flags(); diff --git a/tools/testing/selftests/kvm/steal_time.c b/tools/testing/selftests/kvm/steal_time.c index a8d3afa0b86b..cce2520af720 100644 --- a/tools/testing/selftests/kvm/steal_time.c +++ b/tools/testing/selftests/kvm/steal_time.c @@ -269,9 +269,8 @@ static void guest_code(int cpu) static bool is_steal_time_supported(struct kvm_vcpu *vcpu) { uint64_t id = RISCV_SBI_EXT_REG(KVM_RISCV_SBI_EXT_STA); - unsigned long enabled; + unsigned long enabled = vcpu_get_reg(vcpu, id); - vcpu_get_reg(vcpu, id, &enabled); TEST_ASSERT(enabled == 0 || enabled == 1, "Expected boolean result"); return enabled; diff --git a/tools/testing/selftests/kvm/x86_64/amx_test.c b/tools/testing/selftests/kvm/x86/amx_test.c index f4ce5a185a7d..f4ce5a185a7d 100644 --- a/tools/testing/selftests/kvm/x86_64/amx_test.c +++ b/tools/testing/selftests/kvm/x86/amx_test.c diff --git a/tools/testing/selftests/kvm/x86_64/apic_bus_clock_test.c b/tools/testing/selftests/kvm/x86/apic_bus_clock_test.c index f8916bb34405..f8916bb34405 100644 --- a/tools/testing/selftests/kvm/x86_64/apic_bus_clock_test.c +++ b/tools/testing/selftests/kvm/x86/apic_bus_clock_test.c diff --git a/tools/testing/selftests/kvm/x86_64/cpuid_test.c b/tools/testing/selftests/kvm/x86/cpuid_test.c index 7b3fda6842bc..7b3fda6842bc 100644 --- a/tools/testing/selftests/kvm/x86_64/cpuid_test.c +++ b/tools/testing/selftests/kvm/x86/cpuid_test.c diff --git a/tools/testing/selftests/kvm/x86_64/cr4_cpuid_sync_test.c b/tools/testing/selftests/kvm/x86/cr4_cpuid_sync_test.c index 28cc66454601..28cc66454601 100644 --- a/tools/testing/selftests/kvm/x86_64/cr4_cpuid_sync_test.c +++ b/tools/testing/selftests/kvm/x86/cr4_cpuid_sync_test.c diff --git a/tools/testing/selftests/kvm/x86_64/debug_regs.c b/tools/testing/selftests/kvm/x86/debug_regs.c index 2d814c1d1dc4..2d814c1d1dc4 100644 --- a/tools/testing/selftests/kvm/x86_64/debug_regs.c +++ b/tools/testing/selftests/kvm/x86/debug_regs.c diff --git a/tools/testing/selftests/kvm/x86_64/dirty_log_page_splitting_test.c b/tools/testing/selftests/kvm/x86/dirty_log_page_splitting_test.c index 2929c067c207..2929c067c207 100644 --- a/tools/testing/selftests/kvm/x86_64/dirty_log_page_splitting_test.c +++ b/tools/testing/selftests/kvm/x86/dirty_log_page_splitting_test.c diff --git a/tools/testing/selftests/kvm/x86_64/exit_on_emulation_failure_test.c b/tools/testing/selftests/kvm/x86/exit_on_emulation_failure_test.c index 81055476d394..81055476d394 100644 --- a/tools/testing/selftests/kvm/x86_64/exit_on_emulation_failure_test.c +++ b/tools/testing/selftests/kvm/x86/exit_on_emulation_failure_test.c diff --git a/tools/testing/selftests/kvm/x86_64/feature_msrs_test.c b/tools/testing/selftests/kvm/x86/feature_msrs_test.c index a72f13ae2edb..a72f13ae2edb 100644 --- a/tools/testing/selftests/kvm/x86_64/feature_msrs_test.c +++ b/tools/testing/selftests/kvm/x86/feature_msrs_test.c diff --git a/tools/testing/selftests/kvm/x86_64/fix_hypercall_test.c b/tools/testing/selftests/kvm/x86/fix_hypercall_test.c index 762628f7d4ba..762628f7d4ba 100644 --- a/tools/testing/selftests/kvm/x86_64/fix_hypercall_test.c +++ b/tools/testing/selftests/kvm/x86/fix_hypercall_test.c diff --git a/tools/testing/selftests/kvm/x86_64/flds_emulation.h b/tools/testing/selftests/kvm/x86/flds_emulation.h index 37b1a9f52864..37b1a9f52864 100644 --- a/tools/testing/selftests/kvm/x86_64/flds_emulation.h +++ b/tools/testing/selftests/kvm/x86/flds_emulation.h diff --git a/tools/testing/selftests/kvm/x86_64/hwcr_msr_test.c b/tools/testing/selftests/kvm/x86/hwcr_msr_test.c index 10b1b0ba374e..10b1b0ba374e 100644 --- a/tools/testing/selftests/kvm/x86_64/hwcr_msr_test.c +++ b/tools/testing/selftests/kvm/x86/hwcr_msr_test.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_clock.c b/tools/testing/selftests/kvm/x86/hyperv_clock.c index e058bc676cd6..e058bc676cd6 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_clock.c +++ b/tools/testing/selftests/kvm/x86/hyperv_clock.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_cpuid.c b/tools/testing/selftests/kvm/x86/hyperv_cpuid.c index 4f5881d4ef66..4e920705681a 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_cpuid.c +++ b/tools/testing/selftests/kvm/x86/hyperv_cpuid.c @@ -41,13 +41,19 @@ static bool smt_possible(void) return res; } -static void test_hv_cpuid(const struct kvm_cpuid2 *hv_cpuid_entries, - bool evmcs_expected) +static void test_hv_cpuid(struct kvm_vcpu *vcpu, bool evmcs_expected) { + const bool has_irqchip = !vcpu || vcpu->vm->has_irqchip; + const struct kvm_cpuid2 *hv_cpuid_entries; int i; int nent_expected = 10; u32 test_val; + if (vcpu) + hv_cpuid_entries = vcpu_get_supported_hv_cpuid(vcpu); + else + hv_cpuid_entries = kvm_get_supported_hv_cpuid(); + TEST_ASSERT(hv_cpuid_entries->nent == nent_expected, "KVM_GET_SUPPORTED_HV_CPUID should return %d entries" " (returned %d)", @@ -80,12 +86,19 @@ static void test_hv_cpuid(const struct kvm_cpuid2 *hv_cpuid_entries, entry->eax, evmcs_expected ); break; + case 0x40000003: + TEST_ASSERT(has_irqchip || !(entry->edx & BIT(19)), + "\"Direct\" Synthetic Timers should require in-kernel APIC"); + break; case 0x40000004: test_val = entry->eax & (1UL << 18); TEST_ASSERT(!!test_val == !smt_possible(), "NoNonArchitecturalCoreSharing bit" " doesn't reflect SMT setting"); + + TEST_ASSERT(has_irqchip || !(entry->eax & BIT(10)), + "Cluster IPI (i.e. SEND_IPI) should require in-kernel APIC"); break; case 0x4000000A: TEST_ASSERT(entry->eax & (1UL << 19), @@ -109,9 +122,16 @@ static void test_hv_cpuid(const struct kvm_cpuid2 *hv_cpuid_entries, * entry->edx); */ } + + /* + * Note, the CPUID array returned by the system-scoped helper is a one- + * time allocation, i.e. must not be freed. + */ + if (vcpu) + free((void *)hv_cpuid_entries); } -void test_hv_cpuid_e2big(struct kvm_vm *vm, struct kvm_vcpu *vcpu) +static void test_hv_cpuid_e2big(struct kvm_vm *vm, struct kvm_vcpu *vcpu) { static struct kvm_cpuid2 cpuid = {.nent = 0}; int ret; @@ -129,19 +149,20 @@ void test_hv_cpuid_e2big(struct kvm_vm *vm, struct kvm_vcpu *vcpu) int main(int argc, char *argv[]) { struct kvm_vm *vm; - const struct kvm_cpuid2 *hv_cpuid_entries; struct kvm_vcpu *vcpu; TEST_REQUIRE(kvm_has_cap(KVM_CAP_HYPERV_CPUID)); - vm = vm_create_with_one_vcpu(&vcpu, guest_code); + /* Test the vCPU ioctl without an in-kernel local APIC. */ + vm = vm_create_barebones(); + vcpu = __vm_vcpu_add(vm, 0); + test_hv_cpuid(vcpu, false); + kvm_vm_free(vm); /* Test vCPU ioctl version */ + vm = vm_create_with_one_vcpu(&vcpu, guest_code); test_hv_cpuid_e2big(vm, vcpu); - - hv_cpuid_entries = vcpu_get_supported_hv_cpuid(vcpu); - test_hv_cpuid(hv_cpuid_entries, false); - free((void *)hv_cpuid_entries); + test_hv_cpuid(vcpu, false); if (!kvm_cpu_has(X86_FEATURE_VMX) || !kvm_has_cap(KVM_CAP_HYPERV_ENLIGHTENED_VMCS)) { @@ -149,9 +170,7 @@ int main(int argc, char *argv[]) goto do_sys; } vcpu_enable_evmcs(vcpu); - hv_cpuid_entries = vcpu_get_supported_hv_cpuid(vcpu); - test_hv_cpuid(hv_cpuid_entries, true); - free((void *)hv_cpuid_entries); + test_hv_cpuid(vcpu, true); do_sys: /* Test system ioctl version */ @@ -161,9 +180,7 @@ do_sys: } test_hv_cpuid_e2big(vm, NULL); - - hv_cpuid_entries = kvm_get_supported_hv_cpuid(); - test_hv_cpuid(hv_cpuid_entries, kvm_cpu_has(X86_FEATURE_VMX)); + test_hv_cpuid(NULL, kvm_cpu_has(X86_FEATURE_VMX)); out: kvm_vm_free(vm); diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_evmcs.c b/tools/testing/selftests/kvm/x86/hyperv_evmcs.c index 74cf19661309..74cf19661309 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_evmcs.c +++ b/tools/testing/selftests/kvm/x86/hyperv_evmcs.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_extended_hypercalls.c b/tools/testing/selftests/kvm/x86/hyperv_extended_hypercalls.c index 949e08e98f31..949e08e98f31 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_extended_hypercalls.c +++ b/tools/testing/selftests/kvm/x86/hyperv_extended_hypercalls.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_features.c b/tools/testing/selftests/kvm/x86/hyperv_features.c index 068e9c69710d..068e9c69710d 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_features.c +++ b/tools/testing/selftests/kvm/x86/hyperv_features.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_ipi.c b/tools/testing/selftests/kvm/x86/hyperv_ipi.c index 22c0c124582f..22c0c124582f 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_ipi.c +++ b/tools/testing/selftests/kvm/x86/hyperv_ipi.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_svm_test.c b/tools/testing/selftests/kvm/x86/hyperv_svm_test.c index 0ddb63229bcb..0ddb63229bcb 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_svm_test.c +++ b/tools/testing/selftests/kvm/x86/hyperv_svm_test.c diff --git a/tools/testing/selftests/kvm/x86_64/hyperv_tlb_flush.c b/tools/testing/selftests/kvm/x86/hyperv_tlb_flush.c index 077cd0ec3040..077cd0ec3040 100644 --- a/tools/testing/selftests/kvm/x86_64/hyperv_tlb_flush.c +++ b/tools/testing/selftests/kvm/x86/hyperv_tlb_flush.c diff --git a/tools/testing/selftests/kvm/x86_64/kvm_clock_test.c b/tools/testing/selftests/kvm/x86/kvm_clock_test.c index 5bc12222d87a..5bc12222d87a 100644 --- a/tools/testing/selftests/kvm/x86_64/kvm_clock_test.c +++ b/tools/testing/selftests/kvm/x86/kvm_clock_test.c diff --git a/tools/testing/selftests/kvm/x86_64/kvm_pv_test.c b/tools/testing/selftests/kvm/x86/kvm_pv_test.c index 78878b3a2725..1b805cbdb47b 100644 --- a/tools/testing/selftests/kvm/x86_64/kvm_pv_test.c +++ b/tools/testing/selftests/kvm/x86/kvm_pv_test.c @@ -139,10 +139,12 @@ static void test_pv_unhalt(void) struct kvm_vm *vm; struct kvm_cpuid_entry2 *ent; u32 kvm_sig_old; + int r; - pr_info("testing KVM_FEATURE_PV_UNHALT\n"); + if (!(kvm_check_cap(KVM_CAP_X86_DISABLE_EXITS) & KVM_X86_DISABLE_EXITS_HLT)) + return; - TEST_REQUIRE(KVM_CAP_X86_DISABLE_EXITS); + pr_info("testing KVM_FEATURE_PV_UNHALT\n"); /* KVM_PV_UNHALT test */ vm = vm_create_with_one_vcpu(&vcpu, guest_main); @@ -151,19 +153,45 @@ static void test_pv_unhalt(void) TEST_ASSERT(vcpu_cpuid_has(vcpu, X86_FEATURE_KVM_PV_UNHALT), "Enabling X86_FEATURE_KVM_PV_UNHALT had no effect"); - /* Make sure KVM clears vcpu->arch.kvm_cpuid */ + /* Verify KVM disallows disabling exits after vCPU creation. */ + r = __vm_enable_cap(vm, KVM_CAP_X86_DISABLE_EXITS, KVM_X86_DISABLE_EXITS_HLT); + TEST_ASSERT(r && errno == EINVAL, + "Disabling exits after vCPU creation didn't fail as expected"); + + kvm_vm_free(vm); + + /* Verify that KVM clear PV_UNHALT from guest CPUID. */ + vm = vm_create(1); + vm_enable_cap(vm, KVM_CAP_X86_DISABLE_EXITS, KVM_X86_DISABLE_EXITS_HLT); + + vcpu = vm_vcpu_add(vm, 0, NULL); + TEST_ASSERT(!vcpu_cpuid_has(vcpu, X86_FEATURE_KVM_PV_UNHALT), + "vCPU created with PV_UNHALT set by default"); + + vcpu_set_cpuid_feature(vcpu, X86_FEATURE_KVM_PV_UNHALT); + TEST_ASSERT(!vcpu_cpuid_has(vcpu, X86_FEATURE_KVM_PV_UNHALT), + "PV_UNHALT set in guest CPUID when HLT-exiting is disabled"); + + /* + * Clobber the KVM PV signature and verify KVM does NOT clear PV_UNHALT + * when KVM PV is not present, and DOES clear PV_UNHALT when switching + * back to the correct signature.. + */ ent = vcpu_get_cpuid_entry(vcpu, KVM_CPUID_SIGNATURE); kvm_sig_old = ent->ebx; ent->ebx = 0xdeadbeef; vcpu_set_cpuid(vcpu); - vm_enable_cap(vm, KVM_CAP_X86_DISABLE_EXITS, KVM_X86_DISABLE_EXITS_HLT); + vcpu_set_cpuid_feature(vcpu, X86_FEATURE_KVM_PV_UNHALT); + TEST_ASSERT(vcpu_cpuid_has(vcpu, X86_FEATURE_KVM_PV_UNHALT), + "PV_UNHALT cleared when using bogus KVM PV signature"); + ent = vcpu_get_cpuid_entry(vcpu, KVM_CPUID_SIGNATURE); ent->ebx = kvm_sig_old; vcpu_set_cpuid(vcpu); TEST_ASSERT(!vcpu_cpuid_has(vcpu, X86_FEATURE_KVM_PV_UNHALT), - "KVM_FEATURE_PV_UNHALT is set with KVM_CAP_X86_DISABLE_EXITS"); + "PV_UNHALT set in guest CPUID when HLT-exiting is disabled"); /* FIXME: actually test KVM_FEATURE_PV_UNHALT feature */ diff --git a/tools/testing/selftests/kvm/x86_64/max_vcpuid_cap_test.c b/tools/testing/selftests/kvm/x86/max_vcpuid_cap_test.c index 7e2bfb3c3f3b..7e2bfb3c3f3b 100644 --- a/tools/testing/selftests/kvm/x86_64/max_vcpuid_cap_test.c +++ b/tools/testing/selftests/kvm/x86/max_vcpuid_cap_test.c diff --git a/tools/testing/selftests/kvm/x86_64/monitor_mwait_test.c b/tools/testing/selftests/kvm/x86/monitor_mwait_test.c index 2b550eff35f1..2b550eff35f1 100644 --- a/tools/testing/selftests/kvm/x86_64/monitor_mwait_test.c +++ b/tools/testing/selftests/kvm/x86/monitor_mwait_test.c diff --git a/tools/testing/selftests/kvm/x86_64/nested_exceptions_test.c b/tools/testing/selftests/kvm/x86/nested_exceptions_test.c index 3eb0313ffa39..3eb0313ffa39 100644 --- a/tools/testing/selftests/kvm/x86_64/nested_exceptions_test.c +++ b/tools/testing/selftests/kvm/x86/nested_exceptions_test.c diff --git a/tools/testing/selftests/kvm/x86_64/nx_huge_pages_test.c b/tools/testing/selftests/kvm/x86/nx_huge_pages_test.c index e7efb2b35f8b..e7efb2b35f8b 100644 --- a/tools/testing/selftests/kvm/x86_64/nx_huge_pages_test.c +++ b/tools/testing/selftests/kvm/x86/nx_huge_pages_test.c diff --git a/tools/testing/selftests/kvm/x86_64/nx_huge_pages_test.sh b/tools/testing/selftests/kvm/x86/nx_huge_pages_test.sh index caad084b8bfd..caad084b8bfd 100755 --- a/tools/testing/selftests/kvm/x86_64/nx_huge_pages_test.sh +++ b/tools/testing/selftests/kvm/x86/nx_huge_pages_test.sh diff --git a/tools/testing/selftests/kvm/x86_64/platform_info_test.c b/tools/testing/selftests/kvm/x86/platform_info_test.c index 9cbf283ebc55..9cbf283ebc55 100644 --- a/tools/testing/selftests/kvm/x86_64/platform_info_test.c +++ b/tools/testing/selftests/kvm/x86/platform_info_test.c diff --git a/tools/testing/selftests/kvm/x86_64/pmu_counters_test.c b/tools/testing/selftests/kvm/x86/pmu_counters_test.c index 698cb36989db..698cb36989db 100644 --- a/tools/testing/selftests/kvm/x86_64/pmu_counters_test.c +++ b/tools/testing/selftests/kvm/x86/pmu_counters_test.c diff --git a/tools/testing/selftests/kvm/x86_64/pmu_event_filter_test.c b/tools/testing/selftests/kvm/x86/pmu_event_filter_test.c index c15513cd74d1..c15513cd74d1 100644 --- a/tools/testing/selftests/kvm/x86_64/pmu_event_filter_test.c +++ b/tools/testing/selftests/kvm/x86/pmu_event_filter_test.c diff --git a/tools/testing/selftests/kvm/x86_64/private_mem_conversions_test.c b/tools/testing/selftests/kvm/x86/private_mem_conversions_test.c index 82a8d88b5338..82a8d88b5338 100644 --- a/tools/testing/selftests/kvm/x86_64/private_mem_conversions_test.c +++ b/tools/testing/selftests/kvm/x86/private_mem_conversions_test.c diff --git a/tools/testing/selftests/kvm/x86_64/private_mem_kvm_exits_test.c b/tools/testing/selftests/kvm/x86/private_mem_kvm_exits_test.c index 13e72fcec8dd..13e72fcec8dd 100644 --- a/tools/testing/selftests/kvm/x86_64/private_mem_kvm_exits_test.c +++ b/tools/testing/selftests/kvm/x86/private_mem_kvm_exits_test.c diff --git a/tools/testing/selftests/kvm/x86_64/recalc_apic_map_test.c b/tools/testing/selftests/kvm/x86/recalc_apic_map_test.c index cbc92a862ea9..cbc92a862ea9 100644 --- a/tools/testing/selftests/kvm/x86_64/recalc_apic_map_test.c +++ b/tools/testing/selftests/kvm/x86/recalc_apic_map_test.c diff --git a/tools/testing/selftests/kvm/x86_64/set_boot_cpu_id.c b/tools/testing/selftests/kvm/x86/set_boot_cpu_id.c index 49913784bc82..49913784bc82 100644 --- a/tools/testing/selftests/kvm/x86_64/set_boot_cpu_id.c +++ b/tools/testing/selftests/kvm/x86/set_boot_cpu_id.c diff --git a/tools/testing/selftests/kvm/x86_64/set_sregs_test.c b/tools/testing/selftests/kvm/x86/set_sregs_test.c index c021c0795a96..f4095a3d1278 100644 --- a/tools/testing/selftests/kvm/x86_64/set_sregs_test.c +++ b/tools/testing/selftests/kvm/x86/set_sregs_test.c @@ -41,13 +41,15 @@ do { \ TEST_ASSERT(!memcmp(&new, &orig, sizeof(new)), "KVM modified sregs"); \ } while (0) +#define KVM_ALWAYS_ALLOWED_CR4 (X86_CR4_VME | X86_CR4_PVI | X86_CR4_TSD | \ + X86_CR4_DE | X86_CR4_PSE | X86_CR4_PAE | \ + X86_CR4_MCE | X86_CR4_PGE | X86_CR4_PCE | \ + X86_CR4_OSFXSR | X86_CR4_OSXMMEXCPT) + static uint64_t calc_supported_cr4_feature_bits(void) { - uint64_t cr4; + uint64_t cr4 = KVM_ALWAYS_ALLOWED_CR4; - cr4 = X86_CR4_VME | X86_CR4_PVI | X86_CR4_TSD | X86_CR4_DE | - X86_CR4_PSE | X86_CR4_PAE | X86_CR4_MCE | X86_CR4_PGE | - X86_CR4_PCE | X86_CR4_OSFXSR | X86_CR4_OSXMMEXCPT; if (kvm_cpu_has(X86_FEATURE_UMIP)) cr4 |= X86_CR4_UMIP; if (kvm_cpu_has(X86_FEATURE_LA57)) @@ -72,36 +74,31 @@ static uint64_t calc_supported_cr4_feature_bits(void) return cr4; } -int main(int argc, char *argv[]) +static void test_cr_bits(struct kvm_vcpu *vcpu, uint64_t cr4) { struct kvm_sregs sregs; - struct kvm_vcpu *vcpu; - struct kvm_vm *vm; - uint64_t cr4; int rc, i; - /* - * Create a dummy VM, specifically to avoid doing KVM_SET_CPUID2, and - * use it to verify all supported CR4 bits can be set prior to defining - * the vCPU model, i.e. without doing KVM_SET_CPUID2. - */ - vm = vm_create_barebones(); - vcpu = __vm_vcpu_add(vm, 0); - vcpu_sregs_get(vcpu, &sregs); - - sregs.cr0 = 0; - sregs.cr4 |= calc_supported_cr4_feature_bits(); - cr4 = sregs.cr4; - + sregs.cr0 &= ~(X86_CR0_CD | X86_CR0_NW); + sregs.cr4 |= cr4; rc = _vcpu_sregs_set(vcpu, &sregs); TEST_ASSERT(!rc, "Failed to set supported CR4 bits (0x%lx)", cr4); + TEST_ASSERT(!!(sregs.cr4 & X86_CR4_OSXSAVE) == + (vcpu->cpuid && vcpu_cpuid_has(vcpu, X86_FEATURE_OSXSAVE)), + "KVM didn't %s OSXSAVE in CPUID as expected", + (sregs.cr4 & X86_CR4_OSXSAVE) ? "set" : "clear"); + + TEST_ASSERT(!!(sregs.cr4 & X86_CR4_PKE) == + (vcpu->cpuid && vcpu_cpuid_has(vcpu, X86_FEATURE_OSPKE)), + "KVM didn't %s OSPKE in CPUID as expected", + (sregs.cr4 & X86_CR4_PKE) ? "set" : "clear"); + vcpu_sregs_get(vcpu, &sregs); TEST_ASSERT(sregs.cr4 == cr4, "sregs.CR4 (0x%llx) != CR4 (0x%lx)", sregs.cr4, cr4); - /* Verify all unsupported features are rejected by KVM. */ TEST_INVALID_CR_BIT(vcpu, cr4, sregs, X86_CR4_UMIP); TEST_INVALID_CR_BIT(vcpu, cr4, sregs, X86_CR4_LA57); TEST_INVALID_CR_BIT(vcpu, cr4, sregs, X86_CR4_VMXE); @@ -119,10 +116,28 @@ int main(int argc, char *argv[]) /* NW without CD is illegal, as is PG without PE. */ TEST_INVALID_CR_BIT(vcpu, cr0, sregs, X86_CR0_NW); TEST_INVALID_CR_BIT(vcpu, cr0, sregs, X86_CR0_PG); +} + +int main(int argc, char *argv[]) +{ + struct kvm_sregs sregs; + struct kvm_vcpu *vcpu; + struct kvm_vm *vm; + int rc; + /* + * Create a dummy VM, specifically to avoid doing KVM_SET_CPUID2, and + * use it to verify KVM enforces guest CPUID even if *userspace* never + * sets CPUID. + */ + vm = vm_create_barebones(); + vcpu = __vm_vcpu_add(vm, 0); + test_cr_bits(vcpu, KVM_ALWAYS_ALLOWED_CR4); kvm_vm_free(vm); - /* Create a "real" VM and verify APIC_BASE can be set. */ + /* Create a "real" VM with a fully populated guest CPUID and verify + * APIC_BASE and all supported CR4 can be set. + */ vm = vm_create_with_one_vcpu(&vcpu, NULL); vcpu_sregs_get(vcpu, &sregs); @@ -135,6 +150,8 @@ int main(int argc, char *argv[]) TEST_ASSERT(!rc, "Couldn't set IA32_APIC_BASE to %llx (valid)", sregs.apic_base); + test_cr_bits(vcpu, calc_supported_cr4_feature_bits()); + kvm_vm_free(vm); return 0; diff --git a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c b/tools/testing/selftests/kvm/x86/sev_init2_tests.c index 3fb967f40c6a..3fb967f40c6a 100644 --- a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c +++ b/tools/testing/selftests/kvm/x86/sev_init2_tests.c diff --git a/tools/testing/selftests/kvm/x86_64/sev_migrate_tests.c b/tools/testing/selftests/kvm/x86/sev_migrate_tests.c index 0a6dfba3905b..0a6dfba3905b 100644 --- a/tools/testing/selftests/kvm/x86_64/sev_migrate_tests.c +++ b/tools/testing/selftests/kvm/x86/sev_migrate_tests.c diff --git a/tools/testing/selftests/kvm/x86_64/sev_smoke_test.c b/tools/testing/selftests/kvm/x86/sev_smoke_test.c index ae77698e6e97..a1a688e75266 100644 --- a/tools/testing/selftests/kvm/x86_64/sev_smoke_test.c +++ b/tools/testing/selftests/kvm/x86/sev_smoke_test.c @@ -155,7 +155,7 @@ static void guest_shutdown_code(void) /* Clobber the IDT so that #UD is guaranteed to trigger SHUTDOWN. */ memset(&idt, 0, sizeof(idt)); - __asm__ __volatile__("lidt %0" :: "m"(idt)); + set_idt(&idt); __asm__ __volatile__("ud2"); } diff --git a/tools/testing/selftests/kvm/x86_64/smaller_maxphyaddr_emulation_test.c b/tools/testing/selftests/kvm/x86/smaller_maxphyaddr_emulation_test.c index fabeeaddfb3a..fabeeaddfb3a 100644 --- a/tools/testing/selftests/kvm/x86_64/smaller_maxphyaddr_emulation_test.c +++ b/tools/testing/selftests/kvm/x86/smaller_maxphyaddr_emulation_test.c diff --git a/tools/testing/selftests/kvm/x86_64/smm_test.c b/tools/testing/selftests/kvm/x86/smm_test.c index 55c88d664a94..55c88d664a94 100644 --- a/tools/testing/selftests/kvm/x86_64/smm_test.c +++ b/tools/testing/selftests/kvm/x86/smm_test.c diff --git a/tools/testing/selftests/kvm/x86_64/state_test.c b/tools/testing/selftests/kvm/x86/state_test.c index 141b7fc0c965..141b7fc0c965 100644 --- a/tools/testing/selftests/kvm/x86_64/state_test.c +++ b/tools/testing/selftests/kvm/x86/state_test.c diff --git a/tools/testing/selftests/kvm/x86_64/svm_int_ctl_test.c b/tools/testing/selftests/kvm/x86/svm_int_ctl_test.c index 916e04248fbb..916e04248fbb 100644 --- a/tools/testing/selftests/kvm/x86_64/svm_int_ctl_test.c +++ b/tools/testing/selftests/kvm/x86/svm_int_ctl_test.c diff --git a/tools/testing/selftests/kvm/x86_64/svm_nested_shutdown_test.c b/tools/testing/selftests/kvm/x86/svm_nested_shutdown_test.c index 00135cbba35e..00135cbba35e 100644 --- a/tools/testing/selftests/kvm/x86_64/svm_nested_shutdown_test.c +++ b/tools/testing/selftests/kvm/x86/svm_nested_shutdown_test.c diff --git a/tools/testing/selftests/kvm/x86_64/svm_nested_soft_inject_test.c b/tools/testing/selftests/kvm/x86/svm_nested_soft_inject_test.c index 7b6481d6c0d3..7b6481d6c0d3 100644 --- a/tools/testing/selftests/kvm/x86_64/svm_nested_soft_inject_test.c +++ b/tools/testing/selftests/kvm/x86/svm_nested_soft_inject_test.c diff --git a/tools/testing/selftests/kvm/x86_64/svm_vmcall_test.c b/tools/testing/selftests/kvm/x86/svm_vmcall_test.c index 8a62cca28cfb..8a62cca28cfb 100644 --- a/tools/testing/selftests/kvm/x86_64/svm_vmcall_test.c +++ b/tools/testing/selftests/kvm/x86/svm_vmcall_test.c diff --git a/tools/testing/selftests/kvm/x86_64/sync_regs_test.c b/tools/testing/selftests/kvm/x86/sync_regs_test.c index 8fa3948b0170..8fa3948b0170 100644 --- a/tools/testing/selftests/kvm/x86_64/sync_regs_test.c +++ b/tools/testing/selftests/kvm/x86/sync_regs_test.c diff --git a/tools/testing/selftests/kvm/x86_64/triple_fault_event_test.c b/tools/testing/selftests/kvm/x86/triple_fault_event_test.c index 56306a19144a..56306a19144a 100644 --- a/tools/testing/selftests/kvm/x86_64/triple_fault_event_test.c +++ b/tools/testing/selftests/kvm/x86/triple_fault_event_test.c diff --git a/tools/testing/selftests/kvm/x86_64/tsc_msrs_test.c b/tools/testing/selftests/kvm/x86/tsc_msrs_test.c index 12b0964f4f13..12b0964f4f13 100644 --- a/tools/testing/selftests/kvm/x86_64/tsc_msrs_test.c +++ b/tools/testing/selftests/kvm/x86/tsc_msrs_test.c diff --git a/tools/testing/selftests/kvm/x86_64/tsc_scaling_sync.c b/tools/testing/selftests/kvm/x86/tsc_scaling_sync.c index 59c7304f805e..59c7304f805e 100644 --- a/tools/testing/selftests/kvm/x86_64/tsc_scaling_sync.c +++ b/tools/testing/selftests/kvm/x86/tsc_scaling_sync.c diff --git a/tools/testing/selftests/kvm/x86_64/ucna_injection_test.c b/tools/testing/selftests/kvm/x86/ucna_injection_test.c index 57f157c06b39..57f157c06b39 100644 --- a/tools/testing/selftests/kvm/x86_64/ucna_injection_test.c +++ b/tools/testing/selftests/kvm/x86/ucna_injection_test.c diff --git a/tools/testing/selftests/kvm/x86_64/userspace_io_test.c b/tools/testing/selftests/kvm/x86/userspace_io_test.c index 9481cbcf284f..9481cbcf284f 100644 --- a/tools/testing/selftests/kvm/x86_64/userspace_io_test.c +++ b/tools/testing/selftests/kvm/x86/userspace_io_test.c diff --git a/tools/testing/selftests/kvm/x86_64/userspace_msr_exit_test.c b/tools/testing/selftests/kvm/x86/userspace_msr_exit_test.c index 32b2794b78fe..32b2794b78fe 100644 --- a/tools/testing/selftests/kvm/x86_64/userspace_msr_exit_test.c +++ b/tools/testing/selftests/kvm/x86/userspace_msr_exit_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_apic_access_test.c b/tools/testing/selftests/kvm/x86/vmx_apic_access_test.c index a81a24761aac..a81a24761aac 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_apic_access_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_apic_access_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_close_while_nested_test.c b/tools/testing/selftests/kvm/x86/vmx_close_while_nested_test.c index dad988351493..dad988351493 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_close_while_nested_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_close_while_nested_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_dirty_log_test.c b/tools/testing/selftests/kvm/x86/vmx_dirty_log_test.c index fa512d033205..fa512d033205 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_dirty_log_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_dirty_log_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_exception_with_invalid_guest_state.c b/tools/testing/selftests/kvm/x86/vmx_exception_with_invalid_guest_state.c index 3fd6eceab46f..3fd6eceab46f 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_exception_with_invalid_guest_state.c +++ b/tools/testing/selftests/kvm/x86/vmx_exception_with_invalid_guest_state.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_invalid_nested_guest_state.c b/tools/testing/selftests/kvm/x86/vmx_invalid_nested_guest_state.c index a100ee5f0009..a100ee5f0009 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_invalid_nested_guest_state.c +++ b/tools/testing/selftests/kvm/x86/vmx_invalid_nested_guest_state.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_msrs_test.c b/tools/testing/selftests/kvm/x86/vmx_msrs_test.c index 90720b6205f4..90720b6205f4 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_msrs_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_msrs_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_nested_tsc_scaling_test.c b/tools/testing/selftests/kvm/x86/vmx_nested_tsc_scaling_test.c index 1759fa5cb3f2..1759fa5cb3f2 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_nested_tsc_scaling_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_nested_tsc_scaling_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_pmu_caps_test.c b/tools/testing/selftests/kvm/x86/vmx_pmu_caps_test.c index a1f5ff45d518..a1f5ff45d518 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_pmu_caps_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_pmu_caps_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_preemption_timer_test.c b/tools/testing/selftests/kvm/x86/vmx_preemption_timer_test.c index 00dd2ac07a61..00dd2ac07a61 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_preemption_timer_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_preemption_timer_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_set_nested_state_test.c b/tools/testing/selftests/kvm/x86/vmx_set_nested_state_test.c index 67a62a5a8895..67a62a5a8895 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_set_nested_state_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_set_nested_state_test.c diff --git a/tools/testing/selftests/kvm/x86_64/vmx_tsc_adjust_test.c b/tools/testing/selftests/kvm/x86/vmx_tsc_adjust_test.c index 2ceb5c78c442..2ceb5c78c442 100644 --- a/tools/testing/selftests/kvm/x86_64/vmx_tsc_adjust_test.c +++ b/tools/testing/selftests/kvm/x86/vmx_tsc_adjust_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xapic_ipi_test.c b/tools/testing/selftests/kvm/x86/xapic_ipi_test.c index a76078a08ff8..a76078a08ff8 100644 --- a/tools/testing/selftests/kvm/x86_64/xapic_ipi_test.c +++ b/tools/testing/selftests/kvm/x86/xapic_ipi_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xapic_state_test.c b/tools/testing/selftests/kvm/x86/xapic_state_test.c index 88bcca188799..88bcca188799 100644 --- a/tools/testing/selftests/kvm/x86_64/xapic_state_test.c +++ b/tools/testing/selftests/kvm/x86/xapic_state_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xcr0_cpuid_test.c b/tools/testing/selftests/kvm/x86/xcr0_cpuid_test.c index c8a5c5e51661..c8a5c5e51661 100644 --- a/tools/testing/selftests/kvm/x86_64/xcr0_cpuid_test.c +++ b/tools/testing/selftests/kvm/x86/xcr0_cpuid_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xen_shinfo_test.c b/tools/testing/selftests/kvm/x86/xen_shinfo_test.c index a59b3c799bb2..a59b3c799bb2 100644 --- a/tools/testing/selftests/kvm/x86_64/xen_shinfo_test.c +++ b/tools/testing/selftests/kvm/x86/xen_shinfo_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xen_vmcall_test.c b/tools/testing/selftests/kvm/x86/xen_vmcall_test.c index 2585087cdf5c..2585087cdf5c 100644 --- a/tools/testing/selftests/kvm/x86_64/xen_vmcall_test.c +++ b/tools/testing/selftests/kvm/x86/xen_vmcall_test.c diff --git a/tools/testing/selftests/kvm/x86_64/xss_msr_test.c b/tools/testing/selftests/kvm/x86/xss_msr_test.c index f331a4e9bae3..f331a4e9bae3 100644 --- a/tools/testing/selftests/kvm/x86_64/xss_msr_test.c +++ b/tools/testing/selftests/kvm/x86/xss_msr_test.c diff --git a/tools/testing/selftests/landlock/.gitignore b/tools/testing/selftests/landlock/.gitignore index 470203a7cd73..335b2b1a3463 100644 --- a/tools/testing/selftests/landlock/.gitignore +++ b/tools/testing/selftests/landlock/.gitignore @@ -1,2 +1,4 @@ /*_test +/sandbox-and-launch /true +/wait-pipe diff --git a/tools/testing/selftests/landlock/Makefile b/tools/testing/selftests/landlock/Makefile index 348e2dbdb4e0..5cb0828f0514 100644 --- a/tools/testing/selftests/landlock/Makefile +++ b/tools/testing/selftests/landlock/Makefile @@ -10,14 +10,14 @@ src_test := $(wildcard *_test.c) TEST_GEN_PROGS := $(src_test:.c=) -TEST_GEN_PROGS_EXTENDED := true +TEST_GEN_PROGS_EXTENDED := true sandbox-and-launch wait-pipe # Short targets: -$(TEST_GEN_PROGS): LDLIBS += -lcap +$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread $(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static include ../lib.mk # Targets with $(OUTPUT)/ prefix: -$(TEST_GEN_PROGS): LDLIBS += -lcap +$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread $(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static diff --git a/tools/testing/selftests/landlock/common.h b/tools/testing/selftests/landlock/common.h index 61056fa074bb..6064c9ac0532 100644 --- a/tools/testing/selftests/landlock/common.h +++ b/tools/testing/selftests/landlock/common.h @@ -9,17 +9,15 @@ #include <arpa/inet.h> #include <errno.h> -#include <linux/landlock.h> #include <linux/securebits.h> #include <sys/capability.h> #include <sys/socket.h> -#include <sys/syscall.h> -#include <sys/types.h> #include <sys/un.h> #include <sys/wait.h> #include <unistd.h> #include "../kselftest_harness.h" +#include "wrappers.h" #define TMP_DIR "tmp" @@ -30,33 +28,8 @@ /* TEST_F_FORK() should not be used for new tests. */ #define TEST_F_FORK(fixture_name, test_name) TEST_F(fixture_name, test_name) -#ifndef landlock_create_ruleset -static inline int -landlock_create_ruleset(const struct landlock_ruleset_attr *const attr, - const size_t size, const __u32 flags) -{ - return syscall(__NR_landlock_create_ruleset, attr, size, flags); -} -#endif - -#ifndef landlock_add_rule -static inline int landlock_add_rule(const int ruleset_fd, - const enum landlock_rule_type rule_type, - const void *const rule_attr, - const __u32 flags) -{ - return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr, - flags); -} -#endif - -#ifndef landlock_restrict_self -static inline int landlock_restrict_self(const int ruleset_fd, - const __u32 flags) -{ - return syscall(__NR_landlock_restrict_self, ruleset_fd, flags); -} -#endif +static const char bin_sandbox_and_launch[] = "./sandbox-and-launch"; +static const char bin_wait_pipe[] = "./wait-pipe"; static void _init_caps(struct __test_metadata *const _metadata, bool drop_all) { @@ -234,6 +207,7 @@ enforce_ruleset(struct __test_metadata *const _metadata, const int ruleset_fd) struct protocol_variant { int domain; int type; + int protocol; }; struct service_fixture { @@ -250,11 +224,6 @@ struct service_fixture { }; }; -static pid_t __maybe_unused sys_gettid(void) -{ - return syscall(__NR_gettid); -} - static void __maybe_unused set_unix_address(struct service_fixture *const srv, const unsigned short index) { diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config index 29af19c4e9f9..425de4c20271 100644 --- a/tools/testing/selftests/landlock/config +++ b/tools/testing/selftests/landlock/config @@ -1,8 +1,11 @@ +CONFIG_AF_UNIX_OOB=y CONFIG_CGROUPS=y CONFIG_CGROUP_SCHED=y CONFIG_INET=y CONFIG_IPV6=y CONFIG_KEYS=y +CONFIG_MPTCP=y +CONFIG_MPTCP_IPV6=y CONFIG_NET=y CONFIG_NET_NS=y CONFIG_OVERLAY_FS=y diff --git a/tools/testing/selftests/landlock/fs_test.c b/tools/testing/selftests/landlock/fs_test.c index 6788762188fe..aa6f2c1cbec7 100644 --- a/tools/testing/selftests/landlock/fs_test.c +++ b/tools/testing/selftests/landlock/fs_test.c @@ -37,6 +37,10 @@ #include <linux/fs.h> #include <linux/mount.h> +/* Defines AT_EXECVE_CHECK without type conflicts. */ +#define _ASM_GENERIC_FCNTL_H +#include <linux/fcntl.h> + #include "common.h" #ifndef renameat2 @@ -55,11 +59,17 @@ int open_tree(int dfd, const char *filename, unsigned int flags) } #endif +static int sys_execveat(int dirfd, const char *pathname, char *const argv[], + char *const envp[], int flags) +{ + return syscall(__NR_execveat, dirfd, pathname, argv, envp, flags); +} + #ifndef RENAME_EXCHANGE #define RENAME_EXCHANGE (1 << 1) #endif -#define BINARY_PATH "./true" +static const char bin_true[] = "./true"; /* Paths (sibling number and depth) */ static const char dir_s1d1[] = TMP_DIR "/s1d1"; @@ -85,6 +95,9 @@ static const char file1_s3d1[] = TMP_DIR "/s3d1/f1"; /* dir_s3d2 is a mount point. */ static const char dir_s3d2[] = TMP_DIR "/s3d1/s3d2"; static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3"; +static const char file1_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3/f1"; +static const char dir_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4"; +static const char file1_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4/f1"; /* * layout1 hierarchy: @@ -108,8 +121,11 @@ static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3"; * │  └── f2 * └── s3d1 *   ├── f1 - * └── s3d2 - * └── s3d3 + * └── s3d2 [mount point] + *   ├── s3d3 + *   │ └── f1 + *   └── s3d4 + *   └── f1 */ static bool fgrep(FILE *const inf, const char *const str) @@ -358,7 +374,8 @@ static void create_layout1(struct __test_metadata *const _metadata) ASSERT_EQ(0, mount_opt(&mnt_tmp, dir_s3d2)); clear_cap(_metadata, CAP_SYS_ADMIN); - ASSERT_EQ(0, mkdir(dir_s3d3, 0700)); + create_file(_metadata, file1_s3d3); + create_file(_metadata, file1_s3d4); } static void remove_layout1(struct __test_metadata *const _metadata) @@ -378,7 +395,8 @@ static void remove_layout1(struct __test_metadata *const _metadata) EXPECT_EQ(0, remove_path(dir_s2d2)); EXPECT_EQ(0, remove_path(file1_s3d1)); - EXPECT_EQ(0, remove_path(dir_s3d3)); + EXPECT_EQ(0, remove_path(file1_s3d3)); + EXPECT_EQ(0, remove_path(file1_s3d4)); set_cap(_metadata, CAP_SYS_ADMIN); umount(dir_s3d2); clear_cap(_metadata, CAP_SYS_ADMIN); @@ -1957,8 +1975,8 @@ TEST_F_FORK(layout1, relative_chroot_chdir) test_relative_path(_metadata, REL_CHROOT_CHDIR); } -static void copy_binary(struct __test_metadata *const _metadata, - const char *const dst_path) +static void copy_file(struct __test_metadata *const _metadata, + const char *const src_path, const char *const dst_path) { int dst_fd, src_fd; struct stat statbuf; @@ -1968,11 +1986,10 @@ static void copy_binary(struct __test_metadata *const _metadata, { TH_LOG("Failed to open \"%s\": %s", dst_path, strerror(errno)); } - src_fd = open(BINARY_PATH, O_RDONLY | O_CLOEXEC); + src_fd = open(src_path, O_RDONLY | O_CLOEXEC); ASSERT_LE(0, src_fd) { - TH_LOG("Failed to open \"" BINARY_PATH "\": %s", - strerror(errno)); + TH_LOG("Failed to open \"%s\": %s", src_path, strerror(errno)); } ASSERT_EQ(0, fstat(src_fd, &statbuf)); ASSERT_EQ(statbuf.st_size, @@ -2003,11 +2020,26 @@ static void test_execute(struct __test_metadata *const _metadata, const int err, ASSERT_EQ(1, WIFEXITED(status)); ASSERT_EQ(err ? 2 : 0, WEXITSTATUS(status)) { - TH_LOG("Unexpected return code for \"%s\": %s", path, - strerror(errno)); + TH_LOG("Unexpected return code for \"%s\"", path); }; } +static void test_check_exec(struct __test_metadata *const _metadata, + const int err, const char *const path) +{ + int ret; + char *const argv[] = { (char *)path, NULL }; + + ret = sys_execveat(AT_FDCWD, path, argv, NULL, + AT_EMPTY_PATH | AT_EXECVE_CHECK); + if (err) { + EXPECT_EQ(-1, ret); + EXPECT_EQ(errno, err); + } else { + EXPECT_EQ(0, ret); + } +} + TEST_F_FORK(layout1, execute) { const struct rule rules[] = { @@ -2021,9 +2053,13 @@ TEST_F_FORK(layout1, execute) create_ruleset(_metadata, rules[0].access, rules); ASSERT_LE(0, ruleset_fd); - copy_binary(_metadata, file1_s1d1); - copy_binary(_metadata, file1_s1d2); - copy_binary(_metadata, file1_s1d3); + copy_file(_metadata, bin_true, file1_s1d1); + copy_file(_metadata, bin_true, file1_s1d2); + copy_file(_metadata, bin_true, file1_s1d3); + + /* Checks before file1_s1d1 being denied. */ + test_execute(_metadata, 0, file1_s1d1); + test_check_exec(_metadata, 0, file1_s1d1); enforce_ruleset(_metadata, ruleset_fd); ASSERT_EQ(0, close(ruleset_fd)); @@ -2031,14 +2067,94 @@ TEST_F_FORK(layout1, execute) ASSERT_EQ(0, test_open(dir_s1d1, O_RDONLY)); ASSERT_EQ(0, test_open(file1_s1d1, O_RDONLY)); test_execute(_metadata, EACCES, file1_s1d1); + test_check_exec(_metadata, EACCES, file1_s1d1); ASSERT_EQ(0, test_open(dir_s1d2, O_RDONLY)); ASSERT_EQ(0, test_open(file1_s1d2, O_RDONLY)); test_execute(_metadata, 0, file1_s1d2); + test_check_exec(_metadata, 0, file1_s1d2); ASSERT_EQ(0, test_open(dir_s1d3, O_RDONLY)); ASSERT_EQ(0, test_open(file1_s1d3, O_RDONLY)); test_execute(_metadata, 0, file1_s1d3); + test_check_exec(_metadata, 0, file1_s1d3); +} + +TEST_F_FORK(layout1, umount_sandboxer) +{ + int pipe_child[2], pipe_parent[2]; + char buf_parent; + pid_t child; + int status; + + copy_file(_metadata, bin_sandbox_and_launch, file1_s3d3); + ASSERT_EQ(0, pipe2(pipe_child, 0)); + ASSERT_EQ(0, pipe2(pipe_parent, 0)); + + child = fork(); + ASSERT_LE(0, child); + if (child == 0) { + char pipe_child_str[12], pipe_parent_str[12]; + char *const argv[] = { (char *)file1_s3d3, + (char *)bin_wait_pipe, pipe_child_str, + pipe_parent_str, NULL }; + + /* Passes the pipe FDs to the executed binary and its child. */ + EXPECT_EQ(0, close(pipe_child[0])); + EXPECT_EQ(0, close(pipe_parent[1])); + snprintf(pipe_child_str, sizeof(pipe_child_str), "%d", + pipe_child[1]); + snprintf(pipe_parent_str, sizeof(pipe_parent_str), "%d", + pipe_parent[0]); + + /* + * We need bin_sandbox_and_launch (copied inside the mount as + * file1_s3d3) to execute bin_wait_pipe (outside the mount) to + * make sure the mount point will not be EBUSY because of + * file1_s3d3 being in use. This avoids a potential race + * condition between the following read() and umount() calls. + */ + ASSERT_EQ(0, execve(argv[0], argv, NULL)) + { + TH_LOG("Failed to execute \"%s\": %s", argv[0], + strerror(errno)); + }; + _exit(1); + return; + } + + EXPECT_EQ(0, close(pipe_child[1])); + EXPECT_EQ(0, close(pipe_parent[0])); + + /* Waits for the child to sandbox itself. */ + EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1)); + + /* Tests that the sandboxer is tied to its mount point. */ + set_cap(_metadata, CAP_SYS_ADMIN); + EXPECT_EQ(-1, umount(dir_s3d2)); + EXPECT_EQ(EBUSY, errno); + clear_cap(_metadata, CAP_SYS_ADMIN); + + /* Signals the child to launch a grandchild. */ + EXPECT_EQ(1, write(pipe_parent[1], ".", 1)); + + /* Waits for the grandchild. */ + EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1)); + + /* Tests that the domain's sandboxer is not tied to its mount point. */ + set_cap(_metadata, CAP_SYS_ADMIN); + EXPECT_EQ(0, umount(dir_s3d2)) + { + TH_LOG("Failed to umount \"%s\": %s", dir_s3d2, + strerror(errno)); + }; + clear_cap(_metadata, CAP_SYS_ADMIN); + + /* Signals the grandchild to terminate. */ + EXPECT_EQ(1, write(pipe_parent[1], ".", 1)); + ASSERT_EQ(child, waitpid(child, &status, 0)); + ASSERT_EQ(1, WIFEXITED(status)); + ASSERT_EQ(0, WEXITSTATUS(status)); } TEST_F_FORK(layout1, link) @@ -2444,6 +2560,44 @@ TEST_F_FORK(layout1, refer_mount_root_deny) EXPECT_EQ(0, close(root_fd)); } +TEST_F_FORK(layout1, refer_part_mount_tree_is_allowed) +{ + const struct rule layer1[] = { + { + /* Parent mount point. */ + .path = dir_s3d1, + .access = LANDLOCK_ACCESS_FS_REFER | + LANDLOCK_ACCESS_FS_MAKE_REG, + }, + { + /* + * Removing the source file is allowed because its + * access rights are already a superset of the + * destination. + */ + .path = dir_s3d4, + .access = LANDLOCK_ACCESS_FS_REFER | + LANDLOCK_ACCESS_FS_MAKE_REG | + LANDLOCK_ACCESS_FS_REMOVE_FILE, + }, + {}, + }; + int ruleset_fd; + + ASSERT_EQ(0, unlink(file1_s3d3)); + ruleset_fd = create_ruleset(_metadata, + LANDLOCK_ACCESS_FS_REFER | + LANDLOCK_ACCESS_FS_MAKE_REG | + LANDLOCK_ACCESS_FS_REMOVE_FILE, + layer1); + + ASSERT_LE(0, ruleset_fd); + enforce_ruleset(_metadata, ruleset_fd); + ASSERT_EQ(0, close(ruleset_fd)); + + ASSERT_EQ(0, rename(file1_s3d4, file1_s3d3)); +} + TEST_F_FORK(layout1, reparent_link) { const struct rule layer1[] = { diff --git a/tools/testing/selftests/landlock/net_test.c b/tools/testing/selftests/landlock/net_test.c index 4e0aeb53b225..d9de0ee49ebc 100644 --- a/tools/testing/selftests/landlock/net_test.c +++ b/tools/testing/selftests/landlock/net_test.c @@ -85,18 +85,18 @@ static void setup_loopback(struct __test_metadata *const _metadata) clear_ambient_cap(_metadata, CAP_NET_ADMIN); } +static bool prot_is_tcp(const struct protocol_variant *const prot) +{ + return (prot->domain == AF_INET || prot->domain == AF_INET6) && + prot->type == SOCK_STREAM && + (prot->protocol == IPPROTO_TCP || prot->protocol == IPPROTO_IP); +} + static bool is_restricted(const struct protocol_variant *const prot, const enum sandbox_type sandbox) { - switch (prot->domain) { - case AF_INET: - case AF_INET6: - switch (prot->type) { - case SOCK_STREAM: - return sandbox == TCP_SANDBOX; - } - break; - } + if (sandbox == TCP_SANDBOX) + return prot_is_tcp(prot); return false; } @@ -105,7 +105,7 @@ static int socket_variant(const struct service_fixture *const srv) int ret; ret = socket(srv->protocol.domain, srv->protocol.type | SOCK_CLOEXEC, - 0); + srv->protocol.protocol); if (ret < 0) return -errno; return ret; @@ -290,22 +290,70 @@ FIXTURE_TEARDOWN(protocol) } /* clang-format off */ -FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv4_tcp) { +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv4_tcp1) { /* clang-format on */ .sandbox = NO_SANDBOX, .prot = { .domain = AF_INET, .type = SOCK_STREAM, + /* IPPROTO_IP == 0 */ + .protocol = IPPROTO_IP, }, }; /* clang-format off */ -FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv6_tcp) { +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv4_tcp2) { + /* clang-format on */ + .sandbox = NO_SANDBOX, + .prot = { + .domain = AF_INET, + .type = SOCK_STREAM, + .protocol = IPPROTO_TCP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv4_mptcp) { + /* clang-format on */ + .sandbox = NO_SANDBOX, + .prot = { + .domain = AF_INET, + .type = SOCK_STREAM, + .protocol = IPPROTO_MPTCP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv6_tcp1) { + /* clang-format on */ + .sandbox = NO_SANDBOX, + .prot = { + .domain = AF_INET6, + .type = SOCK_STREAM, + /* IPPROTO_IP == 0 */ + .protocol = IPPROTO_IP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv6_tcp2) { /* clang-format on */ .sandbox = NO_SANDBOX, .prot = { .domain = AF_INET6, .type = SOCK_STREAM, + .protocol = IPPROTO_TCP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_ipv6_mptcp) { + /* clang-format on */ + .sandbox = NO_SANDBOX, + .prot = { + .domain = AF_INET6, + .type = SOCK_STREAM, + .protocol = IPPROTO_MPTCP, }, }; @@ -350,22 +398,70 @@ FIXTURE_VARIANT_ADD(protocol, no_sandbox_with_unix_datagram) { }; /* clang-format off */ -FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv4_tcp) { +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv4_tcp1) { + /* clang-format on */ + .sandbox = TCP_SANDBOX, + .prot = { + .domain = AF_INET, + .type = SOCK_STREAM, + /* IPPROTO_IP == 0 */ + .protocol = IPPROTO_IP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv4_tcp2) { + /* clang-format on */ + .sandbox = TCP_SANDBOX, + .prot = { + .domain = AF_INET, + .type = SOCK_STREAM, + .protocol = IPPROTO_TCP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv4_mptcp) { /* clang-format on */ .sandbox = TCP_SANDBOX, .prot = { .domain = AF_INET, .type = SOCK_STREAM, + .protocol = IPPROTO_MPTCP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv6_tcp1) { + /* clang-format on */ + .sandbox = TCP_SANDBOX, + .prot = { + .domain = AF_INET6, + .type = SOCK_STREAM, + /* IPPROTO_IP == 0 */ + .protocol = IPPROTO_IP, + }, +}; + +/* clang-format off */ +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv6_tcp2) { + /* clang-format on */ + .sandbox = TCP_SANDBOX, + .prot = { + .domain = AF_INET6, + .type = SOCK_STREAM, + .protocol = IPPROTO_TCP, }, }; /* clang-format off */ -FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv6_tcp) { +FIXTURE_VARIANT_ADD(protocol, tcp_sandbox_with_ipv6_mptcp) { /* clang-format on */ .sandbox = TCP_SANDBOX, .prot = { .domain = AF_INET6, .type = SOCK_STREAM, + .protocol = IPPROTO_MPTCP, }, }; diff --git a/tools/testing/selftests/landlock/ptrace_test.c b/tools/testing/selftests/landlock/ptrace_test.c index a19db4d0b3bd..8f31b673ff2d 100644 --- a/tools/testing/selftests/landlock/ptrace_test.c +++ b/tools/testing/selftests/landlock/ptrace_test.c @@ -22,8 +22,6 @@ /* Copied from security/yama/yama_lsm.c */ #define YAMA_SCOPE_DISABLED 0 #define YAMA_SCOPE_RELATIONAL 1 -#define YAMA_SCOPE_CAPABILITY 2 -#define YAMA_SCOPE_NO_ATTACH 3 static void create_domain(struct __test_metadata *const _metadata) { diff --git a/tools/testing/selftests/landlock/sandbox-and-launch.c b/tools/testing/selftests/landlock/sandbox-and-launch.c new file mode 100644 index 000000000000..3e32e1a51ac5 --- /dev/null +++ b/tools/testing/selftests/landlock/sandbox-and-launch.c @@ -0,0 +1,82 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + * Sandbox itself and execute another program (in a different mount point). + * + * Used by layout1.umount_sandboxer from fs_test.c + * + * Copyright © 2024-2025 Microsoft Corporation + */ + +#define _GNU_SOURCE +#include <errno.h> +#include <stdio.h> +#include <stdlib.h> +#include <sys/prctl.h> +#include <unistd.h> + +#include "wrappers.h" + +int main(int argc, char *argv[]) +{ + struct landlock_ruleset_attr ruleset_attr = { + .scoped = LANDLOCK_SCOPE_SIGNAL, + }; + int pipe_child, pipe_parent, ruleset_fd; + char buf; + + /* + * The first argument must be the file descriptor number of a pipe. + * The second argument must be the program to execute. + */ + if (argc != 4) { + fprintf(stderr, "Wrong number of arguments (not three)\n"); + return 1; + } + + pipe_child = atoi(argv[2]); + pipe_parent = atoi(argv[3]); + + ruleset_fd = + landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0); + if (ruleset_fd < 0) { + perror("Failed to create ruleset"); + return 1; + } + + if (prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0)) { + perror("Failed to call prctl()"); + return 1; + } + + if (landlock_restrict_self(ruleset_fd, 0)) { + perror("Failed to restrict self"); + return 1; + } + + if (close(ruleset_fd)) { + perror("Failed to close ruleset"); + return 1; + } + + /* Signals that we are sandboxed. */ + errno = 0; + if (write(pipe_child, ".", 1) != 1) { + perror("Failed to write to the second argument"); + return 1; + } + + /* Waits for the parent to try to umount. */ + if (read(pipe_parent, &buf, 1) != 1) { + perror("Failed to write to the third argument"); + return 1; + } + + /* Shifts arguments. */ + argv[0] = argv[1]; + argv[1] = argv[2]; + argv[2] = argv[3]; + argv[3] = NULL; + execve(argv[0], argv, NULL); + perror("Failed to execute the provided binary"); + return 1; +} diff --git a/tools/testing/selftests/landlock/wait-pipe.c b/tools/testing/selftests/landlock/wait-pipe.c new file mode 100644 index 000000000000..0dbcd260a0fa --- /dev/null +++ b/tools/testing/selftests/landlock/wait-pipe.c @@ -0,0 +1,42 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + * Write in a pipe and wait. + * + * Used by layout1.umount_sandboxer from fs_test.c + * + * Copyright © 2024-2025 Microsoft Corporation + */ + +#define _GNU_SOURCE +#include <stdio.h> +#include <stdlib.h> +#include <unistd.h> + +int main(int argc, char *argv[]) +{ + int pipe_child, pipe_parent; + char buf; + + /* The first argument must be the file descriptor number of a pipe. */ + if (argc != 3) { + fprintf(stderr, "Wrong number of arguments (not two)\n"); + return 1; + } + + pipe_child = atoi(argv[1]); + pipe_parent = atoi(argv[2]); + + /* Signals that we are waiting. */ + if (write(pipe_child, ".", 1) != 1) { + perror("Failed to write to first argument"); + return 1; + } + + /* Waits for the parent do its test. */ + if (read(pipe_parent, &buf, 1) != 1) { + perror("Failed to write to the second argument"); + return 1; + } + + return 0; +} diff --git a/tools/testing/selftests/landlock/wrappers.h b/tools/testing/selftests/landlock/wrappers.h new file mode 100644 index 000000000000..65548323e45d --- /dev/null +++ b/tools/testing/selftests/landlock/wrappers.h @@ -0,0 +1,47 @@ +/* SPDX-License-Identifier: GPL-2.0 */ +/* + * Syscall wrappers + * + * Copyright © 2017-2020 Mickaël Salaün <mic@digikod.net> + * Copyright © 2019-2020 ANSSI + * Copyright © 2021-2025 Microsoft Corporation + */ + +#define _GNU_SOURCE +#include <linux/landlock.h> +#include <sys/syscall.h> +#include <sys/types.h> +#include <unistd.h> + +#ifndef landlock_create_ruleset +static inline int +landlock_create_ruleset(const struct landlock_ruleset_attr *const attr, + const size_t size, const __u32 flags) +{ + return syscall(__NR_landlock_create_ruleset, attr, size, flags); +} +#endif + +#ifndef landlock_add_rule +static inline int landlock_add_rule(const int ruleset_fd, + const enum landlock_rule_type rule_type, + const void *const rule_attr, + const __u32 flags) +{ + return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr, + flags); +} +#endif + +#ifndef landlock_restrict_self +static inline int landlock_restrict_self(const int ruleset_fd, + const __u32 flags) +{ + return syscall(__NR_landlock_restrict_self, ruleset_fd, flags); +} +#endif + +static inline pid_t sys_gettid(void) +{ + return syscall(__NR_gettid); +} diff --git a/tools/testing/selftests/livepatch/functions.sh b/tools/testing/selftests/livepatch/functions.sh index e5d06fb40233..15601402dee6 100644 --- a/tools/testing/selftests/livepatch/functions.sh +++ b/tools/testing/selftests/livepatch/functions.sh @@ -306,7 +306,8 @@ function check_result { result=$(dmesg | awk -v last_dmesg="$LAST_DMESG" 'p; $0 == last_dmesg { p=1 }' | \ grep -e 'livepatch:' -e 'test_klp' | \ grep -v '\(tainting\|taints\) kernel' | \ - sed 's/^\[[ 0-9.]*\] //') + sed 's/^\[[ 0-9.]*\] //' | \ + sed 's/^\[[ ]*[CT][0-9]*\] //') if [[ "$expect" == "$result" ]] ; then echo "ok" diff --git a/tools/testing/selftests/livepatch/test-callbacks.sh b/tools/testing/selftests/livepatch/test-callbacks.sh index 37bbc3fb2780..2a03deb26a12 100755 --- a/tools/testing/selftests/livepatch/test-callbacks.sh +++ b/tools/testing/selftests/livepatch/test-callbacks.sh @@ -259,7 +259,7 @@ $MOD_TARGET: ${MOD_TARGET}_init % insmod test_modules/$MOD_LIVEPATCH.ko pre_patch_ret=-19 livepatch: enabling patch '$MOD_LIVEPATCH' livepatch: '$MOD_LIVEPATCH': initializing patching transition -test_klp_callbacks_demo: pre_patch_callback: vmlinux +$MOD_LIVEPATCH: pre_patch_callback: vmlinux livepatch: pre-patch callback failed for object 'vmlinux' livepatch: failed to enable patch '$MOD_LIVEPATCH' livepatch: '$MOD_LIVEPATCH': canceling patching transition, going to unpatch diff --git a/tools/testing/selftests/livepatch/test-sysfs.sh b/tools/testing/selftests/livepatch/test-sysfs.sh index 2c91428d2997..58fe1d96997c 100755 --- a/tools/testing/selftests/livepatch/test-sysfs.sh +++ b/tools/testing/selftests/livepatch/test-sysfs.sh @@ -5,6 +5,8 @@ . $(dirname $0)/functions.sh MOD_LIVEPATCH=test_klp_livepatch +MOD_LIVEPATCH2=test_klp_callbacks_demo +MOD_LIVEPATCH3=test_klp_syscall setup_config @@ -19,6 +21,8 @@ check_sysfs_rights "$MOD_LIVEPATCH" "enabled" "-rw-r--r--" check_sysfs_value "$MOD_LIVEPATCH" "enabled" "1" check_sysfs_rights "$MOD_LIVEPATCH" "force" "--w-------" check_sysfs_rights "$MOD_LIVEPATCH" "replace" "-r--r--r--" +check_sysfs_rights "$MOD_LIVEPATCH" "stack_order" "-r--r--r--" +check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1" check_sysfs_rights "$MOD_LIVEPATCH" "transition" "-r--r--r--" check_sysfs_value "$MOD_LIVEPATCH" "transition" "0" check_sysfs_rights "$MOD_LIVEPATCH" "vmlinux/patched" "-r--r--r--" @@ -131,4 +135,71 @@ livepatch: '$MOD_LIVEPATCH': completing unpatching transition livepatch: '$MOD_LIVEPATCH': unpatching complete % rmmod $MOD_LIVEPATCH" +start_test "sysfs test stack_order value" + +load_lp $MOD_LIVEPATCH + +check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1" + +load_lp $MOD_LIVEPATCH2 + +check_sysfs_value "$MOD_LIVEPATCH2" "stack_order" "2" + +load_lp $MOD_LIVEPATCH3 + +check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "3" + +disable_lp $MOD_LIVEPATCH2 +unload_lp $MOD_LIVEPATCH2 + +check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1" +check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "2" + +disable_lp $MOD_LIVEPATCH3 +unload_lp $MOD_LIVEPATCH3 + +disable_lp $MOD_LIVEPATCH +unload_lp $MOD_LIVEPATCH + +check_result "% insmod test_modules/$MOD_LIVEPATCH.ko +livepatch: enabling patch '$MOD_LIVEPATCH' +livepatch: '$MOD_LIVEPATCH': initializing patching transition +livepatch: '$MOD_LIVEPATCH': starting patching transition +livepatch: '$MOD_LIVEPATCH': completing patching transition +livepatch: '$MOD_LIVEPATCH': patching complete +% insmod test_modules/$MOD_LIVEPATCH2.ko +livepatch: enabling patch '$MOD_LIVEPATCH2' +livepatch: '$MOD_LIVEPATCH2': initializing patching transition +$MOD_LIVEPATCH2: pre_patch_callback: vmlinux +livepatch: '$MOD_LIVEPATCH2': starting patching transition +livepatch: '$MOD_LIVEPATCH2': completing patching transition +$MOD_LIVEPATCH2: post_patch_callback: vmlinux +livepatch: '$MOD_LIVEPATCH2': patching complete +% insmod test_modules/$MOD_LIVEPATCH3.ko +livepatch: enabling patch '$MOD_LIVEPATCH3' +livepatch: '$MOD_LIVEPATCH3': initializing patching transition +livepatch: '$MOD_LIVEPATCH3': starting patching transition +livepatch: '$MOD_LIVEPATCH3': completing patching transition +livepatch: '$MOD_LIVEPATCH3': patching complete +% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH2/enabled +livepatch: '$MOD_LIVEPATCH2': initializing unpatching transition +$MOD_LIVEPATCH2: pre_unpatch_callback: vmlinux +livepatch: '$MOD_LIVEPATCH2': starting unpatching transition +livepatch: '$MOD_LIVEPATCH2': completing unpatching transition +$MOD_LIVEPATCH2: post_unpatch_callback: vmlinux +livepatch: '$MOD_LIVEPATCH2': unpatching complete +% rmmod $MOD_LIVEPATCH2 +% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH3/enabled +livepatch: '$MOD_LIVEPATCH3': initializing unpatching transition +livepatch: '$MOD_LIVEPATCH3': starting unpatching transition +livepatch: '$MOD_LIVEPATCH3': completing unpatching transition +livepatch: '$MOD_LIVEPATCH3': unpatching complete +% rmmod $MOD_LIVEPATCH3 +% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH/enabled +livepatch: '$MOD_LIVEPATCH': initializing unpatching transition +livepatch: '$MOD_LIVEPATCH': starting unpatching transition +livepatch: '$MOD_LIVEPATCH': completing unpatching transition +livepatch: '$MOD_LIVEPATCH': unpatching complete +% rmmod $MOD_LIVEPATCH" + exit 0 diff --git a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c index 66dec47e3ca3..732e89fe99c0 100644 --- a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c +++ b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c @@ -56,16 +56,15 @@ TEST(flags_zero_lsm_set_self_attr) TEST(flags_overset_lsm_set_self_attr) { const long page_size = sysconf(_SC_PAGESIZE); - char *ctx = calloc(page_size, 1); + struct lsm_ctx *ctx = calloc(page_size, 1); __u32 size = page_size; - struct lsm_ctx *tctx = (struct lsm_ctx *)ctx; ASSERT_NE(NULL, ctx); if (attr_lsm_count()) { - ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, tctx, &size, + ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, ctx, &size, 0)); } - ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, tctx, + ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, ctx, size, 0)); free(ctx); diff --git a/tools/testing/selftests/media_tests/regression_test.txt b/tools/testing/selftests/media_tests/regression_test.txt index 2627367681f7..9d0fcd98c085 100644 --- a/tools/testing/selftests/media_tests/regression_test.txt +++ b/tools/testing/selftests/media_tests/regression_test.txt @@ -1,5 +1,5 @@ Testing for regressions in Media Controller API register, ioctl, syscall, -and unregister paths. There have a few problems that result in user-after +and unregister paths. There have a few problems that result in use-after free on media_device, media_devnode, and cdev pointers when the driver is unbound while ioctl is in progress. @@ -15,11 +15,11 @@ Build media_device_test cd tools/testing/selftests/media_tests make -Regressions test for cdev user-after free error on /dev/mediaX when driver +Regressions test for cdev use-after-free error on /dev/mediaX when driver is unbound: Start media_device_test to regression test media devnode dynamic alloc -and cdev user-after-free fixes. This opens media dev files and sits in +and cdev use-after-free fixes. This opens media dev files and sits in a loop running media ioctl MEDIA_IOC_DEVICE_INFO command once every 10 seconds. The idea is when device file goes away, media devnode and cdev should stick around until this test exits. @@ -40,4 +40,4 @@ keep ioctls going while bind/unbind runs. Copy bind_unbind_sample.txt and make changes to specify the driver name and number to run bind and unbind. Start the bind_unbind.sh -Run dmesg looking for any user-after free errors or mutex lock errors. +Run dmesg looking for any use-after-free errors or mutex lock errors. diff --git a/tools/testing/selftests/memfd/memfd_test.c b/tools/testing/selftests/memfd/memfd_test.c index 95af2d78fd31..5b993924cc3f 100644 --- a/tools/testing/selftests/memfd/memfd_test.c +++ b/tools/testing/selftests/memfd/memfd_test.c @@ -9,6 +9,7 @@ #include <fcntl.h> #include <linux/memfd.h> #include <sched.h> +#include <stdbool.h> #include <stdio.h> #include <stdlib.h> #include <signal.h> @@ -170,7 +171,7 @@ static void mfd_fail_new(const char *name, unsigned int flags) r = sys_memfd_create(name, flags); if (r >= 0) { printf("memfd_create(\"%s\", %u) succeeded, but failure expected\n", - name, flags); + name ? name : "NULL", flags); close(r); abort(); } @@ -281,6 +282,24 @@ static void *mfd_assert_mmap_shared(int fd) return p; } +static void *mfd_assert_mmap_read_shared(int fd) +{ + void *p; + + p = mmap(NULL, + mfd_def_size, + PROT_READ, + MAP_SHARED, + fd, + 0); + if (p == MAP_FAILED) { + printf("mmap() failed: %m\n"); + abort(); + } + + return p; +} + static void *mfd_assert_mmap_private(int fd) { void *p; @@ -979,6 +998,30 @@ static void test_seal_future_write(void) close(fd); } +static void test_seal_write_map_read_shared(void) +{ + int fd; + void *p; + + printf("%s SEAL-WRITE-MAP-READ\n", memfd_str); + + fd = mfd_assert_new("kern_memfd_seal_write_map_read", + mfd_def_size, + MFD_CLOEXEC | MFD_ALLOW_SEALING); + + mfd_assert_add_seals(fd, F_SEAL_WRITE); + mfd_assert_has_seals(fd, F_SEAL_WRITE); + + p = mfd_assert_mmap_read_shared(fd); + + mfd_assert_read(fd); + mfd_assert_read_shared(fd); + mfd_fail_write(fd); + + munmap(p, mfd_def_size); + close(fd); +} + /* * Test SEAL_SHRINK * Test whether SEAL_SHRINK actually prevents shrinking @@ -1557,6 +1600,11 @@ static void test_share_fork(char *banner, char *b_suffix) close(fd); } +static bool pid_ns_supported(void) +{ + return access("/proc/self/ns/pid", F_OK) == 0; +} + int main(int argc, char **argv) { pid_t pid; @@ -1587,12 +1635,17 @@ int main(int argc, char **argv) test_seal_write(); test_seal_future_write(); + test_seal_write_map_read_shared(); test_seal_shrink(); test_seal_grow(); test_seal_resize(); - test_sysctl_simple(); - test_sysctl_nested(); + if (pid_ns_supported()) { + test_sysctl_simple(); + test_sysctl_nested(); + } else { + printf("PID namespaces are not supported; skipping sysctl tests\n"); + } test_share_dup("SHARE-DUP", ""); test_share_mmap("SHARE-MMAP", ""); diff --git a/tools/testing/selftests/mm/.gitignore b/tools/testing/selftests/mm/.gitignore index 8f01f4da1c0d..121000c28c10 100644 --- a/tools/testing/selftests/mm/.gitignore +++ b/tools/testing/selftests/mm/.gitignore @@ -27,6 +27,7 @@ protection_keys_64 madv_populate uffd-stress uffd-unit-tests +uffd-wp-mremap mlock-intersect-test mlock-random-test virtual_address_range @@ -36,6 +37,9 @@ map_fixed_noreplace write_to_hugetlbfs hmm-tests memfd_secret +hugetlb_dio +pkey_sighandler_tests_32 +pkey_sighandler_tests_64 soft-dirty split_huge_page_test ksm_tests @@ -49,7 +53,6 @@ va_high_addr_switch hugetlb_fault_after_madv hugetlb_madv_vs_map mseal_test -seal_elf droppable hugetlb_dio pkey_sighandler_tests_32 diff --git a/tools/testing/selftests/mm/Makefile b/tools/testing/selftests/mm/Makefile index 3de23ea4663f..63ce39d024bb 100644 --- a/tools/testing/selftests/mm/Makefile +++ b/tools/testing/selftests/mm/Makefile @@ -33,9 +33,16 @@ endif # LDLIBS. MAKEFLAGS += --no-builtin-rules -CFLAGS = -Wall -I $(top_srcdir) $(EXTRA_CFLAGS) $(KHDR_INCLUDES) $(TOOLS_INCLUDES) +CFLAGS = -Wall -O2 -I $(top_srcdir) $(EXTRA_CFLAGS) $(KHDR_INCLUDES) $(TOOLS_INCLUDES) LDLIBS = -lrt -lpthread -lm +# Some distributions (such as Ubuntu) configure GCC so that _FORTIFY_SOURCE is +# automatically enabled at -O1 or above. This triggers various unused-result +# warnings where functions such as read() or write() are called and their +# return value is not checked. Disable _FORTIFY_SOURCE to silence those +# warnings. +CFLAGS += -U_FORTIFY_SOURCE + KDIR ?= /lib/modules/$(shell uname -r)/build ifneq (,$(wildcard $(KDIR)/Module.symvers)) ifneq (,$(wildcard $(KDIR)/include/linux/page_frag_cache.h)) @@ -75,13 +82,13 @@ TEST_GEN_FILES += mrelease_test TEST_GEN_FILES += mremap_dontunmap TEST_GEN_FILES += mremap_test TEST_GEN_FILES += mseal_test -TEST_GEN_FILES += seal_elf TEST_GEN_FILES += on-fault-limit TEST_GEN_FILES += pagemap_ioctl TEST_GEN_FILES += thuge-gen TEST_GEN_FILES += transhuge-stress TEST_GEN_FILES += uffd-stress TEST_GEN_FILES += uffd-unit-tests +TEST_GEN_FILES += uffd-wp-mremap TEST_GEN_FILES += split_huge_page_test TEST_GEN_FILES += ksm_tests TEST_GEN_FILES += ksm_functional_tests @@ -152,11 +159,16 @@ $(TEST_GEN_FILES): vm_util.c thp_settings.c $(OUTPUT)/uffd-stress: uffd-common.c $(OUTPUT)/uffd-unit-tests: uffd-common.c +$(OUTPUT)/uffd-wp-mremap: uffd-common.c +$(OUTPUT)/protection_keys: pkey_util.c +$(OUTPUT)/pkey_sighandler_tests: pkey_util.c ifeq ($(ARCH),x86_64) BINARIES_32 := $(patsubst %,$(OUTPUT)/%,$(BINARIES_32)) BINARIES_64 := $(patsubst %,$(OUTPUT)/%,$(BINARIES_64)) +$(BINARIES_32) $(BINARIES_64): pkey_util.c + define gen-target-rule-32 $(1) $(1)_32: $(OUTPUT)/$(1)_32 .PHONY: $(1) $(1)_32 diff --git a/tools/testing/selftests/mm/config b/tools/testing/selftests/mm/config index 4309916f629e..a28baa536332 100644 --- a/tools/testing/selftests/mm/config +++ b/tools/testing/selftests/mm/config @@ -7,3 +7,4 @@ CONFIG_TEST_HMM=m CONFIG_GUP_TEST=y CONFIG_TRANSPARENT_HUGEPAGE=y CONFIG_MEM_SOFT_DIRTY=y +CONFIG_ANON_VMA_NAME=y diff --git a/tools/testing/selftests/mm/cow.c b/tools/testing/selftests/mm/cow.c index 32c6ccc2a6be..9446673645eb 100644 --- a/tools/testing/selftests/mm/cow.c +++ b/tools/testing/selftests/mm/cow.c @@ -758,7 +758,7 @@ static void do_run_with_base_page(test_fn fn, bool swapout) } /* Populate a base page. */ - memset(mem, 0, pagesize); + memset(mem, 1, pagesize); if (swapout) { madvise(mem, pagesize, MADV_PAGEOUT); @@ -824,12 +824,12 @@ static void do_run_with_thp(test_fn fn, enum thp_run thp_run, size_t thpsize) * Try to populate a THP. Touch the first sub-page and test if * we get the last sub-page populated automatically. */ - mem[0] = 0; + mem[0] = 1; if (!pagemap_is_populated(pagemap_fd, mem + thpsize - pagesize)) { ksft_test_result_skip("Did not get a THP populated\n"); goto munmap; } - memset(mem, 0, thpsize); + memset(mem, 1, thpsize); size = thpsize; switch (thp_run) { @@ -1012,7 +1012,7 @@ static void run_with_hugetlb(test_fn fn, const char *desc, size_t hugetlbsize) } /* Populate an huge page. */ - memset(mem, 0, hugetlbsize); + memset(mem, 1, hugetlbsize); /* * We need a total of two hugetlb pages to handle COW/unsharing @@ -1482,7 +1482,7 @@ static void run_with_zeropage(non_anon_test_fn fn, const char *desc) } smem = mmap(NULL, pagesize, PROT_READ, MAP_PRIVATE | MAP_ANON, -1, 0); - if (mem == MAP_FAILED) { + if (smem == MAP_FAILED) { ksft_test_result_fail("mmap() failed\n"); goto munmap; } @@ -1583,7 +1583,7 @@ static void run_with_memfd(non_anon_test_fn fn, const char *desc) goto close; } smem = mmap(NULL, pagesize, PROT_READ, MAP_SHARED, fd, 0); - if (mem == MAP_FAILED) { + if (smem == MAP_FAILED) { ksft_test_result_fail("mmap() failed\n"); goto munmap; } @@ -1634,7 +1634,7 @@ static void run_with_tmpfile(non_anon_test_fn fn, const char *desc) goto close; } smem = mmap(NULL, pagesize, PROT_READ, MAP_SHARED, fd, 0); - if (mem == MAP_FAILED) { + if (smem == MAP_FAILED) { ksft_test_result_fail("mmap() failed\n"); goto munmap; } @@ -1684,7 +1684,7 @@ static void run_with_memfd_hugetlb(non_anon_test_fn fn, const char *desc, goto close; } smem = mmap(NULL, hugetlbsize, PROT_READ, MAP_SHARED, fd, 0); - if (mem == MAP_FAILED) { + if (smem == MAP_FAILED) { ksft_test_result_fail("mmap() failed\n"); goto munmap; } @@ -1696,7 +1696,7 @@ static void run_with_memfd_hugetlb(non_anon_test_fn fn, const char *desc, fn(mem, smem, hugetlbsize); munmap: munmap(mem, hugetlbsize); - if (mem != MAP_FAILED) + if (smem != MAP_FAILED) munmap(smem, hugetlbsize); close: close(fd); diff --git a/tools/testing/selftests/mm/guard-pages.c b/tools/testing/selftests/mm/guard-pages.c index 7cdf815d0d63..ece37212a8a2 100644 --- a/tools/testing/selftests/mm/guard-pages.c +++ b/tools/testing/selftests/mm/guard-pages.c @@ -55,6 +55,12 @@ static int pidfd_open(pid_t pid, unsigned int flags) return syscall(SYS_pidfd_open, pid, flags); } +static ssize_t sys_process_madvise(int pidfd, const struct iovec *iovec, + size_t n, int advice, unsigned int flags) +{ + return syscall(__NR_process_madvise, pidfd, iovec, n, advice, flags); +} + /* * Enable our signal catcher and try to read/write the specified buffer. The * return value indicates whether the read/write succeeds without a fatal @@ -419,7 +425,7 @@ TEST_F(guard_pages, process_madvise) ASSERT_EQ(munmap(&ptr_region[99 * page_size], page_size), 0); /* Now guard in one step. */ - count = process_madvise(pidfd, vec, 6, MADV_GUARD_INSTALL, 0); + count = sys_process_madvise(pidfd, vec, 6, MADV_GUARD_INSTALL, 0); /* OK we don't have permission to do this, skip. */ if (count == -1 && errno == EPERM) @@ -440,7 +446,7 @@ TEST_F(guard_pages, process_madvise) ASSERT_FALSE(try_read_write_buf(&ptr3[19 * page_size])); /* Now do the same with unguard... */ - count = process_madvise(pidfd, vec, 6, MADV_GUARD_REMOVE, 0); + count = sys_process_madvise(pidfd, vec, 6, MADV_GUARD_REMOVE, 0); /* ...and everything should now succeed. */ @@ -990,7 +996,7 @@ TEST_F(guard_pages, fork) MAP_ANON | MAP_PRIVATE, -1, 0); ASSERT_NE(ptr, MAP_FAILED); - /* Establish guard apges in the first 5 pages. */ + /* Establish guard pages in the first 5 pages. */ ASSERT_EQ(madvise(ptr, 5 * page_size, MADV_GUARD_INSTALL), 0); pid = fork(); @@ -1030,6 +1036,77 @@ TEST_F(guard_pages, fork) } /* + * Assert expected behaviour after we fork populated ranges of anonymous memory + * and then guard and unguard the range. + */ +TEST_F(guard_pages, fork_cow) +{ + const unsigned long page_size = self->page_size; + char *ptr; + pid_t pid; + int i; + + /* Map 10 pages. */ + ptr = mmap(NULL, 10 * page_size, PROT_READ | PROT_WRITE, + MAP_ANON | MAP_PRIVATE, -1, 0); + ASSERT_NE(ptr, MAP_FAILED); + + /* Populate range. */ + for (i = 0; i < 10 * page_size; i++) { + char chr = 'a' + (i % 26); + + ptr[i] = chr; + } + + pid = fork(); + ASSERT_NE(pid, -1); + if (!pid) { + /* This is the child process now. */ + + /* Ensure the range is as expected. */ + for (i = 0; i < 10 * page_size; i++) { + char expected = 'a' + (i % 26); + char actual = ptr[i]; + + ASSERT_EQ(actual, expected); + } + + /* Establish guard pages across the whole range. */ + ASSERT_EQ(madvise(ptr, 10 * page_size, MADV_GUARD_INSTALL), 0); + /* Remove it. */ + ASSERT_EQ(madvise(ptr, 10 * page_size, MADV_GUARD_REMOVE), 0); + + /* + * By removing the guard pages, the page tables will be + * cleared. Assert that we are looking at the zero page now. + */ + for (i = 0; i < 10 * page_size; i++) { + char actual = ptr[i]; + + ASSERT_EQ(actual, '\0'); + } + + exit(0); + } + + /* Parent process. */ + + /* Parent simply waits on child. */ + waitpid(pid, NULL, 0); + + /* Ensure the range is unchanged in parent anon range. */ + for (i = 0; i < 10 * page_size; i++) { + char expected = 'a' + (i % 26); + char actual = ptr[i]; + + ASSERT_EQ(actual, expected); + } + + /* Cleanup. */ + ASSERT_EQ(munmap(ptr, 10 * page_size), 0); +} + +/* * Assert that forking a process with VMAs that do have VM_WIPEONFORK set * behave as expected. */ diff --git a/tools/testing/selftests/mm/hugetlb_dio.c b/tools/testing/selftests/mm/hugetlb_dio.c index 432d5af15e66..db63abe5ee5e 100644 --- a/tools/testing/selftests/mm/hugetlb_dio.c +++ b/tools/testing/selftests/mm/hugetlb_dio.c @@ -76,19 +76,15 @@ void run_dio_using_hugetlb(unsigned int start_off, unsigned int end_off) /* Get the free huge pages after unmap*/ free_hpage_a = get_free_hugepages(); + ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b); + ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a); + /* * If the no. of free hugepages before allocation and after unmap does * not match - that means there could still be a page which is pinned. */ - if (free_hpage_a != free_hpage_b) { - ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b); - ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a); - ksft_test_result_fail(": Huge pages not freed!\n"); - } else { - ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b); - ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a); - ksft_test_result_pass(": Huge pages freed successfully !\n"); - } + ksft_test_result(free_hpage_a == free_hpage_b, + "free huge pages from %u-%u\n", start_off, end_off); } int main(void) diff --git a/tools/testing/selftests/mm/ksm_tests.c b/tools/testing/selftests/mm/ksm_tests.c index b748c48908d9..dcdd5bb20f3d 100644 --- a/tools/testing/selftests/mm/ksm_tests.c +++ b/tools/testing/selftests/mm/ksm_tests.c @@ -776,7 +776,7 @@ err_out: int main(int argc, char *argv[]) { - int ret, opt; + int ret = 0, opt; int prot = 0; int ksm_scan_limit_sec = KSM_SCAN_LIMIT_SEC_DEFAULT; int merge_type = KSM_MERGE_TYPE_DEFAULT; diff --git a/tools/testing/selftests/mm/migration.c b/tools/testing/selftests/mm/migration.c index 64bcbb7151cf..1e3a595fbf01 100644 --- a/tools/testing/selftests/mm/migration.c +++ b/tools/testing/selftests/mm/migration.c @@ -204,4 +204,103 @@ TEST_F_TIMEOUT(migration, private_anon_thp, 2*RUNTIME) ASSERT_EQ(pthread_cancel(self->threads[i]), 0); } +/* + * migration test with shared anon THP page + */ + +TEST_F_TIMEOUT(migration, shared_anon_thp, 2*RUNTIME) +{ + pid_t pid; + uint64_t *ptr; + int i; + + if (self->nthreads < 2 || self->n1 < 0 || self->n2 < 0) + SKIP(return, "Not enough threads or NUMA nodes available"); + + ptr = mmap(NULL, 2 * TWOMEG, PROT_READ | PROT_WRITE, + MAP_SHARED | MAP_ANONYMOUS, -1, 0); + ASSERT_NE(ptr, MAP_FAILED); + + ptr = (uint64_t *) ALIGN((uintptr_t) ptr, TWOMEG); + ASSERT_EQ(madvise(ptr, TWOMEG, MADV_HUGEPAGE), 0); + + memset(ptr, 0xde, TWOMEG); + for (i = 0; i < self->nthreads - 1; i++) { + pid = fork(); + if (!pid) { + prctl(PR_SET_PDEATHSIG, SIGHUP); + /* Parent may have died before prctl so check now. */ + if (getppid() == 1) + kill(getpid(), SIGHUP); + access_mem(ptr); + } else { + self->pids[i] = pid; + } + } + + ASSERT_EQ(migrate(ptr, self->n1, self->n2), 0); + for (i = 0; i < self->nthreads - 1; i++) + ASSERT_EQ(kill(self->pids[i], SIGTERM), 0); +} + +/* + * migration test with private anon hugetlb page + */ +TEST_F_TIMEOUT(migration, private_anon_htlb, 2*RUNTIME) +{ + uint64_t *ptr; + int i; + + if (self->nthreads < 2 || self->n1 < 0 || self->n2 < 0) + SKIP(return, "Not enough threads or NUMA nodes available"); + + ptr = mmap(NULL, TWOMEG, PROT_READ | PROT_WRITE, + MAP_PRIVATE | MAP_ANONYMOUS | MAP_HUGETLB, -1, 0); + ASSERT_NE(ptr, MAP_FAILED); + + memset(ptr, 0xde, TWOMEG); + for (i = 0; i < self->nthreads - 1; i++) + if (pthread_create(&self->threads[i], NULL, access_mem, ptr)) + perror("Couldn't create thread"); + + ASSERT_EQ(migrate(ptr, self->n1, self->n2), 0); + for (i = 0; i < self->nthreads - 1; i++) + ASSERT_EQ(pthread_cancel(self->threads[i]), 0); +} + +/* + * migration test with shared anon hugetlb page + */ +TEST_F_TIMEOUT(migration, shared_anon_htlb, 2*RUNTIME) +{ + pid_t pid; + uint64_t *ptr; + int i; + + if (self->nthreads < 2 || self->n1 < 0 || self->n2 < 0) + SKIP(return, "Not enough threads or NUMA nodes available"); + + ptr = mmap(NULL, TWOMEG, PROT_READ | PROT_WRITE, + MAP_SHARED | MAP_ANONYMOUS | MAP_HUGETLB, -1, 0); + ASSERT_NE(ptr, MAP_FAILED); + + memset(ptr, 0xde, TWOMEG); + for (i = 0; i < self->nthreads - 1; i++) { + pid = fork(); + if (!pid) { + prctl(PR_SET_PDEATHSIG, SIGHUP); + /* Parent may have died before prctl so check now. */ + if (getppid() == 1) + kill(getpid(), SIGHUP); + access_mem(ptr); + } else { + self->pids[i] = pid; + } + } + + ASSERT_EQ(migrate(ptr, self->n1, self->n2), 0); + for (i = 0; i < self->nthreads - 1; i++) + ASSERT_EQ(kill(self->pids[i], SIGTERM), 0); +} + TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/mm/mkdirty.c b/tools/testing/selftests/mm/mkdirty.c index 1db134063c38..af2fce496912 100644 --- a/tools/testing/selftests/mm/mkdirty.c +++ b/tools/testing/selftests/mm/mkdirty.c @@ -280,6 +280,7 @@ static void test_uffdio_copy(void) dst = mmap(NULL, pagesize, PROT_READ, MAP_PRIVATE|MAP_ANON, -1, 0); if (dst == MAP_FAILED) { ksft_test_result_fail("mmap() failed\n"); + free(src); return; } diff --git a/tools/testing/selftests/mm/mremap_test.c b/tools/testing/selftests/mm/mremap_test.c index 5a3a9bcba640..bb84476a177f 100644 --- a/tools/testing/selftests/mm/mremap_test.c +++ b/tools/testing/selftests/mm/mremap_test.c @@ -34,7 +34,7 @@ struct config { unsigned long long dest_alignment; unsigned long long region_size; int overlapping; - int dest_preamble_size; + unsigned int dest_preamble_size; }; struct test { @@ -328,7 +328,7 @@ static void mremap_move_within_range(unsigned int pattern_seed, char *rand_addr) { char *test_name = "mremap mremap move within range"; void *src, *dest; - int i, success = 1; + unsigned int i, success = 1; size_t size = SIZE_MB(20); void *ptr = mmap(NULL, size, PROT_READ | PROT_WRITE, @@ -384,7 +384,7 @@ out: static long long remap_region(struct config c, unsigned int threshold_mb, char *rand_addr) { - void *addr, *src_addr, *dest_addr, *dest_preamble_addr; + void *addr, *src_addr, *dest_addr, *dest_preamble_addr = NULL; unsigned long long t, d; struct timespec t_start = {0, 0}, t_end = {0, 0}; long long start_ns, end_ns, align_mask, ret, offset; @@ -569,7 +569,7 @@ static void mremap_move_1mb_from_start(unsigned int pattern_seed, { char *test_name = "mremap move 1mb from start at 1MB+256KB aligned src"; void *src = NULL, *dest = NULL; - int i, success = 1; + unsigned int i, success = 1; /* Config to reuse get_source_mapping() to do an aligned mmap. */ struct config c = { @@ -636,7 +636,7 @@ out: static void run_mremap_test_case(struct test test_case, int *failures, unsigned int threshold_mb, - unsigned int pattern_seed, char *rand_addr) + char *rand_addr) { long long remap_time = remap_region(test_case.config, threshold_mb, rand_addr); @@ -708,7 +708,8 @@ static int parse_args(int argc, char **argv, unsigned int *threshold_mb, int main(int argc, char **argv) { int failures = 0; - int i, run_perf_tests; + unsigned int i; + int run_perf_tests; unsigned int threshold_mb = VALIDATION_DEFAULT_THRESHOLD; /* hard-coded test configs */ @@ -831,7 +832,7 @@ int main(int argc, char **argv) for (i = 0; i < ARRAY_SIZE(test_cases); i++) run_mremap_test_case(test_cases[i], &failures, threshold_mb, - pattern_seed, rand_addr); + rand_addr); maps_fp = fopen("/proc/self/maps", "r"); @@ -853,7 +854,7 @@ int main(int argc, char **argv) "mremap HAVE_MOVE_PMD/PUD optimization time comparison for 1GB region:"); for (i = 0; i < ARRAY_SIZE(perf_test_cases); i++) run_mremap_test_case(perf_test_cases[i], &failures, - threshold_mb, pattern_seed, + threshold_mb, rand_addr); } diff --git a/tools/testing/selftests/mm/mseal_test.c b/tools/testing/selftests/mm/mseal_test.c index 01675c412b2a..ad17005521a8 100644 --- a/tools/testing/selftests/mm/mseal_test.c +++ b/tools/testing/selftests/mm/mseal_test.c @@ -802,7 +802,7 @@ static void test_seal_mprotect_partial_mprotect_tail(bool seal) } -static void test_seal_mprotect_two_vma_with_gap(bool seal) +static void test_seal_mprotect_two_vma_with_gap(void) { void *ptr; unsigned long page_size = getpagesize(); @@ -1864,7 +1864,7 @@ static void test_seal_madvise_nodiscard(bool seal) REPORT_TEST_PASS(); } -int main(int argc, char **argv) +int main(void) { bool test_seal = seal_support(); @@ -1913,8 +1913,8 @@ int main(int argc, char **argv) test_seal_mprotect_partial_mprotect(false); test_seal_mprotect_partial_mprotect(true); - test_seal_mprotect_two_vma_with_gap(false); - test_seal_mprotect_two_vma_with_gap(true); + test_seal_mprotect_two_vma_with_gap(); + test_seal_mprotect_two_vma_with_gap(); test_seal_mprotect_merge(false); test_seal_mprotect_merge(true); diff --git a/tools/testing/selftests/mm/pagemap_ioctl.c b/tools/testing/selftests/mm/pagemap_ioctl.c index bcc73b4e805c..57b4bba2b45f 100644 --- a/tools/testing/selftests/mm/pagemap_ioctl.c +++ b/tools/testing/selftests/mm/pagemap_ioctl.c @@ -34,8 +34,8 @@ #define PAGEMAP "/proc/self/pagemap" int pagemap_fd; int uffd; -int page_size; -int hpage_size; +unsigned int page_size; +unsigned int hpage_size; const char *progname; #define LEN(region) ((region.end - region.start)/page_size) @@ -235,7 +235,9 @@ int get_reads(struct page_region *vec, int vec_size) int sanity_tests_sd(void) { - int mem_size, vec_size, ret, ret2, ret3, i, num_pages = 1000, total_pages = 0; + unsigned long long mem_size, vec_size, i, total_pages = 0; + long ret, ret2, ret3; + int num_pages = 1000; int total_writes, total_reads, reads, count; struct page_region *vec, *vec2; char *mem, *m[2]; @@ -321,9 +323,9 @@ int sanity_tests_sd(void) ret = pagemap_ioctl(mem, mem_size, vec, vec_size, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); - ksft_test_result(ret == mem_size/(page_size * 2), + ksft_test_result((unsigned long long)ret == mem_size/(page_size * 2), "%s Repeated pattern of written and non-written pages\n", __func__); /* 4. Repeated pattern of written and non-written pages in parts */ @@ -331,21 +333,21 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, num_pages/2 - 2, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ret2 = pagemap_ioctl(mem, mem_size, vec, 2, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret2 < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret2, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret2, errno, strerror(errno)); ret3 = pagemap_ioctl(mem, mem_size, vec, vec_size, PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret3 < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret3, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret3, errno, strerror(errno)); ksft_test_result((ret + ret3) == num_pages/2 && ret2 == 2, - "%s Repeated pattern of written and non-written pages in parts %d %d %d\n", + "%s Repeated pattern of written and non-written pages in parts %ld %ld %ld\n", __func__, ret, ret3, ret2); /* 5. Repeated pattern of written and non-written pages max_pages */ @@ -357,13 +359,13 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, num_pages/2, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ret2 = pagemap_ioctl(mem, mem_size, vec, vec_size, PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret2 < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret2, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret2, errno, strerror(errno)); ksft_test_result(ret == num_pages/2 && ret2 == 1, "%s Repeated pattern of written and non-written pages max_pages\n", @@ -378,12 +380,12 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 2, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ret2 = pagemap_ioctl(mem, mem_size, vec2, vec_size, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret2 < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret2, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret2, errno, strerror(errno)); ksft_test_result(ret == 1 && LEN(vec[0]) == 2 && vec[0].start == (uintptr_t)(mem + page_size) && @@ -416,7 +418,7 @@ int sanity_tests_sd(void) ret = pagemap_ioctl(m[1], mem_size, vec, 1, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && LEN(vec[0]) == mem_size/page_size, "%s Two regions\n", __func__); @@ -448,7 +450,7 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); for (i = 0; i < mem_size/page_size; i += 2) mem[i * page_size]++; @@ -457,7 +459,7 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, mem_size/(page_size*5), PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); total_pages += ret; @@ -465,7 +467,7 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, mem_size/(page_size*5), PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); total_pages += ret; @@ -473,7 +475,7 @@ int sanity_tests_sd(void) PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, mem_size/(page_size*5), PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); total_pages += ret; @@ -515,9 +517,9 @@ int sanity_tests_sd(void) vec_size, PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); - if (ret > vec_size) + if ((unsigned long)ret > vec_size) break; reads = get_reads(vec, ret); @@ -554,63 +556,63 @@ int sanity_tests_sd(void) ret = pagemap_ioc(mem, 0, vec, vec_size, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 0 && walk_end == (long)mem, "Walk_end: Same start and end address\n"); ret = pagemap_ioc(mem, 0, vec, vec_size, PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 0 && walk_end == (long)mem, "Walk_end: Same start and end with WP\n"); ret = pagemap_ioc(mem, 0, vec, 0, PM_SCAN_WP_MATCHING | PM_SCAN_CHECK_WPASYNC, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 0 && walk_end == (long)mem, "Walk_end: Same start and end with 0 output buffer\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + mem_size), "Walk_end: Big vec\n"); ret = pagemap_ioc(mem, mem_size, vec, 1, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + mem_size), "Walk_end: vec of minimum length\n"); ret = pagemap_ioc(mem, mem_size, vec, 1, 0, vec_size, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + mem_size), "Walk_end: Max pages specified\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, vec_size/2, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + mem_size/2), "Walk_end: Half max pages\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, 1, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + page_size), "Walk_end: 1 max page\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, -1, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + mem_size), "Walk_end: max pages\n"); @@ -621,49 +623,49 @@ int sanity_tests_sd(void) ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); - ksft_test_result(ret == vec_size/2 && walk_end == (long)(mem + mem_size), + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); + ksft_test_result((unsigned long)ret == vec_size/2 && walk_end == (long)(mem + mem_size), "Walk_end sparse: Big vec\n"); ret = pagemap_ioc(mem, mem_size, vec, 1, 0, 0, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + page_size * 2), "Walk_end sparse: vec of minimum length\n"); ret = pagemap_ioc(mem, mem_size, vec, 1, 0, vec_size, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + page_size * 2), "Walk_end sparse: Max pages specified\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size/2, 0, vec_size, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); - ksft_test_result(ret == vec_size/2 && walk_end == (long)(mem + mem_size), + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); + ksft_test_result((unsigned long)ret == vec_size/2 && walk_end == (long)(mem + mem_size), "Walk_end sparse: Max pages specified\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, vec_size, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); - ksft_test_result(ret == vec_size/2 && walk_end == (long)(mem + mem_size), + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); + ksft_test_result((unsigned long)ret == vec_size/2 && walk_end == (long)(mem + mem_size), "Walk_end sparse: Max pages specified\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, vec_size/2, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); - ksft_test_result(ret == vec_size/2 && walk_end == (long)(mem + mem_size), + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); + ksft_test_result((unsigned long)ret == vec_size/2 && walk_end == (long)(mem + mem_size), "Walk_endsparse : Half max pages\n"); ret = pagemap_ioc(mem, mem_size, vec, vec_size, 0, 1, PAGE_IS_WRITTEN, 0, 0, PAGE_IS_WRITTEN, &walk_end); if (ret < 0) - ksft_exit_fail_msg("error %d %d %s\n", ret, errno, strerror(errno)); + ksft_exit_fail_msg("error %ld %d %s\n", ret, errno, strerror(errno)); ksft_test_result(ret == 1 && walk_end == (long)(mem + page_size * 2), "Walk_end: 1 max page\n"); @@ -674,9 +676,10 @@ int sanity_tests_sd(void) return 0; } -int base_tests(char *prefix, char *mem, int mem_size, int skip) +int base_tests(char *prefix, char *mem, unsigned long long mem_size, int skip) { - int vec_size, written; + unsigned long long vec_size; + int written; struct page_region *vec, *vec2; if (skip) { @@ -799,8 +802,8 @@ int hpage_unit_tests(void) char *map; int ret, ret2; size_t num_pages = 10; - int map_size = hpage_size * num_pages; - int vec_size = map_size/page_size; + unsigned long long map_size = hpage_size * num_pages; + unsigned long long vec_size = map_size/page_size; struct page_region *vec, *vec2; vec = malloc(sizeof(struct page_region) * vec_size); @@ -1047,7 +1050,8 @@ static void test_simple(void) int sanity_tests(void) { - int mem_size, vec_size, ret, fd, i, buf_size; + unsigned long long mem_size, vec_size; + int ret, fd, i, buf_size; struct page_region *vec; char *mem, *fmem; struct stat sbuf; @@ -1312,7 +1316,9 @@ static ssize_t get_dirty_pages_reset(char *mem, unsigned int count, { struct pm_scan_arg arg = {0}; struct page_region rgns[256]; - int i, j, cnt, ret; + unsigned long long i, j; + long ret; + int cnt; arg.size = sizeof(struct pm_scan_arg); arg.start = (uintptr_t)mem; @@ -1330,7 +1336,7 @@ static ssize_t get_dirty_pages_reset(char *mem, unsigned int count, ksft_exit_fail_msg("ioctl failed\n"); cnt = 0; - for (i = 0; i < ret; ++i) { + for (i = 0; i < (unsigned long)ret; ++i) { if (rgns[i].categories != PAGE_IS_WRITTEN) ksft_exit_fail_msg("wrong flags\n"); @@ -1384,9 +1390,10 @@ void *thread_proc(void *mem) static void transact_test(int page_size) { unsigned int i, count, extra_pages; + unsigned int c; pthread_t th; char *mem; - int ret, c; + int ret; if (pthread_barrier_init(&start_barrier, NULL, nthreads + 1)) ksft_exit_fail_msg("pthread_barrier_init\n"); @@ -1405,9 +1412,9 @@ static void transact_test(int page_size) memset(mem, 0, 0x1000 * nthreads * pages_per_thread); count = get_dirty_pages_reset(mem, nthreads * pages_per_thread, 1, page_size); - ksft_test_result(count > 0, "%s count %d\n", __func__, count); + ksft_test_result(count > 0, "%s count %u\n", __func__, count); count = get_dirty_pages_reset(mem, nthreads * pages_per_thread, 1, page_size); - ksft_test_result(count == 0, "%s count %d\n", __func__, count); + ksft_test_result(count == 0, "%s count %u\n", __func__, count); finish = 0; for (i = 0; i < nthreads; ++i) @@ -1429,7 +1436,7 @@ static void transact_test(int page_size) ksft_exit_fail_msg("pthread_barrier_wait\n"); if (count > nthreads * access_per_thread) - ksft_exit_fail_msg("Too big count %d expected %d, iter %d\n", + ksft_exit_fail_msg("Too big count %u expected %u, iter %u\n", count, nthreads * access_per_thread, i); c = get_dirty_pages_reset(mem, nthreads * pages_per_thread, 1, page_size); @@ -1454,7 +1461,7 @@ static void transact_test(int page_size) * access and application gets page fault again for the same write. */ if (count < nthreads * access_per_thread) { - ksft_test_result_fail("Lost update, iter %d, %d vs %d.\n", i, count, + ksft_test_result_fail("Lost update, iter %u, %u vs %u.\n", i, count, nthreads * access_per_thread); return; } @@ -1467,15 +1474,16 @@ static void transact_test(int page_size) finish = 1; pthread_barrier_wait(&end_barrier); - ksft_test_result_pass("%s Extra pages %u (%.1lf%%), extra thread faults %d.\n", __func__, + ksft_test_result_pass("%s Extra pages %u (%.1lf%%), extra thread faults %u.\n", __func__, extra_pages, 100.0 * extra_pages / (iter_count * nthreads * access_per_thread), extra_thread_faults); } -int main(int argc, char *argv[]) +int main(int __attribute__((unused)) argc, char *argv[]) { - int mem_size, shmid, buf_size, fd, i, ret; + int shmid, buf_size, fd, i, ret; + unsigned long long mem_size; char *mem, *map, *fmem; struct stat sbuf; diff --git a/tools/testing/selftests/mm/pkey-arm64.h b/tools/testing/selftests/mm/pkey-arm64.h index d9d2100eafc0..8e9685e03c44 100644 --- a/tools/testing/selftests/mm/pkey-arm64.h +++ b/tools/testing/selftests/mm/pkey-arm64.h @@ -30,7 +30,7 @@ #define NR_PKEYS 8 #define NR_RESERVED_PKEYS 1 /* pkey-0 */ -#define PKEY_ALLOW_ALL 0x77777777 +#define PKEY_REG_ALLOW_ALL 0x77777777 #define PKEY_REG_ALLOW_NONE 0x0 #define PKEY_BITS_PER_PKEY 4 @@ -81,11 +81,11 @@ static inline int get_arch_reserved_keys(void) return NR_RESERVED_PKEYS; } -void expect_fault_on_read_execonly_key(void *p1, int pkey) +static inline void expect_fault_on_read_execonly_key(void *p1, int pkey) { } -void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) +static inline void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) { return PTR_ERR_ENOTSUP; } diff --git a/tools/testing/selftests/mm/pkey-helpers.h b/tools/testing/selftests/mm/pkey-helpers.h index f7cfe163b0ff..f080e97b39be 100644 --- a/tools/testing/selftests/mm/pkey-helpers.h +++ b/tools/testing/selftests/mm/pkey-helpers.h @@ -13,22 +13,22 @@ #include <ucontext.h> #include <sys/mman.h> +#include <linux/types.h> + #include "../kselftest.h" /* Define some kernel-like types */ -#define u8 __u8 -#define u16 __u16 -#define u32 __u32 -#define u64 __u64 +typedef __u8 u8; +typedef __u16 u16; +typedef __u32 u32; +typedef __u64 u64; #define PTR_ERR_ENOTSUP ((void *)-ENOTSUP) #ifndef DEBUG_LEVEL #define DEBUG_LEVEL 0 #endif -#define DPRINT_IN_SIGNAL_BUF_SIZE 4096 extern int dprint_in_signal; -extern char dprint_in_signal_buffer[DPRINT_IN_SIGNAL_BUF_SIZE]; extern int test_nr; extern int iteration_nr; @@ -83,17 +83,18 @@ extern void abort_hooks(void); #ifndef noinline # define noinline __attribute__((noinline)) #endif +#ifndef __maybe_unused +# define __maybe_unused __attribute__((__unused__)) +#endif -noinline int read_ptr(int *ptr) -{ - /* Keep GCC from optimizing this away somehow */ - barrier(); - return *ptr; -} - -void expected_pkey_fault(int pkey); int sys_pkey_alloc(unsigned long flags, unsigned long init_val); int sys_pkey_free(unsigned long pkey); +int sys_mprotect_pkey(void *ptr, size_t size, unsigned long orig_prot, + unsigned long pkey); + +/* For functions called from protection_keys.c only */ +noinline int read_ptr(int *ptr); +void expected_pkey_fault(int pkey); int mprotect_pkey(void *ptr, size_t size, unsigned long orig_prot, unsigned long pkey); void record_pkey_malloc(void *ptr, long size, int prot); @@ -171,38 +172,6 @@ static inline void write_pkey_reg(u64 pkey_reg) pkey_reg, __read_pkey_reg()); } -/* - * These are technically racy. since something could - * change PKEY register between the read and the write. - */ -static inline void __pkey_access_allow(int pkey, int do_allow) -{ - u64 pkey_reg = read_pkey_reg(); - int bit = pkey * 2; - - if (do_allow) - pkey_reg &= (1<<bit); - else - pkey_reg |= (1<<bit); - - dprintf4("pkey_reg now: %016llx\n", read_pkey_reg()); - write_pkey_reg(pkey_reg); -} - -static inline void __pkey_write_allow(int pkey, int do_allow_write) -{ - u64 pkey_reg = read_pkey_reg(); - int bit = pkey * 2 + 1; - - if (do_allow_write) - pkey_reg &= (1<<bit); - else - pkey_reg |= (1<<bit); - - write_pkey_reg(pkey_reg); - dprintf4("pkey_reg now: %016llx\n", read_pkey_reg()); -} - #define ALIGN_UP(x, align_to) (((x) + ((align_to)-1)) & ~((align_to)-1)) #define ALIGN_DOWN(x, align_to) ((x) & ~((align_to)-1)) #define ALIGN_PTR_UP(p, ptr_align_to) \ diff --git a/tools/testing/selftests/mm/pkey-powerpc.h b/tools/testing/selftests/mm/pkey-powerpc.h index 3d0c0bdae5bc..1bad310d282a 100644 --- a/tools/testing/selftests/mm/pkey-powerpc.h +++ b/tools/testing/selftests/mm/pkey-powerpc.h @@ -91,7 +91,7 @@ static inline int get_arch_reserved_keys(void) return NR_RESERVED_PKEYS_64K_3KEYS; } -void expect_fault_on_read_execonly_key(void *p1, int pkey) +static inline void expect_fault_on_read_execonly_key(void *p1, int pkey) { /* * powerpc does not allow userspace to change permissions of exec-only @@ -105,7 +105,7 @@ void expect_fault_on_read_execonly_key(void *p1, int pkey) /* 4-byte instructions * 16384 = 64K page */ #define __page_o_noops() asm(".rept 16384 ; nop; .endr") -void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) +static inline void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) { void *ptr; int ret; diff --git a/tools/testing/selftests/mm/pkey-x86.h b/tools/testing/selftests/mm/pkey-x86.h index ac91777c8917..f7ecd335df1e 100644 --- a/tools/testing/selftests/mm/pkey-x86.h +++ b/tools/testing/selftests/mm/pkey-x86.h @@ -113,7 +113,7 @@ static inline u32 pkey_bit_position(int pkey) #define XSTATE_PKEY 0x200 #define XSTATE_BV_OFFSET 512 -int pkey_reg_xstate_offset(void) +static inline int pkey_reg_xstate_offset(void) { unsigned int eax; unsigned int ebx; @@ -148,7 +148,7 @@ static inline int get_arch_reserved_keys(void) return NR_RESERVED_PKEYS; } -void expect_fault_on_read_execonly_key(void *p1, int pkey) +static inline void expect_fault_on_read_execonly_key(void *p1, int pkey) { int ptr_contents; @@ -157,7 +157,7 @@ void expect_fault_on_read_execonly_key(void *p1, int pkey) expected_pkey_fault(pkey); } -void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) +static inline void *malloc_pkey_with_mprotect_subpage(long size, int prot, u16 pkey) { return PTR_ERR_ENOTSUP; } diff --git a/tools/testing/selftests/mm/pkey_sighandler_tests.c b/tools/testing/selftests/mm/pkey_sighandler_tests.c index c593a426341c..1ac8c8809880 100644 --- a/tools/testing/selftests/mm/pkey_sighandler_tests.c +++ b/tools/testing/selftests/mm/pkey_sighandler_tests.c @@ -32,11 +32,9 @@ #define STACK_SIZE PTHREAD_STACK_MIN -void expected_pkey_fault(int pkey) {} - -pthread_mutex_t mutex = PTHREAD_MUTEX_INITIALIZER; -pthread_cond_t cond = PTHREAD_COND_INITIALIZER; -siginfo_t siginfo = {0}; +static pthread_mutex_t mutex = PTHREAD_MUTEX_INITIALIZER; +static pthread_cond_t cond = PTHREAD_COND_INITIALIZER; +static siginfo_t siginfo = {0}; /* * We need to use inline assembly instead of glibc's syscall because glibc's @@ -163,7 +161,7 @@ static void *thread_segv_with_pkey0_disabled(void *ptr) __write_pkey_reg(pkey_reg_restrictive_default()); /* Segfault (with SEGV_MAPERR) */ - *(int *) (0x1) = 1; + *(volatile int *)NULL = 1; return NULL; } @@ -179,7 +177,6 @@ static void *thread_segv_pkuerr_stack(void *ptr) static void *thread_segv_maperr_ptr(void *ptr) { stack_t *stack = ptr; - int *bad = (int *)1; u64 pkey_reg; /* @@ -195,7 +192,7 @@ static void *thread_segv_maperr_ptr(void *ptr) __write_pkey_reg(pkey_reg); /* Segfault */ - *bad = 1; + *(volatile int *)NULL = 1; syscall_raw(SYS_exit, 0, 0, 0, 0, 0, 0); return NULL; } @@ -234,7 +231,7 @@ static void test_sigsegv_handler_with_pkey0_disabled(void) ksft_test_result(siginfo.si_signo == SIGSEGV && siginfo.si_code == SEGV_MAPERR && - siginfo.si_addr == (void *)1, + siginfo.si_addr == NULL, "%s\n", __func__); } @@ -314,11 +311,11 @@ static void test_sigsegv_handler_with_different_pkey_for_stack(void) __write_pkey_reg(pkey_reg); /* Protect the new stack with MPK 1 */ - pkey = pkey_alloc(0, 0); - pkey_mprotect(stack, STACK_SIZE, PROT_READ | PROT_WRITE, pkey); + pkey = sys_pkey_alloc(0, 0); + sys_mprotect_pkey(stack, STACK_SIZE, PROT_READ | PROT_WRITE, pkey); /* Set up alternate signal stack that will use the default MPK */ - sigstack.ss_sp = mmap(0, STACK_SIZE, PROT_READ | PROT_WRITE | PROT_EXEC, + sigstack.ss_sp = mmap(0, STACK_SIZE, PROT_READ | PROT_WRITE, MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); sigstack.ss_flags = 0; sigstack.ss_size = STACK_SIZE; @@ -349,7 +346,7 @@ static void test_sigsegv_handler_with_different_pkey_for_stack(void) ksft_test_result(siginfo.si_signo == SIGSEGV && siginfo.si_code == SEGV_MAPERR && - siginfo.si_addr == (void *)1, + siginfo.si_addr == NULL, "%s\n", __func__); } @@ -487,11 +484,11 @@ static void test_pkru_sigreturn(void) __write_pkey_reg(pkey_reg); /* Protect the stack with MPK 2 */ - pkey = pkey_alloc(0, 0); - pkey_mprotect(stack, STACK_SIZE, PROT_READ | PROT_WRITE, pkey); + pkey = sys_pkey_alloc(0, 0); + sys_mprotect_pkey(stack, STACK_SIZE, PROT_READ | PROT_WRITE, pkey); /* Set up alternate signal stack that will use the default MPK */ - sigstack.ss_sp = mmap(0, STACK_SIZE, PROT_READ | PROT_WRITE | PROT_EXEC, + sigstack.ss_sp = mmap(0, STACK_SIZE, PROT_READ | PROT_WRITE, MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); sigstack.ss_flags = 0; sigstack.ss_size = STACK_SIZE; @@ -538,6 +535,9 @@ int main(int argc, char *argv[]) ksft_print_header(); ksft_set_plan(ARRAY_SIZE(pkey_tests)); + if (!is_pkeys_supported()) + ksft_exit_skip("pkeys not supported\n"); + for (i = 0; i < ARRAY_SIZE(pkey_tests); i++) (*pkey_tests[i])(); diff --git a/tools/testing/selftests/mm/pkey_util.c b/tools/testing/selftests/mm/pkey_util.c new file mode 100644 index 000000000000..ca4ad0d44ab2 --- /dev/null +++ b/tools/testing/selftests/mm/pkey_util.c @@ -0,0 +1,40 @@ +// SPDX-License-Identifier: GPL-2.0-only +#include <sys/syscall.h> +#include <unistd.h> + +#include "pkey-helpers.h" + +int sys_pkey_alloc(unsigned long flags, unsigned long init_val) +{ + int ret = syscall(SYS_pkey_alloc, flags, init_val); + dprintf1("%s(flags=%lx, init_val=%lx) syscall ret: %d errno: %d\n", + __func__, flags, init_val, ret, errno); + return ret; +} + +int sys_pkey_free(unsigned long pkey) +{ + int ret = syscall(SYS_pkey_free, pkey); + dprintf1("%s(pkey=%ld) syscall ret: %d\n", __func__, pkey, ret); + return ret; +} + +int sys_mprotect_pkey(void *ptr, size_t size, unsigned long orig_prot, + unsigned long pkey) +{ + int sret; + + dprintf2("%s(0x%p, %zx, prot=%lx, pkey=%lx)\n", __func__, + ptr, size, orig_prot, pkey); + + errno = 0; + sret = syscall(__NR_pkey_mprotect, ptr, size, orig_prot, pkey); + if (errno) { + dprintf2("SYS_mprotect_key sret: %d\n", sret); + dprintf2("SYS_mprotect_key prot: 0x%lx\n", orig_prot); + dprintf2("SYS_mprotect_key failed, errno: %d\n", errno); + if (DEBUG_LEVEL >= 2) + perror("SYS_mprotect_pkey"); + } + return sret; +} diff --git a/tools/testing/selftests/mm/protection_keys.c b/tools/testing/selftests/mm/protection_keys.c index 4990f7ab4cb7..a4683f2476f2 100644 --- a/tools/testing/selftests/mm/protection_keys.c +++ b/tools/testing/selftests/mm/protection_keys.c @@ -53,9 +53,15 @@ int test_nr; u64 shadow_pkey_reg; int dprint_in_signal; -char dprint_in_signal_buffer[DPRINT_IN_SIGNAL_BUF_SIZE]; -void cat_into_file(char *str, char *file) +noinline int read_ptr(int *ptr) +{ + /* Keep GCC from optimizing this away somehow */ + barrier(); + return *ptr; +} + +static void cat_into_file(char *str, char *file) { int fd = open(file, O_RDWR); int ret; @@ -82,7 +88,7 @@ void cat_into_file(char *str, char *file) #if CONTROL_TRACING > 0 static int warned_tracing; -int tracing_root_ok(void) +static int tracing_root_ok(void) { if (geteuid() != 0) { if (!warned_tracing) @@ -95,7 +101,7 @@ int tracing_root_ok(void) } #endif -void tracing_on(void) +static void tracing_on(void) { #if CONTROL_TRACING > 0 #define TRACEDIR "/sys/kernel/tracing" @@ -119,7 +125,7 @@ void tracing_on(void) #endif } -void tracing_off(void) +static void tracing_off(void) { #if CONTROL_TRACING > 0 if (!tracing_root_ok()) @@ -153,7 +159,7 @@ __attribute__((__aligned__(65536))) #else __attribute__((__aligned__(PAGE_SIZE))) #endif -void lots_o_noops_around_write(int *write_to_me) +static void lots_o_noops_around_write(int *write_to_me) { dprintf3("running %s()\n", __func__); __page_o_noops(); @@ -164,7 +170,7 @@ void lots_o_noops_around_write(int *write_to_me) dprintf3("%s() done\n", __func__); } -void dump_mem(void *dumpme, int len_bytes) +static void dump_mem(void *dumpme, int len_bytes) { char *c = (void *)dumpme; int i; @@ -207,7 +213,7 @@ static int hw_pkey_set(int pkey, unsigned long rights, unsigned long flags) return 0; } -void pkey_disable_set(int pkey, int flags) +static void pkey_disable_set(int pkey, int flags) { unsigned long syscall_flags = 0; int ret; @@ -245,7 +251,7 @@ void pkey_disable_set(int pkey, int flags) pkey, flags); } -void pkey_disable_clear(int pkey, int flags) +static void pkey_disable_clear(int pkey, int flags) { unsigned long syscall_flags = 0; int ret; @@ -271,19 +277,19 @@ void pkey_disable_clear(int pkey, int flags) pkey, read_pkey_reg()); } -void pkey_write_allow(int pkey) +__maybe_unused static void pkey_write_allow(int pkey) { pkey_disable_clear(pkey, PKEY_DISABLE_WRITE); } -void pkey_write_deny(int pkey) +__maybe_unused static void pkey_write_deny(int pkey) { pkey_disable_set(pkey, PKEY_DISABLE_WRITE); } -void pkey_access_allow(int pkey) +__maybe_unused static void pkey_access_allow(int pkey) { pkey_disable_clear(pkey, PKEY_DISABLE_ACCESS); } -void pkey_access_deny(int pkey) +__maybe_unused static void pkey_access_deny(int pkey) { pkey_disable_set(pkey, PKEY_DISABLE_ACCESS); } @@ -301,9 +307,9 @@ static char *si_code_str(int si_code) return "UNKNOWN"; } -int pkey_faults; -int last_si_pkey = -1; -void signal_handler(int signum, siginfo_t *si, void *vucontext) +static int pkey_faults; +static int last_si_pkey = -1; +static void signal_handler(int signum, siginfo_t *si, void *vucontext) { ucontext_t *uctxt = vucontext; int trapno; @@ -390,27 +396,21 @@ void signal_handler(int signum, siginfo_t *si, void *vucontext) /* restore access and let the faulting instruction continue */ pkey_access_allow(siginfo_pkey); #elif defined(__aarch64__) - aarch64_write_signal_pkey(uctxt, PKEY_ALLOW_ALL); + aarch64_write_signal_pkey(uctxt, PKEY_REG_ALLOW_ALL); #endif /* arch */ pkey_faults++; dprintf1("<<<<==================================================\n"); dprint_in_signal = 0; } -int wait_all_children(void) -{ - int status; - return waitpid(-1, &status, 0); -} - -void sig_chld(int x) +static void sig_chld(int x) { dprint_in_signal = 1; dprintf2("[%d] SIGCHLD: %d\n", getpid(), x); dprint_in_signal = 0; } -void setup_sigsegv_handler(void) +static void setup_sigsegv_handler(void) { int r, rs; struct sigaction newact; @@ -436,13 +436,13 @@ void setup_sigsegv_handler(void) pkey_assert(r == 0); } -void setup_handlers(void) +static void setup_handlers(void) { signal(SIGCHLD, &sig_chld); setup_sigsegv_handler(); } -pid_t fork_lazy_child(void) +static pid_t fork_lazy_child(void) { pid_t forkret; @@ -460,35 +460,7 @@ pid_t fork_lazy_child(void) return forkret; } -int sys_mprotect_pkey(void *ptr, size_t size, unsigned long orig_prot, - unsigned long pkey) -{ - int sret; - - dprintf2("%s(0x%p, %zx, prot=%lx, pkey=%lx)\n", __func__, - ptr, size, orig_prot, pkey); - - errno = 0; - sret = syscall(__NR_pkey_mprotect, ptr, size, orig_prot, pkey); - if (errno) { - dprintf2("SYS_mprotect_key sret: %d\n", sret); - dprintf2("SYS_mprotect_key prot: 0x%lx\n", orig_prot); - dprintf2("SYS_mprotect_key failed, errno: %d\n", errno); - if (DEBUG_LEVEL >= 2) - perror("SYS_mprotect_pkey"); - } - return sret; -} - -int sys_pkey_alloc(unsigned long flags, unsigned long init_val) -{ - int ret = syscall(SYS_pkey_alloc, flags, init_val); - dprintf1("%s(flags=%lx, init_val=%lx) syscall ret: %d errno: %d\n", - __func__, flags, init_val, ret, errno); - return ret; -} - -int alloc_pkey(void) +static int alloc_pkey(void) { int ret; unsigned long init_val = 0x0; @@ -534,19 +506,12 @@ int alloc_pkey(void) return ret; } -int sys_pkey_free(unsigned long pkey) -{ - int ret = syscall(SYS_pkey_free, pkey); - dprintf1("%s(pkey=%ld) syscall ret: %d\n", __func__, pkey, ret); - return ret; -} - /* * I had a bug where pkey bits could be set by mprotect() but * not cleared. This ensures we get lots of random bit sets * and clears on the vma and pte pkey bits. */ -int alloc_random_pkey(void) +static int alloc_random_pkey(void) { int max_nr_pkey_allocs; int ret; @@ -629,7 +594,7 @@ struct pkey_malloc_record { }; struct pkey_malloc_record *pkey_malloc_records; struct pkey_malloc_record *pkey_last_malloc_record; -long nr_pkey_malloc_records; +static long nr_pkey_malloc_records; void record_pkey_malloc(void *ptr, long size, int prot) { long i; @@ -667,7 +632,7 @@ void record_pkey_malloc(void *ptr, long size, int prot) nr_pkey_malloc_records++; } -void free_pkey_malloc(void *ptr) +static void free_pkey_malloc(void *ptr) { long i; int ret; @@ -694,8 +659,7 @@ void free_pkey_malloc(void *ptr) pkey_assert(false); } - -void *malloc_pkey_with_mprotect(long size, int prot, u16 pkey) +static void *malloc_pkey_with_mprotect(long size, int prot, u16 pkey) { void *ptr; int ret; @@ -715,7 +679,7 @@ void *malloc_pkey_with_mprotect(long size, int prot, u16 pkey) return ptr; } -void *malloc_pkey_anon_huge(long size, int prot, u16 pkey) +static void *malloc_pkey_anon_huge(long size, int prot, u16 pkey) { int ret; void *ptr; @@ -745,10 +709,10 @@ void *malloc_pkey_anon_huge(long size, int prot, u16 pkey) return ptr; } -int hugetlb_setup_ok; +static int hugetlb_setup_ok; #define SYSFS_FMT_NR_HUGE_PAGES "/sys/kernel/mm/hugepages/hugepages-%ldkB/nr_hugepages" #define GET_NR_HUGE_PAGES 10 -void setup_hugetlbfs(void) +static void setup_hugetlbfs(void) { int err; int fd; @@ -796,7 +760,7 @@ void setup_hugetlbfs(void) hugetlb_setup_ok = 1; } -void *malloc_pkey_hugetlb(long size, int prot, u16 pkey) +static void *malloc_pkey_hugetlb(long size, int prot, u16 pkey) { void *ptr; int flags = MAP_ANONYMOUS|MAP_PRIVATE|MAP_HUGETLB; @@ -817,42 +781,15 @@ void *malloc_pkey_hugetlb(long size, int prot, u16 pkey) return ptr; } -void *malloc_pkey_mmap_dax(long size, int prot, u16 pkey) -{ - void *ptr; - int fd; - - dprintf1("doing %s(size=%ld, prot=0x%x, pkey=%d)\n", __func__, - size, prot, pkey); - pkey_assert(pkey < NR_PKEYS); - fd = open("/dax/foo", O_RDWR); - pkey_assert(fd >= 0); - - ptr = mmap(0, size, prot, MAP_SHARED, fd, 0); - pkey_assert(ptr != (void *)-1); - - mprotect_pkey(ptr, size, prot, pkey); - - record_pkey_malloc(ptr, size, prot); - - dprintf1("mmap()'d for pkey %d @ %p\n", pkey, ptr); - close(fd); - return ptr; -} - -void *(*pkey_malloc[])(long size, int prot, u16 pkey) = { +static void *(*pkey_malloc[])(long size, int prot, u16 pkey) = { malloc_pkey_with_mprotect, malloc_pkey_with_mprotect_subpage, malloc_pkey_anon_huge, malloc_pkey_hugetlb -/* can not do direct with the pkey_mprotect() API: - malloc_pkey_mmap_direct, - malloc_pkey_mmap_dax, -*/ }; -void *malloc_pkey(long size, int prot, u16 pkey) +static void *malloc_pkey(long size, int prot, u16 pkey) { void *ret; static int malloc_type; @@ -882,7 +819,7 @@ void *malloc_pkey(long size, int prot, u16 pkey) return ret; } -int last_pkey_faults; +static int last_pkey_faults; #define UNKNOWN_PKEY -2 void expected_pkey_fault(int pkey) { @@ -905,7 +842,7 @@ void expected_pkey_fault(int pkey) */ if (__read_pkey_reg() != 0) #elif defined(__aarch64__) - if (__read_pkey_reg() != PKEY_ALLOW_ALL) + if (__read_pkey_reg() != PKEY_REG_ALLOW_ALL) #else if (__read_pkey_reg() != shadow_pkey_reg) #endif /* arch */ @@ -924,9 +861,9 @@ void expected_pkey_fault(int pkey) pkey_assert(last_pkey_faults == pkey_faults); \ } while (0) -int test_fds[10] = { -1 }; -int nr_test_fds; -void __save_test_fd(int fd) +static int test_fds[10] = { -1 }; +static int nr_test_fds; +static void __save_test_fd(int fd) { pkey_assert(fd >= 0); pkey_assert(nr_test_fds < ARRAY_SIZE(test_fds)); @@ -934,14 +871,14 @@ void __save_test_fd(int fd) nr_test_fds++; } -int get_test_read_fd(void) +static int get_test_read_fd(void) { int test_fd = open("/etc/passwd", O_RDONLY); __save_test_fd(test_fd); return test_fd; } -void close_test_fds(void) +static void close_test_fds(void) { int i; @@ -954,7 +891,7 @@ void close_test_fds(void) nr_test_fds = 0; } -void test_pkey_alloc_free_attach_pkey0(int *ptr, u16 pkey) +static void test_pkey_alloc_free_attach_pkey0(int *ptr, u16 pkey) { int i, err; int max_nr_pkey_allocs; @@ -1006,7 +943,7 @@ void test_pkey_alloc_free_attach_pkey0(int *ptr, u16 pkey) pkey_assert(!err); } -void test_read_of_write_disabled_region(int *ptr, u16 pkey) +static void test_read_of_write_disabled_region(int *ptr, u16 pkey) { int ptr_contents; @@ -1016,7 +953,7 @@ void test_read_of_write_disabled_region(int *ptr, u16 pkey) dprintf1("*ptr: %d\n", ptr_contents); dprintf1("\n"); } -void test_read_of_access_disabled_region(int *ptr, u16 pkey) +static void test_read_of_access_disabled_region(int *ptr, u16 pkey) { int ptr_contents; @@ -1028,7 +965,7 @@ void test_read_of_access_disabled_region(int *ptr, u16 pkey) expected_pkey_fault(pkey); } -void test_read_of_access_disabled_region_with_page_already_mapped(int *ptr, +static void test_read_of_access_disabled_region_with_page_already_mapped(int *ptr, u16 pkey) { int ptr_contents; @@ -1045,7 +982,7 @@ void test_read_of_access_disabled_region_with_page_already_mapped(int *ptr, expected_pkey_fault(pkey); } -void test_write_of_write_disabled_region_with_page_already_mapped(int *ptr, +static void test_write_of_write_disabled_region_with_page_already_mapped(int *ptr, u16 pkey) { *ptr = __LINE__; @@ -1056,14 +993,14 @@ void test_write_of_write_disabled_region_with_page_already_mapped(int *ptr, expected_pkey_fault(pkey); } -void test_write_of_write_disabled_region(int *ptr, u16 pkey) +static void test_write_of_write_disabled_region(int *ptr, u16 pkey) { dprintf1("disabling write access to PKEY[%02d], doing write\n", pkey); pkey_write_deny(pkey); *ptr = __LINE__; expected_pkey_fault(pkey); } -void test_write_of_access_disabled_region(int *ptr, u16 pkey) +static void test_write_of_access_disabled_region(int *ptr, u16 pkey) { dprintf1("disabling access to PKEY[%02d], doing write\n", pkey); pkey_access_deny(pkey); @@ -1071,7 +1008,7 @@ void test_write_of_access_disabled_region(int *ptr, u16 pkey) expected_pkey_fault(pkey); } -void test_write_of_access_disabled_region_with_page_already_mapped(int *ptr, +static void test_write_of_access_disabled_region_with_page_already_mapped(int *ptr, u16 pkey) { *ptr = __LINE__; @@ -1082,7 +1019,7 @@ void test_write_of_access_disabled_region_with_page_already_mapped(int *ptr, expected_pkey_fault(pkey); } -void test_kernel_write_of_access_disabled_region(int *ptr, u16 pkey) +static void test_kernel_write_of_access_disabled_region(int *ptr, u16 pkey) { int ret; int test_fd = get_test_read_fd(); @@ -1094,7 +1031,8 @@ void test_kernel_write_of_access_disabled_region(int *ptr, u16 pkey) dprintf1("read ret: %d\n", ret); pkey_assert(ret); } -void test_kernel_write_of_write_disabled_region(int *ptr, u16 pkey) + +static void test_kernel_write_of_write_disabled_region(int *ptr, u16 pkey) { int ret; int test_fd = get_test_read_fd(); @@ -1107,7 +1045,7 @@ void test_kernel_write_of_write_disabled_region(int *ptr, u16 pkey) pkey_assert(ret); } -void test_kernel_gup_of_access_disabled_region(int *ptr, u16 pkey) +static void test_kernel_gup_of_access_disabled_region(int *ptr, u16 pkey) { int pipe_ret, vmsplice_ret; struct iovec iov; @@ -1129,7 +1067,7 @@ void test_kernel_gup_of_access_disabled_region(int *ptr, u16 pkey) close(pipe_fds[1]); } -void test_kernel_gup_write_to_write_disabled_region(int *ptr, u16 pkey) +static void test_kernel_gup_write_to_write_disabled_region(int *ptr, u16 pkey) { int ignored = 0xdada; int futex_ret; @@ -1147,7 +1085,7 @@ void test_kernel_gup_write_to_write_disabled_region(int *ptr, u16 pkey) } /* Assumes that all pkeys other than 'pkey' are unallocated */ -void test_pkey_syscalls_on_non_allocated_pkey(int *ptr, u16 pkey) +static void test_pkey_syscalls_on_non_allocated_pkey(int *ptr, u16 pkey) { int err; int i; @@ -1170,7 +1108,7 @@ void test_pkey_syscalls_on_non_allocated_pkey(int *ptr, u16 pkey) } /* Assumes that all pkeys other than 'pkey' are unallocated */ -void test_pkey_syscalls_bad_args(int *ptr, u16 pkey) +static void test_pkey_syscalls_bad_args(int *ptr, u16 pkey) { int err; int bad_pkey = NR_PKEYS+99; @@ -1180,7 +1118,7 @@ void test_pkey_syscalls_bad_args(int *ptr, u16 pkey) pkey_assert(err); } -void become_child(void) +static void become_child(void) { pid_t forkret; @@ -1196,7 +1134,7 @@ void become_child(void) } /* Assumes that all pkeys other than 'pkey' are unallocated */ -void test_pkey_alloc_exhaust(int *ptr, u16 pkey) +static void test_pkey_alloc_exhaust(int *ptr, u16 pkey) { int err; int allocated_pkeys[NR_PKEYS] = {0}; @@ -1263,7 +1201,7 @@ void test_pkey_alloc_exhaust(int *ptr, u16 pkey) } } -void arch_force_pkey_reg_init(void) +static void arch_force_pkey_reg_init(void) { #if defined(__i386__) || defined(__x86_64__) /* arch */ u64 *buf; @@ -1302,7 +1240,7 @@ void arch_force_pkey_reg_init(void) * a long-running test that continually checks the pkey * register. */ -void test_pkey_init_state(int *ptr, u16 pkey) +static void test_pkey_init_state(int *ptr, u16 pkey) { int err; int allocated_pkeys[NR_PKEYS] = {0}; @@ -1340,7 +1278,7 @@ void test_pkey_init_state(int *ptr, u16 pkey) * have to call pkey_alloc() to use it first. Make sure that it * is usable. */ -void test_mprotect_with_pkey_0(int *ptr, u16 pkey) +static void test_mprotect_with_pkey_0(int *ptr, u16 pkey) { long size; int prot; @@ -1364,7 +1302,7 @@ void test_mprotect_with_pkey_0(int *ptr, u16 pkey) mprotect_pkey(ptr, size, prot, pkey); } -void test_ptrace_of_child(int *ptr, u16 pkey) +static void test_ptrace_of_child(int *ptr, u16 pkey) { __attribute__((__unused__)) int peek_result; pid_t child_pid; @@ -1440,7 +1378,7 @@ void test_ptrace_of_child(int *ptr, u16 pkey) free(plain_ptr_unaligned); } -void *get_pointer_to_instructions(void) +static void *get_pointer_to_instructions(void) { void *p1; @@ -1461,7 +1399,7 @@ void *get_pointer_to_instructions(void) return p1; } -void test_executing_on_unreadable_memory(int *ptr, u16 pkey) +static void test_executing_on_unreadable_memory(int *ptr, u16 pkey) { void *p1; int scratch; @@ -1493,7 +1431,7 @@ void test_executing_on_unreadable_memory(int *ptr, u16 pkey) pkey_assert(!ret); } -void test_implicit_mprotect_exec_only_memory(int *ptr, u16 pkey) +static void test_implicit_mprotect_exec_only_memory(int *ptr, u16 pkey) { void *p1; int scratch; @@ -1542,7 +1480,7 @@ void test_implicit_mprotect_exec_only_memory(int *ptr, u16 pkey) } #if defined(__i386__) || defined(__x86_64__) -void test_ptrace_modifies_pkru(int *ptr, u16 pkey) +static void test_ptrace_modifies_pkru(int *ptr, u16 pkey) { u32 new_pkru; pid_t child; @@ -1665,7 +1603,7 @@ void test_ptrace_modifies_pkru(int *ptr, u16 pkey) #endif #if defined(__aarch64__) -void test_ptrace_modifies_pkru(int *ptr, u16 pkey) +static void test_ptrace_modifies_pkru(int *ptr, u16 pkey) { pid_t child; int status, ret; @@ -1742,7 +1680,7 @@ void test_ptrace_modifies_pkru(int *ptr, u16 pkey) } #endif -void test_mprotect_pkey_on_unsupported_cpu(int *ptr, u16 pkey) +static void test_mprotect_pkey_on_unsupported_cpu(int *ptr, u16 pkey) { int size = PAGE_SIZE; int sret; @@ -1756,7 +1694,7 @@ void test_mprotect_pkey_on_unsupported_cpu(int *ptr, u16 pkey) pkey_assert(sret < 0); } -void (*pkey_tests[])(int *ptr, u16 pkey) = { +static void (*pkey_tests[])(int *ptr, u16 pkey) = { test_read_of_write_disabled_region, test_read_of_access_disabled_region, test_read_of_access_disabled_region_with_page_already_mapped, @@ -1782,7 +1720,7 @@ void (*pkey_tests[])(int *ptr, u16 pkey) = { #endif }; -void run_tests_once(void) +static void run_tests_once(void) { int *ptr; int prot = PROT_READ|PROT_WRITE; @@ -1816,7 +1754,7 @@ void run_tests_once(void) iteration_nr++; } -void pkey_setup_shadow(void) +static void pkey_setup_shadow(void) { shadow_pkey_reg = __read_pkey_reg(); } diff --git a/tools/testing/selftests/mm/run_vmtests.sh b/tools/testing/selftests/mm/run_vmtests.sh index 2fc290d9430c..da7e26668103 100755 --- a/tools/testing/selftests/mm/run_vmtests.sh +++ b/tools/testing/selftests/mm/run_vmtests.sh @@ -45,6 +45,8 @@ separated by spaces: vmalloc smoke tests - hmm hmm smoke tests +- madv_guard + test madvise(2) MADV_GUARD_INSTALL and MADV_GUARD_REMOVE options - madv_populate test memadvise(2) MADV_POPULATE_{READ,WRITE} options - memfd_secret @@ -218,7 +220,7 @@ run_test() { if test_selected ${CATEGORY}; then # On memory constrainted systems some tests can fail to allocate hugepages. # perform some cleanup before the test for a higher success rate. - if [ ${CATEGORY} == "thp" ] | [ ${CATEGORY} == "hugetlb" ]; then + if [ ${CATEGORY} == "thp" -o ${CATEGORY} == "hugetlb" ]; then echo 3 > /proc/sys/vm/drop_caches sleep 2 echo 1 > /proc/sys/vm/compact_memory @@ -307,6 +309,7 @@ CATEGORY="userfaultfd" run_test ${uffd_stress_bin} hugetlb "$half_ufd_size_MB" 3 CATEGORY="userfaultfd" run_test ${uffd_stress_bin} hugetlb-private "$half_ufd_size_MB" 32 CATEGORY="userfaultfd" run_test ${uffd_stress_bin} shmem 20 16 CATEGORY="userfaultfd" run_test ${uffd_stress_bin} shmem-private 20 16 +CATEGORY="userfaultfd" run_test ./uffd-wp-mremap #cleanup echo "$nr_hugepgs" > /proc/sys/vm/nr_hugepages @@ -375,6 +378,9 @@ CATEGORY="mremap" run_test ./mremap_dontunmap CATEGORY="hmm" run_test bash ./test_hmm.sh smoke +# MADV_GUARD_INSTALL and MADV_GUARD_REMOVE tests +CATEGORY="madv_guard" run_test ./guard-pages + # MADV_POPULATE_READ and MADV_POPULATE_WRITE tests CATEGORY="madv_populate" run_test ./madv_populate diff --git a/tools/testing/selftests/mm/seal_elf.c b/tools/testing/selftests/mm/seal_elf.c deleted file mode 100644 index d9f8ba8d5050..000000000000 --- a/tools/testing/selftests/mm/seal_elf.c +++ /dev/null @@ -1,137 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0 -#define _GNU_SOURCE -#include <sys/mman.h> -#include <stdint.h> -#include <asm-generic/unistd.h> -#include <string.h> -#include <sys/time.h> -#include <sys/resource.h> -#include <stdbool.h> -#include "../kselftest.h" -#include <syscall.h> -#include <errno.h> -#include <stdio.h> -#include <stdlib.h> -#include <fcntl.h> -#include <sys/ioctl.h> -#include <sys/vfs.h> -#include <sys/stat.h> -#include "mseal_helpers.h" - -/* - * define sys_xyx to call syscall directly. - */ -static int sys_mseal(void *start, size_t len) -{ - int sret; - - errno = 0; - sret = syscall(__NR_mseal, start, len, 0); - return sret; -} - -static inline int sys_mprotect(void *ptr, size_t size, unsigned long prot) -{ - int sret; - - errno = 0; - sret = syscall(__NR_mprotect, ptr, size, prot); - return sret; -} - -static bool seal_support(void) -{ - int ret; - void *ptr; - unsigned long page_size = getpagesize(); - - ptr = mmap(NULL, page_size, PROT_READ, MAP_ANONYMOUS | MAP_PRIVATE, -1, 0); - if (ptr == (void *) -1) - return false; - - ret = sys_mseal(ptr, page_size); - if (ret < 0) - return false; - - return true; -} - -const char somestr[4096] = {"READONLY"}; - -static void test_seal_elf(void) -{ - int ret; - FILE *maps; - char line[512]; - uintptr_t addr_start, addr_end; - char prot[5]; - char filename[256]; - unsigned long page_size = getpagesize(); - unsigned long long ptr = (unsigned long long) somestr; - char *somestr2 = (char *)somestr; - - /* - * Modify the protection of readonly somestr - */ - if (((unsigned long long)ptr % page_size) != 0) - ptr = (unsigned long long)ptr & ~(page_size - 1); - - ksft_print_msg("somestr = %s\n", somestr); - ksft_print_msg("change protection to rw\n"); - ret = sys_mprotect((void *)ptr, page_size, PROT_READ|PROT_WRITE); - FAIL_TEST_IF_FALSE(!ret); - *somestr2 = 'A'; - ksft_print_msg("somestr is modified to: %s\n", somestr); - ret = sys_mprotect((void *)ptr, page_size, PROT_READ); - FAIL_TEST_IF_FALSE(!ret); - - maps = fopen("/proc/self/maps", "r"); - FAIL_TEST_IF_FALSE(maps); - - /* - * apply sealing to elf binary - */ - while (fgets(line, sizeof(line), maps)) { - if (sscanf(line, "%lx-%lx %4s %*x %*x:%*x %*u %255[^\n]", - &addr_start, &addr_end, prot, filename) == 4) { - if (strlen(filename)) { - /* - * seal the mapping if read only. - */ - if (strstr(prot, "r-")) { - ret = sys_mseal((void *)addr_start, addr_end - addr_start); - FAIL_TEST_IF_FALSE(!ret); - ksft_print_msg("sealed: %lx-%lx %s %s\n", - addr_start, addr_end, prot, filename); - if ((uintptr_t) somestr >= addr_start && - (uintptr_t) somestr <= addr_end) - ksft_print_msg("mapping for somestr found\n"); - } - } - } - } - fclose(maps); - - ret = sys_mprotect((void *)ptr, page_size, PROT_READ | PROT_WRITE); - FAIL_TEST_IF_FALSE(ret < 0); - ksft_print_msg("somestr is sealed, mprotect is rejected\n"); - - REPORT_TEST_PASS(); -} - -int main(int argc, char **argv) -{ - bool test_seal = seal_support(); - - ksft_print_header(); - ksft_print_msg("pid=%d\n", getpid()); - - if (!test_seal) - ksft_exit_skip("sealing not supported, check CONFIG_64BIT\n"); - - ksft_set_plan(1); - - test_seal_elf(); - - ksft_finished(); -} diff --git a/tools/testing/selftests/mm/soft-dirty.c b/tools/testing/selftests/mm/soft-dirty.c index bdfa5d085f00..8e1462ce0532 100644 --- a/tools/testing/selftests/mm/soft-dirty.c +++ b/tools/testing/selftests/mm/soft-dirty.c @@ -128,7 +128,7 @@ static void test_mprotect(int pagemap_fd, int pagesize, bool anon) { const char *type[] = {"file", "anon"}; const char *fname = "./soft-dirty-test-file"; - int test_fd; + int test_fd = 0; char *map; if (anon) { diff --git a/tools/testing/selftests/mm/split_huge_page_test.c b/tools/testing/selftests/mm/split_huge_page_test.c index eb6d1b9fc362..3f353f3d070f 100644 --- a/tools/testing/selftests/mm/split_huge_page_test.c +++ b/tools/testing/selftests/mm/split_huge_page_test.c @@ -108,38 +108,28 @@ static void verify_rss_anon_split_huge_page_all_zeroes(char *one_page, int nr_hp unsigned long rss_anon_before, rss_anon_after; size_t i; - if (!check_huge_anon(one_page, 4, pmd_pagesize)) { - printf("No THP is allocated\n"); - exit(EXIT_FAILURE); - } + if (!check_huge_anon(one_page, 4, pmd_pagesize)) + ksft_exit_fail_msg("No THP is allocated\n"); rss_anon_before = rss_anon(); - if (!rss_anon_before) { - printf("No RssAnon is allocated before split\n"); - exit(EXIT_FAILURE); - } + if (!rss_anon_before) + ksft_exit_fail_msg("No RssAnon is allocated before split\n"); /* split all THPs */ write_debugfs(PID_FMT, getpid(), (uint64_t)one_page, (uint64_t)one_page + len, 0); for (i = 0; i < len; i++) - if (one_page[i] != (char)0) { - printf("%ld byte corrupted\n", i); - exit(EXIT_FAILURE); - } + if (one_page[i] != (char)0) + ksft_exit_fail_msg("%ld byte corrupted\n", i); - if (!check_huge_anon(one_page, 0, pmd_pagesize)) { - printf("Still AnonHugePages not split\n"); - exit(EXIT_FAILURE); - } + if (!check_huge_anon(one_page, 0, pmd_pagesize)) + ksft_exit_fail_msg("Still AnonHugePages not split\n"); rss_anon_after = rss_anon(); - if (rss_anon_after >= rss_anon_before) { - printf("Incorrect RssAnon value. Before: %ld After: %ld\n", + if (rss_anon_after >= rss_anon_before) + ksft_exit_fail_msg("Incorrect RssAnon value. Before: %ld After: %ld\n", rss_anon_before, rss_anon_after); - exit(EXIT_FAILURE); - } } void split_pmd_zero_pages(void) @@ -150,11 +140,11 @@ void split_pmd_zero_pages(void) one_page = allocate_zero_filled_hugepage(len); verify_rss_anon_split_huge_page_all_zeroes(one_page, nr_hpages, len); - printf("Split zero filled huge pages successful\n"); + ksft_test_result_pass("Split zero filled huge pages successful\n"); free(one_page); } -void split_pmd_thp(void) +void split_pmd_thp_to_order(int order) { char *one_page; size_t len = 4 * pmd_pagesize; @@ -174,7 +164,7 @@ void split_pmd_thp(void) /* split all THPs */ write_debugfs(PID_FMT, getpid(), (uint64_t)one_page, - (uint64_t)one_page + len, 0); + (uint64_t)one_page + len, order); for (i = 0; i < len; i++) if (one_page[i] != (char)i) @@ -184,7 +174,7 @@ void split_pmd_thp(void) if (!check_huge_anon(one_page, 0, pmd_pagesize)) ksft_exit_fail_msg("Still AnonHugePages not split\n"); - ksft_test_result_pass("Split huge pages successful\n"); + ksft_test_result_pass("Split huge pages to order %d successful\n", order); free(one_page); } @@ -491,7 +481,7 @@ int main(int argc, char **argv) if (argc > 1) optional_xfs_path = argv[1]; - ksft_set_plan(3+9); + ksft_set_plan(1+8+2+9); pagesize = getpagesize(); pageshift = ffs(pagesize) - 1; @@ -502,7 +492,11 @@ int main(int argc, char **argv) fd_size = 2 * pmd_pagesize; split_pmd_zero_pages(); - split_pmd_thp(); + + for (i = 0; i < 9; i++) + if (i != 1) + split_pmd_thp_to_order(i); + split_pte_mapped_thp(); split_file_backed_thp(); diff --git a/tools/testing/selftests/mm/thp_settings.c b/tools/testing/selftests/mm/thp_settings.c index 577eaab6266f..ad872af1c81a 100644 --- a/tools/testing/selftests/mm/thp_settings.c +++ b/tools/testing/selftests/mm/thp_settings.c @@ -87,7 +87,7 @@ int write_file(const char *path, const char *buf, size_t buflen) return (unsigned int) numwritten; } -const unsigned long read_num(const char *path) +unsigned long read_num(const char *path) { char buf[21]; @@ -172,7 +172,7 @@ void thp_write_string(const char *name, const char *val) } } -const unsigned long thp_read_num(const char *name) +unsigned long thp_read_num(const char *name) { char path[PATH_MAX]; int ret; diff --git a/tools/testing/selftests/mm/thp_settings.h b/tools/testing/selftests/mm/thp_settings.h index 876235a23460..fc131d23d593 100644 --- a/tools/testing/selftests/mm/thp_settings.h +++ b/tools/testing/selftests/mm/thp_settings.h @@ -64,12 +64,12 @@ struct thp_settings { int read_file(const char *path, char *buf, size_t buflen); int write_file(const char *path, const char *buf, size_t buflen); -const unsigned long read_num(const char *path); +unsigned long read_num(const char *path); void write_num(const char *path, unsigned long num); int thp_read_string(const char *name, const char * const strings[]); void thp_write_string(const char *name, const char *val); -const unsigned long thp_read_num(const char *name); +unsigned long thp_read_num(const char *name); void thp_write_num(const char *name, unsigned long num); void thp_write_settings(struct thp_settings *settings); diff --git a/tools/testing/selftests/mm/uffd-unit-tests.c b/tools/testing/selftests/mm/uffd-unit-tests.c index a2e71b1636e7..9ff71fa1f9bf 100644 --- a/tools/testing/selftests/mm/uffd-unit-tests.c +++ b/tools/testing/selftests/mm/uffd-unit-tests.c @@ -1122,7 +1122,7 @@ uffd_move_test_common(uffd_test_args_t *targs, unsigned long chunk_size, char c; unsigned long long count; struct uffd_args args = { 0 }; - char *orig_area_src, *orig_area_dst; + char *orig_area_src = NULL, *orig_area_dst = NULL; unsigned long step_size, step_count; unsigned long src_offs = 0; unsigned long dst_offs = 0; @@ -1190,7 +1190,7 @@ uffd_move_test_common(uffd_test_args_t *targs, unsigned long chunk_size, nr, count, count_verify[src_offs + nr + i]); } } - if (step_size > page_size) { + if (chunk_size > page_size) { area_src = orig_area_src; area_dst = orig_area_dst; } diff --git a/tools/testing/selftests/mm/uffd-wp-mremap.c b/tools/testing/selftests/mm/uffd-wp-mremap.c new file mode 100644 index 000000000000..2c4f984bd73c --- /dev/null +++ b/tools/testing/selftests/mm/uffd-wp-mremap.c @@ -0,0 +1,380 @@ +// SPDX-License-Identifier: GPL-2.0-only + +#define _GNU_SOURCE +#include <stdbool.h> +#include <stdint.h> +#include <fcntl.h> +#include <assert.h> +#include <linux/mman.h> +#include <sys/mman.h> +#include "../kselftest.h" +#include "thp_settings.h" +#include "uffd-common.h" + +static int pagemap_fd; +static size_t pagesize; +static int nr_pagesizes = 1; +static int nr_thpsizes; +static size_t thpsizes[20]; +static int nr_hugetlbsizes; +static size_t hugetlbsizes[10]; + +static int sz2ord(size_t size) +{ + return __builtin_ctzll(size / pagesize); +} + +static int detect_thp_sizes(size_t sizes[], int max) +{ + int count = 0; + unsigned long orders; + size_t kb; + int i; + + /* thp not supported at all. */ + if (!read_pmd_pagesize()) + return 0; + + orders = thp_supported_orders(); + + for (i = 0; orders && count < max; i++) { + if (!(orders & (1UL << i))) + continue; + orders &= ~(1UL << i); + kb = (pagesize >> 10) << i; + sizes[count++] = kb * 1024; + ksft_print_msg("[INFO] detected THP size: %zu KiB\n", kb); + } + + return count; +} + +static void *mmap_aligned(size_t size, int prot, int flags) +{ + size_t mmap_size = size * 2; + char *mmap_mem, *mem; + + mmap_mem = mmap(NULL, mmap_size, prot, flags, -1, 0); + if (mmap_mem == MAP_FAILED) + return mmap_mem; + + mem = (char *)(((uintptr_t)mmap_mem + size - 1) & ~(size - 1)); + munmap(mmap_mem, mem - mmap_mem); + munmap(mem + size, mmap_mem + mmap_size - mem - size); + + return mem; +} + +static void *alloc_one_folio(size_t size, bool private, bool hugetlb) +{ + bool thp = !hugetlb && size > pagesize; + int flags = MAP_ANONYMOUS; + int prot = PROT_READ | PROT_WRITE; + char *mem, *addr; + + assert((size & (size - 1)) == 0); + + if (private) + flags |= MAP_PRIVATE; + else + flags |= MAP_SHARED; + + /* + * For THP, we must explicitly enable the THP size, allocate twice the + * required space then manually align. + */ + if (thp) { + struct thp_settings settings = *thp_current_settings(); + + if (private) + settings.hugepages[sz2ord(size)].enabled = THP_ALWAYS; + else + settings.shmem_hugepages[sz2ord(size)].enabled = SHMEM_ALWAYS; + + thp_push_settings(&settings); + + mem = mmap_aligned(size, prot, flags); + } else { + if (hugetlb) { + flags |= MAP_HUGETLB; + flags |= __builtin_ctzll(size) << MAP_HUGE_SHIFT; + } + + mem = mmap(NULL, size, prot, flags, -1, 0); + } + + if (mem == MAP_FAILED) { + mem = NULL; + goto out; + } + + assert(((uintptr_t)mem & (size - 1)) == 0); + + /* + * Populate the folio by writing the first byte and check that all pages + * are populated. Finally set the whole thing to non-zero data to avoid + * kernel from mapping it back to the zero page. + */ + mem[0] = 1; + for (addr = mem; addr < mem + size; addr += pagesize) { + if (!pagemap_is_populated(pagemap_fd, addr)) { + munmap(mem, size); + mem = NULL; + goto out; + } + } + memset(mem, 1, size); +out: + if (thp) + thp_pop_settings(); + + return mem; +} + +static bool check_uffd_wp_state(void *mem, size_t size, bool expect) +{ + uint64_t pte; + void *addr; + + for (addr = mem; addr < mem + size; addr += pagesize) { + pte = pagemap_get_entry(pagemap_fd, addr); + if (!!(pte & PM_UFFD_WP) != expect) { + ksft_test_result_fail("uffd-wp not %s for pte %lu!\n", + expect ? "set" : "clear", + (addr - mem) / pagesize); + return false; + } + } + + return true; +} + +static bool range_is_swapped(void *addr, size_t size) +{ + for (; size; addr += pagesize, size -= pagesize) + if (!pagemap_is_swapped(pagemap_fd, addr)) + return false; + return true; +} + +static void test_one_folio(size_t size, bool private, bool swapout, bool hugetlb) +{ + struct uffdio_writeprotect wp_prms; + uint64_t features = 0; + void *addr = NULL; + void *mem = NULL; + + assert(!(hugetlb && swapout)); + + ksft_print_msg("[RUN] %s(size=%zu, private=%s, swapout=%s, hugetlb=%s)\n", + __func__, + size, + private ? "true" : "false", + swapout ? "true" : "false", + hugetlb ? "true" : "false"); + + /* Allocate a folio of required size and type. */ + mem = alloc_one_folio(size, private, hugetlb); + if (!mem) { + ksft_test_result_fail("alloc_one_folio() failed\n"); + goto out; + } + + /* Register range for uffd-wp. */ + if (userfaultfd_open(&features)) { + ksft_test_result_fail("userfaultfd_open() failed\n"); + goto out; + } + if (uffd_register(uffd, mem, size, false, true, false)) { + ksft_test_result_fail("uffd_register() failed\n"); + goto out; + } + wp_prms.mode = UFFDIO_WRITEPROTECT_MODE_WP; + wp_prms.range.start = (uintptr_t)mem; + wp_prms.range.len = size; + if (ioctl(uffd, UFFDIO_WRITEPROTECT, &wp_prms)) { + ksft_test_result_fail("ioctl(UFFDIO_WRITEPROTECT) failed\n"); + goto out; + } + + if (swapout) { + madvise(mem, size, MADV_PAGEOUT); + if (!range_is_swapped(mem, size)) { + ksft_test_result_skip("MADV_PAGEOUT did not work, is swap enabled?\n"); + goto out; + } + } + + /* Check that uffd-wp is set for all PTEs in range. */ + if (!check_uffd_wp_state(mem, size, true)) + goto out; + + /* + * Move the mapping to a new, aligned location. Since + * UFFD_FEATURE_EVENT_REMAP is not set, we expect the uffd-wp bit for + * each PTE to be cleared in the new mapping. + */ + addr = mmap_aligned(size, PROT_NONE, MAP_PRIVATE | MAP_ANONYMOUS); + if (addr == MAP_FAILED) { + ksft_test_result_fail("mmap_aligned() failed\n"); + goto out; + } + if (mremap(mem, size, size, MREMAP_FIXED | MREMAP_MAYMOVE, addr) == MAP_FAILED) { + ksft_test_result_fail("mremap() failed\n"); + munmap(addr, size); + goto out; + } + mem = addr; + + /* Check that uffd-wp is cleared for all PTEs in range. */ + if (!check_uffd_wp_state(mem, size, false)) + goto out; + + ksft_test_result_pass("%s(size=%zu, private=%s, swapout=%s, hugetlb=%s)\n", + __func__, + size, + private ? "true" : "false", + swapout ? "true" : "false", + hugetlb ? "true" : "false"); +out: + if (mem) + munmap(mem, size); + if (uffd >= 0) { + close(uffd); + uffd = -1; + } +} + +struct testcase { + size_t *sizes; + int *nr_sizes; + bool private; + bool swapout; + bool hugetlb; +}; + +static const struct testcase testcases[] = { + /* base pages. */ + { + .sizes = &pagesize, + .nr_sizes = &nr_pagesizes, + .private = false, + .swapout = false, + .hugetlb = false, + }, + { + .sizes = &pagesize, + .nr_sizes = &nr_pagesizes, + .private = true, + .swapout = false, + .hugetlb = false, + }, + { + .sizes = &pagesize, + .nr_sizes = &nr_pagesizes, + .private = false, + .swapout = true, + .hugetlb = false, + }, + { + .sizes = &pagesize, + .nr_sizes = &nr_pagesizes, + .private = true, + .swapout = true, + .hugetlb = false, + }, + + /* thp. */ + { + .sizes = thpsizes, + .nr_sizes = &nr_thpsizes, + .private = false, + .swapout = false, + .hugetlb = false, + }, + { + .sizes = thpsizes, + .nr_sizes = &nr_thpsizes, + .private = true, + .swapout = false, + .hugetlb = false, + }, + { + .sizes = thpsizes, + .nr_sizes = &nr_thpsizes, + .private = false, + .swapout = true, + .hugetlb = false, + }, + { + .sizes = thpsizes, + .nr_sizes = &nr_thpsizes, + .private = true, + .swapout = true, + .hugetlb = false, + }, + + /* hugetlb. */ + { + .sizes = hugetlbsizes, + .nr_sizes = &nr_hugetlbsizes, + .private = false, + .swapout = false, + .hugetlb = true, + }, + { + .sizes = hugetlbsizes, + .nr_sizes = &nr_hugetlbsizes, + .private = true, + .swapout = false, + .hugetlb = true, + }, +}; + +int main(int argc, char **argv) +{ + struct thp_settings settings; + int i, j, plan = 0; + + pagesize = getpagesize(); + nr_thpsizes = detect_thp_sizes(thpsizes, ARRAY_SIZE(thpsizes)); + nr_hugetlbsizes = detect_hugetlb_page_sizes(hugetlbsizes, + ARRAY_SIZE(hugetlbsizes)); + + /* If THP is supported, save THP settings and initially disable THP. */ + if (nr_thpsizes) { + thp_save_settings(); + thp_read_settings(&settings); + for (i = 0; i < NR_ORDERS; i++) { + settings.hugepages[i].enabled = THP_NEVER; + settings.shmem_hugepages[i].enabled = SHMEM_NEVER; + } + thp_push_settings(&settings); + } + + for (i = 0; i < ARRAY_SIZE(testcases); i++) + plan += *testcases[i].nr_sizes; + ksft_set_plan(plan); + + pagemap_fd = open("/proc/self/pagemap", O_RDONLY); + if (pagemap_fd < 0) + ksft_exit_fail_msg("opening pagemap failed\n"); + + for (i = 0; i < ARRAY_SIZE(testcases); i++) { + const struct testcase *tc = &testcases[i]; + + for (j = 0; j < *tc->nr_sizes; j++) + test_one_folio(tc->sizes[j], tc->private, tc->swapout, + tc->hugetlb); + } + + /* If THP is supported, restore original THP settings. */ + if (nr_thpsizes) + thp_restore_settings(); + + i = ksft_get_fail_cnt(); + if (i) + ksft_exit_fail_msg("%d out of %d tests failed\n", + i, ksft_test_num()); + ksft_exit_pass(); +} diff --git a/tools/testing/selftests/mm/virtual_address_range.c b/tools/testing/selftests/mm/virtual_address_range.c index 2a2b69e91950..b380e102b22f 100644 --- a/tools/testing/selftests/mm/virtual_address_range.c +++ b/tools/testing/selftests/mm/virtual_address_range.c @@ -10,10 +10,12 @@ #include <string.h> #include <unistd.h> #include <errno.h> +#include <sys/prctl.h> #include <sys/mman.h> #include <sys/time.h> #include <fcntl.h> +#include "vm_util.h" #include "../kselftest.h" /* @@ -82,6 +84,24 @@ static void validate_addr(char *ptr, int high_addr) ksft_exit_fail_msg("Bad address %lx\n", addr); } +static void mark_range(char *ptr, size_t size) +{ + if (prctl(PR_SET_VMA, PR_SET_VMA_ANON_NAME, ptr, size, "virtual_address_range") == -1) { + if (errno == EINVAL) { + /* Depends on CONFIG_ANON_VMA_NAME */ + ksft_test_result_skip("prctl(PR_SET_VMA_ANON_NAME) not supported\n"); + ksft_finished(); + } else { + ksft_exit_fail_perror("prctl(PR_SET_VMA_ANON_NAME) failed\n"); + } + } +} + +static int is_marked_vma(const char *vma_name) +{ + return vma_name && !strcmp(vma_name, "[anon:virtual_address_range]\n"); +} + static int validate_lower_address_hint(void) { char *ptr; @@ -116,12 +136,17 @@ static int validate_complete_va_space(void) prev_end_addr = 0; while (fgets(line, sizeof(line), file)) { + const char *vma_name = NULL; + int vma_name_start = 0; unsigned long hop; - if (sscanf(line, "%lx-%lx %s[rwxp-]", - &start_addr, &end_addr, prot) != 3) + if (sscanf(line, "%lx-%lx %4s %*s %*s %*s %n", + &start_addr, &end_addr, prot, &vma_name_start) != 3) ksft_exit_fail_msg("cannot parse /proc/self/maps\n"); + if (vma_name_start) + vma_name = line + vma_name_start; + /* end of userspace mappings; ignore vsyscall mapping */ if (start_addr & (1UL << 63)) return 0; @@ -135,6 +160,9 @@ static int validate_complete_va_space(void) if (prot[0] != 'r') continue; + if (check_vmflag_io((void *)start_addr)) + continue; + /* * Confirm whether MAP_CHUNK_SIZE chunk can be found or not. * If write succeeds, no need to check MAP_CHUNK_SIZE - 1 @@ -149,6 +177,9 @@ static int validate_complete_va_space(void) return 1; lseek(fd, 0, SEEK_SET); + if (is_marked_vma(vma_name)) + munmap((char *)(start_addr + hop), MAP_CHUNK_SIZE); + hop += MAP_CHUNK_SIZE; } } @@ -166,7 +197,7 @@ int main(int argc, char *argv[]) ksft_set_plan(1); for (i = 0; i < NR_CHUNKS_LOW; i++) { - ptr[i] = mmap(NULL, MAP_CHUNK_SIZE, PROT_READ | PROT_WRITE, + ptr[i] = mmap(NULL, MAP_CHUNK_SIZE, PROT_READ, MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); if (ptr[i] == MAP_FAILED) { @@ -175,6 +206,7 @@ int main(int argc, char *argv[]) break; } + mark_range(ptr[i], MAP_CHUNK_SIZE); validate_addr(ptr[i], 0); } lchunks = i; @@ -186,12 +218,13 @@ int main(int argc, char *argv[]) for (i = 0; i < NR_CHUNKS_HIGH; i++) { hint = hint_addr(); - hptr[i] = mmap(hint, MAP_CHUNK_SIZE, PROT_READ | PROT_WRITE, + hptr[i] = mmap(hint, MAP_CHUNK_SIZE, PROT_READ, MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); if (hptr[i] == MAP_FAILED) break; + mark_range(ptr[i], MAP_CHUNK_SIZE); validate_addr(hptr[i], 1); } hchunks = i; diff --git a/tools/testing/selftests/mm/vm_util.c b/tools/testing/selftests/mm/vm_util.c index d8d0cf04bb57..a36734fb62f3 100644 --- a/tools/testing/selftests/mm/vm_util.c +++ b/tools/testing/selftests/mm/vm_util.c @@ -2,6 +2,7 @@ #include <string.h> #include <fcntl.h> #include <dirent.h> +#include <inttypes.h> #include <sys/ioctl.h> #include <linux/userfaultfd.h> #include <linux/fs.h> @@ -138,7 +139,7 @@ void clear_softdirty(void) ksft_exit_fail_msg("opening clear_refs failed\n"); ret = write(fd, ctrl, strlen(ctrl)); close(fd); - if (ret != strlen(ctrl)) + if (ret != (signed int)strlen(ctrl)) ksft_exit_fail_msg("writing clear_refs failed\n"); } @@ -193,13 +194,11 @@ err_out: return rss_anon; } -bool __check_huge(void *addr, char *pattern, int nr_hpages, - uint64_t hpage_size) +char *__get_smap_entry(void *addr, const char *pattern, char *buf, size_t len) { - uint64_t thp = -1; int ret; FILE *fp; - char buffer[MAX_LINE_LENGTH]; + char *entry = NULL; char addr_pattern[MAX_LINE_LENGTH]; ret = snprintf(addr_pattern, MAX_LINE_LENGTH, "%08lx-", @@ -211,23 +210,40 @@ bool __check_huge(void *addr, char *pattern, int nr_hpages, if (!fp) ksft_exit_fail_msg("%s: Failed to open file %s\n", __func__, SMAP_FILE_PATH); - if (!check_for_pattern(fp, addr_pattern, buffer, sizeof(buffer))) + if (!check_for_pattern(fp, addr_pattern, buf, len)) goto err_out; - /* - * Fetch the pattern in the same block and check the number of - * hugepages. - */ - if (!check_for_pattern(fp, pattern, buffer, sizeof(buffer))) + /* Fetch the pattern in the same block */ + if (!check_for_pattern(fp, pattern, buf, len)) goto err_out; - snprintf(addr_pattern, MAX_LINE_LENGTH, "%s%%9ld kB", pattern); + /* Trim trailing newline */ + entry = strchr(buf, '\n'); + if (entry) + *entry = '\0'; - if (sscanf(buffer, addr_pattern, &thp) != 1) - ksft_exit_fail_msg("Reading smap error\n"); + entry = buf + strlen(pattern); err_out: fclose(fp); + return entry; +} + +bool __check_huge(void *addr, char *pattern, int nr_hpages, + uint64_t hpage_size) +{ + char buffer[MAX_LINE_LENGTH]; + uint64_t thp = -1; + char *entry; + + entry = __get_smap_entry(addr, pattern, buffer, sizeof(buffer)); + if (!entry) + goto err_out; + + if (sscanf(entry, "%9" SCNu64 " kB", &thp) != 1) + ksft_exit_fail_msg("Reading smap error\n"); + +err_out: return thp == (nr_hpages * (hpage_size >> 10)); } @@ -384,3 +400,27 @@ unsigned long get_free_hugepages(void) fclose(f); return fhp; } + +bool check_vmflag_io(void *addr) +{ + char buffer[MAX_LINE_LENGTH]; + const char *flags; + size_t flaglen; + + flags = __get_smap_entry(addr, "VmFlags:", buffer, sizeof(buffer)); + if (!flags) + ksft_exit_fail_msg("%s: No VmFlags for %p\n", __func__, addr); + + while (true) { + flags += strspn(flags, " "); + + flaglen = strcspn(flags, " "); + if (!flaglen) + return false; + + if (flaglen == strlen("io") && !memcmp(flags, "io", flaglen)) + return true; + + flags += flaglen; + } +} diff --git a/tools/testing/selftests/mm/vm_util.h b/tools/testing/selftests/mm/vm_util.h index 2eaed8209925..b60ac68a9dc8 100644 --- a/tools/testing/selftests/mm/vm_util.h +++ b/tools/testing/selftests/mm/vm_util.h @@ -53,6 +53,7 @@ int uffd_unregister(int uffd, void *addr, uint64_t len); int uffd_register_with_ioctls(int uffd, void *addr, uint64_t len, bool miss, bool wp, bool minor, uint64_t *ioctls); unsigned long get_free_hugepages(void); +bool check_vmflag_io(void *addr); /* * On ppc64 this will only work with radix 2M hugepage size diff --git a/tools/testing/selftests/mm/write_to_hugetlbfs.c b/tools/testing/selftests/mm/write_to_hugetlbfs.c index 1289d311efd7..34c91f7e6128 100644 --- a/tools/testing/selftests/mm/write_to_hugetlbfs.c +++ b/tools/testing/selftests/mm/write_to_hugetlbfs.c @@ -89,7 +89,7 @@ int main(int argc, char **argv) size = atoi(optarg); break; case 'p': - strncpy(path, optarg, sizeof(path)); + strncpy(path, optarg, sizeof(path) - 1); break; case 'm': if (atoi(optarg) >= MAX_METHOD) { diff --git a/tools/testing/selftests/net/Makefile b/tools/testing/selftests/net/Makefile index cb2fc601de66..73ee88d6b043 100644 --- a/tools/testing/selftests/net/Makefile +++ b/tools/testing/selftests/net/Makefile @@ -32,6 +32,7 @@ TEST_PROGS += ioam6.sh TEST_PROGS += gro.sh TEST_PROGS += gre_gso.sh TEST_PROGS += cmsg_so_mark.sh +TEST_PROGS += cmsg_so_priority.sh TEST_PROGS += cmsg_time.sh cmsg_ipv6.sh TEST_PROGS += netns-name.sh TEST_PROGS += nl_netdev.py @@ -95,6 +96,7 @@ TEST_PROGS += test_bridge_backup_port.sh TEST_PROGS += fdb_flush.sh fdb_notify.sh TEST_PROGS += fq_band_pktlimit.sh TEST_PROGS += vlan_hw_filter.sh +TEST_PROGS += vlan_bridge_binding.sh TEST_PROGS += bpf_offload.py TEST_PROGS += ipv6_route_update_soft_lockup.sh TEST_PROGS += busy_poll_test.sh diff --git a/tools/testing/selftests/net/bpf_offload.py b/tools/testing/selftests/net/bpf_offload.py index d10f420e4ef6..fd0d959914e4 100755 --- a/tools/testing/selftests/net/bpf_offload.py +++ b/tools/testing/selftests/net/bpf_offload.py @@ -215,12 +215,14 @@ def bpftool_map_list_wait(expected=0, n_retry=20, ns=""): raise Exception("Time out waiting for map counts to stabilize want %d, have %d" % (expected, nmaps)) def bpftool_prog_load(sample, file_name, maps=[], prog_type="xdp", dev=None, - fail=True, include_stderr=False): + fail=True, include_stderr=False, dev_bind=None): args = "prog load %s %s" % (os.path.join(bpf_test_dir, sample), file_name) if prog_type is not None: args += " type " + prog_type if dev is not None: args += " dev " + dev + elif dev_bind is not None: + args += " xdpmeta_dev " + dev_bind if len(maps): args += " map " + " map ".join(maps) @@ -980,6 +982,16 @@ try: rm("/sys/fs/bpf/offload") sim.wait_for_flush() + bpftool_prog_load("sample_ret0.bpf.o", "/sys/fs/bpf/devbound", + dev_bind=sim['ifname']) + devbound = bpf_pinned("/sys/fs/bpf/devbound") + start_test("Test dev-bound program in generic mode...") + ret, _, err = sim.set_xdp(devbound, "generic", fail=False, include_stderr=True) + fail(ret == 0, "devbound program in generic mode allowed") + check_extack(err, "Can't attach device-bound programs in generic mode.", args) + rm("/sys/fs/bpf/devbound") + sim.wait_for_flush() + start_test("Test XDP load failure...") sim.dfs["dev/bpf_bind_verifier_accept"] = 0 ret, _, err = bpftool_prog_load("sample_ret0.bpf.o", "/sys/fs/bpf/offload", diff --git a/tools/testing/selftests/net/busy_poller.c b/tools/testing/selftests/net/busy_poller.c index 99b0e8c17fca..04c7ff577bb8 100644 --- a/tools/testing/selftests/net/busy_poller.c +++ b/tools/testing/selftests/net/busy_poller.c @@ -54,16 +54,16 @@ struct epoll_params { #define EPIOCGPARAMS _IOR(EPOLL_IOC_TYPE, 0x02, struct epoll_params) #endif -static uint32_t cfg_port = 8000; +static uint16_t cfg_port = 8000; static struct in_addr cfg_bind_addr = { .s_addr = INADDR_ANY }; static char *cfg_outfile; static int cfg_max_events = 8; -static int cfg_ifindex; +static uint32_t cfg_ifindex; /* busy poll params */ static uint32_t cfg_busy_poll_usecs; -static uint32_t cfg_busy_poll_budget; -static uint32_t cfg_prefer_busy_poll; +static uint16_t cfg_busy_poll_budget; +static uint8_t cfg_prefer_busy_poll; /* IRQ params */ static uint32_t cfg_defer_hard_irqs; @@ -79,6 +79,7 @@ static void usage(const char *filepath) static void parse_opts(int argc, char **argv) { + unsigned long long tmp; int ret; int c; @@ -86,31 +87,40 @@ static void parse_opts(int argc, char **argv) usage(argv[0]); while ((c = getopt(argc, argv, "p:m:b:u:P:g:o:d:r:s:i:")) != -1) { + /* most options take integer values, except o and b, so reduce + * code duplication a bit for the common case by calling + * strtoull here and leave bounds checking and casting per + * option below. + */ + if (c != 'o' && c != 'b') + tmp = strtoull(optarg, NULL, 0); + switch (c) { case 'u': - cfg_busy_poll_usecs = strtoul(optarg, NULL, 0); - if (cfg_busy_poll_usecs == ULONG_MAX || - cfg_busy_poll_usecs > UINT32_MAX) + if (tmp == ULLONG_MAX || tmp > UINT32_MAX) error(1, ERANGE, "busy_poll_usecs too large"); + + cfg_busy_poll_usecs = (uint32_t)tmp; break; case 'P': - cfg_prefer_busy_poll = strtoul(optarg, NULL, 0); - if (cfg_prefer_busy_poll == ULONG_MAX || - cfg_prefer_busy_poll > 1) + if (tmp == ULLONG_MAX || tmp > 1) error(1, ERANGE, "prefer busy poll should be 0 or 1"); + + cfg_prefer_busy_poll = (uint8_t)tmp; break; case 'g': - cfg_busy_poll_budget = strtoul(optarg, NULL, 0); - if (cfg_busy_poll_budget == ULONG_MAX || - cfg_busy_poll_budget > UINT16_MAX) + if (tmp == ULLONG_MAX || tmp > UINT16_MAX) error(1, ERANGE, "busy poll budget must be [0, UINT16_MAX]"); + + cfg_busy_poll_budget = (uint16_t)tmp; break; case 'p': - cfg_port = strtoul(optarg, NULL, 0); - if (cfg_port > UINT16_MAX) + if (tmp == ULLONG_MAX || tmp > UINT16_MAX) error(1, ERANGE, "port must be <= 65535"); + + cfg_port = (uint16_t)tmp; break; case 'b': ret = inet_aton(optarg, &cfg_bind_addr); @@ -124,41 +134,39 @@ static void parse_opts(int argc, char **argv) error(1, 0, "outfile invalid"); break; case 'm': - cfg_max_events = strtol(optarg, NULL, 0); - - if (cfg_max_events == LONG_MIN || - cfg_max_events == LONG_MAX || - cfg_max_events <= 0) + if (tmp == ULLONG_MAX || tmp > INT_MAX) error(1, ERANGE, - "max events must be > 0 and < LONG_MAX"); + "max events must be > 0 and <= INT_MAX"); + + cfg_max_events = (int)tmp; break; case 'd': - cfg_defer_hard_irqs = strtoul(optarg, NULL, 0); - - if (cfg_defer_hard_irqs == ULONG_MAX || - cfg_defer_hard_irqs > INT32_MAX) + if (tmp == ULLONG_MAX || tmp > INT32_MAX) error(1, ERANGE, "defer_hard_irqs must be <= INT32_MAX"); + + cfg_defer_hard_irqs = (uint32_t)tmp; break; case 'r': - cfg_gro_flush_timeout = strtoull(optarg, NULL, 0); - - if (cfg_gro_flush_timeout == ULLONG_MAX) + if (tmp == ULLONG_MAX || tmp > UINT64_MAX) error(1, ERANGE, - "gro_flush_timeout must be < ULLONG_MAX"); + "gro_flush_timeout must be < UINT64_MAX"); + + cfg_gro_flush_timeout = (uint64_t)tmp; break; case 's': - cfg_irq_suspend_timeout = strtoull(optarg, NULL, 0); - - if (cfg_irq_suspend_timeout == ULLONG_MAX) + if (tmp == ULLONG_MAX || tmp > UINT64_MAX) error(1, ERANGE, "irq_suspend_timeout must be < ULLONG_MAX"); + + cfg_irq_suspend_timeout = (uint64_t)tmp; break; case 'i': - cfg_ifindex = strtoul(optarg, NULL, 0); - if (cfg_ifindex == ULONG_MAX) + if (tmp == ULLONG_MAX || tmp > INT_MAX) error(1, ERANGE, - "ifindex must be < ULONG_MAX"); + "ifindex must be <= INT_MAX"); + + cfg_ifindex = (int)tmp; break; } } @@ -215,7 +223,7 @@ static void setup_queue(void) struct netdev_napi_set_req *set_req = NULL; struct ynl_sock *ys; struct ynl_error yerr; - uint32_t napi_id; + uint32_t napi_id = 0; ys = ynl_sock_create(&ynl_netdev_family, &yerr); if (!ys) @@ -277,8 +285,8 @@ static void run_poller(void) * here */ epoll_params.busy_poll_usecs = cfg_busy_poll_usecs; - epoll_params.busy_poll_budget = (uint16_t)cfg_busy_poll_budget; - epoll_params.prefer_busy_poll = (uint8_t)cfg_prefer_busy_poll; + epoll_params.busy_poll_budget = cfg_busy_poll_budget; + epoll_params.prefer_busy_poll = cfg_prefer_busy_poll; epoll_params.__pad = 0; val = 1; @@ -342,5 +350,9 @@ int main(int argc, char *argv[]) parse_opts(argc, argv); setup_queue(); run_poller(); + + if (cfg_outfile) + free(cfg_outfile); + return 0; } diff --git a/tools/testing/selftests/net/cmsg_sender.c b/tools/testing/selftests/net/cmsg_sender.c index 876c2db02a63..bc314382e4e1 100644 --- a/tools/testing/selftests/net/cmsg_sender.c +++ b/tools/testing/selftests/net/cmsg_sender.c @@ -59,6 +59,7 @@ struct options { unsigned int proto; } sock; struct option_cmsg_u32 mark; + struct option_cmsg_u32 priority; struct { bool ena; unsigned int delay; @@ -97,6 +98,8 @@ static void __attribute__((noreturn)) cs_usage(const char *bin) "\n" "\t\t-m val Set SO_MARK with given value\n" "\t\t-M val Set SO_MARK via setsockopt\n" + "\t\t-P val Set SO_PRIORITY via setsockopt\n" + "\t\t-Q val Set SO_PRIORITY via cmsg\n" "\t\t-d val Set SO_TXTIME with given delay (usec)\n" "\t\t-t Enable time stamp reporting\n" "\t\t-f val Set don't fragment via cmsg\n" @@ -115,7 +118,7 @@ static void cs_parse_args(int argc, char *argv[]) { int o; - while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:")) != -1) { + while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:Q:")) != -1) { switch (o) { case 's': opt.silent_send = true; @@ -148,6 +151,10 @@ static void cs_parse_args(int argc, char *argv[]) opt.mark.ena = true; opt.mark.val = atoi(optarg); break; + case 'Q': + opt.priority.ena = true; + opt.priority.val = atoi(optarg); + break; case 'M': opt.sockopt.mark = atoi(optarg); break; @@ -253,6 +260,8 @@ cs_write_cmsg(int fd, struct msghdr *msg, char *cbuf, size_t cbuf_sz) ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len, SOL_SOCKET, SO_MARK, &opt.mark); ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len, + SOL_SOCKET, SO_PRIORITY, &opt.priority); + ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len, SOL_IPV6, IPV6_DONTFRAG, &opt.v6.dontfrag); ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len, SOL_IPV6, IPV6_TCLASS, &opt.v6.tclass); diff --git a/tools/testing/selftests/net/cmsg_so_priority.sh b/tools/testing/selftests/net/cmsg_so_priority.sh new file mode 100755 index 000000000000..ee07d8653262 --- /dev/null +++ b/tools/testing/selftests/net/cmsg_so_priority.sh @@ -0,0 +1,151 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 + +source lib.sh + +readonly KSFT_SKIP=4 + +IP4=192.0.2.1/24 +TGT4=192.0.2.2 +TGT4_RAW=192.0.2.3 +IP6=2001:db8::1/64 +TGT6=2001:db8::2 +TGT6_RAW=2001:db8::3 +PORT=1234 +TOTAL_TESTS=0 +FAILED_TESTS=0 + +if ! command -v jq &> /dev/null; then + echo "SKIP cmsg_so_priroity.sh test: jq is not installed." >&2 + exit "$KSFT_SKIP" +fi + +check_result() { + ((TOTAL_TESTS++)) + if [ "$1" -ne 0 ]; then + ((FAILED_TESTS++)) + fi +} + +cleanup() +{ + cleanup_ns $NS +} + +trap cleanup EXIT + +setup_ns NS + +create_filter() { + local handle=$1 + local vlan_prio=$2 + local ip_type=$3 + local proto=$4 + local dst_ip=$5 + local ip_proto + + if [[ "$proto" == "u" ]]; then + ip_proto="udp" + elif [[ "$ip_type" == "ipv4" && "$proto" == "i" ]]; then + ip_proto="icmp" + elif [[ "$ip_type" == "ipv6" && "$proto" == "i" ]]; then + ip_proto="icmpv6" + fi + + tc -n $NS filter add dev dummy1 \ + egress pref 1 handle "$handle" proto 802.1q \ + flower vlan_prio "$vlan_prio" vlan_ethtype "$ip_type" \ + dst_ip "$dst_ip" ${ip_proto:+ip_proto $ip_proto} \ + action pass +} + +ip -n $NS link set dev lo up +ip -n $NS link add name dummy1 up type dummy + +ip -n $NS link add link dummy1 name dummy1.10 up type vlan id 10 \ + egress-qos-map 0:0 1:1 2:2 3:3 4:4 5:5 6:6 7:7 + +ip -n $NS address add $IP4 dev dummy1.10 +ip -n $NS address add $IP6 dev dummy1.10 nodad + +ip netns exec $NS sysctl -wq net.ipv4.ping_group_range='0 2147483647' + +ip -n $NS neigh add $TGT4 lladdr 00:11:22:33:44:55 nud permanent \ + dev dummy1.10 +ip -n $NS neigh add $TGT6 lladdr 00:11:22:33:44:55 nud permanent \ + dev dummy1.10 +ip -n $NS neigh add $TGT4_RAW lladdr 00:11:22:33:44:66 nud permanent \ + dev dummy1.10 +ip -n $NS neigh add $TGT6_RAW lladdr 00:11:22:33:44:66 nud permanent \ + dev dummy1.10 + +tc -n $NS qdisc add dev dummy1 clsact + +FILTER_COUNTER=10 + +for i in 4 6; do + for proto in u i r; do + echo "Test IPV$i, prot: $proto" + for priority in {0..7}; do + if [[ $i == 4 && $proto == "r" ]]; then + TGT=$TGT4_RAW + elif [[ $i == 6 && $proto == "r" ]]; then + TGT=$TGT6_RAW + elif [ $i == 4 ]; then + TGT=$TGT4 + else + TGT=$TGT6 + fi + + handle="${FILTER_COUNTER}${priority}" + + create_filter $handle $priority ipv$i $proto $TGT + + pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \ + | jq ".[] | select(.options.handle == ${handle}) | \ + .options.actions[0].stats.packets") + + if [[ $pkts == 0 ]]; then + check_result 0 + else + echo "prio $priority: expected 0, got $pkts" + check_result 1 + fi + + ip netns exec $NS ./cmsg_sender -$i -Q $priority \ + -p $proto $TGT $PORT + + pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \ + | jq ".[] | select(.options.handle == ${handle}) | \ + .options.actions[0].stats.packets") + if [[ $pkts == 1 ]]; then + check_result 0 + else + echo "prio $priority -Q: expected 1, got $pkts" + check_result 1 + fi + + ip netns exec $NS ./cmsg_sender -$i -P $priority \ + -p $proto $TGT $PORT + + pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \ + | jq ".[] | select(.options.handle == ${handle}) | \ + .options.actions[0].stats.packets") + if [[ $pkts == 2 ]]; then + check_result 0 + else + echo "prio $priority -P: expected 2, got $pkts" + check_result 1 + fi + done + FILTER_COUNTER=$((FILTER_COUNTER + 10)) + done +done + +if [ $FAILED_TESTS -ne 0 ]; then + echo "FAIL - $FAILED_TESTS/$TOTAL_TESTS tests failed" + exit 1 +else + echo "OK - All $TOTAL_TESTS tests passed" + exit 0 +fi diff --git a/tools/testing/selftests/net/cmsg_time.sh b/tools/testing/selftests/net/cmsg_time.sh index 1d7e756644bc..478af0aefa97 100755 --- a/tools/testing/selftests/net/cmsg_time.sh +++ b/tools/testing/selftests/net/cmsg_time.sh @@ -34,13 +34,28 @@ BAD=0 TOTAL=0 check_result() { + local ret=$1 + local got=$2 + local exp=$3 + local case=$4 + local xfail=$5 + local xf= + local inc= + + if [ "$xfail" == "xfail" ]; then + xf="(XFAIL)" + inc=0 + else + inc=1 + fi + ((TOTAL++)) - if [ $1 -ne 0 ]; then - echo " Case $4 returned $1, expected 0" - ((BAD++)) + if [ $ret -ne 0 ]; then + echo " Case $case returned $ret, expected 0 $xf" + ((BAD+=inc)) elif [ "$2" != "$3" ]; then - echo " Case $4 returned '$2', expected '$3'" - ((BAD++)) + echo " Case $case returned '$got', expected '$exp' $xf" + ((BAD+=inc)) fi } @@ -66,14 +81,14 @@ for i in "-4 $TGT4" "-6 $TGT6"; do awk '/SND/ { if ($3 > 1000) print "OK"; }') check_result $? "$ts" "OK" "$prot - TXTIME abs" - [ "$KSFT_MACHINE_SLOW" = yes ] && delay=8000 || delay=1000 + [ "$KSFT_MACHINE_SLOW" = yes ] && xfail=xfail - ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d $delay | + ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d 1000 | awk '/SND/ {snd=$3} /SCHED/ {sch=$3} - END { if (snd - sch > '$((delay/2))') print "OK"; - else print snd, "-", sch, "<", '$((delay/2))'; }') - check_result $? "$ts" "OK" "$prot - TXTIME rel" + END { if (snd - sch > 500) print "OK"; + else print snd, "-", sch, "<", 500; }') + check_result $? "$ts" "OK" "$prot - TXTIME rel" $xfail done done diff --git a/tools/testing/selftests/net/fdb_notify.sh b/tools/testing/selftests/net/fdb_notify.sh index c03151e7791c..c159230c9b62 100755 --- a/tools/testing/selftests/net/fdb_notify.sh +++ b/tools/testing/selftests/net/fdb_notify.sh @@ -49,7 +49,7 @@ test_dup_vxlan_self() { ip_link_add br up type bridge vlan_filtering 1 ip_link_add vx up type vxlan id 2000 dstport 4789 - ip_link_master vx br + ip_link_set_master vx br do_test_dup add "vxlan" dev vx self dst 192.0.2.1 do_test_dup del "vxlan" dev vx self dst 192.0.2.1 @@ -59,7 +59,7 @@ test_dup_vxlan_master() { ip_link_add br up type bridge vlan_filtering 1 ip_link_add vx up type vxlan id 2000 dstport 4789 - ip_link_master vx br + ip_link_set_master vx br do_test_dup add "vxlan master" dev vx master do_test_dup del "vxlan master" dev vx master @@ -79,7 +79,7 @@ test_dup_macvlan_master() ip_link_add br up type bridge vlan_filtering 1 ip_link_add dd up type dummy ip_link_add mv up link dd type macvlan mode passthru - ip_link_master mv br + ip_link_set_master mv br do_test_dup add "macvlan master" dev mv self do_test_dup del "macvlan master" dev mv self diff --git a/tools/testing/selftests/net/fib_rule_tests.sh b/tools/testing/selftests/net/fib_rule_tests.sh index 1d58b3b87465..847936363a12 100755 --- a/tools/testing/selftests/net/fib_rule_tests.sh +++ b/tools/testing/selftests/net/fib_rule_tests.sh @@ -291,6 +291,37 @@ fib_rule6_test() "$getnomatch" "iif dscp redirect to table" \ "iif dscp no redirect to table" fi + + fib_check_iproute_support "flowlabel" "flowlabel" + if [ $? -eq 0 ]; then + match="flowlabel 0xfffff" + getmatch="flowlabel 0xfffff" + getnomatch="flowlabel 0xf" + fib_rule6_test_match_n_redirect "$match" "$getmatch" \ + "$getnomatch" "flowlabel redirect to table" \ + "flowlabel no redirect to table" + + match="flowlabel 0xfffff" + getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff" + getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf" + fib_rule6_test_match_n_redirect "$match" "$getmatch" \ + "$getnomatch" "iif flowlabel redirect to table" \ + "iif flowlabel no redirect to table" + + match="flowlabel 0x08000/0x08000" + getmatch="flowlabel 0xfffff" + getnomatch="flowlabel 0xf7fff" + fib_rule6_test_match_n_redirect "$match" "$getmatch" \ + "$getnomatch" "flowlabel masked redirect to table" \ + "flowlabel masked no redirect to table" + + match="flowlabel 0x08000/0x08000" + getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff" + getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf7fff" + fib_rule6_test_match_n_redirect "$match" "$getmatch" \ + "$getnomatch" "iif flowlabel masked redirect to table" \ + "iif flowlabel masked no redirect to table" + fi } fib_rule6_vrf_test() diff --git a/tools/testing/selftests/net/forwarding/Makefile b/tools/testing/selftests/net/forwarding/Makefile index 7d885cff8d79..00bde7b6f39e 100644 --- a/tools/testing/selftests/net/forwarding/Makefile +++ b/tools/testing/selftests/net/forwarding/Makefile @@ -105,6 +105,7 @@ TEST_PROGS = bridge_fdb_learning_limit.sh \ vxlan_bridge_1q_port_8472_ipv6.sh \ vxlan_bridge_1q_port_8472.sh \ vxlan_bridge_1q.sh \ + vxlan_reserved.sh \ vxlan_symmetric_ipv6.sh \ vxlan_symmetric.sh diff --git a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh index 1c8a26046589..2b5700b61ffa 100755 --- a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh +++ b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh @@ -1,7 +1,7 @@ #!/bin/bash # SPDX-License-Identifier: GPL-2.0 -ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding" +ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding pvid_change" NUM_NETIFS=4 source lib.sh @@ -77,12 +77,16 @@ cleanup() ping_ipv4() { - ping_test $h1 192.0.2.2 + local msg=$1 + + ping_test $h1 192.0.2.2 "$msg" } ping_ipv6() { - ping6_test $h1 2001:db8:1::2 + local msg=$1 + + ping6_test $h1 2001:db8:1::2 "$msg" } learning() @@ -95,6 +99,21 @@ flooding() flood_test $swp2 $h1 $h2 } +pvid_change() +{ + # Test that the changing of the VLAN-aware PVID does not affect + # VLAN-unaware forwarding + bridge vlan add vid 3 dev $swp1 pvid untagged + + ping_ipv4 " with bridge port $swp1 PVID changed" + ping_ipv6 " with bridge port $swp1 PVID changed" + + bridge vlan del vid 3 dev $swp1 + + ping_ipv4 " with bridge port $swp1 PVID deleted" + ping_ipv6 " with bridge port $swp1 PVID deleted" +} + trap cleanup EXIT setup_prepare diff --git a/tools/testing/selftests/net/forwarding/lib.sh b/tools/testing/selftests/net/forwarding/lib.sh index 7337f398f9cc..8de80acf249e 100644 --- a/tools/testing/selftests/net/forwarding/lib.sh +++ b/tools/testing/selftests/net/forwarding/lib.sh @@ -68,6 +68,7 @@ declare -A NETIFS=( : "${REQUIRE_JQ:=yes}" : "${REQUIRE_MZ:=yes}" : "${REQUIRE_MTOOLS:=no}" +: "${REQUIRE_TEAMD:=no}" # Whether to override MAC addresses on interfaces participating in the test. : "${STABLE_MAC_ADDRS:=no}" @@ -321,6 +322,9 @@ fi if [[ "$REQUIRE_MZ" = "yes" ]]; then require_command $MZ fi +if [[ "$REQUIRE_TEAMD" = "yes" ]]; then + require_command $TEAMD +fi if [[ "$REQUIRE_MTOOLS" = "yes" ]]; then # https://github.com/troglobit/mtools require_command msend @@ -932,13 +936,6 @@ packets_rate() echo $(((t1 - t0) / interval)) } -mac_get() -{ - local if_name=$1 - - ip -j link show dev $if_name | jq -r '.[]["address"]' -} - ether_addr_to_u64() { local addr="$1" diff --git a/tools/testing/selftests/net/forwarding/local_termination.sh b/tools/testing/selftests/net/forwarding/local_termination.sh index c35548767756..ecd34f364125 100755 --- a/tools/testing/selftests/net/forwarding/local_termination.sh +++ b/tools/testing/selftests/net/forwarding/local_termination.sh @@ -7,7 +7,6 @@ ALL_TESTS="standalone vlan_unaware_bridge vlan_aware_bridge test_vlan \ NUM_NETIFS=2 PING_COUNT=1 REQUIRE_MTOOLS=yes -REQUIRE_MZ=no source lib.sh diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh index fe4d7c906a70..a20d22d1df36 100755 --- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh +++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh @@ -49,6 +49,7 @@ ALL_TESTS=" test_mirror_gretap_second " +REQUIRE_TEAMD="yes" NUM_NETIFS=6 source lib.sh source mirror_lib.sh diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh index 1261e6f46e34..ff7049582d35 100755 --- a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh +++ b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh @@ -53,6 +53,7 @@ ALL_TESTS=" test_mirror_gretap_second " +REQUIRE_TEAMD="yes" NUM_NETIFS=6 source lib.sh source mirror_lib.sh diff --git a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh index e064b946e821..16583a470ec3 100755 --- a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh +++ b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh @@ -109,6 +109,7 @@ ALL_TESTS=" ping_ipv4 ping_ipv6 " +REQUIRE_TEAMD="yes" NUM_NETIFS=8 source lib.sh diff --git a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh index f05ffe213c46..2a4cd1af1b85 100755 --- a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh +++ b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh @@ -76,6 +76,7 @@ ping_ipv4 ping_ipv6 "} +REQUIRE_TEAMD="yes" NUM_NETIFS=8 : ${lib_dir:=.} source $lib_dir/lib.sh diff --git a/tools/testing/selftests/net/forwarding/tc_flower_port_range.sh b/tools/testing/selftests/net/forwarding/tc_flower_port_range.sh index 3885a2a91f7d..baed5e380dae 100755 --- a/tools/testing/selftests/net/forwarding/tc_flower_port_range.sh +++ b/tools/testing/selftests/net/forwarding/tc_flower_port_range.sh @@ -20,6 +20,7 @@ ALL_TESTS=" test_port_range_ipv4_tcp test_port_range_ipv6_udp test_port_range_ipv6_tcp + test_port_range_ipv4_udp_drop " NUM_NETIFS=4 @@ -194,6 +195,51 @@ test_port_range_ipv6_tcp() __test_port_range $proto $ip_proto $sip $dip $mode "$name" } +test_port_range_ipv4_udp_drop() +{ + local proto=ipv4 + local ip_proto=udp + local sip=192.0.2.1 + local dip=192.0.2.2 + local mode="-4" + local name="IPv4 UDP Drop" + local dmac=$(mac_get $h2) + local smac=$(mac_get $h1) + local sport_min=2000 + local sport_max=3000 + local sport_mid=$((sport_min + (sport_max - sport_min) / 2)) + local dport=5000 + + RET=0 + + tc filter add dev $swp1 ingress protocol $proto handle 101 pref 1 \ + flower src_ip $sip dst_ip $dip ip_proto $ip_proto \ + src_port $sport_min-$sport_max \ + dst_port $dport \ + action drop + + # Test ports outside range - should pass + $MZ $mode $h1 -c 1 -q -p 100 -a $smac -b $dmac -A $sip -B $dip \ + -t $ip_proto "sp=$((sport_min - 1)),dp=$dport" + $MZ $mode $h1 -c 1 -q -p 100 -a $smac -b $dmac -A $sip -B $dip \ + -t $ip_proto "sp=$((sport_max + 1)),dp=$dport" + + # Test ports inside range - should be dropped + $MZ $mode $h1 -c 1 -q -p 100 -a $smac -b $dmac -A $sip -B $dip \ + -t $ip_proto "sp=$sport_min,dp=$dport" + $MZ $mode $h1 -c 1 -q -p 100 -a $smac -b $dmac -A $sip -B $dip \ + -t $ip_proto "sp=$sport_mid,dp=$dport" + $MZ $mode $h1 -c 1 -q -p 100 -a $smac -b $dmac -A $sip -B $dip \ + -t $ip_proto "sp=$sport_max,dp=$dport" + + tc_check_packets "dev $swp1 ingress" 101 3 + check_err $? "Filter did not drop the expected number of packets" + + tc filter del dev $swp1 ingress protocol $proto pref 1 handle 101 flower + + log_test "Port range matching - $name" +} + setup_prepare() { h1=${NETIFS[p1]} diff --git a/tools/testing/selftests/net/forwarding/vxlan_reserved.sh b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh new file mode 100755 index 000000000000..46c31794b91b --- /dev/null +++ b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh @@ -0,0 +1,352 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 + +# +--------------------+ +# | H1 (vrf) | +# | + $h1 | +# | | 192.0.2.1/28 | +# +----|---------------+ +# | +# +----|--------------------------------+ +# | SW | | +# | +--|------------------------------+ | +# | | + $swp1 BR1 (802.1d) | | +# | | | | +# | | + vx1 (vxlan) | | +# | | local 192.0.2.17 | | +# | | id 1000 dstport $VXPORT | | +# | +---------------------------------+ | +# | | +# | 192.0.2.32/28 via 192.0.2.18 | +# | | +# | + $rp1 | +# | | 192.0.2.17/28 | +# +--|----------------------------------+ +# | +# +--|----------------------------------+ +# | | | +# | + $rp2 | +# | 192.0.2.18/28 | +# | | +# | VRP2 (vrf) | +# +-------------------------------------+ + +: ${VXPORT:=4789} +: ${ALL_TESTS:=" + default_test + plain_test + reserved_0_test + reserved_10_test + reserved_31_test + reserved_56_test + reserved_63_test + "} + +NUM_NETIFS=4 +source lib.sh + +h1_create() +{ + simple_if_init $h1 192.0.2.1/28 + defer simple_if_fini $h1 192.0.2.1/28 + + tc qdisc add dev $h1 clsact + defer tc qdisc del dev $h1 clsact + + tc filter add dev $h1 ingress pref 77 \ + prot ip flower skip_hw ip_proto icmp action drop + defer tc filter del dev $h1 ingress pref 77 +} + +switch_create() +{ + ip_link_add br1 type bridge vlan_filtering 0 mcast_snooping 0 + # Make sure the bridge uses the MAC address of the local port and not + # that of the VxLAN's device. + ip_link_set_addr br1 $(mac_get $swp1) + ip_link_set_up br1 + + ip_link_set_up $rp1 + ip_addr_add $rp1 192.0.2.17/28 + ip_route_add 192.0.2.32/28 nexthop via 192.0.2.18 + + ip_link_set_master $swp1 br1 + ip_link_set_up $swp1 +} + +vrp2_create() +{ + simple_if_init $rp2 192.0.2.18/28 + defer simple_if_fini $rp2 192.0.2.18/28 +} + +setup_prepare() +{ + h1=${NETIFS[p1]} + swp1=${NETIFS[p2]} + + rp1=${NETIFS[p3]} + rp2=${NETIFS[p4]} + + vrf_prepare + defer vrf_cleanup + + forwarding_enable + defer forwarding_restore + + h1_create + switch_create + + vrp2_create +} + +vxlan_header_bytes() +{ + local vni=$1; shift + local -a extra_bits=("$@") + local -a bits + local i + + for ((i=0; i < 64; i++)); do + bits[i]=0 + done + + # Bit 4 is the I flag and is always on. + bits[4]=1 + + for i in ${extra_bits[@]}; do + bits[i]=1 + done + + # Bits 32..55 carry the VNI + local mask=0x800000 + for ((i=0; i < 24; i++)); do + bits[$((i + 32))]=$(((vni & mask) != 0)) + ((mask >>= 1)) + done + + local bytes + for ((i=0; i < 8; i++)); do + local byte=0 + local j + for ((j=0; j < 8; j++)); do + local bit=${bits[8 * i + j]} + ((byte += bit << (7 - j))) + done + bytes+=$(printf %02x $byte): + done + + echo ${bytes%:} +} + +neg_bytes() +{ + local bytes=$1; shift + + local -A neg=([0]=f [1]=e [2]=d [3]=c [4]=b [5]=a [6]=9 [7]=8 + [8]=7 [9]=6 [a]=5 [b]=4 [c]=3 [d]=2 [e]=1 [f]=0 [:]=:) + local out + local i + + for ((i=0; i < ${#bytes}; i++)); do + local c=${bytes:$i:1} + out+=${neg[$c]} + done + echo $out +} + +vxlan_ping_do() +{ + local count=$1; shift + local dev=$1; shift + local next_hop_mac=$1; shift + local dest_ip=$1; shift + local dest_mac=$1; shift + local vni=$1; shift + local reserved_bits=$1; shift + + local vxlan_header=$(vxlan_header_bytes $vni $reserved_bits) + + $MZ $dev -c $count -d 100msec -q \ + -b $next_hop_mac -B $dest_ip \ + -t udp sp=23456,dp=$VXPORT,p=$(: + )"$vxlan_header:"$( : VXLAN + )"$dest_mac:"$( : ETH daddr + )"00:11:22:33:44:55:"$( : ETH saddr + )"08:00:"$( : ETH type + )"45:"$( : IP version + IHL + )"00:"$( : IP TOS + )"00:54:"$( : IP total length + )"99:83:"$( : IP identification + )"40:00:"$( : IP flags + frag off + )"40:"$( : IP TTL + )"01:"$( : IP proto + )"00:00:"$( : IP header csum + )"$(ipv4_to_bytes 192.0.2.3):"$( : IP saddr + )"$(ipv4_to_bytes 192.0.2.1):"$( : IP daddr + )"08:"$( : ICMP type + )"00:"$( : ICMP code + )"8b:f2:"$( : ICMP csum + )"1f:6a:"$( : ICMP request identifier + )"00:01:"$( : ICMP request seq. number + )"4f:ff:c5:5b:00:00:00:00:"$( : ICMP payload + )"6d:74:0b:00:00:00:00:00:"$( : + )"10:11:12:13:14:15:16:17:"$( : + )"18:19:1a:1b:1c:1d:1e:1f:"$( : + )"20:21:22:23:24:25:26:27:"$( : + )"28:29:2a:2b:2c:2d:2e:2f:"$( : + )"30:31:32:33:34:35:36:37" +} + +vxlan_device_add() +{ + ip_link_add vx1 up type vxlan id 1000 \ + local 192.0.2.17 dstport "$VXPORT" \ + nolearning noudpcsum tos inherit ttl 100 "$@" + ip_link_set_master vx1 br1 +} + +vxlan_all_reserved_bits() +{ + local i + + for ((i=0; i < 64; i++)); do + if ((i == 4 || i >= 32 && i < 56)); then + continue + fi + echo $i + done +} + +vxlan_ping_vanilla() +{ + vxlan_ping_do 10 $rp2 $(mac_get $rp1) 192.0.2.17 $(mac_get $h1) 1000 +} + +vxlan_ping_reserved() +{ + for bit in $(vxlan_all_reserved_bits); do + vxlan_ping_do 1 $rp2 $(mac_get $rp1) \ + 192.0.2.17 $(mac_get $h1) 1000 "$bit" + ((n++)) + done +} + +vxlan_ping_test() +{ + local what=$1; shift + local get_stat=$1; shift + local expect=$1; shift + + RET=0 + + local t0=$($get_stat) + + "$@" + check_err $? "Failure when running $@" + + local t1=$($get_stat) + local delta=$((t1 - t0)) + + ((expect == delta)) + check_err $? "Expected to capture $expect packets, got $delta." + + log_test "$what" +} + +__default_test_do() +{ + local n_allowed_bits=$1; shift + local what=$1; shift + + vxlan_ping_test "$what: clean packets" \ + "tc_rule_stats_get $h1 77 ingress" \ + 10 vxlan_ping_vanilla + + local t0=$(link_stats_get vx1 rx errors) + vxlan_ping_test "$what: mangled packets" \ + "tc_rule_stats_get $h1 77 ingress" \ + $n_allowed_bits vxlan_ping_reserved + local t1=$(link_stats_get vx1 rx errors) + + RET=0 + local expect=$((39 - n_allowed_bits)) + local delta=$((t1 - t0)) + ((expect == delta)) + check_err $? "Expected $expect error packets, got $delta." + log_test "$what: drops reported" +} + +default_test_do() +{ + vxlan_device_add + __default_test_do 0 "Default" +} + +default_test() +{ + in_defer_scope \ + default_test_do +} + +plain_test_do() +{ + vxlan_device_add reserved_bits 0xf7ffffff000000ff + __default_test_do 0 "reserved_bits 0xf7ffffff000000ff" +} + +plain_test() +{ + in_defer_scope \ + plain_test_do +} + +reserved_test() +{ + local bit=$1; shift + + local allowed_bytes=$(vxlan_header_bytes 0xffffff $bit) + local reserved_bytes=$(neg_bytes $allowed_bytes) + local reserved_bits=${reserved_bytes//:/} + + vxlan_device_add reserved_bits 0x$reserved_bits + __default_test_do 1 "reserved_bits 0x$reserved_bits" +} + +reserved_0_test() +{ + in_defer_scope \ + reserved_test 0 +} + +reserved_10_test() +{ + in_defer_scope \ + reserved_test 10 +} + +reserved_31_test() +{ + in_defer_scope \ + reserved_test 31 +} + +reserved_56_test() +{ + in_defer_scope \ + reserved_test 56 +} + +reserved_63_test() +{ + in_defer_scope \ + reserved_test 63 +} + +trap cleanup EXIT + +setup_prepare +setup_wait +tests_run + +exit $EXIT_STATUS diff --git a/tools/testing/selftests/net/ipsec.c b/tools/testing/selftests/net/ipsec.c index be4a30a0d02a..9b44a091802c 100644 --- a/tools/testing/selftests/net/ipsec.c +++ b/tools/testing/selftests/net/ipsec.c @@ -227,7 +227,8 @@ static int rtattr_pack(struct nlmsghdr *nh, size_t req_sz, attr->rta_len = RTA_LENGTH(size); attr->rta_type = rta_type; - memcpy(RTA_DATA(attr), payload, size); + if (payload) + memcpy(RTA_DATA(attr), payload, size); return 0; } diff --git a/tools/testing/selftests/net/lib.sh b/tools/testing/selftests/net/lib.sh index 8994fec1c38f..0bd9a038a1f0 100644 --- a/tools/testing/selftests/net/lib.sh +++ b/tools/testing/selftests/net/lib.sh @@ -435,6 +435,13 @@ xfail_on_veth() fi } +mac_get() +{ + local if_name=$1 + + ip -j link show dev $if_name | jq -r '.[]["address"]' +} + kill_process() { local pid=$1; shift @@ -451,7 +458,7 @@ ip_link_add() defer ip link del dev "$name" } -ip_link_master() +ip_link_set_master() { local member=$1; shift local master=$1; shift @@ -459,3 +466,62 @@ ip_link_master() ip link set dev "$member" master "$master" defer ip link set dev "$member" nomaster } + +ip_link_set_addr() +{ + local name=$1; shift + local addr=$1; shift + + local old_addr=$(mac_get "$name") + ip link set dev "$name" address "$addr" + defer ip link set dev "$name" address "$old_addr" +} + +ip_link_is_up() +{ + local name=$1; shift + + local state=$(ip -j link show "$name" | + jq -r '(.[].flags[] | select(. == "UP")) // "DOWN"') + [[ $state == "UP" ]] +} + +ip_link_set_up() +{ + local name=$1; shift + + if ! ip_link_is_up "$name"; then + ip link set dev "$name" up + defer ip link set dev "$name" down + fi +} + +ip_link_set_down() +{ + local name=$1; shift + + if ip_link_is_up "$name"; then + ip link set dev "$name" down + defer ip link set dev "$name" up + fi +} + +ip_addr_add() +{ + local name=$1; shift + + ip addr add dev "$name" "$@" + defer ip addr del dev "$name" "$@" +} + +ip_route_add() +{ + ip route add "$@" + defer ip route del "$@" +} + +bridge_vlan_add() +{ + bridge vlan add "$@" + defer bridge vlan del "$@" +} diff --git a/tools/testing/selftests/net/lib/Makefile b/tools/testing/selftests/net/lib/Makefile index 18b9443454a9..c22623b9a2a5 100644 --- a/tools/testing/selftests/net/lib/Makefile +++ b/tools/testing/selftests/net/lib/Makefile @@ -1,6 +1,6 @@ # SPDX-License-Identifier: GPL-2.0 -CFLAGS = -Wall -Wl,--no-as-needed -O2 -g +CFLAGS += -Wall -Wl,--no-as-needed -O2 -g CFLAGS += -I../../../../../usr/include/ $(KHDR_INCLUDES) # Additional include paths needed by kselftest.h CFLAGS += -I../../ @@ -9,7 +9,10 @@ TEST_FILES := ../../../../../Documentation/netlink/specs TEST_FILES += ../../../../net/ynl TEST_GEN_FILES += csum +TEST_GEN_FILES += $(patsubst %.c,%.o,$(wildcard *.bpf.c)) TEST_INCLUDES := $(wildcard py/*.py sh/*.sh) include ../../lib.mk + +include ../bpf.mk diff --git a/tools/testing/selftests/net/lib/py/ksft.py b/tools/testing/selftests/net/lib/py/ksft.py index 477ae76de93d..3efe005436cd 100644 --- a/tools/testing/selftests/net/lib/py/ksft.py +++ b/tools/testing/selftests/net/lib/py/ksft.py @@ -71,6 +71,11 @@ def ksft_in(a, b, comment=""): _fail("Check failed", a, "not in", b, comment) +def ksft_is(a, b, comment=""): + if a is not b: + _fail("Check failed", a, "is not", b, comment) + + def ksft_ge(a, b, comment=""): if a < b: _fail("Check failed", a, "<", b, comment) diff --git a/tools/testing/selftests/net/lib/py/utils.py b/tools/testing/selftests/net/lib/py/utils.py index 72590c3f90f1..9e3bcddcf3e8 100644 --- a/tools/testing/selftests/net/lib/py/utils.py +++ b/tools/testing/selftests/net/lib/py/utils.py @@ -10,7 +10,9 @@ import time class CmdExitFailure(Exception): - pass + def __init__(self, msg, cmd_obj): + super().__init__(msg) + self.cmd = cmd_obj class cmd: @@ -48,7 +50,7 @@ class cmd: if len(stderr) > 0 and stderr[-1] == "\n": stderr = stderr[:-1] raise CmdExitFailure("Command failed: %s\nSTDOUT: %s\nSTDERR: %s" % - (self.proc.args, stdout, stderr)) + (self.proc.args, stdout, stderr), self) class bkg(cmd): diff --git a/tools/testing/selftests/net/lib/py/ynl.py b/tools/testing/selftests/net/lib/py/ynl.py index a0d689d58c57..ad1e36baee2a 100644 --- a/tools/testing/selftests/net/lib/py/ynl.py +++ b/tools/testing/selftests/net/lib/py/ynl.py @@ -13,14 +13,14 @@ try: SPEC_PATH = KSFT_DIR / "net/lib/specs" sys.path.append(tools_full_path.as_posix()) - from net.lib.ynl.lib import YnlFamily, NlError + from net.lib.ynl.pyynl.lib import YnlFamily, NlError else: # Running in tree tools_full_path = KSRC / "tools" SPEC_PATH = KSRC / "Documentation/netlink/specs" sys.path.append(tools_full_path.as_posix()) - from net.ynl.lib import YnlFamily, NlError + from net.ynl.pyynl.lib import YnlFamily, NlError except ModuleNotFoundError as e: ksft_pr("Failed importing `ynl` library from kernel sources") ksft_pr(str(e)) @@ -32,23 +32,23 @@ except ModuleNotFoundError as e: # Set schema='' to avoid jsonschema validation, it's slow # class EthtoolFamily(YnlFamily): - def __init__(self): + def __init__(self, recv_size=0): super().__init__((SPEC_PATH / Path('ethtool.yaml')).as_posix(), - schema='') + schema='', recv_size=recv_size) class RtnlFamily(YnlFamily): - def __init__(self): + def __init__(self, recv_size=0): super().__init__((SPEC_PATH / Path('rt_link.yaml')).as_posix(), - schema='') + schema='', recv_size=recv_size) class NetdevFamily(YnlFamily): - def __init__(self): + def __init__(self, recv_size=0): super().__init__((SPEC_PATH / Path('netdev.yaml')).as_posix(), - schema='') + schema='', recv_size=recv_size) class NetshaperFamily(YnlFamily): - def __init__(self): + def __init__(self, recv_size=0): super().__init__((SPEC_PATH / Path('net_shaper.yaml')).as_posix(), - schema='') + schema='', recv_size=recv_size) diff --git a/tools/testing/selftests/net/lib/xdp_dummy.bpf.c b/tools/testing/selftests/net/lib/xdp_dummy.bpf.c new file mode 100644 index 000000000000..d988b2e0cee8 --- /dev/null +++ b/tools/testing/selftests/net/lib/xdp_dummy.bpf.c @@ -0,0 +1,13 @@ +// SPDX-License-Identifier: GPL-2.0 + +#define KBUILD_MODNAME "xdp_dummy" +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> + +SEC("xdp") +int xdp_dummy_prog(struct xdp_md *ctx) +{ + return XDP_PASS; +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/net/mptcp/Makefile b/tools/testing/selftests/net/mptcp/Makefile index 8e3fc05a5397..c76525fe2b84 100644 --- a/tools/testing/selftests/net/mptcp/Makefile +++ b/tools/testing/selftests/net/mptcp/Makefile @@ -2,7 +2,7 @@ top_srcdir = ../../../../.. -CFLAGS = -Wall -Wl,--no-as-needed -O2 -g -I$(top_srcdir)/usr/include $(KHDR_INCLUDES) +CFLAGS += -Wall -Wl,--no-as-needed -O2 -g -I$(top_srcdir)/usr/include $(KHDR_INCLUDES) TEST_PROGS := mptcp_connect.sh pm_netlink.sh mptcp_join.sh diag.sh \ simult_flows.sh mptcp_sockopt.sh userspace_pm.sh diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.c b/tools/testing/selftests/net/mptcp/mptcp_connect.c index 4209b9569039..d240d02fa443 100644 --- a/tools/testing/selftests/net/mptcp/mptcp_connect.c +++ b/tools/testing/selftests/net/mptcp/mptcp_connect.c @@ -25,6 +25,8 @@ #include <sys/types.h> #include <sys/mman.h> +#include <arpa/inet.h> + #include <netdb.h> #include <netinet/in.h> @@ -1211,23 +1213,42 @@ static void parse_setsock_options(const char *name) exit(1); } -void xdisconnect(int fd, int addrlen) +void xdisconnect(int fd) { - struct sockaddr_storage empty; + socklen_t addrlen = sizeof(struct sockaddr_storage); + struct sockaddr_storage addr, empty; int msec_sleep = 10; - int queued = 1; - int i; + void *raw_addr; + int i, cmdlen; + char cmd[128]; + + /* get the local address and convert it to string */ + if (getsockname(fd, (struct sockaddr *)&addr, &addrlen) < 0) + xerror("getsockname"); + + if (addr.ss_family == AF_INET) + raw_addr = &(((struct sockaddr_in *)&addr)->sin_addr); + else if (addr.ss_family == AF_INET6) + raw_addr = &(((struct sockaddr_in6 *)&addr)->sin6_addr); + else + xerror("bad family"); + + strcpy(cmd, "ss -M | grep -q "); + cmdlen = strlen(cmd); + if (!inet_ntop(addr.ss_family, raw_addr, &cmd[cmdlen], + sizeof(cmd) - cmdlen)) + xerror("inet_ntop"); shutdown(fd, SHUT_WR); - /* while until the pending data is completely flushed, the later + /* + * wait until the pending data is completely flushed and all + * the MPTCP sockets reached the closed status. * disconnect will bypass/ignore/drop any pending data. */ for (i = 0; ; i += msec_sleep) { - if (ioctl(fd, SIOCOUTQ, &queued) < 0) - xerror("can't query out socket queue: %d", errno); - - if (!queued) + /* closed socket are not listed by 'ss' */ + if (system(cmd) != 0) break; if (i > poll_timeout) @@ -1281,9 +1302,9 @@ again: return ret; if (cfg_truncate > 0) { - xdisconnect(fd, peer->ai_addrlen); + shutdown(fd, SHUT_WR); } else if (--cfg_repeat > 0) { - xdisconnect(fd, peer->ai_addrlen); + xdisconnect(fd); /* the socket could be unblocking at this point, we need the * connect to be blocking diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.sh b/tools/testing/selftests/net/mptcp/mptcp_connect.sh index b48b4e56826a..5e3c56253274 100755 --- a/tools/testing/selftests/net/mptcp/mptcp_connect.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_connect.sh @@ -137,7 +137,7 @@ TEST_GROUP="" #shellcheck disable=SC2317 cleanup() { - rm -f "$cin_disconnect" "$cout_disconnect" + rm -f "$cin_disconnect" rm -f "$cin" "$cout" rm -f "$sin" "$sout" rm -f "$capout" @@ -155,7 +155,6 @@ cin=$(mktemp) cout=$(mktemp) capout=$(mktemp) cin_disconnect="$cin".disconnect -cout_disconnect="$cout".disconnect trap cleanup EXIT mptcp_lib_ns_init ns1 ns2 ns3 ns4 @@ -445,12 +444,8 @@ do_transfer() printf "(duration %05sms) " "${duration}" if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then mptcp_lib_pr_fail "client exit code $retc, server $rets" - echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port" - cat /tmp/${listener_ns}.out - echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port" - [ ${listener_ns} != ${connector_ns} ] && cat /tmp/${connector_ns}.out + mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \ + "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out" echo cat "$capout" @@ -587,7 +582,7 @@ make_file() mptcp_lib_make_file $name 1024 $ksize dd if=/dev/urandom conv=notrunc of="$name" oflag=append bs=1 count=$rem 2> /dev/null - echo "Created $name (size $(du -b "$name")) containing data sent by $who" + echo "Created $name (size $(stat -c "%s" "$name") B) containing data sent by $who" } run_tests_lo() diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh index c07e2bd3a315..13a3b68181ee 100755 --- a/tools/testing/selftests/net/mptcp/mptcp_join.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh @@ -1039,13 +1039,8 @@ do_transfer() if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then fail_test "client exit code $retc, server $rets" - echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port" - cat /tmp/${listener_ns}.out - echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port" - cat /tmp/${connector_ns}.out - + mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \ + "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out" return 1 fi diff --git a/tools/testing/selftests/net/mptcp/mptcp_lib.sh b/tools/testing/selftests/net/mptcp/mptcp_lib.sh index 975d4d4c862a..051e289d7967 100644 --- a/tools/testing/selftests/net/mptcp/mptcp_lib.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_lib.sh @@ -107,6 +107,27 @@ mptcp_lib_pr_info() { mptcp_lib_print_info "INFO: ${*}" } +# $1-2: listener/connector ns ; $3 port ; $4-5 listener/connector stat file +mptcp_lib_pr_err_stats() { + local lns="${1}" + local cns="${2}" + local port="${3}" + local lstat="${4}" + local cstat="${5}" + + echo -en "${MPTCP_LIB_COLOR_RED}" + { + printf "\nnetns %s (listener) socket stat for %d:\n" "${lns}" "${port}" + ip netns exec "${lns}" ss -Menitam -o "sport = :${port}" + cat "${lstat}" + + printf "\nnetns %s (connector) socket stat for %d:\n" "${cns}" "${port}" + ip netns exec "${cns}" ss -Menitam -o "dport = :${port}" + [ "${lstat}" != "${cstat}" ] && cat "${cstat}" + } 1>&2 + echo -en "${MPTCP_LIB_COLOR_RESET}" +} + # SELFTESTS_MPTCP_LIB_EXPECT_ALL_FEATURES env var can be set when validating all # features using the last version of the kernel and the selftests to make sure # a test is not being skipped by mistake. diff --git a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh index 5e8d5b83e2d0..418a903c3a4d 100755 --- a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh @@ -169,6 +169,11 @@ do_transfer() cmsg+=",TCPINQ" fi + NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \ + nstat -n + NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \ + nstat -n + timeout ${timeout_test} \ ip netns exec ${listener_ns} \ $mptcp_connect -t ${timeout_poll} -l -M 1 -p $port -s ${srv_proto} -c "${cmsg}" \ @@ -189,14 +194,16 @@ do_transfer() wait $spid local rets=$? + NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \ + nstat | grep Tcp > /tmp/${listener_ns}.out + NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \ + nstat | grep Tcp > /tmp/${connector_ns}.out + print_title "Transfer ${ip:2}" if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then mptcp_lib_pr_fail "client exit code $retc, server $rets" - echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port" - - echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2 - ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port" + mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \ + "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out" mptcp_lib_result_fail "transfer ${ip}" diff --git a/tools/testing/selftests/net/mptcp/simult_flows.sh b/tools/testing/selftests/net/mptcp/simult_flows.sh index 8fa77c8e9b65..9c2a415976cb 100755 --- a/tools/testing/selftests/net/mptcp/simult_flows.sh +++ b/tools/testing/selftests/net/mptcp/simult_flows.sh @@ -155,6 +155,11 @@ do_transfer() sleep 1 fi + NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \ + nstat -n + NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \ + nstat -n + timeout ${timeout_test} \ ip netns exec ${ns3} \ ./mptcp_connect -jt ${timeout_poll} -l -p $port -T $max_time \ @@ -180,25 +185,27 @@ do_transfer() kill ${cappid_connector} fi + NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \ + nstat | grep Tcp > /tmp/${ns3}.out + NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \ + nstat | grep Tcp > /tmp/${ns1}.out + cmp $sin $cout > /dev/null 2>&1 local cmps=$? cmp $cin $sout > /dev/null 2>&1 local cmpc=$? - printf "%-16s" " max $max_time " if [ $retc -eq 0 ] && [ $rets -eq 0 ] && \ [ $cmpc -eq 0 ] && [ $cmps -eq 0 ]; then + printf "%-16s" " max $max_time " mptcp_lib_pr_ok cat "$capout" return 0 fi - mptcp_lib_pr_fail - echo "client exit code $retc, server $rets" 1>&2 - echo -e "\nnetns ${ns3} socket stat for $port:" 1>&2 - ip netns exec ${ns3} ss -nita 1>&2 -o "sport = :$port" - echo -e "\nnetns ${ns1} socket stat for $port:" 1>&2 - ip netns exec ${ns1} ss -nita 1>&2 -o "dport = :$port" + mptcp_lib_pr_fail "client exit code $retc, server $rets" + mptcp_lib_pr_err_stats "${ns3}" "${ns1}" "${port}" \ + "/tmp/${ns3}.out" "/tmp/${ns1}.out" ls -l $sin $cout ls -l $cin $sout diff --git a/tools/testing/selftests/net/netfilter/rpath.sh b/tools/testing/selftests/net/netfilter/rpath.sh index 4485fd7675ed..86ec4e68594d 100755 --- a/tools/testing/selftests/net/netfilter/rpath.sh +++ b/tools/testing/selftests/net/netfilter/rpath.sh @@ -61,9 +61,20 @@ ip -net "$ns2" a a 192.168.42.1/24 dev d0 ip -net "$ns1" a a fec0:42::2/64 dev v0 nodad ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad +# avoid neighbor lookups and enable martian IPv6 pings +ns2_hwaddr=$(ip -net "$ns2" link show dev v0 | \ + sed -n 's, *link/ether \([^ ]*\) .*,\1,p') +ns1_hwaddr=$(ip -net "$ns1" link show dev v0 | \ + sed -n 's, *link/ether \([^ ]*\) .*,\1,p') +ip -net "$ns1" neigh add fec0:42::1 lladdr "$ns2_hwaddr" nud permanent dev v0 +ip -net "$ns1" neigh add fec0:23::1 lladdr "$ns2_hwaddr" nud permanent dev v0 +ip -net "$ns2" neigh add fec0:42::2 lladdr "$ns1_hwaddr" nud permanent dev d0 +ip -net "$ns2" neigh add fec0:23::2 lladdr "$ns1_hwaddr" nud permanent dev v0 + # firewall matches to test [ -n "$iptables" ] && { common='-t raw -A PREROUTING -s 192.168.0.0/16' + common+=' -p icmp --icmp-type echo-request' if ! ip netns exec "$ns2" "$iptables" $common -m rpfilter;then echo "Cannot add rpfilter rule" exit $ksft_skip @@ -72,6 +83,7 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad } [ -n "$ip6tables" ] && { common='-t raw -A PREROUTING -s fec0::/16' + common+=' -p icmpv6 --icmpv6-type echo-request' if ! ip netns exec "$ns2" "$ip6tables" $common -m rpfilter;then echo "Cannot add rpfilter rule" exit $ksft_skip @@ -82,8 +94,10 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad table inet t { chain c { type filter hook prerouting priority raw; - ip saddr 192.168.0.0/16 fib saddr . iif oif exists counter - ip6 saddr fec0::/16 fib saddr . iif oif exists counter + ip saddr 192.168.0.0/16 icmp type echo-request \ + fib saddr . iif oif exists counter + ip6 saddr fec0::/16 icmpv6 type echo-request \ + fib saddr . iif oif exists counter } } EOF diff --git a/tools/testing/selftests/net/nl_netdev.py b/tools/testing/selftests/net/nl_netdev.py index 93d9d914529b..93e8cb671c3d 100755 --- a/tools/testing/selftests/net/nl_netdev.py +++ b/tools/testing/selftests/net/nl_netdev.py @@ -18,6 +18,23 @@ def lo_check(nf) -> None: ksft_eq(len(lo_info['xdp-rx-metadata-features']), 0) +def napi_list_check(nf) -> None: + with NetdevSimDev(queue_count=100) as nsimdev: + nsim = nsimdev.nsims[0] + + ip(f"link set dev {nsim.ifname} up") + + napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True) + ksft_eq(len(napis), 100) + + for q in [50, 0, 99]: + for i in range(4): + nsim.dfs_write("queue_reset", f"{q} {i}") + napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True) + ksft_eq(len(napis), 100, + comment=f"queue count after reset queue {q} mode {i}") + + def page_pool_check(nf) -> None: with NetdevSimDev() as nsimdev: nsim = nsimdev.nsims[0] @@ -89,7 +106,7 @@ def page_pool_check(nf) -> None: def main() -> None: nf = NetdevFamily() - ksft_run([empty_check, lo_check, page_pool_check], + ksft_run([empty_check, lo_check, page_pool_check, napi_list_check], args=(nf, )) ksft_exit() diff --git a/tools/testing/selftests/net/openvswitch/Makefile b/tools/testing/selftests/net/openvswitch/Makefile index 2f1508abc826..3fd1da2ec07d 100644 --- a/tools/testing/selftests/net/openvswitch/Makefile +++ b/tools/testing/selftests/net/openvswitch/Makefile @@ -2,7 +2,7 @@ top_srcdir = ../../../../.. -CFLAGS = -Wall -Wl,--no-as-needed -O2 -g -I$(top_srcdir)/usr/include $(KHDR_INCLUDES) +CFLAGS += -Wall -Wl,--no-as-needed -O2 -g -I$(top_srcdir)/usr/include $(KHDR_INCLUDES) TEST_PROGS := openvswitch.sh diff --git a/tools/testing/selftests/net/openvswitch/openvswitch.sh b/tools/testing/selftests/net/openvswitch/openvswitch.sh index cc0bfae2bafa..960e1ab4dd04 100755 --- a/tools/testing/selftests/net/openvswitch/openvswitch.sh +++ b/tools/testing/selftests/net/openvswitch/openvswitch.sh @@ -171,8 +171,10 @@ ovs_add_netns_and_veths () { ovs_add_if "$1" "$2" "$4" -u || return 1 fi - [ $TRACING -eq 1 ] && ovs_netns_spawn_daemon "$1" "$ns" \ - tcpdump -i any -s 65535 + if [ $TRACING -eq 1 ]; then + ovs_netns_spawn_daemon "$1" "$3" tcpdump -l -i any -s 6553 + ovs_wait grep -q "listening on any" ${ovs_dir}/stderr + fi return 0 } diff --git a/tools/testing/selftests/net/packetdrill/ksft_runner.sh b/tools/testing/selftests/net/packetdrill/ksft_runner.sh index 4071c133f29e..ef8b25a606d8 100755 --- a/tools/testing/selftests/net/packetdrill/ksft_runner.sh +++ b/tools/testing/selftests/net/packetdrill/ksft_runner.sh @@ -23,7 +23,7 @@ if [ $# -ne 1 ]; then ktap_exit_fail_msg "usage: $0 <script>" exit "$KSFT_FAIL" fi -script="$1" +script="$(basename $1)" if [ -z "$(which packetdrill)" ]; then ktap_skip_all "packetdrill not found in PATH" @@ -31,16 +31,32 @@ if [ -z "$(which packetdrill)" ]; then fi declare -a optargs +failfunc=ktap_test_fail + if [[ -n "${KSFT_MACHINE_SLOW}" ]]; then optargs+=('--tolerance_usecs=14000') + + # xfail tests that are known flaky with dbg config, not fixable. + # still run them for coverage (and expect 100% pass without dbg). + declare -ar xfail_list=( + "tcp_eor_no-coalesce-retrans.pkt" + "tcp_fast_recovery_prr-ss.*.pkt" + "tcp_slow_start_slow-start-after-win-update.pkt" + "tcp_timestamping.*.pkt" + "tcp_user_timeout_user-timeout-probe.pkt" + "tcp_zerocopy_epoll_.*.pkt" + "tcp_tcp_info_tcp-info-.*-limited.pkt" + ) + readonly xfail_regex="^($(printf '%s|' "${xfail_list[@]}"))$" + [[ "$script" =~ ${xfail_regex} ]] && failfunc=ktap_test_xfail fi ktap_print_header ktap_set_plan 2 -unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $(basename $script) > /dev/null \ - && ktap_test_pass "ipv4" || ktap_test_fail "ipv4" -unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $(basename $script) > /dev/null \ - && ktap_test_pass "ipv6" || ktap_test_fail "ipv6" +unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $script > /dev/null \ + && ktap_test_pass "ipv4" || $failfunc "ipv4" +unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $script > /dev/null \ + && ktap_test_pass "ipv6" || $failfunc "ipv6" ktap_finished diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt new file mode 100644 index 000000000000..38535701656e --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt @@ -0,0 +1,18 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test for blocking accept. + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +0...0.200 accept(3, ..., ...) = 4 + + +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 257 + + +.1 write(4, ..., 2000) = 2000 + +0 > P. 1:2001(2000) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt new file mode 100644 index 000000000000..3692ef102381 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt @@ -0,0 +1,13 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test for blocking connect. + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + + +.1...0.200 connect(3, ..., ...) = 0 + + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +.1 < S. 0:0(0) ack 1 win 5792 <mss 1460,nop,wscale 2,nop,nop,sackOK> + +0 > . 1:1(0) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt new file mode 100644 index 000000000000..914eabab367a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt @@ -0,0 +1,29 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test for blocking read. +--tolerance_usecs=10000 + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 257 + +0 accept(3, ..., ...) = 4 + + +0...0.100 read(4, ..., 2000) = 2000 + +.1 < P. 1:2001(2000) ack 1 win 257 + +0 > . 1:1(0) ack 2001 + + +.1...0.200 read(4, ..., 2000) = 2000 + +.1 < P. 2001:4001(2000) ack 1 win 257 + +0 > . 1:1(0) ack 4001 + + +.1 < P. 4001:6001(2000) ack 1 win 257 + +0 > . 1:1(0) ack 6001 + +0...0.000 read(4, ..., 1000) = 1000 + +0...0.000 read(4, ..., 1000) = 1000 diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt new file mode 100644 index 000000000000..cec5a0725d95 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt @@ -0,0 +1,35 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test for blocking write. +--tolerance_usecs=10000 + +`./defaults.sh +./set_sysctls.py /proc/sys/net/ipv4/tcp_min_tso_segs=10 +` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +.1 < S 0:0(0) win 50000 <mss 1000,nop,wscale 0> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 50000 + +0 accept(3, ..., ...) = 4 + +// Kernel doubles our value -> sk->sk_sndbuf is set to 42000 + +0 setsockopt(4, SOL_SOCKET, SO_SNDBUF, [21000], 4) = 0 + +0 getsockopt(4, SOL_SOCKET, SO_SNDBUF, [42000], [4]) = 0 + +// A write of 60000 does not block. + +0...0.300 write(4, ..., 61000) = 61000 // this write() blocks + + +.1 < . 1:1(0) ack 10001 win 50000 + + +.1 < . 1:1(0) ack 30001 win 50000 + +// This ACK should wakeup the write(). An ACK of 35001 does not. + +.1 < . 1:1(0) ack 36001 win 50000 + +// Reset to sysctls defaults. +`/tmp/sysctl_restore_${PPID}.sh` diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt new file mode 100644 index 000000000000..8514d6bdbb6d --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt @@ -0,0 +1,23 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test basic connection teardown where local process closes first: +// the local process calls close() first, so we send a FIN, and receive an ACK. +// Then we receive a FIN and ACK it. + +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +.01...0.011 connect(3, ..., ...) = 0 + +0 > S 0:0(0) <...> + +0 < S. 0:0(0) ack 1 win 32768 <mss 1000,nop,wscale 6,nop,nop,sackOK> + +0 > . 1:1(0) ack 1 + + +0 write(3, ..., 1000) = 1000 + +0 > P. 1:1001(1000) ack 1 + +0 < . 1:1(0) ack 1001 win 257 + + +0 close(3) = 0 + +0 > F. 1001:1001(0) ack 1 + +0 < . 1:1(0) ack 1002 win 257 + + +0 < F. 1:1(0) ack 1002 win 257 + +0 > . 1002:1002(0) ack 2 diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt new file mode 100644 index 000000000000..04103134bd99 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt @@ -0,0 +1,21 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test to make sure no RST is being sent when close() +// is called on a socket with SYN_SENT state. + +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + + +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <...> + +// Application decideds to close the socket in SYN_SENT state +// Make sure no RST is sent after close(). + +0 close(3) = 0 + +// Receive syn-ack to trigger the send side packet examination: +// If a RESET were sent right after close(), it would have failed with +// a mismatched timestamp. + +.1 < S. 0:0(0) ack 1 win 32000 <mss 1460,nop,wscale 7> + +0 > R 1:1(0) diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt new file mode 100644 index 000000000000..5f3a2914213a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt @@ -0,0 +1,36 @@ +// SPDX-License-Identifier: GPL-2.0 +// Verify behavior for the sequence: remote side sends FIN, then we close(). +// Since the remote side (client) closes first, we test our LAST_ACK code path. + +`./defaults.sh` + +// Initialize a server socket. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +0 < . 1:1(0) ack 1 win 257 + + +0 accept(3, ..., ...) = 4 + +// Client closes first. + +.01 < F. 1:1(0) ack 1 win 257 + +0 > . 1:1(0) ack 2 + +// App notices that client closed. + +0 read(4, ..., 1000) = 0 + +// Then we close. + +.01 close(4) = 0 + +0 > F. 1:1(0) ack 2 + +// Client ACKs our FIN. + +.01 < . 2:2(0) ack 2 win 257 + +// Verify that we send RST in response to any incoming segments +// (because the kernel no longer has any record of this socket). + +.01 < . 2:2(0) ack 2 win 257 + +0 > R 2:2(0) diff --git a/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt new file mode 100644 index 000000000000..643baf3267cf --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt @@ -0,0 +1,21 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test ECN: verify that Linux TCP ECN sending code uses ECT0 (not ECT1). +// +`./defaults.sh +sysctl -q net.ipv4.tcp_ecn=1 # fully enabled +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4 + +// ECN handshake: send EW flags in SYN packet, E flag in SYN-ACK response ++.002 ... 0.004 connect(4, ..., ...) = 0 + + +0 > SEW 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> ++.002 < SE. 0:0(0) ack 1 win 32767 <mss 1000,nop,wscale 6,nop,nop,sackOK> + +0 > . 1:1(0) ack 1 + +// Write 1 MSS. ++.002 write(4, ..., 1000) = 1000 +// Send 1 MSS with ect0. + +0 > [ect0] P. 1:1001(1000) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt new file mode 100644 index 000000000000..f95b9b3c9fa1 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt @@ -0,0 +1,38 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP does not append any data from consequent writes to the tail +// skb created for the chunk. The large chunk itself should be packetized as +// usual. +`./defaults.sh +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + +// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on +// the tail. + +0 write(4, ..., 10400) = 10400 + +// Write another 10040B chunk with no coalescing options. + +0 send(4, ..., 10400, MSG_EOR) = 10400 + +// Write a 2KB chunk. This chunk should not be appended to the packets created +// the previous chunk. + +0 write(4, ..., 2000) = 2000 + + +0 > P. 1:10001(10000) ack 1 ++.001 < . 1:1(0) ack 10001 win 514 +// Now we have enough room to send out the 2 x 400B packets out. + +0 > P. 10001:20801(10800) ack 1 ++.001 < . 1:1(0) ack 20801 win 514 +// This 2KB packet should be sent alone. + +0 > P. 20801:22801(2000) ack 1 ++.001 < . 1:1(0) ack 22801 win 514 diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt new file mode 100644 index 000000000000..2ff66075288e --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt @@ -0,0 +1,72 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP does not append any data from consequent writes to the tail +// skb created for the chunk. Also, when packets are retransmitted, they +// will not be coalesce into the same skb. +`./defaults.sh +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + +// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on +// the tail. + +0 write(4, ..., 10400) = 10400 + +// Write 10 400B chunks with no coalescing options. + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 +// This chunk should not be appended to the skbs created for the previous chunk. + +0 write(4, ..., 10000) = 10000 + + +0 > P. 1:10001(10000) ack 1 ++.001 < . 1:1(0) ack 10001 win 514 +// Now we have enough room to send out the 2 x 400B packets out. + +0 > P. 10001:10801(800) ack 1 +// The 9 remaining 400B chunks should be sent as individual packets. + +0 > P. 10801:11201(400) ack 1 + +0 > P. 11201:11601(400) ack 1 + +0 > P. 11601:12001(400) ack 1 + +0 > P. 12001:12401(400) ack 1 + +0 > P. 12401:12801(400) ack 1 + +0 > P. 12801:13201(400) ack 1 + +0 > P. 13201:13601(400) ack 1 + +0 > P. 13601:14001(400) ack 1 + +0 > P. 14001:14401(400) ack 1 +// The last 10KB chunk should be sent separately. + +0 > P. 14401:24401(10000) ack 1 + ++.001 < . 1:1(0) ack 10401 win 514 ++.001 < . 1:1(0) ack 10801 win 514 ++.001 < . 1:1(0) ack 11201 win 514 ++.001 < . 1:1(0) ack 11601 win 514 ++.001 < . 1:1(0) ack 12001 win 514 <sack 13201:14401,nop,nop> +// TCP should fill the hole but no coalescing should happen, and all +// retransmissions should be sent out as individual packets. + +// Note : This is timeout based retransmit. +// Do not put +0 here or flakes will come back. ++.004~+.008 > P. 12001:12401(400) ack 1 + ++.001 < . 1:1(0) ack 12401 win 514 <sack 13201:14401,nop,nop> + +0 > P. 12401:12801(400) ack 1 + +0 > P. 12801:13201(400) ack 1 ++.001 < . 1:1(0) ack 12801 win 514 <sack 13201:14401,nop,nop> ++.001 < . 1:1(0) ack 14401 win 514 ++.001 < . 1:1(0) ack 24401 win 514 diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt new file mode 100644 index 000000000000..77039c5aac39 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt @@ -0,0 +1,36 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP does not append any data from consequent writes to the tail +// skb created for the chunk. +`./defaults.sh +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + +// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on +// the tail. + +0 write(4, ..., 10400) = 10400 + +// Write a 400B chunk with no coalescing options. + +0 send(4, ..., 400, MSG_EOR) = 400 + +// This chunk should not be appended to the skbs created for the previous chunk. + +0 write(4, ..., 10000) = 10000 + + +0 > P. 1:10001(10000) ack 1 ++.001 < . 1:1(0) ack 10001 win 514 +// Now we have enough room to send out the 2 x 400B packets out. + +0 > P. 10001:10801(800) ack 1 + +0 > P. 10801:20801(10000) ack 1 ++.001 < . 1:1(0) ack 10401 win 514 ++.001 < . 1:1(0) ack 10801 win 514 ++.001 < . 1:1(0) ack 20801 win 514 diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt new file mode 100644 index 000000000000..dd5a06250595 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt @@ -0,0 +1,66 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP does not append any data from consequent writes to the tail +// skb created for the chunk even though we have 10 back-to-back small +// writes. +`./defaults.sh +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + +// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on +// the tail. + +0 write(4, ..., 10400) = 10400 + +// Write 10 400B chunks with no coalescing options. + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 + +0 send(4, ..., 400, MSG_EOR) = 400 +// This chunk should not be appended to the skbs created for the previous chunk. + +0 write(4, ..., 10000) = 10000 + + +0 > P. 1:10001(10000) ack 1 ++.001 < . 1:1(0) ack 10001 win 514 +// Now we have enough room to send out the 2 x 400B packets out. + +0 > P. 10001:10801(800) ack 1 +// The 9 remaining 400B chunks should be sent as individual packets. + +0 > P. 10801:11201(400) ack 1 + +0 > P. 11201:11601(400) ack 1 + +0 > P. 11601:12001(400) ack 1 + +0 > P. 12001:12401(400) ack 1 + +0 > P. 12401:12801(400) ack 1 + +0 > P. 12801:13201(400) ack 1 + +0 > P. 13201:13601(400) ack 1 + +0 > P. 13601:14001(400) ack 1 + +0 > P. 14001:14401(400) ack 1 +// The last 10KB chunk should be sent separately. + +0 > P. 14401:24401(10000) ack 1 + ++.001 < . 1:1(0) ack 10401 win 514 ++.001 < . 1:1(0) ack 10801 win 514 ++.001 < . 1:1(0) ack 11201 win 514 ++.001 < . 1:1(0) ack 11601 win 514 ++.001 < . 1:1(0) ack 12001 win 514 ++.001 < . 1:1(0) ack 12401 win 514 ++.001 < . 1:1(0) ack 12801 win 514 ++.001 < . 1:1(0) ack 13201 win 514 ++.001 < . 1:1(0) ack 13601 win 514 ++.001 < . 1:1(0) ack 14001 win 514 ++.001 < . 1:1(0) ack 14401 win 514 ++.001 < . 1:1(0) ack 24401 win 514 diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt new file mode 100644 index 000000000000..0d3c8077e830 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt @@ -0,0 +1,72 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test PRR-slowstart implementation. +// In this variant we test a simple case where in-flight == ssthresh +// all the way through recovery, so during fast recovery we send one segment +// for each segment SACKed/ACKed. + +// Set up config. +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> +// RTT 100ms + +.1 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Send 10 data segments. + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + +// Lost packet 1:1001. + +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop> + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop> + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:4001,nop,nop> +// Enter fast recovery. + +0 > . 1:1001(1000) ack 1 + +.01 %{ +assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state +assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd +assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh +}% + +// Write some more, which we will send 1 MSS at a time, +// as in-flight segments are SACKed or ACKed. + +.01 write(4, ..., 7000) = 7000 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:5001,nop,nop> + +0 > . 10001:11001(1000) ack 1 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:6001,nop,nop> + +0 > . 11001:12001(1000) ack 1 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:7001,nop,nop> + +0 > . 12001:13001(1000) ack 1 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:8001,nop,nop> + +0 > . 13001:14001(1000) ack 1 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:9001,nop,nop> + +0 > . 14001:15001(1000) ack 1 + + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:10001,nop,nop> + +0 > . 15001:16001(1000) ack 1 + + +.02 < . 1:1(0) ack 10001 win 320 + +0 > P. 16001:17001(1000) ack 1 +// Leave fast recovery. + +.01 %{ +assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state +assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd +assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh +}% + + +.03 < . 1:1(0) ack 12001 win 320 + +.02 < . 1:1(0) ack 14001 win 320 + +.02 < . 1:1(0) ack 16001 win 320 + +.02 < . 1:1(0) ack 17001 win 320 diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt new file mode 100644 index 000000000000..7842a10b6967 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt @@ -0,0 +1,50 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test PRR-slowstart implementation. The sender sends 20 packets. Packet +// 1 to 4, and 11 to 16 are dropped. +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + + +.01 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Write 20 data segments. + +0 write(4, ..., 20000) = 20000 + +0 > P. 1:10001(10000) ack 1 + +// Receive first DUPACK, entering PRR part + +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop> + +0 > . 10001:11001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop> + +0 > . 11001:12001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop> + +0 > . 1:1001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop> + +0 > . 1001:2001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop> + +0 > . 2001:3001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop> + +0 > . 3001:4001(1000) ack 1 +// Enter PRR CRB ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:11001,nop,nop> + +0 > . 12001:13001(1000) ack 1 ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:12001,nop,nop> + +0 > . 13001:14001(1000) ack 1 +// Enter PRR slow start + +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:12001,nop,nop> + +0 > P. 14001:16001(2000) ack 1 ++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:12001,nop,nop> + +0 > . 1001:2001(1000) ack 1 + +0 > . 16001:17001(1000) ack 1 +// inflight reaches ssthresh, goes into packet conservation mode ++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:13001,nop,nop> + +0 > . 17001:18001(1000) ack 1 ++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:14001,nop,nop> + +0 > . 18001:19001(1000) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt new file mode 100644 index 000000000000..b66d7644c3b6 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt @@ -0,0 +1,43 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test PRR-slowstart implementation. The sender sends 20 packets. Packet +// 1 to 4 are lost. The sender writes another 10 packets. +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + + +.01 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Send 20 data segments. + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + +// Lost packet 1,2,3,4 + +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop> ++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop> + +0 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop> + +0 > . 1:1001(1000) ack 1 + +0 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop> + +0 > . 1001:2001(1000) ack 1 + +0 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop> + +0 > . 2001:3001(1000) ack 1 + +0 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop> + +0 > . 3001:4001(1000) ack 1 + +// Receiver ACKs all data. + +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:10001,nop,nop> + +0 < . 1:1(0) ack 2001 win 320 <sack 4001:10001,nop,nop> + +0 < . 1:1(0) ack 3001 win 320 <sack 4001:10001,nop,nop> + +0 < . 1:1(0) ack 10001 win 320 + +// Writes another 10 packets, which the ssthresh*mss amount +// should be sent right away + +.01 write(4, ..., 10000) = 10000 + +0 > . 10001:17001(7000) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt new file mode 100644 index 000000000000..8e87bfecabb5 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt @@ -0,0 +1,41 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test PRR-slowstart implementation. +// In this variant we verify that the sender uses SACK info on an ACK +// below snd_una. + +// Set up config. +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 8> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> +// RTT 10ms + +.01 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Send 10 data segments. + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + +// Lost packet 1:1001,4001:5001,7001:8001. + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop> + +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop> + +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001 8001:9001,nop,nop> + +0 > . 1:1001(1000) ack 1 + ++.012 < . 1:1(0) ack 4001 win 320 <sack 8001:9001,nop,nop> + +0 > . 4001:7001(3000) ack 1 + + +0 write(4, ..., 10000) = 10000 + +// The following ACK was reordered - delayed so that it arrives with +// an ACK field below snd_una. Here we check that the newly-SACKed +// 2MSS at 5001:7001 cause us to send out 2 more MSS. ++.002 < . 1:1(0) ack 3001 win 320 <sack 5001:7001,nop,nop> + +0 > . 7001:8001(1000) ack 1 + +0 > . 10001:11001(1000) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt new file mode 100644 index 000000000000..96b01eb5b7a4 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt @@ -0,0 +1,53 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test RFC 3042 "Limited Transmit": "sending a new data segment in +// response to each of the first two duplicate acknowledgments that +// arrive at the sender". +// This variation tests a receiver that doesn't support SACK. + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Write some data, and send the initial congestion window. + +0 write(4, ..., 15000) = 15000 + +0 > P. 1:10001(10000) ack 1 + +// Limited transmit: on first dupack, send a new data segment. + +.11 < . 1:1(0) ack 1 win 320 + +0 > . 10001:11001(1000) ack 1 + +// Limited transmit: on second dupack, send a new data segment. + +.01 < . 1:1(0) ack 1 win 320 + +0 > . 11001:12001(1000) ack 1 + +// It turned out to be reordering, not loss. +// We have one packet newly acked (1001:3001 were DUP-ACK'd) +// So we revert state back to Open. Slow start cwnd from 10 to 11 +// and send 11 - 9 = 2 packets + +.01 < . 1:1(0) ack 3001 win 320 + +0 > P. 12001:14001(2000) ack 1 + + +.02 < . 1:1(0) ack 5001 win 320 + +0 > P. 14001:15001(1000) ack 1 + +// Client gradually ACKs all data. + +.02 < . 1:1(0) ack 7001 win 320 + +.02 < . 1:1(0) ack 9001 win 320 + +.02 < . 1:1(0) ack 11001 win 320 + +.02 < . 1:1(0) ack 13001 win 320 + +.02 < . 1:1(0) ack 15001 win 320 + +// Clean up. + +.17 close(4) = 0 + +0 > F. 15001:15001(0) ack 1 + +.1 < F. 1:1(0) ack 15002 win 257 + +0 > . 15002:15002(0) ack 2 diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt new file mode 100644 index 000000000000..642da51ec3a4 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt @@ -0,0 +1,50 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test RFC 3042 "Limited Transmit": "sending a new data segment in +// response to each of the first two duplicate acknowledgments that +// arrive at the sender". +// This variation tests a receiver that supports SACK. + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 320 + +0 accept(3, ..., ...) = 4 + +// Write some data, and send the initial congestion window. + +0 write(4, ..., 15000) = 15000 + +0 > P. 1:10001(10000) ack 1 + +// Limited transmit: on first dupack, send a new data segment. + +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop> + +0 > . 10001:11001(1000) ack 1 + +// Limited transmit: on second dupack, send a new data segment. + +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop> + +0 > . 11001:12001(1000) ack 1 + +// It turned out to be reordering, not loss. + +.01 < . 1:1(0) ack 3001 win 320 + +0 > P. 12001:14001(2000) ack 1 + + +.02 < . 1:1(0) ack 5001 win 320 + +0 > P. 14001:15001(1000) ack 1 + +// Client gradually ACKs all data. + +.02 < . 1:1(0) ack 7001 win 320 + +.02 < . 1:1(0) ack 9001 win 320 + +.02 < . 1:1(0) ack 11001 win 320 + +.02 < . 1:1(0) ack 13001 win 320 + +.02 < . 1:1(0) ack 15001 win 320 + +// Clean up. + +.17 close(4) = 0 + +0 > F. 15001:15001(0) ack 1 + +.1 < F. 1:1(0) ack 15002 win 257 + +0 > . 15002:15002(0) ack 2 diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt new file mode 100644 index 000000000000..7adae7a9ef4a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt @@ -0,0 +1,40 @@ +// SPDX-License-Identifier: GPL-2.0 +// This is a test inspired by an Android client app using SSL. This +// test verifies using TCP_NODELAY would save application latency +// (Perhaps even better with TCP_NAGLE). +// +`./defaults.sh +ethtool -K tun0 tso off gso off +./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4 + +0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0 + + +0 connect(4, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.1 < S. 0:0(0) ack 1 win 5792 <mss 974,nop,nop,sackOK,nop,wscale 7> + +0 > . 1:1(0) ack 1 + +// SSL handshake (resumed session) + +0 write(4, ..., 517) = 517 + +0 > P. 1:518(517) ack 1 + +.1 < . 1:1(0) ack 518 win 229 + + +0 < P. 1:144(143) ack 1 win 229 + +0 > . 518:518(0) ack 144 + +0 read(4, ..., 1000) = 143 + +// Application POST header (51B) and body (2002B) + +0 write(4, ..., 51) = 51 + +0 > P. 518:569(51) ack 144 + +.03 write(4, ..., 2002) = 2002 + +0 > . 569:1543(974) ack 144 + +0 > P. 1543:2517(974) ack 144 +// Without disabling Nagle, this packet will not happen until the remote ACK. + +0 > P. 2517:2571(54) ack 144 + + +.1 < . 1:1(0) ack 2571 win 229 + +// Reset sysctls +`/tmp/sysctl_restore_${PPID}.sh` diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt new file mode 100644 index 000000000000..fa9c01813996 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt @@ -0,0 +1,66 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test the MSG_MORE flag will correctly corks the tiny writes +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 257 + +0 accept(3, ..., ...) = 4 +// Disable Nagle by default on this socket. + +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0 + +// Test the basic case: MSG_MORE overwrites TCP_NODELAY and enables Nagle. + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 40}], msg_flags=0}, MSG_MORE) = 40 + +.21~+.215 > P. 1:41(40) ack 1 + +.01 < . 1:1(0) ack 41 win 257 + +// Test unsetting MSG_MORE releases the packet + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 100}], msg_flags=0}, MSG_MORE) = 100 ++.005 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 160}], msg_flags=0}, MSG_MORE) = 160 + +.01 sendmsg(4, {msg_name(...)=..., + msg_iov(3)=[{..., 100}, {..., 200}, {..., 195}], + msg_flags=0}, MSG_MORE) = 495 ++.008 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 5}], msg_flags=0}, 0) = 5 + +0 > P. 41:801(760) ack 1 + +.02 < . 1:1(0) ack 801 win 257 + + +// Test >MSS write will unleash MSS packets but hold on the remaining data. + +.1 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 3100}], msg_flags=0}, MSG_MORE) = 3100 + +0 > . 801:3801(3000) ack 1 ++.003 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 50}], msg_flags=0}, MSG_MORE) = 50 + + +.01 < . 1:1(0) ack 2801 win 257 +// Err... we relase the remaining right after the ACK? note that PUSH is reset + +0 > . 3801:3951(150) ack 1 + +// Test we'll hold on the subsequent writes when inflight (3801:3951) > 0 ++.001 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 1}], msg_flags=0}, MSG_MORE) = 1 ++.002 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 2}], msg_flags=0}, MSG_MORE) = 2 ++.003 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 3}], msg_flags=0}, MSG_MORE) = 3 ++.004 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 4}], msg_flags=0}, MSG_MORE) = 4 + +.02 < . 1:1(0) ack 3951 win 257 + +0 > . 3951:3961(10) ack 1 + +.02 < . 1:1(0) ack 3961 win 257 + + +// Test the case a MSG_MORE send followed by a write flushes the data + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(1)=[{..., 20}], msg_flags=0}, MSG_MORE) = 20 + +.05 write(4, ..., 20) = 20 + +0 > P. 3961:4001(40) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt new file mode 100644 index 000000000000..0ddec5f7dc1a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt @@ -0,0 +1,43 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP_CORK and TCP_NODELAY sockopt behavior +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 257 + +0 accept(3, ..., ...) = 4 +// Set TCP_CORK sockopt to hold small packets + +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0 + + +0 write(4, ..., 40) = 40 + +.05 write(4, ..., 40) = 40 + +// Unset TCP_CORK should push pending bytes out + +.01 setsockopt(4, SOL_TCP, TCP_CORK, [0], 4) = 0 + +0 > P. 1:81(80) ack 1 + +.01 < . 1:1(0) ack 81 win 257 + +// Set TCP_CORK sockopt to hold small packets + +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0 + + +0 write(4, ..., 40) = 40 + +.05 write(4, ..., 40) = 40 + +// Set TCP_NODELAY sockopt should push pending bytes out + +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0 + +0 > P. 81:161(80) ack 1 + +.01 < . 1:1(0) ack 161 win 257 + +// Set MSG_MORE to hold small packets + +0 send(4, ..., 40, MSG_MORE) = 40 + +.05 send(4, ..., 40, MSG_MORE) = 40 + +// Set TCP_NODELAY sockopt should push pending bytes out + +.01 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0 + +0 > . 161:241(80) ack 1 + +.01 < . 1:1(0) ack 241 win 257 diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt new file mode 100644 index 000000000000..310ef31518da --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt @@ -0,0 +1,37 @@ +// SPDX-License-Identifier: GPL-2.0 +// Verify that setsockopt calls that force a route refresh do not +// cause problems matching SACKs with packets in the write queue. +// This variant tests IP_TOS. + +`./defaults.sh` + +// Establish a connection. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_IP, IP_MTU_DISCOVER, [IP_PMTUDISC_DONT], 1) = 0 + +0...0.010 connect(3, ..., ...) = 0 + + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +.01 < S. 0:0(0) ack 1 win 65535 <mss 1460,nop,wscale 2,nop,nop,sackOK> + +0 > . 1:1(0) ack 1 + + +.01 write(3, ..., 5840) = 5840 + +0 > P. 1:5841(5840) ack 1 + +.01 < . 1:1(0) ack 5841 win 65535 + + +.01 write(3, ..., 5840) = 5840 + +0 > P. 5841:11681(5840) ack 1 + +.01 < . 1:1(0) ack 11681 win 65535 + + +.01 write(3, ..., 14600) = 14600 + +0 > P. 11681:26281(14600) ack 1 + +// Try the socket option that we know can force a route refresh. + +0 setsockopt(3, SOL_IP, IP_TOS, [4], 1) = 0 +// Then revert to avoid routing/mangling/etc implications of that setting. + +0 setsockopt(3, SOL_IP, IP_TOS, [0], 1) = 0 + +// Verify that we do not retransmit the SACKed segments. + +.01 < . 1:1(0) ack 13141 win 65535 <sack 16061:17521 20441:26281,nop,nop> + +0 > . 13141:16061(2920) ack 1 + +0 > P. 17521:20441(2920) ack 1 + +.01 < . 1:1(0) ack 26281 win 65535 diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt new file mode 100644 index 000000000000..f185e1ac57ea --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt @@ -0,0 +1,64 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb. +// This variant tests non-FACK SACK with SACKs coming in the order +// 2 6 8 3 9, to test what happens when we get a new SACKed range +// (for packet 3) that is on the right of an existing SACKed range +// (for packet 2). + +`./defaults.sh` + +// Establish a connection and send 10 MSS. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 1024 + +0 accept(3, ..., ...) = 4 + + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + + +.1 < . 1:1(0) ack 1 win 257 <sack 2001:3001,nop,nop> ++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001,nop,nop> ++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001 8001:9001,nop,nop> + +// 3 SACKed packets, so we enter Fast Recovery. + +0 > . 1:1001(1000) ack 1 + +0 %{ assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state }% + +0 %{ assert tcpi_lost == 6, tcpi_lost }% + +// SACK for 3001:4001. +// This SACK for an adjacent range causes the sender to +// shift the newly-SACKed range onto the previous skb. ++.007 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:9001,nop,nop> + +0 > . 1001:2001(1000) ack 1 + +0 %{ assert tcpi_lost == 5, tcpi_lost }% + +0 %{ assert tcpi_reordering == 6, tcpi_reordering }% // 8001:9001 -> 3001:4001 is 6 + +// SACK for 9001:10001. + +.01 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop> + +0 %{ assert tcpi_lost == 5, tcpi_lost }% + +// ACK for 1:1001 as packets from t=0.303 arrive. ++.083 < . 1:1(0) ack 1001 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop> + +0 %{ assert tcpi_lost == 4,tcpi_lost }% + +// ACK for 1:4001 as packets from t=0.310 arrive. ++.017 < . 1:1(0) ack 4001 win 257 <sack 6001:7001 8001:10001,nop,nop> + +0 %{ assert tcpi_lost == 3,tcpi_lost }% + +// ACK for 1:7001 as packets from t=0.320 arrive. + +.01 < . 1:1(0) ack 7001 win 257 <sack 8001:10001,nop,nop> + +// ACK for all data as packets from t=0.403 arrive. + +.1 < . 1:1(0) ack 10001 win 257 + +0 %{ +assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state +assert tcpi_unacked == 0, tcpi_unacked +assert tcpi_sacked == 0, tcpi_sacked +assert tcpi_lost == 0, tcpi_lost +assert tcpi_retrans == 0, tcpi_retrans +}% diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt new file mode 100644 index 000000000000..0093b4973934 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt @@ -0,0 +1,66 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb. +// This variant tests the case where we mark packets 0-4 lost, then +// get a SACK for 3, and then a SACK for 4. + +`./defaults.sh` + +// Establish a connection and send 10 MSS. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 1024 + +0 accept(3, ..., ...) = 4 + + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + +// SACK for 7001:8001. Using RACK we delay the fast retransmit. + +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop> +// RACK reordering timer ++.027 > . 1:1001(1000) ack 1 + +0 %{ +assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state +assert tcpi_lost == 7, tcpi_lost # RACK thinks 1:7001 are lost +assert tcpi_reordering == 3, tcpi_reordering +}% + +// SACK for 3001:4001. ++.002 < . 1:1(0) ack 1 win 257 <sack 3001:4001 7001:8001,nop,nop> + +0 > . 1001:2001(1000) ack 1 + +0 %{ +assert tcpi_lost == 6, tcpi_lost # since 3001:4001 is no longer lost +assert tcpi_reordering == 5, tcpi_reordering # 7001:8001 -> 3001:4001 +}% + +// SACK for 4001:5001. +// This SACK for an adjacent range causes the sender to +// shift the newly-SACKed range onto the previous skb. +// It uses the RFC3517 algorithm to mark 1:3001 lost +// because >=3 higher-sequence packets are SACKed. ++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:8001,nop,nop> + +0 > . 2001:3001(1000) ack 1 + +0 %{ +assert tcpi_lost == 5,tcpi_lost # SACK/RFC3517 thinks 1:3001 are lost +}% + +// SACK for 8001:9001. ++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:9001,nop,nop> + +// SACK for 9001:10001. ++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:10001,nop,nop> + +0 > . 5001:6001(1000) ack 1 + +// To simplify clean-up, say we get an ACK for all data. + +.1 < . 1:1(0) ack 10001 win 257 + +0 %{ +assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state +assert tcpi_unacked == 0, tcpi_unacked +assert tcpi_sacked == 0, tcpi_sacked +assert tcpi_lost == 0, tcpi_lost +assert tcpi_retrans == 0, tcpi_retrans +}% diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt new file mode 100644 index 000000000000..980a832dc81c --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt @@ -0,0 +1,62 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb. +// This variant tests the case where we mark packets 0-4 lost, then +// get a SACK for 5, and then a SACK for 6. + +`./defaults.sh` + +// Establish a connection and send 10 MSS. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.1 < . 1:1(0) ack 1 win 1024 + +0 accept(3, ..., ...) = 4 + + +0 write(4, ..., 10000) = 10000 + +0 > P. 1:10001(10000) ack 1 + +// SACK for 7001:8001. Using RACK we delay a fast retransmit. + +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop> ++.027 > . 1:1001(1000) ack 1 + +0 %{ +assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state +assert tcpi_lost == 7,tcpi_lost # RACK thinks 1:7001 are lost +assert tcpi_reordering == 3, tcpi_reordering +}% + +// SACK for 5001:6001. + +0 < . 1:1(0) ack 1 win 257 <sack 5001:6001 7001:8001,nop,nop> + +0 > . 1001:2001(1000) ack 1 + +0 %{ +assert tcpi_lost == 6, tcpi_lost +assert tcpi_reordering == 3, tcpi_reordering # 7001:8001 -> 5001:6001 is 3 +}% + +// SACK for 6001:7001. +// This SACK for an adjacent range causes the sender to +// shift the newly-SACKed range onto the previous skb. + +0 < . 1:1(0) ack 1 win 257 <sack 5001:8001,nop,nop> + +0 > . 2001:3001(1000) ack 1 + +0 %{ assert tcpi_lost == 5, tcpi_lost }% + +// SACK for 8001:9001. + +0 < . 1:1(0) ack 1 win 257 <sack 5001:9001,nop,nop> + +0 > . 3001:4001(1000) ack 1 + +// SACK for 9001:10001. + +0 < . 1:1(0) ack 1 win 257 <sack 5001:10001,nop,nop> + +0 > . 4001:5001(1000) ack 1 + +// To simplify clean-up, say we get an ACK for all data. + +.1 < . 1:1(0) ack 10001 win 257 + +0 %{ +assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state +assert tcpi_unacked == 0, tcpi_unacked +assert tcpi_sacked == 0, tcpi_sacked +assert tcpi_lost == 0, tcpi_lost +assert tcpi_retrans == 0, tcpi_retrans +}% diff --git a/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt new file mode 100644 index 000000000000..6740859a1360 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt @@ -0,0 +1,26 @@ +// SPDX-License-Identifier: GPL-2.0 +// Simplest possible test of open() and then sendfile(). +// We write some zeroes into a file (since packetdrill expects payloads +// to be all zeroes) and then open() the file, then use sendfile() +// and verify that the correct number of zeroes goes out. + +`./defaults.sh +/bin/rm -f /tmp/testfile +/bin/dd bs=1 count=5 if=/dev/zero of=/tmp/testfile status=none +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +0 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + + +0 open("/tmp/testfile", O_RDONLY) = 5 + +0 sendfile(4, 5, [0], 5) = 5 + +0 > P. 1:6(5) ack 1 diff --git a/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt new file mode 100644 index 000000000000..0cbd43253236 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt @@ -0,0 +1,20 @@ +// SPDX-License-Identifier: GPL-2.0 +`./defaults.sh` + +// Initialize a server socket + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 setsockopt(3, SOL_IP, IP_FREEBIND, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +// Connection should get accepted + +0 < S 0:0(0) win 32972 <mss 1460,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <...> + +0 < . 1:1(0) ack 1 win 257 + +0 accept(3, ..., ...) = 4 + + +0 pipe([5, 6]) = 0 + +0 < U. 1:101(100) ack 1 win 257 urg 100 + +0 splice(4, NULL, 6, NULL, 99, 0) = 99 + +0 splice(4, NULL, 6, NULL, 1, 0) = 0 diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt new file mode 100644 index 000000000000..8940726a3ec2 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt @@ -0,0 +1,42 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test TCP fastopen behavior with NULL as buffer pointer, but a non-zero +// buffer length. +`./defaults.sh +./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0` + +// Cache warmup: send a Fast Open cookie request + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 ++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 ++0 setsockopt(3, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0 ++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation is now in progress) ++0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8,FO,nop,nop> ++0 < S. 123:123(0) ack 1 win 14600 <mss 1460,nop,nop,sackOK,nop,wscale 6,FO abcd1234,nop,nop> ++0 > . 1:1(0) ack 1 ++0 close(3) = 0 ++0 > F. 1:1(0) ack 1 ++0 < F. 1:1(0) ack 2 win 92 ++0 > . 2:2(0) ack 2 + +// Test with MSG_FASTOPEN without TCP_FASTOPEN_CONNECT. ++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4 ++0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0 ++0 sendto(4, NULL, 1, MSG_FASTOPEN, ..., ...) = -1 ++0 close(4) = 0 + +// Test with TCP_FASTOPEN_CONNECT without MSG_FASTOPEN. ++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 5 ++0 fcntl(5, F_SETFL, O_RDWR|O_NONBLOCK) = 0 ++0 setsockopt(5, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0 ++0 connect(5, ..., ...) = 0 ++0 sendto(5, NULL, 1, 0, ..., ...) = -1 ++0 close(5) = 0 + +// Test with both TCP_FASTOPEN_CONNECT and MSG_FASTOPEN. ++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 6 ++0 fcntl(6, F_SETFL, O_RDWR|O_NONBLOCK) = 0 ++0 setsockopt(6, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0 ++0 connect(6, ..., ...) = 0 ++0 sendto(6, NULL, 1, MSG_FASTOPEN, ..., ...) = -1 ++0 close(6) = 0 + +`/tmp/sysctl_restore_${PPID}.sh` diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt new file mode 100644 index 000000000000..b2b2cdf27e20 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt @@ -0,0 +1,30 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test that we correctly skip zero-length IOVs. +`./defaults.sh` + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_ZEROCOPY, [1], 4) = 0 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 257 + +0 accept(3, ..., ...) = 4 + +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0 + + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(4)=[{..., 0}, {..., 40}, {..., 0}, {..., 20}], + msg_flags=0}, 0) = 60 + +0 > P. 1:61(60) ack 1 + +.01 < . 1:1(0) ack 61 win 257 + + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(4)=[{..., 0}, {..., 0}, {..., 0}, {..., 0}], + msg_flags=0}, MSG_ZEROCOPY) = 0 + + +0 sendmsg(4, {msg_name(...)=..., + msg_iov(4)=[{..., 0}, {..., 10}, {..., 0}, {..., 50}], + msg_flags=0}, MSG_ZEROCOPY) = 60 + +0 > P. 61:121(60) ack 1 + +.01 < . 1:1(0) ack 121 win 257 diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt new file mode 100644 index 000000000000..59f5903f285c --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt @@ -0,0 +1,25 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test kernel behavior with NULL as buffer pointer + +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.2 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + + +0 write(4, NULL, 1000) = -1 EFAULT (Bad address) + +0 send(4, NULL, 1000, 0) = -1 EFAULT (Bad address) + +0 sendto(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address) + + +0 < . 1:1001(1000) ack 1 win 200 + +0 read(4, NULL, 1000) = -1 EFAULT (Bad address) + +0 recv(4, NULL, 1000, 0) = -1 EFAULT (Bad address) + +0 recvfrom(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address) diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt new file mode 100644 index 000000000000..d7fdb43a8e89 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt @@ -0,0 +1,20 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test tcpi_last_data_recv for active session +`./defaults.sh` + +// Create a socket and set it to non-blocking. ++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 ++0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR) ++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + ++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) ++0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> ++.030 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8> ++0 > . 1:1(0) ack 1 + ++1 %{ assert 990 <= tcpi_last_data_recv <= 1010, tcpi_last_data_recv }% + ++0 < . 1:1001(1000) ack 1 win 300 ++0 > . 1:1(0) ack 1001 + ++0 %{ assert tcpi_last_data_recv <= 10, tcpi_last_data_recv }% diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt new file mode 100644 index 000000000000..a9bcd46f6cb6 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt @@ -0,0 +1,54 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test rwnd limited time in tcp_info for client side. + +`./defaults.sh` + +// Create a socket and set it to non-blocking. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR) + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + + +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +// Server advertises 0 receive window. + +.01 < S. 0:0(0) ack 1 win 0 <mss 1000,nop,nop,sackOK> + + +0 > . 1:1(0) ack 1 + +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0 + +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking + +// Make sure that initial rwnd limited time is 0. + +0 %{ assert tcpi_rwnd_limited == 0, tcpi_rwnd_limited }% + +// Receive window limited time starts here. + +0 write(3, ..., 1000) = 1000 + +// Check that rwnd limited time in tcp_info is around 0.1s. + +.1 %{ assert 98000 <= tcpi_rwnd_limited <= 110000, tcpi_rwnd_limited }% + +// Server opens the receive window. + +.1 < . 1:1(0) ack 1 win 2000 + +// Check that rwnd limited time in tcp_info is around 0.2s. + +0 %{ assert 198000 <= tcpi_rwnd_limited <= 210000, tcpi_rwnd_limited }% + + +0 > P. 1:1001(1000) ack 1 + +// Server advertises a very small receive window. + +.03 < . 1:1(0) ack 1001 win 10 + +// Receive window limited time starts again. + +0 write(3, ..., 1000) = 1000 + +// Server opens the receive window again. + +.1 < . 1:1(0) ack 1001 win 2000 +// Check that rwnd limited time in tcp_info is around 0.3s +// and busy time is 0.3 + 0.03 (server opened small window temporarily). + +0 %{ assert 298000 <= tcpi_rwnd_limited <= 310000, tcpi_rwnd_limited;\ + assert 328000 <= tcpi_busy_time <= 340000, tcpi_busy_time;\ +}% + + +0 > P. 1001:2001(1000) ack 1 + +.02 < . 1:1(0) ack 2001 win 2000 + +0 %{ assert 348000 <= tcpi_busy_time <= 360000, tcpi_busy_time }% diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt new file mode 100644 index 000000000000..f0de2acd0f8e --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt @@ -0,0 +1,38 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test send-buffer-limited time in tcp_info for client side. +`./defaults.sh` + +// Create a socket and set it to non-blocking. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR) + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + + +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +.01 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8> + +0 > . 1:1(0) ack 1 + +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0 + +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking + +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [10000], 4) = 0 + +0 getsockopt(3, SOL_SOCKET, SO_SNDBUF, [20000], [4]) = 0 + + +.09...0.14 write(3, ..., 150000) = 150000 + + +.01 < . 1:1(0) ack 10001 win 10000 + + +.01 < . 1:1(0) ack 30001 win 10000 + +// cwnd goes from 40(60KB) to 80(120KB), and that we hit the tiny sndbuf limit 10KB + +.01 < . 1:1(0) ack 70001 win 10000 + + +.02 < . 1:1(0) ack 95001 win 10000 + +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited; \ + assert 49000 <= tcpi_busy_time <= 52000, tcpi_busy_time; \ + assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }% + +// This ack frees up enough buffer so we are no longer +// buffer limited (socket flag SOCK_NOSPACE is cleared) + +.02 < . 1:1(0) ack 150001 win 10000 + +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited;\ + assert 69000 <= tcpi_busy_time <= 73000, tcpi_busy_time;\ + assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }% diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt new file mode 100644 index 000000000000..2087ec0c746a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt @@ -0,0 +1,92 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test that tx timestamping sends timestamps only for +// the last byte of each sendmsg. +`./defaults.sh +` + +// Create a socket and set it to non-blocking. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR) + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + +// Establish connection and verify that there was no error. + +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +.01 < S. 0:0(0) ack 1 win 20000 <mss 1000,nop,nop,sackOK> + +0 > . 1:1(0) ack 1 + +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0 + +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking + + +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING, + [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE | + SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE | + SOF_TIMESTAMPING_OPT_ID], 4) = 0 + + +0 write(3, ..., 11000) = 11000 + +0 > P. 1:10001(10000) ack 1 + +.01 < . 1:1(0) ack 10001 win 4000 + +0 > P. 10001:11001(1000) ack 1 + +.01 < . 1:1(0) ack 11001 win 4000 + +// Make sure that internal TCP timestamps are not overwritten and we have sane +// RTT measurement. + +0 %{ +assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt +}% + +// SCM_TSTAMP_SCHED for the last byte should be received almost immediately +// once 10001 is acked at t=20ms. +// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...) +// is called after when SYN is acked. So, we expect the last byte of the first +// chunk to have a timestamp key of 10999 (i.e., 11000 - 1). + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=20000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SCHED, + ee_data=10999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_SND for the last byte should be received almost immediately +// once 10001 is acked at t=20ms. + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=20000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SND, + ee_data=10999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_ACK for the last byte should be received at t=30ms. + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=30000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_ACK, + ee_data=10999}} + ]}, MSG_ERRQUEUE) = 0 diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt new file mode 100644 index 000000000000..876024a31110 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt @@ -0,0 +1,91 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test tx timestamping for partial writes (IPv4). +`./defaults.sh +` + +// Create a socket and set it to non-blocking. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR) + +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0 + +// Establish connection and verify that there was no error. + +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress) + +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8> + +.01 < S. 0:0(0) ack 1 win 2000 <mss 1000,sackOK,TS val 700 ecr 100,nop,wscale 7> + +0 > . 1:1(0) ack 1 <nop,nop,TS val 200 ecr 700> + +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0 + + +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [1000], 4) = 0 + +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING, + [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE | + SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE | + SOF_TIMESTAMPING_OPT_ID], 4) = 0 + +// We have a partial write. + +0 write(3, ..., 10000) = 2964 + +0 > . 1:989(988) ack 1 <nop,nop,TS val 110 ecr 700> + +0 > P. 989:1977(988) ack 1 <nop,nop,TS val 110 ecr 700> + +.01 < . 1:1(0) ack 1977 win 92 <nop,nop,TS val 800 ecr 200> + +0 > P. 1977:2965(988) ack 1 <nop,nop,TS val 114 ecr 800> + +.01 < . 1:1(0) ack 2965 win 92 <nop,nop,TS val 800 ecr 200> + +// Make sure that internal TCP timestamps are not overwritten and we have sane +// RTT measurement. + +0 %{ +assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt +}% + +// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately +// after the first ack at t=20ms. + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=20000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SCHED, + ee_data=2963}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_SND for the first chunk should be received almost immediately +// after the first ack at t=20ms. + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=20000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SND, + ee_data=2963}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_ACK for the first chunk should be received after the last ack at +// t=30ms. + +0 recvmsg(3, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=30000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_ACK, + ee_data=2963}} + ]}, MSG_ERRQUEUE) = 0 diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt new file mode 100644 index 000000000000..84d94780e6be --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt @@ -0,0 +1,145 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test tx timestamping for server-side (IPv4). +`./defaults.sh +` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8> + +.01 < . 1:1(0) ack 1 win 514 + + +0 accept(3, ..., ...) = 4 + +0 setsockopt(4, SOL_SOCKET, SO_TIMESTAMPING, + [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE | + SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE | + SOF_TIMESTAMPING_OPT_ID], 4) = 0 + +// Write two 2KB chunks. +// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...) +// is called after when SYN is acked. So, we expect the last byte of the first +// and the second chunks to have timestamp keys of 1999 (i.e., 2000 - 1) and +// 3999 (i.e., 4000 - 1) respectively. + +0 write(4, ..., 2000) = 2000 + +0 write(4, ..., 2000) = 2000 + +0 > P. 1:2001(2000) ack 1 + +0 > P. 2001:4001(2000) ack 1 + +.01 < . 1:1(0) ack 2001 win 514 + +.01 < . 1:1(0) ack 4001 win 514 + +// Make sure that internal TCP timestamps are not overwritten and we have sane +// RTT measurement. + +0 %{ +assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt +}% + +// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately +// after write at t=10ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=10000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SCHED, + ee_data=1999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_SND for the first chunk should be received almost immediately +// after write at t=10ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=10000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SND, + ee_data=1999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_SCHED for the second chunk should be received almost immediately +// after that at t=10ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=10000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SCHED, + ee_data=3999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_SND for the second chunk should be received almost immediately +// after that at t=10ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=10000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_SND, + ee_data=3999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_ACK for the first chunk should be received at t=20ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=20000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_ACK, + ee_data=1999}} + ]}, MSG_ERRQUEUE) = 0 +// SCM_TSTAMP_ACK for the second chunk should be received at t=30ms. + +0 recvmsg(4, {msg_name(...)=..., + msg_iov(1)=[{...,0}], + msg_flags=MSG_ERRQUEUE|MSG_TRUNC, + msg_control=[ + {cmsg_level=SOL_SOCKET, + cmsg_type=SCM_TIMESTAMPING, + cmsg_data={scm_sec=0,scm_nsec=30000000}}, + {cmsg_level=CMSG_LEVEL_IP, + cmsg_type=CMSG_TYPE_RECVERR, + cmsg_data={ee_errno=ENOMSG, + ee_origin=SO_EE_ORIGIN_TIMESTAMPING, + ee_type=0, + ee_code=0, + ee_info=SCM_TSTAMP_ACK, + ee_data=3999}} + ]}, MSG_ERRQUEUE) = 0 diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt new file mode 100644 index 000000000000..e61424a7bd0a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt @@ -0,0 +1,23 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test that we send FIN packet with correct TSval +--tcp_ts_tick_usecs=1000 +--tolerance_usecs=7000 + +`./defaults.sh` + +// Create a socket. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +// Establish a connection. + +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0> + +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100> + +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100> + +0 accept(3, ..., ...) = 4 + + +1 close(4) = 0 +// Check that FIN TSval is updated properly, one second has passed since last sent packet. + +0 > F. 1:1(0) ack 1 <nop,nop,TS val 1200 ecr 200> diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt new file mode 100644 index 000000000000..174ce9a1bfc0 --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt @@ -0,0 +1,25 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test that we reject TS val updates on a packet with invalid ACK sequence + +`./defaults.sh +` + +// Create a socket. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +// Establish a connection. + +.1 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0> + +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100> + +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100> + +0 accept(3, ..., ...) = 4 + +// bad packet with high tsval (its ACK sequence is above our sndnxt) + +0 < F. 1:1(0) ack 9999 win 20000 <nop,nop,TS val 200000 ecr 100> + + + +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100> + +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201> diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt new file mode 100644 index 000000000000..2e3b3bb7493a --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt @@ -0,0 +1,25 @@ +// SPDX-License-Identifier: GPL-2.0 +// Test that we send RST packet with correct TSval +--tcp_ts_tick_usecs=1000 + +`./defaults.sh` + +// Create a socket. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +// Establish a connection. + +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0> + +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100> + +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100> + +0 accept(3, ..., ...) = 4 + + +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100> + +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201> + + +1 close(4) = 0 +// Check that RST TSval is updated properly, one second has passed since last sent packet. + +0 > R. 1:1(0) ack 1001 <nop,nop,TS val 1200 ecr 201> diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt new file mode 100644 index 000000000000..183051ba0cae --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt @@ -0,0 +1,37 @@ +// SPDX-License-Identifier: GPL-2.0 + +`./defaults.sh` + + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + + +0 < S 0:0(0) win 0 <mss 1460> + +0 > S. 0:0(0) ack 1 <mss 1460> + + +.1 < . 1:1(0) ack 1 win 65530 + +0 accept(3, ..., ...) = 4 + + +0 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0 + +0 write(4, ..., 24) = 24 + +0 > P. 1:25(24) ack 1 + +.1 < . 1:1(0) ack 25 win 65530 + +0 %{ assert tcpi_probes == 0, tcpi_probes; \ + assert tcpi_backoff == 0, tcpi_backoff }% + +// install a qdisc dropping all packets + +0 `tc qdisc delete dev tun0 root 2>/dev/null ; tc qdisc add dev tun0 root pfifo limit 0` + +0 write(4, ..., 24) = 24 + // When qdisc is congested we retry every 500ms + // (TCP_RESOURCE_PROBE_INTERVAL) and therefore + // we retry 6 times before hitting 3s timeout. + // First verify that the connection is alive: ++3.250 write(4, ..., 24) = 24 + // Now verify that shortly after that the socket is dead: + +.100 write(4, ..., 24) = -1 ETIMEDOUT (Connection timed out) + + +0 %{ assert tcpi_probes == 6, tcpi_probes; \ + assert tcpi_backoff == 0, tcpi_backoff }% + +0 close(4) = 0 diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt new file mode 100644 index 000000000000..2efe02bfba9c --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt @@ -0,0 +1,32 @@ +// SPDX-License-Identifier: GPL-2.0 +`./defaults.sh` + +// Initialize connection + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + + +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK> + +.1 < . 1:1(0) ack 1 win 32792 + + + +0 accept(3, ..., ...) = 4 + +// Okay, we received nothing, and decide to close this idle socket. +// We set TCP_USER_TIMEOUT to 3 seconds because really it is not worth +// trying hard to cleanly close this flow, at the price of keeping +// a TCP structure in kernel for about 1 minute ! + +2 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0 + +0 close(4) = 0 + + +0 > F. 1:1(0) ack 1 + +.3~+.400 > F. 1:1(0) ack 1 + +.3~+.400 > F. 1:1(0) ack 1 + +.6~+.800 > F. 1:1(0) ack 1 + +// We finally receive something from the peer, but it is way too late +// Our socket vanished because TCP_USER_TIMEOUT was really small + +0 < . 1:2(1) ack 1 win 32792 + +0 > R 1:1(0) diff --git a/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt new file mode 100644 index 000000000000..8bd60226ccfc --- /dev/null +++ b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt @@ -0,0 +1,24 @@ +// SPDX-License-Identifier: GPL-2.0 +// Verify that established connections drop a segment without the ACK flag set. + +`./defaults.sh` + +// Create a socket. + 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3 + +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0 + +0 bind(3, ..., ...) = 0 + +0 listen(3, 1) = 0 + +// Establish a connection. + +0 < S 0:0(0) win 20000 <mss 1000,sackOK,nop,nop> + +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK> + +.01 < . 1:1(0) ack 1 win 20000 + +0 accept(3, ..., ...) = 4 + +// Receive a segment with no flags set, verify that it's not enqueued. + +.01 < - 1:1001(1000) win 20000 + +0 ioctl(4, SIOCINQ, [0]) = 0 + +// Receive a segment with ACK flag set, verify that it is enqueued. + +.01 < . 1:1001(1000) ack 1 win 20000 + +0 ioctl(4, SIOCINQ, [1000]) = 0 diff --git a/tools/testing/selftests/net/tls.c b/tools/testing/selftests/net/tls.c index 1a706d03bb6b..9a85f93c33d8 100644 --- a/tools/testing/selftests/net/tls.c +++ b/tools/testing/selftests/net/tls.c @@ -44,9 +44,11 @@ struct tls_crypto_info_keys { }; static void tls_crypto_info_init(uint16_t tls_version, uint16_t cipher_type, - struct tls_crypto_info_keys *tls12) + struct tls_crypto_info_keys *tls12, + char key_generation) { - memset(tls12, 0, sizeof(*tls12)); + memset(tls12, key_generation, sizeof(*tls12)); + memset(tls12, 0, sizeof(struct tls_crypto_info)); switch (cipher_type) { case TLS_CIPHER_CHACHA20_POLY1305: @@ -275,7 +277,7 @@ TEST_F(tls_basic, recseq_wrap) if (self->notls) SKIP(return, "no TLS support"); - tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12); + tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0); memset(&tls12.aes128.rec_seq, 0xff, sizeof(tls12.aes128.rec_seq)); ASSERT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); @@ -391,7 +393,7 @@ FIXTURE_SETUP(tls) SKIP(return, "Unsupported cipher in FIPS mode"); tls_crypto_info_init(variant->tls_version, variant->cipher_type, - &tls12); + &tls12, 0); ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls); @@ -1175,7 +1177,7 @@ TEST_F(tls, bidir) struct tls_crypto_info_keys tls12; tls_crypto_info_init(variant->tls_version, variant->cipher_type, - &tls12); + &tls12, 0); ret = setsockopt(self->fd, SOL_TLS, TLS_RX, &tls12, tls12.len); @@ -1614,7 +1616,7 @@ TEST_F(tls, getsockopt) EXPECT_EQ(get.crypto_info.cipher_type, variant->cipher_type); /* get the full crypto_info */ - tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect, 0); len = expect.len; memrnd(&get, sizeof(get)); EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &get, &len), 0); @@ -1668,6 +1670,464 @@ TEST_F(tls, recv_efault) EXPECT_EQ(memcmp(rec2, recv_mem + 9, ret - 9), 0); } +#define TLS_RECORD_TYPE_HANDSHAKE 0x16 +/* key_update, length 1, update_not_requested */ +static const char key_update_msg[] = "\x18\x00\x00\x01\x00"; +static void tls_send_keyupdate(struct __test_metadata *_metadata, int fd) +{ + size_t len = sizeof(key_update_msg); + + EXPECT_EQ(tls_send_cmsg(fd, TLS_RECORD_TYPE_HANDSHAKE, + (char *)key_update_msg, len, 0), + len); +} + +static void tls_recv_keyupdate(struct __test_metadata *_metadata, int fd, int flags) +{ + char buf[100]; + + EXPECT_EQ(tls_recv_cmsg(_metadata, fd, TLS_RECORD_TYPE_HANDSHAKE, buf, sizeof(buf), flags), + sizeof(key_update_msg)); + EXPECT_EQ(memcmp(buf, key_update_msg, sizeof(key_update_msg)), 0); +} + +/* set the key to 0 then 1 for RX, immediately to 1 for TX */ +TEST_F(tls_basic, rekey_rx) +{ + struct tls_crypto_info_keys tls12_0, tls12_1; + char const *test_str = "test_message"; + int send_len = strlen(test_str) + 1; + char buf[20]; + int ret; + + if (self->notls) + return; + + tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128, + &tls12_0, 0); + tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128, + &tls12_1, 1); + + ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len); + ASSERT_EQ(ret, 0); + + ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_0, tls12_0.len); + ASSERT_EQ(ret, 0); + + ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len); + EXPECT_EQ(ret, 0); + + EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len); + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len); + EXPECT_EQ(memcmp(buf, test_str, send_len), 0); +} + +/* set the key to 0 then 1 for TX, immediately to 1 for RX */ +TEST_F(tls_basic, rekey_tx) +{ + struct tls_crypto_info_keys tls12_0, tls12_1; + char const *test_str = "test_message"; + int send_len = strlen(test_str) + 1; + char buf[20]; + int ret; + + if (self->notls) + return; + + tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128, + &tls12_0, 0); + tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128, + &tls12_1, 1); + + ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_0, tls12_0.len); + ASSERT_EQ(ret, 0); + + ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len); + ASSERT_EQ(ret, 0); + + ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len); + EXPECT_EQ(ret, 0); + + EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len); + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len); + EXPECT_EQ(memcmp(buf, test_str, send_len), 0); +} + +TEST_F(tls, rekey) +{ + char const *test_str_1 = "test_message_before_rekey"; + char const *test_str_2 = "test_message_after_rekey"; + struct tls_crypto_info_keys tls12; + int send_len; + char buf[100]; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + /* initial send/recv */ + send_len = strlen(test_str_1) + 1; + EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len); + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len); + EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0); + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + /* send after rekey */ + send_len = strlen(test_str_2) + 1; + EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len); + + /* can't receive the KeyUpdate without a control message */ + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + /* recv blocking -> -EKEYEXPIRED */ + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1); + EXPECT_EQ(errno, EKEYEXPIRED); + + /* recv non-blocking -> -EKEYEXPIRED */ + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1); + EXPECT_EQ(errno, EKEYEXPIRED); + + /* update RX key */ + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + /* recv after rekey */ + EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1); + EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0); +} + +TEST_F(tls, rekey_fail) +{ + char const *test_str_1 = "test_message_before_rekey"; + char const *test_str_2 = "test_message_after_rekey"; + struct tls_crypto_info_keys tls12; + int send_len; + char buf[100]; + + /* initial send/recv */ + send_len = strlen(test_str_1) + 1; + EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len); + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len); + EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0); + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + + if (variant->tls_version != TLS_1_3_VERSION) { + /* just check that rekey is not supported and return */ + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1); + EXPECT_EQ(errno, EBUSY); + return; + } + + /* successful update */ + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + /* invalid update: change of version */ + tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1); + EXPECT_EQ(errno, EINVAL); + + /* invalid update (RX socket): change of version */ + tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), -1); + EXPECT_EQ(errno, EINVAL); + + /* invalid update: change of cipher */ + if (variant->cipher_type == TLS_CIPHER_AES_GCM_256) + tls_crypto_info_init(variant->tls_version, TLS_CIPHER_CHACHA20_POLY1305, &tls12, 1); + else + tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_256, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1); + EXPECT_EQ(errno, EINVAL); + + /* send after rekey, the invalid updates shouldn't have an effect */ + send_len = strlen(test_str_2) + 1; + EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len); + + /* can't receive the KeyUpdate without a control message */ + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + /* recv blocking -> -EKEYEXPIRED */ + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1); + EXPECT_EQ(errno, EKEYEXPIRED); + + /* recv non-blocking -> -EKEYEXPIRED */ + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1); + EXPECT_EQ(errno, EKEYEXPIRED); + + /* update RX key */ + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + /* recv after rekey */ + EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1); + EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0); +} + +TEST_F(tls, rekey_peek) +{ + char const *test_str_1 = "test_message_before_rekey"; + struct tls_crypto_info_keys tls12; + int send_len; + char buf[100]; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + send_len = strlen(test_str_1) + 1; + EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len); + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len); + EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0); + + EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len); + EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0); + + /* can't receive the KeyUpdate without a control message */ + EXPECT_EQ(recv(self->cfd, buf, send_len, MSG_PEEK), -1); + + /* peek KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + /* update RX key */ + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); +} + +TEST_F(tls, splice_rekey) +{ + int send_len = TLS_PAYLOAD_MAX_LEN / 2; + char mem_send[TLS_PAYLOAD_MAX_LEN]; + char mem_recv[TLS_PAYLOAD_MAX_LEN]; + struct tls_crypto_info_keys tls12; + int p[2]; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + memrnd(mem_send, sizeof(mem_send)); + + ASSERT_GE(pipe(p), 0); + EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len); + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len); + + EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len); + EXPECT_EQ(read(p[0], mem_recv, send_len), send_len); + EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0); + + /* can't splice the KeyUpdate */ + EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1); + EXPECT_EQ(errno, EINVAL); + + /* peek KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + /* can't splice before updating the key */ + EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1); + EXPECT_EQ(errno, EKEYEXPIRED); + + /* update RX key */ + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len); + EXPECT_EQ(read(p[0], mem_recv, send_len), send_len); + EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0); +} + +TEST_F(tls, rekey_peek_splice) +{ + char const *test_str_1 = "test_message_before_rekey"; + struct tls_crypto_info_keys tls12; + int send_len; + char buf[100]; + char mem_recv[TLS_PAYLOAD_MAX_LEN]; + int p[2]; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + ASSERT_GE(pipe(p), 0); + + send_len = strlen(test_str_1) + 1; + EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len); + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len); + EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0); + + EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len); + EXPECT_EQ(read(p[0], mem_recv, send_len), send_len); + EXPECT_EQ(memcmp(mem_recv, test_str_1, send_len), 0); +} + +TEST_F(tls, rekey_getsockopt) +{ + struct tls_crypto_info_keys tls12; + struct tls_crypto_info_keys tls12_get; + socklen_t len; + + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 0); + + len = tls12.len; + EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0); + EXPECT_EQ(len, tls12.len); + EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0); + + len = tls12.len; + EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0); + EXPECT_EQ(len, tls12.len); + EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0); + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + tls_recv_keyupdate(_metadata, self->cfd, 0); + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + len = tls12.len; + EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0); + EXPECT_EQ(len, tls12.len); + EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0); + + len = tls12.len; + EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0); + EXPECT_EQ(len, tls12.len); + EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0); +} + +TEST_F(tls, rekey_poll_pending) +{ + char const *test_str = "test_message_after_rekey"; + struct tls_crypto_info_keys tls12; + struct pollfd pfd = { }; + int send_len; + int ret; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + /* send immediately after rekey */ + send_len = strlen(test_str) + 1; + EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len); + + /* key hasn't been updated, expect cfd to be non-readable */ + pfd.fd = self->cfd; + pfd.events = POLLIN; + EXPECT_EQ(poll(&pfd, 1, 0), 0); + + ret = fork(); + ASSERT_GE(ret, 0); + + if (ret) { + int pid2, status; + + /* wait before installing the new key */ + sleep(1); + + /* update RX key while poll() is sleeping */ + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + pid2 = wait(&status); + EXPECT_EQ(pid2, ret); + EXPECT_EQ(status, 0); + } else { + pfd.fd = self->cfd; + pfd.events = POLLIN; + EXPECT_EQ(poll(&pfd, 1, 5000), 1); + + exit(!__test_passed(_metadata)); + } +} + +TEST_F(tls, rekey_poll_delay) +{ + char const *test_str = "test_message_after_rekey"; + struct tls_crypto_info_keys tls12; + struct pollfd pfd = { }; + int send_len; + int ret; + + if (variant->tls_version != TLS_1_3_VERSION) + return; + + /* update TX key */ + tls_send_keyupdate(_metadata, self->fd); + tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1); + EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0); + + /* get KeyUpdate */ + tls_recv_keyupdate(_metadata, self->cfd, 0); + + ret = fork(); + ASSERT_GE(ret, 0); + + if (ret) { + int pid2, status; + + /* wait before installing the new key */ + sleep(1); + + /* update RX key while poll() is sleeping */ + EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0); + + sleep(1); + send_len = strlen(test_str) + 1; + EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len); + + pid2 = wait(&status); + EXPECT_EQ(pid2, ret); + EXPECT_EQ(status, 0); + } else { + pfd.fd = self->cfd; + pfd.events = POLLIN; + EXPECT_EQ(poll(&pfd, 1, 5000), 1); + exit(!__test_passed(_metadata)); + } +} + FIXTURE(tls_err) { int fd, cfd; @@ -1696,7 +2156,7 @@ FIXTURE_SETUP(tls_err) int ret; tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_128, - &tls12); + &tls12, 0); ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls); ulp_sock_pair(_metadata, &self->fd2, &self->cfd2, &self->notls); @@ -2118,7 +2578,7 @@ TEST(tls_v6ops) { int sfd, ret, fd; socklen_t len, len2; - tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12); + tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0); addr.sin6_family = AF_INET6; addr.sin6_addr = in6addr_any; @@ -2177,7 +2637,7 @@ TEST(prequeue) { len = sizeof(addr); memrnd(buf, sizeof(buf)); - tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12); + tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12, 0); addr.sin_family = AF_INET; addr.sin_addr.s_addr = htonl(INADDR_ANY); diff --git a/tools/testing/selftests/net/udpgso.c b/tools/testing/selftests/net/udpgso.c index 3f2fca02fec5..36ff28af4b19 100644 --- a/tools/testing/selftests/net/udpgso.c +++ b/tools/testing/selftests/net/udpgso.c @@ -103,6 +103,19 @@ struct testcase testcases_v4[] = { .r_num_mss = 1, }, { + /* datalen <= MSS < gso_len: will fall back to no GSO */ + .tlen = CONST_MSS_V4, + .gso_len = CONST_MSS_V4 + 1, + .r_num_mss = 0, + .r_len_last = CONST_MSS_V4, + }, + { + /* MSS < datalen < gso_len: fail */ + .tlen = CONST_MSS_V4 + 1, + .gso_len = CONST_MSS_V4 + 2, + .tfail = true, + }, + { /* send a single MSS + 1B */ .tlen = CONST_MSS_V4 + 1, .gso_len = CONST_MSS_V4, @@ -206,6 +219,19 @@ struct testcase testcases_v6[] = { .r_num_mss = 1, }, { + /* datalen <= MSS < gso_len: will fall back to no GSO */ + .tlen = CONST_MSS_V6, + .gso_len = CONST_MSS_V6 + 1, + .r_num_mss = 0, + .r_len_last = CONST_MSS_V6, + }, + { + /* MSS < datalen < gso_len: fail */ + .tlen = CONST_MSS_V6 + 1, + .gso_len = CONST_MSS_V6 + 2, + .tfail = true + }, + { /* send a single MSS + 1B */ .tlen = CONST_MSS_V6 + 1, .gso_len = CONST_MSS_V6, diff --git a/tools/testing/selftests/net/udpgso_bench.sh b/tools/testing/selftests/net/udpgso_bench.sh index 640bc43452fa..88fa1d53ba2b 100755 --- a/tools/testing/selftests/net/udpgso_bench.sh +++ b/tools/testing/selftests/net/udpgso_bench.sh @@ -92,6 +92,9 @@ run_udp() { echo "udp" run_in_netns ${args} + echo "udp sendmmsg" + run_in_netns ${args} -m + echo "udp gso" run_in_netns ${args} -S 0 diff --git a/tools/testing/selftests/net/vlan_bridge_binding.sh b/tools/testing/selftests/net/vlan_bridge_binding.sh new file mode 100755 index 000000000000..e7cb8c678bde --- /dev/null +++ b/tools/testing/selftests/net/vlan_bridge_binding.sh @@ -0,0 +1,256 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 + +source lib.sh + +ALL_TESTS=" + test_binding_on + test_binding_off + test_binding_toggle_on + test_binding_toggle_off + test_binding_toggle_on_when_upper_down + test_binding_toggle_off_when_upper_down + test_binding_toggle_on_when_lower_down + test_binding_toggle_off_when_lower_down +" + +setup_prepare() +{ + local port + + ip_link_add br up type bridge vlan_filtering 1 + + for port in d1 d2 d3; do + ip_link_add $port type veth peer name r$port + ip_link_set_up $port + ip_link_set_up r$port + ip_link_set_master $port br + done + + bridge_vlan_add vid 11 dev br self + bridge_vlan_add vid 11 dev d1 master + + bridge_vlan_add vid 12 dev br self + bridge_vlan_add vid 12 dev d2 master + + bridge_vlan_add vid 13 dev br self + bridge_vlan_add vid 13 dev d1 master + bridge_vlan_add vid 13 dev d2 master + + bridge_vlan_add vid 14 dev br self + bridge_vlan_add vid 14 dev d1 master + bridge_vlan_add vid 14 dev d2 master + bridge_vlan_add vid 14 dev d3 master +} + +operstate_is() +{ + local dev=$1; shift + local expect=$1; shift + + local operstate=$(ip -j link show $dev | jq -r .[].operstate) + if [[ $operstate == UP ]]; then + operstate=1 + elif [[ $operstate == DOWN || $operstate == LOWERLAYERDOWN ]]; then + operstate=0 + fi + echo -n $operstate + [[ $operstate == $expect ]] +} + +check_operstate() +{ + local dev=$1; shift + local expect=$1; shift + local operstate + + operstate=$(busywait 1000 \ + operstate_is "$dev" "$expect") + check_err $? "Got operstate of $operstate, expected $expect" +} + +add_one_vlan() +{ + local link=$1; shift + local id=$1; shift + + ip_link_add $link.$id link $link type vlan id $id "$@" +} + +add_vlans() +{ + add_one_vlan br 11 "$@" + add_one_vlan br 12 "$@" + add_one_vlan br 13 "$@" + add_one_vlan br 14 "$@" +} + +set_vlans() +{ + ip link set dev br.11 "$@" + ip link set dev br.12 "$@" + ip link set dev br.13 "$@" + ip link set dev br.14 "$@" +} + +down_netdevs() +{ + local dev + + for dev in "$@"; do + ip_link_set_down $dev + done +} + +check_operstates() +{ + local opst_11=$1; shift + local opst_12=$1; shift + local opst_13=$1; shift + local opst_14=$1; shift + + check_operstate br.11 $opst_11 + check_operstate br.12 $opst_12 + check_operstate br.13 $opst_13 + check_operstate br.14 $opst_14 +} + +do_test_binding() +{ + local inject=$1; shift + local what=$1; shift + local opsts_d1=$1; shift + local opsts_d2=$1; shift + local opsts_d12=$1; shift + local opsts_d123=$1; shift + + RET=0 + + defer_scope_push + down_netdevs d1 + $inject + check_operstates $opsts_d1 + defer_scope_pop + + defer_scope_push + down_netdevs d2 + $inject + check_operstates $opsts_d2 + defer_scope_pop + + defer_scope_push + down_netdevs d1 d2 + $inject + check_operstates $opsts_d12 + defer_scope_pop + + defer_scope_push + down_netdevs d1 d2 d3 + $inject + check_operstates $opsts_d123 + defer_scope_pop + + log_test "Test bridge_binding $what" +} + +do_test_binding_on() +{ + local inject=$1; shift + local what=$1; shift + + do_test_binding "$inject" "$what" \ + "0 1 1 1" \ + "1 0 1 1" \ + "0 0 0 1" \ + "0 0 0 0" +} + +do_test_binding_off() +{ + local inject=$1; shift + local what=$1; shift + + do_test_binding "$inject" "$what" \ + "1 1 1 1" \ + "1 1 1 1" \ + "1 1 1 1" \ + "0 0 0 0" +} + +test_binding_on() +{ + add_vlans bridge_binding on + set_vlans up + do_test_binding_on : "on" +} + +test_binding_off() +{ + add_vlans bridge_binding off + set_vlans up + do_test_binding_off : "off" +} + +test_binding_toggle_on() +{ + add_vlans bridge_binding off + set_vlans up + set_vlans type vlan bridge_binding on + do_test_binding_on : "off->on" +} + +test_binding_toggle_off() +{ + add_vlans bridge_binding on + set_vlans up + set_vlans type vlan bridge_binding off + do_test_binding_off : "on->off" +} + +dfr_set_binding_on() +{ + set_vlans type vlan bridge_binding on + defer set_vlans type vlan bridge_binding off +} + +dfr_set_binding_off() +{ + set_vlans type vlan bridge_binding off + defer set_vlans type vlan bridge_binding on +} + +test_binding_toggle_on_when_lower_down() +{ + add_vlans bridge_binding off + set_vlans up + do_test_binding_on dfr_set_binding_on "off->on when lower down" +} + +test_binding_toggle_off_when_lower_down() +{ + add_vlans bridge_binding on + set_vlans up + do_test_binding_off dfr_set_binding_off "on->off when lower down" +} + +test_binding_toggle_on_when_upper_down() +{ + add_vlans bridge_binding off + set_vlans type vlan bridge_binding on + set_vlans up + do_test_binding_on : "off->on when upper down" +} + +test_binding_toggle_off_when_upper_down() +{ + add_vlans bridge_binding on + set_vlans type vlan bridge_binding off + set_vlans up + do_test_binding_off : "on->off when upper down" +} + +trap defer_scopes_cleanup EXIT +setup_prepare +tests_run + +exit $EXIT_STATUS diff --git a/tools/testing/selftests/net/ynl.mk b/tools/testing/selftests/net/ynl.mk index d43afe243779..12e7cae251be 100644 --- a/tools/testing/selftests/net/ynl.mk +++ b/tools/testing/selftests/net/ynl.mk @@ -31,7 +31,8 @@ $(OUTPUT)/libynl.a: $(YNL_SPECS) $(OUTPUT)/.libynl-$(YNL_GENS_HASH).sig $(Q)cp $(top_srcdir)/tools/net/ynl/libynl.a $(OUTPUT)/libynl.a EXTRA_CLEAN += \ - $(top_srcdir)/tools/net/ynl/lib/__pycache__ \ + $(top_srcdir)/tools/net/ynl/pyynl/__pycache__ \ + $(top_srcdir)/tools/net/ynl/pyynl/lib/__pycache__ \ $(top_srcdir)/tools/net/ynl/lib/*.[ado] \ $(OUTPUT)/.libynl-*.sig \ $(OUTPUT)/libynl.a diff --git a/tools/testing/selftests/nolibc/Makefile b/tools/testing/selftests/nolibc/Makefile index e92e0b885861..7d14a7c0cb62 100644 --- a/tools/testing/selftests/nolibc/Makefile +++ b/tools/testing/selftests/nolibc/Makefile @@ -43,6 +43,7 @@ cc-option = $(call __cc-option, $(CC),$(CLANG_CROSS_FLAGS),$(1),$(2)) # configure default variants for target kernel supported architectures XARCH_powerpc = ppc XARCH_mips = mips32le +XARCH_riscv = riscv64 XARCH = $(or $(XARCH_$(ARCH)),$(ARCH)) # map from user input variants to their kernel supported architectures @@ -51,6 +52,8 @@ ARCH_ppc64 = powerpc ARCH_ppc64le = powerpc ARCH_mips32le = mips ARCH_mips32be = mips +ARCH_riscv32 = riscv +ARCH_riscv64 = riscv ARCH := $(or $(ARCH_$(XARCH)),$(XARCH)) # kernel image names by architecture @@ -65,6 +68,8 @@ IMAGE_ppc = vmlinux IMAGE_ppc64 = vmlinux IMAGE_ppc64le = arch/powerpc/boot/zImage IMAGE_riscv = arch/riscv/boot/Image +IMAGE_riscv32 = arch/riscv/boot/Image +IMAGE_riscv64 = arch/riscv/boot/Image IMAGE_s390 = arch/s390/boot/bzImage IMAGE_loongarch = arch/loongarch/boot/vmlinuz.efi IMAGE = $(objtree)/$(IMAGE_$(XARCH)) @@ -82,6 +87,8 @@ DEFCONFIG_ppc = pmac32_defconfig DEFCONFIG_ppc64 = powernv_be_defconfig DEFCONFIG_ppc64le = powernv_defconfig DEFCONFIG_riscv = defconfig +DEFCONFIG_riscv32 = rv32_defconfig +DEFCONFIG_riscv64 = defconfig DEFCONFIG_s390 = defconfig DEFCONFIG_loongarch = defconfig DEFCONFIG = $(DEFCONFIG_$(XARCH)) @@ -104,6 +111,8 @@ QEMU_ARCH_ppc = ppc QEMU_ARCH_ppc64 = ppc64 QEMU_ARCH_ppc64le = ppc64 QEMU_ARCH_riscv = riscv64 +QEMU_ARCH_riscv32 = riscv32 +QEMU_ARCH_riscv64 = riscv64 QEMU_ARCH_s390 = s390x QEMU_ARCH_loongarch = loongarch64 QEMU_ARCH = $(QEMU_ARCH_$(XARCH)) @@ -130,6 +139,8 @@ QEMU_ARGS_ppc = -M g3beige -append "console=ttyS0 panic=-1 $(TEST:%=NOLIB QEMU_ARGS_ppc64 = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" QEMU_ARGS_ppc64le = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" QEMU_ARGS_riscv = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" +QEMU_ARGS_riscv32 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" +QEMU_ARGS_riscv64 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" QEMU_ARGS_s390 = -M s390-ccw-virtio -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)" QEMU_ARGS_loongarch = -M virt -append "console=ttyS0,115200 panic=-1 $(TEST:%=NOLIBC_TEST=%)" QEMU_ARGS = -m 1G $(QEMU_ARGS_$(XARCH)) $(QEMU_ARGS_BIOS) $(QEMU_ARGS_EXTRA) diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c index 6fba7025c5e3..0e0e3b48a8c3 100644 --- a/tools/testing/selftests/nolibc/nolibc-test.c +++ b/tools/testing/selftests/nolibc/nolibc-test.c @@ -302,7 +302,10 @@ int expect_syszr(int expr, int llen) { int ret = 0; - if (expr) { + if (errno == ENOSYS) { + llen += printf(" = ENOSYS"); + result(llen, SKIPPED); + } else if (expr) { ret = 1; llen += printf(" = %d %s ", expr, errorname(errno)); result(llen, FAIL); @@ -342,7 +345,10 @@ int expect_sysne(int expr, int llen, int val) { int ret = 0; - if (expr == val) { + if (errno == ENOSYS) { + llen += printf(" = ENOSYS"); + result(llen, SKIPPED); + } else if (expr == val) { ret = 1; llen += printf(" = %d %s ", expr, errorname(errno)); result(llen, FAIL); @@ -367,7 +373,9 @@ int expect_syserr2(int expr, int expret, int experr1, int experr2, int llen) int _errno = errno; llen += printf(" = %d %s ", expr, errorname(_errno)); - if (expr != expret || (_errno != experr1 && _errno != experr2)) { + if (errno == ENOSYS) { + result(llen, SKIPPED); + } else if (expr != expret || (_errno != experr1 && _errno != experr2)) { ret = 1; if (experr2 == 0) llen += printf(" != (%d %s) ", expret, errorname(experr1)); @@ -1229,19 +1237,20 @@ int run_stdlib(int min, int max) static int expect_vfprintf(int llen, int c, const char *expected, const char *fmt, ...) { - int ret, fd; + int ret, pipefd[2]; ssize_t w, r; char buf[100]; FILE *memfile; va_list args; - fd = open("/tmp", O_TMPFILE | O_EXCL | O_RDWR, 0600); - if (fd == -1) { - result(llen, SKIPPED); - return 0; + ret = pipe(pipefd); + if (ret == -1) { + llen += printf(" pipe() != %s", strerror(errno)); + result(llen, FAIL); + return 1; } - memfile = fdopen(fd, "w+"); + memfile = fdopen(pipefd[1], "w"); if (!memfile) { result(llen, FAIL); return 1; @@ -1257,13 +1266,10 @@ static int expect_vfprintf(int llen, int c, const char *expected, const char *fm return 1; } - fflush(memfile); - lseek(fd, 0, SEEK_SET); - - r = read(fd, buf, sizeof(buf) - 1); - fclose(memfile); + r = read(pipefd[0], buf, sizeof(buf) - 1); + if (r != w) { llen += printf(" written(%d) != read(%d)", (int)w, (int)r); result(llen, FAIL); @@ -1323,7 +1329,8 @@ static int run_protection(int min __attribute__((unused)), int max __attribute__((unused))) { pid_t pid; - int llen = 0, status; + int llen = 0, ret; + siginfo_t siginfo = {}; struct rlimit rlimit = { 0, 0 }; llen += printf("0 -fstackprotector "); @@ -1361,10 +1368,11 @@ static int run_protection(int min __attribute__((unused)), return 1; default: - pid = waitpid(pid, &status, 0); + ret = waitid(P_PID, pid, &siginfo, WEXITED); - if (pid == -1 || !WIFSIGNALED(status) || WTERMSIG(status) != SIGABRT) { - llen += printf("waitpid()"); + if (ret != 0 || siginfo.si_signo != SIGCHLD || + siginfo.si_code != CLD_KILLED || siginfo.si_status != SIGABRT) { + llen += printf("waitid()"); result(llen, FAIL); return 1; } diff --git a/tools/testing/selftests/nolibc/run-tests.sh b/tools/testing/selftests/nolibc/run-tests.sh index e7ecda4ae796..9c5160c53881 100755 --- a/tools/testing/selftests/nolibc/run-tests.sh +++ b/tools/testing/selftests/nolibc/run-tests.sh @@ -17,7 +17,7 @@ perform_download=0 test_mode=system werror=1 llvm= -archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv s390 loongarch" +archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv32 riscv64 s390 loongarch" TEMP=$(getopt -o 'j:d:c:b:a:m:pelh' -n "$0" -- "$@") @@ -143,6 +143,13 @@ test_arch() { arch=$1 ct_arch=$(crosstool_arch "$arch") ct_abi=$(crosstool_abi "$1") + + if [ ! -d "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/." ]; then + echo "No toolchain found in ${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}." + echo "Did you install the toolchains or set the correct arch ? Rerun with -h for help." + return 1 + fi + cross_compile=$(realpath "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/${ct_arch}-${ct_abi}-") build_dir="${build_location}/${arch}" if [ "$werror" -ne 0 ]; then diff --git a/tools/testing/selftests/pci_endpoint/.gitignore b/tools/testing/selftests/pci_endpoint/.gitignore new file mode 100644 index 000000000000..6a4837a3e034 --- /dev/null +++ b/tools/testing/selftests/pci_endpoint/.gitignore @@ -0,0 +1,2 @@ +# SPDX-License-Identifier: GPL-2.0-only +pci_endpoint_test diff --git a/tools/testing/selftests/pci_endpoint/Makefile b/tools/testing/selftests/pci_endpoint/Makefile new file mode 100644 index 000000000000..bf21ebf20b4a --- /dev/null +++ b/tools/testing/selftests/pci_endpoint/Makefile @@ -0,0 +1,7 @@ +# SPDX-License-Identifier: GPL-2.0 +CFLAGS += -O2 -Wl,-no-as-needed -Wall $(KHDR_INCLUDES) +LDFLAGS += -lrt -lpthread -lm + +TEST_GEN_PROGS = pci_endpoint_test + +include ../lib.mk diff --git a/tools/testing/selftests/pci_endpoint/config b/tools/testing/selftests/pci_endpoint/config new file mode 100644 index 000000000000..7cdcf117db8d --- /dev/null +++ b/tools/testing/selftests/pci_endpoint/config @@ -0,0 +1,4 @@ +CONFIG_PCI_ENDPOINT=y +CONFIG_PCI_ENDPOINT_CONFIGFS=y +CONFIG_PCI_EPF_TEST=m +CONFIG_PCI_ENDPOINT_TEST=m diff --git a/tools/testing/selftests/pci_endpoint/pci_endpoint_test.c b/tools/testing/selftests/pci_endpoint/pci_endpoint_test.c new file mode 100644 index 000000000000..c267b822c108 --- /dev/null +++ b/tools/testing/selftests/pci_endpoint/pci_endpoint_test.c @@ -0,0 +1,221 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + * Kselftest for PCI Endpoint Subsystem + * + * Copyright (c) 2022 Samsung Electronics Co., Ltd. + * https://www.samsung.com + * Author: Aman Gupta <aman1.gupta@samsung.com> + * + * Copyright (c) 2024, Linaro Ltd. + * Author: Manivannan Sadhasivam <manivannan.sadhasivam@linaro.org> + */ + +#include <errno.h> +#include <fcntl.h> +#include <stdbool.h> +#include <stdio.h> +#include <stdlib.h> +#include <sys/ioctl.h> +#include <unistd.h> + +#include "../../../../include/uapi/linux/pcitest.h" + +#include "../kselftest_harness.h" + +#define pci_ep_ioctl(cmd, arg) \ +({ \ + ret = ioctl(self->fd, cmd, arg); \ + ret = ret < 0 ? -errno : 0; \ +}) + +static const char *test_device = "/dev/pci-endpoint-test.0"; +static const unsigned long test_size[5] = { 1, 1024, 1025, 1024000, 1024001 }; + +FIXTURE(pci_ep_bar) +{ + int fd; +}; + +FIXTURE_SETUP(pci_ep_bar) +{ + self->fd = open(test_device, O_RDWR); + + ASSERT_NE(-1, self->fd) TH_LOG("Can't open PCI Endpoint Test device"); +} + +FIXTURE_TEARDOWN(pci_ep_bar) +{ + close(self->fd); +} + +FIXTURE_VARIANT(pci_ep_bar) +{ + int barno; +}; + +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR0) { .barno = 0 }; +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR1) { .barno = 1 }; +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR2) { .barno = 2 }; +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR3) { .barno = 3 }; +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR4) { .barno = 4 }; +FIXTURE_VARIANT_ADD(pci_ep_bar, BAR5) { .barno = 5 }; + +TEST_F(pci_ep_bar, BAR_TEST) +{ + int ret; + + pci_ep_ioctl(PCITEST_BAR, variant->barno); + EXPECT_FALSE(ret) TH_LOG("Test failed for BAR%d", variant->barno); +} + +FIXTURE(pci_ep_basic) +{ + int fd; +}; + +FIXTURE_SETUP(pci_ep_basic) +{ + self->fd = open(test_device, O_RDWR); + + ASSERT_NE(-1, self->fd) TH_LOG("Can't open PCI Endpoint Test device"); +} + +FIXTURE_TEARDOWN(pci_ep_basic) +{ + close(self->fd); +} + +TEST_F(pci_ep_basic, CONSECUTIVE_BAR_TEST) +{ + int ret; + + pci_ep_ioctl(PCITEST_BARS, 0); + EXPECT_FALSE(ret) TH_LOG("Consecutive BAR test failed"); +} + +TEST_F(pci_ep_basic, LEGACY_IRQ_TEST) +{ + int ret; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 0); + ASSERT_EQ(0, ret) TH_LOG("Can't set Legacy IRQ type"); + + pci_ep_ioctl(PCITEST_LEGACY_IRQ, 0); + EXPECT_FALSE(ret) TH_LOG("Test failed for Legacy IRQ"); +} + +TEST_F(pci_ep_basic, MSI_TEST) +{ + int ret, i; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 1); + ASSERT_EQ(0, ret) TH_LOG("Can't set MSI IRQ type"); + + for (i = 1; i <= 32; i++) { + pci_ep_ioctl(PCITEST_MSI, i); + EXPECT_FALSE(ret) TH_LOG("Test failed for MSI%d", i); + } +} + +TEST_F(pci_ep_basic, MSIX_TEST) +{ + int ret, i; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 2); + ASSERT_EQ(0, ret) TH_LOG("Can't set MSI-X IRQ type"); + + for (i = 1; i <= 2048; i++) { + pci_ep_ioctl(PCITEST_MSIX, i); + EXPECT_FALSE(ret) TH_LOG("Test failed for MSI-X%d", i); + } +} + +FIXTURE(pci_ep_data_transfer) +{ + int fd; +}; + +FIXTURE_SETUP(pci_ep_data_transfer) +{ + self->fd = open(test_device, O_RDWR); + + ASSERT_NE(-1, self->fd) TH_LOG("Can't open PCI Endpoint Test device"); +} + +FIXTURE_TEARDOWN(pci_ep_data_transfer) +{ + close(self->fd); +} + +FIXTURE_VARIANT(pci_ep_data_transfer) +{ + bool use_dma; +}; + +FIXTURE_VARIANT_ADD(pci_ep_data_transfer, memcpy) +{ + .use_dma = false, +}; + +FIXTURE_VARIANT_ADD(pci_ep_data_transfer, dma) +{ + .use_dma = true, +}; + +TEST_F(pci_ep_data_transfer, READ_TEST) +{ + struct pci_endpoint_test_xfer_param param = {}; + int ret, i; + + if (variant->use_dma) + param.flags = PCITEST_FLAGS_USE_DMA; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 1); + ASSERT_EQ(0, ret) TH_LOG("Can't set MSI IRQ type"); + + for (i = 0; i < ARRAY_SIZE(test_size); i++) { + param.size = test_size[i]; + pci_ep_ioctl(PCITEST_READ, ¶m); + EXPECT_FALSE(ret) TH_LOG("Test failed for size (%ld)", + test_size[i]); + } +} + +TEST_F(pci_ep_data_transfer, WRITE_TEST) +{ + struct pci_endpoint_test_xfer_param param = {}; + int ret, i; + + if (variant->use_dma) + param.flags = PCITEST_FLAGS_USE_DMA; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 1); + ASSERT_EQ(0, ret) TH_LOG("Can't set MSI IRQ type"); + + for (i = 0; i < ARRAY_SIZE(test_size); i++) { + param.size = test_size[i]; + pci_ep_ioctl(PCITEST_WRITE, ¶m); + EXPECT_FALSE(ret) TH_LOG("Test failed for size (%ld)", + test_size[i]); + } +} + +TEST_F(pci_ep_data_transfer, COPY_TEST) +{ + struct pci_endpoint_test_xfer_param param = {}; + int ret, i; + + if (variant->use_dma) + param.flags = PCITEST_FLAGS_USE_DMA; + + pci_ep_ioctl(PCITEST_SET_IRQTYPE, 1); + ASSERT_EQ(0, ret) TH_LOG("Can't set MSI IRQ type"); + + for (i = 0; i < ARRAY_SIZE(test_size); i++) { + param.size = test_size[i]; + pci_ep_ioctl(PCITEST_COPY, ¶m); + EXPECT_FALSE(ret) TH_LOG("Test failed for size (%ld)", + test_size[i]); + } +} +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/pid_namespace/.gitignore b/tools/testing/selftests/pid_namespace/.gitignore index 93ab9d7e5b7e..5118f0f3edf4 100644 --- a/tools/testing/selftests/pid_namespace/.gitignore +++ b/tools/testing/selftests/pid_namespace/.gitignore @@ -1 +1,2 @@ +pid_max regression_enomem diff --git a/tools/testing/selftests/pid_namespace/Makefile b/tools/testing/selftests/pid_namespace/Makefile index 9286a1d22cd3..b972f55d07ae 100644 --- a/tools/testing/selftests/pid_namespace/Makefile +++ b/tools/testing/selftests/pid_namespace/Makefile @@ -1,7 +1,7 @@ # SPDX-License-Identifier: GPL-2.0 CFLAGS += -g $(KHDR_INCLUDES) -TEST_GEN_PROGS = regression_enomem +TEST_GEN_PROGS = regression_enomem pid_max LOCAL_HDRS += $(selfdir)/pidfd/pidfd.h diff --git a/tools/testing/selftests/pid_namespace/pid_max.c b/tools/testing/selftests/pid_namespace/pid_max.c new file mode 100644 index 000000000000..51c414faabb0 --- /dev/null +++ b/tools/testing/selftests/pid_namespace/pid_max.c @@ -0,0 +1,358 @@ +/* SPDX-License-Identifier: GPL-2.0 */ +#define _GNU_SOURCE +#include <assert.h> +#include <errno.h> +#include <fcntl.h> +#include <linux/types.h> +#include <sched.h> +#include <signal.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <syscall.h> +#include <sys/wait.h> + +#include "../kselftest_harness.h" +#include "../pidfd/pidfd.h" + +#define __STACK_SIZE (8 * 1024 * 1024) +static pid_t do_clone(int (*fn)(void *), void *arg, int flags) +{ + char *stack; + pid_t ret; + + stack = malloc(__STACK_SIZE); + if (!stack) + return -ENOMEM; + +#ifdef __ia64__ + ret = __clone2(fn, stack, __STACK_SIZE, flags | SIGCHLD, arg); +#else + ret = clone(fn, stack + __STACK_SIZE, flags | SIGCHLD, arg); +#endif + free(stack); + return ret; +} + +static int pid_max_cb(void *data) +{ + int fd, ret; + pid_t pid; + + ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0); + if (ret) { + fprintf(stderr, "%m - Failed to make rootfs private mount\n"); + return -1; + } + + umount2("/proc", MNT_DETACH); + + ret = mount("proc", "/proc", "proc", 0, NULL); + if (ret) { + fprintf(stderr, "%m - Failed to mount proc\n"); + return -1; + } + + fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY); + if (fd < 0) { + fprintf(stderr, "%m - Failed to open pid_max\n"); + return -1; + } + + ret = write(fd, "500", sizeof("500") - 1); + if (ret < 0) { + fprintf(stderr, "%m - Failed to write pid_max\n"); + return -1; + } + + for (int i = 0; i < 501; i++) { + pid = fork(); + if (pid == 0) + exit(EXIT_SUCCESS); + wait_for_pid(pid); + if (pid > 500) { + fprintf(stderr, "Managed to create pid number beyond limit\n"); + return -1; + } + } + + return 0; +} + +static int pid_max_nested_inner(void *data) +{ + int fret = -1; + pid_t pids[2]; + int fd, i, ret; + + ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0); + if (ret) { + fprintf(stderr, "%m - Failed to make rootfs private mount\n"); + return fret; + } + + umount2("/proc", MNT_DETACH); + + ret = mount("proc", "/proc", "proc", 0, NULL); + if (ret) { + fprintf(stderr, "%m - Failed to mount proc\n"); + return fret; + } + + fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY); + if (fd < 0) { + fprintf(stderr, "%m - Failed to open pid_max\n"); + return fret; + } + + ret = write(fd, "500", sizeof("500") - 1); + close(fd); + if (ret < 0) { + fprintf(stderr, "%m - Failed to write pid_max\n"); + return fret; + } + + pids[0] = fork(); + if (pids[0] < 0) { + fprintf(stderr, "Failed to create first new process\n"); + return fret; + } + + if (pids[0] == 0) + exit(EXIT_SUCCESS); + + pids[1] = fork(); + wait_for_pid(pids[0]); + if (pids[1] >= 0) { + if (pids[1] == 0) + exit(EXIT_SUCCESS); + wait_for_pid(pids[1]); + + fprintf(stderr, "Managed to create process even though ancestor pid namespace had a limit\n"); + return fret; + } + + /* Now make sure that we wrap pids at 400. */ + for (i = 0; i < 510; i++) { + pid_t pid; + + pid = fork(); + if (pid < 0) + return fret; + + if (pid == 0) + exit(EXIT_SUCCESS); + + wait_for_pid(pid); + if (pid >= 500) { + fprintf(stderr, "Managed to create process with pid %d beyond configured limit\n", pid); + return fret; + } + } + + return 0; +} + +static int pid_max_nested_outer(void *data) +{ + int fret = -1, nr_procs = 400; + pid_t pids[1000]; + int fd, i, ret; + pid_t pid; + + ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0); + if (ret) { + fprintf(stderr, "%m - Failed to make rootfs private mount\n"); + return fret; + } + + umount2("/proc", MNT_DETACH); + + ret = mount("proc", "/proc", "proc", 0, NULL); + if (ret) { + fprintf(stderr, "%m - Failed to mount proc\n"); + return fret; + } + + fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY); + if (fd < 0) { + fprintf(stderr, "%m - Failed to open pid_max\n"); + return fret; + } + + ret = write(fd, "400", sizeof("400") - 1); + close(fd); + if (ret < 0) { + fprintf(stderr, "%m - Failed to write pid_max\n"); + return fret; + } + + /* + * Create 397 processes. This leaves room for do_clone() (398) and + * one more 399. So creating another process needs to fail. + */ + for (nr_procs = 0; nr_procs < 396; nr_procs++) { + pid = fork(); + if (pid < 0) + goto reap; + + if (pid == 0) + exit(EXIT_SUCCESS); + + pids[nr_procs] = pid; + } + + pid = do_clone(pid_max_nested_inner, NULL, CLONE_NEWPID | CLONE_NEWNS); + if (pid < 0) { + fprintf(stderr, "%m - Failed to clone nested pidns\n"); + goto reap; + } + + if (wait_for_pid(pid)) { + fprintf(stderr, "%m - Nested pid_max failed\n"); + goto reap; + } + + fret = 0; + +reap: + for (int i = 0; i < nr_procs; i++) + wait_for_pid(pids[i]); + + return fret; +} + +static int pid_max_nested_limit_inner(void *data) +{ + int fret = -1, nr_procs = 400; + int fd, ret; + pid_t pid; + pid_t pids[1000]; + + ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0); + if (ret) { + fprintf(stderr, "%m - Failed to make rootfs private mount\n"); + return fret; + } + + umount2("/proc", MNT_DETACH); + + ret = mount("proc", "/proc", "proc", 0, NULL); + if (ret) { + fprintf(stderr, "%m - Failed to mount proc\n"); + return fret; + } + + fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY); + if (fd < 0) { + fprintf(stderr, "%m - Failed to open pid_max\n"); + return fret; + } + + ret = write(fd, "500", sizeof("500") - 1); + close(fd); + if (ret < 0) { + fprintf(stderr, "%m - Failed to write pid_max\n"); + return fret; + } + + for (nr_procs = 0; nr_procs < 500; nr_procs++) { + pid = fork(); + if (pid < 0) + break; + + if (pid == 0) + exit(EXIT_SUCCESS); + + pids[nr_procs] = pid; + } + + if (nr_procs >= 400) { + fprintf(stderr, "Managed to create processes beyond the configured outer limit\n"); + goto reap; + } + + fret = 0; + +reap: + for (int i = 0; i < nr_procs; i++) + wait_for_pid(pids[i]); + + return fret; +} + +static int pid_max_nested_limit_outer(void *data) +{ + int fd, ret; + pid_t pid; + + ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0); + if (ret) { + fprintf(stderr, "%m - Failed to make rootfs private mount\n"); + return -1; + } + + umount2("/proc", MNT_DETACH); + + ret = mount("proc", "/proc", "proc", 0, NULL); + if (ret) { + fprintf(stderr, "%m - Failed to mount proc\n"); + return -1; + } + + fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY); + if (fd < 0) { + fprintf(stderr, "%m - Failed to open pid_max\n"); + return -1; + } + + ret = write(fd, "400", sizeof("400") - 1); + close(fd); + if (ret < 0) { + fprintf(stderr, "%m - Failed to write pid_max\n"); + return -1; + } + + pid = do_clone(pid_max_nested_limit_inner, NULL, CLONE_NEWPID | CLONE_NEWNS); + if (pid < 0) { + fprintf(stderr, "%m - Failed to clone nested pidns\n"); + return -1; + } + + if (wait_for_pid(pid)) { + fprintf(stderr, "%m - Nested pid_max failed\n"); + return -1; + } + + return 0; +} + +TEST(pid_max_simple) +{ + pid_t pid; + + + pid = do_clone(pid_max_cb, NULL, CLONE_NEWPID | CLONE_NEWNS); + ASSERT_GT(pid, 0); + ASSERT_EQ(0, wait_for_pid(pid)); +} + +TEST(pid_max_nested_limit) +{ + pid_t pid; + + pid = do_clone(pid_max_nested_limit_outer, NULL, CLONE_NEWPID | CLONE_NEWNS); + ASSERT_GT(pid, 0); + ASSERT_EQ(0, wait_for_pid(pid)); +} + +TEST(pid_max_nested) +{ + pid_t pid; + + pid = do_clone(pid_max_nested_outer, NULL, CLONE_NEWPID | CLONE_NEWNS); + ASSERT_GT(pid, 0); + ASSERT_EQ(0, wait_for_pid(pid)); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/pidfd/.gitignore b/tools/testing/selftests/pidfd/.gitignore index 973198a3ec3d..bf92481f925c 100644 --- a/tools/testing/selftests/pidfd/.gitignore +++ b/tools/testing/selftests/pidfd/.gitignore @@ -6,3 +6,5 @@ pidfd_wait pidfd_fdinfo_test pidfd_getfd_test pidfd_setns_test +pidfd_file_handle_test +pidfd_bind_mount diff --git a/tools/testing/selftests/pidfd/Makefile b/tools/testing/selftests/pidfd/Makefile index d731e3e76d5b..301343a11b62 100644 --- a/tools/testing/selftests/pidfd/Makefile +++ b/tools/testing/selftests/pidfd/Makefile @@ -2,7 +2,8 @@ CFLAGS += -g $(KHDR_INCLUDES) -pthread -Wall TEST_GEN_PROGS := pidfd_test pidfd_fdinfo_test pidfd_open_test \ - pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test + pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test \ + pidfd_file_handle_test pidfd_bind_mount include ../lib.mk diff --git a/tools/testing/selftests/pidfd/pidfd.h b/tools/testing/selftests/pidfd/pidfd.h index 88d6830ee004..0b96ac4b8ce5 100644 --- a/tools/testing/selftests/pidfd/pidfd.h +++ b/tools/testing/selftests/pidfd/pidfd.h @@ -12,11 +12,11 @@ #include <stdlib.h> #include <string.h> #include <syscall.h> -#include <sys/mount.h> #include <sys/types.h> #include <sys/wait.h> #include "../kselftest.h" +#include "../clone3/clone3_selftests.h" #ifndef P_PIDFD #define P_PIDFD 3 @@ -68,6 +68,11 @@ #define PIDFD_SKIP 3 #define PIDFD_XFAIL 4 +static inline int sys_waitid(int which, pid_t pid, siginfo_t *info, int options) +{ + return syscall(__NR_waitid, which, pid, info, options, NULL); +} + static inline int wait_for_pid(pid_t pid) { int status, ret; @@ -114,4 +119,37 @@ static inline int sys_memfd_create(const char *name, unsigned int flags) return syscall(__NR_memfd_create, name, flags); } +static inline pid_t create_child(int *pidfd, unsigned flags) +{ + struct __clone_args args = { + .flags = CLONE_PIDFD | flags, + .exit_signal = SIGCHLD, + .pidfd = ptr_to_u64(pidfd), + }; + + return sys_clone3(&args, sizeof(struct __clone_args)); +} + +static inline ssize_t read_nointr(int fd, void *buf, size_t count) +{ + ssize_t ret; + + do { + ret = read(fd, buf, count); + } while (ret < 0 && errno == EINTR); + + return ret; +} + +static inline ssize_t write_nointr(int fd, const void *buf, size_t count) +{ + ssize_t ret; + + do { + ret = write(fd, buf, count); + } while (ret < 0 && errno == EINTR); + + return ret; +} + #endif /* __PIDFD_H */ diff --git a/tools/testing/selftests/pidfd/pidfd_bind_mount.c b/tools/testing/selftests/pidfd/pidfd_bind_mount.c new file mode 100644 index 000000000000..7822dd080258 --- /dev/null +++ b/tools/testing/selftests/pidfd/pidfd_bind_mount.c @@ -0,0 +1,188 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +// Copyright (c) 2024 Christian Brauner <brauner@kernel.org> + +#define _GNU_SOURCE +#include <fcntl.h> +#include <limits.h> +#include <sched.h> +#include <stdio.h> +#include <string.h> +#include <linux/fs.h> +#include <sys/ioctl.h> +#include <sys/stat.h> +#include <sys/mount.h> +#include <unistd.h> + +#include "pidfd.h" +#include "../kselftest_harness.h" + +#ifndef __NR_open_tree + #if defined __alpha__ + #define __NR_open_tree 538 + #elif defined _MIPS_SIM + #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */ + #define __NR_open_tree 4428 + #endif + #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */ + #define __NR_open_tree 6428 + #endif + #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */ + #define __NR_open_tree 5428 + #endif + #elif defined __ia64__ + #define __NR_open_tree (428 + 1024) + #else + #define __NR_open_tree 428 + #endif +#endif + +#ifndef __NR_move_mount + #if defined __alpha__ + #define __NR_move_mount 539 + #elif defined _MIPS_SIM + #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */ + #define __NR_move_mount 4429 + #endif + #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */ + #define __NR_move_mount 6429 + #endif + #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */ + #define __NR_move_mount 5429 + #endif + #elif defined __ia64__ + #define __NR_move_mount (428 + 1024) + #else + #define __NR_move_mount 429 + #endif +#endif + +#ifndef MOVE_MOUNT_F_EMPTY_PATH +#define MOVE_MOUNT_F_EMPTY_PATH 0x00000004 /* Empty from path permitted */ +#endif + +#ifndef MOVE_MOUNT_F_EMPTY_PATH +#define MOVE_MOUNT_T_EMPTY_PATH 0x00000040 /* Empty to path permitted */ +#endif + +static inline int sys_move_mount(int from_dfd, const char *from_pathname, + int to_dfd, const char *to_pathname, + unsigned int flags) +{ + return syscall(__NR_move_mount, from_dfd, from_pathname, to_dfd, + to_pathname, flags); +} + +#ifndef OPEN_TREE_CLONE +#define OPEN_TREE_CLONE 1 +#endif + +#ifndef OPEN_TREE_CLOEXEC +#define OPEN_TREE_CLOEXEC O_CLOEXEC +#endif + +#ifndef AT_RECURSIVE +#define AT_RECURSIVE 0x8000 /* Apply to the entire subtree */ +#endif + +static inline int sys_open_tree(int dfd, const char *filename, unsigned int flags) +{ + return syscall(__NR_open_tree, dfd, filename, flags); +} + +FIXTURE(pidfd_bind_mount) { + char template[PATH_MAX]; + int fd_tmp; + int pidfd; + struct stat st1; + struct stat st2; + __u32 gen1; + __u32 gen2; + bool must_unmount; +}; + +FIXTURE_SETUP(pidfd_bind_mount) +{ + self->fd_tmp = -EBADF; + self->must_unmount = false; + ASSERT_EQ(unshare(CLONE_NEWNS), 0); + ASSERT_LE(snprintf(self->template, PATH_MAX, "%s", P_tmpdir "/pidfd_bind_mount_XXXXXX"), PATH_MAX); + self->fd_tmp = mkstemp(self->template); + ASSERT_GE(self->fd_tmp, 0); + self->pidfd = sys_pidfd_open(getpid(), 0); + ASSERT_GE(self->pidfd, 0); + ASSERT_GE(fstat(self->pidfd, &self->st1), 0); + ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen1), 0); +} + +FIXTURE_TEARDOWN(pidfd_bind_mount) +{ + ASSERT_EQ(close(self->fd_tmp), 0); + if (self->must_unmount) + ASSERT_EQ(umount2(self->template, 0), 0); + ASSERT_EQ(unlink(self->template), 0); +} + +/* + * Test that a detached mount can be created for a pidfd and then + * attached to the filesystem hierarchy. + */ +TEST_F(pidfd_bind_mount, bind_mount) +{ + int fd_tree; + + fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH); + ASSERT_GE(fd_tree, 0); + + ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0); + self->must_unmount = true; + + ASSERT_EQ(close(fd_tree), 0); +} + +/* Test that a pidfd can be reopened through procfs. */ +TEST_F(pidfd_bind_mount, reopen) +{ + int pidfd; + char proc_path[PATH_MAX]; + + sprintf(proc_path, "/proc/self/fd/%d", self->pidfd); + pidfd = open(proc_path, O_RDONLY | O_NOCTTY | O_CLOEXEC); + ASSERT_GE(pidfd, 0); + + ASSERT_GE(fstat(self->pidfd, &self->st2), 0); + ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen2), 0); + + ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino); + ASSERT_TRUE(self->gen1 == self->gen2); + + ASSERT_EQ(close(pidfd), 0); +} + +/* + * Test that a detached mount can be created for a pidfd and then + * attached to the filesystem hierarchy and reopened. + */ +TEST_F(pidfd_bind_mount, bind_mount_reopen) +{ + int fd_tree, fd_pidfd_mnt; + + fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH); + ASSERT_GE(fd_tree, 0); + + ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0); + self->must_unmount = true; + + fd_pidfd_mnt = openat(-EBADF, self->template, O_RDONLY | O_NOCTTY | O_CLOEXEC); + ASSERT_GE(fd_pidfd_mnt, 0); + + ASSERT_GE(fstat(fd_tree, &self->st2), 0); + ASSERT_EQ(ioctl(fd_pidfd_mnt, FS_IOC_GETVERSION, &self->gen2), 0); + + ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino); + ASSERT_TRUE(self->gen1 == self->gen2); + + ASSERT_EQ(close(fd_tree), 0); + ASSERT_EQ(close(fd_pidfd_mnt), 0); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/pidfd/pidfd_file_handle_test.c b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c new file mode 100644 index 000000000000..439b9c6c0457 --- /dev/null +++ b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c @@ -0,0 +1,503 @@ +// SPDX-License-Identifier: GPL-2.0 + +#define _GNU_SOURCE +#include <errno.h> +#include <fcntl.h> +#include <limits.h> +#include <linux/types.h> +#include <poll.h> +#include <sched.h> +#include <signal.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <syscall.h> +#include <sys/prctl.h> +#include <sys/wait.h> +#include <unistd.h> +#include <sys/socket.h> +#include <linux/kcmp.h> +#include <sys/stat.h> + +#include "pidfd.h" +#include "../kselftest_harness.h" + +FIXTURE(file_handle) +{ + pid_t pid; + int pidfd; + + pid_t child_pid1; + int child_pidfd1; + + pid_t child_pid2; + int child_pidfd2; + + pid_t child_pid3; + int child_pidfd3; +}; + +FIXTURE_SETUP(file_handle) +{ + int ret; + int ipc_sockets[2]; + char c; + + self->pid = getpid(); + self->pidfd = sys_pidfd_open(self->pid, 0); + ASSERT_GE(self->pidfd, 0); + + ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets); + EXPECT_EQ(ret, 0); + + self->child_pid1 = create_child(&self->child_pidfd1, CLONE_NEWUSER); + EXPECT_GE(self->child_pid1, 0); + + if (self->child_pid1 == 0) { + close(ipc_sockets[0]); + + if (write_nointr(ipc_sockets[1], "1", 1) < 0) + _exit(EXIT_FAILURE); + + close(ipc_sockets[1]); + + pause(); + _exit(EXIT_SUCCESS); + } + + close(ipc_sockets[1]); + ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1); + close(ipc_sockets[0]); + + ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets); + EXPECT_EQ(ret, 0); + + self->child_pid2 = create_child(&self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID); + EXPECT_GE(self->child_pid2, 0); + + if (self->child_pid2 == 0) { + close(ipc_sockets[0]); + + if (write_nointr(ipc_sockets[1], "1", 1) < 0) + _exit(EXIT_FAILURE); + + close(ipc_sockets[1]); + + pause(); + _exit(EXIT_SUCCESS); + } + + close(ipc_sockets[1]); + ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1); + close(ipc_sockets[0]); + + ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets); + EXPECT_EQ(ret, 0); + + self->child_pid3 = create_child(&self->child_pidfd3, CLONE_NEWUSER | CLONE_NEWPID); + EXPECT_GE(self->child_pid3, 0); + + if (self->child_pid3 == 0) { + close(ipc_sockets[0]); + + if (write_nointr(ipc_sockets[1], "1", 1) < 0) + _exit(EXIT_FAILURE); + + close(ipc_sockets[1]); + + pause(); + _exit(EXIT_SUCCESS); + } + + close(ipc_sockets[1]); + ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1); + close(ipc_sockets[0]); +} + +FIXTURE_TEARDOWN(file_handle) +{ + EXPECT_EQ(close(self->pidfd), 0); + + EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd1, SIGKILL, NULL, 0), 0); + if (self->child_pidfd1 >= 0) + EXPECT_EQ(0, close(self->child_pidfd1)); + + EXPECT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0); + + EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd2, SIGKILL, NULL, 0), 0); + if (self->child_pidfd2 >= 0) + EXPECT_EQ(0, close(self->child_pidfd2)); + + EXPECT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0); + + if (self->child_pidfd3 >= 0) { + EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd3, SIGKILL, NULL, 0), 0); + EXPECT_EQ(0, close(self->child_pidfd3)); + EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0); + } +} + +/* + * Test that we can decode a pidfs file handle in the same pid + * namespace. + */ +TEST_F(file_handle, file_handle_same_pidns) +{ + int mnt_id; + struct file_handle *fh; + int pidfd = -EBADF; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd1, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(fstat(self->child_pidfd1, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + free(fh); +} + +/* + * Test that we can decode a pidfs file handle from a child pid + * namespace. + */ +TEST_F(file_handle, file_handle_child_pidns) +{ + int mnt_id; + struct file_handle *fh; + int pidfd = -EBADF; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + free(fh); +} + +/* + * Test that we fail to decode a pidfs file handle from an ancestor + * child pid namespace. + */ +TEST_F(file_handle, file_handle_foreign_pidns) +{ + int mnt_id; + struct file_handle *fh; + pid_t pid; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->pidfd, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(setns(self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID), 0); + + pid = fork(); + ASSERT_GE(pid, 0); + + if (pid == 0) { + int pidfd = open_by_handle_at(self->pidfd, fh, 0); + if (pidfd >= 0) { + TH_LOG("Managed to open pidfd outside of the caller's pid namespace hierarchy"); + _exit(1); + } + _exit(0); + } + + ASSERT_EQ(wait_for_pid(pid), 0); + + free(fh); +} + +/* + * Test that we can decode a pidfs file handle of a process that has + * exited but not been reaped. + */ +TEST_F(file_handle, pid_has_exited) +{ + int mnt_id, pidfd, child_pidfd3; + struct file_handle *fh; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + child_pidfd3 = self->child_pidfd3; + self->child_pidfd3 = -EBADF; + EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0); + EXPECT_EQ(close(child_pidfd3), 0); + EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED | WNOWAIT), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0); +} + +/* + * Test that we fail to decode a pidfs file handle of a process that has + * already been reaped. + */ +TEST_F(file_handle, pid_has_been_reaped) +{ + int mnt_id, pidfd, child_pidfd3; + struct file_handle *fh; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); + + child_pidfd3 = self->child_pidfd3; + self->child_pidfd3 = -EBADF; + EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0); + EXPECT_EQ(close(child_pidfd3), 0); + EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_LT(pidfd, 0); +} + +/* + * Test valid flags to open a pidfd file handle. Note, that + * PIDFD_NONBLOCK is defined as O_NONBLOCK and O_NONBLOCK is an alias to + * O_NDELAY. Also note that PIDFD_THREAD is an alias for O_EXCL. + */ +TEST_F(file_handle, open_by_handle_at_valid_flags) +{ + int mnt_id; + struct file_handle *fh; + int pidfd = -EBADF; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, + O_RDONLY | + O_WRONLY | + O_RDWR | + O_NONBLOCK | + O_NDELAY | + O_CLOEXEC | + O_EXCL); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); +} + +/* + * Test that invalid flags passed to open a pidfd file handle are + * rejected. + */ +TEST_F(file_handle, open_by_handle_at_invalid_flags) +{ + int mnt_id; + struct file_handle *fh; + int pidfd = -EBADF; + static const struct invalid_pidfs_file_handle_flags { + int oflag; + const char *oflag_name; + } invalid_pidfs_file_handle_flags[] = { + { FASYNC, "FASYNC" }, + { O_CREAT, "O_CREAT" }, + { O_NOCTTY, "O_NOCTTY" }, + { O_CREAT, "O_CREAT" }, + { O_TRUNC, "O_TRUNC" }, + { O_APPEND, "O_APPEND" }, + { O_SYNC, "O_SYNC" }, + { O_DSYNC, "O_DSYNC" }, + { O_DIRECT, "O_DIRECT" }, + { O_DIRECTORY, "O_DIRECTORY" }, + { O_NOFOLLOW, "O_NOFOLLOW" }, + { O_NOATIME, "O_NOATIME" }, + { O_PATH, "O_PATH" }, + { O_TMPFILE, "O_TMPFILE" }, + /* + * O_LARGEFILE is added implicitly by + * open_by_handle_at() so pidfs simply masks it off. + */ + }; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0); + + for (int i = 0; i < ARRAY_SIZE(invalid_pidfs_file_handle_flags); i++) { + pidfd = open_by_handle_at(self->pidfd, fh, invalid_pidfs_file_handle_flags[i].oflag); + ASSERT_LT(pidfd, 0) { + TH_LOG("open_by_handle_at() succeeded with invalid flags: %s", invalid_pidfs_file_handle_flags[i].oflag_name); + } + } +} + +/* Test that lookup fails. */ +TEST_F(file_handle, lookup_must_fail) +{ + int mnt_id; + struct file_handle *fh; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, AT_EMPTY_PATH), 0); + ASSERT_EQ(errno, ENOTDIR); + ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, 0), 0); + ASSERT_EQ(errno, ENOTDIR); +} + +#ifndef AT_HANDLE_CONNECTABLE +#define AT_HANDLE_CONNECTABLE 0x002 +#endif + +/* + * Test that AT_HANDLE_CONNECTABLE is rejected. Connectable file handles + * don't make sense for pidfs. Note that currently AT_HANDLE_CONNECTABLE + * is rejected because it is incompatible with AT_EMPTY_PATH which is + * required with pidfds as we don't support lookup. + */ +TEST_F(file_handle, invalid_name_to_handle_at_flags) +{ + int mnt_id; + struct file_handle *fh; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_NE(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_CONNECTABLE), 0); +} + +#ifndef AT_HANDLE_FID +#define AT_HANDLE_FID 0x200 +#endif + +/* + * Test that a request with AT_HANDLE_FID always leads to decodable file + * handle as pidfs always provides export operations. + */ +TEST_F(file_handle, valid_name_to_handle_at_flags) +{ + int mnt_id, pidfd; + struct file_handle *fh; + struct stat st1, st2; + + fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ); + ASSERT_NE(fh, NULL); + memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ); + fh->handle_bytes = MAX_HANDLE_SZ; + + ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_FID), 0); + + ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0); + + pidfd = open_by_handle_at(self->pidfd, fh, 0); + ASSERT_GE(pidfd, 0); + + ASSERT_EQ(fstat(pidfd, &st2), 0); + ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino); + + ASSERT_EQ(close(pidfd), 0); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/pidfd/pidfd_setns_test.c b/tools/testing/selftests/pidfd/pidfd_setns_test.c index 7c2a4349170a..222f8131283b 100644 --- a/tools/testing/selftests/pidfd/pidfd_setns_test.c +++ b/tools/testing/selftests/pidfd/pidfd_setns_test.c @@ -19,7 +19,6 @@ #include <linux/ioctl.h> #include "pidfd.h" -#include "../clone3/clone3_selftests.h" #include "../kselftest_harness.h" #ifndef PIDFS_IOCTL_MAGIC @@ -118,22 +117,6 @@ FIXTURE(current_nsset) int child_pidfd_derived_nsfds2[PIDFD_NS_MAX]; }; -static int sys_waitid(int which, pid_t pid, int options) -{ - return syscall(__NR_waitid, which, pid, NULL, options, NULL); -} - -pid_t create_child(int *pidfd, unsigned flags) -{ - struct __clone_args args = { - .flags = CLONE_PIDFD | flags, - .exit_signal = SIGCHLD, - .pidfd = ptr_to_u64(pidfd), - }; - - return sys_clone3(&args, sizeof(struct clone_args)); -} - static bool switch_timens(void) { int fd, ret; @@ -150,28 +133,6 @@ static bool switch_timens(void) return ret == 0; } -static ssize_t read_nointr(int fd, void *buf, size_t count) -{ - ssize_t ret; - - do { - ret = read(fd, buf, count); - } while (ret < 0 && errno == EINTR); - - return ret; -} - -static ssize_t write_nointr(int fd, const void *buf, size_t count) -{ - ssize_t ret; - - do { - ret = write(fd, buf, count); - } while (ret < 0 && errno == EINTR); - - return ret; -} - FIXTURE_SETUP(current_nsset) { int i, proc_fd, ret; @@ -229,7 +190,7 @@ FIXTURE_SETUP(current_nsset) _exit(EXIT_SUCCESS); } - ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED | WNOWAIT), 0); + ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED | WNOWAIT), 0); self->pidfd = sys_pidfd_open(self->pid, 0); EXPECT_GE(self->pidfd, 0) { @@ -432,9 +393,9 @@ FIXTURE_TEARDOWN(current_nsset) EXPECT_EQ(0, close(self->child_pidfd1)); if (self->child_pidfd2 >= 0) EXPECT_EQ(0, close(self->child_pidfd2)); - ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED), 0); - ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, WEXITED), 0); - ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, WEXITED), 0); + ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED), 0); + ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0); + ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0); } static int preserve_ns(const int pid, const char *ns) diff --git a/tools/testing/selftests/pidfd/pidfd_test.c b/tools/testing/selftests/pidfd/pidfd_test.c index 9faa686f90e4..e9728e86b4f2 100644 --- a/tools/testing/selftests/pidfd/pidfd_test.c +++ b/tools/testing/selftests/pidfd/pidfd_test.c @@ -497,7 +497,7 @@ static int child_poll_leader_exit_test(void *args) pthread_create(&t2, NULL, test_pidfd_poll_leader_exit_thread, NULL); /* - * glibc exit calls exit_group syscall, so explicity call exit only + * glibc exit calls exit_group syscall, so explicitly call exit only * so that only the group leader exits, leaving the threads alone. */ *child_exit_secs = time(NULL); diff --git a/tools/testing/selftests/pidfd/pidfd_wait.c b/tools/testing/selftests/pidfd/pidfd_wait.c index 0dcb8365ddc3..1e2d49751cde 100644 --- a/tools/testing/selftests/pidfd/pidfd_wait.c +++ b/tools/testing/selftests/pidfd/pidfd_wait.c @@ -26,22 +26,11 @@ #define SKIP(s, ...) XFAIL(s, ##__VA_ARGS__) #endif -static pid_t sys_clone3(struct clone_args *args) -{ - return syscall(__NR_clone3, args, sizeof(struct clone_args)); -} - -static int sys_waitid(int which, pid_t pid, siginfo_t *info, int options, - struct rusage *ru) -{ - return syscall(__NR_waitid, which, pid, info, options, ru); -} - TEST(wait_simple) { int pidfd = -1; pid_t parent_tid = -1; - struct clone_args args = { + struct __clone_args args = { .parent_tid = ptr_to_u64(&parent_tid), .pidfd = ptr_to_u64(&pidfd), .flags = CLONE_PIDFD | CLONE_PARENT_SETTID, @@ -55,7 +44,7 @@ TEST(wait_simple) pidfd = open("/proc/self", O_DIRECTORY | O_RDONLY | O_CLOEXEC); ASSERT_GE(pidfd, 0); - pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL); + pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED); ASSERT_NE(pid, 0); EXPECT_EQ(close(pidfd), 0); pidfd = -1; @@ -63,18 +52,18 @@ TEST(wait_simple) pidfd = open("/dev/null", O_RDONLY | O_CLOEXEC); ASSERT_GE(pidfd, 0); - pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL); + pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED); ASSERT_NE(pid, 0); EXPECT_EQ(close(pidfd), 0); pidfd = -1; - pid = sys_clone3(&args); + pid = sys_clone3(&args, sizeof(args)); ASSERT_GE(pid, 0); if (pid == 0) exit(EXIT_SUCCESS); - pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL); + pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED); ASSERT_GE(pid, 0); ASSERT_EQ(WIFEXITED(info.si_status), true); ASSERT_EQ(WEXITSTATUS(info.si_status), 0); @@ -89,7 +78,7 @@ TEST(wait_states) { int pidfd = -1; pid_t parent_tid = -1; - struct clone_args args = { + struct __clone_args args = { .parent_tid = ptr_to_u64(&parent_tid), .pidfd = ptr_to_u64(&pidfd), .flags = CLONE_PIDFD | CLONE_PARENT_SETTID, @@ -102,7 +91,7 @@ TEST(wait_states) }; ASSERT_EQ(pipe(pfd), 0); - pid = sys_clone3(&args); + pid = sys_clone3(&args, sizeof(args)); ASSERT_GE(pid, 0); if (pid == 0) { @@ -117,28 +106,28 @@ TEST(wait_states) } close(pfd[0]); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_STOPPED); ASSERT_EQ(info.si_pid, parent_tid); ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED), 0); ASSERT_EQ(write(pfd[1], "C", 1), 1); close(pfd[1]); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_CONTINUED); ASSERT_EQ(info.si_pid, parent_tid); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED), 0); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_STOPPED); ASSERT_EQ(info.si_pid, parent_tid); ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGKILL, NULL, 0), 0); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_KILLED); ASSERT_EQ(info.si_pid, parent_tid); @@ -151,7 +140,7 @@ TEST(wait_nonblock) int pidfd; unsigned int flags = 0; pid_t parent_tid = -1; - struct clone_args args = { + struct __clone_args args = { .parent_tid = ptr_to_u64(&parent_tid), .flags = CLONE_PARENT_SETTID, .exit_signal = SIGCHLD, @@ -173,12 +162,12 @@ TEST(wait_nonblock) SKIP(return, "Skipping PIDFD_NONBLOCK test"); } - ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL); + ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED); ASSERT_LT(ret, 0); ASSERT_EQ(errno, ECHILD); EXPECT_EQ(close(pidfd), 0); - pid = sys_clone3(&args); + pid = sys_clone3(&args, sizeof(args)); ASSERT_GE(pid, 0); if (pid == 0) { @@ -201,7 +190,7 @@ TEST(wait_nonblock) * Callers need to see EAGAIN/EWOULDBLOCK with non-blocking pidfd when * child processes exist but none have exited. */ - ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL); + ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED); ASSERT_LT(ret, 0); ASSERT_EQ(errno, EAGAIN); @@ -210,19 +199,19 @@ TEST(wait_nonblock) * WNOHANG raised explicitly when child processes exist but none have * exited. */ - ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG, NULL); + ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG); ASSERT_EQ(ret, 0); ASSERT_EQ(fcntl(pidfd, F_SETFL, (flags & ~O_NONBLOCK)), 0); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_STOPPED); ASSERT_EQ(info.si_pid, parent_tid); ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0); - ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0); + ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0); ASSERT_EQ(info.si_signo, SIGCHLD); ASSERT_EQ(info.si_code, CLD_EXITED); ASSERT_EQ(info.si_pid, parent_tid); diff --git a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c index 580fcac0a09f..b71ef8a493ed 100644 --- a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c +++ b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c @@ -20,7 +20,7 @@ static int test_gettimeofday(void) gettimeofday(&tv_end, NULL); } - timersub(&tv_start, &tv_end, &tv_diff); + timersub(&tv_end, &tv_start, &tv_diff); printf("time = %.6f\n", tv_diff.tv_sec + (tv_diff.tv_usec) * 1e-6); diff --git a/tools/testing/selftests/powerpc/include/pkeys.h b/tools/testing/selftests/powerpc/include/pkeys.h index 51729d9a7111..3a0129467de6 100644 --- a/tools/testing/selftests/powerpc/include/pkeys.h +++ b/tools/testing/selftests/powerpc/include/pkeys.h @@ -35,10 +35,18 @@ #define __NR_pkey_alloc 384 #define __NR_pkey_free 385 +#ifndef NT_PPC_PKEY +#define NT_PPC_PKEY 0x110 +#endif + #define PKEY_BITS_PER_PKEY 2 #define NR_PKEYS 32 #define PKEY_BITS_MASK ((1UL << PKEY_BITS_PER_PKEY) - 1) +#define AMR_BITS_PER_PKEY 2 +#define PKEY_REG_BITS (sizeof(u64) * 8) +#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY)) + inline unsigned long pkeyreg_get(void) { return mfspr(SPRN_AMR); diff --git a/tools/testing/selftests/powerpc/ptrace/core-pkey.c b/tools/testing/selftests/powerpc/ptrace/core-pkey.c index f6da4cb30cd6..f061434af452 100644 --- a/tools/testing/selftests/powerpc/ptrace/core-pkey.c +++ b/tools/testing/selftests/powerpc/ptrace/core-pkey.c @@ -16,26 +16,7 @@ #include <unistd.h> #include "ptrace.h" #include "child.h" - -#ifndef __NR_pkey_alloc -#define __NR_pkey_alloc 384 -#endif - -#ifndef __NR_pkey_free -#define __NR_pkey_free 385 -#endif - -#ifndef NT_PPC_PKEY -#define NT_PPC_PKEY 0x110 -#endif - -#ifndef PKEY_DISABLE_EXECUTE -#define PKEY_DISABLE_EXECUTE 0x4 -#endif - -#define AMR_BITS_PER_PKEY 2 -#define PKEY_REG_BITS (sizeof(u64) * 8) -#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY)) +#include "pkeys.h" #define CORE_FILE_LIMIT (5 * 1024 * 1024) /* 5 MB should be enough */ @@ -61,16 +42,6 @@ struct shared_info { time_t core_time; }; -static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights) -{ - return syscall(__NR_pkey_alloc, flags, init_access_rights); -} - -static int sys_pkey_free(int pkey) -{ - return syscall(__NR_pkey_free, pkey); -} - static int increase_core_file_limit(void) { struct rlimit rlim; diff --git a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c index d89474377f11..fc633014424f 100644 --- a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c +++ b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c @@ -7,26 +7,7 @@ */ #include "ptrace.h" #include "child.h" - -#ifndef __NR_pkey_alloc -#define __NR_pkey_alloc 384 -#endif - -#ifndef __NR_pkey_free -#define __NR_pkey_free 385 -#endif - -#ifndef NT_PPC_PKEY -#define NT_PPC_PKEY 0x110 -#endif - -#ifndef PKEY_DISABLE_EXECUTE -#define PKEY_DISABLE_EXECUTE 0x4 -#endif - -#define AMR_BITS_PER_PKEY 2 -#define PKEY_REG_BITS (sizeof(u64) * 8) -#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY)) +#include "pkeys.h" static const char user_read[] = "[User Read (Running)]"; static const char user_write[] = "[User Write (Running)]"; @@ -61,11 +42,6 @@ struct shared_info { unsigned long invalid_uamor; }; -static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights) -{ - return syscall(__NR_pkey_alloc, flags, init_access_rights); -} - static int child(struct shared_info *info) { unsigned long reg; diff --git a/tools/testing/selftests/powerpc/vphn/test-vphn.c b/tools/testing/selftests/powerpc/vphn/test-vphn.c index 81d3069ffb84..f348f54914a9 100644 --- a/tools/testing/selftests/powerpc/vphn/test-vphn.c +++ b/tools/testing/selftests/powerpc/vphn/test-vphn.c @@ -275,7 +275,7 @@ static struct test { } }, { - /* Parse a 32-bit value split accross two consecutives 64-bit + /* Parse a 32-bit value split across two consecutives 64-bit * input values. */ "vphn: 16-bit value followed by 2 x 32-bit values", diff --git a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh index 134cdef5a6e0..48a8052d5dae 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh @@ -181,10 +181,11 @@ done # Function to check for presence of a file on the specified system. # Complain if the system cannot be reached, and retry after a wait. -# Currently just waits forever if a machine disappears. +# Currently just waits 15 minutes if a machine disappears. # # Usage: checkremotefile system pathname checkremotefile () { + local nsshfails=0 local ret local sleeptime=60 @@ -195,6 +196,11 @@ checkremotefile () { if test "$ret" -eq 255 then echo " ---" ssh failure to $1 checking for file $2, retry after $sleeptime seconds. `date` | tee -a "$oldrun/remote-log" + nsshfails=$((nsshfails+1)) + if ((nsshfails > 15)) + then + return 255 + fi elif test "$ret" -eq 0 then return 0 @@ -268,12 +274,23 @@ echo All batches started. `date` | tee -a "$oldrun/remote-log" for i in $systems do echo " ---" Waiting for $i `date` | tee -a "$oldrun/remote-log" - while checkremotefile "$i" "$resdir/$ds/remote.run" + while : do + checkremotefile "$i" "$resdir/$ds/remote.run" + ret=$? + if test "$ret" -eq 1 + then + echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log" + ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - ) + break; + fi + if test "$ret" -eq 255 + then + echo System $i persistent ssh failure, lost results `date` | tee -a "$oldrun/remote-log" + break; + fi sleep 30 done - echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log" - ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - ) done ( kvm-end-run-stats.sh "$oldrun" "$starttime"; echo $? > $T/exitcode ) | tee -a "$oldrun/remote-log" diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot index 8e50bfd4b710..90318591dae2 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot +++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot @@ -5,3 +5,4 @@ rcutree.gp_cleanup_delay=3 rcutree.kthread_prio=2 threadirqs rcutree.use_softirq=0 +rcutorture.preempt_duration=10 diff --git a/tools/testing/selftests/resctrl/Makefile b/tools/testing/selftests/resctrl/Makefile index f408bd6bfc3d..984534cfbf1b 100644 --- a/tools/testing/selftests/resctrl/Makefile +++ b/tools/testing/selftests/resctrl/Makefile @@ -8,5 +8,6 @@ TEST_GEN_PROGS := resctrl_tests LOCAL_HDRS += $(wildcard *.h) include ../lib.mk +CFLAGS += -I$(top_srcdir)/tools/include $(OUTPUT)/resctrl_tests: $(wildcard *.c) diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c index 3bbf3042fb06..d09e693dc739 100644 --- a/tools/testing/selftests/resctrl/cmt_test.c +++ b/tools/testing/selftests/resctrl/cmt_test.c @@ -169,8 +169,8 @@ static int cmt_run_test(const struct resctrl_test *test, const struct user_param return ret; ret = check_results(¶m, span, n); - if (ret && (get_vendor() == ARCH_INTEL)) - ksft_print_msg("Intel CMT may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n"); + if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support()) + ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n"); return ret; } diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c index 536d9089d2f6..c7e9adc0368f 100644 --- a/tools/testing/selftests/resctrl/mba_test.c +++ b/tools/testing/selftests/resctrl/mba_test.c @@ -201,6 +201,8 @@ static int mba_run_test(const struct resctrl_test *test, const struct user_param return ret; ret = check_results(); + if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support()) + ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n"); return ret; } diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c index 315b2ef3b3bc..84d8bc250539 100644 --- a/tools/testing/selftests/resctrl/mbm_test.c +++ b/tools/testing/selftests/resctrl/mbm_test.c @@ -160,8 +160,8 @@ static int mbm_run_test(const struct resctrl_test *test, const struct user_param return ret; ret = check_results(param.fill_buf ? param.fill_buf->buf_size : 0); - if (ret && (get_vendor() == ARCH_INTEL)) - ksft_print_msg("Intel MBM may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n"); + if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support()) + ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n"); return ret; } diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h index dab1953fc7a0..cd3adfc14969 100644 --- a/tools/testing/selftests/resctrl/resctrl.h +++ b/tools/testing/selftests/resctrl/resctrl.h @@ -11,6 +11,7 @@ #include <signal.h> #include <dirent.h> #include <stdbool.h> +#include <ctype.h> #include <sys/stat.h> #include <sys/ioctl.h> #include <sys/mount.h> @@ -21,6 +22,7 @@ #include <sys/eventfd.h> #include <asm/unistd.h> #include <linux/perf_event.h> +#include <linux/compiler.h> #include "../kselftest.h" #define MB (1024 * 1024) @@ -156,8 +158,11 @@ struct perf_event_read { */ extern volatile int *value_sink; +extern int snc_unreliable; + extern char llc_occup_path[1024]; +int snc_nodes_per_l3_cache(void); int get_vendor(void); bool check_resctrlfs_support(void); int filter_dmesg(void); @@ -198,6 +203,7 @@ void ctrlc_handler(int signum, siginfo_t *info, void *ptr); int signal_handler_register(const struct resctrl_test *test); void signal_handler_unregister(void); unsigned int count_bits(unsigned long n); +int snc_kernel_support(void); void perf_event_attr_initialize(struct perf_event_attr *pea, __u64 config); void perf_event_initialize_read_format(struct perf_event_read *pe_read); diff --git a/tools/testing/selftests/resctrl/resctrl_tests.c b/tools/testing/selftests/resctrl/resctrl_tests.c index 3335af815b21..5154ffd821c4 100644 --- a/tools/testing/selftests/resctrl/resctrl_tests.c +++ b/tools/testing/selftests/resctrl/resctrl_tests.c @@ -118,7 +118,7 @@ static bool test_vendor_specific_check(const struct resctrl_test *test) static void run_single_test(const struct resctrl_test *test, const struct user_params *uparams) { - int ret; + int ret, snc_mode; if (test->disabled) return; @@ -128,8 +128,15 @@ static void run_single_test(const struct resctrl_test *test, const struct user_p return; } + snc_mode = snc_nodes_per_l3_cache(); + ksft_print_msg("Starting %s test ...\n", test->name); + if (snc_mode == 1 && snc_unreliable && get_vendor() == ARCH_INTEL) { + ksft_test_result_skip("SNC detection unreliable due to offline CPUs. Test results may not be accurate if SNC enabled.\n"); + return; + } + if (test_prepare(test)) { ksft_exit_fail_msg("Abnormal failure when preparing for the test\n"); return; diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c index d38d6dd90be4..195f04c4d158 100644 --- a/tools/testing/selftests/resctrl/resctrlfs.c +++ b/tools/testing/selftests/resctrl/resctrlfs.c @@ -13,6 +13,8 @@ #include "resctrl.h" +int snc_unreliable; + static int find_resctrl_mount(char *buffer) { FILE *mounts; @@ -157,6 +159,98 @@ int get_domain_id(const char *resource, int cpu_no, int *domain_id) } /* + * Count number of CPUs in a /sys bitmap + */ +static unsigned int count_sys_bitmap_bits(char *name) +{ + FILE *fp = fopen(name, "r"); + int count = 0, c; + + if (!fp) + return 0; + + while ((c = fgetc(fp)) != EOF) { + if (!isxdigit(c)) + continue; + switch (c) { + case 'f': + count++; + fallthrough; + case '7': case 'b': case 'd': case 'e': + count++; + fallthrough; + case '3': case '5': case '6': case '9': case 'a': case 'c': + count++; + fallthrough; + case '1': case '2': case '4': case '8': + count++; + break; + } + } + fclose(fp); + + return count; +} + +static bool cpus_offline_empty(void) +{ + char offline_cpus_str[64]; + FILE *fp; + + fp = fopen("/sys/devices/system/cpu/offline", "r"); + if (!fp) { + ksft_perror("Could not open /sys/devices/system/cpu/offline"); + return 0; + } + + if (fscanf(fp, "%63s", offline_cpus_str) < 0) { + if (!errno) { + fclose(fp); + return 1; + } + ksft_perror("Could not read /sys/devices/system/cpu/offline"); + } + + fclose(fp); + + return 0; +} + +/* + * Detect SNC by comparing #CPUs in node0 with #CPUs sharing LLC with CPU0. + * If any CPUs are offline declare the detection as unreliable. + */ +int snc_nodes_per_l3_cache(void) +{ + int node_cpus, cache_cpus; + static int snc_mode; + + if (!snc_mode) { + snc_mode = 1; + if (!cpus_offline_empty()) { + ksft_print_msg("Runtime SNC detection unreliable due to offline CPUs.\n"); + ksft_print_msg("Setting SNC mode to disabled.\n"); + snc_unreliable = 1; + return snc_mode; + } + node_cpus = count_sys_bitmap_bits("/sys/devices/system/node/node0/cpumap"); + cache_cpus = count_sys_bitmap_bits("/sys/devices/system/cpu/cpu0/cache/index3/shared_cpu_map"); + + if (!node_cpus || !cache_cpus) { + ksft_print_msg("Could not determine Sub-NUMA Cluster mode.\n"); + snc_unreliable = 1; + return snc_mode; + } + snc_mode = cache_cpus / node_cpus; + + if (snc_mode > 1) + ksft_print_msg("SNC-%d mode discovered.\n", snc_mode); + } + + return snc_mode; +} + +/* * get_cache_size - Get cache size for a specified CPU * @cpu_no: CPU number * @cache_type: Cache level L2/L3 @@ -211,6 +305,17 @@ int get_cache_size(int cpu_no, const char *cache_type, unsigned long *cache_size break; } + /* + * The amount of cache represented by each bit in the masks + * in the schemata file is reduced by a factor equal to SNC + * nodes per L3 cache. + * E.g. on a SNC-2 system with a 100MB L3 cache a test that + * allocates memory from its local SNC node (default behavior + * without using libnuma) will only see 50 MB llc_occupancy + * with a fully populated L3 mask in the schemata file. + */ + if (cache_num == 3) + *cache_size /= snc_nodes_per_l3_cache(); return 0; } @@ -852,3 +957,35 @@ unsigned int count_bits(unsigned long n) return count; } + +/** + * snc_kernel_support - Check for existence of mon_sub_L3_00 file that indicates + * SNC resctrl support on the kernel side. + * + * Return: 0 if not supported, 1 if SNC is disabled or SNC discovery is + * unreliable or SNC is both enabled and supported. + */ +int snc_kernel_support(void) +{ + char node_path[PATH_MAX]; + struct stat statbuf; + int ret; + + ret = snc_nodes_per_l3_cache(); + /* + * If SNC is disabled then its kernel support isn't important. If SNC + * got disabled because the discovery process was unreliable the + * snc_unreliable variable was set. It can be used to verify the SNC + * discovery reliability elsewhere in the selftest. + */ + if (ret == 1) + return ret; + + snprintf(node_path, sizeof(node_path), "%s/%s", RESCTRL_PATH, + "mon_data/mon_L3_00/mon_sub_L3_00"); + + if (!stat(node_path, &statbuf)) + return 1; + + return 0; +} diff --git a/tools/testing/selftests/ring-buffer/map_test.c b/tools/testing/selftests/ring-buffer/map_test.c index d10a847130fb..a58f520f2f41 100644 --- a/tools/testing/selftests/ring-buffer/map_test.c +++ b/tools/testing/selftests/ring-buffer/map_test.c @@ -233,12 +233,18 @@ TEST_F(map, data_mmap) ASSERT_NE(data, MAP_FAILED); munmap(data, data_len); - /* Overflow the available subbufs by 1 */ + /* Offset within ring-buffer bounds, mapping size overflow */ meta_len += desc->meta->subbuf_size * 2; data = mmap(NULL, data_len, PROT_READ, MAP_SHARED, desc->cpu_fd, meta_len); ASSERT_EQ(data, MAP_FAILED); + /* Offset outside ring-buffer bounds */ + data_len = desc->meta->subbuf_size * desc->meta->nr_subbufs; + data = mmap(NULL, data_len, PROT_READ, MAP_SHARED, + desc->cpu_fd, data_len + (desc->meta->subbuf_size * 2)); + ASSERT_EQ(data, MAP_FAILED); + /* Verify meta-page padding */ if (desc->meta->meta_page_size > getpagesize()) { data_len = desc->meta->meta_page_size; diff --git a/tools/testing/selftests/riscv/abi/pointer_masking.c b/tools/testing/selftests/riscv/abi/pointer_masking.c index dee41b7ee3e3..059d2e87eb1f 100644 --- a/tools/testing/selftests/riscv/abi/pointer_masking.c +++ b/tools/testing/selftests/riscv/abi/pointer_masking.c @@ -185,8 +185,20 @@ static void test_fork_exec(void) } } +static bool pwrite_wrapper(int fd, void *buf, size_t count, const char *msg) +{ + int ret = pwrite(fd, buf, count, 0); + + if (ret != count) { + ksft_perror(msg); + return false; + } + return true; +} + static void test_tagged_addr_abi_sysctl(void) { + char *err_pwrite_msg = "failed to write to /proc/sys/abi/tagged_addr_disabled\n"; char value; int fd; @@ -200,14 +212,18 @@ static void test_tagged_addr_abi_sysctl(void) } value = '1'; - pwrite(fd, &value, 1, 0); - ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL, - "sysctl disabled\n"); + if (!pwrite_wrapper(fd, &value, 1, "write '1'")) + ksft_test_result_fail(err_pwrite_msg); + else + ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL, + "sysctl disabled\n"); value = '0'; - pwrite(fd, &value, 1, 0); - ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0, - "sysctl enabled\n"); + if (!pwrite_wrapper(fd, &value, 1, "write '0'")) + ksft_test_result_fail(err_pwrite_msg); + else + ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0, + "sysctl enabled\n"); set_tagged_addr_ctrl(0, false); diff --git a/tools/testing/selftests/riscv/vector/.gitignore b/tools/testing/selftests/riscv/vector/.gitignore index 9ae7964491d5..7d9c87cd0649 100644 --- a/tools/testing/selftests/riscv/vector/.gitignore +++ b/tools/testing/selftests/riscv/vector/.gitignore @@ -1,3 +1,4 @@ vstate_exec_nolibc vstate_prctl -v_initval_nolibc +v_initval +v_exec_initval_nolibc diff --git a/tools/testing/selftests/riscv/vector/Makefile b/tools/testing/selftests/riscv/vector/Makefile index bfff0ff4f3be..6f7497f4e7b3 100644 --- a/tools/testing/selftests/riscv/vector/Makefile +++ b/tools/testing/selftests/riscv/vector/Makefile @@ -2,18 +2,27 @@ # Copyright (C) 2021 ARM Limited # Originally tools/testing/arm64/abi/Makefile -TEST_GEN_PROGS := vstate_prctl v_initval_nolibc -TEST_GEN_PROGS_EXTENDED := vstate_exec_nolibc +TEST_GEN_PROGS := v_initval vstate_prctl +TEST_GEN_PROGS_EXTENDED := vstate_exec_nolibc v_exec_initval_nolibc include ../../lib.mk -$(OUTPUT)/vstate_prctl: vstate_prctl.c ../hwprobe/sys_hwprobe.S +$(OUTPUT)/sys_hwprobe.o: ../hwprobe/sys_hwprobe.S + $(CC) -static -c -o$@ $(CFLAGS) $^ + +$(OUTPUT)/v_helpers.o: v_helpers.c + $(CC) -static -c -o$@ $(CFLAGS) $^ + +$(OUTPUT)/vstate_prctl: vstate_prctl.c $(OUTPUT)/sys_hwprobe.o $(OUTPUT)/v_helpers.o $(CC) -static -o$@ $(CFLAGS) $(LDFLAGS) $^ $(OUTPUT)/vstate_exec_nolibc: vstate_exec_nolibc.c $(CC) -nostdlib -static -include ../../../../include/nolibc/nolibc.h \ -Wall $(CFLAGS) $(LDFLAGS) $^ -o $@ -lgcc -$(OUTPUT)/v_initval_nolibc: v_initval_nolibc.c +$(OUTPUT)/v_initval: v_initval.c $(OUTPUT)/sys_hwprobe.o $(OUTPUT)/v_helpers.o + $(CC) -static -o$@ $(CFLAGS) $(LDFLAGS) $^ + +$(OUTPUT)/v_exec_initval_nolibc: v_exec_initval_nolibc.c $(CC) -nostdlib -static -include ../../../../include/nolibc/nolibc.h \ -Wall $(CFLAGS) $(LDFLAGS) $^ -o $@ -lgcc diff --git a/tools/testing/selftests/riscv/vector/v_exec_initval_nolibc.c b/tools/testing/selftests/riscv/vector/v_exec_initval_nolibc.c new file mode 100644 index 000000000000..35c0812e32de --- /dev/null +++ b/tools/testing/selftests/riscv/vector/v_exec_initval_nolibc.c @@ -0,0 +1,94 @@ +// SPDX-License-Identifier: GPL-2.0-only +/* + * Get values of vector registers as soon as the program starts to test if + * is properly cleaning the values before starting a new program. Vector + * registers are caller saved, so no function calls may happen before reading + * the values. To further ensure consistency, this file is compiled without + * libc and without auto-vectorization. + * + * To be "clean" all values must be either all ones or all zeroes. + */ + +#define __stringify_1(x...) #x +#define __stringify(x...) __stringify_1(x) + +int main(int argc, char **argv) +{ + char prev_value = 0, value; + unsigned long vl; + int first = 1; + + if (argc > 2 && strcmp(argv[2], "x")) + asm volatile ( + // 0 | zimm[10:0] | rs1 | 1 1 1 | rd |1010111| vsetvli + // vsetvli t4, x0, e8, m1, d1 + ".4byte 0b00000000000000000111111011010111\n\t" + "mv %[vl], t4\n\t" + : [vl] "=r" (vl) : : "t4" + ); + else + asm volatile ( + ".option push\n\t" + ".option arch, +v\n\t" + "vsetvli %[vl], x0, e8, m1, ta, ma\n\t" + ".option pop\n\t" + : [vl] "=r" (vl) + ); + +#define CHECK_VECTOR_REGISTER(register) ({ \ + for (int i = 0; i < vl; i++) { \ + asm volatile ( \ + ".option push\n\t" \ + ".option arch, +v\n\t" \ + "vmv.x.s %0, " __stringify(register) "\n\t" \ + "vsrl.vi " __stringify(register) ", " __stringify(register) ", 8\n\t" \ + ".option pop\n\t" \ + : "=r" (value)); \ + if (first) { \ + first = 0; \ + } else if (value != prev_value || !(value == 0x00 || value == 0xff)) { \ + printf("Register " __stringify(register) \ + " values not clean! value: %u\n", value); \ + exit(-1); \ + } \ + prev_value = value; \ + } \ +}) + + CHECK_VECTOR_REGISTER(v0); + CHECK_VECTOR_REGISTER(v1); + CHECK_VECTOR_REGISTER(v2); + CHECK_VECTOR_REGISTER(v3); + CHECK_VECTOR_REGISTER(v4); + CHECK_VECTOR_REGISTER(v5); + CHECK_VECTOR_REGISTER(v6); + CHECK_VECTOR_REGISTER(v7); + CHECK_VECTOR_REGISTER(v8); + CHECK_VECTOR_REGISTER(v9); + CHECK_VECTOR_REGISTER(v10); + CHECK_VECTOR_REGISTER(v11); + CHECK_VECTOR_REGISTER(v12); + CHECK_VECTOR_REGISTER(v13); + CHECK_VECTOR_REGISTER(v14); + CHECK_VECTOR_REGISTER(v15); + CHECK_VECTOR_REGISTER(v16); + CHECK_VECTOR_REGISTER(v17); + CHECK_VECTOR_REGISTER(v18); + CHECK_VECTOR_REGISTER(v19); + CHECK_VECTOR_REGISTER(v20); + CHECK_VECTOR_REGISTER(v21); + CHECK_VECTOR_REGISTER(v22); + CHECK_VECTOR_REGISTER(v23); + CHECK_VECTOR_REGISTER(v24); + CHECK_VECTOR_REGISTER(v25); + CHECK_VECTOR_REGISTER(v26); + CHECK_VECTOR_REGISTER(v27); + CHECK_VECTOR_REGISTER(v28); + CHECK_VECTOR_REGISTER(v29); + CHECK_VECTOR_REGISTER(v30); + CHECK_VECTOR_REGISTER(v31); + +#undef CHECK_VECTOR_REGISTER + + return 0; +} diff --git a/tools/testing/selftests/riscv/vector/v_helpers.c b/tools/testing/selftests/riscv/vector/v_helpers.c new file mode 100644 index 000000000000..01a8799dcb78 --- /dev/null +++ b/tools/testing/selftests/riscv/vector/v_helpers.c @@ -0,0 +1,68 @@ +// SPDX-License-Identifier: GPL-2.0-only + +#include "../hwprobe/hwprobe.h" +#include <asm/vendor/thead.h> +#include <stdbool.h> +#include <stdlib.h> +#include <stdio.h> +#include <unistd.h> +#include <sys/wait.h> + +bool is_xtheadvector_supported(void) +{ + struct riscv_hwprobe pair; + + pair.key = RISCV_HWPROBE_KEY_VENDOR_EXT_THEAD_0; + riscv_hwprobe(&pair, 1, 0, NULL, 0); + return pair.value & RISCV_HWPROBE_VENDOR_EXT_XTHEADVECTOR; +} + +bool is_vector_supported(void) +{ + struct riscv_hwprobe pair; + + pair.key = RISCV_HWPROBE_KEY_IMA_EXT_0; + riscv_hwprobe(&pair, 1, 0, NULL, 0); + return pair.value & RISCV_HWPROBE_EXT_ZVE32X; +} + +int launch_test(char *next_program, int test_inherit, int xtheadvector) +{ + char *exec_argv[4], *exec_envp[1]; + int rc, pid, status; + + pid = fork(); + if (pid < 0) { + printf("fork failed %d", pid); + return -1; + } + + if (!pid) { + exec_argv[0] = next_program; + exec_argv[1] = test_inherit != 0 ? "x" : NULL; + exec_argv[2] = xtheadvector != 0 ? "x" : NULL; + exec_argv[3] = NULL; + exec_envp[0] = NULL; + /* launch the program again to check inherit */ + rc = execve(next_program, exec_argv, exec_envp); + if (rc) { + perror("execve"); + printf("child execve failed %d\n", rc); + exit(-1); + } + } + + rc = waitpid(-1, &status, 0); + if (rc < 0) { + printf("waitpid failed\n"); + return -3; + } + + if ((WIFEXITED(status) && WEXITSTATUS(status) == -1) || + WIFSIGNALED(status)) { + printf("child exited abnormally\n"); + return -4; + } + + return WEXITSTATUS(status); +} diff --git a/tools/testing/selftests/riscv/vector/v_helpers.h b/tools/testing/selftests/riscv/vector/v_helpers.h new file mode 100644 index 000000000000..763cddfe26da --- /dev/null +++ b/tools/testing/selftests/riscv/vector/v_helpers.h @@ -0,0 +1,8 @@ +/* SPDX-License-Identifier: GPL-2.0-only */ +#include <stdbool.h> + +bool is_xtheadvector_supported(void); + +bool is_vector_supported(void); + +int launch_test(char *next_program, int test_inherit, int xtheadvector); diff --git a/tools/testing/selftests/riscv/vector/v_initval.c b/tools/testing/selftests/riscv/vector/v_initval.c new file mode 100644 index 000000000000..be9e1d18ad29 --- /dev/null +++ b/tools/testing/selftests/riscv/vector/v_initval.c @@ -0,0 +1,22 @@ +// SPDX-License-Identifier: GPL-2.0-only + +#include "../../kselftest_harness.h" +#include "v_helpers.h" + +#define NEXT_PROGRAM "./v_exec_initval_nolibc" + +TEST(v_initval) +{ + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } + + ASSERT_EQ(0, launch_test(NEXT_PROGRAM, 0, xtheadvector)); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c b/tools/testing/selftests/riscv/vector/v_initval_nolibc.c deleted file mode 100644 index 1dd94197da30..000000000000 --- a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c +++ /dev/null @@ -1,68 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0-only - -#include "../../kselftest.h" -#define MAX_VSIZE (8192 * 32) - -void dump(char *ptr, int size) -{ - int i = 0; - - for (i = 0; i < size; i++) { - if (i != 0) { - if (i % 16 == 0) - printf("\n"); - else if (i % 8 == 0) - printf(" "); - } - printf("%02x ", ptr[i]); - } - printf("\n"); -} - -int main(void) -{ - int i; - unsigned long vl; - char *datap, *tmp; - - datap = malloc(MAX_VSIZE); - if (!datap) { - ksft_test_result_fail("fail to allocate memory for size = %d\n", MAX_VSIZE); - exit(-1); - } - - tmp = datap; - asm volatile ( - ".option push\n\t" - ".option arch, +v\n\t" - "vsetvli %0, x0, e8, m8, ta, ma\n\t" - "vse8.v v0, (%2)\n\t" - "add %1, %2, %0\n\t" - "vse8.v v8, (%1)\n\t" - "add %1, %1, %0\n\t" - "vse8.v v16, (%1)\n\t" - "add %1, %1, %0\n\t" - "vse8.v v24, (%1)\n\t" - ".option pop\n\t" - : "=&r" (vl), "=r" (tmp) : "r" (datap) : "memory"); - - ksft_print_msg("vl = %lu\n", vl); - - if (datap[0] != 0x00 && datap[0] != 0xff) { - ksft_test_result_fail("v-regesters are not properly initialized\n"); - dump(datap, vl * 4); - exit(-1); - } - - for (i = 1; i < vl * 4; i++) { - if (datap[i] != datap[0]) { - ksft_test_result_fail("detect stale values on v-regesters\n"); - dump(datap, vl * 4); - exit(-2); - } - } - - free(datap); - ksft_exit_pass(); - return 0; -} diff --git a/tools/testing/selftests/riscv/vector/vstate_exec_nolibc.c b/tools/testing/selftests/riscv/vector/vstate_exec_nolibc.c index 1f9969bed235..7b7d6f21acb4 100644 --- a/tools/testing/selftests/riscv/vector/vstate_exec_nolibc.c +++ b/tools/testing/selftests/riscv/vector/vstate_exec_nolibc.c @@ -6,13 +6,16 @@ int main(int argc, char **argv) { - int rc, pid, status, test_inherit = 0; + int rc, pid, status, test_inherit = 0, xtheadvector = 0; long ctrl, ctrl_c; char *exec_argv[2], *exec_envp[2]; - if (argc > 1) + if (argc > 1 && strcmp(argv[1], "x")) test_inherit = 1; + if (argc > 2 && strcmp(argv[2], "x")) + xtheadvector = 1; + ctrl = my_syscall1(__NR_prctl, PR_RISCV_V_GET_CONTROL); if (ctrl < 0) { puts("PR_RISCV_V_GET_CONTROL is not supported\n"); @@ -53,11 +56,14 @@ int main(int argc, char **argv) puts("child's vstate_ctrl not equal to parent's\n"); exit(-1); } - asm volatile (".option push\n\t" - ".option arch, +v\n\t" - "vsetvli x0, x0, e32, m8, ta, ma\n\t" - ".option pop\n\t" - ); + if (xtheadvector) + asm volatile (".4byte 0x00007ed7"); + else + asm volatile (".option push\n\t" + ".option arch, +v\n\t" + "vsetvli x0, x0, e32, m8, ta, ma\n\t" + ".option pop\n\t" + ); exit(ctrl); } } diff --git a/tools/testing/selftests/riscv/vector/vstate_prctl.c b/tools/testing/selftests/riscv/vector/vstate_prctl.c index 895177f6bf4c..62fbb17a0556 100644 --- a/tools/testing/selftests/riscv/vector/vstate_prctl.c +++ b/tools/testing/selftests/riscv/vector/vstate_prctl.c @@ -3,179 +3,244 @@ #include <unistd.h> #include <errno.h> #include <sys/wait.h> +#include <sys/types.h> +#include <stdlib.h> -#include "../hwprobe/hwprobe.h" -#include "../../kselftest.h" +#include "../../kselftest_harness.h" +#include "v_helpers.h" #define NEXT_PROGRAM "./vstate_exec_nolibc" -static int launch_test(int test_inherit) -{ - char *exec_argv[3], *exec_envp[1]; - int rc, pid, status; - - pid = fork(); - if (pid < 0) { - ksft_test_result_fail("fork failed %d", pid); - return -1; - } - if (!pid) { - exec_argv[0] = NEXT_PROGRAM; - exec_argv[1] = test_inherit != 0 ? "x" : NULL; - exec_argv[2] = NULL; - exec_envp[0] = NULL; - /* launch the program again to check inherit */ - rc = execve(NEXT_PROGRAM, exec_argv, exec_envp); - if (rc) { - perror("execve"); - ksft_test_result_fail("child execve failed %d\n", rc); - exit(-1); - } - } - - rc = waitpid(-1, &status, 0); - if (rc < 0) { - ksft_test_result_fail("waitpid failed\n"); - return -3; - } - - if ((WIFEXITED(status) && WEXITSTATUS(status) == -1) || - WIFSIGNALED(status)) { - ksft_test_result_fail("child exited abnormally\n"); - return -4; - } - - return WEXITSTATUS(status); -} - -int test_and_compare_child(long provided, long expected, int inherit) +int test_and_compare_child(long provided, long expected, int inherit, int xtheadvector) { int rc; rc = prctl(PR_RISCV_V_SET_CONTROL, provided); if (rc != 0) { - ksft_test_result_fail("prctl with provided arg %lx failed with code %d\n", - provided, rc); + printf("prctl with provided arg %lx failed with code %d\n", + provided, rc); return -1; } - rc = launch_test(inherit); + rc = launch_test(NEXT_PROGRAM, inherit, xtheadvector); if (rc != expected) { - ksft_test_result_fail("Test failed, check %d != %ld\n", rc, - expected); + printf("Test failed, check %d != %ld\n", rc, expected); return -2; } return 0; } -#define PR_RISCV_V_VSTATE_CTRL_CUR_SHIFT 0 -#define PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT 2 +#define PR_RISCV_V_VSTATE_CTRL_CUR_SHIFT 0 +#define PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT 2 -int main(void) +TEST(get_control_no_v) { - struct riscv_hwprobe pair; - long flag, expected; long rc; - pair.key = RISCV_HWPROBE_KEY_IMA_EXT_0; - rc = riscv_hwprobe(&pair, 1, 0, NULL, 0); - if (rc < 0) { - ksft_test_result_fail("hwprobe() failed with %ld\n", rc); - return -1; - } + if (is_vector_supported() || is_xtheadvector_supported()) + SKIP(return, "Test expects vector to be not supported"); - if (pair.key != RISCV_HWPROBE_KEY_IMA_EXT_0) { - ksft_test_result_fail("hwprobe cannot probe RISCV_HWPROBE_KEY_IMA_EXT_0\n"); - return -2; - } + rc = prctl(PR_RISCV_V_GET_CONTROL); + EXPECT_EQ(-1, rc) + TH_LOG("GET_CONTROL should fail on kernel/hw without ZVE32X"); + EXPECT_EQ(EINVAL, errno) + TH_LOG("GET_CONTROL should fail on kernel/hw without ZVE32X"); +} - if (!(pair.value & RISCV_HWPROBE_EXT_ZVE32X)) { - rc = prctl(PR_RISCV_V_GET_CONTROL); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("GET_CONTROL should fail on kernel/hw without ZVE32X\n"); - return -3; - } - - rc = prctl(PR_RISCV_V_SET_CONTROL, PR_RISCV_V_VSTATE_CTRL_ON); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("SET_CONTROL should fail on kernel/hw without ZVE32X\n"); - return -4; - } - - ksft_test_result_skip("Vector not supported\n"); - return 0; - } +TEST(set_control_no_v) +{ + long rc; + + if (is_vector_supported() || is_xtheadvector_supported()) + SKIP(return, "Test expects vector to be not supported"); + + rc = prctl(PR_RISCV_V_SET_CONTROL, PR_RISCV_V_VSTATE_CTRL_ON); + EXPECT_EQ(-1, rc) + TH_LOG("SET_CONTROL should fail on kernel/hw without ZVE32X"); + EXPECT_EQ(EINVAL, errno) + TH_LOG("SET_CONTROL should fail on kernel/hw without ZVE32X"); +} + +TEST(vstate_on_current) +{ + long flag; + long rc; + + if (!is_vector_supported() && !is_xtheadvector_supported()) + SKIP(return, "Vector not supported"); flag = PR_RISCV_V_VSTATE_CTRL_ON; rc = prctl(PR_RISCV_V_SET_CONTROL, flag); - if (rc != 0) { - ksft_test_result_fail("Enabling V for current should always success\n"); - return -5; - } + EXPECT_EQ(0, rc) TH_LOG("Enabling V for current should always succeed"); +} + +TEST(vstate_off_eperm) +{ + long flag; + long rc; + + if (!is_vector_supported() && !is_xtheadvector_supported()) + SKIP(return, "Vector not supported"); flag = PR_RISCV_V_VSTATE_CTRL_OFF; rc = prctl(PR_RISCV_V_SET_CONTROL, flag); - if (rc != -1 || errno != EPERM) { - ksft_test_result_fail("Disabling current's V alive must fail with EPERM(%d)\n", - errno); - return -5; + EXPECT_EQ(EPERM, errno) + TH_LOG("Disabling V in current thread with V enabled must fail with EPERM(%d)", errno); + EXPECT_EQ(-1, rc) + TH_LOG("Disabling V in current thread with V enabled must fail with EPERM(%d)", errno); +} + +TEST(vstate_on_no_nesting) +{ + long flag; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); } /* Turn on next's vector explicitly and test */ flag = PR_RISCV_V_VSTATE_CTRL_ON << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; - if (test_and_compare_child(flag, PR_RISCV_V_VSTATE_CTRL_ON, 0)) - return -6; + + EXPECT_EQ(0, test_and_compare_child(flag, PR_RISCV_V_VSTATE_CTRL_ON, 0, xtheadvector)); +} + +TEST(vstate_off_nesting) +{ + long flag; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } /* Turn off next's vector explicitly and test */ flag = PR_RISCV_V_VSTATE_CTRL_OFF << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; - if (test_and_compare_child(flag, PR_RISCV_V_VSTATE_CTRL_OFF, 0)) - return -7; + + EXPECT_EQ(0, test_and_compare_child(flag, PR_RISCV_V_VSTATE_CTRL_OFF, 1, xtheadvector)); +} + +TEST(vstate_on_inherit_no_nesting) +{ + long flag, expected; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } + + /* Turn on next's vector explicitly and test no inherit */ + flag = PR_RISCV_V_VSTATE_CTRL_ON << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; + flag |= PR_RISCV_V_VSTATE_CTRL_INHERIT; + expected = flag | PR_RISCV_V_VSTATE_CTRL_ON; + + EXPECT_EQ(0, test_and_compare_child(flag, expected, 0, xtheadvector)); +} + +TEST(vstate_on_inherit) +{ + long flag, expected; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } /* Turn on next's vector explicitly and test inherit */ flag = PR_RISCV_V_VSTATE_CTRL_ON << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; flag |= PR_RISCV_V_VSTATE_CTRL_INHERIT; expected = flag | PR_RISCV_V_VSTATE_CTRL_ON; - if (test_and_compare_child(flag, expected, 0)) - return -8; - if (test_and_compare_child(flag, expected, 1)) - return -9; + EXPECT_EQ(0, test_and_compare_child(flag, expected, 1, xtheadvector)); +} + +TEST(vstate_off_inherit_no_nesting) +{ + long flag, expected; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } + /* Turn off next's vector explicitly and test no inherit */ + flag = PR_RISCV_V_VSTATE_CTRL_OFF << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; + flag |= PR_RISCV_V_VSTATE_CTRL_INHERIT; + expected = flag | PR_RISCV_V_VSTATE_CTRL_OFF; + + EXPECT_EQ(0, test_and_compare_child(flag, expected, 0, xtheadvector)); +} + +TEST(vstate_off_inherit) +{ + long flag, expected; + int xtheadvector = 0; + + if (!is_vector_supported()) { + if (is_xtheadvector_supported()) + xtheadvector = 1; + else + SKIP(return, "Vector not supported"); + } /* Turn off next's vector explicitly and test inherit */ flag = PR_RISCV_V_VSTATE_CTRL_OFF << PR_RISCV_V_VSTATE_CTRL_NEXT_SHIFT; flag |= PR_RISCV_V_VSTATE_CTRL_INHERIT; expected = flag | PR_RISCV_V_VSTATE_CTRL_OFF; - if (test_and_compare_child(flag, expected, 0)) - return -10; - if (test_and_compare_child(flag, expected, 1)) - return -11; + EXPECT_EQ(0, test_and_compare_child(flag, expected, 1, xtheadvector)); +} + +/* arguments should fail with EINVAL */ +TEST(inval_set_control_1) +{ + int rc; + + if (!is_vector_supported() && !is_xtheadvector_supported()) + SKIP(return, "Vector not supported"); - /* arguments should fail with EINVAL */ rc = prctl(PR_RISCV_V_SET_CONTROL, 0xff0); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("Undefined control argument should return EINVAL\n"); - return -12; - } + EXPECT_EQ(-1, rc); + EXPECT_EQ(EINVAL, errno); +} + +/* arguments should fail with EINVAL */ +TEST(inval_set_control_2) +{ + int rc; + + if (!is_vector_supported() && !is_xtheadvector_supported()) + SKIP(return, "Vector not supported"); rc = prctl(PR_RISCV_V_SET_CONTROL, 0x3); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("Undefined control argument should return EINVAL\n"); - return -12; - } + EXPECT_EQ(-1, rc); + EXPECT_EQ(EINVAL, errno); +} - rc = prctl(PR_RISCV_V_SET_CONTROL, 0xc); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("Undefined control argument should return EINVAL\n"); - return -12; - } +/* arguments should fail with EINVAL */ +TEST(inval_set_control_3) +{ + int rc; - rc = prctl(PR_RISCV_V_SET_CONTROL, 0xc); - if (rc != -1 || errno != EINVAL) { - ksft_test_result_fail("Undefined control argument should return EINVAL\n"); - return -12; - } + if (!is_vector_supported() && !is_xtheadvector_supported()) + SKIP(return, "Vector not supported"); - ksft_test_result_pass("tests for riscv_v_vstate_ctrl pass\n"); - ksft_exit_pass(); - return 0; + rc = prctl(PR_RISCV_V_SET_CONTROL, 0xc); + EXPECT_EQ(-1, rc); + EXPECT_EQ(EINVAL, errno); } + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/rseq/param_test.c b/tools/testing/selftests/rseq/param_test.c index 2f37961240ca..05d03e679e06 100644 --- a/tools/testing/selftests/rseq/param_test.c +++ b/tools/testing/selftests/rseq/param_test.c @@ -226,8 +226,32 @@ unsigned int yield_mod_cnt, nr_abort; "addi " INJECT_ASM_REG "," INJECT_ASM_REG ", -1\n\t" \ "bnez " INJECT_ASM_REG ", 222b\n\t" \ "333:\n\t" +#elif defined(__or1k__) +#define RSEQ_INJECT_INPUT \ + , [loop_cnt_1]"m"(loop_cnt[1]) \ + , [loop_cnt_2]"m"(loop_cnt[2]) \ + , [loop_cnt_3]"m"(loop_cnt[3]) \ + , [loop_cnt_4]"m"(loop_cnt[4]) \ + , [loop_cnt_5]"m"(loop_cnt[5]) \ + , [loop_cnt_6]"m"(loop_cnt[6]) +#define INJECT_ASM_REG "r31" + +#define RSEQ_INJECT_CLOBBER \ + , INJECT_ASM_REG + +#define RSEQ_INJECT_ASM(n) \ + "l.lwz " INJECT_ASM_REG ", %[loop_cnt_" #n "]\n\t" \ + "l.sfeqi " INJECT_ASM_REG ", 0\n\t" \ + "l.bf 333f\n\t" \ + " l.nop\n\t" \ + "222:\n\t" \ + "l.addi " INJECT_ASM_REG "," INJECT_ASM_REG ", -1\n\t" \ + "l.sfeqi " INJECT_ASM_REG ", 0\n\t" \ + "l.bf 222f\n\t" \ + " l.nop\n\t" \ + "333:\n\t" #else #error unsupported target #endif diff --git a/tools/testing/selftests/rseq/rseq-or1k-bits.h b/tools/testing/selftests/rseq/rseq-or1k-bits.h new file mode 100644 index 000000000000..15d0e8200cd1 --- /dev/null +++ b/tools/testing/selftests/rseq/rseq-or1k-bits.h @@ -0,0 +1,412 @@ +/* SPDX-License-Identifier: LGPL-2.1 OR MIT */ + +#include "rseq-bits-template.h" + +#if defined(RSEQ_TEMPLATE_MO_RELAXED) && \ + (defined(RSEQ_TEMPLATE_CPU_ID) || defined(RSEQ_TEMPLATE_MM_CID)) + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_cmpeqv_storev)(intptr_t *v, intptr_t expect, intptr_t newv, + int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[cmpfail]") +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error2]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[cmpfail]") + RSEQ_INJECT_ASM(4) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[error2]") +#endif + RSEQ_ASM_OP_FINAL_STORE(v, newv, 3) + RSEQ_INJECT_ASM(5) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [v] "m" (*v), + [expect] "r" (expect), + [newv] "r" (newv) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort, cmpfail +#ifdef RSEQ_COMPARE_TWICE + , error1, error2 +#endif + ); + + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +cmpfail: + return 1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +error2: + rseq_bug("expected value comparison failed"); +#endif +} + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_cmpnev_storeoffp_load)(intptr_t *v, intptr_t expectnot, + off_t voffp, intptr_t *load, int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[cmpfail]") +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error2]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) + RSEQ_ASM_OP_CMPNE(v, expectnot, "%l[cmpfail]") + RSEQ_INJECT_ASM(4) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") + RSEQ_ASM_OP_CMPNE(v, expectnot, "%l[error2]") +#endif + RSEQ_ASM_OP_R_LOAD(v) + RSEQ_ASM_OP_R_STORE(load) + RSEQ_ASM_OP_R_LOAD_OFF(voffp) + RSEQ_ASM_OP_R_FINAL_STORE(v, 3) + RSEQ_INJECT_ASM(5) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [v] "m" (*v), + [expectnot] "r" (expectnot), + [load] "m" (*load), + [voffp] "Ir" (voffp) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort, cmpfail +#ifdef RSEQ_COMPARE_TWICE + , error1, error2 +#endif + ); + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +cmpfail: + return 1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +error2: + rseq_bug("expected value comparison failed"); +#endif +} + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_addv)(intptr_t *v, intptr_t count, int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") +#endif + RSEQ_ASM_OP_R_LOAD(v) + RSEQ_ASM_OP_R_ADD(count) + RSEQ_ASM_OP_R_FINAL_STORE(v, 3) + RSEQ_INJECT_ASM(4) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [v] "m" (*v), + [count] "r" (count) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort +#ifdef RSEQ_COMPARE_TWICE + , error1 +#endif + ); + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +#endif +} + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_cmpeqv_cmpeqv_storev)(intptr_t *v, intptr_t expect, + intptr_t *v2, intptr_t expect2, + intptr_t newv, int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[cmpfail]") +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error2]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error3]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[cmpfail]") + RSEQ_INJECT_ASM(4) + RSEQ_ASM_OP_CMPEQ(v2, expect2, "%l[cmpfail]") + RSEQ_INJECT_ASM(5) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[error2]") + RSEQ_ASM_OP_CMPEQ(v2, expect2, "%l[error3]") +#endif + RSEQ_ASM_OP_FINAL_STORE(v, newv, 3) + RSEQ_INJECT_ASM(6) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [v] "m" (*v), + [expect] "r" (expect), + [v2] "m" (*v2), + [expect2] "r" (expect2), + [newv] "r" (newv) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort, cmpfail +#ifdef RSEQ_COMPARE_TWICE + , error1, error2, error3 +#endif + ); + + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +cmpfail: + return 1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +error2: + rseq_bug("expected value comparison failed"); +error3: + rseq_bug("2nd expected value comparison failed"); +#endif +} + +#define RSEQ_ARCH_HAS_OFFSET_DEREF_ADDV + +/* + * pval = *(ptr+off) + * *pval += inc; + */ +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_offset_deref_addv)(intptr_t *ptr, off_t off, intptr_t inc, + int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") +#endif + RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, inc, 3) + RSEQ_INJECT_ASM(4) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [ptr] "r" (ptr), + [off] "r" (off), + [inc] "r" (inc) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort +#ifdef RSEQ_COMPARE_TWICE + , error1 +#endif + ); + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +#endif +} + +#endif /* #if defined(RSEQ_TEMPLATE_MO_RELAXED) && + (defined(RSEQ_TEMPLATE_CPU_ID) || defined(RSEQ_TEMPLATE_MM_CID)) */ + +#if (defined(RSEQ_TEMPLATE_MO_RELAXED) || defined(RSEQ_TEMPLATE_MO_RELEASE)) && \ + (defined(RSEQ_TEMPLATE_CPU_ID) || defined(RSEQ_TEMPLATE_MM_CID)) + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_cmpeqv_trystorev_storev)(intptr_t *v, intptr_t expect, + intptr_t *v2, intptr_t newv2, + intptr_t newv, int cpu) +{ + RSEQ_INJECT_C(9) + + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[cmpfail]") +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error2]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[cmpfail]") + RSEQ_INJECT_ASM(4) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[error2]") +#endif + RSEQ_ASM_OP_STORE(v2, newv2) + RSEQ_INJECT_ASM(5) +#ifdef RSEQ_TEMPLATE_MO_RELEASE + RSEQ_ASM_OP_FINAL_STORE_RELEASE(v, newv, 3) +#else + RSEQ_ASM_OP_FINAL_STORE(v, newv, 3) +#endif + RSEQ_INJECT_ASM(6) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [expect] "r" (expect), + [v] "m" (*v), + [newv] "r" (newv), + [v2] "m" (*v2), + [newv2] "r" (newv2) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1 + RSEQ_INJECT_CLOBBER + : abort, cmpfail +#ifdef RSEQ_COMPARE_TWICE + , error1, error2 +#endif + ); + + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +cmpfail: + return 1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +error2: + rseq_bug("expected value comparison failed"); +#endif +} + +static inline __always_inline +int RSEQ_TEMPLATE_IDENTIFIER(rseq_cmpeqv_trymemcpy_storev)(intptr_t *v, intptr_t expect, + void *dst, void *src, size_t len, + intptr_t newv, int cpu) +{ + RSEQ_INJECT_C(9) + __asm__ __volatile__ goto(RSEQ_ASM_DEFINE_TABLE(1, 2f, 3f, 4f) + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[cmpfail]") +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error1]") + RSEQ_ASM_DEFINE_EXIT_POINT(2f, "%l[error2]") +#endif + RSEQ_ASM_STORE_RSEQ_CS(2, 1b, rseq_cs) + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, 4f) + RSEQ_INJECT_ASM(3) + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[cmpfail]") + RSEQ_INJECT_ASM(4) +#ifdef RSEQ_COMPARE_TWICE + RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") + RSEQ_ASM_OP_CMPEQ(v, expect, "%l[error2]") +#endif + RSEQ_ASM_OP_R_BAD_MEMCPY(dst, src, len) + RSEQ_INJECT_ASM(5) +#ifdef RSEQ_TEMPLATE_MO_RELEASE + RSEQ_ASM_OP_FINAL_STORE_RELEASE(v, newv, 3) +#else + RSEQ_ASM_OP_FINAL_STORE(v, newv, 3) +#endif + RSEQ_INJECT_ASM(6) + RSEQ_ASM_DEFINE_ABORT(4, abort) + : /* gcc asm goto does not allow outputs */ + : [cpu_id] "r" (cpu), + [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), + [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), + [expect] "r" (expect), + [v] "m" (*v), + [newv] "r" (newv), + [dst] "r" (dst), + [src] "r" (src), + [len] "r" (len) + RSEQ_INJECT_INPUT + : "memory", RSEQ_ASM_TMP_REG_1, RSEQ_ASM_TMP_REG_2, + RSEQ_ASM_TMP_REG_3, RSEQ_ASM_TMP_REG_4 + RSEQ_INJECT_CLOBBER + : abort, cmpfail +#ifdef RSEQ_COMPARE_TWICE + , error1, error2 +#endif + ); + + return 0; +abort: + RSEQ_INJECT_FAILED + return -1; +cmpfail: + return 1; +#ifdef RSEQ_COMPARE_TWICE +error1: + rseq_bug("cpu_id comparison failed"); +error2: + rseq_bug("expected value comparison failed"); +#endif +} + +#endif /* #if (defined(RSEQ_TEMPLATE_MO_RELAXED) || defined(RSEQ_TEMPLATE_MO_RELEASE)) && + (defined(RSEQ_TEMPLATE_CPU_ID) || defined(RSEQ_TEMPLATE_MM_CID)) */ + +#include "rseq-bits-reset.h" diff --git a/tools/testing/selftests/rseq/rseq-or1k-thread-pointer.h b/tools/testing/selftests/rseq/rseq-or1k-thread-pointer.h new file mode 100644 index 000000000000..cda740f7aff3 --- /dev/null +++ b/tools/testing/selftests/rseq/rseq-or1k-thread-pointer.h @@ -0,0 +1,13 @@ +/* SPDX-License-Identifier: LGPL-2.1-only OR MIT */ +#ifndef _RSEQ_OR1K_THREAD_POINTER +#define _RSEQ_OR1K_THREAD_POINTER + +static inline void *rseq_thread_pointer(void) +{ + void *__thread_register; + + __asm__ ("l.or %0, r10, r0" : "=r" (__thread_register)); + return __thread_register; +} + +#endif diff --git a/tools/testing/selftests/rseq/rseq-or1k.h b/tools/testing/selftests/rseq/rseq-or1k.h new file mode 100644 index 000000000000..9e78eebdf79a --- /dev/null +++ b/tools/testing/selftests/rseq/rseq-or1k.h @@ -0,0 +1,181 @@ +/* SPDX-License-Identifier: LGPL-2.1 OR MIT */ + +/* + * Select the instruction "l.nop 0x35" as the RSEQ_SIG. + */ +#define RSEQ_SIG 0x15000035 + +#define rseq_smp_mb() __asm__ __volatile__ ("l.msync" ::: "memory") +#define rseq_smp_rmb() rseq_smp_mb() +#define rseq_smp_wmb() rseq_smp_mb() +#define RSEQ_ASM_TMP_REG_1 "r31" +#define RSEQ_ASM_TMP_REG_2 "r29" +#define RSEQ_ASM_TMP_REG_3 "r27" +#define RSEQ_ASM_TMP_REG_4 "r25" + +#define rseq_smp_load_acquire(p) \ +__extension__ ({ \ + rseq_unqual_scalar_typeof(*(p)) ____p1 = RSEQ_READ_ONCE(*(p)); \ + rseq_smp_mb(); \ + ____p1; \ +}) + +#define rseq_smp_acquire__after_ctrl_dep() rseq_smp_rmb() + +#define rseq_smp_store_release(p, v) \ +do { \ + rseq_smp_mb(); \ + RSEQ_WRITE_ONCE(*(p), v); \ +} while (0) + +#define __RSEQ_ASM_DEFINE_TABLE(label, version, flags, start_ip, \ + post_commit_offset, abort_ip) \ + ".pushsection __rseq_cs, \"aw\"\n" \ + ".balign 32\n" \ + __rseq_str(label) ":\n" \ + ".long " __rseq_str(version) ", " __rseq_str(flags) "\n" \ + ".long 0x0, " __rseq_str(start_ip) ", " \ + "0x0, " __rseq_str(post_commit_offset) ", " \ + "0x0, " __rseq_str(abort_ip) "\n" \ + ".popsection\n\t" \ + ".pushsection __rseq_cs_ptr_array, \"aw\"\n" \ + ".long 0x0, " __rseq_str(label) "b\n" \ + ".popsection\n" + +#define RSEQ_ASM_DEFINE_TABLE(label, start_ip, post_commit_ip, abort_ip) \ + __RSEQ_ASM_DEFINE_TABLE(label, 0x0, 0x0, start_ip, \ + ((post_commit_ip) - (start_ip)), abort_ip) + +/* + * Exit points of a rseq critical section consist of all instructions outside + * of the critical section where a critical section can either branch to or + * reach through the normal course of its execution. The abort IP and the + * post-commit IP are already part of the __rseq_cs section and should not be + * explicitly defined as additional exit points. Knowing all exit points is + * useful to assist debuggers stepping over the critical section. + */ +#define RSEQ_ASM_DEFINE_EXIT_POINT(start_ip, exit_ip) \ + ".pushsection __rseq_exit_point_array, \"aw\"\n" \ + ".long 0x0, " __rseq_str(start_ip) ", 0x0, " __rseq_str(exit_ip) "\n" \ + ".popsection\n" + +#define RSEQ_ASM_STORE_RSEQ_CS(label, cs_label, rseq_cs) \ + RSEQ_INJECT_ASM(1) \ + "l.movhi " RSEQ_ASM_TMP_REG_1 ", hi(" __rseq_str(cs_label) ")\n"\ + "l.ori " RSEQ_ASM_TMP_REG_1 ", " RSEQ_ASM_TMP_REG_1 \ + ", lo(" __rseq_str(cs_label) ")\n"\ + "l.sw %[" __rseq_str(rseq_cs) "], " RSEQ_ASM_TMP_REG_1 "\n" \ + __rseq_str(label) ":\n" + +#define RSEQ_ASM_DEFINE_ABORT(label, abort_label) \ + "l.j 222f\n" \ + " l.nop\n" \ + ".balign 4\n" \ + ".long " __rseq_str(RSEQ_SIG) "\n" \ + __rseq_str(label) ":\n" \ + "l.j %l[" __rseq_str(abort_label) "]\n" \ + " l.nop\n" \ + "222:\n" + +#define RSEQ_ASM_OP_STORE(var, value) \ + "l.sw %[" __rseq_str(var) "], %[" __rseq_str(value) "]\n" + +#define RSEQ_ASM_OP_CMPEQ(var, expect, label) \ + "l.lwz " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(var) "]\n" \ + "l.sfne " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(expect) "]\n" \ + "l.bf " __rseq_str(label) "\n" \ + " l.nop\n" + +#define RSEQ_ASM_OP_CMPNE(var, expect, label) \ + "l.lwz " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(var) "]\n" \ + "l.sfeq " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(expect) "]\n" \ + "l.bf " __rseq_str(label) "\n" \ + " l.nop\n" + +#define RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, label) \ + RSEQ_INJECT_ASM(2) \ + RSEQ_ASM_OP_CMPEQ(current_cpu_id, cpu_id, label) + +#define RSEQ_ASM_OP_R_LOAD(var) \ + "l.lwz " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(var) "]\n" + +#define RSEQ_ASM_OP_R_STORE(var) \ + "l.sw %[" __rseq_str(var) "], " RSEQ_ASM_TMP_REG_1 "\n" + +#define RSEQ_ASM_OP_R_LOAD_OFF(offset) \ + "l.lwz " RSEQ_ASM_TMP_REG_1 ", " \ + "%[" __rseq_str(offset) "](" RSEQ_ASM_TMP_REG_1 ")\n" + +#define RSEQ_ASM_OP_R_ADD(count) \ + "l.add " RSEQ_ASM_TMP_REG_1 ", " RSEQ_ASM_TMP_REG_1 \ + ", %[" __rseq_str(count) "]\n" + +#define RSEQ_ASM_OP_FINAL_STORE(var, value, post_commit_label) \ + RSEQ_ASM_OP_STORE(var, value) \ + __rseq_str(post_commit_label) ":\n" + +#define RSEQ_ASM_OP_FINAL_STORE_RELEASE(var, value, post_commit_label) \ + "l.msync\n" \ + RSEQ_ASM_OP_STORE(var, value) \ + __rseq_str(post_commit_label) ":\n" + +#define RSEQ_ASM_OP_R_FINAL_STORE(var, post_commit_label) \ + "l.sw %[" __rseq_str(var) "], " RSEQ_ASM_TMP_REG_1 "\n" \ + __rseq_str(post_commit_label) ":\n" + +#define RSEQ_ASM_OP_R_BAD_MEMCPY(dst, src, len) \ + "l.sfeq %[" __rseq_str(len) "], r0\n" \ + "l.bf 333f\n" \ + " l.nop\n" \ + "l.ori " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(len) "], 0\n" \ + "l.ori " RSEQ_ASM_TMP_REG_2 ", %[" __rseq_str(src) "], 0\n" \ + "l.ori " RSEQ_ASM_TMP_REG_3 ", %[" __rseq_str(dst) "], 0\n" \ + "222:\n" \ + "l.lbz " RSEQ_ASM_TMP_REG_4 ", 0(" RSEQ_ASM_TMP_REG_2 ")\n" \ + "l.sb 0(" RSEQ_ASM_TMP_REG_3 "), " RSEQ_ASM_TMP_REG_4 "\n" \ + "l.addi " RSEQ_ASM_TMP_REG_1 ", " RSEQ_ASM_TMP_REG_1 ", -1\n" \ + "l.addi " RSEQ_ASM_TMP_REG_2 ", " RSEQ_ASM_TMP_REG_2 ", 1\n" \ + "l.addi " RSEQ_ASM_TMP_REG_3 ", " RSEQ_ASM_TMP_REG_3 ", 1\n" \ + "l.sfne " RSEQ_ASM_TMP_REG_1 ", r0\n" \ + "l.bf 222b\n" \ + " l.nop\n" \ + "333:\n" + +#define RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, inc, post_commit_label) \ + "l.ori " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(ptr) "], 0\n" \ + RSEQ_ASM_OP_R_ADD(off) \ + "l.lwz " RSEQ_ASM_TMP_REG_1 ", 0(" RSEQ_ASM_TMP_REG_1 ")\n" \ + RSEQ_ASM_OP_R_ADD(inc) \ + __rseq_str(post_commit_label) ":\n" + +/* Per-cpu-id indexing. */ + +#define RSEQ_TEMPLATE_CPU_ID +#define RSEQ_TEMPLATE_MO_RELAXED +#include "rseq-or1k-bits.h" +#undef RSEQ_TEMPLATE_MO_RELAXED + +#define RSEQ_TEMPLATE_MO_RELEASE +#include "rseq-or1k-bits.h" +#undef RSEQ_TEMPLATE_MO_RELEASE +#undef RSEQ_TEMPLATE_CPU_ID + +/* Per-mm-cid indexing. */ + +#define RSEQ_TEMPLATE_MM_CID +#define RSEQ_TEMPLATE_MO_RELAXED +#include "rseq-or1k-bits.h" +#undef RSEQ_TEMPLATE_MO_RELAXED + +#define RSEQ_TEMPLATE_MO_RELEASE +#include "rseq-or1k-bits.h" +#undef RSEQ_TEMPLATE_MO_RELEASE +#undef RSEQ_TEMPLATE_MM_CID + +/* APIs which are not based on cpu ids. */ + +#define RSEQ_TEMPLATE_CPU_ID_NONE +#define RSEQ_TEMPLATE_MO_RELAXED +#include "rseq-or1k-bits.h" +#undef RSEQ_TEMPLATE_MO_RELAXED +#undef RSEQ_TEMPLATE_CPU_ID_NONE diff --git a/tools/testing/selftests/rseq/rseq-riscv-bits.h b/tools/testing/selftests/rseq/rseq-riscv-bits.h index de31a0143139..f02f411d550d 100644 --- a/tools/testing/selftests/rseq/rseq-riscv-bits.h +++ b/tools/testing/selftests/rseq/rseq-riscv-bits.h @@ -243,7 +243,7 @@ int RSEQ_TEMPLATE_IDENTIFIER(rseq_offset_deref_addv)(intptr_t *ptr, off_t off, i #ifdef RSEQ_COMPARE_TWICE RSEQ_ASM_CMP_CPU_ID(cpu_id, current_cpu_id, "%l[error1]") #endif - RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, 3) + RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, inc, 3) RSEQ_INJECT_ASM(4) RSEQ_ASM_DEFINE_ABORT(4, abort) : /* gcc asm goto does not allow outputs */ @@ -251,8 +251,8 @@ int RSEQ_TEMPLATE_IDENTIFIER(rseq_offset_deref_addv)(intptr_t *ptr, off_t off, i [current_cpu_id] "m" (rseq_get_abi()->RSEQ_TEMPLATE_CPU_ID_FIELD), [rseq_cs] "m" (rseq_get_abi()->rseq_cs.arch.ptr), [ptr] "r" (ptr), - [off] "er" (off), - [inc] "er" (inc) + [off] "r" (off), + [inc] "r" (inc) RSEQ_INJECT_INPUT : "memory", RSEQ_ASM_TMP_REG_1 RSEQ_INJECT_CLOBBER diff --git a/tools/testing/selftests/rseq/rseq-riscv.h b/tools/testing/selftests/rseq/rseq-riscv.h index 37e598d0a365..67d544aaa9a3 100644 --- a/tools/testing/selftests/rseq/rseq-riscv.h +++ b/tools/testing/selftests/rseq/rseq-riscv.h @@ -158,7 +158,7 @@ do { \ "bnez " RSEQ_ASM_TMP_REG_1 ", 222b\n" \ "333:\n" -#define RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, post_commit_label) \ +#define RSEQ_ASM_OP_R_DEREF_ADDV(ptr, off, inc, post_commit_label) \ "mv " RSEQ_ASM_TMP_REG_1 ", %[" __rseq_str(ptr) "]\n" \ RSEQ_ASM_OP_R_ADD(off) \ REG_L RSEQ_ASM_TMP_REG_1 ", 0(" RSEQ_ASM_TMP_REG_1 ")\n" \ diff --git a/tools/testing/selftests/rseq/rseq-thread-pointer.h b/tools/testing/selftests/rseq/rseq-thread-pointer.h index 977c25d758b2..3d5019307a1b 100644 --- a/tools/testing/selftests/rseq/rseq-thread-pointer.h +++ b/tools/testing/selftests/rseq/rseq-thread-pointer.h @@ -12,6 +12,8 @@ #include "rseq-x86-thread-pointer.h" #elif defined(__PPC__) #include "rseq-ppc-thread-pointer.h" +#elif defined(__or1k__) +#include "rseq-or1k-thread-pointer.h" #else #include "rseq-generic-thread-pointer.h" #endif diff --git a/tools/testing/selftests/rseq/rseq.c b/tools/testing/selftests/rseq/rseq.c index 5b9772cdf265..f6156790c3b4 100644 --- a/tools/testing/selftests/rseq/rseq.c +++ b/tools/testing/selftests/rseq/rseq.c @@ -61,7 +61,6 @@ unsigned int rseq_size = -1U; unsigned int rseq_flags; static int rseq_ownership; -static int rseq_reg_success; /* At least one rseq registration has succeded. */ /* Allocate a large area for the TLS. */ #define RSEQ_THREAD_AREA_ALLOC_SIZE 1024 @@ -152,14 +151,27 @@ int rseq_register_current_thread(void) } rc = sys_rseq(&__rseq_abi, get_rseq_min_alloc_size(), 0, RSEQ_SIG); if (rc) { - if (RSEQ_READ_ONCE(rseq_reg_success)) { + /* + * After at least one thread has registered successfully + * (rseq_size > 0), the registration of other threads should + * never fail. + */ + if (RSEQ_READ_ONCE(rseq_size) > 0) { /* Incoherent success/failure within process. */ abort(); } return -1; } assert(rseq_current_cpu_raw() >= 0); - RSEQ_WRITE_ONCE(rseq_reg_success, 1); + + /* + * The first thread to register sets the rseq_size to mimic the libc + * behavior. + */ + if (RSEQ_READ_ONCE(rseq_size) == 0) { + RSEQ_WRITE_ONCE(rseq_size, get_rseq_kernel_feature_size()); + } + return 0; } @@ -235,12 +247,18 @@ void rseq_init(void) return; } rseq_ownership = 1; - if (!rseq_available()) { - rseq_size = 0; - return; - } + + /* Calculate the offset of the rseq area from the thread pointer. */ rseq_offset = (void *)&__rseq_abi - rseq_thread_pointer(); + + /* rseq flags are deprecated, always set to 0. */ rseq_flags = 0; + + /* + * Set the size to 0 until at least one thread registers to mimic the + * libc behavior. + */ + rseq_size = 0; } static __attribute__((destructor)) diff --git a/tools/testing/selftests/rseq/rseq.h b/tools/testing/selftests/rseq/rseq.h index 4e217b620e0c..ba424ce80a71 100644 --- a/tools/testing/selftests/rseq/rseq.h +++ b/tools/testing/selftests/rseq/rseq.h @@ -60,7 +60,14 @@ extern ptrdiff_t rseq_offset; /* - * Size of the registered rseq area. 0 if the registration was + * The rseq ABI is composed of extensible feature fields. The extensions + * are done by appending additional fields at the end of the structure. + * The rseq_size defines the size of the active feature set which can be + * used by the application for the current rseq registration. Features + * starting at offset >= rseq_size are inactive and should not be used. + * + * The rseq_size is the intersection between the available allocation + * size for the rseq area and the feature size supported by the kernel. * unsuccessful. */ extern unsigned int rseq_size; @@ -122,6 +129,8 @@ static inline struct rseq_abi *rseq_get_abi(void) #include <rseq-s390.h> #elif defined(__riscv) #include <rseq-riscv.h> +#elif defined(__or1k__) +#include <rseq-or1k.h> #else #error unsupported target #endif diff --git a/tools/testing/selftests/run_kselftest.sh b/tools/testing/selftests/run_kselftest.sh index a28c1416cb89..50e03eefe7ac 100755 --- a/tools/testing/selftests/run_kselftest.sh +++ b/tools/testing/selftests/run_kselftest.sh @@ -21,7 +21,7 @@ usage() cat <<EOF Usage: $0 [OPTIONS] -s | --summary Print summary with detailed log in output.log (conflict with -p) - -p | --per_test_log Print test log in /tmp with each test name (conflict with -s) + -p | --per-test-log Print test log in /tmp with each test name (conflict with -s) -t | --test COLLECTION:TEST Run TEST from COLLECTION -c | --collection COLLECTION Run all tests from COLLECTION -l | --list List the available collection:test entries diff --git a/tools/testing/selftests/sched_ext/create_dsq.c b/tools/testing/selftests/sched_ext/create_dsq.c index fa946d9146d4..d67431f57ac6 100644 --- a/tools/testing/selftests/sched_ext/create_dsq.c +++ b/tools/testing/selftests/sched_ext/create_dsq.c @@ -14,11 +14,11 @@ static enum scx_test_status setup(void **ctx) { struct create_dsq *skel; - skel = create_dsq__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = create_dsq__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(create_dsq__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c index 37d9bf6fb745..6f4c3f5a1c5d 100644 --- a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c +++ b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c @@ -20,7 +20,7 @@ s32 BPF_STRUCT_OPS(ddsp_bogus_dsq_fail_select_cpu, struct task_struct *p, * If we dispatch to a bogus DSQ that will fall back to the * builtin global DSQ, we fail gracefully. */ - scx_bpf_dispatch_vtime(p, 0xcafef00d, SCX_SLICE_DFL, + scx_bpf_dsq_insert_vtime(p, 0xcafef00d, SCX_SLICE_DFL, p->scx.dsq_vtime, 0); return cpu; } diff --git a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.c b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.c index e65d22f23f3b..b6d13496b24e 100644 --- a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.c +++ b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.c @@ -15,8 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct ddsp_bogus_dsq_fail *skel; - skel = ddsp_bogus_dsq_fail__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = ddsp_bogus_dsq_fail__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(ddsp_bogus_dsq_fail__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c index dffc97d9cdf1..e4a55027778f 100644 --- a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c +++ b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c @@ -17,8 +17,8 @@ s32 BPF_STRUCT_OPS(ddsp_vtimelocal_fail_select_cpu, struct task_struct *p, if (cpu >= 0) { /* Shouldn't be allowed to vtime dispatch to a builtin DSQ. */ - scx_bpf_dispatch_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL, - p->scx.dsq_vtime, 0); + scx_bpf_dsq_insert_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL, + p->scx.dsq_vtime, 0); return cpu; } diff --git a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.c b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.c index abafee587cd6..af9ce4ee8baa 100644 --- a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.c +++ b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.c @@ -14,8 +14,11 @@ static enum scx_test_status setup(void **ctx) { struct ddsp_vtimelocal_fail *skel; - skel = ddsp_vtimelocal_fail__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = ddsp_vtimelocal_fail__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(ddsp_vtimelocal_fail__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c index 6a7db1502c29..c02b2aa6fc64 100644 --- a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c +++ b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c @@ -43,9 +43,12 @@ void BPF_STRUCT_OPS(dsp_local_on_dispatch, s32 cpu, struct task_struct *prev) if (!p) return; - target = bpf_get_prandom_u32() % nr_cpus; + if (p->nr_cpus_allowed == nr_cpus && !is_migration_disabled(p)) + target = bpf_get_prandom_u32() % nr_cpus; + else + target = scx_bpf_task_cpu(p); - scx_bpf_dispatch(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0); + scx_bpf_dsq_insert(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0); bpf_task_release(p); } diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.c b/tools/testing/selftests/sched_ext/dsp_local_on.c index 472851b56854..e1f2ce4abfe6 100644 --- a/tools/testing/selftests/sched_ext/dsp_local_on.c +++ b/tools/testing/selftests/sched_ext/dsp_local_on.c @@ -15,6 +15,7 @@ static enum scx_test_status setup(void **ctx) skel = dsp_local_on__open(); SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); skel->rodata->nr_cpus = libbpf_num_possible_cpus(); SCX_FAIL_IF(dsp_local_on__load(skel), "Failed to load skel"); @@ -34,9 +35,10 @@ static enum scx_test_status run(void *ctx) /* Just sleeping is fine, plenty of scheduling events happening */ sleep(1); - SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_ERROR)); bpf_link__destroy(link); + SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_UNREG)); + return SCX_TEST_PASS; } @@ -50,7 +52,7 @@ static void cleanup(void *ctx) struct scx_test dsp_local_on = { .name = "dsp_local_on", .description = "Verify we can directly dispatch tasks to a local DSQs " - "from osp.dispatch()", + "from ops.dispatch()", .setup = setup, .run = run, .cleanup = cleanup, diff --git a/tools/testing/selftests/sched_ext/enq_last_no_enq_fails.c b/tools/testing/selftests/sched_ext/enq_last_no_enq_fails.c index 73e679953e27..d3387ae03679 100644 --- a/tools/testing/selftests/sched_ext/enq_last_no_enq_fails.c +++ b/tools/testing/selftests/sched_ext/enq_last_no_enq_fails.c @@ -15,11 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct enq_last_no_enq_fails *skel; - skel = enq_last_no_enq_fails__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = enq_last_no_enq_fails__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(enq_last_no_enq_fails__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c index 1efb50d61040..a7cf868d5e31 100644 --- a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c +++ b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c @@ -31,7 +31,7 @@ void BPF_STRUCT_OPS(enq_select_cpu_fails_enqueue, struct task_struct *p, /* Can only call from ops.select_cpu() */ scx_bpf_select_cpu_dfl(p, 0, 0, &found); - scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags); + scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags); } SEC(".struct_ops.link") diff --git a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.c b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.c index dd1350e5f002..a80e3a3b3698 100644 --- a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.c +++ b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.c @@ -15,11 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct enq_select_cpu_fails *skel; - skel = enq_select_cpu_fails__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = enq_select_cpu_fails__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(enq_select_cpu_fails__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/exit.bpf.c b/tools/testing/selftests/sched_ext/exit.bpf.c index d75d4faf07f6..4bc36182d3ff 100644 --- a/tools/testing/selftests/sched_ext/exit.bpf.c +++ b/tools/testing/selftests/sched_ext/exit.bpf.c @@ -33,7 +33,7 @@ void BPF_STRUCT_OPS(exit_enqueue, struct task_struct *p, u64 enq_flags) if (exit_point == EXIT_ENQUEUE) EXIT_CLEANLY(); - scx_bpf_dispatch(p, DSQ_ID, SCX_SLICE_DFL, enq_flags); + scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags); } void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p) @@ -41,7 +41,7 @@ void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p) if (exit_point == EXIT_DISPATCH) EXIT_CLEANLY(); - scx_bpf_consume(DSQ_ID); + scx_bpf_dsq_move_to_local(DSQ_ID); } void BPF_STRUCT_OPS(exit_enable, struct task_struct *p) diff --git a/tools/testing/selftests/sched_ext/exit.c b/tools/testing/selftests/sched_ext/exit.c index 31bcd06e21cd..9451782689de 100644 --- a/tools/testing/selftests/sched_ext/exit.c +++ b/tools/testing/selftests/sched_ext/exit.c @@ -23,6 +23,7 @@ static enum scx_test_status run(void *ctx) char buf[16]; skel = exit__open(); + SCX_ENUM_INIT(skel); skel->rodata->exit_point = tc; exit__load(skel); link = bpf_map__attach_struct_ops(skel->maps.exit_ops); diff --git a/tools/testing/selftests/sched_ext/hotplug.c b/tools/testing/selftests/sched_ext/hotplug.c index 87bf220b1bce..1c9ceb661c43 100644 --- a/tools/testing/selftests/sched_ext/hotplug.c +++ b/tools/testing/selftests/sched_ext/hotplug.c @@ -49,8 +49,10 @@ static enum scx_test_status test_hotplug(bool onlining, bool cbs_defined) SCX_ASSERT(is_cpu_online()); - skel = hotplug__open_and_load(); - SCX_ASSERT(skel); + skel = hotplug__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(hotplug__load(skel), "Failed to load skel"); /* Testing the offline -> online path, so go offline before starting */ if (onlining) diff --git a/tools/testing/selftests/sched_ext/init_enable_count.c b/tools/testing/selftests/sched_ext/init_enable_count.c index 97d45f1e5597..eddf9e0e26e7 100644 --- a/tools/testing/selftests/sched_ext/init_enable_count.c +++ b/tools/testing/selftests/sched_ext/init_enable_count.c @@ -15,22 +15,6 @@ #define SCHED_EXT 7 -static struct init_enable_count * -open_load_prog(bool global) -{ - struct init_enable_count *skel; - - skel = init_enable_count__open(); - SCX_BUG_ON(!skel, "Failed to open skel"); - - if (!global) - skel->struct_ops.init_enable_count_ops->flags |= SCX_OPS_SWITCH_PARTIAL; - - SCX_BUG_ON(init_enable_count__load(skel), "Failed to load skel"); - - return skel; -} - static enum scx_test_status run_test(bool global) { struct init_enable_count *skel; @@ -40,7 +24,14 @@ static enum scx_test_status run_test(bool global) struct sched_param param = {}; pid_t pids[num_pre_forks]; - skel = open_load_prog(global); + skel = init_enable_count__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + + if (!global) + skel->struct_ops.init_enable_count_ops->flags |= SCX_OPS_SWITCH_PARTIAL; + + SCX_FAIL_IF(init_enable_count__load(skel), "Failed to load skel"); /* * Fork a bunch of children before we attach the scheduler so that we @@ -159,7 +150,7 @@ static enum scx_test_status run(void *ctx) struct scx_test init_enable_count = { .name = "init_enable_count", - .description = "Verify we do the correct amount of counting of init, " + .description = "Verify we correctly count the occurrences of init, " "enable, etc callbacks.", .run = run, }; diff --git a/tools/testing/selftests/sched_ext/maximal.bpf.c b/tools/testing/selftests/sched_ext/maximal.bpf.c index 4d4cd8d966db..430f5e13bf55 100644 --- a/tools/testing/selftests/sched_ext/maximal.bpf.c +++ b/tools/testing/selftests/sched_ext/maximal.bpf.c @@ -12,6 +12,8 @@ char _license[] SEC("license") = "GPL"; +#define DSQ_ID 0 + s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu, u64 wake_flags) { @@ -20,7 +22,7 @@ s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu, void BPF_STRUCT_OPS(maximal_enqueue, struct task_struct *p, u64 enq_flags) { - scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags); + scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags); } void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags) @@ -28,7 +30,7 @@ void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags) void BPF_STRUCT_OPS(maximal_dispatch, s32 cpu, struct task_struct *prev) { - scx_bpf_consume(SCX_DSQ_GLOBAL); + scx_bpf_dsq_move_to_local(DSQ_ID); } void BPF_STRUCT_OPS(maximal_runnable, struct task_struct *p, u64 enq_flags) @@ -123,7 +125,7 @@ void BPF_STRUCT_OPS(maximal_cgroup_set_weight, struct cgroup *cgrp, u32 weight) s32 BPF_STRUCT_OPS_SLEEPABLE(maximal_init) { - return 0; + return scx_bpf_create_dsq(DSQ_ID, -1); } void BPF_STRUCT_OPS(maximal_exit, struct scx_exit_info *info) diff --git a/tools/testing/selftests/sched_ext/maximal.c b/tools/testing/selftests/sched_ext/maximal.c index f38fc973c380..c6be50a9941d 100644 --- a/tools/testing/selftests/sched_ext/maximal.c +++ b/tools/testing/selftests/sched_ext/maximal.c @@ -14,8 +14,11 @@ static enum scx_test_status setup(void **ctx) { struct maximal *skel; - skel = maximal__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = maximal__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(maximal__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/maybe_null.c b/tools/testing/selftests/sched_ext/maybe_null.c index 31cfafb0cf65..aacf0c58ca4f 100644 --- a/tools/testing/selftests/sched_ext/maybe_null.c +++ b/tools/testing/selftests/sched_ext/maybe_null.c @@ -43,7 +43,7 @@ static enum scx_test_status run(void *ctx) struct scx_test maybe_null = { .name = "maybe_null", - .description = "Verify if PTR_MAYBE_NULL work for .dispatch", + .description = "Verify if PTR_MAYBE_NULL works for .dispatch", .run = run, }; REGISTER_SCX_TEST(&maybe_null) diff --git a/tools/testing/selftests/sched_ext/minimal.c b/tools/testing/selftests/sched_ext/minimal.c index 6c5db8ebbf8a..89f7261757ff 100644 --- a/tools/testing/selftests/sched_ext/minimal.c +++ b/tools/testing/selftests/sched_ext/minimal.c @@ -15,11 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct minimal *skel; - skel = minimal__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = minimal__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(minimal__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/prog_run.c b/tools/testing/selftests/sched_ext/prog_run.c index 3cd57ef8daaa..05974820ca69 100644 --- a/tools/testing/selftests/sched_ext/prog_run.c +++ b/tools/testing/selftests/sched_ext/prog_run.c @@ -15,11 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct prog_run *skel; - skel = prog_run__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = prog_run__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(prog_run__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/reload_loop.c b/tools/testing/selftests/sched_ext/reload_loop.c index 5cfba2d6e056..308211d80436 100644 --- a/tools/testing/selftests/sched_ext/reload_loop.c +++ b/tools/testing/selftests/sched_ext/reload_loop.c @@ -18,11 +18,10 @@ bool force_exit = false; static enum scx_test_status setup(void **ctx) { - skel = maximal__open_and_load(); - if (!skel) { - SCX_ERR("Failed to open and load skel"); - return SCX_TEST_FAIL; - } + skel = maximal__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(maximal__load(skel), "Failed to load skel"); return SCX_TEST_PASS; } diff --git a/tools/testing/selftests/sched_ext/runner.c b/tools/testing/selftests/sched_ext/runner.c index eab48c7ff309..aa2d7d32dda9 100644 --- a/tools/testing/selftests/sched_ext/runner.c +++ b/tools/testing/selftests/sched_ext/runner.c @@ -22,11 +22,12 @@ const char help_fmt[] = "\n" " -t TEST Only run tests whose name includes this string\n" " -s Include print output for skipped tests\n" +" -l List all available tests\n" " -q Don't print the test descriptions during run\n" " -h Display this help and exit\n"; static volatile int exit_req; -static bool quiet, print_skipped; +static bool quiet, print_skipped, list; #define MAX_SCX_TESTS 2048 @@ -133,7 +134,7 @@ int main(int argc, char **argv) libbpf_set_strict_mode(LIBBPF_STRICT_ALL); - while ((opt = getopt(argc, argv, "qst:h")) != -1) { + while ((opt = getopt(argc, argv, "qslt:h")) != -1) { switch (opt) { case 'q': quiet = true; @@ -141,6 +142,9 @@ int main(int argc, char **argv) case 's': print_skipped = true; break; + case 'l': + list = true; + break; case 't': filter = optarg; break; @@ -154,6 +158,13 @@ int main(int argc, char **argv) enum scx_test_status status; struct scx_test *test = &__scx_tests[i]; + if (list) { + printf("%s\n", test->name); + if (i == (__scx_num_tests - 1)) + return 0; + continue; + } + if (filter && should_skip_test(test, filter)) { /* * Printing the skipped tests and their preambles can diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c index f171ac470970..13d0f5be788d 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c @@ -30,7 +30,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_enqueue, struct task_struct *p, } scx_bpf_put_idle_cpumask(idle_mask); - scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags); + scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags); } SEC(".struct_ops.link") diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl.c b/tools/testing/selftests/sched_ext/select_cpu_dfl.c index a53a40c2d2f0..5b6e045e1109 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dfl.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dfl.c @@ -17,8 +17,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_dfl *skel; - skel = select_cpu_dfl__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_dfl__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_dfl__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c index 9efdbb7da928..815f1d5d61ac 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c @@ -67,7 +67,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_enqueue, struct task_struct *p, saw_local = true; } - scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, enq_flags); + scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, enq_flags); } s32 BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_init_task, diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.c b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.c index 1d85bf4bf3a3..9b5d232efb7f 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.c @@ -17,8 +17,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_dfl_nodispatch *skel; - skel = select_cpu_dfl_nodispatch__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_dfl_nodispatch__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_dfl_nodispatch__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c index 59bfc4f36167..4bb99699e920 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c @@ -29,7 +29,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_select_cpu, struct task_struct *p, cpu = prev_cpu; dispatch: - scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, 0); + scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, 0); return cpu; } diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch.c index 0309ca8785b3..80283dbc41b7 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch.c @@ -17,8 +17,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_dispatch *skel; - skel = select_cpu_dispatch__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_dispatch__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_dispatch__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c index 3bbd5fcdfb18..2a75de11b2cf 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c @@ -18,7 +18,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_bad_dsq_select_cpu, struct task_struct *p s32 prev_cpu, u64 wake_flags) { /* Dispatching to a random DSQ should fail. */ - scx_bpf_dispatch(p, 0xcafef00d, SCX_SLICE_DFL, 0); + scx_bpf_dsq_insert(p, 0xcafef00d, SCX_SLICE_DFL, 0); return prev_cpu; } diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.c index 47eb6ed7627d..5e72ebbc90a5 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.c @@ -15,8 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_dispatch_bad_dsq *skel; - skel = select_cpu_dispatch_bad_dsq__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_dispatch_bad_dsq__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_dispatch_bad_dsq__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c index 0fda57fe0ecf..99d075695c97 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c @@ -18,8 +18,8 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_dbl_dsp_select_cpu, struct task_struct *p s32 prev_cpu, u64 wake_flags) { /* Dispatching twice in a row is disallowed. */ - scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0); - scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0); + scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0); + scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0); return prev_cpu; } diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.c index 48ff028a3c46..aa85949478bc 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.c +++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.c @@ -15,8 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_dispatch_dbl_dsp *skel; - skel = select_cpu_dispatch_dbl_dsp__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_dispatch_dbl_dsp__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_dispatch_dbl_dsp__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c index e6c67bcf5e6e..bfcb96cd4954 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c +++ b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c @@ -2,8 +2,8 @@ /* * A scheduler that validates that enqueue flags are properly stored and * applied at dispatch time when a task is directly dispatched from - * ops.select_cpu(). We validate this by using scx_bpf_dispatch_vtime(), and - * making the test a very basic vtime scheduler. + * ops.select_cpu(). We validate this by using scx_bpf_dsq_insert_vtime(), + * and making the test a very basic vtime scheduler. * * Copyright (c) 2024 Meta Platforms, Inc. and affiliates. * Copyright (c) 2024 David Vernet <dvernet@meta.com> @@ -47,13 +47,13 @@ s32 BPF_STRUCT_OPS(select_cpu_vtime_select_cpu, struct task_struct *p, cpu = prev_cpu; scx_bpf_test_and_clear_cpu_idle(cpu); ddsp: - scx_bpf_dispatch_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0); + scx_bpf_dsq_insert_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0); return cpu; } void BPF_STRUCT_OPS(select_cpu_vtime_dispatch, s32 cpu, struct task_struct *p) { - if (scx_bpf_consume(VTIME_DSQ)) + if (scx_bpf_dsq_move_to_local(VTIME_DSQ)) consumed = true; } diff --git a/tools/testing/selftests/sched_ext/select_cpu_vtime.c b/tools/testing/selftests/sched_ext/select_cpu_vtime.c index b4629c2364f5..1e9b5c9bfff1 100644 --- a/tools/testing/selftests/sched_ext/select_cpu_vtime.c +++ b/tools/testing/selftests/sched_ext/select_cpu_vtime.c @@ -15,8 +15,11 @@ static enum scx_test_status setup(void **ctx) { struct select_cpu_vtime *skel; - skel = select_cpu_vtime__open_and_load(); - SCX_FAIL_IF(!skel, "Failed to open and load skel"); + skel = select_cpu_vtime__open(); + SCX_FAIL_IF(!skel, "Failed to open"); + SCX_ENUM_INIT(skel); + SCX_FAIL_IF(select_cpu_vtime__load(skel), "Failed to load skel"); + *ctx = skel; return SCX_TEST_PASS; diff --git a/tools/testing/selftests/seccomp/seccomp_bpf.c b/tools/testing/selftests/seccomp/seccomp_bpf.c index 8c3a73461475..14ba51b52095 100644 --- a/tools/testing/selftests/seccomp/seccomp_bpf.c +++ b/tools/testing/selftests/seccomp/seccomp_bpf.c @@ -47,6 +47,7 @@ #include <linux/kcmp.h> #include <sys/resource.h> #include <sys/capability.h> +#include <linux/perf_event.h> #include <unistd.h> #include <sys/syscall.h> @@ -68,6 +69,10 @@ # define PR_SET_PTRACER 0x59616d61 #endif +#ifndef noinline +#define noinline __attribute__((noinline)) +#endif + #ifndef PR_SET_NO_NEW_PRIVS #define PR_SET_NO_NEW_PRIVS 38 #define PR_GET_NO_NEW_PRIVS 39 @@ -4888,6 +4893,200 @@ TEST(tsync_vs_dead_thread_leader) EXPECT_EQ(0, status); } +noinline int probed(void) +{ + return 1; +} + +static int parse_uint_from_file(const char *file, const char *fmt) +{ + int err = -1, ret; + FILE *f; + + f = fopen(file, "re"); + if (f) { + err = fscanf(f, fmt, &ret); + fclose(f); + } + return err == 1 ? ret : err; +} + +static int determine_uprobe_perf_type(void) +{ + const char *file = "/sys/bus/event_source/devices/uprobe/type"; + + return parse_uint_from_file(file, "%d\n"); +} + +static int determine_uprobe_retprobe_bit(void) +{ + const char *file = "/sys/bus/event_source/devices/uprobe/format/retprobe"; + + return parse_uint_from_file(file, "config:%d\n"); +} + +static ssize_t get_uprobe_offset(const void *addr) +{ + size_t start, base, end; + bool found = false; + char buf[256]; + FILE *f; + + f = fopen("/proc/self/maps", "r"); + if (!f) + return -1; + + while (fscanf(f, "%zx-%zx %s %zx %*[^\n]\n", &start, &end, buf, &base) == 4) { + if (buf[2] == 'x' && (uintptr_t)addr >= start && (uintptr_t)addr < end) { + found = true; + break; + } + } + fclose(f); + return found ? (uintptr_t)addr - start + base : -1; +} + +FIXTURE(URETPROBE) { + int fd; +}; + +FIXTURE_VARIANT(URETPROBE) { + /* + * All of the URETPROBE behaviors can be tested with either + * uretprobe attached or not + */ + bool attach; +}; + +FIXTURE_VARIANT_ADD(URETPROBE, attached) { + .attach = true, +}; + +FIXTURE_VARIANT_ADD(URETPROBE, not_attached) { + .attach = false, +}; + +FIXTURE_SETUP(URETPROBE) +{ + const size_t attr_sz = sizeof(struct perf_event_attr); + struct perf_event_attr attr; + ssize_t offset; + int type, bit; + +#ifndef __NR_uretprobe + SKIP(return, "__NR_uretprobe syscall not defined"); +#endif + + if (!variant->attach) + return; + + memset(&attr, 0, attr_sz); + + type = determine_uprobe_perf_type(); + ASSERT_GE(type, 0); + bit = determine_uprobe_retprobe_bit(); + ASSERT_GE(bit, 0); + offset = get_uprobe_offset(probed); + ASSERT_GE(offset, 0); + + attr.config |= 1 << bit; + attr.size = attr_sz; + attr.type = type; + attr.config1 = ptr_to_u64("/proc/self/exe"); + attr.config2 = offset; + + self->fd = syscall(__NR_perf_event_open, &attr, + getpid() /* pid */, -1 /* cpu */, -1 /* group_fd */, + PERF_FLAG_FD_CLOEXEC); +} + +FIXTURE_TEARDOWN(URETPROBE) +{ + /* we could call close(self->fd), but we'd need extra filter for + * that and since we are calling _exit right away.. + */ +} + +static int run_probed_with_filter(struct sock_fprog *prog) +{ + if (prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0) || + seccomp(SECCOMP_SET_MODE_FILTER, 0, prog)) { + return -1; + } + + probed(); + return 0; +} + +TEST_F(URETPROBE, uretprobe_default_allow) +{ + struct sock_filter filter[] = { + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog prog = { + .len = (unsigned short)ARRAY_SIZE(filter), + .filter = filter, + }; + + ASSERT_EQ(0, run_probed_with_filter(&prog)); +} + +TEST_F(URETPROBE, uretprobe_default_block) +{ + struct sock_filter filter[] = { + BPF_STMT(BPF_LD|BPF_W|BPF_ABS, + offsetof(struct seccomp_data, nr)), + BPF_JUMP(BPF_JMP|BPF_JEQ|BPF_K, __NR_exit_group, 1, 0), + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_KILL), + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog prog = { + .len = (unsigned short)ARRAY_SIZE(filter), + .filter = filter, + }; + + ASSERT_EQ(0, run_probed_with_filter(&prog)); +} + +TEST_F(URETPROBE, uretprobe_block_uretprobe_syscall) +{ + struct sock_filter filter[] = { + BPF_STMT(BPF_LD|BPF_W|BPF_ABS, + offsetof(struct seccomp_data, nr)), +#ifdef __NR_uretprobe + BPF_JUMP(BPF_JMP|BPF_JEQ|BPF_K, __NR_uretprobe, 0, 1), +#endif + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_KILL), + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog prog = { + .len = (unsigned short)ARRAY_SIZE(filter), + .filter = filter, + }; + + ASSERT_EQ(0, run_probed_with_filter(&prog)); +} + +TEST_F(URETPROBE, uretprobe_default_block_with_uretprobe_syscall) +{ + struct sock_filter filter[] = { + BPF_STMT(BPF_LD|BPF_W|BPF_ABS, + offsetof(struct seccomp_data, nr)), +#ifdef __NR_uretprobe + BPF_JUMP(BPF_JMP|BPF_JEQ|BPF_K, __NR_uretprobe, 2, 0), +#endif + BPF_JUMP(BPF_JMP|BPF_JEQ|BPF_K, __NR_exit_group, 1, 0), + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_KILL), + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog prog = { + .len = (unsigned short)ARRAY_SIZE(filter), + .filter = filter, + }; + + ASSERT_EQ(0, run_probed_with_filter(&prog)); +} + /* * TODO: * - expand NNP testing diff --git a/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py new file mode 100755 index 000000000000..0f44a6199495 --- /dev/null +++ b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py @@ -0,0 +1,21 @@ +#!/usr/bin/env python3 +# SPDX-License-Identifier: GPL-2.0 +# +# Script that checks that SFQ rejects a limit of 1 at the kernel +# level. We can't use iproute2's tc because it does not accept a limit +# of 1. + +import sys +import os + +from pyroute2 import IPRoute +from pyroute2.netlink.exceptions import NetlinkError + +ip = IPRoute() +ifidx = ip.link_lookup(ifname=sys.argv[1]) + +try: + ip.tc('add', 'sfq', ifidx, limit=1) + sys.exit(1) +except NetlinkError: + sys.exit(0) diff --git a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json index 996448afe31b..91d120548bf5 100644 --- a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json +++ b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json @@ -78,10 +78,10 @@ "setup": [ "$TC qdisc add dev $DEV1 ingress" ], - "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0xff", + "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0x1f", "expExitCode": "0", "verifyCmd": "$TC filter get dev $DEV1 parent ffff: handle 1 protocol ip prio 1 flow", - "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 255 baseclass", + "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 31 baseclass", "matchCount": "1", "teardown": [ "$TC qdisc del dev $DEV1 ingress" diff --git a/tools/testing/selftests/tc-testing/tc-tests/infra/qdiscs.json b/tools/testing/selftests/tc-testing/tc-tests/infra/qdiscs.json index d3dd65b05b5f..9044ac054167 100644 --- a/tools/testing/selftests/tc-testing/tc-tests/infra/qdiscs.json +++ b/tools/testing/selftests/tc-testing/tc-tests/infra/qdiscs.json @@ -94,5 +94,37 @@ "$TC qdisc del dev $DUMMY ingress", "$IP addr del 10.10.10.10/24 dev $DUMMY" ] - } + }, + { + "id": "a4b9", + "name": "Test class qlen notification", + "category": [ + "qdisc" + ], + "plugins": { + "requires": "nsPlugin" + }, + "setup": [ + "$IP link set dev $DUMMY up || true", + "$IP addr add 10.10.10.10/24 dev $DUMMY || true", + "$TC qdisc add dev $DUMMY root handle 1: drr", + "$TC filter add dev $DUMMY parent 1: basic classid 1:1", + "$TC class add dev $DUMMY parent 1: classid 1:1 drr", + "$TC qdisc add dev $DUMMY parent 1:1 handle 2: netem", + "$TC qdisc add dev $DUMMY parent 2: handle 3: drr", + "$TC filter add dev $DUMMY parent 3: basic action drop", + "$TC class add dev $DUMMY parent 3: classid 3:1 drr", + "$TC class del dev $DUMMY classid 1:1", + "$TC class add dev $DUMMY parent 1: classid 1:1 drr" + ], + "cmdUnderTest": "ping -c1 -W0.01 -I $DUMMY 10.10.10.1", + "expExitCode": "1", + "verifyCmd": "$TC qdisc ls dev $DUMMY", + "matchPattern": "drr 1: root", + "matchCount": "1", + "teardown": [ + "$TC qdisc del dev $DUMMY root handle 1: drr", + "$IP addr del 10.10.10.10/24 dev $DUMMY" + ] + } ] diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/fifo.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/fifo.json index ae3d286a32b2..6f20d033670d 100644 --- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/fifo.json +++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/fifo.json @@ -313,6 +313,29 @@ "matchPattern": "qdisc bfifo 1: root", "matchCount": "0", "teardown": [ + ] + }, + { + "id": "d774", + "name": "Check pfifo_head_drop qdisc enqueue behaviour when limit == 0", + "category": [ + "qdisc", + "pfifo_head_drop" + ], + "plugins": { + "requires": "nsPlugin" + }, + "setup": [ + "$IP addr add 10.10.10.10/24 dev $DUMMY || true", + "$TC qdisc add dev $DUMMY root handle 1: pfifo_head_drop limit 0", + "$IP link set dev $DUMMY up || true" + ], + "cmdUnderTest": "ping -c2 -W0.01 -I $DUMMY 10.10.10.1", + "expExitCode": "1", + "verifyCmd": "$TC -s qdisc show dev $DUMMY", + "matchPattern": "dropped 2", + "matchCount": "1", + "teardown": [ ] } ] diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json index 16d51936b385..50e8d72781cb 100644 --- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json +++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json @@ -208,5 +208,25 @@ "teardown": [ "$TC qdisc del dev $DUMMY handle 1: root" ] + }, + { + "id": "4d6f", + "name": "Check that limit of 1 is rejected", + "category": [ + "qdisc", + "sfq" + ], + "plugins": { + "requires": "nsPlugin" + }, + "setup": [ + ], + "cmdUnderTest": "./scripts/sfq_rejects_limit_1.py $DUMMY", + "expExitCode": "0", + "verifyCmd": "$TC qdisc show dev $DUMMY", + "matchPattern": "sfq", + "matchCount": "0", + "teardown": [ + ] } ] diff --git a/tools/testing/selftests/timers/clocksource-switch.c b/tools/testing/selftests/timers/clocksource-switch.c index c5264594064c..83faa4e354e3 100644 --- a/tools/testing/selftests/timers/clocksource-switch.c +++ b/tools/testing/selftests/timers/clocksource-switch.c @@ -156,8 +156,8 @@ int main(int argc, char **argv) /* Check everything is sane before we start switching asynchronously */ if (do_sanity_check) { for (i = 0; i < count; i++) { - printf("Validating clocksource %s\n", - clocksource_list[i]); + ksft_print_msg("Validating clocksource %s\n", + clocksource_list[i]); if (change_clocksource(clocksource_list[i])) { status = -1; goto out; @@ -169,7 +169,7 @@ int main(int argc, char **argv) } } - printf("Running Asynchronous Switching Tests...\n"); + ksft_print_msg("Running Asynchronous Switching Tests...\n"); pid = fork(); if (!pid) return run_tests(runtime); diff --git a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c index b5c3ddb90942..02ecfe687dc2 100644 --- a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c +++ b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c @@ -23,45 +23,56 @@ #include <sys/mount.h> #include <unistd.h> +#include "../kselftest.h" + int main(void) { int fd; + // Setting up kselftest framework + ksft_print_header(); + ksft_set_plan(1); + + // Check if test is run as root + if (geteuid()) { + ksft_exit_skip("This test needs root to run!\n"); + return 1; + } + if (unshare(CLONE_NEWNS) == -1) { if (errno == ENOSYS || errno == EPERM) { - fprintf(stderr, "error: unshare, errno %d\n", errno); - return 4; + ksft_exit_skip("unshare() error: unshare, errno %d\n", errno); + } else { + ksft_exit_fail_msg("unshare() error: unshare, errno %d\n", errno); } - fprintf(stderr, "error: unshare, errno %d\n", errno); - return 1; } + if (mount(NULL, "/", NULL, MS_PRIVATE|MS_REC, NULL) == -1) { - fprintf(stderr, "error: mount '/', errno %d\n", errno); - return 1; + ksft_exit_fail_msg("mount() error: Root filesystem private mount: Fail %d\n", errno); } /* Our heroes: 1 root inode, 1 O_TMPFILE inode, 1 permanent inode. */ if (mount(NULL, "/tmp", "tmpfs", 0, "nr_inodes=3") == -1) { - fprintf(stderr, "error: mount tmpfs, errno %d\n", errno); - return 1; + ksft_exit_fail_msg("mount() error: Mounting tmpfs on /tmp: Fail %d\n", errno); } fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600); if (fd == -1) { - fprintf(stderr, "error: open 1, errno %d\n", errno); - return 1; + ksft_exit_fail_msg("openat() error: Open first temporary file: Fail %d\n", errno); } + if (linkat(fd, "", AT_FDCWD, "/tmp/1", AT_EMPTY_PATH) == -1) { - fprintf(stderr, "error: linkat, errno %d\n", errno); - return 1; + ksft_exit_fail_msg("linkat() error: Linking the temporary file: Fail %d\n", errno); + /* Ensure fd is closed on failure */ + close(fd); } close(fd); fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600); if (fd == -1) { - fprintf(stderr, "error: open 2, errno %d\n", errno); - return 1; + ksft_exit_fail_msg("openat() error: Opening the second temporary file: Fail %d\n", errno); } - + ksft_test_result_pass(" "); + ksft_exit_pass(); return 0; } diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c index 28f35620c499..2fe5e983cb22 100644 --- a/tools/testing/selftests/vDSO/parse_vdso.c +++ b/tools/testing/selftests/vDSO/parse_vdso.c @@ -53,6 +53,7 @@ static struct vdso_info /* Symbol table */ ELF(Sym) *symtab; const char *symstrings; + ELF(Word) *gnu_hash; ELF_HASH_ENTRY *bucket, *chain; ELF_HASH_ENTRY nbucket, nchain; @@ -81,6 +82,16 @@ static unsigned long elf_hash(const char *name) return h; } +static uint32_t gnu_hash(const char *name) +{ + const unsigned char *s = (void *)name; + uint32_t h = 5381; + + for (; *s; s++) + h += h * 32 + *s; + return h; +} + void vdso_init_from_sysinfo_ehdr(uintptr_t base) { size_t i; @@ -123,6 +134,7 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base) */ ELF_HASH_ENTRY *hash = 0; vdso_info.symstrings = 0; + vdso_info.gnu_hash = 0; vdso_info.symtab = 0; vdso_info.versym = 0; vdso_info.verdef = 0; @@ -143,6 +155,11 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base) ((uintptr_t)dyn[i].d_un.d_ptr + vdso_info.load_offset); break; + case DT_GNU_HASH: + vdso_info.gnu_hash = + (ELF(Word) *)((uintptr_t)dyn[i].d_un.d_ptr + + vdso_info.load_offset); + break; case DT_VERSYM: vdso_info.versym = (ELF(Versym) *) ((uintptr_t)dyn[i].d_un.d_ptr @@ -155,17 +172,27 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base) break; } } - if (!vdso_info.symstrings || !vdso_info.symtab || !hash) + if (!vdso_info.symstrings || !vdso_info.symtab || + (!hash && !vdso_info.gnu_hash)) return; /* Failed */ if (!vdso_info.verdef) vdso_info.versym = 0; /* Parse the hash table header. */ - vdso_info.nbucket = hash[0]; - vdso_info.nchain = hash[1]; - vdso_info.bucket = &hash[2]; - vdso_info.chain = &hash[vdso_info.nbucket + 2]; + if (vdso_info.gnu_hash) { + vdso_info.nbucket = vdso_info.gnu_hash[0]; + /* The bucket array is located after the header (4 uint32) and the bloom + * filter (size_t array of gnu_hash[2] elements). + */ + vdso_info.bucket = vdso_info.gnu_hash + 4 + + sizeof(size_t) / 4 * vdso_info.gnu_hash[2]; + } else { + vdso_info.nbucket = hash[0]; + vdso_info.nchain = hash[1]; + vdso_info.bucket = &hash[2]; + vdso_info.chain = &hash[vdso_info.nbucket + 2]; + } /* That's all we need. */ vdso_info.valid = true; @@ -209,6 +236,26 @@ static bool vdso_match_version(ELF(Versym) ver, && !strcmp(name, vdso_info.symstrings + aux->vda_name); } +static bool check_sym(ELF(Sym) *sym, ELF(Word) i, const char *name, + const char *version, unsigned long ver_hash) +{ + /* Check for a defined global or weak function w/ right name. */ + if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC) + return false; + if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL && + ELF64_ST_BIND(sym->st_info) != STB_WEAK) + return false; + if (strcmp(name, vdso_info.symstrings + sym->st_name)) + return false; + + /* Check symbol version. */ + if (vdso_info.versym && + !vdso_match_version(vdso_info.versym[i], version, ver_hash)) + return false; + + return true; +} + void *vdso_sym(const char *version, const char *name) { unsigned long ver_hash; @@ -216,29 +263,36 @@ void *vdso_sym(const char *version, const char *name) return 0; ver_hash = elf_hash(version); - ELF(Word) chain = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket]; - - for (; chain != STN_UNDEF; chain = vdso_info.chain[chain]) { - ELF(Sym) *sym = &vdso_info.symtab[chain]; - - /* Check for a defined global or weak function w/ right name. */ - if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC) - continue; - if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL && - ELF64_ST_BIND(sym->st_info) != STB_WEAK) - continue; - if (sym->st_shndx == SHN_UNDEF) - continue; - if (strcmp(name, vdso_info.symstrings + sym->st_name)) - continue; - - /* Check symbol version. */ - if (vdso_info.versym - && !vdso_match_version(vdso_info.versym[chain], - version, ver_hash)) - continue; - - return (void *)(vdso_info.load_offset + sym->st_value); + ELF(Word) i; + + if (vdso_info.gnu_hash) { + uint32_t h1 = gnu_hash(name), h2, *hashval; + + i = vdso_info.bucket[h1 % vdso_info.nbucket]; + if (i == 0) + return 0; + h1 |= 1; + hashval = vdso_info.bucket + vdso_info.nbucket + + (i - vdso_info.gnu_hash[1]); + for (;; i++) { + ELF(Sym) *sym = &vdso_info.symtab[i]; + h2 = *hashval++; + if (h1 == (h2 | 1) && + check_sym(sym, i, name, version, ver_hash)) + return (void *)(vdso_info.load_offset + + sym->st_value); + if (h2 & 1) + break; + } + } else { + i = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket]; + for (; i; i = vdso_info.chain[i]) { + ELF(Sym) *sym = &vdso_info.symtab[i]; + if (sym->st_shndx != SHN_UNDEF && + check_sym(sym, i, name, version, ver_hash)) + return (void *)(vdso_info.load_offset + + sym->st_value); + } } return 0; diff --git a/tools/testing/selftests/x86/lam.c b/tools/testing/selftests/x86/lam.c index 0ea4f6813930..4d4a76532dc9 100644 --- a/tools/testing/selftests/x86/lam.c +++ b/tools/testing/selftests/x86/lam.c @@ -237,7 +237,7 @@ static uint64_t set_metadata(uint64_t src, unsigned long lam) * both pointers should point to the same address. * * @return: - * 0: value on the pointer with metadate and value on original are same + * 0: value on the pointer with metadata and value on original are same * 1: not same. */ static int handle_lam_test(void *src, unsigned int lam) diff --git a/tools/testing/selftests/zram/.gitignore b/tools/testing/selftests/zram/.gitignore new file mode 100644 index 000000000000..088cd9bad87a --- /dev/null +++ b/tools/testing/selftests/zram/.gitignore @@ -0,0 +1,2 @@ +# SPDX-License-Identifier: GPL-2.0-only +err.log diff --git a/tools/testing/shared/linux/maple_tree.h b/tools/testing/shared/linux/maple_tree.h index 06c89bdcc515..f67d47d32857 100644 --- a/tools/testing/shared/linux/maple_tree.h +++ b/tools/testing/shared/linux/maple_tree.h @@ -2,6 +2,6 @@ #define atomic_t int32_t #define atomic_inc(x) uatomic_inc(x) #define atomic_read(x) uatomic_read(x) -#define atomic_set(x, y) do {} while (0) +#define atomic_set(x, y) uatomic_set(x, y) #define U8_MAX UCHAR_MAX #include "../../../../include/linux/maple_tree.h" diff --git a/tools/testing/vma/linux/atomic.h b/tools/testing/vma/linux/atomic.h index e01f66f98982..3e1b6adc027b 100644 --- a/tools/testing/vma/linux/atomic.h +++ b/tools/testing/vma/linux/atomic.h @@ -6,7 +6,7 @@ #define atomic_t int32_t #define atomic_inc(x) uatomic_inc(x) #define atomic_read(x) uatomic_read(x) -#define atomic_set(x, y) do {} while (0) +#define atomic_set(x, y) uatomic_set(x, y) #define U8_MAX UCHAR_MAX #endif /* _LINUX_ATOMIC_H */ diff --git a/tools/testing/vma/vma.c b/tools/testing/vma/vma.c index 8fab5e13c7c3..04ab45e27fb8 100644 --- a/tools/testing/vma/vma.c +++ b/tools/testing/vma/vma.c @@ -18,6 +18,12 @@ static bool fail_prealloc; #define vma_iter_prealloc(vmi, vma) \ (fail_prealloc ? -ENOMEM : mas_preallocate(&(vmi)->mas, (vma), GFP_KERNEL)) +#define CONFIG_DEFAULT_MMAP_MIN_ADDR 65536 + +unsigned long mmap_min_addr = CONFIG_DEFAULT_MMAP_MIN_ADDR; +unsigned long dac_mmap_min_addr = CONFIG_DEFAULT_MMAP_MIN_ADDR; +unsigned long stack_guard_gap = 256UL<<PAGE_SHIFT; + /* * Directly import the VMA implementation here. Our vma_internal.h wrapper * provides userland-equivalent functionality for everything vma.c uses. @@ -47,6 +53,11 @@ struct task_struct *get_current(void) return &__current; } +unsigned long rlimit(unsigned int limit) +{ + return (unsigned long)-1; +} + /* Helper function to simply allocate a VMA. */ static struct vm_area_struct *alloc_vma(struct mm_struct *mm, unsigned long start, @@ -89,7 +100,7 @@ static struct vm_area_struct *alloc_and_link_vma(struct mm_struct *mm, * begun. Linking to the tree will have caused this to be incremented, * which means we will get a false positive otherwise. */ - vma->vm_lock_seq = -1; + vma->vm_lock_seq = UINT_MAX; return vma; } @@ -214,7 +225,7 @@ static bool vma_write_started(struct vm_area_struct *vma) int seq = vma->vm_lock_seq; /* We reset after each check. */ - vma->vm_lock_seq = -1; + vma->vm_lock_seq = UINT_MAX; /* The vma_start_write() stub simply increments this value. */ return seq > -1; @@ -1563,6 +1574,57 @@ static bool test_expand_only_mode(void) return true; } +static bool test_mmap_region_basic(void) +{ + struct mm_struct mm = {}; + unsigned long addr; + struct vm_area_struct *vma; + VMA_ITERATOR(vmi, &mm, 0); + + current->mm = &mm; + + /* Map at 0x300000, length 0x3000. */ + addr = __mmap_region(NULL, 0x300000, 0x3000, + VM_READ | VM_WRITE | VM_MAYREAD | VM_MAYWRITE, + 0x300, NULL); + ASSERT_EQ(addr, 0x300000); + + /* Map at 0x250000, length 0x3000. */ + addr = __mmap_region(NULL, 0x250000, 0x3000, + VM_READ | VM_WRITE | VM_MAYREAD | VM_MAYWRITE, + 0x250, NULL); + ASSERT_EQ(addr, 0x250000); + + /* Map at 0x303000, merging to 0x300000 of length 0x6000. */ + addr = __mmap_region(NULL, 0x303000, 0x3000, + VM_READ | VM_WRITE | VM_MAYREAD | VM_MAYWRITE, + 0x303, NULL); + ASSERT_EQ(addr, 0x303000); + + /* Map at 0x24d000, merging to 0x250000 of length 0x6000. */ + addr = __mmap_region(NULL, 0x24d000, 0x3000, + VM_READ | VM_WRITE | VM_MAYREAD | VM_MAYWRITE, + 0x24d, NULL); + ASSERT_EQ(addr, 0x24d000); + + ASSERT_EQ(mm.map_count, 2); + + for_each_vma(vmi, vma) { + if (vma->vm_start == 0x300000) { + ASSERT_EQ(vma->vm_end, 0x306000); + ASSERT_EQ(vma->vm_pgoff, 0x300); + } else if (vma->vm_start == 0x24d000) { + ASSERT_EQ(vma->vm_end, 0x253000); + ASSERT_EQ(vma->vm_pgoff, 0x24d); + } else { + ASSERT_FALSE(true); + } + } + + cleanup_mm(&mm, &vmi); + return true; +} + int main(void) { int num_tests = 0, num_fail = 0; @@ -1596,6 +1658,8 @@ int main(void) TEST(copy_vma); TEST(expand_only_mode); + TEST(mmap_region_basic); + #undef TEST printf("%d tests run, %d passed, %d failed.\n", diff --git a/tools/testing/vma/vma_internal.h b/tools/testing/vma/vma_internal.h index e76ff579e1fd..1eae23039854 100644 --- a/tools/testing/vma/vma_internal.h +++ b/tools/testing/vma/vma_internal.h @@ -27,11 +27,23 @@ #include <linux/rbtree.h> #include <linux/rwsem.h> +extern unsigned long stack_guard_gap; +#ifdef CONFIG_MMU +extern unsigned long mmap_min_addr; +extern unsigned long dac_mmap_min_addr; +#else +#define mmap_min_addr 0UL +#define dac_mmap_min_addr 0UL +#endif + #define VM_WARN_ON(_expr) (WARN_ON(_expr)) #define VM_WARN_ON_ONCE(_expr) (WARN_ON_ONCE(_expr)) +#define VM_WARN_ON_VMG(_expr, _vmg) (WARN_ON(_expr)) #define VM_BUG_ON(_expr) (BUG_ON(_expr)) #define VM_BUG_ON_VMA(_expr, _vma) (BUG_ON(_expr)) +#define MMF_HAS_MDWE 28 + #define VM_NONE 0x00000000 #define VM_READ 0x00000001 #define VM_WRITE 0x00000002 @@ -39,6 +51,7 @@ #define VM_SHARED 0x00000008 #define VM_MAYREAD 0x00000010 #define VM_MAYWRITE 0x00000020 +#define VM_MAYEXEC 0x00000040 #define VM_GROWSDOWN 0x00000100 #define VM_PFNMAP 0x00000400 #define VM_LOCKED 0x00002000 @@ -51,6 +64,8 @@ #define VM_STACK VM_GROWSDOWN #define VM_SHADOW_STACK VM_NONE #define VM_SOFTDIRTY 0 +#define VM_ARCH_1 0x01000000 /* Architecture-specific flag */ +#define VM_GROWSUP VM_NONE #define VM_ACCESS_FLAGS (VM_READ | VM_WRITE | VM_EXEC) #define VM_SPECIAL (VM_IO | VM_DONTEXPAND | VM_PFNMAP | VM_MIXEDMAP) @@ -58,6 +73,20 @@ /* This mask represents all the VMA flag bits used by mlock */ #define VM_LOCKED_MASK (VM_LOCKED | VM_LOCKONFAULT) +#define TASK_EXEC ((current->personality & READ_IMPLIES_EXEC) ? VM_EXEC : 0) + +#define VM_DATA_FLAGS_TSK_EXEC (VM_READ | VM_WRITE | TASK_EXEC | \ + VM_MAYREAD | VM_MAYWRITE | VM_MAYEXEC) + +#define VM_DATA_DEFAULT_FLAGS VM_DATA_FLAGS_TSK_EXEC + +#define VM_STARTGAP_FLAGS (VM_GROWSDOWN | VM_SHADOW_STACK) + +#define RLIMIT_STACK 3 /* max stack size */ +#define RLIMIT_MEMLOCK 8 /* max locked-in-memory address space */ + +#define CAP_IPC_LOCK 14 + #ifdef CONFIG_64BIT /* VM is sealed, in vm_flags */ #define VM_SEALED _BITUL(63) @@ -122,10 +151,22 @@ enum { TASK_COMM_LEN = 16, }; +/* + * Flags for bug emulation. + * + * These occupy the top three bytes. + */ +enum { + READ_IMPLIES_EXEC = 0x0400000, +}; + struct task_struct { char comm[TASK_COMM_LEN]; pid_t pid; struct mm_struct *mm; + + /* Used for emulating ABI behavior of previous Linux versions: */ + unsigned int personality; }; struct task_struct *get_current(void); @@ -186,6 +227,10 @@ struct mm_struct { unsigned long data_vm; /* VM_WRITE & ~VM_SHARED & ~VM_STACK */ unsigned long exec_vm; /* VM_EXEC & ~VM_WRITE & ~VM_STACK */ unsigned long stack_vm; /* VM_STACK */ + + unsigned long def_flags; + + unsigned long flags; /* Must use atomic bitops to access */ }; struct vma_lock { @@ -241,7 +286,7 @@ struct vm_area_struct { * counter reuse can only lead to occasional unnecessary use of the * slowpath. */ - int vm_lock_seq; + unsigned int vm_lock_seq; struct vma_lock *vm_lock; #endif @@ -373,6 +418,17 @@ struct vm_operations_struct { unsigned long addr); }; +struct vm_unmapped_area_info { +#define VM_UNMAPPED_AREA_TOPDOWN 1 + unsigned long flags; + unsigned long length; + unsigned long low_limit; + unsigned long high_limit; + unsigned long align_mask; + unsigned long align_offset; + unsigned long start_gap; +}; + static inline void vma_iter_invalidate(struct vma_iterator *vmi) { mas_pause(&vmi->mas); @@ -416,7 +472,7 @@ static inline bool vma_lock_alloc(struct vm_area_struct *vma) return false; init_rwsem(&vma->vm_lock->lock); - vma->vm_lock_seq = -1; + vma->vm_lock_seq = UINT_MAX; return true; } @@ -432,6 +488,8 @@ static inline void vma_mark_detached(struct vm_area_struct *vma, bool detached) extern const struct vm_operations_struct vma_dummy_vm_ops; +extern unsigned long rlimit(unsigned int limit); + static inline void vma_init(struct vm_area_struct *vma, struct mm_struct *mm) { memset(vma, 0, sizeof(*vma)); @@ -853,6 +911,11 @@ static inline void mmap_write_unlock(struct mm_struct *) { } +static inline int mmap_write_lock_killable(struct mm_struct *) +{ + return 0; +} + static inline bool can_modify_mm(struct mm_struct *mm, unsigned long start, unsigned long end) @@ -938,7 +1001,7 @@ static inline bool is_file_hugepages(struct file *) static inline int security_vm_enough_memory_mm(struct mm_struct *, long) { - return true; + return 0; } static inline bool may_expand_vm(struct mm_struct *, vm_flags_t, unsigned long) @@ -1033,4 +1096,159 @@ static inline int mmap_file(struct file *, struct vm_area_struct *) return 0; } +static inline unsigned long stack_guard_start_gap(struct vm_area_struct *vma) +{ + if (vma->vm_flags & VM_GROWSDOWN) + return stack_guard_gap; + + /* See reasoning around the VM_SHADOW_STACK definition */ + if (vma->vm_flags & VM_SHADOW_STACK) + return PAGE_SIZE; + + return 0; +} + +static inline unsigned long vm_start_gap(struct vm_area_struct *vma) +{ + unsigned long gap = stack_guard_start_gap(vma); + unsigned long vm_start = vma->vm_start; + + vm_start -= gap; + if (vm_start > vma->vm_start) + vm_start = 0; + return vm_start; +} + +static inline unsigned long vm_end_gap(struct vm_area_struct *vma) +{ + unsigned long vm_end = vma->vm_end; + + if (vma->vm_flags & VM_GROWSUP) { + vm_end += stack_guard_gap; + if (vm_end < vma->vm_end) + vm_end = -PAGE_SIZE; + } + return vm_end; +} + +static inline int is_hugepage_only_range(struct mm_struct *mm, + unsigned long addr, unsigned long len) +{ + return 0; +} + +static inline bool vma_is_accessible(struct vm_area_struct *vma) +{ + return vma->vm_flags & VM_ACCESS_FLAGS; +} + +static inline bool capable(int cap) +{ + return true; +} + +static inline bool mlock_future_ok(struct mm_struct *mm, unsigned long flags, + unsigned long bytes) +{ + unsigned long locked_pages, limit_pages; + + if (!(flags & VM_LOCKED) || capable(CAP_IPC_LOCK)) + return true; + + locked_pages = bytes >> PAGE_SHIFT; + locked_pages += mm->locked_vm; + + limit_pages = rlimit(RLIMIT_MEMLOCK); + limit_pages >>= PAGE_SHIFT; + + return locked_pages <= limit_pages; +} + +static inline int __anon_vma_prepare(struct vm_area_struct *vma) +{ + struct anon_vma *anon_vma = calloc(1, sizeof(struct anon_vma)); + + if (!anon_vma) + return -ENOMEM; + + anon_vma->root = anon_vma; + vma->anon_vma = anon_vma; + + return 0; +} + +static inline int anon_vma_prepare(struct vm_area_struct *vma) +{ + if (likely(vma->anon_vma)) + return 0; + + return __anon_vma_prepare(vma); +} + +static inline void userfaultfd_unmap_complete(struct mm_struct *mm, + struct list_head *uf) +{ +} + +/* + * Denies creating a writable executable mapping or gaining executable permissions. + * + * This denies the following: + * + * a) mmap(PROT_WRITE | PROT_EXEC) + * + * b) mmap(PROT_WRITE) + * mprotect(PROT_EXEC) + * + * c) mmap(PROT_WRITE) + * mprotect(PROT_READ) + * mprotect(PROT_EXEC) + * + * But allows the following: + * + * d) mmap(PROT_READ | PROT_EXEC) + * mmap(PROT_READ | PROT_EXEC | PROT_BTI) + * + * This is only applicable if the user has set the Memory-Deny-Write-Execute + * (MDWE) protection mask for the current process. + * + * @old specifies the VMA flags the VMA originally possessed, and @new the ones + * we propose to set. + * + * Return: false if proposed change is OK, true if not ok and should be denied. + */ +static inline bool map_deny_write_exec(unsigned long old, unsigned long new) +{ + /* If MDWE is disabled, we have nothing to deny. */ + if (!test_bit(MMF_HAS_MDWE, ¤t->mm->flags)) + return false; + + /* If the new VMA is not executable, we have nothing to deny. */ + if (!(new & VM_EXEC)) + return false; + + /* Under MDWE we do not accept newly writably executable VMAs... */ + if (new & VM_WRITE) + return true; + + /* ...nor previously non-executable VMAs becoming executable. */ + if (!(old & VM_EXEC)) + return true; + + return false; +} + +static inline int mapping_map_writable(struct address_space *mapping) +{ + int c = atomic_read(&mapping->i_mmap_writable); + + /* Derived from the raw_atomic_inc_unless_negative() implementation. */ + do { + if (c < 0) + return -EPERM; + } while (!__sync_bool_compare_and_swap(&mapping->i_mmap_writable, c, c+1)); + + return 0; +} + #endif /* __MM_VMA_INTERNAL_H */ diff --git a/tools/testing/vsock/README b/tools/testing/vsock/README index 84ee217ba8ee..680ce666ceb5 100644 --- a/tools/testing/vsock/README +++ b/tools/testing/vsock/README @@ -36,6 +36,21 @@ Invoke test binaries in both directions as follows: --control-port=1234 \ --peer-cid=3 +Some tests are designed to produce kernel memory leaks. Leaks detection, +however, is deferred to Kernel Memory Leak Detector. It is recommended to enable +kmemleak (CONFIG_DEBUG_KMEMLEAK=y) and explicitly trigger a scan after each test +suite run, e.g. + + # echo clear > /sys/kernel/debug/kmemleak + # $TEST_BINARY ... + # echo "wait for any grace periods" && sleep 2 + # echo scan > /sys/kernel/debug/kmemleak + # echo "wait for kmemleak" && sleep 5 + # echo scan > /sys/kernel/debug/kmemleak + # cat /sys/kernel/debug/kmemleak + +For more information see Documentation/dev-tools/kmemleak.rst. + vsock_perf utility ------------------- 'vsock_perf' is a simple tool to measure vsock performance. It works in diff --git a/tools/testing/vsock/control.c b/tools/testing/vsock/control.c index d2deb4b15b94..0066e0324d35 100644 --- a/tools/testing/vsock/control.c +++ b/tools/testing/vsock/control.c @@ -27,6 +27,7 @@ #include "timeout.h" #include "control.h" +#include "util.h" static int control_fd = -1; @@ -50,7 +51,6 @@ void control_init(const char *control_host, for (ai = result; ai; ai = ai->ai_next) { int fd; - int val = 1; fd = socket(ai->ai_family, ai->ai_socktype, ai->ai_protocol); if (fd < 0) @@ -65,11 +65,8 @@ void control_init(const char *control_host, break; } - if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, - &val, sizeof(val)) < 0) { - perror("setsockopt"); - exit(EXIT_FAILURE); - } + setsockopt_int_check(fd, SOL_SOCKET, SO_REUSEADDR, 1, + "setsockopt SO_REUSEADDR"); if (bind(fd, ai->ai_addr, ai->ai_addrlen) < 0) goto next; diff --git a/tools/testing/vsock/msg_zerocopy_common.c b/tools/testing/vsock/msg_zerocopy_common.c index 5a4bdf7b5132..8622e5a0f8b7 100644 --- a/tools/testing/vsock/msg_zerocopy_common.c +++ b/tools/testing/vsock/msg_zerocopy_common.c @@ -14,16 +14,6 @@ #include "msg_zerocopy_common.h" -void enable_so_zerocopy(int fd) -{ - int val = 1; - - if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) { - perror("setsockopt"); - exit(EXIT_FAILURE); - } -} - void vsock_recv_completion(int fd, const bool *zerocopied) { struct sock_extended_err *serr; diff --git a/tools/testing/vsock/msg_zerocopy_common.h b/tools/testing/vsock/msg_zerocopy_common.h index 3763c5ccedb9..ad14139e93ca 100644 --- a/tools/testing/vsock/msg_zerocopy_common.h +++ b/tools/testing/vsock/msg_zerocopy_common.h @@ -12,7 +12,6 @@ #define VSOCK_RECVERR 1 #endif -void enable_so_zerocopy(int fd); void vsock_recv_completion(int fd, const bool *zerocopied); #endif /* MSG_ZEROCOPY_COMMON_H */ diff --git a/tools/testing/vsock/util.c b/tools/testing/vsock/util.c index a3d448a075e3..de25892f865f 100644 --- a/tools/testing/vsock/util.c +++ b/tools/testing/vsock/util.c @@ -96,41 +96,57 @@ void vsock_wait_remote_close(int fd) close(epollfd); } -/* Bind to <bind_port>, connect to <cid, port> and return the file descriptor. */ -int vsock_bind_connect(unsigned int cid, unsigned int port, unsigned int bind_port, int type) +/* Create socket <type>, bind to <cid, port> and return the file descriptor. */ +int vsock_bind(unsigned int cid, unsigned int port, int type) { - struct sockaddr_vm sa_client = { - .svm_family = AF_VSOCK, - .svm_cid = VMADDR_CID_ANY, - .svm_port = bind_port, - }; - struct sockaddr_vm sa_server = { + struct sockaddr_vm sa = { .svm_family = AF_VSOCK, .svm_cid = cid, .svm_port = port, }; + int fd; - int client_fd, ret; - - client_fd = socket(AF_VSOCK, type, 0); - if (client_fd < 0) { + fd = socket(AF_VSOCK, type, 0); + if (fd < 0) { perror("socket"); exit(EXIT_FAILURE); } - if (bind(client_fd, (struct sockaddr *)&sa_client, sizeof(sa_client))) { + if (bind(fd, (struct sockaddr *)&sa, sizeof(sa))) { perror("bind"); exit(EXIT_FAILURE); } + return fd; +} + +int vsock_connect_fd(int fd, unsigned int cid, unsigned int port) +{ + struct sockaddr_vm sa = { + .svm_family = AF_VSOCK, + .svm_cid = cid, + .svm_port = port, + }; + int ret; + timeout_begin(TIMEOUT); do { - ret = connect(client_fd, (struct sockaddr *)&sa_server, sizeof(sa_server)); + ret = connect(fd, (struct sockaddr *)&sa, sizeof(sa)); timeout_check("connect"); } while (ret < 0 && errno == EINTR); timeout_end(); - if (ret < 0) { + return ret; +} + +/* Bind to <bind_port>, connect to <cid, port> and return the file descriptor. */ +int vsock_bind_connect(unsigned int cid, unsigned int port, unsigned int bind_port, int type) +{ + int client_fd; + + client_fd = vsock_bind(VMADDR_CID_ANY, bind_port, type); + + if (vsock_connect_fd(client_fd, cid, port)) { perror("connect"); exit(EXIT_FAILURE); } @@ -141,17 +157,6 @@ int vsock_bind_connect(unsigned int cid, unsigned int port, unsigned int bind_po /* Connect to <cid, port> and return the file descriptor. */ int vsock_connect(unsigned int cid, unsigned int port, int type) { - union { - struct sockaddr sa; - struct sockaddr_vm svm; - } addr = { - .svm = { - .svm_family = AF_VSOCK, - .svm_port = port, - .svm_cid = cid, - }, - }; - int ret; int fd; control_expectln("LISTENING"); @@ -162,20 +167,14 @@ int vsock_connect(unsigned int cid, unsigned int port, int type) exit(EXIT_FAILURE); } - timeout_begin(TIMEOUT); - do { - ret = connect(fd, &addr.sa, sizeof(addr.svm)); - timeout_check("connect"); - } while (ret < 0 && errno == EINTR); - timeout_end(); - - if (ret < 0) { + if (vsock_connect_fd(fd, cid, port)) { int old_errno = errno; close(fd); fd = -1; errno = old_errno; } + return fd; } @@ -192,28 +191,9 @@ int vsock_seqpacket_connect(unsigned int cid, unsigned int port) /* Listen on <cid, port> and return the file descriptor. */ static int vsock_listen(unsigned int cid, unsigned int port, int type) { - union { - struct sockaddr sa; - struct sockaddr_vm svm; - } addr = { - .svm = { - .svm_family = AF_VSOCK, - .svm_port = port, - .svm_cid = cid, - }, - }; int fd; - fd = socket(AF_VSOCK, type, 0); - if (fd < 0) { - perror("socket"); - exit(EXIT_FAILURE); - } - - if (bind(fd, &addr.sa, sizeof(addr.svm)) < 0) { - perror("bind"); - exit(EXIT_FAILURE); - } + fd = vsock_bind(cid, port, type); if (listen(fd, 1) < 0) { perror("listen"); @@ -401,7 +381,7 @@ void recv_buf(int fd, void *buf, size_t len, int flags, ssize_t expected_ret) */ void send_byte(int fd, int expected_ret, int flags) { - const uint8_t byte = 'A'; + static const uint8_t byte = 'A'; send_buf(fd, &byte, sizeof(byte), flags, expected_ret); } @@ -420,7 +400,7 @@ void recv_byte(int fd, int expected_ret, int flags) recv_buf(fd, &byte, sizeof(byte), flags, expected_ret); if (byte != 'A') { - fprintf(stderr, "unexpected byte read %c\n", byte); + fprintf(stderr, "unexpected byte read 0x%02x\n", byte); exit(EXIT_FAILURE); } } @@ -486,8 +466,7 @@ void list_tests(const struct test_case *test_cases) exit(EXIT_FAILURE); } -void skip_test(struct test_case *test_cases, size_t test_cases_len, - const char *test_id_str) +static unsigned long parse_test_id(const char *test_id_str, size_t test_cases_len) { unsigned long test_id; char *endptr = NULL; @@ -505,9 +484,35 @@ void skip_test(struct test_case *test_cases, size_t test_cases_len, exit(EXIT_FAILURE); } + return test_id; +} + +void skip_test(struct test_case *test_cases, size_t test_cases_len, + const char *test_id_str) +{ + unsigned long test_id = parse_test_id(test_id_str, test_cases_len); test_cases[test_id].skip = true; } +void pick_test(struct test_case *test_cases, size_t test_cases_len, + const char *test_id_str) +{ + static bool skip_all = true; + unsigned long test_id; + + if (skip_all) { + unsigned long i; + + for (i = 0; i < test_cases_len; ++i) + test_cases[i].skip = true; + + skip_all = false; + } + + test_id = parse_test_id(test_id_str, test_cases_len); + test_cases[test_id].skip = false; +} + unsigned long hash_djb2(const void *data, size_t len) { unsigned long hash = 5381; @@ -651,3 +656,145 @@ void free_test_iovec(const struct iovec *test_iovec, free(iovec); } + +/* Set "unsigned long long" socket option and check that it's indeed set */ +void setsockopt_ull_check(int fd, int level, int optname, + unsigned long long val, char const *errmsg) +{ + unsigned long long chkval; + socklen_t chklen; + int err; + + err = setsockopt(fd, level, optname, &val, sizeof(val)); + if (err) { + fprintf(stderr, "setsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + chkval = ~val; /* just make storage != val */ + chklen = sizeof(chkval); + + err = getsockopt(fd, level, optname, &chkval, &chklen); + if (err) { + fprintf(stderr, "getsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + if (chklen != sizeof(chkval)) { + fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val), + chklen); + goto fail; + } + + if (chkval != val) { + fprintf(stderr, "value mismatch: set %llu got %llu\n", val, + chkval); + goto fail; + } + return; +fail: + fprintf(stderr, "%s val %llu\n", errmsg, val); + exit(EXIT_FAILURE); +; +} + +/* Set "int" socket option and check that it's indeed set */ +void setsockopt_int_check(int fd, int level, int optname, int val, + char const *errmsg) +{ + int chkval; + socklen_t chklen; + int err; + + err = setsockopt(fd, level, optname, &val, sizeof(val)); + if (err) { + fprintf(stderr, "setsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + chkval = ~val; /* just make storage != val */ + chklen = sizeof(chkval); + + err = getsockopt(fd, level, optname, &chkval, &chklen); + if (err) { + fprintf(stderr, "getsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + if (chklen != sizeof(chkval)) { + fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val), + chklen); + goto fail; + } + + if (chkval != val) { + fprintf(stderr, "value mismatch: set %d got %d\n", val, chkval); + goto fail; + } + return; +fail: + fprintf(stderr, "%s val %d\n", errmsg, val); + exit(EXIT_FAILURE); +} + +static void mem_invert(unsigned char *mem, size_t size) +{ + size_t i; + + for (i = 0; i < size; i++) + mem[i] = ~mem[i]; +} + +/* Set "timeval" socket option and check that it's indeed set */ +void setsockopt_timeval_check(int fd, int level, int optname, + struct timeval val, char const *errmsg) +{ + struct timeval chkval; + socklen_t chklen; + int err; + + err = setsockopt(fd, level, optname, &val, sizeof(val)); + if (err) { + fprintf(stderr, "setsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + /* just make storage != val */ + chkval = val; + mem_invert((unsigned char *)&chkval, sizeof(chkval)); + chklen = sizeof(chkval); + + err = getsockopt(fd, level, optname, &chkval, &chklen); + if (err) { + fprintf(stderr, "getsockopt err: %s (%d)\n", + strerror(errno), errno); + goto fail; + } + + if (chklen != sizeof(chkval)) { + fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val), + chklen); + goto fail; + } + + if (memcmp(&chkval, &val, sizeof(val)) != 0) { + fprintf(stderr, "value mismatch: set %ld:%ld got %ld:%ld\n", + val.tv_sec, val.tv_usec, chkval.tv_sec, chkval.tv_usec); + goto fail; + } + return; +fail: + fprintf(stderr, "%s val %ld:%ld\n", errmsg, val.tv_sec, val.tv_usec); + exit(EXIT_FAILURE); +} + +void enable_so_zerocopy_check(int fd) +{ + setsockopt_int_check(fd, SOL_SOCKET, SO_ZEROCOPY, 1, + "setsockopt SO_ZEROCOPY"); +} diff --git a/tools/testing/vsock/util.h b/tools/testing/vsock/util.h index fff22d4a14c0..d1f765ce3eee 100644 --- a/tools/testing/vsock/util.h +++ b/tools/testing/vsock/util.h @@ -39,10 +39,12 @@ struct test_case { void init_signals(void); unsigned int parse_cid(const char *str); unsigned int parse_port(const char *str); +int vsock_connect_fd(int fd, unsigned int cid, unsigned int port); int vsock_connect(unsigned int cid, unsigned int port, int type); int vsock_accept(unsigned int cid, unsigned int port, struct sockaddr_vm *clientaddrp, int type); int vsock_stream_connect(unsigned int cid, unsigned int port); +int vsock_bind(unsigned int cid, unsigned int port, int type); int vsock_bind_connect(unsigned int cid, unsigned int port, unsigned int bind_port, int type); int vsock_seqpacket_connect(unsigned int cid, unsigned int port); @@ -62,10 +64,19 @@ void run_tests(const struct test_case *test_cases, void list_tests(const struct test_case *test_cases); void skip_test(struct test_case *test_cases, size_t test_cases_len, const char *test_id_str); +void pick_test(struct test_case *test_cases, size_t test_cases_len, + const char *test_id_str); unsigned long hash_djb2(const void *data, size_t len); size_t iovec_bytes(const struct iovec *iov, size_t iovnum); unsigned long iovec_hash_djb2(const struct iovec *iov, size_t iovnum); struct iovec *alloc_test_iovec(const struct iovec *test_iovec, int iovnum); void free_test_iovec(const struct iovec *test_iovec, struct iovec *iovec, int iovnum); +void setsockopt_ull_check(int fd, int level, int optname, + unsigned long long val, char const *errmsg); +void setsockopt_int_check(int fd, int level, int optname, int val, + char const *errmsg); +void setsockopt_timeval_check(int fd, int level, int optname, + struct timeval val, char const *errmsg); +void enable_so_zerocopy_check(int fd); #endif /* UTIL_H */ diff --git a/tools/testing/vsock/vsock_perf.c b/tools/testing/vsock/vsock_perf.c index 4e8578f815e0..75971ac708c9 100644 --- a/tools/testing/vsock/vsock_perf.c +++ b/tools/testing/vsock/vsock_perf.c @@ -33,7 +33,7 @@ static unsigned int port = DEFAULT_PORT; static unsigned long buf_size_bytes = DEFAULT_BUF_SIZE_BYTES; -static unsigned long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES; +static unsigned long long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES; static bool zerocopy; static void error(const char *s) @@ -133,7 +133,7 @@ static float get_gbps(unsigned long bits, time_t ns_delta) ((float)ns_delta / NSEC_PER_SEC); } -static void run_receiver(unsigned long rcvlowat_bytes) +static void run_receiver(int rcvlowat_bytes) { unsigned int read_cnt; time_t rx_begin_ns; @@ -162,8 +162,8 @@ static void run_receiver(unsigned long rcvlowat_bytes) printf("Run as receiver\n"); printf("Listen port %u\n", port); printf("RX buffer %lu bytes\n", buf_size_bytes); - printf("vsock buffer %lu bytes\n", vsock_buf_bytes); - printf("SO_RCVLOWAT %lu bytes\n", rcvlowat_bytes); + printf("vsock buffer %llu bytes\n", vsock_buf_bytes); + printf("SO_RCVLOWAT %d bytes\n", rcvlowat_bytes); fd = socket(AF_VSOCK, SOCK_STREAM, 0); @@ -251,6 +251,16 @@ static void run_receiver(unsigned long rcvlowat_bytes) close(fd); } +static void enable_so_zerocopy(int fd) +{ + int val = 1; + + if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) { + perror("setsockopt"); + exit(EXIT_FAILURE); + } +} + static void run_sender(int peer_cid, unsigned long to_send_bytes) { time_t tx_begin_ns; @@ -439,7 +449,7 @@ static long strtolx(const char *arg) int main(int argc, char **argv) { unsigned long to_send_bytes = DEFAULT_TO_SEND_BYTES; - unsigned long rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES; + int rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES; int peer_cid = -1; bool sender = false; diff --git a/tools/testing/vsock/vsock_test.c b/tools/testing/vsock/vsock_test.c index 8d38dbf8f41f..d0f6d253ac72 100644 --- a/tools/testing/vsock/vsock_test.c +++ b/tools/testing/vsock/vsock_test.c @@ -22,12 +22,17 @@ #include <signal.h> #include <sys/ioctl.h> #include <linux/sockios.h> +#include <linux/time64.h> #include "vsock_test_zerocopy.h" #include "timeout.h" #include "control.h" #include "util.h" +/* Basic messages for control_writeulong(), control_readulong() */ +#define CONTROL_CONTINUE 1 +#define CONTROL_DONE 0 + static void test_stream_connection_reset(const struct test_opts *opts) { union { @@ -108,24 +113,9 @@ static void test_stream_bind_only_client(const struct test_opts *opts) static void test_stream_bind_only_server(const struct test_opts *opts) { - union { - struct sockaddr sa; - struct sockaddr_vm svm; - } addr = { - .svm = { - .svm_family = AF_VSOCK, - .svm_port = opts->peer_port, - .svm_cid = VMADDR_CID_ANY, - }, - }; int fd; - fd = socket(AF_VSOCK, SOCK_STREAM, 0); - - if (bind(fd, &addr.sa, sizeof(addr.svm)) < 0) { - perror("bind"); - exit(EXIT_FAILURE); - } + fd = vsock_bind(VMADDR_CID_ANY, opts->peer_port, SOCK_STREAM); /* Notify the client that the server is ready */ control_writeln("BIND"); @@ -429,7 +419,7 @@ static void test_seqpacket_msg_bounds_client(const struct test_opts *opts) static void test_seqpacket_msg_bounds_server(const struct test_opts *opts) { - unsigned long sock_buf_size; + unsigned long long sock_buf_size; unsigned long remote_hash; unsigned long curr_hash; int fd; @@ -444,17 +434,13 @@ static void test_seqpacket_msg_bounds_server(const struct test_opts *opts) sock_buf_size = SOCK_BUF_SIZE; - if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE, - &sock_buf_size, sizeof(sock_buf_size))) { - perror("setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)"); - exit(EXIT_FAILURE); - } + setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE, + sock_buf_size, + "setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)"); - if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE, - &sock_buf_size, sizeof(sock_buf_size))) { - perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)"); - exit(EXIT_FAILURE); - } + setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE, + sock_buf_size, + "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)"); /* Ready to receive data. */ control_writeln("SRVREADY"); @@ -563,7 +549,7 @@ static time_t current_nsec(void) exit(EXIT_FAILURE); } - return (ts.tv_sec * 1000000000ULL) + ts.tv_nsec; + return (ts.tv_sec * NSEC_PER_SEC) + ts.tv_nsec; } #define RCVTIMEO_TIMEOUT_SEC 1 @@ -586,10 +572,8 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts) tv.tv_sec = RCVTIMEO_TIMEOUT_SEC; tv.tv_usec = 0; - if (setsockopt(fd, SOL_SOCKET, SO_RCVTIMEO, (void *)&tv, sizeof(tv)) == -1) { - perror("setsockopt(SO_RCVTIMEO)"); - exit(EXIT_FAILURE); - } + setsockopt_timeval_check(fd, SOL_SOCKET, SO_RCVTIMEO, tv, + "setsockopt(SO_RCVTIMEO)"); read_enter_ns = current_nsec(); @@ -605,7 +589,7 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts) } read_overhead_ns = current_nsec() - read_enter_ns - - 1000000000ULL * RCVTIMEO_TIMEOUT_SEC; + NSEC_PER_SEC * RCVTIMEO_TIMEOUT_SEC; if (read_overhead_ns > READ_OVERHEAD_NSEC) { fprintf(stderr, @@ -634,7 +618,8 @@ static void test_seqpacket_timeout_server(const struct test_opts *opts) static void test_seqpacket_bigmsg_client(const struct test_opts *opts) { - unsigned long sock_buf_size; + unsigned long long sock_buf_size; + size_t buf_size; socklen_t len; void *data; int fd; @@ -655,13 +640,20 @@ static void test_seqpacket_bigmsg_client(const struct test_opts *opts) sock_buf_size++; - data = malloc(sock_buf_size); + /* size_t can be < unsigned long long */ + buf_size = (size_t)sock_buf_size; + if (buf_size != sock_buf_size) { + fprintf(stderr, "Returned BUFFER_SIZE too large\n"); + exit(EXIT_FAILURE); + } + + data = malloc(buf_size); if (!data) { perror("malloc"); exit(EXIT_FAILURE); } - send_buf(fd, data, sock_buf_size, 0, -EMSGSIZE); + send_buf(fd, data, buf_size, 0, -EMSGSIZE); control_writeln("CLISENT"); @@ -835,7 +827,7 @@ static void test_stream_poll_rcvlowat_server(const struct test_opts *opts) static void test_stream_poll_rcvlowat_client(const struct test_opts *opts) { - unsigned long lowat_val = RCVLOWAT_BUF_SIZE; + int lowat_val = RCVLOWAT_BUF_SIZE; char buf[RCVLOWAT_BUF_SIZE]; struct pollfd fds; short poll_flags; @@ -847,11 +839,8 @@ static void test_stream_poll_rcvlowat_client(const struct test_opts *opts) exit(EXIT_FAILURE); } - if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT, - &lowat_val, sizeof(lowat_val))) { - perror("setsockopt(SO_RCVLOWAT)"); - exit(EXIT_FAILURE); - } + setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT, + lowat_val, "setsockopt(SO_RCVLOWAT)"); control_expectln("SRVSENT"); @@ -1357,9 +1346,10 @@ static void test_stream_rcvlowat_def_cred_upd_client(const struct test_opts *opt static void test_stream_credit_update_test(const struct test_opts *opts, bool low_rx_bytes_test) { - size_t recv_buf_size; + int recv_buf_size; struct pollfd fds; size_t buf_size; + unsigned long long sock_buf_size; void *buf; int fd; @@ -1371,11 +1361,12 @@ static void test_stream_credit_update_test(const struct test_opts *opts, buf_size = RCVLOWAT_CREDIT_UPD_BUF_SIZE; - if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE, - &buf_size, sizeof(buf_size))) { - perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)"); - exit(EXIT_FAILURE); - } + /* size_t can be < unsigned long long */ + sock_buf_size = buf_size; + + setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE, + sock_buf_size, + "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)"); if (low_rx_bytes_test) { /* Set new SO_RCVLOWAT here. This enables sending credit @@ -1384,11 +1375,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts, */ recv_buf_size = 1 + VIRTIO_VSOCK_MAX_PKT_BUF_SIZE; - if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT, - &recv_buf_size, sizeof(recv_buf_size))) { - perror("setsockopt(SO_RCVLOWAT)"); - exit(EXIT_FAILURE); - } + setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT, + recv_buf_size, "setsockopt(SO_RCVLOWAT)"); } /* Send one dummy byte here, because 'setsockopt()' above also @@ -1430,11 +1418,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts, recv_buf_size++; /* Updating SO_RCVLOWAT will send credit update. */ - if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT, - &recv_buf_size, sizeof(recv_buf_size))) { - perror("setsockopt(SO_RCVLOWAT)"); - exit(EXIT_FAILURE); - } + setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT, + recv_buf_size, "setsockopt(SO_RCVLOWAT)"); } fds.fd = fd; @@ -1478,6 +1463,367 @@ static void test_stream_cred_upd_on_set_rcvlowat(const struct test_opts *opts) test_stream_credit_update_test(opts, false); } +/* The goal of test leak_acceptq is to stress the race between connect() and + * close(listener). Implementation of client/server loops boils down to: + * + * client server + * ------ ------ + * write(CONTINUE) + * expect(CONTINUE) + * listen() + * write(LISTENING) + * expect(LISTENING) + * connect() close() + */ +#define ACCEPTQ_LEAK_RACE_TIMEOUT 2 /* seconds */ + +static void test_stream_leak_acceptq_client(const struct test_opts *opts) +{ + time_t tout; + int fd; + + tout = current_nsec() + ACCEPTQ_LEAK_RACE_TIMEOUT * NSEC_PER_SEC; + do { + control_writeulong(CONTROL_CONTINUE); + + fd = vsock_stream_connect(opts->peer_cid, opts->peer_port); + if (fd >= 0) + close(fd); + } while (current_nsec() < tout); + + control_writeulong(CONTROL_DONE); +} + +/* Test for a memory leak. User is expected to run kmemleak scan, see README. */ +static void test_stream_leak_acceptq_server(const struct test_opts *opts) +{ + int fd; + + while (control_readulong() == CONTROL_CONTINUE) { + fd = vsock_stream_listen(VMADDR_CID_ANY, opts->peer_port); + control_writeln("LISTENING"); + close(fd); + } +} + +/* Test for a memory leak. User is expected to run kmemleak scan, see README. */ +static void test_stream_msgzcopy_leak_errq_client(const struct test_opts *opts) +{ + struct pollfd fds = { 0 }; + int fd; + + fd = vsock_stream_connect(opts->peer_cid, opts->peer_port); + if (fd < 0) { + perror("connect"); + exit(EXIT_FAILURE); + } + + enable_so_zerocopy_check(fd); + send_byte(fd, 1, MSG_ZEROCOPY); + + fds.fd = fd; + fds.events = 0; + if (poll(&fds, 1, -1) < 0) { + perror("poll"); + exit(EXIT_FAILURE); + } + + close(fd); +} + +static void test_stream_msgzcopy_leak_errq_server(const struct test_opts *opts) +{ + int fd; + + fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL); + if (fd < 0) { + perror("accept"); + exit(EXIT_FAILURE); + } + + recv_byte(fd, 1, 0); + vsock_wait_remote_close(fd); + close(fd); +} + +/* Test msgzcopy_leak_zcskb is meant to exercise sendmsg() error handling path, + * that might leak an skb. The idea is to fail virtio_transport_init_zcopy_skb() + * by hitting net.core.optmem_max limit in sock_omalloc(), specifically + * + * vsock_connectible_sendmsg + * virtio_transport_stream_enqueue + * virtio_transport_send_pkt_info + * virtio_transport_init_zcopy_skb + * . msg_zerocopy_realloc + * . msg_zerocopy_alloc + * . sock_omalloc + * . sk_omem_alloc + size > sysctl_optmem_max + * return -ENOMEM + * + * We abuse the implementation detail of net/socket.c:____sys_sendmsg(). + * sk_omem_alloc can be precisely bumped by sock_kmalloc(), as it is used to + * fetch user-provided control data. + * + * While this approach works for now, it relies on assumptions regarding the + * implementation and configuration (for example, order of net.core.optmem_max + * can not exceed MAX_PAGE_ORDER), which may not hold in the future. A more + * resilient testing could be implemented by leveraging the Fault injection + * framework (CONFIG_FAULT_INJECTION), e.g. + * + * client# echo N > /sys/kernel/debug/failslab/ignore-gfp-wait + * client# echo 0 > /sys/kernel/debug/failslab/verbose + * + * void client(const struct test_opts *opts) + * { + * char buf[16]; + * int f, s, i; + * + * f = open("/proc/self/fail-nth", O_WRONLY); + * + * for (i = 1; i < 32; i++) { + * control_writeulong(CONTROL_CONTINUE); + * + * s = vsock_stream_connect(opts->peer_cid, opts->peer_port); + * enable_so_zerocopy_check(s); + * + * sprintf(buf, "%d", i); + * write(f, buf, strlen(buf)); + * + * send(s, &(char){ 0 }, 1, MSG_ZEROCOPY); + * + * write(f, "0", 1); + * close(s); + * } + * + * control_writeulong(CONTROL_DONE); + * close(f); + * } + * + * void server(const struct test_opts *opts) + * { + * int fd; + * + * while (control_readulong() == CONTROL_CONTINUE) { + * fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL); + * vsock_wait_remote_close(fd); + * close(fd); + * } + * } + * + * Refer to Documentation/fault-injection/fault-injection.rst. + */ +#define MAX_PAGE_ORDER 10 /* usually */ +#define PAGE_SIZE 4096 + +/* Test for a memory leak. User is expected to run kmemleak scan, see README. */ +static void test_stream_msgzcopy_leak_zcskb_client(const struct test_opts *opts) +{ + size_t optmem_max, ctl_len, chunk_size; + struct msghdr msg = { 0 }; + struct iovec iov; + char *chunk; + int fd, res; + FILE *f; + + f = fopen("/proc/sys/net/core/optmem_max", "r"); + if (!f) { + perror("fopen(optmem_max)"); + exit(EXIT_FAILURE); + } + + if (fscanf(f, "%zu", &optmem_max) != 1) { + fprintf(stderr, "fscanf(optmem_max) failed\n"); + exit(EXIT_FAILURE); + } + + fclose(f); + + fd = vsock_stream_connect(opts->peer_cid, opts->peer_port); + if (fd < 0) { + perror("connect"); + exit(EXIT_FAILURE); + } + + enable_so_zerocopy_check(fd); + + ctl_len = optmem_max - 1; + if (ctl_len > PAGE_SIZE << MAX_PAGE_ORDER) { + fprintf(stderr, "Try with net.core.optmem_max = 100000\n"); + exit(EXIT_FAILURE); + } + + chunk_size = CMSG_SPACE(ctl_len); + chunk = malloc(chunk_size); + if (!chunk) { + perror("malloc"); + exit(EXIT_FAILURE); + } + memset(chunk, 0, chunk_size); + + iov.iov_base = &(char){ 0 }; + iov.iov_len = 1; + + msg.msg_iov = &iov; + msg.msg_iovlen = 1; + msg.msg_control = chunk; + msg.msg_controllen = ctl_len; + + errno = 0; + res = sendmsg(fd, &msg, MSG_ZEROCOPY); + if (res >= 0 || errno != ENOMEM) { + fprintf(stderr, "Expected ENOMEM, got errno=%d res=%d\n", + errno, res); + exit(EXIT_FAILURE); + } + + close(fd); +} + +static void test_stream_msgzcopy_leak_zcskb_server(const struct test_opts *opts) +{ + int fd; + + fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL); + if (fd < 0) { + perror("accept"); + exit(EXIT_FAILURE); + } + + vsock_wait_remote_close(fd); + close(fd); +} + +#define MAX_PORT_RETRIES 24 /* net/vmw_vsock/af_vsock.c */ + +/* Test attempts to trigger a transport release for an unbound socket. This can + * lead to a reference count mishandling. + */ +static void test_stream_transport_uaf_client(const struct test_opts *opts) +{ + int sockets[MAX_PORT_RETRIES]; + struct sockaddr_vm addr; + int fd, i, alen; + + fd = vsock_bind(VMADDR_CID_ANY, VMADDR_PORT_ANY, SOCK_STREAM); + + alen = sizeof(addr); + if (getsockname(fd, (struct sockaddr *)&addr, &alen)) { + perror("getsockname"); + exit(EXIT_FAILURE); + } + + for (i = 0; i < MAX_PORT_RETRIES; ++i) + sockets[i] = vsock_bind(VMADDR_CID_ANY, ++addr.svm_port, + SOCK_STREAM); + + close(fd); + fd = socket(AF_VSOCK, SOCK_STREAM, 0); + if (fd < 0) { + perror("socket"); + exit(EXIT_FAILURE); + } + + if (!vsock_connect_fd(fd, addr.svm_cid, addr.svm_port)) { + perror("Unexpected connect() #1 success"); + exit(EXIT_FAILURE); + } + + /* Vulnerable system may crash now. */ + if (!vsock_connect_fd(fd, VMADDR_CID_HOST, VMADDR_PORT_ANY)) { + perror("Unexpected connect() #2 success"); + exit(EXIT_FAILURE); + } + + close(fd); + while (i--) + close(sockets[i]); + + control_writeln("DONE"); +} + +static void test_stream_transport_uaf_server(const struct test_opts *opts) +{ + control_expectln("DONE"); +} + +static void test_stream_connect_retry_client(const struct test_opts *opts) +{ + int fd; + + fd = socket(AF_VSOCK, SOCK_STREAM, 0); + if (fd < 0) { + perror("socket"); + exit(EXIT_FAILURE); + } + + if (!vsock_connect_fd(fd, opts->peer_cid, opts->peer_port)) { + fprintf(stderr, "Unexpected connect() #1 success\n"); + exit(EXIT_FAILURE); + } + + control_writeln("LISTEN"); + control_expectln("LISTENING"); + + if (vsock_connect_fd(fd, opts->peer_cid, opts->peer_port)) { + perror("connect() #2"); + exit(EXIT_FAILURE); + } + + close(fd); +} + +static void test_stream_connect_retry_server(const struct test_opts *opts) +{ + int fd; + + control_expectln("LISTEN"); + + fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL); + if (fd < 0) { + perror("accept"); + exit(EXIT_FAILURE); + } + + vsock_wait_remote_close(fd); + close(fd); +} + +static void test_stream_linger_client(const struct test_opts *opts) +{ + struct linger optval = { + .l_onoff = 1, + .l_linger = 1 + }; + int fd; + + fd = vsock_stream_connect(opts->peer_cid, opts->peer_port); + if (fd < 0) { + perror("connect"); + exit(EXIT_FAILURE); + } + + if (setsockopt(fd, SOL_SOCKET, SO_LINGER, &optval, sizeof(optval))) { + perror("setsockopt(SO_LINGER)"); + exit(EXIT_FAILURE); + } + + close(fd); +} + +static void test_stream_linger_server(const struct test_opts *opts) +{ + int fd; + + fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL); + if (fd < 0) { + perror("accept"); + exit(EXIT_FAILURE); + } + + vsock_wait_remote_close(fd); + close(fd); +} + static struct test_case test_cases[] = { { .name = "SOCK_STREAM connection reset", @@ -1608,6 +1954,36 @@ static struct test_case test_cases[] = { .run_client = test_seqpacket_unsent_bytes_client, .run_server = test_seqpacket_unsent_bytes_server, }, + { + .name = "SOCK_STREAM leak accept queue", + .run_client = test_stream_leak_acceptq_client, + .run_server = test_stream_leak_acceptq_server, + }, + { + .name = "SOCK_STREAM MSG_ZEROCOPY leak MSG_ERRQUEUE", + .run_client = test_stream_msgzcopy_leak_errq_client, + .run_server = test_stream_msgzcopy_leak_errq_server, + }, + { + .name = "SOCK_STREAM MSG_ZEROCOPY leak completion skb", + .run_client = test_stream_msgzcopy_leak_zcskb_client, + .run_server = test_stream_msgzcopy_leak_zcskb_server, + }, + { + .name = "SOCK_STREAM transport release use-after-free", + .run_client = test_stream_transport_uaf_client, + .run_server = test_stream_transport_uaf_server, + }, + { + .name = "SOCK_STREAM retry failed connect()", + .run_client = test_stream_connect_retry_client, + .run_server = test_stream_connect_retry_server, + }, + { + .name = "SOCK_STREAM SO_LINGER null-ptr-deref", + .run_client = test_stream_linger_client, + .run_server = test_stream_linger_server, + }, {}, }; @@ -1649,6 +2025,11 @@ static const struct option longopts[] = { .val = 's', }, { + .name = "pick", + .has_arg = required_argument, + .val = 't', + }, + { .name = "help", .has_arg = no_argument, .val = '?', @@ -1685,6 +2066,8 @@ static void usage(void) " --peer-cid <cid> CID of the other side\n" " --peer-port <port> AF_VSOCK port used for the test [default: %d]\n" " --list List of tests that will be executed\n" + " --pick <test_id> Test ID to execute selectively;\n" + " use multiple --pick options to select more tests\n" " --skip <test_id> Test ID to skip;\n" " use multiple --skip options to skip more tests\n", DEFAULT_PEER_PORT @@ -1741,6 +2124,10 @@ int main(int argc, char **argv) skip_test(test_cases, ARRAY_SIZE(test_cases) - 1, optarg); break; + case 't': + pick_test(test_cases, ARRAY_SIZE(test_cases) - 1, + optarg); + break; case '?': default: usage(); diff --git a/tools/testing/vsock/vsock_test_zerocopy.c b/tools/testing/vsock/vsock_test_zerocopy.c index 04c376b6937f..9d9a6cb9614a 100644 --- a/tools/testing/vsock/vsock_test_zerocopy.c +++ b/tools/testing/vsock/vsock_test_zerocopy.c @@ -162,7 +162,7 @@ static void test_client(const struct test_opts *opts, } if (test_data->so_zerocopy) - enable_so_zerocopy(fd); + enable_so_zerocopy_check(fd); iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt); diff --git a/tools/testing/vsock/vsock_uring_test.c b/tools/testing/vsock/vsock_uring_test.c index 6c3e6f70c457..5c3078969659 100644 --- a/tools/testing/vsock/vsock_uring_test.c +++ b/tools/testing/vsock/vsock_uring_test.c @@ -73,7 +73,7 @@ static void vsock_io_uring_client(const struct test_opts *opts, } if (msg_zerocopy) - enable_so_zerocopy(fd); + enable_so_zerocopy_check(fd); iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt); |