diff options
Diffstat (limited to 'tools')
260 files changed, 12746 insertions, 2164 deletions
diff --git a/tools/arch/frv/include/uapi/asm/bitsperlong.h b/tools/arch/frv/include/uapi/asm/bitsperlong.h deleted file mode 100644 index 76da34b10f59..000000000000 --- a/tools/arch/frv/include/uapi/asm/bitsperlong.h +++ /dev/null @@ -1,2 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#include <asm-generic/bitsperlong.h> diff --git a/tools/arch/frv/include/uapi/asm/mman.h b/tools/arch/frv/include/uapi/asm/mman.h deleted file mode 100644 index 5bc900b0bc78..000000000000 --- a/tools/arch/frv/include/uapi/asm/mman.h +++ /dev/null @@ -1,7 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef TOOLS_ARCH_FRV_UAPI_ASM_MMAN_FIX_H -#define TOOLS_ARCH_FRV_UAPI_ASM_MMAN_FIX_H -#include <uapi/asm-generic/mman.h> -/* MAP_32BIT is undefined on frv, fix it for perf */ -#define MAP_32BIT 0 -#endif diff --git a/tools/arch/m32r/include/uapi/asm/bitsperlong.h b/tools/arch/m32r/include/uapi/asm/bitsperlong.h deleted file mode 100644 index 76da34b10f59..000000000000 --- a/tools/arch/m32r/include/uapi/asm/bitsperlong.h +++ /dev/null @@ -1,2 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#include <asm-generic/bitsperlong.h> diff --git a/tools/arch/m32r/include/uapi/asm/mman.h b/tools/arch/m32r/include/uapi/asm/mman.h deleted file mode 100644 index d19b82c9c290..000000000000 --- a/tools/arch/m32r/include/uapi/asm/mman.h +++ /dev/null @@ -1,7 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef TOOLS_ARCH_M32R_UAPI_ASM_MMAN_FIX_H -#define TOOLS_ARCH_M32R_UAPI_ASM_MMAN_FIX_H -#include <uapi/asm-generic/mman.h> -/* MAP_32BIT is undefined on m32r, fix it for perf */ -#define MAP_32BIT 0 -#endif diff --git a/tools/arch/mn10300/include/uapi/asm/bitsperlong.h b/tools/arch/mn10300/include/uapi/asm/bitsperlong.h deleted file mode 100644 index 6dc0bb0c13b2..000000000000 --- a/tools/arch/mn10300/include/uapi/asm/bitsperlong.h +++ /dev/null @@ -1 +0,0 @@ -#include <asm-generic/bitsperlong.h> diff --git a/tools/arch/mn10300/include/uapi/asm/mman.h b/tools/arch/mn10300/include/uapi/asm/mman.h deleted file mode 100644 index b9360639974f..000000000000 --- a/tools/arch/mn10300/include/uapi/asm/mman.h +++ /dev/null @@ -1,7 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef TOOLS_ARCH_MN10300_UAPI_ASM_MMAN_FIX_H -#define TOOLS_ARCH_MN10300_UAPI_ASM_MMAN_FIX_H -#include <uapi/asm-generic/mman.h> -/* MAP_32BIT is undefined on mn10300, fix it for perf */ -#define MAP_32BIT 0 -#endif diff --git a/tools/arch/powerpc/include/uapi/asm/unistd.h b/tools/arch/powerpc/include/uapi/asm/unistd.h new file mode 100644 index 000000000000..389c36fd8299 --- /dev/null +++ b/tools/arch/powerpc/include/uapi/asm/unistd.h @@ -0,0 +1,402 @@ +/* SPDX-License-Identifier: GPL-2.0+ WITH Linux-syscall-note */ +/* + * This file contains the system call numbers. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + */ +#ifndef _UAPI_ASM_POWERPC_UNISTD_H_ +#define _UAPI_ASM_POWERPC_UNISTD_H_ + + +#define __NR_restart_syscall 0 +#define __NR_exit 1 +#define __NR_fork 2 +#define __NR_read 3 +#define __NR_write 4 +#define __NR_open 5 +#define __NR_close 6 +#define __NR_waitpid 7 +#define __NR_creat 8 +#define __NR_link 9 +#define __NR_unlink 10 +#define __NR_execve 11 +#define __NR_chdir 12 +#define __NR_time 13 +#define __NR_mknod 14 +#define __NR_chmod 15 +#define __NR_lchown 16 +#define __NR_break 17 +#define __NR_oldstat 18 +#define __NR_lseek 19 +#define __NR_getpid 20 +#define __NR_mount 21 +#define __NR_umount 22 +#define __NR_setuid 23 +#define __NR_getuid 24 +#define __NR_stime 25 +#define __NR_ptrace 26 +#define __NR_alarm 27 +#define __NR_oldfstat 28 +#define __NR_pause 29 +#define __NR_utime 30 +#define __NR_stty 31 +#define __NR_gtty 32 +#define __NR_access 33 +#define __NR_nice 34 +#define __NR_ftime 35 +#define __NR_sync 36 +#define __NR_kill 37 +#define __NR_rename 38 +#define __NR_mkdir 39 +#define __NR_rmdir 40 +#define __NR_dup 41 +#define __NR_pipe 42 +#define __NR_times 43 +#define __NR_prof 44 +#define __NR_brk 45 +#define __NR_setgid 46 +#define __NR_getgid 47 +#define __NR_signal 48 +#define __NR_geteuid 49 +#define __NR_getegid 50 +#define __NR_acct 51 +#define __NR_umount2 52 +#define __NR_lock 53 +#define __NR_ioctl 54 +#define __NR_fcntl 55 +#define __NR_mpx 56 +#define __NR_setpgid 57 +#define __NR_ulimit 58 +#define __NR_oldolduname 59 +#define __NR_umask 60 +#define __NR_chroot 61 +#define __NR_ustat 62 +#define __NR_dup2 63 +#define __NR_getppid 64 +#define __NR_getpgrp 65 +#define __NR_setsid 66 +#define __NR_sigaction 67 +#define __NR_sgetmask 68 +#define __NR_ssetmask 69 +#define __NR_setreuid 70 +#define __NR_setregid 71 +#define __NR_sigsuspend 72 +#define __NR_sigpending 73 +#define __NR_sethostname 74 +#define __NR_setrlimit 75 +#define __NR_getrlimit 76 +#define __NR_getrusage 77 +#define __NR_gettimeofday 78 +#define __NR_settimeofday 79 +#define __NR_getgroups 80 +#define __NR_setgroups 81 +#define __NR_select 82 +#define __NR_symlink 83 +#define __NR_oldlstat 84 +#define __NR_readlink 85 +#define __NR_uselib 86 +#define __NR_swapon 87 +#define __NR_reboot 88 +#define __NR_readdir 89 +#define __NR_mmap 90 +#define __NR_munmap 91 +#define __NR_truncate 92 +#define __NR_ftruncate 93 +#define __NR_fchmod 94 +#define __NR_fchown 95 +#define __NR_getpriority 96 +#define __NR_setpriority 97 +#define __NR_profil 98 +#define __NR_statfs 99 +#define __NR_fstatfs 100 +#define __NR_ioperm 101 +#define __NR_socketcall 102 +#define __NR_syslog 103 +#define __NR_setitimer 104 +#define __NR_getitimer 105 +#define __NR_stat 106 +#define __NR_lstat 107 +#define __NR_fstat 108 +#define __NR_olduname 109 +#define __NR_iopl 110 +#define __NR_vhangup 111 +#define __NR_idle 112 +#define __NR_vm86 113 +#define __NR_wait4 114 +#define __NR_swapoff 115 +#define __NR_sysinfo 116 +#define __NR_ipc 117 +#define __NR_fsync 118 +#define __NR_sigreturn 119 +#define __NR_clone 120 +#define __NR_setdomainname 121 +#define __NR_uname 122 +#define __NR_modify_ldt 123 +#define __NR_adjtimex 124 +#define __NR_mprotect 125 +#define __NR_sigprocmask 126 +#define __NR_create_module 127 +#define __NR_init_module 128 +#define __NR_delete_module 129 +#define __NR_get_kernel_syms 130 +#define __NR_quotactl 131 +#define __NR_getpgid 132 +#define __NR_fchdir 133 +#define __NR_bdflush 134 +#define __NR_sysfs 135 +#define __NR_personality 136 +#define __NR_afs_syscall 137 /* Syscall for Andrew File System */ +#define __NR_setfsuid 138 +#define __NR_setfsgid 139 +#define __NR__llseek 140 +#define __NR_getdents 141 +#define __NR__newselect 142 +#define __NR_flock 143 +#define __NR_msync 144 +#define __NR_readv 145 +#define __NR_writev 146 +#define __NR_getsid 147 +#define __NR_fdatasync 148 +#define __NR__sysctl 149 +#define __NR_mlock 150 +#define __NR_munlock 151 +#define __NR_mlockall 152 +#define __NR_munlockall 153 +#define __NR_sched_setparam 154 +#define __NR_sched_getparam 155 +#define __NR_sched_setscheduler 156 +#define __NR_sched_getscheduler 157 +#define __NR_sched_yield 158 +#define __NR_sched_get_priority_max 159 +#define __NR_sched_get_priority_min 160 +#define __NR_sched_rr_get_interval 161 +#define __NR_nanosleep 162 +#define __NR_mremap 163 +#define __NR_setresuid 164 +#define __NR_getresuid 165 +#define __NR_query_module 166 +#define __NR_poll 167 +#define __NR_nfsservctl 168 +#define __NR_setresgid 169 +#define __NR_getresgid 170 +#define __NR_prctl 171 +#define __NR_rt_sigreturn 172 +#define __NR_rt_sigaction 173 +#define __NR_rt_sigprocmask 174 +#define __NR_rt_sigpending 175 +#define __NR_rt_sigtimedwait 176 +#define __NR_rt_sigqueueinfo 177 +#define __NR_rt_sigsuspend 178 +#define __NR_pread64 179 +#define __NR_pwrite64 180 +#define __NR_chown 181 +#define __NR_getcwd 182 +#define __NR_capget 183 +#define __NR_capset 184 +#define __NR_sigaltstack 185 +#define __NR_sendfile 186 +#define __NR_getpmsg 187 /* some people actually want streams */ +#define __NR_putpmsg 188 /* some people actually want streams */ +#define __NR_vfork 189 +#define __NR_ugetrlimit 190 /* SuS compliant getrlimit */ +#define __NR_readahead 191 +#ifndef __powerpc64__ /* these are 32-bit only */ +#define __NR_mmap2 192 +#define __NR_truncate64 193 +#define __NR_ftruncate64 194 +#define __NR_stat64 195 +#define __NR_lstat64 196 +#define __NR_fstat64 197 +#endif +#define __NR_pciconfig_read 198 +#define __NR_pciconfig_write 199 +#define __NR_pciconfig_iobase 200 +#define __NR_multiplexer 201 +#define __NR_getdents64 202 +#define __NR_pivot_root 203 +#ifndef __powerpc64__ +#define __NR_fcntl64 204 +#endif +#define __NR_madvise 205 +#define __NR_mincore 206 +#define __NR_gettid 207 +#define __NR_tkill 208 +#define __NR_setxattr 209 +#define __NR_lsetxattr 210 +#define __NR_fsetxattr 211 +#define __NR_getxattr 212 +#define __NR_lgetxattr 213 +#define __NR_fgetxattr 214 +#define __NR_listxattr 215 +#define __NR_llistxattr 216 +#define __NR_flistxattr 217 +#define __NR_removexattr 218 +#define __NR_lremovexattr 219 +#define __NR_fremovexattr 220 +#define __NR_futex 221 +#define __NR_sched_setaffinity 222 +#define __NR_sched_getaffinity 223 +/* 224 currently unused */ +#define __NR_tuxcall 225 +#ifndef __powerpc64__ +#define __NR_sendfile64 226 +#endif +#define __NR_io_setup 227 +#define __NR_io_destroy 228 +#define __NR_io_getevents 229 +#define __NR_io_submit 230 +#define __NR_io_cancel 231 +#define __NR_set_tid_address 232 +#define __NR_fadvise64 233 +#define __NR_exit_group 234 +#define __NR_lookup_dcookie 235 +#define __NR_epoll_create 236 +#define __NR_epoll_ctl 237 +#define __NR_epoll_wait 238 +#define __NR_remap_file_pages 239 +#define __NR_timer_create 240 +#define __NR_timer_settime 241 +#define __NR_timer_gettime 242 +#define __NR_timer_getoverrun 243 +#define __NR_timer_delete 244 +#define __NR_clock_settime 245 +#define __NR_clock_gettime 246 +#define __NR_clock_getres 247 +#define __NR_clock_nanosleep 248 +#define __NR_swapcontext 249 +#define __NR_tgkill 250 +#define __NR_utimes 251 +#define __NR_statfs64 252 +#define __NR_fstatfs64 253 +#ifndef __powerpc64__ +#define __NR_fadvise64_64 254 +#endif +#define __NR_rtas 255 +#define __NR_sys_debug_setcontext 256 +/* Number 257 is reserved for vserver */ +#define __NR_migrate_pages 258 +#define __NR_mbind 259 +#define __NR_get_mempolicy 260 +#define __NR_set_mempolicy 261 +#define __NR_mq_open 262 +#define __NR_mq_unlink 263 +#define __NR_mq_timedsend 264 +#define __NR_mq_timedreceive 265 +#define __NR_mq_notify 266 +#define __NR_mq_getsetattr 267 +#define __NR_kexec_load 268 +#define __NR_add_key 269 +#define __NR_request_key 270 +#define __NR_keyctl 271 +#define __NR_waitid 272 +#define __NR_ioprio_set 273 +#define __NR_ioprio_get 274 +#define __NR_inotify_init 275 +#define __NR_inotify_add_watch 276 +#define __NR_inotify_rm_watch 277 +#define __NR_spu_run 278 +#define __NR_spu_create 279 +#define __NR_pselect6 280 +#define __NR_ppoll 281 +#define __NR_unshare 282 +#define __NR_splice 283 +#define __NR_tee 284 +#define __NR_vmsplice 285 +#define __NR_openat 286 +#define __NR_mkdirat 287 +#define __NR_mknodat 288 +#define __NR_fchownat 289 +#define __NR_futimesat 290 +#ifdef __powerpc64__ +#define __NR_newfstatat 291 +#else +#define __NR_fstatat64 291 +#endif +#define __NR_unlinkat 292 +#define __NR_renameat 293 +#define __NR_linkat 294 +#define __NR_symlinkat 295 +#define __NR_readlinkat 296 +#define __NR_fchmodat 297 +#define __NR_faccessat 298 +#define __NR_get_robust_list 299 +#define __NR_set_robust_list 300 +#define __NR_move_pages 301 +#define __NR_getcpu 302 +#define __NR_epoll_pwait 303 +#define __NR_utimensat 304 +#define __NR_signalfd 305 +#define __NR_timerfd_create 306 +#define __NR_eventfd 307 +#define __NR_sync_file_range2 308 +#define __NR_fallocate 309 +#define __NR_subpage_prot 310 +#define __NR_timerfd_settime 311 +#define __NR_timerfd_gettime 312 +#define __NR_signalfd4 313 +#define __NR_eventfd2 314 +#define __NR_epoll_create1 315 +#define __NR_dup3 316 +#define __NR_pipe2 317 +#define __NR_inotify_init1 318 +#define __NR_perf_event_open 319 +#define __NR_preadv 320 +#define __NR_pwritev 321 +#define __NR_rt_tgsigqueueinfo 322 +#define __NR_fanotify_init 323 +#define __NR_fanotify_mark 324 +#define __NR_prlimit64 325 +#define __NR_socket 326 +#define __NR_bind 327 +#define __NR_connect 328 +#define __NR_listen 329 +#define __NR_accept 330 +#define __NR_getsockname 331 +#define __NR_getpeername 332 +#define __NR_socketpair 333 +#define __NR_send 334 +#define __NR_sendto 335 +#define __NR_recv 336 +#define __NR_recvfrom 337 +#define __NR_shutdown 338 +#define __NR_setsockopt 339 +#define __NR_getsockopt 340 +#define __NR_sendmsg 341 +#define __NR_recvmsg 342 +#define __NR_recvmmsg 343 +#define __NR_accept4 344 +#define __NR_name_to_handle_at 345 +#define __NR_open_by_handle_at 346 +#define __NR_clock_adjtime 347 +#define __NR_syncfs 348 +#define __NR_sendmmsg 349 +#define __NR_setns 350 +#define __NR_process_vm_readv 351 +#define __NR_process_vm_writev 352 +#define __NR_finit_module 353 +#define __NR_kcmp 354 +#define __NR_sched_setattr 355 +#define __NR_sched_getattr 356 +#define __NR_renameat2 357 +#define __NR_seccomp 358 +#define __NR_getrandom 359 +#define __NR_memfd_create 360 +#define __NR_bpf 361 +#define __NR_execveat 362 +#define __NR_switch_endian 363 +#define __NR_userfaultfd 364 +#define __NR_membarrier 365 +#define __NR_mlock2 378 +#define __NR_copy_file_range 379 +#define __NR_preadv2 380 +#define __NR_pwritev2 381 +#define __NR_kexec_file_load 382 +#define __NR_statx 383 +#define __NR_pkey_alloc 384 +#define __NR_pkey_free 385 +#define __NR_pkey_mprotect 386 + +#endif /* _UAPI_ASM_POWERPC_UNISTD_H_ */ diff --git a/tools/arch/score/include/uapi/asm/bitsperlong.h b/tools/arch/score/include/uapi/asm/bitsperlong.h deleted file mode 100644 index df48f2717da2..000000000000 --- a/tools/arch/score/include/uapi/asm/bitsperlong.h +++ /dev/null @@ -1,7 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef _ASM_SCORE_BITSPERLONG_H -#define _ASM_SCORE_BITSPERLONG_H - -#include <asm-generic/bitsperlong.h> - -#endif /* _ASM_SCORE_BITSPERLONG_H */ diff --git a/tools/arch/score/include/uapi/asm/mman.h b/tools/arch/score/include/uapi/asm/mman.h deleted file mode 100644 index b4bd195a8586..000000000000 --- a/tools/arch/score/include/uapi/asm/mman.h +++ /dev/null @@ -1,7 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef TOOLS_ARCH_SCORE_UAPI_ASM_MMAN_FIX_H -#define TOOLS_ARCH_SCORE_UAPI_ASM_MMAN_FIX_H -#include <uapi/asm-generic/mman.h> -/* MAP_32BIT is undefined on score, fix it for perf */ -#define MAP_32BIT 0 -#endif diff --git a/tools/arch/tile/include/asm/barrier.h b/tools/arch/tile/include/asm/barrier.h deleted file mode 100644 index 7ad02a591b43..000000000000 --- a/tools/arch/tile/include/asm/barrier.h +++ /dev/null @@ -1,16 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 */ -#ifndef _TOOLS_LINUX_ASM_TILE_BARRIER_H -#define _TOOLS_LINUX_ASM_TILE_BARRIER_H -/* - * FIXME: This came from tools/perf/perf-sys.h, where it was first introduced - * in 620830b6954913647b7c7f68920cf48eddf6ad92, more work needed to make it - * more closely follow the Linux kernel arch/tile/include/asm/barrier.h file. - * Probably when we continue work on tools/ Kconfig support to have all the - * CONFIG_ needed for properly doing that. - */ - -#define mb() asm volatile ("mf" ::: "memory") -#define wmb() mb() -#define rmb() mb() - -#endif /* _TOOLS_LINUX_ASM_TILE_BARRIER_H */ diff --git a/tools/arch/tile/include/uapi/asm/bitsperlong.h b/tools/arch/tile/include/uapi/asm/bitsperlong.h deleted file mode 100644 index 57cca78c0fbb..000000000000 --- a/tools/arch/tile/include/uapi/asm/bitsperlong.h +++ /dev/null @@ -1,27 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -/* - * Copyright 2010 Tilera Corporation. All Rights Reserved. - * - * This program is free software; you can redistribute it and/or - * modify it under the terms of the GNU General Public License - * as published by the Free Software Foundation, version 2. - * - * This program is distributed in the hope that it will be useful, but - * WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE, GOOD TITLE or - * NON INFRINGEMENT. See the GNU General Public License for - * more details. - */ - -#ifndef _ASM_TILE_BITSPERLONG_H -#define _ASM_TILE_BITSPERLONG_H - -#ifdef __LP64__ -# define __BITS_PER_LONG 64 -#else -# define __BITS_PER_LONG 32 -#endif - -#include <asm-generic/bitsperlong.h> - -#endif /* _ASM_TILE_BITSPERLONG_H */ diff --git a/tools/arch/tile/include/uapi/asm/mman.h b/tools/arch/tile/include/uapi/asm/mman.h deleted file mode 100644 index 65ec92925c6c..000000000000 --- a/tools/arch/tile/include/uapi/asm/mman.h +++ /dev/null @@ -1,16 +0,0 @@ -/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ -#ifndef TOOLS_ARCH_TILE_UAPI_ASM_MMAN_FIX_H -#define TOOLS_ARCH_TILE_UAPI_ASM_MMAN_FIX_H -#define MAP_DENYWRITE 0x0800 -#define MAP_EXECUTABLE 0x1000 -#define MAP_GROWSDOWN 0x0100 -#define MAP_HUGETLB 0x4000 -#define MAP_LOCKED 0x0200 -#define MAP_NONBLOCK 0x0080 -#define MAP_NORESERVE 0x0400 -#define MAP_POPULATE 0x0040 -#define MAP_STACK MAP_GROWSDOWN -#include <uapi/asm-generic/mman-common.h> -/* MAP_32BIT is undefined on tile, fix it for perf */ -#define MAP_32BIT 0 -#endif diff --git a/tools/arch/x86/include/asm/cpufeatures.h b/tools/arch/x86/include/asm/cpufeatures.h index 0dfe4d3f74e2..f41079da38c5 100644 --- a/tools/arch/x86/include/asm/cpufeatures.h +++ b/tools/arch/x86/include/asm/cpufeatures.h @@ -213,6 +213,7 @@ #define X86_FEATURE_SEV ( 7*32+20) /* AMD Secure Encrypted Virtualization */ #define X86_FEATURE_USE_IBPB ( 7*32+21) /* "" Indirect Branch Prediction Barrier enabled */ +#define X86_FEATURE_USE_IBRS_FW ( 7*32+22) /* "" Use IBRS during runtime firmware calls */ /* Virtualization flags: Linux defined, word 8 */ #define X86_FEATURE_TPR_SHADOW ( 8*32+ 0) /* Intel TPR Shadow */ diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c index 0b482c0070e0..465995281dcd 100644 --- a/tools/bpf/bpftool/common.c +++ b/tools/bpf/bpftool/common.c @@ -55,6 +55,10 @@ #include "main.h" +#ifndef BPF_FS_MAGIC +#define BPF_FS_MAGIC 0xcafe4a11 +#endif + void p_err(const char *fmt, ...) { va_list ap; diff --git a/tools/bpf/bpftool/map.c b/tools/bpf/bpftool/map.c index f95fa67bb498..f509c86faede 100644 --- a/tools/bpf/bpftool/map.c +++ b/tools/bpf/bpftool/map.c @@ -428,7 +428,7 @@ static int show_map_close_json(int fd, struct bpf_map_info *info) jsonw_string_field(json_wtr, "name", info->name); jsonw_name(json_wtr, "flags"); - jsonw_printf(json_wtr, "%#x", info->map_flags); + jsonw_printf(json_wtr, "%d", info->map_flags); print_dev_json(info->ifindex, info->netns_dev, info->netns_ino); diff --git a/tools/build/Makefile.feature b/tools/build/Makefile.feature index c378f003b007..5b6dda3b1ca8 100644 --- a/tools/build/Makefile.feature +++ b/tools/build/Makefile.feature @@ -82,7 +82,11 @@ FEATURE_TESTS_EXTRA := \ liberty-z \ libunwind-debug-frame \ libunwind-debug-frame-arm \ - libunwind-debug-frame-aarch64 + libunwind-debug-frame-aarch64 \ + cxx \ + llvm \ + llvm-version \ + clang FEATURE_TESTS ?= $(FEATURE_TESTS_BASIC) diff --git a/tools/build/feature/Makefile b/tools/build/feature/Makefile index 0a490cb15149..dac9563b5470 100644 --- a/tools/build/feature/Makefile +++ b/tools/build/feature/Makefile @@ -54,7 +54,10 @@ FILES= \ test-jvmti.bin \ test-sched_getcpu.bin \ test-setns.bin \ - test-libopencsd.bin + test-libopencsd.bin \ + test-clang.bin \ + test-llvm.bin \ + test-llvm-version.bin FILES := $(addprefix $(OUTPUT),$(FILES)) @@ -257,11 +260,13 @@ $(OUTPUT)test-llvm.bin: -I$(shell $(LLVM_CONFIG) --includedir) \ -L$(shell $(LLVM_CONFIG) --libdir) \ $(shell $(LLVM_CONFIG) --libs Core BPF) \ - $(shell $(LLVM_CONFIG) --system-libs) + $(shell $(LLVM_CONFIG) --system-libs) \ + > $(@:.bin=.make.output) 2>&1 $(OUTPUT)test-llvm-version.bin: $(BUILDXX) -std=gnu++11 \ - -I$(shell $(LLVM_CONFIG) --includedir) + -I$(shell $(LLVM_CONFIG) --includedir) \ + > $(@:.bin=.make.output) 2>&1 $(OUTPUT)test-clang.bin: $(BUILDXX) -std=gnu++11 \ @@ -271,7 +276,8 @@ $(OUTPUT)test-clang.bin: -lclangFrontend -lclangEdit -lclangLex \ -lclangAST -Wl,--end-group \ $(shell $(LLVM_CONFIG) --libs Core option) \ - $(shell $(LLVM_CONFIG) --system-libs) + $(shell $(LLVM_CONFIG) --system-libs) \ + > $(@:.bin=.make.output) 2>&1 -include $(OUTPUT)*.d diff --git a/tools/include/asm-generic/barrier.h b/tools/include/asm-generic/barrier.h index 47b933903eaf..52278d880a61 100644 --- a/tools/include/asm-generic/barrier.h +++ b/tools/include/asm-generic/barrier.h @@ -1,7 +1,7 @@ /* * Copied from the kernel sources to tools/perf/: * - * Generic barrier definitions, originally based on MN10300 definitions. + * Generic barrier definitions. * * It should be possible to use these on really simple architectures, * but it serves more as a starting point for new ports. diff --git a/tools/include/linux/bitmap.h b/tools/include/linux/bitmap.h index ca160270fdfa..63440cc8d618 100644 --- a/tools/include/linux/bitmap.h +++ b/tools/include/linux/bitmap.h @@ -98,7 +98,7 @@ static inline int test_and_set_bit(int nr, unsigned long *addr) /** * bitmap_alloc - Allocate bitmap - * @nr: Bit to set + * @nbits: Number of bits */ static inline unsigned long *bitmap_alloc(int nbits) { diff --git a/tools/include/uapi/linux/kvm.h b/tools/include/uapi/linux/kvm.h index 0fb5ef939732..7b26d4b0b052 100644 --- a/tools/include/uapi/linux/kvm.h +++ b/tools/include/uapi/linux/kvm.h @@ -761,6 +761,7 @@ struct kvm_ppc_resize_hpt { #define KVM_TRACE_PAUSE __KVM_DEPRECATED_MAIN_0x07 #define KVM_TRACE_DISABLE __KVM_DEPRECATED_MAIN_0x08 #define KVM_GET_EMULATED_CPUID _IOWR(KVMIO, 0x09, struct kvm_cpuid2) +#define KVM_GET_MSR_FEATURE_INDEX_LIST _IOWR(KVMIO, 0x0a, struct kvm_msr_list) /* * Extension capability list. @@ -934,6 +935,7 @@ struct kvm_ppc_resize_hpt { #define KVM_CAP_S390_AIS_MIGRATION 150 #define KVM_CAP_PPC_GET_CPU_CHAR 151 #define KVM_CAP_S390_BPB 152 +#define KVM_CAP_GET_MSR_FEATURES 153 #ifdef KVM_CAP_IRQ_ROUTING diff --git a/tools/include/uapi/linux/perf_event.h b/tools/include/uapi/linux/perf_event.h index e0739a1aa4b2..912b85b52344 100644 --- a/tools/include/uapi/linux/perf_event.h +++ b/tools/include/uapi/linux/perf_event.h @@ -380,10 +380,14 @@ struct perf_event_attr { __u32 bp_type; union { __u64 bp_addr; + __u64 kprobe_func; /* for perf_kprobe */ + __u64 uprobe_path; /* for perf_uprobe */ __u64 config1; /* extension of config */ }; union { __u64 bp_len; + __u64 kprobe_addr; /* when kprobe_func == NULL */ + __u64 probe_offset; /* for perf_[k,u]probe */ __u64 config2; /* extension of config1 */ }; __u64 branch_sample_type; /* enum perf_branch_sample_type */ @@ -444,17 +448,18 @@ struct perf_event_query_bpf { /* * Ioctls that can be done on a perf event fd: */ -#define PERF_EVENT_IOC_ENABLE _IO ('$', 0) -#define PERF_EVENT_IOC_DISABLE _IO ('$', 1) -#define PERF_EVENT_IOC_REFRESH _IO ('$', 2) -#define PERF_EVENT_IOC_RESET _IO ('$', 3) -#define PERF_EVENT_IOC_PERIOD _IOW('$', 4, __u64) -#define PERF_EVENT_IOC_SET_OUTPUT _IO ('$', 5) -#define PERF_EVENT_IOC_SET_FILTER _IOW('$', 6, char *) -#define PERF_EVENT_IOC_ID _IOR('$', 7, __u64 *) -#define PERF_EVENT_IOC_SET_BPF _IOW('$', 8, __u32) -#define PERF_EVENT_IOC_PAUSE_OUTPUT _IOW('$', 9, __u32) -#define PERF_EVENT_IOC_QUERY_BPF _IOWR('$', 10, struct perf_event_query_bpf *) +#define PERF_EVENT_IOC_ENABLE _IO ('$', 0) +#define PERF_EVENT_IOC_DISABLE _IO ('$', 1) +#define PERF_EVENT_IOC_REFRESH _IO ('$', 2) +#define PERF_EVENT_IOC_RESET _IO ('$', 3) +#define PERF_EVENT_IOC_PERIOD _IOW('$', 4, __u64) +#define PERF_EVENT_IOC_SET_OUTPUT _IO ('$', 5) +#define PERF_EVENT_IOC_SET_FILTER _IOW('$', 6, char *) +#define PERF_EVENT_IOC_ID _IOR('$', 7, __u64 *) +#define PERF_EVENT_IOC_SET_BPF _IOW('$', 8, __u32) +#define PERF_EVENT_IOC_PAUSE_OUTPUT _IOW('$', 9, __u32) +#define PERF_EVENT_IOC_QUERY_BPF _IOWR('$', 10, struct perf_event_query_bpf *) +#define PERF_EVENT_IOC_MODIFY_ATTRIBUTES _IOW('$', 11, struct perf_event_attr *) enum perf_event_ioc_flags { PERF_IOC_FLAG_GROUP = 1U << 0, diff --git a/tools/lib/api/fs/fs.c b/tools/lib/api/fs/fs.c index b24afc0e6e81..6a12bbf39f7b 100644 --- a/tools/lib/api/fs/fs.c +++ b/tools/lib/api/fs/fs.c @@ -315,12 +315,8 @@ int filename__read_int(const char *filename, int *value) return err; } -/* - * Parses @value out of @filename with strtoull. - * By using 0 for base, the strtoull detects the - * base automatically (see man strtoull). - */ -int filename__read_ull(const char *filename, unsigned long long *value) +static int filename__read_ull_base(const char *filename, + unsigned long long *value, int base) { char line[64]; int fd = open(filename, O_RDONLY), err = -1; @@ -329,7 +325,7 @@ int filename__read_ull(const char *filename, unsigned long long *value) return -1; if (read(fd, line, sizeof(line)) > 0) { - *value = strtoull(line, NULL, 0); + *value = strtoull(line, NULL, base); if (*value != ULLONG_MAX) err = 0; } @@ -338,6 +334,25 @@ int filename__read_ull(const char *filename, unsigned long long *value) return err; } +/* + * Parses @value out of @filename with strtoull. + * By using 16 for base to treat the number as hex. + */ +int filename__read_xll(const char *filename, unsigned long long *value) +{ + return filename__read_ull_base(filename, value, 16); +} + +/* + * Parses @value out of @filename with strtoull. + * By using 0 for base, the strtoull detects the + * base automatically (see man strtoull). + */ +int filename__read_ull(const char *filename, unsigned long long *value) +{ + return filename__read_ull_base(filename, value, 0); +} + #define STRERR_BUFSIZE 128 /* For the buffer size of strerror_r */ int filename__read_str(const char *filename, char **buf, size_t *sizep) @@ -417,7 +432,8 @@ int procfs__read_str(const char *entry, char **buf, size_t *sizep) return filename__read_str(path, buf, sizep); } -int sysfs__read_ull(const char *entry, unsigned long long *value) +static int sysfs__read_ull_base(const char *entry, + unsigned long long *value, int base) { char path[PATH_MAX]; const char *sysfs = sysfs__mountpoint(); @@ -427,7 +443,17 @@ int sysfs__read_ull(const char *entry, unsigned long long *value) snprintf(path, sizeof(path), "%s/%s", sysfs, entry); - return filename__read_ull(path, value); + return filename__read_ull_base(path, value, base); +} + +int sysfs__read_xll(const char *entry, unsigned long long *value) +{ + return sysfs__read_ull_base(entry, value, 16); +} + +int sysfs__read_ull(const char *entry, unsigned long long *value) +{ + return sysfs__read_ull_base(entry, value, 0); } int sysfs__read_int(const char *entry, int *value) diff --git a/tools/lib/api/fs/fs.h b/tools/lib/api/fs/fs.h index dda49deefb52..92d03b8396b1 100644 --- a/tools/lib/api/fs/fs.h +++ b/tools/lib/api/fs/fs.h @@ -30,6 +30,7 @@ FS(bpf_fs) int filename__read_int(const char *filename, int *value); int filename__read_ull(const char *filename, unsigned long long *value); +int filename__read_xll(const char *filename, unsigned long long *value); int filename__read_str(const char *filename, char **buf, size_t *sizep); int filename__write_int(const char *filename, int value); @@ -39,6 +40,7 @@ int procfs__read_str(const char *entry, char **buf, size_t *sizep); int sysctl__read_int(const char *sysctl, int *value); int sysfs__read_int(const char *entry, int *value); int sysfs__read_ull(const char *entry, unsigned long long *value); +int sysfs__read_xll(const char *entry, unsigned long long *value); int sysfs__read_str(const char *entry, char **buf, size_t *sizep); int sysfs__read_bool(const char *entry, bool *value); diff --git a/tools/lib/str_error_r.c b/tools/lib/str_error_r.c index d6d65537b0d9..6aad8308a0ac 100644 --- a/tools/lib/str_error_r.c +++ b/tools/lib/str_error_r.c @@ -22,6 +22,6 @@ char *str_error_r(int errnum, char *buf, size_t buflen) { int err = strerror_r(errnum, buf, buflen); if (err) - snprintf(buf, buflen, "INTERNAL ERROR: strerror_r(%d, %p, %zd)=%d", errnum, buf, buflen, err); + snprintf(buf, buflen, "INTERNAL ERROR: strerror_r(%d, [buf], %zd)=%d", errnum, buflen, err); return buf; } diff --git a/tools/lib/symbol/kallsyms.c b/tools/lib/symbol/kallsyms.c index 914cb8e3d40b..689b6a130dd7 100644 --- a/tools/lib/symbol/kallsyms.c +++ b/tools/lib/symbol/kallsyms.c @@ -38,6 +38,10 @@ int kallsyms__parse(const char *filename, void *arg, len = hex2u64(line, &start); + /* Skip the line if we failed to parse the address. */ + if (!len) + continue; + len++; if (len + 2 >= line_len) continue; diff --git a/tools/memory-model/Documentation/cheatsheet.txt b/tools/memory-model/Documentation/cheatsheet.txt new file mode 100644 index 000000000000..956b1ae4aafb --- /dev/null +++ b/tools/memory-model/Documentation/cheatsheet.txt @@ -0,0 +1,29 @@ + Prior Operation Subsequent Operation + --------------- --------------------------- + C Self R W RWM Self R W DR DW RMW SV + -- ---- - - --- ---- - - -- -- --- -- + +Store, e.g., WRITE_ONCE() Y Y +Load, e.g., READ_ONCE() Y Y Y Y +Unsuccessful RMW operation Y Y Y Y +rcu_dereference() Y Y Y Y +Successful *_acquire() R Y Y Y Y Y Y +Successful *_release() C Y Y Y W Y +smp_rmb() Y R Y Y R +smp_wmb() Y W Y Y W +smp_mb() & synchronize_rcu() CP Y Y Y Y Y Y Y Y +Successful full non-void RMW CP Y Y Y Y Y Y Y Y Y Y Y +smp_mb__before_atomic() CP Y Y Y a a a a Y +smp_mb__after_atomic() CP a a Y Y Y Y Y + + +Key: C: Ordering is cumulative + P: Ordering propagates + R: Read, for example, READ_ONCE(), or read portion of RMW + W: Write, for example, WRITE_ONCE(), or write portion of RMW + Y: Provides ordering + a: Provides ordering given intervening RMW atomic operation + DR: Dependent read (address dependency) + DW: Dependent write (address, data, or control dependency) + RMW: Atomic read-modify-write operation + SV Same-variable access diff --git a/tools/memory-model/Documentation/explanation.txt b/tools/memory-model/Documentation/explanation.txt new file mode 100644 index 000000000000..a727c82bd434 --- /dev/null +++ b/tools/memory-model/Documentation/explanation.txt @@ -0,0 +1,1845 @@ +Explanation of the Linux-Kernel Memory Consistency Model +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +:Author: Alan Stern <stern@rowland.harvard.edu> +:Created: October 2017 + +.. Contents + + 1. INTRODUCTION + 2. BACKGROUND + 3. A SIMPLE EXAMPLE + 4. A SELECTION OF MEMORY MODELS + 5. ORDERING AND CYCLES + 6. EVENTS + 7. THE PROGRAM ORDER RELATION: po AND po-loc + 8. A WARNING + 9. DEPENDENCY RELATIONS: data, addr, and ctrl + 10. THE READS-FROM RELATION: rf, rfi, and rfe + 11. CACHE COHERENCE AND THE COHERENCE ORDER RELATION: co, coi, and coe + 12. THE FROM-READS RELATION: fr, fri, and fre + 13. AN OPERATIONAL MODEL + 14. PROPAGATION ORDER RELATION: cumul-fence + 15. DERIVATION OF THE LKMM FROM THE OPERATIONAL MODEL + 16. SEQUENTIAL CONSISTENCY PER VARIABLE + 17. ATOMIC UPDATES: rmw + 18. THE PRESERVED PROGRAM ORDER RELATION: ppo + 19. AND THEN THERE WAS ALPHA + 20. THE HAPPENS-BEFORE RELATION: hb + 21. THE PROPAGATES-BEFORE RELATION: pb + 22. RCU RELATIONS: link, gp-link, rscs-link, and rcu-path + 23. ODDS AND ENDS + + + +INTRODUCTION +------------ + +The Linux-kernel memory consistency model (LKMM) is rather complex and +obscure. This is particularly evident if you read through the +linux-kernel.bell and linux-kernel.cat files that make up the formal +version of the model; they are extremely terse and their meanings are +far from clear. + +This document describes the ideas underlying the LKMM. It is meant +for people who want to understand how the model was designed. It does +not go into the details of the code in the .bell and .cat files; +rather, it explains in English what the code expresses symbolically. + +Sections 2 (BACKGROUND) through 5 (ORDERING AND CYCLES) are aimed +toward beginners; they explain what memory consistency models are and +the basic notions shared by all such models. People already familiar +with these concepts can skim or skip over them. Sections 6 (EVENTS) +through 12 (THE FROM_READS RELATION) describe the fundamental +relations used in many models. Starting in Section 13 (AN OPERATIONAL +MODEL), the workings of the LKMM itself are covered. + +Warning: The code examples in this document are not written in the +proper format for litmus tests. They don't include a header line, the +initializations are not enclosed in braces, the global variables are +not passed by pointers, and they don't have an "exists" clause at the +end. Converting them to the right format is left as an exercise for +the reader. + + +BACKGROUND +---------- + +A memory consistency model (or just memory model, for short) is +something which predicts, given a piece of computer code running on a +particular kind of system, what values may be obtained by the code's +load instructions. The LKMM makes these predictions for code running +as part of the Linux kernel. + +In practice, people tend to use memory models the other way around. +That is, given a piece of code and a collection of values specified +for the loads, the model will predict whether it is possible for the +code to run in such a way that the loads will indeed obtain the +specified values. Of course, this is just another way of expressing +the same idea. + +For code running on a uniprocessor system, the predictions are easy: +Each load instruction must obtain the value written by the most recent +store instruction accessing the same location (we ignore complicating +factors such as DMA and mixed-size accesses.) But on multiprocessor +systems, with multiple CPUs making concurrent accesses to shared +memory locations, things aren't so simple. + +Different architectures have differing memory models, and the Linux +kernel supports a variety of architectures. The LKMM has to be fairly +permissive, in the sense that any behavior allowed by one of these +architectures also has to be allowed by the LKMM. + + +A SIMPLE EXAMPLE +---------------- + +Here is a simple example to illustrate the basic concepts. Consider +some code running as part of a device driver for an input device. The +driver might contain an interrupt handler which collects data from the +device, stores it in a buffer, and sets a flag to indicate the buffer +is full. Running concurrently on a different CPU might be a part of +the driver code being executed by a process in the midst of a read(2) +system call. This code tests the flag to see whether the buffer is +ready, and if it is, copies the data back to userspace. The buffer +and the flag are memory locations shared between the two CPUs. + +We can abstract out the important pieces of the driver code as follows +(the reason for using WRITE_ONCE() and READ_ONCE() instead of simple +assignment statements is discussed later): + + int buf = 0, flag = 0; + + P0() + { + WRITE_ONCE(buf, 1); + WRITE_ONCE(flag, 1); + } + + P1() + { + int r1; + int r2 = 0; + + r1 = READ_ONCE(flag); + if (r1) + r2 = READ_ONCE(buf); + } + +Here the P0() function represents the interrupt handler running on one +CPU and P1() represents the read() routine running on another. The +value 1 stored in buf represents input data collected from the device. +Thus, P0 stores the data in buf and then sets flag. Meanwhile, P1 +reads flag into the private variable r1, and if it is set, reads the +data from buf into a second private variable r2 for copying to +userspace. (Presumably if flag is not set then the driver will wait a +while and try again.) + +This pattern of memory accesses, where one CPU stores values to two +shared memory locations and another CPU loads from those locations in +the opposite order, is widely known as the "Message Passing" or MP +pattern. It is typical of memory access patterns in the kernel. + +Please note that this example code is a simplified abstraction. Real +buffers are usually larger than a single integer, real device drivers +usually use sleep and wakeup mechanisms rather than polling for I/O +completion, and real code generally doesn't bother to copy values into +private variables before using them. All that is beside the point; +the idea here is simply to illustrate the overall pattern of memory +accesses by the CPUs. + +A memory model will predict what values P1 might obtain for its loads +from flag and buf, or equivalently, what values r1 and r2 might end up +with after the code has finished running. + +Some predictions are trivial. For instance, no sane memory model would +predict that r1 = 42 or r2 = -7, because neither of those values ever +gets stored in flag or buf. + +Some nontrivial predictions are nonetheless quite simple. For +instance, P1 might run entirely before P0 begins, in which case r1 and +r2 will both be 0 at the end. Or P0 might run entirely before P1 +begins, in which case r1 and r2 will both be 1. + +The interesting predictions concern what might happen when the two +routines run concurrently. One possibility is that P1 runs after P0's +store to buf but before the store to flag. In this case, r1 and r2 +will again both be 0. (If P1 had been designed to read buf +unconditionally then we would instead have r1 = 0 and r2 = 1.) + +However, the most interesting possibility is where r1 = 1 and r2 = 0. +If this were to occur it would mean the driver contains a bug, because +incorrect data would get sent to the user: 0 instead of 1. As it +happens, the LKMM does predict this outcome can occur, and the example +driver code shown above is indeed buggy. + + +A SELECTION OF MEMORY MODELS +---------------------------- + +The first widely cited memory model, and the simplest to understand, +is Sequential Consistency. According to this model, systems behave as +if each CPU executed its instructions in order but with unspecified +timing. In other words, the instructions from the various CPUs get +interleaved in a nondeterministic way, always according to some single +global order that agrees with the order of the instructions in the +program source for each CPU. The model says that the value obtained +by each load is simply the value written by the most recently executed +store to the same memory location, from any CPU. + +For the MP example code shown above, Sequential Consistency predicts +that the undesired result r1 = 1, r2 = 0 cannot occur. The reasoning +goes like this: + + Since r1 = 1, P0 must store 1 to flag before P1 loads 1 from + it, as loads can obtain values only from earlier stores. + + P1 loads from flag before loading from buf, since CPUs execute + their instructions in order. + + P1 must load 0 from buf before P0 stores 1 to it; otherwise r2 + would be 1 since a load obtains its value from the most recent + store to the same address. + + P0 stores 1 to buf before storing 1 to flag, since it executes + its instructions in order. + + Since an instruction (in this case, P1's store to flag) cannot + execute before itself, the specified outcome is impossible. + +However, real computer hardware almost never follows the Sequential +Consistency memory model; doing so would rule out too many valuable +performance optimizations. On ARM and PowerPC architectures, for +instance, the MP example code really does sometimes yield r1 = 1 and +r2 = 0. + +x86 and SPARC follow yet a different memory model: TSO (Total Store +Ordering). This model predicts that the undesired outcome for the MP +pattern cannot occur, but in other respects it differs from Sequential +Consistency. One example is the Store Buffer (SB) pattern, in which +each CPU stores to its own shared location and then loads from the +other CPU's location: + + int x = 0, y = 0; + + P0() + { + int r0; + + WRITE_ONCE(x, 1); + r0 = READ_ONCE(y); + } + + P1() + { + int r1; + + WRITE_ONCE(y, 1); + r1 = READ_ONCE(x); + } + +Sequential Consistency predicts that the outcome r0 = 0, r1 = 0 is +impossible. (Exercise: Figure out the reasoning.) But TSO allows +this outcome to occur, and in fact it does sometimes occur on x86 and +SPARC systems. + +The LKMM was inspired by the memory models followed by PowerPC, ARM, +x86, Alpha, and other architectures. However, it is different in +detail from each of them. + + +ORDERING AND CYCLES +------------------- + +Memory models are all about ordering. Often this is temporal ordering +(i.e., the order in which certain events occur) but it doesn't have to +be; consider for example the order of instructions in a program's +source code. We saw above that Sequential Consistency makes an +important assumption that CPUs execute instructions in the same order +as those instructions occur in the code, and there are many other +instances of ordering playing central roles in memory models. + +The counterpart to ordering is a cycle. Ordering rules out cycles: +It's not possible to have X ordered before Y, Y ordered before Z, and +Z ordered before X, because this would mean that X is ordered before +itself. The analysis of the MP example under Sequential Consistency +involved just such an impossible cycle: + + W: P0 stores 1 to flag executes before + X: P1 loads 1 from flag executes before + Y: P1 loads 0 from buf executes before + Z: P0 stores 1 to buf executes before + W: P0 stores 1 to flag. + +In short, if a memory model requires certain accesses to be ordered, +and a certain outcome for the loads in a piece of code can happen only +if those accesses would form a cycle, then the memory model predicts +that outcome cannot occur. + +The LKMM is defined largely in terms of cycles, as we will see. + + +EVENTS +------ + +The LKMM does not work directly with the C statements that make up +kernel source code. Instead it considers the effects of those +statements in a more abstract form, namely, events. The model +includes three types of events: + + Read events correspond to loads from shared memory, such as + calls to READ_ONCE(), smp_load_acquire(), or + rcu_dereference(). + + Write events correspond to stores to shared memory, such as + calls to WRITE_ONCE(), smp_store_release(), or atomic_set(). + + Fence events correspond to memory barriers (also known as + fences), such as calls to smp_rmb() or rcu_read_lock(). + +These categories are not exclusive; a read or write event can also be +a fence. This happens with functions like smp_load_acquire() or +spin_lock(). However, no single event can be both a read and a write. +Atomic read-modify-write accesses, such as atomic_inc() or xchg(), +correspond to a pair of events: a read followed by a write. (The +write event is omitted for executions where it doesn't occur, such as +a cmpxchg() where the comparison fails.) + +Other parts of the code, those which do not involve interaction with +shared memory, do not give rise to events. Thus, arithmetic and +logical computations, control-flow instructions, or accesses to +private memory or CPU registers are not of central interest to the +memory model. They only affect the model's predictions indirectly. +For example, an arithmetic computation might determine the value that +gets stored to a shared memory location (or in the case of an array +index, the address where the value gets stored), but the memory model +is concerned only with the store itself -- its value and its address +-- not the computation leading up to it. + +Events in the LKMM can be linked by various relations, which we will +describe in the following sections. The memory model requires certain +of these relations to be orderings, that is, it requires them not to +have any cycles. + + +THE PROGRAM ORDER RELATION: po AND po-loc +----------------------------------------- + +The most important relation between events is program order (po). You +can think of it as the order in which statements occur in the source +code after branches are taken into account and loops have been +unrolled. A better description might be the order in which +instructions are presented to a CPU's execution unit. Thus, we say +that X is po-before Y (written as "X ->po Y" in formulas) if X occurs +before Y in the instruction stream. + +This is inherently a single-CPU relation; two instructions executing +on different CPUs are never linked by po. Also, it is by definition +an ordering so it cannot have any cycles. + +po-loc is a sub-relation of po. It links two memory accesses when the +first comes before the second in program order and they access the +same memory location (the "-loc" suffix). + +Although this may seem straightforward, there is one subtle aspect to +program order we need to explain. The LKMM was inspired by low-level +architectural memory models which describe the behavior of machine +code, and it retains their outlook to a considerable extent. The +read, write, and fence events used by the model are close in spirit to +individual machine instructions. Nevertheless, the LKMM describes +kernel code written in C, and the mapping from C to machine code can +be extremely complex. + +Optimizing compilers have great freedom in the way they translate +source code to object code. They are allowed to apply transformations +that add memory accesses, eliminate accesses, combine them, split them +into pieces, or move them around. Faced with all these possibilities, +the LKMM basically gives up. It insists that the code it analyzes +must contain no ordinary accesses to shared memory; all accesses must +be performed using READ_ONCE(), WRITE_ONCE(), or one of the other +atomic or synchronization primitives. These primitives prevent a +large number of compiler optimizations. In particular, it is +guaranteed that the compiler will not remove such accesses from the +generated code (unless it can prove the accesses will never be +executed), it will not change the order in which they occur in the +code (within limits imposed by the C standard), and it will not +introduce extraneous accesses. + +This explains why the MP and SB examples above used READ_ONCE() and +WRITE_ONCE() rather than ordinary memory accesses. Thanks to this +usage, we can be certain that in the MP example, P0's write event to +buf really is po-before its write event to flag, and similarly for the +other shared memory accesses in the examples. + +Private variables are not subject to this restriction. Since they are +not shared between CPUs, they can be accessed normally without +READ_ONCE() or WRITE_ONCE(), and there will be no ill effects. In +fact, they need not even be stored in normal memory at all -- in +principle a private variable could be stored in a CPU register (hence +the convention that these variables have names starting with the +letter 'r'). + + +A WARNING +--------- + +The protections provided by READ_ONCE(), WRITE_ONCE(), and others are +not perfect; and under some circumstances it is possible for the +compiler to undermine the memory model. Here is an example. Suppose +both branches of an "if" statement store the same value to the same +location: + + r1 = READ_ONCE(x); + if (r1) { + WRITE_ONCE(y, 2); + ... /* do something */ + } else { + WRITE_ONCE(y, 2); + ... /* do something else */ + } + +For this code, the LKMM predicts that the load from x will always be +executed before either of the stores to y. However, a compiler could +lift the stores out of the conditional, transforming the code into +something resembling: + + r1 = READ_ONCE(x); + WRITE_ONCE(y, 2); + if (r1) { + ... /* do something */ + } else { + ... /* do something else */ + } + +Given this version of the code, the LKMM would predict that the load +from x could be executed after the store to y. Thus, the memory +model's original prediction could be invalidated by the compiler. + +Another issue arises from the fact that in C, arguments to many +operators and function calls can be evaluated in any order. For +example: + + r1 = f(5) + g(6); + +The object code might call f(5) either before or after g(6); the +memory model cannot assume there is a fixed program order relation +between them. (In fact, if the functions are inlined then the +compiler might even interleave their object code.) + + +DEPENDENCY RELATIONS: data, addr, and ctrl +------------------------------------------ + +We say that two events are linked by a dependency relation when the +execution of the second event depends in some way on a value obtained +from memory by the first. The first event must be a read, and the +value it obtains must somehow affect what the second event does. +There are three kinds of dependencies: data, address (addr), and +control (ctrl). + +A read and a write event are linked by a data dependency if the value +obtained by the read affects the value stored by the write. As a very +simple example: + + int x, y; + + r1 = READ_ONCE(x); + WRITE_ONCE(y, r1 + 5); + +The value stored by the WRITE_ONCE obviously depends on the value +loaded by the READ_ONCE. Such dependencies can wind through +arbitrarily complicated computations, and a write can depend on the +values of multiple reads. + +A read event and another memory access event are linked by an address +dependency if the value obtained by the read affects the location +accessed by the other event. The second event can be either a read or +a write. Here's another simple example: + + int a[20]; + int i; + + r1 = READ_ONCE(i); + r2 = READ_ONCE(a[r1]); + +Here the location accessed by the second READ_ONCE() depends on the +index value loaded by the first. Pointer indirection also gives rise +to address dependencies, since the address of a location accessed +through a pointer will depend on the value read earlier from that +pointer. + +Finally, a read event and another memory access event are linked by a +control dependency if the value obtained by the read affects whether +the second event is executed at all. Simple example: + + int x, y; + + r1 = READ_ONCE(x); + if (r1) + WRITE_ONCE(y, 1984); + +Execution of the WRITE_ONCE() is controlled by a conditional expression +which depends on the value obtained by the READ_ONCE(); hence there is +a control dependency from the load to the store. + +It should be pretty obvious that events can only depend on reads that +come earlier in program order. Symbolically, if we have R ->data X, +R ->addr X, or R ->ctrl X (where R is a read event), then we must also +have R ->po X. It wouldn't make sense for a computation to depend +somehow on a value that doesn't get loaded from shared memory until +later in the code! + + +THE READS-FROM RELATION: rf, rfi, and rfe +----------------------------------------- + +The reads-from relation (rf) links a write event to a read event when +the value loaded by the read is the value that was stored by the +write. In colloquial terms, the load "reads from" the store. We +write W ->rf R to indicate that the load R reads from the store W. We +further distinguish the cases where the load and the store occur on +the same CPU (internal reads-from, or rfi) and where they occur on +different CPUs (external reads-from, or rfe). + +For our purposes, a memory location's initial value is treated as +though it had been written there by an imaginary initial store that +executes on a separate CPU before the program runs. + +Usage of the rf relation implicitly assumes that loads will always +read from a single store. It doesn't apply properly in the presence +of load-tearing, where a load obtains some of its bits from one store +and some of them from another store. Fortunately, use of READ_ONCE() +and WRITE_ONCE() will prevent load-tearing; it's not possible to have: + + int x = 0; + + P0() + { + WRITE_ONCE(x, 0x1234); + } + + P1() + { + int r1; + + r1 = READ_ONCE(x); + } + +and end up with r1 = 0x1200 (partly from x's initial value and partly +from the value stored by P0). + +On the other hand, load-tearing is unavoidable when mixed-size +accesses are used. Consider this example: + + union { + u32 w; + u16 h[2]; + } x; + + P0() + { + WRITE_ONCE(x.h[0], 0x1234); + WRITE_ONCE(x.h[1], 0x5678); + } + + P1() + { + int r1; + + r1 = READ_ONCE(x.w); + } + +If r1 = 0x56781234 (little-endian!) at the end, then P1 must have read +from both of P0's stores. It is possible to handle mixed-size and +unaligned accesses in a memory model, but the LKMM currently does not +attempt to do so. It requires all accesses to be properly aligned and +of the location's actual size. + + +CACHE COHERENCE AND THE COHERENCE ORDER RELATION: co, coi, and coe +------------------------------------------------------------------ + +Cache coherence is a general principle requiring that in a +multi-processor system, the CPUs must share a consistent view of the +memory contents. Specifically, it requires that for each location in +shared memory, the stores to that location must form a single global +ordering which all the CPUs agree on (the coherence order), and this +ordering must be consistent with the program order for accesses to +that location. + +To put it another way, for any variable x, the coherence order (co) of +the stores to x is simply the order in which the stores overwrite one +another. The imaginary store which establishes x's initial value +comes first in the coherence order; the store which directly +overwrites the initial value comes second; the store which overwrites +that value comes third, and so on. + +You can think of the coherence order as being the order in which the +stores reach x's location in memory (or if you prefer a more +hardware-centric view, the order in which the stores get written to +x's cache line). We write W ->co W' if W comes before W' in the +coherence order, that is, if the value stored by W gets overwritten, +directly or indirectly, by the value stored by W'. + +Coherence order is required to be consistent with program order. This +requirement takes the form of four coherency rules: + + Write-write coherence: If W ->po-loc W' (i.e., W comes before + W' in program order and they access the same location), where W + and W' are two stores, then W ->co W'. + + Write-read coherence: If W ->po-loc R, where W is a store and R + is a load, then R must read from W or from some other store + which comes after W in the coherence order. + + Read-write coherence: If R ->po-loc W, where R is a load and W + is a store, then the store which R reads from must come before + W in the coherence order. + + Read-read coherence: If R ->po-loc R', where R and R' are two + loads, then either they read from the same store or else the + store read by R comes before the store read by R' in the + coherence order. + +This is sometimes referred to as sequential consistency per variable, +because it means that the accesses to any single memory location obey +the rules of the Sequential Consistency memory model. (According to +Wikipedia, sequential consistency per variable and cache coherence +mean the same thing except that cache coherence includes an extra +requirement that every store eventually becomes visible to every CPU.) + +Any reasonable memory model will include cache coherence. Indeed, our +expectation of cache coherence is so deeply ingrained that violations +of its requirements look more like hardware bugs than programming +errors: + + int x; + + P0() + { + WRITE_ONCE(x, 17); + WRITE_ONCE(x, 23); + } + +If the final value stored in x after this code ran was 17, you would +think your computer was broken. It would be a violation of the +write-write coherence rule: Since the store of 23 comes later in +program order, it must also come later in x's coherence order and +thus must overwrite the store of 17. + + int x = 0; + + P0() + { + int r1; + + r1 = READ_ONCE(x); + WRITE_ONCE(x, 666); + } + +If r1 = 666 at the end, this would violate the read-write coherence +rule: The READ_ONCE() load comes before the WRITE_ONCE() store in +program order, so it must not read from that store but rather from one +coming earlier in the coherence order (in this case, x's initial +value). + + int x = 0; + + P0() + { + WRITE_ONCE(x, 5); + } + + P1() + { + int r1, r2; + + r1 = READ_ONCE(x); + r2 = READ_ONCE(x); + } + +If r1 = 5 (reading from P0's store) and r2 = 0 (reading from the +imaginary store which establishes x's initial value) at the end, this +would violate the read-read coherence rule: The r1 load comes before +the r2 load in program order, so it must not read from a store that +comes later in the coherence order. + +(As a minor curiosity, if this code had used normal loads instead of +READ_ONCE() in P1, on Itanium it sometimes could end up with r1 = 5 +and r2 = 0! This results from parallel execution of the operations +encoded in Itanium's Very-Long-Instruction-Word format, and it is yet +another motivation for using READ_ONCE() when accessing shared memory +locations.) + +Just like the po relation, co is inherently an ordering -- it is not +possible for a store to directly or indirectly overwrite itself! And +just like with the rf relation, we distinguish between stores that +occur on the same CPU (internal coherence order, or coi) and stores +that occur on different CPUs (external coherence order, or coe). + +On the other hand, stores to different memory locations are never +related by co, just as instructions on different CPUs are never +related by po. Coherence order is strictly per-location, or if you +prefer, each location has its own independent coherence order. + + +THE FROM-READS RELATION: fr, fri, and fre +----------------------------------------- + +The from-reads relation (fr) can be a little difficult for people to +grok. It describes the situation where a load reads a value that gets +overwritten by a store. In other words, we have R ->fr W when the +value that R reads is overwritten (directly or indirectly) by W, or +equivalently, when R reads from a store which comes earlier than W in +the coherence order. + +For example: + + int x = 0; + + P0() + { + int r1; + + r1 = READ_ONCE(x); + WRITE_ONCE(x, 2); + } + +The value loaded from x will be 0 (assuming cache coherence!), and it +gets overwritten by the value 2. Thus there is an fr link from the +READ_ONCE() to the WRITE_ONCE(). If the code contained any later +stores to x, there would also be fr links from the READ_ONCE() to +them. + +As with rf, rfi, and rfe, we subdivide the fr relation into fri (when +the load and the store are on the same CPU) and fre (when they are on +different CPUs). + +Note that the fr relation is determined entirely by the rf and co +relations; it is not independent. Given a read event R and a write +event W for the same location, we will have R ->fr W if and only if +the write which R reads from is co-before W. In symbols, + + (R ->fr W) := (there exists W' with W' ->rf R and W' ->co W). + + +AN OPERATIONAL MODEL +-------------------- + +The LKMM is based on various operational memory models, meaning that +the models arise from an abstract view of how a computer system +operates. Here are the main ideas, as incorporated into the LKMM. + +The system as a whole is divided into the CPUs and a memory subsystem. +The CPUs are responsible for executing instructions (not necessarily +in program order), and they communicate with the memory subsystem. +For the most part, executing an instruction requires a CPU to perform +only internal operations. However, loads, stores, and fences involve +more. + +When CPU C executes a store instruction, it tells the memory subsystem +to store a certain value at a certain location. The memory subsystem +propagates the store to all the other CPUs as well as to RAM. (As a +special case, we say that the store propagates to its own CPU at the +time it is executed.) The memory subsystem also determines where the +store falls in the location's coherence order. In particular, it must +arrange for the store to be co-later than (i.e., to overwrite) any +other store to the same location which has already propagated to CPU C. + +When a CPU executes a load instruction R, it first checks to see +whether there are any as-yet unexecuted store instructions, for the +same location, that come before R in program order. If there are, it +uses the value of the po-latest such store as the value obtained by R, +and we say that the store's value is forwarded to R. Otherwise, the +CPU asks the memory subsystem for the value to load and we say that R +is satisfied from memory. The memory subsystem hands back the value +of the co-latest store to the location in question which has already +propagated to that CPU. + +(In fact, the picture needs to be a little more complicated than this. +CPUs have local caches, and propagating a store to a CPU really means +propagating it to the CPU's local cache. A local cache can take some +time to process the stores that it receives, and a store can't be used +to satisfy one of the CPU's loads until it has been processed. On +most architectures, the local caches process stores in +First-In-First-Out order, and consequently the processing delay +doesn't matter for the memory model. But on Alpha, the local caches +have a partitioned design that results in non-FIFO behavior. We will +discuss this in more detail later.) + +Note that load instructions may be executed speculatively and may be +restarted under certain circumstances. The memory model ignores these +premature executions; we simply say that the load executes at the +final time it is forwarded or satisfied. + +Executing a fence (or memory barrier) instruction doesn't require a +CPU to do anything special other than informing the memory subsystem +about the fence. However, fences do constrain the way CPUs and the +memory subsystem handle other instructions, in two respects. + +First, a fence forces the CPU to execute various instructions in +program order. Exactly which instructions are ordered depends on the +type of fence: + + Strong fences, including smp_mb() and synchronize_rcu(), force + the CPU to execute all po-earlier instructions before any + po-later instructions; + + smp_rmb() forces the CPU to execute all po-earlier loads + before any po-later loads; + + smp_wmb() forces the CPU to execute all po-earlier stores + before any po-later stores; + + Acquire fences, such as smp_load_acquire(), force the CPU to + execute the load associated with the fence (e.g., the load + part of an smp_load_acquire()) before any po-later + instructions; + + Release fences, such as smp_store_release(), force the CPU to + execute all po-earlier instructions before the store + associated with the fence (e.g., the store part of an + smp_store_release()). + +Second, some types of fence affect the way the memory subsystem +propagates stores. When a fence instruction is executed on CPU C: + + For each other CPU C', smb_wmb() forces all po-earlier stores + on C to propagate to C' before any po-later stores do. + + For each other CPU C', any store which propagates to C before + a release fence is executed (including all po-earlier + stores executed on C) is forced to propagate to C' before the + store associated with the release fence does. + + Any store which propagates to C before a strong fence is + executed (including all po-earlier stores on C) is forced to + propagate to all other CPUs before any instructions po-after + the strong fence are executed on C. + +The propagation ordering enforced by release fences and strong fences +affects stores from other CPUs that propagate to CPU C before the +fence is executed, as well as stores that are executed on C before the +fence. We describe this property by saying that release fences and +strong fences are A-cumulative. By contrast, smp_wmb() fences are not +A-cumulative; they only affect the propagation of stores that are +executed on C before the fence (i.e., those which precede the fence in +program order). + +rcu_read_lock(), rcu_read_unlock(), and synchronize_rcu() fences have +other properties which we discuss later. + + +PROPAGATION ORDER RELATION: cumul-fence +--------------------------------------- + +The fences which affect propagation order (i.e., strong, release, and +smp_wmb() fences) are collectively referred to as cumul-fences, even +though smp_wmb() isn't A-cumulative. The cumul-fence relation is +defined to link memory access events E and F whenever: + + E and F are both stores on the same CPU and an smp_wmb() fence + event occurs between them in program order; or + + F is a release fence and some X comes before F in program order, + where either X = E or else E ->rf X; or + + A strong fence event occurs between some X and F in program + order, where either X = E or else E ->rf X. + +The operational model requires that whenever W and W' are both stores +and W ->cumul-fence W', then W must propagate to any given CPU +before W' does. However, for different CPUs C and C', it does not +require W to propagate to C before W' propagates to C'. + + +DERIVATION OF THE LKMM FROM THE OPERATIONAL MODEL +------------------------------------------------- + +The LKMM is derived from the restrictions imposed by the design +outlined above. These restrictions involve the necessity of +maintaining cache coherence and the fact that a CPU can't operate on a +value before it knows what that value is, among other things. + +The formal version of the LKMM is defined by five requirements, or +axioms: + + Sequential consistency per variable: This requires that the + system obey the four coherency rules. + + Atomicity: This requires that atomic read-modify-write + operations really are atomic, that is, no other stores can + sneak into the middle of such an update. + + Happens-before: This requires that certain instructions are + executed in a specific order. + + Propagation: This requires that certain stores propagate to + CPUs and to RAM in a specific order. + + Rcu: This requires that RCU read-side critical sections and + grace periods obey the rules of RCU, in particular, the + Grace-Period Guarantee. + +The first and second are quite common; they can be found in many +memory models (such as those for C11/C++11). The "happens-before" and +"propagation" axioms have analogs in other memory models as well. The +"rcu" axiom is specific to the LKMM. + +Each of these axioms is discussed below. + + +SEQUENTIAL CONSISTENCY PER VARIABLE +----------------------------------- + +According to the principle of cache coherence, the stores to any fixed +shared location in memory form a global ordering. We can imagine +inserting the loads from that location into this ordering, by placing +each load between the store that it reads from and the following +store. This leaves the relative positions of loads that read from the +same store unspecified; let's say they are inserted in program order, +first for CPU 0, then CPU 1, etc. + +You can check that the four coherency rules imply that the rf, co, fr, +and po-loc relations agree with this global ordering; in other words, +whenever we have X ->rf Y or X ->co Y or X ->fr Y or X ->po-loc Y, the +X event comes before the Y event in the global ordering. The LKMM's +"coherence" axiom expresses this by requiring the union of these +relations not to have any cycles. This means it must not be possible +to find events + + X0 -> X1 -> X2 -> ... -> Xn -> X0, + +where each of the links is either rf, co, fr, or po-loc. This has to +hold if the accesses to the fixed memory location can be ordered as +cache coherence demands. + +Although it is not obvious, it can be shown that the converse is also +true: This LKMM axiom implies that the four coherency rules are +obeyed. + + +ATOMIC UPDATES: rmw +------------------- + +What does it mean to say that a read-modify-write (rmw) update, such +as atomic_inc(&x), is atomic? It means that the memory location (x in +this case) does not get altered between the read and the write events +making up the atomic operation. In particular, if two CPUs perform +atomic_inc(&x) concurrently, it must be guaranteed that the final +value of x will be the initial value plus two. We should never have +the following sequence of events: + + CPU 0 loads x obtaining 13; + CPU 1 loads x obtaining 13; + CPU 0 stores 14 to x; + CPU 1 stores 14 to x; + +where the final value of x is wrong (14 rather than 15). + +In this example, CPU 0's increment effectively gets lost because it +occurs in between CPU 1's load and store. To put it another way, the +problem is that the position of CPU 0's store in x's coherence order +is between the store that CPU 1 reads from and the store that CPU 1 +performs. + +The same analysis applies to all atomic update operations. Therefore, +to enforce atomicity the LKMM requires that atomic updates follow this +rule: Whenever R and W are the read and write events composing an +atomic read-modify-write and W' is the write event which R reads from, +there must not be any stores coming between W' and W in the coherence +order. Equivalently, + + (R ->rmw W) implies (there is no X with R ->fr X and X ->co W), + +where the rmw relation links the read and write events making up each +atomic update. This is what the LKMM's "atomic" axiom says. + + +THE PRESERVED PROGRAM ORDER RELATION: ppo +----------------------------------------- + +There are many situations where a CPU is obligated to execute two +instructions in program order. We amalgamate them into the ppo (for +"preserved program order") relation, which links the po-earlier +instruction to the po-later instruction and is thus a sub-relation of +po. + +The operational model already includes a description of one such +situation: Fences are a source of ppo links. Suppose X and Y are +memory accesses with X ->po Y; then the CPU must execute X before Y if +any of the following hold: + + A strong (smp_mb() or synchronize_rcu()) fence occurs between + X and Y; + + X and Y are both stores and an smp_wmb() fence occurs between + them; + + X and Y are both loads and an smp_rmb() fence occurs between + them; + + X is also an acquire fence, such as smp_load_acquire(); + + Y is also a release fence, such as smp_store_release(). + +Another possibility, not mentioned earlier but discussed in the next +section, is: + + X and Y are both loads, X ->addr Y (i.e., there is an address + dependency from X to Y), and X is a READ_ONCE() or an atomic + access. + +Dependencies can also cause instructions to be executed in program +order. This is uncontroversial when the second instruction is a +store; either a data, address, or control dependency from a load R to +a store W will force the CPU to execute R before W. This is very +simply because the CPU cannot tell the memory subsystem about W's +store before it knows what value should be stored (in the case of a +data dependency), what location it should be stored into (in the case +of an address dependency), or whether the store should actually take +place (in the case of a control dependency). + +Dependencies to load instructions are more problematic. To begin with, +there is no such thing as a data dependency to a load. Next, a CPU +has no reason to respect a control dependency to a load, because it +can always satisfy the second load speculatively before the first, and +then ignore the result if it turns out that the second load shouldn't +be executed after all. And lastly, the real difficulties begin when +we consider address dependencies to loads. + +To be fair about it, all Linux-supported architectures do execute +loads in program order if there is an address dependency between them. +After all, a CPU cannot ask the memory subsystem to load a value from +a particular location before it knows what that location is. However, +the split-cache design used by Alpha can cause it to behave in a way +that looks as if the loads were executed out of order (see the next +section for more details). The kernel includes a workaround for this +problem when the loads come from READ_ONCE(), and therefore the LKMM +includes address dependencies to loads in the ppo relation. + +On the other hand, dependencies can indirectly affect the ordering of +two loads. This happens when there is a dependency from a load to a +store and a second, po-later load reads from that store: + + R ->dep W ->rfi R', + +where the dep link can be either an address or a data dependency. In +this situation we know it is possible for the CPU to execute R' before +W, because it can forward the value that W will store to R'. But it +cannot execute R' before R, because it cannot forward the value before +it knows what that value is, or that W and R' do access the same +location. However, if there is merely a control dependency between R +and W then the CPU can speculatively forward W to R' before executing +R; if the speculation turns out to be wrong then the CPU merely has to +restart or abandon R'. + +(In theory, a CPU might forward a store to a load when it runs across +an address dependency like this: + + r1 = READ_ONCE(ptr); + WRITE_ONCE(*r1, 17); + r2 = READ_ONCE(*r1); + +because it could tell that the store and the second load access the +same location even before it knows what the location's address is. +However, none of the architectures supported by the Linux kernel do +this.) + +Two memory accesses of the same location must always be executed in +program order if the second access is a store. Thus, if we have + + R ->po-loc W + +(the po-loc link says that R comes before W in program order and they +access the same location), the CPU is obliged to execute W after R. +If it executed W first then the memory subsystem would respond to R's +read request with the value stored by W (or an even later store), in +violation of the read-write coherence rule. Similarly, if we had + + W ->po-loc W' + +and the CPU executed W' before W, then the memory subsystem would put +W' before W in the coherence order. It would effectively cause W to +overwrite W', in violation of the write-write coherence rule. +(Interestingly, an early ARMv8 memory model, now obsolete, proposed +allowing out-of-order writes like this to occur. The model avoided +violating the write-write coherence rule by requiring the CPU not to +send the W write to the memory subsystem at all!) + +There is one last example of preserved program order in the LKMM: when +a load-acquire reads from an earlier store-release. For example: + + smp_store_release(&x, 123); + r1 = smp_load_acquire(&x); + +If the smp_load_acquire() ends up obtaining the 123 value that was +stored by the smp_store_release(), the LKMM says that the load must be +executed after the store; the store cannot be forwarded to the load. +This requirement does not arise from the operational model, but it +yields correct predictions on all architectures supported by the Linux +kernel, although for differing reasons. + +On some architectures, including x86 and ARMv8, it is true that the +store cannot be forwarded to the load. On others, including PowerPC +and ARMv7, smp_store_release() generates object code that starts with +a fence and smp_load_acquire() generates object code that ends with a +fence. The upshot is that even though the store may be forwarded to +the load, it is still true that any instruction preceding the store +will be executed before the load or any following instructions, and +the store will be executed before any instruction following the load. + + +AND THEN THERE WAS ALPHA +------------------------ + +As mentioned above, the Alpha architecture is unique in that it does +not appear to respect address dependencies to loads. This means that +code such as the following: + + int x = 0; + int y = -1; + int *ptr = &y; + + P0() + { + WRITE_ONCE(x, 1); + smp_wmb(); + WRITE_ONCE(ptr, &x); + } + + P1() + { + int *r1; + int r2; + + r1 = ptr; + r2 = READ_ONCE(*r1); + } + +can malfunction on Alpha systems (notice that P1 uses an ordinary load +to read ptr instead of READ_ONCE()). It is quite possible that r1 = &x +and r2 = 0 at the end, in spite of the address dependency. + +At first glance this doesn't seem to make sense. We know that the +smp_wmb() forces P0's store to x to propagate to P1 before the store +to ptr does. And since P1 can't execute its second load +until it knows what location to load from, i.e., after executing its +first load, the value x = 1 must have propagated to P1 before the +second load executed. So why doesn't r2 end up equal to 1? + +The answer lies in the Alpha's split local caches. Although the two +stores do reach P1's local cache in the proper order, it can happen +that the first store is processed by a busy part of the cache while +the second store is processed by an idle part. As a result, the x = 1 +value may not become available for P1's CPU to read until after the +ptr = &x value does, leading to the undesirable result above. The +final effect is that even though the two loads really are executed in +program order, it appears that they aren't. + +This could not have happened if the local cache had processed the +incoming stores in FIFO order. By contrast, other architectures +maintain at least the appearance of FIFO order. + +In practice, this difficulty is solved by inserting a special fence +between P1's two loads when the kernel is compiled for the Alpha +architecture. In fact, as of version 4.15, the kernel automatically +adds this fence (called smp_read_barrier_depends() and defined as +nothing at all on non-Alpha builds) after every READ_ONCE() and atomic +load. The effect of the fence is to cause the CPU not to execute any +po-later instructions until after the local cache has finished +processing all the stores it has already received. Thus, if the code +was changed to: + + P1() + { + int *r1; + int r2; + + r1 = READ_ONCE(ptr); + r2 = READ_ONCE(*r1); + } + +then we would never get r1 = &x and r2 = 0. By the time P1 executed +its second load, the x = 1 store would already be fully processed by +the local cache and available for satisfying the read request. Thus +we have yet another reason why shared data should always be read with +READ_ONCE() or another synchronization primitive rather than accessed +directly. + +The LKMM requires that smp_rmb(), acquire fences, and strong fences +share this property with smp_read_barrier_depends(): They do not allow +the CPU to execute any po-later instructions (or po-later loads in the +case of smp_rmb()) until all outstanding stores have been processed by +the local cache. In the case of a strong fence, the CPU first has to +wait for all of its po-earlier stores to propagate to every other CPU +in the system; then it has to wait for the local cache to process all +the stores received as of that time -- not just the stores received +when the strong fence began. + +And of course, none of this matters for any architecture other than +Alpha. + + +THE HAPPENS-BEFORE RELATION: hb +------------------------------- + +The happens-before relation (hb) links memory accesses that have to +execute in a certain order. hb includes the ppo relation and two +others, one of which is rfe. + +W ->rfe R implies that W and R are on different CPUs. It also means +that W's store must have propagated to R's CPU before R executed; +otherwise R could not have read the value stored by W. Therefore W +must have executed before R, and so we have W ->hb R. + +The equivalent fact need not hold if W ->rfi R (i.e., W and R are on +the same CPU). As we have already seen, the operational model allows +W's value to be forwarded to R in such cases, meaning that R may well +execute before W does. + +It's important to understand that neither coe nor fre is included in +hb, despite their similarities to rfe. For example, suppose we have +W ->coe W'. This means that W and W' are stores to the same location, +they execute on different CPUs, and W comes before W' in the coherence +order (i.e., W' overwrites W). Nevertheless, it is possible for W' to +execute before W, because the decision as to which store overwrites +the other is made later by the memory subsystem. When the stores are +nearly simultaneous, either one can come out on top. Similarly, +R ->fre W means that W overwrites the value which R reads, but it +doesn't mean that W has to execute after R. All that's necessary is +for the memory subsystem not to propagate W to R's CPU until after R +has executed, which is possible if W executes shortly before R. + +The third relation included in hb is like ppo, in that it only links +events that are on the same CPU. However it is more difficult to +explain, because it arises only indirectly from the requirement of +cache coherence. The relation is called prop, and it links two events +on CPU C in situations where a store from some other CPU comes after +the first event in the coherence order and propagates to C before the +second event executes. + +This is best explained with some examples. The simplest case looks +like this: + + int x; + + P0() + { + int r1; + + WRITE_ONCE(x, 1); + r1 = READ_ONCE(x); + } + + P1() + { + WRITE_ONCE(x, 8); + } + +If r1 = 8 at the end then P0's accesses must have executed in program +order. We can deduce this from the operational model; if P0's load +had executed before its store then the value of the store would have +been forwarded to the load, so r1 would have ended up equal to 1, not +8. In this case there is a prop link from P0's write event to its read +event, because P1's store came after P0's store in x's coherence +order, and P1's store propagated to P0 before P0's load executed. + +An equally simple case involves two loads of the same location that +read from different stores: + + int x = 0; + + P0() + { + int r1, r2; + + r1 = READ_ONCE(x); + r2 = READ_ONCE(x); + } + + P1() + { + WRITE_ONCE(x, 9); + } + +If r1 = 0 and r2 = 9 at the end then P0's accesses must have executed +in program order. If the second load had executed before the first +then the x = 9 store must have been propagated to P0 before the first +load executed, and so r1 would have been 9 rather than 0. In this +case there is a prop link from P0's first read event to its second, +because P1's store overwrote the value read by P0's first load, and +P1's store propagated to P0 before P0's second load executed. + +Less trivial examples of prop all involve fences. Unlike the simple +examples above, they can require that some instructions are executed +out of program order. This next one should look familiar: + + int buf = 0, flag = 0; + + P0() + { + WRITE_ONCE(buf, 1); + smp_wmb(); + WRITE_ONCE(flag, 1); + } + + P1() + { + int r1; + int r2; + + r1 = READ_ONCE(flag); + r2 = READ_ONCE(buf); + } + +This is the MP pattern again, with an smp_wmb() fence between the two +stores. If r1 = 1 and r2 = 0 at the end then there is a prop link +from P1's second load to its first (backwards!). The reason is +similar to the previous examples: The value P1 loads from buf gets +overwritten by P0's store to buf, the fence guarantees that the store +to buf will propagate to P1 before the store to flag does, and the +store to flag propagates to P1 before P1 reads flag. + +The prop link says that in order to obtain the r1 = 1, r2 = 0 result, +P1 must execute its second load before the first. Indeed, if the load +from flag were executed first, then the buf = 1 store would already +have propagated to P1 by the time P1's load from buf executed, so r2 +would have been 1 at the end, not 0. (The reasoning holds even for +Alpha, although the details are more complicated and we will not go +into them.) + +But what if we put an smp_rmb() fence between P1's loads? The fence +would force the two loads to be executed in program order, and it +would generate a cycle in the hb relation: The fence would create a ppo +link (hence an hb link) from the first load to the second, and the +prop relation would give an hb link from the second load to the first. +Since an instruction can't execute before itself, we are forced to +conclude that if an smp_rmb() fence is added, the r1 = 1, r2 = 0 +outcome is impossible -- as it should be. + +The formal definition of the prop relation involves a coe or fre link, +followed by an arbitrary number of cumul-fence links, ending with an +rfe link. You can concoct more exotic examples, containing more than +one fence, although this quickly leads to diminishing returns in terms +of complexity. For instance, here's an example containing a coe link +followed by two fences and an rfe link, utilizing the fact that +release fences are A-cumulative: + + int x, y, z; + + P0() + { + int r0; + + WRITE_ONCE(x, 1); + r0 = READ_ONCE(z); + } + + P1() + { + WRITE_ONCE(x, 2); + smp_wmb(); + WRITE_ONCE(y, 1); + } + + P2() + { + int r2; + + r2 = READ_ONCE(y); + smp_store_release(&z, 1); + } + +If x = 2, r0 = 1, and r2 = 1 after this code runs then there is a prop +link from P0's store to its load. This is because P0's store gets +overwritten by P1's store since x = 2 at the end (a coe link), the +smp_wmb() ensures that P1's store to x propagates to P2 before the +store to y does (the first fence), the store to y propagates to P2 +before P2's load and store execute, P2's smp_store_release() +guarantees that the stores to x and y both propagate to P0 before the +store to z does (the second fence), and P0's load executes after the +store to z has propagated to P0 (an rfe link). + +In summary, the fact that the hb relation links memory access events +in the order they execute means that it must not have cycles. This +requirement is the content of the LKMM's "happens-before" axiom. + +The LKMM defines yet another relation connected to times of +instruction execution, but it is not included in hb. It relies on the +particular properties of strong fences, which we cover in the next +section. + + +THE PROPAGATES-BEFORE RELATION: pb +---------------------------------- + +The propagates-before (pb) relation capitalizes on the special +features of strong fences. It links two events E and F whenever some +store is coherence-later than E and propagates to every CPU and to RAM +before F executes. The formal definition requires that E be linked to +F via a coe or fre link, an arbitrary number of cumul-fences, an +optional rfe link, a strong fence, and an arbitrary number of hb +links. Let's see how this definition works out. + +Consider first the case where E is a store (implying that the sequence +of links begins with coe). Then there are events W, X, Y, and Z such +that: + + E ->coe W ->cumul-fence* X ->rfe? Y ->strong-fence Z ->hb* F, + +where the * suffix indicates an arbitrary number of links of the +specified type, and the ? suffix indicates the link is optional (Y may +be equal to X). Because of the cumul-fence links, we know that W will +propagate to Y's CPU before X does, hence before Y executes and hence +before the strong fence executes. Because this fence is strong, we +know that W will propagate to every CPU and to RAM before Z executes. +And because of the hb links, we know that Z will execute before F. +Thus W, which comes later than E in the coherence order, will +propagate to every CPU and to RAM before F executes. + +The case where E is a load is exactly the same, except that the first +link in the sequence is fre instead of coe. + +The existence of a pb link from E to F implies that E must execute +before F. To see why, suppose that F executed first. Then W would +have propagated to E's CPU before E executed. If E was a store, the +memory subsystem would then be forced to make E come after W in the +coherence order, contradicting the fact that E ->coe W. If E was a +load, the memory subsystem would then be forced to satisfy E's read +request with the value stored by W or an even later store, +contradicting the fact that E ->fre W. + +A good example illustrating how pb works is the SB pattern with strong +fences: + + int x = 0, y = 0; + + P0() + { + int r0; + + WRITE_ONCE(x, 1); + smp_mb(); + r0 = READ_ONCE(y); + } + + P1() + { + int r1; + + WRITE_ONCE(y, 1); + smp_mb(); + r1 = READ_ONCE(x); + } + +If r0 = 0 at the end then there is a pb link from P0's load to P1's +load: an fre link from P0's load to P1's store (which overwrites the +value read by P0), and a strong fence between P1's store and its load. +In this example, the sequences of cumul-fence and hb links are empty. +Note that this pb link is not included in hb as an instance of prop, +because it does not start and end on the same CPU. + +Similarly, if r1 = 0 at the end then there is a pb link from P1's load +to P0's. This means that if both r1 and r2 were 0 there would be a +cycle in pb, which is not possible since an instruction cannot execute +before itself. Thus, adding smp_mb() fences to the SB pattern +prevents the r0 = 0, r1 = 0 outcome. + +In summary, the fact that the pb relation links events in the order +they execute means that it cannot have cycles. This requirement is +the content of the LKMM's "propagation" axiom. + + +RCU RELATIONS: link, gp-link, rscs-link, and rcu-path +----------------------------------------------------- + +RCU (Read-Copy-Update) is a powerful synchronization mechanism. It +rests on two concepts: grace periods and read-side critical sections. + +A grace period is the span of time occupied by a call to +synchronize_rcu(). A read-side critical section (or just critical +section, for short) is a region of code delimited by rcu_read_lock() +at the start and rcu_read_unlock() at the end. Critical sections can +be nested, although we won't make use of this fact. + +As far as memory models are concerned, RCU's main feature is its +Grace-Period Guarantee, which states that a critical section can never +span a full grace period. In more detail, the Guarantee says: + + If a critical section starts before a grace period then it + must end before the grace period does. In addition, every + store that propagates to the critical section's CPU before the + end of the critical section must propagate to every CPU before + the end of the grace period. + + If a critical section ends after a grace period ends then it + must start after the grace period does. In addition, every + store that propagates to the grace period's CPU before the + start of the grace period must propagate to every CPU before + the start of the critical section. + +Here is a simple example of RCU in action: + + int x, y; + + P0() + { + rcu_read_lock(); + WRITE_ONCE(x, 1); + WRITE_ONCE(y, 1); + rcu_read_unlock(); + } + + P1() + { + int r1, r2; + + r1 = READ_ONCE(x); + synchronize_rcu(); + r2 = READ_ONCE(y); + } + +The Grace Period Guarantee tells us that when this code runs, it will +never end with r1 = 1 and r2 = 0. The reasoning is as follows. r1 = 1 +means that P0's store to x propagated to P1 before P1 called +synchronize_rcu(), so P0's critical section must have started before +P1's grace period. On the other hand, r2 = 0 means that P0's store to +y, which occurs before the end of the critical section, did not +propagate to P1 before the end of the grace period, violating the +Guarantee. + +In the kernel's implementations of RCU, the business about stores +propagating to every CPU is realized by placing strong fences at +suitable places in the RCU-related code. Thus, if a critical section +starts before a grace period does then the critical section's CPU will +execute an smp_mb() fence after the end of the critical section and +some time before the grace period's synchronize_rcu() call returns. +And if a critical section ends after a grace period does then the +synchronize_rcu() routine will execute an smp_mb() fence at its start +and some time before the critical section's opening rcu_read_lock() +executes. + +What exactly do we mean by saying that a critical section "starts +before" or "ends after" a grace period? Some aspects of the meaning +are pretty obvious, as in the example above, but the details aren't +entirely clear. The LKMM formalizes this notion by means of a +relation with the unfortunately generic name "link". It is a very +general relation; among other things, X ->link Z includes cases where +X happens-before or is equal to some event Y which is equal to or +comes before Z in the coherence order. Taking Y = Z, this says that +X ->rfe Z implies X ->link Z, and taking Y = X, it says that X ->fr Z +and X ->co Z each imply X ->link Z. + +The formal definition of the link relation is more than a little +obscure, and we won't give it here. It is closely related to the pb +relation, and the details don't matter unless you want to comb through +a somewhat lengthy formal proof. Pretty much all you need to know +about link is the information in the preceding paragraph. + +The LKMM goes on to define the gp-link and rscs-link relations. They +bring grace periods and read-side critical sections into the picture, +in the following way: + + E ->gp-link F means there is a synchronize_rcu() fence event S + and an event X such that E ->po S, either S ->po X or S = X, + and X ->link F. In other words, E and F are connected by a + grace period followed by an instance of link. + + E ->rscs-link F means there is a critical section delimited by + an rcu_read_lock() fence L and an rcu_read_unlock() fence U, + and an event X such that E ->po U, either L ->po X or L = X, + and X ->link F. Roughly speaking, this says that some event + in the same critical section as E is connected by link to F. + +If we think of the link relation as standing for an extended "before", +then E ->gp-link F says that E executes before a grace period which +ends before F executes. (In fact it says more than this, because it +includes cases where E executes before a grace period and some store +propagates to F's CPU before F executes and doesn't propagate to some +other CPU until after the grace period ends.) Similarly, +E ->rscs-link F says that E is part of (or before the start of) a +critical section which starts before F executes. + +Putting this all together, the LKMM expresses the Grace Period +Guarantee by requiring that there are no cycles consisting of gp-link +and rscs-link connections in which the number of gp-link instances is +>= the number of rscs-link instances. It does this by defining the +rcu-path relation to link events E and F whenever it is possible to +pass from E to F by a sequence of gp-link and rscs-link connections +with at least as many of the former as the latter. The LKMM's "rcu" +axiom then says that there are no events E such that E ->rcu-path E. + +Justifying this axiom takes some intellectual effort, but it is in +fact a valid formalization of the Grace Period Guarantee. We won't +attempt to go through the detailed argument, but the following +analysis gives a taste of what is involved. Suppose we have a +violation of the first part of the Guarantee: A critical section +starts before a grace period, and some store propagates to the +critical section's CPU before the end of the critical section but +doesn't propagate to some other CPU until after the end of the grace +period. + +Putting symbols to these ideas, let L and U be the rcu_read_lock() and +rcu_read_unlock() fence events delimiting the critical section in +question, and let S be the synchronize_rcu() fence event for the grace +period. Saying that the critical section starts before S means there +are events E and F where E is po-after L (which marks the start of the +critical section), E is "before" F in the sense of the link relation, +and F is po-before the grace period S: + + L ->po E ->link F ->po S. + +Let W be the store mentioned above, let Z come before the end of the +critical section and witness that W propagates to the critical +section's CPU by reading from W, and let Y on some arbitrary CPU be a +witness that W has not propagated to that CPU, where Y happens after +some event X which is po-after S. Symbolically, this amounts to: + + S ->po X ->hb* Y ->fr W ->rf Z ->po U. + +The fr link from Y to W indicates that W has not propagated to Y's CPU +at the time that Y executes. From this, it can be shown (see the +discussion of the link relation earlier) that X and Z are connected by +link, yielding: + + S ->po X ->link Z ->po U. + +These formulas say that S is po-between F and X, hence F ->gp-link Z +via X. They also say that Z comes before the end of the critical +section and E comes after its start, hence Z ->rscs-link F via E. But +now we have a forbidden cycle: F ->gp-link Z ->rscs-link F. Thus the +"rcu" axiom rules out this violation of the Grace Period Guarantee. + +For something a little more down-to-earth, let's see how the axiom +works out in practice. Consider the RCU code example from above, this +time with statement labels added to the memory access instructions: + + int x, y; + + P0() + { + rcu_read_lock(); + W: WRITE_ONCE(x, 1); + X: WRITE_ONCE(y, 1); + rcu_read_unlock(); + } + + P1() + { + int r1, r2; + + Y: r1 = READ_ONCE(x); + synchronize_rcu(); + Z: r2 = READ_ONCE(y); + } + + +If r2 = 0 at the end then P0's store at X overwrites the value +that P1's load at Z reads from, so we have Z ->fre X and thus +Z ->link X. In addition, there is a synchronize_rcu() between Y and +Z, so therefore we have Y ->gp-link X. + +If r1 = 1 at the end then P1's load at Y reads from P0's store at W, +so we have W ->link Y. In addition, W and X are in the same critical +section, so therefore we have X ->rscs-link Y. + +This gives us a cycle, Y ->gp-link X ->rscs-link Y, with one gp-link +and one rscs-link, violating the "rcu" axiom. Hence the outcome is +not allowed by the LKMM, as we would expect. + +For contrast, let's see what can happen in a more complicated example: + + int x, y, z; + + P0() + { + int r0; + + rcu_read_lock(); + W: r0 = READ_ONCE(x); + X: WRITE_ONCE(y, 1); + rcu_read_unlock(); + } + + P1() + { + int r1; + + Y: r1 = READ_ONCE(y); + synchronize_rcu(); + Z: WRITE_ONCE(z, 1); + } + + P2() + { + int r2; + + rcu_read_lock(); + U: r2 = READ_ONCE(z); + V: WRITE_ONCE(x, 1); + rcu_read_unlock(); + } + +If r0 = r1 = r2 = 1 at the end, then similar reasoning to before shows +that W ->rscs-link Y via X, Y ->gp-link U via Z, and U ->rscs-link W +via V. And just as before, this gives a cycle: + + W ->rscs-link Y ->gp-link U ->rscs-link W. + +However, this cycle has fewer gp-link instances than rscs-link +instances, and consequently the outcome is not forbidden by the LKMM. +The following instruction timing diagram shows how it might actually +occur: + +P0 P1 P2 +-------------------- -------------------- -------------------- +rcu_read_lock() +X: WRITE_ONCE(y, 1) + Y: r1 = READ_ONCE(y) + synchronize_rcu() starts + . rcu_read_lock() + . V: WRITE_ONCE(x, 1) +W: r0 = READ_ONCE(x) . +rcu_read_unlock() . + synchronize_rcu() ends + Z: WRITE_ONCE(z, 1) + U: r2 = READ_ONCE(z) + rcu_read_unlock() + +This requires P0 and P2 to execute their loads and stores out of +program order, but of course they are allowed to do so. And as you +can see, the Grace Period Guarantee is not violated: The critical +section in P0 both starts before P1's grace period does and ends +before it does, and the critical section in P2 both starts after P1's +grace period does and ends after it does. + + +ODDS AND ENDS +------------- + +This section covers material that didn't quite fit anywhere in the +earlier sections. + +The descriptions in this document don't always match the formal +version of the LKMM exactly. For example, the actual formal +definition of the prop relation makes the initial coe or fre part +optional, and it doesn't require the events linked by the relation to +be on the same CPU. These differences are very unimportant; indeed, +instances where the coe/fre part of prop is missing are of no interest +because all the other parts (fences and rfe) are already included in +hb anyway, and where the formal model adds prop into hb, it includes +an explicit requirement that the events being linked are on the same +CPU. + +Another minor difference has to do with events that are both memory +accesses and fences, such as those corresponding to smp_load_acquire() +calls. In the formal model, these events aren't actually both reads +and fences; rather, they are read events with an annotation marking +them as acquires. (Or write events annotated as releases, in the case +smp_store_release().) The final effect is the same. + +Although we didn't mention it above, the instruction execution +ordering provided by the smp_rmb() fence doesn't apply to read events +that are part of a non-value-returning atomic update. For instance, +given: + + atomic_inc(&x); + smp_rmb(); + r1 = READ_ONCE(y); + +it is not guaranteed that the load from y will execute after the +update to x. This is because the ARMv8 architecture allows +non-value-returning atomic operations effectively to be executed off +the CPU. Basically, the CPU tells the memory subsystem to increment +x, and then the increment is carried out by the memory hardware with +no further involvement from the CPU. Since the CPU doesn't ever read +the value of x, there is nothing for the smp_rmb() fence to act on. + +The LKMM defines a few extra synchronization operations in terms of +things we have already covered. In particular, rcu_dereference() is +treated as READ_ONCE() and rcu_assign_pointer() is treated as +smp_store_release() -- which is basically how the Linux kernel treats +them. + +There are a few oddball fences which need special treatment: +smp_mb__before_atomic(), smp_mb__after_atomic(), and +smp_mb__after_spinlock(). The LKMM uses fence events with special +annotations for them; they act as strong fences just like smp_mb() +except for the sets of events that they order. Instead of ordering +all po-earlier events against all po-later events, as smp_mb() does, +they behave as follows: + + smp_mb__before_atomic() orders all po-earlier events against + po-later atomic updates and the events following them; + + smp_mb__after_atomic() orders po-earlier atomic updates and + the events preceding them against all po-later events; + + smp_mb_after_spinlock() orders po-earlier lock acquisition + events and the events preceding them against all po-later + events. + +The LKMM includes locking. In fact, there is special code for locking +in the formal model, added in order to make tools run faster. +However, this special code is intended to be exactly equivalent to +concepts we have already covered. A spinlock_t variable is treated +the same as an int, and spin_lock(&s) is treated the same as: + + while (cmpxchg_acquire(&s, 0, 1) != 0) + cpu_relax(); + +which waits until s is equal to 0 and then atomically sets it to 1, +and where the read part of the atomic update is also an acquire fence. +An alternate way to express the same thing would be: + + r = xchg_acquire(&s, 1); + +along with a requirement that at the end, r = 0. spin_unlock(&s) is +treated the same as: + + smp_store_release(&s, 0); + +Interestingly, RCU and locking each introduce the possibility of +deadlock. When faced with code sequences such as: + + spin_lock(&s); + spin_lock(&s); + spin_unlock(&s); + spin_unlock(&s); + +or: + + rcu_read_lock(); + synchronize_rcu(); + rcu_read_unlock(); + +what does the LKMM have to say? Answer: It says there are no allowed +executions at all, which makes sense. But this can also lead to +misleading results, because if a piece of code has multiple possible +executions, some of which deadlock, the model will report only on the +non-deadlocking executions. For example: + + int x, y; + + P0() + { + int r0; + + WRITE_ONCE(x, 1); + r0 = READ_ONCE(y); + } + + P1() + { + rcu_read_lock(); + if (READ_ONCE(x) > 0) { + WRITE_ONCE(y, 36); + synchronize_rcu(); + } + rcu_read_unlock(); + } + +Is it possible to end up with r0 = 36 at the end? The LKMM will tell +you it is not, but the model won't mention that this is because P1 +will self-deadlock in the executions where it stores 36 in y. diff --git a/tools/memory-model/Documentation/recipes.txt b/tools/memory-model/Documentation/recipes.txt new file mode 100644 index 000000000000..ee4309a87fc4 --- /dev/null +++ b/tools/memory-model/Documentation/recipes.txt @@ -0,0 +1,570 @@ +This document provides "recipes", that is, litmus tests for commonly +occurring situations, as well as a few that illustrate subtly broken but +attractive nuisances. Many of these recipes include example code from +v4.13 of the Linux kernel. + +The first section covers simple special cases, the second section +takes off the training wheels to cover more involved examples, +and the third section provides a few rules of thumb. + + +Simple special cases +==================== + +This section presents two simple special cases, the first being where +there is only one CPU or only one memory location is accessed, and the +second being use of that old concurrency workhorse, locking. + + +Single CPU or single memory location +------------------------------------ + +If there is only one CPU on the one hand or only one variable +on the other, the code will execute in order. There are (as +usual) some things to be careful of: + +1. Some aspects of the C language are unordered. For example, + in the expression "f(x) + g(y)", the order in which f and g are + called is not defined; the object code is allowed to use either + order or even to interleave the computations. + +2. Compilers are permitted to use the "as-if" rule. That is, a + compiler can emit whatever code it likes for normal accesses, + as long as the results of a single-threaded execution appear + just as if the compiler had followed all the relevant rules. + To see this, compile with a high level of optimization and run + the debugger on the resulting binary. + +3. If there is only one variable but multiple CPUs, that variable + must be properly aligned and all accesses to that variable must + be full sized. Variables that straddle cachelines or pages void + your full-ordering warranty, as do undersized accesses that load + from or store to only part of the variable. + +4. If there are multiple CPUs, accesses to shared variables should + use READ_ONCE() and WRITE_ONCE() or stronger to prevent load/store + tearing, load/store fusing, and invented loads and stores. + There are exceptions to this rule, including: + + i. When there is no possibility of a given shared variable + being updated by some other CPU, for example, while + holding the update-side lock, reads from that variable + need not use READ_ONCE(). + + ii. When there is no possibility of a given shared variable + being either read or updated by other CPUs, for example, + when running during early boot, reads from that variable + need not use READ_ONCE() and writes to that variable + need not use WRITE_ONCE(). + + +Locking +------- + +Locking is well-known and straightforward, at least if you don't think +about it too hard. And the basic rule is indeed quite simple: Any CPU that +has acquired a given lock sees any changes previously seen or made by any +CPU before it released that same lock. Note that this statement is a bit +stronger than "Any CPU holding a given lock sees all changes made by any +CPU during the time that CPU was holding this same lock". For example, +consider the following pair of code fragments: + + /* See MP+polocks.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + spin_lock(&mylock); + WRITE_ONCE(y, 1); + spin_unlock(&mylock); + } + + void CPU1(void) + { + spin_lock(&mylock); + r0 = READ_ONCE(y); + spin_unlock(&mylock); + r1 = READ_ONCE(x); + } + +The basic rule guarantees that if CPU0() acquires mylock before CPU1(), +then both r0 and r1 must be set to the value 1. This also has the +consequence that if the final value of r0 is equal to 1, then the final +value of r1 must also be equal to 1. In contrast, the weaker rule would +say nothing about the final value of r1. + +The converse to the basic rule also holds, as illustrated by the +following litmus test: + + /* See MP+porevlocks.litmus. */ + void CPU0(void) + { + r0 = READ_ONCE(y); + spin_lock(&mylock); + r1 = READ_ONCE(x); + spin_unlock(&mylock); + } + + void CPU1(void) + { + spin_lock(&mylock); + WRITE_ONCE(x, 1); + spin_unlock(&mylock); + WRITE_ONCE(y, 1); + } + +This converse to the basic rule guarantees that if CPU0() acquires +mylock before CPU1(), then both r0 and r1 must be set to the value 0. +This also has the consequence that if the final value of r1 is equal +to 0, then the final value of r0 must also be equal to 0. In contrast, +the weaker rule would say nothing about the final value of r0. + +These examples show only a single pair of CPUs, but the effects of the +locking basic rule extend across multiple acquisitions of a given lock +across multiple CPUs. + +However, it is not necessarily the case that accesses ordered by +locking will be seen as ordered by CPUs not holding that lock. +Consider this example: + + /* See Z6.0+pooncelock+pooncelock+pombonce.litmus. */ + void CPU0(void) + { + spin_lock(&mylock); + WRITE_ONCE(x, 1); + WRITE_ONCE(y, 1); + spin_unlock(&mylock); + } + + void CPU1(void) + { + spin_lock(&mylock); + r0 = READ_ONCE(y); + WRITE_ONCE(z, 1); + spin_unlock(&mylock); + } + + void CPU2(void) + { + WRITE_ONCE(z, 2); + smp_mb(); + r1 = READ_ONCE(x); + } + +Counter-intuitive though it might be, it is quite possible to have +the final value of r0 be 1, the final value of z be 2, and the final +value of r1 be 0. The reason for this surprising outcome is that +CPU2() never acquired the lock, and thus did not benefit from the +lock's ordering properties. + +Ordering can be extended to CPUs not holding the lock by careful use +of smp_mb__after_spinlock(): + + /* See Z6.0+pooncelock+poonceLock+pombonce.litmus. */ + void CPU0(void) + { + spin_lock(&mylock); + WRITE_ONCE(x, 1); + WRITE_ONCE(y, 1); + spin_unlock(&mylock); + } + + void CPU1(void) + { + spin_lock(&mylock); + smp_mb__after_spinlock(); + r0 = READ_ONCE(y); + WRITE_ONCE(z, 1); + spin_unlock(&mylock); + } + + void CPU2(void) + { + WRITE_ONCE(z, 2); + smp_mb(); + r1 = READ_ONCE(x); + } + +This addition of smp_mb__after_spinlock() strengthens the lock acquisition +sufficiently to rule out the counter-intuitive outcome. + + +Taking off the training wheels +============================== + +This section looks at more complex examples, including message passing, +load buffering, release-acquire chains, store buffering. +Many classes of litmus tests have abbreviated names, which may be found +here: https://www.cl.cam.ac.uk/~pes20/ppc-supplemental/test6.pdf + + +Message passing (MP) +-------------------- + +The MP pattern has one CPU execute a pair of stores to a pair of variables +and another CPU execute a pair of loads from this same pair of variables, +but in the opposite order. The goal is to avoid the counter-intuitive +outcome in which the first load sees the value written by the second store +but the second load does not see the value written by the first store. +In the absence of any ordering, this goal may not be met, as can be seen +in the MP+poonceonces.litmus litmus test. This section therefore looks at +a number of ways of meeting this goal. + + +Release and acquire +~~~~~~~~~~~~~~~~~~~ + +Use of smp_store_release() and smp_load_acquire() is one way to force +the desired MP ordering. The general approach is shown below: + + /* See MP+pooncerelease+poacquireonce.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + smp_store_release(&y, 1); + } + + void CPU1(void) + { + r0 = smp_load_acquire(&y); + r1 = READ_ONCE(x); + } + +The smp_store_release() macro orders any prior accesses against the +store, while the smp_load_acquire macro orders the load against any +subsequent accesses. Therefore, if the final value of r0 is the value 1, +the final value of r1 must also be the value 1. + +The init_stack_slab() function in lib/stackdepot.c uses release-acquire +in this way to safely initialize of a slab of the stack. Working out +the mutual-exclusion design is left as an exercise for the reader. + + +Assign and dereference +~~~~~~~~~~~~~~~~~~~~~~ + +Use of rcu_assign_pointer() and rcu_dereference() is quite similar to the +use of smp_store_release() and smp_load_acquire(), except that both +rcu_assign_pointer() and rcu_dereference() operate on RCU-protected +pointers. The general approach is shown below: + + /* See MP+onceassign+derefonce.litmus. */ + int z; + int *y = &z; + int x; + + void CPU0(void) + { + WRITE_ONCE(x, 1); + rcu_assign_pointer(y, &x); + } + + void CPU1(void) + { + rcu_read_lock(); + r0 = rcu_dereference(y); + r1 = READ_ONCE(*r0); + rcu_read_unlock(); + } + +In this example, if the final value of r0 is &x then the final value of +r1 must be 1. + +The rcu_assign_pointer() macro has the same ordering properties as does +smp_store_release(), but the rcu_dereference() macro orders the load only +against later accesses that depend on the value loaded. A dependency +is present if the value loaded determines the address of a later access +(address dependency, as shown above), the value written by a later store +(data dependency), or whether or not a later store is executed in the +first place (control dependency). Note that the term "data dependency" +is sometimes casually used to cover both address and data dependencies. + +In lib/prime_numbers.c, the expand_to_next_prime() function invokes +rcu_assign_pointer(), and the next_prime_number() function invokes +rcu_dereference(). This combination mediates access to a bit vector +that is expanded as additional primes are needed. + + +Write and read memory barriers +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +It is usually better to use smp_store_release() instead of smp_wmb() +and to use smp_load_acquire() instead of smp_rmb(). However, the older +smp_wmb() and smp_rmb() APIs are still heavily used, so it is important +to understand their use cases. The general approach is shown below: + + /* See MP+wmbonceonce+rmbonceonce.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + smp_wmb(); + WRITE_ONCE(y, 1); + } + + void CPU1(void) + { + r0 = READ_ONCE(y); + smp_rmb(); + r1 = READ_ONCE(x); + } + +The smp_wmb() macro orders prior stores against later stores, and the +smp_rmb() macro orders prior loads against later loads. Therefore, if +the final value of r0 is 1, the final value of r1 must also be 1. + +The the xlog_state_switch_iclogs() function in fs/xfs/xfs_log.c contains +the following write-side code fragment: + + log->l_curr_block -= log->l_logBBsize; + ASSERT(log->l_curr_block >= 0); + smp_wmb(); + log->l_curr_cycle++; + +And the xlog_valid_lsn() function in fs/xfs/xfs_log_priv.h contains +the corresponding read-side code fragment: + + cur_cycle = ACCESS_ONCE(log->l_curr_cycle); + smp_rmb(); + cur_block = ACCESS_ONCE(log->l_curr_block); + +Alternatively, consider the following comment in function +perf_output_put_handle() in kernel/events/ring_buffer.c: + + * kernel user + * + * if (LOAD ->data_tail) { LOAD ->data_head + * (A) smp_rmb() (C) + * STORE $data LOAD $data + * smp_wmb() (B) smp_mb() (D) + * STORE ->data_head STORE ->data_tail + * } + +The B/C pairing is an example of the MP pattern using smp_wmb() on the +write side and smp_rmb() on the read side. + +Of course, given that smp_mb() is strictly stronger than either smp_wmb() +or smp_rmb(), any code fragment that would work with smp_rmb() and +smp_wmb() would also work with smp_mb() replacing either or both of the +weaker barriers. + + +Load buffering (LB) +------------------- + +The LB pattern has one CPU load from one variable and then store to a +second, while another CPU loads from the second variable and then stores +to the first. The goal is to avoid the counter-intuitive situation where +each load reads the value written by the other CPU's store. In the +absence of any ordering it is quite possible that this may happen, as +can be seen in the LB+poonceonces.litmus litmus test. + +One way of avoiding the counter-intuitive outcome is through the use of a +control dependency paired with a full memory barrier: + + /* See LB+ctrlonceonce+mbonceonce.litmus. */ + void CPU0(void) + { + r0 = READ_ONCE(x); + if (r0) + WRITE_ONCE(y, 1); + } + + void CPU1(void) + { + r1 = READ_ONCE(y); + smp_mb(); + WRITE_ONCE(x, 1); + } + +This pairing of a control dependency in CPU0() with a full memory +barrier in CPU1() prevents r0 and r1 from both ending up equal to 1. + +The A/D pairing from the ring-buffer use case shown earlier also +illustrates LB. Here is a repeat of the comment in +perf_output_put_handle() in kernel/events/ring_buffer.c, showing a +control dependency on the kernel side and a full memory barrier on +the user side: + + * kernel user + * + * if (LOAD ->data_tail) { LOAD ->data_head + * (A) smp_rmb() (C) + * STORE $data LOAD $data + * smp_wmb() (B) smp_mb() (D) + * STORE ->data_head STORE ->data_tail + * } + * + * Where A pairs with D, and B pairs with C. + +The kernel's control dependency between the load from ->data_tail +and the store to data combined with the user's full memory barrier +between the load from data and the store to ->data_tail prevents +the counter-intuitive outcome where the kernel overwrites the data +before the user gets done loading it. + + +Release-acquire chains +---------------------- + +Release-acquire chains are a low-overhead, flexible, and easy-to-use +method of maintaining order. However, they do have some limitations that +need to be fully understood. Here is an example that maintains order: + + /* See ISA2+pooncerelease+poacquirerelease+poacquireonce.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + smp_store_release(&y, 1); + } + + void CPU1(void) + { + r0 = smp_load_acquire(y); + smp_store_release(&z, 1); + } + + void CPU2(void) + { + r1 = smp_load_acquire(z); + r2 = READ_ONCE(x); + } + +In this case, if r0 and r1 both have final values of 1, then r2 must +also have a final value of 1. + +The ordering in this example is stronger than it needs to be. For +example, ordering would still be preserved if CPU1()'s smp_load_acquire() +invocation was replaced with READ_ONCE(). + +It is tempting to assume that CPU0()'s store to x is globally ordered +before CPU1()'s store to z, but this is not the case: + + /* See Z6.0+pooncerelease+poacquirerelease+mbonceonce.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + smp_store_release(&y, 1); + } + + void CPU1(void) + { + r0 = smp_load_acquire(y); + smp_store_release(&z, 1); + } + + void CPU2(void) + { + WRITE_ONCE(z, 2); + smp_mb(); + r1 = READ_ONCE(x); + } + +One might hope that if the final value of r0 is 1 and the final value +of z is 2, then the final value of r1 must also be 1, but it really is +possible for r1 to have the final value of 0. The reason, of course, +is that in this version, CPU2() is not part of the release-acquire chain. +This situation is accounted for in the rules of thumb below. + +Despite this limitation, release-acquire chains are low-overhead as +well as simple and powerful, at least as memory-ordering mechanisms go. + + +Store buffering +--------------- + +Store buffering can be thought of as upside-down load buffering, so +that one CPU first stores to one variable and then loads from a second, +while another CPU stores to the second variable and then loads from the +first. Preserving order requires nothing less than full barriers: + + /* See SB+mbonceonces.litmus. */ + void CPU0(void) + { + WRITE_ONCE(x, 1); + smp_mb(); + r0 = READ_ONCE(y); + } + + void CPU1(void) + { + WRITE_ONCE(y, 1); + smp_mb(); + r1 = READ_ONCE(x); + } + +Omitting either smp_mb() will allow both r0 and r1 to have final +values of 0, but providing both full barriers as shown above prevents +this counter-intuitive outcome. + +This pattern most famously appears as part of Dekker's locking +algorithm, but it has a much more practical use within the Linux kernel +of ordering wakeups. The following comment taken from waitqueue_active() +in include/linux/wait.h shows the canonical pattern: + + * CPU0 - waker CPU1 - waiter + * + * for (;;) { + * @cond = true; prepare_to_wait(&wq_head, &wait, state); + * smp_mb(); // smp_mb() from set_current_state() + * if (waitqueue_active(wq_head)) if (@cond) + * wake_up(wq_head); break; + * schedule(); + * } + * finish_wait(&wq_head, &wait); + +On CPU0, the store is to @cond and the load is in waitqueue_active(). +On CPU1, prepare_to_wait() contains both a store to wq_head and a call +to set_current_state(), which contains an smp_mb() barrier; the load is +"if (@cond)". The full barriers prevent the undesirable outcome where +CPU1 puts the waiting task to sleep and CPU0 fails to wake it up. + +Note that use of locking can greatly simplify this pattern. + + +Rules of thumb +============== + +There might seem to be no pattern governing what ordering primitives are +needed in which situations, but this is not the case. There is a pattern +based on the relation between the accesses linking successive CPUs in a +given litmus test. There are three types of linkage: + +1. Write-to-read, where the next CPU reads the value that the + previous CPU wrote. The LB litmus-test patterns contain only + this type of relation. In formal memory-modeling texts, this + relation is called "reads-from" and is usually abbreviated "rf". + +2. Read-to-write, where the next CPU overwrites the value that the + previous CPU read. The SB litmus test contains only this type + of relation. In formal memory-modeling texts, this relation is + often called "from-reads" and is sometimes abbreviated "fr". + +3. Write-to-write, where the next CPU overwrites the value written + by the previous CPU. The Z6.0 litmus test pattern contains a + write-to-write relation between the last access of CPU1() and + the first access of CPU2(). In formal memory-modeling texts, + this relation is often called "coherence order" and is sometimes + abbreviated "co". In the C++ standard, it is instead called + "modification order" and often abbreviated "mo". + +The strength of memory ordering required for a given litmus test to +avoid a counter-intuitive outcome depends on the types of relations +linking the memory accesses for the outcome in question: + +o If all links are write-to-read links, then the weakest + possible ordering within each CPU suffices. For example, in + the LB litmus test, a control dependency was enough to do the + job. + +o If all but one of the links are write-to-read links, then a + release-acquire chain suffices. Both the MP and the ISA2 + litmus tests illustrate this case. + +o If more than one of the links are something other than + write-to-read links, then a full memory barrier is required + between each successive pair of non-write-to-read links. This + case is illustrated by the Z6.0 litmus tests, both in the + locking and in the release-acquire sections. + +However, if you find yourself having to stretch these rules of thumb +to fit your situation, you should consider creating a litmus test and +running it on the model. diff --git a/tools/memory-model/Documentation/references.txt b/tools/memory-model/Documentation/references.txt new file mode 100644 index 000000000000..ba2e34c2ec3f --- /dev/null +++ b/tools/memory-model/Documentation/references.txt @@ -0,0 +1,107 @@ +This document provides background reading for memory models and related +tools. These documents are aimed at kernel hackers who are interested +in memory models. + + +Hardware manuals and models +=========================== + +o SPARC International Inc. (Ed.). 1994. "The SPARC Architecture + Reference Manual Version 9". SPARC International Inc. + +o Compaq Computer Corporation (Ed.). 2002. "Alpha Architecture + Reference Manual". Compaq Computer Corporation. + +o Intel Corporation (Ed.). 2002. "A Formal Specification of Intel + Itanium Processor Family Memory Ordering". Intel Corporation. + +o Intel Corporation (Ed.). 2002. "Intel 64 and IA-32 Architectures + Software Developer’s Manual". Intel Corporation. + +o Peter Sewell, Susmit Sarkar, Scott Owens, Francesco Zappa Nardelli, + and Magnus O. Myreen. 2010. "x86-TSO: A Rigorous and Usable + Programmer's Model for x86 Multiprocessors". Commun. ACM 53, 7 + (July, 2010), 89-97. http://doi.acm.org/10.1145/1785414.1785443 + +o IBM Corporation (Ed.). 2009. "Power ISA Version 2.06". IBM + Corporation. + +o ARM Ltd. (Ed.). 2009. "ARM Barrier Litmus Tests and Cookbook". + ARM Ltd. + +o Susmit Sarkar, Peter Sewell, Jade Alglave, Luc Maranget, and + Derek Williams. 2011. "Understanding POWER Multiprocessors". In + Proceedings of the 32Nd ACM SIGPLAN Conference on Programming + Language Design and Implementation (PLDI ’11). ACM, New York, + NY, USA, 175–186. + +o Susmit Sarkar, Kayvan Memarian, Scott Owens, Mark Batty, + Peter Sewell, Luc Maranget, Jade Alglave, and Derek Williams. + 2012. "Synchronising C/C++ and POWER". In Proceedings of the 33rd + ACM SIGPLAN Conference on Programming Language Design and + Implementation (PLDI '12). ACM, New York, NY, USA, 311-322. + +o ARM Ltd. (Ed.). 2014. "ARM Architecture Reference Manual (ARMv8, + for ARMv8-A architecture profile)". ARM Ltd. + +o Imagination Technologies, LTD. 2015. "MIPS(R) Architecture + For Programmers, Volume II-A: The MIPS64(R) Instruction, + Set Reference Manual". Imagination Technologies, + LTD. https://imgtec.com/?do-download=4302. + +o Shaked Flur, Kathryn E. Gray, Christopher Pulte, Susmit + Sarkar, Ali Sezgin, Luc Maranget, Will Deacon, and Peter + Sewell. 2016. "Modelling the ARMv8 Architecture, Operationally: + Concurrency and ISA". In Proceedings of the 43rd Annual ACM + SIGPLAN-SIGACT Symposium on Principles of Programming Languages + (POPL ’16). ACM, New York, NY, USA, 608–621. + +o Shaked Flur, Susmit Sarkar, Christopher Pulte, Kyndylan Nienhuis, + Luc Maranget, Kathryn E. Gray, Ali Sezgin, Mark Batty, and Peter + Sewell. 2017. "Mixed-size Concurrency: ARM, POWER, C/C++11, + and SC". In Proceedings of the 44th ACM SIGPLAN Symposium on + Principles of Programming Languages (POPL 2017). ACM, New York, + NY, USA, 429–442. + + +Linux-kernel memory model +========================= + +o Andrea Parri, Alan Stern, Luc Maranget, Paul E. McKenney, + and Jade Alglave. 2017. "A formal model of + Linux-kernel memory ordering - companion webpage". + http://moscova.inria.fr/∼maranget/cats7/linux/. (2017). [Online; + accessed 30-January-2017]. + +o Jade Alglave, Luc Maranget, Paul E. McKenney, Andrea Parri, and + Alan Stern. 2017. "A formal kernel memory-ordering model (part 1)" + Linux Weekly News. https://lwn.net/Articles/718628/ + +o Jade Alglave, Luc Maranget, Paul E. McKenney, Andrea Parri, and + Alan Stern. 2017. "A formal kernel memory-ordering model (part 2)" + Linux Weekly News. https://lwn.net/Articles/720550/ + + +Memory-model tooling +==================== + +o Daniel Jackson. 2002. "Alloy: A Lightweight Object Modelling + Notation". ACM Trans. Softw. Eng. Methodol. 11, 2 (April 2002), + 256–290. http://doi.acm.org/10.1145/505145.505149 + +o Jade Alglave, Luc Maranget, and Michael Tautschnig. 2014. "Herding + Cats: Modelling, Simulation, Testing, and Data Mining for Weak + Memory". ACM Trans. Program. Lang. Syst. 36, 2, Article 7 (July + 2014), 7:1–7:74 pages. + +o Jade Alglave, Patrick Cousot, and Luc Maranget. 2016. "Syntax and + semantics of the weak consistency model specification language + cat". CoRR abs/1608.07531 (2016). http://arxiv.org/abs/1608.07531 + + +Memory-model comparisons +======================== + +o Paul E. McKenney, Ulrich Weigand, Andrea Parri, and Boqun + Feng. 2016. "Linux-Kernel Memory Model". (6 June 2016). + http://open-std.org/JTC1/SC22/WG21/docs/papers/2016/p0124r2.html. diff --git a/tools/memory-model/README b/tools/memory-model/README new file mode 100644 index 000000000000..0b3a5f3c9ccd --- /dev/null +++ b/tools/memory-model/README @@ -0,0 +1,206 @@ + ===================================== + LINUX KERNEL MEMORY CONSISTENCY MODEL + ===================================== + +============ +INTRODUCTION +============ + +This directory contains the memory consistency model (memory model, for +short) of the Linux kernel, written in the "cat" language and executable +by the externally provided "herd7" simulator, which exhaustively explores +the state space of small litmus tests. + +In addition, the "klitmus7" tool (also externally provided) may be used +to convert a litmus test to a Linux kernel module, which in turn allows +that litmus test to be exercised within the Linux kernel. + + +============ +REQUIREMENTS +============ + +Version 7.48 of the "herd7" and "klitmus7" tools must be downloaded +separately: + + https://github.com/herd/herdtools7 + +See "herdtools7/INSTALL.md" for installation instructions. + + +================== +BASIC USAGE: HERD7 +================== + +The memory model is used, in conjunction with "herd7", to exhaustively +explore the state space of small litmus tests. + +For example, to run SB+mbonceonces.litmus against the memory model: + + $ herd7 -conf linux-kernel.cfg litmus-tests/SB+mbonceonces.litmus + +Here is the corresponding output: + + Test SB+mbonceonces Allowed + States 3 + 0:r0=0; 1:r0=1; + 0:r0=1; 1:r0=0; + 0:r0=1; 1:r0=1; + No + Witnesses + Positive: 0 Negative: 3 + Condition exists (0:r0=0 /\ 1:r0=0) + Observation SB+mbonceonces Never 0 3 + Time SB+mbonceonces 0.01 + Hash=d66d99523e2cac6b06e66f4c995ebb48 + +The "Positive: 0 Negative: 3" and the "Never 0 3" each indicate that +this litmus test's "exists" clause can not be satisfied. + +See "herd7 -help" or "herdtools7/doc/" for more information. + + +===================== +BASIC USAGE: KLITMUS7 +===================== + +The "klitmus7" tool converts a litmus test into a Linux kernel module, +which may then be loaded and run. + +For example, to run SB+mbonceonces.litmus against hardware: + + $ mkdir mymodules + $ klitmus7 -o mymodules litmus-tests/SB+mbonceonces.litmus + $ cd mymodules ; make + $ sudo sh run.sh + +The corresponding output includes: + + Test SB+mbonceonces Allowed + Histogram (3 states) + 644580 :>0:r0=1; 1:r0=0; + 644328 :>0:r0=0; 1:r0=1; + 711092 :>0:r0=1; 1:r0=1; + No + Witnesses + Positive: 0, Negative: 2000000 + Condition exists (0:r0=0 /\ 1:r0=0) is NOT validated + Hash=d66d99523e2cac6b06e66f4c995ebb48 + Observation SB+mbonceonces Never 0 2000000 + Time SB+mbonceonces 0.16 + +The "Positive: 0 Negative: 2000000" and the "Never 0 2000000" indicate +that during two million trials, the state specified in this litmus +test's "exists" clause was not reached. + +And, as with "herd7", please see "klitmus7 -help" or "herdtools7/doc/" +for more information. + + +==================== +DESCRIPTION OF FILES +==================== + +Documentation/cheatsheet.txt + Quick-reference guide to the Linux-kernel memory model. + +Documentation/explanation.txt + Describes the memory model in detail. + +Documentation/recipes.txt + Lists common memory-ordering patterns. + +Documentation/references.txt + Provides background reading. + +linux-kernel.bell + Categorizes the relevant instructions, including memory + references, memory barriers, atomic read-modify-write operations, + lock acquisition/release, and RCU operations. + + More formally, this file (1) lists the subtypes of the various + event types used by the memory model and (2) performs RCU + read-side critical section nesting analysis. + +linux-kernel.cat + Specifies what reorderings are forbidden by memory references, + memory barriers, atomic read-modify-write operations, and RCU. + + More formally, this file specifies what executions are forbidden + by the memory model. Allowed executions are those which + satisfy the model's "coherence", "atomic", "happens-before", + "propagation", and "rcu" axioms, which are defined in the file. + +linux-kernel.cfg + Convenience file that gathers the common-case herd7 command-line + arguments. + +linux-kernel.def + Maps from C-like syntax to herd7's internal litmus-test + instruction-set architecture. + +litmus-tests + Directory containing a few representative litmus tests, which + are listed in litmus-tests/README. A great deal more litmus + tests are available at https://github.com/paulmckrcu/litmus. + +lock.cat + Provides a front-end analysis of lock acquisition and release, + for example, associating a lock acquisition with the preceding + and following releases and checking for self-deadlock. + + More formally, this file defines a performance-enhanced scheme + for generation of the possible reads-from and coherence order + relations on the locking primitives. + +README + This file. + + +=========== +LIMITATIONS +=========== + +The Linux-kernel memory model has the following limitations: + +1. Compiler optimizations are not modeled. Of course, the use + of READ_ONCE() and WRITE_ONCE() limits the compiler's ability + to optimize, but there is Linux-kernel code that uses bare C + memory accesses. Handling this code is on the to-do list. + For more information, see Documentation/explanation.txt (in + particular, the "THE PROGRAM ORDER RELATION: po AND po-loc" + and "A WARNING" sections). + +2. Multiple access sizes for a single variable are not supported, + and neither are misaligned or partially overlapping accesses. + +3. Exceptions and interrupts are not modeled. In some cases, + this limitation can be overcome by modeling the interrupt or + exception with an additional process. + +4. I/O such as MMIO or DMA is not supported. + +5. Self-modifying code (such as that found in the kernel's + alternatives mechanism, function tracer, Berkeley Packet Filter + JIT compiler, and module loader) is not supported. + +6. Complete modeling of all variants of atomic read-modify-write + operations, locking primitives, and RCU is not provided. + For example, call_rcu() and rcu_barrier() are not supported. + However, a substantial amount of support is provided for these + operations, as shown in the linux-kernel.def file. + +The "herd7" tool has some additional limitations of its own, apart from +the memory model: + +1. Non-trivial data structures such as arrays or structures are + not supported. However, pointers are supported, allowing trivial + linked lists to be constructed. + +2. Dynamic memory allocation is not supported, although this can + be worked around in some cases by supplying multiple statically + allocated variables. + +Some of these limitations may be overcome in the future, but others are +more likely to be addressed by incorporating the Linux-kernel memory model +into other tools. diff --git a/tools/memory-model/linux-kernel.bell b/tools/memory-model/linux-kernel.bell new file mode 100644 index 000000000000..432c7cf71b23 --- /dev/null +++ b/tools/memory-model/linux-kernel.bell @@ -0,0 +1,52 @@ +// SPDX-License-Identifier: GPL-2.0+ +(* + * Copyright (C) 2015 Jade Alglave <j.alglave@ucl.ac.uk>, + * Copyright (C) 2016 Luc Maranget <luc.maranget@inria.fr> for Inria + * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu>, + * Andrea Parri <parri.andrea@gmail.com> + * + * An earlier version of this file appears in the companion webpage for + * "Frightening small children and disconcerting grown-ups: Concurrency + * in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, + * which is to appear in ASPLOS 2018. + *) + +"Linux-kernel memory consistency model" + +enum Accesses = 'once (*READ_ONCE,WRITE_ONCE,ACCESS_ONCE*) || + 'release (*smp_store_release*) || + 'acquire (*smp_load_acquire*) || + 'noreturn (* R of non-return RMW *) +instructions R[{'once,'acquire,'noreturn}] +instructions W[{'once,'release}] +instructions RMW[{'once,'acquire,'release}] + +enum Barriers = 'wmb (*smp_wmb*) || + 'rmb (*smp_rmb*) || + 'mb (*smp_mb*) || + 'rcu-lock (*rcu_read_lock*) || + 'rcu-unlock (*rcu_read_unlock*) || + 'sync-rcu (*synchronize_rcu*) || + 'before-atomic (*smp_mb__before_atomic*) || + 'after-atomic (*smp_mb__after_atomic*) || + 'after-spinlock (*smp_mb__after_spinlock*) +instructions F[Barriers] + +(* Compute matching pairs of nested Rcu-lock and Rcu-unlock *) +let matched = let rec + unmatched-locks = Rcu-lock \ domain(matched) + and unmatched-unlocks = Rcu-unlock \ range(matched) + and unmatched = unmatched-locks | unmatched-unlocks + and unmatched-po = [unmatched] ; po ; [unmatched] + and unmatched-locks-to-unlocks = + [unmatched-locks] ; po ; [unmatched-unlocks] + and matched = matched | (unmatched-locks-to-unlocks \ + (unmatched-po ; unmatched-po)) + in matched + +(* Validate nesting *) +flag ~empty Rcu-lock \ domain(matched) as unbalanced-rcu-locking +flag ~empty Rcu-unlock \ range(matched) as unbalanced-rcu-locking + +(* Outermost level of nesting only *) +let crit = matched \ (po^-1 ; matched ; po^-1) diff --git a/tools/memory-model/linux-kernel.cat b/tools/memory-model/linux-kernel.cat new file mode 100644 index 000000000000..df97db03b6c2 --- /dev/null +++ b/tools/memory-model/linux-kernel.cat @@ -0,0 +1,121 @@ +// SPDX-License-Identifier: GPL-2.0+ +(* + * Copyright (C) 2015 Jade Alglave <j.alglave@ucl.ac.uk>, + * Copyright (C) 2016 Luc Maranget <luc.maranget@inria.fr> for Inria + * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu>, + * Andrea Parri <parri.andrea@gmail.com> + * + * An earlier version of this file appears in the companion webpage for + * "Frightening small children and disconcerting grown-ups: Concurrency + * in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, + * which is to appear in ASPLOS 2018. + *) + +"Linux-kernel memory consistency model" + +(* + * File "lock.cat" handles locks and is experimental. + * It can be replaced by include "cos.cat" for tests that do not use locks. + *) + +include "lock.cat" + +(*******************) +(* Basic relations *) +(*******************) + +(* Fences *) +let rmb = [R \ Noreturn] ; fencerel(Rmb) ; [R \ Noreturn] +let wmb = [W] ; fencerel(Wmb) ; [W] +let mb = ([M] ; fencerel(Mb) ; [M]) | + ([M] ; fencerel(Before-atomic) ; [RMW] ; po? ; [M]) | + ([M] ; po? ; [RMW] ; fencerel(After-atomic) ; [M]) | + ([M] ; po? ; [LKW] ; fencerel(After-spinlock) ; [M]) +let gp = po ; [Sync-rcu] ; po? + +let strong-fence = mb | gp + +(* Release Acquire *) +let acq-po = [Acquire] ; po ; [M] +let po-rel = [M] ; po ; [Release] +let rfi-rel-acq = [Release] ; rfi ; [Acquire] + +(**********************************) +(* Fundamental coherence ordering *) +(**********************************) + +(* Sequential Consistency Per Variable *) +let com = rf | co | fr +acyclic po-loc | com as coherence + +(* Atomic Read-Modify-Write *) +empty rmw & (fre ; coe) as atomic + +(**********************************) +(* Instruction execution ordering *) +(**********************************) + +(* Preserved Program Order *) +let dep = addr | data +let rwdep = (dep | ctrl) ; [W] +let overwrite = co | fr +let to-w = rwdep | (overwrite & int) +let to-r = addr | (dep ; rfi) | rfi-rel-acq +let fence = strong-fence | wmb | po-rel | rmb | acq-po +let ppo = to-r | to-w | fence + +(* Propagation: Ordering from release operations and strong fences. *) +let A-cumul(r) = rfe? ; r +let cumul-fence = A-cumul(strong-fence | po-rel) | wmb +let prop = (overwrite & ext)? ; cumul-fence* ; rfe? + +(* + * Happens Before: Ordering from the passage of time. + * No fences needed here for prop because relation confined to one process. + *) +let hb = ppo | rfe | ((prop \ id) & int) +acyclic hb as happens-before + +(****************************************) +(* Write and fence propagation ordering *) +(****************************************) + +(* Propagation: Each non-rf link needs a strong fence. *) +let pb = prop ; strong-fence ; hb* +acyclic pb as propagation + +(*******) +(* RCU *) +(*******) + +(* + * Effect of read-side critical section proceeds from the rcu_read_lock() + * onward on the one hand and from the rcu_read_unlock() backwards on the + * other hand. + *) +let rscs = po ; crit^-1 ; po? + +(* + * The synchronize_rcu() strong fence is special in that it can order not + * one but two non-rf relations, but only in conjunction with an RCU + * read-side critical section. + *) +let link = hb* ; pb* ; prop + +(* Chains that affect the RCU grace-period guarantee *) +let gp-link = gp ; link +let rscs-link = rscs ; link + +(* + * A cycle containing at least as many grace periods as RCU read-side + * critical sections is forbidden. + *) +let rec rcu-path = + gp-link | + (gp-link ; rscs-link) | + (rscs-link ; gp-link) | + (rcu-path ; rcu-path) | + (gp-link ; rcu-path ; rscs-link) | + (rscs-link ; rcu-path ; gp-link) + +irreflexive rcu-path as rcu diff --git a/tools/memory-model/linux-kernel.cfg b/tools/memory-model/linux-kernel.cfg new file mode 100644 index 000000000000..3c8098e99f41 --- /dev/null +++ b/tools/memory-model/linux-kernel.cfg @@ -0,0 +1,21 @@ +macros linux-kernel.def +bell linux-kernel.bell +model linux-kernel.cat +graph columns +squished true +showevents noregs +movelabel true +fontsize 8 +xscale 2.0 +yscale 1.5 +arrowsize 0.8 +showinitrf false +showfinalrf false +showinitwrites false +splines spline +pad 0.1 +edgeattr hb,color,indigo +edgeattr co,color,blue +edgeattr mb,color,darkgreen +edgeattr wmb,color,darkgreen +edgeattr rmb,color,darkgreen diff --git a/tools/memory-model/linux-kernel.def b/tools/memory-model/linux-kernel.def new file mode 100644 index 000000000000..397e4e67e8c8 --- /dev/null +++ b/tools/memory-model/linux-kernel.def @@ -0,0 +1,106 @@ +// SPDX-License-Identifier: GPL-2.0+ +// +// An earlier version of this file appears in the companion webpage for +// "Frightening small children and disconcerting grown-ups: Concurrency +// in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, +// which is to appear in ASPLOS 2018. + +// ONCE +READ_ONCE(X) __load{once}(X) +WRITE_ONCE(X,V) { __store{once}(X,V); } + +// Release Acquire and friends +smp_store_release(X,V) { __store{release}(*X,V); } +smp_load_acquire(X) __load{acquire}(*X) +rcu_assign_pointer(X,V) { __store{release}(X,V); } +rcu_dereference(X) __load{once}(X) + +// Fences +smp_mb() { __fence{mb} ; } +smp_rmb() { __fence{rmb} ; } +smp_wmb() { __fence{wmb} ; } +smp_mb__before_atomic() { __fence{before-atomic} ; } +smp_mb__after_atomic() { __fence{after-atomic} ; } +smp_mb__after_spinlock() { __fence{after-spinlock} ; } + +// Exchange +xchg(X,V) __xchg{mb}(X,V) +xchg_relaxed(X,V) __xchg{once}(X,V) +xchg_release(X,V) __xchg{release}(X,V) +xchg_acquire(X,V) __xchg{acquire}(X,V) +cmpxchg(X,V,W) __cmpxchg{mb}(X,V,W) +cmpxchg_relaxed(X,V,W) __cmpxchg{once}(X,V,W) +cmpxchg_acquire(X,V,W) __cmpxchg{acquire}(X,V,W) +cmpxchg_release(X,V,W) __cmpxchg{release}(X,V,W) + +// Spinlocks +spin_lock(X) { __lock(X) ; } +spin_unlock(X) { __unlock(X) ; } +spin_trylock(X) __trylock(X) + +// RCU +rcu_read_lock() { __fence{rcu-lock}; } +rcu_read_unlock() { __fence{rcu-unlock};} +synchronize_rcu() { __fence{sync-rcu}; } +synchronize_rcu_expedited() { __fence{sync-rcu}; } + +// Atomic +atomic_read(X) READ_ONCE(*X) +atomic_set(X,V) { WRITE_ONCE(*X,V) ; } +atomic_read_acquire(X) smp_load_acquire(X) +atomic_set_release(X,V) { smp_store_release(X,V); } + +atomic_add(V,X) { __atomic_op(X,+,V) ; } +atomic_sub(V,X) { __atomic_op(X,-,V) ; } +atomic_inc(X) { __atomic_op(X,+,1) ; } +atomic_dec(X) { __atomic_op(X,-,1) ; } + +atomic_add_return(V,X) __atomic_op_return{mb}(X,+,V) +atomic_add_return_relaxed(V,X) __atomic_op_return{once}(X,+,V) +atomic_add_return_acquire(V,X) __atomic_op_return{acquire}(X,+,V) +atomic_add_return_release(V,X) __atomic_op_return{release}(X,+,V) +atomic_fetch_add(V,X) __atomic_fetch_op{mb}(X,+,V) +atomic_fetch_add_relaxed(V,X) __atomic_fetch_op{once}(X,+,V) +atomic_fetch_add_acquire(V,X) __atomic_fetch_op{acquire}(X,+,V) +atomic_fetch_add_release(V,X) __atomic_fetch_op{release}(X,+,V) + +atomic_inc_return(X) __atomic_op_return{mb}(X,+,1) +atomic_inc_return_relaxed(X) __atomic_op_return{once}(X,+,1) +atomic_inc_return_acquire(X) __atomic_op_return{acquire}(X,+,1) +atomic_inc_return_release(X) __atomic_op_return{release}(X,+,1) +atomic_fetch_inc(X) __atomic_fetch_op{mb}(X,+,1) +atomic_fetch_inc_relaxed(X) __atomic_fetch_op{once}(X,+,1) +atomic_fetch_inc_acquire(X) __atomic_fetch_op{acquire}(X,+,1) +atomic_fetch_inc_release(X) __atomic_fetch_op{release}(X,+,1) + +atomic_sub_return(V,X) __atomic_op_return{mb}(X,-,V) +atomic_sub_return_relaxed(V,X) __atomic_op_return{once}(X,-,V) +atomic_sub_return_acquire(V,X) __atomic_op_return{acquire}(X,-,V) +atomic_sub_return_release(V,X) __atomic_op_return{release}(X,-,V) +atomic_fetch_sub(V,X) __atomic_fetch_op{mb}(X,-,V) +atomic_fetch_sub_relaxed(V,X) __atomic_fetch_op{once}(X,-,V) +atomic_fetch_sub_acquire(V,X) __atomic_fetch_op{acquire}(X,-,V) +atomic_fetch_sub_release(V,X) __atomic_fetch_op{release}(X,-,V) + +atomic_dec_return(X) __atomic_op_return{mb}(X,-,1) +atomic_dec_return_relaxed(X) __atomic_op_return{once}(X,-,1) +atomic_dec_return_acquire(X) __atomic_op_return{acquire}(X,-,1) +atomic_dec_return_release(X) __atomic_op_return{release}(X,-,1) +atomic_fetch_dec(X) __atomic_fetch_op{mb}(X,-,1) +atomic_fetch_dec_relaxed(X) __atomic_fetch_op{once}(X,-,1) +atomic_fetch_dec_acquire(X) __atomic_fetch_op{acquire}(X,-,1) +atomic_fetch_dec_release(X) __atomic_fetch_op{release}(X,-,1) + +atomic_xchg(X,V) __xchg{mb}(X,V) +atomic_xchg_relaxed(X,V) __xchg{once}(X,V) +atomic_xchg_release(X,V) __xchg{release}(X,V) +atomic_xchg_acquire(X,V) __xchg{acquire}(X,V) +atomic_cmpxchg(X,V,W) __cmpxchg{mb}(X,V,W) +atomic_cmpxchg_relaxed(X,V,W) __cmpxchg{once}(X,V,W) +atomic_cmpxchg_acquire(X,V,W) __cmpxchg{acquire}(X,V,W) +atomic_cmpxchg_release(X,V,W) __cmpxchg{release}(X,V,W) + +atomic_sub_and_test(V,X) __atomic_op_return{mb}(X,-,V) == 0 +atomic_dec_and_test(X) __atomic_op_return{mb}(X,-,1) == 0 +atomic_inc_and_test(X) __atomic_op_return{mb}(X,+,1) == 0 +atomic_add_negative(V,X) __atomic_op_return{mb}(X,+,V) < 0 diff --git a/tools/memory-model/litmus-tests/CoRR+poonceonce+Once.litmus b/tools/memory-model/litmus-tests/CoRR+poonceonce+Once.litmus new file mode 100644 index 000000000000..967f9f2a6226 --- /dev/null +++ b/tools/memory-model/litmus-tests/CoRR+poonceonce+Once.litmus @@ -0,0 +1,26 @@ +C CoRR+poonceonce+Once + +(* + * Result: Never + * + * Test of read-read coherence, that is, whether or not two successive + * reads from the same variable are ordered. + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); +} + +P1(int *x) +{ + int r0; + int r1; + + r0 = READ_ONCE(*x); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/CoRW+poonceonce+Once.litmus b/tools/memory-model/litmus-tests/CoRW+poonceonce+Once.litmus new file mode 100644 index 000000000000..4635739f3974 --- /dev/null +++ b/tools/memory-model/litmus-tests/CoRW+poonceonce+Once.litmus @@ -0,0 +1,25 @@ +C CoRW+poonceonce+Once + +(* + * Result: Never + * + * Test of read-write coherence, that is, whether or not a read from + * a given variable and a later write to that same variable are ordered. + *) + +{} + +P0(int *x) +{ + int r0; + + r0 = READ_ONCE(*x); + WRITE_ONCE(*x, 1); +} + +P1(int *x) +{ + WRITE_ONCE(*x, 2); +} + +exists (x=2 /\ 0:r0=2) diff --git a/tools/memory-model/litmus-tests/CoWR+poonceonce+Once.litmus b/tools/memory-model/litmus-tests/CoWR+poonceonce+Once.litmus new file mode 100644 index 000000000000..bb068c92d8da --- /dev/null +++ b/tools/memory-model/litmus-tests/CoWR+poonceonce+Once.litmus @@ -0,0 +1,25 @@ +C CoWR+poonceonce+Once + +(* + * Result: Never + * + * Test of write-read coherence, that is, whether or not a write to a + * given variable and a later read from that same variable are ordered. + *) + +{} + +P0(int *x) +{ + int r0; + + WRITE_ONCE(*x, 1); + r0 = READ_ONCE(*x); +} + +P1(int *x) +{ + WRITE_ONCE(*x, 2); +} + +exists (x=1 /\ 0:r0=2) diff --git a/tools/memory-model/litmus-tests/CoWW+poonceonce.litmus b/tools/memory-model/litmus-tests/CoWW+poonceonce.litmus new file mode 100644 index 000000000000..0d9f0a958799 --- /dev/null +++ b/tools/memory-model/litmus-tests/CoWW+poonceonce.litmus @@ -0,0 +1,18 @@ +C CoWW+poonceonce + +(* + * Result: Never + * + * Test of write-write coherence, that is, whether or not two successive + * writes to the same variable are ordered. + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); + WRITE_ONCE(*x, 2); +} + +exists (x=1) diff --git a/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus b/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus new file mode 100644 index 000000000000..50d5db9ea983 --- /dev/null +++ b/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus @@ -0,0 +1,45 @@ +C IRIW+mbonceonces+OnceOnce + +(* + * Result: Never + * + * Test of independent reads from independent writes with smp_mb() + * between each pairs of reads. In other words, is smp_mb() sufficient to + * cause two different reading processes to agree on the order of a pair + * of writes, where each write is to a different variable by a different + * process? + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); +} + +P1(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*x); + smp_mb(); + r1 = READ_ONCE(*y); +} + +P2(int *y) +{ + WRITE_ONCE(*y, 1); +} + +P3(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + smp_mb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0 /\ 3:r0=1 /\ 3:r1=0) diff --git a/tools/memory-model/litmus-tests/IRIW+poonceonces+OnceOnce.litmus b/tools/memory-model/litmus-tests/IRIW+poonceonces+OnceOnce.litmus new file mode 100644 index 000000000000..4b54dd6a6cd9 --- /dev/null +++ b/tools/memory-model/litmus-tests/IRIW+poonceonces+OnceOnce.litmus @@ -0,0 +1,43 @@ +C IRIW+poonceonces+OnceOnce + +(* + * Result: Sometimes + * + * Test of independent reads from independent writes with nothing + * between each pairs of reads. In other words, is anything at all + * needed to cause two different reading processes to agree on the order + * of a pair of writes, where each write is to a different variable by a + * different process? + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); +} + +P1(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*x); + r1 = READ_ONCE(*y); +} + +P2(int *y) +{ + WRITE_ONCE(*y, 1); +} + +P3(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0 /\ 3:r0=1 /\ 3:r1=0) diff --git a/tools/memory-model/litmus-tests/ISA2+pooncelock+pooncelock+pombonce.litmus b/tools/memory-model/litmus-tests/ISA2+pooncelock+pooncelock+pombonce.litmus new file mode 100644 index 000000000000..7a39a0aaa976 --- /dev/null +++ b/tools/memory-model/litmus-tests/ISA2+pooncelock+pooncelock+pombonce.litmus @@ -0,0 +1,41 @@ +C ISA2+pooncelock+pooncelock+pombonce.litmus + +(* + * Result: Sometimes + * + * This test shows that the ordering provided by a lock-protected S + * litmus test (P0() and P1()) are not visible to external process P2(). + * This is likely to change soon. + *) + +{} + +P0(int *x, int *y, spinlock_t *mylock) +{ + spin_lock(mylock); + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); + spin_unlock(mylock); +} + +P1(int *y, int *z, spinlock_t *mylock) +{ + int r0; + + spin_lock(mylock); + r0 = READ_ONCE(*y); + WRITE_ONCE(*z, 1); + spin_unlock(mylock); +} + +P2(int *x, int *z) +{ + int r1; + int r2; + + r2 = READ_ONCE(*z); + smp_mb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 2:r2=1 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/ISA2+poonceonces.litmus b/tools/memory-model/litmus-tests/ISA2+poonceonces.litmus new file mode 100644 index 000000000000..b321aa6f4ea5 --- /dev/null +++ b/tools/memory-model/litmus-tests/ISA2+poonceonces.litmus @@ -0,0 +1,37 @@ +C ISA2+poonceonces + +(* + * Result: Sometimes + * + * Given a release-acquire chain ordering the first process's store + * against the last process's load, is ordering preserved if all of the + * smp_store_release() invocations are replaced by WRITE_ONCE() and all + * of the smp_load_acquire() invocations are replaced by READ_ONCE()? + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); +} + +P1(int *y, int *z) +{ + int r0; + + r0 = READ_ONCE(*y); + WRITE_ONCE(*z, 1); +} + +P2(int *x, int *z) +{ + int r0; + int r1; + + r0 = READ_ONCE(*z); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 2:r0=1 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/ISA2+pooncerelease+poacquirerelease+poacquireonce.litmus b/tools/memory-model/litmus-tests/ISA2+pooncerelease+poacquirerelease+poacquireonce.litmus new file mode 100644 index 000000000000..025b0462ec9b --- /dev/null +++ b/tools/memory-model/litmus-tests/ISA2+pooncerelease+poacquirerelease+poacquireonce.litmus @@ -0,0 +1,39 @@ +C ISA2+pooncerelease+poacquirerelease+poacquireonce + +(* + * Result: Never + * + * This litmus test demonstrates that a release-acquire chain suffices + * to order P0()'s initial write against P2()'s final read. The reason + * that the release-acquire chain suffices is because in all but one + * case (P2() to P0()), each process reads from the preceding process's + * write. In memory-model-speak, there is only one non-reads-from + * (AKA non-rf) link, so release-acquire is all that is needed. + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + smp_store_release(y, 1); +} + +P1(int *y, int *z) +{ + int r0; + + r0 = smp_load_acquire(y); + smp_store_release(z, 1); +} + +P2(int *x, int *z) +{ + int r0; + int r1; + + r0 = smp_load_acquire(z); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 2:r0=1 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/LB+ctrlonceonce+mbonceonce.litmus b/tools/memory-model/litmus-tests/LB+ctrlonceonce+mbonceonce.litmus new file mode 100644 index 000000000000..de6708229dd1 --- /dev/null +++ b/tools/memory-model/litmus-tests/LB+ctrlonceonce+mbonceonce.litmus @@ -0,0 +1,34 @@ +C LB+ctrlonceonce+mbonceonce + +(* + * Result: Never + * + * This litmus test demonstrates that lightweight ordering suffices for + * the load-buffering pattern, in other words, preventing all processes + * reading from the preceding process's write. In this example, the + * combination of a control dependency and a full memory barrier are enough + * to do the trick. (But the full memory barrier could be replaced with + * another control dependency and order would still be maintained.) + *) + +{} + +P0(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*x); + if (r0) + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*y); + smp_mb(); + WRITE_ONCE(*x, 1); +} + +exists (0:r0=1 /\ 1:r0=1) diff --git a/tools/memory-model/litmus-tests/LB+poacquireonce+pooncerelease.litmus b/tools/memory-model/litmus-tests/LB+poacquireonce+pooncerelease.litmus new file mode 100644 index 000000000000..07b9904b0e49 --- /dev/null +++ b/tools/memory-model/litmus-tests/LB+poacquireonce+pooncerelease.litmus @@ -0,0 +1,29 @@ +C LB+poacquireonce+pooncerelease + +(* + * Result: Never + * + * Does a release-acquire pair suffice for the load-buffering litmus + * test, where each process reads from one of two variables then writes + * to the other? + *) + +{} + +P0(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*x); + smp_store_release(y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = smp_load_acquire(y); + WRITE_ONCE(*x, 1); +} + +exists (0:r0=1 /\ 1:r0=1) diff --git a/tools/memory-model/litmus-tests/LB+poonceonces.litmus b/tools/memory-model/litmus-tests/LB+poonceonces.litmus new file mode 100644 index 000000000000..74c49cb3c37b --- /dev/null +++ b/tools/memory-model/litmus-tests/LB+poonceonces.litmus @@ -0,0 +1,28 @@ +C LB+poonceonces + +(* + * Result: Sometimes + * + * Can the counter-intuitive outcome for the load-buffering pattern + * be prevented even with no explicit ordering? + *) + +{} + +P0(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*x); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*y); + WRITE_ONCE(*x, 1); +} + +exists (0:r0=1 /\ 1:r0=1) diff --git a/tools/memory-model/litmus-tests/MP+onceassign+derefonce.litmus b/tools/memory-model/litmus-tests/MP+onceassign+derefonce.litmus new file mode 100644 index 000000000000..97731b4bbdd8 --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+onceassign+derefonce.litmus @@ -0,0 +1,34 @@ +C MP+onceassign+derefonce + +(* + * Result: Never + * + * This litmus test demonstrates that rcu_assign_pointer() and + * rcu_dereference() suffice to ensure that an RCU reader will not see + * pre-initialization garbage when it traverses an RCU-protected data + * structure containing a newly inserted element. + *) + +{ +y=z; +z=0; +} + +P0(int *x, int **y) +{ + WRITE_ONCE(*x, 1); + rcu_assign_pointer(*y, x); +} + +P1(int *x, int **y) +{ + int *r0; + int r1; + + rcu_read_lock(); + r0 = rcu_dereference(*y); + r1 = READ_ONCE(*r0); + rcu_read_unlock(); +} + +exists (1:r0=x /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/MP+polocks.litmus b/tools/memory-model/litmus-tests/MP+polocks.litmus new file mode 100644 index 000000000000..712a4fcdf6ce --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+polocks.litmus @@ -0,0 +1,35 @@ +C MP+polocks + +(* + * Result: Never + * + * This litmus test demonstrates how lock acquisitions and releases can + * stand in for smp_load_acquire() and smp_store_release(), respectively. + * In other words, when holding a given lock (or indeed after releasing a + * given lock), a CPU is not only guaranteed to see the accesses that other + * CPUs made while previously holding that lock, it is also guaranteed + * to see all prior accesses by those other CPUs. + *) + +{} + +P0(int *x, int *y, spinlock_t *mylock) +{ + WRITE_ONCE(*x, 1); + spin_lock(mylock); + WRITE_ONCE(*y, 1); + spin_unlock(mylock); +} + +P1(int *x, int *y, spinlock_t *mylock) +{ + int r0; + int r1; + + spin_lock(mylock); + r0 = READ_ONCE(*y); + spin_unlock(mylock); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/MP+poonceonces.litmus b/tools/memory-model/litmus-tests/MP+poonceonces.litmus new file mode 100644 index 000000000000..b2b60b84fb9d --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+poonceonces.litmus @@ -0,0 +1,27 @@ +C MP+poonceonces + +(* + * Result: Maybe + * + * Can the counter-intuitive message-passing outcome be prevented with + * no ordering at all? + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/MP+pooncerelease+poacquireonce.litmus b/tools/memory-model/litmus-tests/MP+pooncerelease+poacquireonce.litmus new file mode 100644 index 000000000000..d52c68429722 --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+pooncerelease+poacquireonce.litmus @@ -0,0 +1,28 @@ +C MP+pooncerelease+poacquireonce + +(* + * Result: Never + * + * This litmus test demonstrates that smp_store_release() and + * smp_load_acquire() provide sufficient ordering for the message-passing + * pattern. + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + smp_store_release(y, 1); +} + +P1(int *x, int *y) +{ + int r0; + int r1; + + r0 = smp_load_acquire(y); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/MP+porevlocks.litmus b/tools/memory-model/litmus-tests/MP+porevlocks.litmus new file mode 100644 index 000000000000..72c9276b363e --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+porevlocks.litmus @@ -0,0 +1,35 @@ +C MP+porevlocks + +(* + * Result: Never + * + * This litmus test demonstrates how lock acquisitions and releases can + * stand in for smp_load_acquire() and smp_store_release(), respectively. + * In other words, when holding a given lock (or indeed after releasing a + * given lock), a CPU is not only guaranteed to see the accesses that other + * CPUs made while previously holding that lock, it is also guaranteed to + * see all prior accesses by those other CPUs. + *) + +{} + +P0(int *x, int *y, spinlock_t *mylock) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + spin_lock(mylock); + r1 = READ_ONCE(*x); + spin_unlock(mylock); +} + +P1(int *x, int *y, spinlock_t *mylock) +{ + spin_lock(mylock); + WRITE_ONCE(*x, 1); + spin_unlock(mylock); + WRITE_ONCE(*y, 1); +} + +exists (0:r0=1 /\ 0:r1=0) diff --git a/tools/memory-model/litmus-tests/MP+wmbonceonce+rmbonceonce.litmus b/tools/memory-model/litmus-tests/MP+wmbonceonce+rmbonceonce.litmus new file mode 100644 index 000000000000..c078f38ff27a --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+wmbonceonce+rmbonceonce.litmus @@ -0,0 +1,30 @@ +C MP+wmbonceonce+rmbonceonce + +(* + * Result: Never + * + * This litmus test demonstrates that smp_wmb() and smp_rmb() provide + * sufficient ordering for the message-passing pattern. However, it + * is usually better to use smp_store_release() and smp_load_acquire(). + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + smp_wmb(); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + smp_rmb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 1:r1=0) diff --git a/tools/memory-model/litmus-tests/R+mbonceonces.litmus b/tools/memory-model/litmus-tests/R+mbonceonces.litmus new file mode 100644 index 000000000000..a0e884ad2132 --- /dev/null +++ b/tools/memory-model/litmus-tests/R+mbonceonces.litmus @@ -0,0 +1,30 @@ +C R+mbonceonces + +(* + * Result: Never + * + * This is the fully ordered (via smp_mb()) version of one of the classic + * counterintuitive litmus tests that illustrates the effects of store + * propagation delays. Note that weakening either of the barriers would + * cause the resulting test to be allowed. + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + smp_mb(); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*y, 2); + smp_mb(); + r0 = READ_ONCE(*x); +} + +exists (y=2 /\ 1:r0=0) diff --git a/tools/memory-model/litmus-tests/R+poonceonces.litmus b/tools/memory-model/litmus-tests/R+poonceonces.litmus new file mode 100644 index 000000000000..5386f128a131 --- /dev/null +++ b/tools/memory-model/litmus-tests/R+poonceonces.litmus @@ -0,0 +1,27 @@ +C R+poonceonces + +(* + * Result: Sometimes + * + * This is the unordered (thus lacking smp_mb()) version of one of the + * classic counterintuitive litmus tests that illustrates the effects of + * store propagation delays. + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*y, 2); + r0 = READ_ONCE(*x); +} + +exists (y=2 /\ 1:r0=0) diff --git a/tools/memory-model/litmus-tests/README b/tools/memory-model/litmus-tests/README new file mode 100644 index 000000000000..04096fb8b8d9 --- /dev/null +++ b/tools/memory-model/litmus-tests/README @@ -0,0 +1,131 @@ +This directory contains the following litmus tests: + +CoRR+poonceonce+Once.litmus + Test of read-read coherence, that is, whether or not two + successive reads from the same variable are ordered. + +CoRW+poonceonce+Once.litmus + Test of read-write coherence, that is, whether or not a read + from a given variable followed by a write to that same variable + are ordered. + +CoWR+poonceonce+Once.litmus + Test of write-read coherence, that is, whether or not a write + to a given variable followed by a read from that same variable + are ordered. + +CoWW+poonceonce.litmus + Test of write-write coherence, that is, whether or not two + successive writes to the same variable are ordered. + +IRIW+mbonceonces+OnceOnce.litmus + Test of independent reads from independent writes with smp_mb() + between each pairs of reads. In other words, is smp_mb() + sufficient to cause two different reading processes to agree on + the order of a pair of writes, where each write is to a different + variable by a different process? + +IRIW+poonceonces+OnceOnce.litmus + Test of independent reads from independent writes with nothing + between each pairs of reads. In other words, is anything at all + needed to cause two different reading processes to agree on the + order of a pair of writes, where each write is to a different + variable by a different process? + +ISA2+pooncelock+pooncelock+pombonce.litmus + Tests whether the ordering provided by a lock-protected S + litmus test is visible to an external process whose accesses are + separated by smp_mb(). This addition of an external process to + S is otherwise known as ISA2. + +ISA2+poonceonces.litmus + As below, but with store-release replaced with WRITE_ONCE() + and load-acquire replaced with READ_ONCE(). + +ISA2+pooncerelease+poacquirerelease+poacquireonce.litmus + Can a release-acquire chain order a prior store against + a later load? + +LB+ctrlonceonce+mbonceonce.litmus + Does a control dependency and an smp_mb() suffice for the + load-buffering litmus test, where each process reads from one + of two variables then writes to the other? + +LB+poacquireonce+pooncerelease.litmus + Does a release-acquire pair suffice for the load-buffering + litmus test, where each process reads from one of two variables then + writes to the other? + +LB+poonceonces.litmus + As above, but with store-release replaced with WRITE_ONCE() + and load-acquire replaced with READ_ONCE(). + +MP+onceassign+derefonce.litmus + As below, but with rcu_assign_pointer() and an rcu_dereference(). + +MP+polocks.litmus + As below, but with the second access of the writer process + and the first access of reader process protected by a lock. + +MP+poonceonces.litmus + As below, but without the smp_rmb() and smp_wmb(). + +MP+pooncerelease+poacquireonce.litmus + As below, but with a release-acquire chain. + +MP+porevlocks.litmus + As below, but with the first access of the writer process + and the second access of reader process protected by a lock. + +MP+wmbonceonce+rmbonceonce.litmus + Does a smp_wmb() (between the stores) and an smp_rmb() (between + the loads) suffice for the message-passing litmus test, where one + process writes data and then a flag, and the other process reads + the flag and then the data. (This is similar to the ISA2 tests, + but with two processes instead of three.) + +R+mbonceonces.litmus + This is the fully ordered (via smp_mb()) version of one of + the classic counterintuitive litmus tests that illustrates the + effects of store propagation delays. + +R+poonceonces.litmus + As above, but without the smp_mb() invocations. + +SB+mbonceonces.litmus + This is the fully ordered (again, via smp_mb() version of store + buffering, which forms the core of Dekker's mutual-exclusion + algorithm. + +SB+poonceonces.litmus + As above, but without the smp_mb() invocations. + +S+poonceonces.litmus + As below, but without the smp_wmb() and acquire load. + +S+wmbonceonce+poacquireonce.litmus + Can a smp_wmb(), instead of a release, and an acquire order + a prior store against a subsequent store? + +WRC+poonceonces+Once.litmus +WRC+pooncerelease+rmbonceonce+Once.litmus + These two are members of an extension of the MP litmus-test class + in which the first write is moved to a separate process. + +Z6.0+pooncelock+pooncelock+pombonce.litmus + Is the ordering provided by a spin_unlock() and a subsequent + spin_lock() sufficient to make ordering apparent to accesses + by a process not holding the lock? + +Z6.0+pooncelock+poonceLock+pombonce.litmus + As above, but with smp_mb__after_spinlock() immediately + following the spin_lock(). + +Z6.0+pooncerelease+poacquirerelease+mbonceonce.litmus + Is the ordering provided by a release-acquire chain sufficient + to make ordering apparent to accesses by a process that does + not participate in that release-acquire chain? + +A great many more litmus tests are available here: + + https://github.com/paulmckrcu/litmus diff --git a/tools/memory-model/litmus-tests/S+poonceonces.litmus b/tools/memory-model/litmus-tests/S+poonceonces.litmus new file mode 100644 index 000000000000..8c9c2f81a580 --- /dev/null +++ b/tools/memory-model/litmus-tests/S+poonceonces.litmus @@ -0,0 +1,28 @@ +C S+poonceonces + +(* + * Result: Sometimes + * + * Starting with a two-process release-acquire chain ordering P0()'s + * first store against P1()'s final load, if the smp_store_release() + * is replaced by WRITE_ONCE() and the smp_load_acquire() replaced by + * READ_ONCE(), is ordering preserved? + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 2); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*y); + WRITE_ONCE(*x, 1); +} + +exists (x=2 /\ 1:r0=1) diff --git a/tools/memory-model/litmus-tests/S+wmbonceonce+poacquireonce.litmus b/tools/memory-model/litmus-tests/S+wmbonceonce+poacquireonce.litmus new file mode 100644 index 000000000000..c53350205d28 --- /dev/null +++ b/tools/memory-model/litmus-tests/S+wmbonceonce+poacquireonce.litmus @@ -0,0 +1,27 @@ +C S+wmbonceonce+poacquireonce + +(* + * Result: Never + * + * Can a smp_wmb(), instead of a release, and an acquire order a prior + * store against a subsequent store? + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 2); + smp_wmb(); + WRITE_ONCE(*y, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = smp_load_acquire(y); + WRITE_ONCE(*x, 1); +} + +exists (x=2 /\ 1:r0=1) diff --git a/tools/memory-model/litmus-tests/SB+mbonceonces.litmus b/tools/memory-model/litmus-tests/SB+mbonceonces.litmus new file mode 100644 index 000000000000..74b874ffa8da --- /dev/null +++ b/tools/memory-model/litmus-tests/SB+mbonceonces.litmus @@ -0,0 +1,32 @@ +C SB+mbonceonces + +(* + * Result: Never + * + * This litmus test demonstrates that full memory barriers suffice to + * order the store-buffering pattern, where each process writes to the + * variable that the preceding process reads. (Locking and RCU can also + * suffice, but not much else.) + *) + +{} + +P0(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*x, 1); + smp_mb(); + r0 = READ_ONCE(*y); +} + +P1(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*y, 1); + smp_mb(); + r0 = READ_ONCE(*x); +} + +exists (0:r0=0 /\ 1:r0=0) diff --git a/tools/memory-model/litmus-tests/SB+poonceonces.litmus b/tools/memory-model/litmus-tests/SB+poonceonces.litmus new file mode 100644 index 000000000000..10d550730b25 --- /dev/null +++ b/tools/memory-model/litmus-tests/SB+poonceonces.litmus @@ -0,0 +1,29 @@ +C SB+poonceonces + +(* + * Result: Sometimes + * + * This litmus test demonstrates that at least some ordering is required + * to order the store-buffering pattern, where each process writes to the + * variable that the preceding process reads. + *) + +{} + +P0(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*x, 1); + r0 = READ_ONCE(*y); +} + +P1(int *x, int *y) +{ + int r0; + + WRITE_ONCE(*y, 1); + r0 = READ_ONCE(*x); +} + +exists (0:r0=0 /\ 1:r0=0) diff --git a/tools/memory-model/litmus-tests/WRC+poonceonces+Once.litmus b/tools/memory-model/litmus-tests/WRC+poonceonces+Once.litmus new file mode 100644 index 000000000000..6a2bc12a1af1 --- /dev/null +++ b/tools/memory-model/litmus-tests/WRC+poonceonces+Once.litmus @@ -0,0 +1,35 @@ +C WRC+poonceonces+Once + +(* + * Result: Sometimes + * + * This litmus test is an extension of the message-passing pattern, + * where the first write is moved to a separate process. Note that this + * test has no ordering at all. + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*x); + WRITE_ONCE(*y, 1); +} + +P2(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 2:r0=1 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus b/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus new file mode 100644 index 000000000000..97fcbffde9a0 --- /dev/null +++ b/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus @@ -0,0 +1,36 @@ +C WRC+pooncerelease+rmbonceonce+Once + +(* + * Result: Never + * + * This litmus test is an extension of the message-passing pattern, where + * the first write is moved to a separate process. Because it features + * a release and a read memory barrier, it should be forbidden. + *) + +{} + +P0(int *x) +{ + WRITE_ONCE(*x, 1); +} + +P1(int *x, int *y) +{ + int r0; + + r0 = READ_ONCE(*x); + smp_store_release(y, 1); +} + +P2(int *x, int *y) +{ + int r0; + int r1; + + r0 = READ_ONCE(*y); + smp_rmb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ 2:r0=1 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/Z6.0+pooncelock+poonceLock+pombonce.litmus b/tools/memory-model/litmus-tests/Z6.0+pooncelock+poonceLock+pombonce.litmus new file mode 100644 index 000000000000..415248fb6699 --- /dev/null +++ b/tools/memory-model/litmus-tests/Z6.0+pooncelock+poonceLock+pombonce.litmus @@ -0,0 +1,42 @@ +C Z6.0+pooncelock+poonceLock+pombonce + +(* + * Result: Never + * + * This litmus test demonstrates how smp_mb__after_spinlock() may be + * used to ensure that accesses in different critical sections for a + * given lock running on different CPUs are nevertheless seen in order + * by CPUs not holding that lock. + *) + +{} + +P0(int *x, int *y, spinlock_t *mylock) +{ + spin_lock(mylock); + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); + spin_unlock(mylock); +} + +P1(int *y, int *z, spinlock_t *mylock) +{ + int r0; + + spin_lock(mylock); + smp_mb__after_spinlock(); + r0 = READ_ONCE(*y); + WRITE_ONCE(*z, 1); + spin_unlock(mylock); +} + +P2(int *x, int *z) +{ + int r1; + + WRITE_ONCE(*z, 2); + smp_mb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ z=2 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/Z6.0+pooncelock+pooncelock+pombonce.litmus b/tools/memory-model/litmus-tests/Z6.0+pooncelock+pooncelock+pombonce.litmus new file mode 100644 index 000000000000..10a2aa04cd07 --- /dev/null +++ b/tools/memory-model/litmus-tests/Z6.0+pooncelock+pooncelock+pombonce.litmus @@ -0,0 +1,40 @@ +C Z6.0+pooncelock+pooncelock+pombonce + +(* + * Result: Sometimes + * + * This example demonstrates that a pair of accesses made by different + * processes each while holding a given lock will not necessarily be + * seen as ordered by a third process not holding that lock. + *) + +{} + +P0(int *x, int *y, spinlock_t *mylock) +{ + spin_lock(mylock); + WRITE_ONCE(*x, 1); + WRITE_ONCE(*y, 1); + spin_unlock(mylock); +} + +P1(int *y, int *z, spinlock_t *mylock) +{ + int r0; + + spin_lock(mylock); + r0 = READ_ONCE(*y); + WRITE_ONCE(*z, 1); + spin_unlock(mylock); +} + +P2(int *x, int *z) +{ + int r1; + + WRITE_ONCE(*z, 2); + smp_mb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ z=2 /\ 2:r1=0) diff --git a/tools/memory-model/litmus-tests/Z6.0+pooncerelease+poacquirerelease+mbonceonce.litmus b/tools/memory-model/litmus-tests/Z6.0+pooncerelease+poacquirerelease+mbonceonce.litmus new file mode 100644 index 000000000000..a20fc3fafb53 --- /dev/null +++ b/tools/memory-model/litmus-tests/Z6.0+pooncerelease+poacquirerelease+mbonceonce.litmus @@ -0,0 +1,42 @@ +C Z6.0+pooncerelease+poacquirerelease+mbonceonce + +(* + * Result: Sometimes + * + * This litmus test shows that a release-acquire chain, while sufficient + * when there is but one non-reads-from (AKA non-rf) link, does not suffice + * if there is more than one. Of the three processes, only P1() reads from + * P0's write, which means that there are two non-rf links: P1() to P2() + * is a write-to-write link (AKA a "coherence" or just "co" link) and P2() + * to P0() is a read-to-write link (AKA a "from-reads" or just "fr" link). + * When there are two or more non-rf links, you typically will need one + * full barrier for each non-rf link. (Exceptions include some cases + * involving locking.) + *) + +{} + +P0(int *x, int *y) +{ + WRITE_ONCE(*x, 1); + smp_store_release(y, 1); +} + +P1(int *y, int *z) +{ + int r0; + + r0 = smp_load_acquire(y); + smp_store_release(z, 1); +} + +P2(int *x, int *z) +{ + int r1; + + WRITE_ONCE(*z, 2); + smp_mb(); + r1 = READ_ONCE(*x); +} + +exists (1:r0=1 /\ z=2 /\ 2:r1=0) diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat new file mode 100644 index 000000000000..ba4a4ec6d313 --- /dev/null +++ b/tools/memory-model/lock.cat @@ -0,0 +1,99 @@ +// SPDX-License-Identifier: GPL-2.0+ +(* + * Copyright (C) 2016 Luc Maranget <luc.maranget@inria.fr> for Inria + * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu> + *) + +(* Generate coherence orders and handle lock operations *) + +include "cross.cat" + +(* From lock reads to their partner lock writes *) +let lk-rmw = ([LKR] ; po-loc ; [LKW]) \ (po ; po) +let rmw = rmw | lk-rmw + +(* + * A paired LKR must always see an unlocked value; spin_lock() calls nested + * inside a critical section (for the same lock) always deadlock. + *) +empty ([LKW] ; po-loc ; [domain(lk-rmw)]) \ (po-loc ; [UL] ; po-loc) + as lock-nest + +(* The litmus test is invalid if an LKW event is not part of an RMW pair *) +flag ~empty LKW \ range(lk-rmw) as unpaired-LKW + +(* This will be allowed if we implement spin_is_locked() *) +flag ~empty LKR \ domain(lk-rmw) as unpaired-LKR + +(* There should be no R or W accesses to spinlocks *) +let ALL-LOCKS = LKR | LKW | UL | LF +flag ~empty [M \ IW] ; loc ; [ALL-LOCKS] as mixed-lock-accesses + +(* The final value of a spinlock should not be tested *) +flag ~empty [FW] ; loc ; [ALL-LOCKS] as lock-final + + +(* + * Put lock operations in their appropriate classes, but leave UL out of W + * until after the co relation has been generated. + *) +let R = R | LKR | LF +let W = W | LKW + +let Release = Release | UL +let Acquire = Acquire | LKR + + +(* Match LKW events to their corresponding UL events *) +let critical = ([LKW] ; po-loc ; [UL]) \ (po-loc ; [LKW | UL] ; po-loc) + +flag ~empty UL \ range(critical) as unmatched-unlock + +(* Allow up to one unmatched LKW per location; more must deadlock *) +let UNMATCHED-LKW = LKW \ domain(critical) +empty ([UNMATCHED-LKW] ; loc ; [UNMATCHED-LKW]) \ id as unmatched-locks + + +(* rfi for LF events: link each LKW to the LF events in its critical section *) +let rfi-lf = ([LKW] ; po-loc ; [LF]) \ ([LKW] ; po-loc ; [UL] ; po-loc) + +(* rfe for LF events *) +let all-possible-rfe-lf = + (* + * Given an LF event r, compute the possible rfe edges for that event + * (all those starting from LKW events in other threads), + * and then convert that relation to a set of single-edge relations. + *) + let possible-rfe-lf r = + let pair-to-relation p = p ++ 0 + in map pair-to-relation ((LKW * {r}) & loc & ext) + (* Do this for each LF event r that isn't in rfi-lf *) + in map possible-rfe-lf (LF \ range(rfi-lf)) + +(* Generate all rf relations for LF events *) +with rfe-lf from cross(all-possible-rfe-lf) +let rf = rf | rfi-lf | rfe-lf + + +(* Generate all co relations, including LKW events but not UL *) +let co0 = co0 | ([IW] ; loc ; [LKW]) | + (([LKW] ; loc ; [UNMATCHED-LKW]) \ [UNMATCHED-LKW]) +include "cos-opt.cat" +let W = W | UL +let M = R | W + +(* Merge UL events into co *) +let co = (co | critical | (critical^-1 ; co))+ +let coe = co & ext +let coi = co & int + +(* Merge LKR events into rf *) +let rf = rf | ([IW | UL] ; singlestep(co) ; lk-rmw^-1) +let rfe = rf & ext +let rfi = rf & int + +let fr = rf^-1 ; co +let fre = fr & ext +let fri = fr & int + +show co,rf,fr diff --git a/tools/objtool/check.c b/tools/objtool/check.c index 46c1d239cc1b..5409f6f6c48d 100644 --- a/tools/objtool/check.c +++ b/tools/objtool/check.c @@ -1116,42 +1116,29 @@ static int read_unwind_hints(struct objtool_file *file) static int read_retpoline_hints(struct objtool_file *file) { - struct section *sec, *relasec; + struct section *sec; struct instruction *insn; struct rela *rela; - int i; - sec = find_section_by_name(file->elf, ".discard.retpoline_safe"); + sec = find_section_by_name(file->elf, ".rela.discard.retpoline_safe"); if (!sec) return 0; - relasec = sec->rela; - if (!relasec) { - WARN("missing .rela.discard.retpoline_safe section"); - return -1; - } - - if (sec->len % sizeof(unsigned long)) { - WARN("retpoline_safe size mismatch: %d %ld", sec->len, sizeof(unsigned long)); - return -1; - } - - for (i = 0; i < sec->len / sizeof(unsigned long); i++) { - rela = find_rela_by_dest(sec, i * sizeof(unsigned long)); - if (!rela) { - WARN("can't find rela for retpoline_safe[%d]", i); + list_for_each_entry(rela, &sec->rela_list, list) { + if (rela->sym->type != STT_SECTION) { + WARN("unexpected relocation symbol type in %s", sec->name); return -1; } insn = find_insn(file, rela->sym->sec, rela->addend); if (!insn) { - WARN("can't find insn for retpoline_safe[%d]", i); + WARN("bad .discard.retpoline_safe entry"); return -1; } if (insn->type != INSN_JUMP_DYNAMIC && insn->type != INSN_CALL_DYNAMIC) { - WARN_FUNC("retpoline_safe hint not a indirect jump/call", + WARN_FUNC("retpoline_safe hint not an indirect jump/call", insn->sec, insn->offset); return -1; } @@ -1399,6 +1386,17 @@ static int update_insn_state(struct instruction *insn, struct insn_state *state) state->vals[op->dest.reg].offset = -state->stack_size; } + else if (op->src.reg == CFI_BP && op->dest.reg == CFI_SP && + cfa->base == CFI_BP) { + + /* + * mov %rbp, %rsp + * + * Restore the original stack pointer (Clang). + */ + state->stack_size = -state->regs[CFI_BP].offset; + } + else if (op->dest.reg == cfa->base) { /* mov %reg, %rsp */ diff --git a/tools/perf/Documentation/perf-annotate.txt b/tools/perf/Documentation/perf-annotate.txt index c635eab6af54..749cc6055dac 100644 --- a/tools/perf/Documentation/perf-annotate.txt +++ b/tools/perf/Documentation/perf-annotate.txt @@ -21,7 +21,7 @@ If there is no debug info in the object, then annotated assembly is displayed. OPTIONS ------- -i:: ---input=:: +--input=<file>:: Input file name. (default: perf.data unless stdin is a fifo) -d:: @@ -55,6 +55,9 @@ OPTIONS --vmlinux=<file>:: vmlinux pathname. +--ignore-vmlinux:: + Ignore vmlinux files. + -m:: --modules:: Load module symbols. WARNING: use only with -k and LIVE kernel. @@ -69,7 +72,9 @@ OPTIONS --stdio:: Use the stdio interface. ---stdio-color:: +--stdio2:: Use the stdio2 interface, non-interactive, uses the TUI formatting. + +--stdio-color=<mode>:: 'always', 'never' or 'auto', allowing configuring color output via the command line, in addition to via "color.ui" .perfconfig. Use '--stdio-color always' to generate color even when redirecting @@ -84,7 +89,7 @@ OPTIONS --gtk:: Use the GTK interface. -C:: ---cpu:: Only report samples for the list of CPUs provided. Multiple CPUs can +--cpu=<cpu>:: Only report samples for the list of CPUs provided. Multiple CPUs can be provided as a comma-separated list with no space: 0,1. Ranges of CPUs are specified with -: 0-2. Default is to report samples on all CPUs. diff --git a/tools/perf/Documentation/perf-c2c.txt b/tools/perf/Documentation/perf-c2c.txt index 822414235170..095aebdc5bb7 100644 --- a/tools/perf/Documentation/perf-c2c.txt +++ b/tools/perf/Documentation/perf-c2c.txt @@ -116,7 +116,7 @@ and calls standard perf record command. Following perf record options are configured by default: (check perf record man page for details) - -W,-d,--sample-cpu + -W,-d,--phys-data,--sample-cpu Unless specified otherwise with '-e' option, following events are monitored by default: diff --git a/tools/perf/Documentation/perf-data.txt b/tools/perf/Documentation/perf-data.txt index 90bb4aabe4f8..c87180764829 100644 --- a/tools/perf/Documentation/perf-data.txt +++ b/tools/perf/Documentation/perf-data.txt @@ -1,5 +1,5 @@ perf-data(1) -============== +============ NAME ---- diff --git a/tools/perf/Documentation/perf-ftrace.txt b/tools/perf/Documentation/perf-ftrace.txt index 721a447f046e..b80c84307dc9 100644 --- a/tools/perf/Documentation/perf-ftrace.txt +++ b/tools/perf/Documentation/perf-ftrace.txt @@ -1,5 +1,5 @@ perf-ftrace(1) -============= +============== NAME ---- diff --git a/tools/perf/Documentation/perf-kallsyms.txt b/tools/perf/Documentation/perf-kallsyms.txt index 954ea9e21236..f3c620951f6e 100644 --- a/tools/perf/Documentation/perf-kallsyms.txt +++ b/tools/perf/Documentation/perf-kallsyms.txt @@ -1,5 +1,5 @@ perf-kallsyms(1) -============== +================ NAME ---- @@ -8,7 +8,7 @@ perf-kallsyms - Searches running kernel for symbols SYNOPSIS -------- [verse] -'perf kallsyms <options> symbol_name[,symbol_name...]' +'perf kallsyms' [<options>] symbol_name[,symbol_name...] DESCRIPTION ----------- diff --git a/tools/perf/Documentation/perf-kmem.txt b/tools/perf/Documentation/perf-kmem.txt index 479fc3261a50..85b8ac695c87 100644 --- a/tools/perf/Documentation/perf-kmem.txt +++ b/tools/perf/Documentation/perf-kmem.txt @@ -25,6 +25,10 @@ OPTIONS --input=<file>:: Select the input file (default: perf.data unless stdin is a fifo) +-f:: +--force:: + Don't do ownership validation + -v:: --verbose:: Be more verbose. (show symbol address, etc) @@ -61,7 +65,7 @@ OPTIONS default, but this option shows live (currently allocated) pages instead. (This option works with --page option only) ---time:: +--time=<start>,<stop>:: Only analyze samples within given time window: <start>,<stop>. Times have the format seconds.microseconds. If start is not given (i.e., time string is ',x.y') then analysis starts at the beginning of the file. If diff --git a/tools/perf/Documentation/perf-list.txt b/tools/perf/Documentation/perf-list.txt index e2a897ae3596..2549c34a7895 100644 --- a/tools/perf/Documentation/perf-list.txt +++ b/tools/perf/Documentation/perf-list.txt @@ -141,7 +141,13 @@ on the first memory controller on socket 0 of a Intel Xeon system Each memory controller has its own PMU. Measuring the complete system bandwidth would require specifying all imc PMUs (see perf list output), -and adding the values together. +and adding the values together. To simplify creation of multiple events, +prefix and glob matching is supported in the PMU name, and the prefix +'uncore_' is also ignored when performing the match. So the command above +can be expanded to all memory controllers by using the syntaxes: + + perf stat -C 0 -a imc/cas_count_read/,imc/cas_count_write/ -I 1000 ... + perf stat -C 0 -a *imc*/cas_count_read/,*imc*/cas_count_write/ -I 1000 ... This example measures the combined core power every second diff --git a/tools/perf/Documentation/perf-mem.txt b/tools/perf/Documentation/perf-mem.txt index 4be08a1e3f8d..b0211410969b 100644 --- a/tools/perf/Documentation/perf-mem.txt +++ b/tools/perf/Documentation/perf-mem.txt @@ -28,6 +28,10 @@ OPTIONS <command>...:: Any command you can specify in a shell. +-f:: +--force:: + Don't do ownership validation + -t:: --type=:: Select the memory operation type: load or store (default: load,store) diff --git a/tools/perf/Documentation/perf-record.txt b/tools/perf/Documentation/perf-record.txt index 3eea6de35a38..cc37b3a4be76 100644 --- a/tools/perf/Documentation/perf-record.txt +++ b/tools/perf/Documentation/perf-record.txt @@ -191,9 +191,16 @@ OPTIONS -i:: --no-inherit:: Child tasks do not inherit counters. + -F:: --freq=:: - Profile at this frequency. + Profile at this frequency. Use 'max' to use the currently maximum + allowed frequency, i.e. the value in the kernel.perf_event_max_sample_rate + sysctl. Will throttle down to the currently maximum allowed frequency. + See --strict-freq. + +--strict-freq:: + Fail if the specified frequency can't be used. -m:: --mmap-pages=:: @@ -308,7 +315,11 @@ can be provided. Each cgroup is applied to the corresponding event, i.e., first to first event, second cgroup to second event and so on. It is possible to provide an empty cgroup (monitor all the time) using, e.g., -G foo,,bar. Cgroups must have corresponding events, i.e., they always refer to events defined earlier on the command -line. +line. If the user wants to track multiple events for a specific cgroup, the user can +use '-e e1 -e e2 -G foo,foo' or just use '-e e1 -e e2 -G foo'. + +If wanting to monitor, say, 'cycles' for a cgroup and also for system wide, this +command line can be used: 'perf stat -e cycles -G cgroup_name -a -e cycles'. -b:: --branch-any:: diff --git a/tools/perf/Documentation/perf-report.txt b/tools/perf/Documentation/perf-report.txt index 907e505b6309..e1a660e60849 100644 --- a/tools/perf/Documentation/perf-report.txt +++ b/tools/perf/Documentation/perf-report.txt @@ -296,6 +296,9 @@ OPTIONS --vmlinux=<file>:: vmlinux pathname +--ignore-vmlinux:: + Ignore vmlinux files. + --kallsyms=<file>:: kallsyms pathname @@ -354,7 +357,8 @@ OPTIONS Path to objdump binary. --group:: - Show event group information together. + Show event group information together. It forces group output also + if there are no groups defined in data file. --demangle:: Demangle symbol names to human readable form. It's enabled by default, @@ -367,7 +371,7 @@ OPTIONS Use the data addresses of samples in addition to instruction addresses to build the histograms. To generate meaningful output, the perf.data file must have been obtained using perf record -d -W and using a - special event -e cpu/mem-loads/ or -e cpu/mem-stores/. See + special event -e cpu/mem-loads/p or -e cpu/mem-stores/p. See 'perf mem' for simpler access. --percent-limit:: diff --git a/tools/perf/Documentation/perf-sched.txt b/tools/perf/Documentation/perf-sched.txt index c7e50f263887..bb33601a823b 100644 --- a/tools/perf/Documentation/perf-sched.txt +++ b/tools/perf/Documentation/perf-sched.txt @@ -1,5 +1,5 @@ perf-sched(1) -============== +============= NAME ---- diff --git a/tools/perf/Documentation/perf-script-perl.txt b/tools/perf/Documentation/perf-script-perl.txt index 142606c0ec9c..5a1f68122f50 100644 --- a/tools/perf/Documentation/perf-script-perl.txt +++ b/tools/perf/Documentation/perf-script-perl.txt @@ -1,5 +1,5 @@ perf-script-perl(1) -================== +=================== NAME ---- diff --git a/tools/perf/Documentation/perf-script.txt b/tools/perf/Documentation/perf-script.txt index 7730c1d2b5d3..36ec0257f8d3 100644 --- a/tools/perf/Documentation/perf-script.txt +++ b/tools/perf/Documentation/perf-script.txt @@ -303,6 +303,9 @@ OPTIONS --show-lost-events Display lost events i.e. events of type PERF_RECORD_LOST. +--show-round-events + Display finished round events i.e. events of type PERF_RECORD_FINISHED_ROUND. + --demangle:: Demangle symbol names to human readable form. It's enabled by default, disable with --no-demangle. diff --git a/tools/perf/Documentation/perf-stat.txt b/tools/perf/Documentation/perf-stat.txt index 823fce7674bb..f15b306be183 100644 --- a/tools/perf/Documentation/perf-stat.txt +++ b/tools/perf/Documentation/perf-stat.txt @@ -49,6 +49,13 @@ report:: parameters are defined by corresponding entries in /sys/bus/event_source/devices/<pmu>/format/* + Note that the last two syntaxes support prefix and glob matching in + the PMU name to simplify creation of events accross multiple instances + of the same type of PMU in large systems (e.g. memory controller PMUs). + Multiple PMU instances are typical for uncore PMUs, so the prefix + 'uncore_' is also ignored when performing this match. + + -i:: --no-inherit:: child tasks do not inherit counters @@ -118,7 +125,11 @@ can be provided. Each cgroup is applied to the corresponding event, i.e., first to first event, second cgroup to second event and so on. It is possible to provide an empty cgroup (monitor all the time) using, e.g., -G foo,,bar. Cgroups must have corresponding events, i.e., they always refer to events defined earlier on the command -line. +line. If the user wants to track multiple events for a specific cgroup, the user can +use '-e e1 -e e2 -G foo,foo' or just use '-e e1 -e e2 -G foo'. + +If wanting to monitor, say, 'cycles' for a cgroup and also for system wide, this +command line can be used: 'perf stat -e cycles -G cgroup_name -a -e cycles'. -o file:: --output file:: @@ -146,6 +157,16 @@ Print count deltas every N milliseconds (minimum: 10ms) The overhead percentage could be high in some cases, for instance with small, sub 100ms intervals. Use with caution. example: 'perf stat -I 1000 -e cycles -a sleep 5' +--interval-count times:: +Print count deltas for fixed number of times. +This option should be used together with "-I" option. + example: 'perf stat -I 1000 --interval-count 2 -e cycles -a' + +--timeout msecs:: +Stop the 'perf stat' session and print count deltas after N milliseconds (minimum: 10 ms). +This option is not supported with the "-I" option. + example: 'perf stat --time 2000 -e cycles -a' + --metric-only:: Only print computed metrics. Print them in a single line. Don't show any raw values. Not supported with --per-thread. @@ -246,6 +267,16 @@ taskset. --no-merge:: Do not merge results from same PMUs. +When multiple events are created from a single event specification, +stat will, by default, aggregate the event counts and show the result +in a single row. This option disables that behavior and shows +the individual events and counts. + +Multiple events are created from a single event specification when: +1. Prefix or glob matching is used for the PMU name. +2. Aliases, which are listed immediately after the Kernel PMU events + by perf list, are used. + --smi-cost:: Measure SMI cost if msr/aperf/ and msr/smi/ events are supported. diff --git a/tools/perf/Documentation/perf-top.txt b/tools/perf/Documentation/perf-top.txt index 8a32cc77bead..114fda12aa49 100644 --- a/tools/perf/Documentation/perf-top.txt +++ b/tools/perf/Documentation/perf-top.txt @@ -55,7 +55,9 @@ Default is to monitor all CPUS. -F <freq>:: --freq=<freq>:: - Profile at this frequency. + Profile at this frequency. Use 'max' to use the currently maximum + allowed frequency, i.e. the value in the kernel.perf_event_max_sample_rate + sysctl. -i:: --inherit:: @@ -65,6 +67,9 @@ Default is to monitor all CPUS. --vmlinux=<path>:: Path to vmlinux. Required for annotation functionality. +--ignore-vmlinux:: + Ignore vmlinux files. + -m <pages>:: --mmap-pages=<pages>:: Number of mmap data pages (must be a power of two) or size diff --git a/tools/perf/Documentation/perf-trace.txt b/tools/perf/Documentation/perf-trace.txt index 33a88e984e66..5a7035c5c523 100644 --- a/tools/perf/Documentation/perf-trace.txt +++ b/tools/perf/Documentation/perf-trace.txt @@ -63,6 +63,31 @@ filter out the startup phase of the program, which is often very different. --uid=:: Record events in threads owned by uid. Name or number. +-G:: +--cgroup:: + Record events in threads in a cgroup. + + Look for cgroups to set at the /sys/fs/cgroup/perf_event directory, then + remove the /sys/fs/cgroup/perf_event/ part and try: + + perf trace -G A -e sched:*switch + + Will set all raw_syscalls:sys_{enter,exit}, pgfault, vfs_getname, etc + _and_ sched:sched_switch to the 'A' cgroup, while: + + perf trace -e sched:*switch -G A + + will only set the sched:sched_switch event to the 'A' cgroup, all the + other events (raw_syscalls:sys_{enter,exit}, etc are left "without" + a cgroup (on the root cgroup, sys wide, etc). + + Multiple cgroups: + + perf trace -G A -e sched:*switch -G B + + the syscall ones go to the 'A' cgroup, the sched:sched_switch goes + to the 'B' cgroup. + --filter-pids=:: Filter out events for these pids and for 'trace' itself (comma separated list). diff --git a/tools/perf/Documentation/perf.data-file-format.txt b/tools/perf/Documentation/perf.data-file-format.txt index f7d85e89a98a..d00f0d51cab8 100644 --- a/tools/perf/Documentation/perf.data-file-format.txt +++ b/tools/perf/Documentation/perf.data-file-format.txt @@ -485,10 +485,5 @@ in pmu-tools parser. This allows to read perf.data from python and dump it. quipper The quipper C++ parser is available at -https://chromium.googlesource.com/chromiumos/platform2 +http://github.com/google/perf_data_converter/tree/master/src/quipper -It is under the chromiumos-wide-profiling/ subdirectory. This library can -convert a perf data file to a protobuf and vice versa. - -Unfortunately this parser tends to be many versions behind and may not be able -to parse data files generated by recent perf. diff --git a/tools/perf/Makefile.config b/tools/perf/Makefile.config index 0dfdaa9fa81e..98ff73648b51 100644 --- a/tools/perf/Makefile.config +++ b/tools/perf/Makefile.config @@ -27,6 +27,8 @@ NO_SYSCALL_TABLE := 1 # Additional ARCH settings for ppc ifeq ($(SRCARCH),powerpc) NO_PERF_REGS := 0 + NO_SYSCALL_TABLE := 0 + CFLAGS += -I$(OUTPUT)arch/powerpc/include/generated LIBUNWIND_LIBS := -lunwind -lunwind-ppc64 endif @@ -73,7 +75,7 @@ endif # Disable it on all other architectures in case libdw unwind # support is detected in system. Add supported architectures # to the check. -ifneq ($(SRCARCH),$(filter $(SRCARCH),x86 arm powerpc s390)) +ifneq ($(SRCARCH),$(filter $(SRCARCH),x86 arm arm64 powerpc s390)) NO_LIBDW_DWARF_UNWIND := 1 endif @@ -666,25 +668,10 @@ else ifneq ($(feature-libpython), 1) $(call disable-python,No 'Python.h' (for Python 2.x support) was found: disables Python support - please install python-devel/python-dev) else - ifneq ($(feature-libpython-version), 1) - $(warning Python 3 is not yet supported; please set) - $(warning PYTHON and/or PYTHON_CONFIG appropriately.) - $(warning If you also have Python 2 installed, then) - $(warning try something like:) - $(warning $(and ,)) - $(warning $(and ,) make PYTHON=python2) - $(warning $(and ,)) - $(warning Otherwise, disable Python support entirely:) - $(warning $(and ,)) - $(warning $(and ,) make NO_LIBPYTHON=1) - $(warning $(and ,)) - $(error $(and ,)) - else - LDFLAGS += $(PYTHON_EMBED_LDFLAGS) - EXTLIBS += $(PYTHON_EMBED_LIBADD) - LANG_BINDINGS += $(obj-perf)python/perf.so - $(call detected,CONFIG_LIBPYTHON) - endif + LDFLAGS += $(PYTHON_EMBED_LDFLAGS) + EXTLIBS += $(PYTHON_EMBED_LIBADD) + LANG_BINDINGS += $(obj-perf)python/perf.so + $(call detected,CONFIG_LIBPYTHON) endif endif endif diff --git a/tools/perf/Makefile.perf b/tools/perf/Makefile.perf index 012328038594..f7517e1b73f8 100644 --- a/tools/perf/Makefile.perf +++ b/tools/perf/Makefile.perf @@ -296,7 +296,7 @@ PYTHON_EXTBUILD_LIB := $(PYTHON_EXTBUILD)lib/ PYTHON_EXTBUILD_TMP := $(PYTHON_EXTBUILD)tmp/ export PYTHON_EXTBUILD_LIB PYTHON_EXTBUILD_TMP -python-clean := $(call QUIET_CLEAN, python) $(RM) -r $(PYTHON_EXTBUILD) $(OUTPUT)python/perf.so +python-clean := $(call QUIET_CLEAN, python) $(RM) -r $(PYTHON_EXTBUILD) $(OUTPUT)python/perf*.so PYTHON_EXT_SRCS := $(shell grep -v ^\# util/python-ext-sources) PYTHON_EXT_DEPS := util/python-ext-sources util/setup.py $(LIBTRACEEVENT) $(LIBAPI) @@ -473,7 +473,7 @@ $(OUTPUT)python/perf.so: $(PYTHON_EXT_SRCS) $(PYTHON_EXT_DEPS) $(LIBTRACEEVENT_D $(PYTHON_WORD) util/setup.py \ --quiet build_ext; \ mkdir -p $(OUTPUT)python && \ - cp $(PYTHON_EXTBUILD_LIB)perf.so $(OUTPUT)python/ + cp $(PYTHON_EXTBUILD_LIB)perf*.so $(OUTPUT)python/ please_set_SHELL_PATH_to_a_more_modern_shell: $(Q)$$(:) @@ -708,15 +708,15 @@ TAG_FILES= ../../include/uapi/linux/perf_event.h TAGS: $(QUIET_GEN)$(RM) TAGS; \ - $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print | xargs etags -a $(TAG_FILES) + $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print -o -name '*.cpp' -print | xargs etags -a $(TAG_FILES) tags: $(QUIET_GEN)$(RM) tags; \ - $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print | xargs ctags -a $(TAG_FILES) + $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print -o -name '*.cpp' -print | xargs ctags -a $(TAG_FILES) cscope: $(QUIET_GEN)$(RM) cscope*; \ - $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print | xargs cscope -b $(TAG_FILES) + $(FIND) $(TAG_FOLDERS) -name '*.[hcS]' -print -o -name '*.cpp' -print | xargs cscope -b $(TAG_FILES) ### Testing rules diff --git a/tools/perf/arch/arm/util/auxtrace.c b/tools/perf/arch/arm/util/auxtrace.c index 2323581b157d..fa639e3e52ac 100644 --- a/tools/perf/arch/arm/util/auxtrace.c +++ b/tools/perf/arch/arm/util/auxtrace.c @@ -68,7 +68,7 @@ struct auxtrace_record bool found_spe = false; static struct perf_pmu **arm_spe_pmus = NULL; static int nr_spes = 0; - int i; + int i = 0; if (!evlist) return NULL; diff --git a/tools/perf/arch/arm/util/cs-etm.c b/tools/perf/arch/arm/util/cs-etm.c index fbfc055d3f4d..5c655ad4621e 100644 --- a/tools/perf/arch/arm/util/cs-etm.c +++ b/tools/perf/arch/arm/util/cs-etm.c @@ -298,12 +298,17 @@ cs_etm_info_priv_size(struct auxtrace_record *itr __maybe_unused, { int i; int etmv3 = 0, etmv4 = 0; - const struct cpu_map *cpus = evlist->cpus; + struct cpu_map *event_cpus = evlist->cpus; + struct cpu_map *online_cpus = cpu_map__new(NULL); /* cpu map is not empty, we have specific CPUs to work with */ - if (!cpu_map__empty(cpus)) { - for (i = 0; i < cpu_map__nr(cpus); i++) { - if (cs_etm_is_etmv4(itr, cpus->map[i])) + if (!cpu_map__empty(event_cpus)) { + for (i = 0; i < cpu__max_cpu(); i++) { + if (!cpu_map__has(event_cpus, i) || + !cpu_map__has(online_cpus, i)) + continue; + + if (cs_etm_is_etmv4(itr, i)) etmv4++; else etmv3++; @@ -311,6 +316,9 @@ cs_etm_info_priv_size(struct auxtrace_record *itr __maybe_unused, } else { /* get configuration for all CPUs in the system */ for (i = 0; i < cpu__max_cpu(); i++) { + if (!cpu_map__has(online_cpus, i)) + continue; + if (cs_etm_is_etmv4(itr, i)) etmv4++; else @@ -318,6 +326,8 @@ cs_etm_info_priv_size(struct auxtrace_record *itr __maybe_unused, } } + cpu_map__put(online_cpus); + return (CS_ETM_HEADER_SIZE + (etmv4 * CS_ETMV4_PRIV_SIZE) + (etmv3 * CS_ETMV3_PRIV_SIZE)); @@ -447,7 +457,9 @@ static int cs_etm_info_fill(struct auxtrace_record *itr, int i; u32 offset; u64 nr_cpu, type; - const struct cpu_map *cpus = session->evlist->cpus; + struct cpu_map *cpu_map; + struct cpu_map *event_cpus = session->evlist->cpus; + struct cpu_map *online_cpus = cpu_map__new(NULL); struct cs_etm_recording *ptr = container_of(itr, struct cs_etm_recording, itr); struct perf_pmu *cs_etm_pmu = ptr->cs_etm_pmu; @@ -458,8 +470,21 @@ static int cs_etm_info_fill(struct auxtrace_record *itr, if (!session->evlist->nr_mmaps) return -EINVAL; - /* If the cpu_map is empty all CPUs are involved */ - nr_cpu = cpu_map__empty(cpus) ? cpu__max_cpu() : cpu_map__nr(cpus); + /* If the cpu_map is empty all online CPUs are involved */ + if (cpu_map__empty(event_cpus)) { + cpu_map = online_cpus; + } else { + /* Make sure all specified CPUs are online */ + for (i = 0; i < cpu_map__nr(event_cpus); i++) { + if (cpu_map__has(event_cpus, i) && + !cpu_map__has(online_cpus, i)) + return -EINVAL; + } + + cpu_map = event_cpus; + } + + nr_cpu = cpu_map__nr(cpu_map); /* Get PMU type as dynamically assigned by the core */ type = cs_etm_pmu->type; @@ -472,15 +497,11 @@ static int cs_etm_info_fill(struct auxtrace_record *itr, offset = CS_ETM_SNAPSHOT + 1; - /* cpu map is not empty, we have specific CPUs to work with */ - if (!cpu_map__empty(cpus)) { - for (i = 0; i < cpu_map__nr(cpus) && offset < priv_size; i++) - cs_etm_get_metadata(cpus->map[i], &offset, itr, info); - } else { - /* get configuration for all CPUs in the system */ - for (i = 0; i < cpu__max_cpu(); i++) + for (i = 0; i < cpu__max_cpu() && offset < priv_size; i++) + if (cpu_map__has(cpu_map, i)) cs_etm_get_metadata(i, &offset, itr, info); - } + + cpu_map__put(online_cpus); return 0; } diff --git a/tools/perf/arch/arm64/include/arch-tests.h b/tools/perf/arch/arm64/include/arch-tests.h new file mode 100644 index 000000000000..90ec4c8cb880 --- /dev/null +++ b/tools/perf/arch/arm64/include/arch-tests.h @@ -0,0 +1,12 @@ +/* SPDX-License-Identifier: GPL-2.0 */ +#ifndef ARCH_TESTS_H +#define ARCH_TESTS_H + +#ifdef HAVE_DWARF_UNWIND_SUPPORT +struct thread; +struct perf_sample; +#endif + +extern struct test arch_tests[]; + +#endif diff --git a/tools/perf/arch/arm64/tests/Build b/tools/perf/arch/arm64/tests/Build index b30eff9bcc83..883c57ff0c08 100644 --- a/tools/perf/arch/arm64/tests/Build +++ b/tools/perf/arch/arm64/tests/Build @@ -1,2 +1,4 @@ libperf-y += regs_load.o libperf-y += dwarf-unwind.o + +libperf-y += arch-tests.o diff --git a/tools/perf/arch/arm64/tests/arch-tests.c b/tools/perf/arch/arm64/tests/arch-tests.c new file mode 100644 index 000000000000..5b1543c98022 --- /dev/null +++ b/tools/perf/arch/arm64/tests/arch-tests.c @@ -0,0 +1,16 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <string.h> +#include "tests/tests.h" +#include "arch-tests.h" + +struct test arch_tests[] = { +#ifdef HAVE_DWARF_UNWIND_SUPPORT + { + .desc = "DWARF unwind", + .func = test__dwarf_unwind, + }, +#endif + { + .func = NULL, + }, +}; diff --git a/tools/perf/arch/arm64/util/Build b/tools/perf/arch/arm64/util/Build index c0b8dfef98ba..68f8a8eb3ad0 100644 --- a/tools/perf/arch/arm64/util/Build +++ b/tools/perf/arch/arm64/util/Build @@ -2,6 +2,7 @@ libperf-y += header.o libperf-y += sym-handling.o libperf-$(CONFIG_DWARF) += dwarf-regs.o libperf-$(CONFIG_LOCAL_LIBUNWIND) += unwind-libunwind.o +libperf-$(CONFIG_LIBDW_DWARF_UNWIND) += unwind-libdw.o libperf-$(CONFIG_AUXTRACE) += ../../arm/util/pmu.o \ ../../arm/util/auxtrace.o \ diff --git a/tools/perf/arch/arm64/util/unwind-libdw.c b/tools/perf/arch/arm64/util/unwind-libdw.c new file mode 100644 index 000000000000..7623d85e77f3 --- /dev/null +++ b/tools/perf/arch/arm64/util/unwind-libdw.c @@ -0,0 +1,60 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <elfutils/libdwfl.h> +#include "../../util/unwind-libdw.h" +#include "../../util/perf_regs.h" +#include "../../util/event.h" + +bool libdw__arch_set_initial_registers(Dwfl_Thread *thread, void *arg) +{ + struct unwind_info *ui = arg; + struct regs_dump *user_regs = &ui->sample->user_regs; + Dwarf_Word dwarf_regs[PERF_REG_ARM64_MAX], dwarf_pc; + +#define REG(r) ({ \ + Dwarf_Word val = 0; \ + perf_reg_value(&val, user_regs, PERF_REG_ARM64_##r); \ + val; \ +}) + + dwarf_regs[0] = REG(X0); + dwarf_regs[1] = REG(X1); + dwarf_regs[2] = REG(X2); + dwarf_regs[3] = REG(X3); + dwarf_regs[4] = REG(X4); + dwarf_regs[5] = REG(X5); + dwarf_regs[6] = REG(X6); + dwarf_regs[7] = REG(X7); + dwarf_regs[8] = REG(X8); + dwarf_regs[9] = REG(X9); + dwarf_regs[10] = REG(X10); + dwarf_regs[11] = REG(X11); + dwarf_regs[12] = REG(X12); + dwarf_regs[13] = REG(X13); + dwarf_regs[14] = REG(X14); + dwarf_regs[15] = REG(X15); + dwarf_regs[16] = REG(X16); + dwarf_regs[17] = REG(X17); + dwarf_regs[18] = REG(X18); + dwarf_regs[19] = REG(X19); + dwarf_regs[20] = REG(X20); + dwarf_regs[21] = REG(X21); + dwarf_regs[22] = REG(X22); + dwarf_regs[23] = REG(X23); + dwarf_regs[24] = REG(X24); + dwarf_regs[25] = REG(X25); + dwarf_regs[26] = REG(X26); + dwarf_regs[27] = REG(X27); + dwarf_regs[28] = REG(X28); + dwarf_regs[29] = REG(X29); + dwarf_regs[30] = REG(LR); + dwarf_regs[31] = REG(SP); + + if (!dwfl_thread_state_registers(thread, 0, PERF_REG_ARM64_MAX, + dwarf_regs)) + return false; + + dwarf_pc = REG(PC); + dwfl_thread_state_register_pc(thread, dwarf_pc); + + return true; +} diff --git a/tools/perf/arch/powerpc/Makefile b/tools/perf/arch/powerpc/Makefile index 42dab7c8f508..a111239df182 100644 --- a/tools/perf/arch/powerpc/Makefile +++ b/tools/perf/arch/powerpc/Makefile @@ -6,3 +6,28 @@ endif HAVE_KVM_STAT_SUPPORT := 1 PERF_HAVE_ARCH_REGS_QUERY_REGISTER_OFFSET := 1 PERF_HAVE_JITDUMP := 1 + +# +# Syscall table generation for perf +# + +out := $(OUTPUT)arch/powerpc/include/generated/asm +header32 := $(out)/syscalls_32.c +header64 := $(out)/syscalls_64.c +sysdef := $(srctree)/tools/arch/powerpc/include/uapi/asm/unistd.h +sysprf := $(srctree)/tools/perf/arch/powerpc/entry/syscalls/ +systbl := $(sysprf)/mksyscalltbl + +# Create output directory if not already present +_dummy := $(shell [ -d '$(out)' ] || mkdir -p '$(out)') + +$(header64): $(sysdef) $(systbl) + $(Q)$(SHELL) '$(systbl)' '64' '$(CC)' $(sysdef) > $@ + +$(header32): $(sysdef) $(systbl) + $(Q)$(SHELL) '$(systbl)' '32' '$(CC)' $(sysdef) > $@ + +clean:: + $(call QUIET_CLEAN, powerpc) $(RM) $(header32) $(header64) + +archheaders: $(header32) $(header64) diff --git a/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl b/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl new file mode 100755 index 000000000000..ef52e1dd694b --- /dev/null +++ b/tools/perf/arch/powerpc/entry/syscalls/mksyscalltbl @@ -0,0 +1,37 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# +# Generate system call table for perf. Derived from +# s390 script. +# +# Copyright IBM Corp. 2017 +# Author(s): Hendrik Brueckner <brueckner@linux.vnet.ibm.com> +# Changed by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com> + +wordsize=$1 +gcc=$2 +input=$3 + +if ! test -r $input; then + echo "Could not read input file" >&2 + exit 1 +fi + +create_table() +{ + local wordsize=$1 + local max_nr + + echo "static const char *syscalltbl_powerpc_${wordsize}[] = {" + while read sc nr; do + printf '\t[%d] = "%s",\n' $nr $sc + max_nr=$nr + done + echo '};' + echo "#define SYSCALLTBL_POWERPC_${wordsize}_MAX_ID $max_nr" +} + +$gcc -m${wordsize} -E -dM -x c $input \ + |sed -ne 's/^#define __NR_//p' \ + |sort -t' ' -k2 -nu \ + |create_table ${wordsize} diff --git a/tools/perf/arch/s390/annotate/instructions.c b/tools/perf/arch/s390/annotate/instructions.c index 8c72b44444cb..cee4e2f7c057 100644 --- a/tools/perf/arch/s390/annotate/instructions.c +++ b/tools/perf/arch/s390/annotate/instructions.c @@ -1,6 +1,113 @@ // SPDX-License-Identifier: GPL-2.0 #include <linux/compiler.h> +static int s390_call__parse(struct arch *arch, struct ins_operands *ops, + struct map_symbol *ms) +{ + char *endptr, *tok, *name; + struct map *map = ms->map; + struct addr_map_symbol target = { + .map = map, + }; + + tok = strchr(ops->raw, ','); + if (!tok) + return -1; + + ops->target.addr = strtoull(tok + 1, &endptr, 16); + + name = strchr(endptr, '<'); + if (name == NULL) + return -1; + + name++; + + if (arch->objdump.skip_functions_char && + strchr(name, arch->objdump.skip_functions_char)) + return -1; + + tok = strchr(name, '>'); + if (tok == NULL) + return -1; + + *tok = '\0'; + ops->target.name = strdup(name); + *tok = '>'; + + if (ops->target.name == NULL) + return -1; + target.addr = map__objdump_2mem(map, ops->target.addr); + + if (map_groups__find_ams(&target) == 0 && + map__rip_2objdump(target.map, map->map_ip(target.map, target.addr)) == ops->target.addr) + ops->target.sym = target.sym; + + return 0; +} + +static int call__scnprintf(struct ins *ins, char *bf, size_t size, + struct ins_operands *ops); + +static struct ins_ops s390_call_ops = { + .parse = s390_call__parse, + .scnprintf = call__scnprintf, +}; + +static int s390_mov__parse(struct arch *arch __maybe_unused, + struct ins_operands *ops, + struct map_symbol *ms __maybe_unused) +{ + char *s = strchr(ops->raw, ','), *target, *endptr; + + if (s == NULL) + return -1; + + *s = '\0'; + ops->source.raw = strdup(ops->raw); + *s = ','; + + if (ops->source.raw == NULL) + return -1; + + target = ++s; + ops->target.raw = strdup(target); + if (ops->target.raw == NULL) + goto out_free_source; + + ops->target.addr = strtoull(target, &endptr, 16); + if (endptr == target) + goto out_free_target; + + s = strchr(endptr, '<'); + if (s == NULL) + goto out_free_target; + endptr = strchr(s + 1, '>'); + if (endptr == NULL) + goto out_free_target; + + *endptr = '\0'; + ops->target.name = strdup(s + 1); + *endptr = '>'; + if (ops->target.name == NULL) + goto out_free_target; + + return 0; + +out_free_target: + zfree(&ops->target.raw); +out_free_source: + zfree(&ops->source.raw); + return -1; +} + +static int mov__scnprintf(struct ins *ins, char *bf, size_t size, + struct ins_operands *ops); + +static struct ins_ops s390_mov_ops = { + .parse = s390_mov__parse, + .scnprintf = mov__scnprintf, +}; + static struct ins_ops *s390__associate_ins_ops(struct arch *arch, const char *name) { struct ins_ops *ops = NULL; @@ -14,21 +121,54 @@ static struct ins_ops *s390__associate_ins_ops(struct arch *arch, const char *na if (!strcmp(name, "bras") || !strcmp(name, "brasl") || !strcmp(name, "basr")) - ops = &call_ops; + ops = &s390_call_ops; if (!strcmp(name, "br")) ops = &ret_ops; + /* override load/store relative to PC */ + if (!strcmp(name, "lrl") || + !strcmp(name, "lgrl") || + !strcmp(name, "lgfrl") || + !strcmp(name, "llgfrl") || + !strcmp(name, "strl") || + !strcmp(name, "stgrl")) + ops = &s390_mov_ops; if (ops) arch__associate_ins_ops(arch, name, ops); return ops; } +static int s390__cpuid_parse(struct arch *arch, char *cpuid) +{ + unsigned int family; + char model[16], model_c[16], cpumf_v[16], cpumf_a[16]; + int ret; + + /* + * cpuid string format: + * "IBM,family,model-capacity,model[,cpum_cf-version,cpum_cf-authorization]" + */ + ret = sscanf(cpuid, "%*[^,],%u,%[^,],%[^,],%[^,],%s", &family, model_c, + model, cpumf_v, cpumf_a); + if (ret >= 2) { + arch->family = family; + arch->model = 0; + return 0; + } + + return -1; +} + static int s390__annotate_init(struct arch *arch, char *cpuid __maybe_unused) { + int err = 0; + if (!arch->initialized) { arch->initialized = true; arch->associate_instruction_ops = s390__associate_ins_ops; + if (cpuid) + err = s390__cpuid_parse(arch, cpuid); } - return 0; + return err; } diff --git a/tools/perf/arch/s390/util/header.c b/tools/perf/arch/s390/util/header.c index 9fa6c3e5782c..a4c30f1c70be 100644 --- a/tools/perf/arch/s390/util/header.c +++ b/tools/perf/arch/s390/util/header.c @@ -1,8 +1,9 @@ /* * Implementation of get_cpuid(). * - * Copyright 2014 IBM Corp. + * Copyright IBM Corp. 2014, 2018 * Author(s): Alexander Yarygin <yarygin@linux.vnet.ibm.com> + * Thomas Richter <tmricht@linux.vnet.ibm.com> * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License (version 2 only) @@ -13,16 +14,153 @@ #include <unistd.h> #include <stdio.h> #include <string.h> +#include <ctype.h> #include "../../util/header.h" +#include "../../util/util.h" + +#define SYSINFO_MANU "Manufacturer:" +#define SYSINFO_TYPE "Type:" +#define SYSINFO_MODEL "Model:" +#define SRVLVL_CPUMF "CPU-MF:" +#define SRVLVL_VERSION "version=" +#define SRVLVL_AUTHORIZATION "authorization=" +#define SYSINFO "/proc/sysinfo" +#define SRVLVL "/proc/service_levels" int get_cpuid(char *buffer, size_t sz) { - const char *cpuid = "IBM/S390"; + char *cp, *line = NULL, *line2; + char type[8], model[33], version[8], manufacturer[32], authorization[8]; + int tpsize = 0, mdsize = 0, vssize = 0, mfsize = 0, atsize = 0; + int read; + unsigned long line_sz; + size_t nbytes; + FILE *sysinfo; + + /* + * Scan /proc/sysinfo line by line and read out values for + * Manufacturer:, Type: and Model:, for example: + * Manufacturer: IBM + * Type: 2964 + * Model: 702 N96 + * The first word is the Model Capacity and the second word is + * Model (can be omitted). Both words have a maximum size of 16 + * bytes. + */ + memset(manufacturer, 0, sizeof(manufacturer)); + memset(type, 0, sizeof(type)); + memset(model, 0, sizeof(model)); + memset(version, 0, sizeof(version)); + memset(authorization, 0, sizeof(authorization)); + + sysinfo = fopen(SYSINFO, "r"); + if (sysinfo == NULL) + return -1; + + while ((read = getline(&line, &line_sz, sysinfo)) != -1) { + if (!strncmp(line, SYSINFO_MANU, strlen(SYSINFO_MANU))) { + line2 = line + strlen(SYSINFO_MANU); + + while ((cp = strtok_r(line2, "\n ", &line2))) { + mfsize += scnprintf(manufacturer + mfsize, + sizeof(manufacturer) - mfsize, "%s", cp); + } + } + + if (!strncmp(line, SYSINFO_TYPE, strlen(SYSINFO_TYPE))) { + line2 = line + strlen(SYSINFO_TYPE); - if (strlen(cpuid) + 1 > sz) + while ((cp = strtok_r(line2, "\n ", &line2))) { + tpsize += scnprintf(type + tpsize, + sizeof(type) - tpsize, "%s", cp); + } + } + + if (!strncmp(line, SYSINFO_MODEL, strlen(SYSINFO_MODEL))) { + line2 = line + strlen(SYSINFO_MODEL); + + while ((cp = strtok_r(line2, "\n ", &line2))) { + mdsize += scnprintf(model + mdsize, sizeof(model) - mdsize, + "%s%s", model[0] ? "," : "", cp); + } + break; + } + } + fclose(sysinfo); + + /* Missing manufacturer, type or model information should not happen */ + if (!manufacturer[0] || !type[0] || !model[0]) return -1; - strcpy(buffer, cpuid); - return 0; + /* + * Scan /proc/service_levels and return the CPU-MF counter facility + * version number and authorization level. + * Optional, does not exist on z/VM guests. + */ + sysinfo = fopen(SRVLVL, "r"); + if (sysinfo == NULL) + goto skip_sysinfo; + while ((read = getline(&line, &line_sz, sysinfo)) != -1) { + if (strncmp(line, SRVLVL_CPUMF, strlen(SRVLVL_CPUMF))) + continue; + + line2 = line + strlen(SRVLVL_CPUMF); + while ((cp = strtok_r(line2, "\n ", &line2))) { + if (!strncmp(cp, SRVLVL_VERSION, + strlen(SRVLVL_VERSION))) { + char *sep = strchr(cp, '='); + + vssize += scnprintf(version + vssize, + sizeof(version) - vssize, "%s", sep + 1); + } + if (!strncmp(cp, SRVLVL_AUTHORIZATION, + strlen(SRVLVL_AUTHORIZATION))) { + char *sep = strchr(cp, '='); + + atsize += scnprintf(authorization + atsize, + sizeof(authorization) - atsize, "%s", sep + 1); + } + } + } + fclose(sysinfo); + +skip_sysinfo: + free(line); + + if (version[0] && authorization[0] ) + nbytes = snprintf(buffer, sz, "%s,%s,%s,%s,%s", + manufacturer, type, model, version, + authorization); + else + nbytes = snprintf(buffer, sz, "%s,%s,%s", manufacturer, type, + model); + return (nbytes >= sz) ? -1 : 0; +} + +char *get_cpuid_str(struct perf_pmu *pmu __maybe_unused) +{ + char *buf = malloc(128); + + if (buf && get_cpuid(buf, 128) < 0) + zfree(&buf); + return buf; +} + +/* + * Compare the cpuid string returned by get_cpuid() function + * with the name generated by the jevents file read from + * pmu-events/arch/s390/mapfile.csv. + * + * Parameter mapcpuid is the cpuid as stored in the + * pmu-events/arch/s390/mapfile.csv. This is just the type number. + * Parameter cpuid is the cpuid returned by function get_cpuid(). + */ +int strcmp_cpuid_str(const char *mapcpuid, const char *cpuid) +{ + char *cp = strchr(cpuid, ','); + + if (cp == NULL) + return -1; + return strncmp(cp + 1, mapcpuid, strlen(mapcpuid)); } diff --git a/tools/perf/arch/x86/tests/perf-time-to-tsc.c b/tools/perf/arch/x86/tests/perf-time-to-tsc.c index 06abe8108b33..7a7721604b86 100644 --- a/tools/perf/arch/x86/tests/perf-time-to-tsc.c +++ b/tools/perf/arch/x86/tests/perf-time-to-tsc.c @@ -60,6 +60,7 @@ int test__perf_time_to_tsc(struct test *test __maybe_unused, int subtest __maybe union perf_event *event; u64 test_tsc, comm1_tsc, comm2_tsc; u64 test_time, comm1_time = 0, comm2_time = 0; + struct perf_mmap *md; threads = thread_map__new(-1, getpid(), UINT_MAX); CHECK_NOT_NULL__(threads); @@ -109,7 +110,11 @@ int test__perf_time_to_tsc(struct test *test __maybe_unused, int subtest __maybe perf_evlist__disable(evlist); for (i = 0; i < evlist->nr_mmaps; i++) { - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { struct perf_sample sample; if (event->header.type != PERF_RECORD_COMM || @@ -128,8 +133,9 @@ int test__perf_time_to_tsc(struct test *test __maybe_unused, int subtest __maybe comm2_time = sample.time; } next_event: - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); } + perf_mmap__read_done(md); } if (!comm1_time || !comm2_time) diff --git a/tools/perf/arch/x86/util/auxtrace.c b/tools/perf/arch/x86/util/auxtrace.c index 6aa3f2a38321..b135af62011c 100644 --- a/tools/perf/arch/x86/util/auxtrace.c +++ b/tools/perf/arch/x86/util/auxtrace.c @@ -37,15 +37,11 @@ struct auxtrace_record *auxtrace_record__init_intel(struct perf_evlist *evlist, intel_pt_pmu = perf_pmu__find(INTEL_PT_PMU_NAME); intel_bts_pmu = perf_pmu__find(INTEL_BTS_PMU_NAME); - if (evlist) { - evlist__for_each_entry(evlist, evsel) { - if (intel_pt_pmu && - evsel->attr.type == intel_pt_pmu->type) - found_pt = true; - if (intel_bts_pmu && - evsel->attr.type == intel_bts_pmu->type) - found_bts = true; - } + evlist__for_each_entry(evlist, evsel) { + if (intel_pt_pmu && evsel->attr.type == intel_pt_pmu->type) + found_pt = true; + if (intel_bts_pmu && evsel->attr.type == intel_bts_pmu->type) + found_bts = true; } if (found_pt && found_bts) { diff --git a/tools/perf/builtin-annotate.c b/tools/perf/builtin-annotate.c index f15731a3d438..51709a961496 100644 --- a/tools/perf/builtin-annotate.c +++ b/tools/perf/builtin-annotate.c @@ -40,10 +40,11 @@ struct perf_annotate { struct perf_tool tool; struct perf_session *session; - bool use_tui, use_stdio, use_gtk; + bool use_tui, use_stdio, use_stdio2, use_gtk; bool full_paths; bool print_line; bool skip_missing; + bool has_br_stack; const char *sym_hist_filter; const char *cpu_list; DECLARE_BITMAP(cpu_bitmap, MAX_NR_CPUS); @@ -146,16 +147,78 @@ static void process_branch_stack(struct branch_stack *bs, struct addr_location * free(bi); } +static int hist_iter__branch_callback(struct hist_entry_iter *iter, + struct addr_location *al __maybe_unused, + bool single __maybe_unused, + void *arg __maybe_unused) +{ + struct hist_entry *he = iter->he; + struct branch_info *bi; + struct perf_sample *sample = iter->sample; + struct perf_evsel *evsel = iter->evsel; + int err; + + hist__account_cycles(sample->branch_stack, al, sample, false); + + bi = he->branch_info; + err = addr_map_symbol__inc_samples(&bi->from, sample, evsel->idx); + + if (err) + goto out; + + err = addr_map_symbol__inc_samples(&bi->to, sample, evsel->idx); + +out: + return err; +} + +static int process_branch_callback(struct perf_evsel *evsel, + struct perf_sample *sample, + struct addr_location *al __maybe_unused, + struct perf_annotate *ann, + struct machine *machine) +{ + struct hist_entry_iter iter = { + .evsel = evsel, + .sample = sample, + .add_entry_cb = hist_iter__branch_callback, + .hide_unresolved = symbol_conf.hide_unresolved, + .ops = &hist_iter_branch, + }; + + struct addr_location a; + int ret; + + if (machine__resolve(machine, &a, sample) < 0) + return -1; + + if (a.sym == NULL) + return 0; + + if (a.map != NULL) + a.map->dso->hit = 1; + + ret = hist_entry_iter__add(&iter, &a, PERF_MAX_STACK_DEPTH, ann); + return ret; +} + +static bool has_annotation(struct perf_annotate *ann) +{ + return ui__has_annotation() || ann->use_stdio2; +} + static int perf_evsel__add_sample(struct perf_evsel *evsel, struct perf_sample *sample, struct addr_location *al, - struct perf_annotate *ann) + struct perf_annotate *ann, + struct machine *machine) { struct hists *hists = evsel__hists(evsel); struct hist_entry *he; int ret; - if (ann->sym_hist_filter != NULL && + if ((!ann->has_br_stack || !has_annotation(ann)) && + ann->sym_hist_filter != NULL && (al->sym == NULL || strcmp(ann->sym_hist_filter, al->sym->name) != 0)) { /* We're only interested in a symbol named sym_hist_filter */ @@ -178,6 +241,9 @@ static int perf_evsel__add_sample(struct perf_evsel *evsel, */ process_branch_stack(sample->branch_stack, al, sample); + if (ann->has_br_stack && has_annotation(ann)) + return process_branch_callback(evsel, sample, al, ann, machine); + he = hists__add_entry(hists, al, NULL, NULL, NULL, sample, true); if (he == NULL) return -ENOMEM; @@ -206,7 +272,8 @@ static int process_sample_event(struct perf_tool *tool, if (ann->cpu_list && !test_bit(sample->cpu, ann->cpu_bitmap)) goto out_put; - if (!al.filtered && perf_evsel__add_sample(evsel, sample, &al, ann)) { + if (!al.filtered && + perf_evsel__add_sample(evsel, sample, &al, ann, machine)) { pr_warning("problem incrementing symbol count, " "skipping event\n"); ret = -1; @@ -220,8 +287,11 @@ static int hist_entry__tty_annotate(struct hist_entry *he, struct perf_evsel *evsel, struct perf_annotate *ann) { - return symbol__tty_annotate(he->ms.sym, he->ms.map, evsel, - ann->print_line, ann->full_paths, 0, 0); + if (!ann->use_stdio2) + return symbol__tty_annotate(he->ms.sym, he->ms.map, evsel, + ann->print_line, ann->full_paths, 0, 0); + return symbol__tty_annotate2(he->ms.sym, he->ms.map, evsel, + ann->print_line, ann->full_paths); } static void hists__find_annotations(struct hists *hists, @@ -238,6 +308,10 @@ static void hists__find_annotations(struct hists *hists, if (he->ms.sym == NULL || he->ms.map->dso->annotate_warned) goto find_next; + if (ann->sym_hist_filter && + (strcmp(he->ms.sym->name, ann->sym_hist_filter) != 0)) + goto find_next; + notes = symbol__annotation(he->ms.sym); if (notes->src == NULL) { find_next: @@ -269,6 +343,7 @@ find_next: nd = rb_next(nd); } else if (use_browser == 1) { key = hist_entry__tui_annotate(he, evsel, NULL); + switch (key) { case -1: if (!ann->skip_missing) @@ -420,6 +495,9 @@ int cmd_annotate(int argc, const char **argv) OPT_BOOLEAN(0, "gtk", &annotate.use_gtk, "Use the GTK interface"), OPT_BOOLEAN(0, "tui", &annotate.use_tui, "Use the TUI interface"), OPT_BOOLEAN(0, "stdio", &annotate.use_stdio, "Use the stdio interface"), + OPT_BOOLEAN(0, "stdio2", &annotate.use_stdio2, "Use the stdio interface"), + OPT_BOOLEAN(0, "ignore-vmlinux", &symbol_conf.ignore_vmlinux, + "don't load vmlinux even if found"), OPT_STRING('k', "vmlinux", &symbol_conf.vmlinux_name, "file", "vmlinux pathname"), OPT_BOOLEAN('m', "modules", &symbol_conf.use_modules, @@ -489,20 +567,22 @@ int cmd_annotate(int argc, const char **argv) if (annotate.session == NULL) return -1; + annotate.has_br_stack = perf_header__has_feat(&annotate.session->header, + HEADER_BRANCH_STACK); + ret = symbol__annotation_init(); if (ret < 0) goto out_delete; + annotation_config__init(); + symbol_conf.try_vmlinux_path = true; ret = symbol__init(&annotate.session->header.env); if (ret < 0) goto out_delete; - if (setup_sorting(NULL) < 0) - usage_with_options(annotate_usage, options); - - if (annotate.use_stdio) + if (annotate.use_stdio || annotate.use_stdio2) use_browser = 0; else if (annotate.use_tui) use_browser = 1; @@ -511,6 +591,15 @@ int cmd_annotate(int argc, const char **argv) setup_browser(true); + if ((use_browser == 1 || annotate.use_stdio2) && annotate.has_br_stack) { + sort__mode = SORT_MODE__BRANCH; + if (setup_sorting(annotate.session->evlist) < 0) + usage_with_options(annotate_usage, options); + } else { + if (setup_sorting(NULL) < 0) + usage_with_options(annotate_usage, options); + } + ret = __cmd_annotate(&annotate); out_delete: diff --git a/tools/perf/builtin-c2c.c b/tools/perf/builtin-c2c.c index 539c3d460158..2126bfbcb385 100644 --- a/tools/perf/builtin-c2c.c +++ b/tools/perf/builtin-c2c.c @@ -32,6 +32,7 @@ #include "evsel.h" #include "ui/browsers/hists.h" #include "thread.h" +#include "mem2node.h" struct c2c_hists { struct hists hists; @@ -49,6 +50,7 @@ struct c2c_hist_entry { struct c2c_hists *hists; struct c2c_stats stats; unsigned long *cpuset; + unsigned long *nodeset; struct c2c_stats *node_stats; unsigned int cacheline_idx; @@ -59,6 +61,11 @@ struct c2c_hist_entry { * because of its callchain dynamic entry */ struct hist_entry he; + + unsigned long paddr; + unsigned long paddr_cnt; + bool paddr_zero; + char *nodestr; }; static char const *coalesce_default = "pid,iaddr"; @@ -66,6 +73,7 @@ static char const *coalesce_default = "pid,iaddr"; struct perf_c2c { struct perf_tool tool; struct c2c_hists hists; + struct mem2node mem2node; unsigned long **nodes; int nodes_cnt; @@ -123,6 +131,10 @@ static void *c2c_he_zalloc(size_t size) if (!c2c_he->cpuset) return NULL; + c2c_he->nodeset = bitmap_alloc(c2c.nodes_cnt); + if (!c2c_he->nodeset) + return NULL; + c2c_he->node_stats = zalloc(c2c.nodes_cnt * sizeof(*c2c_he->node_stats)); if (!c2c_he->node_stats) return NULL; @@ -145,6 +157,8 @@ static void c2c_he_free(void *he) } free(c2c_he->cpuset); + free(c2c_he->nodeset); + free(c2c_he->nodestr); free(c2c_he->node_stats); free(c2c_he); } @@ -194,6 +208,28 @@ static void c2c_he__set_cpu(struct c2c_hist_entry *c2c_he, set_bit(sample->cpu, c2c_he->cpuset); } +static void c2c_he__set_node(struct c2c_hist_entry *c2c_he, + struct perf_sample *sample) +{ + int node; + + if (!sample->phys_addr) { + c2c_he->paddr_zero = true; + return; + } + + node = mem2node__node(&c2c.mem2node, sample->phys_addr); + if (WARN_ONCE(node < 0, "WARNING: failed to find node\n")) + return; + + set_bit(node, c2c_he->nodeset); + + if (c2c_he->paddr != sample->phys_addr) { + c2c_he->paddr_cnt++; + c2c_he->paddr = sample->phys_addr; + } +} + static void compute_stats(struct c2c_hist_entry *c2c_he, struct c2c_stats *stats, u64 weight) @@ -237,9 +273,12 @@ static int process_sample_event(struct perf_tool *tool __maybe_unused, if (mi == NULL) return -ENOMEM; - mi_dup = memdup(mi, sizeof(*mi)); - if (!mi_dup) - goto free_mi; + /* + * The mi object is released in hists__add_entry_ops, + * if it gets sorted out into existing data, so we need + * to take the copy now. + */ + mi_dup = mem_info__get(mi); c2c_decode_stats(&stats, mi); @@ -247,13 +286,14 @@ static int process_sample_event(struct perf_tool *tool __maybe_unused, &al, NULL, NULL, mi, sample, true); if (he == NULL) - goto free_mi_dup; + goto free_mi; c2c_he = container_of(he, struct c2c_hist_entry, he); c2c_add_stats(&c2c_he->stats, &stats); c2c_add_stats(&c2c_hists->stats, &stats); c2c_he__set_cpu(c2c_he, sample); + c2c_he__set_node(c2c_he, sample); hists__inc_nr_samples(&c2c_hists->hists, he->filtered); ret = hist_entry__append_callchain(he, sample); @@ -272,19 +312,15 @@ static int process_sample_event(struct perf_tool *tool __maybe_unused, mi = mi_dup; - mi_dup = memdup(mi, sizeof(*mi)); - if (!mi_dup) - goto free_mi; - c2c_hists = he__get_c2c_hists(he, c2c.cl_sort, 2); if (!c2c_hists) - goto free_mi_dup; + goto free_mi; he = hists__add_entry_ops(&c2c_hists->hists, &c2c_entry_ops, &al, NULL, NULL, mi, sample, true); if (he == NULL) - goto free_mi_dup; + goto free_mi; c2c_he = container_of(he, struct c2c_hist_entry, he); c2c_add_stats(&c2c_he->stats, &stats); @@ -294,6 +330,7 @@ static int process_sample_event(struct perf_tool *tool __maybe_unused, compute_stats(c2c_he, &stats, sample->weight); c2c_he__set_cpu(c2c_he, sample); + c2c_he__set_node(c2c_he, sample); hists__inc_nr_samples(&c2c_hists->hists, he->filtered); ret = hist_entry__append_callchain(he, sample); @@ -303,10 +340,9 @@ out: addr_location__put(&al); return ret; -free_mi_dup: - free(mi_dup); free_mi: - free(mi); + mem_info__put(mi_dup); + mem_info__put(mi); ret = -ENOMEM; goto out; } @@ -457,6 +493,31 @@ static int dcacheline_entry(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp, return scnprintf(hpp->buf, hpp->size, "%*s", width, HEX_STR(buf, addr)); } +static int +dcacheline_node_entry(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp, + struct hist_entry *he) +{ + struct c2c_hist_entry *c2c_he; + int width = c2c_width(fmt, hpp, he->hists); + + c2c_he = container_of(he, struct c2c_hist_entry, he); + if (WARN_ON_ONCE(!c2c_he->nodestr)) + return 0; + + return scnprintf(hpp->buf, hpp->size, "%*s", width, c2c_he->nodestr); +} + +static int +dcacheline_node_count(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp, + struct hist_entry *he) +{ + struct c2c_hist_entry *c2c_he; + int width = c2c_width(fmt, hpp, he->hists); + + c2c_he = container_of(he, struct c2c_hist_entry, he); + return scnprintf(hpp->buf, hpp->size, "%*lu", width, c2c_he->paddr_cnt); +} + static int offset_entry(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp, struct hist_entry *he) { @@ -1202,23 +1263,47 @@ cl_idx_empty_entry(struct perf_hpp_fmt *fmt, struct perf_hpp *hpp, } static struct c2c_dimension dim_dcacheline = { - .header = HEADER_LOW("Cacheline"), + .header = HEADER_SPAN("--- Cacheline ----", "Address", 2), .name = "dcacheline", .cmp = dcacheline_cmp, .entry = dcacheline_entry, .width = 18, }; -static struct c2c_header header_offset_tui = HEADER_LOW("Off"); +static struct c2c_dimension dim_dcacheline_node = { + .header = HEADER_LOW("Node"), + .name = "dcacheline_node", + .cmp = empty_cmp, + .entry = dcacheline_node_entry, + .width = 4, +}; + +static struct c2c_dimension dim_dcacheline_count = { + .header = HEADER_LOW("PA cnt"), + .name = "dcacheline_count", + .cmp = empty_cmp, + .entry = dcacheline_node_count, + .width = 6, +}; + +static struct c2c_header header_offset_tui = HEADER_SPAN("-----", "Off", 2); static struct c2c_dimension dim_offset = { - .header = HEADER_BOTH("Data address", "Offset"), + .header = HEADER_SPAN("--- Data address -", "Offset", 2), .name = "offset", .cmp = offset_cmp, .entry = offset_entry, .width = 18, }; +static struct c2c_dimension dim_offset_node = { + .header = HEADER_LOW("Node"), + .name = "offset_node", + .cmp = empty_cmp, + .entry = dcacheline_node_entry, + .width = 4, +}; + static struct c2c_dimension dim_iaddr = { .header = HEADER_LOW("Code address"), .name = "iaddr", @@ -1538,7 +1623,10 @@ static struct c2c_dimension dim_dcacheline_num_empty = { static struct c2c_dimension *dimensions[] = { &dim_dcacheline, + &dim_dcacheline_node, + &dim_dcacheline_count, &dim_offset, + &dim_offset_node, &dim_iaddr, &dim_tot_hitm, &dim_lcl_hitm, @@ -1841,20 +1929,56 @@ static inline int valid_hitm_or_store(struct hist_entry *he) return has_hitm || c2c_he->stats.store; } -static void calc_width(struct hist_entry *he) +static void set_node_width(struct c2c_hist_entry *c2c_he, int len) +{ + struct c2c_dimension *dim; + + dim = &c2c.hists == c2c_he->hists ? + &dim_dcacheline_node : &dim_offset_node; + + if (len > dim->width) + dim->width = len; +} + +static int set_nodestr(struct c2c_hist_entry *c2c_he) +{ + char buf[30]; + int len; + + if (c2c_he->nodestr) + return 0; + + if (bitmap_weight(c2c_he->nodeset, c2c.nodes_cnt)) { + len = bitmap_scnprintf(c2c_he->nodeset, c2c.nodes_cnt, + buf, sizeof(buf)); + } else { + len = scnprintf(buf, sizeof(buf), "N/A"); + } + + set_node_width(c2c_he, len); + c2c_he->nodestr = strdup(buf); + return c2c_he->nodestr ? 0 : -ENOMEM; +} + +static void calc_width(struct c2c_hist_entry *c2c_he) { struct c2c_hists *c2c_hists; - c2c_hists = container_of(he->hists, struct c2c_hists, hists); - hists__calc_col_len(&c2c_hists->hists, he); + c2c_hists = container_of(c2c_he->he.hists, struct c2c_hists, hists); + hists__calc_col_len(&c2c_hists->hists, &c2c_he->he); + set_nodestr(c2c_he); } static int filter_cb(struct hist_entry *he) { + struct c2c_hist_entry *c2c_he; + + c2c_he = container_of(he, struct c2c_hist_entry, he); + if (c2c.show_src && !he->srcline) he->srcline = hist_entry__get_srcline(he); - calc_width(he); + calc_width(c2c_he); if (!valid_hitm_or_store(he)) he->filtered = HIST_FILTER__C2C; @@ -1871,12 +1995,11 @@ static int resort_cl_cb(struct hist_entry *he) c2c_he = container_of(he, struct c2c_hist_entry, he); c2c_hists = c2c_he->hists; - calc_width(he); - if (display && c2c_hists) { static unsigned int idx; c2c_he->cacheline_idx = idx++; + calc_width(c2c_he); c2c_hists__reinit(c2c_hists, c2c.cl_output, c2c.cl_resort); @@ -2350,14 +2473,66 @@ static void perf_c2c_display(struct perf_session *session) } #endif /* HAVE_SLANG_SUPPORT */ -static void ui_quirks(void) +static char *fill_line(const char *orig, int len) +{ + int i, j, olen = strlen(orig); + char *buf; + + buf = zalloc(len + 1); + if (!buf) + return NULL; + + j = len / 2 - olen / 2; + + for (i = 0; i < j - 1; i++) + buf[i] = '-'; + + buf[i++] = ' '; + + strcpy(buf + i, orig); + + i += olen; + + buf[i++] = ' '; + + for (; i < len; i++) + buf[i] = '-'; + + return buf; +} + +static int ui_quirks(void) { + const char *nodestr = "Data address"; + char *buf; + if (!c2c.use_stdio) { dim_offset.width = 5; dim_offset.header = header_offset_tui; + nodestr = "CL"; } dim_percent_hitm.header = percent_hitm_header[c2c.display]; + + /* Fix the zero line for dcacheline column. */ + buf = fill_line("Cacheline", dim_dcacheline.width + + dim_dcacheline_node.width + + dim_dcacheline_count.width + 4); + if (!buf) + return -ENOMEM; + + dim_dcacheline.header.line[0].text = buf; + + /* Fix the zero line for offset column. */ + buf = fill_line(nodestr, dim_offset.width + + dim_offset_node.width + + dim_dcacheline_count.width + 4); + if (!buf) + return -ENOMEM; + + dim_offset.header.line[0].text = buf; + + return 0; } #define CALLCHAIN_DEFAULT_OPT "graph,0.5,caller,function,percent" @@ -2473,7 +2648,7 @@ static int build_cl_output(char *cl_sort, bool no_source) "percent_lcl_hitm," "percent_stores_l1hit," "percent_stores_l1miss," - "offset,", + "offset,offset_node,dcacheline_count,", add_pid ? "pid," : "", add_tid ? "tid," : "", add_iaddr ? "iaddr," : "", @@ -2602,17 +2777,21 @@ static int perf_c2c__report(int argc, const char **argv) goto out; } - err = setup_callchain(session->evlist); + err = mem2node__init(&c2c.mem2node, &session->header.env); if (err) goto out_session; + err = setup_callchain(session->evlist); + if (err) + goto out_mem2node; + if (symbol__init(&session->header.env) < 0) - goto out_session; + goto out_mem2node; /* No pipe support at the moment. */ if (perf_data__is_pipe(session->data)) { pr_debug("No pipe support at the moment.\n"); - goto out_session; + goto out_mem2node; } if (c2c.use_stdio) @@ -2625,12 +2804,14 @@ static int perf_c2c__report(int argc, const char **argv) err = perf_session__process_events(session); if (err) { pr_err("failed to process sample\n"); - goto out_session; + goto out_mem2node; } c2c_hists__reinit(&c2c.hists, "cl_idx," "dcacheline," + "dcacheline_node," + "dcacheline_count," "tot_recs," "percent_hitm," "tot_hitm,lcl_hitm,rmt_hitm," @@ -2652,10 +2833,15 @@ static int perf_c2c__report(int argc, const char **argv) ui_progress__finish(); - ui_quirks(); + if (ui_quirks()) { + pr_err("failed to setup UI\n"); + goto out_mem2node; + } perf_c2c_display(session); +out_mem2node: + mem2node__exit(&c2c.mem2node); out_session: perf_session__delete(session); out: @@ -2706,7 +2892,7 @@ static int perf_c2c__record(int argc, const char **argv) argc = parse_options(argc, argv, options, record_mem_usage, PARSE_OPT_KEEP_UNKNOWN); - rec_argc = argc + 10; /* max number of arguments */ + rec_argc = argc + 11; /* max number of arguments */ rec_argv = calloc(rec_argc + 1, sizeof(char *)); if (!rec_argv) return -1; @@ -2722,6 +2908,7 @@ static int perf_c2c__record(int argc, const char **argv) rec_argv[i++] = "-W"; rec_argv[i++] = "-d"; + rec_argv[i++] = "--phys-data"; rec_argv[i++] = "--sample-cpu"; for (j = 0; j < PERF_MEM_EVENTS__MAX; j++) { diff --git a/tools/perf/builtin-ftrace.c b/tools/perf/builtin-ftrace.c index 25a42acabee1..f42f228e8899 100644 --- a/tools/perf/builtin-ftrace.c +++ b/tools/perf/builtin-ftrace.c @@ -72,6 +72,7 @@ static int __write_tracing_file(const char *name, const char *val, bool append) ssize_t size = strlen(val); int flags = O_WRONLY; char errbuf[512]; + char *val_copy; file = get_tracing_file(name); if (!file) { @@ -91,12 +92,23 @@ static int __write_tracing_file(const char *name, const char *val, bool append) goto out; } - if (write(fd, val, size) == size) + /* + * Copy the original value and append a '\n'. Without this, + * the kernel can hide possible errors. + */ + val_copy = strdup(val); + if (!val_copy) + goto out_close; + val_copy[size] = '\n'; + + if (write(fd, val_copy, size + 1) == size + 1) ret = 0; else pr_debug("write '%s' to tracing/%s failed: %s\n", val, name, str_error_r(errno, errbuf, sizeof(errbuf))); + free(val_copy); +out_close: close(fd); out: put_tracing_file(file); @@ -280,8 +292,10 @@ static int __cmd_ftrace(struct perf_ftrace *ftrace, int argc, const char **argv) signal(SIGCHLD, sig_handler); signal(SIGPIPE, sig_handler); - if (reset_tracing_files(ftrace) < 0) + if (reset_tracing_files(ftrace) < 0) { + pr_err("failed to reset ftrace\n"); goto out; + } /* reset ftrace buffer */ if (write_tracing_file("trace", "0") < 0) diff --git a/tools/perf/builtin-kvm.c b/tools/perf/builtin-kvm.c index 55d919dc5bc6..72e2ca096bf5 100644 --- a/tools/perf/builtin-kvm.c +++ b/tools/perf/builtin-kvm.c @@ -743,16 +743,23 @@ static bool verify_vcpu(int vcpu) static s64 perf_kvm__mmap_read_idx(struct perf_kvm_stat *kvm, int idx, u64 *mmap_time) { + struct perf_evlist *evlist = kvm->evlist; union perf_event *event; + struct perf_mmap *md; u64 timestamp; s64 n = 0; int err; *mmap_time = ULLONG_MAX; - while ((event = perf_evlist__mmap_read(kvm->evlist, idx)) != NULL) { - err = perf_evlist__parse_sample_timestamp(kvm->evlist, event, ×tamp); + md = &evlist->mmap[idx]; + err = perf_mmap__read_init(md); + if (err < 0) + return (err == -EAGAIN) ? 0 : -1; + + while ((event = perf_mmap__read_event(md)) != NULL) { + err = perf_evlist__parse_sample_timestamp(evlist, event, ×tamp); if (err) { - perf_evlist__mmap_consume(kvm->evlist, idx); + perf_mmap__consume(md); pr_err("Failed to parse sample\n"); return -1; } @@ -762,7 +769,7 @@ static s64 perf_kvm__mmap_read_idx(struct perf_kvm_stat *kvm, int idx, * FIXME: Here we can't consume the event, as perf_session__queue_event will * point to it, and it'll get possibly overwritten by the kernel. */ - perf_evlist__mmap_consume(kvm->evlist, idx); + perf_mmap__consume(md); if (err) { pr_err("Failed to enqueue sample: %d\n", err); @@ -779,6 +786,7 @@ static s64 perf_kvm__mmap_read_idx(struct perf_kvm_stat *kvm, int idx, break; } + perf_mmap__read_done(md); return n; } diff --git a/tools/perf/builtin-record.c b/tools/perf/builtin-record.c index bf4ca749d1ac..22ebeb92ac51 100644 --- a/tools/perf/builtin-record.c +++ b/tools/perf/builtin-record.c @@ -45,6 +45,7 @@ #include <errno.h> #include <inttypes.h> +#include <locale.h> #include <poll.h> #include <unistd.h> #include <sched.h> @@ -70,7 +71,6 @@ struct record { struct auxtrace_record *itr; struct perf_evlist *evlist; struct perf_session *session; - const char *progname; int realtime_prio; bool no_buildid; bool no_buildid_set; @@ -273,6 +273,24 @@ static void record__read_auxtrace_snapshot(struct record *rec) } } +static int record__auxtrace_init(struct record *rec) +{ + int err; + + if (!rec->itr) { + rec->itr = auxtrace_record__init(rec->evlist, &err); + if (err) + return err; + } + + err = auxtrace_parse_snapshot_options(rec->itr, &rec->opts, + rec->opts.auxtrace_snapshot_opts); + if (err) + return err; + + return auxtrace_parse_filters(rec->evlist); +} + #else static inline @@ -293,6 +311,11 @@ int auxtrace_record__snapshot_start(struct auxtrace_record *itr __maybe_unused) return 0; } +static int record__auxtrace_init(struct record *rec __maybe_unused) +{ + return 0; +} + #endif static int record__mmap_evlist(struct record *rec, @@ -509,7 +532,7 @@ static int record__mmap_read_evlist(struct record *rec, struct perf_evlist *evli struct auxtrace_mmap *mm = &maps[i].auxtrace_mmap; if (maps[i].base) { - if (perf_mmap__push(&maps[i], overwrite, rec, record__pushfn) != 0) { + if (perf_mmap__push(&maps[i], rec, record__pushfn) != 0) { rc = -1; goto out; } @@ -731,13 +754,10 @@ static int record__synthesize(struct record *rec, bool tail) return 0; if (data->is_pipe) { - err = perf_event__synthesize_features( - tool, session, rec->evlist, process_synthesized_event); - if (err < 0) { - pr_err("Couldn't synthesize features.\n"); - return err; - } - + /* + * We need to synthesize events first, because some + * features works on top of them (on report side). + */ err = perf_event__synthesize_attrs(tool, session, process_synthesized_event); if (err < 0) { @@ -745,6 +765,13 @@ static int record__synthesize(struct record *rec, bool tail) goto out; } + err = perf_event__synthesize_features(tool, session, rec->evlist, + process_synthesized_event); + if (err < 0) { + pr_err("Couldn't synthesize features.\n"); + return err; + } + if (have_tracepoints(&rec->evlist->entries)) { /* * FIXME err <= 0 here actually means that @@ -830,7 +857,6 @@ static int __cmd_record(struct record *rec, int argc, const char **argv) int status = 0; unsigned long waking = 0; const bool forks = argc > 0; - struct machine *machine; struct perf_tool *tool = &rec->tool; struct record_opts *opts = &rec->opts; struct perf_data *data = &rec->data; @@ -838,8 +864,6 @@ static int __cmd_record(struct record *rec, int argc, const char **argv) bool disabled = false, draining = false; int fd; - rec->progname = argv[0]; - atexit(record__sig_exit); signal(SIGCHLD, sig_handler); signal(SIGINT, sig_handler); @@ -881,6 +905,15 @@ static int __cmd_record(struct record *rec, int argc, const char **argv) } } + /* + * If we have just single event and are sending data + * through pipe, we need to force the ids allocation, + * because we synthesize event name through the pipe + * and need the id for that. + */ + if (data->is_pipe && rec->evlist->nr_entries == 1) + rec->opts.sample_id = true; + if (record__open(rec) != 0) { err = -1; goto out_child; @@ -926,8 +959,6 @@ static int __cmd_record(struct record *rec, int argc, const char **argv) goto out_child; } - machine = &session->machines.host; - err = record__synthesize(rec, false); if (err < 0) goto out_child; @@ -955,6 +986,7 @@ static int __cmd_record(struct record *rec, int argc, const char **argv) * Let the child rip */ if (forks) { + struct machine *machine = &session->machines.host; union perf_event *event; pid_t tgid; @@ -1251,10 +1283,12 @@ static int perf_record_config(const char *var, const char *value, void *cb) return -1; return 0; } - if (!strcmp(var, "record.call-graph")) - var = "call-graph.record-mode"; /* fall-through */ + if (!strcmp(var, "record.call-graph")) { + var = "call-graph.record-mode"; + return perf_default_config(var, value, cb); + } - return perf_default_config(var, value, cb); + return 0; } struct clockid_map { @@ -1542,7 +1576,11 @@ static struct option __record_options[] = { OPT_BOOLEAN(0, "tail-synthesize", &record.opts.tail_synthesize, "synthesize non-sample events at the end of output"), OPT_BOOLEAN(0, "overwrite", &record.opts.overwrite, "use overwrite mode"), - OPT_UINTEGER('F', "freq", &record.opts.user_freq, "profile at this frequency"), + OPT_BOOLEAN(0, "strict-freq", &record.opts.strict_freq, + "Fail if the specified frequency can't be used"), + OPT_CALLBACK('F', "freq", &record.opts, "freq or 'max'", + "profile at this frequency", + record__parse_freq), OPT_CALLBACK('m', "mmap-pages", &record.opts, "pages[,pages]", "number of mmap data pages and AUX area tracing mmap pages", record__parse_mmap_pages), @@ -1651,6 +1689,8 @@ int cmd_record(int argc, const char **argv) struct record *rec = &record; char errbuf[BUFSIZ]; + setlocale(LC_ALL, ""); + #ifndef HAVE_LIBBPF_SUPPORT # define set_nobuild(s, l, c) set_option_nobuild(record_options, s, l, "NO_LIBBPF=1", c) set_nobuild('\0', "clang-path", true); @@ -1711,17 +1751,6 @@ int cmd_record(int argc, const char **argv) alarm(rec->switch_output.time); } - if (!rec->itr) { - rec->itr = auxtrace_record__init(rec->evlist, &err); - if (err) - goto out; - } - - err = auxtrace_parse_snapshot_options(rec->itr, &rec->opts, - rec->opts.auxtrace_snapshot_opts); - if (err) - goto out; - /* * Allow aliases to facilitate the lookup of symbols for address * filters. Refer to auxtrace_parse_filters(). @@ -1730,7 +1759,7 @@ int cmd_record(int argc, const char **argv) symbol__init(NULL); - err = auxtrace_parse_filters(rec->evlist); + err = record__auxtrace_init(rec); if (err) goto out; @@ -1803,7 +1832,7 @@ int cmd_record(int argc, const char **argv) err = target__validate(&rec->opts.target); if (err) { target__strerror(&rec->opts.target, err, errbuf, BUFSIZ); - ui__warning("%s", errbuf); + ui__warning("%s\n", errbuf); } err = target__parse_uid(&rec->opts.target); diff --git a/tools/perf/builtin-report.c b/tools/perf/builtin-report.c index 4ad5dc649716..0f198f6d9b77 100644 --- a/tools/perf/builtin-report.c +++ b/tools/perf/builtin-report.c @@ -68,6 +68,7 @@ struct report { bool header; bool header_only; bool nonany_branch_mode; + bool group_set; int max_stack; struct perf_read_values show_threads_values; const char *pretty_printing_style; @@ -193,6 +194,45 @@ out: return err; } +/* + * Events in data file are not collect in groups, but we still want + * the group display. Set the artificial group and set the leader's + * forced_leader flag to notify the display code. + */ +static void setup_forced_leader(struct report *report, + struct perf_evlist *evlist) +{ + if (report->group_set && !evlist->nr_groups) { + struct perf_evsel *leader = perf_evlist__first(evlist); + + perf_evlist__set_leader(evlist); + leader->forced_leader = true; + } +} + +static int process_feature_event(struct perf_tool *tool, + union perf_event *event, + struct perf_session *session __maybe_unused) +{ + struct report *rep = container_of(tool, struct report, tool); + + if (event->feat.feat_id < HEADER_LAST_FEATURE) + return perf_event__process_feature(tool, event, session); + + if (event->feat.feat_id != HEADER_LAST_FEATURE) { + pr_err("failed: wrong feature ID: %" PRIu64 "\n", + event->feat.feat_id); + return -1; + } + + /* + * All features are received, we can force the + * group if needed. + */ + setup_forced_leader(rep, session->evlist); + return 0; +} + static int process_sample_event(struct perf_tool *tool, union perf_event *event, struct perf_sample *sample, @@ -400,8 +440,10 @@ static size_t hists__fprintf_nr_sample_events(struct hists *hists, struct report nr_samples = convert_unit(nr_samples, &unit); ret = fprintf(fp, "# Samples: %lu%c", nr_samples, unit); - if (evname != NULL) - ret += fprintf(fp, " of event '%s'", evname); + if (evname != NULL) { + ret += fprintf(fp, " of event%s '%s'", + evsel->nr_members > 1 ? "s" : "", evname); + } if (rep->time_str) ret += fprintf(fp, " (time slices: %s)", rep->time_str); @@ -614,6 +656,7 @@ static int stats_print(struct report *rep) static void tasks_setup(struct report *rep) { memset(&rep->tool, 0, sizeof(rep->tool)); + rep->tool.ordered_events = true; if (rep->mmaps_mode) { rep->tool.mmap = perf_event__process_mmap; rep->tool.mmap2 = perf_event__process_mmap2; @@ -954,7 +997,7 @@ int cmd_report(int argc, const char **argv) .id_index = perf_event__process_id_index, .auxtrace_info = perf_event__process_auxtrace_info, .auxtrace = perf_event__process_auxtrace, - .feature = perf_event__process_feature, + .feature = process_feature_event, .ordered_events = true, .ordering_requires_timestamps = true, }, @@ -975,6 +1018,8 @@ int cmd_report(int argc, const char **argv) OPT_BOOLEAN(0, "mmaps", &report.mmaps_mode, "Display recorded tasks memory maps"), OPT_STRING('k', "vmlinux", &symbol_conf.vmlinux_name, "file", "vmlinux pathname"), + OPT_BOOLEAN(0, "ignore-vmlinux", &symbol_conf.ignore_vmlinux, + "don't load vmlinux even if found"), OPT_STRING(0, "kallsyms", &symbol_conf.kallsyms_name, "file", "kallsyms pathname"), OPT_BOOLEAN('f', "force", &symbol_conf.force, "don't complain, do it"), @@ -1056,7 +1101,7 @@ int cmd_report(int argc, const char **argv) "Specify disassembler style (e.g. -M intel for intel syntax)"), OPT_BOOLEAN(0, "show-total-period", &symbol_conf.show_total_period, "Show a column with the sum of periods"), - OPT_BOOLEAN(0, "group", &symbol_conf.event_group, + OPT_BOOLEAN_SET(0, "group", &symbol_conf.event_group, &report.group_set, "Show event group information together"), OPT_CALLBACK_NOOPT('b', "branch-stack", &branch_mode, "", "use branch records for per branch histogram filling", @@ -1173,6 +1218,8 @@ repeat: has_br_stack = perf_header__has_feat(&session->header, HEADER_BRANCH_STACK); + setup_forced_leader(&report, session->evlist); + if (itrace_synth_opts.last_branch) has_br_stack = true; @@ -1295,6 +1342,7 @@ repeat: symbol_conf.priv_size += sizeof(u32); symbol_conf.sort_by_name = true; } + annotation_config__init(); } if (symbol__init(&session->header.env) < 0) @@ -1332,6 +1380,15 @@ repeat: report.range_num = 1; } + if (session->tevent.pevent && + pevent_set_function_resolver(session->tevent.pevent, + machine__resolve_kernel_addr, + &session->machines.host) < 0) { + pr_err("%s: failed to set libtraceevent function resolver\n", + __func__); + return -1; + } + sort__setup_elide(stdout); ret = __cmd_report(&report); diff --git a/tools/perf/builtin-sched.c b/tools/perf/builtin-sched.c index 83283fedb00f..4dfdee668b0c 100644 --- a/tools/perf/builtin-sched.c +++ b/tools/perf/builtin-sched.c @@ -254,6 +254,10 @@ struct thread_runtime { u64 total_delay_time; int last_state; + + char shortname[3]; + bool comm_changed; + u64 migrations; }; @@ -897,6 +901,37 @@ struct sort_dimension { struct list_head list; }; +/* + * handle runtime stats saved per thread + */ +static struct thread_runtime *thread__init_runtime(struct thread *thread) +{ + struct thread_runtime *r; + + r = zalloc(sizeof(struct thread_runtime)); + if (!r) + return NULL; + + init_stats(&r->run_stats); + thread__set_priv(thread, r); + + return r; +} + +static struct thread_runtime *thread__get_runtime(struct thread *thread) +{ + struct thread_runtime *tr; + + tr = thread__priv(thread); + if (tr == NULL) { + tr = thread__init_runtime(thread); + if (tr == NULL) + pr_debug("Failed to malloc memory for runtime data.\n"); + } + + return tr; +} + static int thread_lat_cmp(struct list_head *list, struct work_atoms *l, struct work_atoms *r) { @@ -1480,6 +1515,7 @@ static int map_switch_event(struct perf_sched *sched, struct perf_evsel *evsel, { const u32 next_pid = perf_evsel__intval(evsel, sample, "next_pid"); struct thread *sched_in; + struct thread_runtime *tr; int new_shortname; u64 timestamp0, timestamp = sample->time; s64 delta; @@ -1519,22 +1555,28 @@ static int map_switch_event(struct perf_sched *sched, struct perf_evsel *evsel, if (sched_in == NULL) return -1; + tr = thread__get_runtime(sched_in); + if (tr == NULL) { + thread__put(sched_in); + return -1; + } + sched->curr_thread[this_cpu] = thread__get(sched_in); printf(" "); new_shortname = 0; - if (!sched_in->shortname[0]) { + if (!tr->shortname[0]) { if (!strcmp(thread__comm_str(sched_in), "swapper")) { /* * Don't allocate a letter-number for swapper:0 * as a shortname. Instead, we use '.' for it. */ - sched_in->shortname[0] = '.'; - sched_in->shortname[1] = ' '; + tr->shortname[0] = '.'; + tr->shortname[1] = ' '; } else { - sched_in->shortname[0] = sched->next_shortname1; - sched_in->shortname[1] = sched->next_shortname2; + tr->shortname[0] = sched->next_shortname1; + tr->shortname[1] = sched->next_shortname2; if (sched->next_shortname1 < 'Z') { sched->next_shortname1++; @@ -1552,6 +1594,7 @@ static int map_switch_event(struct perf_sched *sched, struct perf_evsel *evsel, for (i = 0; i < cpus_nr; i++) { int cpu = sched->map.comp ? sched->map.comp_cpus[i] : i; struct thread *curr_thread = sched->curr_thread[cpu]; + struct thread_runtime *curr_tr; const char *pid_color = color; const char *cpu_color = color; @@ -1569,9 +1612,14 @@ static int map_switch_event(struct perf_sched *sched, struct perf_evsel *evsel, else color_fprintf(stdout, cpu_color, "*"); - if (sched->curr_thread[cpu]) - color_fprintf(stdout, pid_color, "%2s ", sched->curr_thread[cpu]->shortname); - else + if (sched->curr_thread[cpu]) { + curr_tr = thread__get_runtime(sched->curr_thread[cpu]); + if (curr_tr == NULL) { + thread__put(sched_in); + return -1; + } + color_fprintf(stdout, pid_color, "%2s ", curr_tr->shortname); + } else color_fprintf(stdout, color, " "); } @@ -1580,14 +1628,15 @@ static int map_switch_event(struct perf_sched *sched, struct perf_evsel *evsel, timestamp__scnprintf_usec(timestamp, stimestamp, sizeof(stimestamp)); color_fprintf(stdout, color, " %12s secs ", stimestamp); - if (new_shortname || (verbose > 0 && sched_in->tid)) { + if (new_shortname || tr->comm_changed || (verbose > 0 && sched_in->tid)) { const char *pid_color = color; if (thread__has_color(sched_in)) pid_color = COLOR_PIDS; color_fprintf(stdout, pid_color, "%s => %s:%d", - sched_in->shortname, thread__comm_str(sched_in), sched_in->tid); + tr->shortname, thread__comm_str(sched_in), sched_in->tid); + tr->comm_changed = false; } if (sched->map.comp && new_cpu) @@ -1691,6 +1740,37 @@ static int perf_sched__process_tracepoint_sample(struct perf_tool *tool __maybe_ return err; } +static int perf_sched__process_comm(struct perf_tool *tool __maybe_unused, + union perf_event *event, + struct perf_sample *sample, + struct machine *machine) +{ + struct thread *thread; + struct thread_runtime *tr; + int err; + + err = perf_event__process_comm(tool, event, sample, machine); + if (err) + return err; + + thread = machine__find_thread(machine, sample->pid, sample->tid); + if (!thread) { + pr_err("Internal error: can't find thread\n"); + return -1; + } + + tr = thread__get_runtime(thread); + if (tr == NULL) { + thread__put(thread); + return -1; + } + + tr->comm_changed = true; + thread__put(thread); + + return 0; +} + static int perf_sched__read_events(struct perf_sched *sched) { const struct perf_evsel_str_handler handlers[] = { @@ -2200,37 +2280,6 @@ static void save_idle_callchain(struct idle_thread_runtime *itr, callchain_cursor__copy(&itr->cursor, &callchain_cursor); } -/* - * handle runtime stats saved per thread - */ -static struct thread_runtime *thread__init_runtime(struct thread *thread) -{ - struct thread_runtime *r; - - r = zalloc(sizeof(struct thread_runtime)); - if (!r) - return NULL; - - init_stats(&r->run_stats); - thread__set_priv(thread, r); - - return r; -} - -static struct thread_runtime *thread__get_runtime(struct thread *thread) -{ - struct thread_runtime *tr; - - tr = thread__priv(thread); - if (tr == NULL) { - tr = thread__init_runtime(thread); - if (tr == NULL) - pr_debug("Failed to malloc memory for runtime data.\n"); - } - - return tr; -} - static struct thread *timehist_get_thread(struct perf_sched *sched, struct perf_sample *sample, struct machine *machine, @@ -3291,7 +3340,7 @@ int cmd_sched(int argc, const char **argv) struct perf_sched sched = { .tool = { .sample = perf_sched__process_tracepoint_sample, - .comm = perf_event__process_comm, + .comm = perf_sched__process_comm, .namespaces = perf_event__process_namespaces, .lost = perf_event__process_lost, .fork = perf_sched__process_fork_event, diff --git a/tools/perf/builtin-script.c b/tools/perf/builtin-script.c index ab19a6ee4093..313c42423393 100644 --- a/tools/perf/builtin-script.c +++ b/tools/perf/builtin-script.c @@ -1489,6 +1489,7 @@ struct perf_script { bool show_switch_events; bool show_namespace_events; bool show_lost_events; + bool show_round_events; bool allocated; bool per_event_dump; struct cpu_map *cpus; @@ -2104,6 +2105,16 @@ process_lost_event(struct perf_tool *tool, return 0; } +static int +process_finished_round_event(struct perf_tool *tool __maybe_unused, + union perf_event *event, + struct ordered_events *oe __maybe_unused) + +{ + perf_event__fprintf(event, stdout); + return 0; +} + static void sig_handler(int sig __maybe_unused) { session_done = 1; @@ -2200,6 +2211,10 @@ static int __cmd_script(struct perf_script *script) script->tool.namespaces = process_namespaces_event; if (script->show_lost_events) script->tool.lost = process_lost_event; + if (script->show_round_events) { + script->tool.ordered_events = false; + script->tool.finished_round = process_finished_round_event; + } if (perf_script__setup_per_event_dump(script)) { pr_err("Couldn't create the per event dump files\n"); @@ -2659,8 +2674,8 @@ static int list_available_scripts(const struct option *opt __maybe_unused, } for_each_lang(scripts_path, scripts_dir, lang_dirent) { - snprintf(lang_path, MAXPATHLEN, "%s/%s/bin", scripts_path, - lang_dirent->d_name); + scnprintf(lang_path, MAXPATHLEN, "%s/%s/bin", scripts_path, + lang_dirent->d_name); lang_dir = opendir(lang_path); if (!lang_dir) continue; @@ -2669,8 +2684,8 @@ static int list_available_scripts(const struct option *opt __maybe_unused, script_root = get_script_root(script_dirent, REPORT_SUFFIX); if (script_root) { desc = script_desc__findnew(script_root); - snprintf(script_path, MAXPATHLEN, "%s/%s", - lang_path, script_dirent->d_name); + scnprintf(script_path, MAXPATHLEN, "%s/%s", + lang_path, script_dirent->d_name); read_script_info(desc, script_path); free(script_root); } @@ -2706,7 +2721,7 @@ static int check_ev_match(char *dir_name, char *scriptname, int match, len; FILE *fp; - sprintf(filename, "%s/bin/%s-record", dir_name, scriptname); + scnprintf(filename, MAXPATHLEN, "%s/bin/%s-record", dir_name, scriptname); fp = fopen(filename, "r"); if (!fp) @@ -2784,8 +2799,8 @@ int find_scripts(char **scripts_array, char **scripts_path_array) } for_each_lang(scripts_path, scripts_dir, lang_dirent) { - snprintf(lang_path, MAXPATHLEN, "%s/%s", scripts_path, - lang_dirent->d_name); + scnprintf(lang_path, MAXPATHLEN, "%s/%s", scripts_path, + lang_dirent->d_name); #ifdef NO_LIBPERL if (strstr(lang_path, "perl")) continue; @@ -2840,8 +2855,8 @@ static char *get_script_path(const char *script_root, const char *suffix) return NULL; for_each_lang(scripts_path, scripts_dir, lang_dirent) { - snprintf(lang_path, MAXPATHLEN, "%s/%s/bin", scripts_path, - lang_dirent->d_name); + scnprintf(lang_path, MAXPATHLEN, "%s/%s/bin", scripts_path, + lang_dirent->d_name); lang_dir = opendir(lang_path); if (!lang_dir) continue; @@ -2852,8 +2867,8 @@ static char *get_script_path(const char *script_root, const char *suffix) free(__script_root); closedir(lang_dir); closedir(scripts_dir); - snprintf(script_path, MAXPATHLEN, "%s/%s", - lang_path, script_dirent->d_name); + scnprintf(script_path, MAXPATHLEN, "%s/%s", + lang_path, script_dirent->d_name); return strdup(script_path); } free(__script_root); @@ -3139,6 +3154,8 @@ int cmd_script(int argc, const char **argv) "Show namespace events (if recorded)"), OPT_BOOLEAN('\0', "show-lost-events", &script.show_lost_events, "Show lost events (if recorded)"), + OPT_BOOLEAN('\0', "show-round-events", &script.show_round_events, + "Show round events (if recorded)"), OPT_BOOLEAN('\0', "per-event-dump", &script.per_event_dump, "Dump trace output to files named by the monitored events"), OPT_BOOLEAN('f', "force", &symbol_conf.force, "don't complain, do it"), diff --git a/tools/perf/builtin-stat.c b/tools/perf/builtin-stat.c index 98bf9d32f222..f5c454855908 100644 --- a/tools/perf/builtin-stat.c +++ b/tools/perf/builtin-stat.c @@ -168,6 +168,7 @@ static struct timespec ref_time; static struct cpu_map *aggr_map; static aggr_get_id_t aggr_get_id; static bool append_file; +static bool interval_count; static const char *output_name; static int output_fd; static int print_free_counters_hint; @@ -507,14 +508,13 @@ static int perf_stat_synthesize_config(bool is_pipe) #define FD(e, x, y) (*(int *)xyarray__entry(e->fd, x, y)) -static int __store_counter_ids(struct perf_evsel *counter, - struct cpu_map *cpus, - struct thread_map *threads) +static int __store_counter_ids(struct perf_evsel *counter) { int cpu, thread; - for (cpu = 0; cpu < cpus->nr; cpu++) { - for (thread = 0; thread < threads->nr; thread++) { + for (cpu = 0; cpu < xyarray__max_x(counter->fd); cpu++) { + for (thread = 0; thread < xyarray__max_y(counter->fd); + thread++) { int fd = FD(counter, cpu, thread); if (perf_evlist__id_add_fd(evsel_list, counter, @@ -534,7 +534,7 @@ static int store_counter_ids(struct perf_evsel *counter) if (perf_evsel__alloc_id(counter, cpus->nr, threads->nr)) return -ENOMEM; - return __store_counter_ids(counter, cpus, threads); + return __store_counter_ids(counter); } static bool perf_evsel__should_store_id(struct perf_evsel *counter) @@ -571,6 +571,8 @@ static struct perf_evsel *perf_evsel__reset_weak_group(struct perf_evsel *evsel) static int __run_perf_stat(int argc, const char **argv) { int interval = stat_config.interval; + int times = stat_config.times; + int timeout = stat_config.timeout; char msg[BUFSIZ]; unsigned long long t0, t1; struct perf_evsel *counter; @@ -584,6 +586,9 @@ static int __run_perf_stat(int argc, const char **argv) if (interval) { ts.tv_sec = interval / USEC_PER_MSEC; ts.tv_nsec = (interval % USEC_PER_MSEC) * NSEC_PER_MSEC; + } else if (timeout) { + ts.tv_sec = timeout / USEC_PER_MSEC; + ts.tv_nsec = (timeout % USEC_PER_MSEC) * NSEC_PER_MSEC; } else { ts.tv_sec = 1; ts.tv_nsec = 0; @@ -632,7 +637,19 @@ try_again: if (verbose > 0) ui__warning("%s\n", msg); goto try_again; - } + } else if (target__has_per_thread(&target) && + evsel_list->threads && + evsel_list->threads->err_thread != -1) { + /* + * For global --per-thread case, skip current + * error thread. + */ + if (!thread_map__remove(evsel_list->threads, + evsel_list->threads->err_thread)) { + evsel_list->threads->err_thread = -1; + goto try_again; + } + } perf_evsel__open_strerror(counter, &target, errno, msg, sizeof(msg)); @@ -696,10 +713,14 @@ try_again: perf_evlist__start_workload(evsel_list); enable_counters(); - if (interval) { + if (interval || timeout) { while (!waitpid(child_pid, &status, WNOHANG)) { nanosleep(&ts, NULL); + if (timeout) + break; process_interval(); + if (interval_count && !(--times)) + break; } } waitpid(child_pid, &status, 0); @@ -716,8 +737,13 @@ try_again: enable_counters(); while (!done) { nanosleep(&ts, NULL); - if (interval) + if (timeout) + break; + if (interval) { process_interval(); + if (interval_count && !(--times)) + break; + } } } @@ -917,7 +943,7 @@ static void print_metric_csv(void *ctx, char buf[64], *vals, *ends; if (unit == NULL || fmt == NULL) { - fprintf(out, "%s%s%s%s", csv_sep, csv_sep, csv_sep, csv_sep); + fprintf(out, "%s%s", csv_sep, csv_sep); return; } snprintf(buf, sizeof(buf), fmt, val); @@ -1225,6 +1251,31 @@ static void aggr_update_shadow(void) } } +static void uniquify_event_name(struct perf_evsel *counter) +{ + char *new_name; + char *config; + + if (!counter->pmu_name || !strncmp(counter->name, counter->pmu_name, + strlen(counter->pmu_name))) + return; + + config = strchr(counter->name, '/'); + if (config) { + if (asprintf(&new_name, + "%s%s", counter->pmu_name, config) > 0) { + free(counter->name); + counter->name = new_name; + } + } else { + if (asprintf(&new_name, + "%s [%s]", counter->name, counter->pmu_name) > 0) { + free(counter->name); + counter->name = new_name; + } + } +} + static void collect_all_aliases(struct perf_evsel *counter, void (*cb)(struct perf_evsel *counter, void *data, bool first), @@ -1253,7 +1304,9 @@ static bool collect_data(struct perf_evsel *counter, if (counter->merged_stat) return false; cb(counter, data, true); - if (!no_merge && counter->auto_merge_stats) + if (no_merge) + uniquify_event_name(counter); + else if (counter->auto_merge_stats) collect_all_aliases(counter, cb, data); return true; } @@ -1891,6 +1944,10 @@ static const struct option stat_options[] = { "command to run after to the measured command"), OPT_UINTEGER('I', "interval-print", &stat_config.interval, "print counts at regular interval in ms (>= 10)"), + OPT_INTEGER(0, "interval-count", &stat_config.times, + "print counts for fixed number of times"), + OPT_UINTEGER(0, "timeout", &stat_config.timeout, + "stop workload and print counts after a timeout period in ms (>= 10ms)"), OPT_SET_UINT(0, "per-socket", &stat_config.aggr_mode, "aggregate counts per processor socket", AGGR_SOCKET), OPT_SET_UINT(0, "per-core", &stat_config.aggr_mode, @@ -2274,11 +2331,16 @@ static int add_default_attributes(void) return 0; if (transaction_run) { + struct parse_events_error errinfo; + if (pmu_have_event("cpu", "cycles-ct") && pmu_have_event("cpu", "el-start")) - err = parse_events(evsel_list, transaction_attrs, NULL); + err = parse_events(evsel_list, transaction_attrs, + &errinfo); else - err = parse_events(evsel_list, transaction_limited_attrs, NULL); + err = parse_events(evsel_list, + transaction_limited_attrs, + &errinfo); if (err) { fprintf(stderr, "Cannot set up transaction events\n"); return -1; @@ -2688,7 +2750,7 @@ int cmd_stat(int argc, const char **argv) int status = -EINVAL, run_idx; const char *mode; FILE *output = stderr; - unsigned int interval; + unsigned int interval, timeout; const char * const stat_subcommands[] = { "record", "report" }; setlocale(LC_ALL, ""); @@ -2719,6 +2781,7 @@ int cmd_stat(int argc, const char **argv) return __cmd_report(argc, argv); interval = stat_config.interval; + timeout = stat_config.timeout; /* * For record command the -o is already taken care of. @@ -2871,6 +2934,33 @@ int cmd_stat(int argc, const char **argv) "Please proceed with caution.\n"); } + if (stat_config.times && interval) + interval_count = true; + else if (stat_config.times && !interval) { + pr_err("interval-count option should be used together with " + "interval-print.\n"); + parse_options_usage(stat_usage, stat_options, "interval-count", 0); + parse_options_usage(stat_usage, stat_options, "I", 1); + goto out; + } + + if (timeout && timeout < 100) { + if (timeout < 10) { + pr_err("timeout must be >= 10ms.\n"); + parse_options_usage(stat_usage, stat_options, "timeout", 0); + goto out; + } else + pr_warning("timeout < 100ms. " + "The overhead percentage could be high in some cases. " + "Please proceed with caution.\n"); + } + if (timeout && interval) { + pr_err("timeout option is not supported with interval-print.\n"); + parse_options_usage(stat_usage, stat_options, "timeout", 0); + parse_options_usage(stat_usage, stat_options, "I", 1); + goto out; + } + if (perf_evlist__alloc_stats(evsel_list, interval)) goto out; diff --git a/tools/perf/builtin-top.c b/tools/perf/builtin-top.c index b7c823ba8374..f39bd60d2708 100644 --- a/tools/perf/builtin-top.c +++ b/tools/perf/builtin-top.c @@ -817,14 +817,13 @@ static void perf_top__mmap_read_idx(struct perf_top *top, int idx) struct perf_session *session = top->session; union perf_event *event; struct machine *machine; - u64 end, start; int ret; md = opts->overwrite ? &evlist->overwrite_mmap[idx] : &evlist->mmap[idx]; - if (perf_mmap__read_init(md, opts->overwrite, &start, &end) < 0) + if (perf_mmap__read_init(md) < 0) return; - while ((event = perf_mmap__read_event(md, opts->overwrite, &start, end)) != NULL) { + while ((event = perf_mmap__read_event(md)) != NULL) { ret = perf_evlist__parse_sample(evlist, event, &sample); if (ret) { pr_err("Can't parse sample, err = %d\n", ret); @@ -879,7 +878,7 @@ static void perf_top__mmap_read_idx(struct perf_top *top, int idx) } else ++session->evlist->stats.nr_unknown_events; next_event: - perf_mmap__consume(md, opts->overwrite); + perf_mmap__consume(md); } perf_mmap__read_done(md); @@ -991,7 +990,7 @@ static int perf_top_overwrite_fallback(struct perf_top *top, evlist__for_each_entry(evlist, counter) counter->attr.write_backward = false; opts->overwrite = false; - ui__warning("fall back to non-overwrite mode\n"); + pr_debug2("fall back to non-overwrite mode\n"); return 1; } @@ -1224,8 +1223,10 @@ parse_callchain_opt(const struct option *opt, const char *arg, int unset) static int perf_top_config(const char *var, const char *value, void *cb __maybe_unused) { - if (!strcmp(var, "top.call-graph")) - var = "call-graph.record-mode"; /* fall-through */ + if (!strcmp(var, "top.call-graph")) { + var = "call-graph.record-mode"; + return perf_default_config(var, value, cb); + } if (!strcmp(var, "top.children")) { symbol_conf.cumulate_callchain = perf_config_bool(var, value); return 0; @@ -1307,7 +1308,9 @@ int cmd_top(int argc, const char **argv) OPT_STRING(0, "sym-annotate", &top.sym_filter, "symbol name", "symbol to annotate"), OPT_BOOLEAN('z', "zero", &top.zero, "zero history across updates"), - OPT_UINTEGER('F', "freq", &opts->user_freq, "profile at this frequency"), + OPT_CALLBACK('F', "freq", &top.record_opts, "freq or 'max'", + "profile at this frequency", + record__parse_freq), OPT_INTEGER('E', "entries", &top.print_entries, "display this many functions"), OPT_BOOLEAN('U', "hide_user_symbols", &top.hide_user_symbols, @@ -1490,6 +1493,8 @@ int cmd_top(int argc, const char **argv) if (status < 0) goto out_delete_evlist; + annotation_config__init(); + symbol_conf.try_vmlinux_path = (symbol_conf.vmlinux_name == NULL); if (symbol__init(NULL) < 0) return -1; diff --git a/tools/perf/builtin-trace.c b/tools/perf/builtin-trace.c index e7f1b182fc15..87b95c9410b4 100644 --- a/tools/perf/builtin-trace.c +++ b/tools/perf/builtin-trace.c @@ -19,6 +19,7 @@ #include <traceevent/event-parse.h> #include <api/fs/tracing_path.h> #include "builtin.h" +#include "util/cgroup.h" #include "util/color.h" #include "util/debug.h" #include "util/env.h" @@ -83,6 +84,7 @@ struct trace { struct perf_evlist *evlist; struct machine *host; struct thread *current; + struct cgroup *cgroup; u64 base_time; FILE *output; unsigned long nr_events; @@ -2370,6 +2372,34 @@ static int trace__run(struct trace *trace, int argc, const char **argv) trace__sched_stat_runtime)) goto out_error_sched_stat_runtime; + /* + * If a global cgroup was set, apply it to all the events without an + * explicit cgroup. I.e.: + * + * trace -G A -e sched:*switch + * + * Will set all raw_syscalls:sys_{enter,exit}, pgfault, vfs_getname, etc + * _and_ sched:sched_switch to the 'A' cgroup, while: + * + * trace -e sched:*switch -G A + * + * will only set the sched:sched_switch event to the 'A' cgroup, all the + * other events (raw_syscalls:sys_{enter,exit}, etc are left "without" + * a cgroup (on the root cgroup, sys wide, etc). + * + * Multiple cgroups: + * + * trace -G A -e sched:*switch -G B + * + * the syscall ones go to the 'A' cgroup, the sched:sched_switch goes + * to the 'B' cgroup. + * + * evlist__set_default_cgroup() grabs a reference of the passed cgroup + * only for the evsels still without a cgroup, i.e. evsel->cgroup == NULL. + */ + if (trace->cgroup) + evlist__set_default_cgroup(trace->evlist, trace->cgroup); + err = perf_evlist__create_maps(evlist, &trace->opts.target); if (err < 0) { fprintf(trace->output, "Problems parsing the target to trace, check your options!\n"); @@ -2472,8 +2502,13 @@ again: for (i = 0; i < evlist->nr_mmaps; i++) { union perf_event *event; + struct perf_mmap *md; + + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + while ((event = perf_mmap__read_event(md)) != NULL) { struct perf_sample sample; ++trace->nr_events; @@ -2486,7 +2521,7 @@ again: trace__handle_event(trace, event, &sample); next_event: - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); if (interrupted) goto out_disable; @@ -2496,6 +2531,7 @@ next_event: draining = true; } } + perf_mmap__read_done(md); } if (trace->nr_events == before) { @@ -2533,6 +2569,7 @@ out_delete_evlist: trace__symbols__exit(trace); perf_evlist__delete(evlist); + cgroup__put(trace->cgroup); trace->evlist = NULL; trace->live = false; return err; @@ -2972,6 +3009,18 @@ out: return err; } +static int trace__parse_cgroups(const struct option *opt, const char *str, int unset) +{ + struct trace *trace = opt->value; + + if (!list_empty(&trace->evlist->entries)) + return parse_cgroups(opt, str, unset); + + trace->cgroup = evlist__findnew_cgroup(trace->evlist, str); + + return 0; +} + int cmd_trace(int argc, const char **argv) { const char *trace_usage[] = { @@ -3062,6 +3111,8 @@ int cmd_trace(int argc, const char **argv) "print the PERF_RECORD_SAMPLE PERF_SAMPLE_ info, for debugging"), OPT_UINTEGER(0, "proc-map-timeout", &trace.opts.proc_map_timeout, "per thread proc mmap processing timeout in ms"), + OPT_CALLBACK('G', "cgroup", &trace, "name", "monitor event in cgroup name only", + trace__parse_cgroups), OPT_UINTEGER('D', "delay", &trace.opts.initial_delay, "ms to wait before starting measurement after program " "start"), @@ -3088,6 +3139,11 @@ int cmd_trace(int argc, const char **argv) argc = parse_options_subcommand(argc, argv, trace_options, trace_subcommands, trace_usage, PARSE_OPT_STOP_AT_NON_OPTION); + if ((nr_cgroups || trace.cgroup) && !trace.opts.target.system_wide) { + usage_with_options_msg(trace_usage, trace_options, + "cgroup monitoring only available in system-wide mode"); + } + err = bpf__setup_stdout(trace.evlist); if (err) { bpf__strerror_setup_stdout(trace.evlist, err, bf, sizeof(bf)); diff --git a/tools/perf/check-headers.sh b/tools/perf/check-headers.sh index 790ec25919a0..9aff89bc7535 100755 --- a/tools/perf/check-headers.sh +++ b/tools/perf/check-headers.sh @@ -42,6 +42,7 @@ arch/parisc/include/uapi/asm/errno.h arch/powerpc/include/uapi/asm/errno.h arch/sparc/include/uapi/asm/errno.h arch/x86/include/uapi/asm/errno.h +arch/powerpc/include/uapi/asm/unistd.h include/asm-generic/bitops/arch_hweight.h include/asm-generic/bitops/const_hweight.h include/asm-generic/bitops/__fls.h @@ -58,6 +59,7 @@ check () { file=$1 shift + opts= while [ -n "$*" ]; do opts="$opts \"$1\"" shift diff --git a/tools/perf/perf-sys.h b/tools/perf/perf-sys.h index 36673f98d66b..3eb7a39169f6 100644 --- a/tools/perf/perf-sys.h +++ b/tools/perf/perf-sys.h @@ -46,10 +46,6 @@ #define CPUINFO_PROC {"Processor"} #endif -#ifdef __metag__ -#define CPUINFO_PROC {"CPU"} -#endif - #ifdef __xtensa__ #define CPUINFO_PROC {"core ID"} #endif diff --git a/tools/perf/perf.h b/tools/perf/perf.h index cfe46236a5e5..8fec1abd0f1f 100644 --- a/tools/perf/perf.h +++ b/tools/perf/perf.h @@ -61,6 +61,8 @@ struct record_opts { bool tail_synthesize; bool overwrite; bool ignore_missing_thread; + bool strict_freq; + bool sample_id; unsigned int freq; unsigned int mmap_pages; unsigned int auxtrace_mmap_pages; @@ -82,4 +84,6 @@ struct record_opts { struct option; extern const char * const *record_usage; extern struct option *record_options; + +int record__parse_freq(const struct option *opt, const char *str, int unset); #endif diff --git a/tools/perf/pmu-events/Build b/tools/perf/pmu-events/Build index 999a4e878162..17783913d330 100644 --- a/tools/perf/pmu-events/Build +++ b/tools/perf/pmu-events/Build @@ -1,10 +1,12 @@ hostprogs := jevents jevents-y += json.o jsmn.o jevents.o +CHOSTFLAGS_jevents.o = -I$(srctree)/tools/include pmu-events-y += pmu-events.o JDIR = pmu-events/arch/$(SRCARCH) JSON = $(shell [ -d $(JDIR) ] && \ find $(JDIR) -name '*.json' -o -name 'mapfile.csv') + # # Locate/process JSON files in pmu-events/arch/ # directory and create tables in pmu-events.c. diff --git a/tools/perf/pmu-events/README b/tools/perf/pmu-events/README index c2ee3e4417fe..e62b09b6a844 100644 --- a/tools/perf/pmu-events/README +++ b/tools/perf/pmu-events/README @@ -11,12 +11,17 @@ tree tools/perf/pmu-events/arch/foo. - Regular files with '.json' extension in the name are assumed to be JSON files, each of which describes a set of PMU events. - - Regular files with basename starting with 'mapfile.csv' are assumed - to be a CSV file that maps a specific CPU to its set of PMU events. - (see below for mapfile format) + - The CSV file that maps a specific CPU to its set of PMU events is to + be named 'mapfile.csv' (see below for mapfile format). - Directories are traversed, but all other files are ignored. + - To reduce JSON event duplication per architecture, platform JSONs may + use "ArchStdEvent" keyword to dereference an "Architecture standard + events", defined in architecture standard JSONs. + Architecture standard JSONs must be located in the architecture root + folder. Matching is based on the "EventName" field. + The PMU events supported by a CPU model are expected to grouped into topics such as Pipelining, Cache, Memory, Floating-point etc. All events for a topic should be placed in a separate JSON file - where the file name identifies @@ -29,6 +34,10 @@ sub directory. Thus for the Silvermont X86 CPU: Cache.json Memory.json Virtual-Memory.json Frontend.json Pipeline.json +The JSONs folder for a CPU model/family may be placed in the root arch +folder, or may be placed in a vendor sub-folder under the arch folder +for instances where the arch and vendor are not the same. + Using the JSON files and the mapfile, 'jevents' generates the C source file, 'pmu-events.c', which encodes the two sets of tables: diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/branch.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/branch.json index 3b6208763e50..0b0e6b26605b 100644 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/branch.json +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/branch.json @@ -1,25 +1,23 @@ [ - {, - "EventCode": "0x7A", - "EventName": "BR_INDIRECT_SPEC", - "BriefDescription": "Branch speculatively executed - Indirect branch" + { + "ArchStdEvent": "BR_INDIRECT_SPEC", }, - {, + { "EventCode": "0xC9", "EventName": "BR_COND", "BriefDescription": "Conditional branch executed" }, - {, + { "EventCode": "0xCA", "EventName": "BR_INDIRECT_MISPRED", "BriefDescription": "Indirect branch mispredicted" }, - {, + { "EventCode": "0xCB", "EventName": "BR_INDIRECT_MISPRED_ADDR", "BriefDescription": "Indirect branch mispredicted because of address miscompare" }, - {, + { "EventCode": "0xCC", "EventName": "BR_COND_MISPRED", "BriefDescription": "Conditional branch mispredicted" diff --git a/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/bus.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/bus.json new file mode 100644 index 000000000000..ce33b2553277 --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/bus.json @@ -0,0 +1,8 @@ +[ + { + "ArchStdEvent": "BUS_ACCESS_RD", + }, + { + "ArchStdEvent": "BUS_ACCESS_WR", + } +] diff --git a/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/cache.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/cache.json new file mode 100644 index 000000000000..5dfbec43c9f9 --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/cache.json @@ -0,0 +1,27 @@ +[ + { + "EventCode": "0xC2", + "EventName": "PREFETCH_LINEFILL", + "BriefDescription": "Linefill because of prefetch" + }, + { + "EventCode": "0xC3", + "EventName": "PREFETCH_LINEFILL_DROP", + "BriefDescription": "Instruction Cache Throttle occurred" + }, + { + "EventCode": "0xC4", + "EventName": "READ_ALLOC_ENTER", + "BriefDescription": "Entering read allocate mode" + }, + { + "EventCode": "0xC5", + "EventName": "READ_ALLOC", + "BriefDescription": "Read allocate mode" + }, + { + "EventCode": "0xC8", + "EventName": "EXT_SNOOP", + "BriefDescription": "SCU Snooped data from another CPU for this CPU" + } +] diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/memory.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/memory.json index 480d9f7460ab..25ae642ba381 100644 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/memory.json +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/memory.json @@ -1,20 +1,10 @@ [ - {, - "EventCode": "0x60", - "EventName": "BUS_ACCESS_LD", - "BriefDescription": "Bus access - Read" - }, - {, - "EventCode": "0x61", - "EventName": "BUS_ACCESS_ST", - "BriefDescription": "Bus access - Write" - }, - {, + { "EventCode": "0xC0", "EventName": "EXT_MEM_REQ", "BriefDescription": "External memory request" }, - {, + { "EventCode": "0xC1", "EventName": "EXT_MEM_REQ_NC", "BriefDescription": "Non-cacheable external memory request" diff --git a/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/other.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/other.json new file mode 100644 index 000000000000..6cc6cbd7bf0b --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/other.json @@ -0,0 +1,28 @@ +[ + { + "ArchStdEvent": "EXC_IRQ", + }, + { + "ArchStdEvent": "EXC_FIQ", + }, + { + "EventCode": "0xC6", + "EventName": "PRE_DECODE_ERR", + "BriefDescription": "Pre-decode error" + }, + { + "EventCode": "0xD0", + "EventName": "L1I_CACHE_ERR", + "BriefDescription": "L1 Instruction Cache (data or tag) memory error" + }, + { + "EventCode": "0xD1", + "EventName": "L1D_CACHE_ERR", + "BriefDescription": "L1 Data Cache (data, tag or dirty) memory error, correctable or non-correctable" + }, + { + "EventCode": "0xD2", + "EventName": "TLB_ERR", + "BriefDescription": "TLB memory error" + } +] diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/pipeline.json b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/pipeline.json index 3149fb90555a..f45a6b5d0025 100644 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/pipeline.json +++ b/tools/perf/pmu-events/arch/arm64/arm/cortex-a53/pipeline.json @@ -1,50 +1,50 @@ [ - {, + { "EventCode": "0xC7", "EventName": "STALL_SB_FULL", "BriefDescription": "Data Write operation that stalls the pipeline because the store buffer is full" }, - {, + { "EventCode": "0xE0", "EventName": "OTHER_IQ_DEP_STALL", "BriefDescription": "Cycles that the DPU IQ is empty and that is not because of a recent micro-TLB miss, instruction cache miss or pre-decode error" }, - {, + { "EventCode": "0xE1", "EventName": "IC_DEP_STALL", "BriefDescription": "Cycles the DPU IQ is empty and there is an instruction cache miss being processed" }, - {, + { "EventCode": "0xE2", "EventName": "IUTLB_DEP_STALL", "BriefDescription": "Cycles the DPU IQ is empty and there is an instruction micro-TLB miss being processed" }, - {, + { "EventCode": "0xE3", "EventName": "DECODE_DEP_STALL", "BriefDescription": "Cycles the DPU IQ is empty and there is a pre-decode error being processed" }, - {, + { "EventCode": "0xE4", "EventName": "OTHER_INTERLOCK_STALL", "BriefDescription": "Cycles there is an interlock other than Advanced SIMD/Floating-point instructions or load/store instruction" }, - {, + { "EventCode": "0xE5", "EventName": "AGU_DEP_STALL", "BriefDescription": "Cycles there is an interlock for a load/store instruction waiting for data to calculate the address in the AGU" }, - {, + { "EventCode": "0xE6", "EventName": "SIMD_DEP_STALL", "BriefDescription": "Cycles there is an interlock for an Advanced SIMD/Floating-point operation." }, - {, + { "EventCode": "0xE7", "EventName": "LD_DEP_STALL", "BriefDescription": "Cycles there is a stall in the Wr stage because of a load miss" }, - {, + { "EventCode": "0xE8", "EventName": "ST_DEP_STALL", "BriefDescription": "Cycles there is a stall in the Wr stage because of a store" diff --git a/tools/perf/pmu-events/arch/arm64/armv8-recommended.json b/tools/perf/pmu-events/arch/arm64/armv8-recommended.json new file mode 100644 index 000000000000..6328828c018c --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/armv8-recommended.json @@ -0,0 +1,452 @@ +[ + { + "PublicDescription": "Attributable Level 1 data cache access, read", + "EventCode": "0x40", + "EventName": "L1D_CACHE_RD", + "BriefDescription": "L1D cache access, read" + }, + { + "PublicDescription": "Attributable Level 1 data cache access, write", + "EventCode": "0x41", + "EventName": "L1D_CACHE_WR", + "BriefDescription": "L1D cache access, write" + }, + { + "PublicDescription": "Attributable Level 1 data cache refill, read", + "EventCode": "0x42", + "EventName": "L1D_CACHE_REFILL_RD", + "BriefDescription": "L1D cache refill, read" + }, + { + "PublicDescription": "Attributable Level 1 data cache refill, write", + "EventCode": "0x43", + "EventName": "L1D_CACHE_REFILL_WR", + "BriefDescription": "L1D cache refill, write" + }, + { + "PublicDescription": "Attributable Level 1 data cache refill, inner", + "EventCode": "0x44", + "EventName": "L1D_CACHE_REFILL_INNER", + "BriefDescription": "L1D cache refill, inner" + }, + { + "PublicDescription": "Attributable Level 1 data cache refill, outer", + "EventCode": "0x45", + "EventName": "L1D_CACHE_REFILL_OUTER", + "BriefDescription": "L1D cache refill, outer" + }, + { + "PublicDescription": "Attributable Level 1 data cache Write-Back, victim", + "EventCode": "0x46", + "EventName": "L1D_CACHE_WB_VICTIM", + "BriefDescription": "L1D cache Write-Back, victim" + }, + { + "PublicDescription": "Level 1 data cache Write-Back, cleaning and coherency", + "EventCode": "0x47", + "EventName": "L1D_CACHE_WB_CLEAN", + "BriefDescription": "L1D cache Write-Back, cleaning and coherency" + }, + { + "PublicDescription": "Attributable Level 1 data cache invalidate", + "EventCode": "0x48", + "EventName": "L1D_CACHE_INVAL", + "BriefDescription": "L1D cache invalidate" + }, + { + "PublicDescription": "Attributable Level 1 data TLB refill, read", + "EventCode": "0x4C", + "EventName": "L1D_TLB_REFILL_RD", + "BriefDescription": "L1D tlb refill, read" + }, + { + "PublicDescription": "Attributable Level 1 data TLB refill, write", + "EventCode": "0x4D", + "EventName": "L1D_TLB_REFILL_WR", + "BriefDescription": "L1D tlb refill, write" + }, + { + "PublicDescription": "Attributable Level 1 data or unified TLB access, read", + "EventCode": "0x4E", + "EventName": "L1D_TLB_RD", + "BriefDescription": "L1D tlb access, read" + }, + { + "PublicDescription": "Attributable Level 1 data or unified TLB access, write", + "EventCode": "0x4F", + "EventName": "L1D_TLB_WR", + "BriefDescription": "L1D tlb access, write" + }, + { + "PublicDescription": "Attributable Level 2 data cache access, read", + "EventCode": "0x50", + "EventName": "L2D_CACHE_RD", + "BriefDescription": "L2D cache access, read" + }, + { + "PublicDescription": "Attributable Level 2 data cache access, write", + "EventCode": "0x51", + "EventName": "L2D_CACHE_WR", + "BriefDescription": "L2D cache access, write" + }, + { + "PublicDescription": "Attributable Level 2 data cache refill, read", + "EventCode": "0x52", + "EventName": "L2D_CACHE_REFILL_RD", + "BriefDescription": "L2D cache refill, read" + }, + { + "PublicDescription": "Attributable Level 2 data cache refill, write", + "EventCode": "0x53", + "EventName": "L2D_CACHE_REFILL_WR", + "BriefDescription": "L2D cache refill, write" + }, + { + "PublicDescription": "Attributable Level 2 data cache Write-Back, victim", + "EventCode": "0x56", + "EventName": "L2D_CACHE_WB_VICTIM", + "BriefDescription": "L2D cache Write-Back, victim" + }, + { + "PublicDescription": "Level 2 data cache Write-Back, cleaning and coherency", + "EventCode": "0x57", + "EventName": "L2D_CACHE_WB_CLEAN", + "BriefDescription": "L2D cache Write-Back, cleaning and coherency" + }, + { + "PublicDescription": "Attributable Level 2 data cache invalidate", + "EventCode": "0x58", + "EventName": "L2D_CACHE_INVAL", + "BriefDescription": "L2D cache invalidate" + }, + { + "PublicDescription": "Attributable Level 2 data or unified TLB refill, read", + "EventCode": "0x5c", + "EventName": "L2D_TLB_REFILL_RD", + "BriefDescription": "L2D cache refill, read" + }, + { + "PublicDescription": "Attributable Level 2 data or unified TLB refill, write", + "EventCode": "0x5d", + "EventName": "L2D_TLB_REFILL_WR", + "BriefDescription": "L2D cache refill, write" + }, + { + "PublicDescription": "Attributable Level 2 data or unified TLB access, read", + "EventCode": "0x5e", + "EventName": "L2D_TLB_RD", + "BriefDescription": "L2D cache access, read" + }, + { + "PublicDescription": "Attributable Level 2 data or unified TLB access, write", + "EventCode": "0x5f", + "EventName": "L2D_TLB_WR", + "BriefDescription": "L2D cache access, write" + }, + { + "PublicDescription": "Bus access read", + "EventCode": "0x60", + "EventName": "BUS_ACCESS_RD", + "BriefDescription": "Bus access read" + }, + { + "PublicDescription": "Bus access write", + "EventCode": "0x61", + "EventName": "BUS_ACCESS_WR", + "BriefDescription": "Bus access write" + } + { + "PublicDescription": "Bus access, Normal, Cacheable, Shareable", + "EventCode": "0x62", + "EventName": "BUS_ACCESS_SHARED", + "BriefDescription": "Bus access, Normal, Cacheable, Shareable" + } + { + "PublicDescription": "Bus access, not Normal, Cacheable, Shareable", + "EventCode": "0x63", + "EventName": "BUS_ACCESS_NOT_SHARED", + "BriefDescription": "Bus access, not Normal, Cacheable, Shareable" + } + { + "PublicDescription": "Bus access, Normal", + "EventCode": "0x64", + "EventName": "BUS_ACCESS_NORMAL", + "BriefDescription": "Bus access, Normal" + } + { + "PublicDescription": "Bus access, peripheral", + "EventCode": "0x65", + "EventName": "BUS_ACCESS_PERIPH", + "BriefDescription": "Bus access, peripheral" + } + { + "PublicDescription": "Data memory access, read", + "EventCode": "0x66", + "EventName": "MEM_ACCESS_RD", + "BriefDescription": "Data memory access, read" + } + { + "PublicDescription": "Data memory access, write", + "EventCode": "0x67", + "EventName": "MEM_ACCESS_WR", + "BriefDescription": "Data memory access, write" + } + { + "PublicDescription": "Unaligned access, read", + "EventCode": "0x68", + "EventName": "UNALIGNED_LD_SPEC", + "BriefDescription": "Unaligned access, read" + } + { + "PublicDescription": "Unaligned access, write", + "EventCode": "0x69", + "EventName": "UNALIGNED_ST_SPEC", + "BriefDescription": "Unaligned access, write" + } + { + "PublicDescription": "Unaligned access", + "EventCode": "0x6a", + "EventName": "UNALIGNED_LDST_SPEC", + "BriefDescription": "Unaligned access" + } + { + "PublicDescription": "Exclusive operation speculatively executed, LDREX or LDX", + "EventCode": "0x6c", + "EventName": "LDREX_SPEC", + "BriefDescription": "Exclusive operation speculatively executed, LDREX or LDX" + } + { + "PublicDescription": "Exclusive operation speculatively executed, STREX or STX pass", + "EventCode": "0x6d", + "EventName": "STREX_PASS_SPEC", + "BriefDescription": "Exclusive operation speculatively executed, STREX or STX pass" + } + { + "PublicDescription": "Exclusive operation speculatively executed, STREX or STX fail", + "EventCode": "0x6e", + "EventName": "STREX_FAIL_SPEC", + "BriefDescription": "Exclusive operation speculatively executed, STREX or STX fail" + } + { + "PublicDescription": "Exclusive operation speculatively executed, STREX or STX", + "EventCode": "0x6f", + "EventName": "STREX_SPEC", + "BriefDescription": "Exclusive operation speculatively executed, STREX or STX" + } + { + "PublicDescription": "Operation speculatively executed, load", + "EventCode": "0x70", + "EventName": "LD_SPEC", + "BriefDescription": "Operation speculatively executed, load" + } + { + "PublicDescription": "Operation speculatively executed, store" + "EventCode": "0x71", + "EventName": "ST_SPEC", + "BriefDescription": "Operation speculatively executed, store" + } + { + "PublicDescription": "Operation speculatively executed, load or store", + "EventCode": "0x72", + "EventName": "LDST_SPEC", + "BriefDescription": "Operation speculatively executed, load or store" + } + { + "PublicDescription": "Operation speculatively executed, integer data processing", + "EventCode": "0x73", + "EventName": "DP_SPEC", + "BriefDescription": "Operation speculatively executed, integer data processing" + } + { + "PublicDescription": "Operation speculatively executed, Advanced SIMD instruction", + "EventCode": "0x74", + "EventName": "ASE_SPEC", + "BriefDescription": "Operation speculatively executed, Advanced SIMD instruction", + } + { + "PublicDescription": "Operation speculatively executed, floating-point instruction", + "EventCode": "0x75", + "EventName": "VFP_SPEC", + "BriefDescription": "Operation speculatively executed, floating-point instruction" + } + { + "PublicDescription": "Operation speculatively executed, software change of the PC", + "EventCode": "0x76", + "EventName": "PC_WRITE_SPEC", + "BriefDescription": "Operation speculatively executed, software change of the PC" + } + { + "PublicDescription": "Operation speculatively executed, Cryptographic instruction", + "EventCode": "0x77", + "EventName": "CRYPTO_SPEC", + "BriefDescription": "Operation speculatively executed, Cryptographic instruction" + } + { + "PublicDescription": "Branch speculatively executed, immediate branch" + "EventCode": "0x78", + "EventName": "BR_IMMED_SPEC", + "BriefDescription": "Branch speculatively executed, immediate branch" + } + { + "PublicDescription": "Branch speculatively executed, procedure return" + "EventCode": "0x79", + "EventName": "BR_RETURN_SPEC", + "BriefDescription": "Branch speculatively executed, procedure return" + } + { + "PublicDescription": "Branch speculatively executed, indirect branch" + "EventCode": "0x7a", + "EventName": "BR_INDIRECT_SPEC", + "BriefDescription": "Branch speculatively executed, indirect branch" + } + { + "PublicDescription": "Barrier speculatively executed, ISB" + "EventCode": "0x7c", + "EventName": "ISB_SPEC", + "BriefDescription": "Barrier speculatively executed, ISB" + } + { + "PublicDescription": "Barrier speculatively executed, DSB" + "EventCode": "0x7d", + "EventName": "DSB_SPEC", + "BriefDescription": "Barrier speculatively executed, DSB" + } + { + "PublicDescription": "Barrier speculatively executed, DMB" + "EventCode": "0x7e", + "EventName": "DMB_SPEC", + "BriefDescription": "Barrier speculatively executed, DMB" + } + { + "PublicDescription": "Exception taken, Other synchronous" + "EventCode": "0x81", + "EventName": "EXC_UNDEF", + "BriefDescription": "Exception taken, Other synchronous" + } + { + "PublicDescription": "Exception taken, Supervisor Call" + "EventCode": "0x82", + "EventName": "EXC_SVC", + "BriefDescription": "Exception taken, Supervisor Call" + } + { + "PublicDescription": "Exception taken, Instruction Abort" + "EventCode": "0x83", + "EventName": "EXC_PABORT", + "BriefDescription": "Exception taken, Instruction Abort" + } + { + "PublicDescription": "Exception taken, Data Abort and SError" + "EventCode": "0x84", + "EventName": "EXC_DABORT", + "BriefDescription": "Exception taken, Data Abort and SError" + } + { + "PublicDescription": "Exception taken, IRQ" + "EventCode": "0x86", + "EventName": "EXC_IRQ", + "BriefDescription": "Exception taken, IRQ" + } + { + "PublicDescription": "Exception taken, FIQ" + "EventCode": "0x87", + "EventName": "EXC_FIQ", + "BriefDescription": "Exception taken, FIQ" + } + { + "PublicDescription": "Exception taken, Secure Monitor Call" + "EventCode": "0x88", + "EventName": "EXC_SMC", + "BriefDescription": "Exception taken, Secure Monitor Call" + } + { + "PublicDescription": "Exception taken, Hypervisor Call" + "EventCode": "0x8a", + "EventName": "EXC_HVC", + "BriefDescription": "Exception taken, Hypervisor Call" + } + { + "PublicDescription": "Exception taken, Instruction Abort not taken locally" + "EventCode": "0x8b", + "EventName": "EXC_TRAP_PABORT", + "BriefDescription": "Exception taken, Instruction Abort not taken locally" + } + { + "PublicDescription": "Exception taken, Data Abort or SError not taken locally" + "EventCode": "0x8c", + "EventName": "EXC_TRAP_DABORT", + "BriefDescription": "Exception taken, Data Abort or SError not taken locally" + } + { + "PublicDescription": "Exception taken, Other traps not taken locally" + "EventCode": "0x8d", + "EventName": "EXC_TRAP_OTHER", + "BriefDescription": "Exception taken, Other traps not taken locally" + } + { + "PublicDescription": "Exception taken, IRQ not taken locally" + "EventCode": "0x8e", + "EventName": "EXC_TRAP_IRQ", + "BriefDescription": "Exception taken, IRQ not taken locally" + } + { + "PublicDescription": "Exception taken, FIQ not taken locally" + "EventCode": "0x8f", + "EventName": "EXC_TRAP_FIQ", + "BriefDescription": "Exception taken, FIQ not taken locally" + } + { + "PublicDescription": "Release consistency operation speculatively executed, Load-Acquire" + "EventCode": "0x90", + "EventName": "RC_LD_SPEC", + "BriefDescription": "Release consistency operation speculatively executed, Load-Acquire" + } + { + "PublicDescription": "Release consistency operation speculatively executed, Store-Release" + "EventCode": "0x91", + "EventName": "RC_ST_SPEC", + "BriefDescription": "Release consistency operation speculatively executed, Store-Release" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache access, read" + "EventCode": "0xa0", + "EventName": "L3D_CACHE_RD", + "BriefDescription": "Attributable Level 3 data or unified cache access, read" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache access, write" + "EventCode": "0xa1", + "EventName": "L3D_CACHE_WR", + "BriefDescription": "Attributable Level 3 data or unified cache access, write" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache refill, read" + "EventCode": "0xa2", + "EventName": "L3D_CACHE_REFILL_RD", + "BriefDescription": "Attributable Level 3 data or unified cache refill, read" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache refill, write" + "EventCode": "0xa3", + "EventName": "L3D_CACHE_REFILL_WR", + "BriefDescription": "Attributable Level 3 data or unified cache refill, write" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache Write-Back, victim" + "EventCode": "0xa6", + "EventName": "L3D_CACHE_WB_VICTIM", + "BriefDescription": "Attributable Level 3 data or unified cache Write-Back, victim" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache Write-Back, cache clean" + "EventCode": "0xa7", + "EventName": "L3D_CACHE_WB_CLEAN", + "BriefDescription": "Attributable Level 3 data or unified cache Write-Back, cache clean" + } + { + "PublicDescription": "Attributable Level 3 data or unified cache access, invalidate" + "EventCode": "0xa8", + "EventName": "L3D_CACHE_INVAL", + "BriefDescription": "Attributable Level 3 data or unified cache access, invalidate" + } +] diff --git a/tools/perf/pmu-events/arch/arm64/cavium/thunderx2-imp-def.json b/tools/perf/pmu-events/arch/arm64/cavium/thunderx2-imp-def.json deleted file mode 100644 index 2db45c40ebc7..000000000000 --- a/tools/perf/pmu-events/arch/arm64/cavium/thunderx2-imp-def.json +++ /dev/null @@ -1,62 +0,0 @@ -[ - { - "PublicDescription": "Attributable Level 1 data cache access, read", - "EventCode": "0x40", - "EventName": "l1d_cache_rd", - "BriefDescription": "L1D cache read", - }, - { - "PublicDescription": "Attributable Level 1 data cache access, write ", - "EventCode": "0x41", - "EventName": "l1d_cache_wr", - "BriefDescription": "L1D cache write", - }, - { - "PublicDescription": "Attributable Level 1 data cache refill, read", - "EventCode": "0x42", - "EventName": "l1d_cache_refill_rd", - "BriefDescription": "L1D cache refill read", - }, - { - "PublicDescription": "Attributable Level 1 data cache refill, write", - "EventCode": "0x43", - "EventName": "l1d_cache_refill_wr", - "BriefDescription": "L1D refill write", - }, - { - "PublicDescription": "Attributable Level 1 data TLB refill, read", - "EventCode": "0x4C", - "EventName": "l1d_tlb_refill_rd", - "BriefDescription": "L1D tlb refill read", - }, - { - "PublicDescription": "Attributable Level 1 data TLB refill, write", - "EventCode": "0x4D", - "EventName": "l1d_tlb_refill_wr", - "BriefDescription": "L1D tlb refill write", - }, - { - "PublicDescription": "Attributable Level 1 data or unified TLB access, read", - "EventCode": "0x4E", - "EventName": "l1d_tlb_rd", - "BriefDescription": "L1D tlb read", - }, - { - "PublicDescription": "Attributable Level 1 data or unified TLB access, write", - "EventCode": "0x4F", - "EventName": "l1d_tlb_wr", - "BriefDescription": "L1D tlb write", - }, - { - "PublicDescription": "Bus access read", - "EventCode": "0x60", - "EventName": "bus_access_rd", - "BriefDescription": "Bus access read", - }, - { - "PublicDescription": "Bus access write", - "EventCode": "0x61", - "EventName": "bus_access_wr", - "BriefDescription": "Bus access write", - } -] diff --git a/tools/perf/pmu-events/arch/arm64/cavium/thunderx2/core-imp-def.json b/tools/perf/pmu-events/arch/arm64/cavium/thunderx2/core-imp-def.json new file mode 100644 index 000000000000..bc03c06c3918 --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/cavium/thunderx2/core-imp-def.json @@ -0,0 +1,32 @@ +[ + { + "ArchStdEvent": "L1D_CACHE_RD", + }, + { + "ArchStdEvent": "L1D_CACHE_WR", + }, + { + "ArchStdEvent": "L1D_CACHE_REFILL_RD", + }, + { + "ArchStdEvent": "L1D_CACHE_REFILL_WR", + }, + { + "ArchStdEvent": "L1D_TLB_REFILL_RD", + }, + { + "ArchStdEvent": "L1D_TLB_REFILL_WR", + }, + { + "ArchStdEvent": "L1D_TLB_RD", + }, + { + "ArchStdEvent": "L1D_TLB_WR", + }, + { + "ArchStdEvent": "BUS_ACCESS_RD", + }, + { + "ArchStdEvent": "BUS_ACCESS_WR", + } +] diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/bus.json b/tools/perf/pmu-events/arch/arm64/cortex-a53/bus.json deleted file mode 100644 index 480d9f7460ab..000000000000 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/bus.json +++ /dev/null @@ -1,22 +0,0 @@ -[ - {, - "EventCode": "0x60", - "EventName": "BUS_ACCESS_LD", - "BriefDescription": "Bus access - Read" - }, - {, - "EventCode": "0x61", - "EventName": "BUS_ACCESS_ST", - "BriefDescription": "Bus access - Write" - }, - {, - "EventCode": "0xC0", - "EventName": "EXT_MEM_REQ", - "BriefDescription": "External memory request" - }, - {, - "EventCode": "0xC1", - "EventName": "EXT_MEM_REQ_NC", - "BriefDescription": "Non-cacheable external memory request" - } -] diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/cache.json b/tools/perf/pmu-events/arch/arm64/cortex-a53/cache.json deleted file mode 100644 index 11baad6344b9..000000000000 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/cache.json +++ /dev/null @@ -1,27 +0,0 @@ -[ - {, - "EventCode": "0xC2", - "EventName": "PREFETCH_LINEFILL", - "BriefDescription": "Linefill because of prefetch" - }, - {, - "EventCode": "0xC3", - "EventName": "PREFETCH_LINEFILL_DROP", - "BriefDescription": "Instruction Cache Throttle occurred" - }, - {, - "EventCode": "0xC4", - "EventName": "READ_ALLOC_ENTER", - "BriefDescription": "Entering read allocate mode" - }, - {, - "EventCode": "0xC5", - "EventName": "READ_ALLOC", - "BriefDescription": "Read allocate mode" - }, - {, - "EventCode": "0xC8", - "EventName": "EXT_SNOOP", - "BriefDescription": "SCU Snooped data from another CPU for this CPU" - } -] diff --git a/tools/perf/pmu-events/arch/arm64/cortex-a53/other.json b/tools/perf/pmu-events/arch/arm64/cortex-a53/other.json deleted file mode 100644 index 73a22402d003..000000000000 --- a/tools/perf/pmu-events/arch/arm64/cortex-a53/other.json +++ /dev/null @@ -1,32 +0,0 @@ -[ - {, - "EventCode": "0x86", - "EventName": "EXC_IRQ", - "BriefDescription": "Exception taken, IRQ" - }, - {, - "EventCode": "0x87", - "EventName": "EXC_FIQ", - "BriefDescription": "Exception taken, FIQ" - }, - {, - "EventCode": "0xC6", - "EventName": "PRE_DECODE_ERR", - "BriefDescription": "Pre-decode error" - }, - {, - "EventCode": "0xD0", - "EventName": "L1I_CACHE_ERR", - "BriefDescription": "L1 Instruction Cache (data or tag) memory error" - }, - {, - "EventCode": "0xD1", - "EventName": "L1D_CACHE_ERR", - "BriefDescription": "L1 Data Cache (data, tag or dirty) memory error, correctable or non-correctable" - }, - {, - "EventCode": "0xD2", - "EventName": "TLB_ERR", - "BriefDescription": "TLB memory error" - } -] diff --git a/tools/perf/pmu-events/arch/arm64/hisilicon/hip08/core-imp-def.json b/tools/perf/pmu-events/arch/arm64/hisilicon/hip08/core-imp-def.json new file mode 100644 index 000000000000..9f0f15d15f75 --- /dev/null +++ b/tools/perf/pmu-events/arch/arm64/hisilicon/hip08/core-imp-def.json @@ -0,0 +1,122 @@ +[ + { + "ArchStdEvent": "L1D_CACHE_RD", + }, + { + "ArchStdEvent": "L1D_CACHE_WR", + }, + { + "ArchStdEvent": "L1D_CACHE_REFILL_RD", + }, + { + "ArchStdEvent": "L1D_CACHE_REFILL_WR", + }, + { + "ArchStdEvent": "L1D_CACHE_WB_VICTIM", + }, + { + "ArchStdEvent": "L1D_CACHE_WB_CLEAN", + }, + { + "ArchStdEvent": "L1D_CACHE_INVAL", + }, + { + "ArchStdEvent": "L1D_TLB_REFILL_RD", + }, + { + "ArchStdEvent": "L1D_TLB_REFILL_WR", + }, + { + "ArchStdEvent": "L1D_TLB_RD", + }, + { + "ArchStdEvent": "L1D_TLB_WR", + }, + { + "ArchStdEvent": "L2D_CACHE_RD", + }, + { + "ArchStdEvent": "L2D_CACHE_WR", + }, + { + "ArchStdEvent": "L2D_CACHE_REFILL_RD", + }, + { + "ArchStdEvent": "L2D_CACHE_REFILL_WR", + }, + { + "ArchStdEvent": "L2D_CACHE_WB_VICTIM", + }, + { + "ArchStdEvent": "L2D_CACHE_WB_CLEAN", + }, + { + "ArchStdEvent": "L2D_CACHE_INVAL", + }, + { + "PublicDescription": "Level 1 instruction cache prefetch access count", + "EventCode": "0x102e", + "EventName": "L1I_CACHE_PRF", + "BriefDescription": "L1I cache prefetch access count", + }, + { + "PublicDescription": "Level 1 instruction cache miss due to prefetch access count", + "EventCode": "0x102f", + "EventName": "L1I_CACHE_PRF_REFILL", + "BriefDescription": "L1I cache miss due to prefetch access count", + }, + { + "PublicDescription": "Instruction queue is empty", + "EventCode": "0x1043", + "EventName": "IQ_IS_EMPTY", + "BriefDescription": "Instruction queue is empty", + }, + { + "PublicDescription": "Instruction fetch stall cycles", + "EventCode": "0x1044", + "EventName": "IF_IS_STALL", + "BriefDescription": "Instruction fetch stall cycles", + }, + { + "PublicDescription": "Instructions can receive, but not send", + "EventCode": "0x2014", + "EventName": "FETCH_BUBBLE", + "BriefDescription": "Instructions can receive, but not send", + }, + { + "PublicDescription": "Prefetch request from LSU", + "EventCode": "0x6013", + "EventName": "PRF_REQ", + "BriefDescription": "Prefetch request from LSU", + }, + { + "PublicDescription": "Hit on prefetched data", + "EventCode": "0x6014", + "EventName": "HIT_ON_PRF", + "BriefDescription": "Hit on prefetched data", + }, + { + "PublicDescription": "Cycles of that the number of issuing micro operations are less than 4", + "EventCode": "0x7001", + "EventName": "EXE_STALL_CYCLE", + "BriefDescription": "Cycles of that the number of issue ups are less than 4", + }, + { + "PublicDescription": "No any micro operation is issued and meanwhile any load operation is not resolved", + "EventCode": "0x7004", + "EventName": "MEM_STALL_ANYLOAD", + "BriefDescription": "No any micro operation is issued and meanwhile any load operation is not resolved", + }, + { + "PublicDescription": "No any micro operation is issued and meanwhile there is any load operation missing L1 cache and pending data refill", + "EventCode": "0x7006", + "EventName": "MEM_STALL_L1MISS", + "BriefDescription": "No any micro operation is issued and meanwhile there is any load operation missing L1 cache and pending data refill", + }, + { + "PublicDescription": "No any micro operation is issued and meanwhile there is any load operation missing both L1 and L2 cache and pending data refill from L3 cache", + "EventCode": "0x7007", + "EventName": "MEM_STALL_L2MISS", + "BriefDescription": "No any micro operation is issued and meanwhile there is any load operation missing both L1 and L2 cache and pending data refill from L3 cache", + }, +] diff --git a/tools/perf/pmu-events/arch/arm64/mapfile.csv b/tools/perf/pmu-events/arch/arm64/mapfile.csv index e61c9ca6cf9e..f03e26ecb658 100644 --- a/tools/perf/pmu-events/arch/arm64/mapfile.csv +++ b/tools/perf/pmu-events/arch/arm64/mapfile.csv @@ -12,5 +12,7 @@ # # #Family-model,Version,Filename,EventType -0x00000000420f5160,v1,cavium,core -0x00000000410fd03[[:xdigit:]],v1,cortex-a53,core +0x00000000410fd03[[:xdigit:]],v1,arm/cortex-a53,core +0x00000000420f5160,v1,cavium/thunderx2,core +0x00000000430f0af0,v1,cavium/thunderx2,core +0x00000000480fd010,v1,hisilicon/hip08,core diff --git a/tools/perf/pmu-events/arch/powerpc/power9/cache.json b/tools/perf/pmu-events/arch/powerpc/power9/cache.json index 7945c5196c43..851072105054 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/cache.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/cache.json @@ -20,11 +20,6 @@ "BriefDescription": "Finish stall due to a scalar fixed point or CR instruction in the execution pipeline. These instructions get routed to the ALU, ALU2, and DIV pipes" }, {, - "EventCode": "0x1D15C", - "EventName": "PM_MRK_DTLB_MISS_1G", - "BriefDescription": "Marked Data TLB reload (after a miss) page size 2M. Implies radix translation was used" - }, - {, "EventCode": "0x4D12A", "EventName": "PM_MRK_DATA_FROM_RL4_CYC", "BriefDescription": "Duration in cycles to reload from another chip's L4 on the same Node or Group ( Remote) due to a marked load" @@ -80,21 +75,6 @@ "BriefDescription": "Threshold counter exceed a count of 4096" }, {, - "EventCode": "0x3D156", - "EventName": "PM_MRK_DTLB_MISS_64K", - "BriefDescription": "Marked Data TLB Miss page size 64K" - }, - {, - "EventCode": "0x4C15E", - "EventName": "PM_MRK_DTLB_MISS_16M", - "BriefDescription": "Marked Data TLB Miss page size 16M" - }, - {, - "EventCode": "0x2D15E", - "EventName": "PM_MRK_DTLB_MISS_16G", - "BriefDescription": "Marked Data TLB Miss page size 16G" - }, - {, "EventCode": "0x3F14A", "EventName": "PM_MRK_DPTEG_FROM_RMEM", "BriefDescription": "A Page Table Entry was loaded into the TLB from another chip's memory on the same Node or Group ( Remote) due to a marked data side request. When using Radix Page Translation, this count excludes PDE reloads. Only PTE reloads are included" @@ -123,10 +103,5 @@ "EventCode": "0x1002A", "EventName": "PM_CMPLU_STALL_LARX", "BriefDescription": "Finish stall because the NTF instruction was a larx waiting to be satisfied" - }, - {, - "EventCode": "0x1C058", - "EventName": "PM_DTLB_MISS_16G", - "BriefDescription": "Data TLB Miss page size 16G" } ]
\ No newline at end of file diff --git a/tools/perf/pmu-events/arch/powerpc/power9/frontend.json b/tools/perf/pmu-events/arch/powerpc/power9/frontend.json index bd8361b5fd6a..f9fa84b16fb5 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/frontend.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/frontend.json @@ -155,11 +155,6 @@ "BriefDescription": "Duration in cycles to reload with Shared (S) data from another chip's L2 or L3 on the same Node or Group (Remote), as this chip due to a marked load" }, {, - "EventCode": "0x3C056", - "EventName": "PM_DTLB_MISS_64K", - "BriefDescription": "Data TLB Miss page size 64K" - }, - {, "EventCode": "0x30060", "EventName": "PM_TM_TRANS_RUN_INST", "BriefDescription": "Run instructions completed in transactional state (gated by the run latch)" @@ -345,11 +340,6 @@ "BriefDescription": "Larx finished" }, {, - "EventCode": "0x4C056", - "EventName": "PM_DTLB_MISS_16M", - "BriefDescription": "Data TLB Miss page size 16M" - }, - {, "EventCode": "0x1003A", "EventName": "PM_CMPLU_STALL_LSU_FIN", "BriefDescription": "Finish stall because the NTF instruction was an LSU op (other than a load or a store) with all its dependencies met and just going through the LSU pipe to finish" diff --git a/tools/perf/pmu-events/arch/powerpc/power9/marked.json b/tools/perf/pmu-events/arch/powerpc/power9/marked.json index 22f9f32060a8..b1954c38bab1 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/marked.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/marked.json @@ -530,11 +530,6 @@ "BriefDescription": "Counts all Icache reloads includes demand, prefetch, prefetch turned into demand and demand turned into prefetch" }, {, - "EventCode": "0x4003C", - "EventName": "PM_DISP_HELD_SYNC_HOLD", - "BriefDescription": "Cycles in which dispatch is held because of a synchronizing instruction in the pipeline" - }, - {, "EventCode": "0x3003C", "EventName": "PM_CMPLU_STALL_NESTED_TEND", "BriefDescription": "Completion stall because the ISU is updating the TEXASR to keep track of the nested tend and decrement the TEXASR nested level. This is a short delay" diff --git a/tools/perf/pmu-events/arch/powerpc/power9/memory.json b/tools/perf/pmu-events/arch/powerpc/power9/memory.json index 9960d1c0dd44..2e2ebc700c74 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/memory.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/memory.json @@ -45,11 +45,6 @@ "BriefDescription": "count of Loads completed" }, {, - "EventCode": "0x2D156", - "EventName": "PM_MRK_DTLB_MISS_4K", - "BriefDescription": "Marked Data TLB Miss page size 4k" - }, - {, "EventCode": "0x4C042", "EventName": "PM_DATA_FROM_L3", "BriefDescription": "The processor's data cache was reloaded from local core's L3 due to a demand load" diff --git a/tools/perf/pmu-events/arch/powerpc/power9/other.json b/tools/perf/pmu-events/arch/powerpc/power9/other.json index 5ce312973f1e..48cf4f920b3f 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/other.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/other.json @@ -70,6 +70,11 @@ "BriefDescription": "Cycles thread running at priority level 0 or 1" }, {, + "EventCode": "0x4C054", + "EventName": "PM_DERAT_MISS_16G_1G", + "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 16G (hpt mode) or 1G (radix mode)" + }, + {, "EventCode": "0x2084", "EventName": "PM_FLUSH_HB_RESTORE_CYC", "BriefDescription": "Cycles in which no new instructions can be dispatched to the ICT after a flush. History buffer recovery" @@ -107,12 +112,12 @@ {, "EventCode": "0x360B2", "EventName": "PM_L3_GRP_GUESS_WRONG_LOW", - "BriefDescription": "Initial scope=group (GS or NNS) but data from outside group (far or rem). Prediction too Low" + "BriefDescription": "Prefetch scope predictor selected GS or NNS, but was wrong because scope was LNS" }, {, "EventCode": "0x168A6", "EventName": "PM_TM_CAM_OVERFLOW", - "BriefDescription": "L3 TM cam overflow during L2 co of SC" + "BriefDescription": "L3 TM CAM is full when a L2 castout of TM_SC line occurs. Line is pushed to memory" }, {, "EventCode": "0xE8B0", @@ -150,11 +155,6 @@ "BriefDescription": "All ISU rejects" }, {, - "EventCode": "0x460A6", - "EventName": "PM_RD_FORMING_SC", - "BriefDescription": "Read forming SC" - }, - {, "EventCode": "0x468A0", "EventName": "PM_L3_PF_OFF_CHIP_MEM", "BriefDescription": "L3 PF from Off chip memory" @@ -187,7 +187,7 @@ {, "EventCode": "0x368A6", "EventName": "PM_SNP_TM_HIT_T", - "BriefDescription": "Snp TM sthit T/Tn/Te" + "BriefDescription": "TM snoop that is a store hits line in L3 in T, Tn or Te state (shared modified)" }, {, "EventCode": "0x3001A", @@ -205,6 +205,11 @@ "BriefDescription": "Duration in cycles to reload with Modified (M) data from another core's ECO L3 on the same chip due to a marked load" }, {, + "EventCode": "0xF0B4", + "EventName": "PM_DC_PREF_CONS_ALLOC", + "BriefDescription": "Prefetch stream allocated in the conservative phase by either the hardware prefetch mechanism or software prefetch. The sum of this pair subtracted from the total number of allocs will give the total allocs in normal phase" + }, + {, "EventCode": "0xF894", "EventName": "PM_LSU3_L1_CAM_CANCEL", "BriefDescription": "ls3 l1 tm cam cancel" @@ -227,7 +232,12 @@ {, "EventCode": "0x468A6", "EventName": "PM_RD_CLEARING_SC", - "BriefDescription": "Read clearing SC" + "BriefDescription": "Core TM load hits line in L3 in TM_SC state and causes it to be invalidated" + }, + {, + "EventCode": "0xD0B0", + "EventName": "PM_HWSYNC", + "BriefDescription": "" }, {, "EventCode": "0x168B0", @@ -265,6 +275,11 @@ "BriefDescription": "Prefetch stream allocated by the hardware prefetch mechanism" }, {, + "EventCode": "0xF0BC", + "EventName": "PM_LS2_UNALIGNED_ST", + "BriefDescription": "Store instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the Store of that size. If the Store wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0xD0AC", "EventName": "PM_SRQ_SYNC_CYC", "BriefDescription": "A sync is in the S2Q (edge detect to count)" @@ -275,6 +290,11 @@ "BriefDescription": "Marked instruction was reloaded from a location beyond the local chiplet" }, {, + "EventCode": "0x58A8", + "EventName": "PM_DECODE_HOLD_ICT_FULL", + "BriefDescription": "Counts the number of cycles in which the IFU was not able to decode and transmit one or more instructions because all itags were in use. This means the ICT is full for this thread" + }, + {, "EventCode": "0x26082", "EventName": "PM_L2_IC_INV", "BriefDescription": "I-cache Invalidates sent over the realod bus to the core" @@ -365,6 +385,16 @@ "BriefDescription": "Duration in cycles to reload either shared or modified data from another core's L2/L3 on a different chip (remote or distant) due to a marked load" }, {, + "EventCode": "0xF888", + "EventName": "PM_LSU1_STORE_REJECT", + "BriefDescription": "All internal store rejects cause the instruction to go back to the SRQ and go to sleep until woken up to try again after the condition has been met" + }, + {, + "EventCode": "0xC098", + "EventName": "PM_LS2_UNALIGNED_LD", + "BriefDescription": "Load instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the load of that size. If the load wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0x20058", "EventName": "PM_DARQ1_10_12_ENTRIES", "BriefDescription": "Cycles in which 10 or more DARQ1 entries (out of 12) are in use" @@ -372,7 +402,7 @@ {, "EventCode": "0x360A6", "EventName": "PM_SNP_TM_HIT_M", - "BriefDescription": "Snp TM st hit M/Mu" + "BriefDescription": "TM snoop that is a store hits line in L3 in M or Mu state (exclusive modified)" }, {, "EventCode": "0x5898", @@ -395,9 +425,9 @@ "BriefDescription": "A data line was written to the L1 due to a hardware or software prefetch" }, {, - "EventCode": "0xF888", - "EventName": "PM_LSU1_STORE_REJECT", - "BriefDescription": "All internal store rejects cause the instruction to go back to the SRQ and go to sleep until woken up to try again after the condition has been met" + "EventCode": "0x2608E", + "EventName": "PM_TM_LD_CONF", + "BriefDescription": "TM Load (fav or non-fav) ran into conflict (failed)" }, {, "EventCode": "0x1D144", @@ -422,7 +452,7 @@ {, "EventCode": "0x26884", "EventName": "PM_DSIDE_MRU_TOUCH", - "BriefDescription": "D-side L2 MRU touch sent to L2" + "BriefDescription": "D-side L2 MRU touch commands sent to the L2" }, {, "EventCode": "0x30134", @@ -440,6 +470,16 @@ "BriefDescription": "XL-form branch was mispredicted due to the predicted target address missing from EAT. The EAT forces a mispredict in this case since there is no predicated target to validate. This is a rare case that may occur when the EAT is full and a branch is issued" }, {, + "EventCode": "0xC094", + "EventName": "PM_LS0_UNALIGNED_LD", + "BriefDescription": "Load instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the load of that size. If the load wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, + "EventCode": "0xF8BC", + "EventName": "PM_LS3_UNALIGNED_ST", + "BriefDescription": "Store instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the Store of that size. If the Store wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0x460AE", "EventName": "PM_L3_P2_CO_RTY", "BriefDescription": "L3 CO received retry port 2 (memory only), every retry counted" @@ -492,7 +532,7 @@ {, "EventCode": "0xC880", "EventName": "PM_LS1_LD_VECTOR_FIN", - "BriefDescription": "" + "BriefDescription": "LS1 finished load vector op" }, {, "EventCode": "0x2894", @@ -515,6 +555,11 @@ "BriefDescription": "Marked derat reload (miss) for any page size" }, {, + "EventCode": "0x160A0", + "EventName": "PM_L3_PF_MISS_L3", + "BriefDescription": "L3 PF missed in L3" + }, + {, "EventCode": "0x1C04A", "EventName": "PM_DATA_FROM_RL2L3_SHR", "BriefDescription": "The processor's data cache was reloaded with Shared (S) data from another chip's L2 or L3 on the same Node or Group (Remote), as this chip due to a demand load" @@ -565,11 +610,21 @@ "BriefDescription": "L2 guess local (LNS) and guess was not correct (ie data not on chip)" }, {, + "EventCode": "0xC888", + "EventName": "PM_LSU_DTLB_MISS_64K", + "BriefDescription": "Data TLB Miss page size 64K" + }, + {, "EventCode": "0xE0A4", "EventName": "PM_TMA_REQ_L2", "BriefDescription": "addrs only req to L2 only on the first one,Indication that Load footprint is not expanding" }, {, + "EventCode": "0xC088", + "EventName": "PM_LSU_DTLB_MISS_4K", + "BriefDescription": "Data TLB Miss page size 4K" + }, + {, "EventCode": "0x3C042", "EventName": "PM_DATA_FROM_L3_DISP_CONFLICT", "BriefDescription": "The processor's data cache was reloaded from local core's L3 with dispatch conflict due to a demand load" @@ -602,7 +657,7 @@ {, "EventCode": "0x26084", "EventName": "PM_L2_RCLD_DISP_FAIL_OTHER", - "BriefDescription": "All I-or-D side load dispatch attempts for this thread that failed due to reason other than address collision (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All D-side-Ld or I-side-instruction-fetch dispatch attempts for this thread that failed due to reasons other than an address collision conflicts with an L2 machines (e.g. Read-Claim/Snoop machine not available)" }, {, "EventCode": "0x101E4", @@ -647,12 +702,12 @@ {, "EventCode": "0x46080", "EventName": "PM_L2_DISP_ALL_L2MISS", - "BriefDescription": "All successful Ld/St dispatches for this thread that were an L2 miss (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All successful D-side-Ld/St or I-side-instruction-fetch dispatches for this thread that were an L2 miss" }, {, - "EventCode": "0x160A0", - "EventName": "PM_L3_PF_MISS_L3", - "BriefDescription": "L3 PF missed in L3" + "EventCode": "0xF8B8", + "EventName": "PM_LS1_UNALIGNED_ST", + "BriefDescription": "Store instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the Store of that size. If the Store wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" }, {, "EventCode": "0x408C", @@ -667,7 +722,7 @@ {, "EventCode": "0x160B2", "EventName": "PM_L3_LOC_GUESS_CORRECT", - "BriefDescription": "initial scope=node/chip (LNS) and data from local node (local) (pred successful) - always PFs only" + "BriefDescription": "Prefetch scope predictor selected LNS and was correct" }, {, "EventCode": "0x48B4", @@ -767,7 +822,7 @@ {, "EventCode": "0x36082", "EventName": "PM_L2_LD_DISP", - "BriefDescription": "All successful I-or-D side load dispatches for this thread (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All successful D-side-Ld or I-side-instruction-fetch dispatches for this thread" }, {, "EventCode": "0xF8B0", @@ -787,7 +842,7 @@ {, "EventCode": "0x16884", "EventName": "PM_L2_RCLD_DISP_FAIL_ADDR", - "BriefDescription": "All I-od-D side load dispatch attempts for this thread that failed due to address collision with RC/CO/SN/SQ machine (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All D-side-Ld or I-side-instruction-fetch dispatch attempts for this thread that failed due to an address collision conflicts with an L2 machines already working on this line (e.g. ld-hit-stq or Read-claim/Castout/Snoop machines)" }, {, "EventCode": "0x460A0", @@ -830,6 +885,11 @@ "BriefDescription": "Instruction prefetch requests" }, {, + "EventCode": "0xC898", + "EventName": "PM_LS3_UNALIGNED_LD", + "BriefDescription": "Load instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the load of that size. If the load wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0x488C", "EventName": "PM_IC_PREF_WRITE", "BriefDescription": "Instruction prefetch written into IL1" @@ -837,7 +897,7 @@ {, "EventCode": "0xF89C", "EventName": "PM_XLATE_MISS", - "BriefDescription": "The LSU requested a line from L2 for translation. It may be satisfied from any source beyond L2. Includes speculative instructions" + "BriefDescription": "The LSU requested a line from L2 for translation. It may be satisfied from any source beyond L2. Includes speculative instructions. Includes instruction, prefetch and demand" }, {, "EventCode": "0x14158", @@ -850,9 +910,14 @@ "BriefDescription": "Duration in cycles to reload with Shared (S) data from another core's L3 on the same chip due to a marked load" }, {, + "EventCode": "0xC88C", + "EventName": "PM_LSU_DTLB_MISS_16G_1G", + "BriefDescription": "Data TLB Miss page size 16G (HPT) or 1G (Radix)" + }, + {, "EventCode": "0x268A6", "EventName": "PM_TM_RST_SC", - "BriefDescription": "TM-snp rst RM SC" + "BriefDescription": "TM snoop hits line in L3 that is TM_SC state and causes it to be invalidated" }, {, "EventCode": "0x468A4", @@ -917,7 +982,7 @@ {, "EventCode": "0x46086", "EventName": "PM_L2_SN_M_RD_DONE", - "BriefDescription": "SNP dispatched for a read and was M (true M)" + "BriefDescription": "Snoop dispatched for a read and was M (true M)" }, {, "EventCode": "0x40154", @@ -980,14 +1045,9 @@ "BriefDescription": "Link stack predicts right address" }, {, - "EventCode": "0x4C05A", - "EventName": "PM_DTLB_MISS_1G", - "BriefDescription": "Data TLB reload (after a miss) page size 1G. Implies radix translation was used" - }, - {, "EventCode": "0x36886", "EventName": "PM_L2_SN_SX_I_DONE", - "BriefDescription": "SNP dispatched and went from Sx to Ix" + "BriefDescription": "Snoop dispatched and went from Sx to Ix" }, {, "EventCode": "0x4E04A", @@ -1000,11 +1060,6 @@ "BriefDescription": "Duration in cycles to reload from another chip's L4 on a different Node or Group (Distant) due to a marked load" }, {, - "EventCode": "0x2608E", - "EventName": "PM_TM_LD_CONF", - "BriefDescription": "TM Load (fav or non-fav) ran into conflict (failed)" - }, - {, "EventCode": "0x4080", "EventName": "PM_INST_FROM_L1", "BriefDescription": "Instruction fetches from L1. L1 instruction hit" @@ -1037,7 +1092,7 @@ {, "EventCode": "0x260A6", "EventName": "PM_NON_TM_RST_SC", - "BriefDescription": "Non-TM snp rst TM SC" + "BriefDescription": "Non-TM snoop hits line in L3 that is TM_SC state and causes it to be invalidated" }, {, "EventCode": "0x3608A", @@ -1065,11 +1120,6 @@ "BriefDescription": "Branch mispredict flushes. Includes target and address misprecition" }, {, - "EventCode": "0x508C", - "EventName": "PM_SHL_CREATED", - "BriefDescription": "Store-Hit-Load Table Entry Created" - }, - {, "EventCode": "0x1504C", "EventName": "PM_IPTEG_FROM_LL4", "BriefDescription": "A Page Table Entry was loaded into the TLB from the local chip's L4 cache due to a instruction side request" @@ -1107,7 +1157,7 @@ {, "EventCode": "0x2608A", "EventName": "PM_ISIDE_DISP_FAIL_ADDR", - "BriefDescription": "All I-side dispatch attempts for this thread that failed due to a addr collision with another machine (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All I-side-instruction-fetch dispatch attempts for this thread that failed due to an address collision conflict with an L2 machine already working on this line (e.g. ld-hit-stq or RC/CO/SN machines)" }, {, "EventCode": "0x50B4", @@ -1180,9 +1230,9 @@ "BriefDescription": "Number of stcx instructions finished. This includes instructions in the speculative path of a branch that may be flushed" }, {, - "EventCode": "0xE0B8", - "EventName": "PM_LS2_TM_DISALLOW", - "BriefDescription": "A TM-ineligible instruction tries to execute inside a transaction and the LSU disallows it" + "EventCode": "0xD8AC", + "EventName": "PM_LWSYNC", + "BriefDescription": "" }, {, "EventCode": "0x2094", @@ -1210,6 +1260,11 @@ "BriefDescription": "Ict empty for this thread due to dispatch holds because the History Buffer was full. Could be GPR/VSR/VMR/FPR/CR/XVF; CR; XVF (XER/VSCR/FPSCR)" }, {, + "EventCode": "0xC894", + "EventName": "PM_LS1_UNALIGNED_LD", + "BriefDescription": "Load instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the load of that size. If the load wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0x360A2", "EventName": "PM_L3_L2_CO_HIT", "BriefDescription": "L2 CO hits" @@ -1292,7 +1347,7 @@ {, "EventCode": "0xC084", "EventName": "PM_LS2_LD_VECTOR_FIN", - "BriefDescription": "" + "BriefDescription": "LS2 finished load vector op" }, {, "EventCode": "0x1608E", @@ -1345,6 +1400,11 @@ "BriefDescription": "Continuous 16 cycle (2to1) window where this signals rotates thru sampling each SN machine busy. PMU uses this wave to then do 16 cyc count to sample total number of machs running" }, {, + "EventCode": "0x36084", + "EventName": "PM_L2_RCST_DISP", + "BriefDescription": "All D-side store dispatch attempts for this thread" + }, + {, "EventCode": "0x46084", "EventName": "PM_L2_RCST_DISP_FAIL_OTHER", "BriefDescription": "All D-side store dispatch attempts for this thread that failed due to reason other than address collision" @@ -1355,11 +1415,6 @@ "BriefDescription": "A demand load referenced a line in an active strided prefetch stream. The stream could have been allocated through the hardware prefetch mechanism or through software." }, {, - "EventCode": "0x36084", - "EventName": "PM_L2_RCST_DISP", - "BriefDescription": "All D-side store dispatch attempts for this thread" - }, - {, "EventCode": "0x45054", "EventName": "PM_FMA_CMPL", "BriefDescription": "two flops operation completed (fmadd, fnmadd, fmsub, fnmsub) Scalar instructions only. " @@ -1372,7 +1427,7 @@ {, "EventCode": "0x36080", "EventName": "PM_L2_INST", - "BriefDescription": "All successful I-side dispatches for this thread (excludes i_l2mru_tch reqs)" + "BriefDescription": "All successful I-side-instruction-fetch (e.g. i-demand, i-prefetch) dispatches for this thread" }, {, "EventCode": "0x3504C", @@ -1387,7 +1442,7 @@ {, "EventCode": "0x1688A", "EventName": "PM_ISIDE_DISP", - "BriefDescription": "All I-side dispatch attempts for this thread (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All I-side-instruction-fetch dispatch attempts for this thread" }, {, "EventCode": "0x468AA", @@ -1420,6 +1475,11 @@ "BriefDescription": "Load tm hit in L1" }, {, + "EventCode": "0xE0B8", + "EventName": "PM_LS2_TM_DISALLOW", + "BriefDescription": "A TM-ineligible instruction tries to execute inside a transaction and the LSU disallows it" + }, + {, "EventCode": "0x44044", "EventName": "PM_INST_FROM_L31_ECO_MOD", "BriefDescription": "The processor's Instruction cache was reloaded with Modified (M) data from another core's ECO L3 on the same chip due to an instruction fetch (not prefetch)" @@ -1467,7 +1527,7 @@ {, "EventCode": "0x36086", "EventName": "PM_L2_RC_ST_DONE", - "BriefDescription": "RC did store to line that was Tx or Sx" + "BriefDescription": "Read-claim machine did store to line that was in Tx or Sx (Tagged or Shared state)" }, {, "EventCode": "0xE8AC", @@ -1500,6 +1560,11 @@ "BriefDescription": "A Page Table Entry was loaded into the TLB from local core's L2 without conflict due to a instruction side request" }, {, + "EventCode": "0x460A6", + "EventName": "PM_RD_FORMING_SC", + "BriefDescription": "Doesn't occur" + }, + {, "EventCode": "0x35042", "EventName": "PM_IPTEG_FROM_L3_DISP_CONFLICT", "BriefDescription": "A Page Table Entry was loaded into the TLB from local core's L3 with dispatch conflict due to a instruction side request" @@ -1527,7 +1592,7 @@ {, "EventCode": "0x36882", "EventName": "PM_L2_LD_HIT", - "BriefDescription": "All successful I-or-D side load dispatches for this thread that were L2 hits (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All successful D-side-Ld or I-side-instruction-fetch dispatches for this thread that were L2 hits" }, {, "EventCode": "0x168AC", @@ -1555,11 +1620,6 @@ "BriefDescription": "ProbeNops dispatched" }, {, - "EventCode": "0x58A8", - "EventName": "PM_DECODE_HOLD_ICT_FULL", - "BriefDescription": "Counts the number of cycles in which the IFU was not able to decode and transmit one or more instructions because all itags were in use. This means the ICT is full for this thread" - }, - {, "EventCode": "0x10052", "EventName": "PM_GRP_PUMP_MPRED_RTY", "BriefDescription": "Final Pump Scope (Group) ended up larger than Initial Pump Scope (Chip) for all data types excluding data prefetch (demand load,inst prefetch,inst fetch,xlate)" @@ -1572,7 +1632,7 @@ {, "EventCode": "0x2688A", "EventName": "PM_ISIDE_DISP_FAIL_OTHER", - "BriefDescription": "All I-side dispatch attempts for this thread that failed due to a reason other than addrs collision (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All I-side-instruction-fetch dispatch attempts for this thread that failed due to reasons other than an address collision conflict with an L2 machine (e.g. no available RC/CO machines)" }, {, "EventCode": "0x2001A", @@ -1652,12 +1712,12 @@ {, "EventCode": "0x46880", "EventName": "PM_ISIDE_MRU_TOUCH", - "BriefDescription": "I-side L2 MRU touch sent to L2 for this thread" + "BriefDescription": "I-side L2 MRU touch sent to L2 for this thread I-side L2 MRU touch commands sent to the L2 for this thread" }, {, - "EventCode": "0x1C05C", - "EventName": "PM_DTLB_MISS_2M", - "BriefDescription": "Data TLB reload (after a miss) page size 2M. Implies radix translation was used" + "EventCode": "0x508C", + "EventName": "PM_SHL_CREATED", + "BriefDescription": "Store-Hit-Load Table Entry Created" }, {, "EventCode": "0x50B8", @@ -1672,7 +1732,7 @@ {, "EventCode": "0x268B2", "EventName": "PM_L3_LOC_GUESS_WRONG", - "BriefDescription": "Initial scope=node (LNS) but data from out side local node (near or far or rem). Prediction too Low" + "BriefDescription": "Prefetch scope predictor selected LNS, but was wrong" }, {, "EventCode": "0x36088", @@ -1685,6 +1745,11 @@ "BriefDescription": "L3 PF received retry port 2, every retry counted" }, {, + "EventCode": "0xD8B0", + "EventName": "PM_PTESYNC", + "BriefDescription": "" + }, + {, "EventCode": "0x26086", "EventName": "PM_CO_TM_SC_FOOTPRINT", "BriefDescription": "L2 did a cleanifdirty CO to the L3 (ie created an SC line in the L3) OR L2 TM_store hit dirty HPC line and L3 indicated SC line formed in L3 on RDR bus" @@ -1740,6 +1805,11 @@ "BriefDescription": "All successful D-Side Store dispatches that were an L2 miss for this thread" }, {, + "EventCode": "0xF8B4", + "EventName": "PM_DC_PREF_XCONS_ALLOC", + "BriefDescription": "Prefetch stream allocated in the Ultra conservative phase by either the hardware prefetch mechanism or software prefetch" + }, + {, "EventCode": "0x35048", "EventName": "PM_IPTEG_FROM_DL2L3_SHR", "BriefDescription": "A Page Table Entry was loaded into the TLB with Shared (S) data from another chip's L2 or L3 on a different Node or Group (Distant), as this chip due to a instruction side request" @@ -1782,7 +1852,7 @@ {, "EventCode": "0x460B2", "EventName": "PM_L3_SYS_GUESS_WRONG", - "BriefDescription": "Initial scope=system (VGS or RNS) but data from local or near. Prediction too high" + "BriefDescription": "Prefetch scope predictor selected VGS or RNS, but was wrong" }, {, "EventCode": "0x58B8", @@ -1800,11 +1870,6 @@ "BriefDescription": "Completion time tabortnoncd, tabortcd, treclaim" }, {, - "EventCode": "0x4C054", - "EventName": "PM_DERAT_MISS_16G", - "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 16G" - }, - {, "EventCode": "0x268A0", "EventName": "PM_L3_CO_L31", "BriefDescription": "L3 CO to L3.1 OR of port 0 and 1 (lossy = may undercount if two cresps come in the same cyc)" @@ -1862,7 +1927,7 @@ {, "EventCode": "0x368B2", "EventName": "PM_L3_GRP_GUESS_WRONG_HIGH", - "BriefDescription": "Initial scope=group (GS or NNS) but data from local node. Prediction too high" + "BriefDescription": "Prefetch scope predictor selected GS or NNS, but was wrong because scope was VGS or RNS" }, {, "EventCode": "0xE8BC", @@ -1897,7 +1962,7 @@ {, "EventCode": "0x260B2", "EventName": "PM_L3_SYS_GUESS_CORRECT", - "BriefDescription": "Initial scope=system (VGS or RNS) and data from outside group (far or rem)(pred successful)" + "BriefDescription": "Prefetch scope predictor selected VGS or RNS and was correct" }, {, "EventCode": "0x1D146", @@ -1915,6 +1980,11 @@ "BriefDescription": "RC requests that were on group (aka nodel) pump attempts" }, {, + "EventCode": "0xC08C", + "EventName": "PM_LSU_DTLB_MISS_16M_2M", + "BriefDescription": "Data TLB Miss page size 16M (HPT) or 2M (Radix)" + }, + {, "EventCode": "0x16080", "EventName": "PM_L2_LD", "BriefDescription": "All successful D-side Load dispatches for this thread (L2 miss + L2 hits)" @@ -1927,7 +1997,7 @@ {, "EventCode": "0xC080", "EventName": "PM_LS0_LD_VECTOR_FIN", - "BriefDescription": "" + "BriefDescription": "LS0 finished load vector op" }, {, "EventCode": "0x368B0", @@ -2000,6 +2070,11 @@ "BriefDescription": "Conditional Branch Completed in which the HW correctly predicted the direction as taken. Counted at completion time" }, {, + "EventCode": "0xF0B8", + "EventName": "PM_LS0_UNALIGNED_ST", + "BriefDescription": "Store instructions whose data crosses a double-word boundary, which causes it to require an additional slice than than what normally would be required of the Store of that size. If the Store wraps from slice 3 to slice 0, thee is an additional 3-cycle penalty" + }, + {, "EventCode": "0x20132", "EventName": "PM_MRK_DFU_FIN", "BriefDescription": "Decimal Unit marked Instruction Finish" @@ -2007,7 +2082,7 @@ {, "EventCode": "0x160A6", "EventName": "PM_TM_SC_CO", - "BriefDescription": "L3 castout TM SC line" + "BriefDescription": "L3 castout of line that was StoreCopy (original value of speculatively written line) in a Transaction" }, {, "EventCode": "0xC8B0", @@ -2017,7 +2092,7 @@ {, "EventCode": "0x16084", "EventName": "PM_L2_RCLD_DISP", - "BriefDescription": "All I-or-D side load dispatch attempts for this thread (excludes i_l2mru_tch_reqs)" + "BriefDescription": "All D-side-Ld or I-side-instruction-fetch dispatch attempts for this thread" }, {, "EventCode": "0x3F150", @@ -2122,12 +2197,12 @@ {, "EventCode": "0x46082", "EventName": "PM_L2_ST_DISP", - "BriefDescription": "All successful D-side store dispatches for this thread (L2 miss + L2 hits)" + "BriefDescription": "All successful D-side store dispatches for this thread" }, {, "EventCode": "0x36880", "EventName": "PM_L2_INST_MISS", - "BriefDescription": "All successful I-side dispatches that were an L2 miss for this thread (excludes i_l2mru_tch reqs)" + "BriefDescription": "All successful I-side-instruction-fetch (e.g. i-demand, i-prefetch) dispatches for this thread that were an L2 miss" }, {, "EventCode": "0xE084", @@ -2217,7 +2292,7 @@ {, "EventCode": "0xC884", "EventName": "PM_LS3_LD_VECTOR_FIN", - "BriefDescription": "" + "BriefDescription": "LS3 finished load vector op" }, {, "EventCode": "0x360A8", @@ -2242,7 +2317,7 @@ {, "EventCode": "0x168B2", "EventName": "PM_L3_GRP_GUESS_CORRECT", - "BriefDescription": "Initial scope=group (GS or NNS) and data from same group (near) (pred successful)" + "BriefDescription": "Prefetch scope predictor selected GS or NNS and was correct" }, {, "EventCode": "0x48A4", diff --git a/tools/perf/pmu-events/arch/powerpc/power9/pipeline.json b/tools/perf/pmu-events/arch/powerpc/power9/pipeline.json index 5af1abbe82c4..b4772f54a271 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/pipeline.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/pipeline.json @@ -65,11 +65,6 @@ "BriefDescription": "Dispatch Held" }, {, - "EventCode": "0x3D154", - "EventName": "PM_MRK_DERAT_MISS_16M", - "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 16M" - }, - {, "EventCode": "0x200F8", "EventName": "PM_EXT_INT", "BriefDescription": "external interrupt" @@ -120,6 +115,11 @@ "BriefDescription": "A Page Table Entry was loaded into the TLB from local core's L3 without dispatch conflicts hit on Mepf state. due to a marked data side request. When using Radix Page Translation, this count excludes PDE reloads. Only PTE reloads are included" }, {, + "EventCode": "0x4C15C", + "EventName": "PM_MRK_DERAT_MISS_16G_1G", + "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 16G (hpt mode) and 1G (radix mode)" + }, + {, "EventCode": "0x10024", "EventName": "PM_PMC5_OVERFLOW", "BriefDescription": "Overflow from counter 5" @@ -155,11 +155,6 @@ "BriefDescription": "Ict empty for this thread due to Icache Miss" }, {, - "EventCode": "0x3D152", - "EventName": "PM_MRK_DERAT_MISS_1G", - "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 1G. Implies radix translation" - }, - {, "EventCode": "0x4F14A", "EventName": "PM_MRK_DPTEG_FROM_OFF_CHIP_CACHE", "BriefDescription": "A Page Table Entry was loaded into the TLB either shared or modified data from another core's L2/L3 on a different chip (remote or distant) due to a marked data side request. When using Radix Page Translation, this count excludes PDE reloads. Only PTE reloads are included" @@ -185,11 +180,6 @@ "BriefDescription": "A Page Table Entry was loaded into the TLB from local core's L2 without conflict due to a marked data side request. When using Radix Page Translation, this count excludes PDE reloads. Only PTE reloads are included" }, {, - "EventCode": "0x2C05A", - "EventName": "PM_DERAT_MISS_1G", - "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 1G. Implies radix translation" - }, - {, "EventCode": "0x1F058", "EventName": "PM_RADIX_PWC_L2_PTE_FROM_L2", "BriefDescription": "A Page Table Entry was reloaded to a level 2 page walk cache from the core's L2 data cache. This implies that level 3 and level 4 PWC accesses were not necessary for this translation" @@ -240,11 +230,6 @@ "BriefDescription": "Data PTEG reload" }, {, - "EventCode": "0x2D152", - "EventName": "PM_MRK_DERAT_MISS_2M", - "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 2M. Implies radix translation" - }, - {, "EventCode": "0x2C046", "EventName": "PM_DATA_FROM_RL2L3_MOD", "BriefDescription": "The processor's data cache was reloaded with Modified (M) data from another chip's L2 or L3 on the same Node or Group (Remote), as this chip due to a demand load" @@ -290,6 +275,11 @@ "BriefDescription": "Finish stall because the NTF instruction was issued to the Decimal Floating Point execution pipe and waiting to finish. Includes decimal floating point instructions + 128 bit binary floating point instructions. Not qualified by multicycle" }, {, + "EventCode": "0x3C054", + "EventName": "PM_DERAT_MISS_16M_2M", + "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 16M (HPT mode) or 2M (Radix mode)" + }, + {, "EventCode": "0x4C04C", "EventName": "PM_DATA_FROM_DMEM", "BriefDescription": "The processor's data cache was reloaded from another chip's memory on the same Node or Group (Distant) due to a demand load" @@ -360,11 +350,6 @@ "BriefDescription": "The processor's Instruction cache was reloaded from a memory location including L4 from local remote or distant due to an instruction fetch (not prefetch)" }, {, - "EventCode": "0x1C05A", - "EventName": "PM_DERAT_MISS_2M", - "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 2M. Implies radix translation" - }, - {, "EventCode": "0x30024", "EventName": "PM_PMC6_OVERFLOW", "BriefDescription": "Overflow from counter 6" @@ -375,6 +360,11 @@ "BriefDescription": "Branch Instruction Finished" }, {, + "EventCode": "0x3D154", + "EventName": "PM_MRK_DERAT_MISS_16M_2M", + "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 16M (hpt mode) or 2M (radix mode)" + }, + {, "EventCode": "0x30020", "EventName": "PM_PMC2_REWIND", "BriefDescription": "PMC2 Rewind Event (did not match condition)" @@ -410,11 +400,6 @@ "BriefDescription": "A Page Table Entry was loaded into the TLB with Modified (M) data from another core's L3 on the same chip due to a marked data side request. When using Radix Page Translation, this count excludes PDE reloads. Only PTE reloads are included" }, {, - "EventCode": "0x4C15C", - "EventName": "PM_MRK_DERAT_MISS_16G", - "BriefDescription": "Marked Data ERAT Miss (Data TLB Access) page size 16G" - }, - {, "EventCode": "0x14052", "EventName": "PM_INST_GRP_PUMP_MPRED_RTY", "BriefDescription": "Final Pump Scope (Group) ended up larger than Initial Pump Scope (Chip) for an instruction fetch" @@ -445,11 +430,6 @@ "BriefDescription": "Icache miss demand cycles" }, {, - "EventCode": "0x3C054", - "EventName": "PM_DERAT_MISS_16M", - "BriefDescription": "Data ERAT Miss (Data TLB Access) page size 16M" - }, - {, "EventCode": "0x2D14E", "EventName": "PM_MRK_DATA_FROM_L21_SHR", "BriefDescription": "The processor's data cache was reloaded with Shared (S) data from another core's L2 on the same chip due to a marked load" diff --git a/tools/perf/pmu-events/arch/powerpc/power9/pmc.json b/tools/perf/pmu-events/arch/powerpc/power9/pmc.json index d0b89f930567..8b3b0f3be664 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/pmc.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/pmc.json @@ -10,11 +10,6 @@ "BriefDescription": "Local memory above threshold for LSU medium" }, {, - "EventCode": "0x2C056", - "EventName": "PM_DTLB_MISS_4K", - "BriefDescription": "Data TLB Miss page size 4k" - }, - {, "EventCode": "0x40118", "EventName": "PM_MRK_DCACHE_RELOAD_INTV", "BriefDescription": "Combined Intervention event" diff --git a/tools/perf/pmu-events/arch/powerpc/power9/translation.json b/tools/perf/pmu-events/arch/powerpc/power9/translation.json index bc8e03d7a6b0..b27642676244 100644 --- a/tools/perf/pmu-events/arch/powerpc/power9/translation.json +++ b/tools/perf/pmu-events/arch/powerpc/power9/translation.json @@ -30,11 +30,6 @@ "BriefDescription": "Store finish count. Includes speculative activity" }, {, - "EventCode": "0x44042", - "EventName": "PM_INST_FROM_L3", - "BriefDescription": "The processor's Instruction cache was reloaded from local core's L3 due to an instruction fetch (not prefetch)" - }, - {, "EventCode": "0x1504A", "EventName": "PM_IPTEG_FROM_RL2L3_SHR", "BriefDescription": "A Page Table Entry was loaded into the TLB with Shared (S) data from another chip's L2 or L3 on the same Node or Group (Remote), as this chip due to a instruction side request" @@ -125,6 +120,11 @@ "BriefDescription": "PMC1 Rewind Value saved" }, {, + "EventCode": "0x44042", + "EventName": "PM_INST_FROM_L3", + "BriefDescription": "The processor's Instruction cache was reloaded from local core's L3 due to an instruction fetch (not prefetch)" + }, + {, "EventCode": "0x200FE", "EventName": "PM_DATA_FROM_L2MISS", "BriefDescription": "Demand LD - L2 Miss (not L2 hit)" diff --git a/tools/perf/pmu-events/arch/s390/cf_z10/basic.json b/tools/perf/pmu-events/arch/s390/cf_z10/basic.json new file mode 100644 index 000000000000..8bf16759ca53 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z10/basic.json @@ -0,0 +1,74 @@ +[ + { + "EventCode": "0", + "EventName": "CPU_CYCLES", + "BriefDescription": "CPU Cycles", + "PublicDescription": "Cycle Count" + }, + { + "EventCode": "1", + "EventName": "INSTRUCTIONS", + "BriefDescription": "Instructions", + "PublicDescription": "Instruction Count" + }, + { + "EventCode": "2", + "EventName": "L1I_DIR_WRITES", + "BriefDescription": "L1I Directory Writes", + "PublicDescription": "Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "3", + "EventName": "L1I_PENALTY_CYCLES", + "BriefDescription": "L1I Penalty Cycles", + "PublicDescription": "Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "4", + "EventName": "L1D_DIR_WRITES", + "BriefDescription": "L1D Directory Writes", + "PublicDescription": "Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "5", + "EventName": "L1D_PENALTY_CYCLES", + "BriefDescription": "L1D Penalty Cycles", + "PublicDescription": "Level-1 D-Cache Penalty Cycle Count" + }, + { + "EventCode": "32", + "EventName": "PROBLEM_STATE_CPU_CYCLES", + "BriefDescription": "Problem-State CPU Cycles", + "PublicDescription": "Problem-State Cycle Count" + }, + { + "EventCode": "33", + "EventName": "PROBLEM_STATE_INSTRUCTIONS", + "BriefDescription": "Problem-State Instructions", + "PublicDescription": "Problem-State Instruction Count" + }, + { + "EventCode": "34", + "EventName": "PROBLEM_STATE_L1I_DIR_WRITES", + "BriefDescription": "Problem-State L1I Directory Writes", + "PublicDescription": "Problem-State Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "35", + "EventName": "PROBLEM_STATE_L1I_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1I Penalty Cycles", + "PublicDescription": "Problem-State Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "36", + "EventName": "PROBLEM_STATE_L1D_DIR_WRITES", + "BriefDescription": "Problem-State L1D Directory Writes", + "PublicDescription": "Problem-State Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "37", + "EventName": "PROBLEM_STATE_L1D_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1D Penalty Cycles", + "PublicDescription": "Problem-State Level-1 D-Cache Penalty Cycle Count" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z10/crypto.json b/tools/perf/pmu-events/arch/s390/cf_z10/crypto.json new file mode 100644 index 000000000000..7e5b72492141 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z10/crypto.json @@ -0,0 +1,98 @@ +[ + { + "EventCode": "64", + "EventName": "PRNG_FUNCTIONS", + "BriefDescription": "PRNG Functions", + "PublicDescription": "Total number of the PRNG functions issued by the CPU" + }, + { + "EventCode": "65", + "EventName": "PRNG_CYCLES", + "BriefDescription": "PRNG Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing PRNG functions issued by the CPU" + }, + { + "EventCode": "66", + "EventName": "PRNG_BLOCKED_FUNCTIONS", + "BriefDescription": "PRNG Blocked Functions", + "PublicDescription": "Total number of the PRNG functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "67", + "EventName": "PRNG_BLOCKED_CYCLES", + "BriefDescription": "PRNG Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the PRNG functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "68", + "EventName": "SHA_FUNCTIONS", + "BriefDescription": "SHA Functions", + "PublicDescription": "Total number of SHA functions issued by the CPU" + }, + { + "EventCode": "69", + "EventName": "SHA_CYCLES", + "BriefDescription": "SHA Cycles", + "PublicDescription": "Total number of CPU cycles when the SHA coprocessor is busy performing the SHA functions issued by the CPU" + }, + { + "EventCode": "70", + "EventName": "SHA_BLOCKED_FUNCTIONS", + "BriefDescription": "SHA Blocked Functions", + "PublicDescription": "Total number of the SHA functions that are issued by the CPU and are blocked because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "71", + "EventName": "SHA_BLOCKED_CYCLES", + "BriefDescription": "SHA Bloced Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the SHA functions issued by the CPU because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "72", + "EventName": "DEA_FUNCTIONS", + "BriefDescription": "DEA Functions", + "PublicDescription": "Total number of the DEA functions issued by the CPU" + }, + { + "EventCode": "73", + "EventName": "DEA_CYCLES", + "BriefDescription": "DEA Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the DEA functions issued by the CPU" + }, + { + "EventCode": "74", + "EventName": "DEA_BLOCKED_FUNCTIONS", + "BriefDescription": "DEA Blocked Functions", + "PublicDescription": "Total number of the DEA functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "75", + "EventName": "DEA_BLOCKED_CYCLES", + "BriefDescription": "DEA Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the DEA functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "76", + "EventName": "AES_FUNCTIONS", + "BriefDescription": "AES Functions", + "PublicDescription": "Total number of AES functions issued by the CPU" + }, + { + "EventCode": "77", + "EventName": "AES_CYCLES", + "BriefDescription": "AES Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the AES functions issued by the CPU" + }, + { + "EventCode": "78", + "EventName": "AES_BLOCKED_FUNCTIONS", + "BriefDescription": "AES Blocked Functions", + "PublicDescription": "Total number of AES functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "79", + "EventName": "AES_BLOCKED_CYCLES", + "BriefDescription": "AES Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the AES functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z10/extended.json b/tools/perf/pmu-events/arch/s390/cf_z10/extended.json new file mode 100644 index 000000000000..0feedb40f30f --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z10/extended.json @@ -0,0 +1,110 @@ +[ + { + "EventCode": "128", + "EventName": "L1I_L2_SOURCED_WRITES", + "BriefDescription": "L1I L2 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from the Level-2 (L1.5) cache" + }, + { + "EventCode": "129", + "EventName": "L1D_L2_SOURCED_WRITES", + "BriefDescription": "L1D L2 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the installed cache line was sourced from the Level-2 (L1.5) cache" + }, + { + "EventCode": "130", + "EventName": "L1I_L3_LOCAL_WRITES", + "BriefDescription": "L1I L3 Local Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the installed cache line was sourced from the Level-3 cache that is on the same book as the Instruction cache (Local L2 cache)" + }, + { + "EventCode": "131", + "EventName": "L1D_L3_LOCAL_WRITES", + "BriefDescription": "L1D L3 Local Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the installtion cache line was source from the Level-3 cache that is on the same book as the Data cache (Local L2 cache)" + }, + { + "EventCode": "132", + "EventName": "L1I_L3_REMOTE_WRITES", + "BriefDescription": "L1I L3 Remote Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the installed cache line was sourced from a Level-3 cache that is not on the same book as the Instruction cache (Remote L2 cache)" + }, + { + "EventCode": "133", + "EventName": "L1D_L3_REMOTE_WRITES", + "BriefDescription": "L1D L3 Remote Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the installed cache line was sourced from a Level-3 cache that is not on the same book as the Data cache (Remote L2 cache)" + }, + { + "EventCode": "134", + "EventName": "L1D_LMEM_SOURCED_WRITES", + "BriefDescription": "L1D Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the installed cache line was sourced from memory that is attached to the same book as the Data cache (Local Memory)" + }, + { + "EventCode": "135", + "EventName": "L1I_LMEM_SOURCED_WRITES", + "BriefDescription": "L1I Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache where the installed cache line was sourced from memory that is attached to the s ame book as the Instruction cache (Local Memory)" + }, + { + "EventCode": "136", + "EventName": "L1D_RO_EXCL_WRITES", + "BriefDescription": "L1D Read-only Exclusive Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache where the line was originally in a Read-Only state in the cache but has been updated to be in the Exclusive state that allows stores to the cache line" + }, + { + "EventCode": "137", + "EventName": "L1I_CACHELINE_INVALIDATES", + "BriefDescription": "L1I Cacheline Invalidates", + "PublicDescription": "A cache line in the Level-1 I-Cache has been invalidated by a store on the same CPU as the Level-1 I-Cache" + }, + { + "EventCode": "138", + "EventName": "ITLB1_WRITES", + "BriefDescription": "ITLB1 Writes", + "PublicDescription": "A translation entry has been written into the Level-1 Instruction Translation Lookaside Buffer" + }, + { + "EventCode": "139", + "EventName": "DTLB1_WRITES", + "BriefDescription": "DTLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer" + }, + { + "EventCode": "140", + "EventName": "TLB2_PTE_WRITES", + "BriefDescription": "TLB2 PTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Page Table Entry arrays" + }, + { + "EventCode": "141", + "EventName": "TLB2_CRSTE_WRITES", + "BriefDescription": "TLB2 CRSTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays" + }, + { + "EventCode": "142", + "EventName": "TLB2_CRSTE_HPAGE_WRITES", + "BriefDescription": "TLB2 CRSTE One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays for a one-megabyte large page translation" + }, + { + "EventCode": "145", + "EventName": "ITLB1_MISSES", + "BriefDescription": "ITLB1 Misses", + "PublicDescription": "Level-1 Instruction TLB miss in progress. Incremented by one for every cycle an ITLB1 miss is in progress" + }, + { + "EventCode": "146", + "EventName": "DTLB1_MISSES", + "BriefDescription": "DTLB1 Misses", + "PublicDescription": "Level-1 Data TLB miss in progress. Incremented by one for every cycle an DTLB1 miss is in progress" + }, + { + "EventCode": "147", + "EventName": "L2C_STORES_SENT", + "BriefDescription": "L2C Stores Sent", + "PublicDescription": "Incremented by one for every store sent to Level-2 (L1.5) cache" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z13/basic.json b/tools/perf/pmu-events/arch/s390/cf_z13/basic.json new file mode 100644 index 000000000000..8bf16759ca53 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z13/basic.json @@ -0,0 +1,74 @@ +[ + { + "EventCode": "0", + "EventName": "CPU_CYCLES", + "BriefDescription": "CPU Cycles", + "PublicDescription": "Cycle Count" + }, + { + "EventCode": "1", + "EventName": "INSTRUCTIONS", + "BriefDescription": "Instructions", + "PublicDescription": "Instruction Count" + }, + { + "EventCode": "2", + "EventName": "L1I_DIR_WRITES", + "BriefDescription": "L1I Directory Writes", + "PublicDescription": "Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "3", + "EventName": "L1I_PENALTY_CYCLES", + "BriefDescription": "L1I Penalty Cycles", + "PublicDescription": "Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "4", + "EventName": "L1D_DIR_WRITES", + "BriefDescription": "L1D Directory Writes", + "PublicDescription": "Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "5", + "EventName": "L1D_PENALTY_CYCLES", + "BriefDescription": "L1D Penalty Cycles", + "PublicDescription": "Level-1 D-Cache Penalty Cycle Count" + }, + { + "EventCode": "32", + "EventName": "PROBLEM_STATE_CPU_CYCLES", + "BriefDescription": "Problem-State CPU Cycles", + "PublicDescription": "Problem-State Cycle Count" + }, + { + "EventCode": "33", + "EventName": "PROBLEM_STATE_INSTRUCTIONS", + "BriefDescription": "Problem-State Instructions", + "PublicDescription": "Problem-State Instruction Count" + }, + { + "EventCode": "34", + "EventName": "PROBLEM_STATE_L1I_DIR_WRITES", + "BriefDescription": "Problem-State L1I Directory Writes", + "PublicDescription": "Problem-State Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "35", + "EventName": "PROBLEM_STATE_L1I_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1I Penalty Cycles", + "PublicDescription": "Problem-State Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "36", + "EventName": "PROBLEM_STATE_L1D_DIR_WRITES", + "BriefDescription": "Problem-State L1D Directory Writes", + "PublicDescription": "Problem-State Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "37", + "EventName": "PROBLEM_STATE_L1D_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1D Penalty Cycles", + "PublicDescription": "Problem-State Level-1 D-Cache Penalty Cycle Count" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z13/crypto.json b/tools/perf/pmu-events/arch/s390/cf_z13/crypto.json new file mode 100644 index 000000000000..7e5b72492141 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z13/crypto.json @@ -0,0 +1,98 @@ +[ + { + "EventCode": "64", + "EventName": "PRNG_FUNCTIONS", + "BriefDescription": "PRNG Functions", + "PublicDescription": "Total number of the PRNG functions issued by the CPU" + }, + { + "EventCode": "65", + "EventName": "PRNG_CYCLES", + "BriefDescription": "PRNG Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing PRNG functions issued by the CPU" + }, + { + "EventCode": "66", + "EventName": "PRNG_BLOCKED_FUNCTIONS", + "BriefDescription": "PRNG Blocked Functions", + "PublicDescription": "Total number of the PRNG functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "67", + "EventName": "PRNG_BLOCKED_CYCLES", + "BriefDescription": "PRNG Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the PRNG functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "68", + "EventName": "SHA_FUNCTIONS", + "BriefDescription": "SHA Functions", + "PublicDescription": "Total number of SHA functions issued by the CPU" + }, + { + "EventCode": "69", + "EventName": "SHA_CYCLES", + "BriefDescription": "SHA Cycles", + "PublicDescription": "Total number of CPU cycles when the SHA coprocessor is busy performing the SHA functions issued by the CPU" + }, + { + "EventCode": "70", + "EventName": "SHA_BLOCKED_FUNCTIONS", + "BriefDescription": "SHA Blocked Functions", + "PublicDescription": "Total number of the SHA functions that are issued by the CPU and are blocked because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "71", + "EventName": "SHA_BLOCKED_CYCLES", + "BriefDescription": "SHA Bloced Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the SHA functions issued by the CPU because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "72", + "EventName": "DEA_FUNCTIONS", + "BriefDescription": "DEA Functions", + "PublicDescription": "Total number of the DEA functions issued by the CPU" + }, + { + "EventCode": "73", + "EventName": "DEA_CYCLES", + "BriefDescription": "DEA Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the DEA functions issued by the CPU" + }, + { + "EventCode": "74", + "EventName": "DEA_BLOCKED_FUNCTIONS", + "BriefDescription": "DEA Blocked Functions", + "PublicDescription": "Total number of the DEA functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "75", + "EventName": "DEA_BLOCKED_CYCLES", + "BriefDescription": "DEA Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the DEA functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "76", + "EventName": "AES_FUNCTIONS", + "BriefDescription": "AES Functions", + "PublicDescription": "Total number of AES functions issued by the CPU" + }, + { + "EventCode": "77", + "EventName": "AES_CYCLES", + "BriefDescription": "AES Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the AES functions issued by the CPU" + }, + { + "EventCode": "78", + "EventName": "AES_BLOCKED_FUNCTIONS", + "BriefDescription": "AES Blocked Functions", + "PublicDescription": "Total number of AES functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "79", + "EventName": "AES_BLOCKED_CYCLES", + "BriefDescription": "AES Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the AES functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z13/extended.json b/tools/perf/pmu-events/arch/s390/cf_z13/extended.json new file mode 100644 index 000000000000..9a002b6967f1 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z13/extended.json @@ -0,0 +1,338 @@ +[ + { + "EventCode": "128", + "EventName": "L1D_RO_EXCL_WRITES", + "BriefDescription": "L1D Read-only Exclusive Writes", + "PublicDescription": "A directory write to the Level-1 Data cache where the line was originally in a Read-Only state in the cache but has been updated to be in the Exclusive state that allows stores to the cache line." + }, + { + "EventCode": "129", + "EventName": "DTLB1_WRITES", + "BriefDescription": "DTLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer" + }, + { + "EventCode": "130", + "EventName": "DTLB1_MISSES", + "BriefDescription": "DTLB1 Misses", + "PublicDescription": "Level-1 Data TLB miss in progress. Incremented by one for every cycle a DTLB1 miss is in progress." + }, + { + "EventCode": "131", + "EventName": "DTLB1_HPAGE_WRITES", + "BriefDescription": "DTLB1 One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer for a one-megabyte page" + }, + { + "EventCode": "132", + "EventName": "DTLB1_GPAGE_WRITES", + "BriefDescription": "DTLB1 Two-Gigabyte Page Writes", + "PublicDescription": "Counter:132 Name:DTLB1_GPAGE_WRITES A translation entry has been written to the Level-1 Data Translation Lookaside Buffer for a two-gigabyte page." + }, + { + "EventCode": "133", + "EventName": "L1D_L2D_SOURCED_WRITES", + "BriefDescription": "L1D L2D Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from the Level-2 Data cache" + }, + { + "EventCode": "134", + "EventName": "ITLB1_WRITES", + "BriefDescription": "ITLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Instruction Translation Lookaside Buffer" + }, + { + "EventCode": "135", + "EventName": "ITLB1_MISSES", + "BriefDescription": "ITLB1 Misses", + "PublicDescription": "Level-1 Instruction TLB miss in progress. Incremented by one for every cycle an ITLB1 miss is in progress" + }, + { + "EventCode": "136", + "EventName": "L1I_L2I_SOURCED_WRITES", + "BriefDescription": "L1I L2I Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from the Level-2 Instruction cache" + }, + { + "EventCode": "137", + "EventName": "TLB2_PTE_WRITES", + "BriefDescription": "TLB2 PTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Page Table Entry arrays" + }, + { + "EventCode": "138", + "EventName": "TLB2_CRSTE_HPAGE_WRITES", + "BriefDescription": "TLB2 CRSTE One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Combined Region Segment Table Entry arrays for a one-megabyte large page translation" + }, + { + "EventCode": "139", + "EventName": "TLB2_CRSTE_WRITES", + "BriefDescription": "TLB2 CRSTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Combined Region Segment Table Entry arrays" + }, + { + "EventCode": "140", + "EventName": "TX_C_TEND", + "BriefDescription": "Completed TEND instructions in constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a constrained transactional-execution mode" + }, + { + "EventCode": "141", + "EventName": "TX_NC_TEND", + "BriefDescription": "Completed TEND instructions in non-constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a non-constrained transactional-execution mode" + }, + { + "EventCode": "143", + "EventName": "L1C_TLB1_MISSES", + "BriefDescription": "L1C TLB1 Misses", + "PublicDescription": "Increments by one for any cycle where a Level-1 cache or Level-1 TLB miss is in progress." + }, + { + "EventCode": "144", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Chip Level-3 cache without intervention" + }, + { + "EventCode": "145", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Chip Level-3 cache with intervention" + }, + { + "EventCode": "146", + "EventName": "L1D_ONNODE_L4_SOURCED_WRITES", + "BriefDescription": "L1D On-Node L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Node Level-4 cache" + }, + { + "EventCode": "147", + "EventName": "L1D_ONNODE_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Node L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Node Level-3 cache with intervention" + }, + { + "EventCode": "148", + "EventName": "L1D_ONNODE_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Node L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Node Level-3 cache without intervention" + }, + { + "EventCode": "149", + "EventName": "L1D_ONDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1D On-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Drawer Level-4 cache" + }, + { + "EventCode": "150", + "EventName": "L1D_ONDRAWER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Drawer L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Drawer Level-3 cache with intervention" + }, + { + "EventCode": "151", + "EventName": "L1D_ONDRAWER_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Drawer L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Drawer Level-3 cache without intervention" + }, + { + "EventCode": "152", + "EventName": "L1D_OFFDRAWER_SCOL_L4_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Same-Column L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-4 cache" + }, + { + "EventCode": "153", + "EventName": "L1D_OFFDRAWER_SCOL_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Drawer Same-Column L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-3 cache with intervention" + }, + { + "EventCode": "154", + "EventName": "L1D_OFFDRAWER_SCOL_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Same-Column L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-3 cache without intervention" + }, + { + "EventCode": "155", + "EventName": "L1D_OFFDRAWER_FCOL_L4_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Far-Column L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-4 cache" + }, + { + "EventCode": "156", + "EventName": "L1D_OFFDRAWER_FCOL_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Drawer Far-Column L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-3 cache with intervention" + }, + { + "EventCode": "157", + "EventName": "L1D_OFFDRAWER_FCOL_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Far-Column L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-3 cache without intervention" + }, + { + "EventCode": "158", + "EventName": "L1D_ONNODE_MEM_SOURCED_WRITES", + "BriefDescription": "L1D On-Node Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Node memory" + }, + { + "EventCode": "159", + "EventName": "L1D_ONDRAWER_MEM_SOURCED_WRITES", + "BriefDescription": "L1D On-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Drawer memory" + }, + { + "EventCode": "160", + "EventName": "L1D_OFFDRAWER_MEM_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Drawer memory" + }, + { + "EventCode": "161", + "EventName": "L1D_ONCHIP_MEM_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Chip memory" + }, + { + "EventCode": "162", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Chip Level-3 cache without intervention" + }, + { + "EventCode": "163", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On Chip Level-3 cache with intervention" + }, + { + "EventCode": "164", + "EventName": "L1I_ONNODE_L4_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Node Level-4 cache" + }, + { + "EventCode": "165", + "EventName": "L1I_ONNODE_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Node L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Node Level-3 cache with intervention" + }, + { + "EventCode": "166", + "EventName": "L1I_ONNODE_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Node L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Node Level-3 cache without intervention" + }, + { + "EventCode": "167", + "EventName": "L1I_ONDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1I On-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Drawer Level-4 cache" + }, + { + "EventCode": "168", + "EventName": "L1I_ONDRAWER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Drawer L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Drawer Level-3 cache with intervention" + }, + { + "EventCode": "169", + "EventName": "L1I_ONDRAWER_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Drawer L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Drawer Level-3 cache without intervention" + }, + { + "EventCode": "170", + "EventName": "L1I_OFFDRAWER_SCOL_L4_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Same-Column L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-4 cache" + }, + { + "EventCode": "171", + "EventName": "L1I_OFFDRAWER_SCOL_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Drawer Same-Column L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-3 cache with intervention" + }, + { + "EventCode": "172", + "EventName": "L1I_OFFDRAWER_SCOL_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Same-Column L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Same-Column Level-3 cache without intervention" + }, + { + "EventCode": "173", + "EventName": "L1I_OFFDRAWER_FCOL_L4_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Far-Column L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-4 cache" + }, + { + "EventCode": "174", + "EventName": "L1I_OFFDRAWER_FCOL_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Drawer Far-Column L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-3 cache with intervention" + }, + { + "EventCode": "175", + "EventName": "L1I_OFFDRAWER_FCOL_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Far-Column L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Far-Column Level-3 cache without intervention" + }, + { + "EventCode": "176", + "EventName": "L1I_ONNODE_MEM_SOURCED_WRITES", + "BriefDescription": "L1I On-Node Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Node memory" + }, + { + "EventCode": "177", + "EventName": "L1I_ONDRAWER_MEM_SOURCED_WRITES", + "BriefDescription": "L1I On-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Drawer memory" + }, + { + "EventCode": "178", + "EventName": "L1I_OFFDRAWER_MEM_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Drawer memory" + }, + { + "EventCode": "179", + "EventName": "L1I_ONCHIP_MEM_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Chip memory" + }, + { + "EventCode": "218", + "EventName": "TX_NC_TABORT", + "BriefDescription": "Aborted transactions in non-constrained TX mode", + "PublicDescription": "A transaction abort has occurred in a non-constrained transactional-execution mode" + }, + { + "EventCode": "219", + "EventName": "TX_C_TABORT_NO_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode not using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is not using any special logic to allow the transaction to complete" + }, + { + "EventCode": "220", + "EventName": "TX_C_TABORT_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is using special logic to allow the transaction to complete" + }, + { + "EventCode": "448", + "EventName": "MT_DIAG_CYCLES_ONE_THR_ACTIVE", + "BriefDescription": "Cycle count with one thread active", + "PublicDescription": "Cycle count with one thread active" + }, + { + "EventCode": "449", + "EventName": "MT_DIAG_CYCLES_TWO_THR_ACTIVE", + "BriefDescription": "Cycle count with two threads active", + "PublicDescription": "Cycle count with two threads active" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z14/basic.json b/tools/perf/pmu-events/arch/s390/cf_z14/basic.json new file mode 100644 index 000000000000..8f653c9d899d --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z14/basic.json @@ -0,0 +1,50 @@ +[ + { + "EventCode": "0", + "EventName": "CPU_CYCLES", + "BriefDescription": "CPU Cycles", + "PublicDescription": "Cycle Count" + }, + { + "EventCode": "1", + "EventName": "INSTRUCTIONS", + "BriefDescription": "Instructions", + "PublicDescription": "Instruction Count" + }, + { + "EventCode": "2", + "EventName": "L1I_DIR_WRITES", + "BriefDescription": "L1I Directory Writes", + "PublicDescription": "Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "3", + "EventName": "L1I_PENALTY_CYCLES", + "BriefDescription": "L1I Penalty Cycles", + "PublicDescription": "Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "4", + "EventName": "L1D_DIR_WRITES", + "BriefDescription": "L1D Directory Writes", + "PublicDescription": "Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "5", + "EventName": "L1D_PENALTY_CYCLES", + "BriefDescription": "L1D Penalty Cycles", + "PublicDescription": "Level-1 D-Cache Penalty Cycle Count" + }, + { + "EventCode": "32", + "EventName": "PROBLEM_STATE_CPU_CYCLES", + "BriefDescription": "Problem-State CPU Cycles", + "PublicDescription": "Problem-State Cycle Count" + }, + { + "EventCode": "33", + "EventName": "PROBLEM_STATE_INSTRUCTIONS", + "BriefDescription": "Problem-State Instructions", + "PublicDescription": "Problem-State Instruction Count" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z14/crypto.json b/tools/perf/pmu-events/arch/s390/cf_z14/crypto.json new file mode 100644 index 000000000000..7e5b72492141 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z14/crypto.json @@ -0,0 +1,98 @@ +[ + { + "EventCode": "64", + "EventName": "PRNG_FUNCTIONS", + "BriefDescription": "PRNG Functions", + "PublicDescription": "Total number of the PRNG functions issued by the CPU" + }, + { + "EventCode": "65", + "EventName": "PRNG_CYCLES", + "BriefDescription": "PRNG Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing PRNG functions issued by the CPU" + }, + { + "EventCode": "66", + "EventName": "PRNG_BLOCKED_FUNCTIONS", + "BriefDescription": "PRNG Blocked Functions", + "PublicDescription": "Total number of the PRNG functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "67", + "EventName": "PRNG_BLOCKED_CYCLES", + "BriefDescription": "PRNG Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the PRNG functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "68", + "EventName": "SHA_FUNCTIONS", + "BriefDescription": "SHA Functions", + "PublicDescription": "Total number of SHA functions issued by the CPU" + }, + { + "EventCode": "69", + "EventName": "SHA_CYCLES", + "BriefDescription": "SHA Cycles", + "PublicDescription": "Total number of CPU cycles when the SHA coprocessor is busy performing the SHA functions issued by the CPU" + }, + { + "EventCode": "70", + "EventName": "SHA_BLOCKED_FUNCTIONS", + "BriefDescription": "SHA Blocked Functions", + "PublicDescription": "Total number of the SHA functions that are issued by the CPU and are blocked because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "71", + "EventName": "SHA_BLOCKED_CYCLES", + "BriefDescription": "SHA Bloced Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the SHA functions issued by the CPU because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "72", + "EventName": "DEA_FUNCTIONS", + "BriefDescription": "DEA Functions", + "PublicDescription": "Total number of the DEA functions issued by the CPU" + }, + { + "EventCode": "73", + "EventName": "DEA_CYCLES", + "BriefDescription": "DEA Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the DEA functions issued by the CPU" + }, + { + "EventCode": "74", + "EventName": "DEA_BLOCKED_FUNCTIONS", + "BriefDescription": "DEA Blocked Functions", + "PublicDescription": "Total number of the DEA functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "75", + "EventName": "DEA_BLOCKED_CYCLES", + "BriefDescription": "DEA Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the DEA functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "76", + "EventName": "AES_FUNCTIONS", + "BriefDescription": "AES Functions", + "PublicDescription": "Total number of AES functions issued by the CPU" + }, + { + "EventCode": "77", + "EventName": "AES_CYCLES", + "BriefDescription": "AES Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the AES functions issued by the CPU" + }, + { + "EventCode": "78", + "EventName": "AES_BLOCKED_FUNCTIONS", + "BriefDescription": "AES Blocked Functions", + "PublicDescription": "Total number of AES functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "79", + "EventName": "AES_BLOCKED_CYCLES", + "BriefDescription": "AES Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the AES functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z14/extended.json b/tools/perf/pmu-events/arch/s390/cf_z14/extended.json new file mode 100644 index 000000000000..aa4dfb46b65b --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z14/extended.json @@ -0,0 +1,320 @@ +[ + { + "EventCode": "128", + "EventName": "L1D_RO_EXCL_WRITES", + "BriefDescription": "L1D Read-only Exclusive Writes", + "PublicDescription": "Counter:128 Name:L1D_RO_EXCL_WRITES A directory write to the Level-1 Data cache where the line was originally in a Read-Only state in the cache but has been updated to be in the Exclusive state that allows stores to the cache line" + }, + { + "EventCode": "129", + "EventName": "DTLB2_WRITES", + "BriefDescription": "DTLB2 Writes", + "PublicDescription": "A translation has been written into The Translation Lookaside Buffer 2 (TLB2) and the request was made by the data cache" + }, + { + "EventCode": "130", + "EventName": "DTLB2_MISSES", + "BriefDescription": "DTLB2 Misses", + "PublicDescription": "A TLB2 miss is in progress for a request made by the data cache. Incremented by one for every TLB2 miss in progress for the Level-1 Data cache on this cycle" + }, + { + "EventCode": "131", + "EventName": "DTLB2_HPAGE_WRITES", + "BriefDescription": "DTLB2 One-Megabyte Page Writes", + "PublicDescription": "A translation entry was written into the Combined Region and Segment Table Entry array in the Level-2 TLB for a one-megabyte page or a Last Host Translation was done" + }, + { + "EventCode": "132", + "EventName": "DTLB2_GPAGE_WRITES", + "BriefDescription": "DTLB2 Two-Gigabyte Page Writes", + "PublicDescription": "A translation entry for a two-gigabyte page was written into the Level-2 TLB" + }, + { + "EventCode": "133", + "EventName": "L1D_L2D_SOURCED_WRITES", + "BriefDescription": "L1D L2D Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from the Level-2 Data cache" + }, + { + "EventCode": "134", + "EventName": "ITLB2_WRITES", + "BriefDescription": "ITLB2 Writes", + "PublicDescription": "A translation entry has been written into the Translation Lookaside Buffer 2 (TLB2) and the request was made by the instruction cache" + }, + { + "EventCode": "135", + "EventName": "ITLB2_MISSES", + "BriefDescription": "ITLB2 Misses", + "PublicDescription": "A TLB2 miss is in progress for a request made by the instruction cache. Incremented by one for every TLB2 miss in progress for the Level-1 Instruction cache in a cycle" + }, + { + "EventCode": "136", + "EventName": "L1I_L2I_SOURCED_WRITES", + "BriefDescription": "L1I L2I Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from the Level-2 Instruction cache" + }, + { + "EventCode": "137", + "EventName": "TLB2_PTE_WRITES", + "BriefDescription": "TLB2 PTE Writes", + "PublicDescription": "A translation entry was written into the Page Table Entry array in the Level-2 TLB" + }, + { + "EventCode": "138", + "EventName": "TLB2_CRSTE_WRITES", + "BriefDescription": "TLB2 CRSTE Writes", + "PublicDescription": "Translation entries were written into the Combined Region and Segment Table Entry array and the Page Table Entry array in the Level-2 TLB" + }, + { + "EventCode": "139", + "EventName": "TLB2_ENGINES_BUSY", + "BriefDescription": "TLB2 Engines Busy", + "PublicDescription": "The number of Level-2 TLB translation engines busy in a cycle" + }, + { + "EventCode": "140", + "EventName": "TX_C_TEND", + "BriefDescription": "Completed TEND instructions in constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a constrained transactional-execution mode" + }, + { + "EventCode": "141", + "EventName": "TX_NC_TEND", + "BriefDescription": "Completed TEND instructions in non-constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a non-constrained transactional-execution mode" + }, + { + "EventCode": "143", + "EventName": "L1C_TLB2_MISSES", + "BriefDescription": "L1C TLB2 Misses", + "PublicDescription": "Increments by one for any cycle where a level-1 cache or level-2 TLB miss is in progress" + }, + { + "EventCode": "144", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Chip Level-3 cache without intervention" + }, + { + "EventCode": "145", + "EventName": "L1D_ONCHIP_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Chip memory" + }, + { + "EventCode": "146", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Chip Level-3 cache with intervention" + }, + { + "EventCode": "147", + "EventName": "L1D_ONCLUSTER_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Cluster L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Cluster Level-3 cache withountervention" + }, + { + "EventCode": "148", + "EventName": "L1D_ONCLUSTER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1D On-Cluster Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Cluster memory" + }, + { + "EventCode": "149", + "EventName": "L1D_ONCLUSTER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Cluster L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On-Cluster Level-3 cache with intervention" + }, + { + "EventCode": "150", + "EventName": "L1D_OFFCLUSTER_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Cluster L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Cluster Level-3 cache without intervention" + }, + { + "EventCode": "151", + "EventName": "L1D_OFFCLUSTER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1D Off-Cluster Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from Off-Cluster memory" + }, + { + "EventCode": "152", + "EventName": "L1D_OFFCLUSTER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Cluster L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Cluster Level-3 cache with intervention" + }, + { + "EventCode": "153", + "EventName": "L1D_OFFDRAWER_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Level-3 cache without intervention" + }, + { + "EventCode": "154", + "EventName": "L1D_OFFDRAWER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from Off-Drawer memory" + }, + { + "EventCode": "155", + "EventName": "L1D_OFFDRAWER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Drawer L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off-Drawer Level-3 cache with intervention" + }, + { + "EventCode": "156", + "EventName": "L1D_ONDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1D On-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Drawer Level-4 cache" + }, + { + "EventCode": "157", + "EventName": "L1D_OFFDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1D Off-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from Off-Drawer Level-4 cache" + }, + { + "EventCode": "158", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES_RO", + "BriefDescription": "L1D On-Chip L3 Sourced Writes read-only", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from On-Chip L3 but a read-only invalidate was done to remove other copies of the cache line" + }, + { + "EventCode": "162", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache ine was sourced from an On-Chip Level-3 cache without intervention" + }, + { + "EventCode": "163", + "EventName": "L1I_ONCHIP_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache ine was sourced from On-Chip memory" + }, + { + "EventCode": "164", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache ine was sourced from an On-Chip Level-3 cache with intervention" + }, + { + "EventCode": "165", + "EventName": "L1I_ONCLUSTER_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Cluster L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Cluster Level-3 cache without intervention" + }, + { + "EventCode": "166", + "EventName": "L1I_ONCLUSTER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1I On-Cluster Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On-Cluster memory" + }, + { + "EventCode": "167", + "EventName": "L1I_ONCLUSTER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Cluster L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Cluster Level-3 cache with intervention" + }, + { + "EventCode": "168", + "EventName": "L1I_OFFCLUSTER_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Cluster L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Cluster Level-3 cache without intervention" + }, + { + "EventCode": "169", + "EventName": "L1I_OFFCLUSTER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1I Off-Cluster Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from Off-Cluster memory" + }, + { + "EventCode": "170", + "EventName": "L1I_OFFCLUSTER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Cluster L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Cluster Level-3 cache with intervention" + }, + { + "EventCode": "171", + "EventName": "L1I_OFFDRAWER_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Level-3 cache without intervention" + }, + { + "EventCode": "172", + "EventName": "L1I_OFFDRAWER_MEMORY_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from Off-Drawer memory" + }, + { + "EventCode": "173", + "EventName": "L1I_OFFDRAWER_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Drawer L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off-Drawer Level-3 cache with intervention" + }, + { + "EventCode": "174", + "EventName": "L1I_ONDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1I On-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from On-Drawer Level-4 cache" + }, + { + "EventCode": "175", + "EventName": "L1I_OFFDRAWER_L4_SOURCED_WRITES", + "BriefDescription": "L1I Off-Drawer L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from Off-Drawer Level-4 cache" + }, + { + "EventCode": "224", + "EventName": "BCD_DFP_EXECUTION_SLOTS", + "BriefDescription": "BCD DFP Execution Slots", + "PublicDescription": "Count of floating point execution slots used for finished Binary Coded Decimal to Decimal Floating Point conversions. Instructions: CDZT, CXZT, CZDT, CZXT" + }, + { + "EventCode": "225", + "EventName": "VX_BCD_EXECUTION_SLOTS", + "BriefDescription": "VX BCD Execution Slots", + "PublicDescription": "Count of floating point execution slots used for finished vector arithmetic Binary Coded Decimal instructions. Instructions: VAP, VSP, VMPVMSP, VDP, VSDP, VRP, VLIP, VSRP, VPSOPVCP, VTP, VPKZ, VUPKZ, VCVB, VCVBG, VCVDVCVDG" + }, + { + "EventCode": "226", + "EventName": "DECIMAL_INSTRUCTIONS", + "BriefDescription": "Decimal Instructions", + "PublicDescription": "Decimal instructions dispatched. Instructions: CVB, CVD, AP, CP, DP, ED, EDMK, MP, SRP, SP, ZAP" + }, + { + "EventCode": "232", + "EventName": "LAST_HOST_TRANSLATIONS", + "BriefDescription": "Last host translation done", + "PublicDescription": "Last Host Translation done" + }, + { + "EventCode": "243", + "EventName": "TX_NC_TABORT", + "BriefDescription": "Aborted transactions in non-constrained TX mode", + "PublicDescription": "A transaction abort has occurred in a non-constrained transactional-execution mode" + }, + { + "EventCode": "244", + "EventName": "TX_C_TABORT_NO_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode not using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is not using any special logic to allow the transaction to complete" + }, + { + "EventCode": "245", + "EventName": "TX_C_TABORT_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is using special logic to allow the transaction to complete" + }, + { + "EventCode": "448", + "EventName": "MT_DIAG_CYCLES_ONE_THR_ACTIVE", + "BriefDescription": "Cycle count with one thread active", + "PublicDescription": "Cycle count with one thread active" + }, + { + "EventCode": "449", + "EventName": "MT_DIAG_CYCLES_TWO_THR_ACTIVE", + "BriefDescription": "Cycle count with two threads active", + "PublicDescription": "Cycle count with two threads active" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z196/basic.json b/tools/perf/pmu-events/arch/s390/cf_z196/basic.json new file mode 100644 index 000000000000..8bf16759ca53 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z196/basic.json @@ -0,0 +1,74 @@ +[ + { + "EventCode": "0", + "EventName": "CPU_CYCLES", + "BriefDescription": "CPU Cycles", + "PublicDescription": "Cycle Count" + }, + { + "EventCode": "1", + "EventName": "INSTRUCTIONS", + "BriefDescription": "Instructions", + "PublicDescription": "Instruction Count" + }, + { + "EventCode": "2", + "EventName": "L1I_DIR_WRITES", + "BriefDescription": "L1I Directory Writes", + "PublicDescription": "Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "3", + "EventName": "L1I_PENALTY_CYCLES", + "BriefDescription": "L1I Penalty Cycles", + "PublicDescription": "Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "4", + "EventName": "L1D_DIR_WRITES", + "BriefDescription": "L1D Directory Writes", + "PublicDescription": "Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "5", + "EventName": "L1D_PENALTY_CYCLES", + "BriefDescription": "L1D Penalty Cycles", + "PublicDescription": "Level-1 D-Cache Penalty Cycle Count" + }, + { + "EventCode": "32", + "EventName": "PROBLEM_STATE_CPU_CYCLES", + "BriefDescription": "Problem-State CPU Cycles", + "PublicDescription": "Problem-State Cycle Count" + }, + { + "EventCode": "33", + "EventName": "PROBLEM_STATE_INSTRUCTIONS", + "BriefDescription": "Problem-State Instructions", + "PublicDescription": "Problem-State Instruction Count" + }, + { + "EventCode": "34", + "EventName": "PROBLEM_STATE_L1I_DIR_WRITES", + "BriefDescription": "Problem-State L1I Directory Writes", + "PublicDescription": "Problem-State Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "35", + "EventName": "PROBLEM_STATE_L1I_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1I Penalty Cycles", + "PublicDescription": "Problem-State Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "36", + "EventName": "PROBLEM_STATE_L1D_DIR_WRITES", + "BriefDescription": "Problem-State L1D Directory Writes", + "PublicDescription": "Problem-State Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "37", + "EventName": "PROBLEM_STATE_L1D_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1D Penalty Cycles", + "PublicDescription": "Problem-State Level-1 D-Cache Penalty Cycle Count" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z196/crypto.json b/tools/perf/pmu-events/arch/s390/cf_z196/crypto.json new file mode 100644 index 000000000000..7e5b72492141 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z196/crypto.json @@ -0,0 +1,98 @@ +[ + { + "EventCode": "64", + "EventName": "PRNG_FUNCTIONS", + "BriefDescription": "PRNG Functions", + "PublicDescription": "Total number of the PRNG functions issued by the CPU" + }, + { + "EventCode": "65", + "EventName": "PRNG_CYCLES", + "BriefDescription": "PRNG Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing PRNG functions issued by the CPU" + }, + { + "EventCode": "66", + "EventName": "PRNG_BLOCKED_FUNCTIONS", + "BriefDescription": "PRNG Blocked Functions", + "PublicDescription": "Total number of the PRNG functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "67", + "EventName": "PRNG_BLOCKED_CYCLES", + "BriefDescription": "PRNG Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the PRNG functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "68", + "EventName": "SHA_FUNCTIONS", + "BriefDescription": "SHA Functions", + "PublicDescription": "Total number of SHA functions issued by the CPU" + }, + { + "EventCode": "69", + "EventName": "SHA_CYCLES", + "BriefDescription": "SHA Cycles", + "PublicDescription": "Total number of CPU cycles when the SHA coprocessor is busy performing the SHA functions issued by the CPU" + }, + { + "EventCode": "70", + "EventName": "SHA_BLOCKED_FUNCTIONS", + "BriefDescription": "SHA Blocked Functions", + "PublicDescription": "Total number of the SHA functions that are issued by the CPU and are blocked because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "71", + "EventName": "SHA_BLOCKED_CYCLES", + "BriefDescription": "SHA Bloced Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the SHA functions issued by the CPU because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "72", + "EventName": "DEA_FUNCTIONS", + "BriefDescription": "DEA Functions", + "PublicDescription": "Total number of the DEA functions issued by the CPU" + }, + { + "EventCode": "73", + "EventName": "DEA_CYCLES", + "BriefDescription": "DEA Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the DEA functions issued by the CPU" + }, + { + "EventCode": "74", + "EventName": "DEA_BLOCKED_FUNCTIONS", + "BriefDescription": "DEA Blocked Functions", + "PublicDescription": "Total number of the DEA functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "75", + "EventName": "DEA_BLOCKED_CYCLES", + "BriefDescription": "DEA Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the DEA functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "76", + "EventName": "AES_FUNCTIONS", + "BriefDescription": "AES Functions", + "PublicDescription": "Total number of AES functions issued by the CPU" + }, + { + "EventCode": "77", + "EventName": "AES_CYCLES", + "BriefDescription": "AES Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the AES functions issued by the CPU" + }, + { + "EventCode": "78", + "EventName": "AES_BLOCKED_FUNCTIONS", + "BriefDescription": "AES Blocked Functions", + "PublicDescription": "Total number of AES functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "79", + "EventName": "AES_BLOCKED_CYCLES", + "BriefDescription": "AES Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the AES functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_z196/extended.json b/tools/perf/pmu-events/arch/s390/cf_z196/extended.json new file mode 100644 index 000000000000..b6d7fec7c2e7 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_z196/extended.json @@ -0,0 +1,146 @@ +[ + { + "EventCode": "128", + "EventName": "L1D_L2_SOURCED_WRITES", + "BriefDescription": "L1D L2 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from the Level-2 cache" + }, + { + "EventCode": "129", + "EventName": "L1I_L2_SOURCED_WRITES", + "BriefDescription": "L1I L2 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from the Level-2 cache" + }, + { + "EventCode": "130", + "EventName": "DTLB1_MISSES", + "BriefDescription": "DTLB1 Misses", + "PublicDescription": "Level-1 Data TLB miss in progress. Incremented by one for every cycle a DTLB1 miss is in progress." + }, + { + "EventCode": "131", + "EventName": "ITLB1_MISSES", + "BriefDescription": "ITLB1 Misses", + "PublicDescription": "Level-1 Instruction TLB miss in progress. Incremented by one for every cycle a ITLB1 miss is in progress." + }, + { + "EventCode": "133", + "EventName": "L2C_STORES_SENT", + "BriefDescription": "L2C Stores Sent", + "PublicDescription": "Incremented by one for every store sent to Level-2 cache" + }, + { + "EventCode": "134", + "EventName": "L1D_OFFBOOK_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Book L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from an Off Book Level-3 cache" + }, + { + "EventCode": "135", + "EventName": "L1D_ONBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1D On-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from an On Book Level-4 cache" + }, + { + "EventCode": "136", + "EventName": "L1I_ONBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1I On-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from an On Book Level-4 cache" + }, + { + "EventCode": "137", + "EventName": "L1D_RO_EXCL_WRITES", + "BriefDescription": "L1D Read-only Exclusive Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache where the line was originally in a Read-Only state in the cache but has been updated to be in the Exclusive state that allows stores to the cache line" + }, + { + "EventCode": "138", + "EventName": "L1D_OFFBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1D Off-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from an Off Book Level-4 cache" + }, + { + "EventCode": "139", + "EventName": "L1I_OFFBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1I Off-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from an Off Book Level-4 cache" + }, + { + "EventCode": "140", + "EventName": "DTLB1_HPAGE_WRITES", + "BriefDescription": "DTLB1 One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer for a one-megabyte page" + }, + { + "EventCode": "141", + "EventName": "L1D_LMEM_SOURCED_WRITES", + "BriefDescription": "L1D Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache where the installed cache line was sourced from memory that is attached to the same book as the Data cache (Local Memory)" + }, + { + "EventCode": "142", + "EventName": "L1I_LMEM_SOURCED_WRITES", + "BriefDescription": "L1I Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache where the installed cache line was sourced from memory that is attached to the same book as the Instruction cache (Local Memory)" + }, + { + "EventCode": "143", + "EventName": "L1I_OFFBOOK_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Book L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from an Off Book Level-3 cache" + }, + { + "EventCode": "144", + "EventName": "DTLB1_WRITES", + "BriefDescription": "DTLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer" + }, + { + "EventCode": "145", + "EventName": "ITLB1_WRITES", + "BriefDescription": "ITLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Instruction Translation Lookaside Buffer" + }, + { + "EventCode": "146", + "EventName": "TLB2_PTE_WRITES", + "BriefDescription": "TLB2 PTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Page Table Entry arrays" + }, + { + "EventCode": "147", + "EventName": "TLB2_CRSTE_HPAGE_WRITES", + "BriefDescription": "TLB2 CRSTE One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays for a one-megabyte large page translation" + }, + { + "EventCode": "148", + "EventName": "TLB2_CRSTE_WRITES", + "BriefDescription": "TLB2 CRSTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays" + }, + { + "EventCode": "150", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from an On Chip Level-3 cache" + }, + { + "EventCode": "152", + "EventName": "L1D_OFFCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache" + }, + { + "EventCode": "153", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from an On Chip Level-3 cache" + }, + { + "EventCode": "155", + "EventName": "L1I_OFFCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 I-Cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_zec12/basic.json b/tools/perf/pmu-events/arch/s390/cf_zec12/basic.json new file mode 100644 index 000000000000..8bf16759ca53 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_zec12/basic.json @@ -0,0 +1,74 @@ +[ + { + "EventCode": "0", + "EventName": "CPU_CYCLES", + "BriefDescription": "CPU Cycles", + "PublicDescription": "Cycle Count" + }, + { + "EventCode": "1", + "EventName": "INSTRUCTIONS", + "BriefDescription": "Instructions", + "PublicDescription": "Instruction Count" + }, + { + "EventCode": "2", + "EventName": "L1I_DIR_WRITES", + "BriefDescription": "L1I Directory Writes", + "PublicDescription": "Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "3", + "EventName": "L1I_PENALTY_CYCLES", + "BriefDescription": "L1I Penalty Cycles", + "PublicDescription": "Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "4", + "EventName": "L1D_DIR_WRITES", + "BriefDescription": "L1D Directory Writes", + "PublicDescription": "Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "5", + "EventName": "L1D_PENALTY_CYCLES", + "BriefDescription": "L1D Penalty Cycles", + "PublicDescription": "Level-1 D-Cache Penalty Cycle Count" + }, + { + "EventCode": "32", + "EventName": "PROBLEM_STATE_CPU_CYCLES", + "BriefDescription": "Problem-State CPU Cycles", + "PublicDescription": "Problem-State Cycle Count" + }, + { + "EventCode": "33", + "EventName": "PROBLEM_STATE_INSTRUCTIONS", + "BriefDescription": "Problem-State Instructions", + "PublicDescription": "Problem-State Instruction Count" + }, + { + "EventCode": "34", + "EventName": "PROBLEM_STATE_L1I_DIR_WRITES", + "BriefDescription": "Problem-State L1I Directory Writes", + "PublicDescription": "Problem-State Level-1 I-Cache Directory Write Count" + }, + { + "EventCode": "35", + "EventName": "PROBLEM_STATE_L1I_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1I Penalty Cycles", + "PublicDescription": "Problem-State Level-1 I-Cache Penalty Cycle Count" + }, + { + "EventCode": "36", + "EventName": "PROBLEM_STATE_L1D_DIR_WRITES", + "BriefDescription": "Problem-State L1D Directory Writes", + "PublicDescription": "Problem-State Level-1 D-Cache Directory Write Count" + }, + { + "EventCode": "37", + "EventName": "PROBLEM_STATE_L1D_PENALTY_CYCLES", + "BriefDescription": "Problem-State L1D Penalty Cycles", + "PublicDescription": "Problem-State Level-1 D-Cache Penalty Cycle Count" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_zec12/crypto.json b/tools/perf/pmu-events/arch/s390/cf_zec12/crypto.json new file mode 100644 index 000000000000..7e5b72492141 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_zec12/crypto.json @@ -0,0 +1,98 @@ +[ + { + "EventCode": "64", + "EventName": "PRNG_FUNCTIONS", + "BriefDescription": "PRNG Functions", + "PublicDescription": "Total number of the PRNG functions issued by the CPU" + }, + { + "EventCode": "65", + "EventName": "PRNG_CYCLES", + "BriefDescription": "PRNG Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing PRNG functions issued by the CPU" + }, + { + "EventCode": "66", + "EventName": "PRNG_BLOCKED_FUNCTIONS", + "BriefDescription": "PRNG Blocked Functions", + "PublicDescription": "Total number of the PRNG functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "67", + "EventName": "PRNG_BLOCKED_CYCLES", + "BriefDescription": "PRNG Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the PRNG functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "68", + "EventName": "SHA_FUNCTIONS", + "BriefDescription": "SHA Functions", + "PublicDescription": "Total number of SHA functions issued by the CPU" + }, + { + "EventCode": "69", + "EventName": "SHA_CYCLES", + "BriefDescription": "SHA Cycles", + "PublicDescription": "Total number of CPU cycles when the SHA coprocessor is busy performing the SHA functions issued by the CPU" + }, + { + "EventCode": "70", + "EventName": "SHA_BLOCKED_FUNCTIONS", + "BriefDescription": "SHA Blocked Functions", + "PublicDescription": "Total number of the SHA functions that are issued by the CPU and are blocked because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "71", + "EventName": "SHA_BLOCKED_CYCLES", + "BriefDescription": "SHA Bloced Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the SHA functions issued by the CPU because the SHA coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "72", + "EventName": "DEA_FUNCTIONS", + "BriefDescription": "DEA Functions", + "PublicDescription": "Total number of the DEA functions issued by the CPU" + }, + { + "EventCode": "73", + "EventName": "DEA_CYCLES", + "BriefDescription": "DEA Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the DEA functions issued by the CPU" + }, + { + "EventCode": "74", + "EventName": "DEA_BLOCKED_FUNCTIONS", + "BriefDescription": "DEA Blocked Functions", + "PublicDescription": "Total number of the DEA functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "75", + "EventName": "DEA_BLOCKED_CYCLES", + "BriefDescription": "DEA Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the DEA functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "76", + "EventName": "AES_FUNCTIONS", + "BriefDescription": "AES Functions", + "PublicDescription": "Total number of AES functions issued by the CPU" + }, + { + "EventCode": "77", + "EventName": "AES_CYCLES", + "BriefDescription": "AES Cycles", + "PublicDescription": "Total number of CPU cycles when the DEA/AES coprocessor is busy performing the AES functions issued by the CPU" + }, + { + "EventCode": "78", + "EventName": "AES_BLOCKED_FUNCTIONS", + "BriefDescription": "AES Blocked Functions", + "PublicDescription": "Total number of AES functions that are issued by the CPU and are blocked because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, + { + "EventCode": "79", + "EventName": "AES_BLOCKED_CYCLES", + "BriefDescription": "AES Blocked Cycles", + "PublicDescription": "Total number of CPU cycles blocked for the AES functions issued by the CPU because the DEA/AES coprocessor is busy performing a function issued by another CPU" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/cf_zec12/extended.json b/tools/perf/pmu-events/arch/s390/cf_zec12/extended.json new file mode 100644 index 000000000000..8682126aabb2 --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/cf_zec12/extended.json @@ -0,0 +1,212 @@ +[ + { + "EventCode": "128", + "EventName": "DTLB1_MISSES", + "BriefDescription": "DTLB1 Misses", + "PublicDescription": "Level-1 Data TLB miss in progress. Incremented by one for every cycle a DTLB1 miss is in progress." + }, + { + "EventCode": "129", + "EventName": "ITLB1_MISSES", + "BriefDescription": "ITLB1 Misses", + "PublicDescription": "Level-1 Instruction TLB miss in progress. Incremented by one for every cycle a ITLB1 miss is in progress." + }, + { + "EventCode": "130", + "EventName": "L1D_L2I_SOURCED_WRITES", + "BriefDescription": "L1D L2I Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from the Level-2 Instruction cache" + }, + { + "EventCode": "131", + "EventName": "L1I_L2I_SOURCED_WRITES", + "BriefDescription": "L1I L2I Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from the Level-2 Instruction cache" + }, + { + "EventCode": "132", + "EventName": "L1D_L2D_SOURCED_WRITES", + "BriefDescription": "L1D L2D Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from the Level-2 Data cache" + }, + { + "EventCode": "133", + "EventName": "DTLB1_WRITES", + "BriefDescription": "DTLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer" + }, + { + "EventCode": "135", + "EventName": "L1D_LMEM_SOURCED_WRITES", + "BriefDescription": "L1D Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache where the installed cache line was sourced from memory that is attached to the same book as the Data cache (Local Memory)" + }, + { + "EventCode": "137", + "EventName": "L1I_LMEM_SOURCED_WRITES", + "BriefDescription": "L1I Local Memory Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache where the installed cache line was sourced from memory that is attached to the same book as the Instruction cache (Local Memory)" + }, + { + "EventCode": "138", + "EventName": "L1D_RO_EXCL_WRITES", + "BriefDescription": "L1D Read-only Exclusive Writes", + "PublicDescription": "A directory write to the Level-1 D-Cache where the line was originally in a Read-Only state in the cache but has been updated to be in the Exclusive state that allows stores to the cache line" + }, + { + "EventCode": "139", + "EventName": "DTLB1_HPAGE_WRITES", + "BriefDescription": "DTLB1 One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Data Translation Lookaside Buffer for a one-megabyte page" + }, + { + "EventCode": "140", + "EventName": "ITLB1_WRITES", + "BriefDescription": "ITLB1 Writes", + "PublicDescription": "A translation entry has been written to the Level-1 Instruction Translation Lookaside Buffer" + }, + { + "EventCode": "141", + "EventName": "TLB2_PTE_WRITES", + "BriefDescription": "TLB2 PTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Page Table Entry arrays" + }, + { + "EventCode": "142", + "EventName": "TLB2_CRSTE_HPAGE_WRITES", + "BriefDescription": "TLB2 CRSTE One-Megabyte Page Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays for a one-megabyte large page translation" + }, + { + "EventCode": "143", + "EventName": "TLB2_CRSTE_WRITES", + "BriefDescription": "TLB2 CRSTE Writes", + "PublicDescription": "A translation entry has been written to the Level-2 TLB Common Region Segment Table Entry arrays" + }, + { + "EventCode": "144", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On Chip Level-3 cache without intervention" + }, + { + "EventCode": "145", + "EventName": "L1D_OFFCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache without intervention" + }, + { + "EventCode": "146", + "EventName": "L1D_OFFBOOK_L3_SOURCED_WRITES", + "BriefDescription": "L1D Off-Book L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off Book Level-3 cache without intervention" + }, + { + "EventCode": "147", + "EventName": "L1D_ONBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1D On-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an On Book Level-4 cache" + }, + { + "EventCode": "148", + "EventName": "L1D_OFFBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1D Off-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off Book Level-4 cache" + }, + { + "EventCode": "149", + "EventName": "TX_NC_TEND", + "BriefDescription": "Completed TEND instructions in non-constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a nonconstrained transactional-execution mode" + }, + { + "EventCode": "150", + "EventName": "L1D_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from a On Chip Level-3 cache with intervention" + }, + { + "EventCode": "151", + "EventName": "L1D_OFFCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache with intervention" + }, + { + "EventCode": "152", + "EventName": "L1D_OFFBOOK_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1D Off-Book L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Data cache directory where the returned cache line was sourced from an Off Book Level-3 cache with intervention" + }, + { + "EventCode": "153", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I On-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On Chip Level-3 cache without intervention" + }, + { + "EventCode": "154", + "EventName": "L1I_OFFCHIP_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Chip L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache without intervention" + }, + { + "EventCode": "155", + "EventName": "L1I_OFFBOOK_L3_SOURCED_WRITES", + "BriefDescription": "L1I Off-Book L3 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off Book Level-3 cache without intervention" + }, + { + "EventCode": "156", + "EventName": "L1I_ONBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1I On-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On Book Level-4 cache" + }, + { + "EventCode": "157", + "EventName": "L1I_OFFBOOK_L4_SOURCED_WRITES", + "BriefDescription": "L1I Off-Book L4 Sourced Writes", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off Book Level-4 cache" + }, + { + "EventCode": "158", + "EventName": "TX_C_TEND", + "BriefDescription": "Completed TEND instructions in constrained TX mode", + "PublicDescription": "A TEND instruction has completed in a constrained transactional-execution mode" + }, + { + "EventCode": "159", + "EventName": "L1I_ONCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I On-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an On Chip Level-3 cache with intervention" + }, + { + "EventCode": "160", + "EventName": "L1I_OFFCHIP_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Chip L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off Chip/On Book Level-3 cache with intervention" + }, + { + "EventCode": "161", + "EventName": "L1I_OFFBOOK_L3_SOURCED_WRITES_IV", + "BriefDescription": "L1I Off-Book L3 Sourced Writes with Intervention", + "PublicDescription": "A directory write to the Level-1 Instruction cache directory where the returned cache line was sourced from an Off Book Level-3 cache with intervention" + }, + { + "EventCode": "177", + "EventName": "TX_NC_TABORT", + "BriefDescription": "Aborted transactions in non-constrained TX mode", + "PublicDescription": "A transaction abort has occurred in a nonconstrained transactional-execution mode" + }, + { + "EventCode": "178", + "EventName": "TX_C_TABORT_NO_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode not using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is not using any special logic to allow the transaction to complete" + }, + { + "EventCode": "179", + "EventName": "TX_C_TABORT_SPECIAL", + "BriefDescription": "Aborted transactions in constrained TX mode using special completion logic", + "PublicDescription": "A transaction abort has occurred in a constrained transactional-execution mode and the CPU is using special logic to allow the transaction to complete" + }, +] diff --git a/tools/perf/pmu-events/arch/s390/mapfile.csv b/tools/perf/pmu-events/arch/s390/mapfile.csv new file mode 100644 index 000000000000..ca7682748a4b --- /dev/null +++ b/tools/perf/pmu-events/arch/s390/mapfile.csv @@ -0,0 +1,6 @@ +Family-model,Version,Filename,EventType +209[78],1,cf_z10,core +281[78],1,cf_z196,core +282[78],1,cf_zec12,core +296[45],1,cf_z13,core +3906,3,cf_z14,core diff --git a/tools/perf/pmu-events/jevents.c b/tools/perf/pmu-events/jevents.c index b578aa26e375..db3a594ee1e4 100644 --- a/tools/perf/pmu-events/jevents.c +++ b/tools/perf/pmu-events/jevents.c @@ -39,11 +39,13 @@ #include <unistd.h> #include <stdarg.h> #include <libgen.h> +#include <limits.h> #include <dirent.h> #include <sys/time.h> /* getrlimit */ #include <sys/resource.h> /* getrlimit */ #include <ftw.h> #include <sys/stat.h> +#include <linux/list.h> #include "jsmn.h" #include "json.h" #include "jevents.h" @@ -249,31 +251,25 @@ static const char *field_to_perf(struct map *table, char *map, jsmntok_t *val) jsmntok_t *loc = (t); \ if (!(t)->start && (t) > tokens) \ loc = (t) - 1; \ - pr_err("%s:%d: " m ", got %s\n", fn, \ - json_line(map, loc), \ - json_name(t)); \ + pr_err("%s:%d: " m ", got %s\n", fn, \ + json_line(map, loc), \ + json_name(t)); \ + err = -EIO; \ goto out_free; \ } } while (0) -#define TOPIC_DEPTH 256 -static char *topic_array[TOPIC_DEPTH]; -static int topic_level; +static char *topic; static char *get_topic(void) { - char *tp_old, *tp = NULL; + char *tp; int i; - for (i = 0; i < topic_level + 1; i++) { - int n; - - tp_old = tp; - n = asprintf(&tp, "%s%s", tp ?: "", topic_array[i]); - if (n < 0) { - pr_info("%s: asprintf() error %s\n", prog); - return NULL; - } - free(tp_old); + /* tp is free'd in process_one_file() */ + i = asprintf(&tp, "%s", topic); + if (i < 0) { + pr_info("%s: asprintf() error %s\n", prog); + return NULL; } for (i = 0; i < (int) strlen(tp); i++) { @@ -290,25 +286,15 @@ static char *get_topic(void) return tp; } -static int add_topic(int level, char *bname) +static int add_topic(char *bname) { - char *topic; - - level -= 2; - - if (level >= TOPIC_DEPTH) - return -EINVAL; - + free(topic); topic = strdup(bname); if (!topic) { pr_info("%s: strdup() error %s for file %s\n", prog, strerror(errno), bname); return -ENOMEM; } - - free(topic_array[topic_level]); - topic_array[topic_level] = topic; - topic_level = level; return 0; } @@ -366,6 +352,81 @@ static int print_events_table_entry(void *data, char *name, char *event, return 0; } +struct event_struct { + struct list_head list; + char *name; + char *event; + char *desc; + char *long_desc; + char *pmu; + char *unit; + char *perpkg; + char *metric_expr; + char *metric_name; + char *metric_group; +}; + +#define ADD_EVENT_FIELD(field) do { if (field) { \ + es->field = strdup(field); \ + if (!es->field) \ + goto out_free; \ +} } while (0) + +#define FREE_EVENT_FIELD(field) free(es->field) + +#define TRY_FIXUP_FIELD(field) do { if (es->field && !*field) {\ + *field = strdup(es->field); \ + if (!*field) \ + return -ENOMEM; \ +} } while (0) + +#define FOR_ALL_EVENT_STRUCT_FIELDS(op) do { \ + op(name); \ + op(event); \ + op(desc); \ + op(long_desc); \ + op(pmu); \ + op(unit); \ + op(perpkg); \ + op(metric_expr); \ + op(metric_name); \ + op(metric_group); \ +} while (0) + +static LIST_HEAD(arch_std_events); + +static void free_arch_std_events(void) +{ + struct event_struct *es, *next; + + list_for_each_entry_safe(es, next, &arch_std_events, list) { + FOR_ALL_EVENT_STRUCT_FIELDS(FREE_EVENT_FIELD); + list_del(&es->list); + free(es); + } +} + +static int save_arch_std_events(void *data, char *name, char *event, + char *desc, char *long_desc, char *pmu, + char *unit, char *perpkg, char *metric_expr, + char *metric_name, char *metric_group) +{ + struct event_struct *es; + struct stat *sb = data; + + es = malloc(sizeof(*es)); + if (!es) + return -ENOMEM; + memset(es, 0, sizeof(*es)); + FOR_ALL_EVENT_STRUCT_FIELDS(ADD_EVENT_FIELD); + list_add_tail(&es->list, &arch_std_events); + return 0; +out_free: + FOR_ALL_EVENT_STRUCT_FIELDS(FREE_EVENT_FIELD); + free(es); + return -ENOMEM; +} + static void print_events_table_suffix(FILE *outfp) { fprintf(outfp, "{\n"); @@ -407,6 +468,32 @@ static char *real_event(const char *name, char *event) return event; } +static int +try_fixup(const char *fn, char *arch_std, char **event, char **desc, + char **name, char **long_desc, char **pmu, char **filter, + char **perpkg, char **unit, char **metric_expr, char **metric_name, + char **metric_group, unsigned long long eventcode) +{ + /* try to find matching event from arch standard values */ + struct event_struct *es; + + list_for_each_entry(es, &arch_std_events, list) { + if (!strcmp(arch_std, es->name)) { + if (!eventcode && es->event) { + /* allow EventCode to be overridden */ + free(*event); + *event = NULL; + } + FOR_ALL_EVENT_STRUCT_FIELDS(TRY_FIXUP_FIELD); + return 0; + } + } + + pr_err("%s: could not find matching %s for %s\n", + prog, arch_std, fn); + return -1; +} + /* Call func with each event in the json file */ int json_events(const char *fn, int (*func)(void *data, char *name, char *event, char *desc, @@ -416,7 +503,7 @@ int json_events(const char *fn, char *metric_name, char *metric_group), void *data) { - int err = -EIO; + int err; size_t size; jsmntok_t *tokens, *tok; int i, j, len; @@ -442,6 +529,7 @@ int json_events(const char *fn, char *metric_expr = NULL; char *metric_name = NULL; char *metric_group = NULL; + char *arch_std = NULL; unsigned long long eventcode = 0; struct msrmap *msr = NULL; jsmntok_t *msrval = NULL; @@ -527,6 +615,10 @@ int json_events(const char *fn, addfield(map, &metric_expr, "", "", val); for (s = metric_expr; *s; s++) *s = tolower(*s); + } else if (json_streq(map, field, "ArchStdEvent")) { + addfield(map, &arch_std, "", "", val); + for (s = arch_std; *s; s++) + *s = tolower(*s); } /* ignore unknown fields */ } @@ -551,8 +643,21 @@ int json_events(const char *fn, if (name) fixname(name); + if (arch_std) { + /* + * An arch standard event is referenced, so try to + * fixup any unassigned values. + */ + err = try_fixup(fn, arch_std, &event, &desc, &name, + &long_desc, &pmu, &filter, &perpkg, + &unit, &metric_expr, &metric_name, + &metric_group, eventcode); + if (err) + goto free_strings; + } err = func(data, name, real_event(name, event), desc, long_desc, pmu, unit, perpkg, metric_expr, metric_name, metric_group); +free_strings: free(event); free(desc); free(name); @@ -565,6 +670,8 @@ int json_events(const char *fn, free(metric_expr); free(metric_name); free(metric_group); + free(arch_std); + if (err) break; tok += j; @@ -588,7 +695,7 @@ static char *file_name_to_table_name(char *fname) * Derive rest of table name from basename of the JSON file, * replacing hyphens and stripping out .json suffix. */ - n = asprintf(&tblname, "pme_%s", basename(fname)); + n = asprintf(&tblname, "pme_%s", fname); if (n < 0) { pr_info("%s: asprintf() error %s for file %s\n", prog, strerror(errno), fname); @@ -598,7 +705,7 @@ static char *file_name_to_table_name(char *fname) for (i = 0; i < strlen(tblname); i++) { c = tblname[i]; - if (c == '-') + if (c == '-' || c == '/') tblname[i] = '_'; else if (c == '.') { tblname[i] = '\0'; @@ -755,25 +862,106 @@ static int get_maxfds(void) static FILE *eventsfp; static char *mapfile; +static int is_leaf_dir(const char *fpath) +{ + DIR *d; + struct dirent *dir; + int res = 1; + + d = opendir(fpath); + if (!d) + return 0; + + while ((dir = readdir(d)) != NULL) { + if (!strcmp(dir->d_name, ".") || !strcmp(dir->d_name, "..")) + continue; + + if (dir->d_type == DT_DIR) { + res = 0; + break; + } else if (dir->d_type == DT_UNKNOWN) { + char path[PATH_MAX]; + struct stat st; + + sprintf(path, "%s/%s", fpath, dir->d_name); + if (stat(path, &st)) + break; + + if (S_ISDIR(st.st_mode)) { + res = 0; + break; + } + } + } + + closedir(d); + + return res; +} + +static int is_json_file(const char *name) +{ + const char *suffix; + + if (strlen(name) < 5) + return 0; + + suffix = name + strlen(name) - 5; + + if (strncmp(suffix, ".json", 5) == 0) + return 1; + return 0; +} + +static int preprocess_arch_std_files(const char *fpath, const struct stat *sb, + int typeflag, struct FTW *ftwbuf) +{ + int level = ftwbuf->level; + int is_file = typeflag == FTW_F; + + if (level == 1 && is_file && is_json_file(fpath)) + return json_events(fpath, save_arch_std_events, (void *)sb); + + return 0; +} + static int process_one_file(const char *fpath, const struct stat *sb, int typeflag, struct FTW *ftwbuf) { - char *tblname, *bname = (char *) fpath + ftwbuf->base; + char *tblname, *bname; int is_dir = typeflag == FTW_D; int is_file = typeflag == FTW_F; int level = ftwbuf->level; int err = 0; + if (level == 2 && is_dir) { + /* + * For level 2 directory, bname will include parent name, + * like vendor/platform. So search back from platform dir + * to find this. + */ + bname = (char *) fpath + ftwbuf->base - 2; + for (;;) { + if (*bname == '/') + break; + bname--; + } + bname++; + } else + bname = (char *) fpath + ftwbuf->base; + pr_debug("%s %d %7jd %-20s %s\n", is_file ? "f" : is_dir ? "d" : "x", level, sb->st_size, bname, fpath); - /* base dir */ - if (level == 0) + /* base dir or too deep */ + if (level == 0 || level > 3) return 0; + /* model directory, reset topic */ - if (level == 1 && is_dir) { + if ((level == 1 && is_dir && is_leaf_dir(fpath)) || + (level == 2 && is_dir)) { if (close_table) print_events_table_suffix(eventsfp); @@ -798,16 +986,10 @@ static int process_one_file(const char *fpath, const struct stat *sb, * after processing all JSON files (so we can write out the * mapping table after all PMU events tables). * - * TODO: Allow for multiple mapfiles? Punt for now. */ if (level == 1 && is_file) { - if (!strncmp(bname, "mapfile.csv", 11)) { - if (mapfile) { - pr_info("%s: Many mapfiles? Using %s, ignoring %s\n", - prog, mapfile, fpath); - } else { - mapfile = strdup(fpath); - } + if (!strcmp(bname, "mapfile.csv")) { + mapfile = strdup(fpath); return 0; } @@ -820,16 +1002,14 @@ static int process_one_file(const char *fpath, const struct stat *sb, * ignore it. It could be a readme.txt for instance. */ if (is_file) { - char *suffix = bname + strlen(bname) - 5; - - if (strncmp(suffix, ".json", 5)) { + if (!is_json_file(bname)) { pr_info("%s: Ignoring file without .json suffix %s\n", prog, fpath); return 0; } } - if (level > 1 && add_topic(level, bname)) + if (level > 1 && add_topic(bname)) return -ENOMEM; /* @@ -928,12 +1108,26 @@ int main(int argc, char *argv[]) maxfds = get_maxfds(); mapfile = NULL; + rc = nftw(ldirname, preprocess_arch_std_files, maxfds, 0); + if (rc && verbose) { + pr_info("%s: Error preprocessing arch standard files %s\n", + prog, ldirname); + goto empty_map; + } else if (rc < 0) { + /* Make build fail */ + free_arch_std_events(); + return 1; + } else if (rc) { + goto empty_map; + } + rc = nftw(ldirname, process_one_file, maxfds, 0); if (rc && verbose) { pr_info("%s: Error walking file tree %s\n", prog, ldirname); goto empty_map; } else if (rc < 0) { /* Make build fail */ + free_arch_std_events(); return 1; } else if (rc) { goto empty_map; @@ -958,5 +1152,6 @@ int main(int argc, char *argv[]) empty_map: fclose(eventsfp); create_empty_mapping(output_file); + free_arch_std_events(); return 0; } diff --git a/tools/perf/python/twatch.py b/tools/perf/python/twatch.py index c235c22b107a..0a29c5c3079f 100755 --- a/tools/perf/python/twatch.py +++ b/tools/perf/python/twatch.py @@ -42,10 +42,10 @@ def main(context_switch = 0, thread = -1): event = evlist.read_on_cpu(cpu) if not event: continue - print "cpu: %2d, pid: %4d, tid: %4d" % (event.sample_cpu, - event.sample_pid, - event.sample_tid), - print event + print("cpu: {0}, pid: {1}, tid: {2} {3}".format(event.sample_cpu, + event.sample_pid, + event.sample_tid, + event)) if __name__ == '__main__': """ diff --git a/tools/perf/scripts/python/Perf-Trace-Util/Context.c b/tools/perf/scripts/python/Perf-Trace-Util/Context.c index fcd1dd667906..1a0d27757eec 100644 --- a/tools/perf/scripts/python/Perf-Trace-Util/Context.c +++ b/tools/perf/scripts/python/Perf-Trace-Util/Context.c @@ -23,7 +23,17 @@ #include "../../../perf.h" #include "../../../util/trace-event.h" +#if PY_MAJOR_VERSION < 3 +#define _PyCapsule_GetPointer(arg1, arg2) \ + PyCObject_AsVoidPtr(arg1) + PyMODINIT_FUNC initperf_trace_context(void); +#else +#define _PyCapsule_GetPointer(arg1, arg2) \ + PyCapsule_GetPointer((arg1), (arg2)) + +PyMODINIT_FUNC PyInit_perf_trace_context(void); +#endif static PyObject *perf_trace_context_common_pc(PyObject *obj, PyObject *args) { @@ -34,7 +44,7 @@ static PyObject *perf_trace_context_common_pc(PyObject *obj, PyObject *args) if (!PyArg_ParseTuple(args, "O", &context)) return NULL; - scripting_context = PyCObject_AsVoidPtr(context); + scripting_context = _PyCapsule_GetPointer(context, NULL); retval = common_pc(scripting_context); return Py_BuildValue("i", retval); @@ -50,7 +60,7 @@ static PyObject *perf_trace_context_common_flags(PyObject *obj, if (!PyArg_ParseTuple(args, "O", &context)) return NULL; - scripting_context = PyCObject_AsVoidPtr(context); + scripting_context = _PyCapsule_GetPointer(context, NULL); retval = common_flags(scripting_context); return Py_BuildValue("i", retval); @@ -66,7 +76,7 @@ static PyObject *perf_trace_context_common_lock_depth(PyObject *obj, if (!PyArg_ParseTuple(args, "O", &context)) return NULL; - scripting_context = PyCObject_AsVoidPtr(context); + scripting_context = _PyCapsule_GetPointer(context, NULL); retval = common_lock_depth(scripting_context); return Py_BuildValue("i", retval); @@ -82,7 +92,25 @@ static PyMethodDef ContextMethods[] = { { NULL, NULL, 0, NULL} }; +#if PY_MAJOR_VERSION < 3 PyMODINIT_FUNC initperf_trace_context(void) { (void) Py_InitModule("perf_trace_context", ContextMethods); } +#else +PyMODINIT_FUNC PyInit_perf_trace_context(void) +{ + static struct PyModuleDef moduledef = { + PyModuleDef_HEAD_INIT, + "perf_trace_context", /* m_name */ + "", /* m_doc */ + -1, /* m_size */ + ContextMethods, /* m_methods */ + NULL, /* m_reload */ + NULL, /* m_traverse */ + NULL, /* m_clear */ + NULL, /* m_free */ + }; + return PyModule_Create(&moduledef); +} +#endif diff --git a/tools/perf/tests/Build b/tools/perf/tests/Build index 87bf3edb037c..6c108fa79ae3 100644 --- a/tools/perf/tests/Build +++ b/tools/perf/tests/Build @@ -20,6 +20,7 @@ perf-y += hists_cumulate.o perf-y += python-use.o perf-y += bp_signal.o perf-y += bp_signal_overflow.o +perf-y += bp_account.o perf-y += task-exit.o perf-y += sw-clock.o perf-y += mmap-thread-lookup.o @@ -47,6 +48,7 @@ perf-y += bitmap.o perf-y += perf-hooks.o perf-y += clang.o perf-y += unit_number__scnprintf.o +perf-y += mem2node.o $(OUTPUT)tests/llvm-src-base.c: tests/bpf-script-example.c tests/Build $(call rule_mkdir) diff --git a/tools/perf/tests/attr.c b/tools/perf/tests/attr.c index 97f64ad7fa08..05dfe11c2f9e 100644 --- a/tools/perf/tests/attr.c +++ b/tools/perf/tests/attr.c @@ -170,8 +170,8 @@ static int run_dir(const char *d, const char *perf) if (verbose > 0) vcnt++; - snprintf(cmd, 3*PATH_MAX, PYTHON " %s/attr.py -d %s/attr/ -p %s %.*s", - d, d, perf, vcnt, v); + scnprintf(cmd, 3*PATH_MAX, PYTHON " %s/attr.py -d %s/attr/ -p %s %.*s", + d, d, perf, vcnt, v); return system(cmd) ? TEST_FAIL : TEST_OK; } diff --git a/tools/perf/tests/backward-ring-buffer.c b/tools/perf/tests/backward-ring-buffer.c index e0b1b414d466..6d598cc071ae 100644 --- a/tools/perf/tests/backward-ring-buffer.c +++ b/tools/perf/tests/backward-ring-buffer.c @@ -33,10 +33,9 @@ static int count_samples(struct perf_evlist *evlist, int *sample_count, for (i = 0; i < evlist->nr_mmaps; i++) { struct perf_mmap *map = &evlist->overwrite_mmap[i]; union perf_event *event; - u64 start, end; - perf_mmap__read_init(map, true, &start, &end); - while ((event = perf_mmap__read_event(map, true, &start, end)) != NULL) { + perf_mmap__read_init(map); + while ((event = perf_mmap__read_event(map)) != NULL) { const u32 type = event->header.type; switch (type) { diff --git a/tools/perf/tests/bp_account.c b/tools/perf/tests/bp_account.c new file mode 100644 index 000000000000..a20cbc445426 --- /dev/null +++ b/tools/perf/tests/bp_account.c @@ -0,0 +1,193 @@ +/* + * Powerpc needs __SANE_USERSPACE_TYPES__ before <linux/types.h> to select + * 'int-ll64.h' and avoid compile warnings when printing __u64 with %llu. + */ +#define __SANE_USERSPACE_TYPES__ + +#include <stdlib.h> +#include <stdio.h> +#include <unistd.h> +#include <string.h> +#include <sys/ioctl.h> +#include <time.h> +#include <fcntl.h> +#include <signal.h> +#include <sys/mman.h> +#include <linux/compiler.h> +#include <linux/hw_breakpoint.h> +#include <sys/ioctl.h> + +#include "tests.h" +#include "debug.h" +#include "perf.h" +#include "cloexec.h" + +volatile long the_var; + +static noinline int test_function(void) +{ + return 0; +} + +static int __event(bool is_x, void *addr, struct perf_event_attr *attr) +{ + int fd; + + memset(attr, 0, sizeof(struct perf_event_attr)); + attr->type = PERF_TYPE_BREAKPOINT; + attr->size = sizeof(struct perf_event_attr); + + attr->config = 0; + attr->bp_type = is_x ? HW_BREAKPOINT_X : HW_BREAKPOINT_W; + attr->bp_addr = (unsigned long) addr; + attr->bp_len = sizeof(long); + + attr->sample_period = 1; + attr->sample_type = PERF_SAMPLE_IP; + + attr->exclude_kernel = 1; + attr->exclude_hv = 1; + + fd = sys_perf_event_open(attr, -1, 0, -1, + perf_event_open_cloexec_flag()); + if (fd < 0) { + pr_debug("failed opening event %llx\n", attr->config); + return TEST_FAIL; + } + + return fd; +} + +static int wp_event(void *addr, struct perf_event_attr *attr) +{ + return __event(false, addr, attr); +} + +static int bp_event(void *addr, struct perf_event_attr *attr) +{ + return __event(true, addr, attr); +} + +static int bp_accounting(int wp_cnt, int share) +{ + struct perf_event_attr attr, attr_mod, attr_new; + int i, fd[wp_cnt], fd_wp, ret; + + for (i = 0; i < wp_cnt; i++) { + fd[i] = wp_event((void *)&the_var, &attr); + TEST_ASSERT_VAL("failed to create wp\n", fd[i] != -1); + pr_debug("wp %d created\n", i); + } + + attr_mod = attr; + attr_mod.bp_type = HW_BREAKPOINT_X; + attr_mod.bp_addr = (unsigned long) test_function; + + ret = ioctl(fd[0], PERF_EVENT_IOC_MODIFY_ATTRIBUTES, &attr_mod); + TEST_ASSERT_VAL("failed to modify wp\n", ret == 0); + + pr_debug("wp 0 modified to bp\n"); + + if (!share) { + fd_wp = wp_event((void *)&the_var, &attr_new); + TEST_ASSERT_VAL("failed to create max wp\n", fd_wp != -1); + pr_debug("wp max created\n"); + } + + for (i = 0; i < wp_cnt; i++) + close(fd[i]); + + return 0; +} + +static int detect_cnt(bool is_x) +{ + struct perf_event_attr attr; + void *addr = is_x ? (void *)test_function : (void *)&the_var; + int fd[100], cnt = 0, i; + + while (1) { + if (cnt == 100) { + pr_debug("way too many debug registers, fix the test\n"); + return 0; + } + fd[cnt] = __event(is_x, addr, &attr); + + if (fd[cnt] < 0) + break; + cnt++; + } + + for (i = 0; i < cnt; i++) + close(fd[i]); + + return cnt; +} + +static int detect_ioctl(void) +{ + struct perf_event_attr attr; + int fd, ret = 1; + + fd = wp_event((void *) &the_var, &attr); + if (fd > 0) { + ret = ioctl(fd, PERF_EVENT_IOC_MODIFY_ATTRIBUTES, &attr); + close(fd); + } + + return ret ? 0 : 1; +} + +static int detect_share(int wp_cnt, int bp_cnt) +{ + struct perf_event_attr attr; + int i, fd[wp_cnt + bp_cnt], ret; + + for (i = 0; i < wp_cnt; i++) { + fd[i] = wp_event((void *)&the_var, &attr); + TEST_ASSERT_VAL("failed to create wp\n", fd[i] != -1); + } + + for (; i < (bp_cnt + wp_cnt); i++) { + fd[i] = bp_event((void *)test_function, &attr); + if (fd[i] == -1) + break; + } + + ret = i != (bp_cnt + wp_cnt); + + while (i--) + close(fd[i]); + + return ret; +} + +/* + * This test does following: + * - detects the number of watch/break-points, + * skip test if any is missing + * - detects PERF_EVENT_IOC_MODIFY_ATTRIBUTES ioctl, + * skip test if it's missing + * - detects if watchpoints and breakpoints share + * same slots + * - create all possible watchpoints on cpu 0 + * - change one of it to breakpoint + * - in case wp and bp do not share slots, + * we create another watchpoint to ensure + * the slot accounting is correct + */ +int test__bp_accounting(struct test *test __maybe_unused, int subtest __maybe_unused) +{ + int has_ioctl = detect_ioctl(); + int wp_cnt = detect_cnt(false); + int bp_cnt = detect_cnt(true); + int share = detect_share(wp_cnt, bp_cnt); + + pr_debug("watchpoints count %d, breakpoints count %d, has_ioctl %d, share %d\n", + wp_cnt, bp_cnt, has_ioctl, share); + + if (!wp_cnt || !bp_cnt || !has_ioctl) + return TEST_SKIP; + + return bp_accounting(wp_cnt, share); +} diff --git a/tools/perf/tests/bpf.c b/tools/perf/tests/bpf.c index e8399beca62b..79b54f8ddebf 100644 --- a/tools/perf/tests/bpf.c +++ b/tools/perf/tests/bpf.c @@ -176,13 +176,19 @@ static int do_test(struct bpf_object *obj, int (*func)(void), for (i = 0; i < evlist->nr_mmaps; i++) { union perf_event *event; + struct perf_mmap *md; - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { const u32 type = event->header.type; if (type == PERF_RECORD_SAMPLE) count ++; } + perf_mmap__read_done(md); } if (count != expect) { diff --git a/tools/perf/tests/builtin-test.c b/tools/perf/tests/builtin-test.c index fafa014240cd..625f5a6772af 100644 --- a/tools/perf/tests/builtin-test.c +++ b/tools/perf/tests/builtin-test.c @@ -116,6 +116,10 @@ static struct test generic_tests[] = { .is_supported = test__bp_signal_is_supported, }, { + .desc = "Breakpoint accounting", + .func = test__bp_accounting, + }, + { .desc = "Number of exit events of a simple workload", .func = test__task_exit, }, @@ -271,6 +275,10 @@ static struct test generic_tests[] = { .func = test__unit_number__scnprint, }, { + .desc = "mem2node", + .func = test__mem2node, + }, + { .func = NULL, }, }; diff --git a/tools/perf/tests/code-reading.c b/tools/perf/tests/code-reading.c index 3bf7b145b826..99936352df4f 100644 --- a/tools/perf/tests/code-reading.c +++ b/tools/perf/tests/code-reading.c @@ -409,15 +409,21 @@ static int process_events(struct machine *machine, struct perf_evlist *evlist, struct state *state) { union perf_event *event; + struct perf_mmap *md; int i, ret; for (i = 0; i < evlist->nr_mmaps; i++) { - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { ret = process_event(machine, evlist, event, state); - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); if (ret < 0) return ret; } + perf_mmap__read_done(md); } return 0; } @@ -482,6 +488,34 @@ static void fs_something(void) } } +static const char *do_determine_event(bool excl_kernel) +{ + const char *event = excl_kernel ? "cycles:u" : "cycles"; + +#ifdef __s390x__ + char cpuid[128], model[16], model_c[16], cpum_cf_v[16]; + unsigned int family; + int ret, cpum_cf_a; + + if (get_cpuid(cpuid, sizeof(cpuid))) + goto out_clocks; + ret = sscanf(cpuid, "%*[^,],%u,%[^,],%[^,],%[^,],%x", &family, model_c, + model, cpum_cf_v, &cpum_cf_a); + if (ret != 5) /* Not available */ + goto out_clocks; + if (excl_kernel && (cpum_cf_a & 4)) + return event; + if (!excl_kernel && (cpum_cf_a & 2)) + return event; + + /* Fall through: missing authorization */ +out_clocks: + event = excl_kernel ? "cpu-clock:u" : "cpu-clock"; + +#endif + return event; +} + static void do_something(void) { fs_something(); @@ -592,10 +626,7 @@ static int do_test_code_reading(bool try_kcore) perf_evlist__set_maps(evlist, cpus, threads); - if (excl_kernel) - str = "cycles:u"; - else - str = "cycles"; + str = do_determine_event(excl_kernel); pr_debug("Parsing event '%s'\n", str); ret = parse_events(evlist, str, NULL); if (ret < 0) { diff --git a/tools/perf/tests/dwarf-unwind.c b/tools/perf/tests/dwarf-unwind.c index 260418969120..2f008067d989 100644 --- a/tools/perf/tests/dwarf-unwind.c +++ b/tools/perf/tests/dwarf-unwind.c @@ -37,6 +37,19 @@ static int init_live_machine(struct machine *machine) mmap_handler, machine, true, 500); } +/* + * We need to keep these functions global, despite the + * fact that they are used only locally in this object, + * in order to keep them around even if the binary is + * stripped. If they are gone, the unwind check for + * symbol fails. + */ +int test_dwarf_unwind__thread(struct thread *thread); +int test_dwarf_unwind__compare(void *p1, void *p2); +int test_dwarf_unwind__krava_3(struct thread *thread); +int test_dwarf_unwind__krava_2(struct thread *thread); +int test_dwarf_unwind__krava_1(struct thread *thread); + #define MAX_STACK 8 static int unwind_entry(struct unwind_entry *entry, void *arg) @@ -45,12 +58,12 @@ static int unwind_entry(struct unwind_entry *entry, void *arg) char *symbol = entry->sym ? entry->sym->name : NULL; static const char *funcs[MAX_STACK] = { "test__arch_unwind_sample", - "unwind_thread", - "compare", + "test_dwarf_unwind__thread", + "test_dwarf_unwind__compare", "bsearch", - "krava_3", - "krava_2", - "krava_1", + "test_dwarf_unwind__krava_3", + "test_dwarf_unwind__krava_2", + "test_dwarf_unwind__krava_1", "test__dwarf_unwind" }; /* @@ -77,7 +90,7 @@ static int unwind_entry(struct unwind_entry *entry, void *arg) return strcmp((const char *) symbol, funcs[idx]); } -static noinline int unwind_thread(struct thread *thread) +noinline int test_dwarf_unwind__thread(struct thread *thread) { struct perf_sample sample; unsigned long cnt = 0; @@ -108,7 +121,7 @@ static noinline int unwind_thread(struct thread *thread) static int global_unwind_retval = -INT_MAX; -static noinline int compare(void *p1, void *p2) +noinline int test_dwarf_unwind__compare(void *p1, void *p2) { /* Any possible value should be 'thread' */ struct thread *thread = *(struct thread **)p1; @@ -117,17 +130,17 @@ static noinline int compare(void *p1, void *p2) /* Call unwinder twice for both callchain orders. */ callchain_param.order = ORDER_CALLER; - global_unwind_retval = unwind_thread(thread); + global_unwind_retval = test_dwarf_unwind__thread(thread); if (!global_unwind_retval) { callchain_param.order = ORDER_CALLEE; - global_unwind_retval = unwind_thread(thread); + global_unwind_retval = test_dwarf_unwind__thread(thread); } } return p1 - p2; } -static noinline int krava_3(struct thread *thread) +noinline int test_dwarf_unwind__krava_3(struct thread *thread) { struct thread *array[2] = {thread, thread}; void *fp = &bsearch; @@ -141,18 +154,19 @@ static noinline int krava_3(struct thread *thread) size_t, int (*)(void *, void *)); _bsearch = fp; - _bsearch(array, &thread, 2, sizeof(struct thread **), compare); + _bsearch(array, &thread, 2, sizeof(struct thread **), + test_dwarf_unwind__compare); return global_unwind_retval; } -static noinline int krava_2(struct thread *thread) +noinline int test_dwarf_unwind__krava_2(struct thread *thread) { - return krava_3(thread); + return test_dwarf_unwind__krava_3(thread); } -static noinline int krava_1(struct thread *thread) +noinline int test_dwarf_unwind__krava_1(struct thread *thread) { - return krava_2(thread); + return test_dwarf_unwind__krava_2(thread); } int test__dwarf_unwind(struct test *test __maybe_unused, int subtest __maybe_unused) @@ -189,7 +203,7 @@ int test__dwarf_unwind(struct test *test __maybe_unused, int subtest __maybe_unu goto out; } - err = krava_1(thread); + err = test_dwarf_unwind__krava_1(thread); thread__put(thread); out: diff --git a/tools/perf/tests/keep-tracking.c b/tools/perf/tests/keep-tracking.c index c46530918938..17c46f3e6f1e 100644 --- a/tools/perf/tests/keep-tracking.c +++ b/tools/perf/tests/keep-tracking.c @@ -27,18 +27,23 @@ static int find_comm(struct perf_evlist *evlist, const char *comm) { union perf_event *event; + struct perf_mmap *md; int i, found; found = 0; for (i = 0; i < evlist->nr_mmaps; i++) { - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + while ((event = perf_mmap__read_event(md)) != NULL) { if (event->header.type == PERF_RECORD_COMM && (pid_t)event->comm.pid == getpid() && (pid_t)event->comm.tid == getpid() && strcmp(event->comm.comm, comm) == 0) found += 1; - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); } + perf_mmap__read_done(md); } return found; } diff --git a/tools/perf/tests/mem.c b/tools/perf/tests/mem.c index 21952e1e6e6d..0f82ee9fd3f7 100644 --- a/tools/perf/tests/mem.c +++ b/tools/perf/tests/mem.c @@ -16,7 +16,7 @@ static int check(union perf_mem_data_src data_src, n = perf_mem__snp_scnprintf(out, sizeof out, &mi); n += perf_mem__lvl_scnprintf(out + n, sizeof out - n, &mi); - snprintf(failure, sizeof failure, "unexpected %s", out); + scnprintf(failure, sizeof failure, "unexpected %s", out); TEST_ASSERT_VAL(failure, !strcmp(string, out)); return 0; } diff --git a/tools/perf/tests/mem2node.c b/tools/perf/tests/mem2node.c new file mode 100644 index 000000000000..0c3c87f86e03 --- /dev/null +++ b/tools/perf/tests/mem2node.c @@ -0,0 +1,75 @@ +#include <linux/compiler.h> +#include <linux/bitmap.h> +#include "cpumap.h" +#include "mem2node.h" +#include "tests.h" + +static struct node { + int node; + const char *map; +} test_nodes[] = { + { .node = 0, .map = "0" }, + { .node = 1, .map = "1-2" }, + { .node = 3, .map = "5-7,9" }, +}; + +#define T TEST_ASSERT_VAL + +static unsigned long *get_bitmap(const char *str, int nbits) +{ + struct cpu_map *map = cpu_map__new(str); + unsigned long *bm = NULL; + int i; + + bm = bitmap_alloc(nbits); + + if (map && bm) { + bitmap_zero(bm, nbits); + + for (i = 0; i < map->nr; i++) { + set_bit(map->map[i], bm); + } + } + + if (map) + cpu_map__put(map); + else + free(bm); + + return bm && map ? bm : NULL; +} + +int test__mem2node(struct test *t __maybe_unused, int subtest __maybe_unused) +{ + struct mem2node map; + struct memory_node nodes[3]; + struct perf_env env = { + .memory_nodes = (struct memory_node *) &nodes[0], + .nr_memory_nodes = ARRAY_SIZE(nodes), + .memory_bsize = 0x100, + }; + unsigned int i; + + for (i = 0; i < ARRAY_SIZE(nodes); i++) { + nodes[i].node = test_nodes[i].node; + nodes[i].size = 10; + + T("failed: alloc bitmap", + (nodes[i].set = get_bitmap(test_nodes[i].map, 10))); + } + + T("failed: mem2node__init", !mem2node__init(&map, &env)); + T("failed: mem2node__node", 0 == mem2node__node(&map, 0x50)); + T("failed: mem2node__node", 1 == mem2node__node(&map, 0x100)); + T("failed: mem2node__node", 1 == mem2node__node(&map, 0x250)); + T("failed: mem2node__node", 3 == mem2node__node(&map, 0x500)); + T("failed: mem2node__node", 3 == mem2node__node(&map, 0x650)); + T("failed: mem2node__node", -1 == mem2node__node(&map, 0x450)); + T("failed: mem2node__node", -1 == mem2node__node(&map, 0x1050)); + + for (i = 0; i < ARRAY_SIZE(nodes); i++) + free(nodes[i].set); + + mem2node__exit(&map); + return 0; +} diff --git a/tools/perf/tests/mmap-basic.c b/tools/perf/tests/mmap-basic.c index c0e971da965c..bb8e6bcb0d96 100644 --- a/tools/perf/tests/mmap-basic.c +++ b/tools/perf/tests/mmap-basic.c @@ -38,6 +38,7 @@ int test__basic_mmap(struct test *test __maybe_unused, int subtest __maybe_unuse expected_nr_events[nsyscalls], i, j; struct perf_evsel *evsels[nsyscalls], *evsel; char sbuf[STRERR_BUFSIZE]; + struct perf_mmap *md; threads = thread_map__new(-1, getpid(), UINT_MAX); if (threads == NULL) { @@ -106,7 +107,11 @@ int test__basic_mmap(struct test *test __maybe_unused, int subtest __maybe_unuse ++foo; } - while ((event = perf_evlist__mmap_read(evlist, 0)) != NULL) { + md = &evlist->mmap[0]; + if (perf_mmap__read_init(md) < 0) + goto out_init; + + while ((event = perf_mmap__read_event(md)) != NULL) { struct perf_sample sample; if (event->header.type != PERF_RECORD_SAMPLE) { @@ -129,9 +134,11 @@ int test__basic_mmap(struct test *test __maybe_unused, int subtest __maybe_unuse goto out_delete_evlist; } nr_events[evsel->idx]++; - perf_evlist__mmap_consume(evlist, 0); + perf_mmap__consume(md); } + perf_mmap__read_done(md); +out_init: err = 0; evlist__for_each_entry(evlist, evsel) { if (nr_events[evsel->idx] != expected_nr_events[evsel->idx]) { diff --git a/tools/perf/tests/openat-syscall-tp-fields.c b/tools/perf/tests/openat-syscall-tp-fields.c index 43519267b93b..344dc3ac2469 100644 --- a/tools/perf/tests/openat-syscall-tp-fields.c +++ b/tools/perf/tests/openat-syscall-tp-fields.c @@ -86,8 +86,13 @@ int test__syscall_openat_tp_fields(struct test *test __maybe_unused, int subtest for (i = 0; i < evlist->nr_mmaps; i++) { union perf_event *event; + struct perf_mmap *md; - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { const u32 type = event->header.type; int tp_flags; struct perf_sample sample; @@ -95,7 +100,7 @@ int test__syscall_openat_tp_fields(struct test *test __maybe_unused, int subtest ++nr_events; if (type != PERF_RECORD_SAMPLE) { - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); continue; } @@ -115,6 +120,7 @@ int test__syscall_openat_tp_fields(struct test *test __maybe_unused, int subtest goto out_ok; } + perf_mmap__read_done(md); } if (nr_events == before) diff --git a/tools/perf/tests/perf-record.c b/tools/perf/tests/perf-record.c index 0afafab85238..34394cc05077 100644 --- a/tools/perf/tests/perf-record.c +++ b/tools/perf/tests/perf-record.c @@ -164,8 +164,13 @@ int test__PERF_RECORD(struct test *test __maybe_unused, int subtest __maybe_unus for (i = 0; i < evlist->nr_mmaps; i++) { union perf_event *event; + struct perf_mmap *md; - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { const u32 type = event->header.type; const char *name = perf_event__name(type); @@ -266,8 +271,9 @@ int test__PERF_RECORD(struct test *test __maybe_unused, int subtest __maybe_unus ++errs; } - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); } + perf_mmap__read_done(md); } /* diff --git a/tools/perf/tests/pmu.c b/tools/perf/tests/pmu.c index 9abca267afa9..7bedf8608fdd 100644 --- a/tools/perf/tests/pmu.c +++ b/tools/perf/tests/pmu.c @@ -98,7 +98,7 @@ static char *test_format_dir_get(void) struct test_format *format = &test_formats[i]; FILE *file; - snprintf(name, PATH_MAX, "%s/%s", dir, format->name); + scnprintf(name, PATH_MAX, "%s/%s", dir, format->name); file = fopen(name, "w"); if (!file) diff --git a/tools/perf/tests/shell/lib/probe_vfs_getname.sh b/tools/perf/tests/shell/lib/probe_vfs_getname.sh index 30a950c9d407..1c16e56cd93e 100644 --- a/tools/perf/tests/shell/lib/probe_vfs_getname.sh +++ b/tools/perf/tests/shell/lib/probe_vfs_getname.sh @@ -5,7 +5,7 @@ had_vfs_getname=$? cleanup_probe_vfs_getname() { if [ $had_vfs_getname -eq 1 ] ; then - perf probe -q -d probe:vfs_getname + perf probe -q -d probe:vfs_getname* fi } diff --git a/tools/perf/tests/shell/trace+probe_libc_inet_pton.sh b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh index c446c894b297..1ecc1f0ff84a 100755 --- a/tools/perf/tests/shell/trace+probe_libc_inet_pton.sh +++ b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh @@ -15,30 +15,28 @@ nm -g $libc 2>/dev/null | fgrep -q inet_pton || exit 254 trace_libc_inet_pton_backtrace() { idx=0 - expected[0]="PING.*bytes" - expected[1]="64 bytes from ::1.*" - expected[2]=".*ping statistics.*" - expected[3]=".*packets transmitted.*" - expected[4]="rtt min.*" - expected[5]="[0-9]+\.[0-9]+[[:space:]]+probe_libc:inet_pton:\([[:xdigit:]]+\)" - expected[6]=".*inet_pton[[:space:]]\($libc\)$" + expected[0]="ping[][0-9 \.:]+probe_libc:inet_pton: \([[:xdigit:]]+\)" + expected[1]=".*inet_pton[[:space:]]\($libc\)$" case "$(uname -m)" in s390x) eventattr='call-graph=dwarf' - expected[7]="gaih_inet[[:space:]]\(inlined\)$" - expected[8]="__GI_getaddrinfo[[:space:]]\(inlined\)$" - expected[9]="main[[:space:]]\(.*/bin/ping.*\)$" - expected[10]="__libc_start_main[[:space:]]\($libc\)$" - expected[11]="_start[[:space:]]\(.*/bin/ping.*\)$" + expected[2]="gaih_inet.*[[:space:]]\($libc|inlined\)$" + expected[3]="__GI_getaddrinfo[[:space:]]\($libc|inlined\)$" + expected[4]="main[[:space:]]\(.*/bin/ping.*\)$" + expected[5]="__libc_start_main[[:space:]]\($libc\)$" + expected[6]="_start[[:space:]]\(.*/bin/ping.*\)$" ;; *) eventattr='max-stack=3' - expected[7]="getaddrinfo[[:space:]]\($libc\)$" - expected[8]=".*\(.*/bin/ping.*\)$" + expected[2]="getaddrinfo[[:space:]]\($libc\)$" + expected[3]=".*\(.*/bin/ping.*\)$" ;; esac - perf trace --no-syscalls -e probe_libc:inet_pton/$eventattr/ ping -6 -c 1 ::1 2>&1 | grep -v ^$ | while read line ; do + file=`mktemp -u /tmp/perf.data.XXX` + + perf record -e probe_libc:inet_pton/$eventattr/ -o $file ping -6 -c 1 ::1 > /dev/null 2>&1 + perf script -i $file | while read line ; do echo $line echo "$line" | egrep -q "${expected[$idx]}" if [ $? -ne 0 ] ; then @@ -48,6 +46,11 @@ trace_libc_inet_pton_backtrace() { let idx+=1 [ -z "${expected[$idx]}" ] && break done + + # If any statements are executed from this point onwards, + # the exit code of the last among these will be reflected + # in err below. If the exit code is 0, the test will pass + # even if the perf script output does not match. } # Check for IPv6 interface existence diff --git a/tools/perf/tests/sw-clock.c b/tools/perf/tests/sw-clock.c index f6c72f915d48..f9490b237893 100644 --- a/tools/perf/tests/sw-clock.c +++ b/tools/perf/tests/sw-clock.c @@ -39,6 +39,7 @@ static int __test__sw_clock_freq(enum perf_sw_ids clock_id) }; struct cpu_map *cpus; struct thread_map *threads; + struct perf_mmap *md; attr.sample_freq = 500; @@ -93,7 +94,11 @@ static int __test__sw_clock_freq(enum perf_sw_ids clock_id) perf_evlist__disable(evlist); - while ((event = perf_evlist__mmap_read(evlist, 0)) != NULL) { + md = &evlist->mmap[0]; + if (perf_mmap__read_init(md) < 0) + goto out_init; + + while ((event = perf_mmap__read_event(md)) != NULL) { struct perf_sample sample; if (event->header.type != PERF_RECORD_SAMPLE) @@ -108,9 +113,11 @@ static int __test__sw_clock_freq(enum perf_sw_ids clock_id) total_periods += sample.period; nr_samples++; next_event: - perf_evlist__mmap_consume(evlist, 0); + perf_mmap__consume(md); } + perf_mmap__read_done(md); +out_init: if ((u64) nr_samples == total_periods) { pr_debug("All (%d) samples have period value of 1!\n", nr_samples); diff --git a/tools/perf/tests/switch-tracking.c b/tools/perf/tests/switch-tracking.c index 33e00295a972..9b5be51e5e7b 100644 --- a/tools/perf/tests/switch-tracking.c +++ b/tools/perf/tests/switch-tracking.c @@ -258,16 +258,22 @@ static int process_events(struct perf_evlist *evlist, unsigned pos, cnt = 0; LIST_HEAD(events); struct event_node *events_array, *node; + struct perf_mmap *md; int i, ret; for (i = 0; i < evlist->nr_mmaps; i++) { - while ((event = perf_evlist__mmap_read(evlist, i)) != NULL) { + md = &evlist->mmap[i]; + if (perf_mmap__read_init(md) < 0) + continue; + + while ((event = perf_mmap__read_event(md)) != NULL) { cnt += 1; ret = add_event(evlist, &events, event); - perf_evlist__mmap_consume(evlist, i); + perf_mmap__consume(md); if (ret < 0) goto out_free_nodes; } + perf_mmap__read_done(md); } events_array = calloc(cnt, sizeof(struct event_node)); diff --git a/tools/perf/tests/task-exit.c b/tools/perf/tests/task-exit.c index 01b62b81751b..e92fa6029ac7 100644 --- a/tools/perf/tests/task-exit.c +++ b/tools/perf/tests/task-exit.c @@ -47,6 +47,7 @@ int test__task_exit(struct test *test __maybe_unused, int subtest __maybe_unused char sbuf[STRERR_BUFSIZE]; struct cpu_map *cpus; struct thread_map *threads; + struct perf_mmap *md; signal(SIGCHLD, sig_handler); @@ -110,13 +111,19 @@ int test__task_exit(struct test *test __maybe_unused, int subtest __maybe_unused perf_evlist__start_workload(evlist); retry: - while ((event = perf_evlist__mmap_read(evlist, 0)) != NULL) { + md = &evlist->mmap[0]; + if (perf_mmap__read_init(md) < 0) + goto out_init; + + while ((event = perf_mmap__read_event(md)) != NULL) { if (event->header.type == PERF_RECORD_EXIT) nr_exit++; - perf_evlist__mmap_consume(evlist, 0); + perf_mmap__consume(md); } + perf_mmap__read_done(md); +out_init: if (!exited || !nr_exit) { perf_evlist__poll(evlist, -1); goto retry; diff --git a/tools/perf/tests/tests.h b/tools/perf/tests/tests.h index 2862b80bc288..a9760e790563 100644 --- a/tools/perf/tests/tests.h +++ b/tools/perf/tests/tests.h @@ -58,6 +58,7 @@ int test__hists_link(struct test *test, int subtest); int test__python_use(struct test *test, int subtest); int test__bp_signal(struct test *test, int subtest); int test__bp_signal_overflow(struct test *test, int subtest); +int test__bp_accounting(struct test *test, int subtest); int test__task_exit(struct test *test, int subtest); int test__mem(struct test *test, int subtest); int test__sw_clock_freq(struct test *test, int subtest); @@ -102,6 +103,7 @@ int test__clang(struct test *test, int subtest); const char *test__clang_subtest_get_desc(int subtest); int test__clang_subtest_get_nr(void); int test__unit_number__scnprint(struct test *test, int subtest); +int test__mem2node(struct test *t, int subtest); bool test__bp_signal_is_supported(void); diff --git a/tools/perf/tests/vmlinux-kallsyms.c b/tools/perf/tests/vmlinux-kallsyms.c index f6789fb029d6..1e5adb65632a 100644 --- a/tools/perf/tests/vmlinux-kallsyms.c +++ b/tools/perf/tests/vmlinux-kallsyms.c @@ -56,7 +56,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest * be compacted against the list of modules found in the "vmlinux" * code and with the one got from /proc/modules from the "kallsyms" code. */ - if (__machine__load_kallsyms(&kallsyms, "/proc/kallsyms", type, true) <= 0) { + if (machine__load_kallsyms(&kallsyms, "/proc/kallsyms", type) <= 0) { pr_debug("dso__load_kallsyms "); goto out; } @@ -125,7 +125,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest if (pair && UM(pair->start) == mem_start) { next_pair: - if (strcmp(sym->name, pair->name) == 0) { + if (arch__compare_symbol_names(sym->name, pair->name) == 0) { /* * kallsyms don't have the symbol end, so we * set that by using the next symbol start - 1, diff --git a/tools/perf/ui/browser.c b/tools/perf/ui/browser.c index 63399af3049f..9f6ce29b83b4 100644 --- a/tools/perf/ui/browser.c +++ b/tools/perf/ui/browser.c @@ -56,12 +56,17 @@ void ui_browser__write_nstring(struct ui_browser *browser __maybe_unused, const slsmg_write_nstring(msg, width); } +void ui_browser__vprintf(struct ui_browser *browser __maybe_unused, const char *fmt, va_list args) +{ + slsmg_vprintf(fmt, args); +} + void ui_browser__printf(struct ui_browser *browser __maybe_unused, const char *fmt, ...) { va_list args; va_start(args, fmt); - slsmg_vprintf(fmt, args); + ui_browser__vprintf(browser, fmt, args); va_end(args); } @@ -779,6 +784,4 @@ void ui_browser__init(void) struct ui_browser_colorset *c = &ui_browser__colorsets[i++]; sltt_set_color(c->colorset, c->name, c->fg, c->bg); } - - annotate_browser__init(); } diff --git a/tools/perf/ui/browser.h b/tools/perf/ui/browser.h index 03e1734412b9..70057178ee34 100644 --- a/tools/perf/ui/browser.h +++ b/tools/perf/ui/browser.h @@ -3,6 +3,7 @@ #define _PERF_UI_BROWSER_H_ 1 #include <linux/types.h> +#include <stdarg.h> #define HE_COLORSET_TOP 50 #define HE_COLORSET_MEDIUM 51 @@ -40,6 +41,7 @@ void ui_browser__reset_index(struct ui_browser *browser); void ui_browser__gotorc(struct ui_browser *browser, int y, int x); void ui_browser__write_nstring(struct ui_browser *browser, const char *msg, unsigned int width); +void ui_browser__vprintf(struct ui_browser *browser, const char *fmt, va_list args); void ui_browser__printf(struct ui_browser *browser, const char *fmt, ...); void ui_browser__write_graph(struct ui_browser *browser, int graph); void __ui_browser__line_arrow(struct ui_browser *browser, unsigned int column, @@ -77,5 +79,4 @@ void ui_browser__list_head_seek(struct ui_browser *browser, off_t offset, int wh unsigned int ui_browser__list_head_refresh(struct ui_browser *browser); void ui_browser__init(void); -void annotate_browser__init(void); #endif /* _PERF_UI_BROWSER_H_ */ diff --git a/tools/perf/ui/browsers/annotate.c b/tools/perf/ui/browsers/annotate.c index 286427975112..c02fb437ac8e 100644 --- a/tools/perf/ui/browsers/annotate.c +++ b/tools/perf/ui/browsers/annotate.c @@ -9,7 +9,6 @@ #include "../../util/sort.h" #include "../../util/symbol.h" #include "../../util/evsel.h" -#include "../../util/config.h" #include "../../util/evlist.h" #include <inttypes.h> #include <pthread.h> @@ -22,28 +21,6 @@ struct disasm_line_samples { struct sym_hist_entry he; }; -#define IPC_WIDTH 6 -#define CYCLES_WIDTH 6 - -struct browser_line { - u32 idx; - int idx_asm; - int jump_sources; -}; - -static struct annotate_browser_opt { - bool hide_src_code, - use_offset, - jump_arrows, - show_linenr, - show_nr_jumps, - show_nr_samples, - show_total_period; -} annotate_browser__opts = { - .use_offset = true, - .jump_arrows = true, -}; - struct arch; struct annotate_browser { @@ -51,245 +28,98 @@ struct annotate_browser { struct rb_root entries; struct rb_node *curr_hot; struct annotation_line *selection; - struct annotation_line **offsets; struct arch *arch; - int nr_events; - u64 start; - int nr_asm_entries; - int nr_entries; - int max_jump_sources; - int nr_jumps; bool searching_backwards; - bool have_cycles; - u8 addr_width; - u8 jumps_width; - u8 target_width; - u8 min_addr_width; - u8 max_addr_width; char search_bf[128]; }; -static inline struct browser_line *browser_line(struct annotation_line *al) +static inline struct annotation *browser__annotation(struct ui_browser *browser) { - void *ptr = al; - - ptr = container_of(al, struct disasm_line, al); - return ptr - sizeof(struct browser_line); + struct map_symbol *ms = browser->priv; + return symbol__annotation(ms->sym); } -static bool disasm_line__filter(struct ui_browser *browser __maybe_unused, - void *entry) +static bool disasm_line__filter(struct ui_browser *browser, void *entry) { - if (annotate_browser__opts.hide_src_code) { - struct annotation_line *al = list_entry(entry, struct annotation_line, node); - - return al->offset == -1; - } - - return false; + struct annotation *notes = browser__annotation(browser); + struct annotation_line *al = list_entry(entry, struct annotation_line, node); + return annotation_line__filter(al, notes); } -static int annotate_browser__jumps_percent_color(struct annotate_browser *browser, - int nr, bool current) +static int ui_browser__jumps_percent_color(struct ui_browser *browser, int nr, bool current) { - if (current && (!browser->b.use_navkeypressed || browser->b.navkeypressed)) + struct annotation *notes = browser__annotation(browser); + + if (current && (!browser->use_navkeypressed || browser->navkeypressed)) return HE_COLORSET_SELECTED; - if (nr == browser->max_jump_sources) + if (nr == notes->max_jump_sources) return HE_COLORSET_TOP; if (nr > 1) return HE_COLORSET_MEDIUM; return HE_COLORSET_NORMAL; } -static int annotate_browser__set_jumps_percent_color(struct annotate_browser *browser, - int nr, bool current) +static int ui_browser__set_jumps_percent_color(void *browser, int nr, bool current) { - int color = annotate_browser__jumps_percent_color(browser, nr, current); - return ui_browser__set_color(&browser->b, color); + int color = ui_browser__jumps_percent_color(browser, nr, current); + return ui_browser__set_color(browser, color); } -static int annotate_browser__pcnt_width(struct annotate_browser *ab) +static int annotate_browser__set_color(void *browser, int color) { - return (annotate_browser__opts.show_total_period ? 12 : 7) * ab->nr_events; + return ui_browser__set_color(browser, color); } -static int annotate_browser__cycles_width(struct annotate_browser *ab) +static void annotate_browser__write_graph(void *browser, int graph) { - return ab->have_cycles ? IPC_WIDTH + CYCLES_WIDTH : 0; + ui_browser__write_graph(browser, graph); } -static void disasm_line__write(struct disasm_line *dl, struct ui_browser *browser, - char *bf, size_t size) +static void annotate_browser__set_percent_color(void *browser, double percent, bool current) { - if (dl->ins.ops && dl->ins.ops->scnprintf) { - if (ins__is_jump(&dl->ins)) { - bool fwd = dl->ops.target.offset > dl->al.offset; - - ui_browser__write_graph(browser, fwd ? SLSMG_DARROW_CHAR : - SLSMG_UARROW_CHAR); - SLsmg_write_char(' '); - } else if (ins__is_call(&dl->ins)) { - ui_browser__write_graph(browser, SLSMG_RARROW_CHAR); - SLsmg_write_char(' '); - } else if (ins__is_ret(&dl->ins)) { - ui_browser__write_graph(browser, SLSMG_LARROW_CHAR); - SLsmg_write_char(' '); - } else { - ui_browser__write_nstring(browser, " ", 2); - } - } else { - ui_browser__write_nstring(browser, " ", 2); - } + ui_browser__set_percent_color(browser, percent, current); +} - disasm_line__scnprintf(dl, bf, size, !annotate_browser__opts.use_offset); +static void annotate_browser__printf(void *browser, const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + ui_browser__vprintf(browser, fmt, args); + va_end(args); } static void annotate_browser__write(struct ui_browser *browser, void *entry, int row) { struct annotate_browser *ab = container_of(browser, struct annotate_browser, b); + struct annotation *notes = browser__annotation(browser); struct annotation_line *al = list_entry(entry, struct annotation_line, node); - struct browser_line *bl = browser_line(al); - bool current_entry = ui_browser__is_current_entry(browser, row); - bool change_color = (!annotate_browser__opts.hide_src_code && - (!current_entry || (browser->use_navkeypressed && - !browser->navkeypressed))); - int width = browser->width, printed; - int i, pcnt_width = annotate_browser__pcnt_width(ab), - cycles_width = annotate_browser__cycles_width(ab); - double percent_max = 0.0; - char bf[256]; - bool show_title = false; - - for (i = 0; i < ab->nr_events; i++) { - if (al->samples[i].percent > percent_max) - percent_max = al->samples[i].percent; - } - - if ((row == 0) && (al->offset == -1 || percent_max == 0.0)) { - if (ab->have_cycles) { - if (al->ipc == 0.0 && al->cycles == 0) - show_title = true; - } else - show_title = true; - } - - if (al->offset != -1 && percent_max != 0.0) { - for (i = 0; i < ab->nr_events; i++) { - ui_browser__set_percent_color(browser, - al->samples[i].percent, - current_entry); - if (annotate_browser__opts.show_total_period) { - ui_browser__printf(browser, "%11" PRIu64 " ", - al->samples[i].he.period); - } else if (annotate_browser__opts.show_nr_samples) { - ui_browser__printf(browser, "%6" PRIu64 " ", - al->samples[i].he.nr_samples); - } else { - ui_browser__printf(browser, "%6.2f ", - al->samples[i].percent); - } - } - } else { - ui_browser__set_percent_color(browser, 0, current_entry); - - if (!show_title) - ui_browser__write_nstring(browser, " ", pcnt_width); - else { - ui_browser__printf(browser, "%*s", pcnt_width, - annotate_browser__opts.show_total_period ? "Period" : - annotate_browser__opts.show_nr_samples ? "Samples" : "Percent"); - } - } - if (ab->have_cycles) { - if (al->ipc) - ui_browser__printf(browser, "%*.2f ", IPC_WIDTH - 1, al->ipc); - else if (!show_title) - ui_browser__write_nstring(browser, " ", IPC_WIDTH); - else - ui_browser__printf(browser, "%*s ", IPC_WIDTH - 1, "IPC"); - - if (al->cycles) - ui_browser__printf(browser, "%*" PRIu64 " ", - CYCLES_WIDTH - 1, al->cycles); - else if (!show_title) - ui_browser__write_nstring(browser, " ", CYCLES_WIDTH); - else - ui_browser__printf(browser, "%*s ", CYCLES_WIDTH - 1, "Cycle"); - } - - SLsmg_write_char(' '); + struct annotation_write_ops ops = { + .first_line = row == 0, + .current_entry = ui_browser__is_current_entry(browser, row), + .change_color = (!notes->options->hide_src_code && + (!ops.current_entry || + (browser->use_navkeypressed && + !browser->navkeypressed))), + .width = browser->width, + .obj = browser, + .set_color = annotate_browser__set_color, + .set_percent_color = annotate_browser__set_percent_color, + .set_jumps_percent_color = ui_browser__set_jumps_percent_color, + .printf = annotate_browser__printf, + .write_graph = annotate_browser__write_graph, + }; /* The scroll bar isn't being used */ if (!browser->navkeypressed) - width += 1; - - if (!*al->line) - ui_browser__write_nstring(browser, " ", width - pcnt_width - cycles_width); - else if (al->offset == -1) { - if (al->line_nr && annotate_browser__opts.show_linenr) - printed = scnprintf(bf, sizeof(bf), "%-*d ", - ab->addr_width + 1, al->line_nr); - else - printed = scnprintf(bf, sizeof(bf), "%*s ", - ab->addr_width, " "); - ui_browser__write_nstring(browser, bf, printed); - ui_browser__write_nstring(browser, al->line, width - printed - pcnt_width - cycles_width + 1); - } else { - u64 addr = al->offset; - int color = -1; - - if (!annotate_browser__opts.use_offset) - addr += ab->start; - - if (!annotate_browser__opts.use_offset) { - printed = scnprintf(bf, sizeof(bf), "%" PRIx64 ": ", addr); - } else { - if (bl->jump_sources) { - if (annotate_browser__opts.show_nr_jumps) { - int prev; - printed = scnprintf(bf, sizeof(bf), "%*d ", - ab->jumps_width, - bl->jump_sources); - prev = annotate_browser__set_jumps_percent_color(ab, bl->jump_sources, - current_entry); - ui_browser__write_nstring(browser, bf, printed); - ui_browser__set_color(browser, prev); - } - - printed = scnprintf(bf, sizeof(bf), "%*" PRIx64 ": ", - ab->target_width, addr); - } else { - printed = scnprintf(bf, sizeof(bf), "%*s ", - ab->addr_width, " "); - } - } - - if (change_color) - color = ui_browser__set_color(browser, HE_COLORSET_ADDR); - ui_browser__write_nstring(browser, bf, printed); - if (change_color) - ui_browser__set_color(browser, color); + ops.width += 1; - disasm_line__write(disasm_line(al), browser, bf, sizeof(bf)); + annotation_line__write(al, notes, &ops); - ui_browser__write_nstring(browser, bf, width - pcnt_width - cycles_width - 3 - printed); - } - - if (current_entry) + if (ops.current_entry) ab->selection = al; } -static bool disasm_line__is_valid_jump(struct disasm_line *dl, struct symbol *sym) -{ - if (!dl || !dl->ins.ops || !ins__is_jump(&dl->ins) - || !disasm_line__has_offset(dl) - || dl->ops.target.offset < 0 - || dl->ops.target.offset >= (s64)symbol__size(sym)) - return false; - - return true; -} - static bool is_fused(struct annotate_browser *ab, struct disasm_line *cursor) { struct disasm_line *pos = list_prev_entry(cursor, al.node); @@ -314,39 +144,65 @@ static void annotate_browser__draw_current_jump(struct ui_browser *browser) struct annotate_browser *ab = container_of(browser, struct annotate_browser, b); struct disasm_line *cursor = disasm_line(ab->selection); struct annotation_line *target; - struct browser_line *btarget, *bcursor; unsigned int from, to; struct map_symbol *ms = ab->b.priv; struct symbol *sym = ms->sym; - u8 pcnt_width = annotate_browser__pcnt_width(ab); + struct annotation *notes = symbol__annotation(sym); + u8 pcnt_width = annotation__pcnt_width(notes); + int width; /* PLT symbols contain external offsets */ if (strstr(sym->name, "@plt")) return; - if (!disasm_line__is_valid_jump(cursor, sym)) + if (!disasm_line__is_valid_local_jump(cursor, sym)) return; - target = ab->offsets[cursor->ops.target.offset]; - - bcursor = browser_line(&cursor->al); - btarget = browser_line(target); + /* + * This first was seen with a gcc function, _cpp_lex_token, that + * has the usual jumps: + * + * │1159e6c: ↓ jne 115aa32 <_cpp_lex_token@@Base+0xf92> + * + * I.e. jumps to a label inside that function (_cpp_lex_token), and + * those works, but also this kind: + * + * │1159e8b: ↓ jne c469be <cpp_named_operator2name@@Base+0xa72> + * + * I.e. jumps to another function, outside _cpp_lex_token, which + * are not being correctly handled generating as a side effect references + * to ab->offset[] entries that are set to NULL, so to make this code + * more robust, check that here. + * + * A proper fix for will be put in place, looking at the function + * name right after the '<' token and probably treating this like a + * 'call' instruction. + */ + target = notes->offsets[cursor->ops.target.offset]; + if (target == NULL) { + ui_helpline__printf("WARN: jump target inconsistency, press 'o', notes->offsets[%#x] = NULL\n", + cursor->ops.target.offset); + return; + } - if (annotate_browser__opts.hide_src_code) { - from = bcursor->idx_asm; - to = btarget->idx_asm; + if (notes->options->hide_src_code) { + from = cursor->al.idx_asm; + to = target->idx_asm; } else { - from = (u64)bcursor->idx; - to = (u64)btarget->idx; + from = (u64)cursor->al.idx; + to = (u64)target->idx; } + width = annotation__cycles_width(notes); + ui_browser__set_color(browser, HE_COLORSET_JUMP_ARROWS); - __ui_browser__line_arrow(browser, pcnt_width + 2 + ab->addr_width, + __ui_browser__line_arrow(browser, + pcnt_width + 2 + notes->widths.addr + width, from, to); if (is_fused(ab, cursor)) { ui_browser__mark_fused(browser, - pcnt_width + 3 + ab->addr_width, + pcnt_width + 3 + notes->widths.addr + width, from - 1, to > from ? true : false); } @@ -354,11 +210,11 @@ static void annotate_browser__draw_current_jump(struct ui_browser *browser) static unsigned int annotate_browser__refresh(struct ui_browser *browser) { - struct annotate_browser *ab = container_of(browser, struct annotate_browser, b); + struct annotation *notes = browser__annotation(browser); int ret = ui_browser__list_head_refresh(browser); - int pcnt_width = annotate_browser__pcnt_width(ab); + int pcnt_width = annotation__pcnt_width(notes); - if (annotate_browser__opts.jump_arrows) + if (notes->options->jump_arrows) annotate_browser__draw_current_jump(browser); ui_browser__set_color(browser, HE_COLORSET_NORMAL); @@ -400,6 +256,7 @@ static void disasm_rb_tree__insert(struct rb_root *root, struct annotation_line static void annotate_browser__set_top(struct annotate_browser *browser, struct annotation_line *pos, u32 idx) { + struct annotation *notes = browser__annotation(&browser->b); unsigned back; ui_browser__refresh_dimensions(&browser->b); @@ -409,7 +266,7 @@ static void annotate_browser__set_top(struct annotate_browser *browser, while (browser->b.top_idx != 0 && back != 0) { pos = list_entry(pos->node.prev, struct annotation_line, node); - if (disasm_line__filter(&browser->b, &pos->node)) + if (annotation_line__filter(pos, notes)) continue; --browser->b.top_idx; @@ -423,16 +280,12 @@ static void annotate_browser__set_top(struct annotate_browser *browser, static void annotate_browser__set_rb_top(struct annotate_browser *browser, struct rb_node *nd) { - struct browser_line *bpos; - struct annotation_line *pos; - u32 idx; + struct annotation *notes = browser__annotation(&browser->b); + struct annotation_line * pos = rb_entry(nd, struct annotation_line, rb_node); + u32 idx = pos->idx; - pos = rb_entry(nd, struct annotation_line, rb_node); - bpos = browser_line(pos); - - idx = bpos->idx; - if (annotate_browser__opts.hide_src_code) - idx = bpos->idx_asm; + if (notes->options->hide_src_code) + idx = pos->idx_asm; annotate_browser__set_top(browser, pos, idx); browser->curr_hot = nd; } @@ -480,47 +333,47 @@ static void annotate_browser__calc_percent(struct annotate_browser *browser, static bool annotate_browser__toggle_source(struct annotate_browser *browser) { + struct annotation *notes = browser__annotation(&browser->b); struct annotation_line *al; - struct browser_line *bl; off_t offset = browser->b.index - browser->b.top_idx; browser->b.seek(&browser->b, offset, SEEK_CUR); al = list_entry(browser->b.top, struct annotation_line, node); - bl = browser_line(al); - if (annotate_browser__opts.hide_src_code) { - if (bl->idx_asm < offset) - offset = bl->idx; + if (notes->options->hide_src_code) { + if (al->idx_asm < offset) + offset = al->idx; - browser->b.nr_entries = browser->nr_entries; - annotate_browser__opts.hide_src_code = false; + browser->b.nr_entries = notes->nr_entries; + notes->options->hide_src_code = false; browser->b.seek(&browser->b, -offset, SEEK_CUR); - browser->b.top_idx = bl->idx - offset; - browser->b.index = bl->idx; + browser->b.top_idx = al->idx - offset; + browser->b.index = al->idx; } else { - if (bl->idx_asm < 0) { + if (al->idx_asm < 0) { ui_helpline__puts("Only available for assembly lines."); browser->b.seek(&browser->b, -offset, SEEK_CUR); return false; } - if (bl->idx_asm < offset) - offset = bl->idx_asm; + if (al->idx_asm < offset) + offset = al->idx_asm; - browser->b.nr_entries = browser->nr_asm_entries; - annotate_browser__opts.hide_src_code = true; + browser->b.nr_entries = notes->nr_asm_entries; + notes->options->hide_src_code = true; browser->b.seek(&browser->b, -offset, SEEK_CUR); - browser->b.top_idx = bl->idx_asm - offset; - browser->b.index = bl->idx_asm; + browser->b.top_idx = al->idx_asm - offset; + browser->b.index = al->idx_asm; } return true; } -static void annotate_browser__init_asm_mode(struct annotate_browser *browser) +static void ui_browser__init_asm_mode(struct ui_browser *browser) { - ui_browser__reset_index(&browser->b); - browser->b.nr_entries = browser->nr_asm_entries; + struct annotation *notes = browser__annotation(browser); + ui_browser__reset_index(browser); + browser->nr_entries = notes->nr_asm_entries; } #define SYM_TITLE_MAX_SIZE (PATH_MAX + 64) @@ -531,6 +384,15 @@ static int sym_title(struct symbol *sym, struct map *map, char *title, return snprintf(title, sz, "%s %s", sym->name, map->dso->long_name); } +/* + * This can be called from external jumps, i.e. jumps from one functon + * to another, like from the kernel's entry_SYSCALL_64 function to the + * swapgs_restore_regs_and_return_to_usermode() function. + * + * So all we check here is that dl->ops.target.sym is set, if it is, just + * go to that function and when exiting from its disassembly, come back + * to the calling function. + */ static bool annotate_browser__callq(struct annotate_browser *browser, struct perf_evsel *evsel, struct hist_browser_timer *hbt) @@ -538,35 +400,25 @@ static bool annotate_browser__callq(struct annotate_browser *browser, struct map_symbol *ms = browser->b.priv; struct disasm_line *dl = disasm_line(browser->selection); struct annotation *notes; - struct addr_map_symbol target = { - .map = ms->map, - .addr = map__objdump_2mem(ms->map, dl->ops.target.addr), - }; char title[SYM_TITLE_MAX_SIZE]; - if (!ins__is_call(&dl->ins)) - return false; - - if (map_groups__find_ams(&target) || - map__rip_2objdump(target.map, target.map->map_ip(target.map, - target.addr)) != - dl->ops.target.addr) { + if (!dl->ops.target.sym) { ui_helpline__puts("The called function was not found."); return true; } - notes = symbol__annotation(target.sym); + notes = symbol__annotation(dl->ops.target.sym); pthread_mutex_lock(¬es->lock); - if (notes->src == NULL && symbol__alloc_hist(target.sym) < 0) { + if (notes->src == NULL && symbol__alloc_hist(dl->ops.target.sym) < 0) { pthread_mutex_unlock(¬es->lock); ui__warning("Not enough memory for annotating '%s' symbol!\n", - target.sym->name); + dl->ops.target.sym->name); return true; } pthread_mutex_unlock(¬es->lock); - symbol__tui_annotate(target.sym, target.map, evsel, hbt); + symbol__tui_annotate(dl->ops.target.sym, ms->map, evsel, hbt); sym_title(ms->sym, ms->map, title, sizeof(title)); ui_browser__show_title(&browser->b, title); return true; @@ -576,23 +428,23 @@ static struct disasm_line *annotate_browser__find_offset(struct annotate_browser *browser, s64 offset, s64 *idx) { - struct map_symbol *ms = browser->b.priv; - struct symbol *sym = ms->sym; - struct annotation *notes = symbol__annotation(sym); + struct annotation *notes = browser__annotation(&browser->b); struct disasm_line *pos; *idx = 0; list_for_each_entry(pos, ¬es->src->source, al.node) { if (pos->al.offset == offset) return pos; - if (!disasm_line__filter(&browser->b, &pos->al.node)) + if (!annotation_line__filter(&pos->al, notes)) ++*idx; } return NULL; } -static bool annotate_browser__jump(struct annotate_browser *browser) +static bool annotate_browser__jump(struct annotate_browser *browser, + struct perf_evsel *evsel, + struct hist_browser_timer *hbt) { struct disasm_line *dl = disasm_line(browser->selection); u64 offset; @@ -601,6 +453,11 @@ static bool annotate_browser__jump(struct annotate_browser *browser) if (!ins__is_jump(&dl->ins)) return false; + if (dl->ops.target.outside) { + annotate_browser__callq(browser, evsel, hbt); + return true; + } + offset = dl->ops.target.offset; dl = annotate_browser__find_offset(browser, offset, &idx); if (dl == NULL) { @@ -617,14 +474,12 @@ static struct annotation_line *annotate_browser__find_string(struct annotate_browser *browser, char *s, s64 *idx) { - struct map_symbol *ms = browser->b.priv; - struct symbol *sym = ms->sym; - struct annotation *notes = symbol__annotation(sym); + struct annotation *notes = browser__annotation(&browser->b); struct annotation_line *al = browser->selection; *idx = browser->b.index; list_for_each_entry_continue(al, ¬es->src->source, node) { - if (disasm_line__filter(&browser->b, &al->node)) + if (annotation_line__filter(al, notes)) continue; ++*idx; @@ -656,14 +511,12 @@ static struct annotation_line *annotate_browser__find_string_reverse(struct annotate_browser *browser, char *s, s64 *idx) { - struct map_symbol *ms = browser->b.priv; - struct symbol *sym = ms->sym; - struct annotation *notes = symbol__annotation(sym); + struct annotation *notes = browser__annotation(&browser->b); struct annotation_line *al = browser->selection; *idx = browser->b.index; list_for_each_entry_continue_reverse(al, ¬es->src->source, node) { - if (disasm_line__filter(&browser->b, &al->node)) + if (annotation_line__filter(al, notes)) continue; --*idx; @@ -739,19 +592,6 @@ bool annotate_browser__continue_search_reverse(struct annotate_browser *browser, return __annotate_browser__search_reverse(browser); } -static void annotate_browser__update_addr_width(struct annotate_browser *browser) -{ - if (annotate_browser__opts.use_offset) - browser->target_width = browser->min_addr_width; - else - browser->target_width = browser->max_addr_width; - - browser->addr_width = browser->target_width; - - if (annotate_browser__opts.show_nr_jumps) - browser->addr_width += browser->jumps_width + 1; -} - static int annotate_browser__run(struct annotate_browser *browser, struct perf_evsel *evsel, struct hist_browser_timer *hbt) @@ -759,6 +599,7 @@ static int annotate_browser__run(struct annotate_browser *browser, struct rb_node *nd = NULL; struct map_symbol *ms = browser->b.priv; struct symbol *sym = ms->sym; + struct annotation *notes = symbol__annotation(ms->sym); const char *help = "Press 'h' for help on key bindings"; int delay_secs = hbt ? hbt->refresh : 0; int key; @@ -833,6 +674,7 @@ static int annotate_browser__run(struct annotate_browser *browser, "t Circulate percent, total period, samples view\n" "/ Search string\n" "k Toggle line numbers\n" + "P Print to [symbol_name].annotation file.\n" "r Run available scripts\n" "? Search string backwards\n"); continue; @@ -842,8 +684,7 @@ static int annotate_browser__run(struct annotate_browser *browser, continue; } case 'k': - annotate_browser__opts.show_linenr = - !annotate_browser__opts.show_linenr; + notes->options->show_linenr = !notes->options->show_linenr; break; case 'H': nd = browser->curr_hot; @@ -853,15 +694,15 @@ static int annotate_browser__run(struct annotate_browser *browser, ui_helpline__puts(help); continue; case 'o': - annotate_browser__opts.use_offset = !annotate_browser__opts.use_offset; - annotate_browser__update_addr_width(browser); + notes->options->use_offset = !notes->options->use_offset; + annotation__update_column_widths(notes); continue; case 'j': - annotate_browser__opts.jump_arrows = !annotate_browser__opts.jump_arrows; + notes->options->jump_arrows = !notes->options->jump_arrows; continue; case 'J': - annotate_browser__opts.show_nr_jumps = !annotate_browser__opts.show_nr_jumps; - annotate_browser__update_addr_width(browser); + notes->options->show_nr_jumps = !notes->options->show_nr_jumps; + annotation__update_column_widths(notes); continue; case '/': if (annotate_browser__search(browser, delay_secs)) { @@ -887,7 +728,7 @@ show_help: browser->b.height, browser->b.index, browser->b.top_idx, - browser->nr_asm_entries); + notes->nr_asm_entries); } continue; case K_ENTER: @@ -903,22 +744,25 @@ show_help: goto show_sup_ins; else if (ins__is_ret(&dl->ins)) goto out; - else if (!(annotate_browser__jump(browser) || + else if (!(annotate_browser__jump(browser, evsel, hbt) || annotate_browser__callq(browser, evsel, hbt))) { show_sup_ins: ui_helpline__puts("Actions are only available for function call/return & jump/branch instructions."); } continue; } + case 'P': + map_symbol__annotation_dump(ms, evsel); + continue; case 't': - if (annotate_browser__opts.show_total_period) { - annotate_browser__opts.show_total_period = false; - annotate_browser__opts.show_nr_samples = true; - } else if (annotate_browser__opts.show_nr_samples) - annotate_browser__opts.show_nr_samples = false; + if (notes->options->show_total_period) { + notes->options->show_total_period = false; + notes->options->show_nr_samples = true; + } else if (notes->options->show_nr_samples) + notes->options->show_nr_samples = false; else - annotate_browser__opts.show_total_period = true; - annotate_browser__update_addr_width(browser); + notes->options->show_total_period = true; + annotation__update_column_widths(notes); continue; case K_LEFT: case K_ESC: @@ -940,12 +784,6 @@ out: int map_symbol__tui_annotate(struct map_symbol *ms, struct perf_evsel *evsel, struct hist_browser_timer *hbt) { - /* Set default value for show_total_period and show_nr_samples */ - annotate_browser__opts.show_total_period = - symbol_conf.show_total_period; - annotate_browser__opts.show_nr_samples = - symbol_conf.show_nr_samples; - return symbol__tui_annotate(ms->sym, ms->map, evsel, hbt); } @@ -959,129 +797,11 @@ int hist_entry__tui_annotate(struct hist_entry *he, struct perf_evsel *evsel, return map_symbol__tui_annotate(&he->ms, evsel, hbt); } - -static unsigned count_insn(struct annotate_browser *browser, u64 start, u64 end) -{ - unsigned n_insn = 0; - u64 offset; - - for (offset = start; offset <= end; offset++) { - if (browser->offsets[offset]) - n_insn++; - } - return n_insn; -} - -static void count_and_fill(struct annotate_browser *browser, u64 start, u64 end, - struct cyc_hist *ch) -{ - unsigned n_insn; - u64 offset; - - n_insn = count_insn(browser, start, end); - if (n_insn && ch->num && ch->cycles) { - float ipc = n_insn / ((double)ch->cycles / (double)ch->num); - - /* Hide data when there are too many overlaps. */ - if (ch->reset >= 0x7fff || ch->reset >= ch->num / 2) - return; - - for (offset = start; offset <= end; offset++) { - struct annotation_line *al = browser->offsets[offset]; - - if (al) - al->ipc = ipc; - } - } -} - -/* - * This should probably be in util/annotate.c to share with the tty - * annotate, but right now we need the per byte offsets arrays, - * which are only here. - */ -static void annotate__compute_ipc(struct annotate_browser *browser, size_t size, - struct symbol *sym) -{ - u64 offset; - struct annotation *notes = symbol__annotation(sym); - - if (!notes->src || !notes->src->cycles_hist) - return; - - pthread_mutex_lock(¬es->lock); - for (offset = 0; offset < size; ++offset) { - struct cyc_hist *ch; - - ch = ¬es->src->cycles_hist[offset]; - if (ch && ch->cycles) { - struct annotation_line *al; - - if (ch->have_start) - count_and_fill(browser, ch->start, offset, ch); - al = browser->offsets[offset]; - if (al && ch->num_aggr) - al->cycles = ch->cycles_aggr / ch->num_aggr; - browser->have_cycles = true; - } - } - pthread_mutex_unlock(¬es->lock); -} - -static void annotate_browser__mark_jump_targets(struct annotate_browser *browser, - size_t size) -{ - u64 offset; - struct map_symbol *ms = browser->b.priv; - struct symbol *sym = ms->sym; - - /* PLT symbols contain external offsets */ - if (strstr(sym->name, "@plt")) - return; - - for (offset = 0; offset < size; ++offset) { - struct annotation_line *al = browser->offsets[offset]; - struct disasm_line *dl; - struct browser_line *blt; - - dl = disasm_line(al); - - if (!disasm_line__is_valid_jump(dl, sym)) - continue; - - al = browser->offsets[dl->ops.target.offset]; - - /* - * FIXME: Oops, no jump target? Buggy disassembler? Or do we - * have to adjust to the previous offset? - */ - if (al == NULL) - continue; - - blt = browser_line(al); - if (++blt->jump_sources > browser->max_jump_sources) - browser->max_jump_sources = blt->jump_sources; - - ++browser->nr_jumps; - } -} - -static inline int width_jumps(int n) -{ - if (n >= 100) - return 5; - if (n / 10) - return 2; - return 1; -} - int symbol__tui_annotate(struct symbol *sym, struct map *map, struct perf_evsel *evsel, struct hist_browser_timer *hbt) { - struct annotation_line *al; - struct annotation *notes; - size_t size; + struct annotation *notes = symbol__annotation(sym); struct map_symbol ms = { .map = map, .sym = sym, @@ -1097,26 +817,14 @@ int symbol__tui_annotate(struct symbol *sym, struct map *map, }, }; int ret = -1, err; - int nr_pcnt = 1; if (sym == NULL) return -1; - size = symbol__size(sym); - if (map->dso->annotate_warned) return -1; - browser.offsets = zalloc(size * sizeof(struct annotation_line *)); - if (browser.offsets == NULL) { - ui__error("Not enough memory!"); - return -1; - } - - if (perf_evsel__is_group_event(evsel)) - nr_pcnt = evsel->nr_members; - - err = symbol__annotate(sym, map, evsel, sizeof(struct browser_line), &browser.arch); + err = symbol__annotate2(sym, map, evsel, &annotation__default_options, &browser.arch); if (err) { char msg[BUFSIZ]; symbol__strerror_disassemble(sym, map, err, msg, sizeof(msg)); @@ -1124,110 +832,21 @@ int symbol__tui_annotate(struct symbol *sym, struct map *map, goto out_free_offsets; } - symbol__calc_percent(sym, evsel); - ui_helpline__push("Press ESC to exit"); - notes = symbol__annotation(sym); - browser.start = map__rip_2objdump(map, sym->start); - - list_for_each_entry(al, ¬es->src->source, node) { - struct browser_line *bpos; - size_t line_len = strlen(al->line); - - if (browser.b.width < line_len) - browser.b.width = line_len; - bpos = browser_line(al); - bpos->idx = browser.nr_entries++; - if (al->offset != -1) { - bpos->idx_asm = browser.nr_asm_entries++; - /* - * FIXME: short term bandaid to cope with assembly - * routines that comes with labels in the same column - * as the address in objdump, sigh. - * - * E.g. copy_user_generic_unrolled - */ - if (al->offset < (s64)size) - browser.offsets[al->offset] = al; - } else - bpos->idx_asm = -1; - } - - annotate_browser__mark_jump_targets(&browser, size); - annotate__compute_ipc(&browser, size, sym); - - browser.addr_width = browser.target_width = browser.min_addr_width = hex_width(size); - browser.max_addr_width = hex_width(sym->end); - browser.jumps_width = width_jumps(browser.max_jump_sources); - browser.nr_events = nr_pcnt; - browser.b.nr_entries = browser.nr_entries; + browser.b.width = notes->max_line_len; + browser.b.nr_entries = notes->nr_entries; browser.b.entries = ¬es->src->source, browser.b.width += 18; /* Percentage */ - if (annotate_browser__opts.hide_src_code) - annotate_browser__init_asm_mode(&browser); - - annotate_browser__update_addr_width(&browser); + if (notes->options->hide_src_code) + ui_browser__init_asm_mode(&browser.b); ret = annotate_browser__run(&browser, evsel, hbt); annotated_source__purge(notes->src); out_free_offsets: - free(browser.offsets); + zfree(¬es->offsets); return ret; } - -#define ANNOTATE_CFG(n) \ - { .name = #n, .value = &annotate_browser__opts.n, } - -/* - * Keep the entries sorted, they are bsearch'ed - */ -static struct annotate_config { - const char *name; - bool *value; -} annotate__configs[] = { - ANNOTATE_CFG(hide_src_code), - ANNOTATE_CFG(jump_arrows), - ANNOTATE_CFG(show_linenr), - ANNOTATE_CFG(show_nr_jumps), - ANNOTATE_CFG(show_nr_samples), - ANNOTATE_CFG(show_total_period), - ANNOTATE_CFG(use_offset), -}; - -#undef ANNOTATE_CFG - -static int annotate_config__cmp(const void *name, const void *cfgp) -{ - const struct annotate_config *cfg = cfgp; - - return strcmp(name, cfg->name); -} - -static int annotate__config(const char *var, const char *value, - void *data __maybe_unused) -{ - struct annotate_config *cfg; - const char *name; - - if (!strstarts(var, "annotate.")) - return 0; - - name = var + 9; - cfg = bsearch(name, annotate__configs, ARRAY_SIZE(annotate__configs), - sizeof(struct annotate_config), annotate_config__cmp); - - if (cfg == NULL) - ui__warning("%s variable unknown, ignoring...", var); - else - *cfg->value = perf_config_bool(name, value); - return 0; -} - -void annotate_browser__init(void) -{ - perf_config(annotate__config, NULL); -} diff --git a/tools/perf/ui/browsers/hists.c b/tools/perf/ui/browsers/hists.c index 6495ee55d9c3..8b4e82548f8e 100644 --- a/tools/perf/ui/browsers/hists.c +++ b/tools/perf/ui/browsers/hists.c @@ -2223,7 +2223,7 @@ static int perf_evsel_browser_title(struct hist_browser *browser, u64 nr_events = hists->stats.total_period; struct perf_evsel *evsel = hists_to_evsel(hists); const char *ev_name = perf_evsel__name(evsel); - char buf[512]; + char buf[512], sample_freq_str[64] = ""; size_t buflen = sizeof(buf); char ref[30] = " show reference callgraph, "; bool enable_ref = false; @@ -2255,10 +2255,15 @@ static int perf_evsel_browser_title(struct hist_browser *browser, if (symbol_conf.show_ref_callgraph && strstr(ev_name, "call-graph=no")) enable_ref = true; + + if (!is_report_browser(hbt)) + scnprintf(sample_freq_str, sizeof(sample_freq_str), " %d Hz,", evsel->attr.sample_freq); + nr_samples = convert_unit(nr_samples, &unit); printed = scnprintf(bf, size, - "Samples: %lu%c of event '%s',%sEvent count (approx.): %" PRIu64, - nr_samples, unit, ev_name, enable_ref ? ref : " ", nr_events); + "Samples: %lu%c of event%s '%s',%s%sEvent count (approx.): %" PRIu64, + nr_samples, unit, evsel->nr_members > 1 ? "s" : "", + ev_name, sample_freq_str, enable_ref ? ref : " ", nr_events); if (hists->uid_filter_str) diff --git a/tools/perf/ui/stdio/hist.c b/tools/perf/ui/stdio/hist.c index 25dd1e0ecc58..6832fcb2e6ff 100644 --- a/tools/perf/ui/stdio/hist.c +++ b/tools/perf/ui/stdio/hist.c @@ -840,15 +840,11 @@ size_t events_stats__fprintf(struct events_stats *stats, FILE *fp) for (i = 0; i < PERF_RECORD_HEADER_MAX; ++i) { const char *name; - if (stats->nr_events[i] == 0) - continue; - name = perf_event__name(i); if (!strcmp(name, "UNKNOWN")) continue; - ret += fprintf(fp, "%16s events: %10d\n", name, - stats->nr_events[i]); + ret += fprintf(fp, "%16s events: %10d\n", name, stats->nr_events[i]); } return ret; diff --git a/tools/perf/util/Build b/tools/perf/util/Build index ea0a452550b0..8052373bcd6a 100644 --- a/tools/perf/util/Build +++ b/tools/perf/util/Build @@ -106,6 +106,7 @@ libperf-y += units.o libperf-y += time-utils.o libperf-y += expr-bison.o libperf-y += branch.o +libperf-y += mem2node.o libperf-$(CONFIG_LIBBPF) += bpf-loader.o libperf-$(CONFIG_BPF_PROLOGUE) += bpf-prologue.o diff --git a/tools/perf/util/annotate.c b/tools/perf/util/annotate.c index 28b233c3dcbe..3a428d7c59b9 100644 --- a/tools/perf/util/annotate.c +++ b/tools/perf/util/annotate.c @@ -14,6 +14,7 @@ #include "sort.h" #include "build-id.h" #include "color.h" +#include "config.h" #include "cache.h" #include "symbol.h" #include "debug.h" @@ -27,8 +28,25 @@ #include <linux/bitops.h> #include <linux/kernel.h> +/* FIXME: For the HE_COLORSET */ +#include "ui/browser.h" + +/* + * FIXME: Using the same values as slang.h, + * but that header may not be available everywhere + */ +#define LARROW_CHAR ((unsigned char)',') +#define RARROW_CHAR ((unsigned char)'+') +#define DARROW_CHAR ((unsigned char)'.') +#define UARROW_CHAR ((unsigned char)'-') + #include "sane_ctype.h" +struct annotation_options annotation__default_options = { + .use_offset = true, + .jump_arrows = true, +}; + const char *disassembler_style; const char *objdump_path; static regex_t file_lineno; @@ -184,9 +202,13 @@ bool ins__is_fused(struct arch *arch, const char *ins1, const char *ins2) return arch->ins_is_fused(arch, ins1, ins2); } -static int call__parse(struct arch *arch, struct ins_operands *ops, struct map *map) +static int call__parse(struct arch *arch, struct ins_operands *ops, struct map_symbol *ms) { char *endptr, *tok, *name; + struct map *map = ms->map; + struct addr_map_symbol target = { + .map = map, + }; ops->target.addr = strtoull(ops->raw, &endptr, 16); @@ -208,32 +230,36 @@ static int call__parse(struct arch *arch, struct ins_operands *ops, struct map * ops->target.name = strdup(name); *tok = '>'; - return ops->target.name == NULL ? -1 : 0; + if (ops->target.name == NULL) + return -1; +find_target: + target.addr = map__objdump_2mem(map, ops->target.addr); -indirect_call: - tok = strchr(endptr, '*'); - if (tok == NULL) { - struct symbol *sym = map__find_symbol(map, map->map_ip(map, ops->target.addr)); - if (sym != NULL) - ops->target.name = strdup(sym->name); - else - ops->target.addr = 0; - return 0; - } + if (map_groups__find_ams(&target) == 0 && + map__rip_2objdump(target.map, map->map_ip(target.map, target.addr)) == ops->target.addr) + ops->target.sym = target.sym; - ops->target.addr = strtoull(tok + 1, NULL, 16); return 0; + +indirect_call: + tok = strchr(endptr, '*'); + if (tok != NULL) + ops->target.addr = strtoull(tok + 1, NULL, 16); + goto find_target; } static int call__scnprintf(struct ins *ins, char *bf, size_t size, struct ins_operands *ops) { - if (ops->target.name) - return scnprintf(bf, size, "%-6s %s", ins->name, ops->target.name); + if (ops->target.sym) + return scnprintf(bf, size, "%-6s %s", ins->name, ops->target.sym->name); if (ops->target.addr == 0) return ins__raw_scnprintf(ins, bf, size, ops); + if (ops->target.name) + return scnprintf(bf, size, "%-6s %s", ins->name, ops->target.name); + return scnprintf(bf, size, "%-6s *%" PRIx64, ins->name, ops->target.addr); } @@ -244,14 +270,29 @@ static struct ins_ops call_ops = { bool ins__is_call(const struct ins *ins) { - return ins->ops == &call_ops; + return ins->ops == &call_ops || ins->ops == &s390_call_ops; } -static int jump__parse(struct arch *arch __maybe_unused, struct ins_operands *ops, struct map *map __maybe_unused) +static int jump__parse(struct arch *arch __maybe_unused, struct ins_operands *ops, struct map_symbol *ms) { - const char *s = strchr(ops->raw, '+'); + struct map *map = ms->map; + struct symbol *sym = ms->sym; + struct addr_map_symbol target = { + .map = map, + }; const char *c = strchr(ops->raw, ','); - + u64 start, end; + /* + * Examples of lines to parse for the _cpp_lex_token@@Base + * function: + * + * 1159e6c: jne 115aa32 <_cpp_lex_token@@Base+0xf92> + * 1159e8b: jne c469be <cpp_named_operator2name@@Base+0xa72> + * + * The first is a jump to an offset inside the same function, + * the second is to another function, i.e. that 0xa72 is an + * offset in the cpp_named_operator2name@@base function. + */ /* * skip over possible up to 2 operands to get to address, e.g.: * tbnz w0, #26, ffff0000083cd190 <security_file_permission+0xd0> @@ -267,8 +308,36 @@ static int jump__parse(struct arch *arch __maybe_unused, struct ins_operands *op ops->target.addr = strtoull(ops->raw, NULL, 16); } - if (s++ != NULL) { - ops->target.offset = strtoull(s, NULL, 16); + target.addr = map__objdump_2mem(map, ops->target.addr); + start = map->unmap_ip(map, sym->start), + end = map->unmap_ip(map, sym->end); + + ops->target.outside = target.addr < start || target.addr > end; + + /* + * FIXME: things like this in _cpp_lex_token (gcc's cc1 program): + + cpp_named_operator2name@@Base+0xa72 + + * Point to a place that is after the cpp_named_operator2name + * boundaries, i.e. in the ELF symbol table for cc1 + * cpp_named_operator2name is marked as being 32-bytes long, but it in + * fact is much larger than that, so we seem to need a symbols__find() + * routine that looks for >= current->start and < next_symbol->start, + * possibly just for C++ objects? + * + * For now lets just make some progress by marking jumps to outside the + * current function as call like. + * + * Actual navigation will come next, with further understanding of how + * the symbol searching and disassembly should be done. + */ + if (map_groups__find_ams(&target) == 0 && + map__rip_2objdump(target.map, map->map_ip(target.map, target.addr)) == ops->target.addr) + ops->target.sym = target.sym; + + if (!ops->target.outside) { + ops->target.offset = target.addr - start; ops->target.offset_avail = true; } else { ops->target.offset_avail = false; @@ -280,11 +349,15 @@ static int jump__parse(struct arch *arch __maybe_unused, struct ins_operands *op static int jump__scnprintf(struct ins *ins, char *bf, size_t size, struct ins_operands *ops) { - const char *c = strchr(ops->raw, ','); + const char *c; if (!ops->target.addr || ops->target.offset < 0) return ins__raw_scnprintf(ins, bf, size, ops); + if (ops->target.outside && ops->target.sym != NULL) + return scnprintf(bf, size, "%-6s %s", ins->name, ops->target.sym->name); + + c = strchr(ops->raw, ','); if (c != NULL) { const char *c2 = strchr(c + 1, ','); @@ -340,7 +413,7 @@ static int comment__symbol(char *raw, char *comment, u64 *addrp, char **namep) return 0; } -static int lock__parse(struct arch *arch, struct ins_operands *ops, struct map *map) +static int lock__parse(struct arch *arch, struct ins_operands *ops, struct map_symbol *ms) { ops->locked.ops = zalloc(sizeof(*ops->locked.ops)); if (ops->locked.ops == NULL) @@ -355,7 +428,7 @@ static int lock__parse(struct arch *arch, struct ins_operands *ops, struct map * goto out_free_ops; if (ops->locked.ins.ops->parse && - ops->locked.ins.ops->parse(arch, ops->locked.ops, map) < 0) + ops->locked.ins.ops->parse(arch, ops->locked.ops, ms) < 0) goto out_free_ops; return 0; @@ -398,7 +471,7 @@ static struct ins_ops lock_ops = { .scnprintf = lock__scnprintf, }; -static int mov__parse(struct arch *arch, struct ins_operands *ops, struct map *map __maybe_unused) +static int mov__parse(struct arch *arch, struct ins_operands *ops, struct map_symbol *ms __maybe_unused) { char *s = strchr(ops->raw, ','), *target, *comment, prev; @@ -459,7 +532,7 @@ static struct ins_ops mov_ops = { .scnprintf = mov__scnprintf, }; -static int dec__parse(struct arch *arch __maybe_unused, struct ins_operands *ops, struct map *map __maybe_unused) +static int dec__parse(struct arch *arch __maybe_unused, struct ins_operands *ops, struct map_symbol *ms __maybe_unused) { char *target, *comment, *s, prev; @@ -826,6 +899,66 @@ int addr_map_symbol__account_cycles(struct addr_map_symbol *ams, return err; } +static unsigned annotation__count_insn(struct annotation *notes, u64 start, u64 end) +{ + unsigned n_insn = 0; + u64 offset; + + for (offset = start; offset <= end; offset++) { + if (notes->offsets[offset]) + n_insn++; + } + return n_insn; +} + +static void annotation__count_and_fill(struct annotation *notes, u64 start, u64 end, struct cyc_hist *ch) +{ + unsigned n_insn; + u64 offset; + + n_insn = annotation__count_insn(notes, start, end); + if (n_insn && ch->num && ch->cycles) { + float ipc = n_insn / ((double)ch->cycles / (double)ch->num); + + /* Hide data when there are too many overlaps. */ + if (ch->reset >= 0x7fff || ch->reset >= ch->num / 2) + return; + + for (offset = start; offset <= end; offset++) { + struct annotation_line *al = notes->offsets[offset]; + + if (al) + al->ipc = ipc; + } + } +} + +void annotation__compute_ipc(struct annotation *notes, size_t size) +{ + u64 offset; + + if (!notes->src || !notes->src->cycles_hist) + return; + + pthread_mutex_lock(¬es->lock); + for (offset = 0; offset < size; ++offset) { + struct cyc_hist *ch; + + ch = ¬es->src->cycles_hist[offset]; + if (ch && ch->cycles) { + struct annotation_line *al; + + if (ch->have_start) + annotation__count_and_fill(notes, ch->start, offset, ch); + al = notes->offsets[offset]; + if (al && ch->num_aggr) + al->cycles = ch->cycles_aggr / ch->num_aggr; + notes->have_cycles = true; + } + } + pthread_mutex_unlock(¬es->lock); +} + int addr_map_symbol__inc_samples(struct addr_map_symbol *ams, struct perf_sample *sample, int evidx) { @@ -838,14 +971,14 @@ int hist_entry__inc_addr_samples(struct hist_entry *he, struct perf_sample *samp return symbol__inc_addr_samples(he->ms.sym, he->ms.map, evidx, ip, sample); } -static void disasm_line__init_ins(struct disasm_line *dl, struct arch *arch, struct map *map) +static void disasm_line__init_ins(struct disasm_line *dl, struct arch *arch, struct map_symbol *ms) { dl->ins.ops = ins__find(arch, dl->ins.name); if (!dl->ins.ops) return; - if (dl->ins.ops->parse && dl->ins.ops->parse(arch, &dl->ops, map) < 0) + if (dl->ins.ops->parse && dl->ins.ops->parse(arch, &dl->ops, ms) < 0) dl->ins.ops = NULL; } @@ -882,7 +1015,7 @@ out_free_name: struct annotate_args { size_t privsize; struct arch *arch; - struct map *map; + struct map_symbol ms; struct perf_evsel *evsel; s64 offset; char *line; @@ -964,7 +1097,7 @@ static struct disasm_line *disasm_line__new(struct annotate_args *args) if (disasm_line__parse(dl->al.line, &dl->ins.name, &dl->ops.raw) < 0) goto out_free_line; - disasm_line__init_ins(dl, args->arch, args->map); + disasm_line__init_ins(dl, args->arch, &args->ms); } } @@ -1222,7 +1355,7 @@ static int symbol__parse_objdump_line(struct symbol *sym, FILE *file, struct annotate_args *args, int *line_nr) { - struct map *map = args->map; + struct map *map = args->ms.map; struct annotation *notes = symbol__annotation(sym); struct disasm_line *dl; char *line = NULL, *parsed_line, *tmp, *tmp2; @@ -1269,6 +1402,7 @@ static int symbol__parse_objdump_line(struct symbol *sym, FILE *file, args->offset = offset; args->line = parsed_line; args->line_nr = *line_nr; + args->ms.sym = sym; dl = disasm_line__new(args); free(line); @@ -1277,14 +1411,14 @@ static int symbol__parse_objdump_line(struct symbol *sym, FILE *file, if (dl == NULL) return -1; - if (!disasm_line__has_offset(dl)) { + if (!disasm_line__has_local_offset(dl)) { dl->ops.target.offset = dl->ops.target.addr - map__rip_2objdump(map, sym->start); dl->ops.target.offset_avail = true; } - /* kcore has no symbols, so add the call target name */ - if (dl->ins.ops && ins__is_call(&dl->ins) && !dl->ops.target.name) { + /* kcore has no symbols, so add the call target symbol */ + if (dl->ins.ops && ins__is_call(&dl->ins) && !dl->ops.target.sym) { struct addr_map_symbol target = { .map = map, .addr = dl->ops.target.addr, @@ -1292,7 +1426,7 @@ static int symbol__parse_objdump_line(struct symbol *sym, FILE *file, if (!map_groups__find_ams(&target) && target.sym->start == target.al_addr) - dl->ops.target.name = strdup(target.sym->name); + dl->ops.target.sym = target.sym; } annotation_line__add(&dl->al, ¬es->src->source); @@ -1421,9 +1555,9 @@ fallback: static int symbol__disassemble(struct symbol *sym, struct annotate_args *args) { - struct map *map = args->map; + struct map *map = args->ms.map; struct dso *dso = map->dso; - char command[PATH_MAX * 2]; + char *command; FILE *file; char symfs_filename[PATH_MAX]; struct kcore_extract kce; @@ -1464,7 +1598,7 @@ static int symbol__disassemble(struct symbol *sym, struct annotate_args *args) strcpy(symfs_filename, tmp); } - snprintf(command, sizeof(command), + err = asprintf(&command, "%s %s%s --start-address=0x%016" PRIx64 " --stop-address=0x%016" PRIx64 " -l -d %s %s -C \"%s\" 2>/dev/null|grep -v \"%s:\"|expand", @@ -1477,12 +1611,17 @@ static int symbol__disassemble(struct symbol *sym, struct annotate_args *args) symbol_conf.annotate_src ? "-S" : "", symfs_filename, symfs_filename); + if (err < 0) { + pr_err("Failure allocating memory for the command to run\n"); + goto out_remove_tmp; + } + pr_debug("Executing: %s\n", command); err = -1; if (pipe(stdout_fd) < 0) { pr_err("Failure creating the pipe to run %s\n", command); - goto out_remove_tmp; + goto out_free_command; } pid = fork(); @@ -1509,7 +1648,7 @@ static int symbol__disassemble(struct symbol *sym, struct annotate_args *args) * If we were using debug info should retry with * original binary. */ - goto out_remove_tmp; + goto out_free_command; } nline = 0; @@ -1537,6 +1676,8 @@ static int symbol__disassemble(struct symbol *sym, struct annotate_args *args) fclose(file); err = 0; +out_free_command: + free(command); out_remove_tmp: close(stdout_fd[0]); @@ -1550,7 +1691,7 @@ out: out_close_stdout: close(stdout_fd[1]); - goto out_remove_tmp; + goto out_free_command; } static void calc_percent(struct sym_hist *hist, @@ -1613,7 +1754,6 @@ int symbol__annotate(struct symbol *sym, struct map *map, { struct annotate_args args = { .privsize = privsize, - .map = map, .evsel = evsel, }; struct perf_env *env = perf_evsel__env(evsel); @@ -1639,6 +1779,9 @@ int symbol__annotate(struct symbol *sym, struct map *map, } } + args.ms.map = map; + args.ms.sym = sym; + return symbol__disassemble(sym, &args); } @@ -1879,6 +2022,103 @@ int symbol__annotate_printf(struct symbol *sym, struct map *map, return more; } +static void FILE__set_percent_color(void *fp __maybe_unused, + double percent __maybe_unused, + bool current __maybe_unused) +{ +} + +static int FILE__set_jumps_percent_color(void *fp __maybe_unused, + int nr __maybe_unused, bool current __maybe_unused) +{ + return 0; +} + +static int FILE__set_color(void *fp __maybe_unused, int color __maybe_unused) +{ + return 0; +} + +static void FILE__printf(void *fp, const char *fmt, ...) +{ + va_list args; + + va_start(args, fmt); + vfprintf(fp, fmt, args); + va_end(args); +} + +static void FILE__write_graph(void *fp, int graph) +{ + const char *s; + switch (graph) { + + case DARROW_CHAR: s = "↓"; break; + case UARROW_CHAR: s = "↑"; break; + case LARROW_CHAR: s = "←"; break; + case RARROW_CHAR: s = "→"; break; + default: s = "?"; break; + } + + fputs(s, fp); +} + +int symbol__annotate_fprintf2(struct symbol *sym, FILE *fp) +{ + struct annotation *notes = symbol__annotation(sym); + struct annotation_write_ops ops = { + .first_line = true, + .obj = fp, + .set_color = FILE__set_color, + .set_percent_color = FILE__set_percent_color, + .set_jumps_percent_color = FILE__set_jumps_percent_color, + .printf = FILE__printf, + .write_graph = FILE__write_graph, + }; + struct annotation_line *al; + + list_for_each_entry(al, ¬es->src->source, node) { + if (annotation_line__filter(al, notes)) + continue; + annotation_line__write(al, notes, &ops); + fputc('\n', fp); + ops.first_line = false; + } + + return 0; +} + +int map_symbol__annotation_dump(struct map_symbol *ms, struct perf_evsel *evsel) +{ + const char *ev_name = perf_evsel__name(evsel); + char buf[1024]; + char *filename; + int err = -1; + FILE *fp; + + if (asprintf(&filename, "%s.annotation", ms->sym->name) < 0) + return -1; + + fp = fopen(filename, "w"); + if (fp == NULL) + goto out_free_filename; + + if (perf_evsel__is_group_event(evsel)) { + perf_evsel__group_desc(evsel, buf, sizeof(buf)); + ev_name = buf; + } + + fprintf(fp, "%s() %s\nEvent: %s\n\n", + ms->sym->name, ms->map->dso->long_name, ev_name); + symbol__annotate_fprintf2(ms->sym, fp); + + fclose(fp); + err = 0; +out_free_filename: + free(filename); + return err; +} + void symbol__annotate_zero_histogram(struct symbol *sym, int evidx) { struct annotation *notes = symbol__annotation(sym); @@ -1938,8 +2178,109 @@ size_t disasm__fprintf(struct list_head *head, FILE *fp) return printed; } +bool disasm_line__is_valid_local_jump(struct disasm_line *dl, struct symbol *sym) +{ + if (!dl || !dl->ins.ops || !ins__is_jump(&dl->ins) || + !disasm_line__has_local_offset(dl) || dl->ops.target.offset < 0 || + dl->ops.target.offset >= (s64)symbol__size(sym)) + return false; + + return true; +} + +void annotation__mark_jump_targets(struct annotation *notes, struct symbol *sym) +{ + u64 offset, size = symbol__size(sym); + + /* PLT symbols contain external offsets */ + if (strstr(sym->name, "@plt")) + return; + + for (offset = 0; offset < size; ++offset) { + struct annotation_line *al = notes->offsets[offset]; + struct disasm_line *dl; + + dl = disasm_line(al); + + if (!disasm_line__is_valid_local_jump(dl, sym)) + continue; + + al = notes->offsets[dl->ops.target.offset]; + + /* + * FIXME: Oops, no jump target? Buggy disassembler? Or do we + * have to adjust to the previous offset? + */ + if (al == NULL) + continue; + + if (++al->jump_sources > notes->max_jump_sources) + notes->max_jump_sources = al->jump_sources; + + ++notes->nr_jumps; + } +} + +void annotation__set_offsets(struct annotation *notes, s64 size) +{ + struct annotation_line *al; + + notes->max_line_len = 0; + + list_for_each_entry(al, ¬es->src->source, node) { + size_t line_len = strlen(al->line); + + if (notes->max_line_len < line_len) + notes->max_line_len = line_len; + al->idx = notes->nr_entries++; + if (al->offset != -1) { + al->idx_asm = notes->nr_asm_entries++; + /* + * FIXME: short term bandaid to cope with assembly + * routines that comes with labels in the same column + * as the address in objdump, sigh. + * + * E.g. copy_user_generic_unrolled + */ + if (al->offset < size) + notes->offsets[al->offset] = al; + } else + al->idx_asm = -1; + } +} + +static inline int width_jumps(int n) +{ + if (n >= 100) + return 5; + if (n / 10) + return 2; + return 1; +} + +void annotation__init_column_widths(struct annotation *notes, struct symbol *sym) +{ + notes->widths.addr = notes->widths.target = + notes->widths.min_addr = hex_width(symbol__size(sym)); + notes->widths.max_addr = hex_width(sym->end); + notes->widths.jumps = width_jumps(notes->max_jump_sources); +} + +void annotation__update_column_widths(struct annotation *notes) +{ + if (notes->options->use_offset) + notes->widths.target = notes->widths.min_addr; + else + notes->widths.target = notes->widths.max_addr; + + notes->widths.addr = notes->widths.target; + + if (notes->options->show_nr_jumps) + notes->widths.addr += notes->widths.jumps + 1; +} + static void annotation__calc_lines(struct annotation *notes, struct map *map, - struct rb_root *root, u64 start) + struct rb_root *root) { struct annotation_line *al; struct rb_root tmp_root = RB_ROOT; @@ -1960,8 +2301,8 @@ static void annotation__calc_lines(struct annotation *notes, struct map *map, if (percent_max <= 0.5) continue; - al->path = get_srcline(map->dso, start + al->offset, NULL, - false, true, start + al->offset); + al->path = get_srcline(map->dso, notes->start + al->offset, NULL, + false, true, notes->start + al->offset); insert_source_line(&tmp_root, al); } @@ -1972,9 +2313,40 @@ static void symbol__calc_lines(struct symbol *sym, struct map *map, struct rb_root *root) { struct annotation *notes = symbol__annotation(sym); - u64 start = map__rip_2objdump(map, sym->start); - annotation__calc_lines(notes, map, root, start); + annotation__calc_lines(notes, map, root); +} + +int symbol__tty_annotate2(struct symbol *sym, struct map *map, + struct perf_evsel *evsel, bool print_lines, + bool full_paths) +{ + struct dso *dso = map->dso; + struct rb_root source_line = RB_ROOT; + struct annotation_options opts = annotation__default_options; + const char *ev_name = perf_evsel__name(evsel); + char buf[1024]; + + if (symbol__annotate2(sym, map, evsel, &opts, NULL) < 0) + return -1; + + if (print_lines) { + srcline_full_filename = full_paths; + symbol__calc_lines(sym, map, &source_line); + print_summary(&source_line, dso->long_name); + } + + if (perf_evsel__is_group_event(evsel)) { + perf_evsel__group_desc(evsel, buf, sizeof(buf)); + ev_name = buf; + } + + fprintf(stdout, "%s() %s\nEvent: %s\n\n", sym->name, dso->long_name, ev_name); + symbol__annotate_fprintf2(sym, stdout); + + annotated_source__purge(symbol__annotation(sym)->src); + + return 0; } int symbol__tty_annotate(struct symbol *sym, struct map *map, @@ -2007,3 +2379,276 @@ bool ui__has_annotation(void) { return use_browser == 1 && perf_hpp_list.sym; } + + +double annotation_line__max_percent(struct annotation_line *al, struct annotation *notes) +{ + double percent_max = 0.0; + int i; + + for (i = 0; i < notes->nr_events; i++) { + if (al->samples[i].percent > percent_max) + percent_max = al->samples[i].percent; + } + + return percent_max; +} + +static void disasm_line__write(struct disasm_line *dl, struct annotation *notes, + void *obj, char *bf, size_t size, + void (*obj__printf)(void *obj, const char *fmt, ...), + void (*obj__write_graph)(void *obj, int graph)) +{ + if (dl->ins.ops && dl->ins.ops->scnprintf) { + if (ins__is_jump(&dl->ins)) { + bool fwd; + + if (dl->ops.target.outside) + goto call_like; + fwd = dl->ops.target.offset > dl->al.offset; + obj__write_graph(obj, fwd ? DARROW_CHAR : UARROW_CHAR); + obj__printf(obj, " "); + } else if (ins__is_call(&dl->ins)) { +call_like: + obj__write_graph(obj, RARROW_CHAR); + obj__printf(obj, " "); + } else if (ins__is_ret(&dl->ins)) { + obj__write_graph(obj, LARROW_CHAR); + obj__printf(obj, " "); + } else { + obj__printf(obj, " "); + } + } else { + obj__printf(obj, " "); + } + + disasm_line__scnprintf(dl, bf, size, !notes->options->use_offset); +} + +static void __annotation_line__write(struct annotation_line *al, struct annotation *notes, + bool first_line, bool current_entry, bool change_color, int width, + void *obj, + int (*obj__set_color)(void *obj, int color), + void (*obj__set_percent_color)(void *obj, double percent, bool current), + int (*obj__set_jumps_percent_color)(void *obj, int nr, bool current), + void (*obj__printf)(void *obj, const char *fmt, ...), + void (*obj__write_graph)(void *obj, int graph)) + +{ + double percent_max = annotation_line__max_percent(al, notes); + int pcnt_width = annotation__pcnt_width(notes), + cycles_width = annotation__cycles_width(notes); + bool show_title = false; + char bf[256]; + int printed; + + if (first_line && (al->offset == -1 || percent_max == 0.0)) { + if (notes->have_cycles) { + if (al->ipc == 0.0 && al->cycles == 0) + show_title = true; + } else + show_title = true; + } + + if (al->offset != -1 && percent_max != 0.0) { + int i; + + for (i = 0; i < notes->nr_events; i++) { + obj__set_percent_color(obj, al->samples[i].percent, current_entry); + if (notes->options->show_total_period) { + obj__printf(obj, "%11" PRIu64 " ", al->samples[i].he.period); + } else if (notes->options->show_nr_samples) { + obj__printf(obj, "%6" PRIu64 " ", + al->samples[i].he.nr_samples); + } else { + obj__printf(obj, "%6.2f ", + al->samples[i].percent); + } + } + } else { + obj__set_percent_color(obj, 0, current_entry); + + if (!show_title) + obj__printf(obj, "%-*s", pcnt_width, " "); + else { + obj__printf(obj, "%-*s", pcnt_width, + notes->options->show_total_period ? "Period" : + notes->options->show_nr_samples ? "Samples" : "Percent"); + } + } + + if (notes->have_cycles) { + if (al->ipc) + obj__printf(obj, "%*.2f ", ANNOTATION__IPC_WIDTH - 1, al->ipc); + else if (!show_title) + obj__printf(obj, "%*s", ANNOTATION__IPC_WIDTH, " "); + else + obj__printf(obj, "%*s ", ANNOTATION__IPC_WIDTH - 1, "IPC"); + + if (al->cycles) + obj__printf(obj, "%*" PRIu64 " ", + ANNOTATION__CYCLES_WIDTH - 1, al->cycles); + else if (!show_title) + obj__printf(obj, "%*s", ANNOTATION__CYCLES_WIDTH, " "); + else + obj__printf(obj, "%*s ", ANNOTATION__CYCLES_WIDTH - 1, "Cycle"); + } + + obj__printf(obj, " "); + + if (!*al->line) + obj__printf(obj, "%-*s", width - pcnt_width - cycles_width, " "); + else if (al->offset == -1) { + if (al->line_nr && notes->options->show_linenr) + printed = scnprintf(bf, sizeof(bf), "%-*d ", notes->widths.addr + 1, al->line_nr); + else + printed = scnprintf(bf, sizeof(bf), "%-*s ", notes->widths.addr, " "); + obj__printf(obj, bf); + obj__printf(obj, "%-*s", width - printed - pcnt_width - cycles_width + 1, al->line); + } else { + u64 addr = al->offset; + int color = -1; + + if (!notes->options->use_offset) + addr += notes->start; + + if (!notes->options->use_offset) { + printed = scnprintf(bf, sizeof(bf), "%" PRIx64 ": ", addr); + } else { + if (al->jump_sources) { + if (notes->options->show_nr_jumps) { + int prev; + printed = scnprintf(bf, sizeof(bf), "%*d ", + notes->widths.jumps, + al->jump_sources); + prev = obj__set_jumps_percent_color(obj, al->jump_sources, + current_entry); + obj__printf(obj, bf); + obj__set_color(obj, prev); + } + + printed = scnprintf(bf, sizeof(bf), "%*" PRIx64 ": ", + notes->widths.target, addr); + } else { + printed = scnprintf(bf, sizeof(bf), "%-*s ", + notes->widths.addr, " "); + } + } + + if (change_color) + color = obj__set_color(obj, HE_COLORSET_ADDR); + obj__printf(obj, bf); + if (change_color) + obj__set_color(obj, color); + + disasm_line__write(disasm_line(al), notes, obj, bf, sizeof(bf), obj__printf, obj__write_graph); + + obj__printf(obj, "%-*s", width - pcnt_width - cycles_width - 3 - printed, bf); + } + +} + +void annotation_line__write(struct annotation_line *al, struct annotation *notes, + struct annotation_write_ops *ops) +{ + __annotation_line__write(al, notes, ops->first_line, ops->current_entry, + ops->change_color, ops->width, ops->obj, + ops->set_color, ops->set_percent_color, + ops->set_jumps_percent_color, ops->printf, + ops->write_graph); +} + +int symbol__annotate2(struct symbol *sym, struct map *map, struct perf_evsel *evsel, + struct annotation_options *options, struct arch **parch) +{ + struct annotation *notes = symbol__annotation(sym); + size_t size = symbol__size(sym); + int nr_pcnt = 1, err; + + notes->offsets = zalloc(size * sizeof(struct annotation_line *)); + if (notes->offsets == NULL) + return -1; + + if (perf_evsel__is_group_event(evsel)) + nr_pcnt = evsel->nr_members; + + err = symbol__annotate(sym, map, evsel, 0, parch); + if (err) + goto out_free_offsets; + + notes->options = options; + + symbol__calc_percent(sym, evsel); + + notes->start = map__rip_2objdump(map, sym->start); + + annotation__set_offsets(notes, size); + annotation__mark_jump_targets(notes, sym); + annotation__compute_ipc(notes, size); + annotation__init_column_widths(notes, sym); + notes->nr_events = nr_pcnt; + + annotation__update_column_widths(notes); + + return 0; + +out_free_offsets: + zfree(¬es->offsets); + return -1; +} + +#define ANNOTATION__CFG(n) \ + { .name = #n, .value = &annotation__default_options.n, } + +/* + * Keep the entries sorted, they are bsearch'ed + */ +static struct annotation_config { + const char *name; + bool *value; +} annotation__configs[] = { + ANNOTATION__CFG(hide_src_code), + ANNOTATION__CFG(jump_arrows), + ANNOTATION__CFG(show_linenr), + ANNOTATION__CFG(show_nr_jumps), + ANNOTATION__CFG(show_nr_samples), + ANNOTATION__CFG(show_total_period), + ANNOTATION__CFG(use_offset), +}; + +#undef ANNOTATION__CFG + +static int annotation_config__cmp(const void *name, const void *cfgp) +{ + const struct annotation_config *cfg = cfgp; + + return strcmp(name, cfg->name); +} + +static int annotation__config(const char *var, const char *value, + void *data __maybe_unused) +{ + struct annotation_config *cfg; + const char *name; + + if (!strstarts(var, "annotate.")) + return 0; + + name = var + 9; + cfg = bsearch(name, annotation__configs, ARRAY_SIZE(annotation__configs), + sizeof(struct annotation_config), annotation_config__cmp); + + if (cfg == NULL) + pr_debug("%s variable unknown, ignoring...", var); + else + *cfg->value = perf_config_bool(name, value); + return 0; +} + +void annotation_config__init(void) +{ + perf_config(annotation__config, NULL); + + annotation__default_options.show_total_period = symbol_conf.show_total_period; + annotation__default_options.show_nr_samples = symbol_conf.show_nr_samples; +} diff --git a/tools/perf/util/annotate.h b/tools/perf/util/annotate.h index ce427445671f..ff7e3df31efa 100644 --- a/tools/perf/util/annotate.h +++ b/tools/perf/util/annotate.h @@ -24,9 +24,11 @@ struct ins_operands { struct { char *raw; char *name; + struct symbol *sym; u64 addr; s64 offset; bool offset_avail; + bool outside; } target; union { struct { @@ -45,7 +47,7 @@ struct arch; struct ins_ops { void (*free)(struct ins_operands *ops); - int (*parse)(struct arch *arch, struct ins_operands *ops, struct map *map); + int (*parse)(struct arch *arch, struct ins_operands *ops, struct map_symbol *ms); int (*scnprintf)(struct ins *ins, char *bf, size_t size, struct ins_operands *ops); }; @@ -57,6 +59,21 @@ bool ins__is_lock(const struct ins *ins); int ins__scnprintf(struct ins *ins, char *bf, size_t size, struct ins_operands *ops); bool ins__is_fused(struct arch *arch, const char *ins1, const char *ins2); +#define ANNOTATION__IPC_WIDTH 6 +#define ANNOTATION__CYCLES_WIDTH 6 + +struct annotation_options { + bool hide_src_code, + use_offset, + jump_arrows, + show_linenr, + show_nr_jumps, + show_nr_samples, + show_total_period; +}; + +extern struct annotation_options annotation__default_options; + struct annotation; struct sym_hist_entry { @@ -76,10 +93,13 @@ struct annotation_line { s64 offset; char *line; int line_nr; + int jump_sources; float ipc; u64 cycles; size_t privsize; char *path; + u32 idx; + int idx_asm; int samples_nr; struct annotation_data samples[0]; }; @@ -97,14 +117,40 @@ static inline struct disasm_line *disasm_line(struct annotation_line *al) return al ? container_of(al, struct disasm_line, al) : NULL; } -static inline bool disasm_line__has_offset(const struct disasm_line *dl) +/* + * Is this offset in the same function as the line it is used? + * asm functions jump to other functions, for instance. + */ +static inline bool disasm_line__has_local_offset(const struct disasm_line *dl) { - return dl->ops.target.offset_avail; + return dl->ops.target.offset_avail && !dl->ops.target.outside; } +/* + * Can we draw an arrow from the jump to its target, for instance? I.e. + * is the jump and its target in the same function? + */ +bool disasm_line__is_valid_local_jump(struct disasm_line *dl, struct symbol *sym); + void disasm_line__free(struct disasm_line *dl); struct annotation_line * annotation_line__next(struct annotation_line *pos, struct list_head *head); + +struct annotation_write_ops { + bool first_line, current_entry, change_color; + int width; + void *obj; + int (*set_color)(void *obj, int color); + void (*set_percent_color)(void *obj, double percent, bool current); + int (*set_jumps_percent_color)(void *obj, int nr, bool current); + void (*printf)(void *obj, const char *fmt, ...); + void (*write_graph)(void *obj, int graph); +}; + +double annotation_line__max_percent(struct annotation_line *al, struct annotation *notes); +void annotation_line__write(struct annotation_line *al, struct annotation *notes, + struct annotation_write_ops *ops); + int disasm_line__scnprintf(struct disasm_line *dl, char *bf, size_t size, bool raw); size_t disasm__fprintf(struct list_head *head, FILE *fp); void symbol__calc_percent(struct symbol *sym, struct perf_evsel *evsel); @@ -150,9 +196,47 @@ struct annotated_source { struct annotation { pthread_mutex_t lock; u64 max_coverage; + u64 start; + struct annotation_options *options; + struct annotation_line **offsets; + int nr_events; + int nr_jumps; + int max_jump_sources; + int nr_entries; + int nr_asm_entries; + u16 max_line_len; + struct { + u8 addr; + u8 jumps; + u8 target; + u8 min_addr; + u8 max_addr; + } widths; + bool have_cycles; struct annotated_source *src; }; +static inline int annotation__cycles_width(struct annotation *notes) +{ + return notes->have_cycles ? ANNOTATION__IPC_WIDTH + ANNOTATION__CYCLES_WIDTH : 0; +} + +static inline int annotation__pcnt_width(struct annotation *notes) +{ + return (notes->options->show_total_period ? 12 : 7) * notes->nr_events; +} + +static inline bool annotation_line__filter(struct annotation_line *al, struct annotation *notes) +{ + return notes->options->hide_src_code && al->offset == -1; +} + +void annotation__set_offsets(struct annotation *notes, s64 size); +void annotation__compute_ipc(struct annotation *notes, size_t size); +void annotation__mark_jump_targets(struct annotation *notes, struct symbol *sym); +void annotation__update_column_widths(struct annotation *notes); +void annotation__init_column_widths(struct annotation *notes, struct symbol *sym); + static inline struct sym_hist *annotation__histogram(struct annotation *notes, int idx) { return (((void *)¬es->src->histograms) + @@ -180,6 +264,10 @@ void symbol__annotate_zero_histograms(struct symbol *sym); int symbol__annotate(struct symbol *sym, struct map *map, struct perf_evsel *evsel, size_t privsize, struct arch **parch); +int symbol__annotate2(struct symbol *sym, struct map *map, + struct perf_evsel *evsel, + struct annotation_options *options, + struct arch **parch); enum symbol_disassemble_errno { SYMBOL_ANNOTATE_ERRNO__SUCCESS = 0, @@ -204,16 +292,23 @@ int symbol__strerror_disassemble(struct symbol *sym, struct map *map, int symbol__annotate_printf(struct symbol *sym, struct map *map, struct perf_evsel *evsel, bool full_paths, int min_pcnt, int max_lines, int context); +int symbol__annotate_fprintf2(struct symbol *sym, FILE *fp); void symbol__annotate_zero_histogram(struct symbol *sym, int evidx); void symbol__annotate_decay_histogram(struct symbol *sym, int evidx); void annotated_source__purge(struct annotated_source *as); +int map_symbol__annotation_dump(struct map_symbol *ms, struct perf_evsel *evsel); + bool ui__has_annotation(void); int symbol__tty_annotate(struct symbol *sym, struct map *map, struct perf_evsel *evsel, bool print_lines, bool full_paths, int min_pcnt, int max_lines); +int symbol__tty_annotate2(struct symbol *sym, struct map *map, + struct perf_evsel *evsel, bool print_lines, + bool full_paths); + #ifdef HAVE_SLANG_SUPPORT int symbol__tui_annotate(struct symbol *sym, struct map *map, struct perf_evsel *evsel, @@ -231,4 +326,6 @@ static inline int symbol__tui_annotate(struct symbol *sym __maybe_unused, extern const char *disassembler_style; +void annotation_config__init(void); + #endif /* __PERF_ANNOTATE_H */ diff --git a/tools/perf/util/auxtrace.c b/tools/perf/util/auxtrace.c index 9faf3b5367db..fb357a00dd86 100644 --- a/tools/perf/util/auxtrace.c +++ b/tools/perf/util/auxtrace.c @@ -60,6 +60,12 @@ #include "sane_ctype.h" #include "symbol/kallsyms.h" +static bool auxtrace__dont_decode(struct perf_session *session) +{ + return !session->itrace_synth_opts || + session->itrace_synth_opts->dont_decode; +} + int auxtrace_mmap__mmap(struct auxtrace_mmap *mm, struct auxtrace_mmap_params *mp, void *userpg, int fd) @@ -227,9 +233,9 @@ static void *auxtrace_copy_data(u64 size, struct perf_session *session) return p; } -static int auxtrace_queues__add_buffer(struct auxtrace_queues *queues, - unsigned int idx, - struct auxtrace_buffer *buffer) +static int auxtrace_queues__queue_buffer(struct auxtrace_queues *queues, + unsigned int idx, + struct auxtrace_buffer *buffer) { struct auxtrace_queue *queue; int err; @@ -280,7 +286,7 @@ static int auxtrace_queues__split_buffer(struct auxtrace_queues *queues, return -ENOMEM; b->size = BUFFER_LIMIT_FOR_32_BIT; b->consecutive = consecutive; - err = auxtrace_queues__add_buffer(queues, idx, b); + err = auxtrace_queues__queue_buffer(queues, idx, b); if (err) { auxtrace_buffer__free(b); return err; @@ -296,11 +302,14 @@ static int auxtrace_queues__split_buffer(struct auxtrace_queues *queues, return 0; } -static int auxtrace_queues__add_event_buffer(struct auxtrace_queues *queues, - struct perf_session *session, - unsigned int idx, - struct auxtrace_buffer *buffer) +static int auxtrace_queues__add_buffer(struct auxtrace_queues *queues, + struct perf_session *session, + unsigned int idx, + struct auxtrace_buffer *buffer, + struct auxtrace_buffer **buffer_ptr) { + int err; + if (session->one_mmap) { buffer->data = buffer->data_offset - session->one_mmap_offset + session->one_mmap_addr; @@ -311,14 +320,20 @@ static int auxtrace_queues__add_event_buffer(struct auxtrace_queues *queues, buffer->data_needs_freeing = true; } else if (BITS_PER_LONG == 32 && buffer->size > BUFFER_LIMIT_FOR_32_BIT) { - int err; - err = auxtrace_queues__split_buffer(queues, idx, buffer); if (err) return err; } - return auxtrace_queues__add_buffer(queues, idx, buffer); + err = auxtrace_queues__queue_buffer(queues, idx, buffer); + if (err) + return err; + + /* FIXME: Doesn't work for split buffer */ + if (buffer_ptr) + *buffer_ptr = buffer; + + return 0; } static bool filter_cpu(struct perf_session *session, int cpu) @@ -353,13 +368,11 @@ int auxtrace_queues__add_event(struct auxtrace_queues *queues, buffer->size = event->auxtrace.size; idx = event->auxtrace.idx; - err = auxtrace_queues__add_event_buffer(queues, session, idx, buffer); + err = auxtrace_queues__add_buffer(queues, session, idx, buffer, + buffer_ptr); if (err) goto out_err; - if (buffer_ptr) - *buffer_ptr = buffer; - return 0; out_err: @@ -762,6 +775,9 @@ int auxtrace_queues__process_index(struct auxtrace_queues *queues, size_t i; int err; + if (auxtrace__dont_decode(session)) + return 0; + list_for_each_entry(auxtrace_index, &session->auxtrace_index, list) { for (i = 0; i < auxtrace_index->nr; i++) { ent = &auxtrace_index->entries[i]; @@ -892,12 +908,6 @@ out_free: return err; } -static bool auxtrace__dont_decode(struct perf_session *session) -{ - return !session->itrace_synth_opts || - session->itrace_synth_opts->dont_decode; -} - int perf_event__process_auxtrace_info(struct perf_tool *tool __maybe_unused, union perf_event *event, struct perf_session *session) diff --git a/tools/perf/util/auxtrace.h b/tools/perf/util/auxtrace.h index 453c148d2158..e731f55da072 100644 --- a/tools/perf/util/auxtrace.h +++ b/tools/perf/util/auxtrace.h @@ -130,6 +130,7 @@ struct auxtrace_index { /** * struct auxtrace - session callbacks to allow AUX area data decoding. * @process_event: lets the decoder see all session events + * @process_auxtrace_event: process a PERF_RECORD_AUXTRACE event * @flush_events: process any remaining data * @free_events: free resources associated with event processing * @free: free resources associated with the session @@ -301,6 +302,7 @@ struct auxtrace_mmap_params { * @parse_snapshot_options: parse snapshot options * @reference: provide a 64-bit reference number for auxtrace_event * @read_finish: called after reading from an auxtrace mmap + * @alignment: alignment (if any) for AUX area data */ struct auxtrace_record { int (*recording_options)(struct auxtrace_record *itr, diff --git a/tools/perf/util/build-id.c b/tools/perf/util/build-id.c index 7f8553630c4d..537eadd81914 100644 --- a/tools/perf/util/build-id.c +++ b/tools/perf/util/build-id.c @@ -316,7 +316,6 @@ static int machine__write_buildid_table(struct machine *machine, struct feat_fd *fd) { int err = 0; - char nm[PATH_MAX]; struct dso *pos; u16 kmisc = PERF_RECORD_MISC_KERNEL, umisc = PERF_RECORD_MISC_USER; @@ -338,9 +337,8 @@ static int machine__write_buildid_table(struct machine *machine, name = pos->short_name; name_len = pos->short_name_len; } else if (dso__is_kcore(pos)) { - machine__mmap_name(machine, nm, sizeof(nm)); - name = nm; - name_len = strlen(nm); + name = machine->mmap_name; + name_len = strlen(name); } else { name = pos->long_name; name_len = pos->long_name_len; @@ -813,12 +811,10 @@ static int dso__cache_build_id(struct dso *dso, struct machine *machine) bool is_kallsyms = dso__is_kallsyms(dso); bool is_vdso = dso__is_vdso(dso); const char *name = dso->long_name; - char nm[PATH_MAX]; if (dso__is_kcore(dso)) { is_kallsyms = true; - machine__mmap_name(machine, nm, sizeof(nm)); - name = nm; + name = machine->mmap_name; } return build_id_cache__add_b(dso->build_id, sizeof(dso->build_id), name, dso->nsinfo, is_kallsyms, is_vdso); diff --git a/tools/perf/util/cgroup.c b/tools/perf/util/cgroup.c index 984f69144f87..decb91f9da82 100644 --- a/tools/perf/util/cgroup.c +++ b/tools/perf/util/cgroup.c @@ -71,7 +71,7 @@ cgroupfs_find_mountpoint(char *buf, size_t maxlen) return -1; } -static int open_cgroup(char *name) +static int open_cgroup(const char *name) { char path[PATH_MAX + 1]; char mnt[PATH_MAX + 1]; @@ -81,7 +81,7 @@ static int open_cgroup(char *name) if (cgroupfs_find_mountpoint(mnt, PATH_MAX + 1)) return -1; - snprintf(path, PATH_MAX, "%s/%s", mnt, name); + scnprintf(path, PATH_MAX, "%s/%s", mnt, name); fd = open(path, O_RDONLY); if (fd == -1) @@ -90,41 +90,64 @@ static int open_cgroup(char *name) return fd; } -static int add_cgroup(struct perf_evlist *evlist, char *str) +static struct cgroup *evlist__find_cgroup(struct perf_evlist *evlist, const char *str) { struct perf_evsel *counter; - struct cgroup_sel *cgrp = NULL; - int n; + struct cgroup *cgrp = NULL; /* * check if cgrp is already defined, if so we reuse it */ evlist__for_each_entry(evlist, counter) { - cgrp = counter->cgrp; - if (!cgrp) + if (!counter->cgrp) continue; - if (!strcmp(cgrp->name, str)) { - refcount_inc(&cgrp->refcnt); + if (!strcmp(counter->cgrp->name, str)) { + cgrp = cgroup__get(counter->cgrp); break; } - - cgrp = NULL; } - if (!cgrp) { - cgrp = zalloc(sizeof(*cgrp)); - if (!cgrp) - return -1; + return cgrp; +} - cgrp->name = str; - refcount_set(&cgrp->refcnt, 1); +static struct cgroup *cgroup__new(const char *name) +{ + struct cgroup *cgroup = zalloc(sizeof(*cgroup)); - cgrp->fd = open_cgroup(str); - if (cgrp->fd == -1) { - free(cgrp); - return -1; - } + if (cgroup != NULL) { + refcount_set(&cgroup->refcnt, 1); + + cgroup->name = strdup(name); + if (!cgroup->name) + goto out_err; + cgroup->fd = open_cgroup(name); + if (cgroup->fd == -1) + goto out_free_name; } + return cgroup; + +out_free_name: + free(cgroup->name); +out_err: + free(cgroup); + return NULL; +} + +struct cgroup *evlist__findnew_cgroup(struct perf_evlist *evlist, const char *name) +{ + struct cgroup *cgroup = evlist__find_cgroup(evlist, name); + + return cgroup ?: cgroup__new(name); +} + +static int add_cgroup(struct perf_evlist *evlist, const char *str) +{ + struct perf_evsel *counter; + struct cgroup *cgrp = evlist__findnew_cgroup(evlist, str); + int n; + + if (!cgrp) + return -1; /* * find corresponding event * if add cgroup N, then need to find event N @@ -135,31 +158,58 @@ static int add_cgroup(struct perf_evlist *evlist, char *str) goto found; n++; } - if (refcount_dec_and_test(&cgrp->refcnt)) - free(cgrp); + cgroup__put(cgrp); return -1; found: counter->cgrp = cgrp; return 0; } -void close_cgroup(struct cgroup_sel *cgrp) +static void cgroup__delete(struct cgroup *cgroup) +{ + close(cgroup->fd); + zfree(&cgroup->name); + free(cgroup); +} + +void cgroup__put(struct cgroup *cgrp) { if (cgrp && refcount_dec_and_test(&cgrp->refcnt)) { - close(cgrp->fd); - zfree(&cgrp->name); - free(cgrp); + cgroup__delete(cgrp); } } -int parse_cgroups(const struct option *opt __maybe_unused, const char *str, +struct cgroup *cgroup__get(struct cgroup *cgroup) +{ + if (cgroup) + refcount_inc(&cgroup->refcnt); + return cgroup; +} + +static void evsel__set_default_cgroup(struct perf_evsel *evsel, struct cgroup *cgroup) +{ + if (evsel->cgrp == NULL) + evsel->cgrp = cgroup__get(cgroup); +} + +void evlist__set_default_cgroup(struct perf_evlist *evlist, struct cgroup *cgroup) +{ + struct perf_evsel *evsel; + + evlist__for_each_entry(evlist, evsel) + evsel__set_default_cgroup(evsel, cgroup); +} + +int parse_cgroups(const struct option *opt, const char *str, int unset __maybe_unused) { struct perf_evlist *evlist = *(struct perf_evlist **)opt->value; + struct perf_evsel *counter; + struct cgroup *cgrp = NULL; const char *p, *e, *eos = str + strlen(str); char *s; - int ret; + int ret, i; if (list_empty(&evlist->entries)) { fprintf(stderr, "must define events before cgroups\n"); @@ -177,10 +227,9 @@ int parse_cgroups(const struct option *opt __maybe_unused, const char *str, if (!s) return -1; ret = add_cgroup(evlist, s); - if (ret) { - free(s); + free(s); + if (ret) return -1; - } } /* nr_cgroups is increased een for empty cgroups */ nr_cgroups++; @@ -188,5 +237,18 @@ int parse_cgroups(const struct option *opt __maybe_unused, const char *str, break; str = p+1; } + /* for the case one cgroup combine to multiple events */ + i = 0; + if (nr_cgroups == 1) { + evlist__for_each_entry(evlist, counter) { + if (i == 0) + cgrp = counter->cgrp; + else { + counter->cgrp = cgrp; + refcount_inc(&cgrp->refcnt); + } + i++; + } + } return 0; } diff --git a/tools/perf/util/cgroup.h b/tools/perf/util/cgroup.h index afafc87e9201..f033a80c1b14 100644 --- a/tools/perf/util/cgroup.h +++ b/tools/perf/util/cgroup.h @@ -6,7 +6,7 @@ struct option; -struct cgroup_sel { +struct cgroup { char *name; int fd; refcount_t refcnt; @@ -14,7 +14,16 @@ struct cgroup_sel { extern int nr_cgroups; /* number of explicit cgroups defined */ -void close_cgroup(struct cgroup_sel *cgrp); + +struct cgroup *cgroup__get(struct cgroup *cgroup); +void cgroup__put(struct cgroup *cgroup); + +struct perf_evlist; + +struct cgroup *evlist__findnew_cgroup(struct perf_evlist *evlist, const char *name); + +void evlist__set_default_cgroup(struct perf_evlist *evlist, struct cgroup *cgroup); + int parse_cgroups(const struct option *opt, const char *str, int unset); #endif /* __CGROUP_H__ */ diff --git a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c index 1fb01849f1c7..640af88331b4 100644 --- a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c +++ b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c @@ -78,6 +78,8 @@ int cs_etm_decoder__reset(struct cs_etm_decoder *decoder) { ocsd_datapath_resp_t dp_ret; + decoder->prev_return = OCSD_RESP_CONT; + dp_ret = ocsd_dt_process_data(decoder->dcd_tree, OCSD_OP_RESET, 0, 0, NULL, NULL); if (OCSD_DATA_RESP_IS_FATAL(dp_ret)) @@ -253,16 +255,16 @@ static void cs_etm_decoder__clear_buffer(struct cs_etm_decoder *decoder) decoder->packet_count = 0; for (i = 0; i < MAX_BUFFER; i++) { decoder->packet_buffer[i].start_addr = 0xdeadbeefdeadbeefUL; - decoder->packet_buffer[i].end_addr = 0xdeadbeefdeadbeefUL; - decoder->packet_buffer[i].exc = false; - decoder->packet_buffer[i].exc_ret = false; - decoder->packet_buffer[i].cpu = INT_MIN; + decoder->packet_buffer[i].end_addr = 0xdeadbeefdeadbeefUL; + decoder->packet_buffer[i].last_instr_taken_branch = false; + decoder->packet_buffer[i].exc = false; + decoder->packet_buffer[i].exc_ret = false; + decoder->packet_buffer[i].cpu = INT_MIN; } } static ocsd_datapath_resp_t cs_etm_decoder__buffer_packet(struct cs_etm_decoder *decoder, - const ocsd_generic_trace_elem *elem, const u8 trace_chan_id, enum cs_etm_sample_type sample_type) { @@ -278,18 +280,16 @@ cs_etm_decoder__buffer_packet(struct cs_etm_decoder *decoder, return OCSD_RESP_FATAL_SYS_ERR; et = decoder->tail; + et = (et + 1) & (MAX_BUFFER - 1); + decoder->tail = et; + decoder->packet_count++; + decoder->packet_buffer[et].sample_type = sample_type; - decoder->packet_buffer[et].start_addr = elem->st_addr; - decoder->packet_buffer[et].end_addr = elem->en_addr; decoder->packet_buffer[et].exc = false; decoder->packet_buffer[et].exc_ret = false; decoder->packet_buffer[et].cpu = *((int *)inode->priv); - - /* Wrap around if need be */ - et = (et + 1) & (MAX_BUFFER - 1); - - decoder->tail = et; - decoder->packet_count++; + decoder->packet_buffer[et].start_addr = 0xdeadbeefdeadbeefUL; + decoder->packet_buffer[et].end_addr = 0xdeadbeefdeadbeefUL; if (decoder->packet_count == MAX_BUFFER - 1) return OCSD_RESP_WAIT; @@ -297,6 +297,47 @@ cs_etm_decoder__buffer_packet(struct cs_etm_decoder *decoder, return OCSD_RESP_CONT; } +static ocsd_datapath_resp_t +cs_etm_decoder__buffer_range(struct cs_etm_decoder *decoder, + const ocsd_generic_trace_elem *elem, + const uint8_t trace_chan_id) +{ + int ret = 0; + struct cs_etm_packet *packet; + + ret = cs_etm_decoder__buffer_packet(decoder, trace_chan_id, + CS_ETM_RANGE); + if (ret != OCSD_RESP_CONT && ret != OCSD_RESP_WAIT) + return ret; + + packet = &decoder->packet_buffer[decoder->tail]; + + packet->start_addr = elem->st_addr; + packet->end_addr = elem->en_addr; + switch (elem->last_i_type) { + case OCSD_INSTR_BR: + case OCSD_INSTR_BR_INDIRECT: + packet->last_instr_taken_branch = elem->last_instr_exec; + break; + case OCSD_INSTR_ISB: + case OCSD_INSTR_DSB_DMB: + case OCSD_INSTR_OTHER: + default: + packet->last_instr_taken_branch = false; + break; + } + + return ret; +} + +static ocsd_datapath_resp_t +cs_etm_decoder__buffer_trace_on(struct cs_etm_decoder *decoder, + const uint8_t trace_chan_id) +{ + return cs_etm_decoder__buffer_packet(decoder, trace_chan_id, + CS_ETM_TRACE_ON); +} + static ocsd_datapath_resp_t cs_etm_decoder__gen_trace_elem_printer( const void *context, const ocsd_trc_index_t indx __maybe_unused, @@ -313,12 +354,13 @@ static ocsd_datapath_resp_t cs_etm_decoder__gen_trace_elem_printer( decoder->trace_on = false; break; case OCSD_GEN_TRC_ELEM_TRACE_ON: + resp = cs_etm_decoder__buffer_trace_on(decoder, + trace_chan_id); decoder->trace_on = true; break; case OCSD_GEN_TRC_ELEM_INSTR_RANGE: - resp = cs_etm_decoder__buffer_packet(decoder, elem, - trace_chan_id, - CS_ETM_RANGE); + resp = cs_etm_decoder__buffer_range(decoder, elem, + trace_chan_id); break; case OCSD_GEN_TRC_ELEM_EXCEPTION: decoder->packet_buffer[decoder->tail].exc = true; diff --git a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.h b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.h index 3d2e6205d186..743f5f444304 100644 --- a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.h +++ b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.h @@ -24,12 +24,14 @@ struct cs_etm_buffer { enum cs_etm_sample_type { CS_ETM_RANGE = 1 << 0, + CS_ETM_TRACE_ON = 1 << 1, }; struct cs_etm_packet { enum cs_etm_sample_type sample_type; u64 start_addr; u64 end_addr; + u8 last_instr_taken_branch; u8 exc; u8 exc_ret; int cpu; diff --git a/tools/perf/util/cs-etm.c b/tools/perf/util/cs-etm.c index b9f0a53dfa65..1b0d422373be 100644 --- a/tools/perf/util/cs-etm.c +++ b/tools/perf/util/cs-etm.c @@ -32,6 +32,14 @@ #define MAX_TIMESTAMP (~0ULL) +/* + * A64 instructions are always 4 bytes + * + * Only A64 is supported, so can use this constant for converting between + * addresses and instruction counts, calculting offsets etc + */ +#define A64_INSTR_SIZE 4 + struct cs_etm_auxtrace { struct auxtrace auxtrace; struct auxtrace_queues queues; @@ -45,11 +53,15 @@ struct cs_etm_auxtrace { u8 snapshot_mode; u8 data_queued; u8 sample_branches; + u8 sample_instructions; int num_cpu; u32 auxtrace_type; u64 branches_sample_type; u64 branches_id; + u64 instructions_sample_type; + u64 instructions_sample_period; + u64 instructions_id; u64 **metadata; u64 kernel_start; unsigned int pmu_type; @@ -68,6 +80,12 @@ struct cs_etm_queue { u64 time; u64 timestamp; u64 offset; + u64 period_instructions; + struct branch_stack *last_branch; + struct branch_stack *last_branch_rb; + size_t last_branch_pos; + struct cs_etm_packet *prev_packet; + struct cs_etm_packet *packet; }; static int cs_etm__update_queues(struct cs_etm_auxtrace *etm); @@ -174,6 +192,16 @@ static void cs_etm__free_queue(void *priv) { struct cs_etm_queue *etmq = priv; + if (!etmq) + return; + + thread__zput(etmq->thread); + cs_etm_decoder__free(etmq->decoder); + zfree(&etmq->event_buf); + zfree(&etmq->last_branch); + zfree(&etmq->last_branch_rb); + zfree(&etmq->prev_packet); + zfree(&etmq->packet); free(etmq); } @@ -270,11 +298,35 @@ static struct cs_etm_queue *cs_etm__alloc_queue(struct cs_etm_auxtrace *etm, struct cs_etm_decoder_params d_params; struct cs_etm_trace_params *t_params; struct cs_etm_queue *etmq; + size_t szp = sizeof(struct cs_etm_packet); etmq = zalloc(sizeof(*etmq)); if (!etmq) return NULL; + etmq->packet = zalloc(szp); + if (!etmq->packet) + goto out_free; + + if (etm->synth_opts.last_branch || etm->sample_branches) { + etmq->prev_packet = zalloc(szp); + if (!etmq->prev_packet) + goto out_free; + } + + if (etm->synth_opts.last_branch) { + size_t sz = sizeof(struct branch_stack); + + sz += etm->synth_opts.last_branch_sz * + sizeof(struct branch_entry); + etmq->last_branch = zalloc(sz); + if (!etmq->last_branch) + goto out_free; + etmq->last_branch_rb = zalloc(sz); + if (!etmq->last_branch_rb) + goto out_free; + } + etmq->event_buf = malloc(PERF_SAMPLE_MAX_SIZE); if (!etmq->event_buf) goto out_free; @@ -329,6 +381,7 @@ static struct cs_etm_queue *cs_etm__alloc_queue(struct cs_etm_auxtrace *etm, goto out_free_decoder; etmq->offset = 0; + etmq->period_instructions = 0; return etmq; @@ -336,6 +389,10 @@ out_free_decoder: cs_etm_decoder__free(etmq->decoder); out_free: zfree(&etmq->event_buf); + zfree(&etmq->last_branch); + zfree(&etmq->last_branch_rb); + zfree(&etmq->prev_packet); + zfree(&etmq->packet); free(etmq); return NULL; @@ -389,6 +446,129 @@ static int cs_etm__update_queues(struct cs_etm_auxtrace *etm) return 0; } +static inline void cs_etm__copy_last_branch_rb(struct cs_etm_queue *etmq) +{ + struct branch_stack *bs_src = etmq->last_branch_rb; + struct branch_stack *bs_dst = etmq->last_branch; + size_t nr = 0; + + /* + * Set the number of records before early exit: ->nr is used to + * determine how many branches to copy from ->entries. + */ + bs_dst->nr = bs_src->nr; + + /* + * Early exit when there is nothing to copy. + */ + if (!bs_src->nr) + return; + + /* + * As bs_src->entries is a circular buffer, we need to copy from it in + * two steps. First, copy the branches from the most recently inserted + * branch ->last_branch_pos until the end of bs_src->entries buffer. + */ + nr = etmq->etm->synth_opts.last_branch_sz - etmq->last_branch_pos; + memcpy(&bs_dst->entries[0], + &bs_src->entries[etmq->last_branch_pos], + sizeof(struct branch_entry) * nr); + + /* + * If we wrapped around at least once, the branches from the beginning + * of the bs_src->entries buffer and until the ->last_branch_pos element + * are older valid branches: copy them over. The total number of + * branches copied over will be equal to the number of branches asked by + * the user in last_branch_sz. + */ + if (bs_src->nr >= etmq->etm->synth_opts.last_branch_sz) { + memcpy(&bs_dst->entries[nr], + &bs_src->entries[0], + sizeof(struct branch_entry) * etmq->last_branch_pos); + } +} + +static inline void cs_etm__reset_last_branch_rb(struct cs_etm_queue *etmq) +{ + etmq->last_branch_pos = 0; + etmq->last_branch_rb->nr = 0; +} + +static inline u64 cs_etm__last_executed_instr(struct cs_etm_packet *packet) +{ + /* + * The packet records the execution range with an exclusive end address + * + * A64 instructions are constant size, so the last executed + * instruction is A64_INSTR_SIZE before the end address + * Will need to do instruction level decode for T32 instructions as + * they can be variable size (not yet supported). + */ + return packet->end_addr - A64_INSTR_SIZE; +} + +static inline u64 cs_etm__instr_count(const struct cs_etm_packet *packet) +{ + /* + * Only A64 instructions are currently supported, so can get + * instruction count by dividing. + * Will need to do instruction level decode for T32 instructions as + * they can be variable size (not yet supported). + */ + return (packet->end_addr - packet->start_addr) / A64_INSTR_SIZE; +} + +static inline u64 cs_etm__instr_addr(const struct cs_etm_packet *packet, + u64 offset) +{ + /* + * Only A64 instructions are currently supported, so can get + * instruction address by muliplying. + * Will need to do instruction level decode for T32 instructions as + * they can be variable size (not yet supported). + */ + return packet->start_addr + offset * A64_INSTR_SIZE; +} + +static void cs_etm__update_last_branch_rb(struct cs_etm_queue *etmq) +{ + struct branch_stack *bs = etmq->last_branch_rb; + struct branch_entry *be; + + /* + * The branches are recorded in a circular buffer in reverse + * chronological order: we start recording from the last element of the + * buffer down. After writing the first element of the stack, move the + * insert position back to the end of the buffer. + */ + if (!etmq->last_branch_pos) + etmq->last_branch_pos = etmq->etm->synth_opts.last_branch_sz; + + etmq->last_branch_pos -= 1; + + be = &bs->entries[etmq->last_branch_pos]; + be->from = cs_etm__last_executed_instr(etmq->prev_packet); + be->to = etmq->packet->start_addr; + /* No support for mispredict */ + be->flags.mispred = 0; + be->flags.predicted = 1; + + /* + * Increment bs->nr until reaching the number of last branches asked by + * the user on the command line. + */ + if (bs->nr < etmq->etm->synth_opts.last_branch_sz) + bs->nr += 1; +} + +static int cs_etm__inject_event(union perf_event *event, + struct perf_sample *sample, u64 type) +{ + event->header.size = perf_event__sample_event_size(sample, type, 0); + return perf_event__synthesize_sample(event, type, 0, sample); +} + + static int cs_etm__get_trace(struct cs_etm_buffer *buff, struct cs_etm_queue *etmq) { @@ -453,35 +633,105 @@ static void cs_etm__set_pid_tid_cpu(struct cs_etm_auxtrace *etm, } } +static int cs_etm__synth_instruction_sample(struct cs_etm_queue *etmq, + u64 addr, u64 period) +{ + int ret = 0; + struct cs_etm_auxtrace *etm = etmq->etm; + union perf_event *event = etmq->event_buf; + struct perf_sample sample = {.ip = 0,}; + + event->sample.header.type = PERF_RECORD_SAMPLE; + event->sample.header.misc = PERF_RECORD_MISC_USER; + event->sample.header.size = sizeof(struct perf_event_header); + + sample.ip = addr; + sample.pid = etmq->pid; + sample.tid = etmq->tid; + sample.id = etmq->etm->instructions_id; + sample.stream_id = etmq->etm->instructions_id; + sample.period = period; + sample.cpu = etmq->packet->cpu; + sample.flags = 0; + sample.insn_len = 1; + sample.cpumode = event->header.misc; + + if (etm->synth_opts.last_branch) { + cs_etm__copy_last_branch_rb(etmq); + sample.branch_stack = etmq->last_branch; + } + + if (etm->synth_opts.inject) { + ret = cs_etm__inject_event(event, &sample, + etm->instructions_sample_type); + if (ret) + return ret; + } + + ret = perf_session__deliver_synth_event(etm->session, event, &sample); + + if (ret) + pr_err( + "CS ETM Trace: failed to deliver instruction event, error %d\n", + ret); + + if (etm->synth_opts.last_branch) + cs_etm__reset_last_branch_rb(etmq); + + return ret; +} + /* * The cs etm packet encodes an instruction range between a branch target * and the next taken branch. Generate sample accordingly. */ -static int cs_etm__synth_branch_sample(struct cs_etm_queue *etmq, - struct cs_etm_packet *packet) +static int cs_etm__synth_branch_sample(struct cs_etm_queue *etmq) { int ret = 0; struct cs_etm_auxtrace *etm = etmq->etm; struct perf_sample sample = {.ip = 0,}; union perf_event *event = etmq->event_buf; - u64 start_addr = packet->start_addr; - u64 end_addr = packet->end_addr; + struct dummy_branch_stack { + u64 nr; + struct branch_entry entries; + } dummy_bs; event->sample.header.type = PERF_RECORD_SAMPLE; event->sample.header.misc = PERF_RECORD_MISC_USER; event->sample.header.size = sizeof(struct perf_event_header); - sample.ip = start_addr; + sample.ip = cs_etm__last_executed_instr(etmq->prev_packet); sample.pid = etmq->pid; sample.tid = etmq->tid; - sample.addr = end_addr; + sample.addr = etmq->packet->start_addr; sample.id = etmq->etm->branches_id; sample.stream_id = etmq->etm->branches_id; sample.period = 1; - sample.cpu = packet->cpu; + sample.cpu = etmq->packet->cpu; sample.flags = 0; sample.cpumode = PERF_RECORD_MISC_USER; + /* + * perf report cannot handle events without a branch stack + */ + if (etm->synth_opts.last_branch) { + dummy_bs = (struct dummy_branch_stack){ + .nr = 1, + .entries = { + .from = sample.ip, + .to = sample.addr, + }, + }; + sample.branch_stack = (struct branch_stack *)&dummy_bs; + } + + if (etm->synth_opts.inject) { + ret = cs_etm__inject_event(event, &sample, + etm->branches_sample_type); + if (ret) + return ret; + } + ret = perf_session__deliver_synth_event(etm->session, event, &sample); if (ret) @@ -578,6 +828,24 @@ static int cs_etm__synth_events(struct cs_etm_auxtrace *etm, etm->sample_branches = true; etm->branches_sample_type = attr.sample_type; etm->branches_id = id; + id += 1; + attr.sample_type &= ~(u64)PERF_SAMPLE_ADDR; + } + + if (etm->synth_opts.last_branch) + attr.sample_type |= PERF_SAMPLE_BRANCH_STACK; + + if (etm->synth_opts.instructions) { + attr.config = PERF_COUNT_HW_INSTRUCTIONS; + attr.sample_period = etm->synth_opts.period; + etm->instructions_sample_period = attr.sample_period; + err = cs_etm__synth_event(session, &attr, id); + if (err) + return err; + etm->sample_instructions = true; + etm->instructions_sample_type = attr.sample_type; + etm->instructions_id = id; + id += 1; } return 0; @@ -585,25 +853,108 @@ static int cs_etm__synth_events(struct cs_etm_auxtrace *etm, static int cs_etm__sample(struct cs_etm_queue *etmq) { + struct cs_etm_auxtrace *etm = etmq->etm; + struct cs_etm_packet *tmp; int ret; - struct cs_etm_packet packet; + u64 instrs_executed; - while (1) { - ret = cs_etm_decoder__get_packet(etmq->decoder, &packet); - if (ret <= 0) + instrs_executed = cs_etm__instr_count(etmq->packet); + etmq->period_instructions += instrs_executed; + + /* + * Record a branch when the last instruction in + * PREV_PACKET is a branch. + */ + if (etm->synth_opts.last_branch && + etmq->prev_packet && + etmq->prev_packet->sample_type == CS_ETM_RANGE && + etmq->prev_packet->last_instr_taken_branch) + cs_etm__update_last_branch_rb(etmq); + + if (etm->sample_instructions && + etmq->period_instructions >= etm->instructions_sample_period) { + /* + * Emit instruction sample periodically + * TODO: allow period to be defined in cycles and clock time + */ + + /* Get number of instructions executed after the sample point */ + u64 instrs_over = etmq->period_instructions - + etm->instructions_sample_period; + + /* + * Calculate the address of the sampled instruction (-1 as + * sample is reported as though instruction has just been + * executed, but PC has not advanced to next instruction) + */ + u64 offset = (instrs_executed - instrs_over - 1); + u64 addr = cs_etm__instr_addr(etmq->packet, offset); + + ret = cs_etm__synth_instruction_sample( + etmq, addr, etm->instructions_sample_period); + if (ret) + return ret; + + /* Carry remaining instructions into next sample period */ + etmq->period_instructions = instrs_over; + } + + if (etm->sample_branches && + etmq->prev_packet && + etmq->prev_packet->sample_type == CS_ETM_RANGE && + etmq->prev_packet->last_instr_taken_branch) { + ret = cs_etm__synth_branch_sample(etmq); + if (ret) return ret; + } + if (etm->sample_branches || etm->synth_opts.last_branch) { /* - * If the packet contains an instruction range, generate an - * instruction sequence event. + * Swap PACKET with PREV_PACKET: PACKET becomes PREV_PACKET for + * the next incoming packet. */ - if (packet.sample_type & CS_ETM_RANGE) - cs_etm__synth_branch_sample(etmq, &packet); + tmp = etmq->packet; + etmq->packet = etmq->prev_packet; + etmq->prev_packet = tmp; } return 0; } +static int cs_etm__flush(struct cs_etm_queue *etmq) +{ + int err = 0; + struct cs_etm_packet *tmp; + + if (etmq->etm->synth_opts.last_branch && + etmq->prev_packet && + etmq->prev_packet->sample_type == CS_ETM_RANGE) { + /* + * Generate a last branch event for the branches left in the + * circular buffer at the end of the trace. + * + * Use the address of the end of the last reported execution + * range + */ + u64 addr = cs_etm__last_executed_instr(etmq->prev_packet); + + err = cs_etm__synth_instruction_sample( + etmq, addr, + etmq->period_instructions); + etmq->period_instructions = 0; + + /* + * Swap PACKET with PREV_PACKET: PACKET becomes PREV_PACKET for + * the next incoming packet. + */ + tmp = etmq->packet; + etmq->packet = etmq->prev_packet; + etmq->prev_packet = tmp; + } + + return err; +} + static int cs_etm__run_decoder(struct cs_etm_queue *etmq) { struct cs_etm_auxtrace *etm = etmq->etm; @@ -615,45 +966,72 @@ static int cs_etm__run_decoder(struct cs_etm_queue *etmq) etm->kernel_start = machine__kernel_start(etm->machine); /* Go through each buffer in the queue and decode them one by one */ -more: - buffer_used = 0; - memset(&buffer, 0, sizeof(buffer)); - err = cs_etm__get_trace(&buffer, etmq); - if (err <= 0) - return err; - /* - * We cannot assume consecutive blocks in the data file are contiguous, - * reset the decoder to force re-sync. - */ - err = cs_etm_decoder__reset(etmq->decoder); - if (err != 0) - return err; - - /* Run trace decoder until buffer consumed or end of trace */ - do { - processed = 0; - - err = cs_etm_decoder__process_data_block( - etmq->decoder, - etmq->offset, - &buffer.buf[buffer_used], - buffer.len - buffer_used, - &processed); - - if (err) + while (1) { + buffer_used = 0; + memset(&buffer, 0, sizeof(buffer)); + err = cs_etm__get_trace(&buffer, etmq); + if (err <= 0) return err; - - etmq->offset += processed; - buffer_used += processed; - /* - * Nothing to do with an error condition, let's hope the next - * chunk will be better. + * We cannot assume consecutive blocks in the data file are + * contiguous, reset the decoder to force re-sync. */ - err = cs_etm__sample(etmq); - } while (buffer.len > buffer_used); + err = cs_etm_decoder__reset(etmq->decoder); + if (err != 0) + return err; + + /* Run trace decoder until buffer consumed or end of trace */ + do { + processed = 0; + err = cs_etm_decoder__process_data_block( + etmq->decoder, + etmq->offset, + &buffer.buf[buffer_used], + buffer.len - buffer_used, + &processed); + if (err) + return err; + + etmq->offset += processed; + buffer_used += processed; + + /* Process each packet in this chunk */ + while (1) { + err = cs_etm_decoder__get_packet(etmq->decoder, + etmq->packet); + if (err <= 0) + /* + * Stop processing this chunk on + * end of data or error + */ + break; + + switch (etmq->packet->sample_type) { + case CS_ETM_RANGE: + /* + * If the packet contains an instruction + * range, generate instruction sequence + * events. + */ + cs_etm__sample(etmq); + break; + case CS_ETM_TRACE_ON: + /* + * Discontinuity in trace, flush + * previous branch stack + */ + cs_etm__flush(etmq); + break; + default: + break; + } + } + } while (buffer.len > buffer_used); -goto more; + if (err == 0) + /* Flush any remaining branch stack entries */ + err = cs_etm__flush(etmq); + } return err; } diff --git a/tools/perf/util/debug.c b/tools/perf/util/debug.c index f3a71db83947..3d6459626c2a 100644 --- a/tools/perf/util/debug.c +++ b/tools/perf/util/debug.c @@ -232,7 +232,6 @@ int perf_quiet_option(void) var++; } - quiet = true; return 0; } diff --git a/tools/perf/util/env.c b/tools/perf/util/env.c index 6d311868d850..4c842762e3f2 100644 --- a/tools/perf/util/env.c +++ b/tools/perf/util/env.c @@ -32,6 +32,10 @@ void perf_env__exit(struct perf_env *env) for (i = 0; i < env->caches_cnt; i++) cpu_cache_level__free(&env->caches[i]); zfree(&env->caches); + + for (i = 0; i < env->nr_memory_nodes; i++) + free(env->memory_nodes[i].set); + zfree(&env->memory_nodes); } int perf_env__set_cmdline(struct perf_env *env, int argc, const char *argv[]) diff --git a/tools/perf/util/env.h b/tools/perf/util/env.h index bf970f57dce0..c4ef2e523367 100644 --- a/tools/perf/util/env.h +++ b/tools/perf/util/env.h @@ -27,6 +27,12 @@ struct numa_node { struct cpu_map *map; }; +struct memory_node { + u64 node; + u64 size; + unsigned long *set; +}; + struct perf_env { char *hostname; char *os_release; @@ -43,6 +49,7 @@ struct perf_env { int nr_sibling_cores; int nr_sibling_threads; int nr_numa_nodes; + int nr_memory_nodes; int nr_pmu_mappings; int nr_groups; char *cmdline; @@ -54,6 +61,8 @@ struct perf_env { struct cpu_cache_level *caches; int caches_cnt; struct numa_node *numa_nodes; + struct memory_node *memory_nodes; + unsigned long long memory_bsize; }; extern struct perf_env perf_env; diff --git a/tools/perf/util/event.c b/tools/perf/util/event.c index 44e603c27944..f0a6cbd033cc 100644 --- a/tools/perf/util/event.c +++ b/tools/perf/util/event.c @@ -894,8 +894,6 @@ int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, struct machine *machine) { size_t size; - const char *mmap_name; - char name_buff[PATH_MAX]; struct map *map = machine__kernel_map(machine); struct kmap *kmap; int err; @@ -918,7 +916,6 @@ int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, return -1; } - mmap_name = machine__mmap_name(machine, name_buff, sizeof(name_buff)); if (machine__is_host(machine)) { /* * kernel uses PERF_RECORD_MISC_USER for user space maps, @@ -931,7 +928,7 @@ int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, kmap = map__kmap(map); size = snprintf(event->mmap.filename, sizeof(event->mmap.filename), - "%s%s", mmap_name, kmap->ref_reloc_sym->name) + 1; + "%s%s", machine->mmap_name, kmap->ref_reloc_sym->name) + 1; size = PERF_ALIGN(size, sizeof(u64)); event->mmap.header.type = PERF_RECORD_MMAP; event->mmap.header.size = (sizeof(event->mmap) - @@ -1591,17 +1588,6 @@ int machine__resolve(struct machine *machine, struct addr_location *al, return -1; dump_printf(" ... thread: %s:%d\n", thread__comm_str(thread), thread->tid); - /* - * Have we already created the kernel maps for this machine? - * - * This should have happened earlier, when we processed the kernel MMAP - * events, but for older perf.data files there was no such thing, so do - * it now. - */ - if (sample->cpumode == PERF_RECORD_MISC_KERNEL && - machine__kernel_map(machine) == NULL) - machine__create_kernel_maps(machine); - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, sample->ip, al); dump_printf(" ...... dso: %s\n", al->map ? al->map->dso->long_name : diff --git a/tools/perf/util/evlist.c b/tools/perf/util/evlist.c index e5fc14e53c05..a59281d64368 100644 --- a/tools/perf/util/evlist.c +++ b/tools/perf/util/evlist.c @@ -702,29 +702,6 @@ static int perf_evlist__resume(struct perf_evlist *evlist) return perf_evlist__set_paused(evlist, false); } -union perf_event *perf_evlist__mmap_read_forward(struct perf_evlist *evlist, int idx) -{ - struct perf_mmap *md = &evlist->mmap[idx]; - - /* - * Check messup is required for forward overwritable ring buffer: - * memory pointed by md->prev can be overwritten in this case. - * No need for read-write ring buffer: kernel stop outputting when - * it hit md->prev (perf_mmap__consume()). - */ - return perf_mmap__read_forward(md); -} - -union perf_event *perf_evlist__mmap_read(struct perf_evlist *evlist, int idx) -{ - return perf_evlist__mmap_read_forward(evlist, idx); -} - -void perf_evlist__mmap_consume(struct perf_evlist *evlist, int idx) -{ - perf_mmap__consume(&evlist->mmap[idx], false); -} - static void perf_evlist__munmap_nofree(struct perf_evlist *evlist) { int i; @@ -745,7 +722,8 @@ void perf_evlist__munmap(struct perf_evlist *evlist) zfree(&evlist->overwrite_mmap); } -static struct perf_mmap *perf_evlist__alloc_mmap(struct perf_evlist *evlist) +static struct perf_mmap *perf_evlist__alloc_mmap(struct perf_evlist *evlist, + bool overwrite) { int i; struct perf_mmap *map; @@ -759,9 +737,10 @@ static struct perf_mmap *perf_evlist__alloc_mmap(struct perf_evlist *evlist) for (i = 0; i < evlist->nr_mmaps; i++) { map[i].fd = -1; + map[i].overwrite = overwrite; /* * When the perf_mmap() call is made we grab one refcount, plus - * one extra to let perf_evlist__mmap_consume() get the last + * one extra to let perf_mmap__consume() get the last * events after all real references (perf_mmap__get()) are * dropped. * @@ -802,7 +781,7 @@ static int perf_evlist__mmap_per_evsel(struct perf_evlist *evlist, int idx, maps = evlist->overwrite_mmap; if (!maps) { - maps = perf_evlist__alloc_mmap(evlist); + maps = perf_evlist__alloc_mmap(evlist, true); if (!maps) return -1; evlist->overwrite_mmap = maps; @@ -1052,7 +1031,7 @@ int perf_evlist__mmap_ex(struct perf_evlist *evlist, unsigned int pages, struct mmap_params mp; if (!evlist->mmap) - evlist->mmap = perf_evlist__alloc_mmap(evlist); + evlist->mmap = perf_evlist__alloc_mmap(evlist, false); if (!evlist->mmap) return -ENOMEM; @@ -1086,11 +1065,30 @@ int perf_evlist__mmap(struct perf_evlist *evlist, unsigned int pages) int perf_evlist__create_maps(struct perf_evlist *evlist, struct target *target) { + bool all_threads = (target->per_thread && target->system_wide); struct cpu_map *cpus; struct thread_map *threads; + /* + * If specify '-a' and '--per-thread' to perf record, perf record + * will override '--per-thread'. target->per_thread = false and + * target->system_wide = true. + * + * If specify '--per-thread' only to perf record, + * target->per_thread = true and target->system_wide = false. + * + * So target->per_thread && target->system_wide is false. + * For perf record, thread_map__new_str doesn't call + * thread_map__new_all_cpus. That will keep perf record's + * current behavior. + * + * For perf stat, it allows the case that target->per_thread and + * target->system_wide are all true. It means to collect system-wide + * per-thread data. thread_map__new_str will call + * thread_map__new_all_cpus to enumerate all threads. + */ threads = thread_map__new_str(target->pid, target->tid, target->uid, - target->per_thread); + all_threads); if (!threads) return -1; diff --git a/tools/perf/util/evlist.h b/tools/perf/util/evlist.h index 336b838e6957..6c41b2f78713 100644 --- a/tools/perf/util/evlist.h +++ b/tools/perf/util/evlist.h @@ -129,10 +129,6 @@ struct perf_sample_id *perf_evlist__id2sid(struct perf_evlist *evlist, u64 id); void perf_evlist__toggle_bkw_mmap(struct perf_evlist *evlist, enum bkw_mmap_state state); -union perf_event *perf_evlist__mmap_read(struct perf_evlist *evlist, int idx); - -union perf_event *perf_evlist__mmap_read_forward(struct perf_evlist *evlist, - int idx); void perf_evlist__mmap_consume(struct perf_evlist *evlist, int idx); int perf_evlist__open(struct perf_evlist *evlist); diff --git a/tools/perf/util/evsel.c b/tools/perf/util/evsel.c index ef351688b797..1ac8d9236efd 100644 --- a/tools/perf/util/evsel.c +++ b/tools/perf/util/evsel.c @@ -244,6 +244,7 @@ void perf_evsel__init(struct perf_evsel *evsel, evsel->metric_name = NULL; evsel->metric_events = NULL; evsel->collect_stat = false; + evsel->pmu_name = NULL; } struct perf_evsel *perf_evsel__new_idx(struct perf_event_attr *attr, int idx) @@ -621,22 +622,34 @@ const char *perf_evsel__group_name(struct perf_evsel *evsel) return evsel->group_name ?: "anon group"; } +/* + * Returns the group details for the specified leader, + * with following rules. + * + * For record -e '{cycles,instructions}' + * 'anon group { cycles:u, instructions:u }' + * + * For record -e 'cycles,instructions' and report --group + * 'cycles:u, instructions:u' + */ int perf_evsel__group_desc(struct perf_evsel *evsel, char *buf, size_t size) { - int ret; + int ret = 0; struct perf_evsel *pos; const char *group_name = perf_evsel__group_name(evsel); - ret = scnprintf(buf, size, "%s", group_name); + if (!evsel->forced_leader) + ret = scnprintf(buf, size, "%s { ", group_name); - ret += scnprintf(buf + ret, size - ret, " { %s", + ret += scnprintf(buf + ret, size - ret, "%s", perf_evsel__name(evsel)); for_each_group_member(pos, evsel) ret += scnprintf(buf + ret, size - ret, ", %s", perf_evsel__name(pos)); - ret += scnprintf(buf + ret, size - ret, " }"); + if (!evsel->forced_leader) + ret += scnprintf(buf + ret, size - ret, " }"); return ret; } @@ -1233,7 +1246,7 @@ void perf_evsel__exit(struct perf_evsel *evsel) perf_evsel__free_fd(evsel); perf_evsel__free_id(evsel); perf_evsel__free_config_terms(evsel); - close_cgroup(evsel->cgrp); + cgroup__put(evsel->cgrp); cpu_map__put(evsel->cpus); cpu_map__put(evsel->own_cpus); thread_map__put(evsel->threads); @@ -1915,6 +1928,9 @@ try_fallback: goto fallback_missing_features; } out_close: + if (err) + threads->err_thread = thread; + do { while (--thread >= 0) { close(FD(evsel, cpu, thread)); diff --git a/tools/perf/util/evsel.h b/tools/perf/util/evsel.h index a7487c6d1866..d3ee3af618ef 100644 --- a/tools/perf/util/evsel.h +++ b/tools/perf/util/evsel.h @@ -30,7 +30,7 @@ struct perf_sample_id { u64 period; }; -struct cgroup_sel; +struct cgroup; /* * The 'struct perf_evsel_config_term' is used to pass event @@ -107,7 +107,7 @@ struct perf_evsel { struct perf_stat_evsel *stats; void *priv; u64 db_id; - struct cgroup_sel *cgrp; + struct cgroup *cgrp; void *handler; struct cpu_map *cpus; struct cpu_map *own_cpus; @@ -125,6 +125,7 @@ struct perf_evsel { bool per_pkg; bool precise_max; bool ignore_missing_thread; + bool forced_leader; /* parse modifier helper */ int exclude_GH; int nr_members; @@ -142,6 +143,7 @@ struct perf_evsel { struct perf_evsel **metric_events; bool collect_stat; bool weak_group; + const char *pmu_name; }; union u64_swap { diff --git a/tools/perf/util/header.c b/tools/perf/util/header.c index a326e0d8b5b6..121df1683c36 100644 --- a/tools/perf/util/header.c +++ b/tools/perf/util/header.c @@ -17,6 +17,7 @@ #include <sys/stat.h> #include <sys/utsname.h> #include <linux/time64.h> +#include <dirent.h> #include "evlist.h" #include "evsel.h" @@ -37,6 +38,7 @@ #include "asm/bug.h" #include "tool.h" #include "time-utils.h" +#include "units.h" #include "sane_ctype.h" @@ -132,6 +134,25 @@ int do_write(struct feat_fd *ff, const void *buf, size_t size) } /* Return: 0 if succeded, -ERR if failed. */ +static int do_write_bitmap(struct feat_fd *ff, unsigned long *set, u64 size) +{ + u64 *p = (u64 *) set; + int i, ret; + + ret = do_write(ff, &size, sizeof(size)); + if (ret < 0) + return ret; + + for (i = 0; (u64) i < BITS_TO_U64(size); i++) { + ret = do_write(ff, p + i, sizeof(*p)); + if (ret < 0) + return ret; + } + + return 0; +} + +/* Return: 0 if succeded, -ERR if failed. */ int write_padded(struct feat_fd *ff, const void *bf, size_t count, size_t count_aligned) { @@ -243,6 +264,38 @@ static char *do_read_string(struct feat_fd *ff) return NULL; } +/* Return: 0 if succeded, -ERR if failed. */ +static int do_read_bitmap(struct feat_fd *ff, unsigned long **pset, u64 *psize) +{ + unsigned long *set; + u64 size, *p; + int i, ret; + + ret = do_read_u64(ff, &size); + if (ret) + return ret; + + set = bitmap_alloc(size); + if (!set) + return -ENOMEM; + + bitmap_zero(set, size); + + p = (u64 *) set; + + for (i = 0; (u64) i < BITS_TO_U64(size); i++) { + ret = do_read_u64(ff, p + i); + if (ret < 0) { + free(set); + return ret; + } + } + + *pset = set; + *psize = size; + return 0; +} + static int write_tracing_data(struct feat_fd *ff, struct perf_evlist *evlist) { @@ -1196,6 +1249,176 @@ static int write_sample_time(struct feat_fd *ff, sizeof(evlist->last_sample_time)); } + +static int memory_node__read(struct memory_node *n, unsigned long idx) +{ + unsigned int phys, size = 0; + char path[PATH_MAX]; + struct dirent *ent; + DIR *dir; + +#define for_each_memory(mem, dir) \ + while ((ent = readdir(dir))) \ + if (strcmp(ent->d_name, ".") && \ + strcmp(ent->d_name, "..") && \ + sscanf(ent->d_name, "memory%u", &mem) == 1) + + scnprintf(path, PATH_MAX, + "%s/devices/system/node/node%lu", + sysfs__mountpoint(), idx); + + dir = opendir(path); + if (!dir) { + pr_warning("failed: cant' open memory sysfs data\n"); + return -1; + } + + for_each_memory(phys, dir) { + size = max(phys, size); + } + + size++; + + n->set = bitmap_alloc(size); + if (!n->set) { + closedir(dir); + return -ENOMEM; + } + + bitmap_zero(n->set, size); + n->node = idx; + n->size = size; + + rewinddir(dir); + + for_each_memory(phys, dir) { + set_bit(phys, n->set); + } + + closedir(dir); + return 0; +} + +static int memory_node__sort(const void *a, const void *b) +{ + const struct memory_node *na = a; + const struct memory_node *nb = b; + + return na->node - nb->node; +} + +static int build_mem_topology(struct memory_node *nodes, u64 size, u64 *cntp) +{ + char path[PATH_MAX]; + struct dirent *ent; + DIR *dir; + u64 cnt = 0; + int ret = 0; + + scnprintf(path, PATH_MAX, "%s/devices/system/node/", + sysfs__mountpoint()); + + dir = opendir(path); + if (!dir) { + pr_warning("failed: can't open node sysfs data\n"); + return -1; + } + + while (!ret && (ent = readdir(dir))) { + unsigned int idx; + int r; + + if (!strcmp(ent->d_name, ".") || + !strcmp(ent->d_name, "..")) + continue; + + r = sscanf(ent->d_name, "node%u", &idx); + if (r != 1) + continue; + + if (WARN_ONCE(cnt >= size, + "failed to write MEM_TOPOLOGY, way too many nodes\n")) + return -1; + + ret = memory_node__read(&nodes[cnt++], idx); + } + + *cntp = cnt; + closedir(dir); + + if (!ret) + qsort(nodes, cnt, sizeof(nodes[0]), memory_node__sort); + + return ret; +} + +#define MAX_MEMORY_NODES 2000 + +/* + * The MEM_TOPOLOGY holds physical memory map for every + * node in system. The format of data is as follows: + * + * 0 - version | for future changes + * 8 - block_size_bytes | /sys/devices/system/memory/block_size_bytes + * 16 - count | number of nodes + * + * For each node we store map of physical indexes for + * each node: + * + * 32 - node id | node index + * 40 - size | size of bitmap + * 48 - bitmap | bitmap of memory indexes that belongs to node + */ +static int write_mem_topology(struct feat_fd *ff __maybe_unused, + struct perf_evlist *evlist __maybe_unused) +{ + static struct memory_node nodes[MAX_MEMORY_NODES]; + u64 bsize, version = 1, i, nr; + int ret; + + ret = sysfs__read_xll("devices/system/memory/block_size_bytes", + (unsigned long long *) &bsize); + if (ret) + return ret; + + ret = build_mem_topology(&nodes[0], MAX_MEMORY_NODES, &nr); + if (ret) + return ret; + + ret = do_write(ff, &version, sizeof(version)); + if (ret < 0) + goto out; + + ret = do_write(ff, &bsize, sizeof(bsize)); + if (ret < 0) + goto out; + + ret = do_write(ff, &nr, sizeof(nr)); + if (ret < 0) + goto out; + + for (i = 0; i < nr; i++) { + struct memory_node *n = &nodes[i]; + + #define _W(v) \ + ret = do_write(ff, &n->v, sizeof(n->v)); \ + if (ret < 0) \ + goto out; + + _W(node) + _W(size) + + #undef _W + + ret = do_write_bitmap(ff, n->set, n->size); + if (ret < 0) + goto out; + } + +out: + return ret; +} + static void print_hostname(struct feat_fd *ff, FILE *fp) { fprintf(fp, "# hostname : %s\n", ff->ph->env.hostname); @@ -1543,6 +1766,35 @@ static void print_sample_time(struct feat_fd *ff, FILE *fp) fprintf(fp, "# sample duration : %10.3f ms\n", d); } +static void memory_node__fprintf(struct memory_node *n, + unsigned long long bsize, FILE *fp) +{ + char buf_map[100], buf_size[50]; + unsigned long long size; + + size = bsize * bitmap_weight(n->set, n->size); + unit_number__scnprintf(buf_size, 50, size); + + bitmap_scnprintf(n->set, n->size, buf_map, 100); + fprintf(fp, "# %3" PRIu64 " [%s]: %s\n", n->node, buf_size, buf_map); +} + +static void print_mem_topology(struct feat_fd *ff, FILE *fp) +{ + struct memory_node *nodes; + int i, nr; + + nodes = ff->ph->env.memory_nodes; + nr = ff->ph->env.nr_memory_nodes; + + fprintf(fp, "# memory nodes (nr %d, block size 0x%llx):\n", + nr, ff->ph->env.memory_bsize); + + for (i = 0; i < nr; i++) { + memory_node__fprintf(&nodes[i], ff->ph->env.memory_bsize, fp); + } +} + static int __event_process_build_id(struct build_id_event *bev, char *filename, struct perf_session *session) @@ -2205,6 +2457,58 @@ static int process_sample_time(struct feat_fd *ff, void *data __maybe_unused) return 0; } +static int process_mem_topology(struct feat_fd *ff, + void *data __maybe_unused) +{ + struct memory_node *nodes; + u64 version, i, nr, bsize; + int ret = -1; + + if (do_read_u64(ff, &version)) + return -1; + + if (version != 1) + return -1; + + if (do_read_u64(ff, &bsize)) + return -1; + + if (do_read_u64(ff, &nr)) + return -1; + + nodes = zalloc(sizeof(*nodes) * nr); + if (!nodes) + return -1; + + for (i = 0; i < nr; i++) { + struct memory_node n; + + #define _R(v) \ + if (do_read_u64(ff, &n.v)) \ + goto out; \ + + _R(node) + _R(size) + + #undef _R + + if (do_read_bitmap(ff, &n.set, &n.size)) + goto out; + + nodes[i] = n; + } + + ff->ph->env.memory_bsize = bsize; + ff->ph->env.memory_nodes = nodes; + ff->ph->env.nr_memory_nodes = nr; + ret = 0; + +out: + if (ret) + free(nodes); + return ret; +} + struct feature_ops { int (*write)(struct feat_fd *ff, struct perf_evlist *evlist); void (*print)(struct feat_fd *ff, FILE *fp); @@ -2263,6 +2567,7 @@ static const struct feature_ops feat_ops[HEADER_LAST_FEATURE] = { FEAT_OPN(STAT, stat, false), FEAT_OPN(CACHE, cache, true), FEAT_OPR(SAMPLE_TIME, sample_time, false), + FEAT_OPR(MEM_TOPOLOGY, mem_topology, true), }; struct header_print_data { @@ -2318,7 +2623,12 @@ int perf_header__fprintf_info(struct perf_session *session, FILE *fp, bool full) if (ret == -1) return -1; - fprintf(fp, "# captured on: %s", ctime(&st.st_ctime)); + fprintf(fp, "# captured on : %s", ctime(&st.st_ctime)); + + fprintf(fp, "# header version : %u\n", header->version); + fprintf(fp, "# data offset : %" PRIu64 "\n", header->data_offset); + fprintf(fp, "# data size : %" PRIu64 "\n", header->data_size); + fprintf(fp, "# feat offset : %" PRIu64 "\n", header->feat_offset); perf_header__process_sections(header, fd, &hd, perf_file_section__fprintf_info); @@ -3105,8 +3415,17 @@ int perf_event__synthesize_features(struct perf_tool *tool, return ret; } } + + /* Send HEADER_LAST_FEATURE mark. */ + fe = ff.buf; + fe->feat_id = HEADER_LAST_FEATURE; + fe->header.type = PERF_RECORD_HEADER_FEATURE; + fe->header.size = sizeof(*fe); + + ret = process(tool, ff.buf, NULL, NULL); + free(ff.buf); - return 0; + return ret; } int perf_event__process_feature(struct perf_tool *tool, diff --git a/tools/perf/util/header.h b/tools/perf/util/header.h index f28aaaa3a440..90d4577a92dc 100644 --- a/tools/perf/util/header.h +++ b/tools/perf/util/header.h @@ -36,6 +36,7 @@ enum { HEADER_STAT, HEADER_CACHE, HEADER_SAMPLE_TIME, + HEADER_MEM_TOPOLOGY, HEADER_LAST_FEATURE, HEADER_FEAT_BITS = 256, }; @@ -174,4 +175,5 @@ int write_padded(struct feat_fd *fd, const void *bf, int get_cpuid(char *buffer, size_t sz); char *get_cpuid_str(struct perf_pmu *pmu __maybe_unused); +int strcmp_cpuid_str(const char *s1, const char *s2); #endif /* __PERF_HEADER_H */ diff --git a/tools/perf/util/hist.c b/tools/perf/util/hist.c index b6140950301e..7d968892ee39 100644 --- a/tools/perf/util/hist.c +++ b/tools/perf/util/hist.c @@ -536,7 +536,7 @@ static struct hist_entry *hists__findnew_entry(struct hists *hists, * This mem info was allocated from sample__resolve_mem * and will not be used anymore. */ - zfree(&entry->mem_info); + mem_info__zput(entry->mem_info); /* If the map of an existing hist_entry has * become out-of-date due to an exec() or @@ -879,7 +879,7 @@ iter_prepare_cumulative_entry(struct hist_entry_iter *iter, * cumulated only one time to prevent entries more than 100% * overhead. */ - he_cache = malloc(sizeof(*he_cache) * (iter->max_stack + 1)); + he_cache = malloc(sizeof(*he_cache) * (callchain_cursor.nr + 1)); if (he_cache == NULL) return -ENOMEM; @@ -1045,8 +1045,6 @@ int hist_entry_iter__add(struct hist_entry_iter *iter, struct addr_location *al, if (err) return err; - iter->max_stack = max_stack_depth; - err = iter->ops->prepare_entry(iter, al); if (err) goto out; @@ -1141,7 +1139,7 @@ void hist_entry__delete(struct hist_entry *he) if (he->mem_info) { map__zput(he->mem_info->iaddr.map); map__zput(he->mem_info->daddr.map); - zfree(&he->mem_info); + mem_info__zput(he->mem_info); } zfree(&he->stat_acc); diff --git a/tools/perf/util/hist.h b/tools/perf/util/hist.h index 02721b579746..e869cad4d89f 100644 --- a/tools/perf/util/hist.h +++ b/tools/perf/util/hist.h @@ -107,7 +107,6 @@ struct hist_entry_iter { int curr; bool hide_unresolved; - int max_stack; struct perf_evsel *evsel; struct perf_sample *sample; diff --git a/tools/perf/util/intel-pt-decoder/intel-pt-decoder.c b/tools/perf/util/intel-pt-decoder/intel-pt-decoder.c index aa1593ce551d..f9157aed1289 100644 --- a/tools/perf/util/intel-pt-decoder/intel-pt-decoder.c +++ b/tools/perf/util/intel-pt-decoder/intel-pt-decoder.c @@ -1378,6 +1378,7 @@ static int intel_pt_overflow(struct intel_pt_decoder *decoder) intel_pt_clear_tx_flags(decoder); decoder->have_tma = false; decoder->cbr = 0; + decoder->timestamp_insn_cnt = 0; decoder->pkt_state = INTEL_PT_STATE_ERR_RESYNC; decoder->overflow = true; return -EOVERFLOW; @@ -1616,6 +1617,7 @@ static int intel_pt_walk_fup_tip(struct intel_pt_decoder *decoder) case INTEL_PT_PWRX: intel_pt_log("ERROR: Missing TIP after FUP\n"); decoder->pkt_state = INTEL_PT_STATE_ERR3; + decoder->pkt_step = 0; return -ENOENT; case INTEL_PT_OVF: @@ -2390,14 +2392,6 @@ const struct intel_pt_state *intel_pt_decode(struct intel_pt_decoder *decoder) return &decoder->state; } -static bool intel_pt_at_psb(unsigned char *buf, size_t len) -{ - if (len < INTEL_PT_PSB_LEN) - return false; - return memmem(buf, INTEL_PT_PSB_LEN, INTEL_PT_PSB_STR, - INTEL_PT_PSB_LEN); -} - /** * intel_pt_next_psb - move buffer pointer to the start of the next PSB packet. * @buf: pointer to buffer pointer @@ -2486,6 +2480,7 @@ static unsigned char *intel_pt_last_psb(unsigned char *buf, size_t len) * @buf: buffer * @len: size of buffer * @tsc: TSC value returned + * @rem: returns remaining size when TSC is found * * Find a TSC packet in @buf and return the TSC value. This function assumes * that @buf starts at a PSB and that PSB+ will contain TSC and so stops if a @@ -2493,7 +2488,8 @@ static unsigned char *intel_pt_last_psb(unsigned char *buf, size_t len) * * Return: %true if TSC is found, false otherwise. */ -static bool intel_pt_next_tsc(unsigned char *buf, size_t len, uint64_t *tsc) +static bool intel_pt_next_tsc(unsigned char *buf, size_t len, uint64_t *tsc, + size_t *rem) { struct intel_pt_pkt packet; int ret; @@ -2504,6 +2500,7 @@ static bool intel_pt_next_tsc(unsigned char *buf, size_t len, uint64_t *tsc) return false; if (packet.type == INTEL_PT_TSC) { *tsc = packet.payload; + *rem = len; return true; } if (packet.type == INTEL_PT_PSBEND) @@ -2554,6 +2551,8 @@ static int intel_pt_tsc_cmp(uint64_t tsc1, uint64_t tsc2) * @len_a: size of first buffer * @buf_b: second buffer * @len_b: size of second buffer + * @consecutive: returns true if there is data in buf_b that is consecutive + * to buf_a * * If the trace contains TSC we can look at the last TSC of @buf_a and the * first TSC of @buf_b in order to determine if the buffers overlap, and then @@ -2566,33 +2565,41 @@ static int intel_pt_tsc_cmp(uint64_t tsc1, uint64_t tsc2) static unsigned char *intel_pt_find_overlap_tsc(unsigned char *buf_a, size_t len_a, unsigned char *buf_b, - size_t len_b) + size_t len_b, bool *consecutive) { uint64_t tsc_a, tsc_b; unsigned char *p; - size_t len; + size_t len, rem_a, rem_b; p = intel_pt_last_psb(buf_a, len_a); if (!p) return buf_b; /* No PSB in buf_a => no overlap */ len = len_a - (p - buf_a); - if (!intel_pt_next_tsc(p, len, &tsc_a)) { + if (!intel_pt_next_tsc(p, len, &tsc_a, &rem_a)) { /* The last PSB+ in buf_a is incomplete, so go back one more */ len_a -= len; p = intel_pt_last_psb(buf_a, len_a); if (!p) return buf_b; /* No full PSB+ => assume no overlap */ len = len_a - (p - buf_a); - if (!intel_pt_next_tsc(p, len, &tsc_a)) + if (!intel_pt_next_tsc(p, len, &tsc_a, &rem_a)) return buf_b; /* No TSC in buf_a => assume no overlap */ } while (1) { /* Ignore PSB+ with no TSC */ - if (intel_pt_next_tsc(buf_b, len_b, &tsc_b) && - intel_pt_tsc_cmp(tsc_a, tsc_b) < 0) - return buf_b; /* tsc_a < tsc_b => no overlap */ + if (intel_pt_next_tsc(buf_b, len_b, &tsc_b, &rem_b)) { + int cmp = intel_pt_tsc_cmp(tsc_a, tsc_b); + + /* Same TSC, so buffers are consecutive */ + if (!cmp && rem_b >= rem_a) { + *consecutive = true; + return buf_b + len_b - (rem_b - rem_a); + } + if (cmp < 0) + return buf_b; /* tsc_a < tsc_b => no overlap */ + } if (!intel_pt_step_psb(&buf_b, &len_b)) return buf_b + len_b; /* No PSB in buf_b => no data */ @@ -2606,6 +2613,8 @@ static unsigned char *intel_pt_find_overlap_tsc(unsigned char *buf_a, * @buf_b: second buffer * @len_b: size of second buffer * @have_tsc: can use TSC packets to detect overlap + * @consecutive: returns true if there is data in buf_b that is consecutive + * to buf_a * * When trace samples or snapshots are recorded there is the possibility that * the data overlaps. Note that, for the purposes of decoding, data is only @@ -2616,7 +2625,7 @@ static unsigned char *intel_pt_find_overlap_tsc(unsigned char *buf_a, */ unsigned char *intel_pt_find_overlap(unsigned char *buf_a, size_t len_a, unsigned char *buf_b, size_t len_b, - bool have_tsc) + bool have_tsc, bool *consecutive) { unsigned char *found; @@ -2628,7 +2637,8 @@ unsigned char *intel_pt_find_overlap(unsigned char *buf_a, size_t len_a, return buf_b; /* No overlap */ if (have_tsc) { - found = intel_pt_find_overlap_tsc(buf_a, len_a, buf_b, len_b); + found = intel_pt_find_overlap_tsc(buf_a, len_a, buf_b, len_b, + consecutive); if (found) return found; } @@ -2643,28 +2653,16 @@ unsigned char *intel_pt_find_overlap(unsigned char *buf_a, size_t len_a, } /* Now len_b >= len_a */ - if (len_b > len_a) { - /* The leftover buffer 'b' must start at a PSB */ - while (!intel_pt_at_psb(buf_b + len_a, len_b - len_a)) { - if (!intel_pt_step_psb(&buf_a, &len_a)) - return buf_b; /* No overlap */ - } - } - while (1) { /* Potential overlap so check the bytes */ found = memmem(buf_a, len_a, buf_b, len_a); - if (found) + if (found) { + *consecutive = true; return buf_b + len_a; + } /* Try again at next PSB in buffer 'a' */ if (!intel_pt_step_psb(&buf_a, &len_a)) return buf_b; /* No overlap */ - - /* The leftover buffer 'b' must start at a PSB */ - while (!intel_pt_at_psb(buf_b + len_a, len_b - len_a)) { - if (!intel_pt_step_psb(&buf_a, &len_a)) - return buf_b; /* No overlap */ - } } } diff --git a/tools/perf/util/intel-pt-decoder/intel-pt-decoder.h b/tools/perf/util/intel-pt-decoder/intel-pt-decoder.h index 921b22e8ca0e..fc1752d50019 100644 --- a/tools/perf/util/intel-pt-decoder/intel-pt-decoder.h +++ b/tools/perf/util/intel-pt-decoder/intel-pt-decoder.h @@ -117,7 +117,7 @@ const struct intel_pt_state *intel_pt_decode(struct intel_pt_decoder *decoder); unsigned char *intel_pt_find_overlap(unsigned char *buf_a, size_t len_a, unsigned char *buf_b, size_t len_b, - bool have_tsc); + bool have_tsc, bool *consecutive); int intel_pt__strerror(int code, char *buf, size_t buflen); diff --git a/tools/perf/util/intel-pt.c b/tools/perf/util/intel-pt.c index 3773d9c54f45..0effaff57020 100644 --- a/tools/perf/util/intel-pt.c +++ b/tools/perf/util/intel-pt.c @@ -132,6 +132,7 @@ struct intel_pt_queue { struct intel_pt *pt; unsigned int queue_nr; struct auxtrace_buffer *buffer; + struct auxtrace_buffer *old_buffer; void *decoder; const struct intel_pt_state *state; struct ip_callchain *chain; @@ -143,6 +144,7 @@ struct intel_pt_queue { bool stop; bool step_through_buffers; bool use_buffer_pid_tid; + bool sync_switch; pid_t pid, tid; int cpu; int switch_state; @@ -207,49 +209,28 @@ static void intel_pt_dump_event(struct intel_pt *pt, unsigned char *buf, static int intel_pt_do_fix_overlap(struct intel_pt *pt, struct auxtrace_buffer *a, struct auxtrace_buffer *b) { + bool consecutive = false; void *start; start = intel_pt_find_overlap(a->data, a->size, b->data, b->size, - pt->have_tsc); + pt->have_tsc, &consecutive); if (!start) return -EINVAL; b->use_size = b->data + b->size - start; b->use_data = start; + if (b->use_size && consecutive) + b->consecutive = true; return 0; } -static void intel_pt_use_buffer_pid_tid(struct intel_pt_queue *ptq, - struct auxtrace_queue *queue, - struct auxtrace_buffer *buffer) -{ - if (queue->cpu == -1 && buffer->cpu != -1) - ptq->cpu = buffer->cpu; - - ptq->pid = buffer->pid; - ptq->tid = buffer->tid; - - intel_pt_log("queue %u cpu %d pid %d tid %d\n", - ptq->queue_nr, ptq->cpu, ptq->pid, ptq->tid); - - thread__zput(ptq->thread); - - if (ptq->tid != -1) { - if (ptq->pid != -1) - ptq->thread = machine__findnew_thread(ptq->pt->machine, - ptq->pid, - ptq->tid); - else - ptq->thread = machine__find_thread(ptq->pt->machine, -1, - ptq->tid); - } -} - /* This function assumes data is processed sequentially only */ static int intel_pt_get_trace(struct intel_pt_buffer *b, void *data) { struct intel_pt_queue *ptq = data; - struct auxtrace_buffer *buffer = ptq->buffer, *old_buffer = buffer; + struct auxtrace_buffer *buffer = ptq->buffer; + struct auxtrace_buffer *old_buffer = ptq->old_buffer; struct auxtrace_queue *queue; + bool might_overlap; if (ptq->stop) { b->len = 0; @@ -257,7 +238,7 @@ static int intel_pt_get_trace(struct intel_pt_buffer *b, void *data) } queue = &ptq->pt->queues.queue_array[ptq->queue_nr]; -next: + buffer = auxtrace_buffer__next(queue, buffer); if (!buffer) { if (old_buffer) @@ -276,7 +257,8 @@ next: return -ENOMEM; } - if (ptq->pt->snapshot_mode && !buffer->consecutive && old_buffer && + might_overlap = ptq->pt->snapshot_mode || ptq->pt->sampling_mode; + if (might_overlap && !buffer->consecutive && old_buffer && intel_pt_do_fix_overlap(ptq->pt, old_buffer, buffer)) return -ENOMEM; @@ -289,33 +271,24 @@ next: } b->ref_timestamp = buffer->reference; - /* - * If in snapshot mode and the buffer has no usable data, get next - * buffer and again check overlap against old_buffer. - */ - if (ptq->pt->snapshot_mode && !b->len) - goto next; - - if (old_buffer) - auxtrace_buffer__drop_data(old_buffer); - - if (!old_buffer || ptq->pt->sampling_mode || (ptq->pt->snapshot_mode && - !buffer->consecutive)) { + if (!old_buffer || (might_overlap && !buffer->consecutive)) { b->consecutive = false; b->trace_nr = buffer->buffer_nr + 1; } else { b->consecutive = true; } - if (ptq->use_buffer_pid_tid && (ptq->pid != buffer->pid || - ptq->tid != buffer->tid)) - intel_pt_use_buffer_pid_tid(ptq, queue, buffer); - if (ptq->step_through_buffers) ptq->stop = true; - if (!b->len) + if (b->len) { + if (old_buffer) + auxtrace_buffer__drop_data(old_buffer); + ptq->old_buffer = buffer; + } else { + auxtrace_buffer__drop_data(buffer); return intel_pt_get_trace(b, data); + } return 0; } @@ -954,16 +927,15 @@ static int intel_pt_setup_queue(struct intel_pt *pt, ptq->cpu = queue->cpu; ptq->tid = queue->tid; - if (pt->sampling_mode) { - if (pt->timeless_decoding) - ptq->step_through_buffers = true; - if (pt->timeless_decoding || !pt->have_sched_switch) - ptq->use_buffer_pid_tid = true; - } + if (pt->sampling_mode && !pt->snapshot_mode && + pt->timeless_decoding) + ptq->step_through_buffers = true; + + ptq->sync_switch = pt->sync_switch; } if (!ptq->on_heap && - (!pt->sync_switch || + (!ptq->sync_switch || ptq->switch_state != INTEL_PT_SS_EXPECTING_SWITCH_EVENT)) { const struct intel_pt_state *state; int ret; @@ -1546,7 +1518,7 @@ static int intel_pt_sample(struct intel_pt_queue *ptq) if (pt->synth_opts.last_branch) intel_pt_update_last_branch_rb(ptq); - if (!pt->sync_switch) + if (!ptq->sync_switch) return 0; if (intel_pt_is_switch_ip(ptq, state->to_ip)) { @@ -1627,6 +1599,21 @@ static u64 intel_pt_switch_ip(struct intel_pt *pt, u64 *ptss_ip) return switch_ip; } +static void intel_pt_enable_sync_switch(struct intel_pt *pt) +{ + unsigned int i; + + pt->sync_switch = true; + + for (i = 0; i < pt->queues.nr_queues; i++) { + struct auxtrace_queue *queue = &pt->queues.queue_array[i]; + struct intel_pt_queue *ptq = queue->priv; + + if (ptq) + ptq->sync_switch = true; + } +} + static int intel_pt_run_decoder(struct intel_pt_queue *ptq, u64 *timestamp) { const struct intel_pt_state *state = ptq->state; @@ -1643,7 +1630,7 @@ static int intel_pt_run_decoder(struct intel_pt_queue *ptq, u64 *timestamp) if (pt->switch_ip) { intel_pt_log("switch_ip: %"PRIx64" ptss_ip: %"PRIx64"\n", pt->switch_ip, pt->ptss_ip); - pt->sync_switch = true; + intel_pt_enable_sync_switch(pt); } } } @@ -1659,9 +1646,9 @@ static int intel_pt_run_decoder(struct intel_pt_queue *ptq, u64 *timestamp) if (state->err) { if (state->err == INTEL_PT_ERR_NODATA) return 1; - if (pt->sync_switch && + if (ptq->sync_switch && state->from_ip >= pt->kernel_start) { - pt->sync_switch = false; + ptq->sync_switch = false; intel_pt_next_tid(pt, ptq); } if (pt->synth_opts.errors) { @@ -1687,7 +1674,7 @@ static int intel_pt_run_decoder(struct intel_pt_queue *ptq, u64 *timestamp) state->timestamp, state->est_timestamp); ptq->timestamp = state->est_timestamp; /* Use estimated TSC in unknown switch state */ - } else if (pt->sync_switch && + } else if (ptq->sync_switch && ptq->switch_state == INTEL_PT_SS_UNKNOWN && intel_pt_is_switch_ip(ptq, state->to_ip) && ptq->next_tid == -1) { @@ -1834,7 +1821,7 @@ static int intel_pt_sync_switch(struct intel_pt *pt, int cpu, pid_t tid, return 1; ptq = intel_pt_cpu_to_ptq(pt, cpu); - if (!ptq) + if (!ptq || !ptq->sync_switch) return 1; switch (ptq->switch_state) { @@ -2075,9 +2062,6 @@ static int intel_pt_process_auxtrace_event(struct perf_session *session, struct intel_pt *pt = container_of(session->auxtrace, struct intel_pt, auxtrace); - if (pt->sampling_mode) - return 0; - if (!pt->data_queued) { struct auxtrace_buffer *buffer; off_t data_offset; diff --git a/tools/perf/util/llvm-utils.c b/tools/perf/util/llvm-utils.c index 4952b429caa7..1cca0a2fa641 100644 --- a/tools/perf/util/llvm-utils.c +++ b/tools/perf/util/llvm-utils.c @@ -433,6 +433,7 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, char serr[STRERR_BUFSIZE]; char *kbuild_dir = NULL, *kbuild_include_opts = NULL; const char *template = llvm_param.clang_bpf_cmd_template; + char *command_echo, *command_out; if (path[0] != '-' && realpath(path, abspath) == NULL) { err = errno; @@ -487,6 +488,16 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, (path[0] == '-') ? path : abspath); pr_debug("llvm compiling command template: %s\n", template); + + if (asprintf(&command_echo, "echo -n \"%s\"", template) < 0) + goto errout; + + err = read_from_pipe(command_echo, (void **) &command_out, NULL); + if (err) + goto errout; + + pr_debug("llvm compiling command : %s\n", command_out); + err = read_from_pipe(template, &obj_buf, &obj_buf_sz); if (err) { pr_err("ERROR:\tunable to compile %s\n", path); @@ -497,6 +508,8 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, goto errout; } + free(command_echo); + free(command_out); free(kbuild_dir); free(kbuild_include_opts); @@ -509,6 +522,7 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, *p_obj_buf_sz = obj_buf_sz; return 0; errout: + free(command_echo); free(kbuild_dir); free(kbuild_include_opts); free(obj_buf); diff --git a/tools/perf/util/machine.c b/tools/perf/util/machine.c index b05a67464c03..2eca8478e24f 100644 --- a/tools/perf/util/machine.c +++ b/tools/perf/util/machine.c @@ -48,8 +48,23 @@ static void machine__threads_init(struct machine *machine) } } +static int machine__set_mmap_name(struct machine *machine) +{ + if (machine__is_host(machine)) + machine->mmap_name = strdup("[kernel.kallsyms]"); + else if (machine__is_default_guest(machine)) + machine->mmap_name = strdup("[guest.kernel.kallsyms]"); + else if (asprintf(&machine->mmap_name, "[guest.kernel.kallsyms.%d]", + machine->pid) < 0) + machine->mmap_name = NULL; + + return machine->mmap_name ? 0 : -ENOMEM; +} + int machine__init(struct machine *machine, const char *root_dir, pid_t pid) { + int err = -ENOMEM; + memset(machine, 0, sizeof(*machine)); map_groups__init(&machine->kmaps, machine); RB_CLEAR_NODE(&machine->rb_node); @@ -73,13 +88,16 @@ int machine__init(struct machine *machine, const char *root_dir, pid_t pid) if (machine->root_dir == NULL) return -ENOMEM; + if (machine__set_mmap_name(machine)) + goto out; + if (pid != HOST_KERNEL_ID) { struct thread *thread = machine__findnew_thread(machine, -1, pid); char comm[64]; if (thread == NULL) - return -ENOMEM; + goto out; snprintf(comm, sizeof(comm), "[guest/%d]", pid); thread__set_comm(thread, comm, 0); @@ -87,7 +105,13 @@ int machine__init(struct machine *machine, const char *root_dir, pid_t pid) } machine->current_tid = NULL; + err = 0; +out: + if (err) { + zfree(&machine->root_dir); + zfree(&machine->mmap_name); + } return 0; } @@ -119,7 +143,7 @@ struct machine *machine__new_kallsyms(void) * ask for not using the kcore parsing code, once this one is fixed * to create a map per module. */ - if (machine && __machine__load_kallsyms(machine, "/proc/kallsyms", MAP__FUNCTION, true) <= 0) { + if (machine && machine__load_kallsyms(machine, "/proc/kallsyms", MAP__FUNCTION) <= 0) { machine__delete(machine); machine = NULL; } @@ -180,6 +204,7 @@ void machine__exit(struct machine *machine) dsos__exit(&machine->dsos); machine__exit_vdso(machine); zfree(&machine->root_dir); + zfree(&machine->mmap_name); zfree(&machine->current_tid); for (i = 0; i < THREADS__TABLE_SIZE; i++) { @@ -322,20 +347,6 @@ void machines__process_guests(struct machines *machines, } } -char *machine__mmap_name(struct machine *machine, char *bf, size_t size) -{ - if (machine__is_host(machine)) - snprintf(bf, size, "[%s]", "kernel.kallsyms"); - else if (machine__is_default_guest(machine)) - snprintf(bf, size, "[%s]", "guest.kernel.kallsyms"); - else { - snprintf(bf, size, "[%s.%d]", "guest.kernel.kallsyms", - machine->pid); - } - - return bf; -} - void machines__set_id_hdr_size(struct machines *machines, u16 id_hdr_size) { struct rb_node *node; @@ -771,24 +782,18 @@ size_t machine__fprintf(struct machine *machine, FILE *fp) static struct dso *machine__get_kernel(struct machine *machine) { - const char *vmlinux_name = NULL; + const char *vmlinux_name = machine->mmap_name; struct dso *kernel; if (machine__is_host(machine)) { - vmlinux_name = symbol_conf.vmlinux_name; - if (!vmlinux_name) - vmlinux_name = DSO__NAME_KALLSYMS; + if (symbol_conf.vmlinux_name) + vmlinux_name = symbol_conf.vmlinux_name; kernel = machine__findnew_kernel(machine, vmlinux_name, "[kernel]", DSO_TYPE_KERNEL); } else { - char bf[PATH_MAX]; - - if (machine__is_default_guest(machine)) + if (symbol_conf.default_guest_vmlinux_name) vmlinux_name = symbol_conf.default_guest_vmlinux_name; - if (!vmlinux_name) - vmlinux_name = machine__mmap_name(machine, bf, - sizeof(bf)); kernel = machine__findnew_kernel(machine, vmlinux_name, "[guest.kernel]", @@ -849,13 +854,10 @@ static int machine__get_running_kernel_start(struct machine *machine, return 0; } -int __machine__create_kernel_maps(struct machine *machine, struct dso *kernel) +static int +__machine__create_kernel_maps(struct machine *machine, struct dso *kernel) { int type; - u64 start = 0; - - if (machine__get_running_kernel_start(machine, NULL, &start)) - return -1; /* In case of renewal the kernel map, destroy previous one */ machine__destroy_kernel_maps(machine); @@ -864,7 +866,7 @@ int __machine__create_kernel_maps(struct machine *machine, struct dso *kernel) struct kmap *kmap; struct map *map; - machine->vmlinux_maps[type] = map__new2(start, kernel, type); + machine->vmlinux_maps[type] = map__new2(0, kernel, type); if (machine->vmlinux_maps[type] == NULL) return -1; @@ -987,11 +989,11 @@ int machines__create_kernel_maps(struct machines *machines, pid_t pid) return machine__create_kernel_maps(machine); } -int __machine__load_kallsyms(struct machine *machine, const char *filename, - enum map_type type, bool no_kcore) +int machine__load_kallsyms(struct machine *machine, const char *filename, + enum map_type type) { struct map *map = machine__kernel_map(machine); - int ret = __dso__load_kallsyms(map->dso, filename, map, no_kcore); + int ret = __dso__load_kallsyms(map->dso, filename, map, true); if (ret > 0) { dso__set_loaded(map->dso, type); @@ -1006,12 +1008,6 @@ int __machine__load_kallsyms(struct machine *machine, const char *filename, return ret; } -int machine__load_kallsyms(struct machine *machine, const char *filename, - enum map_type type) -{ - return __machine__load_kallsyms(machine, filename, type, false); -} - int machine__load_vmlinux_path(struct machine *machine, enum map_type type) { struct map *map = machine__kernel_map(machine); @@ -1215,6 +1211,24 @@ static int machine__create_modules(struct machine *machine) return 0; } +static void machine__set_kernel_mmap(struct machine *machine, + u64 start, u64 end) +{ + int i; + + for (i = 0; i < MAP__NR_TYPES; i++) { + machine->vmlinux_maps[i]->start = start; + machine->vmlinux_maps[i]->end = end; + + /* + * Be a bit paranoid here, some perf.data file came with + * a zero sized synthesized MMAP event for the kernel. + */ + if (start == 0 && end == 0) + machine->vmlinux_maps[i]->end = ~0ULL; + } +} + int machine__create_kernel_maps(struct machine *machine) { struct dso *kernel = machine__get_kernel(machine); @@ -1239,40 +1253,22 @@ int machine__create_kernel_maps(struct machine *machine) "continuing anyway...\n", machine->pid); } - /* - * Now that we have all the maps created, just set the ->end of them: - */ - map_groups__fixup_end(&machine->kmaps); - if (!machine__get_running_kernel_start(machine, &name, &addr)) { if (name && maps__set_kallsyms_ref_reloc_sym(machine->vmlinux_maps, name, addr)) { machine__destroy_kernel_maps(machine); return -1; } + machine__set_kernel_mmap(machine, addr, 0); } + /* + * Now that we have all the maps created, just set the ->end of them: + */ + map_groups__fixup_end(&machine->kmaps); return 0; } -static void machine__set_kernel_mmap_len(struct machine *machine, - union perf_event *event) -{ - int i; - - for (i = 0; i < MAP__NR_TYPES; i++) { - machine->vmlinux_maps[i]->start = event->mmap.start; - machine->vmlinux_maps[i]->end = (event->mmap.start + - event->mmap.len); - /* - * Be a bit paranoid here, some perf.data file came with - * a zero sized synthesized MMAP event for the kernel. - */ - if (machine->vmlinux_maps[i]->end == 0) - machine->vmlinux_maps[i]->end = ~0ULL; - } -} - static bool machine__uses_kcore(struct machine *machine) { struct dso *dso; @@ -1289,7 +1285,6 @@ static int machine__process_kernel_mmap_event(struct machine *machine, union perf_event *event) { struct map *map; - char kmmap_prefix[PATH_MAX]; enum dso_kernel_type kernel_type; bool is_kernel_mmap; @@ -1297,15 +1292,14 @@ static int machine__process_kernel_mmap_event(struct machine *machine, if (machine__uses_kcore(machine)) return 0; - machine__mmap_name(machine, kmmap_prefix, sizeof(kmmap_prefix)); if (machine__is_host(machine)) kernel_type = DSO_TYPE_KERNEL; else kernel_type = DSO_TYPE_GUEST_KERNEL; is_kernel_mmap = memcmp(event->mmap.filename, - kmmap_prefix, - strlen(kmmap_prefix) - 1) == 0; + machine->mmap_name, + strlen(machine->mmap_name) - 1) == 0; if (event->mmap.filename[0] == '/' || (!is_kernel_mmap && event->mmap.filename[0] == '[')) { map = machine__findnew_module_map(machine, event->mmap.start, @@ -1316,7 +1310,7 @@ static int machine__process_kernel_mmap_event(struct machine *machine, map->end = map->start + event->mmap.len; } else if (is_kernel_mmap) { const char *symbol_name = (event->mmap.filename + - strlen(kmmap_prefix)); + strlen(machine->mmap_name)); /* * Should be there already, from the build-id table in * the header. @@ -1357,7 +1351,7 @@ static int machine__process_kernel_mmap_event(struct machine *machine, up_read(&machine->dsos.lock); if (kernel == NULL) - kernel = machine__findnew_dso(machine, kmmap_prefix); + kernel = machine__findnew_dso(machine, machine->mmap_name); if (kernel == NULL) goto out_problem; @@ -1370,7 +1364,8 @@ static int machine__process_kernel_mmap_event(struct machine *machine, if (strstr(kernel->long_name, "vmlinux")) dso__set_short_name(kernel, "[kernel.vmlinux]", false); - machine__set_kernel_mmap_len(machine, event); + machine__set_kernel_mmap(machine, event->mmap.start, + event->mmap.start + event->mmap.len); /* * Avoid using a zero address (kptr_restrict) for the ref reloc @@ -1700,7 +1695,7 @@ static void ip__resolve_data(struct thread *thread, struct mem_info *sample__resolve_mem(struct perf_sample *sample, struct addr_location *al) { - struct mem_info *mi = zalloc(sizeof(*mi)); + struct mem_info *mi = mem_info__new(); if (!mi) return NULL; diff --git a/tools/perf/util/machine.h b/tools/perf/util/machine.h index 5ce860b64c74..66cc200ef86f 100644 --- a/tools/perf/util/machine.h +++ b/tools/perf/util/machine.h @@ -43,6 +43,7 @@ struct machine { bool comm_exec; bool kptr_restrict_warned; char *root_dir; + char *mmap_name; struct threads threads[THREADS__TABLE_SIZE]; struct vdso_info *vdso_info; struct perf_env *env; @@ -142,8 +143,6 @@ struct machine *machines__find(struct machines *machines, pid_t pid); struct machine *machines__findnew(struct machines *machines, pid_t pid); void machines__set_id_hdr_size(struct machines *machines, u16 id_hdr_size); -char *machine__mmap_name(struct machine *machine, char *bf, size_t size); - void machines__set_comm_exec(struct machines *machines, bool comm_exec); struct machine *machine__new_host(void); @@ -226,8 +225,6 @@ struct map *machine__findnew_module_map(struct machine *machine, u64 start, const char *filename); int arch__fix_module_text_start(u64 *start, const char *name); -int __machine__load_kallsyms(struct machine *machine, const char *filename, - enum map_type type, bool no_kcore); int machine__load_kallsyms(struct machine *machine, const char *filename, enum map_type type); int machine__load_vmlinux_path(struct machine *machine, enum map_type type); @@ -239,7 +236,6 @@ size_t machines__fprintf_dsos_buildid(struct machines *machines, FILE *fp, bool (skip)(struct dso *dso, int parm), int parm); void machine__destroy_kernel_maps(struct machine *machine); -int __machine__create_kernel_maps(struct machine *machine, struct dso *kernel); int machine__create_kernel_maps(struct machine *machine); int machines__create_kernel_maps(struct machines *machines, pid_t pid); diff --git a/tools/perf/util/mem2node.c b/tools/perf/util/mem2node.c new file mode 100644 index 000000000000..c6fd81c02586 --- /dev/null +++ b/tools/perf/util/mem2node.c @@ -0,0 +1,134 @@ +#include <errno.h> +#include <inttypes.h> +#include <linux/bitmap.h> +#include "mem2node.h" +#include "util.h" + +struct phys_entry { + struct rb_node rb_node; + u64 start; + u64 end; + u64 node; +}; + +static void phys_entry__insert(struct phys_entry *entry, struct rb_root *root) +{ + struct rb_node **p = &root->rb_node; + struct rb_node *parent = NULL; + struct phys_entry *e; + + while (*p != NULL) { + parent = *p; + e = rb_entry(parent, struct phys_entry, rb_node); + + if (entry->start < e->start) + p = &(*p)->rb_left; + else + p = &(*p)->rb_right; + } + + rb_link_node(&entry->rb_node, parent, p); + rb_insert_color(&entry->rb_node, root); +} + +static void +phys_entry__init(struct phys_entry *entry, u64 start, u64 bsize, u64 node) +{ + entry->start = start; + entry->end = start + bsize; + entry->node = node; + RB_CLEAR_NODE(&entry->rb_node); +} + +int mem2node__init(struct mem2node *map, struct perf_env *env) +{ + struct memory_node *n, *nodes = &env->memory_nodes[0]; + struct phys_entry *entries, *tmp_entries; + u64 bsize = env->memory_bsize; + int i, j = 0, max = 0; + + memset(map, 0x0, sizeof(*map)); + map->root = RB_ROOT; + + for (i = 0; i < env->nr_memory_nodes; i++) { + n = &nodes[i]; + max += bitmap_weight(n->set, n->size); + } + + entries = zalloc(sizeof(*entries) * max); + if (!entries) + return -ENOMEM; + + for (i = 0; i < env->nr_memory_nodes; i++) { + u64 bit; + + n = &nodes[i]; + + for (bit = 0; bit < n->size; bit++) { + u64 start; + + if (!test_bit(bit, n->set)) + continue; + + start = bit * bsize; + + /* + * Merge nearby areas, we walk in order + * through the bitmap, so no need to sort. + */ + if (j > 0) { + struct phys_entry *prev = &entries[j - 1]; + + if ((prev->end == start) && + (prev->node == n->node)) { + prev->end += bsize; + continue; + } + } + + phys_entry__init(&entries[j++], start, bsize, n->node); + } + } + + /* Cut unused entries, due to merging. */ + tmp_entries = realloc(entries, sizeof(*entries) * j); + if (tmp_entries) + entries = tmp_entries; + + for (i = 0; i < j; i++) { + pr_debug("mem2node %03" PRIu64 " [0x%016" PRIx64 "-0x%016" PRIx64 "]\n", + entries[i].node, entries[i].start, entries[i].end); + + phys_entry__insert(&entries[i], &map->root); + } + + map->entries = entries; + return 0; +} + +void mem2node__exit(struct mem2node *map) +{ + zfree(&map->entries); +} + +int mem2node__node(struct mem2node *map, u64 addr) +{ + struct rb_node **p, *parent = NULL; + struct phys_entry *entry; + + p = &map->root.rb_node; + while (*p != NULL) { + parent = *p; + entry = rb_entry(parent, struct phys_entry, rb_node); + if (addr < entry->start) + p = &(*p)->rb_left; + else if (addr >= entry->end) + p = &(*p)->rb_right; + else + goto out; + } + + entry = NULL; +out: + return entry ? (int) entry->node : -1; +} diff --git a/tools/perf/util/mem2node.h b/tools/perf/util/mem2node.h new file mode 100644 index 000000000000..59c4752a2181 --- /dev/null +++ b/tools/perf/util/mem2node.h @@ -0,0 +1,19 @@ +#ifndef __MEM2NODE_H +#define __MEM2NODE_H + +#include <linux/rbtree.h> +#include "env.h" + +struct phys_entry; + +struct mem2node { + struct rb_root root; + struct phys_entry *entries; + int cnt; +}; + +int mem2node__init(struct mem2node *map, struct perf_env *env); +void mem2node__exit(struct mem2node *map); +int mem2node__node(struct mem2node *map, u64 addr); + +#endif /* __MEM2NODE_H */ diff --git a/tools/perf/util/mmap.c b/tools/perf/util/mmap.c index 91531a7c8fbf..fc832676a798 100644 --- a/tools/perf/util/mmap.c +++ b/tools/perf/util/mmap.c @@ -64,25 +64,6 @@ static union perf_event *perf_mmap__read(struct perf_mmap *map, } /* - * legacy interface for mmap read. - * Don't use it. Use perf_mmap__read_event(). - */ -union perf_event *perf_mmap__read_forward(struct perf_mmap *map) -{ - u64 head; - - /* - * Check if event was unmapped due to a POLLHUP/POLLERR. - */ - if (!refcount_read(&map->refcnt)) - return NULL; - - head = perf_mmap__read_head(map); - - return perf_mmap__read(map, &map->prev, head); -} - -/* * Read event from ring buffer one by one. * Return one event for each call. * @@ -94,9 +75,7 @@ union perf_event *perf_mmap__read_forward(struct perf_mmap *map) * } * perf_mmap__read_done() */ -union perf_event *perf_mmap__read_event(struct perf_mmap *map, - bool overwrite, - u64 *startp, u64 end) +union perf_event *perf_mmap__read_event(struct perf_mmap *map) { union perf_event *event; @@ -106,17 +85,14 @@ union perf_event *perf_mmap__read_event(struct perf_mmap *map, if (!refcount_read(&map->refcnt)) return NULL; - if (startp == NULL) - return NULL; - /* non-overwirte doesn't pause the ringbuffer */ - if (!overwrite) - end = perf_mmap__read_head(map); + if (!map->overwrite) + map->end = perf_mmap__read_head(map); - event = perf_mmap__read(map, startp, end); + event = perf_mmap__read(map, &map->start, map->end); - if (!overwrite) - map->prev = *startp; + if (!map->overwrite) + map->prev = map->start; return event; } @@ -139,9 +115,9 @@ void perf_mmap__put(struct perf_mmap *map) perf_mmap__munmap(map); } -void perf_mmap__consume(struct perf_mmap *map, bool overwrite) +void perf_mmap__consume(struct perf_mmap *map) { - if (!overwrite) { + if (!map->overwrite) { u64 old = map->prev; perf_mmap__write_tail(map, old); @@ -191,7 +167,7 @@ void perf_mmap__munmap(struct perf_mmap *map) int perf_mmap__mmap(struct perf_mmap *map, struct mmap_params *mp, int fd) { /* - * The last one will be done at perf_evlist__mmap_consume(), so that we + * The last one will be done at perf_mmap__consume(), so that we * make sure we don't prevent tools from consuming every last event in * the ring buffer. * @@ -223,19 +199,18 @@ int perf_mmap__mmap(struct perf_mmap *map, struct mmap_params *mp, int fd) return 0; } -static int overwrite_rb_find_range(void *buf, int mask, u64 head, u64 *start, u64 *end) +static int overwrite_rb_find_range(void *buf, int mask, u64 *start, u64 *end) { struct perf_event_header *pheader; - u64 evt_head = head; + u64 evt_head = *start; int size = mask + 1; - pr_debug2("overwrite_rb_find_range: buf=%p, head=%"PRIx64"\n", buf, head); - pheader = (struct perf_event_header *)(buf + (head & mask)); - *start = head; + pr_debug2("%s: buf=%p, start=%"PRIx64"\n", __func__, buf, *start); + pheader = (struct perf_event_header *)(buf + (*start & mask)); while (true) { - if (evt_head - head >= (unsigned int)size) { + if (evt_head - *start >= (unsigned int)size) { pr_debug("Finished reading overwrite ring buffer: rewind\n"); - if (evt_head - head > (unsigned int)size) + if (evt_head - *start > (unsigned int)size) evt_head -= pheader->size; *end = evt_head; return 0; @@ -259,27 +234,26 @@ static int overwrite_rb_find_range(void *buf, int mask, u64 head, u64 *start, u6 /* * Report the start and end of the available data in ringbuffer */ -int perf_mmap__read_init(struct perf_mmap *md, bool overwrite, - u64 *startp, u64 *endp) +static int __perf_mmap__read_init(struct perf_mmap *md) { u64 head = perf_mmap__read_head(md); u64 old = md->prev; unsigned char *data = md->base + page_size; unsigned long size; - *startp = overwrite ? head : old; - *endp = overwrite ? old : head; + md->start = md->overwrite ? head : old; + md->end = md->overwrite ? old : head; - if (*startp == *endp) + if (md->start == md->end) return -EAGAIN; - size = *endp - *startp; + size = md->end - md->start; if (size > (unsigned long)(md->mask) + 1) { - if (!overwrite) { + if (!md->overwrite) { WARN_ONCE(1, "failed to keep up with mmap data. (warn only once)\n"); md->prev = head; - perf_mmap__consume(md, overwrite); + perf_mmap__consume(md); return -EAGAIN; } @@ -287,33 +261,43 @@ int perf_mmap__read_init(struct perf_mmap *md, bool overwrite, * Backward ring buffer is full. We still have a chance to read * most of data from it. */ - if (overwrite_rb_find_range(data, md->mask, head, startp, endp)) + if (overwrite_rb_find_range(data, md->mask, &md->start, &md->end)) return -EINVAL; } return 0; } -int perf_mmap__push(struct perf_mmap *md, bool overwrite, - void *to, int push(void *to, void *buf, size_t size)) +int perf_mmap__read_init(struct perf_mmap *map) +{ + /* + * Check if event was unmapped due to a POLLHUP/POLLERR. + */ + if (!refcount_read(&map->refcnt)) + return -ENOENT; + + return __perf_mmap__read_init(map); +} + +int perf_mmap__push(struct perf_mmap *md, void *to, + int push(void *to, void *buf, size_t size)) { u64 head = perf_mmap__read_head(md); - u64 end, start; unsigned char *data = md->base + page_size; unsigned long size; void *buf; int rc = 0; - rc = perf_mmap__read_init(md, overwrite, &start, &end); + rc = perf_mmap__read_init(md); if (rc < 0) return (rc == -EAGAIN) ? 0 : -1; - size = end - start; + size = md->end - md->start; - if ((start & md->mask) + size != (end & md->mask)) { - buf = &data[start & md->mask]; - size = md->mask + 1 - (start & md->mask); - start += size; + if ((md->start & md->mask) + size != (md->end & md->mask)) { + buf = &data[md->start & md->mask]; + size = md->mask + 1 - (md->start & md->mask); + md->start += size; if (push(to, buf, size) < 0) { rc = -1; @@ -321,9 +305,9 @@ int perf_mmap__push(struct perf_mmap *md, bool overwrite, } } - buf = &data[start & md->mask]; - size = end - start; - start += size; + buf = &data[md->start & md->mask]; + size = md->end - md->start; + md->start += size; if (push(to, buf, size) < 0) { rc = -1; @@ -331,7 +315,7 @@ int perf_mmap__push(struct perf_mmap *md, bool overwrite, } md->prev = head; - perf_mmap__consume(md, overwrite); + perf_mmap__consume(md); out: return rc; } @@ -344,5 +328,11 @@ out: */ void perf_mmap__read_done(struct perf_mmap *map) { + /* + * Check if event was unmapped due to a POLLHUP/POLLERR. + */ + if (!refcount_read(&map->refcnt)) + return; + map->prev = perf_mmap__read_head(map); } diff --git a/tools/perf/util/mmap.h b/tools/perf/util/mmap.h index ec7d3a24e276..d82294db1295 100644 --- a/tools/perf/util/mmap.h +++ b/tools/perf/util/mmap.h @@ -20,6 +20,9 @@ struct perf_mmap { int fd; refcount_t refcnt; u64 prev; + u64 start; + u64 end; + bool overwrite; struct auxtrace_mmap auxtrace_mmap; char event_copy[PERF_SAMPLE_MAX_SIZE] __aligned(8); }; @@ -63,7 +66,7 @@ void perf_mmap__munmap(struct perf_mmap *map); void perf_mmap__get(struct perf_mmap *map); void perf_mmap__put(struct perf_mmap *map); -void perf_mmap__consume(struct perf_mmap *map, bool overwrite); +void perf_mmap__consume(struct perf_mmap *map); static inline u64 perf_mmap__read_head(struct perf_mmap *mm) { @@ -86,16 +89,13 @@ static inline void perf_mmap__write_tail(struct perf_mmap *md, u64 tail) union perf_event *perf_mmap__read_forward(struct perf_mmap *map); -union perf_event *perf_mmap__read_event(struct perf_mmap *map, - bool overwrite, - u64 *startp, u64 end); +union perf_event *perf_mmap__read_event(struct perf_mmap *map); -int perf_mmap__push(struct perf_mmap *md, bool backward, - void *to, int push(void *to, void *buf, size_t size)); +int perf_mmap__push(struct perf_mmap *md, void *to, + int push(void *to, void *buf, size_t size)); size_t perf_mmap__mmap_len(struct perf_mmap *map); -int perf_mmap__read_init(struct perf_mmap *md, bool overwrite, - u64 *startp, u64 *endp); +int perf_mmap__read_init(struct perf_mmap *md); void perf_mmap__read_done(struct perf_mmap *map); #endif /*__PERF_MMAP_H */ diff --git a/tools/perf/util/parse-events.c b/tools/perf/util/parse-events.c index 34589c427e52..2fb0272146d8 100644 --- a/tools/perf/util/parse-events.c +++ b/tools/perf/util/parse-events.c @@ -206,8 +206,8 @@ struct tracepoint_path *tracepoint_id_to_path(u64 config) for_each_event(sys_dirent, evt_dir, evt_dirent) { - snprintf(evt_path, MAXPATHLEN, "%s/%s/id", dir_path, - evt_dirent->d_name); + scnprintf(evt_path, MAXPATHLEN, "%s/%s/id", dir_path, + evt_dirent->d_name); fd = open(evt_path, O_RDONLY); if (fd < 0) continue; @@ -1217,7 +1217,7 @@ int parse_events_add_numeric(struct parse_events_state *parse_state, get_config_name(head_config), &config_terms); } -static int __parse_events_add_pmu(struct parse_events_state *parse_state, +int parse_events_add_pmu(struct parse_events_state *parse_state, struct list_head *list, char *name, struct list_head *head_config, bool auto_merge_stats) { @@ -1247,7 +1247,12 @@ static int __parse_events_add_pmu(struct parse_events_state *parse_state, if (!head_config) { attr.type = pmu->type; evsel = __add_event(list, &parse_state->idx, &attr, NULL, pmu, NULL, auto_merge_stats); - return evsel ? 0 : -ENOMEM; + if (evsel) { + evsel->pmu_name = name; + return 0; + } else { + return -ENOMEM; + } } if (perf_pmu__check_alias(pmu, head_config, &info)) @@ -1276,18 +1281,12 @@ static int __parse_events_add_pmu(struct parse_events_state *parse_state, evsel->snapshot = info.snapshot; evsel->metric_expr = info.metric_expr; evsel->metric_name = info.metric_name; + evsel->pmu_name = name; } return evsel ? 0 : -ENOMEM; } -int parse_events_add_pmu(struct parse_events_state *parse_state, - struct list_head *list, char *name, - struct list_head *head_config) -{ - return __parse_events_add_pmu(parse_state, list, name, head_config, false); -} - int parse_events_multi_pmu_add(struct parse_events_state *parse_state, char *str, struct list_head **listp) { @@ -1317,8 +1316,8 @@ int parse_events_multi_pmu_add(struct parse_events_state *parse_state, return -1; list_add_tail(&term->list, head); - if (!__parse_events_add_pmu(parse_state, list, - pmu->name, head, true)) { + if (!parse_events_add_pmu(parse_state, list, + pmu->name, head, true)) { pr_debug("%s -> %s/%s/\n", str, pmu->name, alias->str); ok++; diff --git a/tools/perf/util/parse-events.h b/tools/perf/util/parse-events.h index 88108cd11b4c..5015cfd58277 100644 --- a/tools/perf/util/parse-events.h +++ b/tools/perf/util/parse-events.h @@ -167,7 +167,7 @@ int parse_events_add_breakpoint(struct list_head *list, int *idx, void *ptr, char *type, u64 len); int parse_events_add_pmu(struct parse_events_state *parse_state, struct list_head *list, char *name, - struct list_head *head_config); + struct list_head *head_config, bool auto_merge_stats); int parse_events_multi_pmu_add(struct parse_events_state *parse_state, char *str, diff --git a/tools/perf/util/parse-events.l b/tools/perf/util/parse-events.l index 655ecff636a8..a1a01b1ac8b8 100644 --- a/tools/perf/util/parse-events.l +++ b/tools/perf/util/parse-events.l @@ -175,7 +175,7 @@ bpf_source [^,{}]+\.c[a-zA-Z0-9._]* num_dec [0-9]+ num_hex 0x[a-fA-F0-9]+ num_raw_hex [a-fA-F0-9]+ -name [a-zA-Z_*?][a-zA-Z0-9_*?.]* +name [a-zA-Z_*?\[\]][a-zA-Z0-9_*?.\[\]]* name_minus [a-zA-Z_*?][a-zA-Z0-9\-_*?.:]* drv_cfg_term [a-zA-Z0-9_\.]+(=[a-zA-Z0-9_*?\.:]+)? /* If you add a modifier you need to update check_modifier() */ diff --git a/tools/perf/util/parse-events.y b/tools/perf/util/parse-events.y index e81a20ea8d7d..7afeb80cc39e 100644 --- a/tools/perf/util/parse-events.y +++ b/tools/perf/util/parse-events.y @@ -8,6 +8,7 @@ #define YYDEBUG 1 +#include <fnmatch.h> #include <linux/compiler.h> #include <linux/list.h> #include <linux/types.h> @@ -231,9 +232,13 @@ PE_NAME opt_event_config YYABORT; ALLOC_LIST(list); - if (parse_events_add_pmu(_parse_state, list, $1, $2)) { + if (parse_events_add_pmu(_parse_state, list, $1, $2, false)) { struct perf_pmu *pmu = NULL; int ok = 0; + char *pattern; + + if (asprintf(&pattern, "%s*", $1) < 0) + YYABORT; while ((pmu = perf_pmu__scan(pmu)) != NULL) { char *name = pmu->name; @@ -241,14 +246,19 @@ PE_NAME opt_event_config if (!strncmp(name, "uncore_", 7) && strncmp($1, "uncore_", 7)) name += 7; - if (!strncmp($1, name, strlen($1))) { - if (parse_events_copy_term_list(orig_terms, &terms)) + if (!fnmatch(pattern, name, 0)) { + if (parse_events_copy_term_list(orig_terms, &terms)) { + free(pattern); YYABORT; - if (!parse_events_add_pmu(_parse_state, list, pmu->name, terms)) + } + if (!parse_events_add_pmu(_parse_state, list, pmu->name, terms, true)) ok++; parse_events_terms__delete(terms); } } + + free(pattern); + if (!ok) YYABORT; } diff --git a/tools/perf/util/pmu.c b/tools/perf/util/pmu.c index 57e38fdf0b34..064bdcb7bd78 100644 --- a/tools/perf/util/pmu.c +++ b/tools/perf/util/pmu.c @@ -351,7 +351,7 @@ static int pmu_aliases_parse(char *dir, struct list_head *head) if (pmu_alias_info_file(name)) continue; - snprintf(path, PATH_MAX, "%s/%s", dir, name); + scnprintf(path, PATH_MAX, "%s/%s", dir, name); file = fopen(path, "r"); if (!file) { @@ -576,6 +576,34 @@ char * __weak get_cpuid_str(struct perf_pmu *pmu __maybe_unused) return NULL; } +/* Return zero when the cpuid from the mapfile.csv matches the + * cpuid string generated on this platform. + * Otherwise return non-zero. + */ +int __weak strcmp_cpuid_str(const char *mapcpuid, const char *cpuid) +{ + regex_t re; + regmatch_t pmatch[1]; + int match; + + if (regcomp(&re, mapcpuid, REG_EXTENDED) != 0) { + /* Warn unable to generate match particular string. */ + pr_info("Invalid regular expression %s\n", mapcpuid); + return 1; + } + + match = !regexec(&re, cpuid, 1, pmatch, 0); + regfree(&re); + if (match) { + size_t match_len = (pmatch[0].rm_eo - pmatch[0].rm_so); + + /* Verify the entire string matched. */ + if (match_len == strlen(cpuid)) + return 0; + } + return 1; +} + static char *perf_pmu__getcpuid(struct perf_pmu *pmu) { char *cpuid; @@ -610,31 +638,14 @@ struct pmu_events_map *perf_pmu__find_map(struct perf_pmu *pmu) i = 0; for (;;) { - regex_t re; - regmatch_t pmatch[1]; - int match; - map = &pmu_events_map[i++]; if (!map->table) { map = NULL; break; } - if (regcomp(&re, map->cpuid, REG_EXTENDED) != 0) { - /* Warn unable to generate match particular string. */ - pr_info("Invalid regular expression %s\n", map->cpuid); + if (!strcmp_cpuid_str(map->cpuid, cpuid)) break; - } - - match = !regexec(&re, cpuid, 1, pmatch, 0); - regfree(&re); - if (match) { - size_t match_len = (pmatch[0].rm_eo - pmatch[0].rm_so); - - /* Verify the entire string matched. */ - if (match_len == strlen(cpuid)) - break; - } } free(cpuid); return map; diff --git a/tools/perf/util/probe-finder.c b/tools/perf/util/probe-finder.c index a5731de0e5eb..c37fbef1711d 100644 --- a/tools/perf/util/probe-finder.c +++ b/tools/perf/util/probe-finder.c @@ -423,20 +423,20 @@ static int convert_variable_fields(Dwarf_Die *vr_die, const char *varname, pr_warning("Failed to get the type of %s.\n", varname); return -ENOENT; } - pr_debug2("Var real type: (%x)\n", (unsigned)dwarf_dieoffset(&type)); + pr_debug2("Var real type: %s (%x)\n", dwarf_diename(&type), + (unsigned)dwarf_dieoffset(&type)); tag = dwarf_tag(&type); if (field->name[0] == '[' && (tag == DW_TAG_array_type || tag == DW_TAG_pointer_type)) { - if (field->next) - /* Save original type for next field */ - memcpy(die_mem, &type, sizeof(*die_mem)); + /* Save original type for next field or type */ + memcpy(die_mem, &type, sizeof(*die_mem)); /* Get the type of this array */ if (die_get_real_type(&type, &type) == NULL) { pr_warning("Failed to get the type of %s.\n", varname); return -ENOENT; } - pr_debug2("Array real type: (%x)\n", + pr_debug2("Array real type: %s (%x)\n", dwarf_diename(&type), (unsigned)dwarf_dieoffset(&type)); if (tag == DW_TAG_pointer_type) { ref = zalloc(sizeof(struct probe_trace_arg_ref)); @@ -448,9 +448,6 @@ static int convert_variable_fields(Dwarf_Die *vr_die, const char *varname, *ref_ptr = ref; } ref->offset += dwarf_bytesize(&type) * field->index; - if (!field->next) - /* Save vr_die for converting types */ - memcpy(die_mem, vr_die, sizeof(*die_mem)); goto next; } else if (tag == DW_TAG_pointer_type) { /* Check the pointer and dereference */ diff --git a/tools/perf/util/python.c b/tools/perf/util/python.c index b1e999bd21ef..863b61478edd 100644 --- a/tools/perf/util/python.c +++ b/tools/perf/util/python.c @@ -12,6 +12,30 @@ #include "print_binary.h" #include "thread_map.h" +#if PY_MAJOR_VERSION < 3 +#define _PyUnicode_FromString(arg) \ + PyString_FromString(arg) +#define _PyUnicode_AsString(arg) \ + PyString_AsString(arg) +#define _PyUnicode_FromFormat(...) \ + PyString_FromFormat(__VA_ARGS__) +#define _PyLong_FromLong(arg) \ + PyInt_FromLong(arg) + +#else + +#define _PyUnicode_FromString(arg) \ + PyUnicode_FromString(arg) +#define _PyUnicode_FromFormat(...) \ + PyUnicode_FromFormat(__VA_ARGS__) +#define _PyLong_FromLong(arg) \ + PyLong_FromLong(arg) +#endif + +#ifndef Py_TYPE +#define Py_TYPE(ob) (((PyObject*)(ob))->ob_type) +#endif + /* * Provide these two so that we don't have to link against callchain.c and * start dragging hist.c, etc. @@ -49,7 +73,11 @@ int eprintf(int level, int var, const char *fmt, ...) # define PyVarObject_HEAD_INIT(type, size) PyObject_HEAD_INIT(type) size, #endif +#if PY_MAJOR_VERSION < 3 PyMODINIT_FUNC initperf(void); +#else +PyMODINIT_FUNC PyInit_perf(void); +#endif #define member_def(type, member, ptype, help) \ { #member, ptype, \ @@ -107,7 +135,7 @@ static PyObject *pyrf_mmap_event__repr(struct pyrf_event *pevent) pevent->event.mmap.pgoff, pevent->event.mmap.filename) < 0) { ret = PyErr_NoMemory(); } else { - ret = PyString_FromString(s); + ret = _PyUnicode_FromString(s); free(s); } return ret; @@ -138,7 +166,7 @@ static PyMemberDef pyrf_task_event__members[] = { static PyObject *pyrf_task_event__repr(struct pyrf_event *pevent) { - return PyString_FromFormat("{ type: %s, pid: %u, ppid: %u, tid: %u, " + return _PyUnicode_FromFormat("{ type: %s, pid: %u, ppid: %u, tid: %u, " "ptid: %u, time: %" PRIu64 "}", pevent->event.header.type == PERF_RECORD_FORK ? "fork" : "exit", pevent->event.fork.pid, @@ -171,7 +199,7 @@ static PyMemberDef pyrf_comm_event__members[] = { static PyObject *pyrf_comm_event__repr(struct pyrf_event *pevent) { - return PyString_FromFormat("{ type: comm, pid: %u, tid: %u, comm: %s }", + return _PyUnicode_FromFormat("{ type: comm, pid: %u, tid: %u, comm: %s }", pevent->event.comm.pid, pevent->event.comm.tid, pevent->event.comm.comm); @@ -202,7 +230,7 @@ static PyObject *pyrf_throttle_event__repr(struct pyrf_event *pevent) { struct throttle_event *te = (struct throttle_event *)(&pevent->event.header + 1); - return PyString_FromFormat("{ type: %sthrottle, time: %" PRIu64 ", id: %" PRIu64 + return _PyUnicode_FromFormat("{ type: %sthrottle, time: %" PRIu64 ", id: %" PRIu64 ", stream_id: %" PRIu64 " }", pevent->event.header.type == PERF_RECORD_THROTTLE ? "" : "un", te->time, te->id, te->stream_id); @@ -237,7 +265,7 @@ static PyObject *pyrf_lost_event__repr(struct pyrf_event *pevent) pevent->event.lost.id, pevent->event.lost.lost) < 0) { ret = PyErr_NoMemory(); } else { - ret = PyString_FromString(s); + ret = _PyUnicode_FromString(s); free(s); } return ret; @@ -264,7 +292,7 @@ static PyMemberDef pyrf_read_event__members[] = { static PyObject *pyrf_read_event__repr(struct pyrf_event *pevent) { - return PyString_FromFormat("{ type: read, pid: %u, tid: %u }", + return _PyUnicode_FromFormat("{ type: read, pid: %u, tid: %u }", pevent->event.read.pid, pevent->event.read.tid); /* @@ -299,7 +327,7 @@ static PyObject *pyrf_sample_event__repr(struct pyrf_event *pevent) if (asprintf(&s, "{ type: sample }") < 0) { ret = PyErr_NoMemory(); } else { - ret = PyString_FromString(s); + ret = _PyUnicode_FromString(s); free(s); } return ret; @@ -330,7 +358,7 @@ tracepoint_field(struct pyrf_event *pe, struct format_field *field) } if (field->flags & FIELD_IS_STRING && is_printable_array(data + offset, len)) { - ret = PyString_FromString((char *)data + offset); + ret = _PyUnicode_FromString((char *)data + offset); } else { ret = PyByteArray_FromStringAndSize((const char *) data + offset, len); field->flags &= ~FIELD_IS_STRING; @@ -352,7 +380,7 @@ tracepoint_field(struct pyrf_event *pe, struct format_field *field) static PyObject* get_tracepoint_field(struct pyrf_event *pevent, PyObject *attr_name) { - const char *str = PyString_AsString(PyObject_Str(attr_name)); + const char *str = _PyUnicode_AsString(PyObject_Str(attr_name)); struct perf_evsel *evsel = pevent->evsel; struct format_field *field; @@ -416,7 +444,7 @@ static PyObject *pyrf_context_switch_event__repr(struct pyrf_event *pevent) !!(pevent->event.header.misc & PERF_RECORD_MISC_SWITCH_OUT)) < 0) { ret = PyErr_NoMemory(); } else { - ret = PyString_FromString(s); + ret = _PyUnicode_FromString(s); free(s); } return ret; @@ -528,7 +556,7 @@ static int pyrf_cpu_map__init(struct pyrf_cpu_map *pcpus, static void pyrf_cpu_map__delete(struct pyrf_cpu_map *pcpus) { cpu_map__put(pcpus->cpus); - pcpus->ob_type->tp_free((PyObject*)pcpus); + Py_TYPE(pcpus)->tp_free((PyObject*)pcpus); } static Py_ssize_t pyrf_cpu_map__length(PyObject *obj) @@ -597,7 +625,7 @@ static int pyrf_thread_map__init(struct pyrf_thread_map *pthreads, static void pyrf_thread_map__delete(struct pyrf_thread_map *pthreads) { thread_map__put(pthreads->threads); - pthreads->ob_type->tp_free((PyObject*)pthreads); + Py_TYPE(pthreads)->tp_free((PyObject*)pthreads); } static Py_ssize_t pyrf_thread_map__length(PyObject *obj) @@ -759,7 +787,7 @@ static int pyrf_evsel__init(struct pyrf_evsel *pevsel, static void pyrf_evsel__delete(struct pyrf_evsel *pevsel) { perf_evsel__exit(&pevsel->evsel); - pevsel->ob_type->tp_free((PyObject*)pevsel); + Py_TYPE(pevsel)->tp_free((PyObject*)pevsel); } static PyObject *pyrf_evsel__open(struct pyrf_evsel *pevsel, @@ -850,7 +878,7 @@ static int pyrf_evlist__init(struct pyrf_evlist *pevlist, static void pyrf_evlist__delete(struct pyrf_evlist *pevlist) { perf_evlist__exit(&pevlist->evlist); - pevlist->ob_type->tp_free((PyObject*)pevlist); + Py_TYPE(pevlist)->tp_free((PyObject*)pevlist); } static PyObject *pyrf_evlist__mmap(struct pyrf_evlist *pevlist, @@ -902,12 +930,16 @@ static PyObject *pyrf_evlist__get_pollfd(struct pyrf_evlist *pevlist, for (i = 0; i < evlist->pollfd.nr; ++i) { PyObject *file; +#if PY_MAJOR_VERSION < 3 FILE *fp = fdopen(evlist->pollfd.entries[i].fd, "r"); if (fp == NULL) goto free_list; file = PyFile_FromFile(fp, "perf", "r", NULL); +#else + file = PyFile_FromFd(evlist->pollfd.entries[i].fd, "perf", "r", -1, NULL, NULL, NULL, 1); +#endif if (file == NULL) goto free_list; @@ -951,13 +983,18 @@ static PyObject *pyrf_evlist__read_on_cpu(struct pyrf_evlist *pevlist, union perf_event *event; int sample_id_all = 1, cpu; static char *kwlist[] = { "cpu", "sample_id_all", NULL }; + struct perf_mmap *md; int err; if (!PyArg_ParseTupleAndKeywords(args, kwargs, "i|i", kwlist, &cpu, &sample_id_all)) return NULL; - event = perf_evlist__mmap_read(evlist, cpu); + md = &evlist->mmap[cpu]; + if (perf_mmap__read_init(md) < 0) + goto end; + + event = perf_mmap__read_event(md); if (event != NULL) { PyObject *pyevent = pyrf_event__new(event); struct pyrf_event *pevent = (struct pyrf_event *)pyevent; @@ -967,22 +1004,24 @@ static PyObject *pyrf_evlist__read_on_cpu(struct pyrf_evlist *pevlist, return PyErr_NoMemory(); evsel = perf_evlist__event2evsel(evlist, event); - if (!evsel) + if (!evsel) { + Py_INCREF(Py_None); return Py_None; + } pevent->evsel = evsel; err = perf_evsel__parse_sample(evsel, event, &pevent->sample); /* Consume the even only after we parsed it out. */ - perf_evlist__mmap_consume(evlist, cpu); + perf_mmap__consume(md); if (err) return PyErr_Format(PyExc_OSError, "perf: can't parse sample, err=%d", err); return pyevent; } - +end: Py_INCREF(Py_None); return Py_None; } @@ -1194,9 +1233,9 @@ static PyObject *pyrf__tracepoint(struct pyrf_evsel *pevsel, tp_format = trace_event__tp_format(sys, name); if (IS_ERR(tp_format)) - return PyInt_FromLong(-1); + return _PyLong_FromLong(-1); - return PyInt_FromLong(tp_format->id); + return _PyLong_FromLong(tp_format->id); } static PyMethodDef perf__methods[] = { @@ -1209,11 +1248,31 @@ static PyMethodDef perf__methods[] = { { .ml_name = NULL, } }; +#if PY_MAJOR_VERSION < 3 PyMODINIT_FUNC initperf(void) +#else +PyMODINIT_FUNC PyInit_perf(void) +#endif { PyObject *obj; int i; - PyObject *dict, *module = Py_InitModule("perf", perf__methods); + PyObject *dict; +#if PY_MAJOR_VERSION < 3 + PyObject *module = Py_InitModule("perf", perf__methods); +#else + static struct PyModuleDef moduledef = { + PyModuleDef_HEAD_INIT, + "perf", /* m_name */ + "", /* m_doc */ + -1, /* m_size */ + perf__methods, /* m_methods */ + NULL, /* m_reload */ + NULL, /* m_traverse */ + NULL, /* m_clear */ + NULL, /* m_free */ + }; + PyObject *module = PyModule_Create(&moduledef); +#endif if (module == NULL || pyrf_event__setup_types() < 0 || @@ -1221,7 +1280,11 @@ PyMODINIT_FUNC initperf(void) pyrf_evsel__setup_types() < 0 || pyrf_thread_map__setup_types() < 0 || pyrf_cpu_map__setup_types() < 0) +#if PY_MAJOR_VERSION < 3 return; +#else + return module; +#endif /* The page_size is placed in util object. */ page_size = sysconf(_SC_PAGE_SIZE); @@ -1270,7 +1333,7 @@ PyMODINIT_FUNC initperf(void) goto error; for (i = 0; perf__constants[i].name != NULL; i++) { - obj = PyInt_FromLong(perf__constants[i].value); + obj = _PyLong_FromLong(perf__constants[i].value); if (obj == NULL) goto error; PyDict_SetItemString(dict, perf__constants[i].name, obj); @@ -1280,6 +1343,9 @@ PyMODINIT_FUNC initperf(void) error: if (PyErr_Occurred()) PyErr_SetString(PyExc_ImportError, "perf: Init failed!"); +#if PY_MAJOR_VERSION >= 3 + return module; +#endif } /* diff --git a/tools/perf/util/record.c b/tools/perf/util/record.c index 1e97937b03a9..9cfc7bf16531 100644 --- a/tools/perf/util/record.c +++ b/tools/perf/util/record.c @@ -5,6 +5,7 @@ #include "parse-events.h" #include <errno.h> #include <api/fs/fs.h> +#include <subcmd/parse-options.h> #include "util.h" #include "cloexec.h" @@ -137,6 +138,7 @@ void perf_evlist__config(struct perf_evlist *evlist, struct record_opts *opts, struct perf_evsel *evsel; bool use_sample_identifier = false; bool use_comm_exec; + bool sample_id = opts->sample_id; /* * Set the evsel leader links before we configure attributes, @@ -163,8 +165,7 @@ void perf_evlist__config(struct perf_evlist *evlist, struct record_opts *opts, * match the id. */ use_sample_identifier = perf_can_sample_identifier(); - evlist__for_each_entry(evlist, evsel) - perf_evsel__set_sample_id(evsel, use_sample_identifier); + sample_id = true; } else if (evlist->nr_entries > 1) { struct perf_evsel *first = perf_evlist__first(evlist); @@ -174,6 +175,10 @@ void perf_evlist__config(struct perf_evlist *evlist, struct record_opts *opts, use_sample_identifier = perf_can_sample_identifier(); break; } + sample_id = true; + } + + if (sample_id) { evlist__for_each_entry(evlist, evsel) perf_evsel__set_sample_id(evsel, use_sample_identifier); } @@ -215,11 +220,21 @@ static int record_opts__config_freq(struct record_opts *opts) * User specified frequency is over current maximum. */ if (user_freq && (max_rate < opts->freq)) { - pr_err("Maximum frequency rate (%u) reached.\n" - "Please use -F freq option with lower value or consider\n" - "tweaking /proc/sys/kernel/perf_event_max_sample_rate.\n", - max_rate); - return -1; + if (opts->strict_freq) { + pr_err("error: Maximum frequency rate (%'u Hz) exceeded.\n" + " Please use -F freq option with a lower value or consider\n" + " tweaking /proc/sys/kernel/perf_event_max_sample_rate.\n", + max_rate); + return -1; + } else { + pr_warning("warning: Maximum frequency rate (%'u Hz) exceeded, throttling from %'u Hz to %'u Hz.\n" + " The limit can be raised via /proc/sys/kernel/perf_event_max_sample_rate.\n" + " The kernel will lower it when perf's interrupts take too long.\n" + " Use --strict-freq to disable this throttling, refusing to record.\n", + max_rate, opts->freq, max_rate); + + opts->freq = max_rate; + } } /* @@ -287,3 +302,25 @@ out_delete: perf_evlist__delete(temp_evlist); return ret; } + +int record__parse_freq(const struct option *opt, const char *str, int unset __maybe_unused) +{ + unsigned int freq; + struct record_opts *opts = opt->value; + + if (!str) + return -EINVAL; + + if (strcasecmp(str, "max") == 0) { + if (get_max_rate(&freq)) { + pr_err("couldn't read /proc/sys/kernel/perf_event_max_sample_rate\n"); + return -1; + } + pr_info("info: Using a maximum frequency rate of %'d Hz\n", freq); + } else { + freq = atoi(str); + } + + opts->user_freq = freq; + return 0; +} diff --git a/tools/perf/util/scripting-engines/trace-event-python.c b/tools/perf/util/scripting-engines/trace-event-python.c index ea070883c593..10dd5fce082b 100644 --- a/tools/perf/util/scripting-engines/trace-event-python.c +++ b/tools/perf/util/scripting-engines/trace-event-python.c @@ -49,7 +49,37 @@ #include "print_binary.h" #include "stat.h" +#if PY_MAJOR_VERSION < 3 +#define _PyUnicode_FromString(arg) \ + PyString_FromString(arg) +#define _PyUnicode_FromStringAndSize(arg1, arg2) \ + PyString_FromStringAndSize((arg1), (arg2)) +#define _PyBytes_FromStringAndSize(arg1, arg2) \ + PyString_FromStringAndSize((arg1), (arg2)) +#define _PyLong_FromLong(arg) \ + PyInt_FromLong(arg) +#define _PyLong_AsLong(arg) \ + PyInt_AsLong(arg) +#define _PyCapsule_New(arg1, arg2, arg3) \ + PyCObject_FromVoidPtr((arg1), (arg2)) + PyMODINIT_FUNC initperf_trace_context(void); +#else +#define _PyUnicode_FromString(arg) \ + PyUnicode_FromString(arg) +#define _PyUnicode_FromStringAndSize(arg1, arg2) \ + PyUnicode_FromStringAndSize((arg1), (arg2)) +#define _PyBytes_FromStringAndSize(arg1, arg2) \ + PyBytes_FromStringAndSize((arg1), (arg2)) +#define _PyLong_FromLong(arg) \ + PyLong_FromLong(arg) +#define _PyLong_AsLong(arg) \ + PyLong_AsLong(arg) +#define _PyCapsule_New(arg1, arg2, arg3) \ + PyCapsule_New((arg1), (arg2), (arg3)) + +PyMODINIT_FUNC PyInit_perf_trace_context(void); +#endif #define TRACE_EVENT_TYPE_MAX \ ((1 << (sizeof(unsigned short) * 8)) - 1) @@ -135,7 +165,7 @@ static int get_argument_count(PyObject *handler) PyObject *arg_count_obj = PyObject_GetAttrString(code_obj, "co_argcount"); if (arg_count_obj) { - arg_count = (int) PyInt_AsLong(arg_count_obj); + arg_count = (int) _PyLong_AsLong(arg_count_obj); Py_DECREF(arg_count_obj); } Py_DECREF(code_obj); @@ -182,10 +212,10 @@ static void define_value(enum print_arg_type field_type, value = eval_flag(field_value); - PyTuple_SetItem(t, n++, PyString_FromString(ev_name)); - PyTuple_SetItem(t, n++, PyString_FromString(field_name)); - PyTuple_SetItem(t, n++, PyInt_FromLong(value)); - PyTuple_SetItem(t, n++, PyString_FromString(field_str)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(ev_name)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(field_name)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(value)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(field_str)); try_call_object(handler_name, t); @@ -223,10 +253,10 @@ static void define_field(enum print_arg_type field_type, if (!t) Py_FatalError("couldn't create Python tuple"); - PyTuple_SetItem(t, n++, PyString_FromString(ev_name)); - PyTuple_SetItem(t, n++, PyString_FromString(field_name)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(ev_name)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(field_name)); if (field_type == PRINT_FLAGS) - PyTuple_SetItem(t, n++, PyString_FromString(delim)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(delim)); try_call_object(handler_name, t); @@ -325,12 +355,12 @@ static PyObject *get_field_numeric_entry(struct event_format *event, if (field->flags & FIELD_IS_SIGNED) { if ((long long)val >= LONG_MIN && (long long)val <= LONG_MAX) - obj = PyInt_FromLong(val); + obj = _PyLong_FromLong(val); else obj = PyLong_FromLongLong(val); } else { if (val <= LONG_MAX) - obj = PyInt_FromLong(val); + obj = _PyLong_FromLong(val); else obj = PyLong_FromUnsignedLongLong(val); } @@ -389,9 +419,9 @@ static PyObject *python_process_callchain(struct perf_sample *sample, pydict_set_item_string_decref(pysym, "end", PyLong_FromUnsignedLongLong(node->sym->end)); pydict_set_item_string_decref(pysym, "binding", - PyInt_FromLong(node->sym->binding)); + _PyLong_FromLong(node->sym->binding)); pydict_set_item_string_decref(pysym, "name", - PyString_FromStringAndSize(node->sym->name, + _PyUnicode_FromStringAndSize(node->sym->name, node->sym->namelen)); pydict_set_item_string_decref(pyelem, "sym", pysym); } @@ -406,7 +436,7 @@ static PyObject *python_process_callchain(struct perf_sample *sample, dsoname = map->dso->name; } pydict_set_item_string_decref(pyelem, "dso", - PyString_FromString(dsoname)); + _PyUnicode_FromString(dsoname)); } callchain_cursor_advance(&callchain_cursor); @@ -483,16 +513,16 @@ static PyObject *get_perf_sample_dict(struct perf_sample *sample, if (!dict_sample) Py_FatalError("couldn't create Python dictionary"); - pydict_set_item_string_decref(dict, "ev_name", PyString_FromString(perf_evsel__name(evsel))); - pydict_set_item_string_decref(dict, "attr", PyString_FromStringAndSize( + pydict_set_item_string_decref(dict, "ev_name", _PyUnicode_FromString(perf_evsel__name(evsel))); + pydict_set_item_string_decref(dict, "attr", _PyUnicode_FromStringAndSize( (const char *)&evsel->attr, sizeof(evsel->attr))); pydict_set_item_string_decref(dict_sample, "pid", - PyInt_FromLong(sample->pid)); + _PyLong_FromLong(sample->pid)); pydict_set_item_string_decref(dict_sample, "tid", - PyInt_FromLong(sample->tid)); + _PyLong_FromLong(sample->tid)); pydict_set_item_string_decref(dict_sample, "cpu", - PyInt_FromLong(sample->cpu)); + _PyLong_FromLong(sample->cpu)); pydict_set_item_string_decref(dict_sample, "ip", PyLong_FromUnsignedLongLong(sample->ip)); pydict_set_item_string_decref(dict_sample, "time", @@ -504,17 +534,17 @@ static PyObject *get_perf_sample_dict(struct perf_sample *sample, set_sample_read_in_dict(dict_sample, sample, evsel); pydict_set_item_string_decref(dict, "sample", dict_sample); - pydict_set_item_string_decref(dict, "raw_buf", PyString_FromStringAndSize( + pydict_set_item_string_decref(dict, "raw_buf", _PyBytes_FromStringAndSize( (const char *)sample->raw_data, sample->raw_size)); pydict_set_item_string_decref(dict, "comm", - PyString_FromString(thread__comm_str(al->thread))); + _PyUnicode_FromString(thread__comm_str(al->thread))); if (al->map) { pydict_set_item_string_decref(dict, "dso", - PyString_FromString(al->map->dso->name)); + _PyUnicode_FromString(al->map->dso->name)); } if (al->sym) { pydict_set_item_string_decref(dict, "symbol", - PyString_FromString(al->sym->name)); + _PyUnicode_FromString(al->sym->name)); } pydict_set_item_string_decref(dict, "callchain", callchain); @@ -574,9 +604,9 @@ static void python_process_tracepoint(struct perf_sample *sample, scripting_context->event_data = data; scripting_context->pevent = evsel->tp_format->pevent; - context = PyCObject_FromVoidPtr(scripting_context, NULL); + context = _PyCapsule_New(scripting_context, NULL, NULL); - PyTuple_SetItem(t, n++, PyString_FromString(handler_name)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(handler_name)); PyTuple_SetItem(t, n++, context); /* ip unwinding */ @@ -585,18 +615,18 @@ static void python_process_tracepoint(struct perf_sample *sample, Py_INCREF(callchain); if (!dict) { - PyTuple_SetItem(t, n++, PyInt_FromLong(cpu)); - PyTuple_SetItem(t, n++, PyInt_FromLong(s)); - PyTuple_SetItem(t, n++, PyInt_FromLong(ns)); - PyTuple_SetItem(t, n++, PyInt_FromLong(pid)); - PyTuple_SetItem(t, n++, PyString_FromString(comm)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(cpu)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(s)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(ns)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(pid)); + PyTuple_SetItem(t, n++, _PyUnicode_FromString(comm)); PyTuple_SetItem(t, n++, callchain); } else { - pydict_set_item_string_decref(dict, "common_cpu", PyInt_FromLong(cpu)); - pydict_set_item_string_decref(dict, "common_s", PyInt_FromLong(s)); - pydict_set_item_string_decref(dict, "common_ns", PyInt_FromLong(ns)); - pydict_set_item_string_decref(dict, "common_pid", PyInt_FromLong(pid)); - pydict_set_item_string_decref(dict, "common_comm", PyString_FromString(comm)); + pydict_set_item_string_decref(dict, "common_cpu", _PyLong_FromLong(cpu)); + pydict_set_item_string_decref(dict, "common_s", _PyLong_FromLong(s)); + pydict_set_item_string_decref(dict, "common_ns", _PyLong_FromLong(ns)); + pydict_set_item_string_decref(dict, "common_pid", _PyLong_FromLong(pid)); + pydict_set_item_string_decref(dict, "common_comm", _PyUnicode_FromString(comm)); pydict_set_item_string_decref(dict, "common_callchain", callchain); } for (field = event->format.fields; field; field = field->next) { @@ -615,7 +645,7 @@ static void python_process_tracepoint(struct perf_sample *sample, } if (field->flags & FIELD_IS_STRING && is_printable_array(data + offset, len)) { - obj = PyString_FromString((char *) data + offset); + obj = _PyUnicode_FromString((char *) data + offset); } else { obj = PyByteArray_FromStringAndSize((const char *) data + offset, len); field->flags &= ~FIELD_IS_STRING; @@ -668,7 +698,7 @@ static PyObject *tuple_new(unsigned int sz) static int tuple_set_u64(PyObject *t, unsigned int pos, u64 val) { #if BITS_PER_LONG == 64 - return PyTuple_SetItem(t, pos, PyInt_FromLong(val)); + return PyTuple_SetItem(t, pos, _PyLong_FromLong(val)); #endif #if BITS_PER_LONG == 32 return PyTuple_SetItem(t, pos, PyLong_FromLongLong(val)); @@ -677,12 +707,12 @@ static int tuple_set_u64(PyObject *t, unsigned int pos, u64 val) static int tuple_set_s32(PyObject *t, unsigned int pos, s32 val) { - return PyTuple_SetItem(t, pos, PyInt_FromLong(val)); + return PyTuple_SetItem(t, pos, _PyLong_FromLong(val)); } static int tuple_set_string(PyObject *t, unsigned int pos, const char *s) { - return PyTuple_SetItem(t, pos, PyString_FromString(s)); + return PyTuple_SetItem(t, pos, _PyUnicode_FromString(s)); } static int python_export_evsel(struct db_export *dbe, struct perf_evsel *evsel) @@ -1029,8 +1059,8 @@ process_stat(struct perf_evsel *counter, int cpu, int thread, u64 tstamp, return; } - PyTuple_SetItem(t, n++, PyInt_FromLong(cpu)); - PyTuple_SetItem(t, n++, PyInt_FromLong(thread)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(cpu)); + PyTuple_SetItem(t, n++, _PyLong_FromLong(thread)); tuple_set_u64(t, n++, tstamp); tuple_set_u64(t, n++, count->val); @@ -1212,27 +1242,58 @@ static void set_table_handlers(struct tables *tables) SET_TABLE_HANDLER(call_return); } +#if PY_MAJOR_VERSION < 3 +static void _free_command_line(const char **command_line, int num) +{ + free(command_line); +} +#else +static void _free_command_line(wchar_t **command_line, int num) +{ + int i; + for (i = 0; i < num; i++) + PyMem_RawFree(command_line[i]); + free(command_line); +} +#endif + + /* * Start trace script */ static int python_start_script(const char *script, int argc, const char **argv) { struct tables *tables = &tables_global; +#if PY_MAJOR_VERSION < 3 const char **command_line; +#else + wchar_t **command_line; +#endif char buf[PATH_MAX]; int i, err = 0; FILE *fp; +#if PY_MAJOR_VERSION < 3 command_line = malloc((argc + 1) * sizeof(const char *)); command_line[0] = script; for (i = 1; i < argc + 1; i++) command_line[i] = argv[i - 1]; +#else + command_line = malloc((argc + 1) * sizeof(wchar_t *)); + command_line[0] = Py_DecodeLocale(script, NULL); + for (i = 1; i < argc + 1; i++) + command_line[i] = Py_DecodeLocale(argv[i - 1], NULL); +#endif Py_Initialize(); +#if PY_MAJOR_VERSION < 3 initperf_trace_context(); - PySys_SetArgv(argc + 1, (char **)command_line); +#else + PyInit_perf_trace_context(); + PySys_SetArgv(argc + 1, command_line); +#endif fp = fopen(script, "r"); if (!fp) { @@ -1262,12 +1323,12 @@ static int python_start_script(const char *script, int argc, const char **argv) goto error; } - free(command_line); + _free_command_line(command_line, argc + 1); return err; error: Py_Finalize(); - free(command_line); + _free_command_line(command_line, argc + 1); return err; } diff --git a/tools/perf/util/setup.py b/tools/perf/util/setup.py index af415febbc46..001be4f9d3b9 100644 --- a/tools/perf/util/setup.py +++ b/tools/perf/util/setup.py @@ -1,4 +1,4 @@ -#!/usr/bin/python2 +#!/usr/bin/python from os import getenv @@ -28,6 +28,8 @@ class install_lib(_install_lib): cflags = getenv('CFLAGS', '').split() # switch off several checks (need to be at the end of cflags list) cflags += ['-fno-strict-aliasing', '-Wno-write-strings', '-Wno-unused-parameter' ] +if cc != "clang": + cflags += ['-Wno-cast-function-type' ] src_perf = getenv('srctree') + '/tools/perf' build_lib = getenv('PYTHON_EXTBUILD_LIB') @@ -35,11 +37,11 @@ build_tmp = getenv('PYTHON_EXTBUILD_TMP') libtraceevent = getenv('LIBTRACEEVENT') libapikfs = getenv('LIBAPI') -ext_sources = [f.strip() for f in file('util/python-ext-sources') +ext_sources = [f.strip() for f in open('util/python-ext-sources') if len(f.strip()) > 0 and f[0] != '#'] # use full paths with source files -ext_sources = map(lambda x: '%s/%s' % (src_perf, x) , ext_sources) +ext_sources = list(map(lambda x: '%s/%s' % (src_perf, x) , ext_sources)) perf = Extension('perf', sources = ext_sources, diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c index 2da4d0456a03..e8514f651865 100644 --- a/tools/perf/util/sort.c +++ b/tools/perf/util/sort.c @@ -111,17 +111,20 @@ struct sort_entry sort_thread = { /* --sort comm */ +/* + * We can't use pointer comparison in functions below, + * because it gives different results based on pointer + * values, which could break some sorting assumptions. + */ static int64_t sort__comm_cmp(struct hist_entry *left, struct hist_entry *right) { - /* Compare the addr that should be unique among comm */ return strcmp(comm__str(right->comm), comm__str(left->comm)); } static int64_t sort__comm_collapse(struct hist_entry *left, struct hist_entry *right) { - /* Compare the addr that should be unique among comm */ return strcmp(comm__str(right->comm), comm__str(left->comm)); } diff --git a/tools/perf/util/stat.c b/tools/perf/util/stat.c index 32235657c1ac..a0061e0b0fad 100644 --- a/tools/perf/util/stat.c +++ b/tools/perf/util/stat.c @@ -92,7 +92,7 @@ static const char *id_str[PERF_STAT_EVSEL_ID__MAX] = { }; #undef ID -void perf_stat_evsel_id_init(struct perf_evsel *evsel) +static void perf_stat_evsel_id_init(struct perf_evsel *evsel) { struct perf_stat_evsel *ps = evsel->stats; int i; diff --git a/tools/perf/util/stat.h b/tools/perf/util/stat.h index dbc6f7134f61..8f56ba4fd258 100644 --- a/tools/perf/util/stat.h +++ b/tools/perf/util/stat.h @@ -90,6 +90,8 @@ struct perf_stat_config { bool scale; FILE *output; unsigned int interval; + unsigned int timeout; + int times; struct runtime_stat *stats; int stats_num; }; @@ -126,8 +128,6 @@ bool __perf_evsel_stat__is(struct perf_evsel *evsel, #define perf_stat_evsel__is(evsel, id) \ __perf_evsel_stat__is(evsel, PERF_STAT_EVSEL_ID__ ## id) -void perf_stat_evsel_id_init(struct perf_evsel *evsel); - extern struct runtime_stat rt_stat; extern struct stats walltime_nsecs_stats; diff --git a/tools/perf/util/symbol.c b/tools/perf/util/symbol.c index cc065d4bfafc..62b2dd2253eb 100644 --- a/tools/perf/util/symbol.c +++ b/tools/perf/util/symbol.c @@ -1582,7 +1582,7 @@ int dso__load(struct dso *dso, struct map *map) bool next_slot = false; bool is_reg; bool nsexit; - int sirc; + int sirc = -1; enum dso_binary_type symtab_type = binary_type_symtab[i]; @@ -1600,16 +1600,14 @@ int dso__load(struct dso *dso, struct map *map) nsinfo__mountns_exit(&nsc); is_reg = is_regular_file(name); - sirc = symsrc__init(ss, dso, name, symtab_type); + if (is_reg) + sirc = symsrc__init(ss, dso, name, symtab_type); if (nsexit) nsinfo__mountns_enter(dso->nsinfo, &nsc); - if (!is_reg || sirc < 0) { - if (sirc >= 0) - symsrc__destroy(ss); + if (!is_reg || sirc < 0) continue; - } if (!syms_ss && symsrc__has_symtab(ss)) { syms_ss = ss; @@ -1960,8 +1958,7 @@ static int dso__load_guest_kernel_sym(struct dso *dso, struct map *map) pr_debug("Using %s for symbols\n", kallsyms_filename); if (err > 0 && !dso__is_kcore(dso)) { dso->binary_type = DSO_BINARY_TYPE__GUEST_KALLSYMS; - machine__mmap_name(machine, path, sizeof(path)); - dso__set_long_name(dso, strdup(path), true); + dso__set_long_name(dso, machine->mmap_name, false); map__fixup_start(map); map__fixup_end(map); } @@ -2224,3 +2221,25 @@ int symbol__config_symfs(const struct option *opt __maybe_unused, free(bf); return 0; } + +struct mem_info *mem_info__get(struct mem_info *mi) +{ + if (mi) + refcount_inc(&mi->refcnt); + return mi; +} + +void mem_info__put(struct mem_info *mi) +{ + if (mi && refcount_dec_and_test(&mi->refcnt)) + free(mi); +} + +struct mem_info *mem_info__new(void) +{ + struct mem_info *mi = zalloc(sizeof(*mi)); + + if (mi) + refcount_set(&mi->refcnt, 1); + return mi; +} diff --git a/tools/perf/util/symbol.h b/tools/perf/util/symbol.h index 0563f33c1eb3..70c16741f50a 100644 --- a/tools/perf/util/symbol.h +++ b/tools/perf/util/symbol.h @@ -200,9 +200,10 @@ struct branch_info { }; struct mem_info { - struct addr_map_symbol iaddr; - struct addr_map_symbol daddr; - union perf_mem_data_src data_src; + struct addr_map_symbol iaddr; + struct addr_map_symbol daddr; + union perf_mem_data_src data_src; + refcount_t refcnt; }; struct addr_location { @@ -389,4 +390,16 @@ int sdt_notes__get_count(struct list_head *start); #define SDT_NOTE_NAME "stapsdt" #define NR_ADDR 3 +struct mem_info *mem_info__new(void); +struct mem_info *mem_info__get(struct mem_info *mi); +void mem_info__put(struct mem_info *mi); + +static inline void __mem_info__zput(struct mem_info **mi) +{ + mem_info__put(*mi); + *mi = NULL; +} + +#define mem_info__zput(mi) __mem_info__zput(&mi) + #endif /* __PERF_SYMBOL */ diff --git a/tools/perf/util/syscalltbl.c b/tools/perf/util/syscalltbl.c index 303bdb84ab5a..895122d638dd 100644 --- a/tools/perf/util/syscalltbl.c +++ b/tools/perf/util/syscalltbl.c @@ -30,6 +30,14 @@ static const char **syscalltbl_native = syscalltbl_x86_64; #include <asm/syscalls_64.c> const int syscalltbl_native_max_id = SYSCALLTBL_S390_64_MAX_ID; static const char **syscalltbl_native = syscalltbl_s390_64; +#elif defined(__powerpc64__) +#include <asm/syscalls_64.c> +const int syscalltbl_native_max_id = SYSCALLTBL_POWERPC_64_MAX_ID; +static const char **syscalltbl_native = syscalltbl_powerpc_64; +#elif defined(__powerpc__) +#include <asm/syscalls_32.c> +const int syscalltbl_native_max_id = SYSCALLTBL_POWERPC_32_MAX_ID; +static const char **syscalltbl_native = syscalltbl_powerpc_32; #endif struct syscall { diff --git a/tools/perf/util/thread.h b/tools/perf/util/thread.h index 40cfa36c022a..14d44c3235b8 100644 --- a/tools/perf/util/thread.h +++ b/tools/perf/util/thread.h @@ -26,7 +26,6 @@ struct thread { pid_t ppid; int cpu; refcount_t refcnt; - char shortname[3]; bool comm_set; int comm_len; bool dead; /* if set thread has exited */ diff --git a/tools/perf/util/thread_map.c b/tools/perf/util/thread_map.c index 3e1038f6491c..5d467d8ae9ab 100644 --- a/tools/perf/util/thread_map.c +++ b/tools/perf/util/thread_map.c @@ -32,6 +32,7 @@ static void thread_map__reset(struct thread_map *map, int start, int nr) size_t size = (nr - start) * sizeof(map->map[0]); memset(&map->map[start], 0, size); + map->err_thread = -1; } static struct thread_map *thread_map__realloc(struct thread_map *map, int nr) @@ -323,7 +324,7 @@ out_free_threads: } struct thread_map *thread_map__new_str(const char *pid, const char *tid, - uid_t uid, bool per_thread) + uid_t uid, bool all_threads) { if (pid) return thread_map__new_by_pid_str(pid); @@ -331,7 +332,7 @@ struct thread_map *thread_map__new_str(const char *pid, const char *tid, if (!tid && uid != UINT_MAX) return thread_map__new_by_uid(uid); - if (per_thread) + if (all_threads) return thread_map__new_all_cpus(); return thread_map__new_by_tid_str(tid); diff --git a/tools/perf/util/thread_map.h b/tools/perf/util/thread_map.h index 0a806b99e73c..2f689c90a8c6 100644 --- a/tools/perf/util/thread_map.h +++ b/tools/perf/util/thread_map.h @@ -14,6 +14,7 @@ struct thread_map_data { struct thread_map { refcount_t refcnt; int nr; + int err_thread; struct thread_map_data map[]; }; @@ -31,7 +32,7 @@ struct thread_map *thread_map__get(struct thread_map *map); void thread_map__put(struct thread_map *map); struct thread_map *thread_map__new_str(const char *pid, - const char *tid, uid_t uid, bool per_thread); + const char *tid, uid_t uid, bool all_threads); struct thread_map *thread_map__new_by_tid_str(const char *tid_str); diff --git a/tools/perf/util/trigger.h b/tools/perf/util/trigger.h index 370138e7e35c..88223bc7c82b 100644 --- a/tools/perf/util/trigger.h +++ b/tools/perf/util/trigger.h @@ -12,7 +12,7 @@ * States and transits: * * - * OFF--(on)--> READY --(hit)--> HIT + * OFF--> ON --> READY --(hit)--> HIT * ^ | * | (ready) * | | @@ -27,8 +27,9 @@ struct trigger { volatile enum { TRIGGER_ERROR = -2, TRIGGER_OFF = -1, - TRIGGER_READY = 0, - TRIGGER_HIT = 1, + TRIGGER_ON = 0, + TRIGGER_READY = 1, + TRIGGER_HIT = 2, } state; const char *name; }; @@ -50,7 +51,7 @@ static inline bool trigger_is_error(struct trigger *t) static inline void trigger_on(struct trigger *t) { TRIGGER_WARN_ONCE(t, TRIGGER_OFF); - t->state = TRIGGER_READY; + t->state = TRIGGER_ON; } static inline void trigger_ready(struct trigger *t) diff --git a/tools/perf/util/unwind-libdw.c b/tools/perf/util/unwind-libdw.c index 1e9c974faf67..7bdd239c795c 100644 --- a/tools/perf/util/unwind-libdw.c +++ b/tools/perf/util/unwind-libdw.c @@ -50,7 +50,7 @@ static int __report_module(struct addr_location *al, u64 ip, if (!mod) mod = dwfl_report_elf(ui->dwfl, dso->short_name, - dso->long_name, -1, al->map->start, + (dso->symsrc_filename ? dso->symsrc_filename : dso->long_name), -1, al->map->start, false); return mod && dwfl_addrmodule(ui->dwfl, ip) == mod ? 0 : -1; @@ -236,7 +236,8 @@ int unwind__get_entries(unwind_entry_cb_t cb, void *arg, if (err) goto out; - if (!dwfl_attach_state(ui->dwfl, EM_NONE, thread->tid, &callbacks, ui)) + err = !dwfl_attach_state(ui->dwfl, EM_NONE, thread->tid, &callbacks, ui); + if (err) goto out; err = dwfl_getthread_frames(ui->dwfl, thread->tid, frame_callback, ui); diff --git a/tools/scripts/Makefile.arch b/tools/scripts/Makefile.arch index 78d90a249e88..b10b7a27c33f 100644 --- a/tools/scripts/Makefile.arch +++ b/tools/scripts/Makefile.arch @@ -4,8 +4,7 @@ HOSTARCH := $(shell uname -m | sed -e s/i.86/x86/ -e s/x86_64/x86/ \ -e /arm64/!s/arm.*/arm/ -e s/sa110/arm/ \ -e s/s390x/s390/ -e s/parisc64/parisc/ \ -e s/ppc.*/powerpc/ -e s/mips.*/mips/ \ - -e s/sh[234].*/sh/ -e s/aarch64.*/arm64/ \ - -e s/tile.*/tile/ ) + -e s/sh[234].*/sh/ -e s/aarch64.*/arm64/ ) ifndef ARCH ARCH := $(HOSTARCH) @@ -34,14 +33,6 @@ ifeq ($(ARCH),sh64) SRCARCH := sh endif -# Additional ARCH settings for tile -ifeq ($(ARCH),tilepro) - SRCARCH := tile -endif -ifeq ($(ARCH),tilegx) - SRCARCH := tile -endif - LP64 := $(shell echo __LP64__ | ${CC} ${CFLAGS} -E -x c - | tail -n 1) ifeq ($(LP64), 1) IS_64_BIT := 1 diff --git a/tools/testing/ktest/examples/crosstests.conf b/tools/testing/ktest/examples/crosstests.conf index a1203148dfa1..6907f32590b2 100644 --- a/tools/testing/ktest/examples/crosstests.conf +++ b/tools/testing/ktest/examples/crosstests.conf @@ -59,7 +59,7 @@ DO_DEFAULT := 1 # By setting both DO_FAILED and DO_DEFAULT to zero, you can pick a single # arch that you want to test. (uncomment RUN and chose your arch) -#RUN := m32r +#RUN := arm # At the bottom of the config file exists a bisect test. You can update that # test and set DO_FAILED and DO_DEFAULT to zero, and uncomment this variable @@ -106,33 +106,11 @@ TEST_START IF ${RUN} == arm || ${DO_DEFAULT} CROSS = arm-unknown-linux-gnueabi ARCH = arm -# black fin -TEST_START IF ${RUN} == bfin || ${DO_DEFAULT} -CROSS = bfin-uclinux -ARCH = blackfin -BUILD_OPTIONS = -j8 vmlinux - -# cris - FAILS? -TEST_START IF ${RUN} == cris || ${RUN} == cris64 || ${DO_FAILED} -CROSS = cris-linux -ARCH = cris - -# cris32 - not right arch? -TEST_START IF ${RUN} == cris || ${RUN} == cris32 || ${DO_FAILED} -CROSS = crisv32-linux -ARCH = cris - # ia64 TEST_START IF ${RUN} == ia64 || ${DO_DEFAULT} CROSS = ia64-linux ARCH = ia64 -# frv -TEST_START IF ${RUN} == frv || ${DO_FAILED} -CROSS = frv-linux -ARCH = frv -GCC_VER = 4.5.1 - # m68k fails with error? TEST_START IF ${RUN} == m68k || ${DO_DEFAULT} CROSS = m68k-linux @@ -148,13 +126,6 @@ TEST_START IF ${RUN} == mips || ${RUN} == mips32 || ${DO_DEFAULT} CROSS = mips-linux ARCH = mips -# m32r -TEST_START IF ${RUN} == m32r || ${DO_FAILED} -CROSS = m32r-linux -ARCH = m32r -GCC_VER = 4.5.1 -BUILD_OPTIONS = -j8 vmlinux - # parisc64 failed? TEST_START IF ${RUN} == hppa || ${RUN} == hppa64 || ${DO_FAILED} CROSS = hppa64-linux diff --git a/tools/testing/ktest/ktest.pl b/tools/testing/ktest/ktest.pl index 0c8b61f8398e..8809f244bb7c 100755 --- a/tools/testing/ktest/ktest.pl +++ b/tools/testing/ktest/ktest.pl @@ -3683,8 +3683,6 @@ sub read_depends { # what directory to look at. if ($arch eq "i386" || $arch eq "x86_64") { $arch = "x86"; - } elsif ($arch =~ /^tile/) { - $arch = "tile"; } my $kconfig = "$builddir/arch/$arch/Kconfig"; diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_string.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_string.tc new file mode 100644 index 000000000000..5ba73035e1d9 --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_string.tc @@ -0,0 +1,46 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: Kprobe event string type argument + +[ -f kprobe_events ] || exit_unsupported # this is configurable + +echo 0 > events/enable +echo > kprobe_events + +case `uname -m` in +x86_64) + ARG2=%si + OFFS=8 +;; +i[3456]86) + ARG2=%cx + OFFS=4 +;; +aarch64) + ARG2=%x1 + OFFS=8 +;; +arm*) + ARG2=%r1 + OFFS=4 +;; +*) + echo "Please implement other architecture here" + exit_untested +esac + +: "Test get argument (1)" +echo "p:testprobe create_trace_kprobe arg1=+0(+0(${ARG2})):string" > kprobe_events +echo 1 > events/kprobes/testprobe/enable +! echo test >> kprobe_events +tail -n 1 trace | grep -qe "testprobe.* arg1=\"test\"" + +echo 0 > events/kprobes/testprobe/enable +: "Test get argument (2)" +echo "p:testprobe create_trace_kprobe arg1=+0(+0(${ARG2})):string arg2=+0(+${OFFS}(${ARG2})):string" > kprobe_events +echo 1 > events/kprobes/testprobe/enable +! echo test1 test2 >> kprobe_events +tail -n 1 trace | grep -qe "testprobe.* arg1=\"test1\" arg2=\"test2\"" + +echo 0 > events/enable +echo > kprobe_events diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_syntax.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_syntax.tc new file mode 100644 index 000000000000..231bcd2c4eb5 --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_args_syntax.tc @@ -0,0 +1,97 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: Kprobe event argument syntax + +[ -f kprobe_events ] || exit_unsupported # this is configurable + +grep "x8/16/32/64" README > /dev/null || exit_unsupported # version issue + +echo 0 > events/enable +echo > kprobe_events + +PROBEFUNC="vfs_read" +GOODREG= +BADREG= +GOODSYM="_sdata" +if ! grep -qw ${GOODSYM} /proc/kallsyms ; then + GOODSYM=$PROBEFUNC +fi +BADSYM="deaqswdefr" +SYMADDR=0x`grep -w ${GOODSYM} /proc/kallsyms | cut -f 1 -d " "` +GOODTYPE="x16" +BADTYPE="y16" + +case `uname -m` in +x86_64|i[3456]86) + GOODREG=%ax + BADREG=%ex +;; +aarch64) + GOODREG=%x0 + BADREG=%ax +;; +arm*) + GOODREG=%r0 + BADREG=%ax +;; +esac + +test_goodarg() # Good-args +{ + while [ "$1" ]; do + echo "p ${PROBEFUNC} $1" > kprobe_events + shift 1 + done; +} + +test_badarg() # Bad-args +{ + while [ "$1" ]; do + ! echo "p ${PROBEFUNC} $1" > kprobe_events + shift 1 + done; +} + +echo > kprobe_events + +: "Register access" +test_goodarg ${GOODREG} +test_badarg ${BADREG} + +: "Symbol access" +test_goodarg "@${GOODSYM}" "@${SYMADDR}" "@${GOODSYM}+10" "@${GOODSYM}-10" +test_badarg "@" "@${BADSYM}" "@${GOODSYM}*10" "@${GOODSYM}/10" \ + "@${GOODSYM}%10" "@${GOODSYM}&10" "@${GOODSYM}|10" + +: "Stack access" +test_goodarg "\$stack" "\$stack0" "\$stack1" +test_badarg "\$stackp" "\$stack0+10" "\$stack1-10" + +: "Retval access" +echo "r ${PROBEFUNC} \$retval" > kprobe_events +! echo "p ${PROBEFUNC} \$retval" > kprobe_events + +: "Comm access" +test_goodarg "\$comm" + +: "Indirect memory access" +test_goodarg "+0(${GOODREG})" "-0(${GOODREG})" "+10(\$stack)" \ + "+0(\$stack1)" "+10(@${GOODSYM}-10)" "+0(+10(+20(\$stack)))" +test_badarg "+(${GOODREG})" "(${GOODREG}+10)" "-(${GOODREG})" "(${GOODREG})" \ + "+10(\$comm)" "+0(${GOODREG})+10" + +: "Name assignment" +test_goodarg "varname=${GOODREG}" +test_badarg "varname=varname2=${GOODREG}" + +: "Type syntax" +test_goodarg "${GOODREG}:${GOODTYPE}" +test_badarg "${GOODREG}::${GOODTYPE}" "${GOODREG}:${BADTYPE}" \ + "${GOODTYPE}:${GOODREG}" + +: "Combination check" + +test_goodarg "\$comm:string" "+0(\$stack):string" +test_badarg "\$comm:x64" "\$stack:string" "${GOODREG}:string" + +echo > kprobe_events diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/probepoint.tc b/tools/testing/selftests/ftrace/test.d/kprobe/probepoint.tc new file mode 100644 index 000000000000..4fda01a08da4 --- /dev/null +++ b/tools/testing/selftests/ftrace/test.d/kprobe/probepoint.tc @@ -0,0 +1,43 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0 +# description: Kprobe events - probe points + +[ -f kprobe_events ] || exit_unsupported # this is configurable + +TARGET_FUNC=create_trace_kprobe + +dec_addr() { # hexaddr + printf "%d" "0x"`echo $1 | tail -c 8` +} + +set_offs() { # prev target next + A1=`dec_addr $1` + A2=`dec_addr $2` + A3=`dec_addr $3` + TARGET="0x$2" # an address + PREV=`expr $A1 - $A2` # offset to previous symbol + NEXT=+`expr $A3 - $A2` # offset to next symbol + OVERFLOW=+`printf "0x%x" ${PREV}` # overflow offset to previous symbol +} + +# We have to decode symbol addresses to get correct offsets. +# If the offset is not an instruction boundary, it cause -EILSEQ. +set_offs `grep -A1 -B1 ${TARGET_FUNC} /proc/kallsyms | cut -f 1 -d " " | xargs` + +UINT_TEST=no +# printf "%x" -1 returns (unsigned long)-1. +if [ `printf "%x" -1 | wc -c` != 9 ]; then + UINT_TEST=yes +fi + +echo 0 > events/enable +echo > kprobe_events +echo "p:testprobe ${TARGET_FUNC}" > kprobe_events +echo "p:testprobe ${TARGET}" > kprobe_events +echo "p:testprobe ${TARGET_FUNC}${NEXT}" > kprobe_events +! echo "p:testprobe ${TARGET_FUNC}${PREV}" > kprobe_events +if [ "${UINT_TEST}" = yes ]; then +! echo "p:testprobe ${TARGET_FUNC}${OVERFLOW}" > kprobe_events +fi +echo > kprobe_events +clear_trace diff --git a/tools/testing/selftests/powerpc/mm/subpage_prot.c b/tools/testing/selftests/powerpc/mm/subpage_prot.c index 35ade7406dcd..3ae77ba93208 100644 --- a/tools/testing/selftests/powerpc/mm/subpage_prot.c +++ b/tools/testing/selftests/powerpc/mm/subpage_prot.c @@ -135,6 +135,16 @@ static int run_test(void *addr, unsigned long size) return 0; } +static int syscall_available(void) +{ + int rc; + + errno = 0; + rc = syscall(__NR_subpage_prot, 0, 0, 0); + + return rc == 0 || (errno != ENOENT && errno != ENOSYS); +} + int test_anon(void) { unsigned long align; @@ -145,6 +155,8 @@ int test_anon(void) void *mallocblock; unsigned long mallocsize; + SKIP_IF(!syscall_available()); + if (getpagesize() != 0x10000) { fprintf(stderr, "Kernel page size must be 64K!\n"); return 1; @@ -180,6 +192,8 @@ int test_file(void) off_t filesize; int fd; + SKIP_IF(!syscall_available()); + fd = open(file_name, O_RDWR); if (fd == -1) { perror("failed to open file"); diff --git a/tools/testing/selftests/powerpc/tm/Makefile b/tools/testing/selftests/powerpc/tm/Makefile index a23453943ad2..5c72ff978f27 100644 --- a/tools/testing/selftests/powerpc/tm/Makefile +++ b/tools/testing/selftests/powerpc/tm/Makefile @@ -16,7 +16,7 @@ $(OUTPUT)/tm-syscall: tm-syscall-asm.S $(OUTPUT)/tm-syscall: CFLAGS += -I../../../../../usr/include $(OUTPUT)/tm-tmspr: CFLAGS += -pthread $(OUTPUT)/tm-vmx-unavail: CFLAGS += -pthread -m64 -$(OUTPUT)/tm-resched-dscr: ../pmu/lib.o +$(OUTPUT)/tm-resched-dscr: ../pmu/lib.c $(OUTPUT)/tm-unavailable: CFLAGS += -O0 -pthread -m64 -Wno-error=uninitialized -mvsx $(OUTPUT)/tm-trap: CFLAGS += -O0 -pthread -m64 diff --git a/tools/testing/selftests/powerpc/tm/tm-trap.c b/tools/testing/selftests/powerpc/tm/tm-trap.c index 5d92c23ee6cb..179d592f0073 100644 --- a/tools/testing/selftests/powerpc/tm/tm-trap.c +++ b/tools/testing/selftests/powerpc/tm/tm-trap.c @@ -255,6 +255,8 @@ int tm_trap_test(void) struct sigaction trap_sa; + SKIP_IF(!have_htm()); + trap_sa.sa_flags = SA_SIGINFO; trap_sa.sa_sigaction = trap_signal_handler; sigaction(SIGTRAP, &trap_sa, NULL); diff --git a/tools/testing/selftests/rcutorture/bin/functions.sh b/tools/testing/selftests/rcutorture/bin/functions.sh index 07a13779eece..65f6655026f0 100644 --- a/tools/testing/selftests/rcutorture/bin/functions.sh +++ b/tools/testing/selftests/rcutorture/bin/functions.sh @@ -136,6 +136,9 @@ identify_boot_image () { qemu-system-x86_64|qemu-system-i386) echo arch/x86/boot/bzImage ;; + qemu-system-aarch64) + echo arch/arm64/boot/Image + ;; *) echo vmlinux ;; @@ -158,6 +161,9 @@ identify_qemu () { elif echo $u | grep -q "Intel 80386" then echo qemu-system-i386 + elif echo $u | grep -q aarch64 + then + echo qemu-system-aarch64 elif uname -a | grep -q ppc64 then echo qemu-system-ppc64 @@ -176,16 +182,20 @@ identify_qemu () { # Output arguments for the qemu "-append" string based on CPU type # and the TORTURE_QEMU_INTERACTIVE environment variable. identify_qemu_append () { + local console=ttyS0 case "$1" in qemu-system-x86_64|qemu-system-i386) echo noapic selinux=0 initcall_debug debug ;; + qemu-system-aarch64) + console=ttyAMA0 + ;; esac if test -n "$TORTURE_QEMU_INTERACTIVE" then echo root=/dev/sda else - echo console=ttyS0 + echo console=$console fi } @@ -197,6 +207,9 @@ identify_qemu_args () { case "$1" in qemu-system-x86_64|qemu-system-i386) ;; + qemu-system-aarch64) + echo -machine virt,gic-version=host -cpu host + ;; qemu-system-ppc64) echo -enable-kvm -M pseries -nodefaults echo -device spapr-vscsi @@ -254,7 +267,7 @@ specify_qemu_cpus () { echo $2 else case "$1" in - qemu-system-x86_64|qemu-system-i386) + qemu-system-x86_64|qemu-system-i386|qemu-system-aarch64) echo $2 -smp $3 ;; qemu-system-ppc64) diff --git a/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcuperf-ftrace.sh b/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcuperf-ftrace.sh index 963f71289d22..8948f7926b21 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcuperf-ftrace.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcuperf-ftrace.sh @@ -39,30 +39,31 @@ sed -e 's/us : / : /' | tr -d '\015' | awk ' $8 == "start" { - if (starttask != "") + if (startseq != "") nlost++; starttask = $1; starttime = $3; startseq = $7; + seqtask[startseq] = starttask; } $8 == "end" { - if (starttask == $1 && startseq == $7) { + if (startseq == $7) { curgpdur = $3 - starttime; gptimes[++n] = curgpdur; gptaskcnt[starttask]++; sum += curgpdur; if (curgpdur > 1000) print "Long GP " starttime "us to " $3 "us (" curgpdur "us)"; - starttask = ""; + startseq = ""; } else { # Lost a message or some such, reset. - starttask = ""; + startseq = ""; nlost++; } } -$8 == "done" { +$8 == "done" && seqtask[$7] != $1 { piggybackcnt[$1]++; } diff --git a/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh b/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh index 1b78a12740e5..5f8fbb0d7c17 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh @@ -177,8 +177,8 @@ then exit 0 fi echo "NOTE: $QEMU either did not run or was interactive" > $resdir/console.log -echo $QEMU $qemu_args -m 512 -kernel $KERNEL -append \"$qemu_append $boot_args\" > $resdir/qemu-cmd -( $QEMU $qemu_args -m 512 -kernel $KERNEL -append "$qemu_append $boot_args"& echo $! > $resdir/qemu_pid; wait `cat $resdir/qemu_pid`; echo $? > $resdir/qemu-retval ) & +echo $QEMU $qemu_args -m $TORTURE_QEMU_MEM -kernel $KERNEL -append \"$qemu_append $boot_args\" > $resdir/qemu-cmd +( $QEMU $qemu_args -m $TORTURE_QEMU_MEM -kernel $KERNEL -append "$qemu_append $boot_args"& echo $! > $resdir/qemu_pid; wait `cat $resdir/qemu_pid`; echo $? > $resdir/qemu-retval ) & commandcompleted=0 sleep 10 # Give qemu's pid a chance to reach the file if test -s "$resdir/qemu_pid" diff --git a/tools/testing/selftests/rcutorture/bin/kvm.sh b/tools/testing/selftests/rcutorture/bin/kvm.sh index 7d1f607f0f76..56610dbbdf73 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm.sh @@ -1,10 +1,8 @@ #!/bin/bash # -# Run a series of 14 tests under KVM. These are not particularly -# well-selected or well-tuned, but are the current set. -# -# Edit the definitions below to set the locations of the various directories, -# as well as the test duration. +# Run a series of tests under KVM. By default, this series is specified +# by the relevant CFLIST file, but can be overridden by the --configs +# command-line argument. # # Usage: kvm.sh [ options ] # @@ -44,6 +42,7 @@ TORTURE_BOOT_IMAGE="" TORTURE_INITRD="$KVM/initrd"; export TORTURE_INITRD TORTURE_KCONFIG_ARG="" TORTURE_KMAKE_ARG="" +TORTURE_QEMU_MEM=512 TORTURE_SHUTDOWN_GRACE=180 TORTURE_SUITE=rcu resdir="" @@ -70,6 +69,7 @@ usage () { echo " --kconfig Kconfig-options" echo " --kmake-arg kernel-make-arguments" echo " --mac nn:nn:nn:nn:nn:nn" + echo " --memory megabytes | nnnG" echo " --no-initrd" echo " --qemu-args qemu-arguments" echo " --qemu-cmd qemu-system-..." @@ -147,6 +147,11 @@ do TORTURE_QEMU_MAC=$2 shift ;; + --memory) + checkarg --memory "(memory size)" $# "$2" '^[0-9]\+[MG]\?$' error + TORTURE_QEMU_MEM=$2 + shift + ;; --no-initrd) TORTURE_INITRD=""; export TORTURE_INITRD ;; @@ -174,6 +179,12 @@ do checkarg --torture "(suite name)" "$#" "$2" '^\(lock\|rcu\|rcuperf\)$' '^--' TORTURE_SUITE=$2 shift + if test "$TORTURE_SUITE" = rcuperf + then + # If you really want jitter for rcuperf, specify + # it after specifying rcuperf. (But why?) + jitter=0 + fi ;; *) echo Unknown argument $1 @@ -288,6 +299,7 @@ TORTURE_KMAKE_ARG="$TORTURE_KMAKE_ARG"; export TORTURE_KMAKE_ARG TORTURE_QEMU_CMD="$TORTURE_QEMU_CMD"; export TORTURE_QEMU_CMD TORTURE_QEMU_INTERACTIVE="$TORTURE_QEMU_INTERACTIVE"; export TORTURE_QEMU_INTERACTIVE TORTURE_QEMU_MAC="$TORTURE_QEMU_MAC"; export TORTURE_QEMU_MAC +TORTURE_QEMU_MEM="$TORTURE_QEMU_MEM"; export TORTURE_QEMU_MEM TORTURE_SHUTDOWN_GRACE="$TORTURE_SHUTDOWN_GRACE"; export TORTURE_SHUTDOWN_GRACE TORTURE_SUITE="$TORTURE_SUITE"; export TORTURE_SUITE if ! test -e $resdir diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TASKS03 b/tools/testing/selftests/rcutorture/configs/rcu/TASKS03 index c70c51d5ded1..28568b72a31b 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TASKS03 +++ b/tools/testing/selftests/rcutorture/configs/rcu/TASKS03 @@ -9,5 +9,4 @@ CONFIG_PREEMPT=y CONFIG_HZ_PERIODIC=n CONFIG_NO_HZ_IDLE=n CONFIG_NO_HZ_FULL=y -CONFIG_NO_HZ_FULL_ALL=y #CHECK#CONFIG_RCU_EXPERT=n diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TASKS03.boot b/tools/testing/selftests/rcutorture/configs/rcu/TASKS03.boot index cd2a188eeb6d..838297c58318 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TASKS03.boot +++ b/tools/testing/selftests/rcutorture/configs/rcu/TASKS03.boot @@ -1 +1 @@ -rcutorture.torture_type=tasks +rcutorture.torture_type=tasks nohz_full=1 diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE04 b/tools/testing/selftests/rcutorture/configs/rcu/TREE04 index 27d22695d64c..24c9f6012e35 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TREE04 +++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE04 @@ -7,7 +7,6 @@ CONFIG_PREEMPT=n CONFIG_HZ_PERIODIC=n CONFIG_NO_HZ_IDLE=n CONFIG_NO_HZ_FULL=y -CONFIG_NO_HZ_FULL_ALL=y CONFIG_RCU_FAST_NO_HZ=y CONFIG_RCU_TRACE=y CONFIG_HOTPLUG_CPU=n diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE04.boot b/tools/testing/selftests/rcutorture/configs/rcu/TREE04.boot index e34c33430447..e6071bb96c7d 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TREE04.boot +++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE04.boot @@ -1 +1 @@ -rcutorture.torture_type=rcu_bh rcutree.rcu_fanout_leaf=4 +rcutorture.torture_type=rcu_bh rcutree.rcu_fanout_leaf=4 nohz_full=1-7 diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE07 b/tools/testing/selftests/rcutorture/configs/rcu/TREE07 index 0f4759f4232e..d7afb271a586 100644 --- a/tools/testing/selftests/rcutorture/configs/rcu/TREE07 +++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE07 @@ -7,7 +7,6 @@ CONFIG_PREEMPT=n CONFIG_HZ_PERIODIC=n CONFIG_NO_HZ_IDLE=n CONFIG_NO_HZ_FULL=y -CONFIG_NO_HZ_FULL_ALL=n CONFIG_RCU_FAST_NO_HZ=n CONFIG_RCU_TRACE=y CONFIG_HOTPLUG_CPU=y diff --git a/tools/testing/selftests/rcutorture/configs/rcuperf/ver_functions.sh b/tools/testing/selftests/rcutorture/configs/rcuperf/ver_functions.sh index b9603115d7c7..d36b8fd6f0fc 100644 --- a/tools/testing/selftests/rcutorture/configs/rcuperf/ver_functions.sh +++ b/tools/testing/selftests/rcutorture/configs/rcuperf/ver_functions.sh @@ -20,32 +20,10 @@ # # Authors: Paul E. McKenney <paulmck@linux.vnet.ibm.com> -# rcuperf_param_nreaders bootparam-string -# -# Adds nreaders rcuperf module parameter if not already specified. -rcuperf_param_nreaders () { - if ! echo "$1" | grep -q "rcuperf.nreaders" - then - echo rcuperf.nreaders=-1 - fi -} - -# rcuperf_param_nwriters bootparam-string -# -# Adds nwriters rcuperf module parameter if not already specified. -rcuperf_param_nwriters () { - if ! echo "$1" | grep -q "rcuperf.nwriters" - then - echo rcuperf.nwriters=-1 - fi -} - # per_version_boot_params bootparam-string config-file seconds # # Adds per-version torture-module parameters to kernels supporting them. per_version_boot_params () { - echo $1 `rcuperf_param_nreaders "$1"` \ - `rcuperf_param_nwriters "$1"` \ - rcuperf.shutdown=1 \ + echo $1 rcuperf.shutdown=1 \ rcuperf.verbose=1 } diff --git a/tools/testing/selftests/rcutorture/doc/rcu-test-image.txt b/tools/testing/selftests/rcutorture/doc/rcu-test-image.txt index 66efb59a1bd1..449cf579d6f9 100644 --- a/tools/testing/selftests/rcutorture/doc/rcu-test-image.txt +++ b/tools/testing/selftests/rcutorture/doc/rcu-test-image.txt @@ -1,4 +1,4 @@ -This document describes one way to created the rcu-test-image file +This document describes one way to create the rcu-test-image file that contains the filesystem used by the guest-OS kernel. There are probably much better ways of doing this, and this filesystem could no doubt be smaller. It is probably also possible to simply download diff --git a/tools/testing/selftests/vm/run_vmtests b/tools/testing/selftests/vm/run_vmtests index d2561895a021..22d564673830 100755 --- a/tools/testing/selftests/vm/run_vmtests +++ b/tools/testing/selftests/vm/run_vmtests @@ -2,25 +2,33 @@ # SPDX-License-Identifier: GPL-2.0 #please run as root -#we need 256M, below is the size in kB -needmem=262144 mnt=./huge exitcode=0 -#get pagesize and freepages from /proc/meminfo +#get huge pagesize and freepages from /proc/meminfo while read name size unit; do if [ "$name" = "HugePages_Free:" ]; then freepgs=$size fi if [ "$name" = "Hugepagesize:" ]; then - pgsize=$size + hpgsize_KB=$size fi done < /proc/meminfo +# Simple hugetlbfs tests have a hardcoded minimum requirement of +# huge pages totaling 256MB (262144KB) in size. The userfaultfd +# hugetlb test requires a minimum of 2 * nr_cpus huge pages. Take +# both of these requirements into account and attempt to increase +# number of huge pages available. +nr_cpus=$(nproc) +hpgsize_MB=$((hpgsize_KB / 1024)) +half_ufd_size_MB=$((((nr_cpus * hpgsize_MB + 127) / 128) * 128)) +needmem_KB=$((half_ufd_size_MB * 2 * 1024)) + #set proper nr_hugepages -if [ -n "$freepgs" ] && [ -n "$pgsize" ]; then +if [ -n "$freepgs" ] && [ -n "$hpgsize_KB" ]; then nr_hugepgs=`cat /proc/sys/vm/nr_hugepages` - needpgs=`expr $needmem / $pgsize` + needpgs=$((needmem_KB / hpgsize_KB)) tries=2 while [ $tries -gt 0 ] && [ $freepgs -lt $needpgs ]; do lackpgs=$(( $needpgs - $freepgs )) @@ -107,8 +115,9 @@ fi echo "---------------------------" echo "running userfaultfd_hugetlb" echo "---------------------------" -# 256MB total huge pages == 128MB src and 128MB dst -./userfaultfd hugetlb 128 32 $mnt/ufd_test_file +# Test requires source and destination huge pages. Size of source +# (half_ufd_size_MB) is passed as argument to test. +./userfaultfd hugetlb $half_ufd_size_MB 32 $mnt/ufd_test_file if [ $? -ne 0 ]; then echo "[FAIL]" exitcode=1 diff --git a/tools/testing/selftests/x86/entry_from_vm86.c b/tools/testing/selftests/x86/entry_from_vm86.c index 361466a2eaef..ade443a88421 100644 --- a/tools/testing/selftests/x86/entry_from_vm86.c +++ b/tools/testing/selftests/x86/entry_from_vm86.c @@ -95,6 +95,10 @@ asm ( "int3\n\t" "vmcode_int80:\n\t" "int $0x80\n\t" + "vmcode_popf_hlt:\n\t" + "push %ax\n\t" + "popf\n\t" + "hlt\n\t" "vmcode_umip:\n\t" /* addressing via displacements */ "smsw (2052)\n\t" @@ -124,8 +128,8 @@ asm ( extern unsigned char vmcode[], end_vmcode[]; extern unsigned char vmcode_bound[], vmcode_sysenter[], vmcode_syscall[], - vmcode_sti[], vmcode_int3[], vmcode_int80[], vmcode_umip[], - vmcode_umip_str[], vmcode_umip_sldt[]; + vmcode_sti[], vmcode_int3[], vmcode_int80[], vmcode_popf_hlt[], + vmcode_umip[], vmcode_umip_str[], vmcode_umip_sldt[]; /* Returns false if the test was skipped. */ static bool do_test(struct vm86plus_struct *v86, unsigned long eip, @@ -175,7 +179,7 @@ static bool do_test(struct vm86plus_struct *v86, unsigned long eip, (VM86_TYPE(ret) == rettype && VM86_ARG(ret) == retarg)) { printf("[OK]\tReturned correctly\n"); } else { - printf("[FAIL]\tIncorrect return reason\n"); + printf("[FAIL]\tIncorrect return reason (started at eip = 0x%lx, ended at eip = 0x%lx)\n", eip, v86->regs.eip); nerrs++; } @@ -264,6 +268,9 @@ int main(void) v86.regs.ds = load_addr / 16; v86.regs.es = load_addr / 16; + /* Use the end of the page as our stack. */ + v86.regs.esp = 4096; + assert((v86.regs.cs & 3) == 0); /* Looks like RPL = 0 */ /* #BR -- should deliver SIG??? */ @@ -295,6 +302,23 @@ int main(void) v86.regs.eflags &= ~X86_EFLAGS_IF; do_test(&v86, vmcode_sti - vmcode, VM86_STI, 0, "STI with VIP set"); + /* POPF with VIP set but IF clear: should not trap */ + v86.regs.eflags = X86_EFLAGS_VIP; + v86.regs.eax = 0; + do_test(&v86, vmcode_popf_hlt - vmcode, VM86_UNKNOWN, 0, "POPF with VIP set and IF clear"); + + /* POPF with VIP set and IF set: should trap */ + v86.regs.eflags = X86_EFLAGS_VIP; + v86.regs.eax = X86_EFLAGS_IF; + do_test(&v86, vmcode_popf_hlt - vmcode, VM86_STI, 0, "POPF with VIP and IF set"); + + /* POPF with VIP clear and IF set: should not trap */ + v86.regs.eflags = 0; + v86.regs.eax = X86_EFLAGS_IF; + do_test(&v86, vmcode_popf_hlt - vmcode, VM86_UNKNOWN, 0, "POPF with VIP clear and IF set"); + + v86.regs.eflags = 0; + /* INT3 -- should cause #BP */ do_test(&v86, vmcode_int3 - vmcode, VM86_TRAP, 3, "INT3"); @@ -318,7 +342,7 @@ int main(void) clearhandler(SIGSEGV); /* Make sure nothing explodes if we fork. */ - if (fork() > 0) + if (fork() == 0) return 0; return (nerrs == 0 ? 0 : 1); diff --git a/tools/testing/selftests/x86/ptrace_syscall.c b/tools/testing/selftests/x86/ptrace_syscall.c index 1ae1c5a7392e..6f22238f3217 100644 --- a/tools/testing/selftests/x86/ptrace_syscall.c +++ b/tools/testing/selftests/x86/ptrace_syscall.c @@ -183,8 +183,10 @@ static void test_ptrace_syscall_restart(void) if (ptrace(PTRACE_TRACEME, 0, 0, 0) != 0) err(1, "PTRACE_TRACEME"); + pid_t pid = getpid(), tid = syscall(SYS_gettid); + printf("\tChild will make one syscall\n"); - raise(SIGSTOP); + syscall(SYS_tgkill, pid, tid, SIGSTOP); syscall(SYS_gettid, 10, 11, 12, 13, 14, 15); _exit(0); @@ -301,9 +303,11 @@ static void test_restart_under_ptrace(void) if (ptrace(PTRACE_TRACEME, 0, 0, 0) != 0) err(1, "PTRACE_TRACEME"); + pid_t pid = getpid(), tid = syscall(SYS_gettid); + printf("\tChild will take a nap until signaled\n"); setsigign(SIGUSR1, SA_RESTART); - raise(SIGSTOP); + syscall(SYS_tgkill, pid, tid, SIGSTOP); syscall(SYS_pause, 0, 0, 0, 0, 0, 0); _exit(0); diff --git a/tools/testing/selftests/x86/test_vsyscall.c b/tools/testing/selftests/x86/test_vsyscall.c index be81621446f0..0b4f1cc2291c 100644 --- a/tools/testing/selftests/x86/test_vsyscall.c +++ b/tools/testing/selftests/x86/test_vsyscall.c @@ -450,7 +450,7 @@ static void sigtrap(int sig, siginfo_t *info, void *ctx_void) num_vsyscall_traps++; } -static int test_native_vsyscall(void) +static int test_emulation(void) { time_t tmp; bool is_native; @@ -458,7 +458,7 @@ static int test_native_vsyscall(void) if (!vtime) return 0; - printf("[RUN]\tchecking for native vsyscall\n"); + printf("[RUN]\tchecking that vsyscalls are emulated\n"); sethandler(SIGTRAP, sigtrap, 0); set_eflags(get_eflags() | X86_EFLAGS_TF); vtime(&tmp); @@ -474,11 +474,12 @@ static int test_native_vsyscall(void) */ is_native = (num_vsyscall_traps > 1); - printf("\tvsyscalls are %s (%d instructions in vsyscall page)\n", + printf("[%s]\tvsyscalls are %s (%d instructions in vsyscall page)\n", + (is_native ? "FAIL" : "OK"), (is_native ? "native" : "emulated"), (int)num_vsyscall_traps); - return 0; + return is_native; } #endif @@ -498,7 +499,7 @@ int main(int argc, char **argv) nerrs += test_vsys_r(); #ifdef __x86_64__ - nerrs += test_native_vsyscall(); + nerrs += test_emulation(); #endif return nerrs ? 1 : 0; |