diff options
author | 2006-06-27 05:05:29 +0000 | |
---|---|---|
committer | 2006-06-27 05:05:29 +0000 | |
commit | 0dd1310450b001b7ff1a59ac52d877d1d1fdd9b7 (patch) | |
tree | 3050c0c4f951fa821189d57a099af10d90fc1d58 /lib/libssl/src | |
parent | __attribute__((__packed__)) -> __packed (diff) | |
download | wireguard-openbsd-0dd1310450b001b7ff1a59ac52d877d1d1fdd9b7.tar.xz wireguard-openbsd-0dd1310450b001b7ff1a59ac52d877d1d1fdd9b7.zip |
import of openssl-0.9.7j
Diffstat (limited to 'lib/libssl/src')
130 files changed, 27174 insertions, 324 deletions
diff --git a/lib/libssl/src/Makefile b/lib/libssl/src/Makefile index 45d2befa5cc..398fd3d5fd1 100644 --- a/lib/libssl/src/Makefile +++ b/lib/libssl/src/Makefile @@ -4,7 +4,7 @@ ## Makefile for OpenSSL ## -VERSION=0.9.7g +VERSION=0.9.7j MAJOR=0 MINOR=9.7 SHLIB_VERSION_NUMBER=0.9.7 @@ -104,6 +104,7 @@ PROCESSOR= # Set DES_ENC to des_enc.o if you want to use the C version #There are 4 x86 assember options. FIPS_DES_ENC= +FIPS_AES_ENC= DES_ENC= des_enc.o fcrypt_b.o #DES_ENC= des_enc.o fcrypt_b.o # C #DES_ENC= asm/dx86-elf.o asm/yx86-elf.o # elf @@ -173,11 +174,29 @@ RMD160_ASM_OBJ= KRB5_INCLUDES= LIBKRB5= +# Zlib stuff +ZLIB_INCLUDE= +LIBZLIB= + +# This is the location of fipscanister.o and friends. +# The FIPS module build will place it $(INSTALLTOP)/lib +# but since $(INSTALLTOP) can only take the default value +# when the module is built it will be in /usr/local/ssl/lib +# $(INSTALLTOP) for this build make be different so hard +# code the path. + +FIPSLIBDIR=/usr/local/ssl/lib + +# Shared library base address. Currently only used on Windows. +# + +BASEADDR=0xFB00000 + # When we're prepared to use shared libraries in the programs we link here # we might set SHLIB_MARK to '$(SHARED_LIBS)'. SHLIB_MARK= -DIRS= crypto fips ssl $(SHLIB_MARK) sigs apps test tools +DIRS= crypto fips-1.0 ssl $(SHLIB_MARK) apps test tools SHLIBDIRS= crypto ssl # dirs in crypto to build @@ -188,7 +207,7 @@ SDIRS= objects \ buffer bio stack lhash rand err \ evp asn1 pem x509 x509v3 conf txt_db pkcs7 pkcs12 comp ocsp ui krb5 -FDIRS= sha1 rand des aes dsa rsa dh +FDIRS= sha rand des aes dsa rsa dh hmac # tests to perform. "alltests" is a special word indicating that all tests # should be performed. @@ -207,7 +226,6 @@ ONEDIRS=out tmp EDIRS= times doc bugs util include certs ms shlib mt demos perl sf dep VMS WDIRS= windows LIBS= libcrypto.a libssl.a -SIGS= libcrypto.a.sha1 SHARED_CRYPTO=libcrypto$(SHLIB_EXT) SHARED_SSL=libssl$(SHLIB_EXT) SHARED_LIBS= @@ -227,19 +245,12 @@ HEADER= e_os.h all: Makefile sub_all openssl.pc -sigs: $(SIGS) -libcrypto.a.sha1: libcrypto.a - @if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - $(RANLIB) libcrypto.a; \ - fips/sha1/fips_standalone_sha1 libcrypto.a > libcrypto.a.sha1; \ - fi - sub_all: @for i in $(DIRS); \ do \ if [ -d "$$i" ]; then \ (cd $$i && echo "making all in $$i..." && \ - $(MAKE) CC='${CC}' PLATFORM='${PLATFORM}' CFLAG='${CFLAG}' AS='${AS}' ASFLAG='${ASFLAG}' SDIRS='$(SDIRS)' FDIRS='$(FDIRS)' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' KRB5_INCLUDES='${KRB5_INCLUDES}' LIBKRB5='${LIBKRB5}' EXE_EXT='${EXE_EXT}' SHARED_LIBS='${SHARED_LIBS}' SHLIB_EXT='${SHLIB_EXT}' SHLIB_TARGET='${SHLIB_TARGET}' all ) || exit 1; \ + $(MAKE) CC='${CC}' PLATFORM='${PLATFORM}' CFLAG='${CFLAG}' AS='${AS}' ASFLAG='${ASFLAG}' SDIRS='$(SDIRS)' FDIRS='$(FDIRS)' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' FIPS_AES_ENC='${FIPS_AES_ENC}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' KRB5_INCLUDES='${KRB5_INCLUDES}' LIBKRB5='${LIBKRB5}' EXE_EXT='${EXE_EXT}' SHARED_LIBS='${SHARED_LIBS}' SHLIB_EXT='${SHLIB_EXT}' SHLIB_TARGET='${SHLIB_TARGET}' FIPSLIBDIR='${FIPSLIBDIR}' all ) || exit 1; \ else \ $(MAKE) $$i; \ fi; \ @@ -250,7 +261,7 @@ sub_target: do \ if [ -d "$$i" ]; then \ (cd $$i && echo "making $(TARGET) in $$i..." && \ - $(MAKE) CC='${CC}' PLATFORM='${PLATFORM}' CFLAG='${CFLAG}' AS='${AS}' ASFLAG='${ASFLAG}' SDIRS='$(SDIRS)' FDIRS='$(FDIRS)' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' KRB5_INCLUDES='${KRB5_INCLUDES}' LIBKRB5='${LIBKRB5}' EXE_EXT='${EXE_EXT}' SHARED_LIBS='${SHARED_LIBS}' SHLIB_EXT='${SHLIB_EXT}' SHLIB_TARGET='${SHLIB_TARGET}' TARGET='$(TARGET)' sub_target ) || exit 1; \ + $(MAKE) CC='${CC}' PLATFORM='${PLATFORM}' CFLAG='${CFLAG}' AS='${AS}' ASFLAG='${ASFLAG}' SDIRS='$(SDIRS)' FDIRS='$(FDIRS)' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' FIPS_AES_ENC='${FIPS_AES_ENC}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' KRB5_INCLUDES='${KRB5_INCLUDES}' LIBKRB5='${LIBKRB5}' EXE_EXT='${EXE_EXT}' SHARED_LIBS='${SHARED_LIBS}' SHLIB_EXT='${SHLIB_EXT}' SHLIB_TARGET='${SHLIB_TARGET}' TARGET='$(TARGET)' sub_target ) || exit 1; \ else \ $(MAKE) $$i; \ fi; \ @@ -306,12 +317,12 @@ do_gnu-shared: if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ libs="$(LIBKRB5) $$libs"; \ fi; \ - ( set -x; ${CC} ${SHARED_LDFLAGS} \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -Wl,-soname=lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -Wl,-Bsymbolic \ -Wl,--whole-archive lib$$i.a \ - -Wl,--no-whole-archive $$libs ${EX_LIBS} -lc ) || exit 1; \ + -Wl,--no-whole-archive $$libs ${EX_LIBS} ) || exit 1; \ libs="-l$$i $$libs"; \ done @@ -323,7 +334,8 @@ do_darwin-shared: if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ libs="$(LIBKRB5) $$libs"; \ fi; \ - ( set -x; ${CC} --verbose -dynamiclib -o lib$$i${SHLIB_EXT} \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ + --verbose -dynamiclib -o lib$$i${SHLIB_EXT} \ lib$$i.a $$libs -all_load -current_version ${SHLIB_MAJOR}.${SHLIB_MINOR} \ -compatibility_version ${SHLIB_MAJOR}.`echo ${SHLIB_MINOR} | cut -d. -f1` \ -install_name ${INSTALLTOP}/lib/lib$$i${SHLIB_EXT} ) || exit 1; \ @@ -340,14 +352,15 @@ do_cygwin-shared: [ "$(PLATFORM)" = "mingw" ] && shlib=$${i}eay32.dll; \ [ -f apps/$$shlib ] && rm apps/$$shlib; \ [ -f test/$$shlib ] && rm test/$$shlib; \ - base=; [ $$i = "crypto" ] && base=-Wl,--image-base,0xFE00000; \ - ( set -x; ${CC} ${SHARED_LDFLAGS} \ + base=; [ $$i = "crypto" ] && base=-Wl,--image-base,0x63000000; \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared $$base -o $$shlib \ -Wl,-Bsymbolic \ -Wl,--whole-archive lib$$i.a \ -Wl,--out-implib,lib$$i.dll.a \ -Wl,--no-whole-archive $$libs ${EX_LIBS} ) || exit 1; \ cp -p $$shlib apps/; cp -p $$shlib test/; \ + touch -c lib$$i.dll.a; \ libs="-l$$i $$libs"; \ done @@ -360,10 +373,10 @@ do_alpha-osf1-shared: if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ libs="$(LIBKRB5) $$libs"; \ fi; \ - ( set -x; ${CC} ${SHARED_LDFLAGS} \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared -o lib$$i.so \ -set_version "${SHLIB_VERSION_HISTORY}${SHLIB_VERSION_NUMBER}" \ - -all lib$$i.a -none $$libs ${EX_LIBS} -lc ) || exit 1; \ + -all lib$$i.a -none $$libs ${EX_LIBS} ) || exit 1; \ libs="-l$$i $$libs"; \ done; \ fi @@ -379,10 +392,10 @@ do_tru64-shared: if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ libs="$(LIBKRB5) $$libs"; \ fi; \ - ( set -x; ${CC} ${SHARED_LDFLAGS} \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared -msym -o lib$$i.so \ -set_version "${SHLIB_VERSION_HISTORY}${SHLIB_VERSION_NUMBER}" \ - -all lib$$i.a -none $$libs ${EX_LIBS} -lc ) || exit 1; \ + -all lib$$i.a -none $$libs ${EX_LIBS} ) || exit 1; \ libs="-l$$i $$libs"; \ done; \ fi @@ -398,11 +411,11 @@ do_tru64-shared-rpath: if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ libs="$(LIBKRB5) $$libs"; \ fi; \ - ( set -x; ${CC} ${SHARED_LDFLAGS} \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared -msym -o lib$$i.so \ -rpath ${INSTALLTOP}/lib \ -set_version "${SHLIB_VERSION_HISTORY}${SHLIB_VERSION_NUMBER}" \ - -all lib$$i.a -none $$libs ${EX_LIBS} -lc ) || exit 1; \ + -all lib$$i.a -none $$libs ${EX_LIBS} ) || exit 1; \ libs="-l$$i $$libs"; \ done; \ fi @@ -420,12 +433,12 @@ do_solaris-shared: ( PATH=/usr/ccs/bin:$$PATH ; export PATH; \ MINUSZ='-z '; \ (${CC} -v 2>&1 | grep gcc) > /dev/null && MINUSZ='-Wl,-z,'; \ - set -x; ${CC} ${SHARED_LDFLAGS} -G -dy -z text \ + set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -h lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -Wl,-Bsymbolic \ $${MINUSZ}allextract lib$$i.a $${MINUSZ}defaultextract \ - $$libs ${EX_LIBS} -lc ) || exit 1; \ + $$libs ${EX_LIBS} ) || exit 1; \ libs="-l$$i $$libs"; \ done; \ fi @@ -445,7 +458,7 @@ do_svr3-shared: for obj in `ar t lib$$i.a` ; do \ OBJS="$${OBJS} `grep /$$obj allobjs`" ; \ done ; \ - set -x; ${CC} ${SHARED_LDFLAGS} \ + set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -G -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -h lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ $${OBJS} $$libs ${EX_LIBS} ) || exit 1; \ @@ -471,7 +484,7 @@ do_svr5-shared: OBJS="$${OBJS} `grep /$$obj allobjs`" ; \ done ; \ set -x; LD_LIBRARY_PATH=.:$$LD_LIBRARY_PATH \ - ${CC} ${SHARED_LDFLAGS} \ + $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ $${SHARE_FLAG} -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -h lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ $${OBJS} $$libs ${EX_LIBS} ) || exit 1; \ @@ -490,24 +503,15 @@ do_irix-shared: fi; \ ( WHOLELIB="-all lib$$i.a -none"; \ (${CC} -v 2>&1 | grep gcc) > /dev/null && WHOLELIB="-Wl,-all,lib$$i.a,-none"; \ - set -x; ${CC} ${SHARED_LDFLAGS} \ + set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ -shared -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ -Wl,-soname,lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} \ - $${WHOLELIB} $$libs ${EX_LIBS} -lc) || exit 1; \ + $${WHOLELIB} $$libs ${EX_LIBS}) || exit 1; \ libs="-l$$i $$libs"; \ done; \ fi # This assumes that GNU utilities are *not* used -# HP-UX includes the full pathname of libs we depend on, so we would get -# ./libcrypto (with ./ as path information) compiled into libssl, hence -# we omit the SHLIBDEPS. Applications must be linked with -lssl -lcrypto -# anyway. -# The object modules are loaded from lib$i.a using the undocumented -Fl -# option. -# -# WARNING: Until DSO is fixed to support a search path, we support SHLIB_PATH -# by temporarily specifying "+s"! # do_hpux-shared: for i in ${SHLIBDIRS}; do \ @@ -520,38 +524,11 @@ do_hpux-shared: shlib=lib$$i.sl.${SHLIB_MAJOR}.${SHLIB_MINOR}; \ fi; \ [ -f $$shlib ] && rm -f $$shlib; \ - ( set -x; /usr/ccs/bin/ld ${SHARED_LDFLAGS} \ - +vnocompatwarnings \ - -b -z +s \ - -o $$shlib +h $$shlib \ - -Fl lib$$i.a -ldld -lc ) || exit 1; \ - chmod a=rx $$shlib; \ - done - -# This assumes that GNU utilities are *not* used -# HP-UX includes the full pathname of libs we depend on, so we would get -# ./libcrypto (with ./ as path information) compiled into libssl, hence -# we omit the SHLIBDEPS. Applications must be linked with -lssl -lcrypto -# anyway. -# -# HP-UX in 64bit mode has "+s" enabled by default; it will search for -# shared libraries along LD_LIBRARY_PATH _and_ SHLIB_PATH. -# -do_hpux64-shared: - for i in ${SHLIBDIRS}; do \ - if [ "${SHLIBDIRS}" = "ssl" -a -n "$(LIBKRB5)" ]; then \ - libs="$(LIBKRB5) $$libs"; \ - fi; \ - if expr $(PLATFORM) : '.*ia64' > /dev/null; then \ - shlib=lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR}; \ - else \ - shlib=lib$$i.sl.${SHLIB_MAJOR}.${SHLIB_MINOR}; \ - fi; \ - [ -f $$shlib ] && rm -f $$shlib; \ - ( set -x; /usr/ccs/bin/ld ${SHARED_LDFLAGS} \ - -b -z \ - -o $$shlib +h $$shlib \ - +forceload lib$$i.a -ldl -lc ) || exit 1; \ + ALLSYMSFLAGS='-Wl,-Fl'; \ + expr $(PLATFORM) : 'hpux64' > /dev/null && ALLSYMSFLAGS='-Wl,+forceload'; \ + ( set -x; $${FIPSLD:-${CC}} ${SHARED_LDFLAGS} \ + -Wl,-B,symbolic,+vnocompatwarnings,-z,+h,$$shlib \ + -o $$shlib $$ALLSYMSFLAGS,lib$$i.a -ldld ) || exit 1; \ chmod a=rx $$shlib; \ done @@ -597,7 +574,7 @@ do_aix-shared: OBJECT_MODE=$${OBJECT_MODE:-32}; export OBJECT_MODE; \ ld -r -o lib$$i.o $(ALLSYMSFLAG) lib$$i.a && \ ( nm -Pg lib$$i.o | grep ' [BD] ' | cut -f1 -d' ' > lib$$i.exp; \ - $(SHAREDCMD) $(SHAREDFLAGS) \ + $${FIPSLD:-${CC}} $(SHAREDFLAGS) \ -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} lib$$i.o \ $$libs ${EX_LIBS} ) ) \ || exit 1; \ @@ -613,7 +590,7 @@ do_reliantunix-shared: ( set -x; \ ( Opwd=`pwd` ; mkdir $$tmpdir || exit 1; \ cd $$tmpdir || exit 1 ; ar x $$Opwd/lib$$i.a ; \ - ${CC} -G -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} *.o \ + $${FIPSLD:-${CC}} -G -o lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} *.o \ ) || exit 1; \ cp $$tmpdir/lib$$i.so.${SHLIB_MAJOR}.${SHLIB_MINOR} . ; \ ) || exit 1; \ @@ -759,11 +736,15 @@ crypto/objects/obj_mac.h: crypto/objects/objects.pl crypto/objects/objects.txt c apps/openssl-vms.cnf: apps/openssl.cnf $(PERL) VMS/VMSify-conf.pl < apps/openssl.cnf > apps/openssl-vms.cnf +crypto/bn/bn_prime.h: crypto/bn/bn_prime.pl + $(PERL) crypto/bn/bn_prime.pl >crypto/bn/bn_prime.h + + TABLE: Configure (echo 'Output of `Configure TABLE'"':"; \ $(PERL) Configure TABLE) > TABLE -update: depend errors stacks util/libeay.num util/ssleay.num crypto/objects/obj_dat.h apps/openssl-vms.cnf TABLE +update: errors stacks util/libeay.num util/ssleay.num crypto/objects/obj_dat.h apps/openssl-vms.cnf crypto/bn/bn_prime.h TABLE depend # Build distribution tar-file. As the list of files returned by "find" is # pretty long, on several platforms a "too many arguments" error or similar @@ -868,15 +849,6 @@ install_sw: sed -e '1,/^$$/d' doc/openssl-shared.txt; \ fi; \ fi - @for i in $(SIGS) ;\ - do \ - if [ -f "$$i" ]; then \ - ( echo installing $$i; \ - cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/lib/$$i.new; \ - chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/lib/$$i.new; \ - mv -f $(INSTALL_PREFIX)$(INSTALLTOP)/lib/$$i.new $(INSTALL_PREFIX)$(INSTALLTOP)/lib/$$i ); \ - fi; \ - done; cp openssl.pc $(INSTALL_PREFIX)$(INSTALLTOP)/lib/pkgconfig chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/lib/pkgconfig/openssl.pc @@ -902,8 +874,8 @@ install_docs: --release=$(VERSION) `basename $$i`") \ > $(INSTALL_PREFIX)$(MANDIR)/man$$sec/$$fn.$${sec}$(MANSUFFIX); \ $(PERL) util/extract-names.pl < $$i | \ - grep -v $$filecase "^$$fn\$$" | \ - grep -v "[ ]" | \ + (grep -v $$filecase "^$$fn\$$"; true) | \ + (grep -v "[ ]"; true) | \ (cd $(INSTALL_PREFIX)$(MANDIR)/man$$sec/; \ while read n; do \ $$here/util/point.sh $$fn.$${sec}$(MANSUFFIX) "$$n".$${sec}$(MANSUFFIX); \ @@ -919,8 +891,8 @@ install_docs: --release=$(VERSION) `basename $$i`") \ > $(INSTALL_PREFIX)$(MANDIR)/man$$sec/$$fn.$${sec}$(MANSUFFIX); \ $(PERL) util/extract-names.pl < $$i | \ - grep -v $$filecase "^$$fn\$$" | \ - grep -v "[ ]" | \ + (grep -v $$filecase "^$$fn\$$"; true) | \ + (grep -v "[ ]"; true) | \ (cd $(INSTALL_PREFIX)$(MANDIR)/man$$sec/; \ while read n; do \ $$here/util/point.sh $$fn.$${sec}$(MANSUFFIX) "$$n".$${sec}$(MANSUFFIX); \ diff --git a/lib/libssl/src/apps/Makefile b/lib/libssl/src/apps/Makefile index 93dcf765e6e..4daa92382f7 100644 --- a/lib/libssl/src/apps/Makefile +++ b/lib/libssl/src/apps/Makefile @@ -101,8 +101,9 @@ install: (echo installing $$i; \ cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new; \ chmod 755 $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new; \ - mv -f $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i ); \ - done; + mv -f $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new \ + $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i; \ + ) done; @for i in $(SCRIPTS); \ do \ (echo installing $$i; \ @@ -143,17 +144,19 @@ $(DLIBCRYPTO): $(EXE): progs.h $(E_OBJ) $(PROGRAM).o $(DLIBCRYPTO) $(DLIBSSL) $(RM) $(EXE) - if [ "$(SHLIB_TARGET)" = "hpux-shared" -o "$(SHLIB_TARGET)" = "darwin-shared" ] ; then \ + @if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ + FIPSLD_CC=$(CC); CC=$(TOP)/fips-1.0/fipsld; export CC FIPSLD_CC; \ + fi; \ + SHARED_LIBS="$(SHARED_LIBS)"; \ + if [ "$(SHLIB_TARGET)" = "darwin-shared" ] ; then \ + SHARED_LIBS=""; \ + fi; \ + if [ -z "$$SHARED_LIBS" ]; then \ set -x; $${CC:-$(CC)} -o $(EXE) $(CFLAGS) $(PROGRAM).o $(E_OBJ) $(PEX_LIBS) $(DLIBSSL) $(LIBKRB5) $(DLIBCRYPTO) $(EX_LIBS) ; \ - elif [ -z "$(SHARED_LIBS)" ]; then \ - set -x; $${CC:-$(CC)} -o $(EXE) $(CFLAGS) $(PROGRAM).o $(E_OBJ) $(PEX_LIBS) $(LIBSSL) $(LIBKRB5) $(LIBCRYPTO) $(EX_LIBS) ; \ else \ set -x; LD_LIBRARY_PATH=..:$$LD_LIBRARY_PATH \ $(CC) -o $(EXE) $(CFLAGS) $(PROGRAM).o $(E_OBJ) $(PEX_LIBS) $(LIBSSL) $(LIBKRB5) $(LIBCRYPTO) $(EX_LIBS) ; \ fi - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(EXE); \ - fi -(cd ..; \ OPENSSL="`pwd`/util/opensslwrap.sh"; export OPENSSL; \ $(PERL) tools/c_rehash certs) diff --git a/lib/libssl/src/certs/argena.pem b/lib/libssl/src/certs/argena.pem new file mode 100644 index 00000000000..db730e38dd8 --- /dev/null +++ b/lib/libssl/src/certs/argena.pem @@ -0,0 +1,39 @@ +-----BEGIN CERTIFICATE----- +MIIG0zCCBbugAwIBAgIBADANBgkqhkiG9w0BAQUFADCBzDELMAkGA1UEBhMCQVQx +EDAOBgNVBAgTB0F1c3RyaWExDzANBgNVBAcTBlZpZW5uYTE6MDgGA1UEChMxQVJH +RSBEQVRFTiAtIEF1c3RyaWFuIFNvY2lldHkgZm9yIERhdGEgUHJvdGVjdGlvbjEl +MCMGA1UECxMcQS1DRVJUIENlcnRpZmljYXRpb24gU2VydmljZTEYMBYGA1UEAxMP +QS1DRVJUIEFEVkFOQ0VEMR0wGwYJKoZIhvcNAQkBFg5pbmZvQGEtY2VydC5hdDAe +Fw0wNDEwMjMxNDE0MTRaFw0xMTEwMjMxNDE0MTRaMIHMMQswCQYDVQQGEwJBVDEQ +MA4GA1UECBMHQXVzdHJpYTEPMA0GA1UEBxMGVmllbm5hMTowOAYDVQQKEzFBUkdF +IERBVEVOIC0gQXVzdHJpYW4gU29jaWV0eSBmb3IgRGF0YSBQcm90ZWN0aW9uMSUw +IwYDVQQLExxBLUNFUlQgQ2VydGlmaWNhdGlvbiBTZXJ2aWNlMRgwFgYDVQQDEw9B +LUNFUlQgQURWQU5DRUQxHTAbBgkqhkiG9w0BCQEWDmluZm9AYS1jZXJ0LmF0MIIB +IjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA3euXIy+mnf6BYKbK+QH5k679 +tUFqeT8jlZxMew8eNiHuw9KoxWBzL6KksK+5uK7Gatw+sbAYntEGE80P+Jg1hADM +e+Fr5V0bc6QS3gkVtfUCW/RIvfMM39oxvmqJmOgPnJU7H6+nmLtsq61tv9kVJi/2 +4Y5wXW3odet72sF57EoG6s78w0BUVLNcMngS9bZZzmdG3/d6JbkGgoNF/8DcgCBJ +W/t0JrcIzyppXIOVtUzzOrrU86zuUgT3Rtkl5kjG7DEHpFb9H0fTOY1v8+gRoaO6 +2gA0PCiysgVZjwgVeYe3KAg11nznyleDv198uK3Dc1oXIGYjJx2FpKWUvAuAEwID +AQABo4ICvDCCArgwHQYDVR0OBBYEFDd/Pj6ZcWDKJNSRE3nQdCm0qCTYMIH5BgNV +HSMEgfEwge6AFDd/Pj6ZcWDKJNSRE3nQdCm0qCTYoYHSpIHPMIHMMQswCQYDVQQG +EwJBVDEQMA4GA1UECBMHQXVzdHJpYTEPMA0GA1UEBxMGVmllbm5hMTowOAYDVQQK +EzFBUkdFIERBVEVOIC0gQXVzdHJpYW4gU29jaWV0eSBmb3IgRGF0YSBQcm90ZWN0 +aW9uMSUwIwYDVQQLExxBLUNFUlQgQ2VydGlmaWNhdGlvbiBTZXJ2aWNlMRgwFgYD +VQQDEw9BLUNFUlQgQURWQU5DRUQxHTAbBgkqhkiG9w0BCQEWDmluZm9AYS1jZXJ0 +LmF0ggEAMA8GA1UdEwEB/wQFMAMBAf8wCwYDVR0PBAQDAgHmMEcGA1UdJQRAMD4G +CCsGAQUFBwMBBggrBgEFBQcDAgYIKwYBBQUHAwMGCCsGAQUFBwMEBggrBgEFBQcD +CAYKKwYBBAGCNwoDBDARBglghkgBhvhCAQEEBAMCAP8wUQYDVR0gBEowSDBGBggq +KAAYAQEBAzA6MDgGCCsGAQUFBwIBFixodHRwOi8vd3d3LmEtY2VydC5hdC9jZXJ0 +aWZpY2F0ZS1wb2xpY3kuaHRtbDA7BglghkgBhvhCAQgELhYsaHR0cDovL3d3dy5h +LWNlcnQuYXQvY2VydGlmaWNhdGUtcG9saWN5Lmh0bWwwGQYDVR0RBBIwEIEOaW5m +b0BhLWNlcnQuYXQwLwYDVR0SBCgwJoEOaW5mb0BhLWNlcnQuYXSGFGh0dHA6Ly93 +d3cuYS1jZXJ0LmF0MEUGA1UdHwQ+MDwwOqA4oDaGNGh0dHBzOi8vc2VjdXJlLmEt +Y2VydC5hdC9jZ2ktYmluL2EtY2VydC1hZHZhbmNlZC5jZ2kwDQYJKoZIhvcNAQEF +BQADggEBACX1IvgfdG2rvfv35O48vSEvcVaEdlN8USFBHWz3JRAozgzvaBtwHkjK +Zwt5l/BWOtjbvHfRjDt7ijlBEcxOOrNC1ffyMHwHrXpvff6YpQ5wnxmIYEQcURiG +HMqruEX0WkuDNgSKwefsgXs27eeBauHgNGVcTYH1rmHu/ZyLpLxOyJQ2PCzA1DzW +3rWkIX92ogJ7lTRdWrbxwUL1XGinxnnaQ74+/y0pI9JNEv7ic2tpkweRMpkedaLW +msC1+orfKTebsg69aMaCx7o6jNONRmR/7TVaPf8/k6g52cHZ9YWjQvup22b5rWxG +J5r5LZ4vCPmF4+T4lutjUYAa/lGuQTg= +-----END CERTIFICATE----- diff --git a/lib/libssl/src/certs/argeng.pem b/lib/libssl/src/certs/argeng.pem new file mode 100644 index 00000000000..621e30e208c --- /dev/null +++ b/lib/libssl/src/certs/argeng.pem @@ -0,0 +1,23 @@ +-----BEGIN CERTIFICATE----- +MIIDwzCCAyygAwIBAgIBADANBgkqhkiG9w0BAQQFADCBmDELMAkGA1UEBhMCQVQx +EDAOBgNVBAgTB0F1c3RyaWExDzANBgNVBAcTBlZpZW5uYTFCMEAGA1UEChM5QXJn +ZSBEYXRlbiBPZXN0ZXJyZWljaGlzY2hlIEdlc2VsbHNjaGFmdCBmdWVyIERhdGVu +c2NodXR6MSIwIAYJKoZIhvcNAQkBFhNhLWNlcnRAYXJnZWRhdGVuLmF0MB4XDTAx +MDIxMjExMzAzMFoXDTA5MDIxMjExMzAzMFowgZgxCzAJBgNVBAYTAkFUMRAwDgYD +VQQIEwdBdXN0cmlhMQ8wDQYDVQQHEwZWaWVubmExQjBABgNVBAoTOUFyZ2UgRGF0 +ZW4gT2VzdGVycmVpY2hpc2NoZSBHZXNlbGxzY2hhZnQgZnVlciBEYXRlbnNjaHV0 +ejEiMCAGCSqGSIb3DQEJARYTYS1jZXJ0QGFyZ2VkYXRlbi5hdDCBnzANBgkqhkiG +9w0BAQEFAAOBjQAwgYkCgYEAwgsHqoNtmmrJ86+e1I4hOVBaL4kokqKN2IPOIL+1 +XwY8vfOOUfPEdhWpaC0ldt7VYrksgDiUccgH0FROANWK2GkfKMDzjjXHysR04uEb +Om7Kqjqn0nproOGkFG+QvBZgs+Ws+HXNFJA6V76fU4+JXq4452LSK4Lr5YcBquu3 +NJECAwEAAaOCARkwggEVMB0GA1UdDgQWBBQ0j59zH/G31zRjgK1y2P//tSAWZjCB +xQYDVR0jBIG9MIG6gBQ0j59zH/G31zRjgK1y2P//tSAWZqGBnqSBmzCBmDELMAkG +A1UEBhMCQVQxEDAOBgNVBAgTB0F1c3RyaWExDzANBgNVBAcTBlZpZW5uYTFCMEAG +A1UEChM5QXJnZSBEYXRlbiBPZXN0ZXJyZWljaGlzY2hlIEdlc2VsbHNjaGFmdCBm +dWVyIERhdGVuc2NodXR6MSIwIAYJKoZIhvcNAQkBFhNhLWNlcnRAYXJnZWRhdGVu +LmF0ggEAMAwGA1UdEwQFMAMBAf8wCwYDVR0PBAQDAgEGMBEGCWCGSAGG+EIBAQQE +AwICBDANBgkqhkiG9w0BAQQFAAOBgQBFuJYncqMYB6gXQS3eDOI90BEHfFTKy/dV +AV+K7QdAYikWmqgBheRdPKddJdccPy/Zl/p3ZT7GhDyC5f3wZjcuu8AJ27BNwbCA +x54dgxgCNcyPm79nY8MRtEdEpoRGdSsFKJemz6hpXM++MWFciyrRWIIA44XB0Gv3 +US0spjsDPQ== +-----END CERTIFICATE----- diff --git a/lib/libssl/src/crypto/asn1/Makefile b/lib/libssl/src/crypto/asn1/Makefile index b11298d6216..d1c2d8f4903 100644 --- a/lib/libssl/src/crypto/asn1/Makefile +++ b/lib/libssl/src/crypto/asn1/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/asn1/Makefile +# OpenSSL/crypto/asn1/Makefile # DIR= asn1 diff --git a/lib/libssl/src/crypto/asn1/tasn_enc.c b/lib/libssl/src/crypto/asn1/tasn_enc.c index f6c8ddef0aa..c675c3c832d 100644 --- a/lib/libssl/src/crypto/asn1/tasn_enc.c +++ b/lib/libssl/src/crypto/asn1/tasn_enc.c @@ -445,9 +445,12 @@ int asn1_ex_i2c(ASN1_VALUE **pval, unsigned char *cout, int *putype, const ASN1_ case V_ASN1_BOOLEAN: tbool = (ASN1_BOOLEAN *)pval; if(*tbool == -1) return -1; - /* Default handling if value == size field then omit */ - if(*tbool && (it->size > 0)) return -1; - if(!*tbool && !it->size) return -1; + if (it->utype != V_ASN1_ANY) + { + /* Default handling if value == size field then omit */ + if(*tbool && (it->size > 0)) return -1; + if(!*tbool && !it->size) return -1; + } c = (unsigned char)*tbool; cont = &c; len = 1; diff --git a/lib/libssl/src/crypto/bf/Makefile b/lib/libssl/src/crypto/bf/Makefile index 0e2121efdc7..42e2c050f84 100644 --- a/lib/libssl/src/crypto/bf/Makefile +++ b/lib/libssl/src/crypto/bf/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/blowfish/Makefile +# OpenSSL/crypto/blowfish/Makefile # DIR= bf @@ -110,7 +110,7 @@ bf_enc.o: ../../include/openssl/opensslconf.h bf_enc.c bf_locl.h bf_ofb64.o: ../../include/openssl/blowfish.h ../../include/openssl/e_os2.h bf_ofb64.o: ../../include/openssl/opensslconf.h bf_locl.h bf_ofb64.c bf_skey.o: ../../include/openssl/blowfish.h ../../include/openssl/crypto.h -bf_skey.o: ../../include/openssl/e_os2.h ../../include/openssl/opensslconf.h -bf_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/safestack.h -bf_skey.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h -bf_skey.o: bf_locl.h bf_pi.h bf_skey.c +bf_skey.o: ../../include/openssl/e_os2.h ../../include/openssl/fips.h +bf_skey.o: ../../include/openssl/opensslconf.h ../../include/openssl/opensslv.h +bf_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +bf_skey.o: ../../include/openssl/symhacks.h bf_locl.h bf_pi.h bf_skey.c diff --git a/lib/libssl/src/crypto/bio/Makefile b/lib/libssl/src/crypto/bio/Makefile index 19d93507605..a5651544995 100644 --- a/lib/libssl/src/crypto/bio/Makefile +++ b/lib/libssl/src/crypto/bio/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/bio/Makefile +# OpenSSL/crypto/bio/Makefile # DIR= bio diff --git a/lib/libssl/src/crypto/bn/Makefile b/lib/libssl/src/crypto/bn/Makefile index f693d35d87b..9969d242cc5 100644 --- a/lib/libssl/src/crypto/bn/Makefile +++ b/lib/libssl/src/crypto/bn/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/bn/Makefile +# OpenSSL/crypto/bn/Makefile # DIR= bn @@ -31,12 +31,12 @@ LIB=$(TOP)/libcrypto.a LIBSRC= bn_add.c bn_div.c bn_exp.c bn_lib.c bn_ctx.c bn_mul.c bn_mod.c \ bn_print.c bn_rand.c bn_shift.c bn_word.c bn_blind.c \ bn_kron.c bn_sqrt.c bn_gcd.c bn_prime.c bn_err.c bn_sqr.c bn_asm.c \ - bn_recp.c bn_mont.c bn_mpi.c bn_exp2.c + bn_recp.c bn_mont.c bn_mpi.c bn_exp2.c bn_x931p.c LIBOBJ= bn_add.o bn_div.o bn_exp.o bn_lib.o bn_ctx.o bn_mul.o bn_mod.o \ bn_print.o bn_rand.o bn_shift.o bn_word.o bn_blind.o \ bn_kron.o bn_sqrt.o bn_gcd.o bn_prime.o bn_err.o bn_sqr.o $(BN_ASM) \ - bn_recp.o bn_mont.o bn_mpi.o bn_exp2.o + bn_recp.o bn_mont.o bn_mpi.o bn_exp2.o bn_x931p.o SRC= $(LIBSRC) @@ -329,3 +329,5 @@ bn_word.o: ../../include/openssl/lhash.h ../../include/openssl/opensslconf.h bn_word.o: ../../include/openssl/opensslv.h ../../include/openssl/safestack.h bn_word.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h bn_word.o: ../cryptlib.h bn_lcl.h bn_word.c +bn_x931p.o: ../../include/openssl/bn.h ../../include/openssl/e_os2.h +bn_x931p.o: ../../include/openssl/opensslconf.h bn_x931p.c diff --git a/lib/libssl/src/crypto/bn/asm/ppc.pl b/lib/libssl/src/crypto/bn/asm/ppc.pl index 307c7ccb358..08e00534738 100644 --- a/lib/libssl/src/crypto/bn/asm/ppc.pl +++ b/lib/libssl/src/crypto/bn/asm/ppc.pl @@ -116,7 +116,7 @@ if ($opf =~ /32\.s/) { $UDIV= "divwu"; # unsigned divide $UCMPI= "cmplwi"; # unsigned compare with immediate $UCMP= "cmplw"; # unsigned compare - $COUNTZ="cntlzw"; # count leading zeros + $CNTLZ= "cntlzw"; # count leading zeros $SHL= "slw"; # shift left $SHR= "srw"; # unsigned shift right $SHRI= "srwi"; # unsigned shift right by immediate @@ -124,6 +124,7 @@ if ($opf =~ /32\.s/) { $CLRU= "clrlwi"; # clear upper bits $INSR= "insrwi"; # insert right $ROTL= "rotlwi"; # rotate left by immediate + $TR= "tw"; # conditional trap } elsif ($opf =~ /64\.s/) { $BITS= 64; $BNSZ= $BITS/8; @@ -139,7 +140,7 @@ if ($opf =~ /32\.s/) { $UDIV= "divdu"; # unsigned divide $UCMPI= "cmpldi"; # unsigned compare with immediate $UCMP= "cmpld"; # unsigned compare - $COUNTZ="cntlzd"; # count leading zeros + $CNTLZ= "cntlzd"; # count leading zeros $SHL= "sld"; # shift left $SHR= "srd"; # unsigned shift right $SHRI= "srdi"; # unsigned shift right by immediate @@ -147,6 +148,7 @@ if ($opf =~ /32\.s/) { $CLRU= "clrldi"; # clear upper bits $INSR= "insrdi"; # insert right $ROTL= "rotldi"; # rotate left by immediate + $TR= "td"; # conditional trap } else { die "nonsense $opf"; } ( defined shift || open STDOUT,">$opf" ) || die "can't open $opf: $!"; @@ -1710,17 +1712,12 @@ Lppcasm_add_adios: bclr BO_ALWAYS,CR0_LT Lppcasm_div1: xor r0,r0,r0 #r0=0 - $COUNTZ r7,r5 #r7 = num leading 0s in d. - subfic r8,r7,$BITS #r8 = BN_num_bits_word(d) - cmpi 0,0,r8,$BITS # - bc BO_IF,CR0_EQ,Lppcasm_div2 #proceed if (r8==$BITS) - li r9,1 # r9=1 - $SHL r10,r9,r8 # r9<<=r8 - $UCMP 0,r3,r10 # - bc BO_IF,CR0_GT,Lppcasm_div2 #or if (h > (1<<r8)) - $UDIV r3,r3,r0 #if not assert(0) divide by 0! - #that's how we signal overflow - bclr BO_ALWAYS,CR0_LT #return. NEVER REACHED. + li r8,$BITS + $CNTLZ. r7,r5 #r7 = num leading 0s in d. + bc BO_IF,CR0_EQ,Lppcasm_div2 #proceed if no leading zeros + subf r8,r7,r8 #r8 = BN_num_bits_word(d) + $SHR. r9,r3,r8 #are there any bits above r8'th? + $TR 16,r9,r0 #if there're, signal to dump core... Lppcasm_div2: $UCMP 0,r3,r5 #h>=d? bc BO_IF,CR0_LT,Lppcasm_div3 #goto Lppcasm_div3 if not diff --git a/lib/libssl/src/crypto/bn/asm/sparcv8plus.S b/lib/libssl/src/crypto/bn/asm/sparcv8plus.S index 0074dfdb750..8c56e2e7e7c 100644 --- a/lib/libssl/src/crypto/bn/asm/sparcv8plus.S +++ b/lib/libssl/src/crypto/bn/asm/sparcv8plus.S @@ -162,10 +162,14 @@ * BN_ULONG w; */ bn_mul_add_words: + sra %o2,%g0,%o2 ! signx %o2 brgz,a %o2,.L_bn_mul_add_words_proceed lduw [%o1],%g2 retl clr %o0 + nop + nop + nop .L_bn_mul_add_words_proceed: srl %o3,%g0,%o3 ! clruw %o3 @@ -260,10 +264,14 @@ bn_mul_add_words: * BN_ULONG w; */ bn_mul_words: + sra %o2,%g0,%o2 ! signx %o2 brgz,a %o2,.L_bn_mul_words_proceeed lduw [%o1],%g2 retl clr %o0 + nop + nop + nop .L_bn_mul_words_proceeed: srl %o3,%g0,%o3 ! clruw %o3 @@ -344,10 +352,14 @@ bn_mul_words: * int n; */ bn_sqr_words: + sra %o2,%g0,%o2 ! signx %o2 brgz,a %o2,.L_bn_sqr_words_proceeed lduw [%o1],%g2 retl clr %o0 + nop + nop + nop .L_bn_sqr_words_proceeed: andcc %o2,-4,%g0 @@ -445,6 +457,7 @@ bn_div_words: * int n; */ bn_add_words: + sra %o3,%g0,%o3 ! signx %o3 brgz,a %o3,.L_bn_add_words_proceed lduw [%o1],%o4 retl @@ -454,7 +467,6 @@ bn_add_words: andcc %o3,-4,%g0 bz,pn %icc,.L_bn_add_words_tail addcc %g0,0,%g0 ! clear carry flag - nop .L_bn_add_words_loop: ! wow! 32 aligned! dec 4,%o3 @@ -523,6 +535,7 @@ bn_add_words: * int n; */ bn_sub_words: + sra %o3,%g0,%o3 ! signx %o3 brgz,a %o3,.L_bn_sub_words_proceed lduw [%o1],%o4 retl @@ -532,7 +545,6 @@ bn_sub_words: andcc %o3,-4,%g0 bz,pn %icc,.L_bn_sub_words_tail addcc %g0,0,%g0 ! clear carry flag - nop .L_bn_sub_words_loop: ! wow! 32 aligned! dec 4,%o3 diff --git a/lib/libssl/src/crypto/bn/bn_x931p.c b/lib/libssl/src/crypto/bn/bn_x931p.c new file mode 100644 index 00000000000..c64410dd3ae --- /dev/null +++ b/lib/libssl/src/crypto/bn/bn_x931p.c @@ -0,0 +1,282 @@ +/* bn_x931p.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <openssl/bn.h> + +#ifdef OPENSSL_FIPS + +/* X9.31 routines for prime derivation */ + + +/* X9.31 prime derivation. This is used to generate the primes pi + * (p1, p2, q1, q2) from a parameter Xpi by checking successive odd + * integers. + */ + +static int bn_x931_derive_pi(BIGNUM *pi, const BIGNUM *Xpi, BN_CTX *ctx, + void (*cb)(int, int, void *), void *cb_arg) + { + int i = 0; + if (!BN_copy(pi, Xpi)) + return 0; + if (!BN_is_odd(pi) && !BN_add_word(pi, 1)) + return 0; + for(;;) + { + i++; + if (cb) + cb(0, i, cb_arg); + /* NB 27 MR is specificed in X9.31 */ + if (BN_is_prime_fasttest(pi, 27, cb, ctx, cb_arg, 1)) + break; + if (!BN_add_word(pi, 2)) + return 0; + } + if (cb) + cb(2, i, cb_arg); + return 1; + } + +/* This is the main X9.31 prime derivation function. From parameters + * Xp1, Xp2 and Xp derive the prime p. If the parameters p1 or p2 are + * not NULL they will be returned too: this is needed for testing. + */ + +int BN_X931_derive_prime(BIGNUM *p, BIGNUM *p1, BIGNUM *p2, + void (*cb)(int, int, void *), void *cb_arg, + const BIGNUM *Xp, const BIGNUM *Xp1, const BIGNUM *Xp2, + const BIGNUM *e, BN_CTX *ctx) + { + int ret = 0; + + BIGNUM *t, *p1p2, *pm1; + + /* Only even e supported */ + if (!BN_is_odd(e)) + return 0; + + BN_CTX_start(ctx); + if (!p1) + p1 = BN_CTX_get(ctx); + + if (!p2) + p2 = BN_CTX_get(ctx); + + t = BN_CTX_get(ctx); + + p1p2 = BN_CTX_get(ctx); + + pm1 = BN_CTX_get(ctx); + + if (!bn_x931_derive_pi(p1, Xp1, ctx, cb, cb_arg)) + goto err; + + if (!bn_x931_derive_pi(p2, Xp2, ctx, cb, cb_arg)) + goto err; + + if (!BN_mul(p1p2, p1, p2, ctx)) + goto err; + + /* First set p to value of Rp */ + + if (!BN_mod_inverse(p, p2, p1, ctx)) + goto err; + + if (!BN_mul(p, p, p2, ctx)) + goto err; + + if (!BN_mod_inverse(t, p1, p2, ctx)) + goto err; + + if (!BN_mul(t, t, p1, ctx)) + goto err; + + if (!BN_sub(p, p, t)) + goto err; + + if (p->neg && !BN_add(p, p, p1p2)) + goto err; + + /* p now equals Rp */ + + if (!BN_mod_sub(p, p, Xp, p1p2, ctx)) + goto err; + + if (!BN_add(p, p, Xp)) + goto err; + + /* p now equals Yp0 */ + + for (;;) + { + int i = 1; + if (cb) + cb(0, i++, cb_arg); + if (!BN_copy(pm1, p)) + goto err; + if (!BN_sub_word(pm1, 1)) + goto err; + if (!BN_gcd(t, pm1, e, ctx)) + goto err; + if (BN_is_one(t) + /* X9.31 specifies 8 MR and 1 Lucas test or any prime test + * offering similar or better guarantees 50 MR is considerably + * better. + */ + && BN_is_prime_fasttest(p, 50, cb, ctx, cb_arg, 1)) + break; + if (!BN_add(p, p, p1p2)) + goto err; + } + + if (cb) + cb(3, 0, cb_arg); + + ret = 1; + + err: + + BN_CTX_end(ctx); + + return ret; + } + +/* Generate pair of paramters Xp, Xq for X9.31 prime generation. + * Note: nbits paramter is sum of number of bits in both. + */ + +int BN_X931_generate_Xpq(BIGNUM *Xp, BIGNUM *Xq, int nbits, BN_CTX *ctx) + { + BIGNUM *t; + int i; + /* Number of bits for each prime is of the form + * 512+128s for s = 0, 1, ... + */ + if ((nbits < 1024) || (nbits & 0xff)) + return 0; + nbits >>= 1; + /* The random value Xp must be between sqrt(2) * 2^(nbits-1) and + * 2^nbits - 1. By setting the top two bits we ensure that the lower + * bound is exceeded. + */ + if (!BN_rand(Xp, nbits, 1, 0)) + return 0; + + BN_CTX_start(ctx); + t = BN_CTX_get(ctx); + + for (i = 0; i < 1000; i++) + { + if (!BN_rand(Xq, nbits, 1, 0)) + return 0; + /* Check that |Xp - Xq| > 2^(nbits - 100) */ + BN_sub(t, Xp, Xq); + if (BN_num_bits(t) > (nbits - 100)) + break; + } + + BN_CTX_end(ctx); + + if (i < 1000) + return 1; + + return 0; + + } + +/* Generate primes using X9.31 algorithm. Of the values p, p1, p2, Xp1 + * and Xp2 only 'p' needs to be non-NULL. If any of the others are not NULL + * the relevant parameter will be stored in it. + * + * Due to the fact that |Xp - Xq| > 2^(nbits - 100) must be satisfied Xp and Xq + * are generated using the previous function and supplied as input. + */ + +int BN_X931_generate_prime(BIGNUM *p, BIGNUM *p1, BIGNUM *p2, + BIGNUM *Xp1, BIGNUM *Xp2, + const BIGNUM *Xp, + const BIGNUM *e, BN_CTX *ctx, + void (*cb)(int, int, void *), void *cb_arg) + { + int ret = 0; + + BN_CTX_start(ctx); + if (!Xp1) + Xp1 = BN_CTX_get(ctx); + if (!Xp2) + Xp2 = BN_CTX_get(ctx); + + if (!BN_rand(Xp1, 101, 0, 0)) + goto error; + if (!BN_rand(Xp2, 101, 0, 0)) + goto error; + if (!BN_X931_derive_prime(p, p1, p2, cb, cb_arg, + Xp, Xp1, Xp2, e, ctx)) + goto error; + + ret = 1; + + error: + BN_CTX_end(ctx); + + return ret; + + } + +#endif diff --git a/lib/libssl/src/crypto/buffer/Makefile b/lib/libssl/src/crypto/buffer/Makefile index 3911baf5133..4b53c595a3c 100644 --- a/lib/libssl/src/crypto/buffer/Makefile +++ b/lib/libssl/src/crypto/buffer/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/buffer/Makefile +# OpenSSL/crypto/buffer/Makefile # DIR= buffer diff --git a/lib/libssl/src/crypto/cast/Makefile b/lib/libssl/src/crypto/cast/Makefile index 8b0d04bb7c8..b388f6271c8 100644 --- a/lib/libssl/src/crypto/cast/Makefile +++ b/lib/libssl/src/crypto/cast/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/cast/Makefile +# OpenSSL/crypto/cast/Makefile # DIR= cast @@ -115,6 +115,7 @@ c_ofb64.o: ../../include/openssl/e_os2.h ../../include/openssl/opensslconf.h c_ofb64.o: c_ofb64.c cast_lcl.h c_skey.o: ../../e_os.h ../../include/openssl/cast.h c_skey.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h -c_skey.o: ../../include/openssl/opensslconf.h ../../include/openssl/opensslv.h -c_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h -c_skey.o: ../../include/openssl/symhacks.h c_skey.c cast_lcl.h cast_s.h +c_skey.o: ../../include/openssl/fips.h ../../include/openssl/opensslconf.h +c_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/safestack.h +c_skey.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +c_skey.o: c_skey.c cast_lcl.h cast_s.h diff --git a/lib/libssl/src/crypto/comp/Makefile b/lib/libssl/src/crypto/comp/Makefile index 68109a80137..df1babec5c6 100644 --- a/lib/libssl/src/crypto/comp/Makefile +++ b/lib/libssl/src/crypto/comp/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/comp/Makefile +# OpenSSL/crypto/comp/Makefile # DIR= comp diff --git a/lib/libssl/src/crypto/conf/Makefile b/lib/libssl/src/crypto/conf/Makefile index 6d2f8ffd9a2..403d12b28c1 100644 --- a/lib/libssl/src/crypto/conf/Makefile +++ b/lib/libssl/src/crypto/conf/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/conf/Makefile +# OpenSSL/crypto/conf/Makefile # DIR= conf diff --git a/lib/libssl/src/crypto/des/Makefile b/lib/libssl/src/crypto/des/Makefile index 655f2ea1a89..800af0b123a 100644 --- a/lib/libssl/src/crypto/des/Makefile +++ b/lib/libssl/src/crypto/des/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/des/Makefile +# OpenSSL/crypto/des/Makefile # DIR= des diff --git a/lib/libssl/src/crypto/dh/Makefile b/lib/libssl/src/crypto/dh/Makefile index c091a8130ad..352678b94ae 100644 --- a/lib/libssl/src/crypto/dh/Makefile +++ b/lib/libssl/src/crypto/dh/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/dh/Makefile +# OpenSSL/crypto/dh/Makefile # DIR= dh diff --git a/lib/libssl/src/crypto/dsa/Makefile b/lib/libssl/src/crypto/dsa/Makefile index 3a55058973d..4f102780397 100644 --- a/lib/libssl/src/crypto/dsa/Makefile +++ b/lib/libssl/src/crypto/dsa/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/dsa/Makefile +# OpenSSL/crypto/dsa/Makefile # DIR= dsa diff --git a/lib/libssl/src/crypto/dso/Makefile b/lib/libssl/src/crypto/dso/Makefile index 168951bc3e8..c16278c3ff2 100644 --- a/lib/libssl/src/crypto/dso/Makefile +++ b/lib/libssl/src/crypto/dso/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/dso/Makefile +# OpenSSL/crypto/dso/Makefile # DIR= dso diff --git a/lib/libssl/src/crypto/err/Makefile b/lib/libssl/src/crypto/err/Makefile index 149f3e0eb99..4adec553023 100644 --- a/lib/libssl/src/crypto/err/Makefile +++ b/lib/libssl/src/crypto/err/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/err/Makefile +# OpenSSL/crypto/err/Makefile # DIR= err diff --git a/lib/libssl/src/crypto/evp/Makefile b/lib/libssl/src/crypto/evp/Makefile index 5027a3855ae..d1c2a272bb5 100644 --- a/lib/libssl/src/crypto/evp/Makefile +++ b/lib/libssl/src/crypto/evp/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/evp/Makefile +# OpenSSL/crypto/evp/Makefile # DIR= evp diff --git a/lib/libssl/src/crypto/hmac/Makefile b/lib/libssl/src/crypto/hmac/Makefile index f634dab79da..3d53d8240fe 100644 --- a/lib/libssl/src/crypto/hmac/Makefile +++ b/lib/libssl/src/crypto/hmac/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/md/Makefile +# OpenSSL/crypto/md/Makefile # DIR= hmac diff --git a/lib/libssl/src/crypto/idea/Makefile b/lib/libssl/src/crypto/idea/Makefile index f652783027c..6b8e530d9dd 100644 --- a/lib/libssl/src/crypto/idea/Makefile +++ b/lib/libssl/src/crypto/idea/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/idea/Makefile +# OpenSSL/crypto/idea/Makefile # DIR= idea @@ -86,7 +86,7 @@ i_ecb.o: ../../include/openssl/opensslv.h i_ecb.c idea_lcl.h i_ofb64.o: ../../include/openssl/idea.h ../../include/openssl/opensslconf.h i_ofb64.o: i_ofb64.c idea_lcl.h i_skey.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h -i_skey.o: ../../include/openssl/idea.h ../../include/openssl/opensslconf.h -i_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/safestack.h -i_skey.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h -i_skey.o: i_skey.c idea_lcl.h +i_skey.o: ../../include/openssl/fips.h ../../include/openssl/idea.h +i_skey.o: ../../include/openssl/opensslconf.h ../../include/openssl/opensslv.h +i_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +i_skey.o: ../../include/openssl/symhacks.h i_skey.c idea_lcl.h diff --git a/lib/libssl/src/crypto/lhash/Makefile b/lib/libssl/src/crypto/lhash/Makefile index d325a1644d3..cdb0e77fad4 100644 --- a/lib/libssl/src/crypto/lhash/Makefile +++ b/lib/libssl/src/crypto/lhash/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/lhash/Makefile +# OpenSSL/crypto/lhash/Makefile # DIR= lhash diff --git a/lib/libssl/src/crypto/md2/Makefile b/lib/libssl/src/crypto/md2/Makefile index 90628511dac..9d0351bb2f4 100644 --- a/lib/libssl/src/crypto/md2/Makefile +++ b/lib/libssl/src/crypto/md2/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/md/Makefile +# OpenSSL/crypto/md/Makefile # DIR= md2 diff --git a/lib/libssl/src/crypto/md4/Makefile b/lib/libssl/src/crypto/md4/Makefile index 0b7c8d7ad86..eeb457f20f9 100644 --- a/lib/libssl/src/crypto/md4/Makefile +++ b/lib/libssl/src/crypto/md4/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/md4/Makefile +# OpenSSL/crypto/md4/Makefile # DIR= md4 diff --git a/lib/libssl/src/crypto/md5/Makefile b/lib/libssl/src/crypto/md5/Makefile index 832446fff22..1ed018526fd 100644 --- a/lib/libssl/src/crypto/md5/Makefile +++ b/lib/libssl/src/crypto/md5/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/md5/Makefile +# OpenSSL/crypto/md5/Makefile # DIR= md5 diff --git a/lib/libssl/src/crypto/objects/Makefile b/lib/libssl/src/crypto/objects/Makefile index e449147129c..23b2a69e6d0 100644 --- a/lib/libssl/src/crypto/objects/Makefile +++ b/lib/libssl/src/crypto/objects/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/objects/Makefile +# OpenSSL/crypto/objects/Makefile # DIR= objects diff --git a/lib/libssl/src/crypto/ocsp/ocsp_err.c b/lib/libssl/src/crypto/ocsp/ocsp_err.c index 4c4d8306f8a..65e6093fbc0 100644 --- a/lib/libssl/src/crypto/ocsp/ocsp_err.c +++ b/lib/libssl/src/crypto/ocsp/ocsp_err.c @@ -1,6 +1,6 @@ /* crypto/ocsp/ocsp_err.c */ /* ==================================================================== - * Copyright (c) 1999 The OpenSSL Project. All rights reserved. + * Copyright (c) 1999-2005 The OpenSSL Project. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -64,60 +64,64 @@ /* BEGIN ERROR CODES */ #ifndef OPENSSL_NO_ERR + +#define ERR_FUNC(func) ERR_PACK(ERR_LIB_OCSP,func,0) +#define ERR_REASON(reason) ERR_PACK(ERR_LIB_OCSP,0,reason) + static ERR_STRING_DATA OCSP_str_functs[]= { -{ERR_PACK(0,OCSP_F_ASN1_STRING_ENCODE,0), "ASN1_STRING_encode"}, -{ERR_PACK(0,OCSP_F_CERT_ID_NEW,0), "CERT_ID_NEW"}, -{ERR_PACK(0,OCSP_F_D2I_OCSP_NONCE,0), "D2I_OCSP_NONCE"}, -{ERR_PACK(0,OCSP_F_OCSP_BASIC_ADD1_STATUS,0), "OCSP_basic_add1_status"}, -{ERR_PACK(0,OCSP_F_OCSP_BASIC_SIGN,0), "OCSP_basic_sign"}, -{ERR_PACK(0,OCSP_F_OCSP_BASIC_VERIFY,0), "OCSP_basic_verify"}, -{ERR_PACK(0,OCSP_F_OCSP_CHECK_DELEGATED,0), "OCSP_CHECK_DELEGATED"}, -{ERR_PACK(0,OCSP_F_OCSP_CHECK_IDS,0), "OCSP_CHECK_IDS"}, -{ERR_PACK(0,OCSP_F_OCSP_CHECK_ISSUER,0), "OCSP_CHECK_ISSUER"}, -{ERR_PACK(0,OCSP_F_OCSP_CHECK_VALIDITY,0), "OCSP_check_validity"}, -{ERR_PACK(0,OCSP_F_OCSP_MATCH_ISSUERID,0), "OCSP_MATCH_ISSUERID"}, -{ERR_PACK(0,OCSP_F_OCSP_PARSE_URL,0), "OCSP_parse_url"}, -{ERR_PACK(0,OCSP_F_OCSP_REQUEST_SIGN,0), "OCSP_request_sign"}, -{ERR_PACK(0,OCSP_F_OCSP_REQUEST_VERIFY,0), "OCSP_request_verify"}, -{ERR_PACK(0,OCSP_F_OCSP_RESPONSE_GET1_BASIC,0), "OCSP_response_get1_basic"}, -{ERR_PACK(0,OCSP_F_OCSP_SENDREQ_BIO,0), "OCSP_sendreq_bio"}, -{ERR_PACK(0,OCSP_F_REQUEST_VERIFY,0), "REQUEST_VERIFY"}, +{ERR_FUNC(OCSP_F_ASN1_STRING_ENCODE), "ASN1_STRING_encode"}, +{ERR_FUNC(OCSP_F_CERT_ID_NEW), "CERT_ID_NEW"}, +{ERR_FUNC(OCSP_F_D2I_OCSP_NONCE), "D2I_OCSP_NONCE"}, +{ERR_FUNC(OCSP_F_OCSP_BASIC_ADD1_STATUS), "OCSP_basic_add1_status"}, +{ERR_FUNC(OCSP_F_OCSP_BASIC_SIGN), "OCSP_basic_sign"}, +{ERR_FUNC(OCSP_F_OCSP_BASIC_VERIFY), "OCSP_basic_verify"}, +{ERR_FUNC(OCSP_F_OCSP_CHECK_DELEGATED), "OCSP_CHECK_DELEGATED"}, +{ERR_FUNC(OCSP_F_OCSP_CHECK_IDS), "OCSP_CHECK_IDS"}, +{ERR_FUNC(OCSP_F_OCSP_CHECK_ISSUER), "OCSP_CHECK_ISSUER"}, +{ERR_FUNC(OCSP_F_OCSP_CHECK_VALIDITY), "OCSP_check_validity"}, +{ERR_FUNC(OCSP_F_OCSP_MATCH_ISSUERID), "OCSP_MATCH_ISSUERID"}, +{ERR_FUNC(OCSP_F_OCSP_PARSE_URL), "OCSP_parse_url"}, +{ERR_FUNC(OCSP_F_OCSP_REQUEST_SIGN), "OCSP_request_sign"}, +{ERR_FUNC(OCSP_F_OCSP_REQUEST_VERIFY), "OCSP_request_verify"}, +{ERR_FUNC(OCSP_F_OCSP_RESPONSE_GET1_BASIC), "OCSP_response_get1_basic"}, +{ERR_FUNC(OCSP_F_OCSP_SENDREQ_BIO), "OCSP_sendreq_bio"}, +{ERR_FUNC(OCSP_F_REQUEST_VERIFY), "REQUEST_VERIFY"}, {0,NULL} }; static ERR_STRING_DATA OCSP_str_reasons[]= { -{OCSP_R_BAD_DATA ,"bad data"}, -{OCSP_R_CERTIFICATE_VERIFY_ERROR ,"certificate verify error"}, -{OCSP_R_DIGEST_ERR ,"digest err"}, -{OCSP_R_ERROR_IN_NEXTUPDATE_FIELD ,"error in nextupdate field"}, -{OCSP_R_ERROR_IN_THISUPDATE_FIELD ,"error in thisupdate field"}, -{OCSP_R_ERROR_PARSING_URL ,"error parsing url"}, -{OCSP_R_MISSING_OCSPSIGNING_USAGE ,"missing ocspsigning usage"}, -{OCSP_R_NEXTUPDATE_BEFORE_THISUPDATE ,"nextupdate before thisupdate"}, -{OCSP_R_NOT_BASIC_RESPONSE ,"not basic response"}, -{OCSP_R_NO_CERTIFICATES_IN_CHAIN ,"no certificates in chain"}, -{OCSP_R_NO_CONTENT ,"no content"}, -{OCSP_R_NO_PUBLIC_KEY ,"no public key"}, -{OCSP_R_NO_RESPONSE_DATA ,"no response data"}, -{OCSP_R_NO_REVOKED_TIME ,"no revoked time"}, -{OCSP_R_PRIVATE_KEY_DOES_NOT_MATCH_CERTIFICATE,"private key does not match certificate"}, -{OCSP_R_REQUEST_NOT_SIGNED ,"request not signed"}, -{OCSP_R_RESPONSE_CONTAINS_NO_REVOCATION_DATA,"response contains no revocation data"}, -{OCSP_R_ROOT_CA_NOT_TRUSTED ,"root ca not trusted"}, -{OCSP_R_SERVER_READ_ERROR ,"server read error"}, -{OCSP_R_SERVER_RESPONSE_ERROR ,"server response error"}, -{OCSP_R_SERVER_RESPONSE_PARSE_ERROR ,"server response parse error"}, -{OCSP_R_SERVER_WRITE_ERROR ,"server write error"}, -{OCSP_R_SIGNATURE_FAILURE ,"signature failure"}, -{OCSP_R_SIGNER_CERTIFICATE_NOT_FOUND ,"signer certificate not found"}, -{OCSP_R_STATUS_EXPIRED ,"status expired"}, -{OCSP_R_STATUS_NOT_YET_VALID ,"status not yet valid"}, -{OCSP_R_STATUS_TOO_OLD ,"status too old"}, -{OCSP_R_UNKNOWN_MESSAGE_DIGEST ,"unknown message digest"}, -{OCSP_R_UNKNOWN_NID ,"unknown nid"}, -{OCSP_R_UNSUPPORTED_REQUESTORNAME_TYPE ,"unsupported requestorname type"}, +{ERR_REASON(OCSP_R_BAD_DATA) ,"bad data"}, +{ERR_REASON(OCSP_R_CERTIFICATE_VERIFY_ERROR),"certificate verify error"}, +{ERR_REASON(OCSP_R_DIGEST_ERR) ,"digest err"}, +{ERR_REASON(OCSP_R_ERROR_IN_NEXTUPDATE_FIELD),"error in nextupdate field"}, +{ERR_REASON(OCSP_R_ERROR_IN_THISUPDATE_FIELD),"error in thisupdate field"}, +{ERR_REASON(OCSP_R_ERROR_PARSING_URL) ,"error parsing url"}, +{ERR_REASON(OCSP_R_MISSING_OCSPSIGNING_USAGE),"missing ocspsigning usage"}, +{ERR_REASON(OCSP_R_NEXTUPDATE_BEFORE_THISUPDATE),"nextupdate before thisupdate"}, +{ERR_REASON(OCSP_R_NOT_BASIC_RESPONSE) ,"not basic response"}, +{ERR_REASON(OCSP_R_NO_CERTIFICATES_IN_CHAIN),"no certificates in chain"}, +{ERR_REASON(OCSP_R_NO_CONTENT) ,"no content"}, +{ERR_REASON(OCSP_R_NO_PUBLIC_KEY) ,"no public key"}, +{ERR_REASON(OCSP_R_NO_RESPONSE_DATA) ,"no response data"}, +{ERR_REASON(OCSP_R_NO_REVOKED_TIME) ,"no revoked time"}, +{ERR_REASON(OCSP_R_PRIVATE_KEY_DOES_NOT_MATCH_CERTIFICATE),"private key does not match certificate"}, +{ERR_REASON(OCSP_R_REQUEST_NOT_SIGNED) ,"request not signed"}, +{ERR_REASON(OCSP_R_RESPONSE_CONTAINS_NO_REVOCATION_DATA),"response contains no revocation data"}, +{ERR_REASON(OCSP_R_ROOT_CA_NOT_TRUSTED) ,"root ca not trusted"}, +{ERR_REASON(OCSP_R_SERVER_READ_ERROR) ,"server read error"}, +{ERR_REASON(OCSP_R_SERVER_RESPONSE_ERROR),"server response error"}, +{ERR_REASON(OCSP_R_SERVER_RESPONSE_PARSE_ERROR),"server response parse error"}, +{ERR_REASON(OCSP_R_SERVER_WRITE_ERROR) ,"server write error"}, +{ERR_REASON(OCSP_R_SIGNATURE_FAILURE) ,"signature failure"}, +{ERR_REASON(OCSP_R_SIGNER_CERTIFICATE_NOT_FOUND),"signer certificate not found"}, +{ERR_REASON(OCSP_R_STATUS_EXPIRED) ,"status expired"}, +{ERR_REASON(OCSP_R_STATUS_NOT_YET_VALID) ,"status not yet valid"}, +{ERR_REASON(OCSP_R_STATUS_TOO_OLD) ,"status too old"}, +{ERR_REASON(OCSP_R_UNKNOWN_MESSAGE_DIGEST),"unknown message digest"}, +{ERR_REASON(OCSP_R_UNKNOWN_NID) ,"unknown nid"}, +{ERR_REASON(OCSP_R_UNSUPPORTED_REQUESTORNAME_TYPE),"unsupported requestorname type"}, {0,NULL} }; @@ -131,8 +135,8 @@ void ERR_load_OCSP_strings(void) { init=0; #ifndef OPENSSL_NO_ERR - ERR_load_strings(ERR_LIB_OCSP,OCSP_str_functs); - ERR_load_strings(ERR_LIB_OCSP,OCSP_str_reasons); + ERR_load_strings(0,OCSP_str_functs); + ERR_load_strings(0,OCSP_str_reasons); #endif } diff --git a/lib/libssl/src/crypto/pem/Makefile b/lib/libssl/src/crypto/pem/Makefile index f3dfea2ac8a..fbc2b5d056f 100644 --- a/lib/libssl/src/crypto/pem/Makefile +++ b/lib/libssl/src/crypto/pem/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/pem/Makefile +# OpenSSL/crypto/pem/Makefile # DIR= pem diff --git a/lib/libssl/src/crypto/pkcs12/Makefile b/lib/libssl/src/crypto/pkcs12/Makefile index 854b641f7cd..bef4f279122 100644 --- a/lib/libssl/src/crypto/pkcs12/Makefile +++ b/lib/libssl/src/crypto/pkcs12/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/pkcs12/Makefile +# OpenSSL/crypto/pkcs12/Makefile # DIR= pkcs12 diff --git a/lib/libssl/src/crypto/pkcs7/Makefile b/lib/libssl/src/crypto/pkcs7/Makefile index f15c65f6902..a213ae22275 100644 --- a/lib/libssl/src/crypto/pkcs7/Makefile +++ b/lib/libssl/src/crypto/pkcs7/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/pkcs7/Makefile +# OpenSSL/crypto/pkcs7/Makefile # DIR= pkcs7 diff --git a/lib/libssl/src/crypto/rand/Makefile b/lib/libssl/src/crypto/rand/Makefile index 665eaa18e5e..b1d1a75f981 100644 --- a/lib/libssl/src/crypto/rand/Makefile +++ b/lib/libssl/src/crypto/rand/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/rand/Makefile +# OpenSSL/crypto/rand/Makefile # DIR= rand diff --git a/lib/libssl/src/crypto/rc2/Makefile b/lib/libssl/src/crypto/rc2/Makefile index 18edaca6c69..34080ab7415 100644 --- a/lib/libssl/src/crypto/rc2/Makefile +++ b/lib/libssl/src/crypto/rc2/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/rc2/Makefile +# OpenSSL/crypto/rc2/Makefile # DIR= rc2 @@ -82,7 +82,7 @@ rc2_cbc.o: rc2_cbc.c rc2_locl.h rc2_ecb.o: ../../include/openssl/opensslconf.h ../../include/openssl/opensslv.h rc2_ecb.o: ../../include/openssl/rc2.h rc2_ecb.c rc2_locl.h rc2_skey.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h -rc2_skey.o: ../../include/openssl/opensslconf.h +rc2_skey.o: ../../include/openssl/fips.h ../../include/openssl/opensslconf.h rc2_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/rc2.h rc2_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h rc2_skey.o: ../../include/openssl/symhacks.h rc2_locl.h rc2_skey.c diff --git a/lib/libssl/src/crypto/rc4/Makefile b/lib/libssl/src/crypto/rc4/Makefile index 64e06924f4c..20d078ec87c 100644 --- a/lib/libssl/src/crypto/rc4/Makefile +++ b/lib/libssl/src/crypto/rc4/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/rc4/Makefile +# OpenSSL/crypto/rc4/Makefile # DIR= rc4 @@ -66,10 +66,14 @@ asm/rx86bsdi.o: asm/rx86unix.cpp asm/rx86unix.cpp: asm/rc4-586.pl ../perlasm/x86asm.pl (cd asm; $(PERL) rc4-586.pl cpp >rx86unix.cpp) -asm/rc4-amd64.s: asm/rc4-amd64.pl; $(PERL) asm/rc4-amd64.pl $@ +asm/rc4-x86_64.s: asm/rc4-x86_64.pl; $(PERL) asm/rc4-x86_64.pl $@ asm/rc4-ia64.s: asm/rc4-ia64.S - $(CC) $(CFLAGS) -E asm/rc4-ia64.S > $@ + @case `awk '/^#define RC4_INT/{print$$NF}' $(TOP)/include/openssl/opensslconf.h` in \ + int) set -x; $(CC) $(CFLAGS) -DSZ=4 -E asm/rc4-ia64.S > $@ ;; \ + char) set -x; $(CC) $(CFLAGS) -DSZ=1 -E asm/rc4-ia64.S > $@ ;; \ + *) exit 1 ;; \ + esac files: $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO @@ -116,7 +120,8 @@ rc4_enc.o: ../../include/openssl/symhacks.h ../cryptlib.h rc4_enc.c rc4_locl.h rc4_skey.o: ../../e_os.h ../../include/openssl/bio.h rc4_skey.o: ../../include/openssl/buffer.h ../../include/openssl/crypto.h rc4_skey.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h -rc4_skey.o: ../../include/openssl/lhash.h ../../include/openssl/opensslconf.h +rc4_skey.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +rc4_skey.o: ../../include/openssl/opensslconf.h rc4_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/rc4.h rc4_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h rc4_skey.o: ../../include/openssl/symhacks.h ../cryptlib.h rc4_locl.h diff --git a/lib/libssl/src/crypto/rc4/asm/rc4-ia64.S b/lib/libssl/src/crypto/rc4/asm/rc4-ia64.S index b517d2e88f1..a322d0c718e 100644 --- a/lib/libssl/src/crypto/rc4/asm/rc4-ia64.S +++ b/lib/libssl/src/crypto/rc4/asm/rc4-ia64.S @@ -7,7 +7,7 @@ // disclaimed. // ==================================================================== -.ident "rc4-ia64.S, Version 1.1" +.ident "rc4-ia64.S, Version 2.0" .ident "IA-64 ISA artwork by Andy Polyakov <appro@fy.chalmers.se>" // What's wrong with compiler generated code? Because of the nature of @@ -27,17 +27,10 @@ // Legitimate "collisions" do occur within every 256^2 bytes window. // Fortunately there're enough free instruction slots to keep prior // reference to key[x+1], detect "collision" and compensate for it. -// All this without sacrificing a single clock cycle:-) -// Furthermore. In order to compress loop body to the minimum, I chose -// to deploy deposit instruction, which substitutes for the whole -// key->data+((x&255)<<log2(sizeof(key->data[0]))). This unfortunately -// requires key->data to be aligned at sizeof(key->data) boundary. -// This is why you'll find "RC4_INT pad[512-256-2];" addenum to RC4_KEY -// and "d=(RC4_INT *)(((size_t)(d+255))&~(sizeof(key->data)-1));" in -// rc4_skey.c [and rc4_enc.c, where it's retained for debugging -// purposes]. Throughput is ~210MBps on 900MHz CPU, which is is >3x -// faster than gcc generated code and +30% - if compared to HP-UX C. -// Unrolling loop below should give >30% on top of that... +// All this without sacrificing a single clock cycle:-) Throughput is +// ~210MBps on 900MHz CPU, which is is >3x faster than gcc generated +// code and +30% - if compared to HP-UX C. Unrolling loop below should +// give >30% on top of that... .text .explicit @@ -48,7 +41,9 @@ # define ADDP add #endif +#ifndef SZ #define SZ 4 // this is set to sizeof(RC4_INT) +#endif // SZ==4 seems to be optimal. At least SZ==8 is not any faster, not for // assembler implementation, while SZ==1 code is ~30% slower. #if SZ==1 // RC4_INT is unsigned char @@ -101,45 +96,53 @@ RC4: ADDP out=0,in3 brp.loop.imp .Ltop,.Lexit-16 };; { .mmi; LDKEY yy=[key] // load key->y - add ksch=(255+1)*SZ,key // as ksch will be used with - // deposit instruction only, - // I don't have to &~255... + add ksch=SZ,key mov ar.lc=in1 } { .mmi; mov key_y[1]=r0 // guarantee inequality // in first iteration add xx=1,xx mov pr.rot=1<<16 };; { .mii; nop.m 0 - dep key_x[1]=xx,ksch,OFF,8 + dep key_x[1]=xx,r0,OFF,8 mov ar.ec=3 };; // note that epilogue counter // is off by 1. I compensate // for this at exit... .Ltop: -// The loop is scheduled for 3*(n+2) spin-rate on Itanium 2, which +// The loop is scheduled for 4*(n+2) spin-rate on Itanium 2, which // theoretically gives asymptotic performance of clock frequency -// divided by 3 bytes per seconds, or 500MBps on 1.5GHz CPU. Measured -// performance however is distinctly lower than 1/4:-( The culplrit -// seems to be *(out++)=dat, which inadvertently splits the bundle, -// even though there is M-port available... Unrolling is due... -// Unrolled loop should collect output with variable shift instruction -// in order to avoid starvation for integer shifter... It should be -// possible to get pretty close to theoretical peak... -{ .mmi; (p16) LDKEY tx[0]=[key_x[1]] // tx=key[xx] - (p17) LDKEY ty[0]=[key_y[1]] // ty=key[yy] - (p18) dep rnd[1]=rnd[1],ksch,OFF,8} // &key[(tx+ty)&255] +// divided by 4 bytes per seconds, or 400MBps on 1.6GHz CPU. This is +// for sizeof(RC4_INT)==4. For smaller RC4_INT STKEY inadvertently +// splits the last bundle and you end up with 5*n spin-rate:-( +// Originally the loop was scheduled for 3*n and relied on key +// schedule to be aligned at 256*sizeof(RC4_INT) boundary. But +// *(out++)=dat, which maps to st1, had same effect [inadvertent +// bundle split] and holded the loop back. Rescheduling for 4*n +// made it possible to eliminate dependence on specific alignment +// and allow OpenSSH keep "abusing" our API. Reaching for 3*n would +// require unrolling, sticking to variable shift instruction for +// collecting output [to avoid starvation for integer shifter] and +// copying of key schedule to controlled place in stack [so that +// deposit instruction can serve as substitute for whole +// key->data+((x&255)<<log2(sizeof(key->data[0])))]... { .mmi; (p19) st1 [out]=dat[3],1 // *(out++)=dat (p16) add xx=1,xx // x++ - (p16) cmp.ne.unc p20,p21=key_x[1],key_y[1] };; + (p18) dep rnd[1]=rnd[1],r0,OFF,8 } // ((tx+ty)&255)<<OFF +{ .mmi; (p16) add key_x[1]=ksch,key_x[1] // &key[xx&255] + (p17) add key_y[1]=ksch,key_y[1] };; // &key[yy&255] +{ .mmi; (p16) LDKEY tx[0]=[key_x[1]] // tx=key[xx] + (p17) LDKEY ty[0]=[key_y[1]] // ty=key[yy] + (p16) dep key_x[0]=xx,r0,OFF,8 } // (xx&255)<<OFF +{ .mmi; (p18) add rnd[1]=ksch,rnd[1] // &key[(tx+ty)&255] + (p16) cmp.ne.unc p20,p21=key_x[1],key_y[1] };; { .mmi; (p18) LDKEY rnd[1]=[rnd[1]] // rnd=key[(tx+ty)&255] - (p16) ld1 dat[0]=[inp],1 // dat=*(inp++) - (p16) dep key_x[0]=xx,ksch,OFF,8 } // &key[xx&255] + (p16) ld1 dat[0]=[inp],1 } // dat=*(inp++) .pred.rel "mutex",p20,p21 { .mmi; (p21) add yy=yy,tx[1] // (p16) (p20) add yy=yy,tx[0] // (p16) y+=tx (p21) mov tx[0]=tx[1] };; // (p16) { .mmi; (p17) STKEY [key_y[1]]=tx[1] // key[yy]=tx (p17) STKEY [key_x[2]]=ty[0] // key[xx]=ty - (p16) dep key_y[0]=yy,ksch,OFF,8 } // &key[yy&255] + (p16) dep key_y[0]=yy,r0,OFF,8 } // &key[yy&255] { .mmb; (p17) add rnd[0]=tx[1],ty[0] // tx+=ty (p18) xor dat[2]=dat[2],rnd[1] // dat^=rnd br.ctop.sptk .Ltop };; diff --git a/lib/libssl/src/crypto/rc4/asm/rc4-x86_64.pl b/lib/libssl/src/crypto/rc4/asm/rc4-x86_64.pl new file mode 100755 index 00000000000..b628daca705 --- /dev/null +++ b/lib/libssl/src/crypto/rc4/asm/rc4-x86_64.pl @@ -0,0 +1,150 @@ +#!/usr/bin/env perl +# +# ==================================================================== +# Written by Andy Polyakov <appro@fy.chalmers.se> for the OpenSSL +# project. Rights for redistribution and usage in source and binary +# forms are granted according to the OpenSSL license. +# ==================================================================== +# +# Unlike 0.9.7f this code expects RC4_CHAR back in config line! See +# commentary section in corresponding script in development branch +# for background information about this option carousel. For those +# who don't have energy to figure out these gory details, here is +# basis in form of performance matrix relative to the original +# 0.9.7e C code-base: +# +# 0.9.7e 0.9.7f this +# AMD64 1x 3.3x 2.4x +# EM64T 1x 0.8x 1.5x +# +# In other words idea is to trade -25% AMD64 performance to compensate +# for deterioration and gain +90% on EM64T core. Development branch +# maintains best performance for either target, i.e. 3.3x for AMD64 +# and 1.5x for EM64T. + +$output=shift; + +open STDOUT,">$output" || die "can't open $output: $!"; + +$dat="%rdi"; # arg1 +$len="%rsi"; # arg2 +$inp="%rdx"; # arg3 +$out="%rcx"; # arg4 + +@XX=("%r8","%r10"); +@TX=("%r9","%r11"); +$YY="%r12"; +$TY="%r13"; + +$code=<<___;; +.text + +.globl RC4 +.type RC4,\@function +.align 16 +RC4: or $len,$len + jne .Lentry + repret +.Lentry: + push %r12 + push %r13 + + add \$2,$dat + movzb -2($dat),$XX[0]#d + movzb -1($dat),$YY#d + + add \$1,$XX[0]#b + movzb ($dat,$XX[0]),$TX[0]#d + test \$-8,$len + jz .Lcloop1 + push %rbx +.align 16 # incidentally aligned already +.Lcloop8: + mov ($inp),%eax + mov 4($inp),%ebx +___ +# unroll 2x4-wise, because 64-bit rotates kill Intel P4... +for ($i=0;$i<4;$i++) { +$code.=<<___; + add $TX[0]#b,$YY#b + lea 1($XX[0]),$XX[1] + movzb ($dat,$YY),$TY#d + movzb $XX[1]#b,$XX[1]#d + movzb ($dat,$XX[1]),$TX[1]#d + movb $TX[0]#b,($dat,$YY) + cmp $XX[1],$YY + movb $TY#b,($dat,$XX[0]) + jne .Lcmov$i # Intel cmov is sloooow... + mov $TX[0],$TX[1] +.Lcmov$i: + add $TX[0]#b,$TY#b + xor ($dat,$TY),%al + ror \$8,%eax +___ +push(@TX,shift(@TX)); push(@XX,shift(@XX)); # "rotate" registers +} +for ($i=4;$i<8;$i++) { +$code.=<<___; + add $TX[0]#b,$YY#b + lea 1($XX[0]),$XX[1] + movzb ($dat,$YY),$TY#d + movzb $XX[1]#b,$XX[1]#d + movzb ($dat,$XX[1]),$TX[1]#d + movb $TX[0]#b,($dat,$YY) + cmp $XX[1],$YY + movb $TY#b,($dat,$XX[0]) + jne .Lcmov$i # Intel cmov is sloooow... + mov $TX[0],$TX[1] +.Lcmov$i: + add $TX[0]#b,$TY#b + xor ($dat,$TY),%bl + ror \$8,%ebx +___ +push(@TX,shift(@TX)); push(@XX,shift(@XX)); # "rotate" registers +} +$code.=<<___; + lea -8($len),$len + mov %eax,($out) + lea 8($inp),$inp + mov %ebx,4($out) + lea 8($out),$out + + test \$-8,$len + jnz .Lcloop8 + pop %rbx + cmp \$0,$len + jne .Lcloop1 +.Lexit: + sub \$1,$XX[0]#b + movb $XX[0]#b,-2($dat) + movb $YY#b,-1($dat) + + pop %r13 + pop %r12 + repret + +.align 16 +.Lcloop1: + add $TX[0]#b,$YY#b + movzb ($dat,$YY),$TY#d + movb $TX[0]#b,($dat,$YY) + movb $TY#b,($dat,$XX[0]) + add $TX[0]#b,$TY#b + add \$1,$XX[0]#b + movzb ($dat,$TY),$TY#d + movzb ($dat,$XX[0]),$TX[0]#d + xorb ($inp),$TY#b + lea 1($inp),$inp + movb $TY#b,($out) + lea 1($out),$out + sub \$1,$len + jnz .Lcloop1 + jmp .Lexit +.size RC4,.-RC4 +___ + +$code =~ s/#([bwd])/$1/gm; + +$code =~ s/repret/.byte\t0xF3,0xC3/gm; + +print $code; diff --git a/lib/libssl/src/crypto/rc5/Makefile b/lib/libssl/src/crypto/rc5/Makefile index 3a8d309b297..16e6a600176 100644 --- a/lib/libssl/src/crypto/rc5/Makefile +++ b/lib/libssl/src/crypto/rc5/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/rc5/Makefile +# OpenSSL/crypto/rc5/Makefile # DIR= rc5 @@ -102,7 +102,7 @@ rc5_ecb.o: ../../include/openssl/opensslv.h ../../include/openssl/rc5.h rc5_ecb.o: rc5_ecb.c rc5_locl.h rc5_enc.o: ../../include/openssl/rc5.h rc5_enc.c rc5_locl.h rc5_skey.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h -rc5_skey.o: ../../include/openssl/opensslconf.h +rc5_skey.o: ../../include/openssl/fips.h ../../include/openssl/opensslconf.h rc5_skey.o: ../../include/openssl/opensslv.h ../../include/openssl/rc5.h rc5_skey.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h rc5_skey.o: ../../include/openssl/symhacks.h rc5_locl.h rc5_skey.c diff --git a/lib/libssl/src/crypto/ripemd/Makefile b/lib/libssl/src/crypto/ripemd/Makefile index dc086e34340..20c8b4d8dba 100644 --- a/lib/libssl/src/crypto/ripemd/Makefile +++ b/lib/libssl/src/crypto/ripemd/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/ripemd/Makefile +# OpenSSL/crypto/ripemd/Makefile # DIR= ripemd diff --git a/lib/libssl/src/crypto/rsa/Makefile b/lib/libssl/src/crypto/rsa/Makefile index 5748b0d3d0e..8851825250f 100644 --- a/lib/libssl/src/crypto/rsa/Makefile +++ b/lib/libssl/src/crypto/rsa/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/rsa/Makefile +# OpenSSL/crypto/rsa/Makefile # DIR= rsa @@ -24,10 +24,10 @@ APPS= LIB=$(TOP)/libcrypto.a LIBSRC= rsa_eay.c rsa_gen.c rsa_lib.c rsa_sign.c rsa_saos.c rsa_err.c \ rsa_pk1.c rsa_ssl.c rsa_none.c rsa_oaep.c rsa_chk.c rsa_null.c \ - rsa_asn1.c + rsa_pss.c rsa_x931.c rsa_asn1.c LIBOBJ= rsa_eay.o rsa_gen.o rsa_lib.o rsa_sign.o rsa_saos.o rsa_err.o \ rsa_pk1.o rsa_ssl.o rsa_none.o rsa_oaep.o rsa_chk.o rsa_null.o \ - rsa_asn1.o + rsa_pss.o rsa_x931.o rsa_asn1.o SRC= $(LIBSRC) @@ -184,6 +184,26 @@ rsa_pk1.o: ../../include/openssl/opensslv.h ../../include/openssl/ossl_typ.h rsa_pk1.o: ../../include/openssl/rand.h ../../include/openssl/rsa.h rsa_pk1.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h rsa_pk1.o: ../../include/openssl/symhacks.h ../cryptlib.h rsa_pk1.c +rsa_pss.o: ../../e_os.h ../../include/openssl/aes.h +rsa_pss.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +rsa_pss.o: ../../include/openssl/blowfish.h ../../include/openssl/bn.h +rsa_pss.o: ../../include/openssl/buffer.h ../../include/openssl/cast.h +rsa_pss.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +rsa_pss.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +rsa_pss.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +rsa_pss.o: ../../include/openssl/err.h ../../include/openssl/evp.h +rsa_pss.o: ../../include/openssl/idea.h ../../include/openssl/lhash.h +rsa_pss.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +rsa_pss.o: ../../include/openssl/md5.h ../../include/openssl/mdc2.h +rsa_pss.o: ../../include/openssl/obj_mac.h ../../include/openssl/objects.h +rsa_pss.o: ../../include/openssl/opensslconf.h ../../include/openssl/opensslv.h +rsa_pss.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +rsa_pss.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +rsa_pss.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +rsa_pss.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +rsa_pss.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +rsa_pss.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +rsa_pss.o: ../../include/openssl/ui_compat.h ../cryptlib.h rsa_pss.c rsa_saos.o: ../../e_os.h ../../include/openssl/aes.h rsa_saos.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h rsa_saos.o: ../../include/openssl/blowfish.h ../../include/openssl/bn.h @@ -237,3 +257,13 @@ rsa_ssl.o: ../../include/openssl/opensslv.h ../../include/openssl/ossl_typ.h rsa_ssl.o: ../../include/openssl/rand.h ../../include/openssl/rsa.h rsa_ssl.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h rsa_ssl.o: ../../include/openssl/symhacks.h ../cryptlib.h rsa_ssl.c +rsa_x931.o: ../../e_os.h ../../include/openssl/asn1.h +rsa_x931.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +rsa_x931.o: ../../include/openssl/buffer.h ../../include/openssl/crypto.h +rsa_x931.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +rsa_x931.o: ../../include/openssl/lhash.h ../../include/openssl/obj_mac.h +rsa_x931.o: ../../include/openssl/objects.h ../../include/openssl/opensslconf.h +rsa_x931.o: ../../include/openssl/opensslv.h ../../include/openssl/ossl_typ.h +rsa_x931.o: ../../include/openssl/rand.h ../../include/openssl/rsa.h +rsa_x931.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +rsa_x931.o: ../../include/openssl/symhacks.h ../cryptlib.h rsa_x931.c diff --git a/lib/libssl/src/crypto/rsa/rsa_pss.c b/lib/libssl/src/crypto/rsa/rsa_pss.c new file mode 100644 index 00000000000..2815628f5f7 --- /dev/null +++ b/lib/libssl/src/crypto/rsa/rsa_pss.c @@ -0,0 +1,261 @@ +/* rsa_pss.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include "cryptlib.h" +#include <openssl/bn.h> +#include <openssl/rsa.h> +#include <openssl/evp.h> +#include <openssl/rand.h> +#include <openssl/sha.h> + +const static unsigned char zeroes[] = {0,0,0,0,0,0,0,0}; + +int RSA_verify_PKCS1_PSS(RSA *rsa, const unsigned char *mHash, + const EVP_MD *Hash, const unsigned char *EM, int sLen) + { + int i; + int ret = 0; + int hLen, maskedDBLen, MSBits, emLen; + const unsigned char *H; + unsigned char *DB = NULL; + EVP_MD_CTX ctx; + unsigned char H_[EVP_MAX_MD_SIZE]; + + hLen = EVP_MD_size(Hash); + /* + * Negative sLen has special meanings: + * -1 sLen == hLen + * -2 salt length is autorecovered from signature + * -N reserved + */ + if (sLen == -1) sLen = hLen; + else if (sLen == -2) sLen = -2; + else if (sLen < -2) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_SLEN_CHECK_FAILED); + goto err; + } + + MSBits = (BN_num_bits(rsa->n) - 1) & 0x7; + emLen = RSA_size(rsa); + if (EM[0] & (0xFF << MSBits)) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_FIRST_OCTET_INVALID); + goto err; + } + if (MSBits == 0) + { + EM++; + emLen--; + } + if (emLen < (hLen + sLen + 2)) /* sLen can be small negative */ + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_DATA_TOO_LARGE); + goto err; + } + if (EM[emLen - 1] != 0xbc) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_LAST_OCTET_INVALID); + goto err; + } + maskedDBLen = emLen - hLen - 1; + H = EM + maskedDBLen; + DB = OPENSSL_malloc(maskedDBLen); + if (!DB) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, ERR_R_MALLOC_FAILURE); + goto err; + } + PKCS1_MGF1(DB, maskedDBLen, H, hLen, Hash); + for (i = 0; i < maskedDBLen; i++) + DB[i] ^= EM[i]; + if (MSBits) + DB[0] &= 0xFF >> (8 - MSBits); + for (i = 0; DB[i] == 0 && i < (maskedDBLen-1); i++) ; + if (DB[i++] != 0x1) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_SLEN_RECOVERY_FAILED); + goto err; + } + if (sLen >= 0 && (maskedDBLen - i) != sLen) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_SLEN_CHECK_FAILED); + goto err; + } + EVP_MD_CTX_init(&ctx); + EVP_DigestInit_ex(&ctx, Hash, NULL); + EVP_DigestUpdate(&ctx, zeroes, sizeof zeroes); + EVP_DigestUpdate(&ctx, mHash, hLen); + if (maskedDBLen - i) + EVP_DigestUpdate(&ctx, DB + i, maskedDBLen - i); + EVP_DigestFinal(&ctx, H_, NULL); + EVP_MD_CTX_cleanup(&ctx); + if (memcmp(H_, H, hLen)) + { + RSAerr(RSA_F_RSA_VERIFY_PKCS1_PSS, RSA_R_BAD_SIGNATURE); + ret = 0; + } + else + ret = 1; + + err: + if (DB) + OPENSSL_free(DB); + + return ret; + + } + +int RSA_padding_add_PKCS1_PSS(RSA *rsa, unsigned char *EM, + const unsigned char *mHash, + const EVP_MD *Hash, int sLen) + { + int i; + int ret = 0; + int hLen, maskedDBLen, MSBits, emLen; + unsigned char *H, *salt = NULL, *p; + EVP_MD_CTX ctx; + + hLen = EVP_MD_size(Hash); + /* + * Negative sLen has special meanings: + * -1 sLen == hLen + * -2 salt length is maximized + * -N reserved + */ + if (sLen == -1) sLen = hLen; + else if (sLen == -2) sLen = -2; + else if (sLen < -2) + { + RSAerr(RSA_F_RSA_PADDING_ADD_PKCS1_PSS, RSA_R_SLEN_CHECK_FAILED); + goto err; + } + + MSBits = (BN_num_bits(rsa->n) - 1) & 0x7; + emLen = RSA_size(rsa); + if (MSBits == 0) + { + *EM++ = 0; + emLen--; + } + if (sLen == -2) + { + sLen = emLen - hLen - 2; + } + else if (emLen < (hLen + sLen + 2)) + { + RSAerr(RSA_F_RSA_PADDING_ADD_PKCS1_PSS, + RSA_R_DATA_TOO_LARGE_FOR_KEY_SIZE); + goto err; + } + if (sLen > 0) + { + salt = OPENSSL_malloc(sLen); + if (!salt) + { + RSAerr(RSA_F_RSA_PADDING_ADD_PKCS1_PSS, + ERR_R_MALLOC_FAILURE); + goto err; + } + if (!RAND_bytes(salt, sLen)) + goto err; + } + maskedDBLen = emLen - hLen - 1; + H = EM + maskedDBLen; + EVP_MD_CTX_init(&ctx); + EVP_DigestInit_ex(&ctx, Hash, NULL); + EVP_DigestUpdate(&ctx, zeroes, sizeof zeroes); + EVP_DigestUpdate(&ctx, mHash, hLen); + if (sLen) + EVP_DigestUpdate(&ctx, salt, sLen); + EVP_DigestFinal(&ctx, H, NULL); + EVP_MD_CTX_cleanup(&ctx); + + /* Generate dbMask in place then perform XOR on it */ + PKCS1_MGF1(EM, maskedDBLen, H, hLen, Hash); + + p = EM; + + /* Initial PS XORs with all zeroes which is a NOP so just update + * pointer. Note from a test above this value is guaranteed to + * be non-negative. + */ + p += emLen - sLen - hLen - 2; + *p++ ^= 0x1; + if (sLen > 0) + { + for (i = 0; i < sLen; i++) + *p++ ^= salt[i]; + } + if (MSBits) + EM[0] &= 0xFF >> (8 - MSBits); + + /* H is already in place so just set final 0xbc */ + + EM[emLen - 1] = 0xbc; + + ret = 1; + + err: + if (salt) + OPENSSL_free(salt); + + return ret; + + } diff --git a/lib/libssl/src/crypto/rsa/rsa_x931.c b/lib/libssl/src/crypto/rsa/rsa_x931.c new file mode 100644 index 00000000000..df3c45f802e --- /dev/null +++ b/lib/libssl/src/crypto/rsa/rsa_x931.c @@ -0,0 +1,177 @@ +/* rsa_x931.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include "cryptlib.h" +#include <openssl/bn.h> +#include <openssl/rsa.h> +#include <openssl/rand.h> +#include <openssl/objects.h> + +int RSA_padding_add_X931(unsigned char *to, int tlen, + const unsigned char *from, int flen) + { + int j; + unsigned char *p; + + /* Absolute minimum amount of padding is 1 header nibble, 1 padding + * nibble and 2 trailer bytes: but 1 hash if is already in 'from'. + */ + + j = tlen - flen - 2; + + if (j < 0) + { + RSAerr(RSA_F_RSA_PADDING_ADD_X931,RSA_R_DATA_TOO_LARGE_FOR_KEY_SIZE); + return -1; + } + + p=(unsigned char *)to; + + /* If no padding start and end nibbles are in one byte */ + if (j == 0) + *p++ = 0x6A; + else + { + *p++ = 0x6B; + if (j > 1) + { + memset(p, 0xBB, j - 1); + p += j - 1; + } + *p++ = 0xBA; + } + memcpy(p,from,(unsigned int)flen); + p += flen; + *p = 0xCC; + return(1); + } + +int RSA_padding_check_X931(unsigned char *to, int tlen, + const unsigned char *from, int flen, int num) + { + int i,j; + const unsigned char *p; + + p=from; + if ((num != flen) || ((*p != 0x6A) && (*p != 0x6B))) + { + RSAerr(RSA_F_RSA_PADDING_CHECK_X931,RSA_R_INVALID_HEADER); + return -1; + } + + if (*p++ == 0x6B) + { + j=flen-3; + for (i = 0; i < j; i++) + { + unsigned char c = *p++; + if (c == 0xBA) + break; + if (c != 0xBB) + { + RSAerr(RSA_F_RSA_PADDING_CHECK_X931, + RSA_R_INVALID_PADDING); + return -1; + } + } + + j -= i; + + if (i == 0) + { + RSAerr(RSA_F_RSA_PADDING_CHECK_X931, RSA_R_INVALID_PADDING); + return -1; + } + + } + else j = flen - 2; + + if (p[j] != 0xCC) + { + RSAerr(RSA_F_RSA_PADDING_CHECK_X931, RSA_R_INVALID_TRAILER); + return -1; + } + + memcpy(to,p,(unsigned int)j); + + return(j); + } + +/* Translate between X931 hash ids and NIDs */ + +int RSA_X931_hash_id(int nid) + { + switch (nid) + { + case NID_sha1: + return 0x33; + + case NID_sha256: + return 0x34; + + case NID_sha384: + return 0x36; + + case NID_sha512: + return 0x35; + + } + return -1; + } + diff --git a/lib/libssl/src/crypto/sha/Makefile b/lib/libssl/src/crypto/sha/Makefile index 0426786aa0e..46103bbc830 100644 --- a/lib/libssl/src/crypto/sha/Makefile +++ b/lib/libssl/src/crypto/sha/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/sha/Makefile +# OpenSSL/crypto/sha/Makefile # DIR= sha diff --git a/lib/libssl/src/crypto/stack/Makefile b/lib/libssl/src/crypto/stack/Makefile index 4d5199a000b..711b16832a5 100644 --- a/lib/libssl/src/crypto/stack/Makefile +++ b/lib/libssl/src/crypto/stack/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/stack/Makefile +# OpenSSL/crypto/stack/Makefile # DIR= stack diff --git a/lib/libssl/src/crypto/txt_db/Makefile b/lib/libssl/src/crypto/txt_db/Makefile index f91a08f0066..3cb550a795a 100644 --- a/lib/libssl/src/crypto/txt_db/Makefile +++ b/lib/libssl/src/crypto/txt_db/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/txt_db/Makefile +# OpenSSL/crypto/txt_db/Makefile # DIR= txt_db diff --git a/lib/libssl/src/crypto/ui/ui_err.c b/lib/libssl/src/crypto/ui/ui_err.c index 39a62ae7371..d983cdd66fa 100644 --- a/lib/libssl/src/crypto/ui/ui_err.c +++ b/lib/libssl/src/crypto/ui/ui_err.c @@ -1,6 +1,6 @@ /* crypto/ui/ui_err.c */ /* ==================================================================== - * Copyright (c) 1999 The OpenSSL Project. All rights reserved. + * Copyright (c) 1999-2005 The OpenSSL Project. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -64,32 +64,36 @@ /* BEGIN ERROR CODES */ #ifndef OPENSSL_NO_ERR + +#define ERR_FUNC(func) ERR_PACK(ERR_LIB_UI,func,0) +#define ERR_REASON(reason) ERR_PACK(ERR_LIB_UI,0,reason) + static ERR_STRING_DATA UI_str_functs[]= { -{ERR_PACK(0,UI_F_GENERAL_ALLOCATE_BOOLEAN,0), "GENERAL_ALLOCATE_BOOLEAN"}, -{ERR_PACK(0,UI_F_GENERAL_ALLOCATE_PROMPT,0), "GENERAL_ALLOCATE_PROMPT"}, -{ERR_PACK(0,UI_F_GENERAL_ALLOCATE_STRING,0), "GENERAL_ALLOCATE_STRING"}, -{ERR_PACK(0,UI_F_UI_CTRL,0), "UI_ctrl"}, -{ERR_PACK(0,UI_F_UI_DUP_ERROR_STRING,0), "UI_dup_error_string"}, -{ERR_PACK(0,UI_F_UI_DUP_INFO_STRING,0), "UI_dup_info_string"}, -{ERR_PACK(0,UI_F_UI_DUP_INPUT_BOOLEAN,0), "UI_dup_input_boolean"}, -{ERR_PACK(0,UI_F_UI_DUP_INPUT_STRING,0), "UI_dup_input_string"}, -{ERR_PACK(0,UI_F_UI_DUP_VERIFY_STRING,0), "UI_dup_verify_string"}, -{ERR_PACK(0,UI_F_UI_GET0_RESULT,0), "UI_get0_result"}, -{ERR_PACK(0,UI_F_UI_NEW_METHOD,0), "UI_new_method"}, -{ERR_PACK(0,UI_F_UI_SET_RESULT,0), "UI_set_result"}, +{ERR_FUNC(UI_F_GENERAL_ALLOCATE_BOOLEAN), "GENERAL_ALLOCATE_BOOLEAN"}, +{ERR_FUNC(UI_F_GENERAL_ALLOCATE_PROMPT), "GENERAL_ALLOCATE_PROMPT"}, +{ERR_FUNC(UI_F_GENERAL_ALLOCATE_STRING), "GENERAL_ALLOCATE_STRING"}, +{ERR_FUNC(UI_F_UI_CTRL), "UI_ctrl"}, +{ERR_FUNC(UI_F_UI_DUP_ERROR_STRING), "UI_dup_error_string"}, +{ERR_FUNC(UI_F_UI_DUP_INFO_STRING), "UI_dup_info_string"}, +{ERR_FUNC(UI_F_UI_DUP_INPUT_BOOLEAN), "UI_dup_input_boolean"}, +{ERR_FUNC(UI_F_UI_DUP_INPUT_STRING), "UI_dup_input_string"}, +{ERR_FUNC(UI_F_UI_DUP_VERIFY_STRING), "UI_dup_verify_string"}, +{ERR_FUNC(UI_F_UI_GET0_RESULT), "UI_get0_result"}, +{ERR_FUNC(UI_F_UI_NEW_METHOD), "UI_new_method"}, +{ERR_FUNC(UI_F_UI_SET_RESULT), "UI_set_result"}, {0,NULL} }; static ERR_STRING_DATA UI_str_reasons[]= { -{UI_R_COMMON_OK_AND_CANCEL_CHARACTERS ,"common ok and cancel characters"}, -{UI_R_INDEX_TOO_LARGE ,"index too large"}, -{UI_R_INDEX_TOO_SMALL ,"index too small"}, -{UI_R_NO_RESULT_BUFFER ,"no result buffer"}, -{UI_R_RESULT_TOO_LARGE ,"result too large"}, -{UI_R_RESULT_TOO_SMALL ,"result too small"}, -{UI_R_UNKNOWN_CONTROL_COMMAND ,"unknown control command"}, +{ERR_REASON(UI_R_COMMON_OK_AND_CANCEL_CHARACTERS),"common ok and cancel characters"}, +{ERR_REASON(UI_R_INDEX_TOO_LARGE) ,"index too large"}, +{ERR_REASON(UI_R_INDEX_TOO_SMALL) ,"index too small"}, +{ERR_REASON(UI_R_NO_RESULT_BUFFER) ,"no result buffer"}, +{ERR_REASON(UI_R_RESULT_TOO_LARGE) ,"result too large"}, +{ERR_REASON(UI_R_RESULT_TOO_SMALL) ,"result too small"}, +{ERR_REASON(UI_R_UNKNOWN_CONTROL_COMMAND),"unknown control command"}, {0,NULL} }; @@ -103,8 +107,8 @@ void ERR_load_UI_strings(void) { init=0; #ifndef OPENSSL_NO_ERR - ERR_load_strings(ERR_LIB_UI,UI_str_functs); - ERR_load_strings(ERR_LIB_UI,UI_str_reasons); + ERR_load_strings(0,UI_str_functs); + ERR_load_strings(0,UI_str_reasons); #endif } diff --git a/lib/libssl/src/crypto/x509/Makefile b/lib/libssl/src/crypto/x509/Makefile index 5fb774f1c77..ee3f8a4a236 100644 --- a/lib/libssl/src/crypto/x509/Makefile +++ b/lib/libssl/src/crypto/x509/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/x509/Makefile +# OpenSSL/crypto/x509/Makefile # DIR= x509 diff --git a/lib/libssl/src/crypto/x509v3/Makefile b/lib/libssl/src/crypto/x509v3/Makefile index ed2f91cbb3f..49423f39f75 100644 --- a/lib/libssl/src/crypto/x509v3/Makefile +++ b/lib/libssl/src/crypto/x509v3/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/crypto/x509v3/Makefile +# OpenSSL/crypto/x509v3/Makefile # DIR= x509v3 diff --git a/lib/libssl/src/doc/HOWTO/keys.txt b/lib/libssl/src/doc/HOWTO/keys.txt index 45f42eaaf1b..7ae2a3a1183 100644 --- a/lib/libssl/src/doc/HOWTO/keys.txt +++ b/lib/libssl/src/doc/HOWTO/keys.txt @@ -40,9 +40,9 @@ consider insecure or to be insecure pretty soon. 3. To generate a DSA key -A DSA key can be used both for signing only. This is important to -keep in mind to know what kind of purposes a certificate request with -a DSA key can really be used for. +A DSA key can be used for signing only. This is important to keep +in mind to know what kind of purposes a certificate request with a +DSA key can really be used for. Generating a key for the DSA algorithm is a two-step process. First, you have to generate parameters from which to generate the key: diff --git a/lib/libssl/src/doc/crypto/OPENSSL_config.pod b/lib/libssl/src/doc/crypto/OPENSSL_config.pod index 16600620ccf..e7bba2aacae 100644 --- a/lib/libssl/src/doc/crypto/OPENSSL_config.pod +++ b/lib/libssl/src/doc/crypto/OPENSSL_config.pod @@ -35,7 +35,7 @@ calls OPENSSL_add_all_algorithms() by compiling an application with the preprocessor symbol B<OPENSSL_LOAD_CONF> #define'd. In this way configuration can be added without source changes. -The environment variable B<OPENSSL_CONFIG> can be set to specify the location +The environment variable B<OPENSSL_CONF> can be set to specify the location of the configuration file. Currently ASN1 OBJECTs and ENGINE configuration can be performed future diff --git a/lib/libssl/src/doc/crypto/PKCS7_verify.pod b/lib/libssl/src/doc/crypto/PKCS7_verify.pod index 07c9fdad402..3490b5dc825 100644 --- a/lib/libssl/src/doc/crypto/PKCS7_verify.pod +++ b/lib/libssl/src/doc/crypto/PKCS7_verify.pod @@ -8,7 +8,7 @@ PKCS7_verify - verify a PKCS#7 signedData structure int PKCS7_verify(PKCS7 *p7, STACK_OF(X509) *certs, X509_STORE *store, BIO *indata, BIO *out, int flags); -int PKCS7_get0_signers(PKCS7 *p7, STACK_OF(X509) *certs, int flags); +STACK_OF(X509) *PKCS7_get0_signers(PKCS7 *p7, STACK_OF(X509) *certs, int flags); =head1 DESCRIPTION diff --git a/lib/libssl/src/doc/fingerprints.txt b/lib/libssl/src/doc/fingerprints.txt index c350d381eb9..7d05a855946 100644 --- a/lib/libssl/src/doc/fingerprints.txt +++ b/lib/libssl/src/doc/fingerprints.txt @@ -26,3 +26,32 @@ pub 1024R/49A563D9 1997-02-24 uid Mark Cox <mjc@redhat.com> uid Mark Cox <mark@awe.com> uid Mark Cox <mjc@apache.org> + +pub 1024R/26BB437D 1997-04-28 + Key fingerprint = 00 C9 21 8E D1 AB 70 37 DD 67 A2 3A 0A 6F 8D A5 +uid Ralf S. Engelschall <rse@engelschall.com> + +pub 1024R/9C58A66D 1997-04-03 + Key fingerprint = 13 D0 B8 9D 37 30 C3 ED AC 9C 24 7D 45 8C 17 67 +uid jaenicke@openssl.org +uid Lutz Jaenicke <Lutz.Jaenicke@aet.TU-Cottbus.DE> + +pub 1024D/2118CF83 1998-07-13 + Key fingerprint = 7656 55DE 62E3 96FF 2587 EB6C 4F6D E156 2118 CF83 +uid Ben Laurie <ben@thebunker.net> +uid Ben Laurie <ben@cryptix.org> +uid Ben Laurie <ben@algroup.co.uk> +sub 4096g/1F5143E7 1998-07-13 + +pub 1024R/5A6A9B85 1994-03-22 + Key fingerprint = C7 AC 7E AD 56 6A 65 EC F6 16 66 83 7E 86 68 28 +uid Bodo Moeller <2005@bmoeller.de> +uid Bodo Moeller <2003@bmoeller.de> +uid Bodo Moeller <2004@bmoeller.de> +uid Bodo Moeller <bmoeller@acm.org> +uid Bodo Moeller <bodo@openssl.org> +uid Bodo Moeller <bm@ulf.mali.sub.org> +uid Bodo Moeller <3moeller@informatik.uni-hamburg.de> +uid Bodo Moeller <Bodo_Moeller@public.uni-hamburg.de> +uid Bodo Moeller <3moeller@rzdspc5.informatik.uni-hamburg.de> + diff --git a/lib/libssl/src/fips-1.0/Makefile b/lib/libssl/src/fips-1.0/Makefile new file mode 100644 index 00000000000..891a40b36a4 --- /dev/null +++ b/lib/libssl/src/fips-1.0/Makefile @@ -0,0 +1,242 @@ +# +# OpenSSL/fips-1.0/Makefile +# + +DIR= fips-1.0 +TOP= .. +CC= cc +INCLUDE= -I. -I$(TOP) -I../include +INCLUDES= -I.. -I../.. -I../../include +CFLAG= -g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP= /usr/local/ssl +MAKEFILE= Makefile +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +PERL= perl +RM= rm -f +AR= ar r + +PEX_LIBS= +EX_LIBS= + +CFLAGS= $(INCLUDE) $(CFLAG) -DHMAC_EXT=\"$${HMAC_EXT:-sha1}\" + + +LIBS= + +FDIRS=sha rand des aes dsa rsa dh hmac + +GENERAL=Makefile README fips-lib.com install.com + +LIB= $(TOP)/libcrypto.a +SHARED_LIB= libcrypto$(SHLIB_EXT) +LIBSRC=fips.c fips_err_wrapper.c fipshashes.c +LIBOBJ=fips.o fips_err_wrapper.o fipshashes.o + +FIPS_OBJ_LISTS=sha/lib hmac/lib rand/lib des/lib aes/lib dsa/lib rsa/lib dh/lib + +SRC= $(LIBSRC) + +EXHEADER=fips.h +HEADER=$(EXHEADER) fips_err.h +EXE=fipsld +TEST=fips_test_suite.c + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + @(cd ..; $(MAKE) DIRS=$(DIR) all) + +all: + @if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ + $(MAKE) -e subdirs check lib shared; \ + fi + +check: +# $(PERL) ../util/checkhash.pl || (rm fipscanister.o* 2>/dev/null; exit 1) + echo FIPS module not built: no check done + +# Idea behind fipscanister.o is to "seize" the sequestered code between +# known symbols for fingerprinting purposes, which would be commonly +# done with ld -r start.o ... end.o. The latter however presents a minor +# challenge on multi-ABI platforms. As just implied, we'd rather use ld, +# but the trouble is that we don't generally know how ABI-selection +# compiler flag is translated to corresponding linker flag. All compiler +# drivers seem to recognize -r flag and pass it down to linker, but some +# of them, including gcc, erroneously add -lc, as well as run-time +# components, such as crt1.o and alike. Fortunately among those vendor +# compilers which were observed to misinterpret -r flag multi-ABI ones +# are equipped with smart linkers, which don't require any ABI-selection +# flag and simply assume that all objects are of the same type as first +# one in command line. So the idea is to identify gcc and deficient +# vendor compiler drivers... + +fipscanister.o: fips_start.o $(LIBOBJ) $(FIPS_OBJ_LISTS) fips_end.o + @objs="fips_start.o $(LIBOBJ)"; \ + for i in $(FIPS_OBJ_LISTS); do \ + dir=`dirname $$i`; script="s|^|$$dir/|;s| | $$dir/|g"; \ + objs="$$objs `sed "$$script" $$i`"; \ + done; \ + objs="$$objs fips_end.o" ; \ + if [ -n "${FIPS_SITE_LD}" ]; then \ + set -x; ${FIPS_SITE_LD} -r -o $@ $$objs; \ + elif $(CC) -dumpversion >/dev/null 2>&1; then \ + set -x; $(CC) $(CFLAGS) -r -nostdlib -o $@ $$objs ; \ + else case "`(uname -s) 2>/dev/null`" in \ + HP-UX|OSF1|SunOS) set -x; /usr/ccs/bin/ld -r -o $@ $$objs ;; \ + *) set -x; $(CC) $(CFLAGS) -r -o $@ $$objs ;; \ + esac fi + sha/fips_standalone_sha1 fipscanister.o > fipscanister.o.sha1 + +# If another exception is immediately required, assign approprite +# site-specific ld command to FIPS_SITE_LD environment variable. + +fips_start.o: fips_canister.c + $(CC) $(CFLAGS) -DFIPS_START -c -o $@ fips_canister.c +fips_end.o: fips_canister.c + $(CC) $(CFLAGS) -DFIPS_END -c -o $@ fips_canister.c +fips_premain_dso$(EXE_EXT): fips_premain.c + $(CC) $(CFLAGS) -DFINGERPRINT_PREMAIN_DSO_LOAD -o $@ fips_premain.c \ + ../libcrypto.a $(EX_LIBS) + +subdirs: + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making all in fips/$$i..." && \ + $(MAKE) CC='$(CC)' INCLUDES='${INCLUDES}' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' all ) || exit 1; \ + done; + +sub_target: + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making $(TARGET) in fips/$$i..." && \ + $(MAKE) CC='$(CC)' INCLUDES='${INCLUDES}' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' AR='${AR}' PROCESSOR='${PROCESSOR}' PERL='${PERL}' RANLIB='${RANLIB}' $(TARGET) ) || exit 1; \ + done; + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making 'files' in fips/$$i..." && \ + $(MAKE) PERL='${PERL}' files ); \ + done; + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @for i in $(FDIRS); do \ + (cd $$i && echo "making links in fips/$$i..." && \ + $(MAKE) CC='$(CC)' INCLUDES='${INCLUDES}' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' BN_ASM='${BN_ASM}' DES_ENC='${DES_ENC}' FIPS_DES_ENC='${FIPS_DES_ENC}' SHA1_ASM_OBJ='${SHA1_ASM_OBJ}' FIPS_SHA1_ASM_OBJ='${FIPS_SHA1_ASM_OBJ}' MD5_ASM_OBJ='${MD5_ASM_OBJ}' RMD160_ASM_OBJ='${RMD160_ASM_OBJ}' BF_ENC='${BF_ENC}' CAST_ENC='${CAST_ENC}' RC4_ENC='${RC4_ENC}' RC5_ENC='${RC5_ENC}' AR='${AR}' PERL='${PERL}' links ); \ + done; + +lib: $(FIPSLIBDIR)/fipscanister.o + $(AR) $(LIB) $(FIPSLIBDIR)/fipscanister.o + $(RANLIB) $(LIB) || echo Never mind. + @touch lib + +shared: fips_premain_dso$(EXE_EXT) + if [ -n "$(SHARED_LIBS)" ]; then \ + (cd ..; $(MAKE) FIPSLD_CC=$(CC) FIPSLD=fips-1.0/fipsld $(SHARED_LIB)); \ + fi + +libs: + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making libs in fips/$$i..." && \ + $(MAKE) CC='$(CC)' CFLAG='${CFLAG}' INSTALL_PREFIX='${INSTALL_PREFIX}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' AR='${AR}' lib ); \ + done; + +tests: + (cd ..; make DIRS=test) + +fips_test: top tests + -cd testvectors && perl -p -i -e 's/COUNT=/COUNT = /' des[23]/req/*.req + @for i in dsa sha aes des hmac rand rsa; \ + do \ + (cd $$i && echo "making fips_test in fips/$$i..." && $(MAKE) fips_test) \ + done; + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist ;\ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done; + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making install in fips/$$i..." && \ + $(MAKE) CC='$(CC)' CFLAG='${CFLAG}' INSTALL_PREFIX='${INSTALL_PREFIX}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' install ); \ + done; + @for i in $(EXE) ; \ + do \ + echo "installing $$i"; \ + cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new; \ + chmod 755 $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new; \ + mv -f $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i.new $(INSTALL_PREFIX)$(INSTALLTOP)/bin/$$i; \ + done + @cp -p -f fipscanister.o fipscanister.o.sha1 fips_premain.c \ + $(INSTALL_PREFIX)$(INSTALLTOP)/lib/; \ + strings fipscanister.o | grep "HMAC-SHA1(fips_premain\\.c)" > \ + $(INSTALL_PREFIX)$(INSTALLTOP)/lib/fips_premain.c.sha1; \ + chmod 0444 $(INSTALL_PREFIX)$(INSTALLTOP)/lib/fips* + +lint: + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making lint in fips/$$i..." && \ + $(MAKE) CC='$(CC)' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' lint ); \ + done; + +depend: + if [ ! -f buildinf.h ]; then touch buildinf.h; fi # fake buildinf.h if it does not exist + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDE) $(DEPFLAG) -- $(SRC) + if [ ! -s buildinf.h ]; then rm buildinf.h; fi + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making depend in fips/$$i..." && \ + $(MAKE) MAKEFILE='${MAKEFILE}' INCLUDES='${INCLUDES}' CFLAG='${CFLAG}' DEPFLAG='${DEPFLAG}' MAKEDEPPROG='${MAKEDEPPROG}' KRB5_INCLUDES='${KRB5_INCLUDES}' PERL='${PERL}' depend ); \ + done; + +clean: + rm -f buildinf.h *.o *.obj fips_premain_dso$(EXE_EXT) lib tags core .pure .nfs* *.old *.bak fluff + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making clean in fips/$$i..." && \ + $(MAKE) CC='$(CC)' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' clean ); \ + done; + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + @for i in $(FDIRS) ;\ + do \ + (cd $$i && echo "making dclean in fips/$$i..." && \ + $(MAKE) PERL='${PERL}' CC='$(CC)' CFLAG='${CFLAG}' INSTALLTOP='${INSTALLTOP}' PEX_LIBS='${PEX_LIBS}' EX_LIBS='${EX_LIBS}' dclean ); \ + done; + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips.o: ../include/openssl/bn.h ../include/openssl/cast.h +fips.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips.o: ../include/openssl/err.h ../include/openssl/evp.h +fips.o: ../include/openssl/fips.h ../include/openssl/fips_rand.h +fips.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips.o: ../include/openssl/objects.h ../include/openssl/opensslconf.h +fips.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips.o: ../include/openssl/rand.h ../include/openssl/rc2.h +fips.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h fips.c +fips.o: fips_locl.h +fips_err_wrapper.o: ../include/openssl/opensslconf.h fips_err_wrapper.c diff --git a/lib/libssl/src/fips-1.0/aes/Makefile b/lib/libssl/src/fips-1.0/aes/Makefile new file mode 100644 index 00000000000..d2a72b39887 --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/Makefile @@ -0,0 +1,121 @@ +# +# OpenSSL/fips-1.0/aes/Makefile +# + +DIR= aes +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +FIPS_AES_ENC=fips_aes_core.o + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST=fips_aesavs.c +TESTDATA=fips_aes_data +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_aes_core.c asm/fips-ax86-elf.s fips_aes_selftest.c +LIBOBJ=$(FIPS_AES_ENC) fips_aes_selftest.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) fips_aes_locl.h + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TESTDATA) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +fips_test: + -find ../testvectors/aes/req -name '*.req' > testlist + -rm -rf ../testvectors/aes/rsp + mkdir ../testvectors/aes/rsp + if [ -s testlist ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_aesavs -d testlist; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(PROGS) \ + $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_aes_core.o: ../../include/openssl/aes.h ../../include/openssl/e_os2.h +fips_aes_core.o: ../../include/openssl/fips.h +fips_aes_core.o: ../../include/openssl/opensslconf.h fips_aes_core.c +fips_aes_core.o: fips_aes_locl.h +fips_aes_selftest.o: ../../include/openssl/aes.h ../../include/openssl/bio.h +fips_aes_selftest.o: ../../include/openssl/crypto.h +fips_aes_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_aes_selftest.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_aes_selftest.o: ../../include/openssl/opensslconf.h +fips_aes_selftest.o: ../../include/openssl/opensslv.h +fips_aes_selftest.o: ../../include/openssl/safestack.h +fips_aes_selftest.o: ../../include/openssl/stack.h +fips_aes_selftest.o: ../../include/openssl/symhacks.h fips_aes_selftest.c +fips_aesavs.o: ../../e_os.h ../../include/openssl/aes.h +fips_aesavs.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_aesavs.o: ../../include/openssl/blowfish.h ../../include/openssl/bn.h +fips_aesavs.o: ../../include/openssl/cast.h ../../include/openssl/crypto.h +fips_aesavs.o: ../../include/openssl/des.h ../../include/openssl/des_old.h +fips_aesavs.o: ../../include/openssl/dh.h ../../include/openssl/dsa.h +fips_aesavs.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_aesavs.o: ../../include/openssl/evp.h ../../include/openssl/fips.h +fips_aesavs.o: ../../include/openssl/idea.h ../../include/openssl/lhash.h +fips_aesavs.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +fips_aesavs.o: ../../include/openssl/md5.h ../../include/openssl/mdc2.h +fips_aesavs.o: ../../include/openssl/obj_mac.h ../../include/openssl/objects.h +fips_aesavs.o: ../../include/openssl/opensslconf.h +fips_aesavs.o: ../../include/openssl/opensslv.h +fips_aesavs.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rc2.h +fips_aesavs.o: ../../include/openssl/rc4.h ../../include/openssl/rc5.h +fips_aesavs.o: ../../include/openssl/ripemd.h ../../include/openssl/rsa.h +fips_aesavs.o: ../../include/openssl/safestack.h ../../include/openssl/sha.h +fips_aesavs.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_aesavs.o: ../../include/openssl/ui.h ../../include/openssl/ui_compat.h +fips_aesavs.o: fips_aesavs.c diff --git a/lib/libssl/src/fips-1.0/aes/asm/fips-ax86-elf.s b/lib/libssl/src/fips-1.0/aes/asm/fips-ax86-elf.s new file mode 100644 index 00000000000..a3aa8fa9d91 --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/asm/fips-ax86-elf.s @@ -0,0 +1,1711 @@ + + + + + + + .file "aes-586.s" +.globl AES_Te +.text +.globl _x86_AES_encrypt +.type _x86_AES_encrypt,@function +.align 16 +_x86_AES_encrypt: + movl %edi, 12(%esp) + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + movl 240(%edi), %esi + leal -2(%esi,%esi), %esi + leal (%edi,%esi,8), %esi + movl %esi, 16(%esp) +.align 4 +.L000loop: + movl %eax, %esi + andl $255, %esi + movl (%ebp,%esi,8), %esi + movzbl %bh, %edi + xorl 3(%ebp,%edi,8), %esi + movl %ecx, %edi + shrl $16, %edi + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movl %edx, %edi + shrl $24, %edi + xorl 1(%ebp,%edi,8), %esi + movl %esi, 4(%esp) + + movl %ebx, %esi + andl $255, %esi + shrl $16, %ebx + movl (%ebp,%esi,8), %esi + movzbl %ch, %edi + xorl 3(%ebp,%edi,8), %esi + movl %edx, %edi + shrl $16, %edi + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movl %eax, %edi + shrl $24, %edi + xorl 1(%ebp,%edi,8), %esi + movl %esi, 8(%esp) + + movl %ecx, %esi + andl $255, %esi + shrl $24, %ecx + movl (%ebp,%esi,8), %esi + movzbl %dh, %edi + xorl 3(%ebp,%edi,8), %esi + movl %eax, %edi + shrl $16, %edi + andl $255, %edx + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movzbl %bh, %edi + xorl 1(%ebp,%edi,8), %esi + + movl 12(%esp), %edi + movl (%ebp,%edx,8), %edx + movzbl %ah, %eax + xorl 3(%ebp,%eax,8), %edx + movl 4(%esp), %eax + andl $255, %ebx + xorl 2(%ebp,%ebx,8), %edx + movl 8(%esp), %ebx + xorl 1(%ebp,%ecx,8), %edx + movl %esi, %ecx + + addl $16, %edi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + cmpl 16(%esp), %edi + movl %edi, 12(%esp) + jb .L000loop + movl %eax, %esi + andl $255, %esi + movl 2(%ebp,%esi,8), %esi + andl $255, %esi + movzbl %bh, %edi + movl (%ebp,%edi,8), %edi + andl $65280, %edi + xorl %edi, %esi + movl %ecx, %edi + shrl $16, %edi + andl $255, %edi + movl (%ebp,%edi,8), %edi + andl $16711680, %edi + xorl %edi, %esi + movl %edx, %edi + shrl $24, %edi + movl 2(%ebp,%edi,8), %edi + andl $4278190080, %edi + xorl %edi, %esi + movl %esi, 4(%esp) + movl %ebx, %esi + andl $255, %esi + shrl $16, %ebx + movl 2(%ebp,%esi,8), %esi + andl $255, %esi + movzbl %ch, %edi + movl (%ebp,%edi,8), %edi + andl $65280, %edi + xorl %edi, %esi + movl %edx, %edi + shrl $16, %edi + andl $255, %edi + movl (%ebp,%edi,8), %edi + andl $16711680, %edi + xorl %edi, %esi + movl %eax, %edi + shrl $24, %edi + movl 2(%ebp,%edi,8), %edi + andl $4278190080, %edi + xorl %edi, %esi + movl %esi, 8(%esp) + movl %ecx, %esi + andl $255, %esi + shrl $24, %ecx + movl 2(%ebp,%esi,8), %esi + andl $255, %esi + movzbl %dh, %edi + movl (%ebp,%edi,8), %edi + andl $65280, %edi + xorl %edi, %esi + movl %eax, %edi + shrl $16, %edi + andl $255, %edx + andl $255, %edi + movl (%ebp,%edi,8), %edi + andl $16711680, %edi + xorl %edi, %esi + movzbl %bh, %edi + movl 2(%ebp,%edi,8), %edi + andl $4278190080, %edi + xorl %edi, %esi + movl 12(%esp), %edi + andl $255, %edx + movl 2(%ebp,%edx,8), %edx + andl $255, %edx + movzbl %ah, %eax + movl (%ebp,%eax,8), %eax + andl $65280, %eax + xorl %eax, %edx + movl 4(%esp), %eax + andl $255, %ebx + movl (%ebp,%ebx,8), %ebx + andl $16711680, %ebx + xorl %ebx, %edx + movl 8(%esp), %ebx + movl 2(%ebp,%ecx,8), %ecx + andl $4278190080, %ecx + xorl %ecx, %edx + movl %esi, %ecx + addl $16, %edi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + ret +.align 64 +AES_Te: + .long 2774754246,2774754246 + .long 2222750968,2222750968 + .long 2574743534,2574743534 + .long 2373680118,2373680118 + .long 234025727,234025727 + .long 3177933782,3177933782 + .long 2976870366,2976870366 + .long 1422247313,1422247313 + .long 1345335392,1345335392 + .long 50397442,50397442 + .long 2842126286,2842126286 + .long 2099981142,2099981142 + .long 436141799,436141799 + .long 1658312629,1658312629 + .long 3870010189,3870010189 + .long 2591454956,2591454956 + .long 1170918031,1170918031 + .long 2642575903,2642575903 + .long 1086966153,1086966153 + .long 2273148410,2273148410 + .long 368769775,368769775 + .long 3948501426,3948501426 + .long 3376891790,3376891790 + .long 200339707,200339707 + .long 3970805057,3970805057 + .long 1742001331,1742001331 + .long 4255294047,4255294047 + .long 3937382213,3937382213 + .long 3214711843,3214711843 + .long 4154762323,4154762323 + .long 2524082916,2524082916 + .long 1539358875,1539358875 + .long 3266819957,3266819957 + .long 486407649,486407649 + .long 2928907069,2928907069 + .long 1780885068,1780885068 + .long 1513502316,1513502316 + .long 1094664062,1094664062 + .long 49805301,49805301 + .long 1338821763,1338821763 + .long 1546925160,1546925160 + .long 4104496465,4104496465 + .long 887481809,887481809 + .long 150073849,150073849 + .long 2473685474,2473685474 + .long 1943591083,1943591083 + .long 1395732834,1395732834 + .long 1058346282,1058346282 + .long 201589768,201589768 + .long 1388824469,1388824469 + .long 1696801606,1696801606 + .long 1589887901,1589887901 + .long 672667696,672667696 + .long 2711000631,2711000631 + .long 251987210,251987210 + .long 3046808111,3046808111 + .long 151455502,151455502 + .long 907153956,907153956 + .long 2608889883,2608889883 + .long 1038279391,1038279391 + .long 652995533,652995533 + .long 1764173646,1764173646 + .long 3451040383,3451040383 + .long 2675275242,2675275242 + .long 453576978,453576978 + .long 2659418909,2659418909 + .long 1949051992,1949051992 + .long 773462580,773462580 + .long 756751158,756751158 + .long 2993581788,2993581788 + .long 3998898868,3998898868 + .long 4221608027,4221608027 + .long 4132590244,4132590244 + .long 1295727478,1295727478 + .long 1641469623,1641469623 + .long 3467883389,3467883389 + .long 2066295122,2066295122 + .long 1055122397,1055122397 + .long 1898917726,1898917726 + .long 2542044179,2542044179 + .long 4115878822,4115878822 + .long 1758581177,1758581177 + .long 0,0 + .long 753790401,753790401 + .long 1612718144,1612718144 + .long 536673507,536673507 + .long 3367088505,3367088505 + .long 3982187446,3982187446 + .long 3194645204,3194645204 + .long 1187761037,1187761037 + .long 3653156455,3653156455 + .long 1262041458,1262041458 + .long 3729410708,3729410708 + .long 3561770136,3561770136 + .long 3898103984,3898103984 + .long 1255133061,1255133061 + .long 1808847035,1808847035 + .long 720367557,720367557 + .long 3853167183,3853167183 + .long 385612781,385612781 + .long 3309519750,3309519750 + .long 3612167578,3612167578 + .long 1429418854,1429418854 + .long 2491778321,2491778321 + .long 3477423498,3477423498 + .long 284817897,284817897 + .long 100794884,100794884 + .long 2172616702,2172616702 + .long 4031795360,4031795360 + .long 1144798328,1144798328 + .long 3131023141,3131023141 + .long 3819481163,3819481163 + .long 4082192802,4082192802 + .long 4272137053,4272137053 + .long 3225436288,3225436288 + .long 2324664069,2324664069 + .long 2912064063,2912064063 + .long 3164445985,3164445985 + .long 1211644016,1211644016 + .long 83228145,83228145 + .long 3753688163,3753688163 + .long 3249976951,3249976951 + .long 1977277103,1977277103 + .long 1663115586,1663115586 + .long 806359072,806359072 + .long 452984805,452984805 + .long 250868733,250868733 + .long 1842533055,1842533055 + .long 1288555905,1288555905 + .long 336333848,336333848 + .long 890442534,890442534 + .long 804056259,804056259 + .long 3781124030,3781124030 + .long 2727843637,2727843637 + .long 3427026056,3427026056 + .long 957814574,957814574 + .long 1472513171,1472513171 + .long 4071073621,4071073621 + .long 2189328124,2189328124 + .long 1195195770,1195195770 + .long 2892260552,2892260552 + .long 3881655738,3881655738 + .long 723065138,723065138 + .long 2507371494,2507371494 + .long 2690670784,2690670784 + .long 2558624025,2558624025 + .long 3511635870,3511635870 + .long 2145180835,2145180835 + .long 1713513028,1713513028 + .long 2116692564,2116692564 + .long 2878378043,2878378043 + .long 2206763019,2206763019 + .long 3393603212,3393603212 + .long 703524551,703524551 + .long 3552098411,3552098411 + .long 1007948840,1007948840 + .long 2044649127,2044649127 + .long 3797835452,3797835452 + .long 487262998,487262998 + .long 1994120109,1994120109 + .long 1004593371,1004593371 + .long 1446130276,1446130276 + .long 1312438900,1312438900 + .long 503974420,503974420 + .long 3679013266,3679013266 + .long 168166924,168166924 + .long 1814307912,1814307912 + .long 3831258296,3831258296 + .long 1573044895,1573044895 + .long 1859376061,1859376061 + .long 4021070915,4021070915 + .long 2791465668,2791465668 + .long 2828112185,2828112185 + .long 2761266481,2761266481 + .long 937747667,937747667 + .long 2339994098,2339994098 + .long 854058965,854058965 + .long 1137232011,1137232011 + .long 1496790894,1496790894 + .long 3077402074,3077402074 + .long 2358086913,2358086913 + .long 1691735473,1691735473 + .long 3528347292,3528347292 + .long 3769215305,3769215305 + .long 3027004632,3027004632 + .long 4199962284,4199962284 + .long 133494003,133494003 + .long 636152527,636152527 + .long 2942657994,2942657994 + .long 2390391540,2390391540 + .long 3920539207,3920539207 + .long 403179536,403179536 + .long 3585784431,3585784431 + .long 2289596656,2289596656 + .long 1864705354,1864705354 + .long 1915629148,1915629148 + .long 605822008,605822008 + .long 4054230615,4054230615 + .long 3350508659,3350508659 + .long 1371981463,1371981463 + .long 602466507,602466507 + .long 2094914977,2094914977 + .long 2624877800,2624877800 + .long 555687742,555687742 + .long 3712699286,3712699286 + .long 3703422305,3703422305 + .long 2257292045,2257292045 + .long 2240449039,2240449039 + .long 2423288032,2423288032 + .long 1111375484,1111375484 + .long 3300242801,3300242801 + .long 2858837708,2858837708 + .long 3628615824,3628615824 + .long 84083462,84083462 + .long 32962295,32962295 + .long 302911004,302911004 + .long 2741068226,2741068226 + .long 1597322602,1597322602 + .long 4183250862,4183250862 + .long 3501832553,3501832553 + .long 2441512471,2441512471 + .long 1489093017,1489093017 + .long 656219450,656219450 + .long 3114180135,3114180135 + .long 954327513,954327513 + .long 335083755,335083755 + .long 3013122091,3013122091 + .long 856756514,856756514 + .long 3144247762,3144247762 + .long 1893325225,1893325225 + .long 2307821063,2307821063 + .long 2811532339,2811532339 + .long 3063651117,3063651117 + .long 572399164,572399164 + .long 2458355477,2458355477 + .long 552200649,552200649 + .long 1238290055,1238290055 + .long 4283782570,4283782570 + .long 2015897680,2015897680 + .long 2061492133,2061492133 + .long 2408352771,2408352771 + .long 4171342169,4171342169 + .long 2156497161,2156497161 + .long 386731290,386731290 + .long 3669999461,3669999461 + .long 837215959,837215959 + .long 3326231172,3326231172 + .long 3093850320,3093850320 + .long 3275833730,3275833730 + .long 2962856233,2962856233 + .long 1999449434,1999449434 + .long 286199582,286199582 + .long 3417354363,3417354363 + .long 4233385128,4233385128 + .long 3602627437,3602627437 + .long 974525996,974525996 + .long 1,2,4,8 + .long 16,32,64,128 + .long 27,54,0,0, + .long 0,0,0,0 +.L__x86_AES_encrypt_end: +.size _x86_AES_encrypt,.L__x86_AES_encrypt_end-_x86_AES_encrypt +.ident "_x86_AES_encrypt" +.globl AES_Te +.text +.globl AES_encrypt +.type AES_encrypt,@function +.align 16 +AES_encrypt: + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + + movl 20(%esp), %esi + movl 28(%esp), %edi + movl %esp, %eax + subl $24, %esp + andl $-64, %esp + addl $4, %esp + movl %eax, 16(%esp) + call .L001pic_point +.L001pic_point: + popl %ebp + leal AES_Te-.L001pic_point(%ebp),%ebp + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + call _x86_AES_encrypt + movl 16(%esp), %esp + movl 24(%esp), %esi + movl %eax, (%esi) + movl %ebx, 4(%esi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.L_AES_encrypt_end: +.size AES_encrypt,.L_AES_encrypt_end-AES_encrypt +.ident "AES_encrypt" +.globl AES_Td +.text +.globl _x86_AES_decrypt +.type _x86_AES_decrypt,@function +.align 16 +_x86_AES_decrypt: + movl %edi, 12(%esp) + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + movl 240(%edi), %esi + leal -2(%esi,%esi), %esi + leal (%edi,%esi,8), %esi + movl %esi, 16(%esp) +.align 4 +.L002loop: + movl %eax, %esi + andl $255, %esi + movl (%ebp,%esi,8), %esi + movzbl %dh, %edi + xorl 3(%ebp,%edi,8), %esi + movl %ecx, %edi + shrl $16, %edi + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movl %ebx, %edi + shrl $24, %edi + xorl 1(%ebp,%edi,8), %esi + movl %esi, 4(%esp) + + movl %ebx, %esi + andl $255, %esi + movl (%ebp,%esi,8), %esi + movzbl %ah, %edi + xorl 3(%ebp,%edi,8), %esi + movl %edx, %edi + shrl $16, %edi + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movl %ecx, %edi + shrl $24, %edi + xorl 1(%ebp,%edi,8), %esi + movl %esi, 8(%esp) + + movl %ecx, %esi + andl $255, %esi + movl (%ebp,%esi,8), %esi + movzbl %bh, %edi + xorl 3(%ebp,%edi,8), %esi + movl %eax, %edi + shrl $16, %edi + andl $255, %edi + xorl 2(%ebp,%edi,8), %esi + movl %edx, %edi + shrl $24, %edi + xorl 1(%ebp,%edi,8), %esi + + movl 12(%esp), %edi + andl $255, %edx + movl (%ebp,%edx,8), %edx + movzbl %ch, %ecx + xorl 3(%ebp,%ecx,8), %edx + movl %esi, %ecx + shrl $16, %ebx + andl $255, %ebx + xorl 2(%ebp,%ebx,8), %edx + movl 8(%esp), %ebx + shrl $24, %eax + xorl 1(%ebp,%eax,8), %edx + movl 4(%esp), %eax + + addl $16, %edi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + cmpl 16(%esp), %edi + movl %edi, 12(%esp) + jb .L002loop + movl %eax, %esi + andl $255, %esi + movl 2048(%ebp,%esi,4),%esi + andl $255, %esi + movzbl %dh, %edi + movl 2048(%ebp,%edi,4),%edi + andl $65280, %edi + xorl %edi, %esi + movl %ecx, %edi + shrl $16, %edi + andl $255, %edi + movl 2048(%ebp,%edi,4),%edi + andl $16711680, %edi + xorl %edi, %esi + movl %ebx, %edi + shrl $24, %edi + movl 2048(%ebp,%edi,4),%edi + andl $4278190080, %edi + xorl %edi, %esi + movl %esi, 4(%esp) + movl %ebx, %esi + andl $255, %esi + movl 2048(%ebp,%esi,4),%esi + andl $255, %esi + movzbl %ah, %edi + movl 2048(%ebp,%edi,4),%edi + andl $65280, %edi + xorl %edi, %esi + movl %edx, %edi + shrl $16, %edi + andl $255, %edi + movl 2048(%ebp,%edi,4),%edi + andl $16711680, %edi + xorl %edi, %esi + movl %ecx, %edi + shrl $24, %edi + movl 2048(%ebp,%edi,4),%edi + andl $4278190080, %edi + xorl %edi, %esi + movl %esi, 8(%esp) + movl %ecx, %esi + andl $255, %esi + movl 2048(%ebp,%esi,4),%esi + andl $255, %esi + movzbl %bh, %edi + movl 2048(%ebp,%edi,4),%edi + andl $65280, %edi + xorl %edi, %esi + movl %eax, %edi + shrl $16, %edi + andl $255, %edi + movl 2048(%ebp,%edi,4),%edi + andl $16711680, %edi + xorl %edi, %esi + movl %edx, %edi + shrl $24, %edi + movl 2048(%ebp,%edi,4),%edi + andl $4278190080, %edi + xorl %edi, %esi + movl 12(%esp), %edi + andl $255, %edx + movl 2048(%ebp,%edx,4),%edx + andl $255, %edx + movzbl %ch, %ecx + movl 2048(%ebp,%ecx,4),%ecx + andl $65280, %ecx + xorl %ecx, %edx + movl %esi, %ecx + shrl $16, %ebx + andl $255, %ebx + movl 2048(%ebp,%ebx,4),%ebx + andl $16711680, %ebx + xorl %ebx, %edx + movl 8(%esp), %ebx + shrl $24, %eax + movl 2048(%ebp,%eax,4),%eax + andl $4278190080, %eax + xorl %eax, %edx + movl 4(%esp), %eax + addl $16, %edi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + ret +.align 64 +AES_Td: + .long 1353184337,1353184337 + .long 1399144830,1399144830 + .long 3282310938,3282310938 + .long 2522752826,2522752826 + .long 3412831035,3412831035 + .long 4047871263,4047871263 + .long 2874735276,2874735276 + .long 2466505547,2466505547 + .long 1442459680,1442459680 + .long 4134368941,4134368941 + .long 2440481928,2440481928 + .long 625738485,625738485 + .long 4242007375,4242007375 + .long 3620416197,3620416197 + .long 2151953702,2151953702 + .long 2409849525,2409849525 + .long 1230680542,1230680542 + .long 1729870373,1729870373 + .long 2551114309,2551114309 + .long 3787521629,3787521629 + .long 41234371,41234371 + .long 317738113,317738113 + .long 2744600205,2744600205 + .long 3338261355,3338261355 + .long 3881799427,3881799427 + .long 2510066197,2510066197 + .long 3950669247,3950669247 + .long 3663286933,3663286933 + .long 763608788,763608788 + .long 3542185048,3542185048 + .long 694804553,694804553 + .long 1154009486,1154009486 + .long 1787413109,1787413109 + .long 2021232372,2021232372 + .long 1799248025,1799248025 + .long 3715217703,3715217703 + .long 3058688446,3058688446 + .long 397248752,397248752 + .long 1722556617,1722556617 + .long 3023752829,3023752829 + .long 407560035,407560035 + .long 2184256229,2184256229 + .long 1613975959,1613975959 + .long 1165972322,1165972322 + .long 3765920945,3765920945 + .long 2226023355,2226023355 + .long 480281086,480281086 + .long 2485848313,2485848313 + .long 1483229296,1483229296 + .long 436028815,436028815 + .long 2272059028,2272059028 + .long 3086515026,3086515026 + .long 601060267,601060267 + .long 3791801202,3791801202 + .long 1468997603,1468997603 + .long 715871590,715871590 + .long 120122290,120122290 + .long 63092015,63092015 + .long 2591802758,2591802758 + .long 2768779219,2768779219 + .long 4068943920,4068943920 + .long 2997206819,2997206819 + .long 3127509762,3127509762 + .long 1552029421,1552029421 + .long 723308426,723308426 + .long 2461301159,2461301159 + .long 4042393587,4042393587 + .long 2715969870,2715969870 + .long 3455375973,3455375973 + .long 3586000134,3586000134 + .long 526529745,526529745 + .long 2331944644,2331944644 + .long 2639474228,2639474228 + .long 2689987490,2689987490 + .long 853641733,853641733 + .long 1978398372,1978398372 + .long 971801355,971801355 + .long 2867814464,2867814464 + .long 111112542,111112542 + .long 1360031421,1360031421 + .long 4186579262,4186579262 + .long 1023860118,1023860118 + .long 2919579357,2919579357 + .long 1186850381,1186850381 + .long 3045938321,3045938321 + .long 90031217,90031217 + .long 1876166148,1876166148 + .long 4279586912,4279586912 + .long 620468249,620468249 + .long 2548678102,2548678102 + .long 3426959497,3426959497 + .long 2006899047,2006899047 + .long 3175278768,3175278768 + .long 2290845959,2290845959 + .long 945494503,945494503 + .long 3689859193,3689859193 + .long 1191869601,1191869601 + .long 3910091388,3910091388 + .long 3374220536,3374220536 + .long 0,0 + .long 2206629897,2206629897 + .long 1223502642,1223502642 + .long 2893025566,2893025566 + .long 1316117100,1316117100 + .long 4227796733,4227796733 + .long 1446544655,1446544655 + .long 517320253,517320253 + .long 658058550,658058550 + .long 1691946762,1691946762 + .long 564550760,564550760 + .long 3511966619,3511966619 + .long 976107044,976107044 + .long 2976320012,2976320012 + .long 266819475,266819475 + .long 3533106868,3533106868 + .long 2660342555,2660342555 + .long 1338359936,1338359936 + .long 2720062561,2720062561 + .long 1766553434,1766553434 + .long 370807324,370807324 + .long 179999714,179999714 + .long 3844776128,3844776128 + .long 1138762300,1138762300 + .long 488053522,488053522 + .long 185403662,185403662 + .long 2915535858,2915535858 + .long 3114841645,3114841645 + .long 3366526484,3366526484 + .long 2233069911,2233069911 + .long 1275557295,1275557295 + .long 3151862254,3151862254 + .long 4250959779,4250959779 + .long 2670068215,2670068215 + .long 3170202204,3170202204 + .long 3309004356,3309004356 + .long 880737115,880737115 + .long 1982415755,1982415755 + .long 3703972811,3703972811 + .long 1761406390,1761406390 + .long 1676797112,1676797112 + .long 3403428311,3403428311 + .long 277177154,277177154 + .long 1076008723,1076008723 + .long 538035844,538035844 + .long 2099530373,2099530373 + .long 4164795346,4164795346 + .long 288553390,288553390 + .long 1839278535,1839278535 + .long 1261411869,1261411869 + .long 4080055004,4080055004 + .long 3964831245,3964831245 + .long 3504587127,3504587127 + .long 1813426987,1813426987 + .long 2579067049,2579067049 + .long 4199060497,4199060497 + .long 577038663,577038663 + .long 3297574056,3297574056 + .long 440397984,440397984 + .long 3626794326,3626794326 + .long 4019204898,4019204898 + .long 3343796615,3343796615 + .long 3251714265,3251714265 + .long 4272081548,4272081548 + .long 906744984,906744984 + .long 3481400742,3481400742 + .long 685669029,685669029 + .long 646887386,646887386 + .long 2764025151,2764025151 + .long 3835509292,3835509292 + .long 227702864,227702864 + .long 2613862250,2613862250 + .long 1648787028,1648787028 + .long 3256061430,3256061430 + .long 3904428176,3904428176 + .long 1593260334,1593260334 + .long 4121936770,4121936770 + .long 3196083615,3196083615 + .long 2090061929,2090061929 + .long 2838353263,2838353263 + .long 3004310991,3004310991 + .long 999926984,999926984 + .long 2809993232,2809993232 + .long 1852021992,1852021992 + .long 2075868123,2075868123 + .long 158869197,158869197 + .long 4095236462,4095236462 + .long 28809964,28809964 + .long 2828685187,2828685187 + .long 1701746150,1701746150 + .long 2129067946,2129067946 + .long 147831841,147831841 + .long 3873969647,3873969647 + .long 3650873274,3650873274 + .long 3459673930,3459673930 + .long 3557400554,3557400554 + .long 3598495785,3598495785 + .long 2947720241,2947720241 + .long 824393514,824393514 + .long 815048134,815048134 + .long 3227951669,3227951669 + .long 935087732,935087732 + .long 2798289660,2798289660 + .long 2966458592,2966458592 + .long 366520115,366520115 + .long 1251476721,1251476721 + .long 4158319681,4158319681 + .long 240176511,240176511 + .long 804688151,804688151 + .long 2379631990,2379631990 + .long 1303441219,1303441219 + .long 1414376140,1414376140 + .long 3741619940,3741619940 + .long 3820343710,3820343710 + .long 461924940,461924940 + .long 3089050817,3089050817 + .long 2136040774,2136040774 + .long 82468509,82468509 + .long 1563790337,1563790337 + .long 1937016826,1937016826 + .long 776014843,776014843 + .long 1511876531,1511876531 + .long 1389550482,1389550482 + .long 861278441,861278441 + .long 323475053,323475053 + .long 2355222426,2355222426 + .long 2047648055,2047648055 + .long 2383738969,2383738969 + .long 2302415851,2302415851 + .long 3995576782,3995576782 + .long 902390199,902390199 + .long 3991215329,3991215329 + .long 1018251130,1018251130 + .long 1507840668,1507840668 + .long 1064563285,1064563285 + .long 2043548696,2043548696 + .long 3208103795,3208103795 + .long 3939366739,3939366739 + .long 1537932639,1537932639 + .long 342834655,342834655 + .long 2262516856,2262516856 + .long 2180231114,2180231114 + .long 1053059257,1053059257 + .long 741614648,741614648 + .long 1598071746,1598071746 + .long 1925389590,1925389590 + .long 203809468,203809468 + .long 2336832552,2336832552 + .long 1100287487,1100287487 + .long 1895934009,1895934009 + .long 3736275976,3736275976 + .long 2632234200,2632234200 + .long 2428589668,2428589668 + .long 1636092795,1636092795 + .long 1890988757,1890988757 + .long 1952214088,1952214088 + .long 1113045200,1113045200 + .long 1381126738,151587081,1785358954,3587560917 + .long 808464432,909522486,2779096485,943208504 + .long 3217014719,1077952576,2745410467,2661195422 + .long 2172748161,4092851187,3621246935,4227595259 + .long 2088533116,3823363043,960051513,2189591170 + .long 2610666395,791621423,4294967295,2273806215 + .long 875836468,2391707278,1128481603,1145324612 + .long 3301229764,3739147998,3924421097,3419130827 + .long 1414812756,2071690107,2492765332,842150450 + .long 2795939494,3267543746,589505315,1027423549 + .long 4008636142,1280068684,2509608341,185273099 + .long 1111638594,4210752250,3284386755,1313754702 + .long 134744072,774778414,2711724449,1717986918 + .long 673720360,3654932953,606348324,2998055602 + .long 1987475062,1532713819,2728567458,1229539657 + .long 1835887981,2341178251,3520188881,623191333 + .long 1920103026,4177066232,4143380214,1684300900 + .long 2256963206,1751672936,2560137368,370546198 + .long 3570717908,2762253476,1549556828,3435973836 + .long 1566399837,1701143909,3065427638,2459079314 + .long 1819044972,1886417008,1212696648,1347440720 + .long 4261281277,3991793133,3115956665,3671775962 + .long 1583242846,353703189,1179010630,1465341783 + .long 2812782503,2374864269,2644352413,2223277188 + .long 2425393296,3638089944,2880154539,0 + .long 2358021260,3166485692,3553874899,168430090 + .long 4160223223,3840206052,1482184792,84215045 + .long 3099113656,3014898611,1162167621,101058054 + .long 3503345872,741092396,505290270,2408550287 + .long 3402287818,1061109567,252645135,33686018 + .long 3250700737,2947526575,3183328701,50529027 + .long 16843009,320017171,2324335242,1802201963 + .long 976894522,2442236305,286331153,1094795585 + .long 1330597711,1734829927,3705461980,3941264106 + .long 2543294359,4076008178,3486502863,3469659854 + .long 4042322160,3031741620,3873892070,1936946035 + .long 2526451350,2896997548,1953789044,572662306 + .long 3890735079,2913840557,892679477,2240120197 + .long 3806520034,4193909241,926365495,3907578088 + .long 471604252,1970632053,3755991007,1852730990 + .long 1195853639,4059165169,437918234,1903260017 + .long 488447261,690563369,3318072773,2307492233 + .long 1869573999,3082270647,1650614882,235802126 + .long 2863311530,404232216,3200171710,454761243 + .long 4244438268,1448498774,1044266558,1263225675 + .long 3334915782,3537031890,2038004089,538976288 + .long 2593823386,3688618971,3233857728,4278124286 + .long 2021161080,3452816845,1515870810,4109694196 + .long 522133279,3722304989,2829625512,858993459 + .long 2290649224,117901063,3351758791,825307441 + .long 2981212593,303174162,269488144,1499027801 + .long 656877351,2155905152,3974950124,1600085855 + .long 1616928864,1364283729,2139062143,2846468521 + .long 421075225,3048584629,1246382666,218959117 + .long 757935405,3857049061,2054847098,2678038431 + .long 2475922323,3385444809,2627509404,4025479151 + .long 2694881440,3772834016,993737531,1296911693 + .long 2930683566,707406378,4126537205,2964369584 + .long 3368601800,3958107115,3149642683,1010580540 + .long 2206434179,1397969747,2576980377,1633771873 + .long 387389207,724249387,67372036,2122219134 + .long 3132799674,2004318071,3604403926,640034342 + .long 3789677025,1768515945,336860180,1667457891 + .long 1431655765,555819297,202116108,2105376125 +.L__x86_AES_decrypt_end: +.size _x86_AES_decrypt,.L__x86_AES_decrypt_end-_x86_AES_decrypt +.ident "_x86_AES_decrypt" +.globl AES_Td +.text +.globl AES_decrypt +.type AES_decrypt,@function +.align 16 +AES_decrypt: + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + + movl 20(%esp), %esi + movl 28(%esp), %edi + movl %esp, %eax + subl $24, %esp + andl $-64, %esp + addl $4, %esp + movl %eax, 16(%esp) + call .L003pic_point +.L003pic_point: + popl %ebp + leal AES_Td-.L003pic_point(%ebp),%ebp + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + call _x86_AES_decrypt + movl 16(%esp), %esp + movl 24(%esp), %esi + movl %eax, (%esi) + movl %ebx, 4(%esi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.L_AES_decrypt_end: +.size AES_decrypt,.L_AES_decrypt_end-AES_decrypt +.ident "AES_decrypt" +.globl AES_Te +.globl AES_Td +.text +.globl AES_cbc_encrypt +.type AES_cbc_encrypt,@function +.align 16 +AES_cbc_encrypt: + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + + movl 28(%esp), %ecx + cmpl $0, %ecx + je .L004enc_out + call .L005pic_point +.L005pic_point: + popl %ebp + pushfl + cld + cmpl $0, 44(%esp) + je .L006DECRYPT + leal AES_Te-.L005pic_point(%ebp),%ebp + leal -308(%esp), %edi + andl $-64, %edi + movl %ebp, %eax + leal 2048(%ebp), %ebx + movl %edi, %edx + andl $4095, %eax + andl $4095, %ebx + andl $4095, %edx + cmpl %ebx, %edx + jb .L007te_break_out + subl %ebx, %edx + subl %edx, %edi + jmp .L008te_ok +.L007te_break_out: + subl %eax, %edx + andl $4095, %edx + addl $320, %edx + subl %edx, %edi +.align 4 +.L008te_ok: + movl 24(%esp), %eax + movl 28(%esp), %ebx + movl 36(%esp), %edx + movl 40(%esp), %esi + xchgl %edi, %esp + addl $4, %esp + movl %edi, 16(%esp) + movl %eax, 20(%esp) + movl %ebx, 24(%esp) + movl %ecx, 28(%esp) + movl %edx, 32(%esp) + movl %esi, 36(%esp) + movl $61, %ecx + movl %edx, %esi + leal 60(%esp), %edi + movl %edi, 32(%esp) +.align 4 + .long 4136216051 + movl %eax, %esi + movl $16, %edi +.align 4 +.L009prefetch_te: + movl (%ebp), %eax + movl 32(%ebp), %ebx + movl 64(%ebp), %ecx + movl 96(%ebp), %edx + leal 128(%ebp), %ebp + decl %edi + jnz .L009prefetch_te + subl $2048, %ebp + movl 28(%esp), %ecx + movl 36(%esp), %edi + testl $4294967280, %ecx + jz .L010enc_tail + movl (%edi), %eax + movl 4(%edi), %ebx +.align 4 +.L011enc_loop: + movl 8(%edi), %ecx + movl 12(%edi), %edx + xorl (%esi), %eax + xorl 4(%esi), %ebx + xorl 8(%esi), %ecx + xorl 12(%esi), %edx + movl 32(%esp), %edi + call _x86_AES_encrypt + movl 20(%esp), %esi + movl 24(%esp), %edi + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl 28(%esp), %ecx + leal 16(%esi), %esi + movl %esi, 20(%esp) + leal 16(%edi), %edx + movl %edx, 24(%esp) + subl $16, %ecx + testl $4294967280, %ecx + movl %ecx, 28(%esp) + jnz .L011enc_loop + testl $15, %ecx + jnz .L010enc_tail + movl 36(%esp), %esi + movl 8(%edi), %ecx + movl 12(%edi), %edx + movl %eax, (%esi) + movl %ebx, 4(%esi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + movl 32(%esp), %edi + movl 16(%esp), %esp + movl $60, %ecx + xorl %eax, %eax +.align 4 + .long 4136217587 + popfl +.L004enc_out: + popl %edi + popl %esi + popl %ebx + popl %ebp + ret + pushfl +.align 4 +.L010enc_tail: + pushl %edi + movl 24(%esp), %edi + movl $16, %ebx + subl %ecx, %ebx + cmpl %esi, %edi + je .L012enc_in_place +.align 4 + .long 4136215795 + jmp .L013enc_skip_in_place +.L012enc_in_place: + leal (%edi,%ecx), %edi +.L013enc_skip_in_place: + movl %ebx, %ecx + xorl %eax, %eax +.align 4 + .long 4136217331 + popl %edi + movl 24(%esp), %esi + movl (%edi), %eax + movl 4(%edi), %ebx + movl $16, 28(%esp) + jmp .L011enc_loop +.align 4 +.L006DECRYPT: + leal AES_Td-.L005pic_point(%ebp),%ebp + leal -308(%esp), %edi + andl $-64, %edi + movl %ebp, %eax + leal 3072(%ebp), %ebx + movl %edi, %edx + andl $4095, %eax + andl $4095, %ebx + andl $4095, %edx + cmpl %ebx, %edx + jb .L014td_break_out + subl %ebx, %edx + subl %edx, %edi + jmp .L015td_ok +.L014td_break_out: + subl %eax, %edx + andl $4095, %edx + addl $320, %edx + subl %edx, %edi +.align 4 +.L015td_ok: + movl 24(%esp), %eax + movl 28(%esp), %ebx + movl 36(%esp), %edx + movl 40(%esp), %esi + xchgl %edi, %esp + addl $4, %esp + movl %edi, 16(%esp) + movl %eax, 20(%esp) + movl %ebx, 24(%esp) + movl %ecx, 28(%esp) + movl %edx, 32(%esp) + movl %esi, 36(%esp) + movl $61, %ecx + movl %edx, %esi + leal 60(%esp), %edi + movl %edi, 32(%esp) +.align 4 + .long 4136216051 + movl %eax, %esi + movl $24, %edi +.align 4 +.L016prefetch_td: + movl (%ebp), %eax + movl 32(%ebp), %ebx + movl 64(%ebp), %ecx + movl 96(%ebp), %edx + leal 128(%ebp), %ebp + decl %edi + jnz .L016prefetch_td + subl $3072, %ebp + cmpl 24(%esp), %esi + je .L017dec_in_place + movl 36(%esp), %edi + movl %edi, 40(%esp) +.align 4 +.L018dec_loop: + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl 32(%esp), %edi + call _x86_AES_decrypt + movl 40(%esp), %edi + movl 28(%esp), %esi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + subl $16, %esi + jc .L019dec_partial + movl %esi, 28(%esp) + movl 20(%esp), %esi + movl 24(%esp), %edi + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl %esi, 40(%esp) + leal 16(%esi), %esi + movl %esi, 20(%esp) + leal 16(%edi), %edi + movl %edi, 24(%esp) + jnz .L018dec_loop + movl 40(%esp), %edi +.L020dec_end: + movl 36(%esp), %esi + movl (%edi), %eax + movl 4(%edi), %ebx + movl 8(%edi), %ecx + movl 12(%edi), %edx + movl %eax, (%esi) + movl %ebx, 4(%esi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + jmp .L021dec_out +.align 4 +.L019dec_partial: + leal 44(%esp), %edi + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + leal 16(%esi), %ecx + movl %edi, %esi + movl 24(%esp), %edi + .long 4136215795 + movl 20(%esp), %edi + jmp .L020dec_end +.align 4 +.L017dec_in_place: +.L022dec_in_place_loop: + leal 44(%esp), %edi + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl 32(%esp), %edi + call _x86_AES_decrypt + movl 36(%esp), %edi + movl 24(%esp), %esi + xorl (%edi), %eax + xorl 4(%edi), %ebx + xorl 8(%edi), %ecx + xorl 12(%edi), %edx + movl %eax, (%esi) + movl %ebx, 4(%esi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + leal 16(%esi), %esi + movl %esi, 24(%esp) + leal 44(%esp), %esi + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl 20(%esp), %esi + leal 16(%esi), %esi + movl %esi, 20(%esp) + movl 28(%esp), %ecx + subl $16, %ecx + jc .L023dec_in_place_partial + movl %ecx, 28(%esp) + jnz .L022dec_in_place_loop + jmp .L021dec_out +.align 4 +.L023dec_in_place_partial: + movl 24(%esp), %edi + leal 44(%esp), %esi + leal (%edi,%ecx), %edi + leal 16(%esi,%ecx), %esi + negl %ecx + .long 4136215795 +.align 4 +.L021dec_out: + movl 32(%esp), %edi + movl 16(%esp), %esp + movl $60, %ecx + xorl %eax, %eax +.align 4 + .long 4136217587 + popfl + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.L_AES_cbc_encrypt_end: +.size AES_cbc_encrypt,.L_AES_cbc_encrypt_end-AES_cbc_encrypt +.ident "AES_cbc_encrypt" +.globl AES_Te +.text +.globl AES_set_encrypt_key +.type AES_set_encrypt_key,@function +.align 16 +AES_set_encrypt_key: + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + + call FIPS_selftest_failed + cmpl $0,%eax + mov $-3,%eax + jne .L029exit + + movl 20(%esp), %esi + movl 28(%esp), %edi + testl $-1, %esi + jz .L024badpointer + testl $-1, %edi + jz .L024badpointer + call .L025pic_point +.L025pic_point: + popl %ebp + leal AES_Te-.L025pic_point(%ebp),%ebp + movl 24(%esp), %ecx + cmpl $128, %ecx + je .L02610rounds + cmpl $192, %ecx + je .L02712rounds + cmpl $256, %ecx + je .L02814rounds + movl $-2, %eax + jmp .L029exit +.L02610rounds: + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + xorl %ecx, %ecx + jmp .L03010shortcut +.align 4 +.L03110loop: + movl (%edi), %eax + movl 12(%edi), %edx +.L03010shortcut: + movzbl %dl, %esi + movl 2(%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $4278190080, %ebx + xorl %ebx, %eax + movl 2(%ebp,%esi,8), %ebx + shrl $16, %edx + andl $255, %ebx + movzbl %dl, %esi + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $65280, %ebx + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + andl $16711680, %ebx + xorl %ebx, %eax + xorl 2048(%ebp,%ecx,4),%eax + movl %eax, 16(%edi) + xorl 4(%edi), %eax + movl %eax, 20(%edi) + xorl 8(%edi), %eax + movl %eax, 24(%edi) + xorl 12(%edi), %eax + movl %eax, 28(%edi) + incl %ecx + addl $16, %edi + cmpl $10, %ecx + jl .L03110loop + movl $10, 80(%edi) + xorl %eax, %eax + jmp .L029exit +.L02712rounds: + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl 16(%esi), %ecx + movl 20(%esi), %edx + movl %ecx, 16(%edi) + movl %edx, 20(%edi) + xorl %ecx, %ecx + jmp .L03212shortcut +.align 4 +.L03312loop: + movl (%edi), %eax + movl 20(%edi), %edx +.L03212shortcut: + movzbl %dl, %esi + movl 2(%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $4278190080, %ebx + xorl %ebx, %eax + movl 2(%ebp,%esi,8), %ebx + shrl $16, %edx + andl $255, %ebx + movzbl %dl, %esi + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $65280, %ebx + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + andl $16711680, %ebx + xorl %ebx, %eax + xorl 2048(%ebp,%ecx,4),%eax + movl %eax, 24(%edi) + xorl 4(%edi), %eax + movl %eax, 28(%edi) + xorl 8(%edi), %eax + movl %eax, 32(%edi) + xorl 12(%edi), %eax + movl %eax, 36(%edi) + cmpl $7, %ecx + je .L03412break + incl %ecx + xorl 16(%edi), %eax + movl %eax, 40(%edi) + xorl 20(%edi), %eax + movl %eax, 44(%edi) + addl $24, %edi + jmp .L03312loop +.L03412break: + movl $12, 72(%edi) + xorl %eax, %eax + jmp .L029exit +.L02814rounds: + movl (%esi), %eax + movl 4(%esi), %ebx + movl 8(%esi), %ecx + movl 12(%esi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, 8(%edi) + movl %edx, 12(%edi) + movl 16(%esi), %eax + movl 20(%esi), %ebx + movl 24(%esi), %ecx + movl 28(%esi), %edx + movl %eax, 16(%edi) + movl %ebx, 20(%edi) + movl %ecx, 24(%edi) + movl %edx, 28(%edi) + xorl %ecx, %ecx + jmp .L03514shortcut +.align 4 +.L03614loop: + movl 28(%edi), %edx +.L03514shortcut: + movl (%edi), %eax + movzbl %dl, %esi + movl 2(%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $4278190080, %ebx + xorl %ebx, %eax + movl 2(%ebp,%esi,8), %ebx + shrl $16, %edx + andl $255, %ebx + movzbl %dl, %esi + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $65280, %ebx + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + andl $16711680, %ebx + xorl %ebx, %eax + xorl 2048(%ebp,%ecx,4),%eax + movl %eax, 32(%edi) + xorl 4(%edi), %eax + movl %eax, 36(%edi) + xorl 8(%edi), %eax + movl %eax, 40(%edi) + xorl 12(%edi), %eax + movl %eax, 44(%edi) + cmpl $6, %ecx + je .L03714break + incl %ecx + movl %eax, %edx + movl 16(%edi), %eax + movzbl %dl, %esi + movl 2(%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $255, %ebx + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + shrl $16, %edx + andl $65280, %ebx + movzbl %dl, %esi + xorl %ebx, %eax + movl (%ebp,%esi,8), %ebx + movzbl %dh, %esi + andl $16711680, %ebx + xorl %ebx, %eax + movl 2(%ebp,%esi,8), %ebx + andl $4278190080, %ebx + xorl %ebx, %eax + movl %eax, 48(%edi) + xorl 20(%edi), %eax + movl %eax, 52(%edi) + xorl 24(%edi), %eax + movl %eax, 56(%edi) + xorl 28(%edi), %eax + movl %eax, 60(%edi) + addl $32, %edi + jmp .L03614loop +.L03714break: + movl $14, 48(%edi) + xorl %eax, %eax + jmp .L029exit +.L024badpointer: + movl $-1, %eax +.L029exit: + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.L_AES_set_encrypt_key_end: +.size AES_set_encrypt_key,.L_AES_set_encrypt_key_end-AES_set_encrypt_key +.ident "AES_set_encrypt_key" +.globl AES_Td +.globl AES_Te +.text +.globl AES_set_decrypt_key +.type AES_set_decrypt_key,@function +.align 16 +AES_set_decrypt_key: + movl 4(%esp), %eax + movl 8(%esp), %ecx + movl 12(%esp), %edx + subl $12, %esp + movl %eax, (%esp) + movl %ecx, 4(%esp) + movl %edx, 8(%esp) + call AES_set_encrypt_key + addl $12, %esp + cmpl $0, %eax + je .L038proceed + ret +.L038proceed: + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + movl 28(%esp), %esi + movl 240(%esi), %ecx + leal (,%ecx,4), %ecx + leal (%esi,%ecx,4), %edi +.align 4 +.L039invert: + movl (%esi), %eax + movl 4(%esi), %ebx + movl (%edi), %ecx + movl 4(%edi), %edx + movl %eax, (%edi) + movl %ebx, 4(%edi) + movl %ecx, (%esi) + movl %edx, 4(%esi) + movl 8(%esi), %eax + movl 12(%esi), %ebx + movl 8(%edi), %ecx + movl 12(%edi), %edx + movl %eax, 8(%edi) + movl %ebx, 12(%edi) + movl %ecx, 8(%esi) + movl %edx, 12(%esi) + addl $16, %esi + subl $16, %edi + cmpl %edi, %esi + jne .L039invert + call .L040pic_point +.L040pic_point: + popl %ebp + leal AES_Td-.L040pic_point(%ebp),%edi + leal AES_Te-.L040pic_point(%ebp),%ebp + movl 28(%esp), %esi + movl 240(%esi), %ecx + decl %ecx +.align 4 +.L041permute: + addl $16, %esi + movl (%esi), %eax + movl %eax, %edx + movzbl %ah, %ebx + shrl $16, %edx + andl $255, %eax + movzbl 2(%ebp,%eax,8), %eax + movzbl 2(%ebp,%ebx,8), %ebx + movl (%edi,%eax,8), %eax + xorl 3(%edi,%ebx,8), %eax + movzbl %dh, %ebx + andl $255, %edx + movzbl 2(%ebp,%edx,8), %edx + movzbl 2(%ebp,%ebx,8), %ebx + xorl 2(%edi,%edx,8), %eax + xorl 1(%edi,%ebx,8), %eax + movl %eax, (%esi) + movl 4(%esi), %eax + movl %eax, %edx + movzbl %ah, %ebx + shrl $16, %edx + andl $255, %eax + movzbl 2(%ebp,%eax,8), %eax + movzbl 2(%ebp,%ebx,8), %ebx + movl (%edi,%eax,8), %eax + xorl 3(%edi,%ebx,8), %eax + movzbl %dh, %ebx + andl $255, %edx + movzbl 2(%ebp,%edx,8), %edx + movzbl 2(%ebp,%ebx,8), %ebx + xorl 2(%edi,%edx,8), %eax + xorl 1(%edi,%ebx,8), %eax + movl %eax, 4(%esi) + movl 8(%esi), %eax + movl %eax, %edx + movzbl %ah, %ebx + shrl $16, %edx + andl $255, %eax + movzbl 2(%ebp,%eax,8), %eax + movzbl 2(%ebp,%ebx,8), %ebx + movl (%edi,%eax,8), %eax + xorl 3(%edi,%ebx,8), %eax + movzbl %dh, %ebx + andl $255, %edx + movzbl 2(%ebp,%edx,8), %edx + movzbl 2(%ebp,%ebx,8), %ebx + xorl 2(%edi,%edx,8), %eax + xorl 1(%edi,%ebx,8), %eax + movl %eax, 8(%esi) + movl 12(%esi), %eax + movl %eax, %edx + movzbl %ah, %ebx + shrl $16, %edx + andl $255, %eax + movzbl 2(%ebp,%eax,8), %eax + movzbl 2(%ebp,%ebx,8), %ebx + movl (%edi,%eax,8), %eax + xorl 3(%edi,%ebx,8), %eax + movzbl %dh, %ebx + andl $255, %edx + movzbl 2(%ebp,%edx,8), %edx + movzbl 2(%ebp,%ebx,8), %ebx + xorl 2(%edi,%edx,8), %eax + xorl 1(%edi,%ebx,8), %eax + movl %eax, 12(%esi) + decl %ecx + jnz .L041permute + xorl %eax, %eax + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.L_AES_set_decrypt_key_end: +.size AES_set_decrypt_key,.L_AES_set_decrypt_key_end-AES_set_decrypt_key +.ident "AES_set_decrypt_key" diff --git a/lib/libssl/src/fips-1.0/aes/fips_aes_core.c b/lib/libssl/src/fips-1.0/aes/fips_aes_core.c new file mode 100644 index 00000000000..82199c92e67 --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/fips_aes_core.c @@ -0,0 +1,1263 @@ +/* crypto/aes/aes_core.c -*- mode:C; c-file-style: "eay" -*- */ +/** + * rijndael-alg-fst.c + * + * @version 3.0 (December 2000) + * + * Optimised ANSI C code for the Rijndael cipher (now AES) + * + * @author Vincent Rijmen <vincent.rijmen@esat.kuleuven.ac.be> + * @author Antoon Bosselaers <antoon.bosselaers@esat.kuleuven.ac.be> + * @author Paulo Barreto <paulo.barreto@terra.com.br> + * + * This code is hereby placed in the public domain. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHORS ''AS IS'' AND ANY EXPRESS + * OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + * WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHORS OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR + * BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + * WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE + * OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, + * EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* Note: rewritten a little bit to provide error control and an OpenSSL- + compatible API */ + +#ifndef AES_DEBUG +# ifndef NDEBUG +# define NDEBUG +# endif +#endif +#include <assert.h> + +#include <stdlib.h> +#include <openssl/aes.h> +#include "fips_aes_locl.h" +#include <openssl/fips.h> + +#ifdef OPENSSL_FIPS + +/* +Te0[x] = S [x].[02, 01, 01, 03]; +Te1[x] = S [x].[03, 02, 01, 01]; +Te2[x] = S [x].[01, 03, 02, 01]; +Te3[x] = S [x].[01, 01, 03, 02]; +Te4[x] = S [x].[01, 01, 01, 01]; + +Td0[x] = Si[x].[0e, 09, 0d, 0b]; +Td1[x] = Si[x].[0b, 0e, 09, 0d]; +Td2[x] = Si[x].[0d, 0b, 0e, 09]; +Td3[x] = Si[x].[09, 0d, 0b, 0e]; +Td4[x] = Si[x].[01, 01, 01, 01]; +*/ + +static const u32 Te0[256] = { + 0xc66363a5U, 0xf87c7c84U, 0xee777799U, 0xf67b7b8dU, + 0xfff2f20dU, 0xd66b6bbdU, 0xde6f6fb1U, 0x91c5c554U, + 0x60303050U, 0x02010103U, 0xce6767a9U, 0x562b2b7dU, + 0xe7fefe19U, 0xb5d7d762U, 0x4dababe6U, 0xec76769aU, + 0x8fcaca45U, 0x1f82829dU, 0x89c9c940U, 0xfa7d7d87U, + 0xeffafa15U, 0xb25959ebU, 0x8e4747c9U, 0xfbf0f00bU, + 0x41adadecU, 0xb3d4d467U, 0x5fa2a2fdU, 0x45afafeaU, + 0x239c9cbfU, 0x53a4a4f7U, 0xe4727296U, 0x9bc0c05bU, + 0x75b7b7c2U, 0xe1fdfd1cU, 0x3d9393aeU, 0x4c26266aU, + 0x6c36365aU, 0x7e3f3f41U, 0xf5f7f702U, 0x83cccc4fU, + 0x6834345cU, 0x51a5a5f4U, 0xd1e5e534U, 0xf9f1f108U, + 0xe2717193U, 0xabd8d873U, 0x62313153U, 0x2a15153fU, + 0x0804040cU, 0x95c7c752U, 0x46232365U, 0x9dc3c35eU, + 0x30181828U, 0x379696a1U, 0x0a05050fU, 0x2f9a9ab5U, + 0x0e070709U, 0x24121236U, 0x1b80809bU, 0xdfe2e23dU, + 0xcdebeb26U, 0x4e272769U, 0x7fb2b2cdU, 0xea75759fU, + 0x1209091bU, 0x1d83839eU, 0x582c2c74U, 0x341a1a2eU, + 0x361b1b2dU, 0xdc6e6eb2U, 0xb45a5aeeU, 0x5ba0a0fbU, + 0xa45252f6U, 0x763b3b4dU, 0xb7d6d661U, 0x7db3b3ceU, + 0x5229297bU, 0xdde3e33eU, 0x5e2f2f71U, 0x13848497U, + 0xa65353f5U, 0xb9d1d168U, 0x00000000U, 0xc1eded2cU, + 0x40202060U, 0xe3fcfc1fU, 0x79b1b1c8U, 0xb65b5bedU, + 0xd46a6abeU, 0x8dcbcb46U, 0x67bebed9U, 0x7239394bU, + 0x944a4adeU, 0x984c4cd4U, 0xb05858e8U, 0x85cfcf4aU, + 0xbbd0d06bU, 0xc5efef2aU, 0x4faaaae5U, 0xedfbfb16U, + 0x864343c5U, 0x9a4d4dd7U, 0x66333355U, 0x11858594U, + 0x8a4545cfU, 0xe9f9f910U, 0x04020206U, 0xfe7f7f81U, + 0xa05050f0U, 0x783c3c44U, 0x259f9fbaU, 0x4ba8a8e3U, + 0xa25151f3U, 0x5da3a3feU, 0x804040c0U, 0x058f8f8aU, + 0x3f9292adU, 0x219d9dbcU, 0x70383848U, 0xf1f5f504U, + 0x63bcbcdfU, 0x77b6b6c1U, 0xafdada75U, 0x42212163U, + 0x20101030U, 0xe5ffff1aU, 0xfdf3f30eU, 0xbfd2d26dU, + 0x81cdcd4cU, 0x180c0c14U, 0x26131335U, 0xc3ecec2fU, + 0xbe5f5fe1U, 0x359797a2U, 0x884444ccU, 0x2e171739U, + 0x93c4c457U, 0x55a7a7f2U, 0xfc7e7e82U, 0x7a3d3d47U, + 0xc86464acU, 0xba5d5de7U, 0x3219192bU, 0xe6737395U, + 0xc06060a0U, 0x19818198U, 0x9e4f4fd1U, 0xa3dcdc7fU, + 0x44222266U, 0x542a2a7eU, 0x3b9090abU, 0x0b888883U, + 0x8c4646caU, 0xc7eeee29U, 0x6bb8b8d3U, 0x2814143cU, + 0xa7dede79U, 0xbc5e5ee2U, 0x160b0b1dU, 0xaddbdb76U, + 0xdbe0e03bU, 0x64323256U, 0x743a3a4eU, 0x140a0a1eU, + 0x924949dbU, 0x0c06060aU, 0x4824246cU, 0xb85c5ce4U, + 0x9fc2c25dU, 0xbdd3d36eU, 0x43acacefU, 0xc46262a6U, + 0x399191a8U, 0x319595a4U, 0xd3e4e437U, 0xf279798bU, + 0xd5e7e732U, 0x8bc8c843U, 0x6e373759U, 0xda6d6db7U, + 0x018d8d8cU, 0xb1d5d564U, 0x9c4e4ed2U, 0x49a9a9e0U, + 0xd86c6cb4U, 0xac5656faU, 0xf3f4f407U, 0xcfeaea25U, + 0xca6565afU, 0xf47a7a8eU, 0x47aeaee9U, 0x10080818U, + 0x6fbabad5U, 0xf0787888U, 0x4a25256fU, 0x5c2e2e72U, + 0x381c1c24U, 0x57a6a6f1U, 0x73b4b4c7U, 0x97c6c651U, + 0xcbe8e823U, 0xa1dddd7cU, 0xe874749cU, 0x3e1f1f21U, + 0x964b4bddU, 0x61bdbddcU, 0x0d8b8b86U, 0x0f8a8a85U, + 0xe0707090U, 0x7c3e3e42U, 0x71b5b5c4U, 0xcc6666aaU, + 0x904848d8U, 0x06030305U, 0xf7f6f601U, 0x1c0e0e12U, + 0xc26161a3U, 0x6a35355fU, 0xae5757f9U, 0x69b9b9d0U, + 0x17868691U, 0x99c1c158U, 0x3a1d1d27U, 0x279e9eb9U, + 0xd9e1e138U, 0xebf8f813U, 0x2b9898b3U, 0x22111133U, + 0xd26969bbU, 0xa9d9d970U, 0x078e8e89U, 0x339494a7U, + 0x2d9b9bb6U, 0x3c1e1e22U, 0x15878792U, 0xc9e9e920U, + 0x87cece49U, 0xaa5555ffU, 0x50282878U, 0xa5dfdf7aU, + 0x038c8c8fU, 0x59a1a1f8U, 0x09898980U, 0x1a0d0d17U, + 0x65bfbfdaU, 0xd7e6e631U, 0x844242c6U, 0xd06868b8U, + 0x824141c3U, 0x299999b0U, 0x5a2d2d77U, 0x1e0f0f11U, + 0x7bb0b0cbU, 0xa85454fcU, 0x6dbbbbd6U, 0x2c16163aU, +}; +static const u32 Te1[256] = { + 0xa5c66363U, 0x84f87c7cU, 0x99ee7777U, 0x8df67b7bU, + 0x0dfff2f2U, 0xbdd66b6bU, 0xb1de6f6fU, 0x5491c5c5U, + 0x50603030U, 0x03020101U, 0xa9ce6767U, 0x7d562b2bU, + 0x19e7fefeU, 0x62b5d7d7U, 0xe64dababU, 0x9aec7676U, + 0x458fcacaU, 0x9d1f8282U, 0x4089c9c9U, 0x87fa7d7dU, + 0x15effafaU, 0xebb25959U, 0xc98e4747U, 0x0bfbf0f0U, + 0xec41adadU, 0x67b3d4d4U, 0xfd5fa2a2U, 0xea45afafU, + 0xbf239c9cU, 0xf753a4a4U, 0x96e47272U, 0x5b9bc0c0U, + 0xc275b7b7U, 0x1ce1fdfdU, 0xae3d9393U, 0x6a4c2626U, + 0x5a6c3636U, 0x417e3f3fU, 0x02f5f7f7U, 0x4f83ccccU, + 0x5c683434U, 0xf451a5a5U, 0x34d1e5e5U, 0x08f9f1f1U, + 0x93e27171U, 0x73abd8d8U, 0x53623131U, 0x3f2a1515U, + 0x0c080404U, 0x5295c7c7U, 0x65462323U, 0x5e9dc3c3U, + 0x28301818U, 0xa1379696U, 0x0f0a0505U, 0xb52f9a9aU, + 0x090e0707U, 0x36241212U, 0x9b1b8080U, 0x3ddfe2e2U, + 0x26cdebebU, 0x694e2727U, 0xcd7fb2b2U, 0x9fea7575U, + 0x1b120909U, 0x9e1d8383U, 0x74582c2cU, 0x2e341a1aU, + 0x2d361b1bU, 0xb2dc6e6eU, 0xeeb45a5aU, 0xfb5ba0a0U, + 0xf6a45252U, 0x4d763b3bU, 0x61b7d6d6U, 0xce7db3b3U, + 0x7b522929U, 0x3edde3e3U, 0x715e2f2fU, 0x97138484U, + 0xf5a65353U, 0x68b9d1d1U, 0x00000000U, 0x2cc1ededU, + 0x60402020U, 0x1fe3fcfcU, 0xc879b1b1U, 0xedb65b5bU, + 0xbed46a6aU, 0x468dcbcbU, 0xd967bebeU, 0x4b723939U, + 0xde944a4aU, 0xd4984c4cU, 0xe8b05858U, 0x4a85cfcfU, + 0x6bbbd0d0U, 0x2ac5efefU, 0xe54faaaaU, 0x16edfbfbU, + 0xc5864343U, 0xd79a4d4dU, 0x55663333U, 0x94118585U, + 0xcf8a4545U, 0x10e9f9f9U, 0x06040202U, 0x81fe7f7fU, + 0xf0a05050U, 0x44783c3cU, 0xba259f9fU, 0xe34ba8a8U, + 0xf3a25151U, 0xfe5da3a3U, 0xc0804040U, 0x8a058f8fU, + 0xad3f9292U, 0xbc219d9dU, 0x48703838U, 0x04f1f5f5U, + 0xdf63bcbcU, 0xc177b6b6U, 0x75afdadaU, 0x63422121U, + 0x30201010U, 0x1ae5ffffU, 0x0efdf3f3U, 0x6dbfd2d2U, + 0x4c81cdcdU, 0x14180c0cU, 0x35261313U, 0x2fc3ececU, + 0xe1be5f5fU, 0xa2359797U, 0xcc884444U, 0x392e1717U, + 0x5793c4c4U, 0xf255a7a7U, 0x82fc7e7eU, 0x477a3d3dU, + 0xacc86464U, 0xe7ba5d5dU, 0x2b321919U, 0x95e67373U, + 0xa0c06060U, 0x98198181U, 0xd19e4f4fU, 0x7fa3dcdcU, + 0x66442222U, 0x7e542a2aU, 0xab3b9090U, 0x830b8888U, + 0xca8c4646U, 0x29c7eeeeU, 0xd36bb8b8U, 0x3c281414U, + 0x79a7dedeU, 0xe2bc5e5eU, 0x1d160b0bU, 0x76addbdbU, + 0x3bdbe0e0U, 0x56643232U, 0x4e743a3aU, 0x1e140a0aU, + 0xdb924949U, 0x0a0c0606U, 0x6c482424U, 0xe4b85c5cU, + 0x5d9fc2c2U, 0x6ebdd3d3U, 0xef43acacU, 0xa6c46262U, + 0xa8399191U, 0xa4319595U, 0x37d3e4e4U, 0x8bf27979U, + 0x32d5e7e7U, 0x438bc8c8U, 0x596e3737U, 0xb7da6d6dU, + 0x8c018d8dU, 0x64b1d5d5U, 0xd29c4e4eU, 0xe049a9a9U, + 0xb4d86c6cU, 0xfaac5656U, 0x07f3f4f4U, 0x25cfeaeaU, + 0xafca6565U, 0x8ef47a7aU, 0xe947aeaeU, 0x18100808U, + 0xd56fbabaU, 0x88f07878U, 0x6f4a2525U, 0x725c2e2eU, + 0x24381c1cU, 0xf157a6a6U, 0xc773b4b4U, 0x5197c6c6U, + 0x23cbe8e8U, 0x7ca1ddddU, 0x9ce87474U, 0x213e1f1fU, + 0xdd964b4bU, 0xdc61bdbdU, 0x860d8b8bU, 0x850f8a8aU, + 0x90e07070U, 0x427c3e3eU, 0xc471b5b5U, 0xaacc6666U, + 0xd8904848U, 0x05060303U, 0x01f7f6f6U, 0x121c0e0eU, + 0xa3c26161U, 0x5f6a3535U, 0xf9ae5757U, 0xd069b9b9U, + 0x91178686U, 0x5899c1c1U, 0x273a1d1dU, 0xb9279e9eU, + 0x38d9e1e1U, 0x13ebf8f8U, 0xb32b9898U, 0x33221111U, + 0xbbd26969U, 0x70a9d9d9U, 0x89078e8eU, 0xa7339494U, + 0xb62d9b9bU, 0x223c1e1eU, 0x92158787U, 0x20c9e9e9U, + 0x4987ceceU, 0xffaa5555U, 0x78502828U, 0x7aa5dfdfU, + 0x8f038c8cU, 0xf859a1a1U, 0x80098989U, 0x171a0d0dU, + 0xda65bfbfU, 0x31d7e6e6U, 0xc6844242U, 0xb8d06868U, + 0xc3824141U, 0xb0299999U, 0x775a2d2dU, 0x111e0f0fU, + 0xcb7bb0b0U, 0xfca85454U, 0xd66dbbbbU, 0x3a2c1616U, +}; +static const u32 Te2[256] = { + 0x63a5c663U, 0x7c84f87cU, 0x7799ee77U, 0x7b8df67bU, + 0xf20dfff2U, 0x6bbdd66bU, 0x6fb1de6fU, 0xc55491c5U, + 0x30506030U, 0x01030201U, 0x67a9ce67U, 0x2b7d562bU, + 0xfe19e7feU, 0xd762b5d7U, 0xabe64dabU, 0x769aec76U, + 0xca458fcaU, 0x829d1f82U, 0xc94089c9U, 0x7d87fa7dU, + 0xfa15effaU, 0x59ebb259U, 0x47c98e47U, 0xf00bfbf0U, + 0xadec41adU, 0xd467b3d4U, 0xa2fd5fa2U, 0xafea45afU, + 0x9cbf239cU, 0xa4f753a4U, 0x7296e472U, 0xc05b9bc0U, + 0xb7c275b7U, 0xfd1ce1fdU, 0x93ae3d93U, 0x266a4c26U, + 0x365a6c36U, 0x3f417e3fU, 0xf702f5f7U, 0xcc4f83ccU, + 0x345c6834U, 0xa5f451a5U, 0xe534d1e5U, 0xf108f9f1U, + 0x7193e271U, 0xd873abd8U, 0x31536231U, 0x153f2a15U, + 0x040c0804U, 0xc75295c7U, 0x23654623U, 0xc35e9dc3U, + 0x18283018U, 0x96a13796U, 0x050f0a05U, 0x9ab52f9aU, + 0x07090e07U, 0x12362412U, 0x809b1b80U, 0xe23ddfe2U, + 0xeb26cdebU, 0x27694e27U, 0xb2cd7fb2U, 0x759fea75U, + 0x091b1209U, 0x839e1d83U, 0x2c74582cU, 0x1a2e341aU, + 0x1b2d361bU, 0x6eb2dc6eU, 0x5aeeb45aU, 0xa0fb5ba0U, + 0x52f6a452U, 0x3b4d763bU, 0xd661b7d6U, 0xb3ce7db3U, + 0x297b5229U, 0xe33edde3U, 0x2f715e2fU, 0x84971384U, + 0x53f5a653U, 0xd168b9d1U, 0x00000000U, 0xed2cc1edU, + 0x20604020U, 0xfc1fe3fcU, 0xb1c879b1U, 0x5bedb65bU, + 0x6abed46aU, 0xcb468dcbU, 0xbed967beU, 0x394b7239U, + 0x4ade944aU, 0x4cd4984cU, 0x58e8b058U, 0xcf4a85cfU, + 0xd06bbbd0U, 0xef2ac5efU, 0xaae54faaU, 0xfb16edfbU, + 0x43c58643U, 0x4dd79a4dU, 0x33556633U, 0x85941185U, + 0x45cf8a45U, 0xf910e9f9U, 0x02060402U, 0x7f81fe7fU, + 0x50f0a050U, 0x3c44783cU, 0x9fba259fU, 0xa8e34ba8U, + 0x51f3a251U, 0xa3fe5da3U, 0x40c08040U, 0x8f8a058fU, + 0x92ad3f92U, 0x9dbc219dU, 0x38487038U, 0xf504f1f5U, + 0xbcdf63bcU, 0xb6c177b6U, 0xda75afdaU, 0x21634221U, + 0x10302010U, 0xff1ae5ffU, 0xf30efdf3U, 0xd26dbfd2U, + 0xcd4c81cdU, 0x0c14180cU, 0x13352613U, 0xec2fc3ecU, + 0x5fe1be5fU, 0x97a23597U, 0x44cc8844U, 0x17392e17U, + 0xc45793c4U, 0xa7f255a7U, 0x7e82fc7eU, 0x3d477a3dU, + 0x64acc864U, 0x5de7ba5dU, 0x192b3219U, 0x7395e673U, + 0x60a0c060U, 0x81981981U, 0x4fd19e4fU, 0xdc7fa3dcU, + 0x22664422U, 0x2a7e542aU, 0x90ab3b90U, 0x88830b88U, + 0x46ca8c46U, 0xee29c7eeU, 0xb8d36bb8U, 0x143c2814U, + 0xde79a7deU, 0x5ee2bc5eU, 0x0b1d160bU, 0xdb76addbU, + 0xe03bdbe0U, 0x32566432U, 0x3a4e743aU, 0x0a1e140aU, + 0x49db9249U, 0x060a0c06U, 0x246c4824U, 0x5ce4b85cU, + 0xc25d9fc2U, 0xd36ebdd3U, 0xacef43acU, 0x62a6c462U, + 0x91a83991U, 0x95a43195U, 0xe437d3e4U, 0x798bf279U, + 0xe732d5e7U, 0xc8438bc8U, 0x37596e37U, 0x6db7da6dU, + 0x8d8c018dU, 0xd564b1d5U, 0x4ed29c4eU, 0xa9e049a9U, + 0x6cb4d86cU, 0x56faac56U, 0xf407f3f4U, 0xea25cfeaU, + 0x65afca65U, 0x7a8ef47aU, 0xaee947aeU, 0x08181008U, + 0xbad56fbaU, 0x7888f078U, 0x256f4a25U, 0x2e725c2eU, + 0x1c24381cU, 0xa6f157a6U, 0xb4c773b4U, 0xc65197c6U, + 0xe823cbe8U, 0xdd7ca1ddU, 0x749ce874U, 0x1f213e1fU, + 0x4bdd964bU, 0xbddc61bdU, 0x8b860d8bU, 0x8a850f8aU, + 0x7090e070U, 0x3e427c3eU, 0xb5c471b5U, 0x66aacc66U, + 0x48d89048U, 0x03050603U, 0xf601f7f6U, 0x0e121c0eU, + 0x61a3c261U, 0x355f6a35U, 0x57f9ae57U, 0xb9d069b9U, + 0x86911786U, 0xc15899c1U, 0x1d273a1dU, 0x9eb9279eU, + 0xe138d9e1U, 0xf813ebf8U, 0x98b32b98U, 0x11332211U, + 0x69bbd269U, 0xd970a9d9U, 0x8e89078eU, 0x94a73394U, + 0x9bb62d9bU, 0x1e223c1eU, 0x87921587U, 0xe920c9e9U, + 0xce4987ceU, 0x55ffaa55U, 0x28785028U, 0xdf7aa5dfU, + 0x8c8f038cU, 0xa1f859a1U, 0x89800989U, 0x0d171a0dU, + 0xbfda65bfU, 0xe631d7e6U, 0x42c68442U, 0x68b8d068U, + 0x41c38241U, 0x99b02999U, 0x2d775a2dU, 0x0f111e0fU, + 0xb0cb7bb0U, 0x54fca854U, 0xbbd66dbbU, 0x163a2c16U, +}; +static const u32 Te3[256] = { + + 0x6363a5c6U, 0x7c7c84f8U, 0x777799eeU, 0x7b7b8df6U, + 0xf2f20dffU, 0x6b6bbdd6U, 0x6f6fb1deU, 0xc5c55491U, + 0x30305060U, 0x01010302U, 0x6767a9ceU, 0x2b2b7d56U, + 0xfefe19e7U, 0xd7d762b5U, 0xababe64dU, 0x76769aecU, + 0xcaca458fU, 0x82829d1fU, 0xc9c94089U, 0x7d7d87faU, + 0xfafa15efU, 0x5959ebb2U, 0x4747c98eU, 0xf0f00bfbU, + 0xadadec41U, 0xd4d467b3U, 0xa2a2fd5fU, 0xafafea45U, + 0x9c9cbf23U, 0xa4a4f753U, 0x727296e4U, 0xc0c05b9bU, + 0xb7b7c275U, 0xfdfd1ce1U, 0x9393ae3dU, 0x26266a4cU, + 0x36365a6cU, 0x3f3f417eU, 0xf7f702f5U, 0xcccc4f83U, + 0x34345c68U, 0xa5a5f451U, 0xe5e534d1U, 0xf1f108f9U, + 0x717193e2U, 0xd8d873abU, 0x31315362U, 0x15153f2aU, + 0x04040c08U, 0xc7c75295U, 0x23236546U, 0xc3c35e9dU, + 0x18182830U, 0x9696a137U, 0x05050f0aU, 0x9a9ab52fU, + 0x0707090eU, 0x12123624U, 0x80809b1bU, 0xe2e23ddfU, + 0xebeb26cdU, 0x2727694eU, 0xb2b2cd7fU, 0x75759feaU, + 0x09091b12U, 0x83839e1dU, 0x2c2c7458U, 0x1a1a2e34U, + 0x1b1b2d36U, 0x6e6eb2dcU, 0x5a5aeeb4U, 0xa0a0fb5bU, + 0x5252f6a4U, 0x3b3b4d76U, 0xd6d661b7U, 0xb3b3ce7dU, + 0x29297b52U, 0xe3e33eddU, 0x2f2f715eU, 0x84849713U, + 0x5353f5a6U, 0xd1d168b9U, 0x00000000U, 0xeded2cc1U, + 0x20206040U, 0xfcfc1fe3U, 0xb1b1c879U, 0x5b5bedb6U, + 0x6a6abed4U, 0xcbcb468dU, 0xbebed967U, 0x39394b72U, + 0x4a4ade94U, 0x4c4cd498U, 0x5858e8b0U, 0xcfcf4a85U, + 0xd0d06bbbU, 0xefef2ac5U, 0xaaaae54fU, 0xfbfb16edU, + 0x4343c586U, 0x4d4dd79aU, 0x33335566U, 0x85859411U, + 0x4545cf8aU, 0xf9f910e9U, 0x02020604U, 0x7f7f81feU, + 0x5050f0a0U, 0x3c3c4478U, 0x9f9fba25U, 0xa8a8e34bU, + 0x5151f3a2U, 0xa3a3fe5dU, 0x4040c080U, 0x8f8f8a05U, + 0x9292ad3fU, 0x9d9dbc21U, 0x38384870U, 0xf5f504f1U, + 0xbcbcdf63U, 0xb6b6c177U, 0xdada75afU, 0x21216342U, + 0x10103020U, 0xffff1ae5U, 0xf3f30efdU, 0xd2d26dbfU, + 0xcdcd4c81U, 0x0c0c1418U, 0x13133526U, 0xecec2fc3U, + 0x5f5fe1beU, 0x9797a235U, 0x4444cc88U, 0x1717392eU, + 0xc4c45793U, 0xa7a7f255U, 0x7e7e82fcU, 0x3d3d477aU, + 0x6464acc8U, 0x5d5de7baU, 0x19192b32U, 0x737395e6U, + 0x6060a0c0U, 0x81819819U, 0x4f4fd19eU, 0xdcdc7fa3U, + 0x22226644U, 0x2a2a7e54U, 0x9090ab3bU, 0x8888830bU, + 0x4646ca8cU, 0xeeee29c7U, 0xb8b8d36bU, 0x14143c28U, + 0xdede79a7U, 0x5e5ee2bcU, 0x0b0b1d16U, 0xdbdb76adU, + 0xe0e03bdbU, 0x32325664U, 0x3a3a4e74U, 0x0a0a1e14U, + 0x4949db92U, 0x06060a0cU, 0x24246c48U, 0x5c5ce4b8U, + 0xc2c25d9fU, 0xd3d36ebdU, 0xacacef43U, 0x6262a6c4U, + 0x9191a839U, 0x9595a431U, 0xe4e437d3U, 0x79798bf2U, + 0xe7e732d5U, 0xc8c8438bU, 0x3737596eU, 0x6d6db7daU, + 0x8d8d8c01U, 0xd5d564b1U, 0x4e4ed29cU, 0xa9a9e049U, + 0x6c6cb4d8U, 0x5656faacU, 0xf4f407f3U, 0xeaea25cfU, + 0x6565afcaU, 0x7a7a8ef4U, 0xaeaee947U, 0x08081810U, + 0xbabad56fU, 0x787888f0U, 0x25256f4aU, 0x2e2e725cU, + 0x1c1c2438U, 0xa6a6f157U, 0xb4b4c773U, 0xc6c65197U, + 0xe8e823cbU, 0xdddd7ca1U, 0x74749ce8U, 0x1f1f213eU, + 0x4b4bdd96U, 0xbdbddc61U, 0x8b8b860dU, 0x8a8a850fU, + 0x707090e0U, 0x3e3e427cU, 0xb5b5c471U, 0x6666aaccU, + 0x4848d890U, 0x03030506U, 0xf6f601f7U, 0x0e0e121cU, + 0x6161a3c2U, 0x35355f6aU, 0x5757f9aeU, 0xb9b9d069U, + 0x86869117U, 0xc1c15899U, 0x1d1d273aU, 0x9e9eb927U, + 0xe1e138d9U, 0xf8f813ebU, 0x9898b32bU, 0x11113322U, + 0x6969bbd2U, 0xd9d970a9U, 0x8e8e8907U, 0x9494a733U, + 0x9b9bb62dU, 0x1e1e223cU, 0x87879215U, 0xe9e920c9U, + 0xcece4987U, 0x5555ffaaU, 0x28287850U, 0xdfdf7aa5U, + 0x8c8c8f03U, 0xa1a1f859U, 0x89898009U, 0x0d0d171aU, + 0xbfbfda65U, 0xe6e631d7U, 0x4242c684U, 0x6868b8d0U, + 0x4141c382U, 0x9999b029U, 0x2d2d775aU, 0x0f0f111eU, + 0xb0b0cb7bU, 0x5454fca8U, 0xbbbbd66dU, 0x16163a2cU, +}; +static const u32 Te4[256] = { + 0x63636363U, 0x7c7c7c7cU, 0x77777777U, 0x7b7b7b7bU, + 0xf2f2f2f2U, 0x6b6b6b6bU, 0x6f6f6f6fU, 0xc5c5c5c5U, + 0x30303030U, 0x01010101U, 0x67676767U, 0x2b2b2b2bU, + 0xfefefefeU, 0xd7d7d7d7U, 0xababababU, 0x76767676U, + 0xcacacacaU, 0x82828282U, 0xc9c9c9c9U, 0x7d7d7d7dU, + 0xfafafafaU, 0x59595959U, 0x47474747U, 0xf0f0f0f0U, + 0xadadadadU, 0xd4d4d4d4U, 0xa2a2a2a2U, 0xafafafafU, + 0x9c9c9c9cU, 0xa4a4a4a4U, 0x72727272U, 0xc0c0c0c0U, + 0xb7b7b7b7U, 0xfdfdfdfdU, 0x93939393U, 0x26262626U, + 0x36363636U, 0x3f3f3f3fU, 0xf7f7f7f7U, 0xccccccccU, + 0x34343434U, 0xa5a5a5a5U, 0xe5e5e5e5U, 0xf1f1f1f1U, + 0x71717171U, 0xd8d8d8d8U, 0x31313131U, 0x15151515U, + 0x04040404U, 0xc7c7c7c7U, 0x23232323U, 0xc3c3c3c3U, + 0x18181818U, 0x96969696U, 0x05050505U, 0x9a9a9a9aU, + 0x07070707U, 0x12121212U, 0x80808080U, 0xe2e2e2e2U, + 0xebebebebU, 0x27272727U, 0xb2b2b2b2U, 0x75757575U, + 0x09090909U, 0x83838383U, 0x2c2c2c2cU, 0x1a1a1a1aU, + 0x1b1b1b1bU, 0x6e6e6e6eU, 0x5a5a5a5aU, 0xa0a0a0a0U, + 0x52525252U, 0x3b3b3b3bU, 0xd6d6d6d6U, 0xb3b3b3b3U, + 0x29292929U, 0xe3e3e3e3U, 0x2f2f2f2fU, 0x84848484U, + 0x53535353U, 0xd1d1d1d1U, 0x00000000U, 0xededededU, + 0x20202020U, 0xfcfcfcfcU, 0xb1b1b1b1U, 0x5b5b5b5bU, + 0x6a6a6a6aU, 0xcbcbcbcbU, 0xbebebebeU, 0x39393939U, + 0x4a4a4a4aU, 0x4c4c4c4cU, 0x58585858U, 0xcfcfcfcfU, + 0xd0d0d0d0U, 0xefefefefU, 0xaaaaaaaaU, 0xfbfbfbfbU, + 0x43434343U, 0x4d4d4d4dU, 0x33333333U, 0x85858585U, + 0x45454545U, 0xf9f9f9f9U, 0x02020202U, 0x7f7f7f7fU, + 0x50505050U, 0x3c3c3c3cU, 0x9f9f9f9fU, 0xa8a8a8a8U, + 0x51515151U, 0xa3a3a3a3U, 0x40404040U, 0x8f8f8f8fU, + 0x92929292U, 0x9d9d9d9dU, 0x38383838U, 0xf5f5f5f5U, + 0xbcbcbcbcU, 0xb6b6b6b6U, 0xdadadadaU, 0x21212121U, + 0x10101010U, 0xffffffffU, 0xf3f3f3f3U, 0xd2d2d2d2U, + 0xcdcdcdcdU, 0x0c0c0c0cU, 0x13131313U, 0xececececU, + 0x5f5f5f5fU, 0x97979797U, 0x44444444U, 0x17171717U, + 0xc4c4c4c4U, 0xa7a7a7a7U, 0x7e7e7e7eU, 0x3d3d3d3dU, + 0x64646464U, 0x5d5d5d5dU, 0x19191919U, 0x73737373U, + 0x60606060U, 0x81818181U, 0x4f4f4f4fU, 0xdcdcdcdcU, + 0x22222222U, 0x2a2a2a2aU, 0x90909090U, 0x88888888U, + 0x46464646U, 0xeeeeeeeeU, 0xb8b8b8b8U, 0x14141414U, + 0xdedededeU, 0x5e5e5e5eU, 0x0b0b0b0bU, 0xdbdbdbdbU, + 0xe0e0e0e0U, 0x32323232U, 0x3a3a3a3aU, 0x0a0a0a0aU, + 0x49494949U, 0x06060606U, 0x24242424U, 0x5c5c5c5cU, + 0xc2c2c2c2U, 0xd3d3d3d3U, 0xacacacacU, 0x62626262U, + 0x91919191U, 0x95959595U, 0xe4e4e4e4U, 0x79797979U, + 0xe7e7e7e7U, 0xc8c8c8c8U, 0x37373737U, 0x6d6d6d6dU, + 0x8d8d8d8dU, 0xd5d5d5d5U, 0x4e4e4e4eU, 0xa9a9a9a9U, + 0x6c6c6c6cU, 0x56565656U, 0xf4f4f4f4U, 0xeaeaeaeaU, + 0x65656565U, 0x7a7a7a7aU, 0xaeaeaeaeU, 0x08080808U, + 0xbabababaU, 0x78787878U, 0x25252525U, 0x2e2e2e2eU, + 0x1c1c1c1cU, 0xa6a6a6a6U, 0xb4b4b4b4U, 0xc6c6c6c6U, + 0xe8e8e8e8U, 0xddddddddU, 0x74747474U, 0x1f1f1f1fU, + 0x4b4b4b4bU, 0xbdbdbdbdU, 0x8b8b8b8bU, 0x8a8a8a8aU, + 0x70707070U, 0x3e3e3e3eU, 0xb5b5b5b5U, 0x66666666U, + 0x48484848U, 0x03030303U, 0xf6f6f6f6U, 0x0e0e0e0eU, + 0x61616161U, 0x35353535U, 0x57575757U, 0xb9b9b9b9U, + 0x86868686U, 0xc1c1c1c1U, 0x1d1d1d1dU, 0x9e9e9e9eU, + 0xe1e1e1e1U, 0xf8f8f8f8U, 0x98989898U, 0x11111111U, + 0x69696969U, 0xd9d9d9d9U, 0x8e8e8e8eU, 0x94949494U, + 0x9b9b9b9bU, 0x1e1e1e1eU, 0x87878787U, 0xe9e9e9e9U, + 0xcecececeU, 0x55555555U, 0x28282828U, 0xdfdfdfdfU, + 0x8c8c8c8cU, 0xa1a1a1a1U, 0x89898989U, 0x0d0d0d0dU, + 0xbfbfbfbfU, 0xe6e6e6e6U, 0x42424242U, 0x68686868U, + 0x41414141U, 0x99999999U, 0x2d2d2d2dU, 0x0f0f0f0fU, + 0xb0b0b0b0U, 0x54545454U, 0xbbbbbbbbU, 0x16161616U, +}; +static const u32 Td0[256] = { + 0x51f4a750U, 0x7e416553U, 0x1a17a4c3U, 0x3a275e96U, + 0x3bab6bcbU, 0x1f9d45f1U, 0xacfa58abU, 0x4be30393U, + 0x2030fa55U, 0xad766df6U, 0x88cc7691U, 0xf5024c25U, + 0x4fe5d7fcU, 0xc52acbd7U, 0x26354480U, 0xb562a38fU, + 0xdeb15a49U, 0x25ba1b67U, 0x45ea0e98U, 0x5dfec0e1U, + 0xc32f7502U, 0x814cf012U, 0x8d4697a3U, 0x6bd3f9c6U, + 0x038f5fe7U, 0x15929c95U, 0xbf6d7aebU, 0x955259daU, + 0xd4be832dU, 0x587421d3U, 0x49e06929U, 0x8ec9c844U, + 0x75c2896aU, 0xf48e7978U, 0x99583e6bU, 0x27b971ddU, + 0xbee14fb6U, 0xf088ad17U, 0xc920ac66U, 0x7dce3ab4U, + 0x63df4a18U, 0xe51a3182U, 0x97513360U, 0x62537f45U, + 0xb16477e0U, 0xbb6bae84U, 0xfe81a01cU, 0xf9082b94U, + 0x70486858U, 0x8f45fd19U, 0x94de6c87U, 0x527bf8b7U, + 0xab73d323U, 0x724b02e2U, 0xe31f8f57U, 0x6655ab2aU, + 0xb2eb2807U, 0x2fb5c203U, 0x86c57b9aU, 0xd33708a5U, + 0x302887f2U, 0x23bfa5b2U, 0x02036abaU, 0xed16825cU, + 0x8acf1c2bU, 0xa779b492U, 0xf307f2f0U, 0x4e69e2a1U, + 0x65daf4cdU, 0x0605bed5U, 0xd134621fU, 0xc4a6fe8aU, + 0x342e539dU, 0xa2f355a0U, 0x058ae132U, 0xa4f6eb75U, + 0x0b83ec39U, 0x4060efaaU, 0x5e719f06U, 0xbd6e1051U, + 0x3e218af9U, 0x96dd063dU, 0xdd3e05aeU, 0x4de6bd46U, + 0x91548db5U, 0x71c45d05U, 0x0406d46fU, 0x605015ffU, + 0x1998fb24U, 0xd6bde997U, 0x894043ccU, 0x67d99e77U, + 0xb0e842bdU, 0x07898b88U, 0xe7195b38U, 0x79c8eedbU, + 0xa17c0a47U, 0x7c420fe9U, 0xf8841ec9U, 0x00000000U, + 0x09808683U, 0x322bed48U, 0x1e1170acU, 0x6c5a724eU, + 0xfd0efffbU, 0x0f853856U, 0x3daed51eU, 0x362d3927U, + 0x0a0fd964U, 0x685ca621U, 0x9b5b54d1U, 0x24362e3aU, + 0x0c0a67b1U, 0x9357e70fU, 0xb4ee96d2U, 0x1b9b919eU, + 0x80c0c54fU, 0x61dc20a2U, 0x5a774b69U, 0x1c121a16U, + 0xe293ba0aU, 0xc0a02ae5U, 0x3c22e043U, 0x121b171dU, + 0x0e090d0bU, 0xf28bc7adU, 0x2db6a8b9U, 0x141ea9c8U, + 0x57f11985U, 0xaf75074cU, 0xee99ddbbU, 0xa37f60fdU, + 0xf701269fU, 0x5c72f5bcU, 0x44663bc5U, 0x5bfb7e34U, + 0x8b432976U, 0xcb23c6dcU, 0xb6edfc68U, 0xb8e4f163U, + 0xd731dccaU, 0x42638510U, 0x13972240U, 0x84c61120U, + 0x854a247dU, 0xd2bb3df8U, 0xaef93211U, 0xc729a16dU, + 0x1d9e2f4bU, 0xdcb230f3U, 0x0d8652ecU, 0x77c1e3d0U, + 0x2bb3166cU, 0xa970b999U, 0x119448faU, 0x47e96422U, + 0xa8fc8cc4U, 0xa0f03f1aU, 0x567d2cd8U, 0x223390efU, + 0x87494ec7U, 0xd938d1c1U, 0x8ccaa2feU, 0x98d40b36U, + 0xa6f581cfU, 0xa57ade28U, 0xdab78e26U, 0x3fadbfa4U, + 0x2c3a9de4U, 0x5078920dU, 0x6a5fcc9bU, 0x547e4662U, + 0xf68d13c2U, 0x90d8b8e8U, 0x2e39f75eU, 0x82c3aff5U, + 0x9f5d80beU, 0x69d0937cU, 0x6fd52da9U, 0xcf2512b3U, + 0xc8ac993bU, 0x10187da7U, 0xe89c636eU, 0xdb3bbb7bU, + 0xcd267809U, 0x6e5918f4U, 0xec9ab701U, 0x834f9aa8U, + 0xe6956e65U, 0xaaffe67eU, 0x21bccf08U, 0xef15e8e6U, + 0xbae79bd9U, 0x4a6f36ceU, 0xea9f09d4U, 0x29b07cd6U, + 0x31a4b2afU, 0x2a3f2331U, 0xc6a59430U, 0x35a266c0U, + 0x744ebc37U, 0xfc82caa6U, 0xe090d0b0U, 0x33a7d815U, + 0xf104984aU, 0x41ecdaf7U, 0x7fcd500eU, 0x1791f62fU, + 0x764dd68dU, 0x43efb04dU, 0xccaa4d54U, 0xe49604dfU, + 0x9ed1b5e3U, 0x4c6a881bU, 0xc12c1fb8U, 0x4665517fU, + 0x9d5eea04U, 0x018c355dU, 0xfa877473U, 0xfb0b412eU, + 0xb3671d5aU, 0x92dbd252U, 0xe9105633U, 0x6dd64713U, + 0x9ad7618cU, 0x37a10c7aU, 0x59f8148eU, 0xeb133c89U, + 0xcea927eeU, 0xb761c935U, 0xe11ce5edU, 0x7a47b13cU, + 0x9cd2df59U, 0x55f2733fU, 0x1814ce79U, 0x73c737bfU, + 0x53f7cdeaU, 0x5ffdaa5bU, 0xdf3d6f14U, 0x7844db86U, + 0xcaaff381U, 0xb968c43eU, 0x3824342cU, 0xc2a3405fU, + 0x161dc372U, 0xbce2250cU, 0x283c498bU, 0xff0d9541U, + 0x39a80171U, 0x080cb3deU, 0xd8b4e49cU, 0x6456c190U, + 0x7bcb8461U, 0xd532b670U, 0x486c5c74U, 0xd0b85742U, +}; +static const u32 Td1[256] = { + 0x5051f4a7U, 0x537e4165U, 0xc31a17a4U, 0x963a275eU, + 0xcb3bab6bU, 0xf11f9d45U, 0xabacfa58U, 0x934be303U, + 0x552030faU, 0xf6ad766dU, 0x9188cc76U, 0x25f5024cU, + 0xfc4fe5d7U, 0xd7c52acbU, 0x80263544U, 0x8fb562a3U, + 0x49deb15aU, 0x6725ba1bU, 0x9845ea0eU, 0xe15dfec0U, + 0x02c32f75U, 0x12814cf0U, 0xa38d4697U, 0xc66bd3f9U, + 0xe7038f5fU, 0x9515929cU, 0xebbf6d7aU, 0xda955259U, + 0x2dd4be83U, 0xd3587421U, 0x2949e069U, 0x448ec9c8U, + 0x6a75c289U, 0x78f48e79U, 0x6b99583eU, 0xdd27b971U, + 0xb6bee14fU, 0x17f088adU, 0x66c920acU, 0xb47dce3aU, + 0x1863df4aU, 0x82e51a31U, 0x60975133U, 0x4562537fU, + 0xe0b16477U, 0x84bb6baeU, 0x1cfe81a0U, 0x94f9082bU, + 0x58704868U, 0x198f45fdU, 0x8794de6cU, 0xb7527bf8U, + 0x23ab73d3U, 0xe2724b02U, 0x57e31f8fU, 0x2a6655abU, + 0x07b2eb28U, 0x032fb5c2U, 0x9a86c57bU, 0xa5d33708U, + 0xf2302887U, 0xb223bfa5U, 0xba02036aU, 0x5ced1682U, + 0x2b8acf1cU, 0x92a779b4U, 0xf0f307f2U, 0xa14e69e2U, + 0xcd65daf4U, 0xd50605beU, 0x1fd13462U, 0x8ac4a6feU, + 0x9d342e53U, 0xa0a2f355U, 0x32058ae1U, 0x75a4f6ebU, + 0x390b83ecU, 0xaa4060efU, 0x065e719fU, 0x51bd6e10U, + 0xf93e218aU, 0x3d96dd06U, 0xaedd3e05U, 0x464de6bdU, + 0xb591548dU, 0x0571c45dU, 0x6f0406d4U, 0xff605015U, + 0x241998fbU, 0x97d6bde9U, 0xcc894043U, 0x7767d99eU, + 0xbdb0e842U, 0x8807898bU, 0x38e7195bU, 0xdb79c8eeU, + 0x47a17c0aU, 0xe97c420fU, 0xc9f8841eU, 0x00000000U, + 0x83098086U, 0x48322bedU, 0xac1e1170U, 0x4e6c5a72U, + 0xfbfd0effU, 0x560f8538U, 0x1e3daed5U, 0x27362d39U, + 0x640a0fd9U, 0x21685ca6U, 0xd19b5b54U, 0x3a24362eU, + 0xb10c0a67U, 0x0f9357e7U, 0xd2b4ee96U, 0x9e1b9b91U, + 0x4f80c0c5U, 0xa261dc20U, 0x695a774bU, 0x161c121aU, + 0x0ae293baU, 0xe5c0a02aU, 0x433c22e0U, 0x1d121b17U, + 0x0b0e090dU, 0xadf28bc7U, 0xb92db6a8U, 0xc8141ea9U, + 0x8557f119U, 0x4caf7507U, 0xbbee99ddU, 0xfda37f60U, + 0x9ff70126U, 0xbc5c72f5U, 0xc544663bU, 0x345bfb7eU, + 0x768b4329U, 0xdccb23c6U, 0x68b6edfcU, 0x63b8e4f1U, + 0xcad731dcU, 0x10426385U, 0x40139722U, 0x2084c611U, + 0x7d854a24U, 0xf8d2bb3dU, 0x11aef932U, 0x6dc729a1U, + 0x4b1d9e2fU, 0xf3dcb230U, 0xec0d8652U, 0xd077c1e3U, + 0x6c2bb316U, 0x99a970b9U, 0xfa119448U, 0x2247e964U, + 0xc4a8fc8cU, 0x1aa0f03fU, 0xd8567d2cU, 0xef223390U, + 0xc787494eU, 0xc1d938d1U, 0xfe8ccaa2U, 0x3698d40bU, + 0xcfa6f581U, 0x28a57adeU, 0x26dab78eU, 0xa43fadbfU, + 0xe42c3a9dU, 0x0d507892U, 0x9b6a5fccU, 0x62547e46U, + 0xc2f68d13U, 0xe890d8b8U, 0x5e2e39f7U, 0xf582c3afU, + 0xbe9f5d80U, 0x7c69d093U, 0xa96fd52dU, 0xb3cf2512U, + 0x3bc8ac99U, 0xa710187dU, 0x6ee89c63U, 0x7bdb3bbbU, + 0x09cd2678U, 0xf46e5918U, 0x01ec9ab7U, 0xa8834f9aU, + 0x65e6956eU, 0x7eaaffe6U, 0x0821bccfU, 0xe6ef15e8U, + 0xd9bae79bU, 0xce4a6f36U, 0xd4ea9f09U, 0xd629b07cU, + 0xaf31a4b2U, 0x312a3f23U, 0x30c6a594U, 0xc035a266U, + 0x37744ebcU, 0xa6fc82caU, 0xb0e090d0U, 0x1533a7d8U, + 0x4af10498U, 0xf741ecdaU, 0x0e7fcd50U, 0x2f1791f6U, + 0x8d764dd6U, 0x4d43efb0U, 0x54ccaa4dU, 0xdfe49604U, + 0xe39ed1b5U, 0x1b4c6a88U, 0xb8c12c1fU, 0x7f466551U, + 0x049d5eeaU, 0x5d018c35U, 0x73fa8774U, 0x2efb0b41U, + 0x5ab3671dU, 0x5292dbd2U, 0x33e91056U, 0x136dd647U, + 0x8c9ad761U, 0x7a37a10cU, 0x8e59f814U, 0x89eb133cU, + 0xeecea927U, 0x35b761c9U, 0xede11ce5U, 0x3c7a47b1U, + 0x599cd2dfU, 0x3f55f273U, 0x791814ceU, 0xbf73c737U, + 0xea53f7cdU, 0x5b5ffdaaU, 0x14df3d6fU, 0x867844dbU, + 0x81caaff3U, 0x3eb968c4U, 0x2c382434U, 0x5fc2a340U, + 0x72161dc3U, 0x0cbce225U, 0x8b283c49U, 0x41ff0d95U, + 0x7139a801U, 0xde080cb3U, 0x9cd8b4e4U, 0x906456c1U, + 0x617bcb84U, 0x70d532b6U, 0x74486c5cU, 0x42d0b857U, +}; +static const u32 Td2[256] = { + 0xa75051f4U, 0x65537e41U, 0xa4c31a17U, 0x5e963a27U, + 0x6bcb3babU, 0x45f11f9dU, 0x58abacfaU, 0x03934be3U, + 0xfa552030U, 0x6df6ad76U, 0x769188ccU, 0x4c25f502U, + 0xd7fc4fe5U, 0xcbd7c52aU, 0x44802635U, 0xa38fb562U, + 0x5a49deb1U, 0x1b6725baU, 0x0e9845eaU, 0xc0e15dfeU, + 0x7502c32fU, 0xf012814cU, 0x97a38d46U, 0xf9c66bd3U, + 0x5fe7038fU, 0x9c951592U, 0x7aebbf6dU, 0x59da9552U, + 0x832dd4beU, 0x21d35874U, 0x692949e0U, 0xc8448ec9U, + 0x896a75c2U, 0x7978f48eU, 0x3e6b9958U, 0x71dd27b9U, + 0x4fb6bee1U, 0xad17f088U, 0xac66c920U, 0x3ab47dceU, + 0x4a1863dfU, 0x3182e51aU, 0x33609751U, 0x7f456253U, + 0x77e0b164U, 0xae84bb6bU, 0xa01cfe81U, 0x2b94f908U, + 0x68587048U, 0xfd198f45U, 0x6c8794deU, 0xf8b7527bU, + 0xd323ab73U, 0x02e2724bU, 0x8f57e31fU, 0xab2a6655U, + 0x2807b2ebU, 0xc2032fb5U, 0x7b9a86c5U, 0x08a5d337U, + 0x87f23028U, 0xa5b223bfU, 0x6aba0203U, 0x825ced16U, + 0x1c2b8acfU, 0xb492a779U, 0xf2f0f307U, 0xe2a14e69U, + 0xf4cd65daU, 0xbed50605U, 0x621fd134U, 0xfe8ac4a6U, + 0x539d342eU, 0x55a0a2f3U, 0xe132058aU, 0xeb75a4f6U, + 0xec390b83U, 0xefaa4060U, 0x9f065e71U, 0x1051bd6eU, + + 0x8af93e21U, 0x063d96ddU, 0x05aedd3eU, 0xbd464de6U, + 0x8db59154U, 0x5d0571c4U, 0xd46f0406U, 0x15ff6050U, + 0xfb241998U, 0xe997d6bdU, 0x43cc8940U, 0x9e7767d9U, + 0x42bdb0e8U, 0x8b880789U, 0x5b38e719U, 0xeedb79c8U, + 0x0a47a17cU, 0x0fe97c42U, 0x1ec9f884U, 0x00000000U, + 0x86830980U, 0xed48322bU, 0x70ac1e11U, 0x724e6c5aU, + 0xfffbfd0eU, 0x38560f85U, 0xd51e3daeU, 0x3927362dU, + 0xd9640a0fU, 0xa621685cU, 0x54d19b5bU, 0x2e3a2436U, + 0x67b10c0aU, 0xe70f9357U, 0x96d2b4eeU, 0x919e1b9bU, + 0xc54f80c0U, 0x20a261dcU, 0x4b695a77U, 0x1a161c12U, + 0xba0ae293U, 0x2ae5c0a0U, 0xe0433c22U, 0x171d121bU, + 0x0d0b0e09U, 0xc7adf28bU, 0xa8b92db6U, 0xa9c8141eU, + 0x198557f1U, 0x074caf75U, 0xddbbee99U, 0x60fda37fU, + 0x269ff701U, 0xf5bc5c72U, 0x3bc54466U, 0x7e345bfbU, + 0x29768b43U, 0xc6dccb23U, 0xfc68b6edU, 0xf163b8e4U, + 0xdccad731U, 0x85104263U, 0x22401397U, 0x112084c6U, + 0x247d854aU, 0x3df8d2bbU, 0x3211aef9U, 0xa16dc729U, + 0x2f4b1d9eU, 0x30f3dcb2U, 0x52ec0d86U, 0xe3d077c1U, + 0x166c2bb3U, 0xb999a970U, 0x48fa1194U, 0x642247e9U, + 0x8cc4a8fcU, 0x3f1aa0f0U, 0x2cd8567dU, 0x90ef2233U, + 0x4ec78749U, 0xd1c1d938U, 0xa2fe8ccaU, 0x0b3698d4U, + 0x81cfa6f5U, 0xde28a57aU, 0x8e26dab7U, 0xbfa43fadU, + 0x9de42c3aU, 0x920d5078U, 0xcc9b6a5fU, 0x4662547eU, + 0x13c2f68dU, 0xb8e890d8U, 0xf75e2e39U, 0xaff582c3U, + 0x80be9f5dU, 0x937c69d0U, 0x2da96fd5U, 0x12b3cf25U, + 0x993bc8acU, 0x7da71018U, 0x636ee89cU, 0xbb7bdb3bU, + 0x7809cd26U, 0x18f46e59U, 0xb701ec9aU, 0x9aa8834fU, + 0x6e65e695U, 0xe67eaaffU, 0xcf0821bcU, 0xe8e6ef15U, + 0x9bd9bae7U, 0x36ce4a6fU, 0x09d4ea9fU, 0x7cd629b0U, + 0xb2af31a4U, 0x23312a3fU, 0x9430c6a5U, 0x66c035a2U, + 0xbc37744eU, 0xcaa6fc82U, 0xd0b0e090U, 0xd81533a7U, + 0x984af104U, 0xdaf741ecU, 0x500e7fcdU, 0xf62f1791U, + 0xd68d764dU, 0xb04d43efU, 0x4d54ccaaU, 0x04dfe496U, + 0xb5e39ed1U, 0x881b4c6aU, 0x1fb8c12cU, 0x517f4665U, + 0xea049d5eU, 0x355d018cU, 0x7473fa87U, 0x412efb0bU, + 0x1d5ab367U, 0xd25292dbU, 0x5633e910U, 0x47136dd6U, + 0x618c9ad7U, 0x0c7a37a1U, 0x148e59f8U, 0x3c89eb13U, + 0x27eecea9U, 0xc935b761U, 0xe5ede11cU, 0xb13c7a47U, + 0xdf599cd2U, 0x733f55f2U, 0xce791814U, 0x37bf73c7U, + 0xcdea53f7U, 0xaa5b5ffdU, 0x6f14df3dU, 0xdb867844U, + 0xf381caafU, 0xc43eb968U, 0x342c3824U, 0x405fc2a3U, + 0xc372161dU, 0x250cbce2U, 0x498b283cU, 0x9541ff0dU, + 0x017139a8U, 0xb3de080cU, 0xe49cd8b4U, 0xc1906456U, + 0x84617bcbU, 0xb670d532U, 0x5c74486cU, 0x5742d0b8U, +}; +static const u32 Td3[256] = { + 0xf4a75051U, 0x4165537eU, 0x17a4c31aU, 0x275e963aU, + 0xab6bcb3bU, 0x9d45f11fU, 0xfa58abacU, 0xe303934bU, + 0x30fa5520U, 0x766df6adU, 0xcc769188U, 0x024c25f5U, + 0xe5d7fc4fU, 0x2acbd7c5U, 0x35448026U, 0x62a38fb5U, + 0xb15a49deU, 0xba1b6725U, 0xea0e9845U, 0xfec0e15dU, + 0x2f7502c3U, 0x4cf01281U, 0x4697a38dU, 0xd3f9c66bU, + 0x8f5fe703U, 0x929c9515U, 0x6d7aebbfU, 0x5259da95U, + 0xbe832dd4U, 0x7421d358U, 0xe0692949U, 0xc9c8448eU, + 0xc2896a75U, 0x8e7978f4U, 0x583e6b99U, 0xb971dd27U, + 0xe14fb6beU, 0x88ad17f0U, 0x20ac66c9U, 0xce3ab47dU, + 0xdf4a1863U, 0x1a3182e5U, 0x51336097U, 0x537f4562U, + 0x6477e0b1U, 0x6bae84bbU, 0x81a01cfeU, 0x082b94f9U, + 0x48685870U, 0x45fd198fU, 0xde6c8794U, 0x7bf8b752U, + 0x73d323abU, 0x4b02e272U, 0x1f8f57e3U, 0x55ab2a66U, + 0xeb2807b2U, 0xb5c2032fU, 0xc57b9a86U, 0x3708a5d3U, + 0x2887f230U, 0xbfa5b223U, 0x036aba02U, 0x16825cedU, + 0xcf1c2b8aU, 0x79b492a7U, 0x07f2f0f3U, 0x69e2a14eU, + 0xdaf4cd65U, 0x05bed506U, 0x34621fd1U, 0xa6fe8ac4U, + 0x2e539d34U, 0xf355a0a2U, 0x8ae13205U, 0xf6eb75a4U, + 0x83ec390bU, 0x60efaa40U, 0x719f065eU, 0x6e1051bdU, + 0x218af93eU, 0xdd063d96U, 0x3e05aeddU, 0xe6bd464dU, + 0x548db591U, 0xc45d0571U, 0x06d46f04U, 0x5015ff60U, + 0x98fb2419U, 0xbde997d6U, 0x4043cc89U, 0xd99e7767U, + 0xe842bdb0U, 0x898b8807U, 0x195b38e7U, 0xc8eedb79U, + 0x7c0a47a1U, 0x420fe97cU, 0x841ec9f8U, 0x00000000U, + 0x80868309U, 0x2bed4832U, 0x1170ac1eU, 0x5a724e6cU, + 0x0efffbfdU, 0x8538560fU, 0xaed51e3dU, 0x2d392736U, + 0x0fd9640aU, 0x5ca62168U, 0x5b54d19bU, 0x362e3a24U, + 0x0a67b10cU, 0x57e70f93U, 0xee96d2b4U, 0x9b919e1bU, + 0xc0c54f80U, 0xdc20a261U, 0x774b695aU, 0x121a161cU, + 0x93ba0ae2U, 0xa02ae5c0U, 0x22e0433cU, 0x1b171d12U, + 0x090d0b0eU, 0x8bc7adf2U, 0xb6a8b92dU, 0x1ea9c814U, + 0xf1198557U, 0x75074cafU, 0x99ddbbeeU, 0x7f60fda3U, + 0x01269ff7U, 0x72f5bc5cU, 0x663bc544U, 0xfb7e345bU, + 0x4329768bU, 0x23c6dccbU, 0xedfc68b6U, 0xe4f163b8U, + 0x31dccad7U, 0x63851042U, 0x97224013U, 0xc6112084U, + 0x4a247d85U, 0xbb3df8d2U, 0xf93211aeU, 0x29a16dc7U, + 0x9e2f4b1dU, 0xb230f3dcU, 0x8652ec0dU, 0xc1e3d077U, + 0xb3166c2bU, 0x70b999a9U, 0x9448fa11U, 0xe9642247U, + 0xfc8cc4a8U, 0xf03f1aa0U, 0x7d2cd856U, 0x3390ef22U, + 0x494ec787U, 0x38d1c1d9U, 0xcaa2fe8cU, 0xd40b3698U, + 0xf581cfa6U, 0x7ade28a5U, 0xb78e26daU, 0xadbfa43fU, + 0x3a9de42cU, 0x78920d50U, 0x5fcc9b6aU, 0x7e466254U, + 0x8d13c2f6U, 0xd8b8e890U, 0x39f75e2eU, 0xc3aff582U, + 0x5d80be9fU, 0xd0937c69U, 0xd52da96fU, 0x2512b3cfU, + 0xac993bc8U, 0x187da710U, 0x9c636ee8U, 0x3bbb7bdbU, + 0x267809cdU, 0x5918f46eU, 0x9ab701ecU, 0x4f9aa883U, + 0x956e65e6U, 0xffe67eaaU, 0xbccf0821U, 0x15e8e6efU, + 0xe79bd9baU, 0x6f36ce4aU, 0x9f09d4eaU, 0xb07cd629U, + 0xa4b2af31U, 0x3f23312aU, 0xa59430c6U, 0xa266c035U, + 0x4ebc3774U, 0x82caa6fcU, 0x90d0b0e0U, 0xa7d81533U, + 0x04984af1U, 0xecdaf741U, 0xcd500e7fU, 0x91f62f17U, + 0x4dd68d76U, 0xefb04d43U, 0xaa4d54ccU, 0x9604dfe4U, + 0xd1b5e39eU, 0x6a881b4cU, 0x2c1fb8c1U, 0x65517f46U, + 0x5eea049dU, 0x8c355d01U, 0x877473faU, 0x0b412efbU, + 0x671d5ab3U, 0xdbd25292U, 0x105633e9U, 0xd647136dU, + 0xd7618c9aU, 0xa10c7a37U, 0xf8148e59U, 0x133c89ebU, + 0xa927eeceU, 0x61c935b7U, 0x1ce5ede1U, 0x47b13c7aU, + 0xd2df599cU, 0xf2733f55U, 0x14ce7918U, 0xc737bf73U, + 0xf7cdea53U, 0xfdaa5b5fU, 0x3d6f14dfU, 0x44db8678U, + 0xaff381caU, 0x68c43eb9U, 0x24342c38U, 0xa3405fc2U, + 0x1dc37216U, 0xe2250cbcU, 0x3c498b28U, 0x0d9541ffU, + 0xa8017139U, 0x0cb3de08U, 0xb4e49cd8U, 0x56c19064U, + 0xcb84617bU, 0x32b670d5U, 0x6c5c7448U, 0xb85742d0U, +}; +static const u32 Td4[256] = { + 0x52525252U, 0x09090909U, 0x6a6a6a6aU, 0xd5d5d5d5U, + 0x30303030U, 0x36363636U, 0xa5a5a5a5U, 0x38383838U, + 0xbfbfbfbfU, 0x40404040U, 0xa3a3a3a3U, 0x9e9e9e9eU, + 0x81818181U, 0xf3f3f3f3U, 0xd7d7d7d7U, 0xfbfbfbfbU, + 0x7c7c7c7cU, 0xe3e3e3e3U, 0x39393939U, 0x82828282U, + 0x9b9b9b9bU, 0x2f2f2f2fU, 0xffffffffU, 0x87878787U, + 0x34343434U, 0x8e8e8e8eU, 0x43434343U, 0x44444444U, + 0xc4c4c4c4U, 0xdedededeU, 0xe9e9e9e9U, 0xcbcbcbcbU, + 0x54545454U, 0x7b7b7b7bU, 0x94949494U, 0x32323232U, + 0xa6a6a6a6U, 0xc2c2c2c2U, 0x23232323U, 0x3d3d3d3dU, + 0xeeeeeeeeU, 0x4c4c4c4cU, 0x95959595U, 0x0b0b0b0bU, + 0x42424242U, 0xfafafafaU, 0xc3c3c3c3U, 0x4e4e4e4eU, + 0x08080808U, 0x2e2e2e2eU, 0xa1a1a1a1U, 0x66666666U, + 0x28282828U, 0xd9d9d9d9U, 0x24242424U, 0xb2b2b2b2U, + 0x76767676U, 0x5b5b5b5bU, 0xa2a2a2a2U, 0x49494949U, + 0x6d6d6d6dU, 0x8b8b8b8bU, 0xd1d1d1d1U, 0x25252525U, + 0x72727272U, 0xf8f8f8f8U, 0xf6f6f6f6U, 0x64646464U, + 0x86868686U, 0x68686868U, 0x98989898U, 0x16161616U, + 0xd4d4d4d4U, 0xa4a4a4a4U, 0x5c5c5c5cU, 0xccccccccU, + 0x5d5d5d5dU, 0x65656565U, 0xb6b6b6b6U, 0x92929292U, + 0x6c6c6c6cU, 0x70707070U, 0x48484848U, 0x50505050U, + 0xfdfdfdfdU, 0xededededU, 0xb9b9b9b9U, 0xdadadadaU, + 0x5e5e5e5eU, 0x15151515U, 0x46464646U, 0x57575757U, + 0xa7a7a7a7U, 0x8d8d8d8dU, 0x9d9d9d9dU, 0x84848484U, + 0x90909090U, 0xd8d8d8d8U, 0xababababU, 0x00000000U, + 0x8c8c8c8cU, 0xbcbcbcbcU, 0xd3d3d3d3U, 0x0a0a0a0aU, + 0xf7f7f7f7U, 0xe4e4e4e4U, 0x58585858U, 0x05050505U, + 0xb8b8b8b8U, 0xb3b3b3b3U, 0x45454545U, 0x06060606U, + 0xd0d0d0d0U, 0x2c2c2c2cU, 0x1e1e1e1eU, 0x8f8f8f8fU, + 0xcacacacaU, 0x3f3f3f3fU, 0x0f0f0f0fU, 0x02020202U, + 0xc1c1c1c1U, 0xafafafafU, 0xbdbdbdbdU, 0x03030303U, + 0x01010101U, 0x13131313U, 0x8a8a8a8aU, 0x6b6b6b6bU, + 0x3a3a3a3aU, 0x91919191U, 0x11111111U, 0x41414141U, + 0x4f4f4f4fU, 0x67676767U, 0xdcdcdcdcU, 0xeaeaeaeaU, + 0x97979797U, 0xf2f2f2f2U, 0xcfcfcfcfU, 0xcecececeU, + 0xf0f0f0f0U, 0xb4b4b4b4U, 0xe6e6e6e6U, 0x73737373U, + 0x96969696U, 0xacacacacU, 0x74747474U, 0x22222222U, + 0xe7e7e7e7U, 0xadadadadU, 0x35353535U, 0x85858585U, + 0xe2e2e2e2U, 0xf9f9f9f9U, 0x37373737U, 0xe8e8e8e8U, + 0x1c1c1c1cU, 0x75757575U, 0xdfdfdfdfU, 0x6e6e6e6eU, + 0x47474747U, 0xf1f1f1f1U, 0x1a1a1a1aU, 0x71717171U, + 0x1d1d1d1dU, 0x29292929U, 0xc5c5c5c5U, 0x89898989U, + 0x6f6f6f6fU, 0xb7b7b7b7U, 0x62626262U, 0x0e0e0e0eU, + 0xaaaaaaaaU, 0x18181818U, 0xbebebebeU, 0x1b1b1b1bU, + 0xfcfcfcfcU, 0x56565656U, 0x3e3e3e3eU, 0x4b4b4b4bU, + 0xc6c6c6c6U, 0xd2d2d2d2U, 0x79797979U, 0x20202020U, + 0x9a9a9a9aU, 0xdbdbdbdbU, 0xc0c0c0c0U, 0xfefefefeU, + 0x78787878U, 0xcdcdcdcdU, 0x5a5a5a5aU, 0xf4f4f4f4U, + 0x1f1f1f1fU, 0xddddddddU, 0xa8a8a8a8U, 0x33333333U, + 0x88888888U, 0x07070707U, 0xc7c7c7c7U, 0x31313131U, + 0xb1b1b1b1U, 0x12121212U, 0x10101010U, 0x59595959U, + 0x27272727U, 0x80808080U, 0xececececU, 0x5f5f5f5fU, + 0x60606060U, 0x51515151U, 0x7f7f7f7fU, 0xa9a9a9a9U, + 0x19191919U, 0xb5b5b5b5U, 0x4a4a4a4aU, 0x0d0d0d0dU, + 0x2d2d2d2dU, 0xe5e5e5e5U, 0x7a7a7a7aU, 0x9f9f9f9fU, + 0x93939393U, 0xc9c9c9c9U, 0x9c9c9c9cU, 0xefefefefU, + 0xa0a0a0a0U, 0xe0e0e0e0U, 0x3b3b3b3bU, 0x4d4d4d4dU, + 0xaeaeaeaeU, 0x2a2a2a2aU, 0xf5f5f5f5U, 0xb0b0b0b0U, + 0xc8c8c8c8U, 0xebebebebU, 0xbbbbbbbbU, 0x3c3c3c3cU, + 0x83838383U, 0x53535353U, 0x99999999U, 0x61616161U, + 0x17171717U, 0x2b2b2b2bU, 0x04040404U, 0x7e7e7e7eU, + 0xbabababaU, 0x77777777U, 0xd6d6d6d6U, 0x26262626U, + 0xe1e1e1e1U, 0x69696969U, 0x14141414U, 0x63636363U, + 0x55555555U, 0x21212121U, 0x0c0c0c0cU, 0x7d7d7d7dU, +}; +static const u32 rcon[] = { + 0x01000000, 0x02000000, 0x04000000, 0x08000000, + 0x10000000, 0x20000000, 0x40000000, 0x80000000, + 0x1B000000, 0x36000000, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */ +}; + +/** + * Expand the cipher key into the encryption key schedule. + */ +int AES_set_encrypt_key(const unsigned char *userKey, + const FIPS_AES_SIZE_T bits, AES_KEY *key) { + + u32 *rk; + int i = 0; + u32 temp; + + if (!userKey || !key) + return -1; + if (bits != 128 && bits != 192 && bits != 256) + return -2; + if(FIPS_selftest_failed()) + return -3; + + rk = key->rd_key; + + if (bits==128) + key->rounds = 10; + else if (bits==192) + key->rounds = 12; + else + key->rounds = 14; + + rk[0] = GETU32(userKey ); + rk[1] = GETU32(userKey + 4); + rk[2] = GETU32(userKey + 8); + rk[3] = GETU32(userKey + 12); + if (bits == 128) { + while (1) { + temp = rk[3]; + rk[4] = rk[0] ^ + (Te4[(temp >> 16) & 0xff] & 0xff000000) ^ + (Te4[(temp >> 8) & 0xff] & 0x00ff0000) ^ + (Te4[(temp ) & 0xff] & 0x0000ff00) ^ + (Te4[(temp >> 24) ] & 0x000000ff) ^ + rcon[i]; + rk[5] = rk[1] ^ rk[4]; + rk[6] = rk[2] ^ rk[5]; + rk[7] = rk[3] ^ rk[6]; + if (++i == 10) { + return 0; + } + rk += 4; + } + } + rk[4] = GETU32(userKey + 16); + rk[5] = GETU32(userKey + 20); + if (bits == 192) { + while (1) { + temp = rk[ 5]; + rk[ 6] = rk[ 0] ^ + (Te4[(temp >> 16) & 0xff] & 0xff000000) ^ + (Te4[(temp >> 8) & 0xff] & 0x00ff0000) ^ + (Te4[(temp ) & 0xff] & 0x0000ff00) ^ + (Te4[(temp >> 24) ] & 0x000000ff) ^ + rcon[i]; + rk[ 7] = rk[ 1] ^ rk[ 6]; + rk[ 8] = rk[ 2] ^ rk[ 7]; + rk[ 9] = rk[ 3] ^ rk[ 8]; + if (++i == 8) { + return 0; + } + rk[10] = rk[ 4] ^ rk[ 9]; + rk[11] = rk[ 5] ^ rk[10]; + rk += 6; + } + } + rk[6] = GETU32(userKey + 24); + rk[7] = GETU32(userKey + 28); + if (bits == 256) { + while (1) { + temp = rk[ 7]; + rk[ 8] = rk[ 0] ^ + (Te4[(temp >> 16) & 0xff] & 0xff000000) ^ + (Te4[(temp >> 8) & 0xff] & 0x00ff0000) ^ + (Te4[(temp ) & 0xff] & 0x0000ff00) ^ + (Te4[(temp >> 24) ] & 0x000000ff) ^ + rcon[i]; + rk[ 9] = rk[ 1] ^ rk[ 8]; + rk[10] = rk[ 2] ^ rk[ 9]; + rk[11] = rk[ 3] ^ rk[10]; + if (++i == 7) { + return 0; + } + temp = rk[11]; + rk[12] = rk[ 4] ^ + (Te4[(temp >> 24) ] & 0xff000000) ^ + (Te4[(temp >> 16) & 0xff] & 0x00ff0000) ^ + (Te4[(temp >> 8) & 0xff] & 0x0000ff00) ^ + (Te4[(temp ) & 0xff] & 0x000000ff); + rk[13] = rk[ 5] ^ rk[12]; + rk[14] = rk[ 6] ^ rk[13]; + rk[15] = rk[ 7] ^ rk[14]; + + rk += 8; + } + } + return 0; +} + +/** + * Expand the cipher key into the decryption key schedule. + */ +int AES_set_decrypt_key(const unsigned char *userKey, + const FIPS_AES_SIZE_T bits, AES_KEY *key) { + + u32 *rk; + int i, j, status; + u32 temp; + + /* first, start with an encryption schedule */ + status = AES_set_encrypt_key(userKey, bits, key); + if (status < 0) + return status; + + rk = key->rd_key; + + /* invert the order of the round keys: */ + for (i = 0, j = 4*(key->rounds); i < j; i += 4, j -= 4) { + temp = rk[i ]; rk[i ] = rk[j ]; rk[j ] = temp; + temp = rk[i + 1]; rk[i + 1] = rk[j + 1]; rk[j + 1] = temp; + temp = rk[i + 2]; rk[i + 2] = rk[j + 2]; rk[j + 2] = temp; + temp = rk[i + 3]; rk[i + 3] = rk[j + 3]; rk[j + 3] = temp; + } + /* apply the inverse MixColumn transform to all round keys but the first and the last: */ + for (i = 1; i < (key->rounds); i++) { + rk += 4; + rk[0] = + Td0[Te4[(rk[0] >> 24) ] & 0xff] ^ + Td1[Te4[(rk[0] >> 16) & 0xff] & 0xff] ^ + Td2[Te4[(rk[0] >> 8) & 0xff] & 0xff] ^ + Td3[Te4[(rk[0] ) & 0xff] & 0xff]; + rk[1] = + Td0[Te4[(rk[1] >> 24) ] & 0xff] ^ + Td1[Te4[(rk[1] >> 16) & 0xff] & 0xff] ^ + Td2[Te4[(rk[1] >> 8) & 0xff] & 0xff] ^ + Td3[Te4[(rk[1] ) & 0xff] & 0xff]; + rk[2] = + Td0[Te4[(rk[2] >> 24) ] & 0xff] ^ + Td1[Te4[(rk[2] >> 16) & 0xff] & 0xff] ^ + Td2[Te4[(rk[2] >> 8) & 0xff] & 0xff] ^ + Td3[Te4[(rk[2] ) & 0xff] & 0xff]; + rk[3] = + Td0[Te4[(rk[3] >> 24) ] & 0xff] ^ + Td1[Te4[(rk[3] >> 16) & 0xff] & 0xff] ^ + Td2[Te4[(rk[3] >> 8) & 0xff] & 0xff] ^ + Td3[Te4[(rk[3] ) & 0xff] & 0xff]; + } + return 0; +} + +/* + * Encrypt a single block + * in and out can overlap + */ +void AES_encrypt(const unsigned char *in, unsigned char *out, + const AES_KEY *key) { + + const u32 *rk; + u32 s0, s1, s2, s3, t0, t1, t2, t3; +#ifndef FULL_UNROLL + int r; +#endif /* ?FULL_UNROLL */ + + assert(in && out && key); + rk = key->rd_key; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + s0 = GETU32(in ) ^ rk[0]; + s1 = GETU32(in + 4) ^ rk[1]; + s2 = GETU32(in + 8) ^ rk[2]; + s3 = GETU32(in + 12) ^ rk[3]; +#ifdef FULL_UNROLL + /* round 1: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[ 4]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[ 5]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[ 6]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[ 7]; + /* round 2: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[ 8]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[ 9]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[10]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[11]; + /* round 3: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[12]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[13]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[14]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[15]; + /* round 4: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[16]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[17]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[18]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[19]; + /* round 5: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[20]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[21]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[22]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[23]; + /* round 6: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[24]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[25]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[26]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[27]; + /* round 7: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[28]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[29]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[30]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[31]; + /* round 8: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[32]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[33]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[34]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[35]; + /* round 9: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[36]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[37]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[38]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[39]; + if (key->rounds > 10) { + /* round 10: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[40]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[41]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[42]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[43]; + /* round 11: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[44]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[45]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[46]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[47]; + if (key->rounds > 12) { + /* round 12: */ + s0 = Te0[t0 >> 24] ^ Te1[(t1 >> 16) & 0xff] ^ Te2[(t2 >> 8) & 0xff] ^ Te3[t3 & 0xff] ^ rk[48]; + s1 = Te0[t1 >> 24] ^ Te1[(t2 >> 16) & 0xff] ^ Te2[(t3 >> 8) & 0xff] ^ Te3[t0 & 0xff] ^ rk[49]; + s2 = Te0[t2 >> 24] ^ Te1[(t3 >> 16) & 0xff] ^ Te2[(t0 >> 8) & 0xff] ^ Te3[t1 & 0xff] ^ rk[50]; + s3 = Te0[t3 >> 24] ^ Te1[(t0 >> 16) & 0xff] ^ Te2[(t1 >> 8) & 0xff] ^ Te3[t2 & 0xff] ^ rk[51]; + /* round 13: */ + t0 = Te0[s0 >> 24] ^ Te1[(s1 >> 16) & 0xff] ^ Te2[(s2 >> 8) & 0xff] ^ Te3[s3 & 0xff] ^ rk[52]; + t1 = Te0[s1 >> 24] ^ Te1[(s2 >> 16) & 0xff] ^ Te2[(s3 >> 8) & 0xff] ^ Te3[s0 & 0xff] ^ rk[53]; + t2 = Te0[s2 >> 24] ^ Te1[(s3 >> 16) & 0xff] ^ Te2[(s0 >> 8) & 0xff] ^ Te3[s1 & 0xff] ^ rk[54]; + t3 = Te0[s3 >> 24] ^ Te1[(s0 >> 16) & 0xff] ^ Te2[(s1 >> 8) & 0xff] ^ Te3[s2 & 0xff] ^ rk[55]; + } + } + rk += key->rounds << 2; +#else /* !FULL_UNROLL */ + /* + * Nr - 1 full rounds: + */ + r = key->rounds >> 1; + for (;;) { + t0 = + Te0[(s0 >> 24) ] ^ + Te1[(s1 >> 16) & 0xff] ^ + Te2[(s2 >> 8) & 0xff] ^ + Te3[(s3 ) & 0xff] ^ + rk[4]; + t1 = + Te0[(s1 >> 24) ] ^ + Te1[(s2 >> 16) & 0xff] ^ + Te2[(s3 >> 8) & 0xff] ^ + Te3[(s0 ) & 0xff] ^ + rk[5]; + t2 = + Te0[(s2 >> 24) ] ^ + Te1[(s3 >> 16) & 0xff] ^ + Te2[(s0 >> 8) & 0xff] ^ + Te3[(s1 ) & 0xff] ^ + rk[6]; + t3 = + Te0[(s3 >> 24) ] ^ + Te1[(s0 >> 16) & 0xff] ^ + Te2[(s1 >> 8) & 0xff] ^ + Te3[(s2 ) & 0xff] ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + s0 = + Te0[(t0 >> 24) ] ^ + Te1[(t1 >> 16) & 0xff] ^ + Te2[(t2 >> 8) & 0xff] ^ + Te3[(t3 ) & 0xff] ^ + rk[0]; + s1 = + Te0[(t1 >> 24) ] ^ + Te1[(t2 >> 16) & 0xff] ^ + Te2[(t3 >> 8) & 0xff] ^ + Te3[(t0 ) & 0xff] ^ + rk[1]; + s2 = + Te0[(t2 >> 24) ] ^ + Te1[(t3 >> 16) & 0xff] ^ + Te2[(t0 >> 8) & 0xff] ^ + Te3[(t1 ) & 0xff] ^ + rk[2]; + s3 = + Te0[(t3 >> 24) ] ^ + Te1[(t0 >> 16) & 0xff] ^ + Te2[(t1 >> 8) & 0xff] ^ + Te3[(t2 ) & 0xff] ^ + rk[3]; + } +#endif /* ?FULL_UNROLL */ + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Te4[(t0 >> 24) ] & 0xff000000) ^ + (Te4[(t1 >> 16) & 0xff] & 0x00ff0000) ^ + (Te4[(t2 >> 8) & 0xff] & 0x0000ff00) ^ + (Te4[(t3 ) & 0xff] & 0x000000ff) ^ + rk[0]; + PUTU32(out , s0); + s1 = + (Te4[(t1 >> 24) ] & 0xff000000) ^ + (Te4[(t2 >> 16) & 0xff] & 0x00ff0000) ^ + (Te4[(t3 >> 8) & 0xff] & 0x0000ff00) ^ + (Te4[(t0 ) & 0xff] & 0x000000ff) ^ + rk[1]; + PUTU32(out + 4, s1); + s2 = + (Te4[(t2 >> 24) ] & 0xff000000) ^ + (Te4[(t3 >> 16) & 0xff] & 0x00ff0000) ^ + (Te4[(t0 >> 8) & 0xff] & 0x0000ff00) ^ + (Te4[(t1 ) & 0xff] & 0x000000ff) ^ + rk[2]; + PUTU32(out + 8, s2); + s3 = + (Te4[(t3 >> 24) ] & 0xff000000) ^ + (Te4[(t0 >> 16) & 0xff] & 0x00ff0000) ^ + (Te4[(t1 >> 8) & 0xff] & 0x0000ff00) ^ + (Te4[(t2 ) & 0xff] & 0x000000ff) ^ + rk[3]; + PUTU32(out + 12, s3); +} + +/* + * Decrypt a single block + * in and out can overlap + */ +void AES_decrypt(const unsigned char *in, unsigned char *out, + const AES_KEY *key) { + + const u32 *rk; + u32 s0, s1, s2, s3, t0, t1, t2, t3; +#ifndef FULL_UNROLL + int r; +#endif /* ?FULL_UNROLL */ + + assert(in && out && key); + rk = key->rd_key; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + s0 = GETU32(in ) ^ rk[0]; + s1 = GETU32(in + 4) ^ rk[1]; + s2 = GETU32(in + 8) ^ rk[2]; + s3 = GETU32(in + 12) ^ rk[3]; +#ifdef FULL_UNROLL + /* round 1: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[ 4]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[ 5]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[ 6]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[ 7]; + /* round 2: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[ 8]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[ 9]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[10]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[11]; + /* round 3: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[12]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[13]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[14]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[15]; + /* round 4: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[16]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[17]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[18]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[19]; + /* round 5: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[20]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[21]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[22]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[23]; + /* round 6: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[24]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[25]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[26]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[27]; + /* round 7: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[28]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[29]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[30]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[31]; + /* round 8: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[32]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[33]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[34]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[35]; + /* round 9: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[36]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[37]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[38]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[39]; + if (key->rounds > 10) { + /* round 10: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[40]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[41]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[42]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[43]; + /* round 11: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[44]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[45]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[46]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[47]; + if (key->rounds > 12) { + /* round 12: */ + s0 = Td0[t0 >> 24] ^ Td1[(t3 >> 16) & 0xff] ^ Td2[(t2 >> 8) & 0xff] ^ Td3[t1 & 0xff] ^ rk[48]; + s1 = Td0[t1 >> 24] ^ Td1[(t0 >> 16) & 0xff] ^ Td2[(t3 >> 8) & 0xff] ^ Td3[t2 & 0xff] ^ rk[49]; + s2 = Td0[t2 >> 24] ^ Td1[(t1 >> 16) & 0xff] ^ Td2[(t0 >> 8) & 0xff] ^ Td3[t3 & 0xff] ^ rk[50]; + s3 = Td0[t3 >> 24] ^ Td1[(t2 >> 16) & 0xff] ^ Td2[(t1 >> 8) & 0xff] ^ Td3[t0 & 0xff] ^ rk[51]; + /* round 13: */ + t0 = Td0[s0 >> 24] ^ Td1[(s3 >> 16) & 0xff] ^ Td2[(s2 >> 8) & 0xff] ^ Td3[s1 & 0xff] ^ rk[52]; + t1 = Td0[s1 >> 24] ^ Td1[(s0 >> 16) & 0xff] ^ Td2[(s3 >> 8) & 0xff] ^ Td3[s2 & 0xff] ^ rk[53]; + t2 = Td0[s2 >> 24] ^ Td1[(s1 >> 16) & 0xff] ^ Td2[(s0 >> 8) & 0xff] ^ Td3[s3 & 0xff] ^ rk[54]; + t3 = Td0[s3 >> 24] ^ Td1[(s2 >> 16) & 0xff] ^ Td2[(s1 >> 8) & 0xff] ^ Td3[s0 & 0xff] ^ rk[55]; + } + } + rk += key->rounds << 2; +#else /* !FULL_UNROLL */ + /* + * Nr - 1 full rounds: + */ + r = key->rounds >> 1; + for (;;) { + t0 = + Td0[(s0 >> 24) ] ^ + Td1[(s3 >> 16) & 0xff] ^ + Td2[(s2 >> 8) & 0xff] ^ + Td3[(s1 ) & 0xff] ^ + rk[4]; + t1 = + Td0[(s1 >> 24) ] ^ + Td1[(s0 >> 16) & 0xff] ^ + Td2[(s3 >> 8) & 0xff] ^ + Td3[(s2 ) & 0xff] ^ + rk[5]; + t2 = + Td0[(s2 >> 24) ] ^ + Td1[(s1 >> 16) & 0xff] ^ + Td2[(s0 >> 8) & 0xff] ^ + Td3[(s3 ) & 0xff] ^ + rk[6]; + t3 = + Td0[(s3 >> 24) ] ^ + Td1[(s2 >> 16) & 0xff] ^ + Td2[(s1 >> 8) & 0xff] ^ + Td3[(s0 ) & 0xff] ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + s0 = + Td0[(t0 >> 24) ] ^ + Td1[(t3 >> 16) & 0xff] ^ + Td2[(t2 >> 8) & 0xff] ^ + Td3[(t1 ) & 0xff] ^ + rk[0]; + s1 = + Td0[(t1 >> 24) ] ^ + Td1[(t0 >> 16) & 0xff] ^ + Td2[(t3 >> 8) & 0xff] ^ + Td3[(t2 ) & 0xff] ^ + rk[1]; + s2 = + Td0[(t2 >> 24) ] ^ + Td1[(t1 >> 16) & 0xff] ^ + Td2[(t0 >> 8) & 0xff] ^ + Td3[(t3 ) & 0xff] ^ + rk[2]; + s3 = + Td0[(t3 >> 24) ] ^ + Td1[(t2 >> 16) & 0xff] ^ + Td2[(t1 >> 8) & 0xff] ^ + Td3[(t0 ) & 0xff] ^ + rk[3]; + } +#endif /* ?FULL_UNROLL */ + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Td4[(t0 >> 24) ] & 0xff000000) ^ + (Td4[(t3 >> 16) & 0xff] & 0x00ff0000) ^ + (Td4[(t2 >> 8) & 0xff] & 0x0000ff00) ^ + (Td4[(t1 ) & 0xff] & 0x000000ff) ^ + rk[0]; + PUTU32(out , s0); + s1 = + (Td4[(t1 >> 24) ] & 0xff000000) ^ + (Td4[(t0 >> 16) & 0xff] & 0x00ff0000) ^ + (Td4[(t3 >> 8) & 0xff] & 0x0000ff00) ^ + (Td4[(t2 ) & 0xff] & 0x000000ff) ^ + rk[1]; + PUTU32(out + 4, s1); + s2 = + (Td4[(t2 >> 24) ] & 0xff000000) ^ + (Td4[(t1 >> 16) & 0xff] & 0x00ff0000) ^ + (Td4[(t0 >> 8) & 0xff] & 0x0000ff00) ^ + (Td4[(t3 ) & 0xff] & 0x000000ff) ^ + rk[2]; + PUTU32(out + 8, s2); + s3 = + (Td4[(t3 >> 24) ] & 0xff000000) ^ + (Td4[(t2 >> 16) & 0xff] & 0x00ff0000) ^ + (Td4[(t1 >> 8) & 0xff] & 0x0000ff00) ^ + (Td4[(t0 ) & 0xff] & 0x000000ff) ^ + rk[3]; + PUTU32(out + 12, s3); +} + +#endif /* def OPENSSL_FIPS */ diff --git a/lib/libssl/src/fips-1.0/aes/fips_aes_locl.h b/lib/libssl/src/fips-1.0/aes/fips_aes_locl.h new file mode 100644 index 00000000000..4184729e344 --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/fips_aes_locl.h @@ -0,0 +1,85 @@ +/* crypto/aes/aes.h -*- mode:C; c-file-style: "eay" -*- */ +/* ==================================================================== + * Copyright (c) 1998-2002 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + */ + +#ifndef HEADER_AES_LOCL_H +#define HEADER_AES_LOCL_H + +#include <openssl/e_os2.h> + +#ifdef OPENSSL_NO_AES +#error AES is disabled. +#endif + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +#if defined(_MSC_VER) && !defined(_M_IA64) && !defined(OPENSSL_SYS_WINCE) +# define SWAP(x) (_lrotl(x, 8) & 0x00ff00ff | _lrotr(x, 8) & 0xff00ff00) +# define GETU32(p) SWAP(*((u32 *)(p))) +# define PUTU32(ct, st) { *((u32 *)(ct)) = SWAP((st)); } +#else +# define GETU32(pt) (((u32)(pt)[0] << 24) ^ ((u32)(pt)[1] << 16) ^ ((u32)(pt)[2] << 8) ^ ((u32)(pt)[3])) +# define PUTU32(ct, st) { (ct)[0] = (u8)((st) >> 24); (ct)[1] = (u8)((st) >> 16); (ct)[2] = (u8)((st) >> 8); (ct)[3] = (u8)(st); } +#endif + +typedef unsigned long u32; +typedef unsigned short u16; +typedef unsigned char u8; + +#define MAXKC (256/32) +#define MAXKB (256/8) +#define MAXNR 14 + +/* This controls loop-unrolling in aes_core.c */ +#undef FULL_UNROLL + +#endif /* !HEADER_AES_LOCL_H */ diff --git a/lib/libssl/src/fips-1.0/aes/fips_aes_selftest.c b/lib/libssl/src/fips-1.0/aes/fips_aes_selftest.c new file mode 100644 index 00000000000..0e53d21bd0d --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/fips_aes_selftest.c @@ -0,0 +1,112 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/aes.h> + +#ifdef OPENSSL_FIPS +static struct + { + unsigned char key[16]; + unsigned char plaintext[16]; + unsigned char ciphertext[16]; + } tests[]= + { + { + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07, + 0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F }, + { 0x00,0x11,0x22,0x33,0x44,0x55,0x66,0x77, + 0x88,0x99,0xAA,0xBB,0xCC,0xDD,0xEE,0xFF }, + { 0x69,0xC4,0xE0,0xD8,0x6A,0x7B,0x04,0x30, + 0xD8,0xCD,0xB7,0x80,0x70,0xB4,0xC5,0x5A }, + }, + }; + +void FIPS_corrupt_aes() + { + tests[0].key[0]++; + } + +int FIPS_selftest_aes() + { + int n; + + /* Encrypt and check against known ciphertext */ + for(n=0 ; n < 1 ; ++n) + { + AES_KEY key; + unsigned char buf[16]; + + AES_set_encrypt_key(tests[n].key,128,&key); + AES_encrypt(tests[n].plaintext,buf,&key); + if(memcmp(buf,tests[n].ciphertext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_AES,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + /* Decrypt and check against known plaintext */ + for(n=0 ; n < 1 ; ++n) + { + AES_KEY key; + unsigned char buf[16]; + + AES_set_decrypt_key(tests[n].key,128,&key); + AES_decrypt(tests[n].ciphertext,buf,&key); + if(memcmp(buf,tests[n].plaintext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_AES,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + return 1; + } +#endif diff --git a/lib/libssl/src/fips-1.0/aes/fips_aesavs.c b/lib/libssl/src/fips-1.0/aes/fips_aesavs.c new file mode 100644 index 00000000000..6bb9b899c86 --- /dev/null +++ b/lib/libssl/src/fips-1.0/aes/fips_aesavs.c @@ -0,0 +1,1005 @@ +/* ==================================================================== + * Copyright (c) 2004 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ +/*--------------------------------------------- + NIST AES Algorithm Validation Suite + Test Program + + Donated to OpenSSL by: + V-ONE Corporation + 20250 Century Blvd, Suite 300 + Germantown, MD 20874 + U.S.A. + ----------------------------------------------*/ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <errno.h> +#include <assert.h> + +#include <openssl/aes.h> +#include <openssl/evp.h> +#include <openssl/fips.h> +#include <openssl/err.h> +#include "e_os.h" + +#define AES_BLOCK_SIZE 16 + +#define VERBOSE 1 + +/*-----------------------------------------------*/ + +int AESTest(EVP_CIPHER_CTX *ctx, + char *amode, int akeysz, unsigned char *aKey, + unsigned char *iVec, + int dir, /* 0 = decrypt, 1 = encrypt */ + unsigned char *plaintext, unsigned char *ciphertext, int len) + { + const EVP_CIPHER *cipher = NULL; + int ret = 1; + int kt = 0; + + if (ctx) + memset(ctx, 0, sizeof(EVP_CIPHER_CTX)); + + if (strcasecmp(amode, "CBC") == 0) + kt = 1000; + else if (strcasecmp(amode, "ECB") == 0) + kt = 2000; + else if (strcasecmp(amode, "CFB128") == 0) + kt = 3000; + else if (strncasecmp(amode, "OFB", 3) == 0) + kt = 4000; + else if(!strcasecmp(amode,"CFB1")) + kt=5000; + else if(!strcasecmp(amode,"CFB8")) + kt=6000; + else + { + printf("Unknown mode: %s\n", amode); + EXIT(1); + } + if (ret) + { + if ((akeysz != 128) && (akeysz != 192) && (akeysz != 256)) + { + printf("Invalid key size: %d\n", akeysz); + ret = 0; + } + else + { + kt += akeysz; + switch (kt) + { + case 1128: /* CBC 128 */ + cipher = EVP_aes_128_cbc(); + break; + case 1192: /* CBC 192 */ + cipher = EVP_aes_192_cbc(); + break; + case 1256: /* CBC 256 */ + cipher = EVP_aes_256_cbc(); + break; + case 2128: /* ECB 128 */ + cipher = EVP_aes_128_ecb(); + break; + case 2192: /* ECB 192 */ + cipher = EVP_aes_192_ecb(); + break; + case 2256: /* ECB 256 */ + cipher = EVP_aes_256_ecb(); + break; + case 3128: /* CFB 128 */ + cipher = EVP_aes_128_cfb(); + break; + case 3192: /* CFB 192 */ + cipher = EVP_aes_192_cfb(); + break; + case 3256: /* CFB 256 */ + cipher = EVP_aes_256_cfb(); + break; + case 4128: /* OFB 128 */ + cipher = EVP_aes_128_ofb(); + break; + case 4192: /* OFB 192 */ + cipher = EVP_aes_192_ofb(); + break; + case 4256: /* OFB 256 */ + cipher = EVP_aes_256_ofb(); + break; + case 5128: + cipher=EVP_aes_128_cfb1(); + break; + case 5192: + cipher=EVP_aes_192_cfb1(); + break; + case 5256: + cipher=EVP_aes_256_cfb1(); + break; + case 6128: + cipher=EVP_aes_128_cfb8(); + break; + case 6192: + cipher=EVP_aes_192_cfb8(); + break; + case 6256: + cipher=EVP_aes_256_cfb8(); + break; + default: + printf("Didn't handle mode %d\n",kt); + EXIT(1); + } + if (dir) + { /* encrypt */ + if(!EVP_CipherInit(ctx, cipher, aKey, iVec, AES_ENCRYPT)) + { + ERR_print_errors_fp(stderr); + EXIT(1); + } + + EVP_Cipher(ctx, ciphertext, (unsigned char*)plaintext, len); + } + else + { /* decrypt */ + if(!EVP_CipherInit(ctx, cipher, aKey, iVec, AES_DECRYPT)) + { + ERR_print_errors_fp(stderr); + EXIT(1); + } + EVP_Cipher(ctx, (unsigned char*)plaintext, ciphertext, len); + } + } + } + return ret; + } + +/*-----------------------------------------------*/ + +int hex2bin(char *in, int len, unsigned char *out) +{ + int n1, n2; + unsigned char ch; + + for (n1 = 0, n2 = 0; n1 < len; ) + { /* first byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + if(len == 1) + { + out[n2++]=ch; + break; + } + out[n2] = ch << 4; + /* second byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + out[n2++] |= ch; + } + return n2; +} + +/*-----------------------------------------------*/ + +int bin2hex(unsigned char *in, int len, char *out) +{ + int n1, n2; + unsigned char ch; + + for (n1 = 0, n2 = 0; n1 < len; ++n1) + { + /* first nibble */ + ch = in[n1] >> 4; + if (ch <= 0x09) + out[n2++] = ch + '0'; + else + out[n2++] = ch - 10 + 'a'; + /* second nibble */ + ch = in[n1] & 0x0f; + if (ch <= 0x09) + out[n2++] = ch + '0'; + else + out[n2++] = ch - 10 + 'a'; + } + return n2; +} + +/* NB: this return the number of _bits_ read */ +int bint2bin(const char *in, int len, unsigned char *out) + { + int n; + + memset(out,0,len); + for(n=0 ; n < len ; ++n) + if(in[n] == '1') + out[n/8]|=(0x80 >> (n%8)); + return len; + } + +int bin2bint(const unsigned char *in,int len,char *out) + { + int n; + + for(n=0 ; n < len ; ++n) + out[n]=(in[n/8]&(0x80 >> (n%8))) ? '1' : '0'; + return n; + } + +/*-----------------------------------------------*/ + +void PrintValue(char *tag, unsigned char *val, int len) +{ +#if VERBOSE + char obuf[2048]; + int olen; + olen = bin2hex(val, len, obuf); + printf("%s = %.*s\n", tag, olen, obuf); +#endif +} + +void OutputValue(char *tag, unsigned char *val, int len, FILE *rfp,int bitmode) + { + char obuf[2048]; + int olen; + + if(bitmode) + olen=bin2bint(val,len,obuf); + else + olen=bin2hex(val,len,obuf); + + fprintf(rfp, "%s = %.*s\n", tag, olen, obuf); +#if VERBOSE + printf("%s = %.*s\n", tag, olen, obuf); +#endif + } + +/*-----------------------------------------------*/ +char *t_tag[2] = {"PLAINTEXT", "CIPHERTEXT"}; +char *t_mode[6] = {"CBC","ECB","OFB","CFB1","CFB8","CFB128"}; +enum Mode {CBC, ECB, OFB, CFB1, CFB8, CFB128}; +enum XCrypt {XDECRYPT, XENCRYPT}; + +/*=============================*/ +/* Monte Carlo Tests */ +/*-----------------------------*/ + +/*#define gb(a,b) (((a)[(b)/8] >> ((b)%8))&1)*/ +/*#define sb(a,b,v) ((a)[(b)/8]=((a)[(b)/8]&~(1 << ((b)%8)))|(!!(v) << ((b)%8)))*/ + +#define gb(a,b) (((a)[(b)/8] >> (7-(b)%8))&1) +#define sb(a,b,v) ((a)[(b)/8]=((a)[(b)/8]&~(1 << (7-(b)%8)))|(!!(v) << (7-(b)%8))) + +int do_mct(char *amode, + int akeysz, unsigned char *aKey,unsigned char *iVec, + int dir, unsigned char *text, int len, + FILE *rfp) + { + int ret = 0; + unsigned char key[101][32]; + unsigned char iv[101][AES_BLOCK_SIZE]; + unsigned char ptext[1001][32]; + unsigned char ctext[1001][32]; + unsigned char ciphertext[64+4]; + int i, j, n, n1, n2; + int imode = 0, nkeysz = akeysz/8; + EVP_CIPHER_CTX ctx; + + if (len > 32) + { + printf("\n>>>> Length exceeds 32 for %s %d <<<<\n\n", + amode, akeysz); + return -1; + } + for (imode = 0; imode < 6; ++imode) + if (strcmp(amode, t_mode[imode]) == 0) + break; + if (imode == 6) + { + printf("Unrecognized mode: %s\n", amode); + return -1; + } + + memcpy(key[0], aKey, nkeysz); + if (iVec) + memcpy(iv[0], iVec, AES_BLOCK_SIZE); + if (dir == XENCRYPT) + memcpy(ptext[0], text, len); + else + memcpy(ctext[0], text, len); + for (i = 0; i < 100; ++i) + { + /* printf("Iteration %d\n", i); */ + if (i > 0) + { + fprintf(rfp,"COUNT = %d\n",i); + OutputValue("KEY",key[i],nkeysz,rfp,0); + if (imode != ECB) /* ECB */ + OutputValue("IV",iv[i],AES_BLOCK_SIZE,rfp,0); + /* Output Ciphertext | Plaintext */ + OutputValue(t_tag[dir^1],dir ? ptext[0] : ctext[0],len,rfp, + imode == CFB1); + } + for (j = 0; j < 1000; ++j) + { + switch (imode) + { + case ECB: + if (j == 0) + { /* set up encryption */ + ret = AESTest(&ctx, amode, akeysz, key[i], NULL, + dir, /* 0 = decrypt, 1 = encrypt */ + ptext[j], ctext[j], len); + if (dir == XENCRYPT) + memcpy(ptext[j+1], ctext[j], len); + else + memcpy(ctext[j+1], ptext[j], len); + } + else + { + if (dir == XENCRYPT) + { + EVP_Cipher(&ctx, ctext[j], ptext[j], len); + memcpy(ptext[j+1], ctext[j], len); + } + else + { + EVP_Cipher(&ctx, ptext[j], ctext[j], len); + memcpy(ctext[j+1], ptext[j], len); + } + } + break; + + case CBC: + case OFB: + case CFB128: + if (j == 0) + { + ret = AESTest(&ctx, amode, akeysz, key[i], iv[i], + dir, /* 0 = decrypt, 1 = encrypt */ + ptext[j], ctext[j], len); + if (dir == XENCRYPT) + memcpy(ptext[j+1], iv[i], len); + else + memcpy(ctext[j+1], iv[i], len); + } + else + { + if (dir == XENCRYPT) + { + EVP_Cipher(&ctx, ctext[j], ptext[j], len); + memcpy(ptext[j+1], ctext[j-1], len); + } + else + { + EVP_Cipher(&ctx, ptext[j], ctext[j], len); + memcpy(ctext[j+1], ptext[j-1], len); + } + } + break; + + case CFB8: + if (j == 0) + { + ret = AESTest(&ctx, amode, akeysz, key[i], iv[i], + dir, /* 0 = decrypt, 1 = encrypt */ + ptext[j], ctext[j], len); + } + else + { + if (dir == XENCRYPT) + EVP_Cipher(&ctx, ctext[j], ptext[j], len); + else + EVP_Cipher(&ctx, ptext[j], ctext[j], len); + } + if (dir == XENCRYPT) + { + if (j < 16) + memcpy(ptext[j+1], &iv[i][j], len); + else + memcpy(ptext[j+1], ctext[j-16], len); + } + else + { + if (j < 16) + memcpy(ctext[j+1], &iv[i][j], len); + else + memcpy(ctext[j+1], ptext[j-16], len); + } + break; + + case CFB1: + if(j == 0) + { + /* compensate for wrong endianness of input file */ + if(i == 0) + ptext[0][0]<<=7; + ret=AESTest(&ctx,amode,akeysz,key[i],iv[i],dir, + ptext[j], ctext[j], len); + } + else + { + if (dir == XENCRYPT) + EVP_Cipher(&ctx, ctext[j], ptext[j], len); + else + EVP_Cipher(&ctx, ptext[j], ctext[j], len); + + } + if(dir == XENCRYPT) + { + if(j < 128) + sb(ptext[j+1],0,gb(iv[i],j)); + else + sb(ptext[j+1],0,gb(ctext[j-128],0)); + } + else + { + if(j < 128) + sb(ctext[j+1],0,gb(iv[i],j)); + else + sb(ctext[j+1],0,gb(ptext[j-128],0)); + } + break; + } + } + --j; /* reset to last of range */ + /* Output Ciphertext | Plaintext */ + OutputValue(t_tag[dir],dir ? ctext[j] : ptext[j],len,rfp, + imode == CFB1); + fprintf(rfp, "\n"); /* add separator */ + + /* Compute next KEY */ + if (dir == XENCRYPT) + { + if (imode == CFB8) + { /* ct = CT[j-15] || CT[j-14] || ... || CT[j] */ + for (n1 = 0, n2 = nkeysz-1; n1 < nkeysz; ++n1, --n2) + ciphertext[n1] = ctext[j-n2][0]; + } + else if(imode == CFB1) + { + for(n1=0,n2=akeysz-1 ; n1 < akeysz ; ++n1,--n2) + sb(ciphertext,n1,gb(ctext[j-n2],0)); + } + else + switch (akeysz) + { + case 128: + memcpy(ciphertext, ctext[j], 16); + break; + case 192: + memcpy(ciphertext, ctext[j-1]+8, 8); + memcpy(ciphertext+8, ctext[j], 16); + break; + case 256: + memcpy(ciphertext, ctext[j-1], 16); + memcpy(ciphertext+16, ctext[j], 16); + break; + } + } + else + { + if (imode == CFB8) + { /* ct = CT[j-15] || CT[j-14] || ... || CT[j] */ + for (n1 = 0, n2 = nkeysz-1; n1 < nkeysz; ++n1, --n2) + ciphertext[n1] = ptext[j-n2][0]; + } + else if(imode == CFB1) + { + for(n1=0,n2=akeysz-1 ; n1 < akeysz ; ++n1,--n2) + sb(ciphertext,n1,gb(ptext[j-n2],0)); + } + else + switch (akeysz) + { + case 128: + memcpy(ciphertext, ptext[j], 16); + break; + case 192: + memcpy(ciphertext, ptext[j-1]+8, 8); + memcpy(ciphertext+8, ptext[j], 16); + break; + case 256: + memcpy(ciphertext, ptext[j-1], 16); + memcpy(ciphertext+16, ptext[j], 16); + break; + } + } + /* Compute next key: Key[i+1] = Key[i] xor ct */ + for (n = 0; n < nkeysz; ++n) + key[i+1][n] = key[i][n] ^ ciphertext[n]; + + /* Compute next IV and text */ + if (dir == XENCRYPT) + { + switch (imode) + { + case ECB: + memcpy(ptext[0], ctext[j], AES_BLOCK_SIZE); + break; + case CBC: + case OFB: + case CFB128: + memcpy(iv[i+1], ctext[j], AES_BLOCK_SIZE); + memcpy(ptext[0], ctext[j-1], AES_BLOCK_SIZE); + break; + case CFB8: + /* IV[i+1] = ct */ + for (n1 = 0, n2 = 15; n1 < 16; ++n1, --n2) + iv[i+1][n1] = ctext[j-n2][0]; + ptext[0][0] = ctext[j-16][0]; + break; + case CFB1: + for(n1=0,n2=127 ; n1 < 128 ; ++n1,--n2) + sb(iv[i+1],n1,gb(ctext[j-n2],0)); + ptext[0][0]=ctext[j-128][0]&0x80; + break; + } + } + else + { + switch (imode) + { + case ECB: + memcpy(ctext[0], ptext[j], AES_BLOCK_SIZE); + break; + case CBC: + case OFB: + case CFB128: + memcpy(iv[i+1], ptext[j], AES_BLOCK_SIZE); + memcpy(ctext[0], ptext[j-1], AES_BLOCK_SIZE); + break; + case CFB8: + for (n1 = 0, n2 = 15; n1 < 16; ++n1, --n2) + iv[i+1][n1] = ptext[j-n2][0]; + ctext[0][0] = ptext[j-16][0]; + break; + case CFB1: + for(n1=0,n2=127 ; n1 < 128 ; ++n1,--n2) + sb(iv[i+1],n1,gb(ptext[j-n2],0)); + ctext[0][0]=ptext[j-128][0]&0x80; + break; + } + } + } + + return ret; + } + +/*================================================*/ +/*---------------------------- + # Config info for v-one + # AESVS MMT test data for ECB + # State : Encrypt and Decrypt + # Key Length : 256 + # Fri Aug 30 04:07:22 PM + ----------------------------*/ + +int proc_file(char *rqfile) + { + char afn[256], rfn[256]; + FILE *afp = NULL, *rfp = NULL; + char ibuf[2048]; + int ilen, len, ret = 0; + char algo[8] = ""; + char amode[8] = ""; + char atest[8] = ""; + int akeysz = 0; + unsigned char iVec[20], aKey[40]; + int dir = -1, err = 0, step = 0; + unsigned char plaintext[2048]; + unsigned char ciphertext[2048]; + char *rp; + EVP_CIPHER_CTX ctx; + + if (!rqfile || !(*rqfile)) + { + printf("No req file\n"); + return -1; + } + strcpy(afn, rqfile); + + if ((afp = fopen(afn, "r")) == NULL) + { + printf("Cannot open file: %s, %s\n", + afn, strerror(errno)); + return -1; + } + strcpy(rfn,afn); + rp=strstr(rfn,"req/"); + assert(rp); + memcpy(rp,"rsp",3); + rp = strstr(rfn, ".req"); + memcpy(rp, ".rsp", 4); + if ((rfp = fopen(rfn, "w")) == NULL) + { + printf("Cannot open file: %s, %s\n", + rfn, strerror(errno)); + fclose(afp); + afp = NULL; + return -1; + } + while (!err && (fgets(ibuf, sizeof(ibuf), afp)) != NULL) + { + ilen = strlen(ibuf); + /* printf("step=%d ibuf=%s",step,ibuf); */ + switch (step) + { + case 0: /* read preamble */ + if (ibuf[0] == '\n') + { /* end of preamble */ + if ((*algo == '\0') || + (*amode == '\0') || + (akeysz == 0)) + { + printf("Missing Algorithm, Mode or KeySize (%s/%s/%d)\n", + algo,amode,akeysz); + err = 1; + } + else + { + fputs(ibuf, rfp); + ++ step; + } + } + else if (ibuf[0] != '#') + { + printf("Invalid preamble item: %s\n", ibuf); + err = 1; + } + else + { /* process preamble */ + char *xp, *pp = ibuf+2; + int n; + if (akeysz) + { /* insert current time & date */ + time_t rtim = time(0); + fprintf(rfp, "# %s", ctime(&rtim)); + } + else + { + fputs(ibuf, rfp); + if (strncmp(pp, "AESVS ", 6) == 0) + { + strcpy(algo, "AES"); + /* get test type */ + pp += 6; + xp = strchr(pp, ' '); + n = xp-pp; + strncpy(atest, pp, n); + atest[n] = '\0'; + /* get mode */ + xp = strrchr(pp, ' '); /* get mode" */ + n = strlen(xp+1)-1; + strncpy(amode, xp+1, n); + amode[n] = '\0'; + /* amode[3] = '\0'; */ + printf("Test = %s, Mode = %s\n", atest, amode); + } + else if (strncasecmp(pp, "Key Length : ", 13) == 0) + { + akeysz = atoi(pp+13); + printf("Key size = %d\n", akeysz); + } + } + } + break; + + case 1: /* [ENCRYPT] | [DECRYPT] */ + if (ibuf[0] == '[') + { + fputs(ibuf, rfp); + ++step; + if (strncasecmp(ibuf, "[ENCRYPT]", 9) == 0) + dir = 1; + else if (strncasecmp(ibuf, "[DECRYPT]", 9) == 0) + dir = 0; + else + { + printf("Invalid keyword: %s\n", ibuf); + err = 1; + } + break; + } + else if (dir == -1) + { + err = 1; + printf("Missing ENCRYPT/DECRYPT keyword\n"); + break; + } + else + step = 2; + + case 2: /* KEY = xxxx */ + fputs(ibuf, rfp); + if(*ibuf == '\n') + break; + if(!strncasecmp(ibuf,"COUNT = ",8)) + break; + + if (strncasecmp(ibuf, "KEY = ", 6) != 0) + { + printf("Missing KEY\n"); + err = 1; + } + else + { + len = hex2bin((char*)ibuf+6, strlen(ibuf+6)-1, aKey); + if (len < 0) + { + printf("Invalid KEY\n"); + err =1; + break; + } + PrintValue("KEY", aKey, len); + if (strcmp(amode, "ECB") == 0) + { + memset(iVec, 0, sizeof(iVec)); + step = (dir)? 4: 5; /* no ivec for ECB */ + } + else + ++step; + } + break; + + case 3: /* IV = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "IV = ", 5) != 0) + { + printf("Missing IV\n"); + err = 1; + } + else + { + len = hex2bin((char*)ibuf+5, strlen(ibuf+5)-1, iVec); + if (len < 0) + { + printf("Invalid IV\n"); + err =1; + break; + } + PrintValue("IV", iVec, len); + step = (dir)? 4: 5; + } + break; + + case 4: /* PLAINTEXT = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "PLAINTEXT = ", 12) != 0) + { + printf("Missing PLAINTEXT\n"); + err = 1; + } + else + { + int nn = strlen(ibuf+12); + if(!strcmp(amode,"CFB1")) + len=bint2bin(ibuf+12,nn-1,plaintext); + else + len=hex2bin(ibuf+12, nn-1,plaintext); + if (len < 0) + { + printf("Invalid PLAINTEXT: %s", ibuf+12); + err =1; + break; + } + if (len >= sizeof(plaintext)) + { + printf("Buffer overflow\n"); + } + PrintValue("PLAINTEXT", (unsigned char*)plaintext, len); + if (strcmp(atest, "MCT") == 0) /* Monte Carlo Test */ + { + if(do_mct(amode, akeysz, aKey, iVec, + dir, (unsigned char*)plaintext, len, + rfp) < 0) + EXIT(1); + } + else + { + ret = AESTest(&ctx, amode, akeysz, aKey, iVec, + dir, /* 0 = decrypt, 1 = encrypt */ + plaintext, ciphertext, len); + OutputValue("CIPHERTEXT",ciphertext,len,rfp, + !strcmp(amode,"CFB1")); + } + step = 6; + } + break; + + case 5: /* CIPHERTEXT = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "CIPHERTEXT = ", 13) != 0) + { + printf("Missing KEY\n"); + err = 1; + } + else + { + if(!strcmp(amode,"CFB1")) + len=bint2bin(ibuf+13,strlen(ibuf+13)-1,ciphertext); + else + len = hex2bin(ibuf+13,strlen(ibuf+13)-1,ciphertext); + if (len < 0) + { + printf("Invalid CIPHERTEXT\n"); + err =1; + break; + } + + PrintValue("CIPHERTEXT", ciphertext, len); + if (strcmp(atest, "MCT") == 0) /* Monte Carlo Test */ + { + do_mct(amode, akeysz, aKey, iVec, + dir, ciphertext, len, rfp); + } + else + { + ret = AESTest(&ctx, amode, akeysz, aKey, iVec, + dir, /* 0 = decrypt, 1 = encrypt */ + plaintext, ciphertext, len); + OutputValue("PLAINTEXT",(unsigned char *)plaintext,len,rfp, + !strcmp(amode,"CFB1")); + } + step = 6; + } + break; + + case 6: + if (ibuf[0] != '\n') + { + err = 1; + printf("Missing terminator\n"); + } + else if (strcmp(atest, "MCT") != 0) + { /* MCT already added terminating nl */ + fputs(ibuf, rfp); + } + step = 1; + break; + } + } + if (rfp) + fclose(rfp); + if (afp) + fclose(afp); + return err; + } + +/*-------------------------------------------------- + Processes either a single file or + a set of files whose names are passed in a file. + A single file is specified as: + aes_test -f xxx.req + A set of files is specified as: + aes_test -d xxxxx.xxx + The default is: -d req.txt +--------------------------------------------------*/ +int main(int argc, char **argv) + { + char *rqlist = "req.txt"; + FILE *fp = NULL; + char fn[250] = "", rfn[256] = ""; + int f_opt = 0, d_opt = 1; + +#ifdef OPENSSL_FIPS + if(!FIPS_mode_set(1)) + { + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + EXIT(1); + } +#endif + ERR_load_crypto_strings(); + if (argc > 1) + { + if (strcasecmp(argv[1], "-d") == 0) + { + d_opt = 1; + } + else if (strcasecmp(argv[1], "-f") == 0) + { + f_opt = 1; + d_opt = 0; + } + else + { + printf("Invalid parameter: %s\n", argv[1]); + return 0; + } + if (argc < 3) + { + printf("Missing parameter\n"); + return 0; + } + if (d_opt) + rqlist = argv[2]; + else + strcpy(fn, argv[2]); + } + if (d_opt) + { /* list of files (directory) */ + if (!(fp = fopen(rqlist, "r"))) + { + printf("Cannot open req list file\n"); + return -1; + } + while (fgets(fn, sizeof(fn), fp)) + { + strtok(fn, "\r\n"); + strcpy(rfn, fn); + printf("Processing: %s\n", rfn); + if (proc_file(rfn)) + { + printf(">>> Processing failed for: %s <<<\n", rfn); + EXIT(1); + } + } + fclose(fp); + } + else /* single file */ + { + printf("Processing: %s\n", fn); + if (proc_file(fn)) + { + printf(">>> Processing failed for: %s <<<\n", fn); + } + } + EXIT(0); + return 0; + } diff --git a/lib/libssl/src/fips-1.0/des/Makefile b/lib/libssl/src/fips-1.0/des/Makefile new file mode 100644 index 00000000000..772d7757900 --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/Makefile @@ -0,0 +1,135 @@ +# +# OpenSSL/fips-1.0/des/Makefile +# + +DIR= des +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +FIPS_DES_ENC=fips_des_enc.o + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST= fips_desmovs.c +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_des_enc.c asm/fips-dx86-elf.s fips_des_selftest.c fips_set_key.c +LIBOBJ=$(FIPS_DES_ENC) fips_des_selftest.o fips_set_key.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) fips_des_locl.h + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +fips_test: + -find ../testvectors/tdes/req -name '*.req' > testlist + -rm -rf ../testvectors/tdes/rsp + mkdir ../testvectors/tdes/rsp + if [ -s testlist ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_desmovs -d testlist; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(PROGS) \ + $(SRC) $(TEST) +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_des_enc.o: ../../e_os.h ../../include/openssl/crypto.h +fips_des_enc.o: ../../include/openssl/des.h ../../include/openssl/des_old.h +fips_des_enc.o: ../../include/openssl/e_os2.h ../../include/openssl/fips.h +fips_des_enc.o: ../../include/openssl/opensslconf.h +fips_des_enc.o: ../../include/openssl/opensslv.h +fips_des_enc.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_des_enc.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_des_enc.o: ../../include/openssl/ui_compat.h fips_des_enc.c +fips_des_enc.o: fips_des_locl.h +fips_des_selftest.o: ../../include/openssl/bio.h ../../include/openssl/crypto.h +fips_des_selftest.o: ../../include/openssl/des.h +fips_des_selftest.o: ../../include/openssl/des_old.h +fips_des_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_des_selftest.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_des_selftest.o: ../../include/openssl/opensslconf.h +fips_des_selftest.o: ../../include/openssl/opensslv.h +fips_des_selftest.o: ../../include/openssl/safestack.h +fips_des_selftest.o: ../../include/openssl/stack.h +fips_des_selftest.o: ../../include/openssl/symhacks.h +fips_des_selftest.o: ../../include/openssl/ui.h +fips_des_selftest.o: ../../include/openssl/ui_compat.h fips_des_selftest.c +fips_desmovs.o: ../../e_os.h ../../include/openssl/aes.h +fips_desmovs.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_desmovs.o: ../../include/openssl/blowfish.h ../../include/openssl/bn.h +fips_desmovs.o: ../../include/openssl/cast.h ../../include/openssl/crypto.h +fips_desmovs.o: ../../include/openssl/des.h ../../include/openssl/des_old.h +fips_desmovs.o: ../../include/openssl/dh.h ../../include/openssl/dsa.h +fips_desmovs.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_desmovs.o: ../../include/openssl/evp.h ../../include/openssl/fips.h +fips_desmovs.o: ../../include/openssl/idea.h ../../include/openssl/lhash.h +fips_desmovs.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +fips_desmovs.o: ../../include/openssl/md5.h ../../include/openssl/mdc2.h +fips_desmovs.o: ../../include/openssl/obj_mac.h ../../include/openssl/objects.h +fips_desmovs.o: ../../include/openssl/opensslconf.h +fips_desmovs.o: ../../include/openssl/opensslv.h +fips_desmovs.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rc2.h +fips_desmovs.o: ../../include/openssl/rc4.h ../../include/openssl/rc5.h +fips_desmovs.o: ../../include/openssl/ripemd.h ../../include/openssl/rsa.h +fips_desmovs.o: ../../include/openssl/safestack.h ../../include/openssl/sha.h +fips_desmovs.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_desmovs.o: ../../include/openssl/ui.h ../../include/openssl/ui_compat.h +fips_desmovs.o: fips_desmovs.c +fips_set_key.o: ../../e_os.h ../../include/openssl/crypto.h +fips_set_key.o: ../../include/openssl/des.h ../../include/openssl/des_old.h +fips_set_key.o: ../../include/openssl/e_os2.h ../../include/openssl/fips.h +fips_set_key.o: ../../include/openssl/opensslconf.h +fips_set_key.o: ../../include/openssl/opensslv.h +fips_set_key.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_set_key.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_set_key.o: ../../include/openssl/ui_compat.h fips_des_locl.h +fips_set_key.o: fips_set_key.c diff --git a/lib/libssl/src/fips-1.0/des/asm/fips-dx86-elf.s b/lib/libssl/src/fips-1.0/des/asm/fips-dx86-elf.s new file mode 100644 index 00000000000..7b4b11f0f32 --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/asm/fips-dx86-elf.s @@ -0,0 +1,2707 @@ + + + + + + + .file "des-586.s" + .version "01.01" +gcc2_compiled.: +.text + .align 16 +.globl DES_encrypt1 + .type DES_encrypt1,@function +DES_encrypt1: + pushl %esi + pushl %edi + + + movl 12(%esp), %esi + xorl %ecx, %ecx + pushl %ebx + pushl %ebp + movl (%esi), %eax + movl 28(%esp), %ebx + movl 4(%esi), %edi + + + roll $4, %eax + movl %eax, %esi + xorl %edi, %eax + andl $0xf0f0f0f0, %eax + xorl %eax, %esi + xorl %eax, %edi + + roll $20, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0xfff0000f, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $14, %eax + movl %eax, %edi + xorl %esi, %eax + andl $0x33333333, %eax + xorl %eax, %edi + xorl %eax, %esi + + roll $22, %esi + movl %esi, %eax + xorl %edi, %esi + andl $0x03fc03fc, %esi + xorl %esi, %eax + xorl %esi, %edi + + roll $9, %eax + movl %eax, %esi + xorl %edi, %eax + andl $0xaaaaaaaa, %eax + xorl %eax, %esi + xorl %eax, %edi + +.byte 209 +.byte 199 + .align 8 + call .L000PIC_me_up +.L000PIC_me_up: + popl %ebp + addl $_GLOBAL_OFFSET_TABLE_+[.-.L000PIC_me_up],%ebp + movl DES_SPtrans@GOT(%ebp),%ebp + movl 24(%esp), %ecx + cmpl $0, %ebx + je .L001start_decrypt + + + movl (%ecx), %eax + xorl %ebx, %ebx + movl 4(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 8(%ecx), %eax + xorl %ebx, %ebx + movl 12(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 16(%ecx), %eax + xorl %ebx, %ebx + movl 20(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 24(%ecx), %eax + xorl %ebx, %ebx + movl 28(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 32(%ecx), %eax + xorl %ebx, %ebx + movl 36(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 40(%ecx), %eax + xorl %ebx, %ebx + movl 44(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 48(%ecx), %eax + xorl %ebx, %ebx + movl 52(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 56(%ecx), %eax + xorl %ebx, %ebx + movl 60(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 64(%ecx), %eax + xorl %ebx, %ebx + movl 68(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 72(%ecx), %eax + xorl %ebx, %ebx + movl 76(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 80(%ecx), %eax + xorl %ebx, %ebx + movl 84(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 88(%ecx), %eax + xorl %ebx, %ebx + movl 92(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 96(%ecx), %eax + xorl %ebx, %ebx + movl 100(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 104(%ecx), %eax + xorl %ebx, %ebx + movl 108(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 112(%ecx), %eax + xorl %ebx, %ebx + movl 116(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 120(%ecx), %eax + xorl %ebx, %ebx + movl 124(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + jmp .L002end +.L001start_decrypt: + + + movl 120(%ecx), %eax + xorl %ebx, %ebx + movl 124(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 112(%ecx), %eax + xorl %ebx, %ebx + movl 116(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 104(%ecx), %eax + xorl %ebx, %ebx + movl 108(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 96(%ecx), %eax + xorl %ebx, %ebx + movl 100(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 88(%ecx), %eax + xorl %ebx, %ebx + movl 92(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 80(%ecx), %eax + xorl %ebx, %ebx + movl 84(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 72(%ecx), %eax + xorl %ebx, %ebx + movl 76(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 64(%ecx), %eax + xorl %ebx, %ebx + movl 68(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 56(%ecx), %eax + xorl %ebx, %ebx + movl 60(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 48(%ecx), %eax + xorl %ebx, %ebx + movl 52(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 40(%ecx), %eax + xorl %ebx, %ebx + movl 44(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 32(%ecx), %eax + xorl %ebx, %ebx + movl 36(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 24(%ecx), %eax + xorl %ebx, %ebx + movl 28(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 16(%ecx), %eax + xorl %ebx, %ebx + movl 20(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 8(%ecx), %eax + xorl %ebx, %ebx + movl 12(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl (%ecx), %eax + xorl %ebx, %ebx + movl 4(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi +.L002end: + + + movl 20(%esp), %edx +.byte 209 +.byte 206 + movl %edi, %eax + xorl %esi, %edi + andl $0xaaaaaaaa, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $23, %eax + movl %eax, %edi + xorl %esi, %eax + andl $0x03fc03fc, %eax + xorl %eax, %edi + xorl %eax, %esi + + roll $10, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0x33333333, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $18, %esi + movl %esi, %edi + xorl %eax, %esi + andl $0xfff0000f, %esi + xorl %esi, %edi + xorl %esi, %eax + + roll $12, %edi + movl %edi, %esi + xorl %eax, %edi + andl $0xf0f0f0f0, %edi + xorl %edi, %esi + xorl %edi, %eax + + rorl $4, %eax + movl %eax, (%edx) + movl %esi, 4(%edx) + popl %ebp + popl %ebx + popl %edi + popl %esi + ret +.L_DES_encrypt1_end: + .size DES_encrypt1,.L_DES_encrypt1_end-DES_encrypt1 +.ident "desasm.pl" +.text + .align 16 +.globl DES_encrypt2 + .type DES_encrypt2,@function +DES_encrypt2: + pushl %esi + pushl %edi + + + movl 12(%esp), %eax + xorl %ecx, %ecx + pushl %ebx + pushl %ebp + movl (%eax), %esi + movl 28(%esp), %ebx + roll $3, %esi + movl 4(%eax), %edi + roll $3, %edi + .align 8 + call .L003PIC_me_up +.L003PIC_me_up: + popl %ebp + addl $_GLOBAL_OFFSET_TABLE_+[.-.L003PIC_me_up],%ebp + movl DES_SPtrans@GOT(%ebp),%ebp + movl 24(%esp), %ecx + cmpl $0, %ebx + je .L004start_decrypt + + + movl (%ecx), %eax + xorl %ebx, %ebx + movl 4(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 8(%ecx), %eax + xorl %ebx, %ebx + movl 12(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 16(%ecx), %eax + xorl %ebx, %ebx + movl 20(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 24(%ecx), %eax + xorl %ebx, %ebx + movl 28(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 32(%ecx), %eax + xorl %ebx, %ebx + movl 36(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 40(%ecx), %eax + xorl %ebx, %ebx + movl 44(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 48(%ecx), %eax + xorl %ebx, %ebx + movl 52(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 56(%ecx), %eax + xorl %ebx, %ebx + movl 60(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 64(%ecx), %eax + xorl %ebx, %ebx + movl 68(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 72(%ecx), %eax + xorl %ebx, %ebx + movl 76(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 80(%ecx), %eax + xorl %ebx, %ebx + movl 84(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 88(%ecx), %eax + xorl %ebx, %ebx + movl 92(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 96(%ecx), %eax + xorl %ebx, %ebx + movl 100(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 104(%ecx), %eax + xorl %ebx, %ebx + movl 108(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 112(%ecx), %eax + xorl %ebx, %ebx + movl 116(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 120(%ecx), %eax + xorl %ebx, %ebx + movl 124(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + jmp .L005end +.L004start_decrypt: + + + movl 120(%ecx), %eax + xorl %ebx, %ebx + movl 124(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 112(%ecx), %eax + xorl %ebx, %ebx + movl 116(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 104(%ecx), %eax + xorl %ebx, %ebx + movl 108(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 96(%ecx), %eax + xorl %ebx, %ebx + movl 100(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 88(%ecx), %eax + xorl %ebx, %ebx + movl 92(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 80(%ecx), %eax + xorl %ebx, %ebx + movl 84(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 72(%ecx), %eax + xorl %ebx, %ebx + movl 76(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 64(%ecx), %eax + xorl %ebx, %ebx + movl 68(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 56(%ecx), %eax + xorl %ebx, %ebx + movl 60(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 48(%ecx), %eax + xorl %ebx, %ebx + movl 52(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 40(%ecx), %eax + xorl %ebx, %ebx + movl 44(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 32(%ecx), %eax + xorl %ebx, %ebx + movl 36(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 24(%ecx), %eax + xorl %ebx, %ebx + movl 28(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl 16(%ecx), %eax + xorl %ebx, %ebx + movl 20(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi + + + movl 8(%ecx), %eax + xorl %ebx, %ebx + movl 12(%ecx), %edx + xorl %esi, %eax + xorl %ecx, %ecx + xorl %esi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%edi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%edi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%edi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%edi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%edi + xorl 0x700(%ebp,%ecx),%edi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%edi + xorl 0x500(%ebp,%edx),%edi + + + movl (%ecx), %eax + xorl %ebx, %ebx + movl 4(%ecx), %edx + xorl %edi, %eax + xorl %ecx, %ecx + xorl %edi, %edx + andl $0xfcfcfcfc, %eax + andl $0xcfcfcfcf, %edx + movb %al, %bl + movb %ah, %cl + rorl $4, %edx + xorl (%ebp,%ebx),%esi + movb %dl, %bl + xorl 0x200(%ebp,%ecx),%esi + movb %dh, %cl + shrl $16, %eax + xorl 0x100(%ebp,%ebx),%esi + movb %ah, %bl + shrl $16, %edx + xorl 0x300(%ebp,%ecx),%esi + movb %dh, %cl + andl $0xff, %eax + andl $0xff, %edx + xorl 0x600(%ebp,%ebx),%esi + xorl 0x700(%ebp,%ecx),%esi + movl 24(%esp), %ecx + xorl 0x400(%ebp,%eax),%esi + xorl 0x500(%ebp,%edx),%esi +.L005end: + + + rorl $3, %edi + movl 20(%esp), %eax + rorl $3, %esi + movl %edi, (%eax) + movl %esi, 4(%eax) + popl %ebp + popl %ebx + popl %edi + popl %esi + ret +.L_DES_encrypt2_end: + .size DES_encrypt2,.L_DES_encrypt2_end-DES_encrypt2 +.ident "desasm.pl" +.text + .align 16 +.globl DES_encrypt3 + .type DES_encrypt3,@function +DES_encrypt3: + pushl %ebx + movl 8(%esp), %ebx + pushl %ebp + pushl %esi + pushl %edi + + + movl (%ebx), %edi + movl 4(%ebx), %esi + subl $12, %esp + + + roll $4, %edi + movl %edi, %edx + xorl %esi, %edi + andl $0xf0f0f0f0, %edi + xorl %edi, %edx + xorl %edi, %esi + + roll $20, %esi + movl %esi, %edi + xorl %edx, %esi + andl $0xfff0000f, %esi + xorl %esi, %edi + xorl %esi, %edx + + roll $14, %edi + movl %edi, %esi + xorl %edx, %edi + andl $0x33333333, %edi + xorl %edi, %esi + xorl %edi, %edx + + roll $22, %edx + movl %edx, %edi + xorl %esi, %edx + andl $0x03fc03fc, %edx + xorl %edx, %edi + xorl %edx, %esi + + roll $9, %edi + movl %edi, %edx + xorl %esi, %edi + andl $0xaaaaaaaa, %edi + xorl %edi, %edx + xorl %edi, %esi + + rorl $3, %edx + rorl $2, %esi + movl %esi, 4(%ebx) + movl 36(%esp), %eax + movl %edx, (%ebx) + movl 40(%esp), %edi + movl 44(%esp), %esi + movl $1, 8(%esp) + movl %eax, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + movl $0, 8(%esp) + movl %edi, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + movl $1, 8(%esp) + movl %esi, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + addl $12, %esp + movl (%ebx), %edi + movl 4(%ebx), %esi + + + roll $2, %esi + roll $3, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0xaaaaaaaa, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $23, %eax + movl %eax, %edi + xorl %esi, %eax + andl $0x03fc03fc, %eax + xorl %eax, %edi + xorl %eax, %esi + + roll $10, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0x33333333, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $18, %esi + movl %esi, %edi + xorl %eax, %esi + andl $0xfff0000f, %esi + xorl %esi, %edi + xorl %esi, %eax + + roll $12, %edi + movl %edi, %esi + xorl %eax, %edi + andl $0xf0f0f0f0, %edi + xorl %edi, %esi + xorl %edi, %eax + + rorl $4, %eax + movl %eax, (%ebx) + movl %esi, 4(%ebx) + popl %edi + popl %esi + popl %ebp + popl %ebx + ret +.L_DES_encrypt3_end: + .size DES_encrypt3,.L_DES_encrypt3_end-DES_encrypt3 +.ident "desasm.pl" +.text + .align 16 +.globl DES_decrypt3 + .type DES_decrypt3,@function +DES_decrypt3: + pushl %ebx + movl 8(%esp), %ebx + pushl %ebp + pushl %esi + pushl %edi + + + movl (%ebx), %edi + movl 4(%ebx), %esi + subl $12, %esp + + + roll $4, %edi + movl %edi, %edx + xorl %esi, %edi + andl $0xf0f0f0f0, %edi + xorl %edi, %edx + xorl %edi, %esi + + roll $20, %esi + movl %esi, %edi + xorl %edx, %esi + andl $0xfff0000f, %esi + xorl %esi, %edi + xorl %esi, %edx + + roll $14, %edi + movl %edi, %esi + xorl %edx, %edi + andl $0x33333333, %edi + xorl %edi, %esi + xorl %edi, %edx + + roll $22, %edx + movl %edx, %edi + xorl %esi, %edx + andl $0x03fc03fc, %edx + xorl %edx, %edi + xorl %edx, %esi + + roll $9, %edi + movl %edi, %edx + xorl %esi, %edi + andl $0xaaaaaaaa, %edi + xorl %edi, %edx + xorl %edi, %esi + + rorl $3, %edx + rorl $2, %esi + movl %esi, 4(%ebx) + movl 36(%esp), %esi + movl %edx, (%ebx) + movl 40(%esp), %edi + movl 44(%esp), %eax + movl $0, 8(%esp) + movl %eax, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + movl $1, 8(%esp) + movl %edi, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + movl $0, 8(%esp) + movl %esi, 4(%esp) + movl %ebx, (%esp) + call DES_encrypt2 + addl $12, %esp + movl (%ebx), %edi + movl 4(%ebx), %esi + + + roll $2, %esi + roll $3, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0xaaaaaaaa, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $23, %eax + movl %eax, %edi + xorl %esi, %eax + andl $0x03fc03fc, %eax + xorl %eax, %edi + xorl %eax, %esi + + roll $10, %edi + movl %edi, %eax + xorl %esi, %edi + andl $0x33333333, %edi + xorl %edi, %eax + xorl %edi, %esi + + roll $18, %esi + movl %esi, %edi + xorl %eax, %esi + andl $0xfff0000f, %esi + xorl %esi, %edi + xorl %esi, %eax + + roll $12, %edi + movl %edi, %esi + xorl %eax, %edi + andl $0xf0f0f0f0, %edi + xorl %edi, %esi + xorl %edi, %eax + + rorl $4, %eax + movl %eax, (%ebx) + movl %esi, 4(%ebx) + popl %edi + popl %esi + popl %ebp + popl %ebx + ret +.L_DES_decrypt3_end: + .size DES_decrypt3,.L_DES_decrypt3_end-DES_decrypt3 +.ident "desasm.pl" +.text + .align 16 +.globl DES_ncbc_encrypt + .type DES_ncbc_encrypt,@function +DES_ncbc_encrypt: + + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + movl 28(%esp), %ebp + + movl 36(%esp), %ebx + movl (%ebx), %esi + movl 4(%ebx), %edi + pushl %edi + pushl %esi + pushl %edi + pushl %esi + movl %esp, %ebx + movl 36(%esp), %esi + movl 40(%esp), %edi + + movl 56(%esp), %ecx + + pushl %ecx + + movl 52(%esp), %eax + pushl %eax + pushl %ebx + cmpl $0, %ecx + jz .L006decrypt + andl $4294967288, %ebp + movl 12(%esp), %eax + movl 16(%esp), %ebx + jz .L007encrypt_finish +.L008encrypt_loop: + movl (%esi), %ecx + movl 4(%esi), %edx + xorl %ecx, %eax + xorl %edx, %ebx + movl %eax, 12(%esp) + movl %ebx, 16(%esp) + call DES_encrypt1 + movl 12(%esp), %eax + movl 16(%esp), %ebx + movl %eax, (%edi) + movl %ebx, 4(%edi) + addl $8, %esi + addl $8, %edi + subl $8, %ebp + jnz .L008encrypt_loop +.L007encrypt_finish: + movl 56(%esp), %ebp + andl $7, %ebp + jz .L009finish + call .L010PIC_point +.L010PIC_point: + popl %edx + leal .L011cbc_enc_jmp_table-.L010PIC_point(%edx),%ecx + movl (%ecx,%ebp,4), %ebp + addl %edx, %ebp + xorl %ecx, %ecx + xorl %edx, %edx + jmp *%ebp +.L012ej7: + movb 6(%esi), %dh + sall $8, %edx +.L013ej6: + movb 5(%esi), %dh +.L014ej5: + movb 4(%esi), %dl +.L015ej4: + movl (%esi), %ecx + jmp .L016ejend +.L017ej3: + movb 2(%esi), %ch + sall $8, %ecx +.L018ej2: + movb 1(%esi), %ch +.L019ej1: + movb (%esi), %cl +.L016ejend: + xorl %ecx, %eax + xorl %edx, %ebx + movl %eax, 12(%esp) + movl %ebx, 16(%esp) + call DES_encrypt1 + movl 12(%esp), %eax + movl 16(%esp), %ebx + movl %eax, (%edi) + movl %ebx, 4(%edi) + jmp .L009finish +.align 16 +.L006decrypt: + andl $4294967288, %ebp + movl 20(%esp), %eax + movl 24(%esp), %ebx + jz .L020decrypt_finish +.L021decrypt_loop: + movl (%esi), %eax + movl 4(%esi), %ebx + movl %eax, 12(%esp) + movl %ebx, 16(%esp) + call DES_encrypt1 + movl 12(%esp), %eax + movl 16(%esp), %ebx + movl 20(%esp), %ecx + movl 24(%esp), %edx + xorl %eax, %ecx + xorl %ebx, %edx + movl (%esi), %eax + movl 4(%esi), %ebx + movl %ecx, (%edi) + movl %edx, 4(%edi) + movl %eax, 20(%esp) + movl %ebx, 24(%esp) + addl $8, %esi + addl $8, %edi + subl $8, %ebp + jnz .L021decrypt_loop +.L020decrypt_finish: + movl 56(%esp), %ebp + andl $7, %ebp + jz .L009finish + movl (%esi), %eax + movl 4(%esi), %ebx + movl %eax, 12(%esp) + movl %ebx, 16(%esp) + call DES_encrypt1 + movl 12(%esp), %eax + movl 16(%esp), %ebx + movl 20(%esp), %ecx + movl 24(%esp), %edx + xorl %eax, %ecx + xorl %ebx, %edx + movl (%esi), %eax + movl 4(%esi), %ebx +.L022dj7: + rorl $16, %edx + movb %dl, 6(%edi) + shrl $16, %edx +.L023dj6: + movb %dh, 5(%edi) +.L024dj5: + movb %dl, 4(%edi) +.L025dj4: + movl %ecx, (%edi) + jmp .L026djend +.L027dj3: + rorl $16, %ecx + movb %cl, 2(%edi) + sall $16, %ecx +.L028dj2: + movb %ch, 1(%esi) +.L029dj1: + movb %cl, (%esi) +.L026djend: + jmp .L009finish +.align 16 +.L009finish: + movl 64(%esp), %ecx + addl $28, %esp + movl %eax, (%ecx) + movl %ebx, 4(%ecx) + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.align 16 +.L011cbc_enc_jmp_table: + .long 0 + .long .L019ej1-.L010PIC_point + .long .L018ej2-.L010PIC_point + .long .L017ej3-.L010PIC_point + .long .L015ej4-.L010PIC_point + .long .L014ej5-.L010PIC_point + .long .L013ej6-.L010PIC_point + .long .L012ej7-.L010PIC_point +.L_DES_ncbc_encrypt_end: + .size DES_ncbc_encrypt,.L_DES_ncbc_encrypt_end-DES_ncbc_encrypt +.ident "desasm.pl" +.text + .align 16 +.globl DES_ede3_cbc_encrypt + .type DES_ede3_cbc_encrypt,@function +DES_ede3_cbc_encrypt: + + pushl %ebp + pushl %ebx + pushl %esi + pushl %edi + movl 28(%esp), %ebp + + movl 44(%esp), %ebx + movl (%ebx), %esi + movl 4(%ebx), %edi + pushl %edi + pushl %esi + pushl %edi + pushl %esi + movl %esp, %ebx + movl 36(%esp), %esi + movl 40(%esp), %edi + + movl 64(%esp), %ecx + + movl 56(%esp), %eax + pushl %eax + + movl 56(%esp), %eax + pushl %eax + + movl 56(%esp), %eax + pushl %eax + pushl %ebx + cmpl $0, %ecx + jz .L030decrypt + andl $4294967288, %ebp + movl 16(%esp), %eax + movl 20(%esp), %ebx + jz .L031encrypt_finish +.L032encrypt_loop: + movl (%esi), %ecx + movl 4(%esi), %edx + xorl %ecx, %eax + xorl %edx, %ebx + movl %eax, 16(%esp) + movl %ebx, 20(%esp) + call DES_encrypt3 + movl 16(%esp), %eax + movl 20(%esp), %ebx + movl %eax, (%edi) + movl %ebx, 4(%edi) + addl $8, %esi + addl $8, %edi + subl $8, %ebp + jnz .L032encrypt_loop +.L031encrypt_finish: + movl 60(%esp), %ebp + andl $7, %ebp + jz .L033finish + call .L034PIC_point +.L034PIC_point: + popl %edx + leal .L035cbc_enc_jmp_table-.L034PIC_point(%edx),%ecx + movl (%ecx,%ebp,4), %ebp + addl %edx, %ebp + xorl %ecx, %ecx + xorl %edx, %edx + jmp *%ebp +.L036ej7: + movb 6(%esi), %dh + sall $8, %edx +.L037ej6: + movb 5(%esi), %dh +.L038ej5: + movb 4(%esi), %dl +.L039ej4: + movl (%esi), %ecx + jmp .L040ejend +.L041ej3: + movb 2(%esi), %ch + sall $8, %ecx +.L042ej2: + movb 1(%esi), %ch +.L043ej1: + movb (%esi), %cl +.L040ejend: + xorl %ecx, %eax + xorl %edx, %ebx + movl %eax, 16(%esp) + movl %ebx, 20(%esp) + call DES_encrypt3 + movl 16(%esp), %eax + movl 20(%esp), %ebx + movl %eax, (%edi) + movl %ebx, 4(%edi) + jmp .L033finish +.align 16 +.L030decrypt: + andl $4294967288, %ebp + movl 24(%esp), %eax + movl 28(%esp), %ebx + jz .L044decrypt_finish +.L045decrypt_loop: + movl (%esi), %eax + movl 4(%esi), %ebx + movl %eax, 16(%esp) + movl %ebx, 20(%esp) + call DES_decrypt3 + movl 16(%esp), %eax + movl 20(%esp), %ebx + movl 24(%esp), %ecx + movl 28(%esp), %edx + xorl %eax, %ecx + xorl %ebx, %edx + movl (%esi), %eax + movl 4(%esi), %ebx + movl %ecx, (%edi) + movl %edx, 4(%edi) + movl %eax, 24(%esp) + movl %ebx, 28(%esp) + addl $8, %esi + addl $8, %edi + subl $8, %ebp + jnz .L045decrypt_loop +.L044decrypt_finish: + movl 60(%esp), %ebp + andl $7, %ebp + jz .L033finish + movl (%esi), %eax + movl 4(%esi), %ebx + movl %eax, 16(%esp) + movl %ebx, 20(%esp) + call DES_decrypt3 + movl 16(%esp), %eax + movl 20(%esp), %ebx + movl 24(%esp), %ecx + movl 28(%esp), %edx + xorl %eax, %ecx + xorl %ebx, %edx + movl (%esi), %eax + movl 4(%esi), %ebx +.L046dj7: + rorl $16, %edx + movb %dl, 6(%edi) + shrl $16, %edx +.L047dj6: + movb %dh, 5(%edi) +.L048dj5: + movb %dl, 4(%edi) +.L049dj4: + movl %ecx, (%edi) + jmp .L050djend +.L051dj3: + rorl $16, %ecx + movb %cl, 2(%edi) + sall $16, %ecx +.L052dj2: + movb %ch, 1(%esi) +.L053dj1: + movb %cl, (%esi) +.L050djend: + jmp .L033finish +.align 16 +.L033finish: + movl 76(%esp), %ecx + addl $32, %esp + movl %eax, (%ecx) + movl %ebx, 4(%ecx) + popl %edi + popl %esi + popl %ebx + popl %ebp + ret +.align 16 +.L035cbc_enc_jmp_table: + .long 0 + .long .L043ej1-.L034PIC_point + .long .L042ej2-.L034PIC_point + .long .L041ej3-.L034PIC_point + .long .L039ej4-.L034PIC_point + .long .L038ej5-.L034PIC_point + .long .L037ej6-.L034PIC_point + .long .L036ej7-.L034PIC_point +.L_DES_ede3_cbc_encrypt_end: + .size DES_ede3_cbc_encrypt,.L_DES_ede3_cbc_encrypt_end-DES_ede3_cbc_encrypt +.ident "desasm.pl" diff --git a/lib/libssl/src/fips-1.0/des/fips_des_enc.c b/lib/libssl/src/fips-1.0/des/fips_des_enc.c new file mode 100644 index 00000000000..40e25efa582 --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/fips_des_enc.c @@ -0,0 +1,310 @@ +/* crypto/des/des_enc.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include "fips_des_locl.h" +#include <openssl/fips.h> + +#ifdef OPENSSL_FIPS + +void DES_encrypt1(DES_LONG *data, DES_key_schedule *ks, int enc) + { + register DES_LONG l,r,t,u; +#ifdef DES_PTR + register const unsigned char *des_SP=(const unsigned char *)DES_SPtrans; +#endif +#ifndef DES_UNROLL + register int i; +#endif + register DES_LONG *s; + + if(FIPS_selftest_failed()) + { + data[0]=data[1]=0; + return; + } + + r=data[0]; + l=data[1]; + + IP(r,l); + /* Things have been modified so that the initial rotate is + * done outside the loop. This required the + * DES_SPtrans values in sp.h to be rotated 1 bit to the right. + * One perl script later and things have a 5% speed up on a sparc2. + * Thanks to Richard Outerbridge <71755.204@CompuServe.COM> + * for pointing this out. */ + /* clear the top bits on machines with 8byte longs */ + /* shift left by 2 */ + r=ROTATE(r,29)&0xffffffffL; + l=ROTATE(l,29)&0xffffffffL; + + s=ks->ks->deslong; + /* I don't know if it is worth the effort of loop unrolling the + * inner loop */ + if (enc) + { +#ifdef DES_UNROLL + D_ENCRYPT(l,r, 0); /* 1 */ + D_ENCRYPT(r,l, 2); /* 2 */ + D_ENCRYPT(l,r, 4); /* 3 */ + D_ENCRYPT(r,l, 6); /* 4 */ + D_ENCRYPT(l,r, 8); /* 5 */ + D_ENCRYPT(r,l,10); /* 6 */ + D_ENCRYPT(l,r,12); /* 7 */ + D_ENCRYPT(r,l,14); /* 8 */ + D_ENCRYPT(l,r,16); /* 9 */ + D_ENCRYPT(r,l,18); /* 10 */ + D_ENCRYPT(l,r,20); /* 11 */ + D_ENCRYPT(r,l,22); /* 12 */ + D_ENCRYPT(l,r,24); /* 13 */ + D_ENCRYPT(r,l,26); /* 14 */ + D_ENCRYPT(l,r,28); /* 15 */ + D_ENCRYPT(r,l,30); /* 16 */ +#else + for (i=0; i<32; i+=8) + { + D_ENCRYPT(l,r,i+0); /* 1 */ + D_ENCRYPT(r,l,i+2); /* 2 */ + D_ENCRYPT(l,r,i+4); /* 3 */ + D_ENCRYPT(r,l,i+6); /* 4 */ + } +#endif + } + else + { +#ifdef DES_UNROLL + D_ENCRYPT(l,r,30); /* 16 */ + D_ENCRYPT(r,l,28); /* 15 */ + D_ENCRYPT(l,r,26); /* 14 */ + D_ENCRYPT(r,l,24); /* 13 */ + D_ENCRYPT(l,r,22); /* 12 */ + D_ENCRYPT(r,l,20); /* 11 */ + D_ENCRYPT(l,r,18); /* 10 */ + D_ENCRYPT(r,l,16); /* 9 */ + D_ENCRYPT(l,r,14); /* 8 */ + D_ENCRYPT(r,l,12); /* 7 */ + D_ENCRYPT(l,r,10); /* 6 */ + D_ENCRYPT(r,l, 8); /* 5 */ + D_ENCRYPT(l,r, 6); /* 4 */ + D_ENCRYPT(r,l, 4); /* 3 */ + D_ENCRYPT(l,r, 2); /* 2 */ + D_ENCRYPT(r,l, 0); /* 1 */ +#else + for (i=30; i>0; i-=8) + { + D_ENCRYPT(l,r,i-0); /* 16 */ + D_ENCRYPT(r,l,i-2); /* 15 */ + D_ENCRYPT(l,r,i-4); /* 14 */ + D_ENCRYPT(r,l,i-6); /* 13 */ + } +#endif + } + + /* rotate and clear the top bits on machines with 8byte longs */ + l=ROTATE(l,3)&0xffffffffL; + r=ROTATE(r,3)&0xffffffffL; + + FP(r,l); + data[0]=l; + data[1]=r; + l=r=t=u=0; + } + +void DES_encrypt2(DES_LONG *data, DES_key_schedule *ks, int enc) + { + register DES_LONG l,r,t,u; +#ifdef DES_PTR + register const unsigned char *des_SP=(const unsigned char *)DES_SPtrans; +#endif +#ifndef DES_UNROLL + register int i; +#endif + register DES_LONG *s; + + if(FIPS_selftest_failed()) + { + data[0]=data[1]=0; + return; + } + + r=data[0]; + l=data[1]; + + /* Things have been modified so that the initial rotate is + * done outside the loop. This required the + * DES_SPtrans values in sp.h to be rotated 1 bit to the right. + * One perl script later and things have a 5% speed up on a sparc2. + * Thanks to Richard Outerbridge <71755.204@CompuServe.COM> + * for pointing this out. */ + /* clear the top bits on machines with 8byte longs */ + r=ROTATE(r,29)&0xffffffffL; + l=ROTATE(l,29)&0xffffffffL; + + s=ks->ks->deslong; + /* I don't know if it is worth the effort of loop unrolling the + * inner loop */ + if (enc) + { +#ifdef DES_UNROLL + D_ENCRYPT(l,r, 0); /* 1 */ + D_ENCRYPT(r,l, 2); /* 2 */ + D_ENCRYPT(l,r, 4); /* 3 */ + D_ENCRYPT(r,l, 6); /* 4 */ + D_ENCRYPT(l,r, 8); /* 5 */ + D_ENCRYPT(r,l,10); /* 6 */ + D_ENCRYPT(l,r,12); /* 7 */ + D_ENCRYPT(r,l,14); /* 8 */ + D_ENCRYPT(l,r,16); /* 9 */ + D_ENCRYPT(r,l,18); /* 10 */ + D_ENCRYPT(l,r,20); /* 11 */ + D_ENCRYPT(r,l,22); /* 12 */ + D_ENCRYPT(l,r,24); /* 13 */ + D_ENCRYPT(r,l,26); /* 14 */ + D_ENCRYPT(l,r,28); /* 15 */ + D_ENCRYPT(r,l,30); /* 16 */ +#else + for (i=0; i<32; i+=8) + { + D_ENCRYPT(l,r,i+0); /* 1 */ + D_ENCRYPT(r,l,i+2); /* 2 */ + D_ENCRYPT(l,r,i+4); /* 3 */ + D_ENCRYPT(r,l,i+6); /* 4 */ + } +#endif + } + else + { +#ifdef DES_UNROLL + D_ENCRYPT(l,r,30); /* 16 */ + D_ENCRYPT(r,l,28); /* 15 */ + D_ENCRYPT(l,r,26); /* 14 */ + D_ENCRYPT(r,l,24); /* 13 */ + D_ENCRYPT(l,r,22); /* 12 */ + D_ENCRYPT(r,l,20); /* 11 */ + D_ENCRYPT(l,r,18); /* 10 */ + D_ENCRYPT(r,l,16); /* 9 */ + D_ENCRYPT(l,r,14); /* 8 */ + D_ENCRYPT(r,l,12); /* 7 */ + D_ENCRYPT(l,r,10); /* 6 */ + D_ENCRYPT(r,l, 8); /* 5 */ + D_ENCRYPT(l,r, 6); /* 4 */ + D_ENCRYPT(r,l, 4); /* 3 */ + D_ENCRYPT(l,r, 2); /* 2 */ + D_ENCRYPT(r,l, 0); /* 1 */ +#else + for (i=30; i>0; i-=8) + { + D_ENCRYPT(l,r,i-0); /* 16 */ + D_ENCRYPT(r,l,i-2); /* 15 */ + D_ENCRYPT(l,r,i-4); /* 14 */ + D_ENCRYPT(r,l,i-6); /* 13 */ + } +#endif + } + /* rotate and clear the top bits on machines with 8byte longs */ + data[0]=ROTATE(l,3)&0xffffffffL; + data[1]=ROTATE(r,3)&0xffffffffL; + l=r=t=u=0; + } + +void DES_encrypt3(DES_LONG *data, DES_key_schedule *ks1, + DES_key_schedule *ks2, DES_key_schedule *ks3) + { + register DES_LONG l,r; + + l=data[0]; + r=data[1]; + IP(l,r); + data[0]=l; + data[1]=r; + DES_encrypt2((DES_LONG *)data,ks1,DES_ENCRYPT); + DES_encrypt2((DES_LONG *)data,ks2,DES_DECRYPT); + DES_encrypt2((DES_LONG *)data,ks3,DES_ENCRYPT); + l=data[0]; + r=data[1]; + FP(r,l); + data[0]=l; + data[1]=r; + } + +void DES_decrypt3(DES_LONG *data, DES_key_schedule *ks1, + DES_key_schedule *ks2, DES_key_schedule *ks3) + { + register DES_LONG l,r; + + l=data[0]; + r=data[1]; + IP(l,r); + data[0]=l; + data[1]=r; + DES_encrypt2((DES_LONG *)data,ks3,DES_DECRYPT); + DES_encrypt2((DES_LONG *)data,ks2,DES_ENCRYPT); + DES_encrypt2((DES_LONG *)data,ks1,DES_DECRYPT); + l=data[0]; + r=data[1]; + FP(r,l); + data[0]=l; + data[1]=r; + } + +#else /* ndef OPENSSL_FIPS */ + +static void *dummy=&dummy; + +#endif /* ndef OPENSSL_FIPS */ + diff --git a/lib/libssl/src/fips-1.0/des/fips_des_locl.h b/lib/libssl/src/fips-1.0/des/fips_des_locl.h new file mode 100644 index 00000000000..5c466a5561e --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/fips_des_locl.h @@ -0,0 +1,428 @@ +/* crypto/des/des_locl.h */ +/* Copyright (C) 1995-1997 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#ifndef HEADER_DES_LOCL_H +#define HEADER_DES_LOCL_H + +#include "e_os.h" + +#if defined(OPENSSL_SYS_WIN32) || defined(OPENSSL_SYS_WIN16) +#ifndef OPENSSL_SYS_MSDOS +#define OPENSSL_SYS_MSDOS +#endif +#endif + +#include <stdio.h> +#include <stdlib.h> + +#ifndef OPENSSL_SYS_MSDOS +#if !defined(OPENSSL_SYS_VMS) || defined(__DECC) +#ifdef OPENSSL_UNISTD +# include OPENSSL_UNISTD +#else +# include <unistd.h> +#endif +#include <math.h> +#endif +#endif +#include <openssl/des.h> + +#ifdef OPENSSL_SYS_MSDOS /* Visual C++ 2.1 (Windows NT/95) */ +#include <stdlib.h> +#include <errno.h> +#include <time.h> +#include <io.h> +#endif + +#if defined(__STDC__) || defined(OPENSSL_SYS_VMS) || defined(M_XENIX) || defined(OPENSSL_SYS_MSDOS) +#include <string.h> +#endif + +#ifdef OPENSSL_BUILD_SHLIBCRYPTO +# undef OPENSSL_EXTERN +# define OPENSSL_EXTERN OPENSSL_EXPORT +#endif + +#define ITERATIONS 16 +#define HALF_ITERATIONS 8 + +/* used in des_read and des_write */ +#define MAXWRITE (1024*16) +#define BSIZE (MAXWRITE+4) + +#define c2l(c,l) (l =((DES_LONG)(*((c)++))) , \ + l|=((DES_LONG)(*((c)++)))<< 8L, \ + l|=((DES_LONG)(*((c)++)))<<16L, \ + l|=((DES_LONG)(*((c)++)))<<24L) + +/* NOTE - c is not incremented as per c2l */ +#define c2ln(c,l1,l2,n) { \ + c+=n; \ + l1=l2=0; \ + switch (n) { \ + case 8: l2 =((DES_LONG)(*(--(c))))<<24L; \ + case 7: l2|=((DES_LONG)(*(--(c))))<<16L; \ + case 6: l2|=((DES_LONG)(*(--(c))))<< 8L; \ + case 5: l2|=((DES_LONG)(*(--(c)))); \ + case 4: l1 =((DES_LONG)(*(--(c))))<<24L; \ + case 3: l1|=((DES_LONG)(*(--(c))))<<16L; \ + case 2: l1|=((DES_LONG)(*(--(c))))<< 8L; \ + case 1: l1|=((DES_LONG)(*(--(c)))); \ + } \ + } + +#define l2c(l,c) (*((c)++)=(unsigned char)(((l) )&0xff), \ + *((c)++)=(unsigned char)(((l)>> 8L)&0xff), \ + *((c)++)=(unsigned char)(((l)>>16L)&0xff), \ + *((c)++)=(unsigned char)(((l)>>24L)&0xff)) + +/* replacements for htonl and ntohl since I have no idea what to do + * when faced with machines with 8 byte longs. */ +#define HDRSIZE 4 + +#define n2l(c,l) (l =((DES_LONG)(*((c)++)))<<24L, \ + l|=((DES_LONG)(*((c)++)))<<16L, \ + l|=((DES_LONG)(*((c)++)))<< 8L, \ + l|=((DES_LONG)(*((c)++)))) + +#define l2n(l,c) (*((c)++)=(unsigned char)(((l)>>24L)&0xff), \ + *((c)++)=(unsigned char)(((l)>>16L)&0xff), \ + *((c)++)=(unsigned char)(((l)>> 8L)&0xff), \ + *((c)++)=(unsigned char)(((l) )&0xff)) + +/* NOTE - c is not incremented as per l2c */ +#define l2cn(l1,l2,c,n) { \ + c+=n; \ + switch (n) { \ + case 8: *(--(c))=(unsigned char)(((l2)>>24L)&0xff); \ + case 7: *(--(c))=(unsigned char)(((l2)>>16L)&0xff); \ + case 6: *(--(c))=(unsigned char)(((l2)>> 8L)&0xff); \ + case 5: *(--(c))=(unsigned char)(((l2) )&0xff); \ + case 4: *(--(c))=(unsigned char)(((l1)>>24L)&0xff); \ + case 3: *(--(c))=(unsigned char)(((l1)>>16L)&0xff); \ + case 2: *(--(c))=(unsigned char)(((l1)>> 8L)&0xff); \ + case 1: *(--(c))=(unsigned char)(((l1) )&0xff); \ + } \ + } + +#if defined(OPENSSL_SYS_WIN32) && defined(_MSC_VER) +#define ROTATE(a,n) (_lrotr(a,n)) +#elif defined(__GNUC__) && __GNUC__>=2 && !defined(__STRICT_ANSI__) && !defined(OPENSSL_NO_ASM) && !defined(OPENSSL_NO_INLINE_ASM) && !defined(PEDANTIC) +# if defined(__i386) || defined(__i386__) || defined(__x86_64) || defined(__x86_64__) +# define ROTATE(a,n) ({ register unsigned int ret; \ + asm ("rorl %1,%0" \ + : "=r"(ret) \ + : "I"(n),"0"(a) \ + : "cc"); \ + ret; \ + }) +# endif +#endif +#ifndef ROTATE +#define ROTATE(a,n) (((a)>>(n))+((a)<<(32-(n)))) +#endif + +/* Don't worry about the LOAD_DATA() stuff, that is used by + * fcrypt() to add it's little bit to the front */ + +#ifdef DES_FCRYPT + +#define LOAD_DATA_tmp(R,S,u,t,E0,E1) \ + { DES_LONG tmp; LOAD_DATA(R,S,u,t,E0,E1,tmp); } + +#define LOAD_DATA(R,S,u,t,E0,E1,tmp) \ + t=R^(R>>16L); \ + u=t&E0; t&=E1; \ + tmp=(u<<16); u^=R^s[S ]; u^=tmp; \ + tmp=(t<<16); t^=R^s[S+1]; t^=tmp +#else +#define LOAD_DATA_tmp(a,b,c,d,e,f) LOAD_DATA(a,b,c,d,e,f,g) +#define LOAD_DATA(R,S,u,t,E0,E1,tmp) \ + u=R^s[S ]; \ + t=R^s[S+1] +#endif + +/* The changes to this macro may help or hinder, depending on the + * compiler and the architecture. gcc2 always seems to do well :-). + * Inspired by Dana How <how@isl.stanford.edu> + * DO NOT use the alternative version on machines with 8 byte longs. + * It does not seem to work on the Alpha, even when DES_LONG is 4 + * bytes, probably an issue of accessing non-word aligned objects :-( */ +#ifdef DES_PTR + +/* It recently occurred to me that 0^0^0^0^0^0^0 == 0, so there + * is no reason to not xor all the sub items together. This potentially + * saves a register since things can be xored directly into L */ + +#if defined(DES_RISC1) || defined(DES_RISC2) +#ifdef DES_RISC1 +#define D_ENCRYPT(LL,R,S) { \ + unsigned int u1,u2,u3; \ + LOAD_DATA(R,S,u,t,E0,E1,u1); \ + u2=(int)u>>8L; \ + u1=(int)u&0xfc; \ + u2&=0xfc; \ + t=ROTATE(t,4); \ + u>>=16L; \ + LL^= *(const DES_LONG *)(des_SP +u1); \ + LL^= *(const DES_LONG *)(des_SP+0x200+u2); \ + u3=(int)(u>>8L); \ + u1=(int)u&0xfc; \ + u3&=0xfc; \ + LL^= *(const DES_LONG *)(des_SP+0x400+u1); \ + LL^= *(const DES_LONG *)(des_SP+0x600+u3); \ + u2=(int)t>>8L; \ + u1=(int)t&0xfc; \ + u2&=0xfc; \ + t>>=16L; \ + LL^= *(const DES_LONG *)(des_SP+0x100+u1); \ + LL^= *(const DES_LONG *)(des_SP+0x300+u2); \ + u3=(int)t>>8L; \ + u1=(int)t&0xfc; \ + u3&=0xfc; \ + LL^= *(const DES_LONG *)(des_SP+0x500+u1); \ + LL^= *(const DES_LONG *)(des_SP+0x700+u3); } +#endif +#ifdef DES_RISC2 +#define D_ENCRYPT(LL,R,S) { \ + unsigned int u1,u2,s1,s2; \ + LOAD_DATA(R,S,u,t,E0,E1,u1); \ + u2=(int)u>>8L; \ + u1=(int)u&0xfc; \ + u2&=0xfc; \ + t=ROTATE(t,4); \ + LL^= *(const DES_LONG *)(des_SP +u1); \ + LL^= *(const DES_LONG *)(des_SP+0x200+u2); \ + s1=(int)(u>>16L); \ + s2=(int)(u>>24L); \ + s1&=0xfc; \ + s2&=0xfc; \ + LL^= *(const DES_LONG *)(des_SP+0x400+s1); \ + LL^= *(const DES_LONG *)(des_SP+0x600+s2); \ + u2=(int)t>>8L; \ + u1=(int)t&0xfc; \ + u2&=0xfc; \ + LL^= *(const DES_LONG *)(des_SP+0x100+u1); \ + LL^= *(const DES_LONG *)(des_SP+0x300+u2); \ + s1=(int)(t>>16L); \ + s2=(int)(t>>24L); \ + s1&=0xfc; \ + s2&=0xfc; \ + LL^= *(const DES_LONG *)(des_SP+0x500+s1); \ + LL^= *(const DES_LONG *)(des_SP+0x700+s2); } +#endif +#else +#define D_ENCRYPT(LL,R,S) { \ + LOAD_DATA_tmp(R,S,u,t,E0,E1); \ + t=ROTATE(t,4); \ + LL^= \ + *(const DES_LONG *)(des_SP +((u )&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x200+((u>> 8L)&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x400+((u>>16L)&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x600+((u>>24L)&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x100+((t )&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x300+((t>> 8L)&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x500+((t>>16L)&0xfc))^ \ + *(const DES_LONG *)(des_SP+0x700+((t>>24L)&0xfc)); } +#endif + +#else /* original version */ + +#if defined(DES_RISC1) || defined(DES_RISC2) +#ifdef DES_RISC1 +#define D_ENCRYPT(LL,R,S) {\ + unsigned int u1,u2,u3; \ + LOAD_DATA(R,S,u,t,E0,E1,u1); \ + u>>=2L; \ + t=ROTATE(t,6); \ + u2=(int)u>>8L; \ + u1=(int)u&0x3f; \ + u2&=0x3f; \ + u>>=16L; \ + LL^=DES_SPtrans[0][u1]; \ + LL^=DES_SPtrans[2][u2]; \ + u3=(int)u>>8L; \ + u1=(int)u&0x3f; \ + u3&=0x3f; \ + LL^=DES_SPtrans[4][u1]; \ + LL^=DES_SPtrans[6][u3]; \ + u2=(int)t>>8L; \ + u1=(int)t&0x3f; \ + u2&=0x3f; \ + t>>=16L; \ + LL^=DES_SPtrans[1][u1]; \ + LL^=DES_SPtrans[3][u2]; \ + u3=(int)t>>8L; \ + u1=(int)t&0x3f; \ + u3&=0x3f; \ + LL^=DES_SPtrans[5][u1]; \ + LL^=DES_SPtrans[7][u3]; } +#endif +#ifdef DES_RISC2 +#define D_ENCRYPT(LL,R,S) {\ + unsigned int u1,u2,s1,s2; \ + LOAD_DATA(R,S,u,t,E0,E1,u1); \ + u>>=2L; \ + t=ROTATE(t,6); \ + u2=(int)u>>8L; \ + u1=(int)u&0x3f; \ + u2&=0x3f; \ + LL^=DES_SPtrans[0][u1]; \ + LL^=DES_SPtrans[2][u2]; \ + s1=(int)u>>16L; \ + s2=(int)u>>24L; \ + s1&=0x3f; \ + s2&=0x3f; \ + LL^=DES_SPtrans[4][s1]; \ + LL^=DES_SPtrans[6][s2]; \ + u2=(int)t>>8L; \ + u1=(int)t&0x3f; \ + u2&=0x3f; \ + LL^=DES_SPtrans[1][u1]; \ + LL^=DES_SPtrans[3][u2]; \ + s1=(int)t>>16; \ + s2=(int)t>>24L; \ + s1&=0x3f; \ + s2&=0x3f; \ + LL^=DES_SPtrans[5][s1]; \ + LL^=DES_SPtrans[7][s2]; } +#endif + +#else + +#define D_ENCRYPT(LL,R,S) {\ + LOAD_DATA_tmp(R,S,u,t,E0,E1); \ + t=ROTATE(t,4); \ + LL^=\ + DES_SPtrans[0][(u>> 2L)&0x3f]^ \ + DES_SPtrans[2][(u>>10L)&0x3f]^ \ + DES_SPtrans[4][(u>>18L)&0x3f]^ \ + DES_SPtrans[6][(u>>26L)&0x3f]^ \ + DES_SPtrans[1][(t>> 2L)&0x3f]^ \ + DES_SPtrans[3][(t>>10L)&0x3f]^ \ + DES_SPtrans[5][(t>>18L)&0x3f]^ \ + DES_SPtrans[7][(t>>26L)&0x3f]; } +#endif +#endif + + /* IP and FP + * The problem is more of a geometric problem that random bit fiddling. + 0 1 2 3 4 5 6 7 62 54 46 38 30 22 14 6 + 8 9 10 11 12 13 14 15 60 52 44 36 28 20 12 4 + 16 17 18 19 20 21 22 23 58 50 42 34 26 18 10 2 + 24 25 26 27 28 29 30 31 to 56 48 40 32 24 16 8 0 + + 32 33 34 35 36 37 38 39 63 55 47 39 31 23 15 7 + 40 41 42 43 44 45 46 47 61 53 45 37 29 21 13 5 + 48 49 50 51 52 53 54 55 59 51 43 35 27 19 11 3 + 56 57 58 59 60 61 62 63 57 49 41 33 25 17 9 1 + + The output has been subject to swaps of the form + 0 1 -> 3 1 but the odd and even bits have been put into + 2 3 2 0 + different words. The main trick is to remember that + t=((l>>size)^r)&(mask); + r^=t; + l^=(t<<size); + can be used to swap and move bits between words. + + So l = 0 1 2 3 r = 16 17 18 19 + 4 5 6 7 20 21 22 23 + 8 9 10 11 24 25 26 27 + 12 13 14 15 28 29 30 31 + becomes (for size == 2 and mask == 0x3333) + t = 2^16 3^17 -- -- l = 0 1 16 17 r = 2 3 18 19 + 6^20 7^21 -- -- 4 5 20 21 6 7 22 23 + 10^24 11^25 -- -- 8 9 24 25 10 11 24 25 + 14^28 15^29 -- -- 12 13 28 29 14 15 28 29 + + Thanks for hints from Richard Outerbridge - he told me IP&FP + could be done in 15 xor, 10 shifts and 5 ands. + When I finally started to think of the problem in 2D + I first got ~42 operations without xors. When I remembered + how to use xors :-) I got it to its final state. + */ +#define PERM_OP(a,b,t,n,m) ((t)=((((a)>>(n))^(b))&(m)),\ + (b)^=(t),\ + (a)^=((t)<<(n))) + +#define IP(l,r) \ + { \ + register DES_LONG tt; \ + PERM_OP(r,l,tt, 4,0x0f0f0f0fL); \ + PERM_OP(l,r,tt,16,0x0000ffffL); \ + PERM_OP(r,l,tt, 2,0x33333333L); \ + PERM_OP(l,r,tt, 8,0x00ff00ffL); \ + PERM_OP(r,l,tt, 1,0x55555555L); \ + } + +#define FP(l,r) \ + { \ + register DES_LONG tt; \ + PERM_OP(l,r,tt, 1,0x55555555L); \ + PERM_OP(r,l,tt, 8,0x00ff00ffL); \ + PERM_OP(l,r,tt, 2,0x33333333L); \ + PERM_OP(r,l,tt,16,0x0000ffffL); \ + PERM_OP(l,r,tt, 4,0x0f0f0f0fL); \ + } + +extern const DES_LONG DES_SPtrans[8][64]; + +void fcrypt_body(DES_LONG *out,DES_key_schedule *ks, + DES_LONG Eswap0, DES_LONG Eswap1); +#endif diff --git a/lib/libssl/src/fips-1.0/des/fips_des_selftest.c b/lib/libssl/src/fips-1.0/des/fips_des_selftest.c new file mode 100644 index 00000000000..3e0778eb5e2 --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/fips_des_selftest.c @@ -0,0 +1,200 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/des.h> +#include <openssl/opensslconf.h> + +#ifdef OPENSSL_FIPS +static struct + { + DES_cblock key; + unsigned char plaintext[8]; + unsigned char ciphertext[8]; + } tests[]= + { + { + { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + { 0x8C,0xA6,0x4D,0xE9,0xC1,0xB1,0x23,0xA7 } + }, + { + { 0xFE,0xDC,0xBA,0x98,0x76,0x54,0x32,0x10 }, + { 0x01,0x23,0x45,0x67,0x89,0xAB,0xCD,0xEF }, + { 0xED,0x39,0xD9,0x50,0xFA,0x74,0xBC,0xC4 }, + }, + }; + +static struct + { + DES_cblock key1; + DES_cblock key2; + unsigned char plaintext[8]; + unsigned char ciphertext[8]; + } tests2[]= + { + { + { 0x7c,0x4f,0x6e,0xf7,0xa2,0x04,0x16,0xec }, + { 0x0b,0x6b,0x7c,0x9e,0x5e,0x19,0xa7,0xc4 }, + { 0x06,0xa7,0xd8,0x79,0xaa,0xce,0x69,0xef }, + { 0x4c,0x11,0x17,0x55,0xbf,0xc4,0x4e,0xfd } + }, + { + { 0x5d,0x9e,0x01,0xd3,0x25,0xc7,0x3e,0x34 }, + { 0x01,0x16,0x7c,0x85,0x23,0xdf,0xe0,0x68 }, + { 0x9c,0x50,0x09,0x0f,0x5e,0x7d,0x69,0x7e }, + { 0xd2,0x0b,0x18,0xdf,0xd9,0x0d,0x9e,0xff }, + } + }; + +static struct + { + DES_cblock key1; + DES_cblock key2; + DES_cblock key3; + unsigned char plaintext[8]; + unsigned char ciphertext[8]; + } tests3[]= + { + { + { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + { 0xFE,0xDC,0xBA,0x98,0x76,0x54,0x32,0x10 }, + { 0x12,0x34,0x56,0x78,0x9a,0xbc,0xde,0xf0 }, + { 0x8f,0x8f,0xbf,0x9b,0x5d,0x48,0xb4,0x1c}, + { 0x59,0x8c,0xe5,0xd3,0x6c,0xa2,0xea,0x1b}, + }, + { + { 0xDC,0xBA,0x98,0x76,0x54,0x32,0x10,0xFE }, + { 0x01,0x23,0x45,0x67,0x89,0xAB,0xCD,0xEF }, + { 0xED,0x39,0xD9,0x50,0xFA,0x74,0xBC,0xC4 }, + { 0x01,0x23,0x45,0x67,0x89,0xAB,0xCD,0xEF }, + { 0x11,0x25,0xb0,0x35,0xbe,0xa0,0x82,0x86 }, + }, + }; + +void FIPS_corrupt_des() + { + tests[0].plaintext[0]++; + } + +int FIPS_selftest_des() + { + int n; + + /* Encrypt/decrypt with DES and compare to known answers */ + for(n=0 ; n < 2 ; ++n) + { + DES_key_schedule key; + DES_cblock buf; + + DES_set_key(&tests[n].key,&key); + DES_ecb_encrypt(&tests[n].plaintext,&buf,&key,1); + if(memcmp(buf,tests[n].ciphertext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + DES_ecb_encrypt(&tests[n].ciphertext,&buf,&key,0); + if(memcmp(buf,tests[n].plaintext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + + /* Encrypt/decrypt with 2-key 3DES and compare to known answers */ + for(n=0 ; n < 2 ; ++n) + { + DES_key_schedule key1, key2; + unsigned char buf[8]; + + DES_set_key(&tests2[n].key1,&key1); + DES_set_key(&tests2[n].key2,&key2); + DES_ecb2_encrypt(tests2[n].plaintext,buf,&key1,&key2,1); + if(memcmp(buf,tests2[n].ciphertext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + DES_ecb2_encrypt(tests2[n].ciphertext,buf,&key1,&key2,0); + if(memcmp(buf,tests2[n].plaintext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + + /* Encrypt/decrypt with 3DES and compare to known answers */ + for(n=0 ; n < 2 ; ++n) + { + DES_key_schedule key1, key2, key3; + unsigned char buf[8]; + + DES_set_key(&tests3[n].key1,&key1); + DES_set_key(&tests3[n].key2,&key2); + DES_set_key(&tests3[n].key3,&key3); + DES_ecb3_encrypt(tests3[n].plaintext,buf,&key1,&key2,&key3,1); + if(memcmp(buf,tests3[n].ciphertext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + DES_ecb3_encrypt(tests3[n].ciphertext,buf,&key1,&key2,&key3,0); + if(memcmp(buf,tests3[n].plaintext,sizeof buf)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DES,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + + return 1; + } +#endif diff --git a/lib/libssl/src/fips-1.0/des/fips_desmovs.c b/lib/libssl/src/fips-1.0/des/fips_desmovs.c new file mode 100644 index 00000000000..5eb55726e3b --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/fips_desmovs.c @@ -0,0 +1,833 @@ +/* ==================================================================== + * Copyright (c) 2004 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ +/*--------------------------------------------- + NIST DES Modes of Operation Validation System + Test Program + + Based on the AES Validation Suite, which was: + Donated to OpenSSL by: + V-ONE Corporation + 20250 Century Blvd, Suite 300 + Germantown, MD 20874 + U.S.A. + ----------------------------------------------*/ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <errno.h> +#include <assert.h> + +#include <openssl/des.h> +#include <openssl/evp.h> +#include <openssl/fips.h> +#include <openssl/err.h> +#include "e_os.h" + +/*#define AES_BLOCK_SIZE 16*/ + +#define VERBOSE 0 + +/*-----------------------------------------------*/ + +int DESTest(EVP_CIPHER_CTX *ctx, + char *amode, int akeysz, unsigned char *aKey, + unsigned char *iVec, + int dir, /* 0 = decrypt, 1 = encrypt */ + unsigned char *out, unsigned char *in, int len) + { + const EVP_CIPHER *cipher = NULL; + int kt = 0; + + if (ctx) + memset(ctx, 0, sizeof(EVP_CIPHER_CTX)); + + if (strcasecmp(amode, "CBC") == 0) + kt = 1000; + else if (strcasecmp(amode, "ECB") == 0) + kt = 2000; + else if (strcasecmp(amode, "CFB64") == 0) + kt = 3000; + else if (strncasecmp(amode, "OFB", 3) == 0) + kt = 4000; + else if(!strcasecmp(amode,"CFB1")) + kt=5000; + else if(!strcasecmp(amode,"CFB8")) + kt=6000; + else + { + printf("Unknown mode: %s\n", amode); + EXIT(1); + } + if (akeysz != 64 && akeysz != 192) + { + printf("Invalid key size: %d\n", akeysz); + EXIT(1); + } + else + { + kt += akeysz; + switch (kt) + { + case 1064: + cipher=EVP_des_cbc(); + break; + case 1192: + cipher=EVP_des_ede3_cbc(); + break; + case 2064: + cipher=EVP_des_ecb(); + break; + case 2192: + cipher=EVP_des_ede3_ecb(); + break; + case 3064: + cipher=EVP_des_cfb64(); + break; + case 3192: + cipher=EVP_des_ede3_cfb64(); + break; + case 4064: + cipher=EVP_des_ofb(); + break; + case 4192: + cipher=EVP_des_ede3_ofb(); + break; + case 5064: + cipher=EVP_des_cfb1(); + break; + case 5192: + cipher=EVP_des_ede3_cfb1(); + break; + case 6064: + cipher=EVP_des_cfb8(); + break; + case 6192: + cipher=EVP_des_ede3_cfb8(); + break; + default: + printf("Didn't handle mode %d\n",kt); + EXIT(1); + } + if(!EVP_CipherInit(ctx, cipher, aKey, iVec, dir)) + { + ERR_print_errors_fp(stderr); + EXIT(1); + } + EVP_Cipher(ctx, out, in, len); + } + return 1; + } + +/*-----------------------------------------------*/ + +int hex2bin(char *in, int len, unsigned char *out) + { + int n1, n2; + unsigned char ch; + + for (n1 = 0, n2 = 0; n1 < len; ) + { /* first byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + if(len == 1) + { + out[n2++]=ch; + break; + } + out[n2] = ch << 4; + /* second byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + out[n2++] |= ch; + } + return n2; + } + +/*-----------------------------------------------*/ + +int bin2hex(unsigned char *in, int len, char *out) + { + int n1, n2; + unsigned char ch; + + for (n1 = 0, n2 = 0; n1 < len; ++n1) + { + /* first nibble */ + ch = in[n1] >> 4; + if (ch <= 0x09) + out[n2++] = ch + '0'; + else + out[n2++] = ch - 10 + 'a'; + /* second nibble */ + ch = in[n1] & 0x0f; + if (ch <= 0x09) + out[n2++] = ch + '0'; + else + out[n2++] = ch - 10 + 'a'; + } + return n2; + } + +/* NB: this return the number of _bits_ read */ +int bint2bin(const char *in, int len, unsigned char *out) + { + int n; + + memset(out,0,len); + for(n=0 ; n < len ; ++n) + if(in[n] == '1') + out[n/8]|=(0x80 >> (n%8)); + return len; + } + +int bin2bint(const unsigned char *in,int len,char *out) + { + int n; + + for(n=0 ; n < len ; ++n) + out[n]=(in[n/8]&(0x80 >> (n%8))) ? '1' : '0'; + return n; + } + +/*-----------------------------------------------*/ + +void PrintValue(char *tag, unsigned char *val, int len) + { +#if VERBOSE + char obuf[2048]; + int olen; + olen = bin2hex(val, len, obuf); + printf("%s = %.*s\n", tag, olen, obuf); +#endif + } + +void DebugValue(char *tag, unsigned char *val, int len) + { + char obuf[2048]; + int olen; + olen = bin2hex(val, len, obuf); + printf("%s = %.*s\n", tag, olen, obuf); + } + +void OutputValue(char *tag, unsigned char *val, int len, FILE *rfp,int bitmode) + { + char obuf[2048]; + int olen; + + if(bitmode) + olen=bin2bint(val,len,obuf); + else + olen=bin2hex(val,len,obuf); + + fprintf(rfp, "%s = %.*s\n", tag, olen, obuf); +#if VERBOSE + printf("%s = %.*s\n", tag, olen, obuf); +#endif + } + +void shiftin(unsigned char *dst,unsigned char *src,int nbits) + { + int n; + + /* move the bytes... */ + memmove(dst,dst+nbits/8,3*8-nbits/8); + /* append new data */ + memcpy(dst+3*8-nbits/8,src,(nbits+7)/8); + /* left shift the bits */ + if(nbits%8) + for(n=0 ; n < 3*8 ; ++n) + dst[n]=(dst[n] << (nbits%8))|(dst[n+1] >> (8-nbits%8)); + } + +/*-----------------------------------------------*/ +char *t_tag[2] = {"PLAINTEXT", "CIPHERTEXT"}; +char *t_mode[6] = {"CBC","ECB","OFB","CFB1","CFB8","CFB64"}; +enum Mode {CBC, ECB, OFB, CFB1, CFB8, CFB64}; +int Sizes[6]={64,64,64,1,8,64}; + +void do_mct(char *amode, + int akeysz, int numkeys, unsigned char *akey,unsigned char *ivec, + int dir, unsigned char *text, int len, + FILE *rfp) + { + int i,imode; + unsigned char nk[4*8]; /* longest key+8 */ + unsigned char text0[8]; + + for (imode=0 ; imode < 6 ; ++imode) + if(!strcmp(amode,t_mode[imode])) + break; + if (imode == 6) + { + printf("Unrecognized mode: %s\n", amode); + EXIT(1); + } + + for(i=0 ; i < 400 ; ++i) + { + int j; + int n; + EVP_CIPHER_CTX ctx; + int kp=akeysz/64; + unsigned char old_iv[8]; + + fprintf(rfp,"\nCOUNT = %d\n",i); + if(kp == 1) + OutputValue("KEY",akey,8,rfp,0); + else + for(n=0 ; n < kp ; ++n) + { + fprintf(rfp,"KEY%d",n+1); + OutputValue("",akey+n*8,8,rfp,0); + } + + if(imode != ECB) + OutputValue("IV",ivec,8,rfp,0); + OutputValue(t_tag[dir^1],text,len,rfp,imode == CFB1); + + /* compensate for endianness */ + if(imode == CFB1) + text[0]<<=7; + + memcpy(text0,text,8); + + for(j=0 ; j < 10000 ; ++j) + { + unsigned char old_text[8]; + + memcpy(old_text,text,8); + if(j == 0) + { + memcpy(old_iv,ivec,8); + DESTest(&ctx,amode,akeysz,akey,ivec,dir,text,text,len); + } + else + { + memcpy(old_iv,ctx.iv,8); + EVP_Cipher(&ctx,text,text,len); + } + if(j == 9999) + { + OutputValue(t_tag[dir],text,len,rfp,imode == CFB1); + /* memcpy(ivec,text,8); */ + } + /* DebugValue("iv",ctx.iv,8); */ + /* accumulate material for the next key */ + shiftin(nk,text,Sizes[imode]); + /* DebugValue("nk",nk,24);*/ + if((dir && (imode == CFB1 || imode == CFB8 || imode == CFB64 + || imode == CBC)) || imode == OFB) + memcpy(text,old_iv,8); + + if(!dir && (imode == CFB1 || imode == CFB8 || imode == CFB64)) + { + /* the test specifies using the output of the raw DES operation + which we don't have, so reconstruct it... */ + for(n=0 ; n < 8 ; ++n) + text[n]^=old_text[n]; + } + } + for(n=0 ; n < 8 ; ++n) + akey[n]^=nk[16+n]; + for(n=0 ; n < 8 ; ++n) + akey[8+n]^=nk[8+n]; + for(n=0 ; n < 8 ; ++n) + akey[16+n]^=nk[n]; + if(numkeys < 3) + memcpy(&akey[2*8],akey,8); + if(numkeys < 2) + memcpy(&akey[8],akey,8); + DES_set_odd_parity((DES_cblock *)akey); + DES_set_odd_parity((DES_cblock *)(akey+8)); + DES_set_odd_parity((DES_cblock *)(akey+16)); + memcpy(ivec,ctx.iv,8); + + /* pointless exercise - the final text doesn't depend on the + initial text in OFB mode, so who cares what it is? (Who + designed these tests?) */ + if(imode == OFB) + for(n=0 ; n < 8 ; ++n) + text[n]=text0[n]^old_iv[n]; + } + } + +int proc_file(char *rqfile) + { + char afn[256], rfn[256]; + FILE *afp = NULL, *rfp = NULL; + char ibuf[2048]; + int ilen, len, ret = 0; + char amode[8] = ""; + char atest[100] = ""; + int akeysz=0; + unsigned char iVec[20], aKey[40]; + int dir = -1, err = 0, step = 0; + unsigned char plaintext[2048]; + unsigned char ciphertext[2048]; + char *rp; + EVP_CIPHER_CTX ctx; + int numkeys=1; + + if (!rqfile || !(*rqfile)) + { + printf("No req file\n"); + return -1; + } + strcpy(afn, rqfile); + + if ((afp = fopen(afn, "r")) == NULL) + { + printf("Cannot open file: %s, %s\n", + afn, strerror(errno)); + return -1; + } + strcpy(rfn,afn); + rp=strstr(rfn,"req/"); + assert(rp); + memcpy(rp,"rsp",3); + rp = strstr(rfn, ".req"); + memcpy(rp, ".rsp", 4); + if ((rfp = fopen(rfn, "w")) == NULL) + { + printf("Cannot open file: %s, %s\n", + rfn, strerror(errno)); + fclose(afp); + afp = NULL; + return -1; + } + while (!err && (fgets(ibuf, sizeof(ibuf), afp)) != NULL) + { + ilen = strlen(ibuf); + /* printf("step=%d ibuf=%s",step,ibuf);*/ + if(step == 3 && !strcmp(amode,"ECB")) + { + memset(iVec, 0, sizeof(iVec)); + step = (dir)? 4: 5; /* no ivec for ECB */ + } + switch (step) + { + case 0: /* read preamble */ + if (ibuf[0] == '\n') + { /* end of preamble */ + if (*amode == '\0') + { + printf("Missing Mode\n"); + err = 1; + } + else + { + fputs(ibuf, rfp); + ++ step; + } + } + else if (ibuf[0] != '#') + { + printf("Invalid preamble item: %s\n", ibuf); + err = 1; + } + else + { /* process preamble */ + char *xp, *pp = ibuf+2; + int n; + if(*amode) + { /* insert current time & date */ + time_t rtim = time(0); + fprintf(rfp, "# %s", ctime(&rtim)); + } + else + { + fputs(ibuf, rfp); + if(!strncmp(pp,"INVERSE ",8) || !strncmp(pp,"DES ",4) + || !strncmp(pp,"TDES ",5) + || !strncmp(pp,"PERMUTATION ",12) + || !strncmp(pp,"SUBSTITUTION ",13) + || !strncmp(pp,"VARIABLE ",9)) + { + /* get test type */ + if(!strncmp(pp,"DES ",4)) + pp+=4; + else if(!strncmp(pp,"TDES ",5)) + pp+=5; + xp = strchr(pp, ' '); + n = xp-pp; + strncpy(atest, pp, n); + atest[n] = '\0'; + /* get mode */ + xp = strrchr(pp, ' '); /* get mode" */ + n = strlen(xp+1)-1; + strncpy(amode, xp+1, n); + amode[n] = '\0'; + /* amode[3] = '\0'; */ + printf("Test=%s, Mode=%s\n",atest,amode); + } + } + } + break; + + case 1: /* [ENCRYPT] | [DECRYPT] */ + if(ibuf[0] == '\n') + break; + if (ibuf[0] == '[') + { + fputs(ibuf, rfp); + ++step; + if (strncasecmp(ibuf, "[ENCRYPT]", 9) == 0) + dir = 1; + else if (strncasecmp(ibuf, "[DECRYPT]", 9) == 0) + dir = 0; + else + { + printf("Invalid keyword: %s\n", ibuf); + err = 1; + } + break; + } + else if (dir == -1) + { + err = 1; + printf("Missing ENCRYPT/DECRYPT keyword\n"); + break; + } + else + step = 2; + + case 2: /* KEY = xxxx */ + if(*ibuf == '\n') + { + fputs(ibuf, rfp); + break; + } + if(!strncasecmp(ibuf,"COUNT = ",8)) + { + fputs(ibuf, rfp); + break; + } + if(!strncasecmp(ibuf,"COUNT=",6)) + { + fputs(ibuf, rfp); + break; + } + if(!strncasecmp(ibuf,"NumKeys = ",10)) + { + numkeys=atoi(ibuf+10); + break; + } + + fputs(ibuf, rfp); + if(!strncasecmp(ibuf,"KEY = ",6)) + { + akeysz=64; + len = hex2bin((char*)ibuf+6, strlen(ibuf+6)-1, aKey); + if (len < 0) + { + printf("Invalid KEY\n"); + err=1; + break; + } + PrintValue("KEY", aKey, len); + ++step; + } + else if(!strncasecmp(ibuf,"KEYs = ",7)) + { + akeysz=64*3; + len=hex2bin(ibuf+7,strlen(ibuf+7)-1,aKey); + if(len != 8) + { + printf("Invalid KEY\n"); + err=1; + break; + } + memcpy(aKey+8,aKey,8); + memcpy(aKey+16,aKey,8); + ibuf[4]='\0'; + PrintValue("KEYs",aKey,len); + ++step; + } + else if(!strncasecmp(ibuf,"KEY",3)) + { + int n=ibuf[3]-'1'; + + akeysz=64*3; + len=hex2bin(ibuf+7,strlen(ibuf+7)-1,aKey+n*8); + if(len != 8) + { + printf("Invalid KEY\n"); + err=1; + break; + } + ibuf[4]='\0'; + PrintValue(ibuf,aKey,len); + if(n == 2) + ++step; + } + else + { + printf("Missing KEY\n"); + err = 1; + } + break; + + case 3: /* IV = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "IV = ", 5) != 0) + { + printf("Missing IV\n"); + err = 1; + } + else + { + len = hex2bin((char*)ibuf+5, strlen(ibuf+5)-1, iVec); + if (len < 0) + { + printf("Invalid IV\n"); + err =1; + break; + } + PrintValue("IV", iVec, len); + step = (dir)? 4: 5; + } + break; + + case 4: /* PLAINTEXT = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "PLAINTEXT = ", 12) != 0) + { + printf("Missing PLAINTEXT\n"); + err = 1; + } + else + { + int nn = strlen(ibuf+12); + if(!strcmp(amode,"CFB1")) + len=bint2bin(ibuf+12,nn-1,plaintext); + else + len=hex2bin(ibuf+12, nn-1,plaintext); + if (len < 0) + { + printf("Invalid PLAINTEXT: %s", ibuf+12); + err =1; + break; + } + if (len >= sizeof(plaintext)) + { + printf("Buffer overflow\n"); + } + PrintValue("PLAINTEXT", (unsigned char*)plaintext, len); + if (strcmp(atest, "Monte") == 0) /* Monte Carlo Test */ + { + do_mct(amode,akeysz,numkeys,aKey,iVec,dir,plaintext,len,rfp); + } + else + { + assert(dir == 1); + ret = DESTest(&ctx, amode, akeysz, aKey, iVec, + dir, /* 0 = decrypt, 1 = encrypt */ + ciphertext, plaintext, len); + OutputValue("CIPHERTEXT",ciphertext,len,rfp, + !strcmp(amode,"CFB1")); + } + step = 6; + } + break; + + case 5: /* CIPHERTEXT = xxxx */ + fputs(ibuf, rfp); + if (strncasecmp(ibuf, "CIPHERTEXT = ", 13) != 0) + { + printf("Missing KEY\n"); + err = 1; + } + else + { + if(!strcmp(amode,"CFB1")) + len=bint2bin(ibuf+13,strlen(ibuf+13)-1,ciphertext); + else + len = hex2bin(ibuf+13,strlen(ibuf+13)-1,ciphertext); + if (len < 0) + { + printf("Invalid CIPHERTEXT\n"); + err =1; + break; + } + + PrintValue("CIPHERTEXT", ciphertext, len); + if (strcmp(atest, "Monte") == 0) /* Monte Carlo Test */ + { + do_mct(amode, akeysz, numkeys, aKey, iVec, + dir, ciphertext, len, rfp); + } + else + { + assert(dir == 0); + ret = DESTest(&ctx, amode, akeysz, aKey, iVec, + dir, /* 0 = decrypt, 1 = encrypt */ + plaintext, ciphertext, len); + OutputValue("PLAINTEXT",(unsigned char *)plaintext,len,rfp, + !strcmp(amode,"CFB1")); + } + step = 6; + } + break; + + case 6: + if (ibuf[0] != '\n') + { + err = 1; + printf("Missing terminator\n"); + } + else if (strcmp(atest, "MCT") != 0) + { /* MCT already added terminating nl */ + fputs(ibuf, rfp); + } + step = 1; + break; + } + } + if (rfp) + fclose(rfp); + if (afp) + fclose(afp); + return err; + } + +/*-------------------------------------------------- + Processes either a single file or + a set of files whose names are passed in a file. + A single file is specified as: + aes_test -f xxx.req + A set of files is specified as: + aes_test -d xxxxx.xxx + The default is: -d req.txt +--------------------------------------------------*/ +int main(int argc, char **argv) + { + char *rqlist = "req.txt"; + FILE *fp = NULL; + char fn[250] = "", rfn[256] = ""; + int f_opt = 0, d_opt = 1; + +#ifdef OPENSSL_FIPS + if(!FIPS_mode_set(1)) + { + ERR_load_crypto_strings(); + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + EXIT(1); + } +#endif + ERR_load_crypto_strings(); + if (argc > 1) + { + if (strcasecmp(argv[1], "-d") == 0) + { + d_opt = 1; + } + else if (strcasecmp(argv[1], "-f") == 0) + { + f_opt = 1; + d_opt = 0; + } + else + { + printf("Invalid parameter: %s\n", argv[1]); + return 0; + } + if (argc < 3) + { + printf("Missing parameter\n"); + return 0; + } + if (d_opt) + rqlist = argv[2]; + else + strcpy(fn, argv[2]); + } + if (d_opt) + { /* list of files (directory) */ + if (!(fp = fopen(rqlist, "r"))) + { + printf("Cannot open req list file\n"); + return -1; + } + while (fgets(fn, sizeof(fn), fp)) + { + strtok(fn, "\r\n"); + strcpy(rfn, fn); + printf("Processing: %s\n", rfn); + if (proc_file(rfn)) + { + printf(">>> Processing failed for: %s <<<\n", rfn); + EXIT(1); + } + } + fclose(fp); + } + else /* single file */ + { + printf("Processing: %s\n", fn); + if (proc_file(fn)) + { + printf(">>> Processing failed for: %s <<<\n", fn); + } + } + EXIT(0); + return 0; + } diff --git a/lib/libssl/src/fips-1.0/des/fips_set_key.c b/lib/libssl/src/fips-1.0/des/fips_set_key.c new file mode 100644 index 00000000000..a508ee5acb0 --- /dev/null +++ b/lib/libssl/src/fips-1.0/des/fips_set_key.c @@ -0,0 +1,417 @@ +/* crypto/des/set_key.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +/* set_key.c v 1.4 eay 24/9/91 + * 1.4 Speed up by 400% :-) + * 1.3 added register declarations. + * 1.2 unrolled make_key_sched a bit more + * 1.1 added norm_expand_bits + * 1.0 First working version + */ +#include "fips_des_locl.h" +#include <openssl/fips.h> + +#ifdef OPENSSL_FIPS + +OPENSSL_IMPLEMENT_GLOBAL(int,DES_check_key); /* defaults to false */ + +static const unsigned char odd_parity[256]={ + 1, 1, 2, 2, 4, 4, 7, 7, 8, 8, 11, 11, 13, 13, 14, 14, + 16, 16, 19, 19, 21, 21, 22, 22, 25, 25, 26, 26, 28, 28, 31, 31, + 32, 32, 35, 35, 37, 37, 38, 38, 41, 41, 42, 42, 44, 44, 47, 47, + 49, 49, 50, 50, 52, 52, 55, 55, 56, 56, 59, 59, 61, 61, 62, 62, + 64, 64, 67, 67, 69, 69, 70, 70, 73, 73, 74, 74, 76, 76, 79, 79, + 81, 81, 82, 82, 84, 84, 87, 87, 88, 88, 91, 91, 93, 93, 94, 94, + 97, 97, 98, 98,100,100,103,103,104,104,107,107,109,109,110,110, +112,112,115,115,117,117,118,118,121,121,122,122,124,124,127,127, +128,128,131,131,133,133,134,134,137,137,138,138,140,140,143,143, +145,145,146,146,148,148,151,151,152,152,155,155,157,157,158,158, +161,161,162,162,164,164,167,167,168,168,171,171,173,173,174,174, +176,176,179,179,181,181,182,182,185,185,186,186,188,188,191,191, +193,193,194,194,196,196,199,199,200,200,203,203,205,205,206,206, +208,208,211,211,213,213,214,214,217,217,218,218,220,220,223,223, +224,224,227,227,229,229,230,230,233,233,234,234,236,236,239,239, +241,241,242,242,244,244,247,247,248,248,251,251,253,253,254,254}; + +void DES_set_odd_parity(DES_cblock *key) + { + int i; + + for (i=0; i<DES_KEY_SZ; i++) + (*key)[i]=odd_parity[(*key)[i]]; + } + +int DES_check_key_parity(const_DES_cblock *key) + { + int i; + + for (i=0; i<DES_KEY_SZ; i++) + { + if ((*key)[i] != odd_parity[(*key)[i]]) + return(0); + } + return(1); + } + +/* Weak and semi week keys as take from + * %A D.W. Davies + * %A W.L. Price + * %T Security for Computer Networks + * %I John Wiley & Sons + * %D 1984 + * Many thanks to smb@ulysses.att.com (Steven Bellovin) for the reference + * (and actual cblock values). + */ +#define NUM_WEAK_KEY 16 +static const DES_cblock weak_keys[NUM_WEAK_KEY]={ + /* weak keys */ + {0x01,0x01,0x01,0x01,0x01,0x01,0x01,0x01}, + {0xFE,0xFE,0xFE,0xFE,0xFE,0xFE,0xFE,0xFE}, + {0x1F,0x1F,0x1F,0x1F,0x0E,0x0E,0x0E,0x0E}, + {0xE0,0xE0,0xE0,0xE0,0xF1,0xF1,0xF1,0xF1}, + /* semi-weak keys */ + {0x01,0xFE,0x01,0xFE,0x01,0xFE,0x01,0xFE}, + {0xFE,0x01,0xFE,0x01,0xFE,0x01,0xFE,0x01}, + {0x1F,0xE0,0x1F,0xE0,0x0E,0xF1,0x0E,0xF1}, + {0xE0,0x1F,0xE0,0x1F,0xF1,0x0E,0xF1,0x0E}, + {0x01,0xE0,0x01,0xE0,0x01,0xF1,0x01,0xF1}, + {0xE0,0x01,0xE0,0x01,0xF1,0x01,0xF1,0x01}, + {0x1F,0xFE,0x1F,0xFE,0x0E,0xFE,0x0E,0xFE}, + {0xFE,0x1F,0xFE,0x1F,0xFE,0x0E,0xFE,0x0E}, + {0x01,0x1F,0x01,0x1F,0x01,0x0E,0x01,0x0E}, + {0x1F,0x01,0x1F,0x01,0x0E,0x01,0x0E,0x01}, + {0xE0,0xFE,0xE0,0xFE,0xF1,0xFE,0xF1,0xFE}, + {0xFE,0xE0,0xFE,0xE0,0xFE,0xF1,0xFE,0xF1}}; + +int DES_is_weak_key(const_DES_cblock *key) + { + int i; + + for (i=0; i<NUM_WEAK_KEY; i++) + /* Added == 0 to comparison, I obviously don't run + * this section very often :-(, thanks to + * engineering@MorningStar.Com for the fix + * eay 93/06/29 + * Another problem, I was comparing only the first 4 + * bytes, 97/03/18 */ + if (memcmp(weak_keys[i],key,sizeof(DES_cblock)) == 0) return(1); + return(0); + } + +/* NOW DEFINED IN des_local.h + * See ecb_encrypt.c for a pseudo description of these macros. + * #define PERM_OP(a,b,t,n,m) ((t)=((((a)>>(n))^(b))&(m)),\ + * (b)^=(t),\ + * (a)=((a)^((t)<<(n)))) + */ + +#define HPERM_OP(a,t,n,m) ((t)=((((a)<<(16-(n)))^(a))&(m)),\ + (a)=(a)^(t)^(t>>(16-(n)))) + +static const DES_LONG des_skb[8][64]={ + { + /* for C bits (numbered as per FIPS 46) 1 2 3 4 5 6 */ + 0x00000000L,0x00000010L,0x20000000L,0x20000010L, + 0x00010000L,0x00010010L,0x20010000L,0x20010010L, + 0x00000800L,0x00000810L,0x20000800L,0x20000810L, + 0x00010800L,0x00010810L,0x20010800L,0x20010810L, + 0x00000020L,0x00000030L,0x20000020L,0x20000030L, + 0x00010020L,0x00010030L,0x20010020L,0x20010030L, + 0x00000820L,0x00000830L,0x20000820L,0x20000830L, + 0x00010820L,0x00010830L,0x20010820L,0x20010830L, + 0x00080000L,0x00080010L,0x20080000L,0x20080010L, + 0x00090000L,0x00090010L,0x20090000L,0x20090010L, + 0x00080800L,0x00080810L,0x20080800L,0x20080810L, + 0x00090800L,0x00090810L,0x20090800L,0x20090810L, + 0x00080020L,0x00080030L,0x20080020L,0x20080030L, + 0x00090020L,0x00090030L,0x20090020L,0x20090030L, + 0x00080820L,0x00080830L,0x20080820L,0x20080830L, + 0x00090820L,0x00090830L,0x20090820L,0x20090830L, + },{ + /* for C bits (numbered as per FIPS 46) 7 8 10 11 12 13 */ + 0x00000000L,0x02000000L,0x00002000L,0x02002000L, + 0x00200000L,0x02200000L,0x00202000L,0x02202000L, + 0x00000004L,0x02000004L,0x00002004L,0x02002004L, + 0x00200004L,0x02200004L,0x00202004L,0x02202004L, + 0x00000400L,0x02000400L,0x00002400L,0x02002400L, + 0x00200400L,0x02200400L,0x00202400L,0x02202400L, + 0x00000404L,0x02000404L,0x00002404L,0x02002404L, + 0x00200404L,0x02200404L,0x00202404L,0x02202404L, + 0x10000000L,0x12000000L,0x10002000L,0x12002000L, + 0x10200000L,0x12200000L,0x10202000L,0x12202000L, + 0x10000004L,0x12000004L,0x10002004L,0x12002004L, + 0x10200004L,0x12200004L,0x10202004L,0x12202004L, + 0x10000400L,0x12000400L,0x10002400L,0x12002400L, + 0x10200400L,0x12200400L,0x10202400L,0x12202400L, + 0x10000404L,0x12000404L,0x10002404L,0x12002404L, + 0x10200404L,0x12200404L,0x10202404L,0x12202404L, + },{ + /* for C bits (numbered as per FIPS 46) 14 15 16 17 19 20 */ + 0x00000000L,0x00000001L,0x00040000L,0x00040001L, + 0x01000000L,0x01000001L,0x01040000L,0x01040001L, + 0x00000002L,0x00000003L,0x00040002L,0x00040003L, + 0x01000002L,0x01000003L,0x01040002L,0x01040003L, + 0x00000200L,0x00000201L,0x00040200L,0x00040201L, + 0x01000200L,0x01000201L,0x01040200L,0x01040201L, + 0x00000202L,0x00000203L,0x00040202L,0x00040203L, + 0x01000202L,0x01000203L,0x01040202L,0x01040203L, + 0x08000000L,0x08000001L,0x08040000L,0x08040001L, + 0x09000000L,0x09000001L,0x09040000L,0x09040001L, + 0x08000002L,0x08000003L,0x08040002L,0x08040003L, + 0x09000002L,0x09000003L,0x09040002L,0x09040003L, + 0x08000200L,0x08000201L,0x08040200L,0x08040201L, + 0x09000200L,0x09000201L,0x09040200L,0x09040201L, + 0x08000202L,0x08000203L,0x08040202L,0x08040203L, + 0x09000202L,0x09000203L,0x09040202L,0x09040203L, + },{ + /* for C bits (numbered as per FIPS 46) 21 23 24 26 27 28 */ + 0x00000000L,0x00100000L,0x00000100L,0x00100100L, + 0x00000008L,0x00100008L,0x00000108L,0x00100108L, + 0x00001000L,0x00101000L,0x00001100L,0x00101100L, + 0x00001008L,0x00101008L,0x00001108L,0x00101108L, + 0x04000000L,0x04100000L,0x04000100L,0x04100100L, + 0x04000008L,0x04100008L,0x04000108L,0x04100108L, + 0x04001000L,0x04101000L,0x04001100L,0x04101100L, + 0x04001008L,0x04101008L,0x04001108L,0x04101108L, + 0x00020000L,0x00120000L,0x00020100L,0x00120100L, + 0x00020008L,0x00120008L,0x00020108L,0x00120108L, + 0x00021000L,0x00121000L,0x00021100L,0x00121100L, + 0x00021008L,0x00121008L,0x00021108L,0x00121108L, + 0x04020000L,0x04120000L,0x04020100L,0x04120100L, + 0x04020008L,0x04120008L,0x04020108L,0x04120108L, + 0x04021000L,0x04121000L,0x04021100L,0x04121100L, + 0x04021008L,0x04121008L,0x04021108L,0x04121108L, + },{ + /* for D bits (numbered as per FIPS 46) 1 2 3 4 5 6 */ + 0x00000000L,0x10000000L,0x00010000L,0x10010000L, + 0x00000004L,0x10000004L,0x00010004L,0x10010004L, + 0x20000000L,0x30000000L,0x20010000L,0x30010000L, + 0x20000004L,0x30000004L,0x20010004L,0x30010004L, + 0x00100000L,0x10100000L,0x00110000L,0x10110000L, + 0x00100004L,0x10100004L,0x00110004L,0x10110004L, + 0x20100000L,0x30100000L,0x20110000L,0x30110000L, + 0x20100004L,0x30100004L,0x20110004L,0x30110004L, + 0x00001000L,0x10001000L,0x00011000L,0x10011000L, + 0x00001004L,0x10001004L,0x00011004L,0x10011004L, + 0x20001000L,0x30001000L,0x20011000L,0x30011000L, + 0x20001004L,0x30001004L,0x20011004L,0x30011004L, + 0x00101000L,0x10101000L,0x00111000L,0x10111000L, + 0x00101004L,0x10101004L,0x00111004L,0x10111004L, + 0x20101000L,0x30101000L,0x20111000L,0x30111000L, + 0x20101004L,0x30101004L,0x20111004L,0x30111004L, + },{ + /* for D bits (numbered as per FIPS 46) 8 9 11 12 13 14 */ + 0x00000000L,0x08000000L,0x00000008L,0x08000008L, + 0x00000400L,0x08000400L,0x00000408L,0x08000408L, + 0x00020000L,0x08020000L,0x00020008L,0x08020008L, + 0x00020400L,0x08020400L,0x00020408L,0x08020408L, + 0x00000001L,0x08000001L,0x00000009L,0x08000009L, + 0x00000401L,0x08000401L,0x00000409L,0x08000409L, + 0x00020001L,0x08020001L,0x00020009L,0x08020009L, + 0x00020401L,0x08020401L,0x00020409L,0x08020409L, + 0x02000000L,0x0A000000L,0x02000008L,0x0A000008L, + 0x02000400L,0x0A000400L,0x02000408L,0x0A000408L, + 0x02020000L,0x0A020000L,0x02020008L,0x0A020008L, + 0x02020400L,0x0A020400L,0x02020408L,0x0A020408L, + 0x02000001L,0x0A000001L,0x02000009L,0x0A000009L, + 0x02000401L,0x0A000401L,0x02000409L,0x0A000409L, + 0x02020001L,0x0A020001L,0x02020009L,0x0A020009L, + 0x02020401L,0x0A020401L,0x02020409L,0x0A020409L, + },{ + /* for D bits (numbered as per FIPS 46) 16 17 18 19 20 21 */ + 0x00000000L,0x00000100L,0x00080000L,0x00080100L, + 0x01000000L,0x01000100L,0x01080000L,0x01080100L, + 0x00000010L,0x00000110L,0x00080010L,0x00080110L, + 0x01000010L,0x01000110L,0x01080010L,0x01080110L, + 0x00200000L,0x00200100L,0x00280000L,0x00280100L, + 0x01200000L,0x01200100L,0x01280000L,0x01280100L, + 0x00200010L,0x00200110L,0x00280010L,0x00280110L, + 0x01200010L,0x01200110L,0x01280010L,0x01280110L, + 0x00000200L,0x00000300L,0x00080200L,0x00080300L, + 0x01000200L,0x01000300L,0x01080200L,0x01080300L, + 0x00000210L,0x00000310L,0x00080210L,0x00080310L, + 0x01000210L,0x01000310L,0x01080210L,0x01080310L, + 0x00200200L,0x00200300L,0x00280200L,0x00280300L, + 0x01200200L,0x01200300L,0x01280200L,0x01280300L, + 0x00200210L,0x00200310L,0x00280210L,0x00280310L, + 0x01200210L,0x01200310L,0x01280210L,0x01280310L, + },{ + /* for D bits (numbered as per FIPS 46) 22 23 24 25 27 28 */ + 0x00000000L,0x04000000L,0x00040000L,0x04040000L, + 0x00000002L,0x04000002L,0x00040002L,0x04040002L, + 0x00002000L,0x04002000L,0x00042000L,0x04042000L, + 0x00002002L,0x04002002L,0x00042002L,0x04042002L, + 0x00000020L,0x04000020L,0x00040020L,0x04040020L, + 0x00000022L,0x04000022L,0x00040022L,0x04040022L, + 0x00002020L,0x04002020L,0x00042020L,0x04042020L, + 0x00002022L,0x04002022L,0x00042022L,0x04042022L, + 0x00000800L,0x04000800L,0x00040800L,0x04040800L, + 0x00000802L,0x04000802L,0x00040802L,0x04040802L, + 0x00002800L,0x04002800L,0x00042800L,0x04042800L, + 0x00002802L,0x04002802L,0x00042802L,0x04042802L, + 0x00000820L,0x04000820L,0x00040820L,0x04040820L, + 0x00000822L,0x04000822L,0x00040822L,0x04040822L, + 0x00002820L,0x04002820L,0x00042820L,0x04042820L, + 0x00002822L,0x04002822L,0x00042822L,0x04042822L, + }}; + +int DES_set_key(const_DES_cblock *key, DES_key_schedule *schedule) + { + if (FIPS_selftest_failed()) + return -3; + if (DES_check_key) + { + return DES_set_key_checked(key, schedule); + } + else + { + DES_set_key_unchecked(key, schedule); + return 0; + } + } + +/* return 0 if key parity is odd (correct), + * return -1 if key parity error, + * return -2 if illegal weak key. + */ +int DES_set_key_checked(const_DES_cblock *key, DES_key_schedule *schedule) + { + if (!DES_check_key_parity(key)) + return(-1); + if (DES_is_weak_key(key)) + return(-2); + if (FIPS_selftest_failed()) + return -3; + + DES_set_key_unchecked(key, schedule); + return 0; + } + +void DES_set_key_unchecked(const_DES_cblock *key, DES_key_schedule *schedule) + { + static const int shifts2[16]={0,0,1,1,1,1,1,1,0,1,1,1,1,1,1,0}; + register DES_LONG c,d,t,s,t2; + register const unsigned char *in; + register DES_LONG *k; + register int i; + +#ifdef OPENBSD_DEV_CRYPTO + memcpy(schedule->key,key,sizeof schedule->key); + schedule->session=NULL; +#endif + k = &schedule->ks->deslong[0]; + in = &(*key)[0]; + + c2l(in,c); + c2l(in,d); + + /* do PC1 in 47 simple operations :-) + * Thanks to John Fletcher (john_fletcher@lccmail.ocf.llnl.gov) + * for the inspiration. :-) */ + PERM_OP (d,c,t,4,0x0f0f0f0fL); + HPERM_OP(c,t,-2,0xcccc0000L); + HPERM_OP(d,t,-2,0xcccc0000L); + PERM_OP (d,c,t,1,0x55555555L); + PERM_OP (c,d,t,8,0x00ff00ffL); + PERM_OP (d,c,t,1,0x55555555L); + d= (((d&0x000000ffL)<<16L)| (d&0x0000ff00L) | + ((d&0x00ff0000L)>>16L)|((c&0xf0000000L)>>4L)); + c&=0x0fffffffL; + + for (i=0; i<ITERATIONS; i++) + { + if (shifts2[i]) + { c=((c>>2L)|(c<<26L)); d=((d>>2L)|(d<<26L)); } + else + { c=((c>>1L)|(c<<27L)); d=((d>>1L)|(d<<27L)); } + c&=0x0fffffffL; + d&=0x0fffffffL; + /* could be a few less shifts but I am to lazy at this + * point in time to investigate */ + s= des_skb[0][ (c )&0x3f ]| + des_skb[1][((c>> 6L)&0x03)|((c>> 7L)&0x3c)]| + des_skb[2][((c>>13L)&0x0f)|((c>>14L)&0x30)]| + des_skb[3][((c>>20L)&0x01)|((c>>21L)&0x06) | + ((c>>22L)&0x38)]; + t= des_skb[4][ (d )&0x3f ]| + des_skb[5][((d>> 7L)&0x03)|((d>> 8L)&0x3c)]| + des_skb[6][ (d>>15L)&0x3f ]| + des_skb[7][((d>>21L)&0x0f)|((d>>22L)&0x30)]; + + /* table contained 0213 4657 */ + t2=((t<<16L)|(s&0x0000ffffL))&0xffffffffL; + *(k++)=ROTATE(t2,30)&0xffffffffL; + + t2=((s>>16L)|(t&0xffff0000L)); + *(k++)=ROTATE(t2,26)&0xffffffffL; + } + } + +int DES_key_sched(const_DES_cblock *key, DES_key_schedule *schedule) + { + return(DES_set_key(key,schedule)); + } +/* +#undef des_fixup_key_parity +void des_fixup_key_parity(des_cblock *key) + { + des_set_odd_parity(key); + } +*/ + +#endif /* def OPENSSL_FIPS */ diff --git a/lib/libssl/src/fips-1.0/dh/Makefile b/lib/libssl/src/fips-1.0/dh/Makefile new file mode 100644 index 00000000000..1166ca6e849 --- /dev/null +++ b/lib/libssl/src/fips-1.0/dh/Makefile @@ -0,0 +1,104 @@ +# +# OpenSSL/fips-1.0/dh/Makefile +# + +DIR= dh +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST= +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_dh_check.c fips_dh_gen.c fips_dh_key.c +LIBOBJ=fips_dh_check.o fips_dh_gen.o fips_dh_key.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_dh_check.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +fips_dh_check.o: ../../include/openssl/crypto.h ../../include/openssl/dh.h +fips_dh_check.o: ../../include/openssl/e_os2.h +fips_dh_check.o: ../../include/openssl/opensslconf.h +fips_dh_check.o: ../../include/openssl/opensslv.h +fips_dh_check.o: ../../include/openssl/ossl_typ.h +fips_dh_check.o: ../../include/openssl/safestack.h +fips_dh_check.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_dh_check.o: fips_dh_check.c +fips_dh_gen.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +fips_dh_gen.o: ../../include/openssl/crypto.h ../../include/openssl/dh.h +fips_dh_gen.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_dh_gen.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_dh_gen.o: ../../include/openssl/opensslconf.h +fips_dh_gen.o: ../../include/openssl/opensslv.h +fips_dh_gen.o: ../../include/openssl/ossl_typ.h +fips_dh_gen.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_dh_gen.o: ../../include/openssl/symhacks.h fips_dh_gen.c +fips_dh_key.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +fips_dh_key.o: ../../include/openssl/crypto.h ../../include/openssl/dh.h +fips_dh_key.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_dh_key.o: ../../include/openssl/lhash.h +fips_dh_key.o: ../../include/openssl/opensslconf.h +fips_dh_key.o: ../../include/openssl/opensslv.h +fips_dh_key.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_dh_key.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_dh_key.o: ../../include/openssl/symhacks.h fips_dh_key.c diff --git a/lib/libssl/src/fips-1.0/dh/fips_dh_check.c b/lib/libssl/src/fips-1.0/dh/fips_dh_check.c new file mode 100644 index 00000000000..874920b466f --- /dev/null +++ b/lib/libssl/src/fips-1.0/dh/fips_dh_check.c @@ -0,0 +1,125 @@ +/* crypto/dh/dh_check.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <openssl/bn.h> +#ifndef OPENSSL_NO_DH +#include <openssl/dh.h> + +#ifdef OPENSSL_FIPS + +/* Check that p is a safe prime and + * if g is 2, 3 or 5, check that is is a suitable generator + * where + * for 2, p mod 24 == 11 + * for 3, p mod 12 == 5 + * for 5, p mod 10 == 3 or 7 + * should hold. + */ + +int DH_check(const DH *dh, int *ret) + { + int ok=0; + BN_CTX *ctx=NULL; + BN_ULONG l; + BIGNUM *q=NULL; + + *ret=0; + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + q=BN_new(); + if (q == NULL) goto err; + + if (BN_is_word(dh->g,DH_GENERATOR_2)) + { + l=BN_mod_word(dh->p,24); + if (l != 11) *ret|=DH_NOT_SUITABLE_GENERATOR; + } +#if 0 + else if (BN_is_word(dh->g,DH_GENERATOR_3)) + { + l=BN_mod_word(dh->p,12); + if (l != 5) *ret|=DH_NOT_SUITABLE_GENERATOR; + } +#endif + else if (BN_is_word(dh->g,DH_GENERATOR_5)) + { + l=BN_mod_word(dh->p,10); + if ((l != 3) && (l != 7)) + *ret|=DH_NOT_SUITABLE_GENERATOR; + } + else + *ret|=DH_UNABLE_TO_CHECK_GENERATOR; + + if (!BN_is_prime(dh->p,BN_prime_checks,NULL,ctx,NULL)) + *ret|=DH_CHECK_P_NOT_PRIME; + else + { + if (!BN_rshift1(q,dh->p)) goto err; + if (!BN_is_prime(q,BN_prime_checks,NULL,ctx,NULL)) + *ret|=DH_CHECK_P_NOT_SAFE_PRIME; + } + ok=1; +err: + if (ctx != NULL) BN_CTX_free(ctx); + if (q != NULL) BN_free(q); + return(ok); + } + +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/dh/fips_dh_gen.c b/lib/libssl/src/fips-1.0/dh/fips_dh_gen.c new file mode 100644 index 00000000000..b569e3912d2 --- /dev/null +++ b/lib/libssl/src/fips-1.0/dh/fips_dh_gen.c @@ -0,0 +1,186 @@ +/* crypto/dh/dh_gen.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <string.h> +#include <openssl/err.h> +#include <openssl/bn.h> +#ifndef OPENSSL_NO_DH +#include <openssl/dh.h> +#endif +#include <openssl/fips.h> + +#ifndef OPENSSL_NO_DH +#ifdef OPENSSL_FIPS + +/* We generate DH parameters as follows + * find a prime q which is prime_len/2 bits long. + * p=(2*q)+1 or (p-1)/2 = q + * For this case, g is a generator if + * g^((p-1)/q) mod p != 1 for values of q which are the factors of p-1. + * Since the factors of p-1 are q and 2, we just need to check + * g^2 mod p != 1 and g^q mod p != 1. + * + * Having said all that, + * there is another special case method for the generators 2, 3 and 5. + * for 2, p mod 24 == 11 + * for 3, p mod 12 == 5 <<<<< does not work for safe primes. + * for 5, p mod 10 == 3 or 7 + * + * Thanks to Phil Karn <karn@qualcomm.com> for the pointers about the + * special generators and for answering some of my questions. + * + * I've implemented the second simple method :-). + * Since DH should be using a safe prime (both p and q are prime), + * this generator function can take a very very long time to run. + */ +/* Actually there is no reason to insist that 'generator' be a generator. + * It's just as OK (and in some sense better) to use a generator of the + * order-q subgroup. + */ + +DH *DH_generate_parameters(int prime_len, int generator, + void (*callback)(int,int,void *), void *cb_arg) + { + BIGNUM *p=NULL,*t1,*t2; + DH *ret=NULL; + int g,ok= -1; + BN_CTX *ctx=NULL; + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_DH_GENERATE_PARAMETERS,FIPS_R_FIPS_SELFTEST_FAILED); + return NULL; + } + + ret=DH_new(); + if (ret == NULL) goto err; + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + BN_CTX_start(ctx); + t1 = BN_CTX_get(ctx); + t2 = BN_CTX_get(ctx); + if (t1 == NULL || t2 == NULL) goto err; + + if (generator <= 1) + { + DHerr(DH_F_DH_GENERATE_PARAMETERS, DH_R_BAD_GENERATOR); + goto err; + } + if (generator == DH_GENERATOR_2) + { + if (!BN_set_word(t1,24)) goto err; + if (!BN_set_word(t2,11)) goto err; + g=2; + } +#if 0 /* does not work for safe primes */ + else if (generator == DH_GENERATOR_3) + { + if (!BN_set_word(t1,12)) goto err; + if (!BN_set_word(t2,5)) goto err; + g=3; + } +#endif + else if (generator == DH_GENERATOR_5) + { + if (!BN_set_word(t1,10)) goto err; + if (!BN_set_word(t2,3)) goto err; + /* BN_set_word(t3,7); just have to miss + * out on these ones :-( */ + g=5; + } + else + { + /* in the general case, don't worry if 'generator' is a + * generator or not: since we are using safe primes, + * it will generate either an order-q or an order-2q group, + * which both is OK */ + if (!BN_set_word(t1,2)) goto err; + if (!BN_set_word(t2,1)) goto err; + g=generator; + } + + p=BN_generate_prime(NULL,prime_len,1,t1,t2,callback,cb_arg); + if (p == NULL) goto err; + if (callback != NULL) callback(3,0,cb_arg); + ret->p=p; + ret->g=BN_new(); + if (!BN_set_word(ret->g,g)) goto err; + ok=1; +err: + if (ok == -1) + { + DHerr(DH_F_DH_GENERATE_PARAMETERS,ERR_R_BN_LIB); + ok=0; + } + + if (ctx != NULL) + { + BN_CTX_end(ctx); + BN_CTX_free(ctx); + } + if (!ok && (ret != NULL)) + { + DH_free(ret); + ret=NULL; + } + return(ret); + } + +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/dh/fips_dh_key.c b/lib/libssl/src/fips-1.0/dh/fips_dh_key.c new file mode 100644 index 00000000000..79c10404d5d --- /dev/null +++ b/lib/libssl/src/fips-1.0/dh/fips_dh_key.c @@ -0,0 +1,256 @@ +/* crypto/dh/dh_key.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <openssl/err.h> +#include <openssl/bn.h> +#ifndef OPENSSL_NO_RAND +#include <openssl/rand.h> +#endif +#ifndef OPENSSL_NO_DH +#include <openssl/dh.h> + +#ifdef OPENSSL_FIPS + +static int generate_key(DH *dh); +static int compute_key(unsigned char *key, const BIGNUM *pub_key, DH *dh); +static int dh_bn_mod_exp(const DH *dh, BIGNUM *r, + const BIGNUM *a, const BIGNUM *p, + const BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *m_ctx); +static int dh_init(DH *dh); +static int dh_finish(DH *dh); + +int DH_generate_key(DH *dh) + { + return dh->meth->generate_key(dh); + } + +int DH_compute_key(unsigned char *key, const BIGNUM *pub_key, DH *dh) + { + return dh->meth->compute_key(key, pub_key, dh); + } + +static const DH_METHOD dh_ossl = { +"OpenSSL DH Method", +generate_key, +compute_key, +dh_bn_mod_exp, +dh_init, +dh_finish, +0, +NULL +}; + +const DH_METHOD *DH_OpenSSL(void) +{ + return &dh_ossl; +} + +static int generate_key(DH *dh) + { + int ok=0; + int generate_new_key=0; + unsigned l; + BN_CTX *ctx; + BN_MONT_CTX *mont=NULL; + BIGNUM *pub_key=NULL,*priv_key=NULL; + + ctx = BN_CTX_new(); + if (ctx == NULL) goto err; + + if (dh->priv_key == NULL) + { + priv_key=BN_new(); + if (priv_key == NULL) goto err; + generate_new_key=1; + } + else + priv_key=dh->priv_key; + + if (dh->pub_key == NULL) + { + pub_key=BN_new(); + if (pub_key == NULL) goto err; + } + else + pub_key=dh->pub_key; + + if (dh->flags & DH_FLAG_CACHE_MONT_P) + { + mont = BN_MONT_CTX_set_locked( + (BN_MONT_CTX **)&dh->method_mont_p, + CRYPTO_LOCK_DH, dh->p, ctx); + if (!mont) + goto err; + } + + if (generate_new_key) + { + l = dh->length ? dh->length : BN_num_bits(dh->p)-1; /* secret exponent length */ + if (!BN_rand(priv_key, l, 0, 0)) goto err; + } + + { + BIGNUM local_prk; + BIGNUM *prk; + + if ((dh->flags & DH_FLAG_NO_EXP_CONSTTIME) == 0) + { + BN_init(&local_prk); + prk = &local_prk; + BN_with_flags(prk, priv_key, BN_FLG_EXP_CONSTTIME); + } + else + prk = priv_key; + + if (!dh->meth->bn_mod_exp(dh, pub_key, dh->g, prk, dh->p, ctx, mont)) + goto err; + } + + dh->pub_key=pub_key; + dh->priv_key=priv_key; + ok=1; +err: + if (ok != 1) + DHerr(DH_F_DH_GENERATE_KEY,ERR_R_BN_LIB); + + if ((pub_key != NULL) && (dh->pub_key == NULL)) BN_free(pub_key); + if ((priv_key != NULL) && (dh->priv_key == NULL)) BN_free(priv_key); + BN_CTX_free(ctx); + return(ok); + } + +static int compute_key(unsigned char *key, const BIGNUM *pub_key, DH *dh) + { + BN_CTX *ctx; + BN_MONT_CTX *mont=NULL; + BIGNUM *tmp; + int ret= -1; + + ctx = BN_CTX_new(); + if (ctx == NULL) goto err; + BN_CTX_start(ctx); + tmp = BN_CTX_get(ctx); + + if (dh->priv_key == NULL) + { + DHerr(DH_F_DH_COMPUTE_KEY,DH_R_NO_PRIVATE_VALUE); + goto err; + } + + if (dh->flags & DH_FLAG_CACHE_MONT_P) + { + mont = BN_MONT_CTX_set_locked( + (BN_MONT_CTX **)&dh->method_mont_p, + CRYPTO_LOCK_DH, dh->p, ctx); + if ((dh->flags & DH_FLAG_NO_EXP_CONSTTIME) == 0) + { + /* XXX */ + BN_set_flags(dh->priv_key, BN_FLG_EXP_CONSTTIME); + } + if (!mont) + goto err; + } + + if (!dh->meth->bn_mod_exp(dh, tmp, pub_key, dh->priv_key,dh->p,ctx,mont)) + { + DHerr(DH_F_DH_COMPUTE_KEY,ERR_R_BN_LIB); + goto err; + } + + ret=BN_bn2bin(tmp,key); +err: + BN_CTX_end(ctx); + BN_CTX_free(ctx); + return(ret); + } + +static int dh_bn_mod_exp(const DH *dh, BIGNUM *r, + const BIGNUM *a, const BIGNUM *p, + const BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *m_ctx) + { + /* If a is only one word long and constant time is false, use the faster + * exponenentiation function. + */ + if (a->top == 1 && ((dh->flags & DH_FLAG_NO_EXP_CONSTTIME) != 0)) + { + BN_ULONG A = a->d[0]; + return BN_mod_exp_mont_word(r,A,p,m,ctx,m_ctx); + } + else + return BN_mod_exp_mont(r,a,p,m,ctx,m_ctx); + } + + +static int dh_init(DH *dh) + { + dh->flags |= DH_FLAG_CACHE_MONT_P; + return(1); + } + +static int dh_finish(DH *dh) + { + if(dh->method_mont_p) + BN_MONT_CTX_free((BN_MONT_CTX *)dh->method_mont_p); + return(1); + } + +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/dsa/Makefile b/lib/libssl/src/fips-1.0/dsa/Makefile new file mode 100644 index 00000000000..aeb08b5943f --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/Makefile @@ -0,0 +1,147 @@ +# +# OpenSSL/fips-1.0/dsa/Makefile +# + +DIR= dsa +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST=fips_dsatest.c fips_dssvs.c +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_dsa_ossl.c fips_dsa_gen.c fips_dsa_selftest.c +LIBOBJ=fips_dsa_ossl.o fips_dsa_gen.o fips_dsa_selftest.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +Q=../testvectors/dsa/req +A=../testvectors/dsa/rsp + +fips_test: + -rm -rf $A + mkdir $A + if [ -f $(Q)/PQGGen.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_dssvs pqg < $(Q)/PQGGen.req > $(A)/PQGGen.rsp; fi + if [ -f $(Q)/KeyPair.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_dssvs keypair < $(Q)/KeyPair.req > $(A)/KeyPair.rsp; fi + if [ -f $(Q)/SigGen.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_dssvs siggen < $(Q)/SigGen.req > $(A)/SigGen.rsp; fi + if [ -f $(Q)/SigVer.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_dssvs sigver < $Q/SigVer.req > $A/SigVer.rsp; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_dsa_gen.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_dsa_gen.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_dsa_gen.o: ../../include/openssl/bn.h ../../include/openssl/cast.h +fips_dsa_gen.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_dsa_gen.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_dsa_gen.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_dsa_gen.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_dsa_gen.o: ../../include/openssl/fips.h ../../include/openssl/fips_sha.h +fips_dsa_gen.o: ../../include/openssl/idea.h ../../include/openssl/lhash.h +fips_dsa_gen.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +fips_dsa_gen.o: ../../include/openssl/md5.h ../../include/openssl/mdc2.h +fips_dsa_gen.o: ../../include/openssl/obj_mac.h ../../include/openssl/objects.h +fips_dsa_gen.o: ../../include/openssl/opensslconf.h +fips_dsa_gen.o: ../../include/openssl/opensslv.h +fips_dsa_gen.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_dsa_gen.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_dsa_gen.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_dsa_gen.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_dsa_gen.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_dsa_gen.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_dsa_gen.o: ../../include/openssl/ui_compat.h fips_dsa_gen.c +fips_dsa_ossl.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_dsa_ossl.o: ../../include/openssl/bn.h ../../include/openssl/crypto.h +fips_dsa_ossl.o: ../../include/openssl/dh.h ../../include/openssl/dsa.h +fips_dsa_ossl.o: ../../include/openssl/e_os2.h ../../include/openssl/engine.h +fips_dsa_ossl.o: ../../include/openssl/err.h ../../include/openssl/fips.h +fips_dsa_ossl.o: ../../include/openssl/lhash.h +fips_dsa_ossl.o: ../../include/openssl/opensslconf.h +fips_dsa_ossl.o: ../../include/openssl/opensslv.h +fips_dsa_ossl.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_dsa_ossl.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_dsa_ossl.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_dsa_ossl.o: ../../include/openssl/ui.h fips_dsa_ossl.c +fips_dsa_selftest.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +fips_dsa_selftest.o: ../../include/openssl/crypto.h ../../include/openssl/dh.h +fips_dsa_selftest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_dsa_selftest.o: ../../include/openssl/err.h ../../include/openssl/fips.h +fips_dsa_selftest.o: ../../include/openssl/lhash.h +fips_dsa_selftest.o: ../../include/openssl/opensslconf.h +fips_dsa_selftest.o: ../../include/openssl/opensslv.h +fips_dsa_selftest.o: ../../include/openssl/ossl_typ.h +fips_dsa_selftest.o: ../../include/openssl/safestack.h +fips_dsa_selftest.o: ../../include/openssl/stack.h +fips_dsa_selftest.o: ../../include/openssl/symhacks.h fips_dsa_selftest.c +fips_dsatest.o: ../../e_os.h ../../include/openssl/asn1.h +fips_dsatest.o: ../../include/openssl/bio.h ../../include/openssl/bn.h +fips_dsatest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_dsatest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_dsatest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_dsatest.o: ../../include/openssl/engine.h ../../include/openssl/err.h +fips_dsatest.o: ../../include/openssl/fips.h ../../include/openssl/fips_rand.h +fips_dsatest.o: ../../include/openssl/lhash.h +fips_dsatest.o: ../../include/openssl/opensslconf.h +fips_dsatest.o: ../../include/openssl/opensslv.h +fips_dsatest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_dsatest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_dsatest.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_dsatest.o: ../../include/openssl/ui.h ../../include/openssl/ui_compat.h +fips_dsatest.o: fips_dsatest.c +fips_dssvs.o: ../../include/openssl/opensslconf.h fips_dssvs.c diff --git a/lib/libssl/src/fips-1.0/dsa/fips_dsa_gen.c b/lib/libssl/src/fips-1.0/dsa/fips_dsa_gen.c new file mode 100644 index 00000000000..8ed1de01959 --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/fips_dsa_gen.c @@ -0,0 +1,374 @@ +/* crypto/dsa/dsa_gen.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#undef GENUINE_DSA + +#ifdef GENUINE_DSA +/* Parameter generation follows the original release of FIPS PUB 186, + * Appendix 2.2 (i.e. use SHA as defined in FIPS PUB 180) */ +#define HASH EVP_sha() +#else +/* Parameter generation follows the updated Appendix 2.2 for FIPS PUB 186, + * also Appendix 2.2 of FIPS PUB 186-1 (i.e. use SHA as defined in + * FIPS PUB 180-1) */ +#define HASH EVP_sha1() +#endif + +#include <stdio.h> +#include <string.h> +#include <time.h> +/*#include "cryptlib.h"*/ +#include <openssl/evp.h> +#include <openssl/bn.h> +#ifndef OPENSSL_NO_DSA +#include <openssl/dsa.h> +#endif +#ifndef OPENSSL_NO_RAND +#include <openssl/rand.h> +#endif +#ifndef OPENSSL_NO_SHA +#include <openssl/fips_sha.h> +#endif +#include <openssl/fips.h> +#include <openssl/err.h> + +#ifndef OPENSSL_NO_DSA +#ifdef OPENSSL_FIPS + +static int fips_check_dsa(DSA *dsa) + { + static const unsigned char str1[]="12345678901234567890"; + unsigned char sig[256]; + unsigned int siglen; + + DSA_sign(0, str1, 20, sig, &siglen, dsa); + if(DSA_verify(0, str1, 20, sig, siglen, dsa) != 1) + { + FIPSerr(FIPS_F_FIPS_CHECK_DSA,FIPS_R_PAIRWISE_TEST_FAILED); + return 0; + } + return 1; + } + +DSA *DSA_generate_parameters(FIPS_DSA_SIZE_T bits, + unsigned char *seed_in, FIPS_DSA_SIZE_T seed_len, + int *counter_ret, unsigned long *h_ret, + void (*callback)(int, int, void *), + void *cb_arg) + { + int ok=0; + unsigned char seed[SHA_DIGEST_LENGTH]; + unsigned char md[SHA_DIGEST_LENGTH]; + unsigned char buf[SHA_DIGEST_LENGTH],buf2[SHA_DIGEST_LENGTH]; + BIGNUM *r0,*W,*X,*c,*test; + BIGNUM *g=NULL,*q=NULL,*p=NULL; + BN_MONT_CTX *mont=NULL; + int k,n=0,i,b,m=0; + int counter=0; + int r=0; + BN_CTX *ctx=NULL,*ctx2=NULL,*ctx3=NULL; + unsigned int h=2; + DSA *ret=NULL; + unsigned char *seed_out=seed_in; + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_DSA_GENERATE_PARAMETERS, + FIPS_R_FIPS_SELFTEST_FAILED); + goto err; + } + + if (bits < 512) bits=512; + bits=(bits+63)/64*64; + + if (seed_len < 20) + seed_in = NULL; /* seed buffer too small -- ignore */ + if (seed_len > 20) + seed_len = 20; /* App. 2.2 of FIPS PUB 186 allows larger SEED, + * but our internal buffers are restricted to 160 bits*/ + if ((seed_in != NULL) && (seed_len == 20)) + memcpy(seed,seed_in,seed_len); + + if ((ctx=BN_CTX_new()) == NULL) goto err; + if ((ctx2=BN_CTX_new()) == NULL) goto err; + if ((ctx3=BN_CTX_new()) == NULL) goto err; + if ((ret=DSA_new()) == NULL) goto err; + + if ((mont=BN_MONT_CTX_new()) == NULL) goto err; + + BN_CTX_start(ctx2); + r0 = BN_CTX_get(ctx2); + g = BN_CTX_get(ctx2); + W = BN_CTX_get(ctx2); + q = BN_CTX_get(ctx2); + X = BN_CTX_get(ctx2); + c = BN_CTX_get(ctx2); + p = BN_CTX_get(ctx2); + test = BN_CTX_get(ctx2); + + BN_lshift(test,BN_value_one(),bits-1); + + for (;;) + { + for (;;) /* find q */ + { + int seed_is_random; + + /* step 1 */ + if (callback != NULL) callback(0,m++,cb_arg); + + if (!seed_len) + { + if(RAND_pseudo_bytes(seed,SHA_DIGEST_LENGTH) < 0) + goto err; + seed_is_random = 1; + } + else + { + seed_is_random = 0; + seed_len=0; /* use random seed if 'seed_in' turns out to be bad*/ + } + memcpy(buf,seed,SHA_DIGEST_LENGTH); + memcpy(buf2,seed,SHA_DIGEST_LENGTH); + /* precompute "SEED + 1" for step 7: */ + for (i=SHA_DIGEST_LENGTH-1; i >= 0; i--) + { + buf[i]++; + if (buf[i] != 0) break; + } + + /* step 2 */ + EVP_Digest(seed,SHA_DIGEST_LENGTH,md,NULL,HASH, NULL); + EVP_Digest(buf,SHA_DIGEST_LENGTH,buf2,NULL,HASH, NULL); + for (i=0; i<SHA_DIGEST_LENGTH; i++) + md[i]^=buf2[i]; + + /* step 3 */ + md[0]|=0x80; + md[SHA_DIGEST_LENGTH-1]|=0x01; + if (!BN_bin2bn(md,SHA_DIGEST_LENGTH,q)) goto err; + + /* step 4 */ + r = BN_is_prime_fasttest(q, DSS_prime_checks, callback, ctx3, cb_arg, seed_is_random); + if (r > 0) + break; + if (r != 0) + goto err; + + /* do a callback call */ + /* step 5 */ + } + + if (callback != NULL) callback(2,0,cb_arg); + if (callback != NULL) callback(3,0,cb_arg); + + /* step 6 */ + counter=0; + /* "offset = 2" */ + + n=(bits-1)/160; + b=(bits-1)-n*160; + + for (;;) + { + if (callback != NULL && counter != 0) + callback(0,counter,cb_arg); + + /* step 7 */ + BN_zero(W); + /* now 'buf' contains "SEED + offset - 1" */ + for (k=0; k<=n; k++) + { + /* obtain "SEED + offset + k" by incrementing: */ + for (i=SHA_DIGEST_LENGTH-1; i >= 0; i--) + { + buf[i]++; + if (buf[i] != 0) break; + } + + EVP_Digest(buf,SHA_DIGEST_LENGTH,md,NULL,HASH, NULL); + + /* step 8 */ + if (!BN_bin2bn(md,SHA_DIGEST_LENGTH,r0)) + goto err; + BN_lshift(r0,r0,160*k); + BN_add(W,W,r0); + } + + /* more of step 8 */ + BN_mask_bits(W,bits-1); + BN_copy(X,W); /* this should be ok */ + BN_add(X,X,test); /* this should be ok */ + + /* step 9 */ + BN_lshift1(r0,q); + BN_mod(c,X,r0,ctx); + BN_sub(r0,c,BN_value_one()); + BN_sub(p,X,r0); + + /* step 10 */ + if (BN_cmp(p,test) >= 0) + { + /* step 11 */ + r = BN_is_prime_fasttest(p, DSS_prime_checks, callback, ctx3, cb_arg, 1); + if (r > 0) + goto end; /* found it */ + if (r != 0) + goto err; + } + + /* step 13 */ + counter++; + /* "offset = offset + n + 1" */ + + /* step 14 */ + if (counter >= 4096) break; + } + } +end: + if (callback != NULL) callback(2,1,cb_arg); + + /* We now need to generate g */ + /* Set r0=(p-1)/q */ + BN_sub(test,p,BN_value_one()); + BN_div(r0,NULL,test,q,ctx); + + BN_set_word(test,h); + BN_MONT_CTX_set(mont,p,ctx); + + for (;;) + { + /* g=test^r0%p */ + BN_mod_exp_mont(g,test,r0,p,ctx,mont); + if (!BN_is_one(g)) break; + BN_add(test,test,BN_value_one()); + h++; + } + + if (callback != NULL) callback(3,1,cb_arg); + + ok=1; +err: + if (!ok) + { + if (ret != NULL) DSA_free(ret); + } + else + { + ret->p=BN_dup(p); + ret->q=BN_dup(q); + ret->g=BN_dup(g); + if(seed_out != NULL) memcpy(seed_out,seed,20); + if (counter_ret != NULL) *counter_ret=counter; + if (h_ret != NULL) *h_ret=h; + } + if (ctx != NULL) BN_CTX_free(ctx); + if (ctx2 != NULL) + { + BN_CTX_end(ctx2); + BN_CTX_free(ctx2); + } + if (ctx3 != NULL) BN_CTX_free(ctx3); + if (mont != NULL) BN_MONT_CTX_free(mont); + return(ok?ret:NULL); + } + +int DSA_generate_key(DSA *dsa) + { + int ok=0; + BN_CTX *ctx=NULL; + BIGNUM *pub_key=NULL,*priv_key=NULL; + + if ((ctx=BN_CTX_new()) == NULL) goto err; + + if (dsa->priv_key == NULL) + { + if ((priv_key=BN_new()) == NULL) goto err; + } + else + priv_key=dsa->priv_key; + + do + if (!BN_rand_range(priv_key,dsa->q)) goto err; + while (BN_is_zero(priv_key)); + + if (dsa->pub_key == NULL) + { + if ((pub_key=BN_new()) == NULL) goto err; + } + else + pub_key=dsa->pub_key; + + if (!BN_mod_exp(pub_key,dsa->g,priv_key,dsa->p,ctx)) goto err; + + dsa->priv_key=priv_key; + dsa->pub_key=pub_key; + + if(!fips_check_dsa(dsa)) + goto err; + + ok=1; + +err: + if ((pub_key != NULL) && (dsa->pub_key == NULL)) BN_free(pub_key); + if ((priv_key != NULL) && (dsa->priv_key == NULL)) BN_free(priv_key); + if (ctx != NULL) BN_CTX_free(ctx); + return(ok); + } +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/dsa/fips_dsa_ossl.c b/lib/libssl/src/fips-1.0/dsa/fips_dsa_ossl.c new file mode 100644 index 00000000000..f8f3a39343c --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/fips_dsa_ossl.c @@ -0,0 +1,408 @@ +/* crypto/dsa/dsa_ossl.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +/* Original version from Steven Schoch <schoch@sheba.arc.nasa.gov> */ + +#include <stdio.h> +#include <openssl/bn.h> +#include <openssl/dsa.h> +#include <openssl/rand.h> +#include <openssl/asn1.h> +#ifndef OPENSSL_NO_ENGINE +#include <openssl/engine.h> +#endif +#include <openssl/fips.h> + +#ifdef OPENSSL_FIPS + +static DSA_SIG *dsa_do_sign(const unsigned char *dgst, FIPS_DSA_SIZE_T dlen, DSA *dsa); +static int dsa_sign_setup(DSA *dsa, BN_CTX *ctx_in, BIGNUM **kinvp, BIGNUM **rp); +static int dsa_do_verify(const unsigned char *dgst, FIPS_DSA_SIZE_T dgst_len, DSA_SIG *sig, + DSA *dsa); +static int dsa_init(DSA *dsa); +static int dsa_finish(DSA *dsa); +static int dsa_mod_exp(DSA *dsa, BIGNUM *rr, BIGNUM *a1, BIGNUM *p1, + BIGNUM *a2, BIGNUM *p2, BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *in_mont); +static int dsa_bn_mod_exp(DSA *dsa, BIGNUM *r, BIGNUM *a, const BIGNUM *p, + const BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *m_ctx); + +static const DSA_METHOD openssl_dsa_meth = { +"OpenSSL FIPS DSA method", +dsa_do_sign, +dsa_sign_setup, +dsa_do_verify, +dsa_mod_exp, +dsa_bn_mod_exp, +dsa_init, +dsa_finish, +0, +NULL +}; + +int FIPS_dsa_check(struct dsa_st *dsa) + { + if(dsa->meth != &openssl_dsa_meth || dsa->meth->dsa_do_sign != dsa_do_sign + || dsa->meth->dsa_sign_setup != dsa_sign_setup + || dsa->meth->dsa_mod_exp != dsa_mod_exp + || dsa->meth->bn_mod_exp != dsa_bn_mod_exp + || dsa->meth->init != dsa_init + || dsa->meth->finish != dsa_finish) + { + FIPSerr(FIPS_F_FIPS_DSA_CHECK,FIPS_R_NON_FIPS_METHOD); + return 0; + } + return 1; + } + +const DSA_METHOD *DSA_OpenSSL(void) +{ + return &openssl_dsa_meth; +} + +static DSA_SIG *dsa_do_sign(const unsigned char *dgst, FIPS_DSA_SIZE_T dlen, DSA *dsa) + { + BIGNUM *kinv=NULL,*r=NULL,*s=NULL; + BIGNUM m; + BIGNUM xr; + BN_CTX *ctx=NULL; + int i,reason=ERR_R_BN_LIB; + DSA_SIG *ret=NULL; + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_DSA_DO_SIGN,FIPS_R_FIPS_SELFTEST_FAILED); + return NULL; + } + + BN_init(&m); + BN_init(&xr); + + if (!dsa->p || !dsa->q || !dsa->g) + { + reason=DSA_R_MISSING_PARAMETERS; + goto err; + } + + s=BN_new(); + if (s == NULL) goto err; + + i=BN_num_bytes(dsa->q); /* should be 20 */ + if ((dlen > i) || (dlen > 50)) + { + reason=DSA_R_DATA_TOO_LARGE_FOR_KEY_SIZE; + goto err; + } + + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + + if (!DSA_sign_setup(dsa,ctx,&kinv,&r)) goto err; + + if (BN_bin2bn(dgst,dlen,&m) == NULL) goto err; + + /* Compute s = inv(k) (m + xr) mod q */ + if (!BN_mod_mul(&xr,dsa->priv_key,r,dsa->q,ctx)) goto err;/* s = xr */ + if (!BN_add(s, &xr, &m)) goto err; /* s = m + xr */ + if (BN_cmp(s,dsa->q) > 0) + BN_sub(s,s,dsa->q); + if (!BN_mod_mul(s,s,kinv,dsa->q,ctx)) goto err; + + ret=DSA_SIG_new(); + if (ret == NULL) goto err; + ret->r = r; + ret->s = s; + +err: + if (!ret) + { + DSAerr(DSA_F_DSA_DO_SIGN,reason); + BN_free(r); + BN_free(s); + } + if (ctx != NULL) BN_CTX_free(ctx); + BN_clear_free(&m); + BN_clear_free(&xr); + if (kinv != NULL) /* dsa->kinv is NULL now if we used it */ + BN_clear_free(kinv); + return(ret); + } + +static int dsa_sign_setup(DSA *dsa, BN_CTX *ctx_in, BIGNUM **kinvp, BIGNUM **rp) + { + BN_CTX *ctx; + BIGNUM k,kq,*K,*kinv=NULL,*r=NULL; + int ret=0; + + if (!dsa->p || !dsa->q || !dsa->g) + { + DSAerr(DSA_F_DSA_SIGN_SETUP,DSA_R_MISSING_PARAMETERS); + return 0; + } + + BN_init(&k); + BN_init(&kq); + + if (ctx_in == NULL) + { + if ((ctx=BN_CTX_new()) == NULL) goto err; + } + else + ctx=ctx_in; + + if ((r=BN_new()) == NULL) goto err; + + /* Get random k */ + do + if (!BN_rand_range(&k, dsa->q)) goto err; + while (BN_is_zero(&k)); + if ((dsa->flags & DSA_FLAG_NO_EXP_CONSTTIME) == 0) + { + BN_set_flags(&k, BN_FLG_EXP_CONSTTIME); + } + + if (dsa->flags & DSA_FLAG_CACHE_MONT_P) + { + if (!BN_MONT_CTX_set_locked((BN_MONT_CTX **)&dsa->method_mont_p, + CRYPTO_LOCK_DSA, + dsa->p, ctx)) + goto err; + } + + /* Compute r = (g^k mod p) mod q */ + + if ((dsa->flags & DSA_FLAG_NO_EXP_CONSTTIME) == 0) + { + if (!BN_copy(&kq, &k)) goto err; + + /* We do not want timing information to leak the length of k, + * so we compute g^k using an equivalent exponent of fixed length. + * + * (This is a kludge that we need because the BN_mod_exp_mont() + * does not let us specify the desired timing behaviour.) */ + + if (!BN_add(&kq, &kq, dsa->q)) goto err; + if (BN_num_bits(&kq) <= BN_num_bits(dsa->q)) + { + if (!BN_add(&kq, &kq, dsa->q)) goto err; + } + + K = &kq; + } + else + { + K = &k; + } + if (!dsa->meth->bn_mod_exp(dsa, r,dsa->g,K,dsa->p,ctx, + (BN_MONT_CTX *)dsa->method_mont_p)) goto err; + if (!BN_mod(r,r,dsa->q,ctx)) goto err; + + /* Compute part of 's = inv(k) (m + xr) mod q' */ + if ((kinv=BN_mod_inverse(NULL,&k,dsa->q,ctx)) == NULL) goto err; + + if (*kinvp != NULL) BN_clear_free(*kinvp); + *kinvp=kinv; + kinv=NULL; + if (*rp != NULL) BN_clear_free(*rp); + *rp=r; + ret=1; +err: + if (!ret) + { + DSAerr(DSA_F_DSA_SIGN_SETUP,ERR_R_BN_LIB); + if (kinv != NULL) BN_clear_free(kinv); + if (r != NULL) BN_clear_free(r); + } + if (ctx_in == NULL) BN_CTX_free(ctx); + if (kinv != NULL) BN_clear_free(kinv); + BN_clear_free(&k); + BN_clear_free(&kq); + return(ret); + } + +static int dsa_do_verify(const unsigned char *dgst, FIPS_DSA_SIZE_T dgst_len, DSA_SIG *sig, + DSA *dsa) + { + BN_CTX *ctx; + BIGNUM u1,u2,t1; + BN_MONT_CTX *mont=NULL; + int ret = -1; + + if (!dsa->p || !dsa->q || !dsa->g) + { + DSAerr(DSA_F_DSA_DO_VERIFY,DSA_R_MISSING_PARAMETERS); + return -1; + } + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_DSA_DO_VERIFY,FIPS_R_FIPS_SELFTEST_FAILED); + return -1; + } + + BN_init(&u1); + BN_init(&u2); + BN_init(&t1); + + if ((ctx=BN_CTX_new()) == NULL) goto err; + + if (BN_is_zero(sig->r) || sig->r->neg || BN_ucmp(sig->r, dsa->q) >= 0) + { + ret = 0; + goto err; + } + if (BN_is_zero(sig->s) || sig->s->neg || BN_ucmp(sig->s, dsa->q) >= 0) + { + ret = 0; + goto err; + } + + /* Calculate W = inv(S) mod Q + * save W in u2 */ + if ((BN_mod_inverse(&u2,sig->s,dsa->q,ctx)) == NULL) goto err; + + /* save M in u1 */ + if (BN_bin2bn(dgst,dgst_len,&u1) == NULL) goto err; + + /* u1 = M * w mod q */ + if (!BN_mod_mul(&u1,&u1,&u2,dsa->q,ctx)) goto err; + + /* u2 = r * w mod q */ + if (!BN_mod_mul(&u2,sig->r,&u2,dsa->q,ctx)) goto err; + + + if (dsa->flags & DSA_FLAG_CACHE_MONT_P) + { + mont = BN_MONT_CTX_set_locked( + (BN_MONT_CTX **)&dsa->method_mont_p, + CRYPTO_LOCK_DSA, dsa->p, ctx); + if (!mont) + goto err; + } + +#if 0 + { + BIGNUM t2; + + BN_init(&t2); + /* v = ( g^u1 * y^u2 mod p ) mod q */ + /* let t1 = g ^ u1 mod p */ + if (!BN_mod_exp_mont(&t1,dsa->g,&u1,dsa->p,ctx,mont)) goto err; + /* let t2 = y ^ u2 mod p */ + if (!BN_mod_exp_mont(&t2,dsa->pub_key,&u2,dsa->p,ctx,mont)) goto err; + /* let u1 = t1 * t2 mod p */ + if (!BN_mod_mul(&u1,&t1,&t2,dsa->p,ctx)) goto err_bn; + BN_free(&t2); + } + /* let u1 = u1 mod q */ + if (!BN_mod(&u1,&u1,dsa->q,ctx)) goto err; +#else + { + if (!dsa->meth->dsa_mod_exp(dsa, &t1,dsa->g,&u1,dsa->pub_key,&u2, + dsa->p,ctx,mont)) goto err; + /* BN_copy(&u1,&t1); */ + /* let u1 = u1 mod q */ + if (!BN_mod(&u1,&t1,dsa->q,ctx)) goto err; + } +#endif + /* V is now in u1. If the signature is correct, it will be + * equal to R. */ + ret=(BN_ucmp(&u1, sig->r) == 0); + + err: + if (ret != 1) DSAerr(DSA_F_DSA_DO_VERIFY,ERR_R_BN_LIB); + if (ctx != NULL) BN_CTX_free(ctx); + BN_free(&u1); + BN_free(&u2); + BN_free(&t1); + return(ret); + } + +static int dsa_init(DSA *dsa) +{ + dsa->flags|=DSA_FLAG_CACHE_MONT_P; + return(1); +} + +static int dsa_finish(DSA *dsa) +{ + if(dsa->method_mont_p) + BN_MONT_CTX_free((BN_MONT_CTX *)dsa->method_mont_p); + return(1); +} + +static int dsa_mod_exp(DSA *dsa, BIGNUM *rr, BIGNUM *a1, BIGNUM *p1, + BIGNUM *a2, BIGNUM *p2, BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *in_mont) +{ + return BN_mod_exp2_mont(rr, a1, p1, a2, p2, m, ctx, in_mont); +} + +static int dsa_bn_mod_exp(DSA *dsa, BIGNUM *r, BIGNUM *a, const BIGNUM *p, + const BIGNUM *m, BN_CTX *ctx, + BN_MONT_CTX *m_ctx) +{ + return BN_mod_exp_mont(r, a, p, m, ctx, m_ctx); +} + +#else /* ndef OPENSSL_FIPS */ + +static void *dummy=&dummy; + +#endif /* ndef OPENSSL_FIPS */ diff --git a/lib/libssl/src/fips-1.0/dsa/fips_dsa_selftest.c b/lib/libssl/src/fips-1.0/dsa/fips_dsa_selftest.c new file mode 100644 index 00000000000..795fda9587d --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/fips_dsa_selftest.c @@ -0,0 +1,168 @@ +/* crypto/dsa/dsatest.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <string.h> +#include <openssl/crypto.h> +#include <openssl/dsa.h> +#include <openssl/fips.h> +#include <openssl/err.h> + +#ifdef OPENSSL_FIPS + +/* seed, out_p, out_q, out_g are taken from the updated Appendix 5 to + * FIPS PUB 186 and also appear in Appendix 5 to FIPS PIB 186-1 */ +static unsigned char seed[20]={ + 0xd5,0x01,0x4e,0x4b,0x60,0xef,0x2b,0xa8,0xb6,0x21,0x1b,0x40, + 0x62,0xba,0x32,0x24,0xe0,0x42,0x7d,0xd3, + }; + +static const unsigned char out_p[]={ + 0x8d,0xf2,0xa4,0x94,0x49,0x22,0x76,0xaa, + 0x3d,0x25,0x75,0x9b,0xb0,0x68,0x69,0xcb, + 0xea,0xc0,0xd8,0x3a,0xfb,0x8d,0x0c,0xf7, + 0xcb,0xb8,0x32,0x4f,0x0d,0x78,0x82,0xe5, + 0xd0,0x76,0x2f,0xc5,0xb7,0x21,0x0e,0xaf, + 0xc2,0xe9,0xad,0xac,0x32,0xab,0x7a,0xac, + 0x49,0x69,0x3d,0xfb,0xf8,0x37,0x24,0xc2, + 0xec,0x07,0x36,0xee,0x31,0xc8,0x02,0x91, + }; + +static const unsigned char out_q[]={ + 0xc7,0x73,0x21,0x8c,0x73,0x7e,0xc8,0xee, + 0x99,0x3b,0x4f,0x2d,0xed,0x30,0xf4,0x8e, + 0xda,0xce,0x91,0x5f, + }; + +static const unsigned char out_g[]={ + 0x62,0x6d,0x02,0x78,0x39,0xea,0x0a,0x13, + 0x41,0x31,0x63,0xa5,0x5b,0x4c,0xb5,0x00, + 0x29,0x9d,0x55,0x22,0x95,0x6c,0xef,0xcb, + 0x3b,0xff,0x10,0xf3,0x99,0xce,0x2c,0x2e, + 0x71,0xcb,0x9d,0xe5,0xfa,0x24,0xba,0xbf, + 0x58,0xe5,0xb7,0x95,0x21,0x92,0x5c,0x9c, + 0xc4,0x2e,0x9f,0x6f,0x46,0x4b,0x08,0x8c, + 0xc5,0x72,0xaf,0x53,0xe6,0xd7,0x88,0x02, + }; + +static const unsigned char str1[]="12345678901234567890"; + +void FIPS_corrupt_dsa() + { + ++seed[0]; + } + +int FIPS_selftest_dsa() + { + DSA *dsa=NULL; + int counter,i,j; + unsigned char buf[256]; + unsigned long h; + unsigned char sig[256]; + unsigned int siglen; + + dsa=DSA_generate_parameters(512,seed,20,&counter,&h,NULL,NULL); + + if(dsa == NULL) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + if (counter != 105) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + if (h != 2) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + i=BN_bn2bin(dsa->q,buf); + j=sizeof(out_q); + if (i != j || memcmp(buf,out_q,i) != 0) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + + i=BN_bn2bin(dsa->p,buf); + j=sizeof(out_p); + if (i != j || memcmp(buf,out_p,i) != 0) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + + i=BN_bn2bin(dsa->g,buf); + j=sizeof(out_g); + if (i != j || memcmp(buf,out_g,i) != 0) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + DSA_generate_key(dsa); + DSA_sign(0, str1, 20, sig, &siglen, dsa); + if(DSA_verify(0, str1, 20, sig, siglen, dsa) != 1) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_DSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + DSA_free(dsa); + return 1; + } +#endif diff --git a/lib/libssl/src/fips-1.0/dsa/fips_dsatest.c b/lib/libssl/src/fips-1.0/dsa/fips_dsatest.c new file mode 100644 index 00000000000..5970b201e9e --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/fips_dsatest.c @@ -0,0 +1,257 @@ +/* crypto/dsa/dsatest.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <sys/types.h> +#include <sys/stat.h> + +#include "e_os.h" + +#include <openssl/crypto.h> +#include <openssl/rand.h> +#include <openssl/bio.h> +#include <openssl/err.h> +#ifndef OPENSSL_NO_ENGINE +#include <openssl/engine.h> +#endif +#include <openssl/fips.h> +#include <openssl/fips_rand.h> + +#if defined(OPENSSL_NO_DSA) || !defined(OPENSSL_FIPS) +int main(int argc, char *argv[]) +{ + printf("No FIPS DSA support\n"); + return(0); +} +#else +#include <openssl/dsa.h> + +#ifdef OPENSSL_SYS_WIN16 +#define MS_CALLBACK _far _loadds +#else +#define MS_CALLBACK +#endif + +static void MS_CALLBACK dsa_cb(int p, int n, void *arg); + +/* seed, out_p, out_q, out_g are taken from the updated Appendix 5 to + * FIPS PUB 186 and also appear in Appendix 5 to FIPS PIB 186-1 */ +static unsigned char seed[20]={ + 0xd5,0x01,0x4e,0x4b,0x60,0xef,0x2b,0xa8,0xb6,0x21,0x1b,0x40, + 0x62,0xba,0x32,0x24,0xe0,0x42,0x7d,0xd3, + }; + +static unsigned char out_p[]={ + 0x8d,0xf2,0xa4,0x94,0x49,0x22,0x76,0xaa, + 0x3d,0x25,0x75,0x9b,0xb0,0x68,0x69,0xcb, + 0xea,0xc0,0xd8,0x3a,0xfb,0x8d,0x0c,0xf7, + 0xcb,0xb8,0x32,0x4f,0x0d,0x78,0x82,0xe5, + 0xd0,0x76,0x2f,0xc5,0xb7,0x21,0x0e,0xaf, + 0xc2,0xe9,0xad,0xac,0x32,0xab,0x7a,0xac, + 0x49,0x69,0x3d,0xfb,0xf8,0x37,0x24,0xc2, + 0xec,0x07,0x36,0xee,0x31,0xc8,0x02,0x91, + }; + +static unsigned char out_q[]={ + 0xc7,0x73,0x21,0x8c,0x73,0x7e,0xc8,0xee, + 0x99,0x3b,0x4f,0x2d,0xed,0x30,0xf4,0x8e, + 0xda,0xce,0x91,0x5f, + }; + +static unsigned char out_g[]={ + 0x62,0x6d,0x02,0x78,0x39,0xea,0x0a,0x13, + 0x41,0x31,0x63,0xa5,0x5b,0x4c,0xb5,0x00, + 0x29,0x9d,0x55,0x22,0x95,0x6c,0xef,0xcb, + 0x3b,0xff,0x10,0xf3,0x99,0xce,0x2c,0x2e, + 0x71,0xcb,0x9d,0xe5,0xfa,0x24,0xba,0xbf, + 0x58,0xe5,0xb7,0x95,0x21,0x92,0x5c,0x9c, + 0xc4,0x2e,0x9f,0x6f,0x46,0x4b,0x08,0x8c, + 0xc5,0x72,0xaf,0x53,0xe6,0xd7,0x88,0x02, + }; + +static const unsigned char str1[]="12345678901234567890"; + +static const char rnd_seed[] = "string to make the random number generator think it has entropy"; +static const unsigned char rnd_key1[]="12345678"; +static const unsigned char rnd_key2[]="abcdefgh"; + +static BIO *bio_err=NULL; + +int main(int argc, char **argv) + { + DSA *dsa=NULL; + int counter,ret=0,i,j; + unsigned char buf[256]; + unsigned long h; + unsigned char sig[256]; + unsigned int siglen; + + if (bio_err == NULL) + bio_err=BIO_new_fp(stderr,BIO_NOCLOSE); + +#ifdef OPENSSL_FIPS + if(!FIPS_mode_set(1)) + { + ERR_print_errors(bio_err); + EXIT(1); + } +#endif + CRYPTO_malloc_debug_init(); + CRYPTO_dbg_set_options(V_CRYPTO_MDEBUG_ALL); + CRYPTO_mem_ctrl(CRYPTO_MEM_CHECK_ON); + + ERR_load_crypto_strings(); + FIPS_set_prng_key(rnd_key1,rnd_key2); + RAND_seed(rnd_seed, sizeof rnd_seed); + + BIO_printf(bio_err,"test generation of DSA parameters\n"); + + dsa=DSA_generate_parameters(512,seed,20,&counter,&h,dsa_cb,bio_err); + + BIO_printf(bio_err,"seed\n"); + for (i=0; i<20; i+=4) + { + BIO_printf(bio_err,"%02X%02X%02X%02X ", + seed[i],seed[i+1],seed[i+2],seed[i+3]); + } + BIO_printf(bio_err,"\ncounter=%d h=%d\n",counter,h); + + if (dsa == NULL) goto end; + DSA_print(bio_err,dsa,0); + if (counter != 105) + { + BIO_printf(bio_err,"counter should be 105\n"); + goto end; + } + if (h != 2) + { + BIO_printf(bio_err,"h should be 2\n"); + goto end; + } + + i=BN_bn2bin(dsa->q,buf); + j=sizeof(out_q); + if ((i != j) || (memcmp(buf,out_q,i) != 0)) + { + BIO_printf(bio_err,"q value is wrong\n"); + goto end; + } + + i=BN_bn2bin(dsa->p,buf); + j=sizeof(out_p); + if ((i != j) || (memcmp(buf,out_p,i) != 0)) + { + BIO_printf(bio_err,"p value is wrong\n"); + goto end; + } + + i=BN_bn2bin(dsa->g,buf); + j=sizeof(out_g); + if ((i != j) || (memcmp(buf,out_g,i) != 0)) + { + BIO_printf(bio_err,"g value is wrong\n"); + goto end; + } + DSA_generate_key(dsa); + DSA_sign(0, str1, 20, sig, &siglen, dsa); + if (DSA_verify(0, str1, 20, sig, siglen, dsa) == 1) + ret=1; +end: + if (!ret) + ERR_print_errors(bio_err); + if (dsa != NULL) DSA_free(dsa); + CRYPTO_cleanup_all_ex_data(); + ERR_remove_state(0); + ERR_free_strings(); + CRYPTO_mem_leaks(bio_err); + if (bio_err != NULL) + { + BIO_free(bio_err); + bio_err = NULL; + } + EXIT(!ret); + return(!ret); + } + +static int cb_exit(int ec) + { + EXIT(ec); + return(0); /* To keep some compilers quiet */ + } + +static void MS_CALLBACK dsa_cb(int p, int n, void *arg) + { + char c='*'; + static int ok=0,num=0; + + if (p == 0) { c='.'; num++; }; + if (p == 1) c='+'; + if (p == 2) { c='*'; ok++; } + if (p == 3) c='\n'; + BIO_write(arg,&c,1); + (void)BIO_flush(arg); + + if (!ok && (p == 0) && (num > 1)) + { + BIO_printf((BIO *)arg,"error in dsatest\n"); + cb_exit(1); + } + } +#endif diff --git a/lib/libssl/src/fips-1.0/dsa/fips_dssvs.c b/lib/libssl/src/fips-1.0/dsa/fips_dssvs.c new file mode 100644 index 00000000000..560d6359810 --- /dev/null +++ b/lib/libssl/src/fips-1.0/dsa/fips_dssvs.c @@ -0,0 +1,319 @@ +#include <openssl/opensslconf.h> + +#ifndef OPENSSL_FIPS +#include <stdio.h> + +int main() +{ + printf("No FIPS DSA support\n"); + return(0); +} +#else + +#include <openssl/bn.h> +#include <openssl/dsa.h> +#include <openssl/fips.h> +#include <openssl/err.h> +#include <openssl/fips_sha.h> +#include <string.h> + +int hex2bin(const char *in, unsigned char *out) + { + int n1, n2; + unsigned char ch; + + for (n1=0,n2=0 ; in[n1] && in[n1] != '\n' ; ) + { /* first byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + if(!in[n1]) + { + out[n2++]=ch; + break; + } + out[n2] = ch << 4; + /* second byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + out[n2++] |= ch; + } + return n2; + } + +BIGNUM *hex2bn(const char *in) + { + BIGNUM *p=BN_new(); + + BN_hex2bn(&p,in); + + return p; + } + +int bin2hex(const unsigned char *in,int len,char *out) + { + int n1, n2; + unsigned char ch; + + for (n1=0,n2=0 ; n1 < len ; ++n1) + { + ch=in[n1] >> 4; + if (ch <= 0x09) + out[n2++]=ch+'0'; + else + out[n2++]=ch-10+'a'; + ch=in[n1] & 0x0f; + if(ch <= 0x09) + out[n2++]=ch+'0'; + else + out[n2++]=ch-10+'a'; + } + out[n2]='\0'; + return n2; + } + +void pv(const char *tag,const unsigned char *val,int len) + { + char obuf[2048]; + + bin2hex(val,len,obuf); + printf("%s = %s\n",tag,obuf); + } + +void pbn(const char *tag,const BIGNUM *val) + { + printf("%s = %s\n",tag,BN_bn2hex(val)); + } + +void primes() + { + char buf[10240]; + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + fputs(buf,stdout); + if(!strncmp(buf,"Prime= ",7)) + { + BIGNUM *pp; + + pp=BN_new(); + BN_hex2bn(&pp,buf+7); + printf("result= %c\n", + BN_is_prime(pp,20,NULL,NULL,NULL) ? 'P' : 'F'); + } + } + } + +void pqg() + { + char buf[1024]; + int nmod=0; + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"[mod = ",7)) + nmod=atoi(buf+7); + else if(!strncmp(buf,"N = ",4)) + { + int n=atoi(buf+4); + + printf("[mod = %d]\n\n",nmod); + + while(n--) + { + unsigned char seed[20]; + DSA *dsa; + int counter; + unsigned long h; + + dsa=DSA_generate_parameters(nmod,seed,0,&counter,&h,NULL,NULL); + printf("P = %s\n",BN_bn2hex(dsa->p)); + printf("Q = %s\n",BN_bn2hex(dsa->q)); + printf("G = %s\n",BN_bn2hex(dsa->g)); + pv("Seed",seed,20); + printf("c = %d\n",counter); + printf("H = %lx\n",h); + putc('\n',stdout); + } + } + else + fputs(buf,stdout); + } + } + +void keypair() + { + char buf[1024]; + int nmod=0; + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"[mod = ",7)) + nmod=atoi(buf+7); + else if(!strncmp(buf,"N = ",4)) + { + DSA *dsa; + int n=atoi(buf+4); + + printf("[mod = %d]\n\n",nmod); + + dsa=DSA_generate_parameters(nmod,NULL,0,NULL,NULL,NULL,NULL); + pbn("P",dsa->p); + pbn("Q",dsa->q); + pbn("G",dsa->g); + putc('\n',stdout); + + while(n--) + { + DSA_generate_key(dsa); + + pbn("X",dsa->priv_key); + pbn("Y",dsa->pub_key); + putc('\n',stdout); + } + } + } + } + +void siggen() + { + char buf[1024]; + int nmod=0; + DSA *dsa=NULL; + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"[mod = ",7)) + { + nmod=atoi(buf+7); + printf("[mod = %d]\n\n",nmod); + + dsa=DSA_generate_parameters(nmod,NULL,0,NULL,NULL,NULL,NULL); + pbn("P",dsa->p); + pbn("Q",dsa->q); + pbn("G",dsa->g); + putc('\n',stdout); + } + else if(!strncmp(buf,"Msg = ",6)) + { + unsigned char msg[1024]; + unsigned char hash[20]; + int n; + DSA_SIG *sig; + + n=hex2bin(buf+6,msg); + pv("Msg",msg,n); + + DSA_generate_key(dsa); + pbn("Y",dsa->pub_key); + + SHA1(msg,n,hash); + sig=DSA_do_sign(hash,sizeof hash,dsa); + pbn("R",sig->r); + pbn("S",sig->s); + putc('\n',stdout); + } + } + } + +void sigver() + { + DSA *dsa=NULL; + char buf[1024]; + int nmod=0; + unsigned char hash[20]; + DSA_SIG *sig=DSA_SIG_new(); + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"[mod = ",7)) + { + nmod=atoi(buf+7); + if(dsa) + DSA_free(dsa); + dsa=DSA_new(); + } + else if(!strncmp(buf,"P = ",4)) + dsa->p=hex2bn(buf+4); + else if(!strncmp(buf,"Q = ",4)) + dsa->q=hex2bn(buf+4); + else if(!strncmp(buf,"G = ",4)) + { + dsa->g=hex2bn(buf+4); + + printf("[mod = %d]\n\n",nmod); + pbn("P",dsa->p); + pbn("Q",dsa->q); + pbn("G",dsa->g); + putc('\n',stdout); + } + else if(!strncmp(buf,"Msg = ",6)) + { + unsigned char msg[1024]; + int n; + + n=hex2bin(buf+6,msg); + pv("Msg",msg,n); + SHA1(msg,n,hash); + } + else if(!strncmp(buf,"Y = ",4)) + dsa->pub_key=hex2bn(buf+4); + else if(!strncmp(buf,"R = ",4)) + sig->r=hex2bn(buf+4); + else if(!strncmp(buf,"S = ",4)) + { + sig->s=hex2bn(buf+4); + + pbn("Y",dsa->pub_key); + pbn("R",sig->r); + pbn("S",sig->s); + printf("Result = %c\n",DSA_do_verify(hash,sizeof hash,sig,dsa) + ? 'P' : 'F'); + putc('\n',stdout); + } + } + } + +int main(int argc,char **argv) + { + if(argc != 2) + { + fprintf(stderr,"%s [prime|pqg]\n",argv[0]); + exit(1); + } + if(!FIPS_mode_set(1)) + { + ERR_load_crypto_strings(); + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + exit(1); + } + if(!strcmp(argv[1],"prime")) + primes(); + else if(!strcmp(argv[1],"pqg")) + pqg(); + else if(!strcmp(argv[1],"keypair")) + keypair(); + else if(!strcmp(argv[1],"siggen")) + siggen(); + else if(!strcmp(argv[1],"sigver")) + sigver(); + else + { + fprintf(stderr,"Don't know how to %s.\n",argv[1]); + exit(1); + } + + return 0; + } +#endif diff --git a/lib/libssl/src/fips-1.0/fips-lib.com b/lib/libssl/src/fips-1.0/fips-lib.com new file mode 100644 index 00000000000..539117b2ed8 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips-lib.com @@ -0,0 +1,1196 @@ +$! +$! FIPS-LIB.COM +$! Written By: Robert Byer +$! Vice-President +$! A-Com Computing, Inc. +$! byer@mail.all-net.net +$! +$! Changes by Richard Levitte <richard@levitte.org> +$! +$! This command files compiles and creates the FIPS parts of the +$! "[.xxx.EXE.CRYPTO]LIBCRYPTO.OLB" library for OpenSSL. The "xxx" +$! denotes the machine architecture of AXP or VAX. +$! +$! It was re-written so it would try to determine what "C" compiler to use +$! or you can specify which "C" compiler to use. +$! +$! Specify the following as P1 to build just that part or ALL to just +$! build everything. +$! +$! LIBRARY To just compile the [.xxx.EXE.CRYPTO]LIBCRYPTO.OLB Library. +$! APPS To just compile the [.xxx.EXE.CRYPTO]*.EXE +$! ALL To do both LIBRARY and APPS +$! +$! Specify DEBUG or NODEBUG as P2 to compile with or without debugger +$! information. +$! +$! Specify which compiler at P3 to try to compile under. +$! +$! VAXC For VAX C. +$! DECC For DEC C. +$! GNUC For GNU C. +$! +$! If you don't speficy a compiler, it will try to determine which +$! "C" compiler to use. +$! +$! P4, if defined, sets a TCP/IP library to use, through one of the following +$! keywords: +$! +$! UCX for UCX +$! TCPIP for TCPIP (post UCX) +$! SOCKETSHR for SOCKETSHR+NETLIB +$! +$! P5, if defined, sets a compiler thread NOT needed on OpenVMS 7.1 (and up) +$! +$! P6, if defined, sets a choice of crypto methods to compile. +$! WARNING: this should only be done to recompile some part of an already +$! fully compiled library. +$! +$! +$! Define A TCP/IP Library That We Will Need To Link To. +$! (That Is, If We Need To Link To One.) +$! +$ TCPIP_LIB = "" +$! +$! Check Which Architecture We Are Using. +$! +$ IF (F$GETSYI("CPU").GE.128) +$ THEN +$! +$! The Architecture Is AXP +$! +$ ARCH := AXP +$! +$! Else... +$! +$ ELSE +$! +$! The Architecture Is VAX. +$! +$ ARCH := VAX +$! +$! End The Architecture Check. +$! +$ ENDIF +$! +$! Define The Different Encryption Types. +$! +$ ENCRYPT_TYPES = "Basic,SHA,RAND,DES,AES,DSA,RSA,DH,HMAC" +$! +$! Check To Make Sure We Have Valid Command Line Parameters. +$! +$ GOSUB CHECK_OPTIONS +$! +$! Initialise logical names and such +$! +$ GOSUB INITIALISE +$! +$! Tell The User What Kind of Machine We Run On. +$! +$ WRITE SYS$OUTPUT "Compiling On A ",ARCH," Machine." +$! +$! Define The OBJ Directory. +$! +$ OBJ_DIR := SYS$DISK:[-.'ARCH'.OBJ.CRYPTO] +$! +$! Check To See If The Architecture Specific OBJ Directory Exists. +$! +$ IF (F$PARSE(OBJ_DIR).EQS."") +$ THEN +$! +$! It Dosen't Exist, So Create It. +$! +$ CREATE/DIR 'OBJ_DIR' +$! +$! End The Architecture Specific OBJ Directory Check. +$! +$ ENDIF +$! +$! Define The EXE Directory. +$! +$ EXE_DIR := SYS$DISK:[-.'ARCH'.EXE.CRYPTO] +$! +$! Check To See If The Architecture Specific Directory Exists. +$! +$ IF (F$PARSE(EXE_DIR).EQS."") +$ THEN +$! +$! It Dosen't Exist, So Create It. +$! +$ CREATE/DIRECTORY 'EXE_DIR' +$! +$! End The Architecture Specific Directory Check. +$! +$ ENDIF +$! +$! Define The Library Name. +$! +$ LIB_NAME := 'EXE_DIR'LIBCRYPTO.OLB +$! +$! Define The CRYPTO-LIB We Are To Use. +$! +$ CRYPTO_LIB := 'EXE_DIR'LIBCRYPTO.OLB +$! +$! Check To See If We Already Have A "[.xxx.EXE.CRYPTO]LIBCRYPTO.OLB" Library... +$! +$ IF (F$SEARCH(LIB_NAME).EQS."") +$ THEN +$! +$! Guess Not, Create The Library. +$! +$ LIBRARY/CREATE/OBJECT 'LIB_NAME' +$! +$! End The Library Check. +$! +$ ENDIF +$! +$! Build our options file for the application +$! +$ GOSUB CHECK_OPT_FILE +$! +$! Define The Different Encryption "library" Strings. +$! +$ LIB_ = "fips,fips_err_wrapper" +$ LIB_SHA = "fips_sha1dgst,fips_sha1_selftest,fips_sha256,fips_sha512" +$ LIB_RAND = "fips_rand,fips_rand_selftest" +$ LIB_DES = "fips_des_enc,fips_des_selftest,fips_set_key" +$ LIB_AES = "fips_aes_core,fips_aes_selftest" +$ LIB_DSA = "fips_dsa_ossl,fips_dsa_gen,fips_dsa_selftest" +$ LIB_RSA = "fips_rsa_eay,fips_rsa_gen,fips_rsa_selftest,fips_rsa_x931g" +$ LIB_DH = "fips_dh_check,fips_dh_gen,fips_dh_key" +$ LIB_HMAC = "fips_hmac,fips_hmac_selftest" +$! +$! Setup exceptional compilations +$! +$ ! Add definitions for no threads on OpenVMS 7.1 and higher +$ COMPILEWITH_CC3 = ",bss_rtcp," +$ ! Disable the DOLLARID warning +$ COMPILEWITH_CC4 = ",a_utctm,bss_log,o_time," +$ ! Disable disjoint optimization +$ COMPILEWITH_CC5 = ",md2_dgst,md4_dgst,md5_dgst,mdc2dgst," + - + "sha_dgst,sha1dgst,rmd_dgst,bf_enc," +$ ! Disable the MIXLINKAGE warning +$ COMPILEWITH_CC6 = ",fips_set_key," +$! +$! Figure Out What Other Modules We Are To Build. +$! +$ BUILD_SET: +$! +$! Define A Module Counter. +$! +$ MODULE_COUNTER = 0 +$! +$! Top Of The Loop. +$! +$ MODULE_NEXT: +$! +$! Extract The Module Name From The Encryption List. +$! +$ MODULE_NAME = F$ELEMENT(MODULE_COUNTER,",",ENCRYPT_TYPES) +$ IF MODULE_NAME.EQS."Basic" THEN MODULE_NAME = "" +$ MODULE_NAME1 = MODULE_NAME +$! +$! Check To See If We Are At The End Of The Module List. +$! +$ IF (MODULE_NAME.EQS.",") +$ THEN +$! +$! We Are At The End Of The Module List, Go To MODULE_DONE. +$! +$ GOTO MODULE_DONE +$! +$! End The Module List Check. +$! +$ ENDIF +$! +$! Increment The Moudle Counter. +$! +$ MODULE_COUNTER = MODULE_COUNTER + 1 +$! +$! Create The Library and Apps Module Names. +$! +$ LIB_MODULE = "LIB_" + MODULE_NAME +$ APPS_MODULE = "APPS_" + MODULE_NAME +$ IF (MODULE_NAME.EQS."ASN1_2") +$ THEN +$ MODULE_NAME = "ASN1" +$ ENDIF +$ IF (MODULE_NAME.EQS."EVP_2") +$ THEN +$ MODULE_NAME = "EVP" +$ ENDIF +$! +$! Set state (can be LIB and APPS) +$! +$ STATE = "LIB" +$ IF BUILDALL .EQS. "APPS" THEN STATE = "APPS" +$! +$! Check if the library module name actually is defined +$! +$ IF F$TYPE('LIB_MODULE') .EQS. "" +$ THEN +$ WRITE SYS$ERROR "" +$ WRITE SYS$ERROR "The module ",MODULE_NAME," does not exist. Continuing..." +$ WRITE SYS$ERROR "" +$ GOTO MODULE_NEXT +$ ENDIF +$! +$! Top Of The Module Loop. +$! +$ MODULE_AGAIN: +$! +$! Tell The User What Module We Are Building. +$! +$ IF (MODULE_NAME1.NES."") +$ THEN +$ IF STATE .EQS. "LIB" +$ THEN +$ WRITE SYS$OUTPUT "Compiling The ",MODULE_NAME1," Library Files. (",BUILDALL,",",STATE,")" +$ ELSE IF F$TYPE('APPS_MODULE') .NES. "" +$ THEN +$ WRITE SYS$OUTPUT "Compiling The ",MODULE_NAME1," Applications. (",BUILDALL,",",STATE,")" +$ ENDIF +$ ENDIF +$ ENDIF +$! +$! Define A File Counter And Set It To "0". +$! +$ FILE_COUNTER = 0 +$ APPLICATION = "" +$ APPLICATION_COUNTER = 0 +$! +$! Top Of The File Loop. +$! +$ NEXT_FILE: +$! +$! Look in the LIB_MODULE is we're in state LIB +$! +$ IF STATE .EQS. "LIB" +$ THEN +$! +$! O.K, Extract The File Name From The File List. +$! +$ FILE_NAME = F$ELEMENT(FILE_COUNTER,",",'LIB_MODULE') +$! +$! else +$! +$ ELSE +$ FILE_NAME = "," +$! +$ IF F$TYPE('APPS_MODULE') .NES. "" +$ THEN +$! +$! Extract The File Name From The File List. +$! This part is a bit more complicated. +$! +$ IF APPLICATION .EQS. "" +$ THEN +$ APPLICATION = F$ELEMENT(APPLICATION_COUNTER,";",'APPS_MODULE') +$ APPLICATION_COUNTER = APPLICATION_COUNTER + 1 +$ APPLICATION_OBJECTS = F$ELEMENT(1,"/",APPLICATION) +$ APPLICATION = F$ELEMENT(0,"/",APPLICATION) +$ FILE_COUNTER = 0 +$ ENDIF +$ +$! WRITE SYS$OUTPUT "DEBUG: SHOW SYMBOL APPLICATION*" +$! SHOW SYMBOL APPLICATION* +$! +$ IF APPLICATION .NES. ";" +$ THEN +$ FILE_NAME = F$ELEMENT(FILE_COUNTER,",",APPLICATION_OBJECTS) +$ IF FILE_NAME .EQS. "," +$ THEN +$ APPLICATION = "" +$ GOTO NEXT_FILE +$ ENDIF +$ ENDIF +$ ENDIF +$ ENDIF +$! +$! Check To See If We Are At The End Of The File List. +$! +$ IF (FILE_NAME.EQS.",") +$ THEN +$! +$! We Are At The End Of The File List, Change State Or Goto FILE_DONE. +$! +$ IF STATE .EQS. "LIB" .AND. BUILDALL .NES. "LIBRARY" +$ THEN +$ STATE = "APPS" +$ GOTO MODULE_AGAIN +$ ELSE +$ GOTO FILE_DONE +$ ENDIF +$! +$! End The File List Check. +$! +$ ENDIF +$! +$! Increment The Counter. +$! +$ FILE_COUNTER = FILE_COUNTER + 1 +$! +$! Create The Source File Name. +$! +$ TMP_FILE_NAME = F$ELEMENT(1,"]",FILE_NAME) +$ IF TMP_FILE_NAME .EQS. "]" THEN TMP_FILE_NAME = FILE_NAME +$ IF F$ELEMENT(0,".",TMP_FILE_NAME) .EQS. TMP_FILE_NAME THEN - + FILE_NAME = FILE_NAME + ".c" +$ IF (MODULE_NAME.NES."") +$ THEN +$ SOURCE_FILE = "SYS$DISK:[." + MODULE_NAME+ "]" + FILE_NAME +$ ELSE +$ SOURCE_FILE = "SYS$DISK:[]" + FILE_NAME +$ ENDIF +$ SOURCE_FILE = SOURCE_FILE - "][" +$! +$! Create The Object File Name. +$! +$ OBJECT_FILE = OBJ_DIR + F$PARSE(FILE_NAME,,,"NAME","SYNTAX_ONLY") + ".OBJ" +$ ON WARNING THEN GOTO NEXT_FILE +$! +$! Check To See If The File We Want To Compile Is Actually There. +$! +$ IF (F$SEARCH(SOURCE_FILE).EQS."") +$ THEN +$! +$! Tell The User That The File Doesn't Exist. +$! +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT "The File ",SOURCE_FILE," Doesn't Exist." +$ WRITE SYS$OUTPUT "" +$! +$! Exit The Build. +$! +$ GOTO EXIT +$! +$! End The File Exist Check. +$! +$ ENDIF +$! +$! Tell The User We Are Compiling The File. +$! +$ IF (MODULE_NAME.EQS."") +$ THEN +$ WRITE SYS$OUTPUT "Compiling The ",FILE_NAME," File. (",BUILDALL,",",STATE,")" +$ ENDIF +$ IF (MODULE_NAME.NES."") +$ THEN +$ WRITE SYS$OUTPUT " ",FILE_NAME,"" +$ ENDIF +$! +$! Compile The File. +$! +$ ON ERROR THEN GOTO NEXT_FILE +$ FILE_NAME0 = F$ELEMENT(0,".",FILE_NAME) +$ IF FILE_NAME - ".mar" .NES. FILE_NAME +$ THEN +$ MACRO/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ELSE +$ IF COMPILEWITH_CC3 - FILE_NAME0 .NES. COMPILEWITH_CC3 +$ THEN +$ CC3/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ELSE +$ IF COMPILEWITH_CC4 - FILE_NAME0 .NES. COMPILEWITH_CC4 +$ THEN +$ CC4/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ELSE +$ IF COMPILEWITH_CC5 - FILE_NAME0 .NES. COMPILEWITH_CC5 +$ THEN +$ CC5/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ELSE +$ IF COMPILEWITH_CC6 - FILE_NAME0 .NES. COMPILEWITH_CC6 +$ THEN +$ CC6/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ELSE +$ CC/OBJECT='OBJECT_FILE' 'SOURCE_FILE' +$ ENDIF +$ ENDIF +$ ENDIF +$ ENDIF +$ ENDIF +$ IF STATE .EQS. "LIB" +$ THEN +$! +$! Add It To The Library. +$! +$ LIBRARY/REPLACE 'LIB_NAME' 'OBJECT_FILE' +$! +$! Time To Clean Up The Object File. +$! +$ DELETE 'OBJECT_FILE';* +$ ENDIF +$! +$! Go Back And Do It Again. +$! +$ GOTO NEXT_FILE +$! +$! All Done With This Library Part. +$! +$ FILE_DONE: +$! +$! Time To Build Some Applications +$! +$ IF F$TYPE('APPS_MODULE') .NES. "" .AND. BUILDALL .NES. "LIBRARY" +$ THEN +$ APPLICATION_COUNTER = 0 +$ NEXT_APPLICATION: +$ APPLICATION = F$ELEMENT(APPLICATION_COUNTER,";",'APPS_MODULE') +$ IF APPLICATION .EQS. ";" THEN GOTO APPLICATION_DONE +$ +$ APPLICATION_COUNTER = APPLICATION_COUNTER + 1 +$ APPLICATION_OBJECTS = F$ELEMENT(1,"/",APPLICATION) +$ APPLICATION = F$ELEMENT(0,"/",APPLICATION) +$ +$! WRITE SYS$OUTPUT "DEBUG: SHOW SYMBOL APPLICATION*" +$! SHOW SYMBOL APPLICATION* +$! +$! Tell the user what happens +$! +$ WRITE SYS$OUTPUT " ",APPLICATION,".exe" +$! +$! Link The Program. +$! +$ ON ERROR THEN GOTO NEXT_APPLICATION +$! +$! Check To See If We Are To Link With A Specific TCP/IP Library. +$! +$ IF (TCPIP_LIB.NES."") +$ THEN +$! +$! Link With A TCP/IP Library. +$! +$ LINK/'DEBUGGER'/'TRACEBACK'/EXE='EXE_DIR''APPLICATION'.EXE - + 'OBJ_DIR''APPLICATION_OBJECTS', - + 'CRYPTO_LIB'/LIBRARY, - + 'TCPIP_LIB','OPT_FILE'/OPTION +$! +$! Else... +$! +$ ELSE +$! +$! Don't Link With A TCP/IP Library. +$! +$ LINK/'DEBUGGER'/'TRACEBACK'/EXE='EXE_DIR''APPLICATION'.EXE - + 'OBJ_DIR''APPLICATION_OBJECTS',- + 'CRYPTO_LIB'/LIBRARY, - + 'OPT_FILE'/OPTION +$! +$! End The TCP/IP Library Check. +$! +$ ENDIF +$ GOTO NEXT_APPLICATION +$ APPLICATION_DONE: +$ ENDIF +$! +$! Go Back And Get The Next Module. +$! +$ GOTO MODULE_NEXT +$! +$! All Done With This Module. +$! +$ MODULE_DONE: +$! +$! Tell The User That We Are All Done. +$! +$ WRITE SYS$OUTPUT "All Done..." +$ EXIT: +$ GOSUB CLEANUP +$ EXIT +$! +$! Check For The Link Option FIle. +$! +$ CHECK_OPT_FILE: +$! +$! Check To See If We Need To Make A VAX C Option File. +$! +$ IF (COMPILER.EQS."VAXC") +$ THEN +$! +$! Check To See If We Already Have A VAX C Linker Option File. +$! +$ IF (F$SEARCH(OPT_FILE).EQS."") +$ THEN +$! +$! We Need A VAX C Linker Option File. +$! +$ CREATE 'OPT_FILE' +$DECK +! +! Default System Options File To Link Agianst +! The Sharable VAX C Runtime Library. +! +SYS$SHARE:VAXCRTL.EXE/SHARE +$EOD +$! +$! End The Option File Check. +$! +$ ENDIF +$! +$! End The VAXC Check. +$! +$ ENDIF +$! +$! Check To See If We Need A GNU C Option File. +$! +$ IF (COMPILER.EQS."GNUC") +$ THEN +$! +$! Check To See If We Already Have A GNU C Linker Option File. +$! +$ IF (F$SEARCH(OPT_FILE).EQS."") +$ THEN +$! +$! We Need A GNU C Linker Option File. +$! +$ CREATE 'OPT_FILE' +$DECK +! +! Default System Options File To Link Agianst +! The Sharable C Runtime Library. +! +GNU_CC:[000000]GCCLIB/LIBRARY +SYS$SHARE:VAXCRTL/SHARE +$EOD +$! +$! End The Option File Check. +$! +$ ENDIF +$! +$! End The GNU C Check. +$! +$ ENDIF +$! +$! Check To See If We Need A DEC C Option File. +$! +$ IF (COMPILER.EQS."DECC") +$ THEN +$! +$! Check To See If We Already Have A DEC C Linker Option File. +$! +$ IF (F$SEARCH(OPT_FILE).EQS."") +$ THEN +$! +$! Figure Out If We Need An AXP Or A VAX Linker Option File. +$! +$ IF ARCH .EQS. "VAX" +$ THEN +$! +$! We Need A DEC C Linker Option File For VAX. +$! +$ CREATE 'OPT_FILE' +$DECK +! +! Default System Options File To Link Agianst +! The Sharable DEC C Runtime Library. +! +SYS$SHARE:DECC$SHR.EXE/SHARE +$EOD +$! +$! Else... +$! +$ ELSE +$! +$! Create The AXP Linker Option File. +$! +$ CREATE 'OPT_FILE' +$DECK +! +! Default System Options File For AXP To Link Agianst +! The Sharable C Runtime Library. +! +SYS$SHARE:CMA$OPEN_LIB_SHR/SHARE +SYS$SHARE:CMA$OPEN_RTL/SHARE +$EOD +$! +$! End The VAX/AXP DEC C Option File Check. +$! +$ ENDIF +$! +$! End The Option File Search. +$! +$ ENDIF +$! +$! End The DEC C Check. +$! +$ ENDIF +$! +$! Tell The User What Linker Option File We Are Using. +$! +$ WRITE SYS$OUTPUT "Using Linker Option File ",OPT_FILE,"." +$! +$! Time To RETURN. +$! +$ RETURN +$! +$! Check The User's Options. +$! +$ CHECK_OPTIONS: +$! +$! Check To See If P1 Is Blank. +$! +$ IF (P1.EQS."ALL") +$ THEN +$! +$! P1 Is Blank, So Build Everything. +$! +$ BUILDALL = "TRUE" +$! +$! Else... +$! +$ ELSE +$! +$! Else, Check To See If P1 Has A Valid Arguement. +$! +$ IF (P1.EQS."LIBRARY").OR.(P1.EQS."APPS") +$ THEN +$! +$! A Valid Arguement. +$! +$ BUILDALL = P1 +$! +$! Else... +$! +$ ELSE +$! +$! Tell The User We Don't Know What They Want. +$! +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT "The Option ",P1," Is Invalid. The Valid Options Are:" +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " ALL : Just Build Everything." +$ WRITE SYS$OUTPUT " LIBRARY : To Compile Just The [.xxx.EXE.CRYPTO]LIBCRYPTO.OLB Library." +$ WRITE SYS$OUTPUT " APPS : To Compile Just The [.xxx.EXE.CRYPTO]*.EXE Programs." +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " Where 'xxx' Stands For:" +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " AXP : Alpha Architecture." +$ WRITE SYS$OUTPUT " VAX : VAX Architecture." +$ WRITE SYS$OUTPUT "" +$! +$! Time To EXIT. +$! +$ EXIT +$! +$! End The Valid Arguement Check. +$! +$ ENDIF +$! +$! End The P1 Check. +$! +$ ENDIF +$! +$! Check To See If P2 Is Blank. +$! +$ IF (P2.EQS."NODEBUG") +$ THEN +$! +$! P2 Is NODEBUG, So Compile Without The Debugger Information. +$! +$ DEBUGGER = "NODEBUG" +$ TRACEBACK = "NOTRACEBACK" +$ GCC_OPTIMIZE = "OPTIMIZE" +$ CC_OPTIMIZE = "OPTIMIZE" +$ MACRO_OPTIMIZE = "OPTIMIZE" +$ WRITE SYS$OUTPUT "No Debugger Information Will Be Produced During Compile." +$ WRITE SYS$OUTPUT "Compiling With Compiler Optimization." +$ ELSE +$! +$! Check To See If We Are To Compile With Debugger Information. +$! +$ IF (P2.EQS."DEBUG") +$ THEN +$! +$! Compile With Debugger Information. +$! +$ DEBUGGER = "DEBUG" +$ TRACEBACK = "TRACEBACK" +$ GCC_OPTIMIZE = "NOOPTIMIZE" +$ CC_OPTIMIZE = "NOOPTIMIZE" +$ MACRO_OPTIMIZE = "NOOPTIMIZE" +$ WRITE SYS$OUTPUT "Debugger Information Will Be Produced During Compile." +$ WRITE SYS$OUTPUT "Compiling Without Compiler Optimization." +$ ELSE +$! +$! They Entered An Invalid Option.. +$! +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT "The Option ",P2," Is Invalid. The Valid Options Are:" +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " DEBUG : Compile With The Debugger Information." +$ WRITE SYS$OUTPUT " NODEBUG : Compile Without The Debugger Information." +$ WRITE SYS$OUTPUT "" +$! +$! Time To EXIT. +$! +$ EXIT +$! +$! End The Valid Arguement Check. +$! +$ ENDIF +$! +$! End The P2 Check. +$! +$ ENDIF +$! +$! Special Threads For OpenVMS v7.1 Or Later +$! +$! Written By: Richard Levitte +$! richard@levitte.org +$! +$! +$! Check To See If We Have A Option For P5. +$! +$ IF (P5.EQS."") +$ THEN +$! +$! Get The Version Of VMS We Are Using. +$! +$ ISSEVEN := +$ TMP = F$ELEMENT(0,"-",F$EXTRACT(1,4,F$GETSYI("VERSION"))) +$ TMP = F$INTEGER(F$ELEMENT(0,".",TMP)+F$ELEMENT(1,".",TMP)) +$! +$! Check To See If The VMS Version Is v7.1 Or Later. +$! +$ IF (TMP.GE.71) +$ THEN +$! +$! We Have OpenVMS v7.1 Or Later, So Use The Special Threads. +$! +$ ISSEVEN := ,PTHREAD_USE_D4 +$! +$! End The VMS Version Check. +$! +$ ENDIF +$! +$! End The P5 Check. +$! +$ ENDIF +$! +$! Check To See If P3 Is Blank. +$! +$ IF (P3.EQS."") +$ THEN +$! +$! O.K., The User Didn't Specify A Compiler, Let's Try To +$! Find Out Which One To Use. +$! +$! Check To See If We Have GNU C. +$! +$ IF (F$TRNLNM("GNU_CC").NES."") +$ THEN +$! +$! Looks Like GNUC, Set To Use GNUC. +$! +$ P3 = "GNUC" +$! +$! Else... +$! +$ ELSE +$! +$! Check To See If We Have VAXC Or DECC. +$! +$ IF (ARCH.EQS."AXP").OR.(F$TRNLNM("DECC$CC_DEFAULT").NES."") +$ THEN +$! +$! Looks Like DECC, Set To Use DECC. +$! +$ P3 = "DECC" +$! +$! Else... +$! +$ ELSE +$! +$! Looks Like VAXC, Set To Use VAXC. +$! +$ P3 = "VAXC" +$! +$! End The VAXC Compiler Check. +$! +$ ENDIF +$! +$! End The DECC & VAXC Compiler Check. +$! +$ ENDIF +$! +$! End The Compiler Check. +$! +$ ENDIF +$! +$! Check To See If We Have A Option For P4. +$! +$ IF (P4.EQS."") +$ THEN +$! +$! Find out what socket library we have available +$! +$ IF F$PARSE("SOCKETSHR:") .NES. "" +$ THEN +$! +$! We have SOCKETSHR, and it is my opinion that it's the best to use. +$! +$ P4 = "SOCKETSHR" +$! +$! Tell the user +$! +$ WRITE SYS$OUTPUT "Using SOCKETSHR for TCP/IP" +$! +$! Else, let's look for something else +$! +$ ELSE +$! +$! Like UCX (the reason to do this before Multinet is that the UCX +$! emulation is easier to use...) +$! +$ IF F$TRNLNM("UCX$IPC_SHR") .NES. "" - + .OR. F$PARSE("SYS$SHARE:UCX$IPC_SHR.EXE") .NES. "" - + .OR. F$PARSE("SYS$LIBRARY:UCX$IPC.OLB") .NES. "" +$ THEN +$! +$! Last resort: a UCX or UCX-compatible library +$! +$ P4 = "UCX" +$! +$! Tell the user +$! +$ WRITE SYS$OUTPUT "Using UCX or an emulation thereof for TCP/IP" +$! +$! That was all... +$! +$ ENDIF +$ ENDIF +$ ENDIF +$! +$! Set Up Initial CC Definitions, Possibly With User Ones +$! +$ CCDEFS = "TCPIP_TYPE_''P4',DSO_VMS" +$ IF F$TYPE(USER_CCDEFS) .NES. "" THEN CCDEFS = CCDEFS + "," + USER_CCDEFS +$ CCEXTRAFLAGS = "" +$ IF F$TYPE(USER_CCFLAGS) .NES. "" THEN CCEXTRAFLAGS = USER_CCFLAGS +$ CCDISABLEWARNINGS = "LONGLONGTYPE,LONGLONGSUFX,FOUNDCR" +$ IF F$TYPE(USER_CCDISABLEWARNINGS) .NES. "" THEN - + CCDISABLEWARNINGS = CCDISABLEWARNINGS + "," + USER_CCDISABLEWARNINGS +$! +$! Check To See If The User Entered A Valid Paramter. +$! +$ IF (P3.EQS."VAXC").OR.(P3.EQS."DECC").OR.(P3.EQS."GNUC") +$ THEN +$! +$! Check To See If The User Wanted DECC. +$! +$ IF (P3.EQS."DECC") +$ THEN +$! +$! Looks Like DECC, Set To Use DECC. +$! +$ COMPILER = "DECC" +$! +$! Tell The User We Are Using DECC. +$! +$ WRITE SYS$OUTPUT "Using DECC 'C' Compiler." +$! +$! Use DECC... +$! +$ CC = "CC" +$ IF ARCH.EQS."VAX" .AND. F$TRNLNM("DECC$CC_DEFAULT").NES."/DECC" - + THEN CC = "CC/DECC" +$ CC = CC + "/''CC_OPTIMIZE'/''DEBUGGER'/STANDARD=ANSI89" + - + "/NOLIST/PREFIX=ALL" + - + "/INCLUDE=(SYS$DISK:[],SYS$DISK:[-],SYS$DISK:[-.CRYPTO])" + - + CCEXTRAFLAGS +$! +$! Define The Linker Options File Name. +$! +$ OPT_FILE = "SYS$DISK:[]VAX_DECC_OPTIONS.OPT" +$! +$! End DECC Check. +$! +$ ENDIF +$! +$! Check To See If We Are To Use VAXC. +$! +$ IF (P3.EQS."VAXC") +$ THEN +$! +$! Looks Like VAXC, Set To Use VAXC. +$! +$ COMPILER = "VAXC" +$! +$! Tell The User We Are Using VAX C. +$! +$ WRITE SYS$OUTPUT "Using VAXC 'C' Compiler." +$! +$! Compile Using VAXC. +$! +$ CC = "CC" +$ IF ARCH.EQS."AXP" +$ THEN +$ WRITE SYS$OUTPUT "There is no VAX C on Alpha!" +$ EXIT +$ ENDIF +$ IF F$TRNLNM("DECC$CC_DEFAULT").EQS."/DECC" THEN CC = "CC/VAXC" +$ CC = CC + "/''CC_OPTIMIZE'/''DEBUGGER'/NOLIST" + - + "/INCLUDE=(SYS$DISK:[],SYS$DISK:[-],SYS$DISK:[-.CRYPTO])" + - + CCEXTRAFLAGS +$ CCDEFS = """VAXC""," + CCDEFS +$! +$! Define <sys> As SYS$COMMON:[SYSLIB] +$! +$ DEFINE/NOLOG SYS SYS$COMMON:[SYSLIB] +$! +$! Define The Linker Options File Name. +$! +$ OPT_FILE = "SYS$DISK:[]VAX_VAXC_OPTIONS.OPT" +$! +$! End VAXC Check +$! +$ ENDIF +$! +$! Check To See If We Are To Use GNU C. +$! +$ IF (P3.EQS."GNUC") +$ THEN +$! +$! Looks Like GNUC, Set To Use GNUC. +$! +$ COMPILER = "GNUC" +$! +$! Tell The User We Are Using GNUC. +$! +$ WRITE SYS$OUTPUT "Using GNU 'C' Compiler." +$! +$! Use GNU C... +$! +$ CC = "GCC/NOCASE_HACK/''GCC_OPTIMIZE'/''DEBUGGER'/NOLIST" + - + "/INCLUDE=(SYS$DISK:[],SYS$DISK:[-],SYS$DISK:[-.CRYPTO])" + - + CCEXTRAFLAGS +$! +$! Define The Linker Options File Name. +$! +$ OPT_FILE = "SYS$DISK:[]VAX_GNUC_OPTIONS.OPT" +$! +$! End The GNU C Check. +$! +$ ENDIF +$! +$! Set up default defines +$! +$ CCDEFS = """FLAT_INC=1""," + CCDEFS +$! +$! Finish up the definition of CC. +$! +$ IF COMPILER .EQS. "DECC" +$ THEN +$ IF CCDISABLEWARNINGS .EQS. "" +$ THEN +$ CC4DISABLEWARNINGS = "DOLLARID" +$ CC6DISABLEWARNINGS = "MIXLINKAGE" +$ ELSE +$ CC4DISABLEWARNINGS = CCDISABLEWARNINGS + ",DOLLARID" +$ CC6DISABLEWARNINGS = CCDISABLEWARNINGS + ",MIXLINKAGE" +$ CCDISABLEWARNINGS = "/WARNING=(DISABLE=(" + CCDISABLEWARNINGS + "))" +$ ENDIF +$ CC4DISABLEWARNINGS = "/WARNING=(DISABLE=(" + CC4DISABLEWARNINGS + "))" +$ CC6DISABLEWARNINGS = "/WARNING=(DISABLE=(" + CC6DISABLEWARNINGS + "))" +$ ELSE +$ CCDISABLEWARNINGS = "" +$ CC4DISABLEWARNINGS = "" +$ CC6DISABLEWARNINGS = "" +$ ENDIF +$ CC3 = CC + "/DEFINE=(" + CCDEFS + ISSEVEN + ")" + CCDISABLEWARNINGS +$ CC = CC + "/DEFINE=(" + CCDEFS + ")" + CCDISABLEWARNINGS +$ IF ARCH .EQS. "VAX" .AND. COMPILER .EQS. "DECC" .AND. P2 .NES. "DEBUG" +$ THEN +$ CC5 = CC + "/OPTIMIZE=NODISJOINT" +$ ELSE +$ CC5 = CC + "/NOOPTIMIZE" +$ ENDIF +$ CC4 = CC - CCDISABLEWARNINGS + CC4DISABLEWARNINGS +$ CC6 = CC - CCDISABLEWARNINGS + CC6DISABLEWARNINGS +$! +$! Show user the result +$! +$ WRITE/SYMBOL SYS$OUTPUT "Main C Compiling Command: ",CC +$! +$! Else The User Entered An Invalid Arguement. +$! +$ ELSE +$! +$! Tell The User We Don't Know What They Want. +$! +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT "The Option ",P3," Is Invalid. The Valid Options Are:" +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " VAXC : To Compile With VAX C." +$ WRITE SYS$OUTPUT " DECC : To Compile With DEC C." +$ WRITE SYS$OUTPUT " GNUC : To Compile With GNU C." +$ WRITE SYS$OUTPUT "" +$! +$! Time To EXIT. +$! +$ EXIT +$! +$! End The Valid Arguement Check. +$! +$ ENDIF +$! +$! Build a MACRO command for the architecture at hand +$! +$ IF ARCH .EQS. "VAX" THEN MACRO = "MACRO/''DEBUGGER'" +$ IF ARCH .EQS. "AXP" THEN MACRO = "MACRO/MIGRATION/''DEBUGGER'/''MACRO_OPTIMIZE'" +$! +$! Show user the result +$! +$ WRITE/SYMBOL SYS$OUTPUT "Main MACRO Compiling Command: ",MACRO +$! +$! Time to check the contents, and to make sure we get the correct library. +$! +$ IF P4.EQS."SOCKETSHR" .OR. P4.EQS."MULTINET" .OR. P4.EQS."UCX" - + .OR. P4.EQS."TCPIP" .OR. P4.EQS."NONE" +$ THEN +$! +$! Check to see if SOCKETSHR was chosen +$! +$ IF P4.EQS."SOCKETSHR" +$ THEN +$! +$! Set the library to use SOCKETSHR +$! +$ TCPIP_LIB = "SYS$DISK:[-.VMS]SOCKETSHR_SHR.OPT/OPT" +$! +$! Done with SOCKETSHR +$! +$ ENDIF +$! +$! Check to see if MULTINET was chosen +$! +$ IF P4.EQS."MULTINET" +$ THEN +$! +$! Set the library to use UCX emulation. +$! +$ P4 = "UCX" +$! +$! Done with MULTINET +$! +$ ENDIF +$! +$! Check to see if UCX was chosen +$! +$ IF P4.EQS."UCX" +$ THEN +$! +$! Set the library to use UCX. +$! +$ TCPIP_LIB = "SYS$DISK:[-.VMS]UCX_SHR_DECC.OPT/OPT" +$ IF F$TRNLNM("UCX$IPC_SHR") .NES. "" +$ THEN +$ TCPIP_LIB = "SYS$DISK:[-.VMS]UCX_SHR_DECC_LOG.OPT/OPT" +$ ELSE +$ IF COMPILER .NES. "DECC" .AND. ARCH .EQS. "VAX" THEN - + TCPIP_LIB = "SYS$DISK:[-.VMS]UCX_SHR_VAXC.OPT/OPT" +$ ENDIF +$! +$! Done with UCX +$! +$ ENDIF +$! +$! Check to see if TCPIP was chosen +$! +$ IF P4.EQS."TCPIP" +$ THEN +$! +$! Set the library to use TCPIP (post UCX). +$! +$ TCPIP_LIB = "SYS$DISK:[-.VMS]TCPIP_SHR_DECC.OPT/OPT" +$! +$! Done with TCPIP +$! +$ ENDIF +$! +$! Check to see if NONE was chosen +$! +$ IF P4.EQS."NONE" +$ THEN +$! +$! Do not use a TCPIP library. +$! +$ TCPIP_LIB = "" +$! +$! Done with TCPIP +$! +$ ENDIF +$! +$! Print info +$! +$ WRITE SYS$OUTPUT "TCP/IP library spec: ", TCPIP_LIB +$! +$! Else The User Entered An Invalid Arguement. +$! +$ ELSE +$! +$! Tell The User We Don't Know What They Want. +$! +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT "The Option ",P4," Is Invalid. The Valid Options Are:" +$ WRITE SYS$OUTPUT "" +$ WRITE SYS$OUTPUT " SOCKETSHR : To link with SOCKETSHR TCP/IP library." +$ WRITE SYS$OUTPUT " UCX : To link with UCX TCP/IP library." +$ WRITE SYS$OUTPUT " TCPIP : To link with TCPIP (post UCX) TCP/IP library." +$ WRITE SYS$OUTPUT "" +$! +$! Time To EXIT. +$! +$ EXIT +$! +$! Done with TCP/IP libraries +$! +$ ENDIF +$! +$! Check if the user wanted to compile just a subset of all the encryption +$! methods. +$! +$ IF P6 .NES. "" +$ THEN +$ ENCRYPT_TYPES = P6 +$ ENDIF +$! +$! Time To RETURN... +$! +$ RETURN +$! +$ INITIALISE: +$! +$! Save old value of the logical name OPENSSL +$! +$ __SAVE_OPENSSL = F$TRNLNM("OPENSSL","LNM$PROCESS_TABLE") +$! +$! Save directory information +$! +$ __HERE = F$PARSE(F$PARSE("A.;",F$ENVIRONMENT("PROCEDURE"))-"A.;","[]A.;") - "A.;" +$ __HERE = F$EDIT(__HERE,"UPCASE") +$ __TOP = __HERE - "FIPS-1_0]" +$ __INCLUDE = __TOP + "INCLUDE.OPENSSL]" +$! +$! Set up the logical name OPENSSL to point at the include directory +$! +$ DEFINE OPENSSL/NOLOG '__INCLUDE' +$! +$! Done +$! +$ RETURN +$! +$ CLEANUP: +$! +$! Restore the logical name OPENSSL if it had a value +$! +$ IF __SAVE_OPENSSL .EQS. "" +$ THEN +$ DEASSIGN OPENSSL +$ ELSE +$ DEFINE/NOLOG OPENSSL '__SAVE_OPENSSL' +$ ENDIF +$! +$! Done +$! +$ RETURN diff --git a/lib/libssl/src/fips-1.0/fips.c b/lib/libssl/src/fips-1.0/fips.c new file mode 100644 index 00000000000..bb833bfa2ce --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips.c @@ -0,0 +1,313 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <openssl/fips.h> +#include <openssl/rand.h> +#include <openssl/fips_rand.h> +#include <openssl/err.h> +#include <openssl/bio.h> +#include <openssl/hmac.h> +#include <string.h> +#include <limits.h> +#include "fips_locl.h" + +#ifdef OPENSSL_FIPS + +#ifndef PATH_MAX +#define PATH_MAX 1024 +#endif + +static int fips_selftest_fail; +static int fips_mode; +static const void *fips_rand_check; + +static void fips_set_mode(int onoff) + { + int owning_thread = fips_is_owning_thread(); + + if (fips_is_started()) + { + if (!owning_thread) fips_w_lock(); + fips_mode = onoff; + if (!owning_thread) fips_w_unlock(); + } + } + +static void fips_set_rand_check(const void *rand_check) + { + int owning_thread = fips_is_owning_thread(); + + if (fips_is_started()) + { + if (!owning_thread) fips_w_lock(); + fips_rand_check = rand_check; + if (!owning_thread) fips_w_unlock(); + } + } + +int FIPS_mode(void) + { + int ret = 0; + int owning_thread = fips_is_owning_thread(); + + if (fips_is_started()) + { + if (!owning_thread) fips_r_lock(); + ret = fips_mode; + if (!owning_thread) fips_r_unlock(); + } + return ret; + } + +const void *FIPS_rand_check(void) + { + const void *ret = 0; + int owning_thread = fips_is_owning_thread(); + + if (fips_is_started()) + { + if (!owning_thread) fips_r_lock(); + ret = fips_rand_check; + if (!owning_thread) fips_r_unlock(); + } + return ret; + } + +int FIPS_selftest_failed(void) + { + int ret = 0; + if (fips_is_started()) + { + int owning_thread = fips_is_owning_thread(); + + if (!owning_thread) fips_r_lock(); + ret = fips_selftest_fail; + if (!owning_thread) fips_r_unlock(); + } + return ret; + } + +int FIPS_selftest() + { + ERR_load_crypto_strings(); + + return FIPS_selftest_sha1() + && FIPS_selftest_hmac() + && FIPS_selftest_aes() + && FIPS_selftest_des() + && FIPS_selftest_rsa() + && FIPS_selftest_dsa(); + } + +extern const void *FIPS_text_start(), *FIPS_text_end(); +extern const unsigned char FIPS_rodata_start[], FIPS_rodata_end[]; +unsigned char FIPS_signature [20] = { 0 }; +static const char FIPS_hmac_key[]="etaonrishdlcupfm"; + +unsigned int FIPS_incore_fingerprint(unsigned char *sig,unsigned int len) + { + const unsigned char *p1 = FIPS_text_start(); + const unsigned char *p2 = FIPS_text_end(); + const unsigned char *p3 = FIPS_rodata_start; + const unsigned char *p4 = FIPS_rodata_end; + HMAC_CTX c; + + HMAC_CTX_init(&c); + HMAC_Init(&c,FIPS_hmac_key,strlen(FIPS_hmac_key),EVP_sha1()); + + /* detect overlapping regions */ + if (p1<=p3 && p2>=p3) + p3=p1, p4=p2>p4?p2:p4, p1=NULL, p2=NULL; + else if (p3<=p1 && p4>=p1) + p3=p3, p4=p2>p4?p2:p4, p1=NULL, p2=NULL; + + if (p1) + HMAC_Update(&c,p1,(size_t)p2-(size_t)p1); + + if (FIPS_signature>=p3 && FIPS_signature<p4) + { + /* "punch" hole */ + HMAC_Update(&c,p3,(size_t)FIPS_signature-(size_t)p3); + p3 = FIPS_signature+sizeof(FIPS_signature); + if (p3<p4) + HMAC_Update(&c,p3,(size_t)p4-(size_t)p3); + } + else + HMAC_Update(&c,p3,(size_t)p4-(size_t)p3); + + HMAC_Final(&c,sig,&len); + HMAC_CTX_cleanup(&c); + + return len; + } + +int FIPS_check_incore_fingerprint(void) + { + unsigned char sig[EVP_MAX_MD_SIZE]; + unsigned int len; + extern int OPENSSL_NONPIC_relocated; + + if (FIPS_text_start()==NULL) + { + FIPSerr(FIPS_F_FIPS_CHECK_FINGERPRINT,FIPS_R_UNSUPPORTED_PLATFORM); + return 0; + } + + len=FIPS_incore_fingerprint (sig,sizeof(sig)); + + if (len!=sizeof(FIPS_signature) || + memcmp(FIPS_signature,sig,sizeof(FIPS_signature))) + { + if (FIPS_signature>=FIPS_rodata_start && FIPS_signature<FIPS_rodata_end) + FIPSerr(FIPS_F_FIPS_CHECK_FINGERPRINT,FIPS_R_FINGERPRINT_DOES_NOT_MATCH_SEGMENT_ALIASING); + else if (OPENSSL_NONPIC_relocated) + FIPSerr(FIPS_F_FIPS_CHECK_FINGERPRINT,FIPS_R_FINGERPRINT_DOES_NOT_MATCH_NONPIC_RELOCATED); + else + FIPSerr(FIPS_F_FIPS_CHECK_FINGERPRINT,FIPS_R_FINGERPRINT_DOES_NOT_MATCH); + return 0; + } + + return 1; + } + +int FIPS_mode_set(int onoff) + { + int fips_set_owning_thread(); + int fips_clear_owning_thread(); + int ret = 0; + + fips_w_lock(); + fips_set_started(); + fips_set_owning_thread(); + + if(onoff) + { + unsigned char buf[24]; + + fips_selftest_fail = 0; + + /* Don't go into FIPS mode twice, just so we can do automagic + seeding */ + if(FIPS_mode()) + { + FIPSerr(FIPS_F_FIPS_MODE_SET,FIPS_R_FIPS_MODE_ALREADY_SET); + fips_selftest_fail = 1; + ret = 0; + goto end; + } + + if(fips_signature_witness() != FIPS_signature) + { + FIPSerr(FIPS_F_FIPS_MODE_SET,FIPS_R_CONTRADICTING_EVIDENCE); + fips_selftest_fail = 1; + ret = 0; + goto end; + } + + if(!FIPS_check_incore_fingerprint()) + { + fips_selftest_fail = 1; + ret = 0; + goto end; + } + + /* Perform RNG KAT before seeding */ + if (!FIPS_selftest_rng()) + { + fips_selftest_fail = 1; + ret = 0; + goto end; + } + + /* automagically seed PRNG if not already seeded */ + if(!FIPS_rand_seeded()) + { + if(RAND_bytes(buf,sizeof buf) <= 0) + { + fips_selftest_fail = 1; + ret = 0; + goto end; + } + FIPS_set_prng_key(buf,buf+8); + FIPS_rand_seed(buf+16,8); + } + + /* now switch into FIPS mode */ + fips_set_rand_check(FIPS_rand_method()); + RAND_set_rand_method(FIPS_rand_method()); + if(FIPS_selftest()) + fips_set_mode(1); + else + { + fips_selftest_fail = 1; + ret = 0; + goto end; + } + ret = 1; + goto end; + } + fips_set_mode(0); + fips_selftest_fail = 0; + ret = 1; +end: + fips_clear_owning_thread(); + fips_w_unlock(); + return ret; + } + +#if 0 +/* here just to cause error codes to exist */ +static void dummy() + { + FIPSerr(FIPS_F_HASH_FINAL,FIPS_F_NON_FIPS_METHOD); + FIPSerr(FIPS_F_HASH_FINAL,FIPS_R_FIPS_SELFTEST_FAILED); + } +#endif + +#endif diff --git a/lib/libssl/src/fips-1.0/fips.h b/lib/libssl/src/fips-1.0/fips.h new file mode 100644 index 00000000000..f67bb885c82 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips.h @@ -0,0 +1,131 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <openssl/opensslconf.h> + +#ifdef OPENSSL_FIPS + +#ifdef __cplusplus +extern "C" { +#endif + +struct dsa_st; + +int FIPS_mode_set(int onoff); +int FIPS_mode(void); +const void *FIPS_rand_check(void); +int FIPS_selftest_failed(void); +int FIPS_dsa_check(struct dsa_st *dsa); +void FIPS_corrupt_sha1(void); +int FIPS_selftest_sha1(void); +void FIPS_corrupt_aes(void); +int FIPS_selftest_aes(void); +void FIPS_corrupt_des(void); +int FIPS_selftest_des(void); +void FIPS_corrupt_rsa(void); +int FIPS_selftest_rsa(void); +void FIPS_corrupt_dsa(void); +int FIPS_selftest_dsa(void); +void FIPS_corrupt_rng(void); +int FIPS_selftest_rng(void); +int FIPS_selftest_hmac(void); + +/* BEGIN ERROR CODES */ +/* The following lines are auto generated by the script mkerr.pl. Any changes + * made after this point may be overwritten when the script is next run. + */ +void ERR_load_FIPS_strings(void); + +/* Error codes for the FIPS functions. */ + +/* Function codes. */ +#define FIPS_F_DH_GENERATE_PARAMETERS 117 +#define FIPS_F_DSA_DO_SIGN 111 +#define FIPS_F_DSA_DO_VERIFY 112 +#define FIPS_F_DSA_GENERATE_PARAMETERS 110 +#define FIPS_F_FIPS_CHECK_DSA 116 +#define FIPS_F_FIPS_CHECK_EXE 106 +#define FIPS_F_FIPS_CHECK_FINGERPRINT 120 +#define FIPS_F_FIPS_CHECK_RSA 115 +#define FIPS_F_FIPS_DSA_CHECK 102 +#define FIPS_F_FIPS_MODE_SET 105 +#define FIPS_F_FIPS_SELFTEST_AES 104 +#define FIPS_F_FIPS_SELFTEST_DES 107 +#define FIPS_F_FIPS_SELFTEST_DSA 109 +#define FIPS_F_FIPS_SELFTEST_RNG 118 +#define FIPS_F_FIPS_SELFTEST_RSA 108 +#define FIPS_F_FIPS_SELFTEST_SHA 103 +#define FIPS_F_HASH_FINAL 100 +#define FIPS_F_RSA_EAY_PUBLIC_ENCRYPT 114 +#define FIPS_F_RSA_GENERATE_KEY 113 +#define FIPS_F_RSA_X931_GENERATE_KEY 119 +#define FIPS_F_SSLEAY_RAND_BYTES 101 +#define FIPS_F_FIPS_CHECK_DSO 120 + +/* Reason codes. */ +#define FIPS_R_CANNOT_READ_EXE 103 +#define FIPS_R_CANNOT_READ_EXE_DIGEST 104 +#define FIPS_R_EXE_DIGEST_DOES_NOT_MATCH 105 +#define FIPS_R_FINGERPRINT_DOES_NOT_MATCH 110 +#define FIPS_R_FINGERPRINT_DOES_NOT_MATCH_NONPIC_RELOCATED 111 +#define FIPS_R_FINGERPRINT_DOES_NOT_MATCH_SEGMENT_ALIASING 112 +#define FIPS_R_FIPS_MODE_ALREADY_SET 102 +#define FIPS_R_FIPS_SELFTEST_FAILED 106 +#define FIPS_R_INVALID_KEY_LENGTH 109 +#define FIPS_R_KEY_TOO_SHORT 108 +#define FIPS_R_NON_FIPS_METHOD 100 +#define FIPS_R_PAIRWISE_TEST_FAILED 107 +#define FIPS_R_SELFTEST_FAILED 101 +#define FIPS_R_UNSUPPORTED_PLATFORM 113 +#define FIPS_R_CONTRADICTING_EVIDENCE 114 + +#ifdef __cplusplus +} +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/fips_canister.c b/lib/libssl/src/fips-1.0/fips_canister.c new file mode 100644 index 00000000000..7dec62bb64b --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_canister.c @@ -0,0 +1,171 @@ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. Rights for redistribution + * and usage in source and binary forms are granted according to the + * OpenSSL license. + */ + +#include <stdio.h> +#if defined(__DECC) +# include <c_asm.h> +# pragma __nostandard +#endif + +#include "e_os.h" + +#if !defined(POINTER_TO_FUNCTION_IS_POINTER_TO_1ST_INSTRUCTION) +# if (defined(__sun) && (defined(__sparc) || defined(__sparcv9))) || \ + (defined(__sgi) && (defined(__mips) || defined(mips))) || \ + (defined(__osf__) && defined(__alpha)) || \ + (defined(__linux) && (defined(__arm) || defined(__arm__))) || \ + (defined(__i386) || defined(__i386__)) || \ + (defined(__x86_64) || defined(__x86_64__)) || \ + (defined(vax) || defined(__vax__)) +# define POINTER_TO_FUNCTION_IS_POINTER_TO_1ST_INSTRUCTION +# endif +#endif + +#ifdef FIPS_START +#define FIPS_ref_point FIPS_text_start +/* Some compilers put string literals into a separate segment. As we + * are mostly interested to hash AES tables in .rodata, we declare + * reference points accordingly. In case you wonder, the values are + * big-endian encoded variable names, just to prevent these arrays + * from being merged by linker. */ +const unsigned int FIPS_rodata_start[]= + { 0x46495053, 0x5f726f64, 0x6174615f, 0x73746172 }; +#else +#define FIPS_ref_point FIPS_text_end +const unsigned int FIPS_rodata_end[]= + { 0x46495053, 0x5f726f64, 0x6174615f, 0x656e645b }; +#endif + +/* + * I declare reference function as static in order to avoid certain + * pitfalls in -dynamic linker behaviour... + */ +static void *instruction_pointer(void) +{ void *ret=NULL; +/* These are ABI-neutral CPU-specific snippets. ABI-neutrality means + * that they are designed to work under any OS running on particular + * CPU, which is why you don't find any #ifdef THIS_OR_THAT_OS in + * this function. */ +#if defined(INSTRUCTION_POINTER_IMPLEMENTED) + INSTRUCTION_POINTER_IMPLEMENTED(ret); +#elif defined(__GNUC__) && __GNUC__>=2 +# if defined(__alpha) || defined(__alpha__) +# define INSTRUCTION_POINTER_IMPLEMENTED + __asm __volatile ( "br %0,1f\n1:" : "=r"(ret) ); +# elif defined(__i386) || defined(__i386__) +# define INSTRUCTION_POINTER_IMPLEMENTED + __asm __volatile ( "call 1f\n1: popl %0" : "=r"(ret) ); + ret = (void *)((size_t)ret&~3UL); /* align for better performance */ +# elif defined(__ia64) || defined(__ia64__) +# define INSTRUCTION_POINTER_IMPLEMENTED + __asm __volatile ( "mov %0=ip" : "=r"(ret) ); +# elif defined(__hppa) || defined(__hppa__) || defined(__pa_risc) +# define INSTRUCTION_POINTER_IMPLEMENTED + __asm __volatile ( "blr %%r0,%0\n\tnop" : "=r"(ret) ); + ret = (void *)((size_t)ret&~3UL); /* mask privilege level */ +# elif defined(__mips) || defined(__mips__) +# define INSTRUCTION_POINTER_IMPLEMENTED + void *scratch; + __asm __volatile ( "move %1,$31\n\t" /* save ra */ + "bal .+8; nop\n\t" + "move %0,$31\n\t" + "move $31,%1" /* restore ra */ + : "=r"(ret),"=r"(scratch) ); +# elif defined(__ppc__) || defined(__powerpc) || defined(__powerpc__) || \ + defined(__POWERPC__) || defined(_POWER) || defined(__PPC__) || \ + defined(__PPC64__) || defined(__powerpc64__) +# define INSTRUCTION_POINTER_IMPLEMENTED + void *scratch; + __asm __volatile ( "mfspr %1,8\n\t" /* save lr */ + "bl .+4\n\t" + "mfspr %0,8\n\t" /* mflr ret */ + "mtspr 8,%1" /* restore lr */ + : "=r"(ret),"=r"(scratch) ); +# elif defined(__sparc) || defined(__sparc__) || defined(__sparcv9) +# define INSTRUCTION_POINTER_IMPLEMENTED + void *scratch; + __asm __volatile ( "mov %%o7,%1\n\t" + "call .+8; nop\n\t" + "mov %%o7,%0\n\t" + "mov %1,%%o7" + : "=r"(ret),"=r"(scratch) ); +# elif defined(__x86_64) || defined(__x86_64__) +# define INSTRUCTION_POINTER_IMPLEMENTED + __asm __volatile ( "leaq 0(%%rip),%0" : "=r"(ret) ); + ret = (void *)((size_t)ret&~3UL); /* align for better performance */ +# endif +#elif defined(__DECC) && defined(__alpha) +# define INSTRUCTION_POINTER_IMPLEMENTED + ret = (void *)(size_t)asm("br %v0,1f\n1:"); +#elif defined(_MSC_VER) && defined(_M_IX86) +# undef INSTRUCTION_POINTER_IMPLEMENTED + void *scratch; + _asm { + call self + self: pop eax + mov scratch,eax + } + ret = (void *)((size_t)scratch&~3UL); +#endif + return ret; +} + +/* + * This function returns pointer to an instruction in the vicinity of + * its entry point, but not outside this object module. This guarantees + * that sequestered code is covered... + */ +void *FIPS_ref_point() +{ +#if defined(INSTRUCTION_POINTER_IMPLEMENTED) + return instruction_pointer(); +/* Below we essentially cover vendor compilers which do not support + * inline assembler... */ +#elif defined(_AIX) + struct { void *ip,*gp,*env; } *p = (void *)instruction_pointer; + return p->ip; +#elif defined(_HPUX_SOURCE) +# if defined(__hppa) || defined(__hppa__) + struct { void *i[4]; } *p = (void *)FIPS_ref_point; + + if (sizeof(p) == 8) /* 64-bit */ + return p->i[2]; + else if ((size_t)p & 2) + { p = (void *)((size_t)p&~3UL); + return p->i[0]; + } + else + return (void *)p; +# elif defined(__ia64) || defined(__ia64__) + struct { unsigned long long ip,gp; } *p=(void *)instruction_pointer; + return (void *)(size_t)p->ip; +# endif +#elif (defined(__VMS) || defined(VMS)) && !(defined(vax) || defined(__vax__)) + /* applies to both alpha and ia64 */ + struct { unsigned __int64 opaque,ip; } *p=(void *)instruction_pointer; + return (void *)(size_t)p->ip; +#elif defined(__VOS__) + /* applies to both pa-risc and ia32 */ + struct { void *dp,*ip,*gp; } *p = (void *)instruction_pointer; + return p->ip; +#elif defined(_WIN32) +# if defined(_WIN64) && defined(_M_IA64) + struct { void *ip,*gp; } *p = (void *)FIPS_ref_point; + return p->ip; +# else + return (void *)FIPS_ref_point; +# endif +/* + * In case you wonder why there is no #ifdef __linux. All Linux targets + * are GCC-based and therefore are covered by instruction_pointer above + * [well, some are covered by by the one below]... + */ +#elif defined(POINTER_TO_FUNCTION_IS_POINTER_TO_1ST_INSTRUCTION) + return (void *)instruction_pointer; +#else + return NULL; +#endif +} diff --git a/lib/libssl/src/fips-1.0/fips_err.h b/lib/libssl/src/fips-1.0/fips_err.h new file mode 100644 index 00000000000..c57aebf8a3d --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_err.h @@ -0,0 +1,133 @@ +/* fips/fips_err.h */ +/* ==================================================================== + * Copyright (c) 1999-2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +/* NOTE: this file was auto generated by the mkerr.pl script: any changes + * made to it will be overwritten when the script next updates this file, + * only reason strings will be preserved. + */ + +#include <stdio.h> +#include <openssl/err.h> +#include <openssl/fips.h> + +/* BEGIN ERROR CODES */ +#ifndef OPENSSL_NO_ERR + +#define ERR_FUNC(func) ERR_PACK(ERR_LIB_FIPS,func,0) +#define ERR_REASON(reason) ERR_PACK(ERR_LIB_FIPS,0,reason) + +static ERR_STRING_DATA FIPS_str_functs[]= + { +{ERR_FUNC(FIPS_F_DH_GENERATE_PARAMETERS), "DH_generate_parameters"}, +{ERR_FUNC(FIPS_F_DSA_DO_SIGN), "DSA_do_sign"}, +{ERR_FUNC(FIPS_F_DSA_DO_VERIFY), "DSA_do_verify"}, +{ERR_FUNC(FIPS_F_DSA_GENERATE_PARAMETERS), "DSA_generate_parameters"}, +{ERR_FUNC(FIPS_F_FIPS_CHECK_DSA), "FIPS_CHECK_DSA"}, +{ERR_FUNC(FIPS_F_FIPS_CHECK_EXE), "FIPS_CHECK_EXE"}, +{ERR_FUNC(FIPS_F_FIPS_CHECK_FINGERPRINT), "FIPS_CHECK_FINGERPRINT"}, +{ERR_FUNC(FIPS_F_FIPS_CHECK_RSA), "FIPS_CHECK_RSA"}, +{ERR_FUNC(FIPS_F_FIPS_DSA_CHECK), "FIPS_dsa_check"}, +{ERR_FUNC(FIPS_F_FIPS_MODE_SET), "FIPS_mode_set"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_AES), "FIPS_selftest_aes"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_DES), "FIPS_selftest_des"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_DSA), "FIPS_selftest_dsa"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_RNG), "FIPS_selftest_rng"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_RSA), "FIPS_selftest_rsa"}, +{ERR_FUNC(FIPS_F_FIPS_SELFTEST_SHA), "FIPS_SELFTEST_SHA"}, +{ERR_FUNC(FIPS_F_HASH_FINAL), "HASH_FINAL"}, +{ERR_FUNC(FIPS_F_RSA_EAY_PUBLIC_ENCRYPT), "RSA_EAY_PUBLIC_ENCRYPT"}, +{ERR_FUNC(FIPS_F_RSA_GENERATE_KEY), "RSA_generate_key"}, +{ERR_FUNC(FIPS_F_RSA_X931_GENERATE_KEY), "RSA_X931_generate_key"}, +{ERR_FUNC(FIPS_F_SSLEAY_RAND_BYTES), "SSLEAY_RAND_BYTES"}, +{ERR_FUNC(FIPS_F_FIPS_CHECK_DSO), "FIPS_check_dso"}, +{0,NULL} + }; + +static ERR_STRING_DATA FIPS_str_reasons[]= + { +{ERR_REASON(FIPS_R_CANNOT_READ_EXE) ,"cannot access executable object"}, +{ERR_REASON(FIPS_R_CANNOT_READ_EXE_DIGEST),"cannot access detached digest"}, +{ERR_REASON(FIPS_R_EXE_DIGEST_DOES_NOT_MATCH),"detached digest verification failed"}, +{ERR_REASON(FIPS_R_FINGERPRINT_DOES_NOT_MATCH),"fingerprint does not match"}, +{ERR_REASON(FIPS_R_FINGERPRINT_DOES_NOT_MATCH_NONPIC_RELOCATED),"fingerprint does not match, possibly because non-PIC was relocated"}, +{ERR_REASON(FIPS_R_FINGERPRINT_DOES_NOT_MATCH_SEGMENT_ALIASING),"fingerprint does not match, invalid segment aliasing"}, +{ERR_REASON(FIPS_R_FIPS_MODE_ALREADY_SET),"fips mode already set"}, +{ERR_REASON(FIPS_R_FIPS_SELFTEST_FAILED) ,"fips selftest failed"}, +{ERR_REASON(FIPS_R_INVALID_KEY_LENGTH) ,"invalid key length"}, +{ERR_REASON(FIPS_R_KEY_TOO_SHORT) ,"key too short"}, +{ERR_REASON(FIPS_R_NON_FIPS_METHOD) ,"non fips method"}, +{ERR_REASON(FIPS_R_PAIRWISE_TEST_FAILED) ,"pairwise test failed"}, +{ERR_REASON(FIPS_R_SELFTEST_FAILED) ,"selftest failed"}, +{ERR_REASON(FIPS_R_UNSUPPORTED_PLATFORM) ,"unsupported platform"}, +{ERR_REASON(FIPS_R_CONTRADICTING_EVIDENCE),"duplicate code detected, check your linking procedure"}, +{0,NULL} + }; + +#endif + +void ERR_load_FIPS_strings(void) + { + static int init; + + if (!init) + { + init=1; +#ifndef OPENSSL_NO_ERR + ERR_load_strings(0,FIPS_str_functs); + ERR_load_strings(0,FIPS_str_reasons); +#endif + + } + } diff --git a/lib/libssl/src/fips-1.0/fips_err_wrapper.c b/lib/libssl/src/fips-1.0/fips_err_wrapper.c new file mode 100644 index 00000000000..09f11748f60 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_err_wrapper.c @@ -0,0 +1,7 @@ +#include <openssl/opensslconf.h> + +#ifdef OPENSSL_FIPS +# include "fips_err.h" +#else +static void *dummy=&dummy; +#endif diff --git a/lib/libssl/src/fips-1.0/fips_locl.h b/lib/libssl/src/fips-1.0/fips_locl.h new file mode 100644 index 00000000000..bbddfaab827 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_locl.h @@ -0,0 +1,71 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#ifdef OPENSSL_FIPS + +#ifdef __cplusplus +extern "C" { +#endif + +/* These are trampolines implemented in crypto/cryptlib.c */ +void fips_w_lock(void); +void fips_w_unlock(void); +void fips_r_lock(void); +void fips_r_unlock(void); +int fips_is_started(void); +void fips_set_started(void); +int fips_is_owning_thread(void); +int fips_set_owning_thread(void); +int fips_clear_owning_thread(void); +unsigned char *fips_signature_witness(void); + +#ifdef __cplusplus +} +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/fips_premain.c b/lib/libssl/src/fips-1.0/fips_premain.c new file mode 100644 index 00000000000..6a75d909eb1 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_premain.c @@ -0,0 +1,171 @@ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. Rights for redistribution + * and usage in source and binary forms are granted according to the + * OpenSSL license. + */ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#if defined(__unix) || defined(__unix__) +#include <unistd.h> +#endif + +#ifndef FINGERPRINT_PREMAIN_DSO_LOAD + +#if defined(__GNUC__) && __GNUC__>=2 + void FINGERPRINT_premain(void) __attribute__((constructor)); + /* Most commonly this results in pointer to premain to be dropped + * to .ctors segment, which is traversed by GCC crtbegin.o upon + * program startup. Except on a.out OpenBSD where it results in + * _GLOBAL_$I$premain() {premain();} being auto-generated by + * compiler... But one way or another this is believed to cover + * *all* GCC targets. */ +#elif defined(_MSC_VER) +# ifdef _WINDLL + __declspec(dllexport) /* this is essentially cosmetics... */ +# endif + void FINGERPRINT_premain(void); + static int premain_wrapper(void) { FINGERPRINT_premain(); return 0; } +# pragma data_seg(".CRT$XCU") + static int (*p)(void) = premain_wrapper; + /* This results in pointer to premain to appear in .CRT segment, + * which is traversed by Visual C run-time initialization code. + * This applies to both Win32 and [all flavors of] Win64. */ +# pragma data_seg() +#elif defined(__SUNPRO_C) + void FINGERPRINT_premain(void); +# pragma init(FINGERPRINT_premain) + /* This results in a call to premain to appear in .init segment. */ +#elif defined(__DECC) && (defined(__VMS) || defined(VMS)) + void FINGERPRINT_premain(void); +# pragma __nostandard + globaldef { "LIB$INITIALIZ" } readonly _align (LONGWORD) + int spare[8] = {0}; + globaldef { "LIB$INITIALIZE" } readonly _align (LONGWORD) + void (*x_FINGERPRINT_premain)(void) = FINGERPRINT_premain; + /* Refer to LIB$INITIALIZE to ensure it exists in the image. */ + int lib$initialize(); + globaldef int (*lib_init_ref)() = lib$initialize; +# pragma __standard +#elif 0 + The rest has to be taken care of through command line: + + -Wl,-init,FINGERPRINT_premain on OSF1 and IRIX + -Wl,+init,FINGERPRINT_premain on HP-UX + -Wl,-binitfini:FINGERPRINT_premain on AIX + + On ELF platforms this results in a call to premain to appear in + .init segment... +#endif + +#ifndef HMAC_SHA1_SIG +#define HMAC_SHA1_SIG "?have to make sure this string is unique" +#endif + +static const unsigned char FINGERPRINT_ascii_value[40] = HMAC_SHA1_SIG; + +#define atox(c) ((c)>='a'?((c)-'a'+10):((c)>='A'?(c)-'A'+10:(c)-'0')) + +extern const void *FIPS_text_start(), *FIPS_text_end(); +extern const unsigned char FIPS_rodata_start[], FIPS_rodata_end[]; +extern unsigned char FIPS_signature[20]; +extern unsigned int FIPS_incore_fingerprint(unsigned char *,unsigned int); + +/* + * As name suggests this code is executed prior main(). We use this + * opportunity to fingerprint sequestered code in virtual address + * space of target application. + */ +void FINGERPRINT_premain(void) +{ unsigned char sig[sizeof(FIPS_signature)]; + const unsigned char *p=FINGERPRINT_ascii_value; + unsigned int len=sizeof(sig),i; + + /* "volatilization" is done to disengage unwanted optimization... */ + if (*((volatile unsigned char *)p)=='?') + { if (FIPS_text_start()==NULL) + { fprintf(stderr,"FIPS_text_start() returns NULL\n"); + _exit(1); + } +#if defined(DEBUG_FINGERPRINT_PREMAIN) + fprintf(stderr,".text:%p+%d=%p\n",FIPS_text_start(), + (int)((size_t)FIPS_text_end()-(size_t)FIPS_text_start()), + FIPS_text_end()); + fprintf(stderr,".rodata:%p+%d=%p\n",FIPS_rodata_start, + (int)((size_t)FIPS_rodata_end-(size_t)FIPS_rodata_start), + FIPS_rodata_end); +#endif + + len=FIPS_incore_fingerprint(sig,sizeof(sig)); + + if (len!=sizeof(sig)) + { fprintf(stderr,"fingerprint length mismatch: %u\n",len); + _exit(1); + } + + for (i=0;i<len;i++) printf("%02x",sig[i]); + printf("\n"); + fflush(stdout); + _exit(0); + } + else if (FIPS_signature[0]=='\0') do + { for (i=0;i<sizeof(FIPS_signature);i++,p+=2) + FIPS_signature[i] = (atox(p[0])<<4)|atox(p[1]); + +#if defined(DEBUG_FINGERPRINT_PREMAIN) + if (getenv("OPENSSL_FIPS")==NULL) break; + + len=FIPS_incore_fingerprint(sig,sizeof(sig)); + + if (memcmp(FIPS_signature,sig,sizeof(FIPS_signature))) + { fprintf(stderr,"FINGERPRINT_premain: FIPS_signature mismatch\n"); + _exit(1); + } +#endif + } while(0); +} + +#else + +#include <openssl/bio.h> +#include <openssl/dso.h> +#include <openssl/err.h> + +int main(int argc,char *argv[]) +{ DSO *dso; + DSO_FUNC_TYPE func; + BIO *bio_err; + + if (argc < 2) + { fprintf (stderr,"usage: %s libcrypto.dso\n",argv[0]); + return 1; + } + + if ((bio_err=BIO_new(BIO_s_file())) == NULL) + { fprintf (stderr,"unable to allocate BIO\n"); + return 1; + } + BIO_set_fp(bio_err,stderr,BIO_NOCLOSE|BIO_FP_TEXT); + ERR_load_crypto_strings(); + + dso = DSO_load(NULL,argv[1],NULL,DSO_FLAG_NO_NAME_TRANSLATION); + if (dso == NULL) + { ERR_print_errors(bio_err); + return 1; + } + + /* This is not normally reached, because FINGERPRINT_premain should + * have executed and terminated application already upon DSO_load... */ + func = DSO_bind_func(dso,"FINGERPRINT_premain"); + if (func == NULL) + { ERR_print_errors(bio_err); + return 1; + } + + (*func)(); + + return 0; +} + +#endif diff --git a/lib/libssl/src/fips-1.0/fips_test_suite.c b/lib/libssl/src/fips-1.0/fips_test_suite.c new file mode 100644 index 00000000000..904ff97577d --- /dev/null +++ b/lib/libssl/src/fips-1.0/fips_test_suite.c @@ -0,0 +1,510 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * + * This command is intended as a test driver for the FIPS-140 testing + * lab performing FIPS-140 validation. It demonstrates the use of the + * OpenSSL library ito perform a variety of common cryptographic + * functions. A power-up self test is demonstrated by deliberately + * pointing to an invalid executable hash + * + * Contributed by Steve Marquess. + * + */ +#include <stdio.h> +#include <assert.h> +#include <ctype.h> +#include <string.h> +#include <stdlib.h> +#include <openssl/aes.h> +#include <openssl/des.h> +#include <openssl/rsa.h> +#include <openssl/dsa.h> +#include <openssl/hmac.h> +#include <openssl/fips_sha.h> +#include <openssl/md5.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/bn.h> +#include <openssl/rand.h> +#ifndef OPENSSL_FIPS +int main(int argc, char *argv[]) + { + printf("No FIPS support\n"); + return(0); + } +#else + +/* AES: encrypt and decrypt known plaintext, verify result matches original plaintext +*/ +static int FIPS_aes_test() + { + unsigned char userkey[16] = { 0xde, 0xad, 0xbe, 0xef, 0xfe, 0xed, 0xf0, 0x0d }; + unsigned char plaintext[16] = "etaonrishdlcu"; + unsigned char ciphertext[16]; + unsigned char buf[16]; + AES_KEY key; + AES_KEY dkey; + + ERR_clear_error(); + if (AES_set_encrypt_key( userkey, 128, &key )) + return 0; + AES_encrypt( plaintext, ciphertext, &key); + if (AES_set_decrypt_key( userkey, 128, &dkey )) + return 0; + AES_decrypt( ciphertext, buf, &dkey); + if (memcmp(buf, plaintext, sizeof(buf))) + return 0; + return 1; + } + +/* DES: encrypt and decrypt known plaintext, verify result matches original plaintext +*/ +static int FIPS_des_test() + { + DES_cblock userkey = { 0xde, 0xad, 0xbe, 0xef, 0xfe, 0xed, 0xf0, 0x0d }; + DES_cblock plaintext = { 'e', 't', 'a', 'o', 'n', 'r', 'i', 's' }; + + DES_key_schedule key; + DES_cblock ciphertext; + DES_cblock buf; + + ERR_clear_error(); + if (DES_set_key(&userkey, &key) < 0) + return 0; + DES_ecb_encrypt( &plaintext, &ciphertext, &key, 1); + DES_ecb_encrypt( &ciphertext, &buf, &key, 0); + if (memcmp(buf, plaintext, sizeof(buf))) + return 0; + return 1; + } + +/* DSA: generate key and sign a known digest, then verify the signature + * against the digest +*/ +static int FIPS_dsa_test() + { + DSA *dsa = NULL; + unsigned char dgst[] = "etaonrishdlc"; + unsigned char sig[256]; + unsigned int siglen; + + ERR_clear_error(); + dsa = DSA_generate_parameters(512,NULL,0,NULL,NULL,NULL,NULL); + if (!dsa) + return 0; + if (!DSA_generate_key(dsa)) + return 0; + if ( DSA_sign(0,dgst,sizeof(dgst) - 1,sig,&siglen,dsa) != 1 ) + return 0; + if ( DSA_verify(0,dgst,sizeof(dgst) - 1,sig,siglen,dsa) != 1 ) + return 0; + DSA_free(dsa); + return 1; + } + +/* RSA: generate keys and encrypt and decrypt known plaintext, verify result + * matches the original plaintext +*/ +static int FIPS_rsa_test() + { + RSA *key; + unsigned char input_ptext[] = "etaonrishdlc"; + unsigned char ctext[256]; + unsigned char ptext[256]; + int n; + + ERR_clear_error(); + key = RSA_generate_key(1024,65537,NULL,NULL); + if (!key) + return 0; + n = RSA_size(key); + n = RSA_public_encrypt(sizeof(input_ptext) - 1,input_ptext,ctext,key,RSA_PKCS1_PADDING); + if (n < 0) + return 0; + n = RSA_private_decrypt(n,ctext,ptext,key,RSA_PKCS1_PADDING); + if (n < 0) + return 0; + RSA_free(key); + if (memcmp(input_ptext,ptext,sizeof(input_ptext) - 1)) + return 0; + return 1; + } + +/* SHA1: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_sha1_test() + { + unsigned char digest[SHA_DIGEST_LENGTH] = + { 0x11, 0xf1, 0x9a, 0x3a, 0xec, 0x1a, 0x1e, 0x8e, 0x65, 0xd4, 0x9a, 0x38, 0x0c, 0x8b, 0x1e, 0x2c, 0xe8, 0xb3, 0xc5, 0x18 }; + unsigned char str[] = "etaonrishd"; + + unsigned char md[SHA_DIGEST_LENGTH]; + + ERR_clear_error(); + if (!SHA1(str,sizeof(str) - 1,md)) return 0; + if (memcmp(md,digest,sizeof(md))) + return 0; + return 1; + } + +/* SHA256: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_sha256_test() + { + unsigned char digest[SHA256_DIGEST_LENGTH] = + {0xf5, 0x53, 0xcd, 0xb8, 0xcf, 0x1, 0xee, 0x17, 0x9b, 0x93, 0xc9, 0x68, 0xc0, 0xea, 0x40, 0x91, + 0x6, 0xec, 0x8e, 0x11, 0x96, 0xc8, 0x5d, 0x1c, 0xaf, 0x64, 0x22, 0xe6, 0x50, 0x4f, 0x47, 0x57}; + unsigned char str[] = "etaonrishd"; + + unsigned char md[SHA256_DIGEST_LENGTH]; + + ERR_clear_error(); + if (!SHA256(str,sizeof(str) - 1,md)) return 0; + if (memcmp(md,digest,sizeof(md))) + return 0; + return 1; + } + +/* SHA512: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_sha512_test() + { + unsigned char digest[SHA512_DIGEST_LENGTH] = + {0x99, 0xc9, 0xe9, 0x5b, 0x88, 0xd4, 0x78, 0x88, 0xdf, 0x88, 0x5f, 0x94, 0x71, 0x64, 0x28, 0xca, + 0x16, 0x1f, 0x3d, 0xf4, 0x1f, 0xf3, 0x0f, 0xc5, 0x03, 0x99, 0xb2, 0xd0, 0xe7, 0x0b, 0x94, 0x4a, + 0x45, 0xd2, 0x6c, 0x4f, 0x20, 0x06, 0xef, 0x71, 0xa9, 0x25, 0x7f, 0x24, 0xb1, 0xd9, 0x40, 0x22, + 0x49, 0x54, 0x10, 0xc2, 0x22, 0x9d, 0x27, 0xfe, 0xbd, 0xd6, 0xd6, 0xeb, 0x2d, 0x42, 0x1d, 0xa3}; + unsigned char str[] = "etaonrishd"; + + unsigned char md[SHA512_DIGEST_LENGTH]; + + ERR_clear_error(); + if (!SHA512(str,sizeof(str) - 1,md)) return 0; + if (memcmp(md,digest,sizeof(md))) + return 0; + return 1; + } + +/* HMAC-SHA1: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_hmac_sha1_test() + { + unsigned char key[] = "etaonrishd"; + unsigned char iv[] = "Sample text"; + unsigned char kaval[EVP_MAX_MD_SIZE] = + {0x73, 0xf7, 0xa0, 0x48, 0xf8, 0x94, 0xed, 0xdd, 0x0a, 0xea, 0xea, 0x56, 0x1b, 0x61, 0x2e, 0x70, + 0xb2, 0xfb, 0xec, 0xc6}; + + unsigned char out[EVP_MAX_MD_SIZE]; + unsigned int outlen; + + ERR_clear_error(); + if (!HMAC(EVP_sha1(),key,sizeof(key)-1,iv,sizeof(iv)-1,out,&outlen)) return 0; + if (memcmp(out,kaval,outlen)) + return 0; + return 1; + } + +/* HMAC-SHA224: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_hmac_sha224_test() + { + unsigned char key[] = "etaonrishd"; + unsigned char iv[] = "Sample text"; + unsigned char kaval[EVP_MAX_MD_SIZE] = + {0x75, 0x58, 0xd5, 0xbd, 0x55, 0x6d, 0x87, 0x0f, 0x75, 0xff, 0xbe, 0x1c, 0xb2, 0xf0, 0x20, 0x35, + 0xe5, 0x62, 0x49, 0xb6, 0x94, 0xb9, 0xfc, 0x65, 0x34, 0x33, 0x3a, 0x19}; + + unsigned char out[EVP_MAX_MD_SIZE]; + unsigned int outlen; + + ERR_clear_error(); + if (!HMAC(EVP_sha224(),key,sizeof(key)-1,iv,sizeof(iv)-1,out,&outlen)) return 0; + if (memcmp(out,kaval,outlen)) + return 0; + return 1; + } + +/* HMAC-SHA256: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_hmac_sha256_test() + { + unsigned char key[] = "etaonrishd"; + unsigned char iv[] = "Sample text"; + unsigned char kaval[EVP_MAX_MD_SIZE] = + {0xe9, 0x17, 0xc1, 0x7b, 0x4c, 0x6b, 0x77, 0xda, 0xd2, 0x30, 0x36, 0x02, 0xf5, 0x72, 0x33, 0x87, + 0x9f, 0xc6, 0x6e, 0x7b, 0x7e, 0xa8, 0xea, 0xaa, 0x9f, 0xba, 0xee, 0x51, 0xff, 0xda, 0x24, 0xf4}; + + unsigned char out[EVP_MAX_MD_SIZE]; + unsigned int outlen; + + ERR_clear_error(); + if (!HMAC(EVP_sha256(),key,sizeof(key)-1,iv,sizeof(iv)-1,out,&outlen)) return 0; + if (memcmp(out,kaval,outlen)) + return 0; + return 1; + } + +/* HMAC-SHA384: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_hmac_sha384_test() + { + unsigned char key[] = "etaonrishd"; + unsigned char iv[] = "Sample text"; + unsigned char kaval[EVP_MAX_MD_SIZE] = + {0xb2, 0x9d, 0x40, 0x58, 0x32, 0xc4, 0xe3, 0x31, 0xb6, 0x63, 0x08, 0x26, 0x99, 0xef, 0x3b, 0x10, + 0xe2, 0xdf, 0xf8, 0xff, 0xc6, 0xe1, 0x03, 0x29, 0x81, 0x2a, 0x1b, 0xac, 0xb0, 0x07, 0x39, 0x08, + 0xf3, 0x91, 0x35, 0x11, 0x76, 0xd6, 0x4c, 0x20, 0xfb, 0x4d, 0xc3, 0xf3, 0xb8, 0x9b, 0x88, 0x1c}; + + unsigned char out[EVP_MAX_MD_SIZE]; + unsigned int outlen; + + ERR_clear_error(); + if (!HMAC(EVP_sha384(),key,sizeof(key)-1,iv,sizeof(iv)-1,out,&outlen)) return 0; + if (memcmp(out,kaval,outlen)) + return 0; + return 1; + } + +/* HMAC-SHA512: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int FIPS_hmac_sha512_test() + { + unsigned char key[] = "etaonrishd"; + unsigned char iv[] = "Sample text"; + unsigned char kaval[EVP_MAX_MD_SIZE] = + {0xcd, 0x3e, 0xb9, 0x51, 0xb8, 0xbc, 0x7f, 0x9a, 0x23, 0xaf, 0xf3, 0x77, 0x59, 0x85, 0xa9, 0xe6, + 0xf7, 0xd1, 0x51, 0x96, 0x17, 0xe0, 0x92, 0xd8, 0xa6, 0x3b, 0xc1, 0xad, 0x7e, 0x24, 0xca, 0xb1, + 0xd7, 0x79, 0x0a, 0xa5, 0xea, 0x2c, 0x02, 0x58, 0x0b, 0xa6, 0x52, 0x6b, 0x61, 0x7f, 0xeb, 0x9c, + 0x47, 0x86, 0x5d, 0x74, 0x2b, 0x88, 0xdf, 0xee, 0x46, 0x69, 0x96, 0x3d, 0xa6, 0xd9, 0x2a, 0x53}; + + unsigned char out[EVP_MAX_MD_SIZE]; + unsigned int outlen; + + ERR_clear_error(); + if (!HMAC(EVP_sha512(),key,sizeof(key)-1,iv,sizeof(iv)-1,out,&outlen)) return 0; + if (memcmp(out,kaval,outlen)) + return 0; + return 1; + } + +/* MD5: generate hash of known digest value and compare to known + precomputed correct hash +*/ +static int md5_test() + { + unsigned char digest[MD5_DIGEST_LENGTH] = + { 0x48, 0x50, 0xf0, 0xa3, 0x3a, 0xed, 0xd3, 0xaf, 0x6e, 0x47, 0x7f, 0x83, 0x02, 0xb1, 0x09, 0x68 }; + unsigned char str[] = "etaonrishd"; + + unsigned char md[MD5_DIGEST_LENGTH]; + + ERR_clear_error(); + if (!MD5(str,sizeof(str) - 1,md)) + return 0; + if (memcmp(md,digest,sizeof(md))) + return 0; + return 1; + } + +/* DH: generate shared parameters +*/ +static int dh_test() + { + DH *dh; + + ERR_clear_error(); + dh = DH_generate_parameters(256, 2, NULL, NULL); + if (dh) + return 1; + return 0; + } + +/* Zeroize +*/ +static int Zeroize() + { + RSA *key; + unsigned char userkey[16] = + { 0x48, 0x50, 0xf0, 0xa3, 0x3a, 0xed, 0xd3, 0xaf, 0x6e, 0x47, 0x7f, 0x83, 0x02, 0xb1, 0x09, 0x68 }; + int i, n; + + key = RSA_generate_key(1024,65537,NULL,NULL); + if (!key) + return 0; + n = BN_num_bytes(key->d); + printf(" Generated %d byte RSA private key\n", n); + printf("\tBN key before overwriting:\n%s\n", BN_bn2hex(key->d)); + BN_rand(key->d,n*8,-1,0); + printf("\tBN key after overwriting:\n%s\n", BN_bn2hex(key->d)); + + printf("\tchar buffer key before overwriting: \n\t\t"); + for(i = 0; i < sizeof(userkey); i++) printf("%02x", userkey[i]); + printf("\n"); + RAND_bytes(userkey, sizeof userkey); + printf("\tchar buffer key after overwriting: \n\t\t"); + for(i = 0; i < sizeof(userkey); i++) printf("%02x", userkey[i]); + printf("\n"); + + return 1; + } + +static int Error; +const char * Fail(const char *msg) + { + Error++; + return msg; + } + +int main(int argc,char **argv) + { + + printf("\tFIPS-mode test application\n\n"); + + /* Load entropy from external file, if any */ + RAND_load_file(".rnd", 1024); + + if (argv[1]) { + /* Corrupted KAT tests */ + if (!strcmp(argv[1], "aes")) { + FIPS_corrupt_aes(); + printf("AES encryption/decryption with corrupted KAT...\n"); + } else if (!strcmp(argv[1], "des")) { + FIPS_corrupt_des(); + printf("DES-ECB encryption/decryption with corrupted KAT...\n"); + } else if (!strcmp(argv[1], "dsa")) { + FIPS_corrupt_dsa(); + printf("DSA key generation and signature validation with corrupted KAT...\n"); + } else if (!strcmp(argv[1], "rsa")) { + FIPS_corrupt_rsa(); + printf("RSA key generation and encryption/decryption with corrupted KAT...\n"); + } else if (!strcmp(argv[1], "sha1")) { + FIPS_corrupt_sha1(); + printf("SHA-1 hash with corrupted KAT...\n"); + } else if (!strcmp(argv[1], "rng")) { + FIPS_corrupt_rng(); + printf("RNG test with corrupted KAT...\n"); + } else { + printf("Bad argument \"%s\"\n", argv[1]); + exit(1); + } + if (!FIPS_mode_set(1)) + { + ERR_load_crypto_strings(); + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + printf("Power-up self test failed\n"); + exit(1); + } + printf("Power-up self test successful\n"); + exit(0); + } + + /* Non-Approved cryptographic operation + */ + printf("1. Non-Approved cryptographic operation test...\n"); + printf("\ta. Excluded algorithm (MD5)..."); + printf( md5_test() ? "successful\n" : Fail("FAILED!\n") ); + printf("\tb. Included algorithm (D-H)..."); + printf( dh_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* Power-up self test + */ + ERR_clear_error(); + printf("2. Automatic power-up self test..."); + if (!FIPS_mode_set(1)) + { + ERR_load_crypto_strings(); + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + printf(Fail("FAILED!\n")); + exit(1); + } + printf("successful\n"); + + /* AES encryption/decryption + */ + printf("3. AES encryption/decryption..."); + printf( FIPS_aes_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* RSA key generation and encryption/decryption + */ + printf("4. RSA key generation and encryption/decryption..."); + printf( FIPS_rsa_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* DES-CBC encryption/decryption + */ + printf("5. DES-ECB encryption/decryption..."); + printf( FIPS_des_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* DSA key generation and signature validation + */ + printf("6. DSA key generation and signature validation..."); + printf( FIPS_dsa_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* SHA-1 hash + */ + printf("7a. SHA-1 hash..."); + printf( FIPS_sha1_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* SHA-256 hash + */ + printf("7b. SHA-256 hash..."); + printf( FIPS_sha256_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* SHA-512 hash + */ + printf("7c. SHA-512 hash..."); + printf( FIPS_sha512_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* HMAC-SHA-1 hash + */ + printf("7d. SHA-1 hash..."); + printf( FIPS_hmac_sha1_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* HMAC-SHA-224 hash + */ + printf("7e. SHA-224 hash..."); + printf( FIPS_hmac_sha224_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* HMAC-SHA-256 hash + */ + printf("7f. SHA-256 hash..."); + printf( FIPS_hmac_sha256_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* HMAC-SHA-384 hash + */ + printf("7g. SHA-384 hash..."); + printf( FIPS_hmac_sha384_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* HMAC-SHA-512 hash + */ + printf("7h. SHA-512 hash..."); + printf( FIPS_hmac_sha512_test() ? "successful\n" : Fail("FAILED!\n") ); + + /* Non-Approved cryptographic operation + */ + printf("8. Non-Approved cryptographic operation test...\n"); + printf("\ta. Excluded algorithm (MD5)..."); + printf( md5_test() ? Fail("passed INCORRECTLY!\n") + : "failed as expected\n" ); + printf("\tb. Included algorithm (D-H)..."); + printf( dh_test() ? "successful as expected\n" + : Fail("failed INCORRECTLY!\n") ); + + /* Zeroization + */ + printf("9. Zero-ization...\n"); + Zeroize(); + + printf("\nAll tests completed with %d errors\n", Error); + return 0; + } +#endif diff --git a/lib/libssl/src/fips-1.0/fipshashes.c b/lib/libssl/src/fips-1.0/fipshashes.c new file mode 100644 index 00000000000..b96fe2c51ce --- /dev/null +++ b/lib/libssl/src/fips-1.0/fipshashes.c @@ -0,0 +1,43 @@ +const char * const FIPS_source_hashes[] = { +"HMAC-SHA1(Makefile)= 369e2e023b73789e6af4b8fa2503a7b909c4c3f0", +"HMAC-SHA1(fips.c)= 3a2deb3c319512952bf5547ed92116a7e0db472b", +"HMAC-SHA1(fips_err_wrapper.c)= d3e2be316062510312269e98f964cb87e7577898", +"HMAC-SHA1(fips.h)= 57d602d18efe0594f806fbcc64269e9440638ef4", +"HMAC-SHA1(fips_err.h)= e0649ee1d60c8162f7eeb293f89f3b63ac85202a", +"HMAC-SHA1(fips_locl.h)= f90a23c7f68642727012bbfd48ed58706383ad71", +"HMAC-SHA1(fips_canister.c)= da6d0f5daf9594881fd060773a5f3e057ba302ff", +"HMAC-SHA1(fips_premain.c)= 6a08d15c578f1258246181bf52134ae974aa5a80", +"HMAC-SHA1(aes/fips_aes_core.c)= b70bbbd675efe0613da0d57055310926a0104d55", +"HMAC-SHA1(aes/asm/fips-ax86-elf.s)= f797b524a79196e7f59458a5b223432fcfd4a868", +"HMAC-SHA1(aes/fips_aes_selftest.c)= 98b01502221e7fe529fd981222f2cbb52eb4cbe0", +"HMAC-SHA1(aes/fips_aes_locl.h)= a98eb0aa449f1d95b8064e261b2ac2b1f328685e", +"HMAC-SHA1(des/fips_des_enc.c)= 9527f8ea81602358f1aa11348237fdb1e9eeff32", +"HMAC-SHA1(des/asm/fips-dx86-elf.s)= 9570b03422ffbe5d3d090f91758ebfd46acd5d57", +"HMAC-SHA1(des/fips_des_selftest.c)= 3bc574e51647c5f5ab45d1007b2cf461d67764a9", +"HMAC-SHA1(des/fips_set_key.c)= cd1ba25d29376849523a9ddc194c3156a8a7a913", +"HMAC-SHA1(des/fips_des_locl.h)= e008da40dc6913e374edd66a20d44e1752f00583", +"HMAC-SHA1(dh/fips_dh_check.c)= 63347e2007e224381d4a7b6d871633889de72cf3", +"HMAC-SHA1(dh/fips_dh_gen.c)= 93fe69b758ca9d70d70cda1c57fff4eb5c668e85", +"HMAC-SHA1(dh/fips_dh_key.c)= 2d79eb8d59929ec129d34f53b5aded4a290a28ca", +"HMAC-SHA1(dsa/fips_dsa_ossl.c)= 2fadb271897a775f023393aa22ddede8a76eec0d", +"HMAC-SHA1(dsa/fips_dsa_gen.c)= 78c879484fd849312ca4828b957df3842b70efc0", +"HMAC-SHA1(dsa/fips_dsa_selftest.c)= 7c2ba8d82feda2aadc8b769a3b6c4c25a6356e01", +"HMAC-SHA1(rand/fips_rand.c)= 7e3964447a81cfe4e75df981827d14a5fe0c2923", +"HMAC-SHA1(rand/fips_rand.h)= bf009ea8963e79b1e414442ede9ae7010a03160b", +"HMAC-SHA1(rand/fips_rand_selftest.c)= 5661f383decf0708d0230409fe1564223e834a3b", +"HMAC-SHA1(rsa/fips_rsa_eay.c)= 2512f849a220daa083f346b10effdb2ee96d4395", +"HMAC-SHA1(rsa/fips_rsa_gen.c)= 577466931c054d99caf4ac2aefff0e35efd94024", +"HMAC-SHA1(rsa/fips_rsa_selftest.c)= a9dc47bd1001f795d1565111d26433c300101e06", +"HMAC-SHA1(rsa/fips_rsa_x931g.c)= 1827d381bb21c53a38a7194cb1c428a2b5f1e3ab", +"HMAC-SHA1(sha/fips_sha1dgst.c)= 26e529d630b5e754b4a29bd1bb697e991e7fdc04", +"HMAC-SHA1(sha/fips_standalone_sha1.c)= 46a66875e68398eabca2e933958a2d865149ca1b", +"HMAC-SHA1(sha/fips_sha1_selftest.c)= a08f9c1e2c0f63b9aa96b927c0333a03b020749f", +"HMAC-SHA1(sha/asm/fips-sx86-elf.s)= ae66fb23ab8e1a2287e87a0a2dd30a4b9039fe63", +"HMAC-SHA1(sha/fips_sha_locl.h)= 30b6d6bdbdc9db0d66dc89010c1f4fe1c7b60574", +"HMAC-SHA1(sha/fips_md32_common.h)= c34d8b7785d3194ff968cf6d3efdd2bfcaec1fad", +"HMAC-SHA1(sha/fips_sha.h)= cbe98c211cff1684adfa3fe6e6225e92a0a25f6c", +"HMAC-SHA1(sha/fips_sha256.c)= 97e6dee22a1fe993cc48aa8ff37af10701d7f599", +"HMAC-SHA1(sha/fips_sha512.c)= 74e6ef26de96f774d233888b831289e69834dd79", +"HMAC-SHA1(hmac/fips_hmac.c)= a477cec1da76c0092979c4a875b6469339bff7ef", +"HMAC-SHA1(hmac/fips_hmac_selftest.c)= ebb32b205babf4300017de767fd6e3f1879765c9", +}; diff --git a/lib/libssl/src/fips-1.0/fipsld b/lib/libssl/src/fips-1.0/fipsld new file mode 100755 index 00000000000..819f68731f0 --- /dev/null +++ b/lib/libssl/src/fips-1.0/fipsld @@ -0,0 +1,147 @@ +#!/bin/sh -e +# +# Copyright (c) 2005 The OpenSSL Project. +# +# Depending on output file name, the script either embeds fingerprint +# into libcrypto.so or static application. "Static" refers to static +# libcrypto.a, not [necessarily] application per se. +# +# Even though this script is called fipsld, it expects C compiler +# command line syntax and $FIPSLD_CC or $CC environment variable set +# and can even be used to compile source files. + +#set -x + +CC=${FIPSLD_CC:-${CC}} +[ -n "${CC}" ] || { echo '$CC is not defined'; exit 1; } + +# Initially -c wasn't intended to be interpreted here, but it might +# make life easier for those who want to build FIPS-ified applications +# with minimal [if any] modifications to their Makefiles... +( while [ "x$1" != "x" -a "x$1" != "x-c" ]; do shift; done; + [ $# -ge 1 ] +) && exec ${CC} "$@" + +# Turn on debugging output? +( while [ "x$1" != "x" -a "x$1" != "x-DDEBUG_FINGERPRINT_PREMAIN" ]; do shift; done; + [ $# -ge 1 ] +) && set -x + +TARGET=`(while [ "x$1" != "x" -a "x$1" != "x-o" ]; do shift; done; echo $2)` +[ -n "${TARGET}" ] || { echo 'no -o specified'; exit 1; } + +THERE="`echo $0 | sed -e 's|[^/]*$||'`".. + +# Location of installed validated FIPS module +FIPSLIBDIR=${FIPSLIBDIR:-/usr/local/ssl/lib} +# If this is a build from a validated tarball use this instead +# FIPSLIBDIR=${THERE}/fips-1.0 + +[ -f "${FIPSLIBDIR}/fipscanister.o" ] || + { echo "fipscanister.o not found"; exit 1; } + +HMAC_KEY="etaonrishdlcupfm" + +case "`(uname -s) 2>/dev/null`" in +OSF1|IRIX*) _WL_PREMAIN="-Wl,-init,FINGERPRINT_premain" ;; +HP-UX) _WL_PREMAIN="-Wl,+init,FINGERPRINT_premain" ;; +AIX) _WL_PREMAIN="-Wl,-binitfini:FINGERPRINT_premain";; +Darwin) ( while [ "x$1" != "x" -a "x$1" != "x-dynamiclib" ]; do shift; done; + [ $# -ge 1 ] + ) && _WL_PREMAIN="-Wl,-init,_FINGERPRINT_premain" ;; +esac + +case "${TARGET}" in +[!/]*) TARGET=./${TARGET} ;; +esac + +case "${TARGET}" in +*libcrypto*|*.dll) # must be linking a shared lib... + # Shared lib creation can be taking place in the source + # directory only!!! + FINGERTYPE="${THERE}/fips-1.0/sha/fips_standalone_sha1" + CANISTER_O="${FIPSLIBDIR}/fipscanister.o" + PREMAIN_C="${FIPSLIBDIR}/fips_premain.c" + +echo Canister: $CANISTER_O + + # verify fipscanister.o against its detached signature... + ${FINGERTYPE} "${CANISTER_O}" | sed "s/(.*\//(/" | \ + diff -w "${CANISTER_O}.sha1" - || \ + { echo "${CANISTER_O} fingerprint mismatch"; exit 1; } + + # verify fips_premain.c against its signature embedded into + # fipscanister.o... + SIG=`${FINGERTYPE} "${PREMAIN_C}" | sed -n "s/(.*\//(/;/^./p"` + REF=`strings "${CANISTER_O}" | grep "HMAC-SHA1(fips_premain\\.c)"` + [ "${SIG}" = "${REF}" ] || \ + { echo "${PREMAIN_C} fingerprint mismatch"; exit 1; } + + # Temporarily remove fipscanister.o from libcrypto.a! + # We are required to use the standalone copy... + trap 'ar r "${THERE}/libcrypto.a" "${CANISTER_O}"; + (ranlib "${THERE}/libcrypto.a") 2>/dev/null; + sleep 1; + touch -c "${TARGET}"' 0 + + ar d "${THERE}/libcrypto.a" fipscanister.o 2>&1 > /dev/null || : + (ranlib "${THERE}/libcrypto.a") 2>/dev/null || : + + ${CC} "${CANISTER_O}" \ + "${PREMAIN_C}" \ + ${_WL_PREMAIN} "$@" + + # generate signature... + SIG=`("${THERE}/fips-1.0/fips_premain_dso" "${TARGET}" || rm "${TARGET}")` + if [ -z "${SIG}" ]; then + echo "unable to collect signature"; exit 1 + fi + + # recompile with signature... + ${CC} "${CANISTER_O}" \ + -DHMAC_SHA1_SIG=\"${SIG}\" "${PREMAIN_C}" \ + ${_WL_PREMAIN} "$@" + ;; + +*) # must be linking statically... + # Static linking can be taking place either in the source + # directory or off the installed binary target destination. + if [ -x "${THERE}/fips-1.0/sha/fips_standalone_sha1" ]; then + FINGERTYPE="${THERE}/fips-1.0/sha/fips_standalone_sha1" + else # Installed tree is expected to contain + # lib/fipscanister.o, lib/fipscanister.o.sha1 and + # lib/fips_premain.c [not to mention bin/openssl]. + FINGERTYPE="${THERE}/bin/openssl sha1 -hmac ${HMAC_KEY}" + fi + + CANISTER_O="${FIPSLIBDIR}/fipscanister.o" + PREMAIN_C="${FIPSLIBDIR}/fips_premain.c" + + # verify fipscanister.o against its detached signature... + ${FINGERTYPE} "${CANISTER_O}" | sed "s/(.*\//(/" | \ + diff -w "${CANISTER_O}.sha1" - || \ + { echo "${CANISTER_O} fingerprint mismatch"; exit 1; } + + # verify fips_premain.c against its signature embedded into + # fipscanister.o... + SIG=`${FINGERTYPE} "${PREMAIN_C}" | sed -n "s/(.*\//(/;/^./p"` + REF=`strings "${CANISTER_O}" | grep "HMAC-SHA1(fips_premain\\.c)"` + [ "${SIG}" = "${REF}" ] || \ + { echo "${PREMAIN_C} fingerprint mismatch"; exit 1; } + + ${CC} "${CANISTER_O}" \ + "${PREMAIN_C}" \ + ${_WL_PREMAIN} "$@" + + # generate signature... + SIG=`("${TARGET}" || /bin/rm "${TARGET}")` + if [ -z "${SIG}" ]; then + echo "unable to collect signature"; exit 1 + fi + + # recompile with signature... + ${CC} "${CANISTER_O}" \ + -DHMAC_SHA1_SIG=\"${SIG}\" "${PREMAIN_C}" \ + ${_WL_PREMAIN} "$@" + ;; +esac diff --git a/lib/libssl/src/fips-1.0/hmac/Makefile b/lib/libssl/src/fips-1.0/hmac/Makefile new file mode 100644 index 00000000000..a5e777f71ae --- /dev/null +++ b/lib/libssl/src/fips-1.0/hmac/Makefile @@ -0,0 +1,155 @@ +# +# OpenSSL/fips-1.0/hmac/Makefile +# + +DIR= hmac +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST=fips_hmactest.c +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_hmac.c fips_hmac_selftest.c +LIBOBJ=fips_hmac.o fips_hmac_selftest.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +Q=../testvectors/hmac/req +A=../testvectors/hmac/rsp + +fips_test: + -rm -rf $(A) + mkdir $(A) + if [ -f $(Q)/HMAC.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_hmactest < $(Q)/HMAC.req > $(A)/HMAC.rsp; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_hmac.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_hmac.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_hmac.o: ../../include/openssl/bn.h ../../include/openssl/cast.h +fips_hmac.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_hmac.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_hmac.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_hmac.o: ../../include/openssl/evp.h ../../include/openssl/hmac.h +fips_hmac.o: ../../include/openssl/idea.h ../../include/openssl/md2.h +fips_hmac.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_hmac.o: ../../include/openssl/mdc2.h ../../include/openssl/obj_mac.h +fips_hmac.o: ../../include/openssl/objects.h +fips_hmac.o: ../../include/openssl/opensslconf.h +fips_hmac.o: ../../include/openssl/opensslv.h ../../include/openssl/ossl_typ.h +fips_hmac.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_hmac.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_hmac.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_hmac.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_hmac.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_hmac.o: ../../include/openssl/ui_compat.h fips_hmac.c +fips_hmac_selftest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_hmac_selftest.o: ../../include/openssl/bio.h +fips_hmac_selftest.o: ../../include/openssl/blowfish.h +fips_hmac_selftest.o: ../../include/openssl/bn.h ../../include/openssl/cast.h +fips_hmac_selftest.o: ../../include/openssl/crypto.h +fips_hmac_selftest.o: ../../include/openssl/des.h +fips_hmac_selftest.o: ../../include/openssl/des_old.h +fips_hmac_selftest.o: ../../include/openssl/dh.h ../../include/openssl/dsa.h +fips_hmac_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_hmac_selftest.o: ../../include/openssl/evp.h ../../include/openssl/fips.h +fips_hmac_selftest.o: ../../include/openssl/hmac.h ../../include/openssl/idea.h +fips_hmac_selftest.o: ../../include/openssl/lhash.h ../../include/openssl/md2.h +fips_hmac_selftest.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_hmac_selftest.o: ../../include/openssl/mdc2.h +fips_hmac_selftest.o: ../../include/openssl/obj_mac.h +fips_hmac_selftest.o: ../../include/openssl/objects.h +fips_hmac_selftest.o: ../../include/openssl/opensslconf.h +fips_hmac_selftest.o: ../../include/openssl/opensslv.h +fips_hmac_selftest.o: ../../include/openssl/ossl_typ.h +fips_hmac_selftest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_hmac_selftest.o: ../../include/openssl/rc5.h +fips_hmac_selftest.o: ../../include/openssl/ripemd.h +fips_hmac_selftest.o: ../../include/openssl/rsa.h +fips_hmac_selftest.o: ../../include/openssl/safestack.h +fips_hmac_selftest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_hmac_selftest.o: ../../include/openssl/symhacks.h +fips_hmac_selftest.o: ../../include/openssl/ui.h +fips_hmac_selftest.o: ../../include/openssl/ui_compat.h fips_hmac_selftest.c +fips_hmactest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_hmactest.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_hmactest.o: ../../include/openssl/bn.h ../../include/openssl/buffer.h +fips_hmactest.o: ../../include/openssl/cast.h ../../include/openssl/conf.h +fips_hmactest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_hmactest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_hmactest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_hmactest.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_hmactest.o: ../../include/openssl/hmac.h ../../include/openssl/idea.h +fips_hmactest.o: ../../include/openssl/lhash.h ../../include/openssl/md2.h +fips_hmactest.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_hmactest.o: ../../include/openssl/mdc2.h ../../include/openssl/obj_mac.h +fips_hmactest.o: ../../include/openssl/objects.h +fips_hmactest.o: ../../include/openssl/opensslconf.h +fips_hmactest.o: ../../include/openssl/opensslv.h +fips_hmactest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/pkcs7.h +fips_hmactest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_hmactest.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_hmactest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_hmactest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_hmactest.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_hmactest.o: ../../include/openssl/ui_compat.h ../../include/openssl/x509.h +fips_hmactest.o: ../../include/openssl/x509_vfy.h +fips_hmactest.o: ../../include/openssl/x509v3.h fips_hmactest.c diff --git a/lib/libssl/src/fips-1.0/hmac/fips_hmac.c b/lib/libssl/src/fips-1.0/hmac/fips_hmac.c new file mode 100644 index 00000000000..b36f1637489 --- /dev/null +++ b/lib/libssl/src/fips-1.0/hmac/fips_hmac.c @@ -0,0 +1,190 @@ +/* crypto/hmac/hmac.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <openssl/hmac.h> + +#ifdef OPENSSL_FIPS + +void HMAC_Init_ex(HMAC_CTX *ctx, const void *key, int len, + const EVP_MD *md, ENGINE *impl) + { + int i,j,reset=0; + unsigned char pad[HMAC_MAX_MD_CBLOCK]; + + if (md != NULL) + { + reset=1; + ctx->md=md; + } + else + md=ctx->md; + + if (key != NULL) + { + if (FIPS_mode() && !(md->flags & EVP_MD_FLAG_FIPS) + && (!(ctx->md_ctx.flags & EVP_MD_CTX_FLAG_NON_FIPS_ALLOW) + || !(ctx->i_ctx.flags & EVP_MD_CTX_FLAG_NON_FIPS_ALLOW) + || !(ctx->o_ctx.flags & EVP_MD_CTX_FLAG_NON_FIPS_ALLOW))) + OpenSSLDie(__FILE__,__LINE__, + "HMAC: digest not allowed in FIPS mode"); + + reset=1; + j=EVP_MD_block_size(md); + OPENSSL_assert(j <= sizeof ctx->key); + if (j < len) + { + EVP_DigestInit_ex(&ctx->md_ctx,md, impl); + EVP_DigestUpdate(&ctx->md_ctx,key,len); + EVP_DigestFinal_ex(&(ctx->md_ctx),ctx->key, + &ctx->key_length); + } + else + { + OPENSSL_assert(len <= sizeof ctx->key); + memcpy(ctx->key,key,len); + ctx->key_length=len; + } + if(ctx->key_length != HMAC_MAX_MD_CBLOCK) + memset(&ctx->key[ctx->key_length], 0, + HMAC_MAX_MD_CBLOCK - ctx->key_length); + } + + if (reset) + { + for (i=0; i<HMAC_MAX_MD_CBLOCK; i++) + pad[i]=0x36^ctx->key[i]; + EVP_DigestInit_ex(&ctx->i_ctx,md, impl); + EVP_DigestUpdate(&ctx->i_ctx,pad,EVP_MD_block_size(md)); + + for (i=0; i<HMAC_MAX_MD_CBLOCK; i++) + pad[i]=0x5c^ctx->key[i]; + EVP_DigestInit_ex(&ctx->o_ctx,md, impl); + EVP_DigestUpdate(&ctx->o_ctx,pad,EVP_MD_block_size(md)); + } + EVP_MD_CTX_copy_ex(&ctx->md_ctx,&ctx->i_ctx); + } + +void HMAC_Init(HMAC_CTX *ctx, const void *key, int len, + const EVP_MD *md) + { + if(key && md) + HMAC_CTX_init(ctx); + HMAC_Init_ex(ctx,key,len,md, NULL); + } + +void HMAC_Update(HMAC_CTX *ctx, const unsigned char *data, int len) + { + EVP_DigestUpdate(&ctx->md_ctx,data,len); + } + +void HMAC_Final(HMAC_CTX *ctx, unsigned char *md, unsigned int *len) + { + int j; + unsigned int i; + unsigned char buf[EVP_MAX_MD_SIZE]; + + j=EVP_MD_block_size(ctx->md); + + EVP_DigestFinal_ex(&ctx->md_ctx,buf,&i); + EVP_MD_CTX_copy_ex(&ctx->md_ctx,&ctx->o_ctx); + EVP_DigestUpdate(&ctx->md_ctx,buf,i); + EVP_DigestFinal_ex(&ctx->md_ctx,md,len); + } + +void HMAC_CTX_init(HMAC_CTX *ctx) + { + EVP_MD_CTX_init(&ctx->i_ctx); + EVP_MD_CTX_init(&ctx->o_ctx); + EVP_MD_CTX_init(&ctx->md_ctx); + } + +void HMAC_CTX_cleanup(HMAC_CTX *ctx) + { + EVP_MD_CTX_cleanup(&ctx->i_ctx); + EVP_MD_CTX_cleanup(&ctx->o_ctx); + EVP_MD_CTX_cleanup(&ctx->md_ctx); + memset(ctx,0,sizeof *ctx); + } + +unsigned char *HMAC(const EVP_MD *evp_md, const void *key, int key_len, + const unsigned char *d, int n, unsigned char *md, + unsigned int *md_len) + { + HMAC_CTX c; + static unsigned char m[EVP_MAX_MD_SIZE]; + + if (md == NULL) md=m; + HMAC_CTX_init(&c); + HMAC_Init(&c,key,key_len,evp_md); + HMAC_Update(&c,d,n); + HMAC_Final(&c,md,md_len); + HMAC_CTX_cleanup(&c); + return(md); + } + +void HMAC_CTX_set_flags(HMAC_CTX *ctx, unsigned long flags) + { + EVP_MD_CTX_set_flags(&ctx->i_ctx, flags); + EVP_MD_CTX_set_flags(&ctx->o_ctx, flags); + EVP_MD_CTX_set_flags(&ctx->md_ctx, flags); + } + +#endif + diff --git a/lib/libssl/src/fips-1.0/hmac/fips_hmac_selftest.c b/lib/libssl/src/fips-1.0/hmac/fips_hmac_selftest.c new file mode 100644 index 00000000000..fc599b75efc --- /dev/null +++ b/lib/libssl/src/fips-1.0/hmac/fips_hmac_selftest.c @@ -0,0 +1,135 @@ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/hmac.h> + +#ifdef OPENSSL_FIPS +typedef struct { + const EVP_MD *(*alg)(void); + const char *key, *iv; + unsigned char kaval[EVP_MAX_MD_SIZE]; +} HMAC_KAT; + +static const HMAC_KAT vector[] = { + { EVP_sha1, + /* from http://csrc.nist.gov/publications/fips/fips198/fips-198a.pdf */ + "0123456789:;<=>?@ABC", + "Sample #2", + { 0x09,0x22,0xd3,0x40,0x5f,0xaa,0x3d,0x19, + 0x4f,0x82,0xa4,0x58,0x30,0x73,0x7d,0x5c, + 0xc6,0xc7,0x5d,0x24 } + }, + { EVP_sha224, + /* just keep extending the above... */ + "0123456789:;<=>?@ABC", + "Sample #2", + { 0xdd,0xef,0x0a,0x40,0xcb,0x7d,0x50,0xfb, + 0x6e,0xe6,0xce,0xa1,0x20,0xba,0x26,0xaa, + 0x08,0xf3,0x07,0x75,0x87,0xb8,0xad,0x1b, + 0x8c,0x8d,0x12,0xc7 } + }, + { EVP_sha256, + "0123456789:;<=>?@ABC", + "Sample #2", + { 0xb8,0xf2,0x0d,0xb5,0x41,0xea,0x43,0x09, + 0xca,0x4e,0xa9,0x38,0x0c,0xd0,0xe8,0x34, + 0xf7,0x1f,0xbe,0x91,0x74,0xa2,0x61,0x38, + 0x0d,0xc1,0x7e,0xae,0x6a,0x34,0x51,0xd9 } + }, + { EVP_sha384, + "0123456789:;<=>?@ABC", + "Sample #2", + { 0x08,0xbc,0xb0,0xda,0x49,0x1e,0x87,0xad, + 0x9a,0x1d,0x6a,0xce,0x23,0xc5,0x0b,0xf6, + 0xb7,0x18,0x06,0xa5,0x77,0xcd,0x49,0x04, + 0x89,0xf1,0xe6,0x23,0x44,0x51,0x51,0x9f, + 0x85,0x56,0x80,0x79,0x0c,0xbd,0x4d,0x50, + 0xa4,0x5f,0x29,0xe3,0x93,0xf0,0xe8,0x7f } + }, + { EVP_sha512, + "0123456789:;<=>?@ABC", + "Sample #2", + { 0x80,0x9d,0x44,0x05,0x7c,0x5b,0x95,0x41, + 0x05,0xbd,0x04,0x13,0x16,0xdb,0x0f,0xac, + 0x44,0xd5,0xa4,0xd5,0xd0,0x89,0x2b,0xd0, + 0x4e,0x86,0x64,0x12,0xc0,0x90,0x77,0x68, + 0xf1,0x87,0xb7,0x7c,0x4f,0xae,0x2c,0x2f, + 0x21,0xa5,0xb5,0x65,0x9a,0x4f,0x4b,0xa7, + 0x47,0x02,0xa3,0xde,0x9b,0x51,0xf1,0x45, + 0xbd,0x4f,0x25,0x27,0x42,0x98,0x99,0x05 } + }, +}; + +int FIPS_selftest_hmac() + { + int n; + unsigned int outlen; + unsigned char out[EVP_MAX_MD_SIZE]; + const EVP_MD *md; + const HMAC_KAT *t; + + for(n=0,t=vector; n<sizeof(vector)/sizeof(vector[0]); n++,t++) + { + md = (*t->alg)(); + HMAC(md,t->key,strlen(t->key), + (const unsigned char *)t->iv,strlen(t->iv), + out,&outlen); + + if(memcmp(out,t->kaval,outlen)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_SHA,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + return 1; + } +#endif diff --git a/lib/libssl/src/fips-1.0/hmac/fips_hmactest.c b/lib/libssl/src/fips-1.0/hmac/fips_hmactest.c new file mode 100644 index 00000000000..e26e33ee3f3 --- /dev/null +++ b/lib/libssl/src/fips-1.0/hmac/fips_hmactest.c @@ -0,0 +1,335 @@ +/* fips_hmactest.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#include <openssl/bio.h> +#include <openssl/evp.h> +#include <openssl/hmac.h> +#include <openssl/err.h> +#include <openssl/x509v3.h> + +#ifndef OPENSSL_FIPS + +int main(int argc, char *argv[]) +{ + printf("No FIPS HMAC support\n"); + return(0); +} + +#else + +static int hmac_test(BIO *err, const EVP_MD *md, BIO *out, BIO *in); +static int print_hmac(BIO *err, const EVP_MD *md, BIO *out, + unsigned char *Key, int Klen, + unsigned char *Msg, int Msglen, int Tlen); + +int main(int argc, char **argv) + { + BIO *in = NULL, *out = NULL, *err = NULL; + + int ret = 1; + + ERR_load_crypto_strings(); + + err = BIO_new_fp(stderr, BIO_NOCLOSE); + + if (!err) + { + fprintf(stderr, "FATAL stderr initialization error\n"); + goto end; + } + + if(!FIPS_mode_set(1)) + { + ERR_print_errors(err); + goto end; + } + + if (argc == 1) + in = BIO_new_fp(stdin, BIO_NOCLOSE); + else + in = BIO_new_file(argv[1], "r"); + + if (argc < 2) + out = BIO_new_fp(stdout, BIO_NOCLOSE); + else + out = BIO_new_file(argv[2], "w"); + + if (!in) + { + BIO_printf(err, "FATAL input initialization error\n"); + goto end; + } + + if (!out) + { + fprintf(stderr, "FATAL output initialization error\n"); + goto end; + } + + if (!hmac_test(err, EVP_sha1(), out, in)) + { + fprintf(stderr, "FATAL hmac file processing error\n"); + goto end; + } + else + ret = 0; + + end: + + if (ret && err) + ERR_print_errors(err); + + if (in) + BIO_free(in); + if (out) + BIO_free(out); + if (err) + BIO_free(err); + + return ret; + + } + +#define HMAC_TEST_MAXLINELEN 1024 + +int hmac_test(BIO *err, const EVP_MD *md, BIO *out, BIO *in) + { + char *linebuf, *olinebuf, *p, *q; + char *keyword, *value; + unsigned char *Key = NULL, *Msg = NULL; + int Count, Klen, Tlen; + long Keylen, Msglen; + int ret = 0; + int lnum = 0; + + olinebuf = OPENSSL_malloc(HMAC_TEST_MAXLINELEN); + linebuf = OPENSSL_malloc(HMAC_TEST_MAXLINELEN); + + if (!linebuf || !olinebuf) + goto error; + + Count = -1; + Klen = -1; + Tlen = -1; + + while (BIO_gets(in, olinebuf, HMAC_TEST_MAXLINELEN) > 0) + { + lnum++; + strcpy(linebuf, olinebuf); + keyword = linebuf; + /* Skip leading space */ + while (isspace((unsigned char)*keyword)) + keyword++; + + /* Look for = sign */ + p = strchr(linebuf, '='); + + /* If no = or starts with [ (for [L=20] line) just copy */ + if (!p) + { + if (!BIO_puts(out, olinebuf)) + goto error; + continue; + } + + q = p - 1; + + /* Remove trailing space */ + while (isspace((unsigned char)*q)) + *q-- = 0; + + *p = 0; + value = p + 1; + + /* Remove leading space from value */ + while (isspace((unsigned char)*value)) + value++; + + /* Remove trailing space from value */ + p = value + strlen(value) - 1; + + while (*p == '\n' || isspace((unsigned char)*p)) + *p-- = 0; + + if (!strcmp(keyword,"[L") && *p==']') + { + switch (atoi(value)) + { + case 20: md=EVP_sha1(); break; + case 28: md=EVP_sha224(); break; + case 32: md=EVP_sha256(); break; + case 48: md=EVP_sha384(); break; + case 64: md=EVP_sha512(); break; + default: goto parse_error; + } + } + else if (!strcmp(keyword, "Count")) + { + if (Count != -1) + goto parse_error; + Count = atoi(value); + if (Count < 0) + goto parse_error; + } + else if (!strcmp(keyword, "Klen")) + { + if (Klen != -1) + goto parse_error; + Klen = atoi(value); + if (Klen < 0) + goto parse_error; + } + else if (!strcmp(keyword, "Tlen")) + { + if (Tlen != -1) + goto parse_error; + Tlen = atoi(value); + if (Tlen < 0) + goto parse_error; + } + else if (!strcmp(keyword, "Msg")) + { + if (Msg) + goto parse_error; + Msg = string_to_hex(value, &Msglen); + if (!Msg) + goto parse_error; + } + else if (!strcmp(keyword, "Key")) + { + if (Key) + goto parse_error; + Key = string_to_hex(value, &Keylen); + if (!Key) + goto parse_error; + } + else if (!strcmp(keyword, "Mac")) + continue; + else + goto parse_error; + + BIO_puts(out, olinebuf); + + if (Key && Msg && (Tlen > 0) && (Klen > 0)) + { + if (!print_hmac(err, md, out, Key, Klen, Msg, Msglen, Tlen)) + goto error; + OPENSSL_free(Key); + Key = NULL; + OPENSSL_free(Msg); + Msg = NULL; + Klen = -1; + Tlen = -1; + Count = -1; + } + + } + + + ret = 1; + + + error: + + if (olinebuf) + OPENSSL_free(olinebuf); + if (linebuf) + OPENSSL_free(linebuf); + if (Key) + OPENSSL_free(Key); + if (Msg) + OPENSSL_free(Msg); + + return ret; + + parse_error: + + BIO_printf(err, "FATAL parse error processing line %d\n", lnum); + + goto error; + + } + +static int print_hmac(BIO *err, const EVP_MD *emd, BIO *out, + unsigned char *Key, int Klen, + unsigned char *Msg, int Msglen, int Tlen) + { + int i, mdlen; + unsigned char md[EVP_MAX_MD_SIZE]; + if (!HMAC(emd, Key, Klen, Msg, Msglen, md, + (unsigned int *)&mdlen)) + { + BIO_puts(err, "Error calculating HMAC\n"); + return 0; + } + if (Tlen > mdlen) + { + BIO_puts(err, "Parameter error, Tlen > HMAC length\n"); + return 0; + } + BIO_puts(out, "Mac = "); + for (i = 0; i < Tlen; i++) + BIO_printf(out, "%02x", md[i]); + BIO_puts(out, "\n"); + return 1; + } + +#endif diff --git a/lib/libssl/src/fips-1.0/install.com b/lib/libssl/src/fips-1.0/install.com new file mode 100644 index 00000000000..8867fcf4c0c --- /dev/null +++ b/lib/libssl/src/fips-1.0/install.com @@ -0,0 +1,57 @@ +$! INSTALL.COM -- Installs the files in a given directory tree +$! +$! Author: Richard Levitte <richard@levitte.org> +$! Time of creation: 27-MAY-2004 11:47 +$! +$! P1 root of the directory tree +$! +$ IF P1 .EQS. "" +$ THEN +$ WRITE SYS$OUTPUT "First argument missing." +$ WRITE SYS$OUTPUT "Should be the directory where you want things installed." +$ EXIT +$ ENDIF +$ +$ ROOT = F$PARSE(P1,"[]A.;0",,,"SYNTAX_ONLY,NO_CONCEAL") - "A.;0" +$ ROOT_DEV = F$PARSE(ROOT,,,"DEVICE","SYNTAX_ONLY") +$ ROOT_DIR = F$PARSE(ROOT,,,"DIRECTORY","SYNTAX_ONLY") - + - "[000000." - "][" - "[" - "]" +$ ROOT = ROOT_DEV + "[" + ROOT_DIR +$ +$ DEFINE/NOLOG WRK_SSLROOT 'ROOT'.] /TRANS=CONC +$ DEFINE/NOLOG WRK_SSLINCLUDE WRK_SSLROOT:[INCLUDE] +$ +$ IF F$PARSE("WRK_SSLROOT:[000000]") .EQS. "" THEN - + CREATE/DIR/LOG WRK_SSLROOT:[000000] +$ IF F$PARSE("WRK_SSLINCLUDE:") .EQS. "" THEN - + CREATE/DIR/LOG WRK_SSLINCLUDE: +$ +$ FDIRS := ,RAND,SHA1,DES,AES,DSA,RSA,DH,HMAC +$ EXHEADER_ := fips.h +$ EXHEADER_SHA := fips_sha.h +$ EXHEADER_RAND := fips_rand.h +$ EXHEADER_DES := +$ EXHEADER_AES := +$ EXHEADER_DSA := +$ EXHEADER_RSA := +$ EXHEADER_DH := +$ EXHEADER_HMAC := +$ +$ I = 0 +$ LOOP_FDIRS: +$ D = F$EDIT(F$ELEMENT(I, ",", FDIRS),"TRIM") +$ I = I + 1 +$ IF D .EQS. "," THEN GOTO LOOP_FDIRS_END +$ tmp = EXHEADER_'D' +$ IF tmp .EQS. "" THEN GOTO LOOP_FDIRS +$ IF D .EQS. "" +$ THEN +$ COPY 'tmp' WRK_SSLINCLUDE: /LOG +$ ELSE +$ COPY [.'D']'tmp' WRK_SSLINCLUDE: /LOG +$ ENDIF +$ SET FILE/PROT=WORLD:RE WRK_SSLINCLUDE:'tmp' +$ GOTO LOOP_FDIRS +$ LOOP_FDIRS_END: +$ +$ EXIT diff --git a/lib/libssl/src/fips-1.0/openssl_fips_fingerprint b/lib/libssl/src/fips-1.0/openssl_fips_fingerprint new file mode 100755 index 00000000000..f59a67d537d --- /dev/null +++ b/lib/libssl/src/fips-1.0/openssl_fips_fingerprint @@ -0,0 +1,31 @@ +#!/bin/sh +# +# Check the library fingerprint and generate an executable fingerprint, or +# return an error + +lib=$1 +exe=$2 +ext=${HMAC_EXT:-sha1} + +# deal with the case where we're run from within the build and OpenSSL is +# not yet installed. Also, make sure LD_LIBRARY_PATH is properly set in +# case shared libraries are built. +if [ "X$TOP" != "X" ] +then + if test "$OSTYPE" = msdosdjgpp; then + PATH="$TOP/apps;$TOP;$PATH" + else + PATH="$TOP/apps:$TOP:$PATH" + fi + LD_LIBRARY_PATH=$TOP; export LD_LIBRARY_PATH +else + LD_LIBRARY_PATH=.; export LD_LIBRARY_PATH +fi + +echo "Checking library fingerprint for $lib" +openssl sha1 -hmac etaonrishdlcupfm $lib | sed "s/(.*\//(/" | diff -w $lib.sha1 - || { echo "$libs fingerprint mismatch"; exit 1; } + +[ -x $exe.exe ] && exe=$exe.exe + +echo "Making fingerprint for $exe" +openssl sha1 -hmac etaonrishdlcupfm -binary $exe > $exe.$ext || rm $exe.$ext diff --git a/lib/libssl/src/fips-1.0/rand/Makefile b/lib/libssl/src/fips-1.0/rand/Makefile new file mode 100644 index 00000000000..6820f3a2055 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/Makefile @@ -0,0 +1,126 @@ +# +# OpenSSL/fips-1.0/rand/Makefile +# + +DIR= rand +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST= fips_randtest.c fips_rngvs.c +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_rand.c fips_rand_selftest.c +LIBOBJ=fips_rand.o fips_rand_selftest.o + +SRC= $(LIBSRC) + +EXHEADER= fips_rand.h +HEADER= $(EXHEADER) + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips SDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +Q=../testvectors/rng/req +A=../testvectors/rng/rsp + +fips_test: + -rm -rf $(A) + mkdir $(A) + if [ -f $(Q)/ANSI931_TDES2MCT.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rngvs mct < $(Q)/ANSI931_TDES2MCT.req > $(A)/ANSI931_TDES2MCT.rsp; fi + if [ -f $(Q)/ANSI931_TDES2VST.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rngvs vst < $(Q)/ANSI931_TDES2VST.req > $(A)/ANSI931_TDES2VST.rsp; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_rand.o: ../../e_os.h ../../include/openssl/bio.h +fips_rand.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_rand.o: ../../include/openssl/des_old.h ../../include/openssl/e_os2.h +fips_rand.o: ../../include/openssl/err.h ../../include/openssl/fips_rand.h +fips_rand.o: ../../include/openssl/lhash.h ../../include/openssl/opensslconf.h +fips_rand.o: ../../include/openssl/opensslv.h ../../include/openssl/ossl_typ.h +fips_rand.o: ../../include/openssl/rand.h ../../include/openssl/safestack.h +fips_rand.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_rand.o: ../../include/openssl/ui.h ../../include/openssl/ui_compat.h +fips_rand.o: fips_rand.c +fips_rand_selftest.o: ../../include/openssl/bio.h +fips_rand_selftest.o: ../../include/openssl/crypto.h +fips_rand_selftest.o: ../../include/openssl/des.h +fips_rand_selftest.o: ../../include/openssl/des_old.h +fips_rand_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_rand_selftest.o: ../../include/openssl/fips.h +fips_rand_selftest.o: ../../include/openssl/fips_rand.h +fips_rand_selftest.o: ../../include/openssl/lhash.h +fips_rand_selftest.o: ../../include/openssl/opensslconf.h +fips_rand_selftest.o: ../../include/openssl/opensslv.h +fips_rand_selftest.o: ../../include/openssl/ossl_typ.h +fips_rand_selftest.o: ../../include/openssl/rand.h +fips_rand_selftest.o: ../../include/openssl/safestack.h +fips_rand_selftest.o: ../../include/openssl/stack.h +fips_rand_selftest.o: ../../include/openssl/symhacks.h +fips_rand_selftest.o: ../../include/openssl/ui.h +fips_rand_selftest.o: ../../include/openssl/ui_compat.h fips_rand_selftest.c +fips_randtest.o: ../../e_os.h ../../include/openssl/bio.h +fips_randtest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_randtest.o: ../../include/openssl/des_old.h ../../include/openssl/e_os2.h +fips_randtest.o: ../../include/openssl/err.h ../../include/openssl/fips_rand.h +fips_randtest.o: ../../include/openssl/lhash.h +fips_randtest.o: ../../include/openssl/opensslconf.h +fips_randtest.o: ../../include/openssl/opensslv.h +fips_randtest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_randtest.o: ../../include/openssl/safestack.h +fips_randtest.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_randtest.o: ../../include/openssl/ui.h ../../include/openssl/ui_compat.h +fips_randtest.o: fips_randtest.c +fips_rngvs.o: ../../include/openssl/opensslconf.h fips_rngvs.c diff --git a/lib/libssl/src/fips-1.0/rand/fips_rand.c b/lib/libssl/src/fips-1.0/rand/fips_rand.c new file mode 100644 index 00000000000..7df2dc804e4 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/fips_rand.c @@ -0,0 +1,359 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +/* + * This is a FIPS approved PRNG, ANSI X9.31 A.2.4. + */ + +#include "e_os.h" + +/* If we don't define _XOPEN_SOURCE_EXTENDED, struct timeval won't + be defined and gettimeofday() won't be declared with strict compilers + like DEC C in ANSI C mode. */ +#ifndef _XOPEN_SOURCE_EXTENDED +#define _XOPEN_SOURCE_EXTENDED 1 +#endif + +#include <openssl/des.h> +#include <openssl/rand.h> +#include <openssl/err.h> +#include <openssl/fips_rand.h> +#ifndef OPENSSL_SYS_WIN32 +#include <sys/time.h> +#endif +#include <assert.h> +#ifndef OPENSSL_SYS_WIN32 +# ifdef OPENSSL_UNISTD +# include OPENSSL_UNISTD +# else +# include <unistd.h> +# endif +#endif +#include <string.h> + +void *OPENSSL_stderr(void); + +#ifdef OPENSSL_FIPS + +#define SEED_SIZE 8 + +static unsigned char seed[SEED_SIZE]; +static FIPS_RAND_SIZE_T n_seed; +static FIPS_RAND_SIZE_T o_seed; +static DES_cblock key1; +static DES_cblock key2; +static DES_key_schedule ks1,ks2; +static int key_set; +static int key_init; +static int test_mode; +static unsigned char test_faketime[8]; + +#ifndef GETPID_IS_MEANINGLESS +static int seed_pid; +static int key_pid; +#endif + +static void fips_rand_cleanup(void); +static void fips_rand_add(const void *buf, FIPS_RAND_SIZE_T num, double add_entropy); +static int fips_rand_bytes(unsigned char *buf, FIPS_RAND_SIZE_T num); +static int fips_rand_status(void); + +static const RAND_METHOD rand_fips_meth= + { + FIPS_rand_seed, + fips_rand_bytes, + fips_rand_cleanup, + fips_rand_add, + fips_rand_bytes, + fips_rand_status + }; + +static int second; + +const RAND_METHOD *FIPS_rand_method(void) +{ + return &rand_fips_meth; +} + +void FIPS_set_prng_key(const unsigned char k1[8],const unsigned char k2[8]) + { + memcpy(&key1,k1,sizeof key1); + memcpy(&key2,k2,sizeof key2); + key_set=1; +#ifndef GETPID_IS_MEANINGLESS + key_pid=getpid(); +#endif + second=0; + } + +void FIPS_test_mode(int test,const unsigned char faketime[8]) + { + test_mode=test; + if(!test_mode) + return; + memcpy(test_faketime,faketime,sizeof test_faketime); + } + +/* NB: this returns true if _partially_ seeded */ +int FIPS_rand_seeded() + { return key_set || n_seed; } + +static void fips_gettime(unsigned char buf[8]) + { +#ifdef OPENSSL_SYS_WIN32 + FILETIME ft; +#else + struct timeval tv; +#endif + + if(test_mode) + { + /* fprintf(OPENSSL_stderr(),"WARNING!!! PRNG IN TEST MODE!!!\n"); */ + memcpy(buf,test_faketime,sizeof test_faketime); + return; + } +#ifdef OPENSSL_SYS_WIN32 + GetSystemTimeAsFileTime(&ft); + buf[0] = (unsigned char) (ft.dwHighDateTime & 0xff); + buf[1] = (unsigned char) ((ft.dwHighDateTime >> 8) & 0xff); + buf[2] = (unsigned char) ((ft.dwHighDateTime >> 16) & 0xff); + buf[3] = (unsigned char) ((ft.dwHighDateTime >> 24) & 0xff); + buf[4] = (unsigned char) (ft.dwLowDateTime & 0xff); + buf[5] = (unsigned char) ((ft.dwLowDateTime >> 8) & 0xff); + buf[6] = (unsigned char) ((ft.dwLowDateTime >> 16) & 0xff); + buf[7] = (unsigned char) ((ft.dwLowDateTime >> 24) & 0xff); +#else + gettimeofday(&tv,NULL); + buf[0] = (unsigned char) (tv.tv_sec & 0xff); + buf[1] = (unsigned char) ((tv.tv_sec >> 8) & 0xff); + buf[2] = (unsigned char) ((tv.tv_sec >> 16) & 0xff); + buf[3] = (unsigned char) ((tv.tv_sec >> 24) & 0xff); + buf[4] = (unsigned char) (tv.tv_usec & 0xff); + buf[5] = (unsigned char) ((tv.tv_usec >> 8) & 0xff); + buf[6] = (unsigned char) ((tv.tv_usec >> 16) & 0xff); + buf[7] = (unsigned char) ((tv.tv_usec >> 24) & 0xff); +#endif + +#if 0 /* This eminently sensible strategy is not acceptable to NIST. Sigh. */ +#ifndef GETPID_IS_MEANINGLESS + /* we mix in the PID to ensure that after a fork the children don't give + * the same results as each other + */ + pid=getpid(); + /* make sure we shift the pid to the MSB */ + if((pid&0xffff0000) == 0) + pid<<=16; + *(long *)&buf[0]^=pid; +#endif +#endif + } + +static void fips_rand_encrypt(unsigned char *out,const unsigned char *in) + { + DES_ecb2_encrypt(in,out,&ks1,&ks2,1); + } + +static void fips_rand_cleanup(void) + { + OPENSSL_cleanse(seed,sizeof seed); + n_seed=0; + o_seed=0; + key_init=0; + } + +void FIPS_rand_seed(const void *buf_, FIPS_RAND_SIZE_T num) + { + const char *buf=buf_; + FIPS_RAND_SIZE_T n; + + /* If the key hasn't been set, we can't seed! */ + if(!key_set) + return; + + CRYPTO_w_lock(CRYPTO_LOCK_RAND); + if(!key_init) + { + key_init=1; + DES_set_key(&key1,&ks1); + DES_set_key(&key2,&ks2); + } + + /* + * This algorithm only uses 64 bits of seed, so ensure that we use + * the most recent 64 bits. + */ + for(n=0 ; n < num ; ) + { + FIPS_RAND_SIZE_T t=num-n; + + if(o_seed+t > sizeof seed) + t=sizeof seed-o_seed; + memcpy(seed+o_seed,buf+n,t); + n+=t; + o_seed+=t; + if(o_seed == sizeof seed) + o_seed=0; + if(n_seed < sizeof seed) + n_seed+=t; + } + +#ifndef GETPID_IS_MEANINGLESS + seed_pid=getpid(); +#endif + + CRYPTO_w_unlock(CRYPTO_LOCK_RAND); + } + +static void fips_rand_add(const void *buf, FIPS_RAND_SIZE_T num, double add_entropy) + { + FIPS_rand_seed(buf,num); + } + +static int fips_rand_bytes(unsigned char *buf,FIPS_RAND_SIZE_T num) + { + FIPS_RAND_SIZE_T n; + unsigned char timeseed[8]; + unsigned char intermediate[SEED_SIZE]; + unsigned char output[SEED_SIZE]; + static unsigned char previous[SEED_SIZE]; +#ifndef GETPID_IS_MEANINGLESS + int pid; +#endif + + if(n_seed < sizeof seed) + { + RANDerr(RAND_F_FIPS_RAND_BYTES,RAND_R_PRNG_NOT_SEEDED); + return 0; + } + +#ifdef FIPS_RAND_MAX_SIZE_T + if (num > FIPS_RAND_MAX_SIZE_T) + { +#ifdef RAND_R_PRNG_ASKING_FOR_TOO_MUCH + RANDerr(RAND_F_FIPS_RAND_BYTES,RAND_R_PRNG_ASKING_FOR_TOO_MUCH); + return 0; +#else + return -1; /* signal "not supported" condition */ +#endif + } +#endif + +#ifndef GETPID_IS_MEANINGLESS + pid=getpid(); + if(pid != seed_pid) + { + RANDerr(RAND_F_FIPS_RAND_BYTES,RAND_R_PRNG_NOT_RESEEDED); + return 0; + } + if(pid != key_pid) + { + RANDerr(RAND_F_FIPS_RAND_BYTES,RAND_R_PRNG_NOT_REKEYED); + return 0; + } +#endif + + CRYPTO_w_lock(CRYPTO_LOCK_RAND); + + for(n=0 ; n < num ; ) + { + unsigned char t[SEED_SIZE]; + FIPS_RAND_SIZE_T l; + + /* ANS X9.31 A.2.4: I = ede*K(DT) + timeseed == DT + intermediate == I + */ + fips_gettime(timeseed); + fips_rand_encrypt(intermediate,timeseed); + + /* ANS X9.31 A.2.4: R = ede*K(I^V) + intermediate == I + seed == V + output == R + */ + for(l=0 ; l < sizeof t ; ++l) + t[l]=intermediate[l]^seed[l]; + fips_rand_encrypt(output,t); + + /* ANS X9.31 A.2.4: V = ede*K(R^I) + output == R + intermediate == I + seed == V + */ + for(l=0 ; l < sizeof t ; ++l) + t[l]=output[l]^intermediate[l]; + fips_rand_encrypt(seed,t); + + if(second && !memcmp(output,previous,sizeof previous)) + { + RANDerr(RAND_F_FIPS_RAND_BYTES,RAND_R_PRNG_STUCK); + CRYPTO_w_unlock(CRYPTO_LOCK_RAND); + return 0; + } + memcpy(previous,output,sizeof previous); + second=1; + + /* Successive values of R may be concatenated to produce a + pseudo random number of the desired length */ + l=SEED_SIZE < num-n ? SEED_SIZE : num-n; + memcpy(buf+n,output,l); + n+=l; + } + + CRYPTO_w_unlock(CRYPTO_LOCK_RAND); + + return 1; + } + +static int fips_rand_status(void) + { + return n_seed == sizeof seed; + } + +#endif /* OPENSSL_FIPS */ diff --git a/lib/libssl/src/fips-1.0/rand/fips_rand.h b/lib/libssl/src/fips-1.0/rand/fips_rand.h new file mode 100644 index 00000000000..093727240e7 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/fips_rand.h @@ -0,0 +1,73 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#ifndef HEADER_FIPS_RAND_H +#define HEADER_FIPS_RAND_H + +#include "des.h" + +#ifdef OPENSSL_FIPS + +#ifdef __cplusplus +extern "C" { +#endif + +void FIPS_set_prng_key(const unsigned char k1[8],const unsigned char k2[8]); +void FIPS_test_mode(int test,const unsigned char faketime[8]); +void FIPS_rand_seed(const void *buf, FIPS_RAND_SIZE_T num); +/* NB: this returns true if _partially_ seeded */ +int FIPS_rand_seeded(void); + +const RAND_METHOD *FIPS_rand_method(void); + +#ifdef __cplusplus +} +#endif +#endif +#endif diff --git a/lib/libssl/src/fips-1.0/rand/fips_rand_selftest.c b/lib/libssl/src/fips-1.0/rand/fips_rand_selftest.c new file mode 100644 index 00000000000..691b929d71c --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/fips_rand_selftest.c @@ -0,0 +1,120 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/rand.h> +#include <openssl/fips_rand.h> + +#ifdef OPENSSL_FIPS +static struct + { + unsigned char key1[8]; + unsigned char key2[8]; + unsigned char seed[8]; + unsigned char dt[8]; + } init_iv[] = + { + { + { 0x75, 0xc7, 0x1a, 0xe5, 0xa1, 0x1a, 0x23, 0x2c }, + { 0x40, 0x25, 0x6d, 0xcd, 0x94, 0xf7, 0x67, 0xb0 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xc8, 0x9a, 0x1d, 0x88, 0x8e, 0xd1, 0x2f, 0x3c }, + }, + { + { 0x75, 0xc7, 0x1a, 0xe5, 0xa1, 0x1a, 0x23, 0x2c }, + { 0x40, 0x25, 0x6d, 0xcd, 0x94, 0xf7, 0x67, 0xb0 }, + { 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xc8, 0x9a, 0x1d, 0x88, 0x8e, 0xd1, 0x2f, 0x40 }, + }, + { + { 0x75, 0xc7, 0x1a, 0xe5, 0xa1, 0x1a, 0x23, 0x2c }, + { 0x40, 0x25, 0x6d, 0xcd, 0x94, 0xf7, 0x67, 0xb0 }, + { 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff }, + { 0xc8, 0x9a, 0x1d, 0x88, 0x8e, 0xd1, 0x2f, 0x7b }, + }, + }; + +static const unsigned char expected_ret[][8]= + { + { 0x94, 0x4d, 0xc7, 0x21, 0x0d, 0x6d, 0x7f, 0xd7 }, + { 0x02, 0x43, 0x3c, 0x94, 0x17, 0xa3, 0x32, 0x6f }, + { 0xe7, 0xe2, 0xb2, 0x96, 0x4f, 0x36, 0xed, 0x41 }, + }; + +void FIPS_corrupt_rng() + { + init_iv[0].dt[0]++; + } + +int FIPS_selftest_rng() + { + int n; + + for(n=0 ; n < 3 ; ++n) + { + unsigned char actual_ret[8]; + + FIPS_rand_method()->cleanup(); + FIPS_set_prng_key(init_iv[n].key1,init_iv[n].key2); + FIPS_rand_seed(init_iv[n].seed,8); + FIPS_test_mode(1,init_iv[n].dt); + if ((FIPS_rand_method()->bytes(actual_ret, 8) <=0) || (memcmp(actual_ret,expected_ret[n],sizeof actual_ret))) + { + FIPS_test_mode(0,NULL); + FIPSerr(FIPS_F_FIPS_SELFTEST_RNG,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + FIPS_test_mode(0,NULL); + return 1; + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rand/fips_randtest.c b/lib/libssl/src/fips-1.0/rand/fips_randtest.c new file mode 100644 index 00000000000..6165944e56f --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/fips_randtest.c @@ -0,0 +1,369 @@ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <stdio.h> +#include <stdlib.h> +#include <openssl/rand.h> +#include <openssl/fips_rand.h> +#include <openssl/err.h> + +#include "e_os.h" + +#ifndef OPENSSL_FIPS +int main(int argc, char *argv[]) +{ + printf("No FIPS RAND support\n"); + return(0); +} + +#else + +/* some FIPS 140-1 random number test */ +/* some simple tests */ + +static DES_cblock prng_key1={0x21,0x58,0x47,0xb7,0xc2,0x97,0x5a,0x8e}; +static DES_cblock prng_key2={0x61,0x23,0x05,0x96,0x18,0x91,0x86,0xac}; +static unsigned char prng_seed[8]={0x6b,0xa3,0x4f,0x07,0xe4,0x2a,0xb0,0xc}; + +typedef struct + { + DES_cblock keys[2]; + const unsigned char time[8]; + const unsigned char seed[8]; + const unsigned char block1[8]; + const unsigned char block100[8]; + } PRNGtest; + +/* FIXME: these test vectors are made up! */ +static PRNGtest t1= + { + { { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, + { 0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, + }, + { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + { 0x33,0xc3,0xdf,0xfe,0x60,0x60,0x49,0x9e }, + { 0xcd,0x2b,0x41,0xaf,0x80,0x51,0x37,0xd8 } + }; +static PRNGtest t2= + { + { { 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff }, + { 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff } }, + { 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff }, + { 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff }, + { 0x65,0xf1,0xa4,0x07,0x42,0x38,0xd5,0x25 }, + { 0xbb,0x75,0x84,0x20,0x7a,0x44,0xf0,0xa0 } + }; + +static void dump(const unsigned char *b,int n) + { + while(n-- > 0) + { + printf(" %02x",*b++); + } + } + +static void compare(const unsigned char *result,const unsigned char *expected, + int n) + { + int i; + + for(i=0 ; i < n ; ++i) + if(result[i] != expected[i]) + { + puts("Random test failed, got:"); + dump(result,8); + puts("\n expected:"); + dump(expected,8); + putchar('\n'); + EXIT(1); + } + } + +static void run_test(const PRNGtest *t) + { + unsigned char buf[8]; + int n; + + FIPS_set_prng_key(t->keys[0],t->keys[1]); + FIPS_test_mode(1,t->time); + RAND_seed(t->seed,sizeof t->seed); + + if(RAND_bytes(buf,8) <= 0) + { + ERR_print_errors_fp(stderr); + EXIT(2); + } + compare(buf,t->block1,8); + for(n=0 ; n < 99 ; ++n) + if(RAND_bytes(buf,8) <= 0) + { + ERR_print_errors_fp(stderr); + EXIT(2); + } + compare(buf,t->block100,8); + FIPS_test_mode(0,NULL); + } + +int main() + { + unsigned char buf[2500]; + int i,j,k,s,sign,nsign,err=0; + unsigned long n1; + unsigned long n2[16]; + unsigned long runs[2][34]; + /*double d; */ + long d; + + ERR_load_crypto_strings(); + RAND_set_rand_method(FIPS_rand_method()); + + run_test(&t1); + run_test(&t2); + + FIPS_set_prng_key(prng_key1,prng_key2); + RAND_seed(prng_seed,sizeof prng_seed); + + i = RAND_pseudo_bytes(buf,2500); + if (i <= 0) + { + printf ("init failed, the rand method is not properly installed\n"); + err++; + goto err; + } + + n1=0; + for (i=0; i<16; i++) n2[i]=0; + for (i=0; i<34; i++) runs[0][i]=runs[1][i]=0; + + /* test 1 and 2 */ + sign=0; + nsign=0; + for (i=0; i<2500; i++) + { + j=buf[i]; + + n2[j&0x0f]++; + n2[(j>>4)&0x0f]++; + + for (k=0; k<8; k++) + { + s=(j&0x01); + if (s == sign) + nsign++; + else + { + if (nsign > 34) nsign=34; + if (nsign != 0) + { + runs[sign][nsign-1]++; + if (nsign > 6) + runs[sign][5]++; + } + sign=s; + nsign=1; + } + + if (s) n1++; + j>>=1; + } + } + if (nsign > 34) nsign=34; + if (nsign != 0) runs[sign][nsign-1]++; + + /* test 1 */ + if (!((9654 < n1) && (n1 < 10346))) + { + printf("test 1 failed, X=%lu\n",n1); + err++; + } + printf("test 1 done\n"); + + /* test 2 */ +#ifdef undef + d=0; + for (i=0; i<16; i++) + d+=n2[i]*n2[i]; + d=d*16.0/5000.0-5000.0; + if (!((1.03 < d) && (d < 57.4))) + { + printf("test 2 failed, X=%.2f\n",d); + err++; + } +#endif + d=0; + for (i=0; i<16; i++) + d+=n2[i]*n2[i]; + d=(d*8)/25-500000; + if (!((103 < d) && (d < 5740))) + { + printf("test 2 failed, X=%ld.%02ld\n",d/100L,d%100L); + err++; + } + printf("test 2 done\n"); + + /* test 3 */ + for (i=0; i<2; i++) + { + if (!((2267 < runs[i][0]) && (runs[i][0] < 2733))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,1,runs[i][0]); + err++; + } + if (!((1079 < runs[i][1]) && (runs[i][1] < 1421))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,2,runs[i][1]); + err++; + } + if (!(( 502 < runs[i][2]) && (runs[i][2] < 748))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,3,runs[i][2]); + err++; + } + if (!(( 223 < runs[i][3]) && (runs[i][3] < 402))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,4,runs[i][3]); + err++; + } + if (!(( 90 < runs[i][4]) && (runs[i][4] < 223))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,5,runs[i][4]); + err++; + } + if (!(( 90 < runs[i][5]) && (runs[i][5] < 223))) + { + printf("test 3 failed, bit=%d run=%d num=%lu\n", + i,6,runs[i][5]); + err++; + } + } + printf("test 3 done\n"); + + /* test 4 */ + if (runs[0][33] != 0) + { + printf("test 4 failed, bit=%d run=%d num=%lu\n", + 0,34,runs[0][33]); + err++; + } + if (runs[1][33] != 0) + { + printf("test 4 failed, bit=%d run=%d num=%lu\n", + 1,34,runs[1][33]); + err++; + } + printf("test 4 done\n"); + err: + err=((err)?1:0); + EXIT(err); + return(err); + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rand/fips_rngvs.c b/lib/libssl/src/fips-1.0/rand/fips_rngvs.c new file mode 100644 index 00000000000..2c3fdbcca7c --- /dev/null +++ b/lib/libssl/src/fips-1.0/rand/fips_rngvs.c @@ -0,0 +1,234 @@ +/* + * Crude test driver for processing the VST and MCT testvector files + * generated by the CMVP RNGVS product. + * + * Note the input files are assumed to have a _very_ specific format + * as described in the NIST document "The Random Number Generator + * Validation System (RNGVS)", May 25, 2004. + * + */ +#include <openssl/opensslconf.h> + +#ifndef OPENSSL_FIPS +#include <stdio.h> +int main() +{ + printf("No FIPS RNG support\n"); + return 0; +} +#else + +#include <openssl/bn.h> +#include <openssl/dsa.h> +#include <openssl/fips.h> +#include <openssl/err.h> +#include <openssl/rand.h> +#include <openssl/fips_rand.h> +#include <string.h> + +int hex2bin(const char *in, unsigned char *out) + { + int n1, n2; + unsigned char ch; + + for (n1=0,n2=0 ; in[n1] && in[n1] != '\n' ; ) + { /* first byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + if(!in[n1]) + { + out[n2++]=ch; + break; + } + out[n2] = ch << 4; + /* second byte */ + if ((in[n1] >= '0') && (in[n1] <= '9')) + ch = in[n1++] - '0'; + else if ((in[n1] >= 'A') && (in[n1] <= 'F')) + ch = in[n1++] - 'A' + 10; + else if ((in[n1] >= 'a') && (in[n1] <= 'f')) + ch = in[n1++] - 'a' + 10; + else + return -1; + out[n2++] |= ch; + } + return n2; + } + +int bin2hex(const unsigned char *in,int len,char *out) + { + int n1, n2; + unsigned char ch; + + for (n1=0,n2=0 ; n1 < len ; ++n1) + { + ch=in[n1] >> 4; + if (ch <= 0x09) + out[n2++]=ch+'0'; + else + out[n2++]=ch-10+'a'; + ch=in[n1] & 0x0f; + if(ch <= 0x09) + out[n2++]=ch+'0'; + else + out[n2++]=ch-10+'a'; + } + out[n2]='\0'; + return n2; + } + +void pv(const char *tag,const unsigned char *val,int len) + { + char obuf[2048]; + + bin2hex(val,len,obuf); + printf("%s = %s\n",tag,obuf); + } + +void vst() + { + unsigned char key1[8]; + unsigned char key2[8]; + unsigned char v[8]; + unsigned char dt[8]; + unsigned char ret[8]; + char buf[1024]; + int n; + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"Key1 = ",7)) + { + n=hex2bin(buf+7,key1); + pv("Key1",key1,n); + } + else if(!strncmp(buf,"Key2 = ",7)) + { + n=hex2bin(buf+7,key2); + pv("Key1",key2,n); + } + else if(!strncmp(buf,"DT = ",5)) + { + n=hex2bin(buf+5,dt); + pv("DT",dt,n); + } + else if(!strncmp(buf,"V = ",4)) + { + n=hex2bin(buf+4,v); + pv("V",v,n); + + FIPS_rand_method()->cleanup(); + FIPS_set_prng_key(key1,key2); + FIPS_rand_seed(v,8); + FIPS_test_mode(1,dt); + if (FIPS_rand_method()->bytes(ret,8) <= 0) + { + FIPS_test_mode(0,NULL); + FIPSerr(FIPS_F_FIPS_SELFTEST_RNG,FIPS_R_SELFTEST_FAILED); + return; + } + + pv("R",ret,8); + putc('\n',stdout); + } + else + fputs(buf,stdout); + } + } + + +void mct() + { + unsigned char key1[8]; + unsigned char key2[8]; + unsigned char v[8]; + unsigned char dt[8]; + unsigned char ret[8]; + char buf[1024]; + int n; + + BIGNUM *bn; + BIGNUM *pbn; + bn = BN_new(); + + while(fgets(buf,sizeof buf,stdin) != NULL) + { + if(!strncmp(buf,"Key1 = ",7)) + { + n=hex2bin(buf+7,key1); + pv("Key1",key1,n); + } + else if(!strncmp(buf,"Key2 = ",7)) + { + n=hex2bin(buf+7,key2); + pv("Key1",key2,n); + } + else if(!strncmp(buf,"DT = ",5)) + { + n=hex2bin(buf+5,dt); + pv("DT",dt,n); + } + else if(!strncmp(buf,"V = ",4)) + { + int iter; + n=hex2bin(buf+4,v); + pv("V",v,n); + + FIPS_rand_method()->cleanup(); + FIPS_set_prng_key(key1,key2); + FIPS_rand_seed(v,8); + for (iter=0; iter < 10000; ++iter) + { + FIPS_test_mode(1,dt); + if (FIPS_rand_method()->bytes(ret,8) <= 0) + { + FIPS_test_mode(0,NULL); + FIPSerr(FIPS_F_FIPS_SELFTEST_RNG,FIPS_R_SELFTEST_FAILED); + return; + } + pbn = BN_bin2bn(dt,8,bn); + n = BN_add(bn,bn,BN_value_one()); + n = BN_bn2bin(bn,dt); + } + + pv("R",ret,8); + putc('\n',stdout); + } + else + fputs(buf,stdout); + } + BN_free(bn); + } + +int main(int argc,char **argv) + { + if(argc != 2) + { + fprintf(stderr,"%s [mct|vst]\n",argv[0]); + exit(1); + } + if(!FIPS_mode_set(1)) + { + ERR_load_crypto_strings(); + ERR_print_errors(BIO_new_fp(stderr,BIO_NOCLOSE)); + exit(1); + } + if(!strcmp(argv[1],"mct")) + mct(); + else if(!strcmp(argv[1],"vst")) + vst(); + else + { + fprintf(stderr,"Don't know how to %s.\n",argv[1]); + exit(1); + } + + return 0; + } +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/Makefile b/lib/libssl/src/fips-1.0/rsa/Makefile new file mode 100644 index 00000000000..179df4758ac --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/Makefile @@ -0,0 +1,208 @@ +# +# OpenSSL/fips-1.0/rsa/Makefile +# + +DIR= rsa +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST= fips_rsavtest.c fips_rsastest.c fips_rsagtest.c +APPS= + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_rsa_eay.c fips_rsa_gen.c fips_rsa_selftest.c fips_rsa_x931g.c +LIBOBJ=fips_rsa_eay.o fips_rsa_gen.o fips_rsa_selftest.o fips_rsa_x931g.o + +SRC= $(LIBSRC) + +EXHEADER= +HEADER= $(EXHEADER) + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips FDIRS=$(DIR) sub_all) + +all: lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +Q=../testvectors/rsa/req +A=../testvectors/rsa/rsp +Q62=../testvectors/rsa_salt_62/req +A62=../testvectors/rsa_salt_62/rsp + +fips_test: + -rm -rf $(A) $(A62) + mkdir $(A) $(A62) + if [ -f $(Q)/SigGen15.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsastest < $(Q)/SigGen15.req > $(A)/SigGen15.rsp; fi + if [ -f $(Q)/SigVer15.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsavtest < $(Q)/SigVer15.req > $(A)/SigVer15.rsp; fi + if [ -f $(Q)/SigGenPSS.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsastest -saltlen 0 < $(Q)/SigGenPSS.req > $(A)/SigGenPSS.rsp; fi + if [ -f $(Q)/SigVerPSS.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsavtest -saltlen 0 < $(Q)/SigVerPSS.req > $(A)/SigVerPSS.rsp; fi + if [ -f $(Q)/SigGenRSA.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsastest -x931 < $(Q)/SigGenRSA.req > $(A)/SigGenRSA.rsp; fi + if [ -f $(Q)/SigVerRSA.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsavtest -x931 < $(Q)/SigVerRSA.req > $(A)/SigVerRSA.rsp; fi + if [ -f $(Q62)/SigGenPSS.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsastest -saltlen 62 < $(Q62)/SigGenPSS.req >$(A62)/SigGenPSS.rsp; fi + if [ -f $(Q62)/SigVerPSS.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsavtest -saltlen 62 <$(Q62)/SigVerPSS.req >$(A62)/SigVerPSS.rsp; fi + if [ -f $(Q)/KeyGenRSA.req ]; then $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_rsagtest < $(Q)/KeyGenRSA.req > $(A)/KeyGenRSA.rsp; fi + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_rsa_eay.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_rsa_eay.o: ../../include/openssl/bn.h ../../include/openssl/crypto.h +fips_rsa_eay.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_rsa_eay.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_rsa_eay.o: ../../include/openssl/opensslconf.h +fips_rsa_eay.o: ../../include/openssl/opensslv.h +fips_rsa_eay.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rand.h +fips_rsa_eay.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_rsa_eay.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_rsa_eay.o: fips_rsa_eay.c +fips_rsa_gen.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_rsa_gen.o: ../../include/openssl/bn.h ../../include/openssl/crypto.h +fips_rsa_gen.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_rsa_gen.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_rsa_gen.o: ../../include/openssl/opensslconf.h +fips_rsa_gen.o: ../../include/openssl/opensslv.h +fips_rsa_gen.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rsa.h +fips_rsa_gen.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_rsa_gen.o: ../../include/openssl/symhacks.h fips_rsa_gen.c +fips_rsa_selftest.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_rsa_selftest.o: ../../include/openssl/bn.h ../../include/openssl/crypto.h +fips_rsa_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_rsa_selftest.o: ../../include/openssl/fips.h +fips_rsa_selftest.o: ../../include/openssl/fips_sha.h +fips_rsa_selftest.o: ../../include/openssl/lhash.h +fips_rsa_selftest.o: ../../include/openssl/opensslconf.h +fips_rsa_selftest.o: ../../include/openssl/opensslv.h +fips_rsa_selftest.o: ../../include/openssl/ossl_typ.h +fips_rsa_selftest.o: ../../include/openssl/rsa.h +fips_rsa_selftest.o: ../../include/openssl/safestack.h +fips_rsa_selftest.o: ../../include/openssl/stack.h +fips_rsa_selftest.o: ../../include/openssl/symhacks.h fips_rsa_selftest.c +fips_rsa_x931g.o: ../../include/openssl/asn1.h ../../include/openssl/bio.h +fips_rsa_x931g.o: ../../include/openssl/bn.h ../../include/openssl/crypto.h +fips_rsa_x931g.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_rsa_x931g.o: ../../include/openssl/fips.h ../../include/openssl/lhash.h +fips_rsa_x931g.o: ../../include/openssl/opensslconf.h +fips_rsa_x931g.o: ../../include/openssl/opensslv.h +fips_rsa_x931g.o: ../../include/openssl/ossl_typ.h ../../include/openssl/rsa.h +fips_rsa_x931g.o: ../../include/openssl/safestack.h +fips_rsa_x931g.o: ../../include/openssl/stack.h +fips_rsa_x931g.o: ../../include/openssl/symhacks.h fips_rsa_x931g.c +fips_rsagtest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_rsagtest.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_rsagtest.o: ../../include/openssl/bn.h ../../include/openssl/buffer.h +fips_rsagtest.o: ../../include/openssl/cast.h ../../include/openssl/conf.h +fips_rsagtest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_rsagtest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_rsagtest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_rsagtest.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_rsagtest.o: ../../include/openssl/hmac.h ../../include/openssl/idea.h +fips_rsagtest.o: ../../include/openssl/lhash.h ../../include/openssl/md2.h +fips_rsagtest.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_rsagtest.o: ../../include/openssl/mdc2.h ../../include/openssl/obj_mac.h +fips_rsagtest.o: ../../include/openssl/objects.h +fips_rsagtest.o: ../../include/openssl/opensslconf.h +fips_rsagtest.o: ../../include/openssl/opensslv.h +fips_rsagtest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/pkcs7.h +fips_rsagtest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_rsagtest.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_rsagtest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_rsagtest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_rsagtest.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_rsagtest.o: ../../include/openssl/ui_compat.h ../../include/openssl/x509.h +fips_rsagtest.o: ../../include/openssl/x509_vfy.h +fips_rsagtest.o: ../../include/openssl/x509v3.h fips_rsagtest.c +fips_rsastest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_rsastest.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_rsastest.o: ../../include/openssl/bn.h ../../include/openssl/buffer.h +fips_rsastest.o: ../../include/openssl/cast.h ../../include/openssl/conf.h +fips_rsastest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_rsastest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_rsastest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_rsastest.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_rsastest.o: ../../include/openssl/hmac.h ../../include/openssl/idea.h +fips_rsastest.o: ../../include/openssl/lhash.h ../../include/openssl/md2.h +fips_rsastest.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_rsastest.o: ../../include/openssl/mdc2.h ../../include/openssl/obj_mac.h +fips_rsastest.o: ../../include/openssl/objects.h +fips_rsastest.o: ../../include/openssl/opensslconf.h +fips_rsastest.o: ../../include/openssl/opensslv.h +fips_rsastest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/pkcs7.h +fips_rsastest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_rsastest.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_rsastest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_rsastest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_rsastest.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_rsastest.o: ../../include/openssl/ui_compat.h ../../include/openssl/x509.h +fips_rsastest.o: ../../include/openssl/x509_vfy.h +fips_rsastest.o: ../../include/openssl/x509v3.h fips_rsastest.c +fips_rsavtest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_rsavtest.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_rsavtest.o: ../../include/openssl/bn.h ../../include/openssl/buffer.h +fips_rsavtest.o: ../../include/openssl/cast.h ../../include/openssl/conf.h +fips_rsavtest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_rsavtest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_rsavtest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_rsavtest.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_rsavtest.o: ../../include/openssl/hmac.h ../../include/openssl/idea.h +fips_rsavtest.o: ../../include/openssl/lhash.h ../../include/openssl/md2.h +fips_rsavtest.o: ../../include/openssl/md4.h ../../include/openssl/md5.h +fips_rsavtest.o: ../../include/openssl/mdc2.h ../../include/openssl/obj_mac.h +fips_rsavtest.o: ../../include/openssl/objects.h +fips_rsavtest.o: ../../include/openssl/opensslconf.h +fips_rsavtest.o: ../../include/openssl/opensslv.h +fips_rsavtest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/pkcs7.h +fips_rsavtest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_rsavtest.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_rsavtest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_rsavtest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_rsavtest.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_rsavtest.o: ../../include/openssl/ui_compat.h ../../include/openssl/x509.h +fips_rsavtest.o: ../../include/openssl/x509_vfy.h +fips_rsavtest.o: ../../include/openssl/x509v3.h fips_rsavtest.c diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsa_eay.c b/lib/libssl/src/fips-1.0/rsa/fips_rsa_eay.c new file mode 100644 index 00000000000..2d0d973f1ea --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsa_eay.c @@ -0,0 +1,788 @@ +/* crypto/rsa/rsa_eay.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ +/* ==================================================================== + * Copyright (c) 1998-2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <openssl/err.h> +#include <openssl/bn.h> +#include <openssl/rsa.h> +#include <openssl/rand.h> +#include <openssl/fips.h> + +#if !defined(RSA_NULL) && defined(OPENSSL_FIPS) + +static int RSA_eay_public_encrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa,int padding); +static int RSA_eay_private_encrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa,int padding); +static int RSA_eay_public_decrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa,int padding); +static int RSA_eay_private_decrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa,int padding); +static int RSA_eay_mod_exp(BIGNUM *r0, const BIGNUM *i, RSA *rsa); +static int RSA_eay_init(RSA *rsa); +static int RSA_eay_finish(RSA *rsa); +static const RSA_METHOD rsa_pkcs1_eay_meth={ + "Eric Young's PKCS#1 RSA", + RSA_eay_public_encrypt, + RSA_eay_public_decrypt, /* signature verification */ + RSA_eay_private_encrypt, /* signing */ + RSA_eay_private_decrypt, + RSA_eay_mod_exp, + BN_mod_exp_mont, /* XXX probably we should not use Montgomery if e == 3 */ + RSA_eay_init, + RSA_eay_finish, + 0, /* flags */ + NULL, + 0, /* rsa_sign */ + 0 /* rsa_verify */ + }; + +const RSA_METHOD *RSA_PKCS1_SSLeay(void) + { + return(&rsa_pkcs1_eay_meth); + } + +static int RSA_eay_public_encrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa, int padding) + { + BIGNUM f,ret; + int i,j,k,num=0,r= -1; + unsigned char *buf=NULL; + BN_CTX *ctx=NULL; + + BN_init(&f); + BN_init(&ret); + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_RSA_EAY_PUBLIC_ENCRYPT,FIPS_R_FIPS_SELFTEST_FAILED); + goto err; + } + + if ((ctx=BN_CTX_new()) == NULL) goto err; + num=BN_num_bytes(rsa->n); + if ((buf=(unsigned char *)OPENSSL_malloc(num)) == NULL) + { + RSAerr(RSA_F_RSA_EAY_PUBLIC_ENCRYPT,ERR_R_MALLOC_FAILURE); + goto err; + } + + switch (padding) + { + case RSA_PKCS1_PADDING: + i=RSA_padding_add_PKCS1_type_2(buf,num,from,flen); + break; +#ifndef OPENSSL_NO_SHA + case RSA_PKCS1_OAEP_PADDING: + i=RSA_padding_add_PKCS1_OAEP(buf,num,from,flen,NULL,0); + break; +#endif + case RSA_SSLV23_PADDING: + i=RSA_padding_add_SSLv23(buf,num,from,flen); + break; + case RSA_NO_PADDING: + i=RSA_padding_add_none(buf,num,from,flen); + break; + default: + RSAerr(RSA_F_RSA_EAY_PUBLIC_ENCRYPT,RSA_R_UNKNOWN_PADDING_TYPE); + goto err; + } + if (i <= 0) goto err; + + if (BN_bin2bn(buf,num,&f) == NULL) goto err; + + if (BN_ucmp(&f, rsa->n) >= 0) + { + /* usually the padding functions would catch this */ + RSAerr(RSA_F_RSA_EAY_PUBLIC_ENCRYPT,RSA_R_DATA_TOO_LARGE_FOR_MODULUS); + goto err; + } + + if (rsa->flags & RSA_FLAG_CACHE_PUBLIC) + { + if (!BN_MONT_CTX_set_locked(&rsa->_method_mod_n, + CRYPTO_LOCK_RSA, rsa->n, ctx)) + goto err; + } + + if (!rsa->meth->bn_mod_exp(&ret,&f,rsa->e,rsa->n,ctx, + rsa->_method_mod_n)) goto err; + + /* put in leading 0 bytes if the number is less than the + * length of the modulus */ + j=BN_num_bytes(&ret); + i=BN_bn2bin(&ret,&(to[num-j])); + for (k=0; k<(num-i); k++) + to[k]=0; + + r=num; +err: + if (ctx != NULL) BN_CTX_free(ctx); + BN_clear_free(&f); + BN_clear_free(&ret); + if (buf != NULL) + { + OPENSSL_cleanse(buf,num); + OPENSSL_free(buf); + } + return(r); + } + +static int rsa_eay_blinding(RSA *rsa, BN_CTX *ctx) + { + int ret = 1; + CRYPTO_w_lock(CRYPTO_LOCK_RSA); + /* Check again inside the lock - the macro's check is racey */ + if(rsa->blinding == NULL) + ret = RSA_blinding_on(rsa, ctx); + CRYPTO_w_unlock(CRYPTO_LOCK_RSA); + return ret; + } + +#define BLINDING_HELPER(rsa, ctx, err_instr) \ + do { \ + if((!((rsa)->flags & RSA_FLAG_NO_BLINDING)) && \ + ((rsa)->blinding == NULL) && \ + !rsa_eay_blinding(rsa, ctx)) \ + err_instr \ + } while(0) + +static BN_BLINDING *setup_blinding(RSA *rsa, BN_CTX *ctx) + { + BIGNUM *A, *Ai; + BN_BLINDING *ret = NULL; + + /* added in OpenSSL 0.9.6j and 0.9.7b */ + + /* NB: similar code appears in RSA_blinding_on (rsa_lib.c); + * this should be placed in a new function of its own, but for reasons + * of binary compatibility can't */ + + BN_CTX_start(ctx); + A = BN_CTX_get(ctx); + if ((RAND_status() == 0) && rsa->d != NULL && rsa->d->d != NULL) + { + /* if PRNG is not properly seeded, resort to secret exponent as unpredictable seed */ + RAND_add(rsa->d->d, rsa->d->dmax * sizeof rsa->d->d[0], 0); + if (!BN_pseudo_rand_range(A,rsa->n)) goto err; + } + else + { + if (!BN_rand_range(A,rsa->n)) goto err; + } + if ((Ai=BN_mod_inverse(NULL,A,rsa->n,ctx)) == NULL) goto err; + + if (!rsa->meth->bn_mod_exp(A,A,rsa->e,rsa->n,ctx,rsa->_method_mod_n)) + goto err; + ret = BN_BLINDING_new(A,Ai,rsa->n); + BN_free(Ai); +err: + BN_CTX_end(ctx); + return ret; + } + +/* signing */ +static int RSA_eay_private_encrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa, int padding) + { + BIGNUM f,ret, *res; + int i,j,k,num=0,r= -1; + unsigned char *buf=NULL; + BN_CTX *ctx=NULL; + int local_blinding = 0; + BN_BLINDING *blinding = NULL; + + BN_init(&f); + BN_init(&ret); + + if ((ctx=BN_CTX_new()) == NULL) goto err; + num=BN_num_bytes(rsa->n); + if ((buf=(unsigned char *)OPENSSL_malloc(num)) == NULL) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_ENCRYPT,ERR_R_MALLOC_FAILURE); + goto err; + } + + switch (padding) + { + case RSA_PKCS1_PADDING: + i=RSA_padding_add_PKCS1_type_1(buf,num,from,flen); + break; + case RSA_NO_PADDING: + i=RSA_padding_add_none(buf,num,from,flen); + break; + case RSA_X931_PADDING: + i=RSA_padding_add_X931(buf,num,from,flen); + break; + case RSA_SSLV23_PADDING: + default: + RSAerr(RSA_F_RSA_EAY_PRIVATE_ENCRYPT,RSA_R_UNKNOWN_PADDING_TYPE); + goto err; + } + if (i <= 0) goto err; + + if (BN_bin2bn(buf,num,&f) == NULL) goto err; + + if (BN_ucmp(&f, rsa->n) >= 0) + { + /* usually the padding functions would catch this */ + RSAerr(RSA_F_RSA_EAY_PRIVATE_ENCRYPT,RSA_R_DATA_TOO_LARGE_FOR_MODULUS); + goto err; + } + + BLINDING_HELPER(rsa, ctx, goto err;); + blinding = rsa->blinding; + + /* Now unless blinding is disabled, 'blinding' is non-NULL. + * But the BN_BLINDING object may be owned by some other thread + * (we don't want to keep it constant and we don't want to use + * lots of locking to avoid race conditions, so only a single + * thread can use it; other threads have to use local blinding + * factors) */ + if (!(rsa->flags & RSA_FLAG_NO_BLINDING)) + { + if (blinding == NULL) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_ENCRYPT, ERR_R_INTERNAL_ERROR); + goto err; + } + } + + if (blinding != NULL) + { + if (blinding->thread_id != CRYPTO_thread_id()) + { + /* we need a local one-time blinding factor */ + + blinding = setup_blinding(rsa, ctx); + if (blinding == NULL) + goto err; + local_blinding = 1; + } + } + + if (blinding) + if (!BN_BLINDING_convert(&f, blinding, ctx)) goto err; + + if ( (rsa->flags & RSA_FLAG_EXT_PKEY) || + ((rsa->p != NULL) && + (rsa->q != NULL) && + (rsa->dmp1 != NULL) && + (rsa->dmq1 != NULL) && + (rsa->iqmp != NULL)) ) + { + if (!rsa->meth->rsa_mod_exp(&ret,&f,rsa)) goto err; + } + else + { + BIGNUM local_d; + BIGNUM *d = NULL; + + if (!(rsa->flags & RSA_FLAG_NO_EXP_CONSTTIME)) + { + BN_init(&local_d); + d = &local_d; + BN_with_flags(d, rsa->d, BN_FLG_EXP_CONSTTIME); + } + else + d = rsa->d; + if (!rsa->meth->bn_mod_exp(&ret,&f,d,rsa->n,ctx,NULL)) goto err; + } + + if (blinding) + if (!BN_BLINDING_invert(&ret, blinding, ctx)) goto err; + + if (padding == RSA_X931_PADDING) + { + BN_sub(&f, rsa->n, &ret); + if (BN_cmp(&ret, &f)) + res = &f; + else + res = &ret; + } + else + res = &ret; + + /* put in leading 0 bytes if the number is less than the + * length of the modulus */ + j=BN_num_bytes(res); + i=BN_bn2bin(res,&(to[num-j])); + for (k=0; k<(num-i); k++) + to[k]=0; + + r=num; +err: + if (ctx != NULL) BN_CTX_free(ctx); + BN_clear_free(&ret); + BN_clear_free(&f); + if (local_blinding) + BN_BLINDING_free(blinding); + if (buf != NULL) + { + OPENSSL_cleanse(buf,num); + OPENSSL_free(buf); + } + return(r); + } + +static int RSA_eay_private_decrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa, int padding) + { + BIGNUM f,ret; + int j,num=0,r= -1; + unsigned char *p; + unsigned char *buf=NULL; + BN_CTX *ctx=NULL; + int local_blinding = 0; + BN_BLINDING *blinding = NULL; + + BN_init(&f); + BN_init(&ret); + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + + num=BN_num_bytes(rsa->n); + + if ((buf=(unsigned char *)OPENSSL_malloc(num)) == NULL) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT,ERR_R_MALLOC_FAILURE); + goto err; + } + + /* This check was for equality but PGP does evil things + * and chops off the top '0' bytes */ + if (flen > num) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT,RSA_R_DATA_GREATER_THAN_MOD_LEN); + goto err; + } + + /* make data into a big number */ + if (BN_bin2bn(from,(int)flen,&f) == NULL) goto err; + + if (BN_ucmp(&f, rsa->n) >= 0) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT,RSA_R_DATA_TOO_LARGE_FOR_MODULUS); + goto err; + } + + BLINDING_HELPER(rsa, ctx, goto err;); + blinding = rsa->blinding; + + /* Now unless blinding is disabled, 'blinding' is non-NULL. + * But the BN_BLINDING object may be owned by some other thread + * (we don't want to keep it constant and we don't want to use + * lots of locking to avoid race conditions, so only a single + * thread can use it; other threads have to use local blinding + * factors) */ + if (!(rsa->flags & RSA_FLAG_NO_BLINDING)) + { + if (blinding == NULL) + { + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT, ERR_R_INTERNAL_ERROR); + goto err; + } + } + + if (blinding != NULL) + { + if (blinding->thread_id != CRYPTO_thread_id()) + { + /* we need a local one-time blinding factor */ + + blinding = setup_blinding(rsa, ctx); + if (blinding == NULL) + goto err; + local_blinding = 1; + } + } + + if (blinding) + if (!BN_BLINDING_convert(&f, blinding, ctx)) goto err; + + /* do the decrypt */ + if ( (rsa->flags & RSA_FLAG_EXT_PKEY) || + ((rsa->p != NULL) && + (rsa->q != NULL) && + (rsa->dmp1 != NULL) && + (rsa->dmq1 != NULL) && + (rsa->iqmp != NULL)) ) + { + if (!rsa->meth->rsa_mod_exp(&ret,&f,rsa)) goto err; + } + else + { + BIGNUM local_d; + BIGNUM *d = NULL; + + if (!(rsa->flags & RSA_FLAG_NO_EXP_CONSTTIME)) + { + d = &local_d; + BN_with_flags(d, rsa->d, BN_FLG_EXP_CONSTTIME); + } + else + d = rsa->d; + if (!rsa->meth->bn_mod_exp(&ret,&f,d,rsa->n,ctx,NULL)) + goto err; + } + + if (blinding) + if (!BN_BLINDING_invert(&ret, blinding, ctx)) goto err; + + p=buf; + j=BN_bn2bin(&ret,p); /* j is only used with no-padding mode */ + + switch (padding) + { + case RSA_PKCS1_PADDING: + r=RSA_padding_check_PKCS1_type_2(to,num,buf,j,num); + break; +#ifndef OPENSSL_NO_SHA + case RSA_PKCS1_OAEP_PADDING: + r=RSA_padding_check_PKCS1_OAEP(to,num,buf,j,num,NULL,0); + break; +#endif + case RSA_SSLV23_PADDING: + r=RSA_padding_check_SSLv23(to,num,buf,j,num); + break; + case RSA_NO_PADDING: + r=RSA_padding_check_none(to,num,buf,j,num); + break; + default: + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT,RSA_R_UNKNOWN_PADDING_TYPE); + goto err; + } + if (r < 0) + RSAerr(RSA_F_RSA_EAY_PRIVATE_DECRYPT,RSA_R_PADDING_CHECK_FAILED); + +err: + if (ctx != NULL) BN_CTX_free(ctx); + BN_clear_free(&f); + BN_clear_free(&ret); + if (local_blinding) + BN_BLINDING_free(blinding); + if (buf != NULL) + { + OPENSSL_cleanse(buf,num); + OPENSSL_free(buf); + } + return(r); + } + +/* signature verification */ +static int RSA_eay_public_decrypt(FIPS_RSA_SIZE_T flen, const unsigned char *from, + unsigned char *to, RSA *rsa, int padding) + { + BIGNUM f,ret; + int i,num=0,r= -1; + unsigned char *p; + unsigned char *buf=NULL; + BN_CTX *ctx=NULL; + + BN_init(&f); + BN_init(&ret); + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + + num=BN_num_bytes(rsa->n); + buf=(unsigned char *)OPENSSL_malloc(num); + if (buf == NULL) + { + RSAerr(RSA_F_RSA_EAY_PUBLIC_DECRYPT,ERR_R_MALLOC_FAILURE); + goto err; + } + + /* This check was for equality but PGP does evil things + * and chops off the top '0' bytes */ + if (flen > num) + { + RSAerr(RSA_F_RSA_EAY_PUBLIC_DECRYPT,RSA_R_DATA_GREATER_THAN_MOD_LEN); + goto err; + } + + if (BN_bin2bn(from,flen,&f) == NULL) goto err; + + if (BN_ucmp(&f, rsa->n) >= 0) + { + RSAerr(RSA_F_RSA_EAY_PUBLIC_DECRYPT,RSA_R_DATA_TOO_LARGE_FOR_MODULUS); + goto err; + } + + /* do the decrypt */ + + if (rsa->flags & RSA_FLAG_CACHE_PUBLIC) + { + if (!BN_MONT_CTX_set_locked(&rsa->_method_mod_n, + CRYPTO_LOCK_RSA, rsa->n, ctx)) + goto err; + } + + if (!rsa->meth->bn_mod_exp(&ret,&f,rsa->e,rsa->n,ctx, + rsa->_method_mod_n)) goto err; + + if ((padding == RSA_X931_PADDING) && ((ret.d[0] & 0xf) != 12)) + BN_sub(&ret, rsa->n, &ret); + + p=buf; + i=BN_bn2bin(&ret,p); + + switch (padding) + { + case RSA_PKCS1_PADDING: + r=RSA_padding_check_PKCS1_type_1(to,num,buf,i,num); + break; + case RSA_X931_PADDING: + r=RSA_padding_check_X931(to,num,buf,i,num); + break; + case RSA_NO_PADDING: + r=RSA_padding_check_none(to,num,buf,i,num); + break; + default: + RSAerr(RSA_F_RSA_EAY_PUBLIC_DECRYPT,RSA_R_UNKNOWN_PADDING_TYPE); + goto err; + } + if (r < 0) + RSAerr(RSA_F_RSA_EAY_PUBLIC_DECRYPT,RSA_R_PADDING_CHECK_FAILED); + +err: + if (ctx != NULL) BN_CTX_free(ctx); + BN_clear_free(&f); + BN_clear_free(&ret); + if (buf != NULL) + { + OPENSSL_cleanse(buf,num); + OPENSSL_free(buf); + } + return(r); + } + +static int RSA_eay_mod_exp(BIGNUM *r0, const BIGNUM *I, RSA *rsa) + { + BIGNUM r1,m1,vrfy; + BIGNUM local_dmp1, local_dmq1; + BIGNUM *dmp1, *dmq1; + int ret=0; + BN_CTX *ctx; + + BN_init(&m1); + BN_init(&r1); + BN_init(&vrfy); + if ((ctx=BN_CTX_new()) == NULL) goto err; + + if (rsa->flags & RSA_FLAG_CACHE_PRIVATE) + { + if (!BN_MONT_CTX_set_locked(&rsa->_method_mod_p, + CRYPTO_LOCK_RSA, rsa->p, ctx)) + goto err; + if (!BN_MONT_CTX_set_locked(&rsa->_method_mod_q, + CRYPTO_LOCK_RSA, rsa->q, ctx)) + goto err; + } + + if (!BN_mod(&r1,I,rsa->q,ctx)) goto err; + if (!(rsa->flags & RSA_FLAG_NO_EXP_CONSTTIME)) + { + dmq1 = &local_dmq1; + BN_with_flags(dmq1, rsa->dmq1, BN_FLG_EXP_CONSTTIME); + } + else + dmq1 = rsa->dmq1; + if (!rsa->meth->bn_mod_exp(&m1,&r1,dmq1,rsa->q,ctx, + rsa->_method_mod_q)) goto err; + + if (!BN_mod(&r1,I,rsa->p,ctx)) goto err; + if (!(rsa->flags & RSA_FLAG_NO_EXP_CONSTTIME)) + { + dmp1 = &local_dmp1; + BN_with_flags(dmp1, rsa->dmp1, BN_FLG_EXP_CONSTTIME); + } + else + dmp1 = rsa->dmp1; + if (!rsa->meth->bn_mod_exp(r0,&r1,dmp1,rsa->p,ctx, + rsa->_method_mod_p)) goto err; + + if (!BN_sub(r0,r0,&m1)) goto err; + /* This will help stop the size of r0 increasing, which does + * affect the multiply if it optimised for a power of 2 size */ + if (r0->neg) + if (!BN_add(r0,r0,rsa->p)) goto err; + + if (!BN_mul(&r1,r0,rsa->iqmp,ctx)) goto err; + if (!BN_mod(r0,&r1,rsa->p,ctx)) goto err; + /* If p < q it is occasionally possible for the correction of + * adding 'p' if r0 is negative above to leave the result still + * negative. This can break the private key operations: the following + * second correction should *always* correct this rare occurrence. + * This will *never* happen with OpenSSL generated keys because + * they ensure p > q [steve] + */ + if (r0->neg) + if (!BN_add(r0,r0,rsa->p)) goto err; + if (!BN_mul(&r1,r0,rsa->q,ctx)) goto err; + if (!BN_add(r0,&r1,&m1)) goto err; + + if (rsa->e && rsa->n) + { + if (!rsa->meth->bn_mod_exp(&vrfy,r0,rsa->e,rsa->n,ctx,NULL)) goto err; + /* If 'I' was greater than (or equal to) rsa->n, the operation + * will be equivalent to using 'I mod n'. However, the result of + * the verify will *always* be less than 'n' so we don't check + * for absolute equality, just congruency. */ + if (!BN_sub(&vrfy, &vrfy, I)) goto err; + if (!BN_mod(&vrfy, &vrfy, rsa->n, ctx)) goto err; + if (vrfy.neg) + if (!BN_add(&vrfy, &vrfy, rsa->n)) goto err; + if (!BN_is_zero(&vrfy)) + { + /* 'I' and 'vrfy' aren't congruent mod n. Don't leak + * miscalculated CRT output, just do a raw (slower) + * mod_exp and return that instead. */ + + BIGNUM local_d; + BIGNUM *d = NULL; + + if (!(rsa->flags & RSA_FLAG_NO_EXP_CONSTTIME)) + { + d = &local_d; + BN_with_flags(d, rsa->d, BN_FLG_EXP_CONSTTIME); + } + else + d = rsa->d; + if (!rsa->meth->bn_mod_exp(r0,I,d,rsa->n,ctx,NULL)) goto err; + } + } + ret=1; +err: + BN_clear_free(&m1); + BN_clear_free(&r1); + BN_clear_free(&vrfy); + BN_CTX_free(ctx); + return(ret); + } + +static int RSA_eay_init(RSA *rsa) + { + rsa->flags|=RSA_FLAG_CACHE_PUBLIC|RSA_FLAG_CACHE_PRIVATE; + return(1); + } + +static int RSA_eay_finish(RSA *rsa) + { + if (rsa->_method_mod_n != NULL) + BN_MONT_CTX_free(rsa->_method_mod_n); + if (rsa->_method_mod_p != NULL) + BN_MONT_CTX_free(rsa->_method_mod_p); + if (rsa->_method_mod_q != NULL) + BN_MONT_CTX_free(rsa->_method_mod_q); + return(1); + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsa_gen.c b/lib/libssl/src/fips-1.0/rsa/fips_rsa_gen.c new file mode 100644 index 00000000000..3f50746733e --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsa_gen.c @@ -0,0 +1,282 @@ +/* crypto/rsa/rsa_gen.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <string.h> +#include <time.h> +#include <openssl/err.h> +#include <openssl/bn.h> +#include <openssl/rsa.h> +#include <openssl/fips.h> + +void *OPENSSL_stderr(void); + +#ifdef OPENSSL_FIPS + +int fips_check_rsa(RSA *rsa) + { + int n, ret = 0; + unsigned char tctext[256], *ctext = tctext; + unsigned char tptext[256], *ptext = tptext; + /* The longest we can have with PKCS#1 v1.5 padding and a 512 bit key, + * namely 512/8-11-1 = 52 bytes */ + static const unsigned char original_ptext[] = + "\x01\x23\x45\x67\x89\xab\xcd\xef\x01\x23\x45\x67\x89\xab\xcd\xef" + "\x01\x23\x45\x67\x89\xab\xcd\xef\x01\x23\x45\x67\x89\xab\xcd\xef" + "\x01\x23\x45\x67\x89\xab\xcd\xef\x01\x23\x45\x67\x89\xab\xcd\xef" + "\x01\x23\x45\x67"; + + if (RSA_size(rsa) > sizeof(tctext)) + { + ctext = OPENSSL_malloc(RSA_size(rsa)); + ptext = OPENSSL_malloc(RSA_size(rsa)); + if (!ctext || !ptext) + { + ERR_print_errors_fp(OPENSSL_stderr()); + exit(1); + } + } + + + /* this will fail for keys shorter than 512 bits */ + n=RSA_private_encrypt(sizeof(original_ptext)-1,original_ptext,ctext,rsa, + RSA_PKCS1_PADDING); + if(n < 0) + { + ERR_print_errors_fp(OPENSSL_stderr()); + exit(1); + } + if(!memcmp(ctext,original_ptext,n)) + { + FIPSerr(FIPS_F_FIPS_CHECK_RSA,FIPS_R_PAIRWISE_TEST_FAILED); + goto error; + } + n=RSA_public_decrypt(n,ctext,ptext,rsa,RSA_PKCS1_PADDING); + if(n < 0) + { + ERR_print_errors_fp(OPENSSL_stderr()); + exit(1); + } + if(n != sizeof(original_ptext)-1 || memcmp(ptext,original_ptext,n)) + { + FIPSerr(FIPS_F_FIPS_CHECK_RSA,FIPS_R_PAIRWISE_TEST_FAILED); + goto error; + } + + ret = 1; + + error: + + if (RSA_size(rsa) > sizeof(tctext)) + { + OPENSSL_free(ctext); + OPENSSL_free(ptext); + } + + return ret; + } + +RSA *RSA_generate_key(FIPS_RSA_SIZE_T bits, unsigned long e_value, + void (*callback)(int,int,void *), void *cb_arg) + { + RSA *rsa=NULL; + BIGNUM *r0=NULL,*r1=NULL,*r2=NULL,*r3=NULL,*tmp; + int bitsp,bitsq,ok= -1,n=0,i; + BN_CTX *ctx=NULL,*ctx2=NULL; + + if (bits < 512) + { + FIPSerr(FIPS_F_RSA_GENERATE_KEY,FIPS_R_KEY_TOO_SHORT); + return NULL; + } + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_RSA_GENERATE_KEY,FIPS_R_FIPS_SELFTEST_FAILED); + return NULL; + } + + ctx=BN_CTX_new(); + if (ctx == NULL) goto err; + ctx2=BN_CTX_new(); + if (ctx2 == NULL) goto err; + BN_CTX_start(ctx); + r0 = BN_CTX_get(ctx); + r1 = BN_CTX_get(ctx); + r2 = BN_CTX_get(ctx); + r3 = BN_CTX_get(ctx); + if (r3 == NULL) goto err; + + bitsp=(bits+1)/2; + bitsq=bits-bitsp; + rsa=RSA_new(); + if (rsa == NULL) goto err; + + /* set e */ + rsa->e=BN_new(); + if (rsa->e == NULL) goto err; + +#if 1 + /* The problem is when building with 8, 16, or 32 BN_ULONG, + * unsigned long can be larger */ + for (i=0; i<sizeof(unsigned long)*8; i++) + { + if (e_value & (1UL<<i)) + BN_set_bit(rsa->e,i); + } +#else + if (!BN_set_word(rsa->e,e_value)) goto err; +#endif + + /* generate p and q */ + for (;;) + { + rsa->p=BN_generate_prime(NULL,bitsp,0,NULL,NULL,callback,cb_arg); + if (rsa->p == NULL) goto err; + if (!BN_sub(r2,rsa->p,BN_value_one())) goto err; + if (!BN_gcd(r1,r2,rsa->e,ctx)) goto err; + if (BN_is_one(r1)) break; + if (callback != NULL) callback(2,n++,cb_arg); + BN_free(rsa->p); + } + if (callback != NULL) callback(3,0,cb_arg); + for (;;) + { + rsa->q=BN_generate_prime(NULL,bitsq,0,NULL,NULL,callback,cb_arg); + if (rsa->q == NULL) goto err; + if (!BN_sub(r2,rsa->q,BN_value_one())) goto err; + if (!BN_gcd(r1,r2,rsa->e,ctx)) goto err; + if (BN_is_one(r1) && (BN_cmp(rsa->p,rsa->q) != 0)) + break; + if (callback != NULL) callback(2,n++,cb_arg); + BN_free(rsa->q); + } + if (callback != NULL) callback(3,1,cb_arg); + if (BN_cmp(rsa->p,rsa->q) < 0) + { + tmp=rsa->p; + rsa->p=rsa->q; + rsa->q=tmp; + } + + /* calculate n */ + rsa->n=BN_new(); + if (rsa->n == NULL) goto err; + if (!BN_mul(rsa->n,rsa->p,rsa->q,ctx)) goto err; + + /* calculate d */ + if (!BN_sub(r1,rsa->p,BN_value_one())) goto err; /* p-1 */ + if (!BN_sub(r2,rsa->q,BN_value_one())) goto err; /* q-1 */ + if (!BN_mul(r0,r1,r2,ctx)) goto err; /* (p-1)(q-1) */ + +/* should not be needed, since gcd(p-1,e) == 1 and gcd(q-1,e) == 1 */ +/* for (;;) + { + if (!BN_gcd(r3,r0,rsa->e,ctx)) goto err; + if (BN_is_one(r3)) break; + + if (1) + { + if (!BN_add_word(rsa->e,2L)) goto err; + continue; + } + RSAerr(RSA_F_RSA_GENERATE_KEY,RSA_R_BAD_E_VALUE); + goto err; + } +*/ + rsa->d=BN_mod_inverse(NULL,rsa->e,r0,ctx2); /* d */ + if (rsa->d == NULL) goto err; + + /* calculate d mod (p-1) */ + rsa->dmp1=BN_new(); + if (rsa->dmp1 == NULL) goto err; + if (!BN_mod(rsa->dmp1,rsa->d,r1,ctx)) goto err; + + /* calculate d mod (q-1) */ + rsa->dmq1=BN_new(); + if (rsa->dmq1 == NULL) goto err; + if (!BN_mod(rsa->dmq1,rsa->d,r2,ctx)) goto err; + + /* calculate inverse of q mod p */ + rsa->iqmp=BN_mod_inverse(NULL,rsa->q,rsa->p,ctx2); + if (rsa->iqmp == NULL) goto err; + + if(!fips_check_rsa(rsa)) + goto err; + + ok=1; +err: + if (ok == -1) + { + RSAerr(RSA_F_RSA_GENERATE_KEY,ERR_LIB_BN); + ok=0; + } + BN_CTX_end(ctx); + BN_CTX_free(ctx); + BN_CTX_free(ctx2); + + if (!ok) + { + if (rsa != NULL) RSA_free(rsa); + return(NULL); + } + else + return(rsa); + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsa_selftest.c b/lib/libssl/src/fips-1.0/rsa/fips_rsa_selftest.c new file mode 100644 index 00000000000..0b620c717bb --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsa_selftest.c @@ -0,0 +1,251 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/rsa.h> +#include <openssl/fips_sha.h> +#include <openssl/opensslconf.h> + +#ifdef OPENSSL_FIPS +#define SetKey \ + key->n = BN_bin2bn(n, sizeof(n)-1, key->n); \ + key->e = BN_bin2bn(e, sizeof(e)-1, key->e); \ + key->d = BN_bin2bn(d, sizeof(d)-1, key->d); \ + key->p = BN_bin2bn(p, sizeof(p)-1, key->p); \ + key->q = BN_bin2bn(q, sizeof(q)-1, key->q); \ + key->dmp1 = BN_bin2bn(dmp1, sizeof(dmp1)-1, key->dmp1); \ + key->dmq1 = BN_bin2bn(dmq1, sizeof(dmq1)-1, key->dmq1); \ + key->iqmp = BN_bin2bn(iqmp, sizeof(iqmp)-1, key->iqmp); \ + memcpy(c, ctext_ex, sizeof(ctext_ex) - 1); \ + return (sizeof(ctext_ex) - 1); + +static unsigned char n[] = +"\x00\xBB\xF8\x2F\x09\x06\x82\xCE\x9C\x23\x38\xAC\x2B\x9D\xA8\x71" +"\xF7\x36\x8D\x07\xEE\xD4\x10\x43\xA4\x40\xD6\xB6\xF0\x74\x54\xF5" +"\x1F\xB8\xDF\xBA\xAF\x03\x5C\x02\xAB\x61\xEA\x48\xCE\xEB\x6F\xCD" +"\x48\x76\xED\x52\x0D\x60\xE1\xEC\x46\x19\x71\x9D\x8A\x5B\x8B\x80" +"\x7F\xAF\xB8\xE0\xA3\xDF\xC7\x37\x72\x3E\xE6\xB4\xB7\xD9\x3A\x25" +"\x84\xEE\x6A\x64\x9D\x06\x09\x53\x74\x88\x34\xB2\x45\x45\x98\x39" +"\x4E\xE0\xAA\xB1\x2D\x7B\x61\xA5\x1F\x52\x7A\x9A\x41\xF6\xC1\x68" +"\x7F\xE2\x53\x72\x98\xCA\x2A\x8F\x59\x46\xF8\xE5\xFD\x09\x1D\xBD" +"\xCB"; + + +static int setrsakey(RSA *key, unsigned char *c) + { + static const unsigned char e[] = "\x11"; + + static const unsigned char d[] = +"\x00\xA5\xDA\xFC\x53\x41\xFA\xF2\x89\xC4\xB9\x88\xDB\x30\xC1\xCD" +"\xF8\x3F\x31\x25\x1E\x06\x68\xB4\x27\x84\x81\x38\x01\x57\x96\x41" +"\xB2\x94\x10\xB3\xC7\x99\x8D\x6B\xC4\x65\x74\x5E\x5C\x39\x26\x69" +"\xD6\x87\x0D\xA2\xC0\x82\xA9\x39\xE3\x7F\xDC\xB8\x2E\xC9\x3E\xDA" +"\xC9\x7F\xF3\xAD\x59\x50\xAC\xCF\xBC\x11\x1C\x76\xF1\xA9\x52\x94" +"\x44\xE5\x6A\xAF\x68\xC5\x6C\x09\x2C\xD3\x8D\xC3\xBE\xF5\xD2\x0A" +"\x93\x99\x26\xED\x4F\x74\xA1\x3E\xDD\xFB\xE1\xA1\xCE\xCC\x48\x94" +"\xAF\x94\x28\xC2\xB7\xB8\x88\x3F\xE4\x46\x3A\x4B\xC8\x5B\x1C\xB3" +"\xC1"; + + static const unsigned char p[] = +"\x00\xEE\xCF\xAE\x81\xB1\xB9\xB3\xC9\x08\x81\x0B\x10\xA1\xB5\x60" +"\x01\x99\xEB\x9F\x44\xAE\xF4\xFD\xA4\x93\xB8\x1A\x9E\x3D\x84\xF6" +"\x32\x12\x4E\xF0\x23\x6E\x5D\x1E\x3B\x7E\x28\xFA\xE7\xAA\x04\x0A" +"\x2D\x5B\x25\x21\x76\x45\x9D\x1F\x39\x75\x41\xBA\x2A\x58\xFB\x65" +"\x99"; + + static const unsigned char q[] = +"\x00\xC9\x7F\xB1\xF0\x27\xF4\x53\xF6\x34\x12\x33\xEA\xAA\xD1\xD9" +"\x35\x3F\x6C\x42\xD0\x88\x66\xB1\xD0\x5A\x0F\x20\x35\x02\x8B\x9D" +"\x86\x98\x40\xB4\x16\x66\xB4\x2E\x92\xEA\x0D\xA3\xB4\x32\x04\xB5" +"\xCF\xCE\x33\x52\x52\x4D\x04\x16\xA5\xA4\x41\xE7\x00\xAF\x46\x15" +"\x03"; + + static const unsigned char dmp1[] = +"\x54\x49\x4C\xA6\x3E\xBA\x03\x37\xE4\xE2\x40\x23\xFC\xD6\x9A\x5A" +"\xEB\x07\xDD\xDC\x01\x83\xA4\xD0\xAC\x9B\x54\xB0\x51\xF2\xB1\x3E" +"\xD9\x49\x09\x75\xEA\xB7\x74\x14\xFF\x59\xC1\xF7\x69\x2E\x9A\x2E" +"\x20\x2B\x38\xFC\x91\x0A\x47\x41\x74\xAD\xC9\x3C\x1F\x67\xC9\x81"; + + static const unsigned char dmq1[] = +"\x47\x1E\x02\x90\xFF\x0A\xF0\x75\x03\x51\xB7\xF8\x78\x86\x4C\xA9" +"\x61\xAD\xBD\x3A\x8A\x7E\x99\x1C\x5C\x05\x56\xA9\x4C\x31\x46\xA7" +"\xF9\x80\x3F\x8F\x6F\x8A\xE3\x42\xE9\x31\xFD\x8A\xE4\x7A\x22\x0D" +"\x1B\x99\xA4\x95\x84\x98\x07\xFE\x39\xF9\x24\x5A\x98\x36\xDA\x3D"; + + static const unsigned char iqmp[] = +"\x00\xB0\x6C\x4F\xDA\xBB\x63\x01\x19\x8D\x26\x5B\xDB\xAE\x94\x23" +"\xB3\x80\xF2\x71\xF7\x34\x53\x88\x50\x93\x07\x7F\xCD\x39\xE2\x11" +"\x9F\xC9\x86\x32\x15\x4F\x58\x83\xB1\x67\xA9\x67\xBF\x40\x2B\x4E" +"\x9E\x2E\x0F\x96\x56\xE6\x98\xEA\x36\x66\xED\xFB\x25\x79\x80\x39" +"\xF7"; + + static const unsigned char ctext_ex[] = +"\x42\x4b\xc9\x51\x61\xd4\xca\xa0\x18\x6c\x4d\xca\x61\x8f\x2d\x07" +"\x8c\x63\xc5\x6b\xa2\x4c\x32\xb1\xda\xb7\xdd\x32\xb6\x51\x68\xc3" +"\x6e\x98\x46\xd6\xbb\x1a\xd5\x99\x05\x92\x7c\xd7\xbc\x08\x9e\xe4" +"\xc3\x70\x4d\xe6\x99\x7e\x61\x31\x07\x7a\x19\xdb\x3e\x11\xfa\x3d" +"\x7c\x61\xd7\x78\x14\x3f\x05\x16\xa0\xc4\xbf\xcd\xee\xca\x67\x4c" +"\x80\x4e\xca\x43\x2f\x35\x43\x58\xa7\x50\x7e\x3e\x52\x82\xab\xac" +"\xa6\x50\xe8\x39\x9f\xe0\x7f\x58\x1d\x1b\x90\x93\x04\xec\xb3\xf9" +"\x24\xd3\x75\x3e\x39\xd1\x14\xc6\x33\xce\xd6\xee\x20\x47\xec\xe4"; + + SetKey; + } + +void FIPS_corrupt_rsa() + { + n[0]++; + } + +int FIPS_selftest_rsa() + { + int clen; + RSA *key; + unsigned char expected_ctext[256]; + unsigned char ctext[256]; + unsigned char ptext[256]; + static const unsigned char original_ptext[] = + "\x01\x23\x45\x67\x89\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0" + "\x23\x45\x67\x89\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12" + "\x45\x67\x89\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34" + "\x67\x89\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56" + "\x89\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56\x78" + "\xab\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56\x78\x9a" + "\xcd\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56\x78\x9a\xbc" + "\xef\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56\x78\x9a\xbc\xde" + "\xf0\x12\x34\x56\x78\x9a\xbc\xde\xf0\x12\x34\x56\x78\x9a\xbc\xde"; + unsigned char md[SHA_DIGEST_LENGTH]; + static const unsigned char mdkat[SHA_DIGEST_LENGTH] = + "\x2d\x57\x1d\x6f\x5c\x37\xf9\xf0\x3b\xb4\x3c\xe8\x2c\x4c\xb3\x04" + "\x75\xa2\x0e\xfb"; + static const unsigned char ctextkat[] = + "\x3e\xc5\x0a\xbe\x29\xa2\xca\x9a\x35\x14\x17\x26\xa4\x0f\xa3\x03" + "\x65\xb5\x37\xf5\x6a\xaa\xb\xf\x2c\x0d\x8\xc0\x73\x8\x3c\x88\x85" + "\x36\x68\x16\xfe\x2f\x59\x77\x7e\x2a\x76\x9a\xc7\x27\x19\x9b\x54" + "\x14\x87\xf3\xe0\xce\x1e\x68\x10\x40\x14\xac\xbc\xe6\x6f\x26\x1f" + "\x55\xd1\x15\x81\x48\x10\xf4\x89\xe5\x67\x52\x42\x87\x04\x74\x4e" + "\x96\x14\x7c\x53\xc9\x1e\x84\x11\x7d\x7d\x23\xbd\xff\x6c\xcb\x00" + "\x96\x2e\x7d\xfb\x47\xea\x78\xcd\xd8\x04\x3a\x98\x06\x13\x68\x39" + "\xa1\xe2\xbc\x9f\x64\xc7\x62\xf0\x74\x4d\x42\xe0\x0b\xcf\x24\x48"; + int i; + + /* Perform pairwise consistency test by: ... */ + + key=RSA_new(); + clen=setrsakey(key,expected_ctext); + /* ...1) apply public key to plaintext, resulting ciphertext must be + * different + */ + i=RSA_public_encrypt(128,original_ptext,ctext,key, + RSA_NO_PADDING); + if(i != clen || memcmp(ctext,expected_ctext,i)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + if(!memcmp(ctext,original_ptext,i)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + /* ...2) apply private key to ciphertext and compare result to + * original plaintext; results must be equal + */ + i=RSA_private_decrypt(i,ctext,ptext,key,RSA_NO_PADDING); + if(i != 128 || memcmp(ptext,original_ptext,i)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + + /* Perform sign and verify Known Answer Test by... */ + + /* ...1) using the same RSA key to encrypt the SHA-1 hash of a + * plaintext value larger than the RSA key size + */ + if (RSA_size(key) >= sizeof(original_ptext) - 1) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + /* ...2) then generate the SHA-1 digest of plaintext, and compare the + * digest to the Known Answer (note here we duplicate the SHA-1 KAT) + */ + SHA1(original_ptext,sizeof(original_ptext) - 1,md); + if(memcmp(md,mdkat,SHA_DIGEST_LENGTH)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_SHA,FIPS_R_SELFTEST_FAILED); + return 0; + } + /* ...3) then encrypt the digest, and compare the ciphertext + * to the Known Answer + */ + i=RSA_private_encrypt(sizeof(md),md,ctext,key,RSA_PKCS1_PADDING); + if(i != clen || memcmp(ctextkat,ctext,i)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + /* ...4) and finally decrypt the signed digest and compare with + * the original Known Answer + */ + i=RSA_public_decrypt(i,ctext,md,key,RSA_PKCS1_PADDING); + if(i != sizeof(md) || memcmp(mdkat,md,i)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_RSA,FIPS_R_SELFTEST_FAILED); + return 0; + } + + RSA_free(key); + return 1; + } + +#endif /* def OPENSSL_FIPS */ diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsa_x931g.c b/lib/libssl/src/fips-1.0/rsa/fips_rsa_x931g.c new file mode 100644 index 00000000000..41e1473bca7 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsa_x931g.c @@ -0,0 +1,289 @@ +/* crypto/rsa/rsa_gen.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdio.h> +#include <string.h> +#include <time.h> +#include <openssl/err.h> +#include <openssl/bn.h> +#include <openssl/rsa.h> +#include <openssl/fips.h> + +#ifdef OPENSSL_FIPS + +extern int fips_check_rsa(RSA *rsa); + + +/* X9.31 RSA key derivation and generation */ + +int RSA_X931_derive(RSA *rsa, BIGNUM *p1, BIGNUM *p2, BIGNUM *q1, BIGNUM *q2, + void (*cb)(int, int, void *), void *cb_arg, + const BIGNUM *Xp1, const BIGNUM *Xp2, const BIGNUM *Xp, + const BIGNUM *Xq1, const BIGNUM *Xq2, const BIGNUM *Xq, + const BIGNUM *e) + { + BIGNUM *r0=NULL,*r1=NULL,*r2=NULL,*r3=NULL; + BN_CTX *ctx=NULL,*ctx2=NULL; + + if (!rsa) + goto err; + + ctx = BN_CTX_new(); + BN_CTX_start(ctx); + if (!ctx) + goto err; + + r0 = BN_CTX_get(ctx); + r1 = BN_CTX_get(ctx); + r2 = BN_CTX_get(ctx); + r3 = BN_CTX_get(ctx); + + if (r3 == NULL) + goto err; + if (!rsa->e) + { + rsa->e = BN_dup(e); + if (!rsa->e) + goto err; + } + else + e = rsa->e; + + /* If not all parameters present only calculate what we can. + * This allows test programs to output selective parameters. + */ + + if (Xp && !rsa->p) + { + rsa->p = BN_new(); + if (!rsa->p) + goto err; + + if (!BN_X931_derive_prime(rsa->p, p1, p2, cb, cb_arg, + Xp, Xp1, Xp2, e, ctx)) + goto err; + } + + if (Xq && !rsa->q) + { + rsa->q = BN_new(); + if (!rsa->q) + goto err; + if (!BN_X931_derive_prime(rsa->q, q1, q2, cb, cb_arg, + Xq, Xq1, Xq2, e, ctx)) + goto err; + } + + if (!rsa->p || !rsa->q) + { + BN_CTX_end(ctx); + BN_CTX_free(ctx); + return 2; + } + + /* Since both primes are set we can now calculate all remaining + * components. + */ + + /* calculate n */ + rsa->n=BN_new(); + if (rsa->n == NULL) + goto err; + if (!BN_mul(rsa->n,rsa->p,rsa->q,ctx)) + goto err; + + /* calculate d */ + if (!BN_sub(r1,rsa->p,BN_value_one())) + goto err; /* p-1 */ + if (!BN_sub(r2,rsa->q,BN_value_one())) + goto err; /* q-1 */ + if (!BN_mul(r0,r1,r2,ctx)) + goto err; /* (p-1)(q-1) */ + + if (!BN_gcd(r3, r1, r2, ctx)) + goto err; + + if (!BN_div(r0, NULL, r0, r3, ctx)) + goto err; /* LCM((p-1)(q-1)) */ + + ctx2 = BN_CTX_new(); + if (!ctx2) + goto err; + + rsa->d=BN_mod_inverse(NULL,rsa->e,r0,ctx2); /* d */ + if (rsa->d == NULL) + goto err; + + /* calculate d mod (p-1) */ + rsa->dmp1=BN_new(); + if (rsa->dmp1 == NULL) + goto err; + if (!BN_mod(rsa->dmp1,rsa->d,r1,ctx)) + goto err; + + /* calculate d mod (q-1) */ + rsa->dmq1=BN_new(); + if (rsa->dmq1 == NULL) + goto err; + if (!BN_mod(rsa->dmq1,rsa->d,r2,ctx)) + goto err; + + /* calculate inverse of q mod p */ + rsa->iqmp=BN_mod_inverse(NULL,rsa->q,rsa->p,ctx2); + + err: + if (ctx) + { + BN_CTX_end(ctx); + BN_CTX_free(ctx); + } + if (ctx2) + BN_CTX_free(ctx2); + /* If this is set all calls successful */ + if (rsa->iqmp != NULL) + return 1; + + return 0; + + } + +RSA *RSA_X931_generate_key(FIPS_RSA_SIZE_T bits, const BIGNUM *e, + void (*cb)(int,int,void *), void *cb_arg) + { + RSA *rsa = NULL; + int ok = 0; + BIGNUM *Xp = NULL, *Xq = NULL; + BN_CTX *ctx = NULL; + + if (bits < 1024) + { + FIPSerr(FIPS_F_RSA_X931_GENERATE_KEY,FIPS_R_KEY_TOO_SHORT); + return NULL; + } + + if (bits & 0xff) + { + FIPSerr(FIPS_F_RSA_X931_GENERATE_KEY,FIPS_R_INVALID_KEY_LENGTH); + return NULL; + } + + if(FIPS_selftest_failed()) + { + FIPSerr(FIPS_F_RSA_X931_GENERATE_KEY,FIPS_R_FIPS_SELFTEST_FAILED); + return NULL; + } + + ctx = BN_CTX_new(); + if (!ctx) + goto error; + + BN_CTX_start(ctx); + Xp = BN_CTX_get(ctx); + Xq = BN_CTX_get(ctx); + if (!BN_X931_generate_Xpq(Xp, Xq, bits, ctx)) + goto error; + + rsa = RSA_new(); + if (!rsa) + goto error; + rsa->p = BN_new(); + rsa->q = BN_new(); + if (!rsa->p || !rsa->q) + goto error; + + /* Generate two primes from Xp, Xq */ + + if (!BN_X931_generate_prime(rsa->p, NULL, NULL, NULL, NULL, Xp, + e, ctx, cb, cb_arg)) + goto error; + + if (!BN_X931_generate_prime(rsa->q, NULL, NULL, NULL, NULL, Xq, + e, ctx, cb, cb_arg)) + goto error; + + /* Since rsa->p and rsa->q are valid this call will just derive + * remaining RSA components. + */ + + if (!RSA_X931_derive(rsa, NULL, NULL, NULL, NULL, cb, cb_arg, + NULL, NULL, NULL, NULL, NULL, NULL, e)) + goto error; + + if(!fips_check_rsa(rsa)) + goto error; + + ok = 1; + + error: + if (ctx) + { + BN_CTX_end(ctx); + BN_CTX_free(ctx); + } + + if (ok) + return rsa; + + if (rsa) + RSA_free(rsa); + + return NULL; + + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsagtest.c b/lib/libssl/src/fips-1.0/rsa/fips_rsagtest.c new file mode 100644 index 00000000000..15d3225d538 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsagtest.c @@ -0,0 +1,420 @@ +/* fips_rsagtest.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#include <openssl/bio.h> +#include <openssl/evp.h> +#include <openssl/hmac.h> +#include <openssl/err.h> +#include <openssl/x509v3.h> + +#ifndef OPENSSL_FIPS + +int main(int argc, char *argv[]) +{ + printf("No FIPS RSA support\n"); + return(0); +} + +#else + +extern int RSA_X931_derive(RSA *rsa, BIGNUM *p1, BIGNUM *p2, BIGNUM *q1, BIGNUM *q2, + void (*cb)(int, int, void *), void *cb_arg, + const BIGNUM *Xp1, const BIGNUM *Xp2, const BIGNUM *Xp, + const BIGNUM *Xq1, const BIGNUM *Xq2, const BIGNUM *Xq, + const BIGNUM *e); + +int rsa_test(BIO *err, BIO *out, BIO *in); +static int rsa_printkey1(BIO *err, BIO *out, RSA *rsa, + BIGNUM *Xp1, BIGNUM *Xp2, BIGNUM *Xp, + BIGNUM *e); +static int rsa_printkey2(BIO *err, BIO *out, RSA *rsa, + BIGNUM *Xq1, BIGNUM *Xq2, BIGNUM *Xq); + +int main(int argc, char **argv) + { + BIO *in = NULL, *out = NULL, *err = NULL; + + int ret = 1; + ERR_load_crypto_strings(); + + err = BIO_new_fp(stderr, BIO_NOCLOSE); + + if (!err) + { + fprintf(stderr, "FATAL stderr initialization error\n"); + goto end; + } + + if(!FIPS_mode_set(1)) + { + ERR_print_errors(err); + goto end; + } + + if (argc == 1) + in = BIO_new_fp(stdin, BIO_NOCLOSE); + else + in = BIO_new_file(argv[1], "r"); + + if (argc < 2) + out = BIO_new_fp(stdout, BIO_NOCLOSE); + else + out = BIO_new_file(argv[2], "w"); + + if (!in) + { + BIO_printf(err, "FATAL input initialization error\n"); + goto end; + } + + if (!out) + { + fprintf(stderr, "FATAL output initialization error\n"); + goto end; + } + + if (!rsa_test(err, out, in)) + { + fprintf(stderr, "FATAL RSAVTEST file processing error\n"); + goto end; + } + else + ret = 0; + + end: + + if (ret && err) + ERR_print_errors(err); + + if (in) + BIO_free(in); + if (out) + BIO_free(out); + if (err) + BIO_free(err); + + return ret; + + } + + +static void do_bn_print(BIO *out, const char *name, BIGNUM *b) + { + char *htmp, *p; + /* Can't use BN_print_fp because it uses upper case so + * use BN_bn2hex() and convert. + */ + htmp = BN_bn2hex(b); + for(p = htmp; *p; p++) + { + if (isupper(*p)) + *p = tolower(*p); + } + BIO_printf(out, "%s = %s\n", name, htmp); + OPENSSL_free(htmp); + } + +#define RSA_TEST_MAXLINELEN 10240 + +int rsa_test(BIO *err, BIO *out, BIO *in) + { + char *linebuf, *olinebuf, *p, *q; + char *keyword, *value; + RSA *rsa = NULL; + BIGNUM *Xp1 = NULL, *Xp2 = NULL, *Xp = NULL; + BIGNUM *Xq1 = NULL, *Xq2 = NULL, *Xq = NULL; + BIGNUM *e = NULL; + int ret = 0; + int lnum = 0; + + olinebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + linebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + + if (!linebuf || !olinebuf) + goto error; + + while (BIO_gets(in, olinebuf, RSA_TEST_MAXLINELEN) > 0) + { + lnum++; + strcpy(linebuf, olinebuf); + keyword = linebuf; + /* Skip leading space */ + while (isspace((unsigned char)*keyword)) + keyword++; + + /* Look for = sign */ + p = strchr(linebuf, '='); + + /* If no = or starts with [ (for [foo = bar] line) just copy */ + if (!p || *keyword=='[') + { + if (!BIO_puts(out, olinebuf)) + goto error; + continue; + } + + q = p - 1; + + /* Remove trailing space */ + while (isspace((unsigned char)*q)) + *q-- = 0; + + + value = p + 1; + + /* Remove leading space from value */ + while (isspace((unsigned char)*value)) + value++; + + /* Remove trailing space from value */ + p = value + strlen(value) - 1; + + while (*p == '\n' || isspace((unsigned char)*p)) + *p-- = 0; + + if (!strcmp(keyword, "xp1")) + { + if (Xp1 || !BN_hex2bn(&Xp1,value)) + goto parse_error; + } + else if (!strcmp(keyword, "xp2")) + { + if (Xp2 || !BN_hex2bn(&Xp2,value)) + goto parse_error; + } + else if (!strcmp(keyword, "Xp")) + { + if (Xp || !BN_hex2bn(&Xp,value)) + goto parse_error; + } + else if (!strcmp(keyword, "xq1")) + { + if (Xq1 || !BN_hex2bn(&Xq1,value)) + goto parse_error; + } + else if (!strcmp(keyword, "xq2")) + { + if (Xq2 || !BN_hex2bn(&Xq2,value)) + goto parse_error; + } + else if (!strcmp(keyword, "Xq")) + { + if (Xq || !BN_hex2bn(&Xq,value)) + goto parse_error; + } + else if (!strcmp(keyword, "e")) + { + if (e || !BN_hex2bn(&e,value)) + goto parse_error; + } + else if (!strcmp(keyword, "p1")) + continue; + else if (!strcmp(keyword, "p2")) + continue; + else if (!strcmp(keyword, "p")) + continue; + else if (!strcmp(keyword, "q1")) + continue; + else if (!strcmp(keyword, "q2")) + continue; + else if (!strcmp(keyword, "q")) + continue; + else if (!strcmp(keyword, "n")) + continue; + else if (!strcmp(keyword, "d")) + continue; + else + goto parse_error; + + BIO_puts(out, olinebuf); + + if (e && Xp1 && Xp2 && Xp) + { + rsa = RSA_new(); + if (!rsa) + goto error; + if (!rsa_printkey1(err, out, rsa, Xp1, Xp2, Xp, e)) + goto error; + BN_free(Xp1); + Xp1 = NULL; + BN_free(Xp2); + Xp2 = NULL; + BN_free(Xp); + Xp = NULL; + BN_free(e); + e = NULL; + } + + if (rsa && Xq1 && Xq2 && Xq) + { + if (!rsa_printkey2(err, out, rsa, Xq1, Xq2, Xq)) + goto error; + BN_free(Xq1); + Xq1 = NULL; + BN_free(Xq2); + Xq2 = NULL; + BN_free(Xq); + Xq = NULL; + RSA_free(rsa); + rsa = NULL; + } + } + + ret = 1; + + error: + + if (olinebuf) + OPENSSL_free(olinebuf); + if (linebuf) + OPENSSL_free(linebuf); + + if (Xp1) + BN_free(Xp1); + if (Xp2) + BN_free(Xp2); + if (Xp) + BN_free(Xp); + if (Xq1) + BN_free(Xq1); + if (Xq1) + BN_free(Xq1); + if (Xq2) + BN_free(Xq2); + if (Xq) + BN_free(Xq); + if (e) + BN_free(e); + if (rsa) + RSA_free(rsa); + + return ret; + + parse_error: + + BIO_printf(err, "FATAL parse error processing line %d\n", lnum); + + goto error; + + } + +static int rsa_printkey1(BIO *err, BIO *out, RSA *rsa, + BIGNUM *Xp1, BIGNUM *Xp2, BIGNUM *Xp, + BIGNUM *e) + { + int ret = 0; + BIGNUM *p1 = NULL, *p2 = NULL; + p1 = BN_new(); + p2 = BN_new(); + if (!p1 || !p2) + goto error; + + if (!RSA_X931_derive(rsa, p1, p2, NULL, NULL, 0, NULL, Xp1, Xp2, Xp, + NULL, NULL, NULL, e)) + goto error; + + do_bn_print(out, "p1", p1); + do_bn_print(out, "p2", p2); + do_bn_print(out, "p", rsa->p); + + ret = 1; + + error: + if (p1) + BN_free(p1); + if (p2) + BN_free(p2); + + return ret; + } + +static int rsa_printkey2(BIO *err, BIO *out, RSA *rsa, + BIGNUM *Xq1, BIGNUM *Xq2, BIGNUM *Xq) + { + int ret = 0; + BIGNUM *q1 = NULL, *q2 = NULL; + q1 = BN_new(); + q2 = BN_new(); + if (!q1 || !q2) + goto error; + + if (!RSA_X931_derive(rsa, NULL, NULL, q1, q2, 0, NULL, NULL, NULL, NULL, + Xq1, Xq2, Xq, NULL)) + goto error; + + do_bn_print(out, "q1", q1); + do_bn_print(out, "q2", q2); + do_bn_print(out, "q", rsa->q); + do_bn_print(out, "n", rsa->n); + do_bn_print(out, "d", rsa->d); + + ret = 1; + + error: + if (q1) + BN_free(q1); + if (q2) + BN_free(q2); + + return ret; + } + +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsastest.c b/lib/libssl/src/fips-1.0/rsa/fips_rsastest.c new file mode 100644 index 00000000000..880dd636a7d --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsastest.c @@ -0,0 +1,402 @@ +/* fips_rsastest.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#include <openssl/bio.h> +#include <openssl/evp.h> +#include <openssl/hmac.h> +#include <openssl/err.h> +#include <openssl/x509v3.h> + +#ifndef OPENSSL_FIPS + +int main(int argc, char *argv[]) +{ + printf("No FIPS RSA support\n"); + return(0); +} + +#else + +static int rsa_stest(BIO *err, BIO *out, BIO *in, int Saltlen); +static int rsa_printsig(BIO *err, BIO *out, RSA *rsa, const EVP_MD *dgst, + unsigned char *Msg, long Msglen, int Saltlen); + +int main(int argc, char **argv) + { + BIO *in = NULL, *out = NULL, *err = NULL; + + int ret = 1, Saltlen = -1; + ERR_load_crypto_strings(); + + err = BIO_new_fp(stderr, BIO_NOCLOSE); + + if (!err) + { + fprintf(stderr, "FATAL stderr initialization error\n"); + goto end; + } + + if(!FIPS_mode_set(1)) + { + ERR_print_errors(err); + goto end; + } + + if ((argc > 2) && !strcmp("-saltlen", argv[1])) + { + Saltlen = atoi(argv[2]); + if (Saltlen < 0) + { + BIO_printf(err, "FATAL: Invalid salt length\n"); + goto end; + } + argc -= 2; + argv += 2; + } + else if ((argc > 1) && !strcmp("-x931", argv[1])) + { + Saltlen = -2; + argc--; + argv++; + } + + if (argc == 1) + in = BIO_new_fp(stdin, BIO_NOCLOSE); + else + in = BIO_new_file(argv[1], "r"); + + if (argc < 2) + out = BIO_new_fp(stdout, BIO_NOCLOSE); + else + out = BIO_new_file(argv[2], "w"); + + if (!in) + { + BIO_printf(err, "FATAL input initialization error\n"); + goto end; + } + + if (!out) + { + fprintf(stderr, "FATAL output initialization error\n"); + goto end; + } + + if (!rsa_stest(err, out, in, Saltlen)) + { + fprintf(stderr, "FATAL RSAVTEST file processing error\n"); + goto end; + } + else + ret = 0; + + end: + + if (ret && err) + ERR_print_errors(err); + + if (in) + BIO_free(in); + if (out) + BIO_free(out); + if (err) + BIO_free(err); + + return ret; + + } + +#define RSA_TEST_MAXLINELEN 10240 + +int rsa_stest(BIO *err, BIO *out, BIO *in, int Saltlen) + { + char *linebuf, *olinebuf, *p, *q; + char *keyword, *value; + RSA *rsa = NULL; + const EVP_MD *dgst = NULL; + unsigned char *Msg = NULL; + long Msglen; + int keylen = -1, current_keylen = -1; + int ret = 0; + int lnum = 0; + + olinebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + linebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + + if (!linebuf || !olinebuf) + goto error; + + while (BIO_gets(in, olinebuf, RSA_TEST_MAXLINELEN) > 0) + { + lnum++; + strcpy(linebuf, olinebuf); + keyword = linebuf; + /* Skip leading space */ + while (isspace((unsigned char)*keyword)) + keyword++; + + /* Look for = sign */ + p = strchr(linebuf, '='); + + /* If no = just copy */ + if (!p) + { + if (!BIO_puts(out, olinebuf)) + goto error; + continue; + } + + q = p - 1; + + /* Remove trailing space */ + while (isspace((unsigned char)*q)) + *q-- = 0; + + + value = p + 1; + + /* Remove leading space from value */ + while (isspace((unsigned char)*value)) + value++; + + /* Remove trailing space from value */ + p = value + strlen(value) - 1; + + while (*p == '\n' || isspace((unsigned char)*p)) + *p-- = 0; + + /* Look for [mod = XXX] for key length */ + + if (!strcmp(keyword, "[mod")) + { + p = value + strlen(value) - 1; + if (*p != ']') + goto parse_error; + *p = 0; + keylen = atoi(value); + if (keylen < 0) + goto parse_error; + } + else if (!strcmp(keyword, "SHAAlg")) + { + if (!strcmp(value, "SHA1")) + dgst = EVP_sha1(); + else if (!strcmp(value, "SHA224")) + dgst = EVP_sha224(); + else if (!strcmp(value, "SHA256")) + dgst = EVP_sha256(); + else if (!strcmp(value, "SHA384")) + dgst = EVP_sha384(); + else if (!strcmp(value, "SHA512")) + dgst = EVP_sha512(); + else + { + BIO_printf(err, + "FATAL: unsupported algorithm \"%s\"\n", + value); + goto parse_error; + } + } + else if (!strcmp(keyword, "Msg")) + { + if (Msg) + goto parse_error; + if (strlen(value) & 1) + *(--value) = '0'; + Msg = string_to_hex(value, &Msglen); + if (!Msg) + goto parse_error; + } + + BIO_puts(out, olinebuf); + + /* If key length has changed, generate and output public + * key components of new RSA private key. + */ + + if (keylen != current_keylen) + { + if (rsa) + RSA_free(rsa); + rsa = RSA_generate_key(keylen, 0x1001, 0, NULL); + if (!rsa) + goto error; + BIO_puts(out, "n = "); + BN_print(out, rsa->n); + BIO_puts(out, "\ne = "); + BN_print(out, rsa->e); + BIO_puts(out, "\n"); + current_keylen = keylen; + } + + if (Msg && dgst) + { + if (!rsa_printsig(err, out, rsa, dgst, Msg, Msglen, + Saltlen)) + goto error; + OPENSSL_free(Msg); + Msg = NULL; + } + + } + + ret = 1; + + error: + + if (olinebuf) + OPENSSL_free(olinebuf); + if (linebuf) + OPENSSL_free(linebuf); + if (rsa) + RSA_free(rsa); + + return ret; + + parse_error: + + BIO_printf(err, "FATAL parse error processing line %d\n", lnum); + + goto error; + + } + +static int rsa_printsig(BIO *err, BIO *out, RSA *rsa, const EVP_MD *dgst, + unsigned char *Msg, long Msglen, int Saltlen) + { + int ret = 0; + unsigned char *sigbuf = NULL; + int i, siglen; + /* EVP_PKEY structure */ + EVP_PKEY *key = NULL; + EVP_MD_CTX ctx; + key = EVP_PKEY_new(); + if (!key) + goto error; + if (!EVP_PKEY_set1_RSA(key, rsa)) + goto error; + + siglen = EVP_PKEY_size(key); + sigbuf = OPENSSL_malloc(siglen); + if (!sigbuf) + goto error; + + EVP_MD_CTX_init(&ctx); + + if (Saltlen != -1) + { + unsigned int mdlen; + unsigned char mdtmp[EVP_MAX_MD_SIZE + 1]; + + if (!EVP_DigestInit_ex(&ctx, dgst, NULL)) + goto error; + if (!EVP_DigestUpdate(&ctx, Msg, Msglen)) + goto error; + if (!EVP_DigestFinal(&ctx, mdtmp, &mdlen)) + goto error; + + if (Saltlen == -2) + { + mdtmp[mdlen] = RSA_X931_hash_id(EVP_MD_type(dgst)); + siglen = RSA_private_encrypt(mdlen + 1, mdtmp, + sigbuf, rsa, RSA_X931_PADDING); + if (siglen <= 0) + goto error; + } + else + { + if (!RSA_padding_add_PKCS1_PSS(rsa, sigbuf, mdtmp, + dgst, Saltlen)) + goto error; + siglen = RSA_private_encrypt(siglen, sigbuf, sigbuf, + rsa, RSA_NO_PADDING); + if (siglen <= 0) + goto error; + } + } + else + { + if (!EVP_SignInit_ex(&ctx, dgst, NULL)) + goto error; + if (!EVP_SignUpdate(&ctx, Msg, Msglen)) + goto error; + if (!EVP_SignFinal(&ctx, sigbuf, (unsigned int *)&siglen, key)) + goto error; + } + + EVP_MD_CTX_cleanup(&ctx); + + BIO_puts(out, "S = "); + + for (i = 0; i < siglen; i++) + BIO_printf(out, "%02X", sigbuf[i]); + + BIO_puts(out, "\n"); + + ret = 1; + + error: + if (key) + EVP_PKEY_free(key); + + return ret; + } +#endif diff --git a/lib/libssl/src/fips-1.0/rsa/fips_rsavtest.c b/lib/libssl/src/fips-1.0/rsa/fips_rsavtest.c new file mode 100644 index 00000000000..7e2c40424d2 --- /dev/null +++ b/lib/libssl/src/fips-1.0/rsa/fips_rsavtest.c @@ -0,0 +1,425 @@ +/* fips_rsavtest.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#include <openssl/bio.h> +#include <openssl/evp.h> +#include <openssl/hmac.h> +#include <openssl/err.h> +#include <openssl/x509v3.h> + +#ifndef OPENSSL_FIPS + +int main(int argc, char *argv[]) +{ + printf("No FIPS RSA support\n"); + return(0); +} + +#else + +int rsa_test(BIO *err, BIO *out, BIO *in, int saltlen); +static int rsa_printver(BIO *err, BIO *out, + BIGNUM *n, BIGNUM *e, + const EVP_MD *dgst, + unsigned char *Msg, long Msglen, + unsigned char *S, long Slen, int Saltlen); + +int main(int argc, char **argv) + { + BIO *in = NULL, *out = NULL, *err = NULL; + + int ret = 1; + int Saltlen = -1; + ERR_load_crypto_strings(); + + err = BIO_new_fp(stderr, BIO_NOCLOSE); + + if (!err) + { + fprintf(stderr, "FATAL stderr initialization error\n"); + goto end; + } + + if(!FIPS_mode_set(1)) + { + ERR_print_errors(err); + goto end; + } + + if ((argc > 2) && !strcmp("-saltlen", argv[1])) + { + Saltlen = atoi(argv[2]); + if (Saltlen < 0) + { + BIO_printf(err, "FATAL: Invalid salt length\n"); + goto end; + } + argc -= 2; + argv += 2; + } + else if ((argc > 1) && !strcmp("-x931", argv[1])) + { + Saltlen = -2; + argc--; + argv++; + } + + if (argc == 1) + in = BIO_new_fp(stdin, BIO_NOCLOSE); + else + in = BIO_new_file(argv[1], "r"); + + if (argc < 2) + out = BIO_new_fp(stdout, BIO_NOCLOSE); + else + out = BIO_new_file(argv[2], "w"); + + if (!in) + { + BIO_printf(err, "FATAL input initialization error\n"); + goto end; + } + + if (!out) + { + fprintf(stderr, "FATAL output initialization error\n"); + goto end; + } + + if (!rsa_test(err, out, in, Saltlen)) + { + fprintf(stderr, "FATAL RSAVTEST file processing error\n"); + goto end; + } + else + ret = 0; + + end: + + if (ret && err) + ERR_print_errors(err); + + if (in) + BIO_free(in); + if (out) + BIO_free(out); + if (err) + BIO_free(err); + + return ret; + + } + +#define RSA_TEST_MAXLINELEN 10240 + +int rsa_test(BIO *err, BIO *out, BIO *in, int Saltlen) + { + char *linebuf, *olinebuf, *p, *q; + char *keyword, *value; + const EVP_MD *dgst = NULL; + BIGNUM *n = NULL, *e = NULL; + unsigned char *Msg = NULL, *S = NULL; + long Msglen, Slen; + int ret = 0; + int lnum = 0; + + olinebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + linebuf = OPENSSL_malloc(RSA_TEST_MAXLINELEN); + + if (!linebuf || !olinebuf) + goto error; + + while (BIO_gets(in, olinebuf, RSA_TEST_MAXLINELEN) > 0) + { + lnum++; + strcpy(linebuf, olinebuf); + keyword = linebuf; + /* Skip leading space */ + while (isspace((unsigned char)*keyword)) + keyword++; + + /* Look for = sign */ + p = strchr(linebuf, '='); + + /* If no = or starts with [ (for [foo = bar] line) just copy */ + if (!p || *keyword=='[') + { + if (!BIO_puts(out, olinebuf)) + goto error; + continue; + } + + q = p - 1; + + /* Remove trailing space */ + while (isspace((unsigned char)*q)) + *q-- = 0; + + + value = p + 1; + + /* Remove leading space from value */ + while (isspace((unsigned char)*value)) + value++; + + /* Remove trailing space from value */ + p = value + strlen(value) - 1; + + while (*p == '\n' || isspace((unsigned char)*p)) + *p-- = 0; + + if (!strcmp(keyword, "n")) + { + if (!BN_hex2bn(&n,value)) + goto parse_error; + } + else if (!strcmp(keyword, "e")) + { + if (!BN_hex2bn(&e,value)) + goto parse_error; + } + else if (!strcmp(keyword, "SHAAlg")) + { + if (!strcmp(value, "SHA1")) + dgst = EVP_sha1(); + else if (!strcmp(value, "SHA224")) + dgst = EVP_sha224(); + else if (!strcmp(value, "SHA256")) + dgst = EVP_sha256(); + else if (!strcmp(value, "SHA384")) + dgst = EVP_sha384(); + else if (!strcmp(value, "SHA512")) + dgst = EVP_sha512(); + else + { + BIO_printf(err, + "FATAL: unsupported algorithm \"%s\"\n", + value); + goto parse_error; + } + } + else if (!strcmp(keyword, "Msg")) + { + if (Msg) + goto parse_error; + if (strlen(value) & 1) + *(--value) = '0'; + Msg = string_to_hex(value, &Msglen); + if (!Msg) + goto parse_error; + } + else if (!strcmp(keyword, "S")) + { + if (S) + goto parse_error; + if (strlen(value) & 1) + *(--value) = '0'; + S = string_to_hex(value, &Slen); + if (!S) + goto parse_error; + } + else if (!strcmp(keyword, "Result")) + continue; + else + goto parse_error; + + BIO_puts(out, olinebuf); + + if (n && e && Msg && S && dgst) + { + if (!rsa_printver(err, out, n, e, dgst, + Msg, Msglen, S, Slen, Saltlen)) + goto error; + OPENSSL_free(Msg); + Msg = NULL; + OPENSSL_free(S); + S = NULL; + } + + } + + + ret = 1; + + + error: + + if (olinebuf) + OPENSSL_free(olinebuf); + if (linebuf) + OPENSSL_free(linebuf); + if (n) + BN_free(n); + if (e) + BN_free(e); + + return ret; + + parse_error: + + BIO_printf(err, "FATAL parse error processing line %d\n", lnum); + + goto error; + + } + +static int rsa_printver(BIO *err, BIO *out, + BIGNUM *n, BIGNUM *e, + const EVP_MD *dgst, + unsigned char *Msg, long Msglen, + unsigned char *S, long Slen, int Saltlen) + { + int ret = 0, r; + /* Setup RSA and EVP_PKEY structures */ + RSA *rsa_pubkey = NULL; + EVP_PKEY *pubkey = NULL; + EVP_MD_CTX ctx; + unsigned char *buf = NULL; + rsa_pubkey = RSA_new(); + pubkey = EVP_PKEY_new(); + if (!rsa_pubkey || !pubkey) + goto error; + rsa_pubkey->n = BN_dup(n); + rsa_pubkey->e = BN_dup(e); + if (!rsa_pubkey->n || !rsa_pubkey->e) + goto error; + if (!EVP_PKEY_set1_RSA(pubkey, rsa_pubkey)) + goto error; + + EVP_MD_CTX_init(&ctx); + + if (Saltlen != -1) + { + int pad; + unsigned char mdtmp[EVP_MAX_MD_SIZE]; + buf = OPENSSL_malloc(RSA_size(rsa_pubkey)); + if (Saltlen == -2) + pad = RSA_X931_PADDING; + else + pad = RSA_NO_PADDING; + if (!buf) + goto error; + r = RSA_public_decrypt(Slen, S, buf, rsa_pubkey, pad); + + if (r > 0) + { + EVP_DigestInit_ex(&ctx, dgst, NULL); + if (!EVP_DigestUpdate(&ctx, Msg, Msglen)) + goto error; + if (!EVP_DigestFinal_ex(&ctx, mdtmp, NULL)) + goto error; + if (pad == RSA_X931_PADDING) + { + int mdlen = EVP_MD_size(dgst); + if (r != mdlen + 1) + r = 0; + else if (buf[mdlen] != + RSA_X931_hash_id(EVP_MD_type(dgst))) + r = 0; + else if (memcmp(buf, mdtmp, mdlen)) + r = 0; + else + r = 1; + } + else + r = RSA_verify_PKCS1_PSS(rsa_pubkey, + mdtmp, dgst, + buf, Saltlen); + } + if (r < 0) + r = 0; + } + else + { + + if (!EVP_VerifyInit_ex(&ctx, dgst, NULL)) + goto error; + if (!EVP_VerifyUpdate(&ctx, Msg, Msglen)) + goto error; + + r = EVP_VerifyFinal(&ctx, S, Slen, pubkey); + + } + + EVP_MD_CTX_cleanup(&ctx); + + if (r < 0) + goto error; + ERR_clear_error(); + + if (r == 0) + BIO_puts(out, "Result = F\n"); + else + BIO_puts(out, "Result = P\n"); + + ret = 1; + + error: + if (rsa_pubkey) + RSA_free(rsa_pubkey); + if (pubkey) + EVP_PKEY_free(pubkey); + if (buf) + OPENSSL_free(buf); + + return ret; + } +#endif diff --git a/lib/libssl/src/fips-1.0/sha/Makefile b/lib/libssl/src/fips-1.0/sha/Makefile new file mode 100644 index 00000000000..31556697ceb --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/Makefile @@ -0,0 +1,200 @@ +# +# OpenSSL/fips-1.0/sha/Makefile +# + +DIR= sha +TOP= ../.. +CC= cc +INCLUDES= +CFLAG=-g +INSTALL_PREFIX= +OPENSSLDIR= /usr/local/ssl +INSTALLTOP=/usr/local/ssl +MAKEDEPPROG= makedepend +MAKEDEPEND= $(TOP)/util/domd $(TOP) -MD $(MAKEDEPPROG) +MAKEFILE= Makefile +AR= ar r +EXE_EXT= + +CFLAGS= $(INCLUDES) $(CFLAG) + +GENERAL=Makefile +TEST= fips_shatest.c +TESTDATA= SHAmix.req SHAmix.fax +APPS= +EXE= fips_standalone_sha1$(EXE_EXT) + +LIB=$(TOP)/libcrypto.a +LIBSRC=fips_sha1dgst.c fips_sha1_selftest.c asm/fips-sx86-elf.s \ + fips_sha256.c fips_sha512.c +LIBOBJ=fips_sha1dgst.o fips_sha1_selftest.o $(FIPS_SHA1_ASM_OBJ) \ + fips_sha256.o fips_sha512.o + +SRC= $(LIBSRC) fips_standalone_sha1.c + +EXHEADER=fips_sha.h +HEADER= $(EXHEADER) fips_sha_locl.h fips_md32_common.h + +ALL= $(GENERAL) $(SRC) $(HEADER) + +top: + (cd $(TOP); $(MAKE) DIRS=fips SDIRS=$(DIR) sub_all) + +all: fips_standalone_sha1$(EXE_EXT) lib + +lib: $(LIBOBJ) + @echo $(LIBOBJ) > lib + +fips_standalone_sha1$(EXE_EXT): fips_standalone_sha1.o fips_sha1dgst.o $(FIPS_SHA1_ASM_OBJ) + $(CC) -o fips_standalone_sha1$(EXE_EXT) $(CFLAGS) \ + fips_standalone_sha1.o fips_sha1dgst.o $(FIPS_SHA1_ASM_OBJ) + +files: + $(PERL) $(TOP)/util/files.pl Makefile >> $(TOP)/MINFO + +links: + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/include/openssl $(EXHEADER) + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/test $(TEST) + cp $(TESTDATA) $(TOP)/test + @$(PERL) $(TOP)/util/mklink.pl $(TOP)/apps $(APPS) + +install: + @headerlist="$(EXHEADER)"; for i in $$headerlist; \ + do \ + (cp $$i $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i; \ + chmod 644 $(INSTALL_PREFIX)$(INSTALLTOP)/include/openssl/$$i ); \ + done + +tags: + ctags $(SRC) + +tests: + +Q=../testvectors/sha/req +A=../testvectors/sha/rsp + +VECTORS = SHA1LongMsg \ + SHA1Monte \ + SHA1ShortMsg \ + SHA224LongMsg \ + SHA224Monte \ + SHA224ShortMsg \ + SHA256LongMsg \ + SHA256Monte \ + SHA256ShortMsg \ + SHA384LongMsg \ + SHA384Monte \ + SHA384ShortMsg \ + SHA512LongMsg \ + SHA512Monte \ + SHA512ShortMsg + +fips_test: + -rm -rf $(A) + mkdir $(A) + for file in $(VECTORS); do \ + if [ -f $(Q)/$$file.req ]; then \ + $(TOP)/util/shlib_wrap.sh $(TOP)/test/fips_shatest $(Q)/$$file.req $(A)/$$file.rsp; \ + fi; \ + done + +lint: + lint -DLINT $(INCLUDES) $(SRC)>fluff + +depend: + $(MAKEDEPEND) -- $(CFLAG) $(INCLUDES) $(DEPFLAG) -- $(SRC) $(TEST) + +dclean: + $(PERL) -pe 'if (/^# DO NOT DELETE THIS LINE/) {print; exit(0);}' $(MAKEFILE) >Makefile.new + mv -f Makefile.new $(MAKEFILE) + +clean: + rm -f *.o *.obj lib tags core .pure .nfs* *.old *.bak fluff $(EXE) + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +fips_sha1_selftest.o: ../../include/openssl/bio.h +fips_sha1_selftest.o: ../../include/openssl/crypto.h +fips_sha1_selftest.o: ../../include/openssl/e_os2.h ../../include/openssl/err.h +fips_sha1_selftest.o: ../../include/openssl/fips.h +fips_sha1_selftest.o: ../../include/openssl/fips_sha.h +fips_sha1_selftest.o: ../../include/openssl/lhash.h +fips_sha1_selftest.o: ../../include/openssl/opensslconf.h +fips_sha1_selftest.o: ../../include/openssl/opensslv.h +fips_sha1_selftest.o: ../../include/openssl/safestack.h +fips_sha1_selftest.o: ../../include/openssl/stack.h +fips_sha1_selftest.o: ../../include/openssl/symhacks.h fips_sha1_selftest.c +fips_sha1dgst.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h +fips_sha1dgst.o: ../../include/openssl/opensslconf.h +fips_sha1dgst.o: ../../include/openssl/opensslv.h +fips_sha1dgst.o: ../../include/openssl/safestack.h +fips_sha1dgst.o: ../../include/openssl/stack.h ../../include/openssl/symhacks.h +fips_sha1dgst.o: fips_sha1dgst.c +fips_sha256.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h +fips_sha256.o: ../../include/openssl/fips.h ../../include/openssl/fips_sha.h +fips_sha256.o: ../../include/openssl/opensslconf.h +fips_sha256.o: ../../include/openssl/opensslv.h +fips_sha256.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_sha256.o: ../../include/openssl/symhacks.h fips_sha256.c +fips_sha512.o: ../../include/openssl/crypto.h ../../include/openssl/e_os2.h +fips_sha512.o: ../../include/openssl/fips.h ../../include/openssl/fips_sha.h +fips_sha512.o: ../../include/openssl/opensslconf.h +fips_sha512.o: ../../include/openssl/opensslv.h +fips_sha512.o: ../../include/openssl/safestack.h ../../include/openssl/stack.h +fips_sha512.o: ../../include/openssl/symhacks.h fips_sha512.c +fips_shatest.o: ../../include/openssl/aes.h ../../include/openssl/asn1.h +fips_shatest.o: ../../include/openssl/bio.h ../../include/openssl/blowfish.h +fips_shatest.o: ../../include/openssl/bn.h ../../include/openssl/buffer.h +fips_shatest.o: ../../include/openssl/cast.h ../../include/openssl/conf.h +fips_shatest.o: ../../include/openssl/crypto.h ../../include/openssl/des.h +fips_shatest.o: ../../include/openssl/des_old.h ../../include/openssl/dh.h +fips_shatest.o: ../../include/openssl/dsa.h ../../include/openssl/e_os2.h +fips_shatest.o: ../../include/openssl/err.h ../../include/openssl/evp.h +fips_shatest.o: ../../include/openssl/idea.h ../../include/openssl/lhash.h +fips_shatest.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +fips_shatest.o: ../../include/openssl/md5.h ../../include/openssl/mdc2.h +fips_shatest.o: ../../include/openssl/obj_mac.h ../../include/openssl/objects.h +fips_shatest.o: ../../include/openssl/opensslconf.h +fips_shatest.o: ../../include/openssl/opensslv.h +fips_shatest.o: ../../include/openssl/ossl_typ.h ../../include/openssl/pkcs7.h +fips_shatest.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_shatest.o: ../../include/openssl/rc5.h ../../include/openssl/ripemd.h +fips_shatest.o: ../../include/openssl/rsa.h ../../include/openssl/safestack.h +fips_shatest.o: ../../include/openssl/sha.h ../../include/openssl/stack.h +fips_shatest.o: ../../include/openssl/symhacks.h ../../include/openssl/ui.h +fips_shatest.o: ../../include/openssl/ui_compat.h ../../include/openssl/x509.h +fips_shatest.o: ../../include/openssl/x509_vfy.h ../../include/openssl/x509v3.h +fips_shatest.o: fips_shatest.c +fips_standalone_sha1.o: ../../include/openssl/aes.h +fips_standalone_sha1.o: ../../include/openssl/asn1.h +fips_standalone_sha1.o: ../../include/openssl/bio.h +fips_standalone_sha1.o: ../../include/openssl/blowfish.h +fips_standalone_sha1.o: ../../include/openssl/bn.h ../../include/openssl/cast.h +fips_standalone_sha1.o: ../../include/openssl/crypto.h +fips_standalone_sha1.o: ../../include/openssl/des.h +fips_standalone_sha1.o: ../../include/openssl/des_old.h +fips_standalone_sha1.o: ../../include/openssl/dh.h ../../include/openssl/dsa.h +fips_standalone_sha1.o: ../../include/openssl/e_os2.h +fips_standalone_sha1.o: ../../include/openssl/evp.h +fips_standalone_sha1.o: ../../include/openssl/fips_sha.h +fips_standalone_sha1.o: ../../include/openssl/hmac.h +fips_standalone_sha1.o: ../../include/openssl/idea.h +fips_standalone_sha1.o: ../../include/openssl/md2.h ../../include/openssl/md4.h +fips_standalone_sha1.o: ../../include/openssl/md5.h +fips_standalone_sha1.o: ../../include/openssl/mdc2.h +fips_standalone_sha1.o: ../../include/openssl/obj_mac.h +fips_standalone_sha1.o: ../../include/openssl/objects.h +fips_standalone_sha1.o: ../../include/openssl/opensslconf.h +fips_standalone_sha1.o: ../../include/openssl/opensslv.h +fips_standalone_sha1.o: ../../include/openssl/ossl_typ.h +fips_standalone_sha1.o: ../../include/openssl/rc2.h ../../include/openssl/rc4.h +fips_standalone_sha1.o: ../../include/openssl/rc5.h +fips_standalone_sha1.o: ../../include/openssl/ripemd.h +fips_standalone_sha1.o: ../../include/openssl/rsa.h +fips_standalone_sha1.o: ../../include/openssl/safestack.h +fips_standalone_sha1.o: ../../include/openssl/sha.h +fips_standalone_sha1.o: ../../include/openssl/stack.h +fips_standalone_sha1.o: ../../include/openssl/symhacks.h +fips_standalone_sha1.o: ../../include/openssl/ui.h +fips_standalone_sha1.o: ../../include/openssl/ui_compat.h +fips_standalone_sha1.o: fips_standalone_sha1.c diff --git a/lib/libssl/src/fips-1.0/sha/SHAmix.fax b/lib/libssl/src/fips-1.0/sha/SHAmix.fax new file mode 100644 index 00000000000..83bcb14126a --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/SHAmix.fax @@ -0,0 +1,129 @@ +[L = 64] + +Len = 16 +Msg = 98a1 +MD = 74d78642f70ca830bec75fc60a585917e388cfa4cd1d23daab1c4d9ff1010cac3e67275df64db5a6a7c7d0fda24f1fc3eb272678a7c8becff6743ee812129078 + +Len = 104 +Msg = 35a37a46df4ccbadd815942249 +MD = 6f5589ea195e745654885d50de687d7fe682affc8da1fb09e681540525f04ecb93022361a27759b9e272c883564223c5e4ecafeb0daaf1abce6caa4bd4153379 + +Len = 352 +Msg = a93aed0fa5e163a82c9a934aebaab8180edf7de0b32f0fe99f9c75ec305b24609334cefa372c7c758262dc8f +MD = 66a16799d606c569d2fcd70d7d8321ec90ef61711481aaf7d747744ebfd08ec2e7aead49429af7b4ceec6d8e147ed018e034efbe07982699e818db5fc4b1d71a + +Len = 1016 +Msg = 433e88eb2f8aba562d15c18126fbdffb81d5d6c9397fa052321f5f78cd629708ba099b540da5451e949eeab8687a8d6ac35c531411cb37144ab5ff6a7eb46f1ab28fbcd2ea0444cd87c57bf7d3c02952dba3d3987da07622c16e7c086d90e88ad3d9d4afee301d2bad915d868f54197b70b23c9fa385c443404fbc9abf7e6a +MD = 790bc4844e9aeef8938df0ccda17890556a4151817111a526a88919cfb172f0b03c216080c1b60210eb1942097f17b6d0691bf5b018b6d959198d6a694b922c9 + +Len = 13696 +Msg = 2c46a76a9dfbae1f5e59f085e9c3d4b600c24b2d404d062cf948e75a3d4ab5b137a31397be9eb34b2a03c78367e0b85448891b511ddee1f787cccd498b172cb7e656c044a03ffde8e42478330fbe9c34072a9e99ce31b41757cc820d98e7d564e06694b96b66f4be34c5eadd0ae4e61fe6abbe4d7ccee855104fedee8b451a7fcedb793d469b0094c0ed07c97fda00dd8c1662b44e3ee6775a5ef6368cb662d257be561a5967893433a4b63f97295036a37272176d081545df00852bc5c4162324161296cd51f76433f2df867a5840f2d0c8d5be00b4dc89443d82175bf69c3bdceb97facae2b2ed68e06ae74fef36d8bd1f75f130cba509341dd54079d45de22845cc8e77a022977c7540aa3e779cb1127f39f825d4d78e55a967ef45e7c1dfb02d9999fd15af2914ba47177177d94576f1091a0657d9e04fe81e6be7b631fc1baae66584c9c26ddbb568750d77555c927bcda1fbdc15c7cbe3e3fe88ca13ff12c59b383343c12976708c0e3dff78be0e286dd32eecf20b71a09fee50a9d0b13c85a15b320b162690f399282798aa3291fdd2f9c40ed873e829388466ddd1da42f2de16aaa9272ccf44790cf3c95382c304e25ae8cb2fc9d9869808f3ee7d42cb143bb0c3a55e03db6d1202ca1bdb744e448640c0aa60d3ebbda5c21e623bb080f4a073a48822725d764e51d415aad1d7c5a7f17433d15ac7d849f910c375ee0899f6a576dada42fd651343383f286009902bb62deeeb2514de6af7f09892c20d0b238f6021f03b62444b1e1f21beeb89acfcd7136416fe7bd8f202e76afaf5345311798be7cb25351add2bb044d2380221009c4d1cbbaba4cdc8631dc0144f2778a6aa1eb3d3c81df0b1b2142fce111af8214d049e40f536c5d462b9224a978e82cc6c420e70ecc3cdaffb726a183c793845315f730fa4dac9fe46e4180397107a6a051f7f0a58ceb9bf4df37e1a81c8e9569187228e8037df2e59c52ba815566768bedc8e09d5e7bdc9f2bff23aaaaf133bb5a3332750f6124ce185e29fda0851addfa2c3d52bb6dfb530fd4ee27dd5bfdce5dc2f41debe6740274bc651aecd4023b098a7d622e2296b50d51b79c4e3f521695a9d43f038e8f273405e26584d3db179e7c1758114a3d39970df674580bbf2884405974f0b9c4b0d8b3287a2314f3f81b6991812f354d655f62513c9551b378cc2efa4c3e08b313c56cada52217fb6112eb8299b28445aca8f72e7170a1cd8bbfee4d2145fbe8d49c6af8831c4d4fc7177a50ee55a7b484261504af946c6bd5e1d6b89092f3c487c0568fa07c356fae9b8e831b8320289039746a435b122cfbc4a0d316bf90d481d3b7d979cc50d98c1190af8dc58e0035557dd5e94f437f41fab513202643a77748f76c6b77302bf40c392cd18731da082c99bdedeb70e15cd68bff59619cabcc92adcf122753c55afde0817352bc247d1170b8ddba1ad1b0faadfe0efbfc5fe6334377fa372c3435691f53dfc2ad5e08966b2d3525b1eec2d993a5cd4ff34278bd40dd80313a0727d05e0a932156152f3e11a190d8d69726f5c57d20f811e1e8932e86409ffdac96c6251c2a2976b8757adcac5d2de94931d1cbea866ec8bcba5774f8a7fde792f6acfd0f01356fd66fdf54a416af6a9397e00f848a2e9831627cbcbb52b5a868ec174e69b4cfa1ed72cdf23f39d7eaf4bdb318c188b1f0fe75655e34ad71907cdb77a1a2b162cd7c22d93dc45321eafb17cd60282e83736267b3e1fb249c307d49509f50839942f0f493afd9ef37db053a918e3ec83d801bbdead07554a018b8ba348fe9b7dd92ea7c5fc0e65a644ba19aa1fb6c022ab768ec7cb249ba17b9dda2860bd4aaaa3dc70ec009804141ad5ebc61203658e57a0887ec0fded18d844a96e79ba7e879c4253056f23e205a80ab1471953438f85848f4ab31ab175c089e0bbb97ea0dd6a67385770356741966053735e2cc2ecdd2c8c75cc045181dd7267584b901674b553082b2c58fb8f8be0b99306194a6f069f684535423304d40a268d55784a14260fa9c9cb1306b82f91cbee3c9f43dea9e50903135cc1c6505605a100bfa28564a2057974eef0852b7b72ce264815026d0759f691db618ef760edde73ec888e181403834f7221bb27a69479ec9b28a3fb0c3f68d4467d25712fc48ad78763f9ea6e8a2e85260225ca1b1a38b720e589fafca29f07257c5467cb74ee53189b8c81b784c43e93f98abde1ed53af60b27b13df6ce45001c6e1813de3521028981086f7d88ba13f6fb1a800f312fbe2f842eebe847fd760c394668cfbfd353ec14ca0366eccd7b4cd63318116bdc42e20a632a0d2b8c5cddb37bfc0a239ebe3800a787d2ece077a7968036b3d9b31cd906f888e3ed742cd769033e2c24c5a9e3c10b6d300db5a17dd88 +MD = a86e07bcd19080d4a83e1384bd8189f60a7dd7a6998406ade0bf03f805375bd823c7656dd51cd9d63e542f8ade41f16d73794d60d0906424133778156ee54b95 + +Len = 100816 +Msg = f8ed40e878dc68ceec52cc8e2868722310fb117ca3a52e1839eb85d308b8aa00ed0bf0b76aec8a70eba4f0d14d2d85c5a0e876ce2c8ee59cb36947def6c40a587aa07b368ca8e8a08367018e45b984de0d7f1aa46b977cc18c0cd9b7bb897cbb2814aa0ce8f8c9843e03c86c19f2ba95dd2ac4a466a93aae4b3b05055ff148517ecf43e286c57744a3e10a14d0c26e139a503e7927aa688c78609170ebe3b54104390e5f6cf538093a67922e7210e77fcb584ec9b6844e829be246a266460cb442bad52ca47255fb8cfe276108c36e02f9acbd3d191d34b93d29ec40d80496d1c1bb5ef036221641200e905598c54bc4abb3527c5a5f6258e59d4bf54a0498c108a2725428efc2047e0096b32dfdc6ec69d5d72f81301f881ca62a66c22e5dab9fd9d90084c0a36b2f3a0123cc5327a3bc7a12fd947ab57169ac533e4b6a2cb80fc65b9b527cff9fba26994c7fafb5102a0acd8f9d246a3a54178c23eaa04c0fdfd3c0cd980d1fc7a72b25d74df9b95c3dedce8ca316870c654f9ebea9b806da9767cf40605a4b0c7fb06f6b3f197bae7d8cde9daf38530e25bc51b68f9aa23ec0e95199b14bca96c91f3db15bf8432f714dc46ac87218691bc66cb3a42f6865e1c30f8394c8e68c0ddf5851ab7c5906a1994a9af6ac1c44d0d6b95ff15d9f77825ccea40fb9e516d45888f2378e045d95d936d541cea9c8ca52fe5f7d0d919b2b1c59a42d06105ea4f2943c05178e59d67351c5b2c0051c93a4045e512884fa656b772cf398af89081546d920fd3d24ebd16310506a786ab33293027394c1bcb7b1efe46b550ac28529646e8d2a5ae65c59345e24b44cd7b06673f3ed3b9008aa568a739c26682fa596b7a655842cc6b2758b583487c78d14a76bdac7033806c5c210828ef313f8efc4072681f5fded748c31a58ac933b4665c445f07d603e0905e49b84aa55146eb1c1c99196413832a05efee2e64d6732fefc629b79b37bb9390fcbed7226b412204bda523b8b8af5c4a8bdb263ef9f3f6c7b9e1de3a1dc257c1f33b3d54a9101be5b4f2a9db319993c2cd137c41e35c434ce52e859afd1a635af4d8852252dc5e28c729b2b4c96a56d57f3f3854ded59fe612b9b3a51fee3fc1c83db673b0cc7433bff2472bc74a2eeb6706605e308690fd072a7042ca6474603711d8310909e47063f46f287260a26c4f11fe492298a0f98d28c45948a4899e08fcf443a6ba36457dd8329314d53ac0fd0819fcfc3357426c5bb8d3dfd706e205a81091cf08f31cd3459854f3d07e503991ba5f067e3c406c6c5396d8257496f4ba3703cb1ba25c2fe4aa54577af782cd57e85a88a2d75c54039e8b7bb559219edd6e81e41acb6d575d6f798afb2cbf7f00abd5c9c7b0fceec79f9a0fb040ebcbb7bff3602df7b71357efacd37aa57019350bb81213508a006160acde3dae5c42f03141887eaca22d7b33d6791febfb619d11ebabb13e6c5378e9a72e852ddccd31cc53a43275966b7042ddc51485ca20e1c456dcc7020cafb5407548b044d332229911fc74d7fb97de25abff7efb431da82de2ed7e25d0dcc06ffc74e57ca93a6a9f64d76a5c39776fe2266f88d6d0229b527525fd2e22a1407e26f94c5bc6adb1e7327f3c8bb8d4c983385c579dd8f5623df8cd6da569c7de73d9210e6b9253a177653a13ece075940fc81016d8c35fa4f6542df5120c174158ff32533476f4e059e35117081a24798fbdd1eb10f82809836f8dbefe755611347f75423dd8571695960c6f66cca71f0a01e8fecbe1183bee3335eff10b4ff8104132040e2145ec3164b2448f60c730887b9d7894e5f7df3f876cb17136c99cf32db1c02fba860937378dbd093c4c5112133781f06c8ca07c527c2c085e8ba5e52b399f2909e217aef6e3035ecafe2caeb1004069dea023af7eab873deb5ebcef2313c9827821bb9f89fd3d1570a569673d3ede86a4fb13dff242eb98450a8917fd8865c56e0a9f11d72394b79808b0429f3a83cf2465161596887fa2d557b367a1de9c7753666b0cca9c30cba9f0a749c03c55cdc7a6d45852c76ce2010de3e7f75d95228efdc79949b238d90b25f983868b7f07f585f7b00e45d9e132f3c09ee84f794d899759be3dabd46a256f4cf8da71270617cc2425b24cef25d1d2f3945afa6f81abfccc858cd02e05619649b1a5347650934105c02622d538447223d136a8a0455cf3c6f61f696b32266197b5cd1d936fd3ad4288520fb4a2f59bf95e659f33210446ef18debeb679dd99de0c3c74a6eb3dd783861f5db4e94a151c42ce27519d0bbbf1f3b1163563ec06c8bfd881d94a3b896fc07352fc97ada73685588a2242da1b718f81bb1077bc70fbd58b8b52163489ae403838b533851bec30ed0ecd97d72d1af534f3703db59f1f563bdc39d690a0e90e545506463a37e84974fd7b256bbb912cb4077d3e3f5bdd4bd2bab713b696c830b1f2185734c4d2dbd49d5372fe8b813ce73f5e01c36bddbb376ef4541033f2b0355613eeda8951ebf7377e08f967902eb7e23c0fa798c6ae52401721053f1095cacb1e9496500e83c412236fc21566090b3a3eee55aa402c0b774802fd81c9e8579761cfcfdfb1aa23786b2dc35dacd5ca8d8d283369f53e4a5db18060c2c6b0c303052aeeffe169fcaf7ecc63090a9ade245045ab9c8aebf738772297caaef5f857322a597846c7370083d409df27612e47b0cb240daa3cfa51c57108612ac0dddb0f59791289ccbdb3a2cb1fa9ac31a23dd5440682fb373bf0c1f41c4fe2185ad7c53eb69552807410053b0c2d40132250e637b8c425e6a35d93333b5b7d0557927b6179c848ec455fd1ab38348c0e96c60b2da49bd15118df64b6ce4fa48fbc555a4b2874141718e731a40b85382ae6e86ead31cea77f83bf5c063bf1febf71688a832d615e09d6f14badedeaeb6ffbfe343fc7274e78cd46a2aaec0a349c5f133291ee57cdcb65c5474e46294de6bb50886bce6c6f44dcb95f2a4761ed2e6c9e7bfed51e0964afab4e0f7e0b07960f2590baae66b1ec9a63ba0fb6c0d27e81508c51487dbbdc9beb8879fd58c188dfc774b3d0ddbd77ee8bdcdfa0ed8a9387728e12b13e8b3c10cc1c132bd822c2147c5ddf9a993aedbf78ec256db1be76644ca8ca7727208bf89732657152d34e948d73c47561d156f773136684d4162d02260300020123d13a95f4f835907c344942ddeccafe2abb7dc4792c4f1e39c24748c63cba933b16be0b8853e058c47a1ae2c4dfff39ec2339b345fe3557d03c1df91a0607a711636c4416ffdb73532aeeb74f237ed8bf971388a0659e4682a46b8327e751034cbf2c87c7828da9d24baf07a742ada34d1ef38ab1e8f2b4f801192c146600709533e61bc2665dc1e9e6441bf3c4f6643bc0c102a10f9a69da5b0e3d0a0c7cb694c682493032b5853f02953b5c2fc0e1348565389762fc2dcfbb34fd305f2d9df080e859396ffcbb7da78aae0a0d72e3de76c774bc6a81c87f2872b6afe97ced5269009304a4992c4add0bbe24e57632e19ad0fe37ae910193aab0aeae32cf6d618ab33eba59f6a04fad00b1d2403396e6fa661d31b695a1b349d62f56c08fe6c6eae7a482177adf341e51d03ea511d7959c721bd20bf371860ecd7fce1d25212891850b85648db0a039e6638d9c78bc958add3e41341536b5007be63fd1f7e3308876bcebcb97dc3b05a7b2eaadd00f8fcc8dcfa7b961bbe727c9aed1626ff786d6a0ffdbd1002cae8a7d047b6181962a686c152b2341c7c58c9f1dab5af424d183ed1c7d003165a1d04ea3683ff31a0f68615af6f91c21f736e67df641ed31b998445afadf9052bbe004d5dad08f62e5d353e42fc35a92242d8414d99dc4e7e81c8c027af686baa5c185e3f99abb3855b22cfdff0a62e2f47a632b7df8e00e0317af5c24ce7c64077bbb15ec27e062070cd3eb8e549ed9112469090ad9a96eb59294b021eed81987178cb2dcff67a9a2e930f6032c753e203380f8a7c987cea393234699de03a1d09ce204f0a8b6d5cf522b6887174fdbccb08f3e7c4fe2f778254465b32766c48812a45151ac37ae354dac87419f9476baa27e24b2f322b2da4ddf579750684a5881bae2269351fb7de59b9d5a4badd8951135f2713dafc57215dc626ee170fae7f20bff98e36b864e1fe0f0f9a300c903069bf0e0b6f2f8e78423cf6063e89dde6c81efcf26ef15510563c84730f611ac879a6628e55115e1a29de6945d37fbe4f803fcf2e344712d9e0d6f6c79f8773a9f199b705235e20a7830ee3357c5dca29d7a6c29a3d2628bf2c42c8f076cc4525301d8e1860729070dc53164d9fa08bf63cc889eed01b0130a7146d860bbc09ead3865a3082db0836a45f5506c3e46e452e298764939226cedfd06700e4e33c6b4a78add601140249596831e97f960b973a4e4dc3fe2813fa34eb47f998ce57270368fb81719a09298a223f7e3931ce5cdfab3f658649533354e982c87dc9e49eacebb5bb4af9a767b4f1c03d774431168cd4fec1b2726f1aae3f9a062a825f3295557eebf3af4784487b869fb049de44d03fee71194fc200af72103b157431935b5ab9bc122773ffd313d52d7acf1078386090fc011de695e71567cfd51c06317d4ff8841ceeb74ad35f4e5f4d20921123cb88bb2079674ad39e133cdfd6478d69c9bddc7a818be5d7b254bd9e0abdb030f52846fdfeae8ff370a51a9c5f6017af3c6c3db17c5c614ea18ab0e3ca0dd5de621217dffa36e5c5318fe191040a50cc3ca620683bc34da6c142e1c50afce28a86b8b66d189adcd755561a647080d93f3ede1cf54c3afb7e863fc8a82a2576d3f79e9b2bb634e598507a3d7d017e0176b7868bff3a3dfb4474b3ce03c401f33929364e727fbf8096b77eb351435c7a113b3215cc6246dd86f1517a7e550cf828900248f7c1754e40fed62477b296a37d3e53231360d012c4908b466e49b0e620c0a5031228009f259b030956ebd70e49357c3c3ac2842b6bd6e3ca5a3e985dc03f7105681fec03b320a7ca753b782ad3b52fd9c8e3bd980b48dd6ec8901dbf756108e85015821c880416e0693e0479cb31c0743450f6d9214afabc4feadb9bcee9def460a58d3a02d9e3039970068b8e3fd0a403a6ca7f2c71ae2b46ab3c731b1e65e2104c47fcb1f69e7c8c6df8c09b33f2e1cd4192faab316a44536dcac608832019f5765cc5240eabe3c87445c980c299a5e7ae0acc2c2ed19fdc8f011515bcb00476b03633c7669db1b44f97f6cd402778e9687c740dbe5686789b79d0b13f784a2a866eb91ab2d66f064c49e8df513ec348fd7272ee548ba08e1f9f99696ffb53677550d59c67f88404f6e610455a422d9cd987493ca5c366a397dccface2bba8e3e99719dafa768956cbf6fd8defc4104b8925878716a0514f70cbf3fa2c2bc2f66fabe654eed3076257e71117665703eb88c79e4c2b94e8e856e7a6ef90ee2a358409db78b98056ce1750eb80725d70e35507fdfa5933a61496ba48fbd5555717b33b59d4ef211fe096aefd478859ffc97a41372023ef114adcae5a8d5e03c21369baf1e7f417cb40326bc6db1cdf0904651dda3c1039a2f1755e7c329f7c03bf33f324206ce6e1638711c8c9a45f153aa1f847cca2a5d3af1d24fe7a1e1094819e8e712cbe10ead1012b7371b35cbcc2bd5b10505fb63bea20ac81d25e83ed0105e7595b6c28400f4d336791ce4a584323d0b455bbed44392c5f86c9d5287593f6986d4b0b8f9974a7a4157859ba801251d3b44b2bad84f29cb87dcf1680d6d10d1bfd59f0c95fb7bd07fdb3ea2fccd6e3ee80af438956ccfe31e750972f893ea5dcaa26d077fb3f09d990c2f41c8707368bba007803621ecd76540cdb8705435d74f4300eee04710a936f241c034709e625b0dd5dae1f6e86d034426819c365a05f5be420cdf4042bbff965a666a5756f67259448ebf742b6ea189fa17a4c3bfaf651d19a8a525f09d9cff637c8fac02eaa58d3ee3f7221da1e61833c0b183cd9f47686f09597e8115b435454acef80c079eafaa22b18927d07bf8b7c5ebfdec9c42a52b7824d45decef41e6184dc2db1505ca6f94172fafc10731706e79b9856dfede353d2eadeceaf72a302e3492d7dc81e3777e4e9e1f3d33cc4402833ffedb241a75a09e9495d671f80ad3acf06823bb04a92b815edd0ca7d01dcb3318c1ae5c62d3e99c0ec37908b45b51dd65f6b45b34ede2d6f553f60a45e20fafcb34ae4dbd375f52a5db9c62650deeee78e955087c2bea75ede7c304347b171fe0c1a2a033894be6e04605271307f307b2a9cf6ae24b8c87ce033a3fa4cf2bacdfcf54fcccb1f580476c7d00c631a8529a9eea2a713610341e0e25609dc8927e51c58a0a9197a54963b5cb95877354f4b8316df02ed2bea367704a12274d96bcbe0d0d728923a368bb8ab98d5db5401894c822632308ddfd309071fb4b477d8eac0ea5dbbc3e3606d8510d9051dfb5e4b7cdcf2c57c1b76902d864c3109c901da53019ed33cea84b407490486ad9f980a8a63df3d2e3921064afea137f35179130db3351f5bc3f5e7d590a5ab08b5415efbd345f9d57b71ade7dca939efa5a12d677b9af0af14468176a43712bde10cb15787c18bf066eaef8abcdea77d3a0c61d6c74ae7b54fe90940d0233e4b874c9a141dcc740d7fff43b9fbbc012a933d890232cf74fccb7ff7eac1148e203c7381b7f1d1429b1b1152ec25cbf7562596eb402a9328e43b5dc5cae36592da5523f0b9907a6817ecd395a7c778daae85bb11372b20641a04250b77b3a0ece885d07faf9622650259b874536d6d2b92181c834dc111b6fcba483167be40ecc922fb87006f63b9e8e632879563f37a8f712db9fa68c1a20ab239c0116fe022fad1279f3288b8e74a16d447e467b6381515814dd3aecab5c2a09c400b44e9100c04c720dc7e8c6d9460002da6c52004c16999975fef8752c2f9c229cbd9e6446b226cc454bd68cd665668a17328bb30f301e92ef5c7a2197a326df5c99b422096de8af231d1d8872e6e505bcfff026d4862f28d4bb3856a66ced22c9b0587451d8da4230a38561b5b1c69b523a4701a2001382aa82fcbd60733a14696a540227db44aef346d6c0a7ae5173604d59eb828614cafc1b8cfecda054dcc7306f73925e6d1af56ed74c51c6cdb66e9fee8d7a0078254fedb0c0f5dc85a4686870709b499eafbc8451aebadf848b0598ce8f955688bd2d6032abe10d1391d67c20a049841f95d2ee0c8deae2bc1baca0c098d8718cba1ddcd968981c47cd98d247aca4f838f3bf16d092eab8be8deb1f8d504d37cc44a8c96c9f22f2698036d4ad3bb48b31f109626565c147d20a4a7dfd61fb918f81548fb4f78875c1d138e819f6822651b93a3c92ad77793fba5222d870ea671f9cac967919d18f96e92778548415b2e170d90b201215354fc48a77e62823a2c2bb354782ad052732f08beb278f751529416f37d83ea26248517ae2ef2ead28c1077908995a2d25db0deaa957bcab39715283287fd626ea7388abccba2d90e364a7ff4284c84f70da68ce1aafb5be0401cb9d45e085aab41892a49e10cbd5baf2c34f5e0ca076f2772abea6f622b66020d546f8c2f134a87f96edbeb9b08394b585f2c2f98aa792f97b43b5f3aa9c34189804a9ecc2cfaeefbd0f967d85a25bf3136fd8132dec38aa82e4af6ff677682f3b62be27a180aeb22f918c24f23bf6f5954e0722324cccd06829fc32ae4fe3aee6e5a03b3651900e13fb0a759e544d033418b6ed40d037b4549a0404792c8fddc317b7f028493c4c91d6773932f8486417544f3d007e5f9e6fc02fadff175303f77f6b0e1f709bb3d3a93b38552ccf62688a39da1a602dd5e122e6f4e9171769ada5255cc5cf938dfefcbe3ab0faca434c42dc8c357e89a3d1488fa3df35c3580b124ba3bf6d0d203d586707eb692150ed05a01bf9de5c4e67bb948088784016394d47abb853f2b6b643a066ad81bcd1735aed4e108a8c1fcd025b548de874eb60de7f3c568728959147d1219e4b830e06ca2bee1f8a035e28a54ee6958d4821a84e5d1e41139905f7ec60fe67ce5f4eccdcc2c3d1e4a753a32dd3004970a4ff3824471822fe2b5010b9b6c6b01336dbf0181a95cba2624663215468519871cc39e8a7f4a151c8bd03363b402020f2fb98069b2cb8cc1b7e930938e7540d95d1d223e47865135793f9eb573660ff79f7ed2fae503e68ba44596ee745fbd8fa562c5c666d174cc01b1961736e18b8b517161ab9c8058026e0ddd6c94aed0086a26e1b959a5e05eb9d8c1ff5b2ef518ca23b4f265db61b499a48cc46bed28d23ffc1e8d9c9e345c06079ad47c88dd4e8e286575bd7f9420ab9c2d5c6685488b8b34d4c9ac04e1427ae0994cf789b48b01d1db9c2fe75fc5187727bb11119f82d0739ce4048467a08cd635bf78cc1b6cc9c28fdc199d351064a81456f81c9e56a43aef7332973804b06b18a26caa62523a7d0acc272ba49124b17bb68800d5756afd34ddb2b7e2dd8a118aac3fcf39d9f853c4d2c4fd3ed5bd25a6604d68d57db93d15aa1160f8a97e6c24238e84f272780966867f9c644ca2775cdac4af0ece036cfa6ebb1cd9d701dd7daec5763c9a4de0385db383a5647918e79c6a6de1f4ee1f6b722c561704c8d7efa4710d78dfce8ad2df0d3d82cbb59cef0bcb001f70bdc6e17af1a720b117fe02bb1dd527b18e6bce70e9447cd0cc85cbcf431fe7c006f5e4ef878a974a93b25f492847c9ae020583c9d412f4124246164d8f080b615e2eee267a7aeb5fa0974de52cefef23cdda7b305a33a91e9b50471ceb72dae337c485d636e28d6ee31f5705983808b1567d4d4ae820ec445c56e6a404cad6b408691475397c0dd6cfad232106ba96e5104052700a653e21f9ac6d79578a9f52548f426a1e81dd45bae30acdd4d22a2dafd633564d6b2f45e7d35413503c955cb0a9784b42ae8c2a5933a6729f3922f969a158540dcd201ecb6e32f88b5b4921914a2e8f424c8b031f115ea5d23a21e6f22439ffd7e5d11b08df729f65613b4f6ad3edbc9a066a5e712ecbddfa6fa764cdf170c0485f82d924a99b7e7ad8dc44c1f93e49b6469a9af3de5691944413f1417b753bcb84d5b7a34f362c383cbc802b0c88bd23a7ac471b9287571c42081b1134bfc8ce104a550942ab1f2a074cb00a90558d6e841ff15cfde6951f03e450a1bfc90dec6c513fcb2692ddccc31d22e5274d41036656183c72fce208e44920776f196193137ac67d6d65ce9cfaae774f23a86e6ee8ff3a4e9422a4667d971906e5496a4e80278774899c882708611bad282f6c1d666bc5e7c40082b43a6e98d494a18e9b3cf7f154fdbf90d786e59e83b72ad0ab893c49aca50ed37ea5202e650fda54f5c46ca2a35c476f4b009c5e6733232275abd1341199b63d22386c484cb95c43ea90e609c407bc79ddd00609cc2eb0d82848db239b249f164b7ea384d0239fe1e64d04955b9297472cafa2ff272c5c78100aaa86cdd8120556f25652a3c12da5853338e3be8f505d93ea03cd1cae7e78e95befdc0e26b760d11e05403c348e0523fe036381408033c009a8e1f117af5100a6eb91f08307df465c20bc1dd029875ef7e49338689f602d98f2dc690a57a6f2864e57098f8bd723574944ad3688b292db6d01387a16493912722ac8f91fd12b748899bdaeabdf0479df788eda440d7bf30d1c25d78d757f00b74bb556506637fc1ab87162f05d464e63a6272db3fe56e9357275035d6b6bee32bd92c4a1dc94778551e94ee1d8854f767bfac3811bd0287672aaa01ea18c25650f05a68cbacd9158e479b508e72df778589e1e03dc543b60bb3b10399e5c50de9e728e69774fb3f5fea757ddefccd0f9da75afe4b67f9c54aaaaf646e858fb001a6deed0a8a769ecef0689c988de566b6015fb8c40aeb5f2df7ea4bee60e8e69d15c4a4aa5411dbe63fbdd6418cf025d87f37362f15e22aba83abe1a3de9857c71c2234023b969eacc0bc526363b7f30b092ca114f2a6cefb34394d146866ac86a33fc497a8cb8e2a5bac398579ff7958878421fb08fff4f8f3deb8c9641b8de392647df3017a5467f9d7b23036935ec6e188dd6dbfb544b8a9e04a4b3c7fa1e4d1d9879daf69986b8083e6eb023a4b5eff80fef17f8f65433c882a21565a919448e6091d1b61013fdaf9fc3e45bbe827c9b4ab10b05600a1961e81d31c7404f8e0d32bfcac2937eaed811db167dfdc29286b0d51bad2bcdb9dea76eaf495a31a7fe717c1c98be374a36271cdd06ed06c02ef4c3c06cb42f73b3332ed488416010e6bf2f4dc4dade6e2e61f19e9306bf941868f59fa0939005743dd647f0a04b576a7e71d4c383c479453501e18ec56d7cb79fe31ff534afbd8609ed701ef163f9de31bc58114399fa0f22b62c66c380e8a10c34b7e731df2a8d39dcf36fbf3a66d67b973e3a94bf6ee0bd96f5c76baa76492032fdd2f59ecaee403d486f543f2cd7ae7b0dabe1b5566e681cd40d384a94349e9668650a6f2d2daf86c59a7b02ba466cd03ce1d50c3f0ca4c02dc4b3d1c0e7b9a77df9eae0bfcffa32117d7e05adc7195f4278c93497401629897a58d08ad7141ea52e0163f14992d7a284e7b875ce4640b4dd48ceedad1ea17d8ab1e760773044845e0899602f1bdfff4d42ab80c0765d1a8bde2ba0a830c050923956d06c80b182264ad19ae4f7c39e43195f7d421bdcda00e3eb5ec5ef2ec91d69df691ba7fe250352acf01fa92af5e2c634b9c7c97889e9147e869acc153d88cdc18908f882f371ba9c1e13c26e9cb8e3cbd4c5e1988080ca65a67b3a4c3460cfadbec904d853fddd2f5375b6070941fca53cc106b5748480213cfbdc1c34320a0478b05f76fd0454c75eca069cb1fa7b21704dab67dc40d041c8a1040db378e76655636ad725219c049e6536982d6ee9f11dd032280e622547c7ff44a938a1f233c356a98182d22d5770fbc871e20bb37483dd5d6ea1551993b95b30774a49b50d411ebe0e8c92834094e23ec2664d822c40e96fb42b8607b62b6949e05edcaa436d0ffac6a8ff384068acfc0220c0b098d368fb8113918a4f8c9de37cece74c8695cef2427e54a6e77ad092a9b7f1d94ac9f0836deff41b905b5dafc58ad6063759b0372a634f69a639e19521825d66a282f489c3172a3659264d0132af3571e637782bb6fe5c0afd24547612166fd3409d0991392fa054ea5bd07a4cd0921a13ad7b62a0b5e6d56cd8adb7f3eaa5c99576941c38aff311c49a8c9d8c755869302a2e5e40109c8365a551cd3f859b9421be189d3a0e9ed78830d5cd6a2414e9cc4c25814d94d98f8848e5386d6dbddd65d22b96c5d20020a5dd409c7e5344065871e57e01c91a443501dc8bf619890fe231319b5480c3879dee618d319962596539e2970513fb5c0c8eac3a71ff99962779cf1d7e916566d0e29d121c5cec5d7302a18ed00be9316f3de8c669a64c2a960a588f9c8a42690f6867cda7146e8ce27aa6a7fb27606eed9df6a235a42d17ce71627446e206e879de56025a66556263f06684dedcfd6f083d6a707e5fc8f8212d716e062f0f7fd0c2fc62bea93d68581265a803c31cac3f8ac8939c5f8c464ebd19df42c7e8998494af614c8383294f3f3883f2404ac10404759e182a038c97aea04a85530ec005e203807c5bc30fa9f5339b32fb0427e64915e29a25bb25ac60b92256470e7de5298d42c6b88995f8d2fb704e49d55b66b71e237af90fcbfd71d9093e1a543da2e9911ac4102346dc4704859cb33ac5f5dce2b3331a9dc9fb506461a5436c89bf90d39afcf93cbca4cfc35da6ddb112243928246ae0d1ba269b0fce0468d3ecabbdb925c9ea3241e2dbdc6b151fb4aa724a42f98b0248171fa01fa103f116d0e7deb65dc359b09126f9a420300fd209508ec7a50be56d5b470e387d0c52a1d104625f9571ce1404d1b7af3fb00475b95f752ab96610be112d33ded48624015781e7198f4dcdf917839471fbedb43c34efabe09941fab6b342cf672a29dbb1eed0db788dbfcfcc63bcfe80f7718571f691818dd6f839e3cc282f85f03fe0400171cdf1235049fa53de7450b4c40ed398d5a486f52124c1c63de2afc950e81839f52d17e2a7d32f82788465a65da6cd763c6360763561ed2bf47749080549b6e2db87514e1ee1c85a0bbd346eb6e3cc29267cbedcad67a287fc5be65ec59ba8b6854b31c83dfc5155187d4150685c5c2c342ed68b01ac9e44b60f0c100a347a0f93074dd37d8956fe2f43110dda66e9f9e6185c23dab74cfca21f3ede4bca87687549ea02662f45dfa0ad27f9959a120cacb7c419810e1b1a50fad31c12c47d5bbc61bad77044aa541d29faa6126c60ef088b82eead17a52843307d4bf798b853d90d14c5347ff10615381d85e964331b7a123d15a77a6790d93e920052ddb4db4baaac5e2b27b66ff955e53b8308151c81da4711189ccf0eb393c5bbccfa1f6c94a8d5f4bcd266fc6a12061967ce836ca042257368f567dc42de6ce0be84449234a6163b72069f25b7ead4b2003e1a7665e87ccf211abe94175d1c11bff2c0b6bc110194d34aab96934ef59804cd26e4434ba166d9833fb091be37b139cc10748b881c93690528a96ccccd2dbe024510b8da37dceab567dc52706461c486a0463369cbb99bcca2e8a4d2e005c45401964722a4b3ed37c351c9f21685e8992c9634349379f41796deebffc2928058c8ef6ea37c6e4970dedb78d1c2a00ea9e1ff1e7708470a6c60e6a2b1e966aa872776afdb238e97f716b3df8dfd42bf0f7ceb52bf9eb33731bdba5987b8f48b4599d67b383e77413107857e951ae0625059e5616ccb41131df9a480efd5beab3a9c99615921caedc53dbad675c00ba1030577db1d22731677914fa958b44792cc9c19e2ac71ebe61a05ee67ae7116e39e1c0d103f18bbc9d531164360d901da8234d29fb0b37cd2a60c7aa2adb2a4b297ea2fb14122ad95bd4592ef86c88fdae1e37dc8e44ad03c0fcdfa3801e93796771c5a2ec1e4ab12a64b3ffe48e7442c6224661ed5cc987aada6e778399941f7b20f16f94fb346b916be87f005c9c13789741602039d38270643cce3c347565eef5ee09139330301951c15756be47994de6f1802dc5131b9b011051b1d87d744756831a71cc8528487f032fee9dbffccc751e6a1ee6d07bb218b3a7ec6bf5740ead7a47b6907d7aa95b79aecedf4a637ead8fc6fb8654c93d13ee79f5d6258dcc61993aebc65e4fc14eea7d006e31f6e9f60e3bca8ce52ec559876fd20255e507daa99b185671ce1ac11d448c30bcdf97b9617195e0ccd2d15246308dd6cda74a8071114327fe203b1adbaa780f3243105c5111636a51dce966f5652e39d4f91abbbb4576234d6cacc3ec57cef2dd4dda49a6c33d12bb7595fd5ab5bb15b40301f34ddfb831a5dbf62218f496c003227fe6282e2ac054c45e7f3fc93e51b3ee8690f08612395095a0a12729d663eded879d9ffb325c62f2cb546a48bed51ae232fa6ce28a2494c132a6e09d98c2e3d478d5d2d15dce2e2665e4a3db448931068b99899c2bd8ba87349b0cf9e3c52cffdcf58a59b4fe0089b298b42ad7553f831bd60f5cfa3e09102fe773e4c05412973a678f3b3ed420433cd664dc7f218e816a17c5c9013ecb84abf2dd073557dbc41b92a91e0339d57b8b077a9a44d56427fec5748c47c1460b2e2412094db6d0ad06dea0aa0c1368592594bf0b2f590a9d6149e44dd4adc4cb42e5d9940d59397b83b33b88604c210694e3fbd84795c80c1b09ddb3b1ec8bef6e9dfc4d7f295e551a79436007ca48aa605ef5a89571e59cb26f2766e564e39d3bb441deaa0c8664549881d90a77256c0f6c77241fd6ab74b0e2890f78ff16fd2f9271ef96ebfbd0b878ba9c703900752b7447f4efaa60bd9dc9cd5673a36b39d49f54274caf03c0cf82b95141fa20ed3ce02ebf0dd74d9eff8eb9e2dd3a2976b244b12fd33ee75c1f1c459f86a1cefbc817f42d7f43ba406098165cbeab99df4fe751ae3382efce32af252e461652c7598161e74fd8eeca474fab6b1ede039935f2fd4d7562623b90a422a78941f47a76863d95857c33653d1b42b806bbafcfeccb7bb4a0c58acebf6104b2570afc3ca88e4fdf2719cf39c964a1ea7d2ae4a7fadc938abc95adac495093f6b959b1347501606b3f960b6d739291aa8c13eb49e98b0f78d2b91400b6d8961cb6165c8b684738e4d4db2f2ac30ddaa03a5e0cde4142b625e81907f08c60d7cb5729456806c89ff0efd08397423e44738ff38f8e88684f3a099dcda455521caca37ab4f4d9ed5d37975d4fdd778b97cc93babc804864a35e3a2db04598152e67a2f1f157681c3962d46ada23ea5d9a524f9cdbdd08a07a3a85b1f6fbde11d5a35c7743b83bbefd19aedf6d92241d16aeca7f33cc51839b75f111e8edaeaed808daf2f43fdb3c6f032ea45052ac31d4870c4d0d76aa75d0b88635ce449054013f234c4a16cffc58c95ba1cb8a0a0399861eecb1039bdedfab4d05f0270c6b16f03f6b8e629f687f133ebf2662c7f930530746679aac2791f54d6a95bfab5be0c33739074ed4e7ae88dde4a8036a7d6095cf41776366b6ae3f8f4a0734f48c275e129cfffff5e0abd042f99a957bf6f0f47fc7288750f4fe30198f8cad7067b36cd87ebca08abd3f9475e7443f83cca91a1ebfc42ef3494871f51f6d52a5524b9391c687571be5327c7c94ee2a096653acb410917fd51e56a92be4f24c1db6b97b465ca84c31c04c2f61eae07e952eb6554aa4d8a380d9ee81c1c462c360fcc3cdff2867a953b655562cd06162af8b99bbe662e0c27ce4d9a1c1a907def48a3231c2110c930a2f1498e32dbbfee0e5c5869332f3024fa5dfb0327a27c663cacd4e9902de34dd93529e90eb347bafa5035f56fc578e8386c7571d1f0ba335225ecd8be026b4544ad70f3af11501a53119ee39a8558ca0ed5b3d897ffb9cf0fcab55a0942d3bf7bc6b94ea27a6b748f2cfda431f35252c44610b7e843ed91ebf7e8fe10638f04f52d6d5a7752ec62350efcb7c473f80b1f2a26805151e8346d39d23551e92fbe372df7979c3f756bbb43f6bed09bbc6b65fe6fd241ae1c2f1a0d0b805c582853b85502968f9478e9a84895f9d4ef01ec4f3f571e57cd0bda68ee1f6f7e14fb6e0f4ef8c7dff6796472a935294fc27b16216966d5021339ded059687355b42b55926854bbfbd9f974a0c26eadbfca8a6183093996cf252894e6db910c71ca3ab2e82d90d371c36b92c9409cf7937bb266ea9b29c41d774aa522e103cb30bbabfe872b57beb027623742806aa7694a859ede9bc1fd7b9e32880b064b0030fce1a0e5cdf3ce558a5feaa32e323dbfab6661c5878c9377ee52a615b7c17bf1228e328aa20f92d070c71561969e1af532e76835fb0436810c3d87b982217edfb1143bfc3405ac9f6f3a50145608dfa8658b0ab642a347255c55b59cd1c5897b2cf625a0f0706c30ca1c1321e90cec57b7c3d1bd1af455e3732db80643383c41eaa6781f63da6233360ee720cc04d171ae2445b0c071e339d547f7ac32f407d29ec7abce0a9e1ef5276544877bab2f84bd2eef47ffa66f96e7170cd54d836c9badbc59435146031502c1a3cc744a470f693636d9050c5b894d2d6047df60eb0bac16d905d46cbf017ca69d66427cb88036eca4ea9d0e579f6bfd8a4a850703a0fe49d39c107c9358e98689fb62bd0475aab4b2031446b437c7f9e373caf0270a28d7b15c71f02079dde401e26175bb6e392106a9072021f0e5c5145a1db6f595b032faed8551f6e2ce318db1ab513db876a3eb42d225014949c19543e9c5dfd2290e28c5d72c87223f0195ffbcba1c02c7d0087721efd2af6881dee7dba7565e07abc35bc3fa41c6a4d6a313222ac6dbb117c69c62db2691c68869ac5fc5e987b0ae4335f815c73ea4235da2582dde81d6fdae5911617daef847be17f2bc09edd88830eac03977f89179fe03eb2dc3b38df43803ca2d38455232549110f4580ec3cc04c0d8cfe493013d2cde47c506ef6a8dfc42d998f70378fac5ce4709345926dc477e9e339d8c87ff6287ea6e2873e14d538cdc3f2a47e0e37a2601652f5b665b616a7d1ef3537a3327a76f93990f7694e6484e7a52a10e9eea2edc92b99406abfb2b11ec86667c7af4a333dfe900bf071d1bbcf4f0ad768fae4f450c53817c507d26e926e753e3395201d3ad89061f16706d841994abad283f0db74cada25beb5fe46f48669a62e0b849cb77097e1b4578b45062af4a071b04f0cfddf87519cf2bfa10ebb4b860239ff187e6dad73806ae968e6ac0f738baa88edb3ae4883a9e59be7a6b222c5f54818f95578daff9fc7a7aba8c4a41a699923e85ddf24a32bb71c808516f64d506058a70539276d57984d75161cba7d53a4a864c51a249a6b8fcad5738dd0055ba8468b56579ba5f102642df65c598490f3a0c9b1064f4eb1962c4c38bfb7d55d496a0b0f7b3f90b42f733d112c89176aaf937eea4bada845f3ca4e9b56b3a5a06b4c90fa4c1914ea47020c2f32531e270007ed389246906ecf2c4465f7cc5d6a347583dd73341ad97199021819be81100d867d628323ef7552db945e4c0be604cf6c4a8197958bcbd6c1879387d3286dff979632c54baba2a35ea84efd7726b662b94fae61464d069e0103692599fb86fdc3a06e01c6ae3deb3de6fdb21806c716e5f82b784e4ad3f0e2de629a18e3a2309003dfde9dde8e5101b83312f76e811277afc286b56879f4eb80468e58c60bc088284d05d725ddfe3185b7c51b472a7ff7db3930839142d4a452ddab628e07d43375801d7c6a711a55b452748d770b84ede35920c1ac74b595baef963d21df9418533fcf959593ccf5afccc753e86c4ae231eafe77a158c2472143faf169db29bf2b53c3288d8b3c9added65778095f85e2cb471ab58362041f0a27d874c42bbb06385a0403ca193cba67cf70029cdb7e73c7e2267b856fa0b8dd4c706b45e7174659b0ee2891df911724324f7ca5daf07c912b9b2abff762e62a1817688757492975db7185c4695f3a90895634b8d07453b36dd95197abc31d5d153dfb0d0ec92639540e99d6590f9b394f14c93a5e829fbb33616e810f59c502be44a13b700fd3009545e34c211abf9afe1bb8ced793c6f516d40010649f83a78ddbe9b71d8596582997d0aa54192e1200db61dade30500d72a184ca7dfcbfb80e5442f489d316cc8b75005564835d4b11c482e2c4d0d160f14a8b13ae0a0fb0ba5e3b782770aaca357df0e1c4d1c3b28b776a8b3e0da1abfd4f7190673fca1e1c5a31c688d6e8ddb21300e4178d07c4e854a718ac3f672b0120d6a54c16957c9ec8c444208e47737bc4eeb0bf2d801eb2fcb72f91fe988aa75f38e6cf26e858dc2a718580ff5d281d13e8fc3e3bc30c75c0193481c39c375a5b06b962d9491f3f1fb80f1cb27067f0709e0b0730573a9b5f5bdbee1708ad84b4ceb1a9a61e4c41e90655764057bfa07b8c81cc83a315be1aed6a49715479c0fd0f53f625fe6c7f36fadd001149ab978532e4d0de3d1a38934c74265b161899843704fad16ffc6189f42a5cadec98603e0f98c6889bd4a559079e074cb40678fad4690a20d988735280a1ee8ea71275069132101b35c18ecc9d3c6eceb4cfe9b165e4b6acc17d4f113ef8283c0fb6506f5635401e916d4f7e7bc3cf49aed166587a0c72cdbe673f467d81bc2e9cd08cd8dd16d90b353481df31e89b45e8b +MD = be3cfa6c965b2ee4e6fb0236665b0b95f66c8da8b338375b7393672283b0e50b96112d7cb76fffaa6db8ea4a7687fc6234dc1ee52e764d69ba8ac40c0f51beba + +[L = 48] + +Len = 16 +Msg = 3a35 +MD = 87bea682792f6bb4977fe1b92e0cc7017413dd263732c3604f0ebd63c2817ce5ddc5d78c0137f614a06e72ab1cab2f4c + +Len = 104 +Msg = 7db15b3ee240b45d4610950996 +MD = 7311a6356ab38a690c0b3a1581c3e7b6de418996c05e79849891b061c51d53dffc0fff2b8ad1c1eff165aee5ef6e18ff + +Len = 352 +Msg = d2a1efc725c46cd6a19760f49edf0bae823c1b4992ae2260085746cf65833bd008e56e64002383f51f960239 +MD = adb1778360ec659e90609e74b6af219a01a024f216b68aa944841429ed5b03b139444b8b848f73fd5f350ef02d46b6ce + +Len = 1016 +Msg = d11ad1253592c094746da7b5c88d329bc3ce1929913b8be07e82d3f6b7a536a855f31ad197376eba6f2f4534413fc4e4e7673fdff8739f774a710754b568b7c61a473059a41c98aa4e86617aa66d2601d0f0d584cd9f132afeebdc0ce3da6a8b290059e6e4aa080c195c42ae7f7e1e99865223439929b0a3a0d79b46ca6419 +MD = 0cbec7be7299f48f043c3d1aacf833b4258c32190a21a8ac2471666b4a51b63cc77fff6e081aaf5ef21b1b7523d65763 + +Len = 13696 +Msg = 2f7a9929dffaa4a4dcfeea1fc37b18e3cf935abbaa17cf9d834b3a8d61e9fabfb7683cfc387d6f46ece3f8bf845827c7ebe86a651d6dc1e83c5772cee1a9fee4b04453af2f68430bd87835126cfd1b3f8beea4d3822fb27864570e255cb65b414197480b6bc20a39c5450adf2474da93d72f6ecf8063899722d3755b7a19f71e93e782d89593ab19ddd3ddf053c54e0bf832311fbf132e8b9e540f38e4d9bcc3cdbf69de54e40ef348a9170ba2f65def167f568ce846889c0161448342fe907718a465e451bc1b0f2e4f21f9b911f186589f43dea305811473837c063b915d849c20deb43323bab4b64e61823f1df119e71962dd975700391b411f8778980a3080ba3c14a321d32c082d416ddd2345f0eb751a516d44ee55222395cfa11e7fc4edfbe7cd49bf4ebd4d7428843a2ad5538b3cd201ccd431aeafb146a65d28a4870a6948a7cc0413b0adac7e8dff3a898aeff5f4b65d10b28ceb749bd354c061c3008ec569d5f90a4d4f5caa51d35b49dc4028e738c8ff5939fef3fa202fed9ebef6f2c7dd0ba41cdb5c0c16985f96fd93a65d134fb4a90ffc0fb6cc5396b843c2151bb7c9170f2fa4fb44292a4af28df5481de0c3c917ba1c46467a35302738158493fbf6a0422cee558d4bce3d78e14b4fefb65bb05043e2cc2a6a8ea64565ff6ce2fd2c4f43fc02926ee44ee02fe1dce25cfde0115c9396c9ea06269f17b2caf58e2332cc1c8528d9705c70da1f76f22aeb1d1b93449180640fb5c4c4a708bc4621d7d2bed5b1a752191cfdd45086d34f247ed1df0f24e7c620de32bdfc4d1f882380d2cd7467c926f48abc75cbfac8788f88cd9dc5361517a5eb36311e6b39e21a85fba2038fd47d860f776697bb19cdb5a4d6746fae507e274399c91648537d905015e58910117e5914f44ebcb00e771d38b30c1473e1232d4e222cebceb4810c48e83e0fd4c852f4fffcd643c0ef9e4fae2d0ebc6f102f3f749b02a5e3a61517d53b539cc24120df3957a633d50369d46c0c226f8924cae51dcaf54d716f61385fd8cf38c2c311a32bcd6594d6930133dc18ef36a9671ba8b179abe95f588ef74e8558ebbc974dc73c26bb6eaae78ef464181e18b71f4b0f986ecc8495a9c4dc0b0b96be9806fbd3d32952ca3b4737a06ed6561e9c9581a33a720123fbaa2a70fc3233b83e56444f5aa0cfaf70fb24be6118404f3e11e6ea004cf2d079a3e93a8ac1d4e297cf4fc43851dd26314a7ed6a5a784b386daa26e50c64692f7db28c21d82234289bb45bad5042236667e6d70a24bc9525c3adcb793a6a5725d9b10911e3bc8e3fd604db7998346e7f7dd1815c0cbb735a977bd4b32b5b976932bc92ef3b56bcadc089045ec95f241cdb0a84c67f1f76353da6cb493bb27a881d37a2106b8b3010cf935eb3601ce4dce3e449eff8331e444ab117a20809a1010db4cf3be0c488f777b6532df908112e3d11592f04a0cc16232d62340cbb8b5268a662b8278d37c03d848a04f0ab498f5af43b0a20e310197b7e1395a65299fac29f051bcc5fcd09a5605bfee370ee8ea21f5807d9748acca815a44d81796d68b0014eed3bb6a94233fc51725de3809ac6f538beaacf8cbe3d96aca21a7a763a957f8892f22c6d086d9af2e5ac9d90321e186584f17e964c90739559ddd034df076c4aa38c2b78aab6dec8ef6be9adf33bfb66f159ec4826653ee6cb483539c47a4a1d95663e6cc7a42a3bf628623a4c9500a59a50a312aa104b198ce5f3e58952bb79ff1ccfa9ddba2fd4705e91b5acaddab9d6522d7666264ac5f533b6d8ac4512d8371c69c06b6d322b046ae2a0a20aec1c3bfb05f3d91b9044cabdd873abb5f2b0e3e19740df31e39828f9ff9bbb20b73541a7a70b8174ce4e43e0d356e629cdbc6c08d29bd7acb6a4347823075683ce9d7de4ab3ddda6572b175951f30a15263355fe9641b3322df7dd52077402a884cd472e6d0b6c34cd63ab63cec8760c7ebe384f7cc31066bbdb7a3417425e039c4d340166e4bba4839076ac9457c87459c57957d0a06dced2f7a18acd22b7295785dafa435a2a8a2c3a1fa05d115fe129d19fc44c5a29bf15b4d9c2b375bc8e591f92756cfc573a39b8fccb8395cad7617b11f14a60e2dbf69b897844cbbcb70363010f6e1bc0590ea594aa924597dbb32a868b55551789f82437180b85661809089d34a168d44b4d788dba23b13542715843eee797366d9ce7793e72331735bc78cd61b13421a568ba3e66926921c04e9d00888ba7ddeb474db63813756ea4a02c1823083e36ebd2d32d5c88cdebb98d511304cc276c7799cf84a1699ccac9569b13f530c762732e6bd0f8415001b2c02d11dff36660b717054b16df49ba38425e3764a56052ffddecdfc686aff22079897376cc15591e11579fe4feeccb55f +MD = 70e1259106fc7a7c6be11d95fb673bfaf0074e342fdaefb458faf4619e7f0edbd68d509b9ca7243d2e5e039d42ee3b47 + +Len = 100816 +Msg = 5f464d3301c5e0871d6b41b002dcd09abc80a805de3482d97f3fd7b9838745da1c0534168f76b93c3c53bbabd904541ffe5179cae619dea77446140b7400f47d242141c7f2e9894d88f44c9e066861498e7394f206f594a419790d697f6a11187f84bc6fb288186109343eb11172bec076d041a4c7306d7978c009fc2d2d62563614ed3555ba2d21c8fcd70e8389352dbe4ec808af3231ce990452eb05b1b0dc4fbb1b4265e69235cc3561dae4148c386cd770474863a84a822b2e5f905fc255d55f90bd6a760d441dc52240ba7d8c888a5283891a2c99963d1fe680549d6267cdea92cfead167f6c49663668f2bfdc61fa647f5abf3ce5ad2c6c175dbd456ba41436aa06f5f68f5c88e6b74ea86a79934bd05b486210d3d470a0967ad6d67f7385260578088d7e63197849354f651aad07e04ed301f1fe7a6d2047d50ce5dc6bbffbb1da6b47d740898f4eb54e3c5a1fbd18ec93254cc01f705fce04e6100ced132c519674b2345547804a372b5c925bd9ee9701527db33408d37b72f8d18b882d3c4744eb58f011d21fce336d426de1fcd5e09610216248b51fe2b79b96c2bd6ca0155e05a8a516b7a24d529a9a475284735bd9c4c437ddf399864b64fc5d0d6ffc4e5a7a3dbdd476bc39ed29a0a92e1f2b6b3506c2be5452d4f896db6eb4f895b554b2af64c4cb8dc2369b91022dc50b7291404cc9605c31569c32756a64ff8c4fbb0f1bca346c7b58a5c6774b2fc7f7fd50741d34c8564d92f396b97be782923ff3c855ea9757bde419f632c8399763003b58ee9140c2d62e914c1e1fa742661a9166d42267edc40905b35a25d5c3cb3fb457376b7422896df7bb19c23e8f764416731d2e20cf2c1beb8663c07edd8f105e078e2fed05c5e5897c430017fa2160f565a75a4c5c64a15dd7d644bf355d169ae2696ae5ed1a39e8f81055cdf315e5b0c6f9235515fc4dbf30281ef17b83a6ed604f89293904bf78c7183fcb0ab236cb1f8935e59c51559217efabc000b165d819b717118a03facb61a13a99b194f8b6c7ddfe5850127d79078397a56564c7ed6716a129409680434061b2a4782c9006587de927c1ae09d6778a5f1c39fc419fe10493eb0d4ad492fbd05485eee7913c59df82fe7182af2cf06a6e8edf06676200077bd1408f5c1cec537cb8566470cb44895826d04ec20f0aba4297c501add65c75d5767ad2ab63aa81b7b66f01b32590f1d55b7e50e6df1ee077a19c8c895f5ef62d452cc336e9aee171fa997ddcedd7af86e6cc37722fb5838a46c5e58e7f700edfb7c6bf832171d9581f660752867118e9535a6118635709d6f1c1cb21b938068958e956149d9bffc67f355cb88205d4894ba97c3e3c8be9fa2d20abe79f3f93a6a2f4f56fd075bb49a4b7dc83630e58c32a29d757fdbcaa607352f65483cf2cb4208a3bf94ca7a25e2a4e05279be31c33696c10fa4971d1b64ee938dd299f483e5c098845749a3b706a787529bf2ca56693d0a7a98243e6482a43e1f5d3086ca1b00368d8ead5ed2d0fb79b1e2f537ab9340809ca3a9b5eb2900390432293008ab7086c2811d33de0648be5597ef002c7c462b5e0f4e0b1720a98b2299ad7aa55eb78f0c77c2ab4371385f280107ae40ebf814a8223dc74f31483c63d9e4ed09fc7e5a51bac34d69d97163116a66c84ea9fe4263269b71fd228555ae3cf5109c4d6ced7b9049a2b8069bd2f71834d6c07fffbd7561939188bc07dcea08086bc7182a5270427c3199bf5fb5c4549861fd32a38ec81c4ab058c777dc01864787f0275f911a17838272cd65135f66baf06d8d93bc439eeb55d50b7c5adafed8eb8140b4b05f59871dacf954f4b096c30b7857774fcd319c096750bf605db8e31fe02cd1b9294eaf8bb009d4609f2cdb3a8657f650501b8553765de8f572fb91ac77b35db35f402453e5c58f60146f2906ff56b9c6b3a5d0bb6afb9e2201110919ac9c01a7e9750dfdb2f72afbf7a8d6f64b1c68b9de17a2c9abf289eef24074eee9b1649caf3693118165503a30200993d271aa31b8b92606a10a52612dd1fab495b82f9a98cade18b9d8a723a71ceb63fd1d27372bd281f9b40aa1839b0cc2f2177a09aa8e7b159ac118d7c145e7a4f032e788d21facde2b4dbc1d5d2238f530d9bf9bd2798f611d03ed8919f0c85bc2da99750b7a8d6322d2e66ff6ab9ebaf7424e8c1c3f4fe92be61f65359106395f5ef995e925be3868ad513f561f873acdbaf18590c903d64bd275121c11ea655124d091740887868544c5348664399d3da96e2e35fff34f062fb939d656bc072096e510b40b2f75ff010af68d64fd0acc778e2e13c9667de266b1816c4ac449521b02bbb217002c604be72e73051aa9048d192e3210a68769dd2693e5d44951711aed3a751240d42f8925844131daa36c51d7d59bbaf99623fddf1649db954705fd6f3405e63894f5258c9ffecf83208c2c90cc55b1a8d2972ea6b3a049ee54942b50526b7930953986e428b2c75e47ed870bba68dbfa624dd94112f3059da0a80c583baeb570fe8314f5c66501b34116c81148dd22396fcd6479da49f7e952c8084f97d6803ff85c3787222064ca368f596a1ebb6dab20a03916b3ab071c927d87fc10ecc4e7ab4a5761e3eadaea4de1a0dee30aa39a9e4dbee047201d7d8a4df1284cf668ae3ed7dc4cb2cc4b5cae9307353fd2ae4c105c5d9f3bb021535fc3ae9bf3ff54ddda8b2e1037cd9d69822df436dc1c750a9f557d1a3a63fbe73c64261dae0c70bba6edb57519f5b957f138d1aa5fefe01b73c1851aea42938147bac2762527a492cb85da43014c876e223b05597354d7c9b328df67f354d168a84ce86dff57d8a870db034196dbeff83ebef80bbe52425a8810f2c9fea29ee688a201cce4a5f447be789a3881a9da3b6c491288e8f1091719032608b332e0410f4576597e17e0b5dde305f069be2e80d565bb979a3915488f88e3ebb90e81c264bcaddd72b8843af4a4ae31f723d50fa0995b027c334c351128913bb93e67b1b08f101f6b8dc8202b44fbc3d3dfb530f66e5a8f35e69725c86998c05ac87c561a4706e90fa095adab4a566da4fab82bff6b20076e5bdf62dbd6614245b6a6f8cb6bf60106f8d12b9c3e26f8127dc547e2181531ce980a3273f452892110cfe1ea834a30f99d66e026a9d22dc76fc3cec8fda2d7fea701deb84dd45c97dcde57a017693e90983a156f11c4d168d89c06d8a32dbfa590adadd16850854f24bba315b0bbf372f03711a20163afa0c137383b9120b26c59f5e9e7cd2ccaf0ef4e0d70d5a81748ad441ee5fe178e14317cab184fe178fb0cc0d82105d2f423467fdcda0f9871b9d84882609248356f3053a99866dad9f9b0f8c4a897a8cb8f30365a7ae5f3ca6e772d863d445e6d57c6a478e35d719d0e4e84f3a30b1816ddb55bcd79df21ea0e95da72a19cc1fe74fc576120bc108be3ed4cae3bea889fb4ddd67efe858a994237378eb623dab070d954ac780c1e6d2095383c98ba622cbdb18fb53260979fb2672c21a4600f4bf06583a112d303096d4e30e7e1060d869f386eba3cf7aec3052ca17593dcc9969fa9cd88179c262770211cf53f53f175037a5cd445d239cee48f7ed0aa1d715a22ac18a8aeecf191d415e4afd92b76c091803f4c757a9e89f696ab7b11ad6d5f24774e4a004dcb0e3f33705dd8150431f051016af37647b9e44b10bef114276d4b1055b634461c655a82a847639a038ec9f58876e84e9a2955b696e072d8054c3f81173473604d5fcc0a75b4a340dba0c375beb87b8b01a0f2de232bbb8371c3a9d27a0ce521c4c43dd3bdeebf92f42f87d88978d5b4e3e563cba0e5f59dd29c31096885b113ea5c57e66a3be015b703bc26d3fd1d51a7c14f85f65747ac909d7e30c8e800be27eebf4a62e42e538ae30b6883907cebb7fc5e150bc9da3a138f394e817df9a9e44420078f30d0d3d6981ca581791a097a5e3982c983d5cec239096c7d8cc55c87242026d769ef1d04eb96e5b5001e3358af88d417cc61f107659791a35d8b5f7a5767ae24d5b2ba7aa12230076db1f1b9b6f213dceea62949d98bc5db38743b23a59ea75dbe4231a285678f5f07facc053c2048022fcb01f15e8c100d64a877ecd56d196a6ac60ae35e0e09a517224ba409ba7b70d8f9fe65bc427b212a4e9b3cb17b0d332267cea4f3bea7c1e550f7ffe567b20e3057aa0ebb560d00d28e2f7aff718a9f2d4d044f0d20709bb9ad567c98cff7c4810e8c542370cf90a491bc1088f69998d59f344b74db6c1bdb61f284e99b517a11452ca0bb37c7bae77fca6514b341066086e600f098a32a92935380a173c9182a2513584c54ff67e580dfe16b508acf1729a3d649ff1eae286bffd688fe658612d6c8e69e6e7f7de4ba85ec54747cdc42b1f23546b7e490e31280f066e52fac117fd3b0792e4de62d5843ee98c7201529455c85b169fdb90cb05e3403cf2f737148bd20a53c73880880a14ffff37d62130e682e50bc7210ea6c1f0c27656cc1785a0d9ce93ff94dbc5b2877519d9bac4a339e98ec594a7cc76f4ddf994fee8070dd4b8e0fe0e51b93105fcf566f83d914dd862b4ce78de7e9e16f142234bd969ff8005dddc641dcd3c7cfbdd6113cd3ba34a9503a0f433899e90e158abde2ed4ed4b3711c991577c5aafeaa982bce80835f8e6d7c7975571fafb1499991646bc499ec32930367d4b1de76ff656442cab987bdecdbcc2b2bc35ce01816594bfa4b6e33080caa41dbdf8ebf2205649f98a2d3bf331fb16b9ecd1824eacbbc9f81297b115b4d36aa7496e05f7d40d4edd1886c1bac10cf3f97840a03277e6369e7a7e90d932050ab8720fce076de5c355fb17959bd75cfaeff325b0737f8f5b1160de0b0184ba04afcc30bca77a6a37e29662302d01858c0bc1d32b883011b7df5a387805296cd91bbc835a3e76152d017ee929d4cbf137eb78db89d71617dd76cb00707aacb8088ac77a1f52ed710331193edb29933a7efd8cc153e6adfc2c6637e88cd86b06036b8177847b4d086b0ff9b5dc91f3cbd1c08217023d7449253c25331594f0f16a3c5f2e122e0145c4ec94f096b45a1fd0b2dd3f1d51e58978471782a336eae49d7bc4e050d1c6a391658f71a1f752c0ec6302bc2dba9e3766359359ce34955a2db86740c90d09cc50e92dbb76e17a39955fa7108bddeaddaf860d1aff14acec8b609ac1d336270a940604209df91cf45be72edee04277d694a6f968ae6d8e065702f3d607f3baf8db4ab7637fa4c78bb0b7fe69937eb1dcb616fca564a5a521e12df71fefbc321187159bd6a47b066a3440ba634de9153a94546b63aa33aed9da2018e1f30628df37f5360ca4f2660a46ffd73e58183e8abffdea25f7bdf798a2b7cddeaa481bcc6e682a67e99143066963d96d4a928a478951dd6ec59b1be8cb23aa688e1867738aecdd9afade39c92c0b2572bdde84eb912ed990ac618834c412231216fdb84f1e01b3f8414fc6dd0f646fd0fa62bb0157b3535e1497c9272df1cc5dcd4e6ab9a8456222655c56ac73fe0d2aa8b599035daddf0986a45b1a59510abe19a11b6dba065c8bcf8a85d20a3681c2414dab7c036cc1358b1dba98d6ae62c5948c36b5b3e307a6f860c0c822ac724a5c917ed5f98ece548a7a741d366868e6c676394c3659f7f6786594196dde332543376f9ba0724b091d30f431f91d919417e5bf7ba1e9a21cb80f6c204c3a58d59d960a5788b5cba5abd7c7518f4c5170115125de97009a6c3fc4d5773e4f57fdd433eb7422c7c4dccee57a1679633ced3b5f08df763d4577983c5ca8b49bc4e08fa76f8bff36daf0fed068db47f0c87e0e45d518dffe37c129cc6e2f5f9e0430185723098e715284a42f302a6b8368a4f2dc16f534d1e5db9d0b86659fc4ba6f16c982774115d02a57684c7e5489b1f491584b0f0546e4194a6041f5e5be3bfff3852a4fc772d83491023a61a37228ef6260edc0d1cb972cba610d5ad1d92d554700771d8236ef55e983765ed8eb21e7de7c8bb51aee9368758454fee4a3f32179c1e54af1d069e0b9728cd0554351907e018146511e4d6f0450b57c8ebd21c71450116296bdfc779945da60b9192c5bb9a67b1f04d94992df4cbb3e30732dc8af2177fef17e0b7d01740b8a64db16bc29c1e589b6bdfc967edeb2ce8a649ba892bc856a929f0b837a838ca7f917a52436ea3d20e72afacc5b9d58a7fd0fefd96787c65ffa7f910d6d0ada63d64d5c4679960e7f06aeb8c70dfef954f8e39efdb629b72979be208d616071289cfaa0756a4bb5eea5c7baf8fe7a31501e7e2d67d708d461c0c93e85f03afd70bd9e16437171e01a34f475e4b5a58d13ce4e2fba72bbba93403f3f8981e0bbd6a8a6223327bf096c44b36e0ccbf7592a98c1fa67f198b628787ec80aaef848b4fea158c715799e6f458327f399e6420f0e7821f2dc4663bbea065c7bdfe830b6102e2e7193381b9dc7f2381ba808c43b8fdf3addab4b5fa81564716f7d46e0349d9b27b559710d723c7ef2f79eb55c3a9d75b99ae6fde6877b278b583f8ae3cae776b914b0cae0772397fd19b6a27676c7ca02cd07f4b4d49bbe1ec87f2ac7e39e5f7712319c31271dbbbaf4b826af8a9f4acab696c62719f7a6a032c4bcf90922a3c630647b7c1c7b78b10afbd863f07486561a0bc8d9b1ff5fc41998a7e3c604e24af1c1df2da1dd5d83eefa2e4012f7fb5959ef9339574367deff73723484b5a969c8c23dc251a3b887f34b9ea09c9a1838e8aaabb254445d7556dda257dfd5579737fe1dd6c67f3851ca68b011e7cb7b6958d588f143828f0bb24fceca31b47b77d1ce05e75ab05b55d6c9f9107f0c738f2cf8a1629f7e9b2694324e082503937ff8ca7c5098f770289af7d038dcedcf0ed77c8b82e2a9003a6f3db69e14131e144f6be7cf0bb5353ea96aebd78befbc6ceae9bdde97823cdbc5ca8ef8a993a9d9383aee9f2d6a18fc64ab92990672ea2dc9b89ed248aacf7f1a513da43fe5953335afe76d78867a066f226ae9c727c6c60671c50a50732698ef7a492d51998eb6da5368a667baf6d12b77eb36686ee0ca239dc6f3598be0bda79e47f0891fe4d8989df8c685480de11c148a2b44c8a6bea3a50b09be557c51f545a09a30e9362cf3080e6a6bee3dbad370ce24f6c5a6f8091007ca195057fa3af8f99703a601086c2a1ffe55fde4c2c4153dbff8d6601ab68743c0d50d021b0b3099535ba6c40f866ca3ff0df7c19d709a3f58b57b40ab5e43556a8c0c1938c875267bb39c0db6b45840e8ee7c22bf6b48798bd744f70e42fca343a8bdfbd7f55f275ca5d62c7288756d4861fba68d16d842c5b893c1d8171bb3c8b593387d3426f292ace5cee7753c9f9a12e6bb9af5a24192e4184f7d3d191d862d3c3dace7853eaa235b6369fd164e5a7bddd06daa3eec7fe4130e82478d36f88a0999cba1f251ffb3a7689ea2baf016073193898716a9f933448d7ba8e0968c669bdb7dd5e6e32fd84a6ce9e8632b393f9263532ec2107b4c0d2abdf3abb2de2d63511805eb58a70bc4ded040d76640af60ce7f03b9a682b8dd84ed8a47225a48e0b94ea47828f1c8974cd64e5027d8b13d43519875d2bbe4461a7f0f5b5b8d63a472765405ea9c994225806395e64dff88506f7f7f3b6368d769e6e550d4e3e81efb13771cf403e855f75312f1383ce4c2744d0b4e3735a0f1e1b99eb014fa60c0d1ca9035fbc4403330c2fefa8411fb7c3d6ede5b5c8f4736106bbe01923d483a84f031e9685a3b6a70646a2a5059ce35fa496b3f21fca6047471a5bdd33908cc9328de9fb032347c249bf7093390b750696124621dfa67fd9c7fe85d6e5a4d277ad8f8d169f8b5e8dbee280f8443518bd94abc5ca704e781e6cb1868ba2d6fbbaa850326fbfa5a20e4df6fb5f8ee2728e86a758763a8af21e1f7a8584d3f0b09a0b19fe8fcd37bc4fdf45084d7fd92b80544f29aba52496e2c9a0aa4adeb89820be321cfd2f0a53585a15d04c7fe4ec9be6eb5df419e20b71506c1f642df75c53a9e3b2414fe6102fa8af7be3f6c95de824c31fd6fe8ef9d49e26095a2674a33cb574e9e493939bdeaf5b309b4c51256ef71e95dbbcee0a11991693b533f916e1c82ce86d65d89b6d596017fae944ec364546e78abbcbe4322b83e2fcbb4c5d4ccb54d8642c7eb9e28c08598a356a5c46f8813e6b63ec2f3e3bb721b726361f85a734e0514f4e9c4732991ed3998b1ba8f618c2071d1b943eb0f8766fdb7f0492421429bd380deca3325c8d5c7b6ed16429539ae54f1eba39748f09aa44efb67d863cda304e8653ff7499cfad44dc27807779ef8e63be4b376ec403f3c84eda4e5af31c30f9807762e0980b4e5d9dc406cad4e888bfc3ec4186de8ccfcf631b0ba5831747a1c200d45ea06ac82c7952fd09aaae5dcdf5475da427cbc8c1f71ebe5132f2fcae15975ed6fa14a11b38766e1c446894f31c0496b0e5e96507d28e6e4549d6d78841e40630ef306491a1da60eaea3fb69bffcbf192610e2e07bc1124690fea61980e8ed654c5e796f67d26db5de35b4a2c67427833e360ac2a7d4fe7a5ce572144443ed62ac460c1b19402e85c79e3d80e1c143279b20a66d8dcf2bfe1cc44a0f5aa9b0d9b36c46c2cae148dd0f2ffe9a8e6e7274d1832e57aa39fb40553da6414094e838d613a20ce9307d49f97d904648d6460985b01af769800cff9a940f70729fe40e98feb64ff0a81c5b2b096b1a9d832e440c49e4e3684bd17a5169fe138d2544d9806fec027dd2a67f1856178e090f9bb2f9b314a202e7e95f2e41fa80dccf7b1810e9cbcaed2acc2445d60e26f7d63ee4b28e4299e60ea4fc659e7d6f0de91748bf1ede1fdb2acde9482bb76bf6716847eb2dd7517e0a94f0bbf20f248d2c79fa0f518b67a44d5c4c73a9bbc3816ba85ae8344b5f377649da75cf1857d6e4338a76446c48e52cc7bc7ce283d4252f8fac5e1427299edc33f84798316f77bad4a87849e91a1a23c0b7a86898046e278eaaa15ff33730a6d3f885dfe2d1dc0acda2a9e49a71cfecb7dcaa9e70eaa8fe15d4567a280e8960ba49d5289535907e9f277f96e8e652c21d89e81696dd821db5b7e1e53e160584477aa9e4c0e12160c9956df36cce6f4e724dd543827366010ed3d843cdf4319c1bf968a70e9b1b6bcd8af96c9eb0620c569716b7bc42e13251a6adf8201faa129844b5e1d699cafa1b66a674e732c7662b0410e5bca2704c5ebed7850d0ebb825cfb0627a183cc9643b709aedeac2c06700358400c389f99666ae97ccd37f265da7addeb07df9ccad6fa777d0da2fc47b6235179136bbbb409596841e921eb278142a19e6203c7f235bf8461ccadb4b47dd290d36ac27126c808b866f9531261f1e0f5c458a6bab6f064b4efc432e1c7379f9af19ac34c5c22e76e6e7651e48f9ce44eff542f018397889d896cc9001a63e8e455fbe4a9ee9a740edad894fe1af2bb21a1dd0318e28ba982c12ed69c08835ce17336ad1638af3cfe0ea892ab8e83d3f25e6bd98d5e4d36292992e2122c265a26cbb3931dd4c1b0d0ac5ee19974d0dd45777908bb416cbce52531820effcd7f28e1fb2d3d4d826e1b2673e834485a25af9f9d174f566abc3b36732ceefdd91a7c3885e1d10d51c321ff704d0883905b7539309ba5e7b7a2bfefd0494e90e9da7541ec37858ec05ea9a9ec5672b113cd5ad6ebfc5b8fe40ed7c3f17d8a73703dc89086b4d75c5eaf06b840bb2f5b4519a4fb17bfdca9605f17253f203efffc92da96fde023007d22cdad05d18aecb4bf08085c5ca5eecd21f2b611e7e8a0ef981fe7aa2014f5ac6862fab44011dfd33be8a1226943aa7ae5fee9221b0400d9ac2ce5241b09a68cde6b13c47d50bf310ecb37f25c32770a299020d8500d8a4b5d7621e4379dbd6ef34a9aceefd4055ea6144f54bbfedefb5b5b0fbd1d81c7a51a802072ec3d84f34585f22c1df84caca07849b1ef054cbef9b40848e9fd238761df5358cf55a79a53a1bc749e49ffab7c5bd9a28bf24ad5833facf43bcc3852c1e85cfe47929fc49c325c20d74588eb9833519f192243cf96625057899b70a7c93f8fdbfb60d8129d9c43c95f8782ed8293641ffd21d21d91a0b4db69d766f6d6497e9a414ceb04b65425d6ad6c8811da00639dce8d8030038f2d08330c75b0879aab81bfb3330b950e54c13780d308fceed2a103a1a8b77a923b66aba737654ba7995acd306aa7b80f632184412e2369c353c2132ae614553e626f0a3436959104ba6e0040dc597dfbc3602a49e401bf2249699375b2c722083489f54fcdc1f616a133ef6112a1754818158ff78f245b9046100b0e89407f74145fe336976af971c054f12d98002c68b3aa2bd699fbcd71bc4dc071e430bbf694595a951e01098aaa499be2f70611f248a694539ef8936b2e8b7a3c5de8662436fed1f7bc24a4e5c17a663d9a23b4692993301b08cb3bc10f518eca51081c717ec8dfbb0c2669f7987fe6aa0bd98231d8e8b58951b42537f12884a857e02d62de4fda6b88b6b754b1b27394c6a819e0f92f6b2b2473fe245678e252ed31477cc7ec6895bc361b718fcab3aa550fc9faeccfe77cdb5b151ab1db2e569b5bc923ee26f0b6113504d295112d47218140e44652a10af10a088f95c7cf2fccd040fc93980939122411ec643e26e7d69ced3178402e320fe156e774b75b5afc2f3d6b6ab828bb4993b1436faa5728cec34d66f520f59e82716ed6d1324944c3c91d04d5ffc5a921f4716c39de24768484d0096f7d8dbce35aeec22db11f899e5e7e3d57e7668f35d6c0db3542255d9262137d39ae6cf9bcde254dfccc54a6062fcf8982f781d9ffab2df4f49ec04a72eb9646d63bf9e1799bc0bec0ec7f0675ed9f8dc9b8be15d9f2175dfa1c8bc99071c70ad7bedb10a4143fa91c89f54777f84c9eae9361cf7f4c2b7ab873ee5785a5241db0af86f3c6d7f091623d6dc576d07550a42023633a09c8dfa21d7e70cce64c13f37663f75c47921c246f3f2d1d16a8283ce7697da4cb7e016971a2a1d0c59d6202bc18b7cee3828de597efdab53b33a9fb41aa7b49f1c964512901773bb396ac80e90ba1a94c408b2860065ae9aec64a41d76cf8842d299d0babf14d5840d647d075c34175e26a786f30091a24f1ce8db30137520dce1cfffb6318a0d0fdcac883eac603bf365efa2c806eb4f194cae8c16780342165222192f6ee2e103ae2a31dc08a84dfc89c64d2e9ada7ca1839dfff62ddfb7982c79684cfc821a098bc6bf09f87317209b16d14d45c6f38fc99f7bf9bb73460977bb323665d480c87c687cec052a5f08a2c6744c8e177a8a269b4a47a925b9123cd2c014313edae988f8aeaeb633ee5ba6be7f53fe36da3aa37ab2077f5fd75a82a55a0fe62af213b85e9e7694f78cc2b0e63a8c1b89db484722fc62c688678a511c474f0eff8eef1382946d26de00e5c626ec1d7079445c1b7c6f7f05073249b11fd1fb30257724a14cd7bbf451146bf366de2e826fdf1d25705587c4460040ab963e3bd504755b6aa5b18786b68efd3c8e59e8dbd172346fe7f4a18bac98164669d73984044f3c777368f965763742ab86a3720208c64801c796f6e3a1c4748b81e41ac58dcf6ecfa0453b18fad7e3473604f57f7da302e1fa81ad538d4a0280c4ad092007bb9a7a12907227a936871886c699db97d00a1966fdef64d9f3672f1b792c1edadc6781b391c91bea1bd7275f30859dbd1707b1f554e49ceb874ca06e92ab466efa7eeb6990667a27507a7ba789e24d593ea2af8eccb3862cce58daa63eaf212bdd86c01ed471cfc79b191c481ad773d20e821d18af85a7049034e5a9c660357a4c2808b9a6139f32c55c13282b8d98904f4f027d438189dc9487c96172e50dc1100ccc224e7374cf96ea6731032c43fbc9b367a4d1d0b31aa3fa8eb589672e69f1d9144114bbd508d56c2049ecdbfd7b43545375a099ad2885353d8c550d22dbb738e6fe3f104b444c89475a2cc24d7887daced8fa05006c02dfded01c00707e2ad04c41199c5decc1eae34b0c0abb5a5beee1b5253c3350e1a077682767a0b9124a4df2e8879366fd37fc04d4dbcf89883892f46a65ce3aec22123cbe6b3af6364df1f9f5f9751bc8179b6dcc5c126dd65feb7d11a85994e90ab6342834c79c5f82413e88198c73e932c66e3cb60b6e0c0cf438622e5dc5a1036c38afe9cf13559044a9e90f5fd72a3188ef6b1043f5f4e6b40ea51f6235dcb33b3099b2d8c2e02103235f0476ad51bce6d8a2934068549633e521a3ee4c62c22b042fb86c13c8da849233205a5e277aea1129678c31f5c379a71fe08b72fad9449cb923126dd465d1e0ae8a925374149b8248b3afb69f168f3ae701c00f6ea08fe07f1b5338ce6af2f3156ba6f300310114479f2f6119367c88c12c158b84be13b9c8c7b5dd7c90edb5b3ea1fa5927a25ad6d5596992dcd4877f58a134e05dcd80dde4fc2c2a680cc0ccf3084d3f4970e3603fa6bc5a180fcf1ca4241c0b8a1e7c607dc025016e297e2b0645de4ec2fc49851b9374f3ef99edd897c284a67b647ca8c96fcef935d541e9faf334043ea50b99fb8819ecce039227b624e52d8c20003b5a43808e4990da8e4398c4fc172b983351fd11a13dcd2aae5193d42d46e1b57c92e3e01d23fc968c729f3782d6c07dd5a17af2bda96735c12cc7d8023629fb0125e974425f7914690a7ed26508343ae58c8a439ebb6232049a194768d4594f5d65aca37a5686c2a86dd04bef35d74e0755937ac0ce3ebded1c00c8adabf030e5e4a5f44193b62fcf2f1bfa9dca2a25afaf2f1ec06c5d17ef3526d26d17af3e2f257ded24b177ba41c0ba64fd4fbd5042fbd5961a105e0e9f77f3db13c1b6c5bd9a9d04801a5c00a4c544218a21016c65bdff774a44b1d05256e0693e14d76605d67bd10048d3816caf31a6d10886c88c783538bd93e92bbc4484f3388b61adac4b92b911c76ebb1dd11b7b4e40be032bccff610068746f41e34a1fbfbfe5faf57c8a4331008e2c1cfd69f57e74379ac80eb6769f4ce4196795b835201ce4ec85ebcaf5eaaec242fe6695cbce1d53fde5b002e006bba8c8a1ee57da061ceed0d21bdd57ab0cab9e46bf3764d9a6c3ab19736d43b33f32eb955f9174ee4a54666e7f19cefeb49aac7a59b7370d9ae730b7bb4e08413222f0a66bfdac252fb61bcfa838f262312febfde8add8f6843f1d64ea3da42d4ef986498604d65737a44f5a099338520cdbdb65ce73b110dd4bcf8592a4adc3e0170b13404f99f0ec8f9fb225c1275a921f09369db165e9109dd5be472b9bc1901bfd882d264d9ed8d88b4c8f3b35f88b69e3e4b8ef5debb895be536a3af492d968dc1caf31879d672f70ad9869ea98335cf9e4a2760f955fd3e8099e4b2eb4269e354548f9de9921e50e49f3f5cbd63468b9db0cfdf17250c8f13535d4c0a1f21c87967cd798fe93b9b2960447401ef90db22c3adfba0f55f5585ad37040e8d6745184dd536d5a26edec365bd6edff1bcc616cdea3bfc8b9d98c0ef9a626054e361194cd05b2287612399f6d3d3be2f71555f14ad2893af6f60ab61adef663c3c2464ade671dd5ebc71935aad290573588fe6e11f48cd2b7db62e4b9932890d1b96e1b83eff70f026d199db75fb1e83197c937b672613c66ea131f485b4318e27c079b4018d4205484993bf50ce70275b244f2caf47cb47eb2a9ca59afbc78809a912eb56a4bb65cae4694f682c6329c690003a1c355f779b5857a60091b1c3685995a366cb43d753a704d3e59c5f5003c78feed877351e27334b3fdefe5907edd9eb25588a42248b9c4a93efa7cc63bad1e5900b95b70436c35eb85cc8251c4030fab9556920141cca24d6acd3122b92b7e868dc174bf071117958a4797fc90866aca685f1456fab397ae647ab9970348082bd74865bab7f248568db98ced7ed84e8360fa91afde3f23509e6b4caf948349ad9fb6a4efe0a0468302cae7a0f999195af1c19058669fc3b88b2780b9075dc180298498caeb7ba0cf8bd42eb36b1959d5ad3ca6fd1e85f76abd27ec5fb637ee38173ad7d86304d5708b6dc8817e099e77f5d43c1a70624cdb96e4e6103bb25e59eb51d894d1dc533a74005bb79cca35b66e10c61d06b5227fcb071457025d605a0862218ca252b871f8343ec231dbee15688aeb914c0f16ebabe6edb0a489b2bd10d4392c6f1863bb6a62181de7cef61997ab02f3bad0a893cc0cd8a99cd7b3f7773085f0929de36b5d124e3729140c375de9a2d0cd9a360cadf17b9e45b7f2adbdff9e75b743b62642ed67aa703b8ef33dcf51a50edc7dbab42d3d2b49badd2457a9f92847aa6a60ae2beae457a5fce1a9e485ecf907be22913893cd1350f20fc6c81c94be426eaf01864e813a03e4674491b61516bc95d8a77c15f03d0adfc4adc27f27a5ac4165ff6518eda1a5c408708f78a9e26b834179804a312148d4f75f21a77d78387139da40c0a6293c2a59d0162437d68504f189ed970c5abb9ffc6d8e1be2b0877c7f24b1dc273b1765bfc5ce6f4b8d99a96d5b1c92ee53a39f685b304313d909c1ba8130d20d51c824cec420b0315229df295f75b453a6c131afaae0c36d7c4fff70623638a4f7ded5eb7db58d95deb6249a29b171d8ce651556dee8037bf4ca74453a4a76aab7cc07ba44e55de57dbef8542c3851ea353fb8e259ee89bbecf9ce8d8bd6227afc0028afac48a7acd9b4e8cbe982eb1475917ad6be4cdca9cf6e7cddd971b2924f2bb730264801685d387485e41993c3fa0af9987e8b52c21688fd9a9595ad8d1b9f41e0457be18492aa09f69e64e2954d1ca3cc1d32b2915cd9cf6862ca79c80beb47347c4cceadf48a37b29b1d6de4e94717d60cdb4293fcf170bba388bddf7a9035a15d433f20fd697c3e4c8b8c5f590ab44aefdda94681407008ea48d03ff21e9bbb4ae7a9aa37c855fe3537c44106e8079f18c24d2584474bd4a99367660ce6f7e6d7c294961e174366e7babc569d5f80572a21a4bd7086629363e0c9ee2599c8b8863c96613ae6c32cc67ccafc66e1cce79654567ad08e62e9abc99e44d6a79ca4d8de15b7f8a763a4741676af0e1f3bd4e002c8fa1ebfbb3bd3a65ae68a80c230422f98f6e1e9837252e045eafd585ba389958297d59aea1e8e1f665fcbc5f7ff449996aa712dc0faf582cf3caf3dbae80594f9f07fc06de63d9d672d14d7ac4662b4a54f40d4aab2de766910be2fc7f6f679b5708790b5376498d3baf0463dca2f093b51bb7e9f3e7033ba0384af0174becc3bb477bc5e86959a12a5e8924adf0bffdf5e5b9c1cf24d232881ad5c05c5c0f50318ea83d8683339ca6a583c52198c00f7c1abbda282e7fd3b179297338ecf9c923a3a87a130dfc06164e9b4c1fe11d51b382643de44b30a6831dee119241d1b6f84f2484784fdf65e41f78c38e15fb4b00e45df1edc40e3467cdcda351a4c0a0185ac4649e91024377e1c331587a8586cc0a4dfe29e14004c3536d305f5dee0eeb8c2f216c1b8d27375b239f6458e08980badd6d82e9ee9e007578c0a3b48288d9ad0ec3c934a99a8c5741149af937dc82bdb545df26428b87fc935c05f1a4964a8408539f267e23de9bc498e2a4b0083cdb7c8e27de6252bfaf680a6d5b7ec1a6dac6d7d537334a95f1553324a0739414dbdb50445a767b0f589fd4c33b35905577ef5a53b0f097191f9cee4836a908748779941de2a78fe1bde0c2efd9f48cbf232ce101d9df93d3ed40d036ae7aedc3a5ff619abd1c159ca8d2dbda7de13b4ca62576c7f925c52925eae2d7500dc969fe14c0a335ff95a7df1d276a6f242765c781208d59edb5848d412b11638b27ce5a61b8209075976c2a6aae88f6e6d8704fe9e83b425dec4defeeb3cd311b8c5a818d51f917a8a4525361791d5c4fd5d70704d4b9fa9df1ea119882f400e682753a41931712c043c120a98f0fe786a600b47befefc9d64cc5bbe8a16c191490874e258760c9e4fd215bebf848e0b4d35521f53ec5f9308644b785171fc4cc3ff886e034bd833d59dbcacebdae8f00e43c151bcb24d1d226d1cc19ecf349361530a81ba3168af3df5536fbe52b3b93621f57959df298e5b4d3c14928d2ef7b9c977c7dda54242d17f8661978a62d94d565b00abc199790b9b25fbfd4a3ffc35c95ccafe35d9a138a2c24d17f06ae2cc376e822317f16fcbcd56e23f84ec135dc935e58c61b34cfbf5a36cb00350483b6bac786030e5c5045a6b61c9aba7dfaa4f7fb21897539863ee865ae061a77c0359915de3aacb3b5dc8cfe53c4d17b393c2b6bb23652f36390407922969d510cc97b99d1df4361530aef10707d7a021b2d9576b2d49ca88b3cc83ad1baa6d88ef8c81c08f8baaf515637b21ace9d5cc8fd9fe4ca6c3aa129caea7060791d566f4de8662b90f9e5d849cdadf9bd23cf6737b07ca105142663c30de27adcea11d64d433fe1ace84b0f6917c8b655f2a421602f07e0a7127e61ae9859c5e9f652ec82416fd2566f291f417ecdf99bf3231d02864e2e5a1cf34c13f59de9aa2760d8734bbda79576c62f566b8269990e9384a41c1634271acb4c7a8b768f276685c3a8c7f20872e56b683244b1af562c3e7dcf592a9915f44f886cc2ac5f679c07d5aa1fd69cf3a460f25c722073da336a310aa551062d92c7297002060072af2f3500b9310c239bedf45c5e985c2e0d60c7dd68522376dc7b560fb34d1b5089450c32ffcbff07b35a96bb6fe01259a06868d00af697f8bbb238d03d49570a109181c9576c1ea9d2ee02000cc23e63d6c93c6cf3050bbb15b6f73b09c25da62e5abd4c2bdb1110e1f25db39f04885595cd6a388c4726c8d4cdbad87d80d42fcaeae843e2e17f44c9aed25c8f6f9736c7ba1bbd3b839126de40a930024a65aacb872936e446114e706a868444cb140e53d976816983f3dd1d57eeca01eab8211b7aa8ae99d26e35c06ea4b226e0a6e52172a40e7f0df5f67759ae2ee026749ba10b8e33694c3e01a001526f9d75f6c419cdccece3ea3f78d69014e509c741214581034bbc7e2bbaf76db8421154abb2233117a1ffe2786b21424576e295c9baef262e80fa2edb69aff800b3ea436eb827e8adb73abc48d740b86c69d557b16e874038598b25f616afeb4f4a900be7dd0d38b5b6fb4259c51a3aaf4748d7a445f518485ed72b25c7df8ed0906b74bd29bd6a5724ac3a503c990f3697a5db484821f68718470810862728a80ce34599a41fc5bd8bb46dd845a4812ae1532c457ef4211d0e41835e5a6f030247614822571c930c727ba397e723d6b3aeba9244f054e331c82e65b74c9f6504c74b4301499a1a6f6269a3352aff57f88442d4eda42a82ebcf7776c5629f97d6160bffdd8282a40ce2e6375b161e4c22ee53bce7a45f4774aa827e2da657e1a1bc07445f0bbd770b7a5a25b1b469fd58715510dbf8d97af4e1b9459a20b08a8d3fa9d92feb32db95b22d36de0bc8b1c397b09970a6826392fd8392b2d790dcc1295888f42ac81ad213c7328b2324b28be7cc1f4fb8414a7785472f1dd3e11d66017b1756d1697be92490e15f056346d7e9126a1f35fd76cb016fe2841c8996a3507c4fffe7fc45026df10b03b86fb6cf26e8418926a030b5fa62748fbb728fa19dc2f8947468c1477750771e442e4a9d25b76d359211c05df788ade5b7824f8770b5dac0819737dec916ee59b28a49666ee8b7ca81386eec8049542f18a3207e51bdbc291470eeefecac385c096a +MD = b70acba01bd715f542859a4224d035eb177fe7b34d5447e099acd1716ba6d00f515bd02021b5b3015d736b04687544de + +[L = 32] + +Len = 16 +Msg = 43cd +MD = 7c5f9ed821a021ef1850dd4e0b179a656fbe27b104463720f467db32bbfab5a4 + +Len = 104 +Msg = 5f75a437ce0698a7d8151c3fe0 +MD = 774782a9c3023dcef8b2cb83f7994324e3cca35323419b3914a9b6bc3ace5ce1 + +Len = 352 +Msg = f88bac738d1e3e10f75e46e3fe026d7e423fdcf3d7e4028b33a291bb4aabca53f780fbf99e0346d610d4a38f +MD = f114f1a390bfc30f34652751f3a38e8bdc9597625e363689459b80082eb34009 + +Len = 488 +Msg = 832e5b78a73a1012ee62e00621db7f4d248893007c6e5d6e0e689c6b291baeebc72df9cf10b289fe20e7fab80a2399271d0ac63766049da875eed56264 +MD = 7d00fe393c308eadb8c0a4f771d409e17c9a796e63b45fc8e84c0cb2bdb62532 + +Len = 13976 +Msg = deab57cdeb41974037a9bef5e292894038264eb4d8993d4d1501e6ef9c68fb0f571f57b0925640925deae9a6317e3bc4d6cdd5a0833e52fb48baca16a9ba9b6c8ca469a0555763b54f04c87d4e41aa549258f30eefe5a52d2ba06657a8773b0842e094857b6d8911d6a0636280025e56356fade362b4bf4c875cc19be0c6644b447be0454dbf390eb966c03e10e9de3487b90d0825d327c12495e3c89ad09c9d591e55c91376fb14c2fde9f7461fb25450df1a65806b65f3caf4d5c81ebc6e664871fcf915b9578bb70ee6776acc62205888dce2baa4024941209e81b4b35f0eda1bdcbd9ab1d6db6140bda4c41776fe675d5c681da5852d50c246dda4ddf9fdd7c5fdfeec85ff6c883c78689c2977584406a1ddef977606c182d6c33561c39c071668a2515e5aa6f4aa1faa392aed95b82ab32b79a15e3b5a07551ab068455131b72493126470f26c30b852e4415e1d8b719b3803ecc336e4facbcc5d1908851f4f39b776bec8b6b9794d47e5965458858560eed5a0305e260240c0849d93a19787b0f8c795eb5ba32be573845256ae6d0b0a3336e42a1beac8bdde6d1b6e0b6207903d4b105f4af2ef89bd099ded870daea2f170e03bd5f6f4490e60bc222d4876e16d4c58aeea6e6c400dbb9e9f4b2b142f0fc9bdeaf4132ded38a4a8366e107cac7210945fa2df4b124be37ef76290e5b9758aa3bfe0091bb0448206323584c2f833e0edfbdc0c33075fc9647a3404ca490bfab94302a0679a1a42fe9fec6af0cd98038b09ffbecd2832b579b2294f6ae5b96328fdc0a0b9b3a32cba04fa8bae3389c3951173bdc17caaefe526aa386f98670b177683d0b804c5875fe9c7afa233ee66349c9fd1b60bb0becf5e1d887e67fd3baf34b4f90d94699d18d6bb9d77d4af358f31edc254de2d6c5fe3ec07425c633b18c1b9e3606b78b40b543e1fd31fb578cf58c45744fc073fbf3c7d7d607e815379a5fc565892d81560eab8fb5f1ae6771b998c592e6d288014f13ab283d53fcbfa66e31a9d107308402191fac2cf2b799c7dae91b93a7676898b8a6e516a86eac58ed8f6d8ed2fd4d38031e4a4466dc8798b90c48e6adb6b4391d47872443cfaffa542b4b132f6c3408f0081af8692aadb4c9bbd55053ea56d8b82998f6b4b41d331891acfe6af1bb0d6679989978368ea463743b514866d2d01fb9950e8990867bc14f1db1142254adeccf3da812949cd03cd1d569e9d0bab7ca7405cc21096e3cd4d007cbb9629372e98584b4c6b97ad0bc314e1ab6ac71184ee555c01973570ed9b115bed956f9e4e349083013098b1e483f0fe44d5e9849f38a2f7ae152b36a266ea1faf263ea8c706632ba8629602187379546fc6b82e57ededd6d074c15c771754710731e07c207899eb47e8d7c72ffd768c36257d373375ffa06f9b3f0af11417f9ff9f9b44e1f1f96ae8aaa429af88b14da1da81c7bb38a0fe9372ed6a9ac6fb5e9e56b82593d94c5192904450227bf040b7ce0904789f979845e112a1f995c849ec3f7e49bd975a474e8201630f40fc0d80e76019f110ae158cd0f8da96ea4561f24237d8e795ebf52368218bff3e9d5b040ecd2caef4ab1e7127e53bfa2b3b4fb74829f9993ac703192aedef79dd9ad24c2c976638b4575afbce22ecacc273ba43379ed55ceeb51838b0adb80585bd1b5f2707ee16b67a7232adf7163415b24b9ff9dc94b7197fdc89e2a90d2b9eccde45e965edd064dc0d1eadabe11b8ec3aad2742b5d3323ebf913a92817749090c20758f98aef2544d4c8b48874e8936d7ee492d5585675c214deeb74fd67c4d170ac5e0aeefa607c6e37abd4f8238e776fde3921afab75cbd8f392d3e88da057903ce2e140797f4a85737bd89455e6aa27c7535687b78cd0ea59848e006c8de9c9c0cbc7a9f5e977be850adc710503ce4ba7c7bd0b042297f518abec6c8ef451c33e030251f506cbc3744228b6bb4dab86877d9e6019a0ea9f39ed37557b3b5527c171da5f013e0d3c480a038cff2c087d6e5d41b17e6c8f90c334b5e2b9ccbe9d4efd99fba1f907d00a49b71b5a08aedb644fed24bcf04e71be67b03cd20d53ccef8f854f5e9f7f28c1e98a8a53496646713bebe15a93f1ea336e6e8a4e68de5dab0fe880bf983eec75d1c5027357f6669e098411e0bc3ea2293138f5b34425f78b6508b94d4c0cc32ee9afaa409a26e5f2a1fddcd6d5ff42a89755a58b08f243957a2e208e24b055f51992ab447bc06876eba169c545fa71b88a0fc15d1e0be9d334a1dd0c86f44bd149b42c07608a9a30d0b7e13574f8d862f2ac72b2ed38904d7cab194fdb9e4dcb615f5610b24e202a36866baccac01fadb575df11dd43e00a3b92fcdd8c7702ea49d951e7dad2a56c075730b4af1ceda2bcb2310256f28312579fad40ff471336ea6a44143edfcffc297258d48bd2ea47efab8f0dc00f1e6dba1a55009ed627b7 +MD = 6e5905b22cb95e48b73c5a885f5463f554d81257bd26301c4393d57fff1c8323 + +Len = 48824 +Msg = 5223e2fece634a95e1e7c83ad4a11a0478f4a41572bd66c2d7902cf4f94404cd80b1f58fbcb8eeba3984fd759410c12f8ee922865f363f684df5a8787c87ceb3086fb8535157f7f39653dbf5c66ae7219253838ec77cf1c6db518225c5ba0a8212e5911236474b8820ddcb8111b87320adb82ff553986324aa2a21c37ce4a083c89ce9931290d4c1fea933e31d014d7507a28e83aa917ccae10bed1a490e77fe501b299f8e3b78e659407ce1934d5d68c7980800746f26ffa9794ef1d23f793bd2eab7fe524e213e58280f441ba48b40162305335b3a480c2afeac11c27f8d817792fd7805d4b61224eb52d35c0fbf471bcaede505fbc9398b216f43bfd69b1a669a61d44fd21faae410af58ff95e1c3ff1528de1aba93cef56bff4d714d8c4cc88a4ddcda52444ec1208d99ab3fd9fde98c1ee6437d8d138f62c5f782eb4660c5eb28564b5b0d46e3a2546009148f3d02b837c5284e9f508290270b97b9b29e84445a0b4df662d9711e6b73c11cebcb7120dc427034b1ccf57d8e4f5bbdb84d2e1d4bc3862a2b51931d3c9a7a5fd6ee5f4c7327c338abd011af638d730141b6eafe63469eff50f473262e9fdce636eff4c5663acb6075a4fdb00c8b8a8d3322e1700a5b3e7db90b36c1a94991b8f51657121b442db6f890e208f312466778d73bfaa8cc0ead4edd0776155f3eddf9abb1bbfc0c94421adce83d7ee94f99f61e1f25a55fb596f8b40ccedbaa8e5e2cf629496f5ca60bc4cf36d917da4e2b973eb57869dddc409dd66d5061f22642743fe843defa0b19dfb2f56425abeb234181267b5c0d2ab4268c538510feb191bbcd1631b0af6c7451cd4c641025cd8bde2d9ab6e6b948f97c1ee6f35098d553e8e9da9b4d437125046864633f109d6a558b38b270a7dd1785d44d248a863a91e3db5c0a1d7ec133decb65e81c3402c98ee329f660a092172bf6b1a02491895394ebc506882805a6c93e767c0e58a5af717d950a206c0f0055cb39ed88816a9fe3613d15f608e486ac08bfa67d462d24e6a0a37716d3fbdaeb9c0e951c1e847fb884ebc1cfe707dc6e7269eed1c44331d5957bc4ac9dfeaed4b157204a3080fafb9df8917b8d15aff9c49cdc739b8fdc26a546794991c183fa523d14797e051894f48b0d62c2b70834467ff9c993b82fc1152c1f5479ec6144c7e8fb10d1bce26bd1cdbeec4e95ee073f3bcc3c7367328e30543d371b27509a577f5c79f14d5f687ce62b82f856695af9f7dd350543ec763de75b593f1859e44c2ac01ba65f98743cfddd8a89a38115badcb51a0ff5655f830c0122af6a830aec13ae5eb89a93755b3a5a6eca233f21cb12db545a24a5334becb8fa32c3d7f5805faeaaeea85a551fc62c94807faa6474c0d74cae79b5d8ddae07498fcc5b8b4f394867112ef5fad1c9da66765ecbc7fc0f3269d29c9c38817c77778f2c19b5a3c705fde9d76a4eb86aed4a7369a832ad267312903462397f7b8fecfa8b195cc2316cd53e48c3371ed2ecaa3e484b8ecd2e22b1aee910c51ed5d71198936266f5a00655d82c089f49295feda0a2bcc1a54ec8adf565acc3a8b2d74c30eafbbd843c59e67f293f6d8296cf7b611f01b57dafec6e2d4d411a633918068c38ef47b72ceff1fae772891141c3bc496824509d78165c1e4cd4b4989321a8722643eed69950dc120fa8da3e53c3181f252d7c4cd2cedf8f086f788ee77a98ab5b019828aa02108f49ea4a51f457f7adfd2220d3e59d5f4a29194e8f5eac40ff80312ff6888ff6393c3fc0914b08c1b9990d247ad80a441558db1ee1203e07353dd99a885a7ff5d791af2548815dde0ca1f56f89d39ef6b93dbcd0cd54b854173903c12649587433f0425fbcbddfb66ebce3eb4800dfddfe7fc44d9b23a3916b1db68c187da4dd13ff0157352814b1a792de7fff855761abc6fb7b93b48525fa90fbe3a51dea974069f3f5fdea86387eccee13f58a8eeb8abc6a43fd30e9788c3bd9ae1751b30a82d420225b2abdb1bc121b9073380be16107188d20be54f2e9c658d5b443869ea0e991c496104086290b6edcc1b656adf94f0d42458750fbd8d88040c518ebbb644f4dc4f7c6971d8d60eee0272df7b51a3d5248b4b264fb22195ad891fb6ac994ae5c0bc6714ae0b0b9a484edc576638b78ee89b568195a8f33ed8362128c30f9b0c7804b3ce1355abc96b15aa55c1e16a9e9ec90d1f580e7cb412a7e85d8585bfb950acd4de5865214ce4db7f6314d81784c588c1482d5f28c5fb62e7dd7aa8237ce9396ccde3a616754414cdf7b5a958c1eb7f25a48c2781b4e0dba220f8c350d7b02ece252b94f5e2e766189c4ac1a8e67f00acacead402316196a9b0a673e24a33f18b7cb6be4a066d33e1c93abd8252feb1c8d9cff134ac0c0861150a463264e316172d0b8e7d6043f2bbf71bf97fa7f9070ca3a21b93853ec55ab67a96db884c2113bea0822a70ea46f9ae5501eb55ec74eaa3179fa96d7842092d9e023844ed96f3c9fc35bbc8ee953d677c636fdd578fd5507719e0c55702fed2eaf4f32b35ec29a7a515bbc8bf61f9baf89a77aeb8bc6f247706c41d398cae5ec80b76abc3a5380001aea500eb31b10160139d5a8e8f1a976dd2dde5ce439a29dba24d370536a14bb87cf201e088e5e3397b3b61477c6a41e22a98af53cc34bc8c55f15d7924e7e32fed4d3c3ddc2ac8eb1dfc438218c08c6a6a8eea888b208f6092dd9f9df49e7ede8bf11051afd23b0b983a81bcc8d00f7d1f2b27cb04c03aeee59c7df23a17775ae5984eda788eb2015680ac5610fb1380b4e7d7a9cda6178dca98690449f5551b66ad2826cab2b662f56903fc95b4611bc86f7a834a34ddc3be7bf142c8baa096abaa3cd51ad0c0b6d15e590eab9e50a4c60c91061f1ed6373d91974c1ad9d263110a0d43fd8b596396cafc0ae70b7ac24a59bba090a6994ec483db7ed4c572f723670a11c724e8ffa2497d8fccae37eaa1d14ac1537eaf80efbd2e597b2ffac97f2bc3cd2c4017f170544dfbb0d9109478fddf06ec0981542bc8107a725be25070d2cab4716f4edfad75fddd582ebd363c49e8efaed9a76ee51f22304eebc232a4f67f865b04f610a628fdb317116666785fe8ca30619a07c83cc449855202d687f162b12d93b63af6e7ddfb7223d4ab998a5f450523c1d521ab76f4aa113cc2967e04a38dae07c51c2d0f44fdc8605c3c53ccee91a2c73dade5dae021cbc87d5cd6e5fbefb65335827311fe1e91921ecd66b2055a6102d7a976308a80c44e6d47a67718c84f2112d65486a558f1f269b91d9f47e3e11d09c0c748625bad2718e3674898abdb19d3644bcdc9317c09a3ac02f514b2a57e6a706362e5f6e8fb16cc83daea0eec85fdc8c367d84c9230730291440a4b109f7034d510a3f70a22dd4fa69e8b65e5fdf87045d560eec71f4e59531c7711d4f8917a96e22ad07346d2f92a13fb4569fa6a075da6e1acad1eac1cb2ef19ab452264de2357c927c6dfae6598cbc821eaf3b8da754ce91a96c702c95b2c308bf3a550cbf4d22d417745b5f17d36608feb826b862747c59d26a0e8eb96547a1852f9fbd095f1c5d20721804941d462f3ee2f0876ee2825c8df24c4f00f0844e50588ac688127013df8eba3c971362dd255420649245e880212cb3d732fb82f866dda090040f28e09cf1c86eea5dc4fbfc373eb69745b4afd841ca8e172d4a8510e7698345fd4cab9ec2ca0453a274720bb2d2e5468bf0d0f85919dd762fe3df969e6c071285e25c2e2a49659b8a78289aee655965bfa3cbca9b292a19a855ec40293185354ff4da9451ccf98abfda07f1137e79bc89d688963081dec641a99656b040637402890f185edb28e7e6a2f65848a6af158f90eea440aa6246a2e6c31f5d220b9846aae2027afe5a7caad6dc16b56463367cd9e73bf22a1d6172145de4565ee369c55e3b99ccbef70fb080a3748340fbe8f6b95ba46e8b76de5a3c4bedc37c55ae24ad02267da26769a3a732badac2e0f3a5393028dd54d78701647582cd04c8310e9f1ff1b433125229547130e1737a1f33604f0d670ea7221097c3eb9c7fa4b8293d7b429af76191ea8e481dc1da31344537a09b33404d782eda1d6f5775500c1d8efc615778baf0905d9fcba1806ef986c40b1c6a72335104376b58266c36f5939a8b95123e8635c0c95e80aaeb97379b1179d6332dc07539b595ec32eebd3a336a1128f3cf2e2924db6d8504a516b62f26d012b7f75cab765c8374a3824da5a405746023b51894649ab422d636513ee809fa181d5b6fbc63351e37a1b14efc8f739e86ca78ae3e280f1c9e4824b2976ec4dd308ede6171a7474c7f530128089bbd75e10f9e57ee17408b4384f99f886a5f63a2320a9b90eb9bf692e1fc449171eae3bb1bb17a6ed937ea57af3c82db84e073b5306683e1d63705b9742a085fb802cf5a1639818417fc2223f476c2566351f4b3b17a822e11255f3c3412dd39190e200727bcd3f9799519ef792ec7c2b0b9d0e2dccf013d436dee63483c2ce83c15c00a76c4d894a60cb90366ecf9e61221ee8bdaec66d715159876d8305b35c81f96ab2cd8f81f4769e9a6e439c08c329036f5d2591ac42f2747bc0e77d4e566358a3271819b6003b290211b9b847ab70e906aed9f86cc38aae27e1098fdc3bd5d84e66c45292183f198bc329cad794aa4e430534511b7d9a75104061b409676a16c1146af0a286e2de8bf51c4a35193581a902bd3224cb9257c961989042538092af92644a63d6d6f6872a29aceca39341ad29dd22354812c4b7c7068b039ac9ca7e6358e662a28be001d4aa697ace540cc3ed3c97b98d8c5a6fd3543ae9a7962c9229b14b0b646229807747064be3e83191cf24092dd67f675638d9f6510486379f47f5eeda870a3187946819ec9ed05e7b325bfd0eed5c9a0f4a2063d63c1a8a0a309f586c94d4a68bbe860ae9599ce204c92cf9d92cb460ff99cff9e5a8b3824786360e1e1861e71158395faeaebe7aa2f61f76190f174aab9a313f0bf4f1befbbb22768b8c22719cf3fa9ec908b576fa4bbc084b1ee5b5a7eddc89b58b45ae7b421d38215aa6e49304323eb4e202655f3c8b16ebd6b03058e75a907ee63fcf6aad5eb96c1e5faea81b88b5eee525c4663af52877c0f759432913b9d48030903e7f9f70e851cd4e20bc56aaf36cb02293d992b38b583b8f0b25a08c3303d8af5b1b37f5127f7021b13934645ef3020e5caadc5e7326ed4ff56f797e26cb986b6512b0cc76f1d8e7be44aaa88e12cbc644f14a7feb979d2ab66907063c51e052d0f8b25d827377fecc5111be0d365e08d17f559e3134cb9db294f1cac03150f4232f853ec15ecde55fd1023b58e83934869796400088e9177e85a2227ee45addd049c1d6b03e5b29dd570496fdb2fde7d8cc74fbb5fe76266ebd90a3b4d57e6e6cb9f0bbdb7ca03ae955915768011c714c909a27ee20135927af55d4feaf2c345d029a54af942da6f85f2103345d059f66864e6b0578111e2ddd5a1cd8bbf4ae35b60747b93f53ec8ec64c10cf4149909b102a2b88712ff3e5ba3611cf96585a6b36fffb64b8c37a114d6b16a53879136eb0b5e003a5a068e3e8422a4fc8d7c77227cce64ebafcde2437166b62ccf486660a7a2ef37012ebacca26ecd5bdf363feeb06aee39050974c25d6a564594c67f56fcf7ed48b07fab4e25ccffe002bbe460325abafe37f23dd9c145b4667f146a1635e462330f02470b35c5a2519f1350c02b263201ec9026cfc57d3659373910e878f2b6c1c5be774df8e01e775d476956c257bd0ccdec17ee939c46e5653d5813eda752ba7bbb245a99a5db1ae55d19692074c2e5820df97c502a4bd1b12929e1be8e9ce6d802347c3e9c4202de6046436c05ab55b2fcb2c227adade6c2046d98102cfd0d859a91f8104eb9f6f155da2acf93df2405bf2c083eafd3ec41d60b810e0bdef6298b21193642a9c0c646bc6771a5c61a25604d96bdb727abd5a7ebe4ddb2a56a6ddece26d8007b26043ad44279c3c8ffb7e6ffb3cd4e10ea2780f509a8a9bc31f99a7e66201195f1543a0a020f754d9a665a29a896faf673df6811379579891374c71b2234fc61e95d4d46f15d44bdb4d7c3b3be3f46410ca46827b8cca976d8866e8ca33c4945d5c87b705588b78015b529843af0b75a7e1e871fd276c1e947d896b92e6181ab7e3ccc7077bb57fe85a6958667d3d7a790f6cde1cebb494c2912478a0eca2bfaad62492e9f1caaa0cc520da08c0d2d910cd44255f4c2ca0646dc89e789a1cf9a28e2f99315d33accb1639cbaf0c94181b85fef648bb4cc7f66dc65b8e90bf5f3b763e58520098febfe7e47bddc2d9cdd5e40dbf4ddb8d51f51bde2e57432266d248d13ed09e62f66794d188f9861c50ec41f0eee30f76f4ece250956733ee97036098db41991a4a3eb7816196c8e447db3a2913bcd992174a7bde1f42d57c764b47f5bc09533760c1ba74943a0dca291f2746bc1fcc573f9a22c72a5eca347b1679683fbc8f32b08d381baf67b7266b14b3ba46a04a3ee45881ac452f64df1bf17f70f4cf9fa4dfed9ae70184679184784a0451d2f5c19c02031e0e4957b4df68b4a069a6f6f6458f6d773924a1841ba664a55c2c3187dd33416cd410e56e4bf8d3671cf737bf67df2a4cc4dcc786872b9e2dc4009fea0e48a749353ac053d80e36357d24d468dd595bc823017c015d7450fe38149370c5decf13b00b6b0e0a2567ac08b45f7b0c8a7c89d227219d051d17a706ccbea49a42035cb327381568eae23b5e2a3b7e8beef6f260d24ab224827ca8ee9d640dd23eee94ed02c9e26abb3053cbfaeadbb1f365a24d8769d92240da842e0b361524020b5c9c22a2fd8602dc9600aaf02b35344309f6bb018a94d4cbc9639ab7430657c4046f0b25df517e31626abeedd58c2e19aa0ae1a43ed2bacad91dc04a2fdf9cc33cc420f4f04379e95988ab36731d5d5402d89fb47e826f4243bb206124364d63564a0872f8d2826eebd9046c7c6f2e7c951e49d4b22a7eec89da1fbed890d63ef15f26422185143c89da3ee269f83e1de11a7467822146042be92295a585e3a09e720ec522e1cbdcb41acf5ac45ee892677ba3ff670d71339a76ed98237be252ae21268e756f05ba0b094a1803f9da84a8a05d0ec9456cf565e1b548cae95eafa0fb01f091935e6eff2413bcb15f605f15270408216fb5b41ed83dfa1454c522375e35bdefe54275f109d0ab450636ac4d8e4d9e27f2d81a15b8cc5e98549254a1c9162918db3e399118f5864774a9d6a2347e1315753071eb1204c8bf5f52b1a0da37e484ebbe545fdfe6b031215678c3b83a19a24d7b661f626beb01eb82b384f02f42bcad4f40addd48db8a92b90d2297e6143702056123286617f86fbef4fea940f648867d790b8f803abc5f4e0e3f4226954c296afd96e287e21b7243d05e743161810da578096521805edd81f68a45500f6a3a1885cb1f45cbd399dde024df65072eb973c827fca13eeaa3f140842016f509aa9ab4603d2457c92cc9aef24950697a0044e3d7c483b8d8391886cd50dff8c2f16de3d6caa7f864c1b3874750781b2b78b545a94b4da0b0036433c6561f5cfea50eae9f5645302eef18238473606e9b9931880d0f6368fa9970d1ffbe59c4454bf97f4a5e8091801b53ee4a209e0642d83605836f69742071aaebd9d813b10f4ccac03851ee9f20cd1351f8e68554c9bc5f58ad19d474ca128edbf561d195e52ddf3c19bee3bb597ac2f92143bafc98bc09fbda6d18dd4ff2a93cd2ba17f54f75c32d3f141468c2baef4e53b6a340286dc2599bf7bb002aa86688e26f5b51a6aaf32e48ffd539d4f3f4bbf0cde2d20138151c82384f9ff29a634ab4e0103d93340bb9a7b0caa108bc7fdc88d7de14abb17e9efdad2b0f304f0bfcbabaeb1b9db75959dbf54930e67aed3a9c8309aa90506b6b9ed4f1d06c4ced19746e206e1e9b8879663bf56bf6c5c920ac5e09e6579b780cb63e1875ef0a731b726864b7ae5705a2d6d343a4a213a05928b7337a59f900fd04472382610e2a8d25383c9ab5804d609e79a88d70eaef3ea22d3aa9100fa2a6e98e97684ade9fe90d6bfc59dc9dec3d3d8db8990bc2123ba92e64253235e9b4d682e8aa04e23fb9bb6248a77c065e93249de829bb2fc5ea9e396461090222816bb29bca37bf86698fb995f62c50110cf418bbe2078a56c5f1ec9fdf3d0b09a719ac253b5bcd00932ae058b86611aff51c8ca8448978615854b69b0216a6eb8050ce199fd9a13aa0fd652570a1b187f61e6831b3a960521c3705da8c5e6c64c7b196ed4a49c2912d77b670b177c6458a7a49ecc1ffd8c57c0978d2a05cd1f1c7ac9514dd14b7b0933a52cefd40b6452ca0903df1f55828025c7e18109a6e0f2ab25724cad2d6f57cb5d894a6a508134731e9b9c61254f64990941f4faf97394b634b91860cc6ec346aa666600d323c849ea4c4a0ef55acbc56495ca004f3fca42ff0ffb11b0e1164c95ab89bf1db3d4f575ff334d4e0d7d50e0c54c422eac5ef78c5a3be95f2e18872540fccfb597211ec79d9d47b6cf41e385b9c2e92122167fe584210f63bf919c620d +MD = d7c901f0d92a868dced7e2659e90121108611dd7781325fc57e5c336c2279510 + +[L = 28] + +Len = 16 +Msg = 3dd2 +MD = b7399529fe614af98f9ecd73e45790406883cb22e3bdcdf28fadd033 + +Len = 104 +Msg = 3d232201038fe7d846ac1bd4c6 +MD = d0aee5482c509540a4ea4b902bf42fc8df3af6de42fb14e903d1b2e4 + +Len = 352 +Msg = 44c98cfc71f82215dadf494d68d1d6b92bb4eb81fa0fbf945a659d9aa2c2302b5c93fd3eedba31e479e29d36 +MD = 56c22e6066cd4c4d6415c5a225257e7f888b317ba4e98eadb72b4be0 + +Len = 504 +Msg = 02a5c7b1b749d6d49bed302d9439f23ab83020bd4d573906f4190e74216ad33aceab775f71cd31092bba5cfa42f0845bd16fc1b8bed6434dedc92f80b395aa +MD = 33a84e66cf1ce6970c35807db25e05ca05809e53d4e34cda9bfc0045 + +Len = 13976 +Msg = bd70deb2cafa75918308d703a6783fe9dc5e3d21de9bfeb6dbb1cd531ed5dafeec463a02abde302d4ae6ab3cdc2f0f94865e38339c88bde507ff71bbea6b30b9851cd8cf599e950b8c8e620c90adccba0033f934ca66ea0a936afdad575bb6235099beff1a632c9114a8045a0919fdc21083880eb05c0d8c489c7810aecef4a41766f67c37557e28a9db9a0d909c2b167ff7eba79693afd3ee3aeace38eb73a5a02a882cf89b123812cf2a0f6d5edd1d14362ce9c43257474def5cce3adbba8cb48e7af9a45e702a182dbf47e8869b3f99e953ba81628e502c60d4f8ffc551c31b3ad6ca85c52164839d5e9d493deee4d4b76604174bdb5655385d34ced2c1b09dd5a486e1f9ac501bc611f9d7aa5c748f496faecc14c6c18e1dfc6aee2991bd0207ea1701219955a751df43dbf66f57904675a0e9e6d7f9a0b8bb82a8f44951117ab2642d6671daf1e5d1639d48aff6a05781c2b5e8976653b0a164445872d393d30355acf0bb49bf2bed4265c9a3b786249afc7a438d706eadb6f90a7f93ad51bde6d2c8e6ff09dacb3dc67ba0d3030c54c8367e1e4280bb5903274191344610de61c3c770c6820a6cc9d826f7c743f88f13580ba23cfc00598fd733b5dd069bde7f10f2b8961c16b69761b0f308dd137f844a67f6054e065863f226141755b96645a291e3fa3fc853b2475fbe1d3b25ca22f4da4425dc95fc855e63d6699b311ebd5fec1c7753e6e81f747c808ec3f618f63eaeb1221075edff0532225c40ccadee304a8997c03920e7ce4e60e4df4d120611296786516dd4d9cdda2077ac52bce0fdf552e1ee89a0133f1f87a6f6f35f5c53958ed806465919a0a5fa42488bf29caf33a0dd469e13abae351d5c6fb1a800ee384da199c823c965d9d5457a3ef8292c4d9b142e3f1fb502da498eb44d95f8c85bcd6871bbdbf004bfdc09ab35758f5e8b6a0d0f366c3b255333c52c8fcd4ecb4536b5f6e72897649f3415443612d72c3436505249a344feeb04883f41f90ade40af119014b3c56fc108f1ab0a77087d9226665d416cd975e9e4605529c032e8926002a70924820c6c7e264a794b2a3beb63d69ae56e017294fad4d611cbd0d3847212a38f22d623eabe3b884a36464d8814286fff52c4dd366f6c2abfc2eb865e0dc9ec6e55ca9d81f1b8cc47e2629bb162e54655bf2a9e156ab0bafb4b8ce96858aeea6e6665607a3f268036f4890dad759486b15e3c9e791429ec8f11bae4ea7c490656fdb0551dcf0b0be017c08bc674bd97d9d701c3ac955e2941ba7d5f2ba122a6f0c1b164b1caf2d50df111fd4287e9e195d181f6f514d7dadbefdd4274edc234025b727680576046842a834b6ad89eccaff5c5209bb91d652357e3750d8bb0165572fb71d09fdfc60f6b1e5d868c67c0edead427e7aeb734e29b96e03ea174b6b1af523feacaf6bd745ceb1bdecec9251958b7f521182daddf62ff6c4f58977adeba81c616ff2e937ca4f16eb9c44e63f9e974709122083ae45524ff87d7a0cca33a90f09b660db0efeb393c61967de2564315827ef1cf42b71c0f822f471713c9d885a3c3281d7c95dbc96f1c6dde0af70ea11232b00a2d215ec8de8fcf84b6193b6ac9d46de660361aabed3371fa44a6f32107f3854262eac355f9ef98701f580b4649175cefc29950e7a0eec958f629999c4b0a98fd4bdaf5c0bd97c963b551f2220bd41ec00b8726836e949e818a49aa1ac5bf12c64fb9991111ce8be3e0cb9605f753dae1a4c84389416f17fb66cecba45d591b22d64e5a4edcde067a088d9ff7f5dbb9dbf324510000c55d50f480a640fb22da9b4862dd81080d61af9560b601edb5e3346263f5f193df97079a27e3f9876078b80ebdcdb17ca4c50aef0c8329c72a7f77584cd963e105eea9c28a2ad4e95c1d018e27d0e720ea59147f59ad796b80b6293da8a55ed47e8abdd37221db0a5eefff31688e2adc294654ab0fddf9c1ffafd4783f01eb539492cb35a77315d0ad19395f47b18298a7b353dcf5bab0b2f193ff73d99310478d2e5c4ff1c68a2493c138818edef73caec9977bd4eda6249c8933953e06d796b288f78b18c343ef561082fd03bf92b084afaaee741de3004abaf746350048294bc52450e31147173f2da13d6ffc5adc718e149f9df3702f414dd3ee88296ae8a0106b071b589e8696401da7993d58a9bf8e5bf417165498c96b4ff5fd2b45bbf88f551688425122a3737ca54b2992fdb4d60957a93097222c3cf4c45dabe18b9d6a69e6f27567d5adec489e4b6812c29a8fa52f1de642b7b0e749c16f54473ed5ca2fdf2199e885fed308fa62a3e0deb7e0b8e439e25b3e9f95d755fdcb7ebee9d73069dd57dd1cdc5145205882023b54f2c9dec6cced9e3f6d24e8cdbb8ef121b8f3eded574d81908e867af5ac82bfb8ed60848b4bfdc1d998bae3a9ca80c1c49601d11a40409c62b1536f01ca67 +MD = 60700d4ef068822d0fe6df450b4aa8e206b2790d6dcf973229a59889 + +Len = 48824 +Msg = 5fd54472a44e4476d254c0940071ad42dc723354f76ba61f63fbb9df80d1ee56136f51b6982e66c1da83602fc08093506a9e2cf27cb92085ba5c627dd63f59f8850e91a1d86cb1d4ca38ad03160f3c584b128d9b21e935570e086d3815307ab8df396cfa0c100bf6cbfc0fd7a8258fa1a656bc178e02cfdc868540d8e5ad39dd46794a8bdc205e710555ee7421ca7475a4f3232e6a0cd55d4b5d4525f0bd7eb1e455931aeea6918b9fceb2a32706d31a6d7028a85e102f228417e2e7db68317ae155af70eda98c8dc1ecc32a62e294d92855354c1114c5735a3c81e551b63a81650107557f3237bf953989d17c65a0fafd2bb1e32c237f98f55389e8f8b0810e97e201914c487a68403c6d621a98ddc515780435564245d87ce462b8785def699f7f06ebfdf33dd1ed7dd5a3e781348298c7950a387bff7d1878731d7ac66ad9a6607f2c3a3b6843c2852a5e882a8d78ae9dce2a79d595cdf09626dfa6f1dba7d40ed21caa29e304e7dbd559a89bd1f07d84165dc259ef112dc6e2c5a3e82b1c50106983f6c4965c85073c5deddbe6323003d56abb0df590f69010981ab3407e43eeaa29c6156995c492c931fff1b686eda3741a0bfb9094747d1620b2580415d431ffd6c02245f6cb03e39f87e82834dcea59355b2ba663ce145d2514e15e2b2c60cf518ff510c6c3e2f16d2dc523832762ed8352a320462ddd4d6fe755350672038163d996b44ed3b85d64989291bdf39398cb996de785b9614ec5d4bd73efcfa37fd4470b17d6240b8e4c715759286b04c3d7d791e2689927c9f18320ff2e6bc7306c805e23a5de66eced5f1a630cb43dd46db515f837f6b824b99b86c10b6df7fcf22d97be05284edf0e0be597b3f9c63556db031339f79ac9e6c5f8a1cefdbb4b30f5bcd23c2a4dcf791cbfdd6460284c5af0621ab7c5571e40a87c87be459c85ec81d746930dea24f43bb11d6611ea83409d3bf4f987778d8eed1d5b246a2112ef78ef0252f9ae464810c13f02359441d289958b4766807d9a3be0054897d35b01830deec1151f9e3d42f92b80f4aeedd65c78c6e98afc562a3bcf6d72f238c6e94a38f2288ac7929a7a61c92875c1f115c0ed8d261a727f0794f17ceaa3dabc717478f6ce7f2e8b295f000241e154b4575bfac8483f6b62f9ef4e18f7d341a65faad5e2fc1ddaf2b09adebc155ff09e63d5aa5f95206e66c7f4ef2ae3aaf3ea7c93589efa8c552df8d203e0ea181c1703d7023b56e603f33b4adb9bf44f7af290d8081210f327a6c9b0785709346087fd090c42d2b8b2711b9a1a5173eb5e246320ee27867ad6c3eadc4407bada44561a12cf5d53bf0448308bb536a8a525eabc1410c3a34becee25fd6fda453251ec229b53751f2280e142c6b331daa659ab655b78cfb08bf18e40bb02b7f1650eb2dd4ba1707f0aafa219f21c29521581ce249e2e34f5656b0a04c00485079b040e13cbc038bb9f17f47cb8f908591b26bdc28538d8baffe4cc39b17d2ecffbb9698bc2b8b31b08424034c051b535e0cfdf07b7a0a54781e33ba739759991aeb72c0ed992cbe76eb8ec0ab12c182e8b049cbadd6e82e314f1bf15fef5ae95dc86bd64b8556766f8ff62c33492198e454e5ca59ea856d8e095c04da8045522abac865506096ee1cfa1082af08ca09b3533878ea3580b6c0c57a615e0ab768246b3eda96bb6caa01a2648068e21959f843d853e948588e8c0bfda364ef1f9fbd3235c27916562eb0214891eb55ae0e059f4bf7d1838b5942656c27899dec6d67b823a981d1e1e0aaff5323b0e3d69a7dddf9b12d7787ab763a3c7a2697ac65b655aefc4bae7e6444850ad2540d5193b378682c77a4dbf9aa22e517e68cedfd1ba32e3730ecaa2e3f6ae61a4f427d6e69071dd62a9bf6c860980c9d23ce1fa82a1937e6dc1ce3a2de096b680d23d89ee102912ac0bd769c1c02095678dbb00b4430428797cfb966b2f901480811e1b9cde358b6d499c9e93f0961f050465d7b0c70d4961e75a9fe40a24e36eaad27238231dae6d0a17f446c16bce7348e669be563649eba9f23be29adb8b10f462780a066ae573f74e51215a26097b02469c25180890e06acc53ab063c742e08d51359b0a39749b84b9f6be44f3ae3da8e5a2f340a8607d4eed08877d007928d332d6f49502bb5f416c46d866fc87477c58a22d3c5932a8d6298c1151daa032c84ad92f8f90b8053b5aa6f690d1bf682f314471cbf200f3d30959e07adc6488dd17b0be5279e727f3237b8b4b19b31a220dfe63882937f8d5ead677608c42a57217f2239614c521d94559290e3b0ed8055d5474e96564224f6ca6389b40a71337da11e1c307dead8e4eb43252cc2f1c49addb18781cf20acffd3db693b02e5c8ecc949b51b99005529e0149a13390615f5df6e0bcd68e1ca82b0173d25134dbf76dfe92daa085d3f6b1e4d18217df41b70c4c40101884c2886495f2ef8a473bf23cb47ab6533c93cb38c36c6dcf6837f1272fc91a6962b6e1386fb643e1f1d71fc75ab58d5800bf4081217cdce0c7ae9e3d25de543fc4444314f32067eeb147c08c55c5c8158ed11729837547f28a300eccc312260215f50e98c4e3d4170208a50a4a4def1243538f906df8476b0c46d3449be73866d463d422595300e160840daf8c906ae4aac13a64457853b0ea6d8c32f4efe3b48c0b1450250086d459648b0ab14fd3f341a4a803be77e56a811e7a26827eb0a1a9454f90bc6ece665904adaa3cdeb2c4847858fd1d79750e8cd45d8da9163784b8bd06629410502debfed5eca3cf8fef0fa6bdcef6efaaf35a1986d6fd68e0f436dca9442077a4818ebda4606a94a3c93fda46e7ef5ccfef656896a0d3d93566b02ed8c3f6174417cdcb99a415b0c6e9816d94e64b438c295b4bfd69e0d9ad52911de5509971b7370593160629b641d690eb2828bf363857983e3b9098fcd15e66448f786f196685d2ceaa251b17ad06dacd614d9fa78ce0a8b9c1c360b529d0bc1d17ba0b70ea8ac1b8d67f6e5770f0cbaee0b38109d26b09493060dc851f5fef121e83e30aab9c3efc2b8397e8362aefea1708f7ffa14d3656f7f7610f3a629bce14648a593250c6f309c02c6c552bb42984ac58db920dbc7d98f59295f37f3e9b99da55ef074ed65801b390366669b4c7aa1c483ffd23082793f9e5cbe30c34250f63fa3ea2cd097593dc67e8d27b7e4f07e73a9f7b33a5ef6962df1381a038d4f58fdbca9d71ccf640b917f631b75d4a2e8ba46c64a6223f99cee30f47c1a935dccc7f054fc39d3498c824e10cc3ee337e781a3971f0e98295aca611bde701c2359858914248f6bafc88232bbc27bd85883b00990bba7862fd7a7cbd4c86df049071fcd10d686613ec877758d83927cacc530bed9a596b5b21c6fb748c379d676de7e05719a867c9f934b5dad99ed97dcb4e70a9b6542ed5b2f086d9f56fc9752e788785ef8f7837a31e433438cf2f18f58be37fe8412f6d21a5c35000a5efb862926700079413f76ab2c3e79e20b516eba9d8c29897097bee55157936607cabaac41337ea4cc783c0809c875259f8020e16d5045fcc39ac796d11a82f25fcc9579bf0a010200f5745065175fdc15474ed514cc796672c59637c3c8f236cfc9c0978a3db1194680c58c27746090d76ca09f7c48ee4ee7e1d3cf0ea70dbbbd88e30e8814b57404dfd7c33727a0c84cb7bd468b0bcb3c89b526679c00fb0892d2a5e7a3d73698a3db53fd7d78460cdcf24ed22b5f39b8c00b3506541ae4a5b76fae29c1cd5b0f8c3ce142e0af7ae4efe3fa4c438a604bf4a9abb41e3fef1b9227a7dccc3f4d6026ca289b4b1366d9ed546abbbbd5677c8d582e79e2b544f18dc23809ab753313d84dd10fa3ed2f723f0b46277b8877d4f3e0665e88c50caf0f0708b746b736b00c8c83a7d18500384bd035996aebb7da8f09fd6af9b76fde7fbfc0ee854d7ec02950e76abd23ffb27a6ddf1772465016c79b98a61bd3940547b207b6507e32cb9761a5604f0f546834a8edac7ae06910045de218d761a4accea886188f947b57bd876491709028e2e24b075d6b022b51af1880ca16a8c65b7c69e51b2ad580ee058acc0606f0a3a9ea1cd4342bf4be602e941dc4bef1239bb9bccbc8098a6a17d63186c6fa75ec44b6e4fd38a3fe49c5eb995f0cb884e2f3ed6be02515fa605b98453ad935682c3bac6a2971bb68f4094cefeeaceda92dec803ccd3d346f8b40b48f8f489e118a17367801e85c79e9b3bb5d73ac44a8290cdbf83a154f2f125090d42e1a1cb72f5ebbd42da46c7a4d4b9fad9612a4c800de6467ceb74f831e1395dfbf5799a3429ba34754add4b34b5960a5fee8f752dae78450322a1ab3d7102b77e907fc1eec5355991e0c7d6c0866660e5436248edeb1a37c0e769a0764cfbb6354332d6e55103b9235c84eedaff918af3f0213c435c32ab409a4b5c7eed8ab6ca9e313dba459bcfa3ee92e7d669be0526856ac3c06a57fbecbba553a9cb4655a901d98af02b74098e478076655d325bd7639d73d7ae00c62fdc361a997ea4ff5b0eba33096b12f35cc7cc0eea62950b912b47c11b9fb386a47c4c15c0602d304b2541da889cff299a1fd415e7e25c70ee4cd83feea7e6a9c50c75d9b128458513d61ec5d0299ef8c090472fe0850f384938ed44d36f10cc2c1d31daee3f946a2fa18f9982a988fd6ac973b1569313ce3c8ff5746c4dd85a241f1e9dca0e904c091832ca028533a3e34c184edcc510bf22a27f530bdca3d057928a96f72dafc73a9aa6dbf2552598e468735cc5736c67a620e9455483e9cb2108045ad80569582ea93a53b491e528c8df336fb326ad74317bc1dfb8ec30a73af01a5dff3e437b7fe48ba5dbb3e8f01ae0c6fc28675a415f23a796bb6e0ef0efeb4b14cf20d4ad88ad1966da43a76b454dac8687bdd97b89b8f8eede91eb34ca4a0523ea65736ae39341fb32b9b716f25662a37382c16f3b9c346c84f03bef54acd6efb364c6401b07b3f7679e8e7f8c9b77b75e6e98b90f4df88460f1978d19744eecccb743a999aaedd00b5a94018e9d5a56bac9d5d55f6e93bad52e84aa7340cbbf98d56213d9dd3e1970867e3972dc98e61b3cff40b64ec49463ff79a41c82dbbcaa37a82b761f432849aa83a3d3c9a209e2207b87ae9ed9959ffced165fcb0d8873668c3cd8f18ba0f92f7acd2bf50416c22ce11692bf6132eb9f558dc789cf9776da94e48cf48607f19d9a11d5df4db11dbaa67a1d20e9f0c96f5956ee3f906e371c489efc88b0c1e56d881e7bf8dd5d6742622eb873e253dbe54f2e2e6d0e6136941de8c23e9a632727bb5f88c23170316c7aa0df28d8d07589dd6022828834f7ea9b4e5876a1704944aa3186dbf89e0e81767cfba03bfb38c55a9945209c4dfd88272c49d1745dce5ceb40f0a6713b5139dc2fb87a8a4888406d2610b7b910a9e5782ef0df719028d8e50a40a269dc9bee12157038522d06537bb31fc87d21af9ad4b2e7e127bbdb313e0a116010f65126cedadd4a122d15a71cbcccc346f55100e354b997154567fe3caccd50251d137c58fc3a2048dd5883b6af9248b51040c01a80c051b8a151a8878edf0304b5554746d6116b749221a1d0082ac925e6e140f0c3b6a180742ac8a50ce0e93e6399102f151d7c14000369ff52d0b537fdd51bec99e7271b1255c6fbc36d83408c417f6825a8e2a58b9054ab2c3ead69d97ea9947fec32d720653c123ecf51a9a3f0ed88743e3fb7b94aea59d0bf0219ee50825ef220554312cb907edb90e4d85f29e316ad57d3b90d859391fcfc63e6c0fd3ec27d4e1efd6e0b5ca8165cbd6af25ed8792d805f27fce308ca1d51335ed5d727558dafe05486a6f9149b8d3bc022026656714222830be582889e6800c0b170e48ebfd069e711210e4ac7acf07652a6f5051507de68aeffc9540cab5cdac84ceee46059ec23820c04b127266c0bf8df0d2b856be3377ab42592f495980baeddbeed3ba707a85dba64fe36941eefa8fd37204ec8c18df3852febd2b142b1c9a5cd0f9e424cd408ceb7788270899fd793db99ddb8f9ca8df550c513790d8bad37a1d1f4a62c4527bb64c677462c9b093582decea70c7bbe873095536728e7ce05d5cafb5d166a1f03055e918f787fb244c5857e3d7a1009bd37f30f165564a082c1510ed19bb1633811a76da70dac67641c2478c6b335f409ef54a2d0f370c9510d0aabae3cb998bd023778375cbf9cf5ef125afd584c11efbf40bb51839aacd3016e5e4d79f134245f952dbad617c78cb6f5712bd9c0c7e1303db5029640cf9b56e29329c3e6a9e0a2371aac1a437b9b1c4477ec9842aa80eaa22c5eac11b60c661de6ddbb088e844293ab8589c13d938765bbaa44301e4137148dd0257bd4c8c766c5d3bfe53671e9417cd1b52f622870ffd90f4e17b7a4ae1b5601a2edb032e353bca652fb565beea6fb0b2cdcadac71794c662677fb1dc81d116d94f5eced526b37c004b95284cb6aa2ac415754a1f14882595dcf4d3f1d905c6e8c12cf5a9d23d3ab55bdaf9f17d2f03f933e1bab89040753648c426b072b73aee8c2fc0d1c03fce2c656e20d4c96803fb2ef471b912267eecb4d6f342d3513894b94d77767823fe0c7438e51f21bcf16f0e98b94b23a10760271281cf843989824f7061bf834f93fd8d2090f70e939700dcb4d8964a19da39a9601a7e0ed9f55f567fc7d5682d55a9ba0e68861756bb549f2f17c10ff6bd2042a80477f89743d3d762f1dfaf230bb502eab6f4c46b26135ff3bef5faa179bdfbd288e3cadd3d88d8012706e19b7fcc6e9cc2699d3ba0e624e715599480d6b7dbc6eeea0d12a9236444b17285fc7794040dd40c2b2ef175f7f3641664fc9bb7ea6d7eb3489d504f8013d64a23aebcb5ce233405f5ade067dffff253f27e926431ad806703e8fab23656e0b7431916d8d4c72a7d831e3664e5f30839c76c8167b76f3b2dc75a6ef48df515e06ea54ca51de2fd9c5eeabb1610b7eef06a2f3167859cf82e1a5b76be8ed8beee2bba28c3b15af6890d7a37226834ec9f63306a0da11aff918753d8b83fe7220803c070db98195d6d18357233f5504a6e3bd6f30115d3987f93aa5d89aa0b8b577d1fed94da057a6f088233efc0f44f86798896eae9ad0b20c8c9cdd9d72a3f02213f6797800894b864cb44fed009440fa5b0197023929f9bad16f052cc2d87327788a68b9209f46fb4776b092d75713048b5453ccd699d19cafa8e9a93fdab0f0863711916efe3bd81ee71b8e0221e12e9ffe2f6ee1a4dc1a8de6e593480f3c05b3691e916a4a7ca51971eb2f0f693dd10f6b8468f8cf7bcce285938b5a0a76ef86acfa2990f88bdafdc39a065db17b845028ed2b7a9e331c44217de20440e406868f1eca818d0be20248c2948b8f4cb118b2e456e585949139270f57c54715f3297bf714aa7c5f72ed8ddf6a074703ffbf95e45bc81a02c42822c22d2b718f2de5e03d687a4b18d605ef5ae75f9d43c8cb4e77aaa0c0101d978120f29574b22f52783c667f7daab3e1f9cfacf2e68e94a24918e3fe2c4f061deeb64891b5217fe5908e7f389897751839982b7fb736fbfb1232684e93123611b7fc8fbeb74f8815b5ae13240051920f3b6ed34483ff673c467ed7f0a8fbf619796e485affbed0697415d2d0598ba34d5b9e44ffd12a5edc323883a2e28efe9baf860324f2d2016748503eac1888213926b0e0f0335a4b51820a2bd3b42d982ec6ce307b453b6385aed7a735a1e98479394147c40f01c532926e10e1b26a5b395bc150ec4b4daf5b1436bd0baa225583ffc9d9e9d8a354f60fded37b41c7c051daea04e689ab2d4e24d7d07c75c50ccfd6a527e024d1632246c6f40f06b86ffec0b29cf894b665d53d459226b93422d37a8da23587fe884dc3c0f2fb55dea296a9a5b9a0d101f186d9fa6288c912202547cdf958569d2cbf235740eed38d10b0025dbb6de31058e98780d22149c19d4bcaf06dd7353fd91cd1f47e47f45622e1472542be2f63f463d253617eafd4f2ad609f9020884905dd5c22fba53ccc619104b6c0203a7f6c8c26fc80ff6fceb8c0c51600c2e46b4b872e6d597511524545a76cb42278b519d911e6c1320e01682c551e204ccdf91290c52e0836167a5685cbb1af338eb794c10fac92950f3f7956acf28f1ca984e380bcff9876b0c71dc7ce4011d1d0f955da9ca885c6e7bb74c6194dadb0fb9146dd725c8a9574aaf3824b727c9be3fce59c35850b162c17d3013689fca858a0a51d81cf4f30d6a8705bbfe35ff03c34cc7c56aca32140d72c8e8121fc71353596b777b266d75b322c9a97fd2c5d4e2362f19c99de66da7bd9c495c03d9a15b28431a0c051e786fa80f5503a72519e6b419263d72d553d688349c0cf30918eba0622b953a0efce4415c29515c26ba15f00e548ef108afe3f8194aeb965e5e4be94f10df6c45ea5c133a8c3398d09fb80f950b83c1866a1637d2bcc195e05cc32a9233b244cc2b1d4930e66f032cb1163c37b3e58b576ab76de759569797fa9b8bb4fad66aaaa56f09c7a0ce4641d6799d7bb47cf684990ec1e08871458c211a353ccf1285e7429c7b8520180918f7 +MD = 85747c796a910421ecb364b4b4f0e68b49e9217944f6586eac4993ec + +[L = 20] + +Len = 16 +Msg = 8a61 +MD = 60bdeabf39efdf21ba9c0f94af6552d2ffe699e1 + +Len = 104 +Msg = 37487aa02b03bdbc6bc62e7e26 +MD = f146072f92dc4a551721a10bf0b01564cc2b43df + +Len = 352 +Msg = 6ecd002568bae3bf1873993041bfa292eb94e9ad092d8eb3585be82e8a20cb36a47a06e7a57d301268a4a533 +MD = b0a2d6033cf1d8ff120a605b745d736ee4aa06d2 + +Len = 504 +Msg = f6dc1d2f6b8e126d99939664693d8709513f97d730074ec2794e536d94ede79c81f2b2ecbff3c2c26ca2d181ada2c60050997f3bb087ce48d956c18dedb227 +MD = 395dd2989edc854746e384f339f0808c515747be + +Len = 13976 +Msg = 07a6372c863c7d7c6764e4f05addbbe161762735dfd2d23bf268e2d603cd28de9c369ac379390473e1d3fa7e37af1178cca54fa0f782dfbe68070952b93462ea46c640d43ffe71f5fba42df98f4c48ada0d8aca8753e0731508bc15dff283178ae5c10a6ff132eca5dde63a78d3ac94685152897828eb25a55fdf140fd33fd4e7b03f283e201a1baae8986d25603fb0b2566aab345fb48031d648144dddc2e3556c0ceb1104f348d96ae7dc0152e45c625d21b46e70c31f250c858aec4ab2cf5e79d8c79b0854e0abf5330b9f044113d306161968f4ad6f0973160c9dc296056d5a11523ea2b56fbce8387070fccc639ec1c65ec663b9dc49aa880dc4ddd3020c9d44ff7e8cab6266e436af19b4ecb82010a0f8f9469ef380034a02e3f50051a6a3f233dcfe9d553459dc1bebc538ae0183448c9405c351271dea808d908480e61e9793cca111b4cfb9874b799626a1bd9a0f6e0929ad51b97ad81b2438f5fc255db3a3dfec9f0d8393c6b245b03d3faeb58021db3ad391b17a91174a66db4feef1b4c889699bcbea7928f4d29be2d47f76455c8cb1dc7da9cda41962a28ad8cd7b39965b809e7c7eca1c6792c1ce1c8a4cad6290170e91fcc49fa5ff64ab433b4aa081c8da2d9bbb072f9f18ca455469b946c877e3006b34ffd2219335b30ba2e0980f43cebfb629d0b11fe70dff28883ca012c6ae4855fcefea20a08e189eaeed7eb36ed6db3835976f4e60053205805727c5eec15d0e9f155637a9e66268b9c1c302bcaae6ae88cbb8cf1668a487cc996c4662c4a4e195f094cb31c717165e0e13718f8388957dfe0bf69c70cd0bd763dc38c530b67b9c12244fcab8bd13f602de848a2937699f9ef77944e5f22e3b470601789e1838fbea9359c733aaee2c7082b02ee459b7684ef9bbc200da4b62d368351f5520a65ffa506dc9b097117bb7ae88d04d85fb525e91327689ec0fe86971480c0e864012b1e9f044c7d80a4e48c07320dd4292086e4c71d4c98dd826a9bfced112bfa2beb1ce85cad204451ec45703931bf637d4fe89fe8f485620b7f4b21e011a232ade7a8c92be77925e878ae0bea9723749528fe83cf89ecb9616dae6ca0e8d5754ec6c92abb21108c2f33cdc18c6887c430b72c5b193356494cddccc577bd4c2cd53188f352846edff0c2ac7869cb74bb16a77c0f0f194a7a9477ae15abb890bd0bcfeb0c39381a87f1d05319c7e971c10e9ef687f96450b400e25b4285032892b849fd5db8649cedfb03c88defea063ee144a1ab1f3bf05f59c7db364dc39c11a446c3ce16307d78d50315ba29f5bb9a57438564c8c7b3e367cd37d74b2375a4966f47489dc5448f4979428abd32193d3840aa983d3020a9f29d760fc7493ab2576c90b1934b799c1d0d55e4f2caa78f4ce61930c79dc017c2dea0c5085d73a3b0e4a6f341e9a5061a6658af11e5edf95bdad915ac3619969e39bee15788a8de667f92f4efc84f35082d52d562aa74e12cc7f22d3425b58f5056d74afcf162cd44e65b9ee510ff91af094c3d2d42c3b088536d62a98f1c689edcf3ea3fc228d711c109d76ae83d82d6a34dcfbad563cf3726519b519fd48b51741aa86720836494b7a589c778927047a25d73508adaa401e9a6c0767a675e31c5556cbe35fadc9671359b45e985c3c8af84113989b299ae4474b85e4b5d4b0578ab1e8a2915a8df97c4f52a639fe32272cb91bbfb721505dec46d51383cb8973425a714245c2e37d0577fbe0d66381d9239db1f08a380cf609dc699698e0fada2caeda44d58d766c4f8214b10642b80b8d7d8add7cc41d47108ab7d07dab71069a2d982cc900b331caec317942122158bac6eac9175c2dcba0c04443aa9188832b553f5ca8c336880824d6bc02486a2b4c086665d276aafe3b1b93729829adca50c44466fd5b5cb977aa78fbcf5c0f0da1b09216468a11493ffb39efdeda5d669ae92bee2f2fb250aa1b9cbb11c36c7a6c6dd26cdc3cfd572ffd8c1dd72a13c27a327a34c6b6b3d80fc6c67c72152eec0c8ecbdc1bd5cb829b811e7f29af6d786f4e93dd4c96fdda295a6aa258d7b2fcf291c2d68e0b1866032475964ec0c6f2fa8c2d6a3936ecb187350def4e818507bf157c0e9b33406be7660605af14cccc9c799b4e051d0d0899e53495bb8931a6e2984bc6dbe4e02ec8b4642fc2f1cb5fd5a5520b48cfcb49e1f9533838753554dd98b6a1b8a67409279df477330e5f37367e06247ca5c3ffefd00e693dcc0c9c30754121c9ee88a574915b9e77c104fd2f921c2c096573951407ba9b440423d76bdc6fc978237a6e302cede7f99038ec31500884775556941f1edc30e3a417b0e02cb6fb5bfbe5cdfacf4006411287bedc565fb06f1be987416407dc852254934df4ab59edce476f3506e65be6ce6ddf91038642291fb8e92ba5b1f0b105670905a2c14796110bac6f52455b430a47b8eff61 +MD = 1adccf11e5b7ce2a3ddf71e920138c8647ad699c + +Len = 48824 +Msg = cd8490c93613bdf1f284b94b330f6d6f45a39c651d2a160b340e2eb696fc6d1c35e88872845190d141c669de92a97daa5433b1d7b0b899fdef2ce74b8fe72a7296a5b5be26d1dc86520367c730c7400c2fa06f91ab4c48a7bf4ae35a5b9acd5296c4fdf7451b0ad9cc439b4e34f11e5d7ef2bdda376f8dd34d6f092b219dc085dd4c4a6308b8808f588eedbbc7af7f64e83182fc7ca7cf4741a341060a7969d31445834c982fa8739ded4555108acbea1666a83da17f77cc42ee73323eb53203e3b790f81c08e94c44678b6538096ab7b09916e6cf7ceb2af85987f8e4d982dff1ab59b0bdccaae1f405a73366b5c5935dd0b43e2d2894290ceb66a0246dc02de728c5bba30255fb56ce8107c3144246c5156a8fe40ada9126adf67227fa56b66c37be63f532516211ca012977b04a97916f201f1baa2629eda520b51508ab4229df2ceedce406dece0110e0a911464f69e7be38fb91deba0addcdb3161d2799c628f5a57fa1dc37357c947681bd9c36f4832c20ac466c0c245de3b250c33282ea1a02d007f03b34ed427631283eb614db4d521f555136e7e42b4cfbee8134c63dbe3bb79b5a8b9f9f5b9f5ac61cfab1c54d197f1e3ba613f251eed616df952d691b88a16466343ef2d0f63882ddd2d55b8a6786308b2257f5d7b38af166bd7f1339d2d8899c9eda8fa86215850ba547450c267eb3c9147d96c38161a69d1584e521ffa23384313a1debcd37f72ddad02adb3cadce7ee34b7c1f42a15d0d030487daf9488aa7562845a11ee7ffccdb38b300935caa31f78a4ff3dd93403cf0c6a16ca611b58c736aafd33d6dc56f0f47878211d26f6ab801b9453a7f74b44593dae0f047ddbbf2c902891111729edec44f69a05944b18e7a601f41ad24fd6833da3dbe3029bd390de7c9841b2ee2b079b2bd2737518fe1bbec88da64769dc36e4a8bf716c219b2fe059d7dd220c1ed2c59878db5bf8b198e0689edee921ebc0cd2d3853fcf57c363050ce58071c5fda6ebcfbc1bb62e9eb956286291a108bdd4191c4ff47900d6068e1ea26b487649af119b9bb15dfed804836f2196cbe12d8fc86e3d7ce89b52ad49dc9ddbce5b370f73f512bedd853039366612453733740586d1372143b09f21dd4dbe1a2bfc308db8e4098c5e4b0c1e16141ee50e85fafefc4e2529b3c7252af37aee6f86e19df28871686107d7d57dcc812bc077602642d2ecefdd5f694b8f336913210793e4068da2178600b1f41cffb5221c9b4b6298afb47e85701d7b1a44241679d8996f916c81ff437261cfc358b9ec42a2ce16ca3bacb8690d6c1d91cfb3e0bf1e7ba45bd01606df856fd03c7e946f7ab371a89e1fde86d05fdd97bd7b1c583b04c2ed2b5f6815a460645e4e1b4e950bf6bd81dd0352d1048df85266f1696534aff5b1cbc17f15d82cc8e0c0d4f0453f9439094f8e0f7f4bc045b654d9a2f1f44a9c57019f63ecc41021c05b5380675cb56ea8bb691d79ee204d2c4edacde3c1fb3f4996a11d84b035f965e74009e2ab80e2c7ea3c84a834d4971a1e9cf423e4ea67ee526eb3c3e4c2d7372c4290a0741e1fcca5ae4cf36705abe98ac81e98a5419baefcaf3093a7e0449ef1021f88ffb7ad21b2677e41cdda12025b06542c4b2564f15e0b99db43b7c7020028bd829372122cd910227cb07c53cb58fd9dc620c0491f3e2bf883fe6ee8cb1f5b73767977d857e4513e8b5612f6ae4b56014e6a3ad2a065b65472212e2f611743484cfaef860999d1dc5608c58412fab888ad72bb87dd9b55b692f31e252daf8944ec5c02a5a9c23903c50dbd845f2fcc3bc9806af13ca7b025cabe675195b1d56f3fe7d7bca12530bcc0af217efcb03a218bdb6f9726536ea902c8303b02e3ced22be59753588b5f0e2f3419fa5345a942dbcdf3010465384a225ba26cdd0f1d74999c69f336bb6d01fae5cf81cbb8c1a7a29c1eb83ca6b51113bde56b8cfb6a5d72557622a37f039d090a689accd02b57c691174338de8e05bb3620c079705c969c58e56b079dc9eb44eb0fcebe548f5a31f4072a5ed56a2f03107bf40a359b2601eddf53cade66f294cfeaa40a0d94b9c90d15f61852f295d3911f8ea914d015885c8c64540a83badf0021a416c3e37b78236a2ecd1fce4114033416bdd3a36c18ec13250ee9c74c0fc4dd564b3d24a825802d5ae402a53bacace115ae3bbb329be79d1e5e42dbaf0a6446431145fe49b86a8703c7c41f8985d54f12e314c16ff89351d8addf66ebba2783f2d1a11965182aa0b0dd2de53586c5a695c6265c2b173958da648611090557bdebf11a1e042f089fe98e049f4796c60d26be38356fe020d9ace9008410d53a1bb7db78b52ee44bac364213f5c59f1eac4e3314f3423b92fdd7a6156608111ac6ddf58385ec1f3df12061208db98816ac948d803fad10d5ece2018c60faa13de5e5a9033745c824932e53f4122a39f635813545c1b74732cd55642f19ed6deca1585ebf7242c849bde981572a2199066e9c912b2068c8f1c8b936c43ae95c6e22bd7b80dfea05f495d751107da5928e806d0af905c87b5a0795df146af6580d8f9c6a0e2645686d43822ce9b4be0bd5937c097917e048b5af71c7e7521d490f107e9231ee5bd9fbf0727ba87774ed24cd52f471ffb71849ebd55605996515bdcfe95bb1df3541e7c42da4166dd01ec3597634aa6455d15fe14af435e8d7a55ff1682d55a2da867ae63d11fb3fd987fa5d7032ecefc35d3fb9570940e779e13da18070e6df5292f97f2a281f9598101102c955fe4808a2319c85fdef3d55b19e05bb8c2d3da64bafb67a53491513a24f6f0804aa162c8a7db25b38089373fecc45a0eaef65dd9be3b4b7f9436a5423fdcdb5a9b60138fc6a2261225390d9ae0d8ab7f0f7ffff69dca06881d33a637d634358abebb333df41151f239add91abaafc89070cb2159ce3a31655c22e4696c9fa7a7211d1251d4bb21ea4a321a3dbebc29d97f526251e40e548dcd7ed07587719a266f006179dcd22e50b3705152817057b097b043ad63b8d867edc20aea9b4c959ef4ff70f47128cfcc21e31f17978ecacc366f459ac1cc459a3976e4173ca322675f84f18036119ec2f204c3fb554a0b72f7e9d8c882ab147b3d280ca9dff7b9160b1b437b901f03cbc05fe05c6f44824b48aa8da52ae7dda1653fd500f9ccd221843cf76513b3b74d094f14d93a00d7cb954bc4cf2f04f9a35e38edcb1e84f62057647dcb3571f1dd296ca1e049f1746a8a282e85138500e7649db756b2d2ad88f11c471c89dc6be2cd43481013b8d0ae83da2b855cea7be424f8b2325b1850d1fdef03e765458df4513d57c72ba9751e1edc3c4e7f97e3202bb46eec7be89871ba3704aa6c6fc08851e551a3f655fa1fb798d12f003faf31c56b6df399a5dd0ed29ef9e4139dbc254bc5d6051840a859eabaaad56324588fae881fd638d2b70fb3813402df61d941ab495588e5fc3823249bf9a03cf877902394f512de118edaf98843a5445e9073fcfa409df3db0221f1c77e2dd21e74f9e10c9e180dc4ed17010eb949c6d67a22bd5337b2c68f9eccdec778ece728e91353696b742c8f5a3a569f054efb8c1ed478ee9b75e26c768a5816aa6bd08a4c72e745fdb5deb34ecb86b3a84346c1c70f9c16fc45bc0421f0da2f630912d5079f390cc53b78e343310de722b53d2a3b4aa386caa0d7e91986e19c3363426ba30eb5284293af81d00158a3f5233327b40c3b989725ba7dd5b31ac7abf8d3e0b737e843065cd7316dc2f374a00bed4cf9caa0d6e232c854df1bc24c3d484bc6bcb14ec770d5745474dc6ac3b3ddbffc551c9fcc2c56a5e0ae17948457c01e701bf1554022bc2b7d9dd42b2b91172fd85e6874d2d61fc7b3bb3cee2a9bfec09f6d7e98279c6f511f4140b116c856c1438e34bca59fdca2409f025b896a52d68719bf93e82e7d89bbf798991fda0af8d06d17f39eba4bca09c1fe594b537ad4c9b94ab52c895539d639425f9146b24b016368a638e5bba391bc8763cae7c52ff9c496884f1d84e5e08ed451358ecb3c4919dd410e82cac35ae744078287c05c89b42999ea6b8b127d40d53a5722d45139e8bc507a11e7add7fa9ab12cc40afeec008a4668e3e6440f27bb5780936c0e3668ac51262390c79b3f21fd041cf36ba3522f3a552714ff188bfd554c60d0e7d11213cf7d3864a5175d4047c2f3284741f18ec22995a5b82bf62190151bc1529c6d9927f9b0c1dacebd9c2dc406f7f64a973f9a70cff6e3abeebeb46514bbf2ead382f7262d46bd43d88c1b91a9011d1f8ba81fa536a7162aee2b2ec6fc0f2d6efc87b98d2e41e0f946969da659c21053775ece415a34d42b6cfd5bc52259867b411dfb991461ca618052309ca9c96468c2da12dfab0e822ff3bbe7ba281982a239ac19c47024fe1f0e3550cf0975add1f680a9dac9b2c4ab0aed4f409ddda6765eb8a0a9d1e9d07458c69ac8195541219b18efcd06c0001f2ae7fee2d404666a18ca3cb3aa4f0623e86c5b1229f6c2ca28d951111294b91edc52730b6b2c46e000672a7c89b2f38045bd3e37dbb8a75e18687a514dcf740c87a34834d3c3cc8aadf6166ec0c42d2be92f90a3af49633ff23cd80848ceb57ac550eaf9ae496bdc6a2d7cf50fe107895b4a1ed014f78af24eccd6a07420f1dc0df1e7c44b4ba937dd43cab9c798371b148325578d61931766af02b45054bdc2d9fcab2f4b49092f6fff7c27886820739d6140a4a905f0020249e8ae8dd87da1a1e7b1851eb01045aaa72dc8a2bf68055e7aed41d85336648a3405195d2ab61b0e29a770461f32fd05e14c17d72c5252f026a7b9abe7ea9176d3c46f6ed9fb716758d97b41e4f5d81a24538f763d83eecafafc668422612b40cfc32b3354b24755fbe400a2bfed494fe6d0ba0051713b776e67e2f1915e94708e6dc74b398f2f526933aad8fe7dc32faf40022606aebb6e0756b994c3176fae7640ee06d6c67bd54764c4752f1bf831f43e0227cba101174c5554ce26400f333dd8e9f6db1cdf670ce407d7d06c3aef4c0724b62edc8f1ba3e04f0e394d15a73b9255abb4d6ac70303dcf9160d32dc02d4804219ed5c7e3b48402e58ab2f58305f9bb95d2a8759947de96328ed5234cfe7d0b2a9a014df7e4cd0ae48906315f139b8635d2e6bd4aba32e62b8906cdfe5622c411bf0373d0cb07d17bb2bb5b83eae4401c243605fd1df759fd0ddc704ccab5a9776c40fbf6bde0f11b9646c699f26063a9550ac228c9884c277bcadcc0a2c225dc203e28e253c4e464b23d2529d09c7b7dd3c984667372472b615645f294c4e3b0797f9d1c234015b78502d98bfc04f1fa2f16cf3e7221d5794d035e4b172a4d84e679cb1c82df2fb49d3c6668eb1661bed56705096c2371a19d668832808eedd9e5b1256c18fe7ccc494e5e29145d453c553ec86fb7f3a634d0d45661875f2f1005ba5e734c1a976f37cd23450e4606e32d027bc9ec2edd9395e14b2082179bd7b4f9b8caa2d00a2de71d48553f7d4153cb56a1b08f11925e4b11c9281744ae9171f3d6faa3ab3f88c5c34fd23e4f6efeceafdcbc07686ef56efa62c0ad62f1cdcb4d3b5bc508c1f05263bc347158fa5495828f34eb7fcde98fefaa82bafeefed3f4a58968d751c051b52e0047f066de5be533bc3b1e439ab1c8602f6c67503803c8fa113737cb8279f358dbacdf45432b7a654d0e1122cca93420e956661d7275181c75b0d9c20e84c7007dfc49f27bc00007cf4ffa631c892981fd70141d532fcd51de5c23fe0b7a186d0dc296362f235d61698740cc315891cc9342da17843bcde274c17e462263d0e8b4832dd9075a7bbb443d4b26b41e534ad5551ed5ada102175e695363fb48d6b99ac978a3aa6f405d87f983384ce35740e930491d75675337c5dc081e3d301228e61bde5cc169968e5b4350cca2b085f9f75cc4b88497a78cd0a0073d90246c7dc102c7cbf3516498e8a41aa85d8cc5bc285ff66e8338e85ca83fb6889e2bccff52059bb9e92e92c155a349952680ffd0a3c346061a53fdf074417fc90c4d1af7c2acc3ee4b080752cbc9455ba5931b7e910f1e4af0efce905d2cc9c685923ead387fa532c0e8ad92719c76c281cd010e1acce500ae1443838b8afb48af032069dd07aa4df0d56bcb70a64592633699c8658102f1fbca441325e27f1732a7a973d8cb3a0684d72943ef6f1892f2d7ccf39bb6dfe5801ab98653bdbcfbb787bf125253be2624f6cf44177d588bd7b780d9e3f4e3a4e50b8a253fa21abce6a94b9073289c76773b46140f5a6e46b9de9ec066c176f5d1a69f380e1901216617363362d13ebb26ad74fb008ec08841550ff14ca800a1ecf2e007ebaad9f4e0d9664448d60ac0d8544243129fb81c1723b9b4bc2ee971dff736d9fcde0afbfbf5c50a4cc06a4c363998326c17bdc9e2508651dedd9a2a52bd87f8693cfcff60753acf9716c526e8635f12377e36564ae55d0fdb3c7997ec4dbdaa5b4d18c7b660acd95060831795da7d299a5a8d8cf9e92537dbd3ef7f56aebe38fa97c41da6bf0572a0270be7e5a7dcc0be3529339464c811052b65a938e874ea6da469c7d8992ce0aff1c75e82d1621ecb967213c65f2de582cb41de3804c507ddfc708ef3f6096ba4491e431160f98de806d0f334e03cfb7a3bece601099bd971253f3aa0df845da8b478603d5d88533d0cab9c89f2dd9a1404cf8939ffdda652a94093865a85fce2bc3d7babcff7b9f3306bd76b9af80c78ad518f89ee73b7a710da604e72f4927be8d65d06be2e0732fa786a83e27597cfbed9bf98df445499e0746b9f2cb9659ac0a9cef433148521f33b1d78d13c8441c0d1e20fd93ac450a3787a2292bcbd68cd1f961d34937be9a21abaf26f361bf53aa0c095e53c51f3e04d567eabe6e40d96a17c2bcc9230b18f7e079bc549a314b4ae21d30a3341aa205bc75c7f1d21b0a49549c300faeda243d0ce18da5e66c5b663cd705005dd9fea0a9564174abb797d64c58fdab1fae44576d514b75eaa31c9278b15bf9b6df7c6c2873d7a56fb91ab77b83761a09f9e1ddae535622fb87f7462256a60dd39dd3ceb6690b0272920b635ea639daf24f95462c523e5bbd8d8407c61163ab38877d5edfa04c2a78d4d240523ba97c7d01c71783f8748e85164b4dd08c25506a4ed18300b42b7bc6e417f512ae456ceec2ffc83190991a06d4a58ede215babcd3688e1d61f1975016244e80c88ae2aec05c7eeb1c50caca72b3b415b6b870bf5e10bd1ac3ba6b4acb1d1afac554444d94c97e171005fa4ea9c651bb4e527ff58d0c2f90fb453a92d6546a26e9e98395b09e8471bdcf2a145aacb649708cf048a7856ce8cf390c107ff2c66efbf2a76c5b041860ea576103cd8c6b25e50eca9ff6a2fa88083fe9ac0d1fb639c516b9bcdf23c34c6145a705498ff9b9747f15e1c08c63da6efeda4eca02c3f00dfec06c82220c9de840040118dde76be788daf84e6a2f44c81fe6defcc474f99c51c4648d297cbc48f081e0809dbda505d020cbe865e430e0491644ec8c52bd3ab8ce8c4862990f49fe2588caf804ce9500ef42d5a50c057c257168e283e4a4aedbe4ccfaf3eeffb212f9e23d15434d60bf4f455f512e2b655aff3225d1b217c261110cec0400f54dd303d6231d028c2eb649bccc91d30a6391c88bff9d447c3cf35a3467be5957e0ea4d4dc237c9f2c68ce48f658f820a3d72d559b60f233ce538c92cb148808e34fedf2d648c21e7f2ea29a77270c393bda42d869351d6c085d965dc12cbfd0311b8bf604f4391d378781eea3b5f1e0da9d0d8f8de88e56fe47d362cd46f591d3ec0f7cccb85a21f21ddcd4107821ce0ca9ddf99dfdfd9b0c9cd45053e5b1b4385bd8f5b227ada31b5c23e9420014474e8b4494fde7c38edfe70994d97b8cbdfac588df49a49c472fcce78cccc051f31cbbc1e0422878d8d490f3aee28adf1587c38fb7e7d1be54abeaa83cf54b633803a5e669ff4295df8735231ce39631616bd05e0e31117c722c2fd6787003b0bc7fe422a089c89329544e085d71102c1813769450a9f66f160d1702cdb17bd2c6fdf0f722762d193ce83623eeffab17b01b10a31db6e2feb6eb3abdbb2e36320e1a56e44e48d26090afa7f65003a98cbfef590ac3ec89b3eb230557cf6aa566e841806aa2767b21bb26fe001f11ae039e0c9a4bf1bf3d271960f16158eb5bd9ebf0080abd8369d512cab2d1aaae2b14d0ff6ee705a38fb0c801a98b0624cc138fc24834fdf430f33e1760db913da3290f34415c9e3df3e97da1780545ab68ac5a24db89f24d62f4a399728e4144a8c89f47ac2d29e30c49b0bcf790a5e3d3fcd1943c6a28f37251d9dd827a69579e6c17b629c927473b5a07b0a29d9562708d6c8ce576109ad1a3473ffb2047eb069beeec24c114bef392c929038c92abd0e6a19b610e27881361824d57008b7373d0ab76379570ded76c9b8284fe2c247791073c29b2fc6fca05019220ab92856892d3c0dcc6da0b597fe559c162d060d71513ebca050d9638164b9ae271fba5575ade787ec5aee8fc253d1b234b1df561db3e36ac64b9b0100dd6b407043537b2b141f +MD = 2cbc07b9b9c819b8fd38d8a614a8a9c3fa7e40ee diff --git a/lib/libssl/src/fips-1.0/sha/SHAmix.req b/lib/libssl/src/fips-1.0/sha/SHAmix.req new file mode 100644 index 00000000000..453fce20ce0 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/SHAmix.req @@ -0,0 +1,99 @@ +[L = 64] + +Len = 16 +Msg = 98a1 + +Len = 104 +Msg = 35a37a46df4ccbadd815942249 + +Len = 352 +Msg = a93aed0fa5e163a82c9a934aebaab8180edf7de0b32f0fe99f9c75ec305b24609334cefa372c7c758262dc8f + +Len = 1016 +Msg = 433e88eb2f8aba562d15c18126fbdffb81d5d6c9397fa052321f5f78cd629708ba099b540da5451e949eeab8687a8d6ac35c531411cb37144ab5ff6a7eb46f1ab28fbcd2ea0444cd87c57bf7d3c02952dba3d3987da07622c16e7c086d90e88ad3d9d4afee301d2bad915d868f54197b70b23c9fa385c443404fbc9abf7e6a + +Len = 13696 +Msg = 2c46a76a9dfbae1f5e59f085e9c3d4b600c24b2d404d062cf948e75a3d4ab5b137a31397be9eb34b2a03c78367e0b85448891b511ddee1f787cccd498b172cb7e656c044a03ffde8e42478330fbe9c34072a9e99ce31b41757cc820d98e7d564e06694b96b66f4be34c5eadd0ae4e61fe6abbe4d7ccee855104fedee8b451a7fcedb793d469b0094c0ed07c97fda00dd8c1662b44e3ee6775a5ef6368cb662d257be561a5967893433a4b63f97295036a37272176d081545df00852bc5c4162324161296cd51f76433f2df867a5840f2d0c8d5be00b4dc89443d82175bf69c3bdceb97facae2b2ed68e06ae74fef36d8bd1f75f130cba509341dd54079d45de22845cc8e77a022977c7540aa3e779cb1127f39f825d4d78e55a967ef45e7c1dfb02d9999fd15af2914ba47177177d94576f1091a0657d9e04fe81e6be7b631fc1baae66584c9c26ddbb568750d77555c927bcda1fbdc15c7cbe3e3fe88ca13ff12c59b383343c12976708c0e3dff78be0e286dd32eecf20b71a09fee50a9d0b13c85a15b320b162690f399282798aa3291fdd2f9c40ed873e829388466ddd1da42f2de16aaa9272ccf44790cf3c95382c304e25ae8cb2fc9d9869808f3ee7d42cb143bb0c3a55e03db6d1202ca1bdb744e448640c0aa60d3ebbda5c21e623bb080f4a073a48822725d764e51d415aad1d7c5a7f17433d15ac7d849f910c375ee0899f6a576dada42fd651343383f286009902bb62deeeb2514de6af7f09892c20d0b238f6021f03b62444b1e1f21beeb89acfcd7136416fe7bd8f202e76afaf5345311798be7cb25351add2bb044d2380221009c4d1cbbaba4cdc8631dc0144f2778a6aa1eb3d3c81df0b1b2142fce111af8214d049e40f536c5d462b9224a978e82cc6c420e70ecc3cdaffb726a183c793845315f730fa4dac9fe46e4180397107a6a051f7f0a58ceb9bf4df37e1a81c8e9569187228e8037df2e59c52ba815566768bedc8e09d5e7bdc9f2bff23aaaaf133bb5a3332750f6124ce185e29fda0851addfa2c3d52bb6dfb530fd4ee27dd5bfdce5dc2f41debe6740274bc651aecd4023b098a7d622e2296b50d51b79c4e3f521695a9d43f038e8f273405e26584d3db179e7c1758114a3d39970df674580bbf2884405974f0b9c4b0d8b3287a2314f3f81b6991812f354d655f62513c9551b378cc2efa4c3e08b313c56cada52217fb6112eb8299b28445aca8f72e7170a1cd8bbfee4d2145fbe8d49c6af8831c4d4fc7177a50ee55a7b484261504af946c6bd5e1d6b89092f3c487c0568fa07c356fae9b8e831b8320289039746a435b122cfbc4a0d316bf90d481d3b7d979cc50d98c1190af8dc58e0035557dd5e94f437f41fab513202643a77748f76c6b77302bf40c392cd18731da082c99bdedeb70e15cd68bff59619cabcc92adcf122753c55afde0817352bc247d1170b8ddba1ad1b0faadfe0efbfc5fe6334377fa372c3435691f53dfc2ad5e08966b2d3525b1eec2d993a5cd4ff34278bd40dd80313a0727d05e0a932156152f3e11a190d8d69726f5c57d20f811e1e8932e86409ffdac96c6251c2a2976b8757adcac5d2de94931d1cbea866ec8bcba5774f8a7fde792f6acfd0f01356fd66fdf54a416af6a9397e00f848a2e9831627cbcbb52b5a868ec174e69b4cfa1ed72cdf23f39d7eaf4bdb318c188b1f0fe75655e34ad71907cdb77a1a2b162cd7c22d93dc45321eafb17cd60282e83736267b3e1fb249c307d49509f50839942f0f493afd9ef37db053a918e3ec83d801bbdead07554a018b8ba348fe9b7dd92ea7c5fc0e65a644ba19aa1fb6c022ab768ec7cb249ba17b9dda2860bd4aaaa3dc70ec009804141ad5ebc61203658e57a0887ec0fded18d844a96e79ba7e879c4253056f23e205a80ab1471953438f85848f4ab31ab175c089e0bbb97ea0dd6a67385770356741966053735e2cc2ecdd2c8c75cc045181dd7267584b901674b553082b2c58fb8f8be0b99306194a6f069f684535423304d40a268d55784a14260fa9c9cb1306b82f91cbee3c9f43dea9e50903135cc1c6505605a100bfa28564a2057974eef0852b7b72ce264815026d0759f691db618ef760edde73ec888e181403834f7221bb27a69479ec9b28a3fb0c3f68d4467d25712fc48ad78763f9ea6e8a2e85260225ca1b1a38b720e589fafca29f07257c5467cb74ee53189b8c81b784c43e93f98abde1ed53af60b27b13df6ce45001c6e1813de3521028981086f7d88ba13f6fb1a800f312fbe2f842eebe847fd760c394668cfbfd353ec14ca0366eccd7b4cd63318116bdc42e20a632a0d2b8c5cddb37bfc0a239ebe3800a787d2ece077a7968036b3d9b31cd906f888e3ed742cd769033e2c24c5a9e3c10b6d300db5a17dd88 + +Len = 100816 +Msg = f8ed40e878dc68ceec52cc8e2868722310fb117ca3a52e1839eb85d308b8aa00ed0bf0b76aec8a70eba4f0d14d2d85c5a0e876ce2c8ee59cb36947def6c40a587aa07b368ca8e8a08367018e45b984de0d7f1aa46b977cc18c0cd9b7bb897cbb2814aa0ce8f8c9843e03c86c19f2ba95dd2ac4a466a93aae4b3b05055ff148517ecf43e286c57744a3e10a14d0c26e139a503e7927aa688c78609170ebe3b54104390e5f6cf538093a67922e7210e77fcb584ec9b6844e829be246a266460cb442bad52ca47255fb8cfe276108c36e02f9acbd3d191d34b93d29ec40d80496d1c1bb5ef036221641200e905598c54bc4abb3527c5a5f6258e59d4bf54a0498c108a2725428efc2047e0096b32dfdc6ec69d5d72f81301f881ca62a66c22e5dab9fd9d90084c0a36b2f3a0123cc5327a3bc7a12fd947ab57169ac533e4b6a2cb80fc65b9b527cff9fba26994c7fafb5102a0acd8f9d246a3a54178c23eaa04c0fdfd3c0cd980d1fc7a72b25d74df9b95c3dedce8ca316870c654f9ebea9b806da9767cf40605a4b0c7fb06f6b3f197bae7d8cde9daf38530e25bc51b68f9aa23ec0e95199b14bca96c91f3db15bf8432f714dc46ac87218691bc66cb3a42f6865e1c30f8394c8e68c0ddf5851ab7c5906a1994a9af6ac1c44d0d6b95ff15d9f77825ccea40fb9e516d45888f2378e045d95d936d541cea9c8ca52fe5f7d0d919b2b1c59a42d06105ea4f2943c05178e59d67351c5b2c0051c93a4045e512884fa656b772cf398af89081546d920fd3d24ebd16310506a786ab33293027394c1bcb7b1efe46b550ac28529646e8d2a5ae65c59345e24b44cd7b06673f3ed3b9008aa568a739c26682fa596b7a655842cc6b2758b583487c78d14a76bdac7033806c5c210828ef313f8efc4072681f5fded748c31a58ac933b4665c445f07d603e0905e49b84aa55146eb1c1c99196413832a05efee2e64d6732fefc629b79b37bb9390fcbed7226b412204bda523b8b8af5c4a8bdb263ef9f3f6c7b9e1de3a1dc257c1f33b3d54a9101be5b4f2a9db319993c2cd137c41e35c434ce52e859afd1a635af4d8852252dc5e28c729b2b4c96a56d57f3f3854ded59fe612b9b3a51fee3fc1c83db673b0cc7433bff2472bc74a2eeb6706605e308690fd072a7042ca6474603711d8310909e47063f46f287260a26c4f11fe492298a0f98d28c45948a4899e08fcf443a6ba36457dd8329314d53ac0fd0819fcfc3357426c5bb8d3dfd706e205a81091cf08f31cd3459854f3d07e503991ba5f067e3c406c6c5396d8257496f4ba3703cb1ba25c2fe4aa54577af782cd57e85a88a2d75c54039e8b7bb559219edd6e81e41acb6d575d6f798afb2cbf7f00abd5c9c7b0fceec79f9a0fb040ebcbb7bff3602df7b71357efacd37aa57019350bb81213508a006160acde3dae5c42f03141887eaca22d7b33d6791febfb619d11ebabb13e6c5378e9a72e852ddccd31cc53a43275966b7042ddc51485ca20e1c456dcc7020cafb5407548b044d332229911fc74d7fb97de25abff7efb431da82de2ed7e25d0dcc06ffc74e57ca93a6a9f64d76a5c39776fe2266f88d6d0229b527525fd2e22a1407e26f94c5bc6adb1e7327f3c8bb8d4c983385c579dd8f5623df8cd6da569c7de73d9210e6b9253a177653a13ece075940fc81016d8c35fa4f6542df5120c174158ff32533476f4e059e35117081a24798fbdd1eb10f82809836f8dbefe755611347f75423dd8571695960c6f66cca71f0a01e8fecbe1183bee3335eff10b4ff8104132040e2145ec3164b2448f60c730887b9d7894e5f7df3f876cb17136c99cf32db1c02fba860937378dbd093c4c5112133781f06c8ca07c527c2c085e8ba5e52b399f2909e217aef6e3035ecafe2caeb1004069dea023af7eab873deb5ebcef2313c9827821bb9f89fd3d1570a569673d3ede86a4fb13dff242eb98450a8917fd8865c56e0a9f11d72394b79808b0429f3a83cf2465161596887fa2d557b367a1de9c7753666b0cca9c30cba9f0a749c03c55cdc7a6d45852c76ce2010de3e7f75d95228efdc79949b238d90b25f983868b7f07f585f7b00e45d9e132f3c09ee84f794d899759be3dabd46a256f4cf8da71270617cc2425b24cef25d1d2f3945afa6f81abfccc858cd02e05619649b1a5347650934105c02622d538447223d136a8a0455cf3c6f61f696b32266197b5cd1d936fd3ad4288520fb4a2f59bf95e659f33210446ef18debeb679dd99de0c3c74a6eb3dd783861f5db4e94a151c42ce27519d0bbbf1f3b1163563ec06c8bfd881d94a3b896fc07352fc97ada73685588a2242da1b718f81bb1077bc70fbd58b8b52163489ae403838b533851bec30ed0ecd97d72d1af534f3703db59f1f563bdc39d690a0e90e545506463a37e84974fd7b256bbb912cb4077d3e3f5bdd4bd2bab713b696c830b1f2185734c4d2dbd49d5372fe8b813ce73f5e01c36bddbb376ef4541033f2b0355613eeda8951ebf7377e08f967902eb7e23c0fa798c6ae52401721053f1095cacb1e9496500e83c412236fc21566090b3a3eee55aa402c0b774802fd81c9e8579761cfcfdfb1aa23786b2dc35dacd5ca8d8d283369f53e4a5db18060c2c6b0c303052aeeffe169fcaf7ecc63090a9ade245045ab9c8aebf738772297caaef5f857322a597846c7370083d409df27612e47b0cb240daa3cfa51c57108612ac0dddb0f59791289ccbdb3a2cb1fa9ac31a23dd5440682fb373bf0c1f41c4fe2185ad7c53eb69552807410053b0c2d40132250e637b8c425e6a35d93333b5b7d0557927b6179c848ec455fd1ab38348c0e96c60b2da49bd15118df64b6ce4fa48fbc555a4b2874141718e731a40b85382ae6e86ead31cea77f83bf5c063bf1febf71688a832d615e09d6f14badedeaeb6ffbfe343fc7274e78cd46a2aaec0a349c5f133291ee57cdcb65c5474e46294de6bb50886bce6c6f44dcb95f2a4761ed2e6c9e7bfed51e0964afab4e0f7e0b07960f2590baae66b1ec9a63ba0fb6c0d27e81508c51487dbbdc9beb8879fd58c188dfc774b3d0ddbd77ee8bdcdfa0ed8a9387728e12b13e8b3c10cc1c132bd822c2147c5ddf9a993aedbf78ec256db1be76644ca8ca7727208bf89732657152d34e948d73c47561d156f773136684d4162d02260300020123d13a95f4f835907c344942ddeccafe2abb7dc4792c4f1e39c24748c63cba933b16be0b8853e058c47a1ae2c4dfff39ec2339b345fe3557d03c1df91a0607a711636c4416ffdb73532aeeb74f237ed8bf971388a0659e4682a46b8327e751034cbf2c87c7828da9d24baf07a742ada34d1ef38ab1e8f2b4f801192c146600709533e61bc2665dc1e9e6441bf3c4f6643bc0c102a10f9a69da5b0e3d0a0c7cb694c682493032b5853f02953b5c2fc0e1348565389762fc2dcfbb34fd305f2d9df080e859396ffcbb7da78aae0a0d72e3de76c774bc6a81c87f2872b6afe97ced5269009304a4992c4add0bbe24e57632e19ad0fe37ae910193aab0aeae32cf6d618ab33eba59f6a04fad00b1d2403396e6fa661d31b695a1b349d62f56c08fe6c6eae7a482177adf341e51d03ea511d7959c721bd20bf371860ecd7fce1d25212891850b85648db0a039e6638d9c78bc958add3e41341536b5007be63fd1f7e3308876bcebcb97dc3b05a7b2eaadd00f8fcc8dcfa7b961bbe727c9aed1626ff786d6a0ffdbd1002cae8a7d047b6181962a686c152b2341c7c58c9f1dab5af424d183ed1c7d003165a1d04ea3683ff31a0f68615af6f91c21f736e67df641ed31b998445afadf9052bbe004d5dad08f62e5d353e42fc35a92242d8414d99dc4e7e81c8c027af686baa5c185e3f99abb3855b22cfdff0a62e2f47a632b7df8e00e0317af5c24ce7c64077bbb15ec27e062070cd3eb8e549ed9112469090ad9a96eb59294b021eed81987178cb2dcff67a9a2e930f6032c753e203380f8a7c987cea393234699de03a1d09ce204f0a8b6d5cf522b6887174fdbccb08f3e7c4fe2f778254465b32766c48812a45151ac37ae354dac87419f9476baa27e24b2f322b2da4ddf579750684a5881bae2269351fb7de59b9d5a4badd8951135f2713dafc57215dc626ee170fae7f20bff98e36b864e1fe0f0f9a300c903069bf0e0b6f2f8e78423cf6063e89dde6c81efcf26ef15510563c84730f611ac879a6628e55115e1a29de6945d37fbe4f803fcf2e344712d9e0d6f6c79f8773a9f199b705235e20a7830ee3357c5dca29d7a6c29a3d2628bf2c42c8f076cc4525301d8e1860729070dc53164d9fa08bf63cc889eed01b0130a7146d860bbc09ead3865a3082db0836a45f5506c3e46e452e298764939226cedfd06700e4e33c6b4a78add601140249596831e97f960b973a4e4dc3fe2813fa34eb47f998ce57270368fb81719a09298a223f7e3931ce5cdfab3f658649533354e982c87dc9e49eacebb5bb4af9a767b4f1c03d774431168cd4fec1b2726f1aae3f9a062a825f3295557eebf3af4784487b869fb049de44d03fee71194fc200af72103b157431935b5ab9bc122773ffd313d52d7acf1078386090fc011de695e71567cfd51c06317d4ff8841ceeb74ad35f4e5f4d20921123cb88bb2079674ad39e133cdfd6478d69c9bddc7a818be5d7b254bd9e0abdb030f52846fdfeae8ff370a51a9c5f6017af3c6c3db17c5c614ea18ab0e3ca0dd5de621217dffa36e5c5318fe191040a50cc3ca620683bc34da6c142e1c50afce28a86b8b66d189adcd755561a647080d93f3ede1cf54c3afb7e863fc8a82a2576d3f79e9b2bb634e598507a3d7d017e0176b7868bff3a3dfb4474b3ce03c401f33929364e727fbf8096b77eb351435c7a113b3215cc6246dd86f1517a7e550cf828900248f7c1754e40fed62477b296a37d3e53231360d012c4908b466e49b0e620c0a5031228009f259b030956ebd70e49357c3c3ac2842b6bd6e3ca5a3e985dc03f7105681fec03b320a7ca753b782ad3b52fd9c8e3bd980b48dd6ec8901dbf756108e85015821c880416e0693e0479cb31c0743450f6d9214afabc4feadb9bcee9def460a58d3a02d9e3039970068b8e3fd0a403a6ca7f2c71ae2b46ab3c731b1e65e2104c47fcb1f69e7c8c6df8c09b33f2e1cd4192faab316a44536dcac608832019f5765cc5240eabe3c87445c980c299a5e7ae0acc2c2ed19fdc8f011515bcb00476b03633c7669db1b44f97f6cd402778e9687c740dbe5686789b79d0b13f784a2a866eb91ab2d66f064c49e8df513ec348fd7272ee548ba08e1f9f99696ffb53677550d59c67f88404f6e610455a422d9cd987493ca5c366a397dccface2bba8e3e99719dafa768956cbf6fd8defc4104b8925878716a0514f70cbf3fa2c2bc2f66fabe654eed3076257e71117665703eb88c79e4c2b94e8e856e7a6ef90ee2a358409db78b98056ce1750eb80725d70e35507fdfa5933a61496ba48fbd5555717b33b59d4ef211fe096aefd478859ffc97a41372023ef114adcae5a8d5e03c21369baf1e7f417cb40326bc6db1cdf0904651dda3c1039a2f1755e7c329f7c03bf33f324206ce6e1638711c8c9a45f153aa1f847cca2a5d3af1d24fe7a1e1094819e8e712cbe10ead1012b7371b35cbcc2bd5b10505fb63bea20ac81d25e83ed0105e7595b6c28400f4d336791ce4a584323d0b455bbed44392c5f86c9d5287593f6986d4b0b8f9974a7a4157859ba801251d3b44b2bad84f29cb87dcf1680d6d10d1bfd59f0c95fb7bd07fdb3ea2fccd6e3ee80af438956ccfe31e750972f893ea5dcaa26d077fb3f09d990c2f41c8707368bba007803621ecd76540cdb8705435d74f4300eee04710a936f241c034709e625b0dd5dae1f6e86d034426819c365a05f5be420cdf4042bbff965a666a5756f67259448ebf742b6ea189fa17a4c3bfaf651d19a8a525f09d9cff637c8fac02eaa58d3ee3f7221da1e61833c0b183cd9f47686f09597e8115b435454acef80c079eafaa22b18927d07bf8b7c5ebfdec9c42a52b7824d45decef41e6184dc2db1505ca6f94172fafc10731706e79b9856dfede353d2eadeceaf72a302e3492d7dc81e3777e4e9e1f3d33cc4402833ffedb241a75a09e9495d671f80ad3acf06823bb04a92b815edd0ca7d01dcb3318c1ae5c62d3e99c0ec37908b45b51dd65f6b45b34ede2d6f553f60a45e20fafcb34ae4dbd375f52a5db9c62650deeee78e955087c2bea75ede7c304347b171fe0c1a2a033894be6e04605271307f307b2a9cf6ae24b8c87ce033a3fa4cf2bacdfcf54fcccb1f580476c7d00c631a8529a9eea2a713610341e0e25609dc8927e51c58a0a9197a54963b5cb95877354f4b8316df02ed2bea367704a12274d96bcbe0d0d728923a368bb8ab98d5db5401894c822632308ddfd309071fb4b477d8eac0ea5dbbc3e3606d8510d9051dfb5e4b7cdcf2c57c1b76902d864c3109c901da53019ed33cea84b407490486ad9f980a8a63df3d2e3921064afea137f35179130db3351f5bc3f5e7d590a5ab08b5415efbd345f9d57b71ade7dca939efa5a12d677b9af0af14468176a43712bde10cb15787c18bf066eaef8abcdea77d3a0c61d6c74ae7b54fe90940d0233e4b874c9a141dcc740d7fff43b9fbbc012a933d890232cf74fccb7ff7eac1148e203c7381b7f1d1429b1b1152ec25cbf7562596eb402a9328e43b5dc5cae36592da5523f0b9907a6817ecd395a7c778daae85bb11372b20641a04250b77b3a0ece885d07faf9622650259b874536d6d2b92181c834dc111b6fcba483167be40ecc922fb87006f63b9e8e632879563f37a8f712db9fa68c1a20ab239c0116fe022fad1279f3288b8e74a16d447e467b6381515814dd3aecab5c2a09c400b44e9100c04c720dc7e8c6d9460002da6c52004c16999975fef8752c2f9c229cbd9e6446b226cc454bd68cd665668a17328bb30f301e92ef5c7a2197a326df5c99b422096de8af231d1d8872e6e505bcfff026d4862f28d4bb3856a66ced22c9b0587451d8da4230a38561b5b1c69b523a4701a2001382aa82fcbd60733a14696a540227db44aef346d6c0a7ae5173604d59eb828614cafc1b8cfecda054dcc7306f73925e6d1af56ed74c51c6cdb66e9fee8d7a0078254fedb0c0f5dc85a4686870709b499eafbc8451aebadf848b0598ce8f955688bd2d6032abe10d1391d67c20a049841f95d2ee0c8deae2bc1baca0c098d8718cba1ddcd968981c47cd98d247aca4f838f3bf16d092eab8be8deb1f8d504d37cc44a8c96c9f22f2698036d4ad3bb48b31f109626565c147d20a4a7dfd61fb918f81548fb4f78875c1d138e819f6822651b93a3c92ad77793fba5222d870ea671f9cac967919d18f96e92778548415b2e170d90b201215354fc48a77e62823a2c2bb354782ad052732f08beb278f751529416f37d83ea26248517ae2ef2ead28c1077908995a2d25db0deaa957bcab39715283287fd626ea7388abccba2d90e364a7ff4284c84f70da68ce1aafb5be0401cb9d45e085aab41892a49e10cbd5baf2c34f5e0ca076f2772abea6f622b66020d546f8c2f134a87f96edbeb9b08394b585f2c2f98aa792f97b43b5f3aa9c34189804a9ecc2cfaeefbd0f967d85a25bf3136fd8132dec38aa82e4af6ff677682f3b62be27a180aeb22f918c24f23bf6f5954e0722324cccd06829fc32ae4fe3aee6e5a03b3651900e13fb0a759e544d033418b6ed40d037b4549a0404792c8fddc317b7f028493c4c91d6773932f8486417544f3d007e5f9e6fc02fadff175303f77f6b0e1f709bb3d3a93b38552ccf62688a39da1a602dd5e122e6f4e9171769ada5255cc5cf938dfefcbe3ab0faca434c42dc8c357e89a3d1488fa3df35c3580b124ba3bf6d0d203d586707eb692150ed05a01bf9de5c4e67bb948088784016394d47abb853f2b6b643a066ad81bcd1735aed4e108a8c1fcd025b548de874eb60de7f3c568728959147d1219e4b830e06ca2bee1f8a035e28a54ee6958d4821a84e5d1e41139905f7ec60fe67ce5f4eccdcc2c3d1e4a753a32dd3004970a4ff3824471822fe2b5010b9b6c6b01336dbf0181a95cba2624663215468519871cc39e8a7f4a151c8bd03363b402020f2fb98069b2cb8cc1b7e930938e7540d95d1d223e47865135793f9eb573660ff79f7ed2fae503e68ba44596ee745fbd8fa562c5c666d174cc01b1961736e18b8b517161ab9c8058026e0ddd6c94aed0086a26e1b959a5e05eb9d8c1ff5b2ef518ca23b4f265db61b499a48cc46bed28d23ffc1e8d9c9e345c06079ad47c88dd4e8e286575bd7f9420ab9c2d5c6685488b8b34d4c9ac04e1427ae0994cf789b48b01d1db9c2fe75fc5187727bb11119f82d0739ce4048467a08cd635bf78cc1b6cc9c28fdc199d351064a81456f81c9e56a43aef7332973804b06b18a26caa62523a7d0acc272ba49124b17bb68800d5756afd34ddb2b7e2dd8a118aac3fcf39d9f853c4d2c4fd3ed5bd25a6604d68d57db93d15aa1160f8a97e6c24238e84f272780966867f9c644ca2775cdac4af0ece036cfa6ebb1cd9d701dd7daec5763c9a4de0385db383a5647918e79c6a6de1f4ee1f6b722c561704c8d7efa4710d78dfce8ad2df0d3d82cbb59cef0bcb001f70bdc6e17af1a720b117fe02bb1dd527b18e6bce70e9447cd0cc85cbcf431fe7c006f5e4ef878a974a93b25f492847c9ae020583c9d412f4124246164d8f080b615e2eee267a7aeb5fa0974de52cefef23cdda7b305a33a91e9b50471ceb72dae337c485d636e28d6ee31f5705983808b1567d4d4ae820ec445c56e6a404cad6b408691475397c0dd6cfad232106ba96e5104052700a653e21f9ac6d79578a9f52548f426a1e81dd45bae30acdd4d22a2dafd633564d6b2f45e7d35413503c955cb0a9784b42ae8c2a5933a6729f3922f969a158540dcd201ecb6e32f88b5b4921914a2e8f424c8b031f115ea5d23a21e6f22439ffd7e5d11b08df729f65613b4f6ad3edbc9a066a5e712ecbddfa6fa764cdf170c0485f82d924a99b7e7ad8dc44c1f93e49b6469a9af3de5691944413f1417b753bcb84d5b7a34f362c383cbc802b0c88bd23a7ac471b9287571c42081b1134bfc8ce104a550942ab1f2a074cb00a90558d6e841ff15cfde6951f03e450a1bfc90dec6c513fcb2692ddccc31d22e5274d41036656183c72fce208e44920776f196193137ac67d6d65ce9cfaae774f23a86e6ee8ff3a4e9422a4667d971906e5496a4e80278774899c882708611bad282f6c1d666bc5e7c40082b43a6e98d494a18e9b3cf7f154fdbf90d786e59e83b72ad0ab893c49aca50ed37ea5202e650fda54f5c46ca2a35c476f4b009c5e6733232275abd1341199b63d22386c484cb95c43ea90e609c407bc79ddd00609cc2eb0d82848db239b249f164b7ea384d0239fe1e64d04955b9297472cafa2ff272c5c78100aaa86cdd8120556f25652a3c12da5853338e3be8f505d93ea03cd1cae7e78e95befdc0e26b760d11e05403c348e0523fe036381408033c009a8e1f117af5100a6eb91f08307df465c20bc1dd029875ef7e49338689f602d98f2dc690a57a6f2864e57098f8bd723574944ad3688b292db6d01387a16493912722ac8f91fd12b748899bdaeabdf0479df788eda440d7bf30d1c25d78d757f00b74bb556506637fc1ab87162f05d464e63a6272db3fe56e9357275035d6b6bee32bd92c4a1dc94778551e94ee1d8854f767bfac3811bd0287672aaa01ea18c25650f05a68cbacd9158e479b508e72df778589e1e03dc543b60bb3b10399e5c50de9e728e69774fb3f5fea757ddefccd0f9da75afe4b67f9c54aaaaf646e858fb001a6deed0a8a769ecef0689c988de566b6015fb8c40aeb5f2df7ea4bee60e8e69d15c4a4aa5411dbe63fbdd6418cf025d87f37362f15e22aba83abe1a3de9857c71c2234023b969eacc0bc526363b7f30b092ca114f2a6cefb34394d146866ac86a33fc497a8cb8e2a5bac398579ff7958878421fb08fff4f8f3deb8c9641b8de392647df3017a5467f9d7b23036935ec6e188dd6dbfb544b8a9e04a4b3c7fa1e4d1d9879daf69986b8083e6eb023a4b5eff80fef17f8f65433c882a21565a919448e6091d1b61013fdaf9fc3e45bbe827c9b4ab10b05600a1961e81d31c7404f8e0d32bfcac2937eaed811db167dfdc29286b0d51bad2bcdb9dea76eaf495a31a7fe717c1c98be374a36271cdd06ed06c02ef4c3c06cb42f73b3332ed488416010e6bf2f4dc4dade6e2e61f19e9306bf941868f59fa0939005743dd647f0a04b576a7e71d4c383c479453501e18ec56d7cb79fe31ff534afbd8609ed701ef163f9de31bc58114399fa0f22b62c66c380e8a10c34b7e731df2a8d39dcf36fbf3a66d67b973e3a94bf6ee0bd96f5c76baa76492032fdd2f59ecaee403d486f543f2cd7ae7b0dabe1b5566e681cd40d384a94349e9668650a6f2d2daf86c59a7b02ba466cd03ce1d50c3f0ca4c02dc4b3d1c0e7b9a77df9eae0bfcffa32117d7e05adc7195f4278c93497401629897a58d08ad7141ea52e0163f14992d7a284e7b875ce4640b4dd48ceedad1ea17d8ab1e760773044845e0899602f1bdfff4d42ab80c0765d1a8bde2ba0a830c050923956d06c80b182264ad19ae4f7c39e43195f7d421bdcda00e3eb5ec5ef2ec91d69df691ba7fe250352acf01fa92af5e2c634b9c7c97889e9147e869acc153d88cdc18908f882f371ba9c1e13c26e9cb8e3cbd4c5e1988080ca65a67b3a4c3460cfadbec904d853fddd2f5375b6070941fca53cc106b5748480213cfbdc1c34320a0478b05f76fd0454c75eca069cb1fa7b21704dab67dc40d041c8a1040db378e76655636ad725219c049e6536982d6ee9f11dd032280e622547c7ff44a938a1f233c356a98182d22d5770fbc871e20bb37483dd5d6ea1551993b95b30774a49b50d411ebe0e8c92834094e23ec2664d822c40e96fb42b8607b62b6949e05edcaa436d0ffac6a8ff384068acfc0220c0b098d368fb8113918a4f8c9de37cece74c8695cef2427e54a6e77ad092a9b7f1d94ac9f0836deff41b905b5dafc58ad6063759b0372a634f69a639e19521825d66a282f489c3172a3659264d0132af3571e637782bb6fe5c0afd24547612166fd3409d0991392fa054ea5bd07a4cd0921a13ad7b62a0b5e6d56cd8adb7f3eaa5c99576941c38aff311c49a8c9d8c755869302a2e5e40109c8365a551cd3f859b9421be189d3a0e9ed78830d5cd6a2414e9cc4c25814d94d98f8848e5386d6dbddd65d22b96c5d20020a5dd409c7e5344065871e57e01c91a443501dc8bf619890fe231319b5480c3879dee618d319962596539e2970513fb5c0c8eac3a71ff99962779cf1d7e916566d0e29d121c5cec5d7302a18ed00be9316f3de8c669a64c2a960a588f9c8a42690f6867cda7146e8ce27aa6a7fb27606eed9df6a235a42d17ce71627446e206e879de56025a66556263f06684dedcfd6f083d6a707e5fc8f8212d716e062f0f7fd0c2fc62bea93d68581265a803c31cac3f8ac8939c5f8c464ebd19df42c7e8998494af614c8383294f3f3883f2404ac10404759e182a038c97aea04a85530ec005e203807c5bc30fa9f5339b32fb0427e64915e29a25bb25ac60b92256470e7de5298d42c6b88995f8d2fb704e49d55b66b71e237af90fcbfd71d9093e1a543da2e9911ac4102346dc4704859cb33ac5f5dce2b3331a9dc9fb506461a5436c89bf90d39afcf93cbca4cfc35da6ddb112243928246ae0d1ba269b0fce0468d3ecabbdb925c9ea3241e2dbdc6b151fb4aa724a42f98b0248171fa01fa103f116d0e7deb65dc359b09126f9a420300fd209508ec7a50be56d5b470e387d0c52a1d104625f9571ce1404d1b7af3fb00475b95f752ab96610be112d33ded48624015781e7198f4dcdf917839471fbedb43c34efabe09941fab6b342cf672a29dbb1eed0db788dbfcfcc63bcfe80f7718571f691818dd6f839e3cc282f85f03fe0400171cdf1235049fa53de7450b4c40ed398d5a486f52124c1c63de2afc950e81839f52d17e2a7d32f82788465a65da6cd763c6360763561ed2bf47749080549b6e2db87514e1ee1c85a0bbd346eb6e3cc29267cbedcad67a287fc5be65ec59ba8b6854b31c83dfc5155187d4150685c5c2c342ed68b01ac9e44b60f0c100a347a0f93074dd37d8956fe2f43110dda66e9f9e6185c23dab74cfca21f3ede4bca87687549ea02662f45dfa0ad27f9959a120cacb7c419810e1b1a50fad31c12c47d5bbc61bad77044aa541d29faa6126c60ef088b82eead17a52843307d4bf798b853d90d14c5347ff10615381d85e964331b7a123d15a77a6790d93e920052ddb4db4baaac5e2b27b66ff955e53b8308151c81da4711189ccf0eb393c5bbccfa1f6c94a8d5f4bcd266fc6a12061967ce836ca042257368f567dc42de6ce0be84449234a6163b72069f25b7ead4b2003e1a7665e87ccf211abe94175d1c11bff2c0b6bc110194d34aab96934ef59804cd26e4434ba166d9833fb091be37b139cc10748b881c93690528a96ccccd2dbe024510b8da37dceab567dc52706461c486a0463369cbb99bcca2e8a4d2e005c45401964722a4b3ed37c351c9f21685e8992c9634349379f41796deebffc2928058c8ef6ea37c6e4970dedb78d1c2a00ea9e1ff1e7708470a6c60e6a2b1e966aa872776afdb238e97f716b3df8dfd42bf0f7ceb52bf9eb33731bdba5987b8f48b4599d67b383e77413107857e951ae0625059e5616ccb41131df9a480efd5beab3a9c99615921caedc53dbad675c00ba1030577db1d22731677914fa958b44792cc9c19e2ac71ebe61a05ee67ae7116e39e1c0d103f18bbc9d531164360d901da8234d29fb0b37cd2a60c7aa2adb2a4b297ea2fb14122ad95bd4592ef86c88fdae1e37dc8e44ad03c0fcdfa3801e93796771c5a2ec1e4ab12a64b3ffe48e7442c6224661ed5cc987aada6e778399941f7b20f16f94fb346b916be87f005c9c13789741602039d38270643cce3c347565eef5ee09139330301951c15756be47994de6f1802dc5131b9b011051b1d87d744756831a71cc8528487f032fee9dbffccc751e6a1ee6d07bb218b3a7ec6bf5740ead7a47b6907d7aa95b79aecedf4a637ead8fc6fb8654c93d13ee79f5d6258dcc61993aebc65e4fc14eea7d006e31f6e9f60e3bca8ce52ec559876fd20255e507daa99b185671ce1ac11d448c30bcdf97b9617195e0ccd2d15246308dd6cda74a8071114327fe203b1adbaa780f3243105c5111636a51dce966f5652e39d4f91abbbb4576234d6cacc3ec57cef2dd4dda49a6c33d12bb7595fd5ab5bb15b40301f34ddfb831a5dbf62218f496c003227fe6282e2ac054c45e7f3fc93e51b3ee8690f08612395095a0a12729d663eded879d9ffb325c62f2cb546a48bed51ae232fa6ce28a2494c132a6e09d98c2e3d478d5d2d15dce2e2665e4a3db448931068b99899c2bd8ba87349b0cf9e3c52cffdcf58a59b4fe0089b298b42ad7553f831bd60f5cfa3e09102fe773e4c05412973a678f3b3ed420433cd664dc7f218e816a17c5c9013ecb84abf2dd073557dbc41b92a91e0339d57b8b077a9a44d56427fec5748c47c1460b2e2412094db6d0ad06dea0aa0c1368592594bf0b2f590a9d6149e44dd4adc4cb42e5d9940d59397b83b33b88604c210694e3fbd84795c80c1b09ddb3b1ec8bef6e9dfc4d7f295e551a79436007ca48aa605ef5a89571e59cb26f2766e564e39d3bb441deaa0c8664549881d90a77256c0f6c77241fd6ab74b0e2890f78ff16fd2f9271ef96ebfbd0b878ba9c703900752b7447f4efaa60bd9dc9cd5673a36b39d49f54274caf03c0cf82b95141fa20ed3ce02ebf0dd74d9eff8eb9e2dd3a2976b244b12fd33ee75c1f1c459f86a1cefbc817f42d7f43ba406098165cbeab99df4fe751ae3382efce32af252e461652c7598161e74fd8eeca474fab6b1ede039935f2fd4d7562623b90a422a78941f47a76863d95857c33653d1b42b806bbafcfeccb7bb4a0c58acebf6104b2570afc3ca88e4fdf2719cf39c964a1ea7d2ae4a7fadc938abc95adac495093f6b959b1347501606b3f960b6d739291aa8c13eb49e98b0f78d2b91400b6d8961cb6165c8b684738e4d4db2f2ac30ddaa03a5e0cde4142b625e81907f08c60d7cb5729456806c89ff0efd08397423e44738ff38f8e88684f3a099dcda455521caca37ab4f4d9ed5d37975d4fdd778b97cc93babc804864a35e3a2db04598152e67a2f1f157681c3962d46ada23ea5d9a524f9cdbdd08a07a3a85b1f6fbde11d5a35c7743b83bbefd19aedf6d92241d16aeca7f33cc51839b75f111e8edaeaed808daf2f43fdb3c6f032ea45052ac31d4870c4d0d76aa75d0b88635ce449054013f234c4a16cffc58c95ba1cb8a0a0399861eecb1039bdedfab4d05f0270c6b16f03f6b8e629f687f133ebf2662c7f930530746679aac2791f54d6a95bfab5be0c33739074ed4e7ae88dde4a8036a7d6095cf41776366b6ae3f8f4a0734f48c275e129cfffff5e0abd042f99a957bf6f0f47fc7288750f4fe30198f8cad7067b36cd87ebca08abd3f9475e7443f83cca91a1ebfc42ef3494871f51f6d52a5524b9391c687571be5327c7c94ee2a096653acb410917fd51e56a92be4f24c1db6b97b465ca84c31c04c2f61eae07e952eb6554aa4d8a380d9ee81c1c462c360fcc3cdff2867a953b655562cd06162af8b99bbe662e0c27ce4d9a1c1a907def48a3231c2110c930a2f1498e32dbbfee0e5c5869332f3024fa5dfb0327a27c663cacd4e9902de34dd93529e90eb347bafa5035f56fc578e8386c7571d1f0ba335225ecd8be026b4544ad70f3af11501a53119ee39a8558ca0ed5b3d897ffb9cf0fcab55a0942d3bf7bc6b94ea27a6b748f2cfda431f35252c44610b7e843ed91ebf7e8fe10638f04f52d6d5a7752ec62350efcb7c473f80b1f2a26805151e8346d39d23551e92fbe372df7979c3f756bbb43f6bed09bbc6b65fe6fd241ae1c2f1a0d0b805c582853b85502968f9478e9a84895f9d4ef01ec4f3f571e57cd0bda68ee1f6f7e14fb6e0f4ef8c7dff6796472a935294fc27b16216966d5021339ded059687355b42b55926854bbfbd9f974a0c26eadbfca8a6183093996cf252894e6db910c71ca3ab2e82d90d371c36b92c9409cf7937bb266ea9b29c41d774aa522e103cb30bbabfe872b57beb027623742806aa7694a859ede9bc1fd7b9e32880b064b0030fce1a0e5cdf3ce558a5feaa32e323dbfab6661c5878c9377ee52a615b7c17bf1228e328aa20f92d070c71561969e1af532e76835fb0436810c3d87b982217edfb1143bfc3405ac9f6f3a50145608dfa8658b0ab642a347255c55b59cd1c5897b2cf625a0f0706c30ca1c1321e90cec57b7c3d1bd1af455e3732db80643383c41eaa6781f63da6233360ee720cc04d171ae2445b0c071e339d547f7ac32f407d29ec7abce0a9e1ef5276544877bab2f84bd2eef47ffa66f96e7170cd54d836c9badbc59435146031502c1a3cc744a470f693636d9050c5b894d2d6047df60eb0bac16d905d46cbf017ca69d66427cb88036eca4ea9d0e579f6bfd8a4a850703a0fe49d39c107c9358e98689fb62bd0475aab4b2031446b437c7f9e373caf0270a28d7b15c71f02079dde401e26175bb6e392106a9072021f0e5c5145a1db6f595b032faed8551f6e2ce318db1ab513db876a3eb42d225014949c19543e9c5dfd2290e28c5d72c87223f0195ffbcba1c02c7d0087721efd2af6881dee7dba7565e07abc35bc3fa41c6a4d6a313222ac6dbb117c69c62db2691c68869ac5fc5e987b0ae4335f815c73ea4235da2582dde81d6fdae5911617daef847be17f2bc09edd88830eac03977f89179fe03eb2dc3b38df43803ca2d38455232549110f4580ec3cc04c0d8cfe493013d2cde47c506ef6a8dfc42d998f70378fac5ce4709345926dc477e9e339d8c87ff6287ea6e2873e14d538cdc3f2a47e0e37a2601652f5b665b616a7d1ef3537a3327a76f93990f7694e6484e7a52a10e9eea2edc92b99406abfb2b11ec86667c7af4a333dfe900bf071d1bbcf4f0ad768fae4f450c53817c507d26e926e753e3395201d3ad89061f16706d841994abad283f0db74cada25beb5fe46f48669a62e0b849cb77097e1b4578b45062af4a071b04f0cfddf87519cf2bfa10ebb4b860239ff187e6dad73806ae968e6ac0f738baa88edb3ae4883a9e59be7a6b222c5f54818f95578daff9fc7a7aba8c4a41a699923e85ddf24a32bb71c808516f64d506058a70539276d57984d75161cba7d53a4a864c51a249a6b8fcad5738dd0055ba8468b56579ba5f102642df65c598490f3a0c9b1064f4eb1962c4c38bfb7d55d496a0b0f7b3f90b42f733d112c89176aaf937eea4bada845f3ca4e9b56b3a5a06b4c90fa4c1914ea47020c2f32531e270007ed389246906ecf2c4465f7cc5d6a347583dd73341ad97199021819be81100d867d628323ef7552db945e4c0be604cf6c4a8197958bcbd6c1879387d3286dff979632c54baba2a35ea84efd7726b662b94fae61464d069e0103692599fb86fdc3a06e01c6ae3deb3de6fdb21806c716e5f82b784e4ad3f0e2de629a18e3a2309003dfde9dde8e5101b83312f76e811277afc286b56879f4eb80468e58c60bc088284d05d725ddfe3185b7c51b472a7ff7db3930839142d4a452ddab628e07d43375801d7c6a711a55b452748d770b84ede35920c1ac74b595baef963d21df9418533fcf959593ccf5afccc753e86c4ae231eafe77a158c2472143faf169db29bf2b53c3288d8b3c9added65778095f85e2cb471ab58362041f0a27d874c42bbb06385a0403ca193cba67cf70029cdb7e73c7e2267b856fa0b8dd4c706b45e7174659b0ee2891df911724324f7ca5daf07c912b9b2abff762e62a1817688757492975db7185c4695f3a90895634b8d07453b36dd95197abc31d5d153dfb0d0ec92639540e99d6590f9b394f14c93a5e829fbb33616e810f59c502be44a13b700fd3009545e34c211abf9afe1bb8ced793c6f516d40010649f83a78ddbe9b71d8596582997d0aa54192e1200db61dade30500d72a184ca7dfcbfb80e5442f489d316cc8b75005564835d4b11c482e2c4d0d160f14a8b13ae0a0fb0ba5e3b782770aaca357df0e1c4d1c3b28b776a8b3e0da1abfd4f7190673fca1e1c5a31c688d6e8ddb21300e4178d07c4e854a718ac3f672b0120d6a54c16957c9ec8c444208e47737bc4eeb0bf2d801eb2fcb72f91fe988aa75f38e6cf26e858dc2a718580ff5d281d13e8fc3e3bc30c75c0193481c39c375a5b06b962d9491f3f1fb80f1cb27067f0709e0b0730573a9b5f5bdbee1708ad84b4ceb1a9a61e4c41e90655764057bfa07b8c81cc83a315be1aed6a49715479c0fd0f53f625fe6c7f36fadd001149ab978532e4d0de3d1a38934c74265b161899843704fad16ffc6189f42a5cadec98603e0f98c6889bd4a559079e074cb40678fad4690a20d988735280a1ee8ea71275069132101b35c18ecc9d3c6eceb4cfe9b165e4b6acc17d4f113ef8283c0fb6506f5635401e916d4f7e7bc3cf49aed166587a0c72cdbe673f467d81bc2e9cd08cd8dd16d90b353481df31e89b45e8b + +[L = 48] + +Len = 16 +Msg = 3a35 + +Len = 104 +Msg = 7db15b3ee240b45d4610950996 + +Len = 352 +Msg = d2a1efc725c46cd6a19760f49edf0bae823c1b4992ae2260085746cf65833bd008e56e64002383f51f960239 + +Len = 1016 +Msg = d11ad1253592c094746da7b5c88d329bc3ce1929913b8be07e82d3f6b7a536a855f31ad197376eba6f2f4534413fc4e4e7673fdff8739f774a710754b568b7c61a473059a41c98aa4e86617aa66d2601d0f0d584cd9f132afeebdc0ce3da6a8b290059e6e4aa080c195c42ae7f7e1e99865223439929b0a3a0d79b46ca6419 + +Len = 13696 +Msg = 2f7a9929dffaa4a4dcfeea1fc37b18e3cf935abbaa17cf9d834b3a8d61e9fabfb7683cfc387d6f46ece3f8bf845827c7ebe86a651d6dc1e83c5772cee1a9fee4b04453af2f68430bd87835126cfd1b3f8beea4d3822fb27864570e255cb65b414197480b6bc20a39c5450adf2474da93d72f6ecf8063899722d3755b7a19f71e93e782d89593ab19ddd3ddf053c54e0bf832311fbf132e8b9e540f38e4d9bcc3cdbf69de54e40ef348a9170ba2f65def167f568ce846889c0161448342fe907718a465e451bc1b0f2e4f21f9b911f186589f43dea305811473837c063b915d849c20deb43323bab4b64e61823f1df119e71962dd975700391b411f8778980a3080ba3c14a321d32c082d416ddd2345f0eb751a516d44ee55222395cfa11e7fc4edfbe7cd49bf4ebd4d7428843a2ad5538b3cd201ccd431aeafb146a65d28a4870a6948a7cc0413b0adac7e8dff3a898aeff5f4b65d10b28ceb749bd354c061c3008ec569d5f90a4d4f5caa51d35b49dc4028e738c8ff5939fef3fa202fed9ebef6f2c7dd0ba41cdb5c0c16985f96fd93a65d134fb4a90ffc0fb6cc5396b843c2151bb7c9170f2fa4fb44292a4af28df5481de0c3c917ba1c46467a35302738158493fbf6a0422cee558d4bce3d78e14b4fefb65bb05043e2cc2a6a8ea64565ff6ce2fd2c4f43fc02926ee44ee02fe1dce25cfde0115c9396c9ea06269f17b2caf58e2332cc1c8528d9705c70da1f76f22aeb1d1b93449180640fb5c4c4a708bc4621d7d2bed5b1a752191cfdd45086d34f247ed1df0f24e7c620de32bdfc4d1f882380d2cd7467c926f48abc75cbfac8788f88cd9dc5361517a5eb36311e6b39e21a85fba2038fd47d860f776697bb19cdb5a4d6746fae507e274399c91648537d905015e58910117e5914f44ebcb00e771d38b30c1473e1232d4e222cebceb4810c48e83e0fd4c852f4fffcd643c0ef9e4fae2d0ebc6f102f3f749b02a5e3a61517d53b539cc24120df3957a633d50369d46c0c226f8924cae51dcaf54d716f61385fd8cf38c2c311a32bcd6594d6930133dc18ef36a9671ba8b179abe95f588ef74e8558ebbc974dc73c26bb6eaae78ef464181e18b71f4b0f986ecc8495a9c4dc0b0b96be9806fbd3d32952ca3b4737a06ed6561e9c9581a33a720123fbaa2a70fc3233b83e56444f5aa0cfaf70fb24be6118404f3e11e6ea004cf2d079a3e93a8ac1d4e297cf4fc43851dd26314a7ed6a5a784b386daa26e50c64692f7db28c21d82234289bb45bad5042236667e6d70a24bc9525c3adcb793a6a5725d9b10911e3bc8e3fd604db7998346e7f7dd1815c0cbb735a977bd4b32b5b976932bc92ef3b56bcadc089045ec95f241cdb0a84c67f1f76353da6cb493bb27a881d37a2106b8b3010cf935eb3601ce4dce3e449eff8331e444ab117a20809a1010db4cf3be0c488f777b6532df908112e3d11592f04a0cc16232d62340cbb8b5268a662b8278d37c03d848a04f0ab498f5af43b0a20e310197b7e1395a65299fac29f051bcc5fcd09a5605bfee370ee8ea21f5807d9748acca815a44d81796d68b0014eed3bb6a94233fc51725de3809ac6f538beaacf8cbe3d96aca21a7a763a957f8892f22c6d086d9af2e5ac9d90321e186584f17e964c90739559ddd034df076c4aa38c2b78aab6dec8ef6be9adf33bfb66f159ec4826653ee6cb483539c47a4a1d95663e6cc7a42a3bf628623a4c9500a59a50a312aa104b198ce5f3e58952bb79ff1ccfa9ddba2fd4705e91b5acaddab9d6522d7666264ac5f533b6d8ac4512d8371c69c06b6d322b046ae2a0a20aec1c3bfb05f3d91b9044cabdd873abb5f2b0e3e19740df31e39828f9ff9bbb20b73541a7a70b8174ce4e43e0d356e629cdbc6c08d29bd7acb6a4347823075683ce9d7de4ab3ddda6572b175951f30a15263355fe9641b3322df7dd52077402a884cd472e6d0b6c34cd63ab63cec8760c7ebe384f7cc31066bbdb7a3417425e039c4d340166e4bba4839076ac9457c87459c57957d0a06dced2f7a18acd22b7295785dafa435a2a8a2c3a1fa05d115fe129d19fc44c5a29bf15b4d9c2b375bc8e591f92756cfc573a39b8fccb8395cad7617b11f14a60e2dbf69b897844cbbcb70363010f6e1bc0590ea594aa924597dbb32a868b55551789f82437180b85661809089d34a168d44b4d788dba23b13542715843eee797366d9ce7793e72331735bc78cd61b13421a568ba3e66926921c04e9d00888ba7ddeb474db63813756ea4a02c1823083e36ebd2d32d5c88cdebb98d511304cc276c7799cf84a1699ccac9569b13f530c762732e6bd0f8415001b2c02d11dff36660b717054b16df49ba38425e3764a56052ffddecdfc686aff22079897376cc15591e11579fe4feeccb55f + +Len = 100816 +Msg = 5f464d3301c5e0871d6b41b002dcd09abc80a805de3482d97f3fd7b9838745da1c0534168f76b93c3c53bbabd904541ffe5179cae619dea77446140b7400f47d242141c7f2e9894d88f44c9e066861498e7394f206f594a419790d697f6a11187f84bc6fb288186109343eb11172bec076d041a4c7306d7978c009fc2d2d62563614ed3555ba2d21c8fcd70e8389352dbe4ec808af3231ce990452eb05b1b0dc4fbb1b4265e69235cc3561dae4148c386cd770474863a84a822b2e5f905fc255d55f90bd6a760d441dc52240ba7d8c888a5283891a2c99963d1fe680549d6267cdea92cfead167f6c49663668f2bfdc61fa647f5abf3ce5ad2c6c175dbd456ba41436aa06f5f68f5c88e6b74ea86a79934bd05b486210d3d470a0967ad6d67f7385260578088d7e63197849354f651aad07e04ed301f1fe7a6d2047d50ce5dc6bbffbb1da6b47d740898f4eb54e3c5a1fbd18ec93254cc01f705fce04e6100ced132c519674b2345547804a372b5c925bd9ee9701527db33408d37b72f8d18b882d3c4744eb58f011d21fce336d426de1fcd5e09610216248b51fe2b79b96c2bd6ca0155e05a8a516b7a24d529a9a475284735bd9c4c437ddf399864b64fc5d0d6ffc4e5a7a3dbdd476bc39ed29a0a92e1f2b6b3506c2be5452d4f896db6eb4f895b554b2af64c4cb8dc2369b91022dc50b7291404cc9605c31569c32756a64ff8c4fbb0f1bca346c7b58a5c6774b2fc7f7fd50741d34c8564d92f396b97be782923ff3c855ea9757bde419f632c8399763003b58ee9140c2d62e914c1e1fa742661a9166d42267edc40905b35a25d5c3cb3fb457376b7422896df7bb19c23e8f764416731d2e20cf2c1beb8663c07edd8f105e078e2fed05c5e5897c430017fa2160f565a75a4c5c64a15dd7d644bf355d169ae2696ae5ed1a39e8f81055cdf315e5b0c6f9235515fc4dbf30281ef17b83a6ed604f89293904bf78c7183fcb0ab236cb1f8935e59c51559217efabc000b165d819b717118a03facb61a13a99b194f8b6c7ddfe5850127d79078397a56564c7ed6716a129409680434061b2a4782c9006587de927c1ae09d6778a5f1c39fc419fe10493eb0d4ad492fbd05485eee7913c59df82fe7182af2cf06a6e8edf06676200077bd1408f5c1cec537cb8566470cb44895826d04ec20f0aba4297c501add65c75d5767ad2ab63aa81b7b66f01b32590f1d55b7e50e6df1ee077a19c8c895f5ef62d452cc336e9aee171fa997ddcedd7af86e6cc37722fb5838a46c5e58e7f700edfb7c6bf832171d9581f660752867118e9535a6118635709d6f1c1cb21b938068958e956149d9bffc67f355cb88205d4894ba97c3e3c8be9fa2d20abe79f3f93a6a2f4f56fd075bb49a4b7dc83630e58c32a29d757fdbcaa607352f65483cf2cb4208a3bf94ca7a25e2a4e05279be31c33696c10fa4971d1b64ee938dd299f483e5c098845749a3b706a787529bf2ca56693d0a7a98243e6482a43e1f5d3086ca1b00368d8ead5ed2d0fb79b1e2f537ab9340809ca3a9b5eb2900390432293008ab7086c2811d33de0648be5597ef002c7c462b5e0f4e0b1720a98b2299ad7aa55eb78f0c77c2ab4371385f280107ae40ebf814a8223dc74f31483c63d9e4ed09fc7e5a51bac34d69d97163116a66c84ea9fe4263269b71fd228555ae3cf5109c4d6ced7b9049a2b8069bd2f71834d6c07fffbd7561939188bc07dcea08086bc7182a5270427c3199bf5fb5c4549861fd32a38ec81c4ab058c777dc01864787f0275f911a17838272cd65135f66baf06d8d93bc439eeb55d50b7c5adafed8eb8140b4b05f59871dacf954f4b096c30b7857774fcd319c096750bf605db8e31fe02cd1b9294eaf8bb009d4609f2cdb3a8657f650501b8553765de8f572fb91ac77b35db35f402453e5c58f60146f2906ff56b9c6b3a5d0bb6afb9e2201110919ac9c01a7e9750dfdb2f72afbf7a8d6f64b1c68b9de17a2c9abf289eef24074eee9b1649caf3693118165503a30200993d271aa31b8b92606a10a52612dd1fab495b82f9a98cade18b9d8a723a71ceb63fd1d27372bd281f9b40aa1839b0cc2f2177a09aa8e7b159ac118d7c145e7a4f032e788d21facde2b4dbc1d5d2238f530d9bf9bd2798f611d03ed8919f0c85bc2da99750b7a8d6322d2e66ff6ab9ebaf7424e8c1c3f4fe92be61f65359106395f5ef995e925be3868ad513f561f873acdbaf18590c903d64bd275121c11ea655124d091740887868544c5348664399d3da96e2e35fff34f062fb939d656bc072096e510b40b2f75ff010af68d64fd0acc778e2e13c9667de266b1816c4ac449521b02bbb217002c604be72e73051aa9048d192e3210a68769dd2693e5d44951711aed3a751240d42f8925844131daa36c51d7d59bbaf99623fddf1649db954705fd6f3405e63894f5258c9ffecf83208c2c90cc55b1a8d2972ea6b3a049ee54942b50526b7930953986e428b2c75e47ed870bba68dbfa624dd94112f3059da0a80c583baeb570fe8314f5c66501b34116c81148dd22396fcd6479da49f7e952c8084f97d6803ff85c3787222064ca368f596a1ebb6dab20a03916b3ab071c927d87fc10ecc4e7ab4a5761e3eadaea4de1a0dee30aa39a9e4dbee047201d7d8a4df1284cf668ae3ed7dc4cb2cc4b5cae9307353fd2ae4c105c5d9f3bb021535fc3ae9bf3ff54ddda8b2e1037cd9d69822df436dc1c750a9f557d1a3a63fbe73c64261dae0c70bba6edb57519f5b957f138d1aa5fefe01b73c1851aea42938147bac2762527a492cb85da43014c876e223b05597354d7c9b328df67f354d168a84ce86dff57d8a870db034196dbeff83ebef80bbe52425a8810f2c9fea29ee688a201cce4a5f447be789a3881a9da3b6c491288e8f1091719032608b332e0410f4576597e17e0b5dde305f069be2e80d565bb979a3915488f88e3ebb90e81c264bcaddd72b8843af4a4ae31f723d50fa0995b027c334c351128913bb93e67b1b08f101f6b8dc8202b44fbc3d3dfb530f66e5a8f35e69725c86998c05ac87c561a4706e90fa095adab4a566da4fab82bff6b20076e5bdf62dbd6614245b6a6f8cb6bf60106f8d12b9c3e26f8127dc547e2181531ce980a3273f452892110cfe1ea834a30f99d66e026a9d22dc76fc3cec8fda2d7fea701deb84dd45c97dcde57a017693e90983a156f11c4d168d89c06d8a32dbfa590adadd16850854f24bba315b0bbf372f03711a20163afa0c137383b9120b26c59f5e9e7cd2ccaf0ef4e0d70d5a81748ad441ee5fe178e14317cab184fe178fb0cc0d82105d2f423467fdcda0f9871b9d84882609248356f3053a99866dad9f9b0f8c4a897a8cb8f30365a7ae5f3ca6e772d863d445e6d57c6a478e35d719d0e4e84f3a30b1816ddb55bcd79df21ea0e95da72a19cc1fe74fc576120bc108be3ed4cae3bea889fb4ddd67efe858a994237378eb623dab070d954ac780c1e6d2095383c98ba622cbdb18fb53260979fb2672c21a4600f4bf06583a112d303096d4e30e7e1060d869f386eba3cf7aec3052ca17593dcc9969fa9cd88179c262770211cf53f53f175037a5cd445d239cee48f7ed0aa1d715a22ac18a8aeecf191d415e4afd92b76c091803f4c757a9e89f696ab7b11ad6d5f24774e4a004dcb0e3f33705dd8150431f051016af37647b9e44b10bef114276d4b1055b634461c655a82a847639a038ec9f58876e84e9a2955b696e072d8054c3f81173473604d5fcc0a75b4a340dba0c375beb87b8b01a0f2de232bbb8371c3a9d27a0ce521c4c43dd3bdeebf92f42f87d88978d5b4e3e563cba0e5f59dd29c31096885b113ea5c57e66a3be015b703bc26d3fd1d51a7c14f85f65747ac909d7e30c8e800be27eebf4a62e42e538ae30b6883907cebb7fc5e150bc9da3a138f394e817df9a9e44420078f30d0d3d6981ca581791a097a5e3982c983d5cec239096c7d8cc55c87242026d769ef1d04eb96e5b5001e3358af88d417cc61f107659791a35d8b5f7a5767ae24d5b2ba7aa12230076db1f1b9b6f213dceea62949d98bc5db38743b23a59ea75dbe4231a285678f5f07facc053c2048022fcb01f15e8c100d64a877ecd56d196a6ac60ae35e0e09a517224ba409ba7b70d8f9fe65bc427b212a4e9b3cb17b0d332267cea4f3bea7c1e550f7ffe567b20e3057aa0ebb560d00d28e2f7aff718a9f2d4d044f0d20709bb9ad567c98cff7c4810e8c542370cf90a491bc1088f69998d59f344b74db6c1bdb61f284e99b517a11452ca0bb37c7bae77fca6514b341066086e600f098a32a92935380a173c9182a2513584c54ff67e580dfe16b508acf1729a3d649ff1eae286bffd688fe658612d6c8e69e6e7f7de4ba85ec54747cdc42b1f23546b7e490e31280f066e52fac117fd3b0792e4de62d5843ee98c7201529455c85b169fdb90cb05e3403cf2f737148bd20a53c73880880a14ffff37d62130e682e50bc7210ea6c1f0c27656cc1785a0d9ce93ff94dbc5b2877519d9bac4a339e98ec594a7cc76f4ddf994fee8070dd4b8e0fe0e51b93105fcf566f83d914dd862b4ce78de7e9e16f142234bd969ff8005dddc641dcd3c7cfbdd6113cd3ba34a9503a0f433899e90e158abde2ed4ed4b3711c991577c5aafeaa982bce80835f8e6d7c7975571fafb1499991646bc499ec32930367d4b1de76ff656442cab987bdecdbcc2b2bc35ce01816594bfa4b6e33080caa41dbdf8ebf2205649f98a2d3bf331fb16b9ecd1824eacbbc9f81297b115b4d36aa7496e05f7d40d4edd1886c1bac10cf3f97840a03277e6369e7a7e90d932050ab8720fce076de5c355fb17959bd75cfaeff325b0737f8f5b1160de0b0184ba04afcc30bca77a6a37e29662302d01858c0bc1d32b883011b7df5a387805296cd91bbc835a3e76152d017ee929d4cbf137eb78db89d71617dd76cb00707aacb8088ac77a1f52ed710331193edb29933a7efd8cc153e6adfc2c6637e88cd86b06036b8177847b4d086b0ff9b5dc91f3cbd1c08217023d7449253c25331594f0f16a3c5f2e122e0145c4ec94f096b45a1fd0b2dd3f1d51e58978471782a336eae49d7bc4e050d1c6a391658f71a1f752c0ec6302bc2dba9e3766359359ce34955a2db86740c90d09cc50e92dbb76e17a39955fa7108bddeaddaf860d1aff14acec8b609ac1d336270a940604209df91cf45be72edee04277d694a6f968ae6d8e065702f3d607f3baf8db4ab7637fa4c78bb0b7fe69937eb1dcb616fca564a5a521e12df71fefbc321187159bd6a47b066a3440ba634de9153a94546b63aa33aed9da2018e1f30628df37f5360ca4f2660a46ffd73e58183e8abffdea25f7bdf798a2b7cddeaa481bcc6e682a67e99143066963d96d4a928a478951dd6ec59b1be8cb23aa688e1867738aecdd9afade39c92c0b2572bdde84eb912ed990ac618834c412231216fdb84f1e01b3f8414fc6dd0f646fd0fa62bb0157b3535e1497c9272df1cc5dcd4e6ab9a8456222655c56ac73fe0d2aa8b599035daddf0986a45b1a59510abe19a11b6dba065c8bcf8a85d20a3681c2414dab7c036cc1358b1dba98d6ae62c5948c36b5b3e307a6f860c0c822ac724a5c917ed5f98ece548a7a741d366868e6c676394c3659f7f6786594196dde332543376f9ba0724b091d30f431f91d919417e5bf7ba1e9a21cb80f6c204c3a58d59d960a5788b5cba5abd7c7518f4c5170115125de97009a6c3fc4d5773e4f57fdd433eb7422c7c4dccee57a1679633ced3b5f08df763d4577983c5ca8b49bc4e08fa76f8bff36daf0fed068db47f0c87e0e45d518dffe37c129cc6e2f5f9e0430185723098e715284a42f302a6b8368a4f2dc16f534d1e5db9d0b86659fc4ba6f16c982774115d02a57684c7e5489b1f491584b0f0546e4194a6041f5e5be3bfff3852a4fc772d83491023a61a37228ef6260edc0d1cb972cba610d5ad1d92d554700771d8236ef55e983765ed8eb21e7de7c8bb51aee9368758454fee4a3f32179c1e54af1d069e0b9728cd0554351907e018146511e4d6f0450b57c8ebd21c71450116296bdfc779945da60b9192c5bb9a67b1f04d94992df4cbb3e30732dc8af2177fef17e0b7d01740b8a64db16bc29c1e589b6bdfc967edeb2ce8a649ba892bc856a929f0b837a838ca7f917a52436ea3d20e72afacc5b9d58a7fd0fefd96787c65ffa7f910d6d0ada63d64d5c4679960e7f06aeb8c70dfef954f8e39efdb629b72979be208d616071289cfaa0756a4bb5eea5c7baf8fe7a31501e7e2d67d708d461c0c93e85f03afd70bd9e16437171e01a34f475e4b5a58d13ce4e2fba72bbba93403f3f8981e0bbd6a8a6223327bf096c44b36e0ccbf7592a98c1fa67f198b628787ec80aaef848b4fea158c715799e6f458327f399e6420f0e7821f2dc4663bbea065c7bdfe830b6102e2e7193381b9dc7f2381ba808c43b8fdf3addab4b5fa81564716f7d46e0349d9b27b559710d723c7ef2f79eb55c3a9d75b99ae6fde6877b278b583f8ae3cae776b914b0cae0772397fd19b6a27676c7ca02cd07f4b4d49bbe1ec87f2ac7e39e5f7712319c31271dbbbaf4b826af8a9f4acab696c62719f7a6a032c4bcf90922a3c630647b7c1c7b78b10afbd863f07486561a0bc8d9b1ff5fc41998a7e3c604e24af1c1df2da1dd5d83eefa2e4012f7fb5959ef9339574367deff73723484b5a969c8c23dc251a3b887f34b9ea09c9a1838e8aaabb254445d7556dda257dfd5579737fe1dd6c67f3851ca68b011e7cb7b6958d588f143828f0bb24fceca31b47b77d1ce05e75ab05b55d6c9f9107f0c738f2cf8a1629f7e9b2694324e082503937ff8ca7c5098f770289af7d038dcedcf0ed77c8b82e2a9003a6f3db69e14131e144f6be7cf0bb5353ea96aebd78befbc6ceae9bdde97823cdbc5ca8ef8a993a9d9383aee9f2d6a18fc64ab92990672ea2dc9b89ed248aacf7f1a513da43fe5953335afe76d78867a066f226ae9c727c6c60671c50a50732698ef7a492d51998eb6da5368a667baf6d12b77eb36686ee0ca239dc6f3598be0bda79e47f0891fe4d8989df8c685480de11c148a2b44c8a6bea3a50b09be557c51f545a09a30e9362cf3080e6a6bee3dbad370ce24f6c5a6f8091007ca195057fa3af8f99703a601086c2a1ffe55fde4c2c4153dbff8d6601ab68743c0d50d021b0b3099535ba6c40f866ca3ff0df7c19d709a3f58b57b40ab5e43556a8c0c1938c875267bb39c0db6b45840e8ee7c22bf6b48798bd744f70e42fca343a8bdfbd7f55f275ca5d62c7288756d4861fba68d16d842c5b893c1d8171bb3c8b593387d3426f292ace5cee7753c9f9a12e6bb9af5a24192e4184f7d3d191d862d3c3dace7853eaa235b6369fd164e5a7bddd06daa3eec7fe4130e82478d36f88a0999cba1f251ffb3a7689ea2baf016073193898716a9f933448d7ba8e0968c669bdb7dd5e6e32fd84a6ce9e8632b393f9263532ec2107b4c0d2abdf3abb2de2d63511805eb58a70bc4ded040d76640af60ce7f03b9a682b8dd84ed8a47225a48e0b94ea47828f1c8974cd64e5027d8b13d43519875d2bbe4461a7f0f5b5b8d63a472765405ea9c994225806395e64dff88506f7f7f3b6368d769e6e550d4e3e81efb13771cf403e855f75312f1383ce4c2744d0b4e3735a0f1e1b99eb014fa60c0d1ca9035fbc4403330c2fefa8411fb7c3d6ede5b5c8f4736106bbe01923d483a84f031e9685a3b6a70646a2a5059ce35fa496b3f21fca6047471a5bdd33908cc9328de9fb032347c249bf7093390b750696124621dfa67fd9c7fe85d6e5a4d277ad8f8d169f8b5e8dbee280f8443518bd94abc5ca704e781e6cb1868ba2d6fbbaa850326fbfa5a20e4df6fb5f8ee2728e86a758763a8af21e1f7a8584d3f0b09a0b19fe8fcd37bc4fdf45084d7fd92b80544f29aba52496e2c9a0aa4adeb89820be321cfd2f0a53585a15d04c7fe4ec9be6eb5df419e20b71506c1f642df75c53a9e3b2414fe6102fa8af7be3f6c95de824c31fd6fe8ef9d49e26095a2674a33cb574e9e493939bdeaf5b309b4c51256ef71e95dbbcee0a11991693b533f916e1c82ce86d65d89b6d596017fae944ec364546e78abbcbe4322b83e2fcbb4c5d4ccb54d8642c7eb9e28c08598a356a5c46f8813e6b63ec2f3e3bb721b726361f85a734e0514f4e9c4732991ed3998b1ba8f618c2071d1b943eb0f8766fdb7f0492421429bd380deca3325c8d5c7b6ed16429539ae54f1eba39748f09aa44efb67d863cda304e8653ff7499cfad44dc27807779ef8e63be4b376ec403f3c84eda4e5af31c30f9807762e0980b4e5d9dc406cad4e888bfc3ec4186de8ccfcf631b0ba5831747a1c200d45ea06ac82c7952fd09aaae5dcdf5475da427cbc8c1f71ebe5132f2fcae15975ed6fa14a11b38766e1c446894f31c0496b0e5e96507d28e6e4549d6d78841e40630ef306491a1da60eaea3fb69bffcbf192610e2e07bc1124690fea61980e8ed654c5e796f67d26db5de35b4a2c67427833e360ac2a7d4fe7a5ce572144443ed62ac460c1b19402e85c79e3d80e1c143279b20a66d8dcf2bfe1cc44a0f5aa9b0d9b36c46c2cae148dd0f2ffe9a8e6e7274d1832e57aa39fb40553da6414094e838d613a20ce9307d49f97d904648d6460985b01af769800cff9a940f70729fe40e98feb64ff0a81c5b2b096b1a9d832e440c49e4e3684bd17a5169fe138d2544d9806fec027dd2a67f1856178e090f9bb2f9b314a202e7e95f2e41fa80dccf7b1810e9cbcaed2acc2445d60e26f7d63ee4b28e4299e60ea4fc659e7d6f0de91748bf1ede1fdb2acde9482bb76bf6716847eb2dd7517e0a94f0bbf20f248d2c79fa0f518b67a44d5c4c73a9bbc3816ba85ae8344b5f377649da75cf1857d6e4338a76446c48e52cc7bc7ce283d4252f8fac5e1427299edc33f84798316f77bad4a87849e91a1a23c0b7a86898046e278eaaa15ff33730a6d3f885dfe2d1dc0acda2a9e49a71cfecb7dcaa9e70eaa8fe15d4567a280e8960ba49d5289535907e9f277f96e8e652c21d89e81696dd821db5b7e1e53e160584477aa9e4c0e12160c9956df36cce6f4e724dd543827366010ed3d843cdf4319c1bf968a70e9b1b6bcd8af96c9eb0620c569716b7bc42e13251a6adf8201faa129844b5e1d699cafa1b66a674e732c7662b0410e5bca2704c5ebed7850d0ebb825cfb0627a183cc9643b709aedeac2c06700358400c389f99666ae97ccd37f265da7addeb07df9ccad6fa777d0da2fc47b6235179136bbbb409596841e921eb278142a19e6203c7f235bf8461ccadb4b47dd290d36ac27126c808b866f9531261f1e0f5c458a6bab6f064b4efc432e1c7379f9af19ac34c5c22e76e6e7651e48f9ce44eff542f018397889d896cc9001a63e8e455fbe4a9ee9a740edad894fe1af2bb21a1dd0318e28ba982c12ed69c08835ce17336ad1638af3cfe0ea892ab8e83d3f25e6bd98d5e4d36292992e2122c265a26cbb3931dd4c1b0d0ac5ee19974d0dd45777908bb416cbce52531820effcd7f28e1fb2d3d4d826e1b2673e834485a25af9f9d174f566abc3b36732ceefdd91a7c3885e1d10d51c321ff704d0883905b7539309ba5e7b7a2bfefd0494e90e9da7541ec37858ec05ea9a9ec5672b113cd5ad6ebfc5b8fe40ed7c3f17d8a73703dc89086b4d75c5eaf06b840bb2f5b4519a4fb17bfdca9605f17253f203efffc92da96fde023007d22cdad05d18aecb4bf08085c5ca5eecd21f2b611e7e8a0ef981fe7aa2014f5ac6862fab44011dfd33be8a1226943aa7ae5fee9221b0400d9ac2ce5241b09a68cde6b13c47d50bf310ecb37f25c32770a299020d8500d8a4b5d7621e4379dbd6ef34a9aceefd4055ea6144f54bbfedefb5b5b0fbd1d81c7a51a802072ec3d84f34585f22c1df84caca07849b1ef054cbef9b40848e9fd238761df5358cf55a79a53a1bc749e49ffab7c5bd9a28bf24ad5833facf43bcc3852c1e85cfe47929fc49c325c20d74588eb9833519f192243cf96625057899b70a7c93f8fdbfb60d8129d9c43c95f8782ed8293641ffd21d21d91a0b4db69d766f6d6497e9a414ceb04b65425d6ad6c8811da00639dce8d8030038f2d08330c75b0879aab81bfb3330b950e54c13780d308fceed2a103a1a8b77a923b66aba737654ba7995acd306aa7b80f632184412e2369c353c2132ae614553e626f0a3436959104ba6e0040dc597dfbc3602a49e401bf2249699375b2c722083489f54fcdc1f616a133ef6112a1754818158ff78f245b9046100b0e89407f74145fe336976af971c054f12d98002c68b3aa2bd699fbcd71bc4dc071e430bbf694595a951e01098aaa499be2f70611f248a694539ef8936b2e8b7a3c5de8662436fed1f7bc24a4e5c17a663d9a23b4692993301b08cb3bc10f518eca51081c717ec8dfbb0c2669f7987fe6aa0bd98231d8e8b58951b42537f12884a857e02d62de4fda6b88b6b754b1b27394c6a819e0f92f6b2b2473fe245678e252ed31477cc7ec6895bc361b718fcab3aa550fc9faeccfe77cdb5b151ab1db2e569b5bc923ee26f0b6113504d295112d47218140e44652a10af10a088f95c7cf2fccd040fc93980939122411ec643e26e7d69ced3178402e320fe156e774b75b5afc2f3d6b6ab828bb4993b1436faa5728cec34d66f520f59e82716ed6d1324944c3c91d04d5ffc5a921f4716c39de24768484d0096f7d8dbce35aeec22db11f899e5e7e3d57e7668f35d6c0db3542255d9262137d39ae6cf9bcde254dfccc54a6062fcf8982f781d9ffab2df4f49ec04a72eb9646d63bf9e1799bc0bec0ec7f0675ed9f8dc9b8be15d9f2175dfa1c8bc99071c70ad7bedb10a4143fa91c89f54777f84c9eae9361cf7f4c2b7ab873ee5785a5241db0af86f3c6d7f091623d6dc576d07550a42023633a09c8dfa21d7e70cce64c13f37663f75c47921c246f3f2d1d16a8283ce7697da4cb7e016971a2a1d0c59d6202bc18b7cee3828de597efdab53b33a9fb41aa7b49f1c964512901773bb396ac80e90ba1a94c408b2860065ae9aec64a41d76cf8842d299d0babf14d5840d647d075c34175e26a786f30091a24f1ce8db30137520dce1cfffb6318a0d0fdcac883eac603bf365efa2c806eb4f194cae8c16780342165222192f6ee2e103ae2a31dc08a84dfc89c64d2e9ada7ca1839dfff62ddfb7982c79684cfc821a098bc6bf09f87317209b16d14d45c6f38fc99f7bf9bb73460977bb323665d480c87c687cec052a5f08a2c6744c8e177a8a269b4a47a925b9123cd2c014313edae988f8aeaeb633ee5ba6be7f53fe36da3aa37ab2077f5fd75a82a55a0fe62af213b85e9e7694f78cc2b0e63a8c1b89db484722fc62c688678a511c474f0eff8eef1382946d26de00e5c626ec1d7079445c1b7c6f7f05073249b11fd1fb30257724a14cd7bbf451146bf366de2e826fdf1d25705587c4460040ab963e3bd504755b6aa5b18786b68efd3c8e59e8dbd172346fe7f4a18bac98164669d73984044f3c777368f965763742ab86a3720208c64801c796f6e3a1c4748b81e41ac58dcf6ecfa0453b18fad7e3473604f57f7da302e1fa81ad538d4a0280c4ad092007bb9a7a12907227a936871886c699db97d00a1966fdef64d9f3672f1b792c1edadc6781b391c91bea1bd7275f30859dbd1707b1f554e49ceb874ca06e92ab466efa7eeb6990667a27507a7ba789e24d593ea2af8eccb3862cce58daa63eaf212bdd86c01ed471cfc79b191c481ad773d20e821d18af85a7049034e5a9c660357a4c2808b9a6139f32c55c13282b8d98904f4f027d438189dc9487c96172e50dc1100ccc224e7374cf96ea6731032c43fbc9b367a4d1d0b31aa3fa8eb589672e69f1d9144114bbd508d56c2049ecdbfd7b43545375a099ad2885353d8c550d22dbb738e6fe3f104b444c89475a2cc24d7887daced8fa05006c02dfded01c00707e2ad04c41199c5decc1eae34b0c0abb5a5beee1b5253c3350e1a077682767a0b9124a4df2e8879366fd37fc04d4dbcf89883892f46a65ce3aec22123cbe6b3af6364df1f9f5f9751bc8179b6dcc5c126dd65feb7d11a85994e90ab6342834c79c5f82413e88198c73e932c66e3cb60b6e0c0cf438622e5dc5a1036c38afe9cf13559044a9e90f5fd72a3188ef6b1043f5f4e6b40ea51f6235dcb33b3099b2d8c2e02103235f0476ad51bce6d8a2934068549633e521a3ee4c62c22b042fb86c13c8da849233205a5e277aea1129678c31f5c379a71fe08b72fad9449cb923126dd465d1e0ae8a925374149b8248b3afb69f168f3ae701c00f6ea08fe07f1b5338ce6af2f3156ba6f300310114479f2f6119367c88c12c158b84be13b9c8c7b5dd7c90edb5b3ea1fa5927a25ad6d5596992dcd4877f58a134e05dcd80dde4fc2c2a680cc0ccf3084d3f4970e3603fa6bc5a180fcf1ca4241c0b8a1e7c607dc025016e297e2b0645de4ec2fc49851b9374f3ef99edd897c284a67b647ca8c96fcef935d541e9faf334043ea50b99fb8819ecce039227b624e52d8c20003b5a43808e4990da8e4398c4fc172b983351fd11a13dcd2aae5193d42d46e1b57c92e3e01d23fc968c729f3782d6c07dd5a17af2bda96735c12cc7d8023629fb0125e974425f7914690a7ed26508343ae58c8a439ebb6232049a194768d4594f5d65aca37a5686c2a86dd04bef35d74e0755937ac0ce3ebded1c00c8adabf030e5e4a5f44193b62fcf2f1bfa9dca2a25afaf2f1ec06c5d17ef3526d26d17af3e2f257ded24b177ba41c0ba64fd4fbd5042fbd5961a105e0e9f77f3db13c1b6c5bd9a9d04801a5c00a4c544218a21016c65bdff774a44b1d05256e0693e14d76605d67bd10048d3816caf31a6d10886c88c783538bd93e92bbc4484f3388b61adac4b92b911c76ebb1dd11b7b4e40be032bccff610068746f41e34a1fbfbfe5faf57c8a4331008e2c1cfd69f57e74379ac80eb6769f4ce4196795b835201ce4ec85ebcaf5eaaec242fe6695cbce1d53fde5b002e006bba8c8a1ee57da061ceed0d21bdd57ab0cab9e46bf3764d9a6c3ab19736d43b33f32eb955f9174ee4a54666e7f19cefeb49aac7a59b7370d9ae730b7bb4e08413222f0a66bfdac252fb61bcfa838f262312febfde8add8f6843f1d64ea3da42d4ef986498604d65737a44f5a099338520cdbdb65ce73b110dd4bcf8592a4adc3e0170b13404f99f0ec8f9fb225c1275a921f09369db165e9109dd5be472b9bc1901bfd882d264d9ed8d88b4c8f3b35f88b69e3e4b8ef5debb895be536a3af492d968dc1caf31879d672f70ad9869ea98335cf9e4a2760f955fd3e8099e4b2eb4269e354548f9de9921e50e49f3f5cbd63468b9db0cfdf17250c8f13535d4c0a1f21c87967cd798fe93b9b2960447401ef90db22c3adfba0f55f5585ad37040e8d6745184dd536d5a26edec365bd6edff1bcc616cdea3bfc8b9d98c0ef9a626054e361194cd05b2287612399f6d3d3be2f71555f14ad2893af6f60ab61adef663c3c2464ade671dd5ebc71935aad290573588fe6e11f48cd2b7db62e4b9932890d1b96e1b83eff70f026d199db75fb1e83197c937b672613c66ea131f485b4318e27c079b4018d4205484993bf50ce70275b244f2caf47cb47eb2a9ca59afbc78809a912eb56a4bb65cae4694f682c6329c690003a1c355f779b5857a60091b1c3685995a366cb43d753a704d3e59c5f5003c78feed877351e27334b3fdefe5907edd9eb25588a42248b9c4a93efa7cc63bad1e5900b95b70436c35eb85cc8251c4030fab9556920141cca24d6acd3122b92b7e868dc174bf071117958a4797fc90866aca685f1456fab397ae647ab9970348082bd74865bab7f248568db98ced7ed84e8360fa91afde3f23509e6b4caf948349ad9fb6a4efe0a0468302cae7a0f999195af1c19058669fc3b88b2780b9075dc180298498caeb7ba0cf8bd42eb36b1959d5ad3ca6fd1e85f76abd27ec5fb637ee38173ad7d86304d5708b6dc8817e099e77f5d43c1a70624cdb96e4e6103bb25e59eb51d894d1dc533a74005bb79cca35b66e10c61d06b5227fcb071457025d605a0862218ca252b871f8343ec231dbee15688aeb914c0f16ebabe6edb0a489b2bd10d4392c6f1863bb6a62181de7cef61997ab02f3bad0a893cc0cd8a99cd7b3f7773085f0929de36b5d124e3729140c375de9a2d0cd9a360cadf17b9e45b7f2adbdff9e75b743b62642ed67aa703b8ef33dcf51a50edc7dbab42d3d2b49badd2457a9f92847aa6a60ae2beae457a5fce1a9e485ecf907be22913893cd1350f20fc6c81c94be426eaf01864e813a03e4674491b61516bc95d8a77c15f03d0adfc4adc27f27a5ac4165ff6518eda1a5c408708f78a9e26b834179804a312148d4f75f21a77d78387139da40c0a6293c2a59d0162437d68504f189ed970c5abb9ffc6d8e1be2b0877c7f24b1dc273b1765bfc5ce6f4b8d99a96d5b1c92ee53a39f685b304313d909c1ba8130d20d51c824cec420b0315229df295f75b453a6c131afaae0c36d7c4fff70623638a4f7ded5eb7db58d95deb6249a29b171d8ce651556dee8037bf4ca74453a4a76aab7cc07ba44e55de57dbef8542c3851ea353fb8e259ee89bbecf9ce8d8bd6227afc0028afac48a7acd9b4e8cbe982eb1475917ad6be4cdca9cf6e7cddd971b2924f2bb730264801685d387485e41993c3fa0af9987e8b52c21688fd9a9595ad8d1b9f41e0457be18492aa09f69e64e2954d1ca3cc1d32b2915cd9cf6862ca79c80beb47347c4cceadf48a37b29b1d6de4e94717d60cdb4293fcf170bba388bddf7a9035a15d433f20fd697c3e4c8b8c5f590ab44aefdda94681407008ea48d03ff21e9bbb4ae7a9aa37c855fe3537c44106e8079f18c24d2584474bd4a99367660ce6f7e6d7c294961e174366e7babc569d5f80572a21a4bd7086629363e0c9ee2599c8b8863c96613ae6c32cc67ccafc66e1cce79654567ad08e62e9abc99e44d6a79ca4d8de15b7f8a763a4741676af0e1f3bd4e002c8fa1ebfbb3bd3a65ae68a80c230422f98f6e1e9837252e045eafd585ba389958297d59aea1e8e1f665fcbc5f7ff449996aa712dc0faf582cf3caf3dbae80594f9f07fc06de63d9d672d14d7ac4662b4a54f40d4aab2de766910be2fc7f6f679b5708790b5376498d3baf0463dca2f093b51bb7e9f3e7033ba0384af0174becc3bb477bc5e86959a12a5e8924adf0bffdf5e5b9c1cf24d232881ad5c05c5c0f50318ea83d8683339ca6a583c52198c00f7c1abbda282e7fd3b179297338ecf9c923a3a87a130dfc06164e9b4c1fe11d51b382643de44b30a6831dee119241d1b6f84f2484784fdf65e41f78c38e15fb4b00e45df1edc40e3467cdcda351a4c0a0185ac4649e91024377e1c331587a8586cc0a4dfe29e14004c3536d305f5dee0eeb8c2f216c1b8d27375b239f6458e08980badd6d82e9ee9e007578c0a3b48288d9ad0ec3c934a99a8c5741149af937dc82bdb545df26428b87fc935c05f1a4964a8408539f267e23de9bc498e2a4b0083cdb7c8e27de6252bfaf680a6d5b7ec1a6dac6d7d537334a95f1553324a0739414dbdb50445a767b0f589fd4c33b35905577ef5a53b0f097191f9cee4836a908748779941de2a78fe1bde0c2efd9f48cbf232ce101d9df93d3ed40d036ae7aedc3a5ff619abd1c159ca8d2dbda7de13b4ca62576c7f925c52925eae2d7500dc969fe14c0a335ff95a7df1d276a6f242765c781208d59edb5848d412b11638b27ce5a61b8209075976c2a6aae88f6e6d8704fe9e83b425dec4defeeb3cd311b8c5a818d51f917a8a4525361791d5c4fd5d70704d4b9fa9df1ea119882f400e682753a41931712c043c120a98f0fe786a600b47befefc9d64cc5bbe8a16c191490874e258760c9e4fd215bebf848e0b4d35521f53ec5f9308644b785171fc4cc3ff886e034bd833d59dbcacebdae8f00e43c151bcb24d1d226d1cc19ecf349361530a81ba3168af3df5536fbe52b3b93621f57959df298e5b4d3c14928d2ef7b9c977c7dda54242d17f8661978a62d94d565b00abc199790b9b25fbfd4a3ffc35c95ccafe35d9a138a2c24d17f06ae2cc376e822317f16fcbcd56e23f84ec135dc935e58c61b34cfbf5a36cb00350483b6bac786030e5c5045a6b61c9aba7dfaa4f7fb21897539863ee865ae061a77c0359915de3aacb3b5dc8cfe53c4d17b393c2b6bb23652f36390407922969d510cc97b99d1df4361530aef10707d7a021b2d9576b2d49ca88b3cc83ad1baa6d88ef8c81c08f8baaf515637b21ace9d5cc8fd9fe4ca6c3aa129caea7060791d566f4de8662b90f9e5d849cdadf9bd23cf6737b07ca105142663c30de27adcea11d64d433fe1ace84b0f6917c8b655f2a421602f07e0a7127e61ae9859c5e9f652ec82416fd2566f291f417ecdf99bf3231d02864e2e5a1cf34c13f59de9aa2760d8734bbda79576c62f566b8269990e9384a41c1634271acb4c7a8b768f276685c3a8c7f20872e56b683244b1af562c3e7dcf592a9915f44f886cc2ac5f679c07d5aa1fd69cf3a460f25c722073da336a310aa551062d92c7297002060072af2f3500b9310c239bedf45c5e985c2e0d60c7dd68522376dc7b560fb34d1b5089450c32ffcbff07b35a96bb6fe01259a06868d00af697f8bbb238d03d49570a109181c9576c1ea9d2ee02000cc23e63d6c93c6cf3050bbb15b6f73b09c25da62e5abd4c2bdb1110e1f25db39f04885595cd6a388c4726c8d4cdbad87d80d42fcaeae843e2e17f44c9aed25c8f6f9736c7ba1bbd3b839126de40a930024a65aacb872936e446114e706a868444cb140e53d976816983f3dd1d57eeca01eab8211b7aa8ae99d26e35c06ea4b226e0a6e52172a40e7f0df5f67759ae2ee026749ba10b8e33694c3e01a001526f9d75f6c419cdccece3ea3f78d69014e509c741214581034bbc7e2bbaf76db8421154abb2233117a1ffe2786b21424576e295c9baef262e80fa2edb69aff800b3ea436eb827e8adb73abc48d740b86c69d557b16e874038598b25f616afeb4f4a900be7dd0d38b5b6fb4259c51a3aaf4748d7a445f518485ed72b25c7df8ed0906b74bd29bd6a5724ac3a503c990f3697a5db484821f68718470810862728a80ce34599a41fc5bd8bb46dd845a4812ae1532c457ef4211d0e41835e5a6f030247614822571c930c727ba397e723d6b3aeba9244f054e331c82e65b74c9f6504c74b4301499a1a6f6269a3352aff57f88442d4eda42a82ebcf7776c5629f97d6160bffdd8282a40ce2e6375b161e4c22ee53bce7a45f4774aa827e2da657e1a1bc07445f0bbd770b7a5a25b1b469fd58715510dbf8d97af4e1b9459a20b08a8d3fa9d92feb32db95b22d36de0bc8b1c397b09970a6826392fd8392b2d790dcc1295888f42ac81ad213c7328b2324b28be7cc1f4fb8414a7785472f1dd3e11d66017b1756d1697be92490e15f056346d7e9126a1f35fd76cb016fe2841c8996a3507c4fffe7fc45026df10b03b86fb6cf26e8418926a030b5fa62748fbb728fa19dc2f8947468c1477750771e442e4a9d25b76d359211c05df788ade5b7824f8770b5dac0819737dec916ee59b28a49666ee8b7ca81386eec8049542f18a3207e51bdbc291470eeefecac385c096a + +[L = 32] + +Len = 16 +Msg = 43cd + +Len = 104 +Msg = 5f75a437ce0698a7d8151c3fe0 + +Len = 352 +Msg = f88bac738d1e3e10f75e46e3fe026d7e423fdcf3d7e4028b33a291bb4aabca53f780fbf99e0346d610d4a38f + +Len = 488 +Msg = 832e5b78a73a1012ee62e00621db7f4d248893007c6e5d6e0e689c6b291baeebc72df9cf10b289fe20e7fab80a2399271d0ac63766049da875eed56264 + +Len = 13976 +Msg = deab57cdeb41974037a9bef5e292894038264eb4d8993d4d1501e6ef9c68fb0f571f57b0925640925deae9a6317e3bc4d6cdd5a0833e52fb48baca16a9ba9b6c8ca469a0555763b54f04c87d4e41aa549258f30eefe5a52d2ba06657a8773b0842e094857b6d8911d6a0636280025e56356fade362b4bf4c875cc19be0c6644b447be0454dbf390eb966c03e10e9de3487b90d0825d327c12495e3c89ad09c9d591e55c91376fb14c2fde9f7461fb25450df1a65806b65f3caf4d5c81ebc6e664871fcf915b9578bb70ee6776acc62205888dce2baa4024941209e81b4b35f0eda1bdcbd9ab1d6db6140bda4c41776fe675d5c681da5852d50c246dda4ddf9fdd7c5fdfeec85ff6c883c78689c2977584406a1ddef977606c182d6c33561c39c071668a2515e5aa6f4aa1faa392aed95b82ab32b79a15e3b5a07551ab068455131b72493126470f26c30b852e4415e1d8b719b3803ecc336e4facbcc5d1908851f4f39b776bec8b6b9794d47e5965458858560eed5a0305e260240c0849d93a19787b0f8c795eb5ba32be573845256ae6d0b0a3336e42a1beac8bdde6d1b6e0b6207903d4b105f4af2ef89bd099ded870daea2f170e03bd5f6f4490e60bc222d4876e16d4c58aeea6e6c400dbb9e9f4b2b142f0fc9bdeaf4132ded38a4a8366e107cac7210945fa2df4b124be37ef76290e5b9758aa3bfe0091bb0448206323584c2f833e0edfbdc0c33075fc9647a3404ca490bfab94302a0679a1a42fe9fec6af0cd98038b09ffbecd2832b579b2294f6ae5b96328fdc0a0b9b3a32cba04fa8bae3389c3951173bdc17caaefe526aa386f98670b177683d0b804c5875fe9c7afa233ee66349c9fd1b60bb0becf5e1d887e67fd3baf34b4f90d94699d18d6bb9d77d4af358f31edc254de2d6c5fe3ec07425c633b18c1b9e3606b78b40b543e1fd31fb578cf58c45744fc073fbf3c7d7d607e815379a5fc565892d81560eab8fb5f1ae6771b998c592e6d288014f13ab283d53fcbfa66e31a9d107308402191fac2cf2b799c7dae91b93a7676898b8a6e516a86eac58ed8f6d8ed2fd4d38031e4a4466dc8798b90c48e6adb6b4391d47872443cfaffa542b4b132f6c3408f0081af8692aadb4c9bbd55053ea56d8b82998f6b4b41d331891acfe6af1bb0d6679989978368ea463743b514866d2d01fb9950e8990867bc14f1db1142254adeccf3da812949cd03cd1d569e9d0bab7ca7405cc21096e3cd4d007cbb9629372e98584b4c6b97ad0bc314e1ab6ac71184ee555c01973570ed9b115bed956f9e4e349083013098b1e483f0fe44d5e9849f38a2f7ae152b36a266ea1faf263ea8c706632ba8629602187379546fc6b82e57ededd6d074c15c771754710731e07c207899eb47e8d7c72ffd768c36257d373375ffa06f9b3f0af11417f9ff9f9b44e1f1f96ae8aaa429af88b14da1da81c7bb38a0fe9372ed6a9ac6fb5e9e56b82593d94c5192904450227bf040b7ce0904789f979845e112a1f995c849ec3f7e49bd975a474e8201630f40fc0d80e76019f110ae158cd0f8da96ea4561f24237d8e795ebf52368218bff3e9d5b040ecd2caef4ab1e7127e53bfa2b3b4fb74829f9993ac703192aedef79dd9ad24c2c976638b4575afbce22ecacc273ba43379ed55ceeb51838b0adb80585bd1b5f2707ee16b67a7232adf7163415b24b9ff9dc94b7197fdc89e2a90d2b9eccde45e965edd064dc0d1eadabe11b8ec3aad2742b5d3323ebf913a92817749090c20758f98aef2544d4c8b48874e8936d7ee492d5585675c214deeb74fd67c4d170ac5e0aeefa607c6e37abd4f8238e776fde3921afab75cbd8f392d3e88da057903ce2e140797f4a85737bd89455e6aa27c7535687b78cd0ea59848e006c8de9c9c0cbc7a9f5e977be850adc710503ce4ba7c7bd0b042297f518abec6c8ef451c33e030251f506cbc3744228b6bb4dab86877d9e6019a0ea9f39ed37557b3b5527c171da5f013e0d3c480a038cff2c087d6e5d41b17e6c8f90c334b5e2b9ccbe9d4efd99fba1f907d00a49b71b5a08aedb644fed24bcf04e71be67b03cd20d53ccef8f854f5e9f7f28c1e98a8a53496646713bebe15a93f1ea336e6e8a4e68de5dab0fe880bf983eec75d1c5027357f6669e098411e0bc3ea2293138f5b34425f78b6508b94d4c0cc32ee9afaa409a26e5f2a1fddcd6d5ff42a89755a58b08f243957a2e208e24b055f51992ab447bc06876eba169c545fa71b88a0fc15d1e0be9d334a1dd0c86f44bd149b42c07608a9a30d0b7e13574f8d862f2ac72b2ed38904d7cab194fdb9e4dcb615f5610b24e202a36866baccac01fadb575df11dd43e00a3b92fcdd8c7702ea49d951e7dad2a56c075730b4af1ceda2bcb2310256f28312579fad40ff471336ea6a44143edfcffc297258d48bd2ea47efab8f0dc00f1e6dba1a55009ed627b7 + +Len = 48824 +Msg = 5223e2fece634a95e1e7c83ad4a11a0478f4a41572bd66c2d7902cf4f94404cd80b1f58fbcb8eeba3984fd759410c12f8ee922865f363f684df5a8787c87ceb3086fb8535157f7f39653dbf5c66ae7219253838ec77cf1c6db518225c5ba0a8212e5911236474b8820ddcb8111b87320adb82ff553986324aa2a21c37ce4a083c89ce9931290d4c1fea933e31d014d7507a28e83aa917ccae10bed1a490e77fe501b299f8e3b78e659407ce1934d5d68c7980800746f26ffa9794ef1d23f793bd2eab7fe524e213e58280f441ba48b40162305335b3a480c2afeac11c27f8d817792fd7805d4b61224eb52d35c0fbf471bcaede505fbc9398b216f43bfd69b1a669a61d44fd21faae410af58ff95e1c3ff1528de1aba93cef56bff4d714d8c4cc88a4ddcda52444ec1208d99ab3fd9fde98c1ee6437d8d138f62c5f782eb4660c5eb28564b5b0d46e3a2546009148f3d02b837c5284e9f508290270b97b9b29e84445a0b4df662d9711e6b73c11cebcb7120dc427034b1ccf57d8e4f5bbdb84d2e1d4bc3862a2b51931d3c9a7a5fd6ee5f4c7327c338abd011af638d730141b6eafe63469eff50f473262e9fdce636eff4c5663acb6075a4fdb00c8b8a8d3322e1700a5b3e7db90b36c1a94991b8f51657121b442db6f890e208f312466778d73bfaa8cc0ead4edd0776155f3eddf9abb1bbfc0c94421adce83d7ee94f99f61e1f25a55fb596f8b40ccedbaa8e5e2cf629496f5ca60bc4cf36d917da4e2b973eb57869dddc409dd66d5061f22642743fe843defa0b19dfb2f56425abeb234181267b5c0d2ab4268c538510feb191bbcd1631b0af6c7451cd4c641025cd8bde2d9ab6e6b948f97c1ee6f35098d553e8e9da9b4d437125046864633f109d6a558b38b270a7dd1785d44d248a863a91e3db5c0a1d7ec133decb65e81c3402c98ee329f660a092172bf6b1a02491895394ebc506882805a6c93e767c0e58a5af717d950a206c0f0055cb39ed88816a9fe3613d15f608e486ac08bfa67d462d24e6a0a37716d3fbdaeb9c0e951c1e847fb884ebc1cfe707dc6e7269eed1c44331d5957bc4ac9dfeaed4b157204a3080fafb9df8917b8d15aff9c49cdc739b8fdc26a546794991c183fa523d14797e051894f48b0d62c2b70834467ff9c993b82fc1152c1f5479ec6144c7e8fb10d1bce26bd1cdbeec4e95ee073f3bcc3c7367328e30543d371b27509a577f5c79f14d5f687ce62b82f856695af9f7dd350543ec763de75b593f1859e44c2ac01ba65f98743cfddd8a89a38115badcb51a0ff5655f830c0122af6a830aec13ae5eb89a93755b3a5a6eca233f21cb12db545a24a5334becb8fa32c3d7f5805faeaaeea85a551fc62c94807faa6474c0d74cae79b5d8ddae07498fcc5b8b4f394867112ef5fad1c9da66765ecbc7fc0f3269d29c9c38817c77778f2c19b5a3c705fde9d76a4eb86aed4a7369a832ad267312903462397f7b8fecfa8b195cc2316cd53e48c3371ed2ecaa3e484b8ecd2e22b1aee910c51ed5d71198936266f5a00655d82c089f49295feda0a2bcc1a54ec8adf565acc3a8b2d74c30eafbbd843c59e67f293f6d8296cf7b611f01b57dafec6e2d4d411a633918068c38ef47b72ceff1fae772891141c3bc496824509d78165c1e4cd4b4989321a8722643eed69950dc120fa8da3e53c3181f252d7c4cd2cedf8f086f788ee77a98ab5b019828aa02108f49ea4a51f457f7adfd2220d3e59d5f4a29194e8f5eac40ff80312ff6888ff6393c3fc0914b08c1b9990d247ad80a441558db1ee1203e07353dd99a885a7ff5d791af2548815dde0ca1f56f89d39ef6b93dbcd0cd54b854173903c12649587433f0425fbcbddfb66ebce3eb4800dfddfe7fc44d9b23a3916b1db68c187da4dd13ff0157352814b1a792de7fff855761abc6fb7b93b48525fa90fbe3a51dea974069f3f5fdea86387eccee13f58a8eeb8abc6a43fd30e9788c3bd9ae1751b30a82d420225b2abdb1bc121b9073380be16107188d20be54f2e9c658d5b443869ea0e991c496104086290b6edcc1b656adf94f0d42458750fbd8d88040c518ebbb644f4dc4f7c6971d8d60eee0272df7b51a3d5248b4b264fb22195ad891fb6ac994ae5c0bc6714ae0b0b9a484edc576638b78ee89b568195a8f33ed8362128c30f9b0c7804b3ce1355abc96b15aa55c1e16a9e9ec90d1f580e7cb412a7e85d8585bfb950acd4de5865214ce4db7f6314d81784c588c1482d5f28c5fb62e7dd7aa8237ce9396ccde3a616754414cdf7b5a958c1eb7f25a48c2781b4e0dba220f8c350d7b02ece252b94f5e2e766189c4ac1a8e67f00acacead402316196a9b0a673e24a33f18b7cb6be4a066d33e1c93abd8252feb1c8d9cff134ac0c0861150a463264e316172d0b8e7d6043f2bbf71bf97fa7f9070ca3a21b93853ec55ab67a96db884c2113bea0822a70ea46f9ae5501eb55ec74eaa3179fa96d7842092d9e023844ed96f3c9fc35bbc8ee953d677c636fdd578fd5507719e0c55702fed2eaf4f32b35ec29a7a515bbc8bf61f9baf89a77aeb8bc6f247706c41d398cae5ec80b76abc3a5380001aea500eb31b10160139d5a8e8f1a976dd2dde5ce439a29dba24d370536a14bb87cf201e088e5e3397b3b61477c6a41e22a98af53cc34bc8c55f15d7924e7e32fed4d3c3ddc2ac8eb1dfc438218c08c6a6a8eea888b208f6092dd9f9df49e7ede8bf11051afd23b0b983a81bcc8d00f7d1f2b27cb04c03aeee59c7df23a17775ae5984eda788eb2015680ac5610fb1380b4e7d7a9cda6178dca98690449f5551b66ad2826cab2b662f56903fc95b4611bc86f7a834a34ddc3be7bf142c8baa096abaa3cd51ad0c0b6d15e590eab9e50a4c60c91061f1ed6373d91974c1ad9d263110a0d43fd8b596396cafc0ae70b7ac24a59bba090a6994ec483db7ed4c572f723670a11c724e8ffa2497d8fccae37eaa1d14ac1537eaf80efbd2e597b2ffac97f2bc3cd2c4017f170544dfbb0d9109478fddf06ec0981542bc8107a725be25070d2cab4716f4edfad75fddd582ebd363c49e8efaed9a76ee51f22304eebc232a4f67f865b04f610a628fdb317116666785fe8ca30619a07c83cc449855202d687f162b12d93b63af6e7ddfb7223d4ab998a5f450523c1d521ab76f4aa113cc2967e04a38dae07c51c2d0f44fdc8605c3c53ccee91a2c73dade5dae021cbc87d5cd6e5fbefb65335827311fe1e91921ecd66b2055a6102d7a976308a80c44e6d47a67718c84f2112d65486a558f1f269b91d9f47e3e11d09c0c748625bad2718e3674898abdb19d3644bcdc9317c09a3ac02f514b2a57e6a706362e5f6e8fb16cc83daea0eec85fdc8c367d84c9230730291440a4b109f7034d510a3f70a22dd4fa69e8b65e5fdf87045d560eec71f4e59531c7711d4f8917a96e22ad07346d2f92a13fb4569fa6a075da6e1acad1eac1cb2ef19ab452264de2357c927c6dfae6598cbc821eaf3b8da754ce91a96c702c95b2c308bf3a550cbf4d22d417745b5f17d36608feb826b862747c59d26a0e8eb96547a1852f9fbd095f1c5d20721804941d462f3ee2f0876ee2825c8df24c4f00f0844e50588ac688127013df8eba3c971362dd255420649245e880212cb3d732fb82f866dda090040f28e09cf1c86eea5dc4fbfc373eb69745b4afd841ca8e172d4a8510e7698345fd4cab9ec2ca0453a274720bb2d2e5468bf0d0f85919dd762fe3df969e6c071285e25c2e2a49659b8a78289aee655965bfa3cbca9b292a19a855ec40293185354ff4da9451ccf98abfda07f1137e79bc89d688963081dec641a99656b040637402890f185edb28e7e6a2f65848a6af158f90eea440aa6246a2e6c31f5d220b9846aae2027afe5a7caad6dc16b56463367cd9e73bf22a1d6172145de4565ee369c55e3b99ccbef70fb080a3748340fbe8f6b95ba46e8b76de5a3c4bedc37c55ae24ad02267da26769a3a732badac2e0f3a5393028dd54d78701647582cd04c8310e9f1ff1b433125229547130e1737a1f33604f0d670ea7221097c3eb9c7fa4b8293d7b429af76191ea8e481dc1da31344537a09b33404d782eda1d6f5775500c1d8efc615778baf0905d9fcba1806ef986c40b1c6a72335104376b58266c36f5939a8b95123e8635c0c95e80aaeb97379b1179d6332dc07539b595ec32eebd3a336a1128f3cf2e2924db6d8504a516b62f26d012b7f75cab765c8374a3824da5a405746023b51894649ab422d636513ee809fa181d5b6fbc63351e37a1b14efc8f739e86ca78ae3e280f1c9e4824b2976ec4dd308ede6171a7474c7f530128089bbd75e10f9e57ee17408b4384f99f886a5f63a2320a9b90eb9bf692e1fc449171eae3bb1bb17a6ed937ea57af3c82db84e073b5306683e1d63705b9742a085fb802cf5a1639818417fc2223f476c2566351f4b3b17a822e11255f3c3412dd39190e200727bcd3f9799519ef792ec7c2b0b9d0e2dccf013d436dee63483c2ce83c15c00a76c4d894a60cb90366ecf9e61221ee8bdaec66d715159876d8305b35c81f96ab2cd8f81f4769e9a6e439c08c329036f5d2591ac42f2747bc0e77d4e566358a3271819b6003b290211b9b847ab70e906aed9f86cc38aae27e1098fdc3bd5d84e66c45292183f198bc329cad794aa4e430534511b7d9a75104061b409676a16c1146af0a286e2de8bf51c4a35193581a902bd3224cb9257c961989042538092af92644a63d6d6f6872a29aceca39341ad29dd22354812c4b7c7068b039ac9ca7e6358e662a28be001d4aa697ace540cc3ed3c97b98d8c5a6fd3543ae9a7962c9229b14b0b646229807747064be3e83191cf24092dd67f675638d9f6510486379f47f5eeda870a3187946819ec9ed05e7b325bfd0eed5c9a0f4a2063d63c1a8a0a309f586c94d4a68bbe860ae9599ce204c92cf9d92cb460ff99cff9e5a8b3824786360e1e1861e71158395faeaebe7aa2f61f76190f174aab9a313f0bf4f1befbbb22768b8c22719cf3fa9ec908b576fa4bbc084b1ee5b5a7eddc89b58b45ae7b421d38215aa6e49304323eb4e202655f3c8b16ebd6b03058e75a907ee63fcf6aad5eb96c1e5faea81b88b5eee525c4663af52877c0f759432913b9d48030903e7f9f70e851cd4e20bc56aaf36cb02293d992b38b583b8f0b25a08c3303d8af5b1b37f5127f7021b13934645ef3020e5caadc5e7326ed4ff56f797e26cb986b6512b0cc76f1d8e7be44aaa88e12cbc644f14a7feb979d2ab66907063c51e052d0f8b25d827377fecc5111be0d365e08d17f559e3134cb9db294f1cac03150f4232f853ec15ecde55fd1023b58e83934869796400088e9177e85a2227ee45addd049c1d6b03e5b29dd570496fdb2fde7d8cc74fbb5fe76266ebd90a3b4d57e6e6cb9f0bbdb7ca03ae955915768011c714c909a27ee20135927af55d4feaf2c345d029a54af942da6f85f2103345d059f66864e6b0578111e2ddd5a1cd8bbf4ae35b60747b93f53ec8ec64c10cf4149909b102a2b88712ff3e5ba3611cf96585a6b36fffb64b8c37a114d6b16a53879136eb0b5e003a5a068e3e8422a4fc8d7c77227cce64ebafcde2437166b62ccf486660a7a2ef37012ebacca26ecd5bdf363feeb06aee39050974c25d6a564594c67f56fcf7ed48b07fab4e25ccffe002bbe460325abafe37f23dd9c145b4667f146a1635e462330f02470b35c5a2519f1350c02b263201ec9026cfc57d3659373910e878f2b6c1c5be774df8e01e775d476956c257bd0ccdec17ee939c46e5653d5813eda752ba7bbb245a99a5db1ae55d19692074c2e5820df97c502a4bd1b12929e1be8e9ce6d802347c3e9c4202de6046436c05ab55b2fcb2c227adade6c2046d98102cfd0d859a91f8104eb9f6f155da2acf93df2405bf2c083eafd3ec41d60b810e0bdef6298b21193642a9c0c646bc6771a5c61a25604d96bdb727abd5a7ebe4ddb2a56a6ddece26d8007b26043ad44279c3c8ffb7e6ffb3cd4e10ea2780f509a8a9bc31f99a7e66201195f1543a0a020f754d9a665a29a896faf673df6811379579891374c71b2234fc61e95d4d46f15d44bdb4d7c3b3be3f46410ca46827b8cca976d8866e8ca33c4945d5c87b705588b78015b529843af0b75a7e1e871fd276c1e947d896b92e6181ab7e3ccc7077bb57fe85a6958667d3d7a790f6cde1cebb494c2912478a0eca2bfaad62492e9f1caaa0cc520da08c0d2d910cd44255f4c2ca0646dc89e789a1cf9a28e2f99315d33accb1639cbaf0c94181b85fef648bb4cc7f66dc65b8e90bf5f3b763e58520098febfe7e47bddc2d9cdd5e40dbf4ddb8d51f51bde2e57432266d248d13ed09e62f66794d188f9861c50ec41f0eee30f76f4ece250956733ee97036098db41991a4a3eb7816196c8e447db3a2913bcd992174a7bde1f42d57c764b47f5bc09533760c1ba74943a0dca291f2746bc1fcc573f9a22c72a5eca347b1679683fbc8f32b08d381baf67b7266b14b3ba46a04a3ee45881ac452f64df1bf17f70f4cf9fa4dfed9ae70184679184784a0451d2f5c19c02031e0e4957b4df68b4a069a6f6f6458f6d773924a1841ba664a55c2c3187dd33416cd410e56e4bf8d3671cf737bf67df2a4cc4dcc786872b9e2dc4009fea0e48a749353ac053d80e36357d24d468dd595bc823017c015d7450fe38149370c5decf13b00b6b0e0a2567ac08b45f7b0c8a7c89d227219d051d17a706ccbea49a42035cb327381568eae23b5e2a3b7e8beef6f260d24ab224827ca8ee9d640dd23eee94ed02c9e26abb3053cbfaeadbb1f365a24d8769d92240da842e0b361524020b5c9c22a2fd8602dc9600aaf02b35344309f6bb018a94d4cbc9639ab7430657c4046f0b25df517e31626abeedd58c2e19aa0ae1a43ed2bacad91dc04a2fdf9cc33cc420f4f04379e95988ab36731d5d5402d89fb47e826f4243bb206124364d63564a0872f8d2826eebd9046c7c6f2e7c951e49d4b22a7eec89da1fbed890d63ef15f26422185143c89da3ee269f83e1de11a7467822146042be92295a585e3a09e720ec522e1cbdcb41acf5ac45ee892677ba3ff670d71339a76ed98237be252ae21268e756f05ba0b094a1803f9da84a8a05d0ec9456cf565e1b548cae95eafa0fb01f091935e6eff2413bcb15f605f15270408216fb5b41ed83dfa1454c522375e35bdefe54275f109d0ab450636ac4d8e4d9e27f2d81a15b8cc5e98549254a1c9162918db3e399118f5864774a9d6a2347e1315753071eb1204c8bf5f52b1a0da37e484ebbe545fdfe6b031215678c3b83a19a24d7b661f626beb01eb82b384f02f42bcad4f40addd48db8a92b90d2297e6143702056123286617f86fbef4fea940f648867d790b8f803abc5f4e0e3f4226954c296afd96e287e21b7243d05e743161810da578096521805edd81f68a45500f6a3a1885cb1f45cbd399dde024df65072eb973c827fca13eeaa3f140842016f509aa9ab4603d2457c92cc9aef24950697a0044e3d7c483b8d8391886cd50dff8c2f16de3d6caa7f864c1b3874750781b2b78b545a94b4da0b0036433c6561f5cfea50eae9f5645302eef18238473606e9b9931880d0f6368fa9970d1ffbe59c4454bf97f4a5e8091801b53ee4a209e0642d83605836f69742071aaebd9d813b10f4ccac03851ee9f20cd1351f8e68554c9bc5f58ad19d474ca128edbf561d195e52ddf3c19bee3bb597ac2f92143bafc98bc09fbda6d18dd4ff2a93cd2ba17f54f75c32d3f141468c2baef4e53b6a340286dc2599bf7bb002aa86688e26f5b51a6aaf32e48ffd539d4f3f4bbf0cde2d20138151c82384f9ff29a634ab4e0103d93340bb9a7b0caa108bc7fdc88d7de14abb17e9efdad2b0f304f0bfcbabaeb1b9db75959dbf54930e67aed3a9c8309aa90506b6b9ed4f1d06c4ced19746e206e1e9b8879663bf56bf6c5c920ac5e09e6579b780cb63e1875ef0a731b726864b7ae5705a2d6d343a4a213a05928b7337a59f900fd04472382610e2a8d25383c9ab5804d609e79a88d70eaef3ea22d3aa9100fa2a6e98e97684ade9fe90d6bfc59dc9dec3d3d8db8990bc2123ba92e64253235e9b4d682e8aa04e23fb9bb6248a77c065e93249de829bb2fc5ea9e396461090222816bb29bca37bf86698fb995f62c50110cf418bbe2078a56c5f1ec9fdf3d0b09a719ac253b5bcd00932ae058b86611aff51c8ca8448978615854b69b0216a6eb8050ce199fd9a13aa0fd652570a1b187f61e6831b3a960521c3705da8c5e6c64c7b196ed4a49c2912d77b670b177c6458a7a49ecc1ffd8c57c0978d2a05cd1f1c7ac9514dd14b7b0933a52cefd40b6452ca0903df1f55828025c7e18109a6e0f2ab25724cad2d6f57cb5d894a6a508134731e9b9c61254f64990941f4faf97394b634b91860cc6ec346aa666600d323c849ea4c4a0ef55acbc56495ca004f3fca42ff0ffb11b0e1164c95ab89bf1db3d4f575ff334d4e0d7d50e0c54c422eac5ef78c5a3be95f2e18872540fccfb597211ec79d9d47b6cf41e385b9c2e92122167fe584210f63bf919c620d + +[L = 28] + +Len = 16 +Msg = 3dd2 + +Len = 104 +Msg = 3d232201038fe7d846ac1bd4c6 + +Len = 352 +Msg = 44c98cfc71f82215dadf494d68d1d6b92bb4eb81fa0fbf945a659d9aa2c2302b5c93fd3eedba31e479e29d36 + +Len = 504 +Msg = 02a5c7b1b749d6d49bed302d9439f23ab83020bd4d573906f4190e74216ad33aceab775f71cd31092bba5cfa42f0845bd16fc1b8bed6434dedc92f80b395aa + +Len = 13976 +Msg = bd70deb2cafa75918308d703a6783fe9dc5e3d21de9bfeb6dbb1cd531ed5dafeec463a02abde302d4ae6ab3cdc2f0f94865e38339c88bde507ff71bbea6b30b9851cd8cf599e950b8c8e620c90adccba0033f934ca66ea0a936afdad575bb6235099beff1a632c9114a8045a0919fdc21083880eb05c0d8c489c7810aecef4a41766f67c37557e28a9db9a0d909c2b167ff7eba79693afd3ee3aeace38eb73a5a02a882cf89b123812cf2a0f6d5edd1d14362ce9c43257474def5cce3adbba8cb48e7af9a45e702a182dbf47e8869b3f99e953ba81628e502c60d4f8ffc551c31b3ad6ca85c52164839d5e9d493deee4d4b76604174bdb5655385d34ced2c1b09dd5a486e1f9ac501bc611f9d7aa5c748f496faecc14c6c18e1dfc6aee2991bd0207ea1701219955a751df43dbf66f57904675a0e9e6d7f9a0b8bb82a8f44951117ab2642d6671daf1e5d1639d48aff6a05781c2b5e8976653b0a164445872d393d30355acf0bb49bf2bed4265c9a3b786249afc7a438d706eadb6f90a7f93ad51bde6d2c8e6ff09dacb3dc67ba0d3030c54c8367e1e4280bb5903274191344610de61c3c770c6820a6cc9d826f7c743f88f13580ba23cfc00598fd733b5dd069bde7f10f2b8961c16b69761b0f308dd137f844a67f6054e065863f226141755b96645a291e3fa3fc853b2475fbe1d3b25ca22f4da4425dc95fc855e63d6699b311ebd5fec1c7753e6e81f747c808ec3f618f63eaeb1221075edff0532225c40ccadee304a8997c03920e7ce4e60e4df4d120611296786516dd4d9cdda2077ac52bce0fdf552e1ee89a0133f1f87a6f6f35f5c53958ed806465919a0a5fa42488bf29caf33a0dd469e13abae351d5c6fb1a800ee384da199c823c965d9d5457a3ef8292c4d9b142e3f1fb502da498eb44d95f8c85bcd6871bbdbf004bfdc09ab35758f5e8b6a0d0f366c3b255333c52c8fcd4ecb4536b5f6e72897649f3415443612d72c3436505249a344feeb04883f41f90ade40af119014b3c56fc108f1ab0a77087d9226665d416cd975e9e4605529c032e8926002a70924820c6c7e264a794b2a3beb63d69ae56e017294fad4d611cbd0d3847212a38f22d623eabe3b884a36464d8814286fff52c4dd366f6c2abfc2eb865e0dc9ec6e55ca9d81f1b8cc47e2629bb162e54655bf2a9e156ab0bafb4b8ce96858aeea6e6665607a3f268036f4890dad759486b15e3c9e791429ec8f11bae4ea7c490656fdb0551dcf0b0be017c08bc674bd97d9d701c3ac955e2941ba7d5f2ba122a6f0c1b164b1caf2d50df111fd4287e9e195d181f6f514d7dadbefdd4274edc234025b727680576046842a834b6ad89eccaff5c5209bb91d652357e3750d8bb0165572fb71d09fdfc60f6b1e5d868c67c0edead427e7aeb734e29b96e03ea174b6b1af523feacaf6bd745ceb1bdecec9251958b7f521182daddf62ff6c4f58977adeba81c616ff2e937ca4f16eb9c44e63f9e974709122083ae45524ff87d7a0cca33a90f09b660db0efeb393c61967de2564315827ef1cf42b71c0f822f471713c9d885a3c3281d7c95dbc96f1c6dde0af70ea11232b00a2d215ec8de8fcf84b6193b6ac9d46de660361aabed3371fa44a6f32107f3854262eac355f9ef98701f580b4649175cefc29950e7a0eec958f629999c4b0a98fd4bdaf5c0bd97c963b551f2220bd41ec00b8726836e949e818a49aa1ac5bf12c64fb9991111ce8be3e0cb9605f753dae1a4c84389416f17fb66cecba45d591b22d64e5a4edcde067a088d9ff7f5dbb9dbf324510000c55d50f480a640fb22da9b4862dd81080d61af9560b601edb5e3346263f5f193df97079a27e3f9876078b80ebdcdb17ca4c50aef0c8329c72a7f77584cd963e105eea9c28a2ad4e95c1d018e27d0e720ea59147f59ad796b80b6293da8a55ed47e8abdd37221db0a5eefff31688e2adc294654ab0fddf9c1ffafd4783f01eb539492cb35a77315d0ad19395f47b18298a7b353dcf5bab0b2f193ff73d99310478d2e5c4ff1c68a2493c138818edef73caec9977bd4eda6249c8933953e06d796b288f78b18c343ef561082fd03bf92b084afaaee741de3004abaf746350048294bc52450e31147173f2da13d6ffc5adc718e149f9df3702f414dd3ee88296ae8a0106b071b589e8696401da7993d58a9bf8e5bf417165498c96b4ff5fd2b45bbf88f551688425122a3737ca54b2992fdb4d60957a93097222c3cf4c45dabe18b9d6a69e6f27567d5adec489e4b6812c29a8fa52f1de642b7b0e749c16f54473ed5ca2fdf2199e885fed308fa62a3e0deb7e0b8e439e25b3e9f95d755fdcb7ebee9d73069dd57dd1cdc5145205882023b54f2c9dec6cced9e3f6d24e8cdbb8ef121b8f3eded574d81908e867af5ac82bfb8ed60848b4bfdc1d998bae3a9ca80c1c49601d11a40409c62b1536f01ca67 + +Len = 48824 +Msg = 5fd54472a44e4476d254c0940071ad42dc723354f76ba61f63fbb9df80d1ee56136f51b6982e66c1da83602fc08093506a9e2cf27cb92085ba5c627dd63f59f8850e91a1d86cb1d4ca38ad03160f3c584b128d9b21e935570e086d3815307ab8df396cfa0c100bf6cbfc0fd7a8258fa1a656bc178e02cfdc868540d8e5ad39dd46794a8bdc205e710555ee7421ca7475a4f3232e6a0cd55d4b5d4525f0bd7eb1e455931aeea6918b9fceb2a32706d31a6d7028a85e102f228417e2e7db68317ae155af70eda98c8dc1ecc32a62e294d92855354c1114c5735a3c81e551b63a81650107557f3237bf953989d17c65a0fafd2bb1e32c237f98f55389e8f8b0810e97e201914c487a68403c6d621a98ddc515780435564245d87ce462b8785def699f7f06ebfdf33dd1ed7dd5a3e781348298c7950a387bff7d1878731d7ac66ad9a6607f2c3a3b6843c2852a5e882a8d78ae9dce2a79d595cdf09626dfa6f1dba7d40ed21caa29e304e7dbd559a89bd1f07d84165dc259ef112dc6e2c5a3e82b1c50106983f6c4965c85073c5deddbe6323003d56abb0df590f69010981ab3407e43eeaa29c6156995c492c931fff1b686eda3741a0bfb9094747d1620b2580415d431ffd6c02245f6cb03e39f87e82834dcea59355b2ba663ce145d2514e15e2b2c60cf518ff510c6c3e2f16d2dc523832762ed8352a320462ddd4d6fe755350672038163d996b44ed3b85d64989291bdf39398cb996de785b9614ec5d4bd73efcfa37fd4470b17d6240b8e4c715759286b04c3d7d791e2689927c9f18320ff2e6bc7306c805e23a5de66eced5f1a630cb43dd46db515f837f6b824b99b86c10b6df7fcf22d97be05284edf0e0be597b3f9c63556db031339f79ac9e6c5f8a1cefdbb4b30f5bcd23c2a4dcf791cbfdd6460284c5af0621ab7c5571e40a87c87be459c85ec81d746930dea24f43bb11d6611ea83409d3bf4f987778d8eed1d5b246a2112ef78ef0252f9ae464810c13f02359441d289958b4766807d9a3be0054897d35b01830deec1151f9e3d42f92b80f4aeedd65c78c6e98afc562a3bcf6d72f238c6e94a38f2288ac7929a7a61c92875c1f115c0ed8d261a727f0794f17ceaa3dabc717478f6ce7f2e8b295f000241e154b4575bfac8483f6b62f9ef4e18f7d341a65faad5e2fc1ddaf2b09adebc155ff09e63d5aa5f95206e66c7f4ef2ae3aaf3ea7c93589efa8c552df8d203e0ea181c1703d7023b56e603f33b4adb9bf44f7af290d8081210f327a6c9b0785709346087fd090c42d2b8b2711b9a1a5173eb5e246320ee27867ad6c3eadc4407bada44561a12cf5d53bf0448308bb536a8a525eabc1410c3a34becee25fd6fda453251ec229b53751f2280e142c6b331daa659ab655b78cfb08bf18e40bb02b7f1650eb2dd4ba1707f0aafa219f21c29521581ce249e2e34f5656b0a04c00485079b040e13cbc038bb9f17f47cb8f908591b26bdc28538d8baffe4cc39b17d2ecffbb9698bc2b8b31b08424034c051b535e0cfdf07b7a0a54781e33ba739759991aeb72c0ed992cbe76eb8ec0ab12c182e8b049cbadd6e82e314f1bf15fef5ae95dc86bd64b8556766f8ff62c33492198e454e5ca59ea856d8e095c04da8045522abac865506096ee1cfa1082af08ca09b3533878ea3580b6c0c57a615e0ab768246b3eda96bb6caa01a2648068e21959f843d853e948588e8c0bfda364ef1f9fbd3235c27916562eb0214891eb55ae0e059f4bf7d1838b5942656c27899dec6d67b823a981d1e1e0aaff5323b0e3d69a7dddf9b12d7787ab763a3c7a2697ac65b655aefc4bae7e6444850ad2540d5193b378682c77a4dbf9aa22e517e68cedfd1ba32e3730ecaa2e3f6ae61a4f427d6e69071dd62a9bf6c860980c9d23ce1fa82a1937e6dc1ce3a2de096b680d23d89ee102912ac0bd769c1c02095678dbb00b4430428797cfb966b2f901480811e1b9cde358b6d499c9e93f0961f050465d7b0c70d4961e75a9fe40a24e36eaad27238231dae6d0a17f446c16bce7348e669be563649eba9f23be29adb8b10f462780a066ae573f74e51215a26097b02469c25180890e06acc53ab063c742e08d51359b0a39749b84b9f6be44f3ae3da8e5a2f340a8607d4eed08877d007928d332d6f49502bb5f416c46d866fc87477c58a22d3c5932a8d6298c1151daa032c84ad92f8f90b8053b5aa6f690d1bf682f314471cbf200f3d30959e07adc6488dd17b0be5279e727f3237b8b4b19b31a220dfe63882937f8d5ead677608c42a57217f2239614c521d94559290e3b0ed8055d5474e96564224f6ca6389b40a71337da11e1c307dead8e4eb43252cc2f1c49addb18781cf20acffd3db693b02e5c8ecc949b51b99005529e0149a13390615f5df6e0bcd68e1ca82b0173d25134dbf76dfe92daa085d3f6b1e4d18217df41b70c4c40101884c2886495f2ef8a473bf23cb47ab6533c93cb38c36c6dcf6837f1272fc91a6962b6e1386fb643e1f1d71fc75ab58d5800bf4081217cdce0c7ae9e3d25de543fc4444314f32067eeb147c08c55c5c8158ed11729837547f28a300eccc312260215f50e98c4e3d4170208a50a4a4def1243538f906df8476b0c46d3449be73866d463d422595300e160840daf8c906ae4aac13a64457853b0ea6d8c32f4efe3b48c0b1450250086d459648b0ab14fd3f341a4a803be77e56a811e7a26827eb0a1a9454f90bc6ece665904adaa3cdeb2c4847858fd1d79750e8cd45d8da9163784b8bd06629410502debfed5eca3cf8fef0fa6bdcef6efaaf35a1986d6fd68e0f436dca9442077a4818ebda4606a94a3c93fda46e7ef5ccfef656896a0d3d93566b02ed8c3f6174417cdcb99a415b0c6e9816d94e64b438c295b4bfd69e0d9ad52911de5509971b7370593160629b641d690eb2828bf363857983e3b9098fcd15e66448f786f196685d2ceaa251b17ad06dacd614d9fa78ce0a8b9c1c360b529d0bc1d17ba0b70ea8ac1b8d67f6e5770f0cbaee0b38109d26b09493060dc851f5fef121e83e30aab9c3efc2b8397e8362aefea1708f7ffa14d3656f7f7610f3a629bce14648a593250c6f309c02c6c552bb42984ac58db920dbc7d98f59295f37f3e9b99da55ef074ed65801b390366669b4c7aa1c483ffd23082793f9e5cbe30c34250f63fa3ea2cd097593dc67e8d27b7e4f07e73a9f7b33a5ef6962df1381a038d4f58fdbca9d71ccf640b917f631b75d4a2e8ba46c64a6223f99cee30f47c1a935dccc7f054fc39d3498c824e10cc3ee337e781a3971f0e98295aca611bde701c2359858914248f6bafc88232bbc27bd85883b00990bba7862fd7a7cbd4c86df049071fcd10d686613ec877758d83927cacc530bed9a596b5b21c6fb748c379d676de7e05719a867c9f934b5dad99ed97dcb4e70a9b6542ed5b2f086d9f56fc9752e788785ef8f7837a31e433438cf2f18f58be37fe8412f6d21a5c35000a5efb862926700079413f76ab2c3e79e20b516eba9d8c29897097bee55157936607cabaac41337ea4cc783c0809c875259f8020e16d5045fcc39ac796d11a82f25fcc9579bf0a010200f5745065175fdc15474ed514cc796672c59637c3c8f236cfc9c0978a3db1194680c58c27746090d76ca09f7c48ee4ee7e1d3cf0ea70dbbbd88e30e8814b57404dfd7c33727a0c84cb7bd468b0bcb3c89b526679c00fb0892d2a5e7a3d73698a3db53fd7d78460cdcf24ed22b5f39b8c00b3506541ae4a5b76fae29c1cd5b0f8c3ce142e0af7ae4efe3fa4c438a604bf4a9abb41e3fef1b9227a7dccc3f4d6026ca289b4b1366d9ed546abbbbd5677c8d582e79e2b544f18dc23809ab753313d84dd10fa3ed2f723f0b46277b8877d4f3e0665e88c50caf0f0708b746b736b00c8c83a7d18500384bd035996aebb7da8f09fd6af9b76fde7fbfc0ee854d7ec02950e76abd23ffb27a6ddf1772465016c79b98a61bd3940547b207b6507e32cb9761a5604f0f546834a8edac7ae06910045de218d761a4accea886188f947b57bd876491709028e2e24b075d6b022b51af1880ca16a8c65b7c69e51b2ad580ee058acc0606f0a3a9ea1cd4342bf4be602e941dc4bef1239bb9bccbc8098a6a17d63186c6fa75ec44b6e4fd38a3fe49c5eb995f0cb884e2f3ed6be02515fa605b98453ad935682c3bac6a2971bb68f4094cefeeaceda92dec803ccd3d346f8b40b48f8f489e118a17367801e85c79e9b3bb5d73ac44a8290cdbf83a154f2f125090d42e1a1cb72f5ebbd42da46c7a4d4b9fad9612a4c800de6467ceb74f831e1395dfbf5799a3429ba34754add4b34b5960a5fee8f752dae78450322a1ab3d7102b77e907fc1eec5355991e0c7d6c0866660e5436248edeb1a37c0e769a0764cfbb6354332d6e55103b9235c84eedaff918af3f0213c435c32ab409a4b5c7eed8ab6ca9e313dba459bcfa3ee92e7d669be0526856ac3c06a57fbecbba553a9cb4655a901d98af02b74098e478076655d325bd7639d73d7ae00c62fdc361a997ea4ff5b0eba33096b12f35cc7cc0eea62950b912b47c11b9fb386a47c4c15c0602d304b2541da889cff299a1fd415e7e25c70ee4cd83feea7e6a9c50c75d9b128458513d61ec5d0299ef8c090472fe0850f384938ed44d36f10cc2c1d31daee3f946a2fa18f9982a988fd6ac973b1569313ce3c8ff5746c4dd85a241f1e9dca0e904c091832ca028533a3e34c184edcc510bf22a27f530bdca3d057928a96f72dafc73a9aa6dbf2552598e468735cc5736c67a620e9455483e9cb2108045ad80569582ea93a53b491e528c8df336fb326ad74317bc1dfb8ec30a73af01a5dff3e437b7fe48ba5dbb3e8f01ae0c6fc28675a415f23a796bb6e0ef0efeb4b14cf20d4ad88ad1966da43a76b454dac8687bdd97b89b8f8eede91eb34ca4a0523ea65736ae39341fb32b9b716f25662a37382c16f3b9c346c84f03bef54acd6efb364c6401b07b3f7679e8e7f8c9b77b75e6e98b90f4df88460f1978d19744eecccb743a999aaedd00b5a94018e9d5a56bac9d5d55f6e93bad52e84aa7340cbbf98d56213d9dd3e1970867e3972dc98e61b3cff40b64ec49463ff79a41c82dbbcaa37a82b761f432849aa83a3d3c9a209e2207b87ae9ed9959ffced165fcb0d8873668c3cd8f18ba0f92f7acd2bf50416c22ce11692bf6132eb9f558dc789cf9776da94e48cf48607f19d9a11d5df4db11dbaa67a1d20e9f0c96f5956ee3f906e371c489efc88b0c1e56d881e7bf8dd5d6742622eb873e253dbe54f2e2e6d0e6136941de8c23e9a632727bb5f88c23170316c7aa0df28d8d07589dd6022828834f7ea9b4e5876a1704944aa3186dbf89e0e81767cfba03bfb38c55a9945209c4dfd88272c49d1745dce5ceb40f0a6713b5139dc2fb87a8a4888406d2610b7b910a9e5782ef0df719028d8e50a40a269dc9bee12157038522d06537bb31fc87d21af9ad4b2e7e127bbdb313e0a116010f65126cedadd4a122d15a71cbcccc346f55100e354b997154567fe3caccd50251d137c58fc3a2048dd5883b6af9248b51040c01a80c051b8a151a8878edf0304b5554746d6116b749221a1d0082ac925e6e140f0c3b6a180742ac8a50ce0e93e6399102f151d7c14000369ff52d0b537fdd51bec99e7271b1255c6fbc36d83408c417f6825a8e2a58b9054ab2c3ead69d97ea9947fec32d720653c123ecf51a9a3f0ed88743e3fb7b94aea59d0bf0219ee50825ef220554312cb907edb90e4d85f29e316ad57d3b90d859391fcfc63e6c0fd3ec27d4e1efd6e0b5ca8165cbd6af25ed8792d805f27fce308ca1d51335ed5d727558dafe05486a6f9149b8d3bc022026656714222830be582889e6800c0b170e48ebfd069e711210e4ac7acf07652a6f5051507de68aeffc9540cab5cdac84ceee46059ec23820c04b127266c0bf8df0d2b856be3377ab42592f495980baeddbeed3ba707a85dba64fe36941eefa8fd37204ec8c18df3852febd2b142b1c9a5cd0f9e424cd408ceb7788270899fd793db99ddb8f9ca8df550c513790d8bad37a1d1f4a62c4527bb64c677462c9b093582decea70c7bbe873095536728e7ce05d5cafb5d166a1f03055e918f787fb244c5857e3d7a1009bd37f30f165564a082c1510ed19bb1633811a76da70dac67641c2478c6b335f409ef54a2d0f370c9510d0aabae3cb998bd023778375cbf9cf5ef125afd584c11efbf40bb51839aacd3016e5e4d79f134245f952dbad617c78cb6f5712bd9c0c7e1303db5029640cf9b56e29329c3e6a9e0a2371aac1a437b9b1c4477ec9842aa80eaa22c5eac11b60c661de6ddbb088e844293ab8589c13d938765bbaa44301e4137148dd0257bd4c8c766c5d3bfe53671e9417cd1b52f622870ffd90f4e17b7a4ae1b5601a2edb032e353bca652fb565beea6fb0b2cdcadac71794c662677fb1dc81d116d94f5eced526b37c004b95284cb6aa2ac415754a1f14882595dcf4d3f1d905c6e8c12cf5a9d23d3ab55bdaf9f17d2f03f933e1bab89040753648c426b072b73aee8c2fc0d1c03fce2c656e20d4c96803fb2ef471b912267eecb4d6f342d3513894b94d77767823fe0c7438e51f21bcf16f0e98b94b23a10760271281cf843989824f7061bf834f93fd8d2090f70e939700dcb4d8964a19da39a9601a7e0ed9f55f567fc7d5682d55a9ba0e68861756bb549f2f17c10ff6bd2042a80477f89743d3d762f1dfaf230bb502eab6f4c46b26135ff3bef5faa179bdfbd288e3cadd3d88d8012706e19b7fcc6e9cc2699d3ba0e624e715599480d6b7dbc6eeea0d12a9236444b17285fc7794040dd40c2b2ef175f7f3641664fc9bb7ea6d7eb3489d504f8013d64a23aebcb5ce233405f5ade067dffff253f27e926431ad806703e8fab23656e0b7431916d8d4c72a7d831e3664e5f30839c76c8167b76f3b2dc75a6ef48df515e06ea54ca51de2fd9c5eeabb1610b7eef06a2f3167859cf82e1a5b76be8ed8beee2bba28c3b15af6890d7a37226834ec9f63306a0da11aff918753d8b83fe7220803c070db98195d6d18357233f5504a6e3bd6f30115d3987f93aa5d89aa0b8b577d1fed94da057a6f088233efc0f44f86798896eae9ad0b20c8c9cdd9d72a3f02213f6797800894b864cb44fed009440fa5b0197023929f9bad16f052cc2d87327788a68b9209f46fb4776b092d75713048b5453ccd699d19cafa8e9a93fdab0f0863711916efe3bd81ee71b8e0221e12e9ffe2f6ee1a4dc1a8de6e593480f3c05b3691e916a4a7ca51971eb2f0f693dd10f6b8468f8cf7bcce285938b5a0a76ef86acfa2990f88bdafdc39a065db17b845028ed2b7a9e331c44217de20440e406868f1eca818d0be20248c2948b8f4cb118b2e456e585949139270f57c54715f3297bf714aa7c5f72ed8ddf6a074703ffbf95e45bc81a02c42822c22d2b718f2de5e03d687a4b18d605ef5ae75f9d43c8cb4e77aaa0c0101d978120f29574b22f52783c667f7daab3e1f9cfacf2e68e94a24918e3fe2c4f061deeb64891b5217fe5908e7f389897751839982b7fb736fbfb1232684e93123611b7fc8fbeb74f8815b5ae13240051920f3b6ed34483ff673c467ed7f0a8fbf619796e485affbed0697415d2d0598ba34d5b9e44ffd12a5edc323883a2e28efe9baf860324f2d2016748503eac1888213926b0e0f0335a4b51820a2bd3b42d982ec6ce307b453b6385aed7a735a1e98479394147c40f01c532926e10e1b26a5b395bc150ec4b4daf5b1436bd0baa225583ffc9d9e9d8a354f60fded37b41c7c051daea04e689ab2d4e24d7d07c75c50ccfd6a527e024d1632246c6f40f06b86ffec0b29cf894b665d53d459226b93422d37a8da23587fe884dc3c0f2fb55dea296a9a5b9a0d101f186d9fa6288c912202547cdf958569d2cbf235740eed38d10b0025dbb6de31058e98780d22149c19d4bcaf06dd7353fd91cd1f47e47f45622e1472542be2f63f463d253617eafd4f2ad609f9020884905dd5c22fba53ccc619104b6c0203a7f6c8c26fc80ff6fceb8c0c51600c2e46b4b872e6d597511524545a76cb42278b519d911e6c1320e01682c551e204ccdf91290c52e0836167a5685cbb1af338eb794c10fac92950f3f7956acf28f1ca984e380bcff9876b0c71dc7ce4011d1d0f955da9ca885c6e7bb74c6194dadb0fb9146dd725c8a9574aaf3824b727c9be3fce59c35850b162c17d3013689fca858a0a51d81cf4f30d6a8705bbfe35ff03c34cc7c56aca32140d72c8e8121fc71353596b777b266d75b322c9a97fd2c5d4e2362f19c99de66da7bd9c495c03d9a15b28431a0c051e786fa80f5503a72519e6b419263d72d553d688349c0cf30918eba0622b953a0efce4415c29515c26ba15f00e548ef108afe3f8194aeb965e5e4be94f10df6c45ea5c133a8c3398d09fb80f950b83c1866a1637d2bcc195e05cc32a9233b244cc2b1d4930e66f032cb1163c37b3e58b576ab76de759569797fa9b8bb4fad66aaaa56f09c7a0ce4641d6799d7bb47cf684990ec1e08871458c211a353ccf1285e7429c7b8520180918f7 + +[L = 20] + +Len = 16 +Msg = 8a61 + +Len = 104 +Msg = 37487aa02b03bdbc6bc62e7e26 + +Len = 352 +Msg = 6ecd002568bae3bf1873993041bfa292eb94e9ad092d8eb3585be82e8a20cb36a47a06e7a57d301268a4a533 + +Len = 504 +Msg = f6dc1d2f6b8e126d99939664693d8709513f97d730074ec2794e536d94ede79c81f2b2ecbff3c2c26ca2d181ada2c60050997f3bb087ce48d956c18dedb227 + +Len = 13976 +Msg = 07a6372c863c7d7c6764e4f05addbbe161762735dfd2d23bf268e2d603cd28de9c369ac379390473e1d3fa7e37af1178cca54fa0f782dfbe68070952b93462ea46c640d43ffe71f5fba42df98f4c48ada0d8aca8753e0731508bc15dff283178ae5c10a6ff132eca5dde63a78d3ac94685152897828eb25a55fdf140fd33fd4e7b03f283e201a1baae8986d25603fb0b2566aab345fb48031d648144dddc2e3556c0ceb1104f348d96ae7dc0152e45c625d21b46e70c31f250c858aec4ab2cf5e79d8c79b0854e0abf5330b9f044113d306161968f4ad6f0973160c9dc296056d5a11523ea2b56fbce8387070fccc639ec1c65ec663b9dc49aa880dc4ddd3020c9d44ff7e8cab6266e436af19b4ecb82010a0f8f9469ef380034a02e3f50051a6a3f233dcfe9d553459dc1bebc538ae0183448c9405c351271dea808d908480e61e9793cca111b4cfb9874b799626a1bd9a0f6e0929ad51b97ad81b2438f5fc255db3a3dfec9f0d8393c6b245b03d3faeb58021db3ad391b17a91174a66db4feef1b4c889699bcbea7928f4d29be2d47f76455c8cb1dc7da9cda41962a28ad8cd7b39965b809e7c7eca1c6792c1ce1c8a4cad6290170e91fcc49fa5ff64ab433b4aa081c8da2d9bbb072f9f18ca455469b946c877e3006b34ffd2219335b30ba2e0980f43cebfb629d0b11fe70dff28883ca012c6ae4855fcefea20a08e189eaeed7eb36ed6db3835976f4e60053205805727c5eec15d0e9f155637a9e66268b9c1c302bcaae6ae88cbb8cf1668a487cc996c4662c4a4e195f094cb31c717165e0e13718f8388957dfe0bf69c70cd0bd763dc38c530b67b9c12244fcab8bd13f602de848a2937699f9ef77944e5f22e3b470601789e1838fbea9359c733aaee2c7082b02ee459b7684ef9bbc200da4b62d368351f5520a65ffa506dc9b097117bb7ae88d04d85fb525e91327689ec0fe86971480c0e864012b1e9f044c7d80a4e48c07320dd4292086e4c71d4c98dd826a9bfced112bfa2beb1ce85cad204451ec45703931bf637d4fe89fe8f485620b7f4b21e011a232ade7a8c92be77925e878ae0bea9723749528fe83cf89ecb9616dae6ca0e8d5754ec6c92abb21108c2f33cdc18c6887c430b72c5b193356494cddccc577bd4c2cd53188f352846edff0c2ac7869cb74bb16a77c0f0f194a7a9477ae15abb890bd0bcfeb0c39381a87f1d05319c7e971c10e9ef687f96450b400e25b4285032892b849fd5db8649cedfb03c88defea063ee144a1ab1f3bf05f59c7db364dc39c11a446c3ce16307d78d50315ba29f5bb9a57438564c8c7b3e367cd37d74b2375a4966f47489dc5448f4979428abd32193d3840aa983d3020a9f29d760fc7493ab2576c90b1934b799c1d0d55e4f2caa78f4ce61930c79dc017c2dea0c5085d73a3b0e4a6f341e9a5061a6658af11e5edf95bdad915ac3619969e39bee15788a8de667f92f4efc84f35082d52d562aa74e12cc7f22d3425b58f5056d74afcf162cd44e65b9ee510ff91af094c3d2d42c3b088536d62a98f1c689edcf3ea3fc228d711c109d76ae83d82d6a34dcfbad563cf3726519b519fd48b51741aa86720836494b7a589c778927047a25d73508adaa401e9a6c0767a675e31c5556cbe35fadc9671359b45e985c3c8af84113989b299ae4474b85e4b5d4b0578ab1e8a2915a8df97c4f52a639fe32272cb91bbfb721505dec46d51383cb8973425a714245c2e37d0577fbe0d66381d9239db1f08a380cf609dc699698e0fada2caeda44d58d766c4f8214b10642b80b8d7d8add7cc41d47108ab7d07dab71069a2d982cc900b331caec317942122158bac6eac9175c2dcba0c04443aa9188832b553f5ca8c336880824d6bc02486a2b4c086665d276aafe3b1b93729829adca50c44466fd5b5cb977aa78fbcf5c0f0da1b09216468a11493ffb39efdeda5d669ae92bee2f2fb250aa1b9cbb11c36c7a6c6dd26cdc3cfd572ffd8c1dd72a13c27a327a34c6b6b3d80fc6c67c72152eec0c8ecbdc1bd5cb829b811e7f29af6d786f4e93dd4c96fdda295a6aa258d7b2fcf291c2d68e0b1866032475964ec0c6f2fa8c2d6a3936ecb187350def4e818507bf157c0e9b33406be7660605af14cccc9c799b4e051d0d0899e53495bb8931a6e2984bc6dbe4e02ec8b4642fc2f1cb5fd5a5520b48cfcb49e1f9533838753554dd98b6a1b8a67409279df477330e5f37367e06247ca5c3ffefd00e693dcc0c9c30754121c9ee88a574915b9e77c104fd2f921c2c096573951407ba9b440423d76bdc6fc978237a6e302cede7f99038ec31500884775556941f1edc30e3a417b0e02cb6fb5bfbe5cdfacf4006411287bedc565fb06f1be987416407dc852254934df4ab59edce476f3506e65be6ce6ddf91038642291fb8e92ba5b1f0b105670905a2c14796110bac6f52455b430a47b8eff61 + +Len = 48824 +Msg = cd8490c93613bdf1f284b94b330f6d6f45a39c651d2a160b340e2eb696fc6d1c35e88872845190d141c669de92a97daa5433b1d7b0b899fdef2ce74b8fe72a7296a5b5be26d1dc86520367c730c7400c2fa06f91ab4c48a7bf4ae35a5b9acd5296c4fdf7451b0ad9cc439b4e34f11e5d7ef2bdda376f8dd34d6f092b219dc085dd4c4a6308b8808f588eedbbc7af7f64e83182fc7ca7cf4741a341060a7969d31445834c982fa8739ded4555108acbea1666a83da17f77cc42ee73323eb53203e3b790f81c08e94c44678b6538096ab7b09916e6cf7ceb2af85987f8e4d982dff1ab59b0bdccaae1f405a73366b5c5935dd0b43e2d2894290ceb66a0246dc02de728c5bba30255fb56ce8107c3144246c5156a8fe40ada9126adf67227fa56b66c37be63f532516211ca012977b04a97916f201f1baa2629eda520b51508ab4229df2ceedce406dece0110e0a911464f69e7be38fb91deba0addcdb3161d2799c628f5a57fa1dc37357c947681bd9c36f4832c20ac466c0c245de3b250c33282ea1a02d007f03b34ed427631283eb614db4d521f555136e7e42b4cfbee8134c63dbe3bb79b5a8b9f9f5b9f5ac61cfab1c54d197f1e3ba613f251eed616df952d691b88a16466343ef2d0f63882ddd2d55b8a6786308b2257f5d7b38af166bd7f1339d2d8899c9eda8fa86215850ba547450c267eb3c9147d96c38161a69d1584e521ffa23384313a1debcd37f72ddad02adb3cadce7ee34b7c1f42a15d0d030487daf9488aa7562845a11ee7ffccdb38b300935caa31f78a4ff3dd93403cf0c6a16ca611b58c736aafd33d6dc56f0f47878211d26f6ab801b9453a7f74b44593dae0f047ddbbf2c902891111729edec44f69a05944b18e7a601f41ad24fd6833da3dbe3029bd390de7c9841b2ee2b079b2bd2737518fe1bbec88da64769dc36e4a8bf716c219b2fe059d7dd220c1ed2c59878db5bf8b198e0689edee921ebc0cd2d3853fcf57c363050ce58071c5fda6ebcfbc1bb62e9eb956286291a108bdd4191c4ff47900d6068e1ea26b487649af119b9bb15dfed804836f2196cbe12d8fc86e3d7ce89b52ad49dc9ddbce5b370f73f512bedd853039366612453733740586d1372143b09f21dd4dbe1a2bfc308db8e4098c5e4b0c1e16141ee50e85fafefc4e2529b3c7252af37aee6f86e19df28871686107d7d57dcc812bc077602642d2ecefdd5f694b8f336913210793e4068da2178600b1f41cffb5221c9b4b6298afb47e85701d7b1a44241679d8996f916c81ff437261cfc358b9ec42a2ce16ca3bacb8690d6c1d91cfb3e0bf1e7ba45bd01606df856fd03c7e946f7ab371a89e1fde86d05fdd97bd7b1c583b04c2ed2b5f6815a460645e4e1b4e950bf6bd81dd0352d1048df85266f1696534aff5b1cbc17f15d82cc8e0c0d4f0453f9439094f8e0f7f4bc045b654d9a2f1f44a9c57019f63ecc41021c05b5380675cb56ea8bb691d79ee204d2c4edacde3c1fb3f4996a11d84b035f965e74009e2ab80e2c7ea3c84a834d4971a1e9cf423e4ea67ee526eb3c3e4c2d7372c4290a0741e1fcca5ae4cf36705abe98ac81e98a5419baefcaf3093a7e0449ef1021f88ffb7ad21b2677e41cdda12025b06542c4b2564f15e0b99db43b7c7020028bd829372122cd910227cb07c53cb58fd9dc620c0491f3e2bf883fe6ee8cb1f5b73767977d857e4513e8b5612f6ae4b56014e6a3ad2a065b65472212e2f611743484cfaef860999d1dc5608c58412fab888ad72bb87dd9b55b692f31e252daf8944ec5c02a5a9c23903c50dbd845f2fcc3bc9806af13ca7b025cabe675195b1d56f3fe7d7bca12530bcc0af217efcb03a218bdb6f9726536ea902c8303b02e3ced22be59753588b5f0e2f3419fa5345a942dbcdf3010465384a225ba26cdd0f1d74999c69f336bb6d01fae5cf81cbb8c1a7a29c1eb83ca6b51113bde56b8cfb6a5d72557622a37f039d090a689accd02b57c691174338de8e05bb3620c079705c969c58e56b079dc9eb44eb0fcebe548f5a31f4072a5ed56a2f03107bf40a359b2601eddf53cade66f294cfeaa40a0d94b9c90d15f61852f295d3911f8ea914d015885c8c64540a83badf0021a416c3e37b78236a2ecd1fce4114033416bdd3a36c18ec13250ee9c74c0fc4dd564b3d24a825802d5ae402a53bacace115ae3bbb329be79d1e5e42dbaf0a6446431145fe49b86a8703c7c41f8985d54f12e314c16ff89351d8addf66ebba2783f2d1a11965182aa0b0dd2de53586c5a695c6265c2b173958da648611090557bdebf11a1e042f089fe98e049f4796c60d26be38356fe020d9ace9008410d53a1bb7db78b52ee44bac364213f5c59f1eac4e3314f3423b92fdd7a6156608111ac6ddf58385ec1f3df12061208db98816ac948d803fad10d5ece2018c60faa13de5e5a9033745c824932e53f4122a39f635813545c1b74732cd55642f19ed6deca1585ebf7242c849bde981572a2199066e9c912b2068c8f1c8b936c43ae95c6e22bd7b80dfea05f495d751107da5928e806d0af905c87b5a0795df146af6580d8f9c6a0e2645686d43822ce9b4be0bd5937c097917e048b5af71c7e7521d490f107e9231ee5bd9fbf0727ba87774ed24cd52f471ffb71849ebd55605996515bdcfe95bb1df3541e7c42da4166dd01ec3597634aa6455d15fe14af435e8d7a55ff1682d55a2da867ae63d11fb3fd987fa5d7032ecefc35d3fb9570940e779e13da18070e6df5292f97f2a281f9598101102c955fe4808a2319c85fdef3d55b19e05bb8c2d3da64bafb67a53491513a24f6f0804aa162c8a7db25b38089373fecc45a0eaef65dd9be3b4b7f9436a5423fdcdb5a9b60138fc6a2261225390d9ae0d8ab7f0f7ffff69dca06881d33a637d634358abebb333df41151f239add91abaafc89070cb2159ce3a31655c22e4696c9fa7a7211d1251d4bb21ea4a321a3dbebc29d97f526251e40e548dcd7ed07587719a266f006179dcd22e50b3705152817057b097b043ad63b8d867edc20aea9b4c959ef4ff70f47128cfcc21e31f17978ecacc366f459ac1cc459a3976e4173ca322675f84f18036119ec2f204c3fb554a0b72f7e9d8c882ab147b3d280ca9dff7b9160b1b437b901f03cbc05fe05c6f44824b48aa8da52ae7dda1653fd500f9ccd221843cf76513b3b74d094f14d93a00d7cb954bc4cf2f04f9a35e38edcb1e84f62057647dcb3571f1dd296ca1e049f1746a8a282e85138500e7649db756b2d2ad88f11c471c89dc6be2cd43481013b8d0ae83da2b855cea7be424f8b2325b1850d1fdef03e765458df4513d57c72ba9751e1edc3c4e7f97e3202bb46eec7be89871ba3704aa6c6fc08851e551a3f655fa1fb798d12f003faf31c56b6df399a5dd0ed29ef9e4139dbc254bc5d6051840a859eabaaad56324588fae881fd638d2b70fb3813402df61d941ab495588e5fc3823249bf9a03cf877902394f512de118edaf98843a5445e9073fcfa409df3db0221f1c77e2dd21e74f9e10c9e180dc4ed17010eb949c6d67a22bd5337b2c68f9eccdec778ece728e91353696b742c8f5a3a569f054efb8c1ed478ee9b75e26c768a5816aa6bd08a4c72e745fdb5deb34ecb86b3a84346c1c70f9c16fc45bc0421f0da2f630912d5079f390cc53b78e343310de722b53d2a3b4aa386caa0d7e91986e19c3363426ba30eb5284293af81d00158a3f5233327b40c3b989725ba7dd5b31ac7abf8d3e0b737e843065cd7316dc2f374a00bed4cf9caa0d6e232c854df1bc24c3d484bc6bcb14ec770d5745474dc6ac3b3ddbffc551c9fcc2c56a5e0ae17948457c01e701bf1554022bc2b7d9dd42b2b91172fd85e6874d2d61fc7b3bb3cee2a9bfec09f6d7e98279c6f511f4140b116c856c1438e34bca59fdca2409f025b896a52d68719bf93e82e7d89bbf798991fda0af8d06d17f39eba4bca09c1fe594b537ad4c9b94ab52c895539d639425f9146b24b016368a638e5bba391bc8763cae7c52ff9c496884f1d84e5e08ed451358ecb3c4919dd410e82cac35ae744078287c05c89b42999ea6b8b127d40d53a5722d45139e8bc507a11e7add7fa9ab12cc40afeec008a4668e3e6440f27bb5780936c0e3668ac51262390c79b3f21fd041cf36ba3522f3a552714ff188bfd554c60d0e7d11213cf7d3864a5175d4047c2f3284741f18ec22995a5b82bf62190151bc1529c6d9927f9b0c1dacebd9c2dc406f7f64a973f9a70cff6e3abeebeb46514bbf2ead382f7262d46bd43d88c1b91a9011d1f8ba81fa536a7162aee2b2ec6fc0f2d6efc87b98d2e41e0f946969da659c21053775ece415a34d42b6cfd5bc52259867b411dfb991461ca618052309ca9c96468c2da12dfab0e822ff3bbe7ba281982a239ac19c47024fe1f0e3550cf0975add1f680a9dac9b2c4ab0aed4f409ddda6765eb8a0a9d1e9d07458c69ac8195541219b18efcd06c0001f2ae7fee2d404666a18ca3cb3aa4f0623e86c5b1229f6c2ca28d951111294b91edc52730b6b2c46e000672a7c89b2f38045bd3e37dbb8a75e18687a514dcf740c87a34834d3c3cc8aadf6166ec0c42d2be92f90a3af49633ff23cd80848ceb57ac550eaf9ae496bdc6a2d7cf50fe107895b4a1ed014f78af24eccd6a07420f1dc0df1e7c44b4ba937dd43cab9c798371b148325578d61931766af02b45054bdc2d9fcab2f4b49092f6fff7c27886820739d6140a4a905f0020249e8ae8dd87da1a1e7b1851eb01045aaa72dc8a2bf68055e7aed41d85336648a3405195d2ab61b0e29a770461f32fd05e14c17d72c5252f026a7b9abe7ea9176d3c46f6ed9fb716758d97b41e4f5d81a24538f763d83eecafafc668422612b40cfc32b3354b24755fbe400a2bfed494fe6d0ba0051713b776e67e2f1915e94708e6dc74b398f2f526933aad8fe7dc32faf40022606aebb6e0756b994c3176fae7640ee06d6c67bd54764c4752f1bf831f43e0227cba101174c5554ce26400f333dd8e9f6db1cdf670ce407d7d06c3aef4c0724b62edc8f1ba3e04f0e394d15a73b9255abb4d6ac70303dcf9160d32dc02d4804219ed5c7e3b48402e58ab2f58305f9bb95d2a8759947de96328ed5234cfe7d0b2a9a014df7e4cd0ae48906315f139b8635d2e6bd4aba32e62b8906cdfe5622c411bf0373d0cb07d17bb2bb5b83eae4401c243605fd1df759fd0ddc704ccab5a9776c40fbf6bde0f11b9646c699f26063a9550ac228c9884c277bcadcc0a2c225dc203e28e253c4e464b23d2529d09c7b7dd3c984667372472b615645f294c4e3b0797f9d1c234015b78502d98bfc04f1fa2f16cf3e7221d5794d035e4b172a4d84e679cb1c82df2fb49d3c6668eb1661bed56705096c2371a19d668832808eedd9e5b1256c18fe7ccc494e5e29145d453c553ec86fb7f3a634d0d45661875f2f1005ba5e734c1a976f37cd23450e4606e32d027bc9ec2edd9395e14b2082179bd7b4f9b8caa2d00a2de71d48553f7d4153cb56a1b08f11925e4b11c9281744ae9171f3d6faa3ab3f88c5c34fd23e4f6efeceafdcbc07686ef56efa62c0ad62f1cdcb4d3b5bc508c1f05263bc347158fa5495828f34eb7fcde98fefaa82bafeefed3f4a58968d751c051b52e0047f066de5be533bc3b1e439ab1c8602f6c67503803c8fa113737cb8279f358dbacdf45432b7a654d0e1122cca93420e956661d7275181c75b0d9c20e84c7007dfc49f27bc00007cf4ffa631c892981fd70141d532fcd51de5c23fe0b7a186d0dc296362f235d61698740cc315891cc9342da17843bcde274c17e462263d0e8b4832dd9075a7bbb443d4b26b41e534ad5551ed5ada102175e695363fb48d6b99ac978a3aa6f405d87f983384ce35740e930491d75675337c5dc081e3d301228e61bde5cc169968e5b4350cca2b085f9f75cc4b88497a78cd0a0073d90246c7dc102c7cbf3516498e8a41aa85d8cc5bc285ff66e8338e85ca83fb6889e2bccff52059bb9e92e92c155a349952680ffd0a3c346061a53fdf074417fc90c4d1af7c2acc3ee4b080752cbc9455ba5931b7e910f1e4af0efce905d2cc9c685923ead387fa532c0e8ad92719c76c281cd010e1acce500ae1443838b8afb48af032069dd07aa4df0d56bcb70a64592633699c8658102f1fbca441325e27f1732a7a973d8cb3a0684d72943ef6f1892f2d7ccf39bb6dfe5801ab98653bdbcfbb787bf125253be2624f6cf44177d588bd7b780d9e3f4e3a4e50b8a253fa21abce6a94b9073289c76773b46140f5a6e46b9de9ec066c176f5d1a69f380e1901216617363362d13ebb26ad74fb008ec08841550ff14ca800a1ecf2e007ebaad9f4e0d9664448d60ac0d8544243129fb81c1723b9b4bc2ee971dff736d9fcde0afbfbf5c50a4cc06a4c363998326c17bdc9e2508651dedd9a2a52bd87f8693cfcff60753acf9716c526e8635f12377e36564ae55d0fdb3c7997ec4dbdaa5b4d18c7b660acd95060831795da7d299a5a8d8cf9e92537dbd3ef7f56aebe38fa97c41da6bf0572a0270be7e5a7dcc0be3529339464c811052b65a938e874ea6da469c7d8992ce0aff1c75e82d1621ecb967213c65f2de582cb41de3804c507ddfc708ef3f6096ba4491e431160f98de806d0f334e03cfb7a3bece601099bd971253f3aa0df845da8b478603d5d88533d0cab9c89f2dd9a1404cf8939ffdda652a94093865a85fce2bc3d7babcff7b9f3306bd76b9af80c78ad518f89ee73b7a710da604e72f4927be8d65d06be2e0732fa786a83e27597cfbed9bf98df445499e0746b9f2cb9659ac0a9cef433148521f33b1d78d13c8441c0d1e20fd93ac450a3787a2292bcbd68cd1f961d34937be9a21abaf26f361bf53aa0c095e53c51f3e04d567eabe6e40d96a17c2bcc9230b18f7e079bc549a314b4ae21d30a3341aa205bc75c7f1d21b0a49549c300faeda243d0ce18da5e66c5b663cd705005dd9fea0a9564174abb797d64c58fdab1fae44576d514b75eaa31c9278b15bf9b6df7c6c2873d7a56fb91ab77b83761a09f9e1ddae535622fb87f7462256a60dd39dd3ceb6690b0272920b635ea639daf24f95462c523e5bbd8d8407c61163ab38877d5edfa04c2a78d4d240523ba97c7d01c71783f8748e85164b4dd08c25506a4ed18300b42b7bc6e417f512ae456ceec2ffc83190991a06d4a58ede215babcd3688e1d61f1975016244e80c88ae2aec05c7eeb1c50caca72b3b415b6b870bf5e10bd1ac3ba6b4acb1d1afac554444d94c97e171005fa4ea9c651bb4e527ff58d0c2f90fb453a92d6546a26e9e98395b09e8471bdcf2a145aacb649708cf048a7856ce8cf390c107ff2c66efbf2a76c5b041860ea576103cd8c6b25e50eca9ff6a2fa88083fe9ac0d1fb639c516b9bcdf23c34c6145a705498ff9b9747f15e1c08c63da6efeda4eca02c3f00dfec06c82220c9de840040118dde76be788daf84e6a2f44c81fe6defcc474f99c51c4648d297cbc48f081e0809dbda505d020cbe865e430e0491644ec8c52bd3ab8ce8c4862990f49fe2588caf804ce9500ef42d5a50c057c257168e283e4a4aedbe4ccfaf3eeffb212f9e23d15434d60bf4f455f512e2b655aff3225d1b217c261110cec0400f54dd303d6231d028c2eb649bccc91d30a6391c88bff9d447c3cf35a3467be5957e0ea4d4dc237c9f2c68ce48f658f820a3d72d559b60f233ce538c92cb148808e34fedf2d648c21e7f2ea29a77270c393bda42d869351d6c085d965dc12cbfd0311b8bf604f4391d378781eea3b5f1e0da9d0d8f8de88e56fe47d362cd46f591d3ec0f7cccb85a21f21ddcd4107821ce0ca9ddf99dfdfd9b0c9cd45053e5b1b4385bd8f5b227ada31b5c23e9420014474e8b4494fde7c38edfe70994d97b8cbdfac588df49a49c472fcce78cccc051f31cbbc1e0422878d8d490f3aee28adf1587c38fb7e7d1be54abeaa83cf54b633803a5e669ff4295df8735231ce39631616bd05e0e31117c722c2fd6787003b0bc7fe422a089c89329544e085d71102c1813769450a9f66f160d1702cdb17bd2c6fdf0f722762d193ce83623eeffab17b01b10a31db6e2feb6eb3abdbb2e36320e1a56e44e48d26090afa7f65003a98cbfef590ac3ec89b3eb230557cf6aa566e841806aa2767b21bb26fe001f11ae039e0c9a4bf1bf3d271960f16158eb5bd9ebf0080abd8369d512cab2d1aaae2b14d0ff6ee705a38fb0c801a98b0624cc138fc24834fdf430f33e1760db913da3290f34415c9e3df3e97da1780545ab68ac5a24db89f24d62f4a399728e4144a8c89f47ac2d29e30c49b0bcf790a5e3d3fcd1943c6a28f37251d9dd827a69579e6c17b629c927473b5a07b0a29d9562708d6c8ce576109ad1a3473ffb2047eb069beeec24c114bef392c929038c92abd0e6a19b610e27881361824d57008b7373d0ab76379570ded76c9b8284fe2c247791073c29b2fc6fca05019220ab92856892d3c0dcc6da0b597fe559c162d060d71513ebca050d9638164b9ae271fba5575ade787ec5aee8fc253d1b234b1df561db3e36ac64b9b0100dd6b407043537b2b141f diff --git a/lib/libssl/src/fips-1.0/sha/asm/fips-sx86-elf.s b/lib/libssl/src/fips-1.0/sha/asm/fips-sx86-elf.s new file mode 100644 index 00000000000..2a4d98791dc --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/asm/fips-sx86-elf.s @@ -0,0 +1,1568 @@ + + + + + + + .file "sha1-586.s" + .version "01.01" +gcc2_compiled.: +.text + .align 16 +.globl sha1_block_asm_data_order + .type sha1_block_asm_data_order,@function +sha1_block_asm_data_order: + movl 12(%esp), %ecx + pushl %esi + sall $6, %ecx + movl 12(%esp), %esi + pushl %ebp + addl %esi, %ecx + pushl %ebx + movl 16(%esp), %ebp + pushl %edi + movl 12(%ebp), %edx + subl $108, %esp + movl 16(%ebp), %edi + movl 8(%ebp), %ebx + movl %ecx, 68(%esp) + +.L000start: + + movl (%esi), %eax + movl 4(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, (%esp) + movl %ecx, 4(%esp) + movl 8(%esi), %eax + movl 12(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 8(%esp) + movl %ecx, 12(%esp) + movl 16(%esi), %eax + movl 20(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 16(%esp) + movl %ecx, 20(%esp) + movl 24(%esi), %eax + movl 28(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 24(%esp) + movl %ecx, 28(%esp) + movl 32(%esi), %eax + movl 36(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 32(%esp) + movl %ecx, 36(%esp) + movl 40(%esi), %eax + movl 44(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 40(%esp) + movl %ecx, 44(%esp) + movl 48(%esi), %eax + movl 52(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 48(%esp) + movl %ecx, 52(%esp) + movl 56(%esi), %eax + movl 60(%esi), %ecx + + xchgb %al, %ah + rorl $16, %eax + xchgb %al, %ah + + xchgb %cl, %ch + rorl $16, %ecx + xchgb %cl, %ch + movl %eax, 56(%esp) + movl %ecx, 60(%esp) + + + movl %esi, 132(%esp) +.L001shortcut: + + + movl (%ebp), %eax + movl 4(%ebp), %ecx + + movl %eax, %ebp + movl %ebx, %esi + roll $5, %ebp + xorl %edx, %esi + andl %ecx, %esi + rorl $2, %ecx + addl %edi, %ebp + movl (%esp), %edi + xorl %edx, %esi + leal 1518500249(%ebp,%edi,1),%ebp + addl %ebp, %esi + + movl %esi, %ebp + movl %ecx, %edi + roll $5, %ebp + xorl %ebx, %edi + andl %eax, %edi + rorl $2, %eax + addl %edx, %ebp + movl 4(%esp), %edx + xorl %ebx, %edi + leal 1518500249(%ebp,%edx,1),%ebp + addl %ebp, %edi + + movl %edi, %ebp + movl %eax, %edx + roll $5, %ebp + xorl %ecx, %edx + andl %esi, %edx + rorl $2, %esi + addl %ebx, %ebp + movl 8(%esp), %ebx + xorl %ecx, %edx + leal 1518500249(%ebp,%ebx,1),%ebp + addl %ebp, %edx + + movl %edx, %ebp + movl %esi, %ebx + roll $5, %ebp + xorl %eax, %ebx + andl %edi, %ebx + rorl $2, %edi + addl %ecx, %ebp + movl 12(%esp), %ecx + xorl %eax, %ebx + leal 1518500249(%ebp,%ecx,1),%ebp + addl %ebp, %ebx + + movl %ebx, %ebp + movl %edi, %ecx + roll $5, %ebp + xorl %esi, %ecx + andl %edx, %ecx + rorl $2, %edx + addl %eax, %ebp + movl 16(%esp), %eax + xorl %esi, %ecx + leal 1518500249(%ebp,%eax,1),%ebp + addl %ebp, %ecx + + movl %ecx, %ebp + movl %edx, %eax + roll $5, %ebp + xorl %edi, %eax + andl %ebx, %eax + rorl $2, %ebx + addl %esi, %ebp + movl 20(%esp), %esi + xorl %edi, %eax + leal 1518500249(%ebp,%esi,1),%ebp + addl %ebp, %eax + + movl %eax, %ebp + movl %ebx, %esi + roll $5, %ebp + xorl %edx, %esi + andl %ecx, %esi + rorl $2, %ecx + addl %edi, %ebp + movl 24(%esp), %edi + xorl %edx, %esi + leal 1518500249(%ebp,%edi,1),%ebp + addl %ebp, %esi + + movl %esi, %ebp + movl %ecx, %edi + roll $5, %ebp + xorl %ebx, %edi + andl %eax, %edi + rorl $2, %eax + addl %edx, %ebp + movl 28(%esp), %edx + xorl %ebx, %edi + leal 1518500249(%ebp,%edx,1),%ebp + addl %ebp, %edi + + movl %edi, %ebp + movl %eax, %edx + roll $5, %ebp + xorl %ecx, %edx + andl %esi, %edx + rorl $2, %esi + addl %ebx, %ebp + movl 32(%esp), %ebx + xorl %ecx, %edx + leal 1518500249(%ebp,%ebx,1),%ebp + addl %ebp, %edx + + movl %edx, %ebp + movl %esi, %ebx + roll $5, %ebp + xorl %eax, %ebx + andl %edi, %ebx + rorl $2, %edi + addl %ecx, %ebp + movl 36(%esp), %ecx + xorl %eax, %ebx + leal 1518500249(%ebp,%ecx,1),%ebp + addl %ebp, %ebx + + movl %ebx, %ebp + movl %edi, %ecx + roll $5, %ebp + xorl %esi, %ecx + andl %edx, %ecx + rorl $2, %edx + addl %eax, %ebp + movl 40(%esp), %eax + xorl %esi, %ecx + leal 1518500249(%ebp,%eax,1),%ebp + addl %ebp, %ecx + + movl %ecx, %ebp + movl %edx, %eax + roll $5, %ebp + xorl %edi, %eax + andl %ebx, %eax + rorl $2, %ebx + addl %esi, %ebp + movl 44(%esp), %esi + xorl %edi, %eax + leal 1518500249(%ebp,%esi,1),%ebp + addl %ebp, %eax + + movl %eax, %ebp + movl %ebx, %esi + roll $5, %ebp + xorl %edx, %esi + andl %ecx, %esi + rorl $2, %ecx + addl %edi, %ebp + movl 48(%esp), %edi + xorl %edx, %esi + leal 1518500249(%ebp,%edi,1),%ebp + addl %ebp, %esi + + movl %esi, %ebp + movl %ecx, %edi + roll $5, %ebp + xorl %ebx, %edi + andl %eax, %edi + rorl $2, %eax + addl %edx, %ebp + movl 52(%esp), %edx + xorl %ebx, %edi + leal 1518500249(%ebp,%edx,1),%ebp + addl %ebp, %edi + + movl %edi, %ebp + movl %eax, %edx + roll $5, %ebp + xorl %ecx, %edx + andl %esi, %edx + rorl $2, %esi + addl %ebx, %ebp + movl 56(%esp), %ebx + xorl %ecx, %edx + leal 1518500249(%ebp,%ebx,1),%ebp + addl %ebp, %edx + + movl %edx, %ebp + movl %esi, %ebx + roll $5, %ebp + xorl %eax, %ebx + andl %edi, %ebx + rorl $2, %edi + addl %ecx, %ebp + movl 60(%esp), %ecx + xorl %eax, %ebx + leal 1518500249(%ebp,%ecx,1),%ebp + addl %ebp, %ebx + + movl 8(%esp), %ecx + movl %edi, %ebp + xorl (%esp), %ecx + xorl %esi, %ebp + xorl 32(%esp), %ecx + andl %edx, %ebp + xorl 52(%esp), %ecx + rorl $2, %edx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, (%esp) + leal 1518500249(%ecx,%eax,1),%ecx + movl %ebx, %eax + addl %ebp, %ecx + roll $5, %eax + addl %eax, %ecx + + movl 12(%esp), %eax + movl %edx, %ebp + xorl 4(%esp), %eax + xorl %edi, %ebp + xorl 36(%esp), %eax + andl %ebx, %ebp + xorl 56(%esp), %eax + rorl $2, %ebx + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 4(%esp) + leal 1518500249(%eax,%esi,1),%eax + movl %ecx, %esi + addl %ebp, %eax + roll $5, %esi + addl %esi, %eax + + movl 16(%esp), %esi + movl %ebx, %ebp + xorl 8(%esp), %esi + xorl %edx, %ebp + xorl 40(%esp), %esi + andl %ecx, %ebp + xorl 60(%esp), %esi + rorl $2, %ecx + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 8(%esp) + leal 1518500249(%esi,%edi,1),%esi + movl %eax, %edi + addl %ebp, %esi + roll $5, %edi + addl %edi, %esi + + movl 20(%esp), %edi + movl %ecx, %ebp + xorl 12(%esp), %edi + xorl %ebx, %ebp + xorl 44(%esp), %edi + andl %eax, %ebp + xorl (%esp), %edi + rorl $2, %eax + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 12(%esp) + leal 1518500249(%edi,%edx,1),%edi + movl %esi, %edx + addl %ebp, %edi + roll $5, %edx + addl %edx, %edi + + movl 16(%esp), %edx + movl %esi, %ebp + xorl 24(%esp), %edx + rorl $2, %esi + xorl 48(%esp), %edx + xorl %eax, %ebp + xorl 4(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 16(%esp) + leal 1859775393(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 20(%esp), %ebx + movl %edi, %ebp + xorl 28(%esp), %ebx + rorl $2, %edi + xorl 52(%esp), %ebx + xorl %esi, %ebp + xorl 8(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 20(%esp) + leal 1859775393(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 24(%esp), %ecx + movl %edx, %ebp + xorl 32(%esp), %ecx + rorl $2, %edx + xorl 56(%esp), %ecx + xorl %edi, %ebp + xorl 12(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, 24(%esp) + leal 1859775393(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 28(%esp), %eax + movl %ebx, %ebp + xorl 36(%esp), %eax + rorl $2, %ebx + xorl 60(%esp), %eax + xorl %edx, %ebp + xorl 16(%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 28(%esp) + leal 1859775393(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 32(%esp), %esi + movl %ecx, %ebp + xorl 40(%esp), %esi + rorl $2, %ecx + xorl (%esp), %esi + xorl %ebx, %ebp + xorl 20(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 32(%esp) + leal 1859775393(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 36(%esp), %edi + movl %eax, %ebp + xorl 44(%esp), %edi + rorl $2, %eax + xorl 4(%esp), %edi + xorl %ecx, %ebp + xorl 24(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 36(%esp) + leal 1859775393(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl 40(%esp), %edx + movl %esi, %ebp + xorl 48(%esp), %edx + rorl $2, %esi + xorl 8(%esp), %edx + xorl %eax, %ebp + xorl 28(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 40(%esp) + leal 1859775393(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 44(%esp), %ebx + movl %edi, %ebp + xorl 52(%esp), %ebx + rorl $2, %edi + xorl 12(%esp), %ebx + xorl %esi, %ebp + xorl 32(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 44(%esp) + leal 1859775393(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 48(%esp), %ecx + movl %edx, %ebp + xorl 56(%esp), %ecx + rorl $2, %edx + xorl 16(%esp), %ecx + xorl %edi, %ebp + xorl 36(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, 48(%esp) + leal 1859775393(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 52(%esp), %eax + movl %ebx, %ebp + xorl 60(%esp), %eax + rorl $2, %ebx + xorl 20(%esp), %eax + xorl %edx, %ebp + xorl 40(%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 52(%esp) + leal 1859775393(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 56(%esp), %esi + movl %ecx, %ebp + xorl (%esp), %esi + rorl $2, %ecx + xorl 24(%esp), %esi + xorl %ebx, %ebp + xorl 44(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 56(%esp) + leal 1859775393(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 60(%esp), %edi + movl %eax, %ebp + xorl 4(%esp), %edi + rorl $2, %eax + xorl 28(%esp), %edi + xorl %ecx, %ebp + xorl 48(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 60(%esp) + leal 1859775393(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl (%esp), %edx + movl %esi, %ebp + xorl 8(%esp), %edx + rorl $2, %esi + xorl 32(%esp), %edx + xorl %eax, %ebp + xorl 52(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, (%esp) + leal 1859775393(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 4(%esp), %ebx + movl %edi, %ebp + xorl 12(%esp), %ebx + rorl $2, %edi + xorl 36(%esp), %ebx + xorl %esi, %ebp + xorl 56(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 4(%esp) + leal 1859775393(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 8(%esp), %ecx + movl %edx, %ebp + xorl 16(%esp), %ecx + rorl $2, %edx + xorl 40(%esp), %ecx + xorl %edi, %ebp + xorl 60(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, 8(%esp) + leal 1859775393(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 12(%esp), %eax + movl %ebx, %ebp + xorl 20(%esp), %eax + rorl $2, %ebx + xorl 44(%esp), %eax + xorl %edx, %ebp + xorl (%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 12(%esp) + leal 1859775393(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 16(%esp), %esi + movl %ecx, %ebp + xorl 24(%esp), %esi + rorl $2, %ecx + xorl 48(%esp), %esi + xorl %ebx, %ebp + xorl 4(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 16(%esp) + leal 1859775393(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 20(%esp), %edi + movl %eax, %ebp + xorl 28(%esp), %edi + rorl $2, %eax + xorl 52(%esp), %edi + xorl %ecx, %ebp + xorl 8(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 20(%esp) + leal 1859775393(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl 24(%esp), %edx + movl %esi, %ebp + xorl 32(%esp), %edx + rorl $2, %esi + xorl 56(%esp), %edx + xorl %eax, %ebp + xorl 12(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 24(%esp) + leal 1859775393(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 28(%esp), %ebx + movl %edi, %ebp + xorl 36(%esp), %ebx + rorl $2, %edi + xorl 60(%esp), %ebx + xorl %esi, %ebp + xorl 16(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 28(%esp) + leal 1859775393(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 32(%esp), %ecx + movl %edx, %ebp + xorl 40(%esp), %ecx + orl %edi, %ebp + xorl (%esp), %ecx + andl %esi, %ebp + xorl 20(%esp), %ecx +.byte 209 +.byte 193 + movl %ecx, 32(%esp) + leal 2400959708(%ecx,%eax,1),%ecx + movl %edx, %eax + rorl $2, %edx + andl %edi, %eax + orl %eax, %ebp + movl %ebx, %eax + roll $5, %eax + addl %eax, %ebp + addl %ebp, %ecx + + movl 36(%esp), %eax + movl %ebx, %ebp + xorl 44(%esp), %eax + orl %edx, %ebp + xorl 4(%esp), %eax + andl %edi, %ebp + xorl 24(%esp), %eax +.byte 209 +.byte 192 + movl %eax, 36(%esp) + leal 2400959708(%eax,%esi,1),%eax + movl %ebx, %esi + rorl $2, %ebx + andl %edx, %esi + orl %esi, %ebp + movl %ecx, %esi + roll $5, %esi + addl %esi, %ebp + addl %ebp, %eax + + movl 40(%esp), %esi + movl %ecx, %ebp + xorl 48(%esp), %esi + orl %ebx, %ebp + xorl 8(%esp), %esi + andl %edx, %ebp + xorl 28(%esp), %esi +.byte 209 +.byte 198 + movl %esi, 40(%esp) + leal 2400959708(%esi,%edi,1),%esi + movl %ecx, %edi + rorl $2, %ecx + andl %ebx, %edi + orl %edi, %ebp + movl %eax, %edi + roll $5, %edi + addl %edi, %ebp + addl %ebp, %esi + + movl 44(%esp), %edi + movl %eax, %ebp + xorl 52(%esp), %edi + orl %ecx, %ebp + xorl 12(%esp), %edi + andl %ebx, %ebp + xorl 32(%esp), %edi +.byte 209 +.byte 199 + movl %edi, 44(%esp) + leal 2400959708(%edi,%edx,1),%edi + movl %eax, %edx + rorl $2, %eax + andl %ecx, %edx + orl %edx, %ebp + movl %esi, %edx + roll $5, %edx + addl %edx, %ebp + addl %ebp, %edi + + movl 48(%esp), %edx + movl %esi, %ebp + xorl 56(%esp), %edx + orl %eax, %ebp + xorl 16(%esp), %edx + andl %ecx, %ebp + xorl 36(%esp), %edx +.byte 209 +.byte 194 + movl %edx, 48(%esp) + leal 2400959708(%edx,%ebx,1),%edx + movl %esi, %ebx + rorl $2, %esi + andl %eax, %ebx + orl %ebx, %ebp + movl %edi, %ebx + roll $5, %ebx + addl %ebx, %ebp + addl %ebp, %edx + + movl 52(%esp), %ebx + movl %edi, %ebp + xorl 60(%esp), %ebx + orl %esi, %ebp + xorl 20(%esp), %ebx + andl %eax, %ebp + xorl 40(%esp), %ebx +.byte 209 +.byte 195 + movl %ebx, 52(%esp) + leal 2400959708(%ebx,%ecx,1),%ebx + movl %edi, %ecx + rorl $2, %edi + andl %esi, %ecx + orl %ecx, %ebp + movl %edx, %ecx + roll $5, %ecx + addl %ecx, %ebp + addl %ebp, %ebx + + movl 56(%esp), %ecx + movl %edx, %ebp + xorl (%esp), %ecx + orl %edi, %ebp + xorl 24(%esp), %ecx + andl %esi, %ebp + xorl 44(%esp), %ecx +.byte 209 +.byte 193 + movl %ecx, 56(%esp) + leal 2400959708(%ecx,%eax,1),%ecx + movl %edx, %eax + rorl $2, %edx + andl %edi, %eax + orl %eax, %ebp + movl %ebx, %eax + roll $5, %eax + addl %eax, %ebp + addl %ebp, %ecx + + movl 60(%esp), %eax + movl %ebx, %ebp + xorl 4(%esp), %eax + orl %edx, %ebp + xorl 28(%esp), %eax + andl %edi, %ebp + xorl 48(%esp), %eax +.byte 209 +.byte 192 + movl %eax, 60(%esp) + leal 2400959708(%eax,%esi,1),%eax + movl %ebx, %esi + rorl $2, %ebx + andl %edx, %esi + orl %esi, %ebp + movl %ecx, %esi + roll $5, %esi + addl %esi, %ebp + addl %ebp, %eax + + movl (%esp), %esi + movl %ecx, %ebp + xorl 8(%esp), %esi + orl %ebx, %ebp + xorl 32(%esp), %esi + andl %edx, %ebp + xorl 52(%esp), %esi +.byte 209 +.byte 198 + movl %esi, (%esp) + leal 2400959708(%esi,%edi,1),%esi + movl %ecx, %edi + rorl $2, %ecx + andl %ebx, %edi + orl %edi, %ebp + movl %eax, %edi + roll $5, %edi + addl %edi, %ebp + addl %ebp, %esi + + movl 4(%esp), %edi + movl %eax, %ebp + xorl 12(%esp), %edi + orl %ecx, %ebp + xorl 36(%esp), %edi + andl %ebx, %ebp + xorl 56(%esp), %edi +.byte 209 +.byte 199 + movl %edi, 4(%esp) + leal 2400959708(%edi,%edx,1),%edi + movl %eax, %edx + rorl $2, %eax + andl %ecx, %edx + orl %edx, %ebp + movl %esi, %edx + roll $5, %edx + addl %edx, %ebp + addl %ebp, %edi + + movl 8(%esp), %edx + movl %esi, %ebp + xorl 16(%esp), %edx + orl %eax, %ebp + xorl 40(%esp), %edx + andl %ecx, %ebp + xorl 60(%esp), %edx +.byte 209 +.byte 194 + movl %edx, 8(%esp) + leal 2400959708(%edx,%ebx,1),%edx + movl %esi, %ebx + rorl $2, %esi + andl %eax, %ebx + orl %ebx, %ebp + movl %edi, %ebx + roll $5, %ebx + addl %ebx, %ebp + addl %ebp, %edx + + movl 12(%esp), %ebx + movl %edi, %ebp + xorl 20(%esp), %ebx + orl %esi, %ebp + xorl 44(%esp), %ebx + andl %eax, %ebp + xorl (%esp), %ebx +.byte 209 +.byte 195 + movl %ebx, 12(%esp) + leal 2400959708(%ebx,%ecx,1),%ebx + movl %edi, %ecx + rorl $2, %edi + andl %esi, %ecx + orl %ecx, %ebp + movl %edx, %ecx + roll $5, %ecx + addl %ecx, %ebp + addl %ebp, %ebx + + movl 16(%esp), %ecx + movl %edx, %ebp + xorl 24(%esp), %ecx + orl %edi, %ebp + xorl 48(%esp), %ecx + andl %esi, %ebp + xorl 4(%esp), %ecx +.byte 209 +.byte 193 + movl %ecx, 16(%esp) + leal 2400959708(%ecx,%eax,1),%ecx + movl %edx, %eax + rorl $2, %edx + andl %edi, %eax + orl %eax, %ebp + movl %ebx, %eax + roll $5, %eax + addl %eax, %ebp + addl %ebp, %ecx + + movl 20(%esp), %eax + movl %ebx, %ebp + xorl 28(%esp), %eax + orl %edx, %ebp + xorl 52(%esp), %eax + andl %edi, %ebp + xorl 8(%esp), %eax +.byte 209 +.byte 192 + movl %eax, 20(%esp) + leal 2400959708(%eax,%esi,1),%eax + movl %ebx, %esi + rorl $2, %ebx + andl %edx, %esi + orl %esi, %ebp + movl %ecx, %esi + roll $5, %esi + addl %esi, %ebp + addl %ebp, %eax + + movl 24(%esp), %esi + movl %ecx, %ebp + xorl 32(%esp), %esi + orl %ebx, %ebp + xorl 56(%esp), %esi + andl %edx, %ebp + xorl 12(%esp), %esi +.byte 209 +.byte 198 + movl %esi, 24(%esp) + leal 2400959708(%esi,%edi,1),%esi + movl %ecx, %edi + rorl $2, %ecx + andl %ebx, %edi + orl %edi, %ebp + movl %eax, %edi + roll $5, %edi + addl %edi, %ebp + addl %ebp, %esi + + movl 28(%esp), %edi + movl %eax, %ebp + xorl 36(%esp), %edi + orl %ecx, %ebp + xorl 60(%esp), %edi + andl %ebx, %ebp + xorl 16(%esp), %edi +.byte 209 +.byte 199 + movl %edi, 28(%esp) + leal 2400959708(%edi,%edx,1),%edi + movl %eax, %edx + rorl $2, %eax + andl %ecx, %edx + orl %edx, %ebp + movl %esi, %edx + roll $5, %edx + addl %edx, %ebp + addl %ebp, %edi + + movl 32(%esp), %edx + movl %esi, %ebp + xorl 40(%esp), %edx + orl %eax, %ebp + xorl (%esp), %edx + andl %ecx, %ebp + xorl 20(%esp), %edx +.byte 209 +.byte 194 + movl %edx, 32(%esp) + leal 2400959708(%edx,%ebx,1),%edx + movl %esi, %ebx + rorl $2, %esi + andl %eax, %ebx + orl %ebx, %ebp + movl %edi, %ebx + roll $5, %ebx + addl %ebx, %ebp + addl %ebp, %edx + + movl 36(%esp), %ebx + movl %edi, %ebp + xorl 44(%esp), %ebx + orl %esi, %ebp + xorl 4(%esp), %ebx + andl %eax, %ebp + xorl 24(%esp), %ebx +.byte 209 +.byte 195 + movl %ebx, 36(%esp) + leal 2400959708(%ebx,%ecx,1),%ebx + movl %edi, %ecx + rorl $2, %edi + andl %esi, %ecx + orl %ecx, %ebp + movl %edx, %ecx + roll $5, %ecx + addl %ecx, %ebp + addl %ebp, %ebx + + movl 40(%esp), %ecx + movl %edx, %ebp + xorl 48(%esp), %ecx + orl %edi, %ebp + xorl 8(%esp), %ecx + andl %esi, %ebp + xorl 28(%esp), %ecx +.byte 209 +.byte 193 + movl %ecx, 40(%esp) + leal 2400959708(%ecx,%eax,1),%ecx + movl %edx, %eax + rorl $2, %edx + andl %edi, %eax + orl %eax, %ebp + movl %ebx, %eax + roll $5, %eax + addl %eax, %ebp + addl %ebp, %ecx + + movl 44(%esp), %eax + movl %ebx, %ebp + xorl 52(%esp), %eax + orl %edx, %ebp + xorl 12(%esp), %eax + andl %edi, %ebp + xorl 32(%esp), %eax +.byte 209 +.byte 192 + movl %eax, 44(%esp) + leal 2400959708(%eax,%esi,1),%eax + movl %ebx, %esi + rorl $2, %ebx + andl %edx, %esi + orl %esi, %ebp + movl %ecx, %esi + roll $5, %esi + addl %esi, %ebp + addl %ebp, %eax + + movl 48(%esp), %esi + movl %ecx, %ebp + xorl 56(%esp), %esi + rorl $2, %ecx + xorl 16(%esp), %esi + xorl %ebx, %ebp + xorl 36(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 48(%esp) + leal 3395469782(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 52(%esp), %edi + movl %eax, %ebp + xorl 60(%esp), %edi + rorl $2, %eax + xorl 20(%esp), %edi + xorl %ecx, %ebp + xorl 40(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 52(%esp) + leal 3395469782(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl 56(%esp), %edx + movl %esi, %ebp + xorl (%esp), %edx + rorl $2, %esi + xorl 24(%esp), %edx + xorl %eax, %ebp + xorl 44(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 56(%esp) + leal 3395469782(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 60(%esp), %ebx + movl %edi, %ebp + xorl 4(%esp), %ebx + rorl $2, %edi + xorl 28(%esp), %ebx + xorl %esi, %ebp + xorl 48(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 60(%esp) + leal 3395469782(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl (%esp), %ecx + movl %edx, %ebp + xorl 8(%esp), %ecx + rorl $2, %edx + xorl 32(%esp), %ecx + xorl %edi, %ebp + xorl 52(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, (%esp) + leal 3395469782(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 4(%esp), %eax + movl %ebx, %ebp + xorl 12(%esp), %eax + rorl $2, %ebx + xorl 36(%esp), %eax + xorl %edx, %ebp + xorl 56(%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 4(%esp) + leal 3395469782(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 8(%esp), %esi + movl %ecx, %ebp + xorl 16(%esp), %esi + rorl $2, %ecx + xorl 40(%esp), %esi + xorl %ebx, %ebp + xorl 60(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 8(%esp) + leal 3395469782(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 12(%esp), %edi + movl %eax, %ebp + xorl 20(%esp), %edi + rorl $2, %eax + xorl 44(%esp), %edi + xorl %ecx, %ebp + xorl (%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 12(%esp) + leal 3395469782(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl 16(%esp), %edx + movl %esi, %ebp + xorl 24(%esp), %edx + rorl $2, %esi + xorl 48(%esp), %edx + xorl %eax, %ebp + xorl 4(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 16(%esp) + leal 3395469782(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 20(%esp), %ebx + movl %edi, %ebp + xorl 28(%esp), %ebx + rorl $2, %edi + xorl 52(%esp), %ebx + xorl %esi, %ebp + xorl 8(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 20(%esp) + leal 3395469782(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 24(%esp), %ecx + movl %edx, %ebp + xorl 32(%esp), %ecx + rorl $2, %edx + xorl 56(%esp), %ecx + xorl %edi, %ebp + xorl 12(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, 24(%esp) + leal 3395469782(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 28(%esp), %eax + movl %ebx, %ebp + xorl 36(%esp), %eax + rorl $2, %ebx + xorl 60(%esp), %eax + xorl %edx, %ebp + xorl 16(%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 28(%esp) + leal 3395469782(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 32(%esp), %esi + movl %ecx, %ebp + xorl 40(%esp), %esi + rorl $2, %ecx + xorl (%esp), %esi + xorl %ebx, %ebp + xorl 20(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 32(%esp) + leal 3395469782(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 36(%esp), %edi + movl %eax, %ebp + xorl 44(%esp), %edi + rorl $2, %eax + xorl 4(%esp), %edi + xorl %ecx, %ebp + xorl 24(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 36(%esp) + leal 3395469782(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + movl 40(%esp), %edx + movl %esi, %ebp + xorl 48(%esp), %edx + rorl $2, %esi + xorl 8(%esp), %edx + xorl %eax, %ebp + xorl 28(%esp), %edx + xorl %ecx, %ebp +.byte 209 +.byte 194 + movl %edx, 40(%esp) + leal 3395469782(%edx,%ebx,1),%edx + movl %edi, %ebx + roll $5, %ebx + addl %ebp, %edx + addl %ebx, %edx + + movl 44(%esp), %ebx + movl %edi, %ebp + xorl 52(%esp), %ebx + rorl $2, %edi + xorl 12(%esp), %ebx + xorl %esi, %ebp + xorl 32(%esp), %ebx + xorl %eax, %ebp +.byte 209 +.byte 195 + movl %ebx, 44(%esp) + leal 3395469782(%ebx,%ecx,1),%ebx + movl %edx, %ecx + roll $5, %ecx + addl %ebp, %ebx + addl %ecx, %ebx + + movl 48(%esp), %ecx + movl %edx, %ebp + xorl 56(%esp), %ecx + rorl $2, %edx + xorl 16(%esp), %ecx + xorl %edi, %ebp + xorl 36(%esp), %ecx + xorl %esi, %ebp +.byte 209 +.byte 193 + movl %ecx, 48(%esp) + leal 3395469782(%ecx,%eax,1),%ecx + movl %ebx, %eax + roll $5, %eax + addl %ebp, %ecx + addl %eax, %ecx + + movl 52(%esp), %eax + movl %ebx, %ebp + xorl 60(%esp), %eax + rorl $2, %ebx + xorl 20(%esp), %eax + xorl %edx, %ebp + xorl 40(%esp), %eax + xorl %edi, %ebp +.byte 209 +.byte 192 + movl %eax, 52(%esp) + leal 3395469782(%eax,%esi,1),%eax + movl %ecx, %esi + roll $5, %esi + addl %ebp, %eax + addl %esi, %eax + + movl 56(%esp), %esi + movl %ecx, %ebp + xorl (%esp), %esi + rorl $2, %ecx + xorl 24(%esp), %esi + xorl %ebx, %ebp + xorl 44(%esp), %esi + xorl %edx, %ebp +.byte 209 +.byte 198 + movl %esi, 56(%esp) + leal 3395469782(%esi,%edi,1),%esi + movl %eax, %edi + roll $5, %edi + addl %ebp, %esi + addl %edi, %esi + + movl 60(%esp), %edi + movl %eax, %ebp + xorl 4(%esp), %edi + rorl $2, %eax + xorl 28(%esp), %edi + xorl %ecx, %ebp + xorl 48(%esp), %edi + xorl %ebx, %ebp +.byte 209 +.byte 199 + movl %edi, 60(%esp) + leal 3395469782(%edi,%edx,1),%edi + movl %esi, %edx + roll $5, %edx + addl %ebp, %edi + addl %edx, %edi + + + movl 128(%esp), %ebp + movl 12(%ebp), %edx + addl %ecx, %edx + movl 4(%ebp), %ecx + addl %esi, %ecx + movl %eax, %esi + movl (%ebp), %eax + movl %edx, 12(%ebp) + addl %edi, %eax + movl 16(%ebp), %edi + addl %ebx, %edi + movl 8(%ebp), %ebx + addl %esi, %ebx + movl %eax, (%ebp) + movl 132(%esp), %esi + movl %ebx, 8(%ebp) + addl $64, %esi + movl 68(%esp), %eax + movl %edi, 16(%ebp) + cmpl %eax, %esi + movl %ecx, 4(%ebp) + jb .L000start + addl $108, %esp + popl %edi + popl %ebx + popl %ebp + popl %esi + ret +.L_sha1_block_asm_data_order_end: + .size sha1_block_asm_data_order,.L_sha1_block_asm_data_order_end-sha1_block_asm_data_order +.ident "desasm.pl" +.text + .align 16 +.globl sha1_block_asm_host_order + .type sha1_block_asm_host_order,@function +sha1_block_asm_host_order: + movl 12(%esp), %ecx + pushl %esi + sall $6, %ecx + movl 12(%esp), %esi + pushl %ebp + addl %esi, %ecx + pushl %ebx + movl 16(%esp), %ebp + pushl %edi + movl 12(%ebp), %edx + subl $108, %esp + movl 16(%ebp), %edi + movl 8(%ebp), %ebx + movl %ecx, 68(%esp) + + movl (%esi), %eax + movl 4(%esi), %ecx + movl %eax, (%esp) + movl %ecx, 4(%esp) + movl 8(%esi), %eax + movl 12(%esi), %ecx + movl %eax, 8(%esp) + movl %ecx, 12(%esp) + movl 16(%esi), %eax + movl 20(%esi), %ecx + movl %eax, 16(%esp) + movl %ecx, 20(%esp) + movl 24(%esi), %eax + movl 28(%esi), %ecx + movl %eax, 24(%esp) + movl %ecx, 28(%esp) + movl 32(%esi), %eax + movl 36(%esi), %ecx + movl %eax, 32(%esp) + movl %ecx, 36(%esp) + movl 40(%esi), %eax + movl 44(%esi), %ecx + movl %eax, 40(%esp) + movl %ecx, 44(%esp) + movl 48(%esi), %eax + movl 52(%esi), %ecx + movl %eax, 48(%esp) + movl %ecx, 52(%esp) + movl 56(%esi), %eax + movl 60(%esi), %ecx + movl %eax, 56(%esp) + movl %ecx, 60(%esp) + jmp .L001shortcut +.L_sha1_block_asm_host_order_end: + .size sha1_block_asm_host_order,.L_sha1_block_asm_host_order_end-sha1_block_asm_host_order +.ident "desasm.pl" diff --git a/lib/libssl/src/fips-1.0/sha/fips_md32_common.h b/lib/libssl/src/fips-1.0/sha/fips_md32_common.h new file mode 100644 index 00000000000..b5ad231e3a0 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_md32_common.h @@ -0,0 +1,623 @@ +/* crypto/md32_common.h */ +/* ==================================================================== + * Copyright (c) 1999-2002 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +/* + * This is a generic 32 bit "collector" for message digest algorithms. + * Whenever needed it collects input character stream into chunks of + * 32 bit values and invokes a block function that performs actual hash + * calculations. + * + * Porting guide. + * + * Obligatory macros: + * + * DATA_ORDER_IS_BIG_ENDIAN or DATA_ORDER_IS_LITTLE_ENDIAN + * this macro defines byte order of input stream. + * HASH_CBLOCK + * size of a unit chunk HASH_BLOCK operates on. + * HASH_LONG + * has to be at lest 32 bit wide, if it's wider, then + * HASH_LONG_LOG2 *has to* be defined along + * HASH_CTX + * context structure that at least contains following + * members: + * typedef struct { + * ... + * HASH_LONG Nl,Nh; + * HASH_LONG data[HASH_LBLOCK]; + * unsigned int num; + * ... + * } HASH_CTX; + * HASH_UPDATE + * name of "Update" function, implemented here. + * HASH_TRANSFORM + * name of "Transform" function, implemented here. + * HASH_FINAL + * name of "Final" function, implemented here. + * HASH_BLOCK_HOST_ORDER + * name of "block" function treating *aligned* input message + * in host byte order, implemented externally. + * HASH_BLOCK_DATA_ORDER + * name of "block" function treating *unaligned* input message + * in original (data) byte order, implemented externally (it + * actually is optional if data and host are of the same + * "endianess"). + * HASH_MAKE_STRING + * macro convering context variables to an ASCII hash string. + * + * Optional macros: + * + * B_ENDIAN or L_ENDIAN + * defines host byte-order. + * HASH_LONG_LOG2 + * defaults to 2 if not states otherwise. + * HASH_LBLOCK + * assumed to be HASH_CBLOCK/4 if not stated otherwise. + * HASH_BLOCK_DATA_ORDER_ALIGNED + * alternative "block" function capable of treating + * aligned input message in original (data) order, + * implemented externally. + * + * MD5 example: + * + * #define DATA_ORDER_IS_LITTLE_ENDIAN + * + * #define HASH_LONG MD5_LONG + * #define HASH_LONG_LOG2 MD5_LONG_LOG2 + * #define HASH_CTX MD5_CTX + * #define HASH_CBLOCK MD5_CBLOCK + * #define HASH_LBLOCK MD5_LBLOCK + * #define HASH_UPDATE MD5_Update + * #define HASH_TRANSFORM MD5_Transform + * #define HASH_FINAL MD5_Final + * #define HASH_BLOCK_HOST_ORDER md5_block_host_order + * #define HASH_BLOCK_DATA_ORDER md5_block_data_order + * + * <appro@fy.chalmers.se> + */ + +#if !defined(DATA_ORDER_IS_BIG_ENDIAN) && !defined(DATA_ORDER_IS_LITTLE_ENDIAN) +#error "DATA_ORDER must be defined!" +#endif + +#ifndef HASH_CBLOCK +#error "HASH_CBLOCK must be defined!" +#endif +#ifndef HASH_LONG +#error "HASH_LONG must be defined!" +#endif +#ifndef HASH_CTX +#error "HASH_CTX must be defined!" +#endif + +#ifndef HASH_UPDATE +#error "HASH_UPDATE must be defined!" +#endif +#ifndef HASH_TRANSFORM +#error "HASH_TRANSFORM must be defined!" +#endif +#ifndef HASH_FINAL +#error "HASH_FINAL must be defined!" +#endif + +#ifndef HASH_BLOCK_HOST_ORDER +#error "HASH_BLOCK_HOST_ORDER must be defined!" +#endif + +#if 0 +/* + * Moved below as it's required only if HASH_BLOCK_DATA_ORDER_ALIGNED + * isn't defined. + */ +#ifndef HASH_BLOCK_DATA_ORDER +#error "HASH_BLOCK_DATA_ORDER must be defined!" +#endif +#endif + +#ifndef HASH_LBLOCK +#define HASH_LBLOCK (HASH_CBLOCK/4) +#endif + +#ifndef HASH_LONG_LOG2 +#define HASH_LONG_LOG2 2 +#endif + +/* + * Engage compiler specific rotate intrinsic function if available. + */ +#undef ROTATE +#ifndef PEDANTIC +# if defined(_MSC_VER) || defined(__ICC) +# define ROTATE(a,n) _lrotl(a,n) +# elif defined(__MWERKS__) +# if defined(__POWERPC__) +# define ROTATE(a,n) __rlwinm(a,n,0,31) +# elif defined(__MC68K__) + /* Motorola specific tweak. <appro@fy.chalmers.se> */ +# define ROTATE(a,n) ( n<24 ? __rol(a,n) : __ror(a,32-n) ) +# else +# define ROTATE(a,n) __rol(a,n) +# endif +# elif defined(__GNUC__) && __GNUC__>=2 && !defined(OPENSSL_NO_ASM) && !defined(OPENSSL_NO_INLINE_ASM) + /* + * Some GNU C inline assembler templates. Note that these are + * rotates by *constant* number of bits! But that's exactly + * what we need here... + * <appro@fy.chalmers.se> + */ +# if defined(__i386) || defined(__i386__) || defined(__x86_64) || defined(__x86_64__) +# define ROTATE(a,n) ({ register unsigned int ret; \ + asm ( \ + "roll %1,%0" \ + : "=r"(ret) \ + : "I"(n), "0"(a) \ + : "cc"); \ + ret; \ + }) +# elif defined(__powerpc) || defined(__ppc__) || defined(__powerpc64__) +# define ROTATE(a,n) ({ register unsigned int ret; \ + asm ( \ + "rlwinm %0,%1,%2,0,31" \ + : "=r"(ret) \ + : "r"(a), "I"(n)); \ + ret; \ + }) +# endif +# endif +#endif /* PEDANTIC */ + +#if HASH_LONG_LOG2==2 /* Engage only if sizeof(HASH_LONG)== 4 */ +/* A nice byte order reversal from Wei Dai <weidai@eskimo.com> */ +#ifdef ROTATE +/* 5 instructions with rotate instruction, else 9 */ +#define REVERSE_FETCH32(a,l) ( \ + l=*(const HASH_LONG *)(a), \ + ((ROTATE(l,8)&0x00FF00FF)|(ROTATE((l&0x00FF00FF),24))) \ + ) +#else +/* 6 instructions with rotate instruction, else 8 */ +#define REVERSE_FETCH32(a,l) ( \ + l=*(const HASH_LONG *)(a), \ + l=(((l>>8)&0x00FF00FF)|((l&0x00FF00FF)<<8)), \ + ROTATE(l,16) \ + ) +/* + * Originally the middle line started with l=(((l&0xFF00FF00)>>8)|... + * It's rewritten as above for two reasons: + * - RISCs aren't good at long constants and have to explicitely + * compose 'em with several (well, usually 2) instructions in a + * register before performing the actual operation and (as you + * already realized:-) having same constant should inspire the + * compiler to permanently allocate the only register for it; + * - most modern CPUs have two ALUs, but usually only one has + * circuitry for shifts:-( this minor tweak inspires compiler + * to schedule shift instructions in a better way... + * + * <appro@fy.chalmers.se> + */ +#endif +#endif + +#ifndef ROTATE +#define ROTATE(a,n) (((a)<<(n))|(((a)&0xffffffff)>>(32-(n)))) +#endif + +/* + * Make some obvious choices. E.g., HASH_BLOCK_DATA_ORDER_ALIGNED + * and HASH_BLOCK_HOST_ORDER ought to be the same if input data + * and host are of the same "endianess". It's possible to mask + * this with blank #define HASH_BLOCK_DATA_ORDER though... + * + * <appro@fy.chalmers.se> + */ +#if defined(B_ENDIAN) +# if defined(DATA_ORDER_IS_BIG_ENDIAN) +# if !defined(HASH_BLOCK_DATA_ORDER_ALIGNED) && HASH_LONG_LOG2==2 +# define HASH_BLOCK_DATA_ORDER_ALIGNED HASH_BLOCK_HOST_ORDER +# endif +# endif +#elif defined(L_ENDIAN) +# if defined(DATA_ORDER_IS_LITTLE_ENDIAN) +# if !defined(HASH_BLOCK_DATA_ORDER_ALIGNED) && HASH_LONG_LOG2==2 +# define HASH_BLOCK_DATA_ORDER_ALIGNED HASH_BLOCK_HOST_ORDER +# endif +# endif +#endif + +#if !defined(HASH_BLOCK_DATA_ORDER_ALIGNED) +#ifndef HASH_BLOCK_DATA_ORDER +#error "HASH_BLOCK_DATA_ORDER must be defined!" +#endif +#endif + +#if defined(DATA_ORDER_IS_BIG_ENDIAN) + +#ifndef PEDANTIC +# if defined(__GNUC__) && __GNUC__>=2 && !defined(OPENSSL_NO_ASM) && !defined(OPENSSL_NO_INLINE_ASM) +# if defined(__i386) || defined(__i386__) || defined(__x86_64) || defined(__x86_64__) + /* + * This gives ~30-40% performance improvement in SHA-256 compiled + * with gcc [on P4]. Well, first macro to be frank. We can pull + * this trick on x86* platforms only, because these CPUs can fetch + * unaligned data without raising an exception. + */ +# define HOST_c2l(c,l) ({ unsigned int r=*((const unsigned int *)(c)); \ + asm ("bswapl %0":"=r"(r):"0"(r)); \ + (c)+=4; (l)=r; }) +# define HOST_l2c(l,c) ({ unsigned int r=(l); \ + asm ("bswapl %0":"=r"(r):"0"(r)); \ + *((unsigned int *)(c))=r; (c)+=4; r; }) +# endif +# endif +#endif + +#ifndef HOST_c2l +#define HOST_c2l(c,l) (l =(((unsigned long)(*((c)++)))<<24), \ + l|=(((unsigned long)(*((c)++)))<<16), \ + l|=(((unsigned long)(*((c)++)))<< 8), \ + l|=(((unsigned long)(*((c)++))) ), \ + l) +#endif +#define HOST_p_c2l(c,l,n) { \ + switch (n) { \ + case 0: l =((unsigned long)(*((c)++)))<<24; \ + case 1: l|=((unsigned long)(*((c)++)))<<16; \ + case 2: l|=((unsigned long)(*((c)++)))<< 8; \ + case 3: l|=((unsigned long)(*((c)++))); \ + } } +#define HOST_p_c2l_p(c,l,sc,len) { \ + switch (sc) { \ + case 0: l =((unsigned long)(*((c)++)))<<24; \ + if (--len == 0) break; \ + case 1: l|=((unsigned long)(*((c)++)))<<16; \ + if (--len == 0) break; \ + case 2: l|=((unsigned long)(*((c)++)))<< 8; \ + } } +/* NOTE the pointer is not incremented at the end of this */ +#define HOST_c2l_p(c,l,n) { \ + l=0; (c)+=n; \ + switch (n) { \ + case 3: l =((unsigned long)(*(--(c))))<< 8; \ + case 2: l|=((unsigned long)(*(--(c))))<<16; \ + case 1: l|=((unsigned long)(*(--(c))))<<24; \ + } } +#ifndef HOST_l2c +#define HOST_l2c(l,c) (*((c)++)=(unsigned char)(((l)>>24)&0xff), \ + *((c)++)=(unsigned char)(((l)>>16)&0xff), \ + *((c)++)=(unsigned char)(((l)>> 8)&0xff), \ + *((c)++)=(unsigned char)(((l) )&0xff), \ + l) +#endif + +#elif defined(DATA_ORDER_IS_LITTLE_ENDIAN) + +#if defined(__i386) || defined(__i386__) || defined(__x86_64) || defined(__x86_64__) + /* See comment in DATA_ORDER_IS_BIG_ENDIAN section. */ +# define HOST_c2l(c,l) ((l)=*((const unsigned int *)(c)), (c)+=4, l) +# define HOST_l2c(l,c) (*((unsigned int *)(c))=(l), (c)+=4, l) +#endif + +#ifndef HOST_c2l +#define HOST_c2l(c,l) (l =(((unsigned long)(*((c)++))) ), \ + l|=(((unsigned long)(*((c)++)))<< 8), \ + l|=(((unsigned long)(*((c)++)))<<16), \ + l|=(((unsigned long)(*((c)++)))<<24), \ + l) +#endif +#define HOST_p_c2l(c,l,n) { \ + switch (n) { \ + case 0: l =((unsigned long)(*((c)++))); \ + case 1: l|=((unsigned long)(*((c)++)))<< 8; \ + case 2: l|=((unsigned long)(*((c)++)))<<16; \ + case 3: l|=((unsigned long)(*((c)++)))<<24; \ + } } +#define HOST_p_c2l_p(c,l,sc,len) { \ + switch (sc) { \ + case 0: l =((unsigned long)(*((c)++))); \ + if (--len == 0) break; \ + case 1: l|=((unsigned long)(*((c)++)))<< 8; \ + if (--len == 0) break; \ + case 2: l|=((unsigned long)(*((c)++)))<<16; \ + } } +/* NOTE the pointer is not incremented at the end of this */ +#define HOST_c2l_p(c,l,n) { \ + l=0; (c)+=n; \ + switch (n) { \ + case 3: l =((unsigned long)(*(--(c))))<<16; \ + case 2: l|=((unsigned long)(*(--(c))))<< 8; \ + case 1: l|=((unsigned long)(*(--(c)))); \ + } } +#ifndef HOST_l2c +#define HOST_l2c(l,c) (*((c)++)=(unsigned char)(((l) )&0xff), \ + *((c)++)=(unsigned char)(((l)>> 8)&0xff), \ + *((c)++)=(unsigned char)(((l)>>16)&0xff), \ + *((c)++)=(unsigned char)(((l)>>24)&0xff), \ + l) +#endif + +#endif + +/* + * Time for some action:-) + */ + +int HASH_UPDATE (HASH_CTX *c, const void *data_, size_t len) + { + const unsigned char *data=data_; + register HASH_LONG * p; + register HASH_LONG l; + size_t sw,sc,ew,ec; + + if(FIPS_selftest_failed()) + return 0; + + if (len==0) return 1; + + l=(c->Nl+(((HASH_LONG)len)<<3))&0xffffffffUL; + /* 95-05-24 eay Fixed a bug with the overflow handling, thanks to + * Wei Dai <weidai@eskimo.com> for pointing it out. */ + if (l < c->Nl) /* overflow */ + c->Nh++; + c->Nh+=(len>>29); /* might cause compiler warning on 16-bit */ + c->Nl=l; + + if (c->num != 0) + { + p=c->data; + sw=c->num>>2; + sc=c->num&0x03; + + if ((c->num+len) >= HASH_CBLOCK) + { + l=p[sw]; HOST_p_c2l(data,l,sc); p[sw++]=l; + for (; sw<HASH_LBLOCK; sw++) + { + HOST_c2l(data,l); p[sw]=l; + } + HASH_BLOCK_HOST_ORDER (c,p,1); + len-=(HASH_CBLOCK-c->num); + c->num=0; + /* drop through and do the rest */ + } + else + { + c->num+=(unsigned int)len; + if ((sc+len) < 4) /* ugly, add char's to a word */ + { + l=p[sw]; HOST_p_c2l_p(data,l,sc,len); p[sw]=l; + } + else + { + ew=(c->num>>2); + ec=(c->num&0x03); + if (sc) + l=p[sw]; + HOST_p_c2l(data,l,sc); + p[sw++]=l; + for (; sw < ew; sw++) + { + HOST_c2l(data,l); p[sw]=l; + } + if (ec) + { + HOST_c2l_p(data,l,ec); p[sw]=l; + } + } + return 1; + } + } + + sw=len/HASH_CBLOCK; + if (sw > 0) + { +#if defined(HASH_BLOCK_DATA_ORDER_ALIGNED) + /* + * Note that HASH_BLOCK_DATA_ORDER_ALIGNED gets defined + * only if sizeof(HASH_LONG)==4. + */ + if ((((size_t)data)%4) == 0) + { + /* data is properly aligned so that we can cast it: */ + HASH_BLOCK_DATA_ORDER_ALIGNED (c,(const HASH_LONG *)data,sw); + sw*=HASH_CBLOCK; + data+=sw; + len-=sw; + } + else +#if !defined(HASH_BLOCK_DATA_ORDER) + while (sw--) + { + memcpy (p=c->data,data,HASH_CBLOCK); + HASH_BLOCK_DATA_ORDER_ALIGNED(c,p,1); + data+=HASH_CBLOCK; + len-=HASH_CBLOCK; + } +#endif +#endif +#if defined(HASH_BLOCK_DATA_ORDER) + { + HASH_BLOCK_DATA_ORDER(c,data,sw); + sw*=HASH_CBLOCK; + data+=sw; + len-=sw; + } +#endif + } + + if (len!=0) + { + p = c->data; + c->num = len; + ew=len>>2; /* words to copy */ + ec=len&0x03; + for (; ew; ew--,p++) + { + HOST_c2l(data,l); *p=l; + } + HOST_c2l_p(data,l,ec); + *p=l; + } + return 1; + } + + +void HASH_TRANSFORM (HASH_CTX *c, const unsigned char *data) + { +#if defined(HASH_BLOCK_DATA_ORDER_ALIGNED) + if ((((size_t)data)%4) == 0) + /* data is properly aligned so that we can cast it: */ + HASH_BLOCK_DATA_ORDER_ALIGNED (c,(const HASH_LONG *)data,1); + else +#if !defined(HASH_BLOCK_DATA_ORDER) + { + memcpy (c->data,data,HASH_CBLOCK); + HASH_BLOCK_DATA_ORDER_ALIGNED (c,c->data,1); + } +#endif +#endif +#if defined(HASH_BLOCK_DATA_ORDER) + HASH_BLOCK_DATA_ORDER (c,data,1); +#endif + } + + +int HASH_FINAL (unsigned char *md, HASH_CTX *c) + { + register HASH_LONG *p; + register unsigned long l; + register int i,j; + static const unsigned char end[4]={0x80,0x00,0x00,0x00}; + const unsigned char *cp=end; + + /* c->num should definitly have room for at least one more byte. */ + p=c->data; + i=c->num>>2; + j=c->num&0x03; + +#if 0 + /* purify often complains about the following line as an + * Uninitialized Memory Read. While this can be true, the + * following p_c2l macro will reset l when that case is true. + * This is because j&0x03 contains the number of 'valid' bytes + * already in p[i]. If and only if j&0x03 == 0, the UMR will + * occur but this is also the only time p_c2l will do + * l= *(cp++) instead of l|= *(cp++) + * Many thanks to Alex Tang <altitude@cic.net> for pickup this + * 'potential bug' */ +#ifdef PURIFY + if (j==0) p[i]=0; /* Yeah, but that's not the way to fix it:-) */ +#endif + l=p[i]; +#else + l = (j==0) ? 0 : p[i]; +#endif + HOST_p_c2l(cp,l,j); p[i++]=l; /* i is the next 'undefined word' */ + + if (i>(HASH_LBLOCK-2)) /* save room for Nl and Nh */ + { + if (i<HASH_LBLOCK) p[i]=0; + HASH_BLOCK_HOST_ORDER (c,p,1); + i=0; + } + for (; i<(HASH_LBLOCK-2); i++) + p[i]=0; + +#if defined(DATA_ORDER_IS_BIG_ENDIAN) + p[HASH_LBLOCK-2]=c->Nh; + p[HASH_LBLOCK-1]=c->Nl; +#elif defined(DATA_ORDER_IS_LITTLE_ENDIAN) + p[HASH_LBLOCK-2]=c->Nl; + p[HASH_LBLOCK-1]=c->Nh; +#endif + HASH_BLOCK_HOST_ORDER (c,p,1); + +#ifndef HASH_MAKE_STRING +#error "HASH_MAKE_STRING must be defined!" +#else + HASH_MAKE_STRING(c,md); +#endif + + c->num=0; + /* clear stuff, HASH_BLOCK may be leaving some stuff on the stack + * but I'm not worried :-) + OPENSSL_cleanse((void *)c,sizeof(HASH_CTX)); + */ + return 1; + } + +#ifndef MD32_REG_T +#define MD32_REG_T long +/* + * This comment was originaly written for MD5, which is why it + * discusses A-D. But it basically applies to all 32-bit digests, + * which is why it was moved to common header file. + * + * In case you wonder why A-D are declared as long and not + * as MD5_LONG. Doing so results in slight performance + * boost on LP64 architectures. The catch is we don't + * really care if 32 MSBs of a 64-bit register get polluted + * with eventual overflows as we *save* only 32 LSBs in + * *either* case. Now declaring 'em long excuses the compiler + * from keeping 32 MSBs zeroed resulting in 13% performance + * improvement under SPARC Solaris7/64 and 5% under AlphaLinux. + * Well, to be honest it should say that this *prevents* + * performance degradation. + * <appro@fy.chalmers.se> + * Apparently there're LP64 compilers that generate better + * code if A-D are declared int. Most notably GCC-x86_64 + * generates better code. + * <appro@fy.chalmers.se> + */ +#endif diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha.h b/lib/libssl/src/fips-1.0/sha/fips_sha.h new file mode 100644 index 00000000000..4520b06ce1e --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha.h @@ -0,0 +1,186 @@ +/* fips/sha1/fips_sha.h */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#ifndef HEADER_SHA_H +#define HEADER_SHA_H + +#include <openssl/e_os2.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#if defined(OPENSSL_NO_SHA) || (defined(OPENSSL_NO_SHA0) && defined(OPENSSL_NO_SHA1)) +#error SHA is disabled. +#endif + +/* + * !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! + * ! SHA_LONG has to be at least 32 bits wide. If it's wider, then ! + * ! SHA_LONG_LOG2 has to be defined along. ! + * !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! + */ + +#if defined(OPENSSL_SYS_WIN16) || defined(__LP32__) +#define SHA_LONG unsigned long +#elif defined(OPENSSL_SYS_CRAY) || defined(__ILP64__) +#define SHA_LONG unsigned long +#define SHA_LONG_LOG2 3 +#else +#define SHA_LONG unsigned int +#endif + +#define SHA_LBLOCK 16 +#define SHA_CBLOCK (SHA_LBLOCK*4) /* SHA treats input data as a + * contiguous array of 32 bit + * wide big-endian values. */ +#define SHA_LAST_BLOCK (SHA_CBLOCK-8) +#define SHA_DIGEST_LENGTH 20 + +typedef struct SHAstate_st + { + SHA_LONG h0,h1,h2,h3,h4; + SHA_LONG Nl,Nh; + SHA_LONG data[SHA_LBLOCK]; + unsigned int num; + } SHA_CTX; + +#ifndef OPENSSL_NO_SHA1 +int SHA1_Init(SHA_CTX *c); +int SHA1_Update(SHA_CTX *c, const void *data, size_t len); +int SHA1_Final(unsigned char *md, SHA_CTX *c); +unsigned char *SHA1(const unsigned char *d, size_t n, unsigned char *md); +void SHA1_Transform(SHA_CTX *c, const unsigned char *data); +#endif + +#define SHA256_CBLOCK (SHA_LBLOCK*4) /* SHA-256 treats input data as a + * contiguous array of 32 bit + * wide big-endian values. */ +#define SHA224_DIGEST_LENGTH 28 +#define SHA256_DIGEST_LENGTH 32 + +typedef struct SHA256state_st + { + SHA_LONG h[8]; + SHA_LONG Nl,Nh; + SHA_LONG data[SHA_LBLOCK]; + unsigned int num,md_len; + } SHA256_CTX; + +#ifndef OPENSSL_NO_SHA256 +int SHA224_Init(SHA256_CTX *c); +int SHA224_Update(SHA256_CTX *c, const void *data, size_t len); +int SHA224_Final(unsigned char *md, SHA256_CTX *c); +unsigned char *SHA224(const unsigned char *d, size_t n,unsigned char *md); +int SHA256_Init(SHA256_CTX *c); +int SHA256_Update(SHA256_CTX *c, const void *data, size_t len); +int SHA256_Final(unsigned char *md, SHA256_CTX *c); +unsigned char *SHA256(const unsigned char *d, size_t n,unsigned char *md); +void SHA256_Transform(SHA256_CTX *c, const unsigned char *data); +#endif + +#define SHA384_DIGEST_LENGTH 48 +#define SHA512_DIGEST_LENGTH 64 + +/* + * Unlike 32-bit digest algorithms, SHA-512 *relies* on SHA_LONG64 + * being exactly 64-bit wide. See Implementation Notes in sha512.c + * for further details. + */ +#define SHA512_CBLOCK (SHA_LBLOCK*8) /* SHA-512 treats input data as a + * contiguous array of 64 bit + * wide big-endian values. */ +#if (defined(_WIN32) || defined(_WIN64)) && !defined(__MINGW32__) +#define SHA_LONG64 unsigned __int64 +#define U64(C) C##UI64 +#elif defined(__arch64__) +#define SHA_LONG64 unsigned long +#define U64(C) C##UL +#else +#define SHA_LONG64 unsigned long long +#define U64(C) C##ULL +#endif + +typedef struct SHA512state_st + { + SHA_LONG64 h[8]; + SHA_LONG64 Nl,Nh; + union { + SHA_LONG64 d[SHA_LBLOCK]; + unsigned char p[SHA512_CBLOCK]; + } u; + unsigned int num,md_len; + } SHA512_CTX; + +#ifndef OPENSSL_NO_SHA512 +int SHA384_Init(SHA512_CTX *c); +int SHA384_Update(SHA512_CTX *c, const void *data, size_t len); +int SHA384_Final(unsigned char *md, SHA512_CTX *c); +unsigned char *SHA384(const unsigned char *d, size_t n,unsigned char *md); +int SHA512_Init(SHA512_CTX *c); +int SHA512_Update(SHA512_CTX *c, const void *data, size_t len); +int SHA512_Final(unsigned char *md, SHA512_CTX *c); +unsigned char *SHA512(const unsigned char *d, size_t n,unsigned char *md); +void SHA512_Transform(SHA512_CTX *c, const unsigned char *data); +#endif + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha1_selftest.c b/lib/libssl/src/fips-1.0/sha/fips_sha1_selftest.c new file mode 100644 index 00000000000..73a65cdc065 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha1_selftest.c @@ -0,0 +1,96 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <string.h> +#include <openssl/err.h> +#include <openssl/fips.h> +#include <openssl/fips_sha.h> + +#ifdef OPENSSL_FIPS +static char test[][60]= + { + "", + "abc", + "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq" + }; + +static const unsigned char ret[][SHA_DIGEST_LENGTH]= + { + { 0xda,0x39,0xa3,0xee,0x5e,0x6b,0x4b,0x0d,0x32,0x55, + 0xbf,0xef,0x95,0x60,0x18,0x90,0xaf,0xd8,0x07,0x09 }, + { 0xa9,0x99,0x3e,0x36,0x47,0x06,0x81,0x6a,0xba,0x3e, + 0x25,0x71,0x78,0x50,0xc2,0x6c,0x9c,0xd0,0xd8,0x9d }, + { 0x84,0x98,0x3e,0x44,0x1c,0x3b,0xd2,0x6e,0xba,0xae, + 0x4a,0xa1,0xf9,0x51,0x29,0xe5,0xe5,0x46,0x70,0xf1 }, + }; + +void FIPS_corrupt_sha1() + { + test[2][0]++; + } + +int FIPS_selftest_sha1() + { + int n; + + for(n=0 ; n<sizeof(test)/sizeof(test[0]) ; ++n) + { + unsigned char md[SHA_DIGEST_LENGTH]; + + SHA1((unsigned char*)test[n],strlen(test[n]),md); + if(memcmp(md,ret[n],sizeof md)) + { + FIPSerr(FIPS_F_FIPS_SELFTEST_SHA,FIPS_R_SELFTEST_FAILED); + return 0; + } + } + return 1; + } + +#endif diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha1dgst.c b/lib/libssl/src/fips-1.0/sha/fips_sha1dgst.c new file mode 100644 index 00000000000..fb9e15453c0 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha1dgst.c @@ -0,0 +1,96 @@ +/* crypto/sha/sha1dgst.c */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#if !defined(OPENSSL_NO_SHA1) && !defined(OPENSSL_NO_SHA) + +#undef SHA_0 +#define SHA_1 + +#include <openssl/opensslv.h> +#include <openssl/opensslconf.h> +#include <openssl/crypto.h> + +#ifdef OPENSSL_FIPS +const char SHA1_version[]="SHA1" OPENSSL_VERSION_PTEXT; + +/* The implementation is in fips_md32_common.h */ +#include "fips_sha_locl.h" + +unsigned char *SHA1(const unsigned char *d, size_t n, unsigned char *md) + { + SHA_CTX c; + static unsigned char m[SHA_DIGEST_LENGTH]; + + OPENSSL_assert(sizeof(unsigned long)<=sizeof(size_t)); + if (md == NULL) md=m; + if (!SHA1_Init(&c)) + return NULL; + SHA1_Update(&c,d,n); + SHA1_Final(md,&c); + OPENSSL_cleanse(&c,sizeof(c)); + return(md); + } + +#else /* ndef OPENSSL_FIPS */ + +static void *dummy=&dummy; + +#endif /* ndef OPENSSL_FIPS */ + +#endif + diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha256.c b/lib/libssl/src/fips-1.0/sha/fips_sha256.c new file mode 100644 index 00000000000..b5a1ca0cac2 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha256.c @@ -0,0 +1,325 @@ +/* crypto/sha/sha256.c */ +/* ==================================================================== + * Copyright (c) 2004 The OpenSSL Project. All rights reserved + * according to the OpenSSL license [found in ../../LICENSE]. + * ==================================================================== + */ +#if !defined(OPENSSL_NO_SHA) && !defined(OPENSSL_NO_SHA256) + +#include <stdlib.h> +#include <string.h> + +#include <openssl/opensslconf.h> +#include <openssl/crypto.h> +#include <openssl/fips_sha.h> +#include <openssl/fips.h> +#include <openssl/opensslv.h> + +#ifdef OPENSSL_FIPS + +const char SHA256_version[]="SHA-256" OPENSSL_VERSION_PTEXT; + +int SHA224_Init (SHA256_CTX *c) + { + c->h[0]=0xc1059ed8UL; c->h[1]=0x367cd507UL; + c->h[2]=0x3070dd17UL; c->h[3]=0xf70e5939UL; + c->h[4]=0xffc00b31UL; c->h[5]=0x68581511UL; + c->h[6]=0x64f98fa7UL; c->h[7]=0xbefa4fa4UL; + c->Nl=0; c->Nh=0; + c->num=0; c->md_len=SHA224_DIGEST_LENGTH; + return 1; + } + +int SHA256_Init (SHA256_CTX *c) + { + c->h[0]=0x6a09e667UL; c->h[1]=0xbb67ae85UL; + c->h[2]=0x3c6ef372UL; c->h[3]=0xa54ff53aUL; + c->h[4]=0x510e527fUL; c->h[5]=0x9b05688cUL; + c->h[6]=0x1f83d9abUL; c->h[7]=0x5be0cd19UL; + c->Nl=0; c->Nh=0; + c->num=0; c->md_len=SHA256_DIGEST_LENGTH; + return 1; + } + +unsigned char *SHA224(const unsigned char *d, size_t n, unsigned char *md) + { + SHA256_CTX c; + static unsigned char m[SHA224_DIGEST_LENGTH]; + + if (md == NULL) md=m; + SHA224_Init(&c); + SHA256_Update(&c,d,n); + SHA256_Final(md,&c); + OPENSSL_cleanse(&c,sizeof(c)); + return(md); + } + +unsigned char *SHA256(const unsigned char *d, size_t n, unsigned char *md) + { + SHA256_CTX c; + static unsigned char m[SHA256_DIGEST_LENGTH]; + + if (md == NULL) md=m; + SHA256_Init(&c); + SHA256_Update(&c,d,n); + SHA256_Final(md,&c); + OPENSSL_cleanse(&c,sizeof(c)); + return(md); + } + +int SHA224_Update(SHA256_CTX *c, const void *data, size_t len) +{ return SHA256_Update (c,data,len); } +int SHA224_Final (unsigned char *md, SHA256_CTX *c) +{ return SHA256_Final (md,c); } + +#ifndef SHA_LONG_LOG2 +#define SHA_LONG_LOG2 2 /* default to 32 bits */ +#endif + +#define DATA_ORDER_IS_BIG_ENDIAN + +#define HASH_LONG SHA_LONG +#define HASH_LONG_LOG2 SHA_LONG_LOG2 +#define HASH_CTX SHA256_CTX +#define HASH_CBLOCK SHA_CBLOCK +#define HASH_LBLOCK SHA_LBLOCK +/* + * Note that FIPS180-2 discusses "Truncation of the Hash Function Output." + * default: case below covers for it. It's not clear however if it's + * permitted to truncate to amount of bytes not divisible by 4. I bet not, + * but if it is, then default: case shall be extended. For reference. + * Idea behind separate cases for pre-defined lenghts is to let the + * compiler decide if it's appropriate to unroll small loops. + */ +#define HASH_MAKE_STRING(c,s) do { \ + unsigned long ll; \ + unsigned int n; \ + switch ((c)->md_len) \ + { case SHA224_DIGEST_LENGTH: \ + for (n=0;n<SHA224_DIGEST_LENGTH/4;n++) \ + { ll=(c)->h[n]; HOST_l2c(ll,(s)); } \ + break; \ + case SHA256_DIGEST_LENGTH: \ + for (n=0;n<SHA256_DIGEST_LENGTH/4;n++) \ + { ll=(c)->h[n]; HOST_l2c(ll,(s)); } \ + break; \ + default: \ + if ((c)->md_len > SHA256_DIGEST_LENGTH) \ + return 0; \ + for (n=0;n<(c)->md_len/4;n++) \ + { ll=(c)->h[n]; HOST_l2c(ll,(s)); } \ + break; \ + } \ + } while (0) + +#define HASH_UPDATE SHA256_Update +#define HASH_TRANSFORM SHA256_Transform +#define HASH_FINAL SHA256_Final +#define HASH_BLOCK_HOST_ORDER sha256_block_host_order +#define HASH_BLOCK_DATA_ORDER sha256_block_data_order +void sha256_block_host_order (SHA256_CTX *ctx, const void *in, size_t num); +void sha256_block_data_order (SHA256_CTX *ctx, const void *in, size_t num); + +#include "fips_md32_common.h" + +#ifdef SHA256_ASM +void sha256_block (SHA256_CTX *ctx, const void *in, size_t num, int host); +#else +static const SHA_LONG K256[64] = { + 0x428a2f98UL,0x71374491UL,0xb5c0fbcfUL,0xe9b5dba5UL, + 0x3956c25bUL,0x59f111f1UL,0x923f82a4UL,0xab1c5ed5UL, + 0xd807aa98UL,0x12835b01UL,0x243185beUL,0x550c7dc3UL, + 0x72be5d74UL,0x80deb1feUL,0x9bdc06a7UL,0xc19bf174UL, + 0xe49b69c1UL,0xefbe4786UL,0x0fc19dc6UL,0x240ca1ccUL, + 0x2de92c6fUL,0x4a7484aaUL,0x5cb0a9dcUL,0x76f988daUL, + 0x983e5152UL,0xa831c66dUL,0xb00327c8UL,0xbf597fc7UL, + 0xc6e00bf3UL,0xd5a79147UL,0x06ca6351UL,0x14292967UL, + 0x27b70a85UL,0x2e1b2138UL,0x4d2c6dfcUL,0x53380d13UL, + 0x650a7354UL,0x766a0abbUL,0x81c2c92eUL,0x92722c85UL, + 0xa2bfe8a1UL,0xa81a664bUL,0xc24b8b70UL,0xc76c51a3UL, + 0xd192e819UL,0xd6990624UL,0xf40e3585UL,0x106aa070UL, + 0x19a4c116UL,0x1e376c08UL,0x2748774cUL,0x34b0bcb5UL, + 0x391c0cb3UL,0x4ed8aa4aUL,0x5b9cca4fUL,0x682e6ff3UL, + 0x748f82eeUL,0x78a5636fUL,0x84c87814UL,0x8cc70208UL, + 0x90befffaUL,0xa4506cebUL,0xbef9a3f7UL,0xc67178f2UL }; + +/* + * FIPS specification refers to right rotations, while our ROTATE macro + * is left one. This is why you might notice that rotation coefficients + * differ from those observed in FIPS document by 32-N... + */ +#define Sigma0(x) (ROTATE((x),30) ^ ROTATE((x),19) ^ ROTATE((x),10)) +#define Sigma1(x) (ROTATE((x),26) ^ ROTATE((x),21) ^ ROTATE((x),7)) +#define sigma0(x) (ROTATE((x),25) ^ ROTATE((x),14) ^ ((x)>>3)) +#define sigma1(x) (ROTATE((x),15) ^ ROTATE((x),13) ^ ((x)>>10)) + +#define Ch(x,y,z) (((x) & (y)) ^ ((~(x)) & (z))) +#define Maj(x,y,z) (((x) & (y)) ^ ((x) & (z)) ^ ((y) & (z))) + +#ifdef OPENSSL_SMALL_FOOTPRINT + +static void sha256_block (SHA256_CTX *ctx, const void *in, size_t num, int host) + { + unsigned MD32_REG_T a,b,c,d,e,f,g,h,s0,s1,T1,T2; + SHA_LONG X[16]; + int i; + const unsigned char *data=in; + + while (num--) { + + a = ctx->h[0]; b = ctx->h[1]; c = ctx->h[2]; d = ctx->h[3]; + e = ctx->h[4]; f = ctx->h[5]; g = ctx->h[6]; h = ctx->h[7]; + + if (host) + { + const SHA_LONG *W=(const SHA_LONG *)data; + + for (i=0;i<16;i++) + { + T1 = X[i] = W[i]; + T1 += h + Sigma1(e) + Ch(e,f,g) + K256[i]; + T2 = Sigma0(a) + Maj(a,b,c); + h = g; g = f; f = e; e = d + T1; + d = c; c = b; b = a; a = T1 + T2; + } + + data += SHA256_CBLOCK; + } + else + { + SHA_LONG l; + + for (i=0;i<16;i++) + { + HOST_c2l(data,l); T1 = X[i] = l; + T1 += h + Sigma1(e) + Ch(e,f,g) + K256[i]; + T2 = Sigma0(a) + Maj(a,b,c); + h = g; g = f; f = e; e = d + T1; + d = c; c = b; b = a; a = T1 + T2; + } + } + + for (;i<64;i++) + { + s0 = X[(i+1)&0x0f]; s0 = sigma0(s0); + s1 = X[(i+14)&0x0f]; s1 = sigma1(s1); + + T1 = X[i&0xf] += s0 + s1 + X[(i+9)&0xf]; + T1 += h + Sigma1(e) + Ch(e,f,g) + K256[i]; + T2 = Sigma0(a) + Maj(a,b,c); + h = g; g = f; f = e; e = d + T1; + d = c; c = b; b = a; a = T1 + T2; + } + + ctx->h[0] += a; ctx->h[1] += b; ctx->h[2] += c; ctx->h[3] += d; + ctx->h[4] += e; ctx->h[5] += f; ctx->h[6] += g; ctx->h[7] += h; + + } +} + +#else + +#define ROUND_00_15(i,a,b,c,d,e,f,g,h) do { \ + T1 += h + Sigma1(e) + Ch(e,f,g) + K256[i]; \ + h = Sigma0(a) + Maj(a,b,c); \ + d += T1; h += T1; } while (0) + +#define ROUND_16_63(i,a,b,c,d,e,f,g,h,X) do { \ + s0 = X[(i+1)&0x0f]; s0 = sigma0(s0); \ + s1 = X[(i+14)&0x0f]; s1 = sigma1(s1); \ + T1 = X[(i)&0x0f] += s0 + s1 + X[(i+9)&0x0f]; \ + ROUND_00_15(i,a,b,c,d,e,f,g,h); } while (0) + +static void sha256_block (SHA256_CTX *ctx, const void *in, size_t num, int host) + { + unsigned MD32_REG_T a,b,c,d,e,f,g,h,s0,s1,T1; + SHA_LONG X[16]; + int i; + const unsigned char *data=in; + + while (num--) { + + a = ctx->h[0]; b = ctx->h[1]; c = ctx->h[2]; d = ctx->h[3]; + e = ctx->h[4]; f = ctx->h[5]; g = ctx->h[6]; h = ctx->h[7]; + + if (host) + { + const SHA_LONG *W=(const SHA_LONG *)data; + + T1 = X[0] = W[0]; ROUND_00_15(0,a,b,c,d,e,f,g,h); + T1 = X[1] = W[1]; ROUND_00_15(1,h,a,b,c,d,e,f,g); + T1 = X[2] = W[2]; ROUND_00_15(2,g,h,a,b,c,d,e,f); + T1 = X[3] = W[3]; ROUND_00_15(3,f,g,h,a,b,c,d,e); + T1 = X[4] = W[4]; ROUND_00_15(4,e,f,g,h,a,b,c,d); + T1 = X[5] = W[5]; ROUND_00_15(5,d,e,f,g,h,a,b,c); + T1 = X[6] = W[6]; ROUND_00_15(6,c,d,e,f,g,h,a,b); + T1 = X[7] = W[7]; ROUND_00_15(7,b,c,d,e,f,g,h,a); + T1 = X[8] = W[8]; ROUND_00_15(8,a,b,c,d,e,f,g,h); + T1 = X[9] = W[9]; ROUND_00_15(9,h,a,b,c,d,e,f,g); + T1 = X[10] = W[10]; ROUND_00_15(10,g,h,a,b,c,d,e,f); + T1 = X[11] = W[11]; ROUND_00_15(11,f,g,h,a,b,c,d,e); + T1 = X[12] = W[12]; ROUND_00_15(12,e,f,g,h,a,b,c,d); + T1 = X[13] = W[13]; ROUND_00_15(13,d,e,f,g,h,a,b,c); + T1 = X[14] = W[14]; ROUND_00_15(14,c,d,e,f,g,h,a,b); + T1 = X[15] = W[15]; ROUND_00_15(15,b,c,d,e,f,g,h,a); + + data += SHA256_CBLOCK; + } + else + { + SHA_LONG l; + + HOST_c2l(data,l); T1 = X[0] = l; ROUND_00_15(0,a,b,c,d,e,f,g,h); + HOST_c2l(data,l); T1 = X[1] = l; ROUND_00_15(1,h,a,b,c,d,e,f,g); + HOST_c2l(data,l); T1 = X[2] = l; ROUND_00_15(2,g,h,a,b,c,d,e,f); + HOST_c2l(data,l); T1 = X[3] = l; ROUND_00_15(3,f,g,h,a,b,c,d,e); + HOST_c2l(data,l); T1 = X[4] = l; ROUND_00_15(4,e,f,g,h,a,b,c,d); + HOST_c2l(data,l); T1 = X[5] = l; ROUND_00_15(5,d,e,f,g,h,a,b,c); + HOST_c2l(data,l); T1 = X[6] = l; ROUND_00_15(6,c,d,e,f,g,h,a,b); + HOST_c2l(data,l); T1 = X[7] = l; ROUND_00_15(7,b,c,d,e,f,g,h,a); + HOST_c2l(data,l); T1 = X[8] = l; ROUND_00_15(8,a,b,c,d,e,f,g,h); + HOST_c2l(data,l); T1 = X[9] = l; ROUND_00_15(9,h,a,b,c,d,e,f,g); + HOST_c2l(data,l); T1 = X[10] = l; ROUND_00_15(10,g,h,a,b,c,d,e,f); + HOST_c2l(data,l); T1 = X[11] = l; ROUND_00_15(11,f,g,h,a,b,c,d,e); + HOST_c2l(data,l); T1 = X[12] = l; ROUND_00_15(12,e,f,g,h,a,b,c,d); + HOST_c2l(data,l); T1 = X[13] = l; ROUND_00_15(13,d,e,f,g,h,a,b,c); + HOST_c2l(data,l); T1 = X[14] = l; ROUND_00_15(14,c,d,e,f,g,h,a,b); + HOST_c2l(data,l); T1 = X[15] = l; ROUND_00_15(15,b,c,d,e,f,g,h,a); + } + + for (i=16;i<64;i+=8) + { + ROUND_16_63(i+0,a,b,c,d,e,f,g,h,X); + ROUND_16_63(i+1,h,a,b,c,d,e,f,g,X); + ROUND_16_63(i+2,g,h,a,b,c,d,e,f,X); + ROUND_16_63(i+3,f,g,h,a,b,c,d,e,X); + ROUND_16_63(i+4,e,f,g,h,a,b,c,d,X); + ROUND_16_63(i+5,d,e,f,g,h,a,b,c,X); + ROUND_16_63(i+6,c,d,e,f,g,h,a,b,X); + ROUND_16_63(i+7,b,c,d,e,f,g,h,a,X); + } + + ctx->h[0] += a; ctx->h[1] += b; ctx->h[2] += c; ctx->h[3] += d; + ctx->h[4] += e; ctx->h[5] += f; ctx->h[6] += g; ctx->h[7] += h; + + } + } + +#endif +#endif /* SHA256_ASM */ + +/* + * Idea is to trade couple of cycles for some space. On IA-32 we save + * about 4K in "big footprint" case. In "small footprint" case any gain + * is appreciated:-) + */ +void HASH_BLOCK_HOST_ORDER (SHA256_CTX *ctx, const void *in, size_t num) +{ sha256_block (ctx,in,num,1); } + +void HASH_BLOCK_DATA_ORDER (SHA256_CTX *ctx, const void *in, size_t num) +{ sha256_block (ctx,in,num,0); } + +#endif + +#endif /* OPENSSL_NO_SHA256 */ + diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha512.c b/lib/libssl/src/fips-1.0/sha/fips_sha512.c new file mode 100644 index 00000000000..9e906af315b --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha512.c @@ -0,0 +1,487 @@ +/* crypto/sha/sha512.c */ +/* ==================================================================== + * Copyright (c) 2004 The OpenSSL Project. All rights reserved + * according to the OpenSSL license [found in ../../LICENSE]. + * ==================================================================== + */ +#if !defined(OPENSSL_NO_SHA) && !defined(OPENSSL_NO_SHA512) +/* + * IMPLEMENTATION NOTES. + * + * As you might have noticed 32-bit hash algorithms: + * + * - permit SHA_LONG to be wider than 32-bit (case on CRAY); + * - optimized versions implement two transform functions: one operating + * on [aligned] data in host byte order and one - on data in input + * stream byte order; + * - share common byte-order neutral collector and padding function + * implementations, ../md32_common.h; + * + * Neither of the above applies to this SHA-512 implementations. Reasons + * [in reverse order] are: + * + * - it's the only 64-bit hash algorithm for the moment of this writing, + * there is no need for common collector/padding implementation [yet]; + * - by supporting only one transform function [which operates on + * *aligned* data in input stream byte order, big-endian in this case] + * we minimize burden of maintenance in two ways: a) collector/padding + * function is simpler; b) only one transform function to stare at; + * - SHA_LONG64 is required to be exactly 64-bit in order to be able to + * apply a number of optimizations to mitigate potential performance + * penalties caused by previous design decision; + * + * Caveat lector. + * + * Implementation relies on the fact that "long long" is 64-bit on + * both 32- and 64-bit platforms. If some compiler vendor comes up + * with 128-bit long long, adjustment to sha.h would be required. + * As this implementation relies on 64-bit integer type, it's totally + * inappropriate for platforms which don't support it, most notably + * 16-bit platforms. + * <appro@fy.chalmers.se> + */ +#include <stdlib.h> +#include <string.h> + +#include <openssl/opensslconf.h> +#include <openssl/crypto.h> +#include <openssl/fips_sha.h> +#include <openssl/fips.h> +#include <openssl/opensslv.h> + +#ifdef OPENSSL_FIPS + +const char SHA512_version[]="SHA-512" OPENSSL_VERSION_PTEXT; + +#if defined(_M_IX86) || defined(_M_AMD64) || defined(__i386) || defined(__x86_64) +#define SHA512_BLOCK_CAN_MANAGE_UNALIGNED_DATA +#endif + +int SHA384_Init (SHA512_CTX *c) + { + c->h[0]=U64(0xcbbb9d5dc1059ed8); + c->h[1]=U64(0x629a292a367cd507); + c->h[2]=U64(0x9159015a3070dd17); + c->h[3]=U64(0x152fecd8f70e5939); + c->h[4]=U64(0x67332667ffc00b31); + c->h[5]=U64(0x8eb44a8768581511); + c->h[6]=U64(0xdb0c2e0d64f98fa7); + c->h[7]=U64(0x47b5481dbefa4fa4); + c->Nl=0; c->Nh=0; + c->num=0; c->md_len=SHA384_DIGEST_LENGTH; + return 1; + } + +int SHA512_Init (SHA512_CTX *c) + { + c->h[0]=U64(0x6a09e667f3bcc908); + c->h[1]=U64(0xbb67ae8584caa73b); + c->h[2]=U64(0x3c6ef372fe94f82b); + c->h[3]=U64(0xa54ff53a5f1d36f1); + c->h[4]=U64(0x510e527fade682d1); + c->h[5]=U64(0x9b05688c2b3e6c1f); + c->h[6]=U64(0x1f83d9abfb41bd6b); + c->h[7]=U64(0x5be0cd19137e2179); + c->Nl=0; c->Nh=0; + c->num=0; c->md_len=SHA512_DIGEST_LENGTH; + return 1; + } + +#ifndef SHA512_ASM +static +#endif +void sha512_block (SHA512_CTX *ctx, const void *in, size_t num); + +int SHA512_Final (unsigned char *md, SHA512_CTX *c) + { + unsigned char *p=(unsigned char *)c->u.p; + size_t n=c->num; + + p[n]=0x80; /* There always is a room for one */ + n++; + if (n > (sizeof(c->u)-16)) + memset (p+n,0,sizeof(c->u)-n), n=0, + sha512_block (c,p,1); + + memset (p+n,0,sizeof(c->u)-16-n); +#ifdef B_ENDIAN + c->u.d[SHA_LBLOCK-2] = c->Nh; + c->u.d[SHA_LBLOCK-1] = c->Nl; +#else + p[sizeof(c->u)-1] = (unsigned char)(c->Nl); + p[sizeof(c->u)-2] = (unsigned char)(c->Nl>>8); + p[sizeof(c->u)-3] = (unsigned char)(c->Nl>>16); + p[sizeof(c->u)-4] = (unsigned char)(c->Nl>>24); + p[sizeof(c->u)-5] = (unsigned char)(c->Nl>>32); + p[sizeof(c->u)-6] = (unsigned char)(c->Nl>>40); + p[sizeof(c->u)-7] = (unsigned char)(c->Nl>>48); + p[sizeof(c->u)-8] = (unsigned char)(c->Nl>>56); + p[sizeof(c->u)-9] = (unsigned char)(c->Nh); + p[sizeof(c->u)-10] = (unsigned char)(c->Nh>>8); + p[sizeof(c->u)-11] = (unsigned char)(c->Nh>>16); + p[sizeof(c->u)-12] = (unsigned char)(c->Nh>>24); + p[sizeof(c->u)-13] = (unsigned char)(c->Nh>>32); + p[sizeof(c->u)-14] = (unsigned char)(c->Nh>>40); + p[sizeof(c->u)-15] = (unsigned char)(c->Nh>>48); + p[sizeof(c->u)-16] = (unsigned char)(c->Nh>>56); +#endif + + sha512_block (c,p,1); + + if (md==0) return 0; + + switch (c->md_len) + { + /* Let compiler decide if it's appropriate to unroll... */ + case SHA384_DIGEST_LENGTH: + for (n=0;n<SHA384_DIGEST_LENGTH/8;n++) + { + SHA_LONG64 t = c->h[n]; + + *(md++) = (unsigned char)(t>>56); + *(md++) = (unsigned char)(t>>48); + *(md++) = (unsigned char)(t>>40); + *(md++) = (unsigned char)(t>>32); + *(md++) = (unsigned char)(t>>24); + *(md++) = (unsigned char)(t>>16); + *(md++) = (unsigned char)(t>>8); + *(md++) = (unsigned char)(t); + } + break; + case SHA512_DIGEST_LENGTH: + for (n=0;n<SHA512_DIGEST_LENGTH/8;n++) + { + SHA_LONG64 t = c->h[n]; + + *(md++) = (unsigned char)(t>>56); + *(md++) = (unsigned char)(t>>48); + *(md++) = (unsigned char)(t>>40); + *(md++) = (unsigned char)(t>>32); + *(md++) = (unsigned char)(t>>24); + *(md++) = (unsigned char)(t>>16); + *(md++) = (unsigned char)(t>>8); + *(md++) = (unsigned char)(t); + } + break; + /* ... as well as make sure md_len is not abused. */ + default: return 0; + } + + return 1; + } + +int SHA384_Final (unsigned char *md,SHA512_CTX *c) +{ return SHA512_Final (md,c); } + +int SHA512_Update (SHA512_CTX *c, const void *_data, size_t len) + { + SHA_LONG64 l; + unsigned char *p=c->u.p; + const unsigned char *data=(const unsigned char *)_data; + + if(FIPS_selftest_failed()) + return 0; + + if (len==0) return 1; + + l = (c->Nl+(((SHA_LONG64)len)<<3))&U64(0xffffffffffffffff); + if (l < c->Nl) c->Nh++; + if (sizeof(len)>=8) c->Nh+=(((SHA_LONG64)len)>>61); + c->Nl=l; + + if (c->num != 0) + { + size_t n = sizeof(c->u) - c->num; + + if (len < n) + { + memcpy (p+c->num,data,len), c->num += len; + return 1; + } + else { + memcpy (p+c->num,data,n), c->num = 0; + len-=n, data+=n; + sha512_block (c,p,1); + } + } + + if (len >= sizeof(c->u)) + { +#ifndef SHA512_BLOCK_CAN_MANAGE_UNALIGNED_DATA + if ((size_t)data%sizeof(c->u.d[0]) != 0) + while (len >= sizeof(c->u)) + memcpy (p,data,sizeof(c->u)), + sha512_block (c,p,1), + len -= sizeof(c->u), + data += sizeof(c->u); + else +#endif + sha512_block (c,data,len/sizeof(c->u)), + data += len, + len %= sizeof(c->u), + data -= len; + } + + if (len != 0) memcpy (p,data,len), c->num = (int)len; + + return 1; + } + +int SHA384_Update (SHA512_CTX *c, const void *data, size_t len) +{ return SHA512_Update (c,data,len); } + +void SHA512_Transform (SHA512_CTX *c, const unsigned char *data) +{ sha512_block (c,data,1); } + +unsigned char *SHA384(const unsigned char *d, size_t n, unsigned char *md) + { + SHA512_CTX c; + static unsigned char m[SHA384_DIGEST_LENGTH]; + + if (md == NULL) md=m; + SHA384_Init(&c); + SHA512_Update(&c,d,n); + SHA512_Final(md,&c); + OPENSSL_cleanse(&c,sizeof(c)); + return(md); + } + +unsigned char *SHA512(const unsigned char *d, size_t n, unsigned char *md) + { + SHA512_CTX c; + static unsigned char m[SHA512_DIGEST_LENGTH]; + + if (md == NULL) md=m; + SHA512_Init(&c); + SHA512_Update(&c,d,n); + SHA512_Final(md,&c); + OPENSSL_cleanse(&c,sizeof(c)); + return(md); + } + +#ifndef SHA512_ASM +static const SHA_LONG64 K512[80] = { + U64(0x428a2f98d728ae22),U64(0x7137449123ef65cd), + U64(0xb5c0fbcfec4d3b2f),U64(0xe9b5dba58189dbbc), + U64(0x3956c25bf348b538),U64(0x59f111f1b605d019), + U64(0x923f82a4af194f9b),U64(0xab1c5ed5da6d8118), + U64(0xd807aa98a3030242),U64(0x12835b0145706fbe), + U64(0x243185be4ee4b28c),U64(0x550c7dc3d5ffb4e2), + U64(0x72be5d74f27b896f),U64(0x80deb1fe3b1696b1), + U64(0x9bdc06a725c71235),U64(0xc19bf174cf692694), + U64(0xe49b69c19ef14ad2),U64(0xefbe4786384f25e3), + U64(0x0fc19dc68b8cd5b5),U64(0x240ca1cc77ac9c65), + U64(0x2de92c6f592b0275),U64(0x4a7484aa6ea6e483), + U64(0x5cb0a9dcbd41fbd4),U64(0x76f988da831153b5), + U64(0x983e5152ee66dfab),U64(0xa831c66d2db43210), + U64(0xb00327c898fb213f),U64(0xbf597fc7beef0ee4), + U64(0xc6e00bf33da88fc2),U64(0xd5a79147930aa725), + U64(0x06ca6351e003826f),U64(0x142929670a0e6e70), + U64(0x27b70a8546d22ffc),U64(0x2e1b21385c26c926), + U64(0x4d2c6dfc5ac42aed),U64(0x53380d139d95b3df), + U64(0x650a73548baf63de),U64(0x766a0abb3c77b2a8), + U64(0x81c2c92e47edaee6),U64(0x92722c851482353b), + U64(0xa2bfe8a14cf10364),U64(0xa81a664bbc423001), + U64(0xc24b8b70d0f89791),U64(0xc76c51a30654be30), + U64(0xd192e819d6ef5218),U64(0xd69906245565a910), + U64(0xf40e35855771202a),U64(0x106aa07032bbd1b8), + U64(0x19a4c116b8d2d0c8),U64(0x1e376c085141ab53), + U64(0x2748774cdf8eeb99),U64(0x34b0bcb5e19b48a8), + U64(0x391c0cb3c5c95a63),U64(0x4ed8aa4ae3418acb), + U64(0x5b9cca4f7763e373),U64(0x682e6ff3d6b2b8a3), + U64(0x748f82ee5defb2fc),U64(0x78a5636f43172f60), + U64(0x84c87814a1f0ab72),U64(0x8cc702081a6439ec), + U64(0x90befffa23631e28),U64(0xa4506cebde82bde9), + U64(0xbef9a3f7b2c67915),U64(0xc67178f2e372532b), + U64(0xca273eceea26619c),U64(0xd186b8c721c0c207), + U64(0xeada7dd6cde0eb1e),U64(0xf57d4f7fee6ed178), + U64(0x06f067aa72176fba),U64(0x0a637dc5a2c898a6), + U64(0x113f9804bef90dae),U64(0x1b710b35131c471b), + U64(0x28db77f523047d84),U64(0x32caab7b40c72493), + U64(0x3c9ebe0a15c9bebc),U64(0x431d67c49c100d4c), + U64(0x4cc5d4becb3e42b6),U64(0x597f299cfc657e2a), + U64(0x5fcb6fab3ad6faec),U64(0x6c44198c4a475817) }; + +#ifndef PEDANTIC +# if defined(__GNUC__) && __GNUC__>=2 && !defined(OPENSSL_NO_ASM) && !defined(OPENSSL_NO_INLINE_ASM) +# if defined(__x86_64) || defined(__x86_64__) +# define PULL64(x) ({ SHA_LONG64 ret=*((const SHA_LONG64 *)(&(x))); \ + asm ("bswapq %0" \ + : "=r"(ret) \ + : "0"(ret)); ret; }) +# endif +# endif +#endif + +#ifndef PULL64 +#define B(x,j) (((SHA_LONG64)(*(((const unsigned char *)(&x))+j)))<<((7-j)*8)) +#define PULL64(x) (B(x,0)|B(x,1)|B(x,2)|B(x,3)|B(x,4)|B(x,5)|B(x,6)|B(x,7)) +#endif + +#ifndef PEDANTIC +# if defined(_MSC_VER) +# if defined(_WIN64) /* applies to both IA-64 and AMD64 */ +# define ROTR(a,n) _rotr64((a),n) +# endif +# elif defined(__GNUC__) && __GNUC__>=2 && !defined(OPENSSL_NO_ASM) && !defined(OPENSSL_NO_INLINE_ASM) +# if defined(__x86_64) || defined(__x86_64__) +# define ROTR(a,n) ({ unsigned long ret; \ + asm ("rorq %1,%0" \ + : "=r"(ret) \ + : "J"(n),"0"(a) \ + : "cc"); ret; }) +# elif defined(_ARCH_PPC) && defined(__64BIT__) +# define ROTR(a,n) ({ unsigned long ret; \ + asm ("rotrdi %0,%1,%2" \ + : "=r"(ret) \ + : "r"(a),"K"(n)); ret; }) +# endif +# endif +#endif + +#ifndef ROTR +#define ROTR(x,s) (((x)>>s) | (x)<<(64-s)) +#endif + +#define Sigma0(x) (ROTR((x),28) ^ ROTR((x),34) ^ ROTR((x),39)) +#define Sigma1(x) (ROTR((x),14) ^ ROTR((x),18) ^ ROTR((x),41)) +#define sigma0(x) (ROTR((x),1) ^ ROTR((x),8) ^ ((x)>>7)) +#define sigma1(x) (ROTR((x),19) ^ ROTR((x),61) ^ ((x)>>6)) + +#define Ch(x,y,z) (((x) & (y)) ^ ((~(x)) & (z))) +#define Maj(x,y,z) (((x) & (y)) ^ ((x) & (z)) ^ ((y) & (z))) + +#ifdef OPENSSL_SMALL_FOOTPRINT + +static void sha512_block (SHA512_CTX *ctx, const void *in, size_t num) + { + const SHA_LONG64 *W=in; + SHA_LONG64 a,b,c,d,e,f,g,h,s0,s1,T1,T2; + SHA_LONG64 X[16]; + int i; + + while (num--) { + + a = ctx->h[0]; b = ctx->h[1]; c = ctx->h[2]; d = ctx->h[3]; + e = ctx->h[4]; f = ctx->h[5]; g = ctx->h[6]; h = ctx->h[7]; + + for (i=0;i<16;i++) + { +#ifdef B_ENDIAN + T1 = X[i] = W[i]; +#else + T1 = X[i] = PULL64(W[i]); +#endif + T1 += h + Sigma1(e) + Ch(e,f,g) + K512[i]; + T2 = Sigma0(a) + Maj(a,b,c); + h = g; g = f; f = e; e = d + T1; + d = c; c = b; b = a; a = T1 + T2; + } + + for (;i<80;i++) + { + s0 = X[(i+1)&0x0f]; s0 = sigma0(s0); + s1 = X[(i+14)&0x0f]; s1 = sigma1(s1); + + T1 = X[i&0xf] += s0 + s1 + X[(i+9)&0xf]; + T1 += h + Sigma1(e) + Ch(e,f,g) + K512[i]; + T2 = Sigma0(a) + Maj(a,b,c); + h = g; g = f; f = e; e = d + T1; + d = c; c = b; b = a; a = T1 + T2; + } + + ctx->h[0] += a; ctx->h[1] += b; ctx->h[2] += c; ctx->h[3] += d; + ctx->h[4] += e; ctx->h[5] += f; ctx->h[6] += g; ctx->h[7] += h; + + W+=SHA_LBLOCK; + } + } + +#else + +#define ROUND_00_15(i,a,b,c,d,e,f,g,h) do { \ + T1 += h + Sigma1(e) + Ch(e,f,g) + K512[i]; \ + h = Sigma0(a) + Maj(a,b,c); \ + d += T1; h += T1; } while (0) + +#define ROUND_16_80(i,a,b,c,d,e,f,g,h,X) do { \ + s0 = X[(i+1)&0x0f]; s0 = sigma0(s0); \ + s1 = X[(i+14)&0x0f]; s1 = sigma1(s1); \ + T1 = X[(i)&0x0f] += s0 + s1 + X[(i+9)&0x0f]; \ + ROUND_00_15(i,a,b,c,d,e,f,g,h); } while (0) + +static void sha512_block (SHA512_CTX *ctx, const void *in, size_t num) + { + const SHA_LONG64 *W=in; + SHA_LONG64 a,b,c,d,e,f,g,h,s0,s1,T1; + SHA_LONG64 X[16]; + int i; + + while (num--) { + + a = ctx->h[0]; b = ctx->h[1]; c = ctx->h[2]; d = ctx->h[3]; + e = ctx->h[4]; f = ctx->h[5]; g = ctx->h[6]; h = ctx->h[7]; + +#ifdef B_ENDIAN + T1 = X[0] = W[0]; ROUND_00_15(0,a,b,c,d,e,f,g,h); + T1 = X[1] = W[1]; ROUND_00_15(1,h,a,b,c,d,e,f,g); + T1 = X[2] = W[2]; ROUND_00_15(2,g,h,a,b,c,d,e,f); + T1 = X[3] = W[3]; ROUND_00_15(3,f,g,h,a,b,c,d,e); + T1 = X[4] = W[4]; ROUND_00_15(4,e,f,g,h,a,b,c,d); + T1 = X[5] = W[5]; ROUND_00_15(5,d,e,f,g,h,a,b,c); + T1 = X[6] = W[6]; ROUND_00_15(6,c,d,e,f,g,h,a,b); + T1 = X[7] = W[7]; ROUND_00_15(7,b,c,d,e,f,g,h,a); + T1 = X[8] = W[8]; ROUND_00_15(8,a,b,c,d,e,f,g,h); + T1 = X[9] = W[9]; ROUND_00_15(9,h,a,b,c,d,e,f,g); + T1 = X[10] = W[10]; ROUND_00_15(10,g,h,a,b,c,d,e,f); + T1 = X[11] = W[11]; ROUND_00_15(11,f,g,h,a,b,c,d,e); + T1 = X[12] = W[12]; ROUND_00_15(12,e,f,g,h,a,b,c,d); + T1 = X[13] = W[13]; ROUND_00_15(13,d,e,f,g,h,a,b,c); + T1 = X[14] = W[14]; ROUND_00_15(14,c,d,e,f,g,h,a,b); + T1 = X[15] = W[15]; ROUND_00_15(15,b,c,d,e,f,g,h,a); +#else + T1 = X[0] = PULL64(W[0]); ROUND_00_15(0,a,b,c,d,e,f,g,h); + T1 = X[1] = PULL64(W[1]); ROUND_00_15(1,h,a,b,c,d,e,f,g); + T1 = X[2] = PULL64(W[2]); ROUND_00_15(2,g,h,a,b,c,d,e,f); + T1 = X[3] = PULL64(W[3]); ROUND_00_15(3,f,g,h,a,b,c,d,e); + T1 = X[4] = PULL64(W[4]); ROUND_00_15(4,e,f,g,h,a,b,c,d); + T1 = X[5] = PULL64(W[5]); ROUND_00_15(5,d,e,f,g,h,a,b,c); + T1 = X[6] = PULL64(W[6]); ROUND_00_15(6,c,d,e,f,g,h,a,b); + T1 = X[7] = PULL64(W[7]); ROUND_00_15(7,b,c,d,e,f,g,h,a); + T1 = X[8] = PULL64(W[8]); ROUND_00_15(8,a,b,c,d,e,f,g,h); + T1 = X[9] = PULL64(W[9]); ROUND_00_15(9,h,a,b,c,d,e,f,g); + T1 = X[10] = PULL64(W[10]); ROUND_00_15(10,g,h,a,b,c,d,e,f); + T1 = X[11] = PULL64(W[11]); ROUND_00_15(11,f,g,h,a,b,c,d,e); + T1 = X[12] = PULL64(W[12]); ROUND_00_15(12,e,f,g,h,a,b,c,d); + T1 = X[13] = PULL64(W[13]); ROUND_00_15(13,d,e,f,g,h,a,b,c); + T1 = X[14] = PULL64(W[14]); ROUND_00_15(14,c,d,e,f,g,h,a,b); + T1 = X[15] = PULL64(W[15]); ROUND_00_15(15,b,c,d,e,f,g,h,a); +#endif + + for (i=16;i<80;i+=8) + { + ROUND_16_80(i+0,a,b,c,d,e,f,g,h,X); + ROUND_16_80(i+1,h,a,b,c,d,e,f,g,X); + ROUND_16_80(i+2,g,h,a,b,c,d,e,f,X); + ROUND_16_80(i+3,f,g,h,a,b,c,d,e,X); + ROUND_16_80(i+4,e,f,g,h,a,b,c,d,X); + ROUND_16_80(i+5,d,e,f,g,h,a,b,c,X); + ROUND_16_80(i+6,c,d,e,f,g,h,a,b,X); + ROUND_16_80(i+7,b,c,d,e,f,g,h,a,X); + } + + ctx->h[0] += a; ctx->h[1] += b; ctx->h[2] += c; ctx->h[3] += d; + ctx->h[4] += e; ctx->h[5] += f; ctx->h[6] += g; ctx->h[7] += h; + + W+=SHA_LBLOCK; + } + } + +#endif + +#endif /* SHA512_ASM */ + +#endif + +#endif /* OPENSSL_NO_SHA512 */ + diff --git a/lib/libssl/src/fips-1.0/sha/fips_sha_locl.h b/lib/libssl/src/fips-1.0/sha/fips_sha_locl.h new file mode 100644 index 00000000000..bf31d3b8451 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_sha_locl.h @@ -0,0 +1,482 @@ +/* crypto/sha/sha_locl.h */ +/* Copyright (C) 1995-1998 Eric Young (eay@cryptsoft.com) + * All rights reserved. + * + * This package is an SSL implementation written + * by Eric Young (eay@cryptsoft.com). + * The implementation was written so as to conform with Netscapes SSL. + * + * This library is free for commercial and non-commercial use as long as + * the following conditions are aheared to. The following conditions + * apply to all code found in this distribution, be it the RC4, RSA, + * lhash, DES, etc., code; not just the SSL code. The SSL documentation + * included with this distribution is covered by the same copyright terms + * except that the holder is Tim Hudson (tjh@cryptsoft.com). + * + * Copyright remains Eric Young's, and as such any Copyright notices in + * the code are not to be removed. + * If this package is used in a product, Eric Young should be given attribution + * as the author of the parts of the library used. + * This can be in the form of a textual message at program startup or + * in documentation (online or textual) provided with the package. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * "This product includes cryptographic software written by + * Eric Young (eay@cryptsoft.com)" + * The word 'cryptographic' can be left out if the rouines from the library + * being used are not cryptographic related :-). + * 4. If you include any Windows specific code (or a derivative thereof) from + * the apps directory (application code) you must include an acknowledgement: + * "This product includes software written by Tim Hudson (tjh@cryptsoft.com)" + * + * THIS SOFTWARE IS PROVIDED BY ERIC YOUNG ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * The licence and distribution terms for any publically available version or + * derivative of this code cannot be changed. i.e. this code cannot simply be + * copied and put under another distribution licence + * [including the GNU Public Licence.] + */ + +#include <stdlib.h> +#include <string.h> + +#include <openssl/opensslconf.h> +#include <openssl/fips_sha.h> +#include <openssl/fips.h> + +#ifndef SHA_LONG_LOG2 +#define SHA_LONG_LOG2 2 /* default to 32 bits */ +#endif + +#define DATA_ORDER_IS_BIG_ENDIAN + +#define HASH_LONG SHA_LONG +#define HASH_LONG_LOG2 SHA_LONG_LOG2 +#define HASH_CTX SHA_CTX +#define HASH_CBLOCK SHA_CBLOCK +#define HASH_LBLOCK SHA_LBLOCK +#define HASH_MAKE_STRING(c,s) do { \ + unsigned long ll; \ + ll=(c)->h0; HOST_l2c(ll,(s)); \ + ll=(c)->h1; HOST_l2c(ll,(s)); \ + ll=(c)->h2; HOST_l2c(ll,(s)); \ + ll=(c)->h3; HOST_l2c(ll,(s)); \ + ll=(c)->h4; HOST_l2c(ll,(s)); \ + } while (0) + +#if defined(SHA_0) + +# define HASH_UPDATE SHA_Update +# define HASH_TRANSFORM SHA_Transform +# define HASH_FINAL SHA_Final +# define HASH_INIT SHA_Init +# define HASH_BLOCK_HOST_ORDER sha_block_host_order +# define HASH_BLOCK_DATA_ORDER sha_block_data_order +# define Xupdate(a,ix,ia,ib,ic,id) (ix=(a)=(ia^ib^ic^id)) + + void sha_block_host_order (SHA_CTX *c, const void *p,size_t num); + void sha_block_data_order (SHA_CTX *c, const void *p,size_t num); + +#elif defined(SHA_1) + +# define HASH_UPDATE SHA1_Update +# define HASH_TRANSFORM SHA1_Transform +# define HASH_FINAL SHA1_Final +# define HASH_INIT SHA1_Init +# define HASH_BLOCK_HOST_ORDER sha1_block_host_order +# define HASH_BLOCK_DATA_ORDER sha1_block_data_order +# if defined(__MWERKS__) && defined(__MC68K__) + /* Metrowerks for Motorola fails otherwise:-( <appro@fy.chalmers.se> */ +# define Xupdate(a,ix,ia,ib,ic,id) do { (a)=(ia^ib^ic^id); \ + ix=(a)=ROTATE((a),1); \ + } while (0) +# else +# define Xupdate(a,ix,ia,ib,ic,id) ( (a)=(ia^ib^ic^id), \ + ix=(a)=ROTATE((a),1) \ + ) +# endif + +# ifdef SHA1_ASM +# if defined(__i386) || defined(__i386__) || defined(_M_IX86) || defined(__INTEL__) +# define sha1_block_host_order sha1_block_asm_host_order +# define DONT_IMPLEMENT_BLOCK_HOST_ORDER +# define sha1_block_data_order sha1_block_asm_data_order +# define DONT_IMPLEMENT_BLOCK_DATA_ORDER +# define HASH_BLOCK_DATA_ORDER_ALIGNED sha1_block_asm_data_order +# endif +# endif + void sha1_block_host_order (SHA_CTX *c, const void *p,size_t num); + void sha1_block_data_order (SHA_CTX *c, const void *p,size_t num); + +#else +# error "Either SHA_0 or SHA_1 must be defined." +#endif + +#include "fips_md32_common.h" + +#define INIT_DATA_h0 0x67452301UL +#define INIT_DATA_h1 0xefcdab89UL +#define INIT_DATA_h2 0x98badcfeUL +#define INIT_DATA_h3 0x10325476UL +#define INIT_DATA_h4 0xc3d2e1f0UL + +int HASH_INIT (SHA_CTX *c) + { + /* This assert denotes binary compatibility in 0.9.7 context + and commonly optimized away by compiler. */ + OPENSSL_assert(sizeof(unsigned long)<=sizeof(size_t)); + c->h0=INIT_DATA_h0; + c->h1=INIT_DATA_h1; + c->h2=INIT_DATA_h2; + c->h3=INIT_DATA_h3; + c->h4=INIT_DATA_h4; + c->Nl=0; + c->Nh=0; + c->num=0; + return 1; + } + +#define K_00_19 0x5a827999UL +#define K_20_39 0x6ed9eba1UL +#define K_40_59 0x8f1bbcdcUL +#define K_60_79 0xca62c1d6UL + +/* As pointed out by Wei Dai <weidai@eskimo.com>, F() below can be + * simplified to the code in F_00_19. Wei attributes these optimisations + * to Peter Gutmann's SHS code, and he attributes it to Rich Schroeppel. + * #define F(x,y,z) (((x) & (y)) | ((~(x)) & (z))) + * I've just become aware of another tweak to be made, again from Wei Dai, + * in F_40_59, (x&a)|(y&a) -> (x|y)&a + */ +#define F_00_19(b,c,d) ((((c) ^ (d)) & (b)) ^ (d)) +#define F_20_39(b,c,d) ((b) ^ (c) ^ (d)) +#define F_40_59(b,c,d) (((b) & (c)) | (((b)|(c)) & (d))) +#define F_60_79(b,c,d) F_20_39(b,c,d) + +#define BODY_00_15(i,a,b,c,d,e,f,xi) \ + (f)=xi+(e)+K_00_19+ROTATE((a),5)+F_00_19((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#define BODY_16_19(i,a,b,c,d,e,f,xi,xa,xb,xc,xd) \ + Xupdate(f,xi,xa,xb,xc,xd); \ + (f)+=(e)+K_00_19+ROTATE((a),5)+F_00_19((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#define BODY_20_31(i,a,b,c,d,e,f,xi,xa,xb,xc,xd) \ + Xupdate(f,xi,xa,xb,xc,xd); \ + (f)+=(e)+K_20_39+ROTATE((a),5)+F_20_39((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#define BODY_32_39(i,a,b,c,d,e,f,xa,xb,xc,xd) \ + Xupdate(f,xa,xa,xb,xc,xd); \ + (f)+=(e)+K_20_39+ROTATE((a),5)+F_20_39((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#define BODY_40_59(i,a,b,c,d,e,f,xa,xb,xc,xd) \ + Xupdate(f,xa,xa,xb,xc,xd); \ + (f)+=(e)+K_40_59+ROTATE((a),5)+F_40_59((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#define BODY_60_79(i,a,b,c,d,e,f,xa,xb,xc,xd) \ + Xupdate(f,xa,xa,xb,xc,xd); \ + (f)=xa+(e)+K_60_79+ROTATE((a),5)+F_60_79((b),(c),(d)); \ + (b)=ROTATE((b),30); + +#ifdef X +#undef X +#endif +#ifndef MD32_XARRAY + /* + * Originally X was an array. As it's automatic it's natural + * to expect RISC compiler to accomodate at least part of it in + * the register bank, isn't it? Unfortunately not all compilers + * "find" this expectation reasonable:-( On order to make such + * compilers generate better code I replace X[] with a bunch of + * X0, X1, etc. See the function body below... + * <appro@fy.chalmers.se> + */ +# define X(i) XX##i +#else + /* + * However! Some compilers (most notably HP C) get overwhelmed by + * that many local variables so that we have to have the way to + * fall down to the original behavior. + */ +# define X(i) XX[i] +#endif + +#ifndef DONT_IMPLEMENT_BLOCK_HOST_ORDER +void HASH_BLOCK_HOST_ORDER (SHA_CTX *c, const void *d, size_t num) + { + const SHA_LONG *W=d; + register unsigned MD32_REG_T A,B,C,D,E,T; +#ifndef MD32_XARRAY + unsigned MD32_REG_T XX0, XX1, XX2, XX3, XX4, XX5, XX6, XX7, + XX8, XX9,XX10,XX11,XX12,XX13,XX14,XX15; +#else + SHA_LONG XX[16]; +#endif + + if(FIPS_selftest_failed()) + return; + + A=c->h0; + B=c->h1; + C=c->h2; + D=c->h3; + E=c->h4; + + for (;;) + { + BODY_00_15( 0,A,B,C,D,E,T,W[ 0]); + BODY_00_15( 1,T,A,B,C,D,E,W[ 1]); + BODY_00_15( 2,E,T,A,B,C,D,W[ 2]); + BODY_00_15( 3,D,E,T,A,B,C,W[ 3]); + BODY_00_15( 4,C,D,E,T,A,B,W[ 4]); + BODY_00_15( 5,B,C,D,E,T,A,W[ 5]); + BODY_00_15( 6,A,B,C,D,E,T,W[ 6]); + BODY_00_15( 7,T,A,B,C,D,E,W[ 7]); + BODY_00_15( 8,E,T,A,B,C,D,W[ 8]); + BODY_00_15( 9,D,E,T,A,B,C,W[ 9]); + BODY_00_15(10,C,D,E,T,A,B,W[10]); + BODY_00_15(11,B,C,D,E,T,A,W[11]); + BODY_00_15(12,A,B,C,D,E,T,W[12]); + BODY_00_15(13,T,A,B,C,D,E,W[13]); + BODY_00_15(14,E,T,A,B,C,D,W[14]); + BODY_00_15(15,D,E,T,A,B,C,W[15]); + + BODY_16_19(16,C,D,E,T,A,B,X( 0),W[ 0],W[ 2],W[ 8],W[13]); + BODY_16_19(17,B,C,D,E,T,A,X( 1),W[ 1],W[ 3],W[ 9],W[14]); + BODY_16_19(18,A,B,C,D,E,T,X( 2),W[ 2],W[ 4],W[10],W[15]); + BODY_16_19(19,T,A,B,C,D,E,X( 3),W[ 3],W[ 5],W[11],X( 0)); + + BODY_20_31(20,E,T,A,B,C,D,X( 4),W[ 4],W[ 6],W[12],X( 1)); + BODY_20_31(21,D,E,T,A,B,C,X( 5),W[ 5],W[ 7],W[13],X( 2)); + BODY_20_31(22,C,D,E,T,A,B,X( 6),W[ 6],W[ 8],W[14],X( 3)); + BODY_20_31(23,B,C,D,E,T,A,X( 7),W[ 7],W[ 9],W[15],X( 4)); + BODY_20_31(24,A,B,C,D,E,T,X( 8),W[ 8],W[10],X( 0),X( 5)); + BODY_20_31(25,T,A,B,C,D,E,X( 9),W[ 9],W[11],X( 1),X( 6)); + BODY_20_31(26,E,T,A,B,C,D,X(10),W[10],W[12],X( 2),X( 7)); + BODY_20_31(27,D,E,T,A,B,C,X(11),W[11],W[13],X( 3),X( 8)); + BODY_20_31(28,C,D,E,T,A,B,X(12),W[12],W[14],X( 4),X( 9)); + BODY_20_31(29,B,C,D,E,T,A,X(13),W[13],W[15],X( 5),X(10)); + BODY_20_31(30,A,B,C,D,E,T,X(14),W[14],X( 0),X( 6),X(11)); + BODY_20_31(31,T,A,B,C,D,E,X(15),W[15],X( 1),X( 7),X(12)); + + BODY_32_39(32,E,T,A,B,C,D,X( 0),X( 2),X( 8),X(13)); + BODY_32_39(33,D,E,T,A,B,C,X( 1),X( 3),X( 9),X(14)); + BODY_32_39(34,C,D,E,T,A,B,X( 2),X( 4),X(10),X(15)); + BODY_32_39(35,B,C,D,E,T,A,X( 3),X( 5),X(11),X( 0)); + BODY_32_39(36,A,B,C,D,E,T,X( 4),X( 6),X(12),X( 1)); + BODY_32_39(37,T,A,B,C,D,E,X( 5),X( 7),X(13),X( 2)); + BODY_32_39(38,E,T,A,B,C,D,X( 6),X( 8),X(14),X( 3)); + BODY_32_39(39,D,E,T,A,B,C,X( 7),X( 9),X(15),X( 4)); + + BODY_40_59(40,C,D,E,T,A,B,X( 8),X(10),X( 0),X( 5)); + BODY_40_59(41,B,C,D,E,T,A,X( 9),X(11),X( 1),X( 6)); + BODY_40_59(42,A,B,C,D,E,T,X(10),X(12),X( 2),X( 7)); + BODY_40_59(43,T,A,B,C,D,E,X(11),X(13),X( 3),X( 8)); + BODY_40_59(44,E,T,A,B,C,D,X(12),X(14),X( 4),X( 9)); + BODY_40_59(45,D,E,T,A,B,C,X(13),X(15),X( 5),X(10)); + BODY_40_59(46,C,D,E,T,A,B,X(14),X( 0),X( 6),X(11)); + BODY_40_59(47,B,C,D,E,T,A,X(15),X( 1),X( 7),X(12)); + BODY_40_59(48,A,B,C,D,E,T,X( 0),X( 2),X( 8),X(13)); + BODY_40_59(49,T,A,B,C,D,E,X( 1),X( 3),X( 9),X(14)); + BODY_40_59(50,E,T,A,B,C,D,X( 2),X( 4),X(10),X(15)); + BODY_40_59(51,D,E,T,A,B,C,X( 3),X( 5),X(11),X( 0)); + BODY_40_59(52,C,D,E,T,A,B,X( 4),X( 6),X(12),X( 1)); + BODY_40_59(53,B,C,D,E,T,A,X( 5),X( 7),X(13),X( 2)); + BODY_40_59(54,A,B,C,D,E,T,X( 6),X( 8),X(14),X( 3)); + BODY_40_59(55,T,A,B,C,D,E,X( 7),X( 9),X(15),X( 4)); + BODY_40_59(56,E,T,A,B,C,D,X( 8),X(10),X( 0),X( 5)); + BODY_40_59(57,D,E,T,A,B,C,X( 9),X(11),X( 1),X( 6)); + BODY_40_59(58,C,D,E,T,A,B,X(10),X(12),X( 2),X( 7)); + BODY_40_59(59,B,C,D,E,T,A,X(11),X(13),X( 3),X( 8)); + + BODY_60_79(60,A,B,C,D,E,T,X(12),X(14),X( 4),X( 9)); + BODY_60_79(61,T,A,B,C,D,E,X(13),X(15),X( 5),X(10)); + BODY_60_79(62,E,T,A,B,C,D,X(14),X( 0),X( 6),X(11)); + BODY_60_79(63,D,E,T,A,B,C,X(15),X( 1),X( 7),X(12)); + BODY_60_79(64,C,D,E,T,A,B,X( 0),X( 2),X( 8),X(13)); + BODY_60_79(65,B,C,D,E,T,A,X( 1),X( 3),X( 9),X(14)); + BODY_60_79(66,A,B,C,D,E,T,X( 2),X( 4),X(10),X(15)); + BODY_60_79(67,T,A,B,C,D,E,X( 3),X( 5),X(11),X( 0)); + BODY_60_79(68,E,T,A,B,C,D,X( 4),X( 6),X(12),X( 1)); + BODY_60_79(69,D,E,T,A,B,C,X( 5),X( 7),X(13),X( 2)); + BODY_60_79(70,C,D,E,T,A,B,X( 6),X( 8),X(14),X( 3)); + BODY_60_79(71,B,C,D,E,T,A,X( 7),X( 9),X(15),X( 4)); + BODY_60_79(72,A,B,C,D,E,T,X( 8),X(10),X( 0),X( 5)); + BODY_60_79(73,T,A,B,C,D,E,X( 9),X(11),X( 1),X( 6)); + BODY_60_79(74,E,T,A,B,C,D,X(10),X(12),X( 2),X( 7)); + BODY_60_79(75,D,E,T,A,B,C,X(11),X(13),X( 3),X( 8)); + BODY_60_79(76,C,D,E,T,A,B,X(12),X(14),X( 4),X( 9)); + BODY_60_79(77,B,C,D,E,T,A,X(13),X(15),X( 5),X(10)); + BODY_60_79(78,A,B,C,D,E,T,X(14),X( 0),X( 6),X(11)); + BODY_60_79(79,T,A,B,C,D,E,X(15),X( 1),X( 7),X(12)); + + c->h0=(c->h0+E)&0xffffffffL; + c->h1=(c->h1+T)&0xffffffffL; + c->h2=(c->h2+A)&0xffffffffL; + c->h3=(c->h3+B)&0xffffffffL; + c->h4=(c->h4+C)&0xffffffffL; + + if (--num == 0) break; + + A=c->h0; + B=c->h1; + C=c->h2; + D=c->h3; + E=c->h4; + + W+=SHA_LBLOCK; + } + } +#endif + +#ifndef DONT_IMPLEMENT_BLOCK_DATA_ORDER +void HASH_BLOCK_DATA_ORDER (SHA_CTX *c, const void *p, size_t num) + { + const unsigned char *data=p; + register unsigned MD32_REG_T A,B,C,D,E,T,l; +#ifndef MD32_XARRAY + unsigned MD32_REG_T XX0, XX1, XX2, XX3, XX4, XX5, XX6, XX7, + XX8, XX9,XX10,XX11,XX12,XX13,XX14,XX15; +#else + SHA_LONG XX[16]; +#endif + + if(FIPS_selftest_failed()) + return; + + A=c->h0; + B=c->h1; + C=c->h2; + D=c->h3; + E=c->h4; + + for (;;) + { + + HOST_c2l(data,l); X( 0)=l; HOST_c2l(data,l); X( 1)=l; + BODY_00_15( 0,A,B,C,D,E,T,X( 0)); HOST_c2l(data,l); X( 2)=l; + BODY_00_15( 1,T,A,B,C,D,E,X( 1)); HOST_c2l(data,l); X( 3)=l; + BODY_00_15( 2,E,T,A,B,C,D,X( 2)); HOST_c2l(data,l); X( 4)=l; + BODY_00_15( 3,D,E,T,A,B,C,X( 3)); HOST_c2l(data,l); X( 5)=l; + BODY_00_15( 4,C,D,E,T,A,B,X( 4)); HOST_c2l(data,l); X( 6)=l; + BODY_00_15( 5,B,C,D,E,T,A,X( 5)); HOST_c2l(data,l); X( 7)=l; + BODY_00_15( 6,A,B,C,D,E,T,X( 6)); HOST_c2l(data,l); X( 8)=l; + BODY_00_15( 7,T,A,B,C,D,E,X( 7)); HOST_c2l(data,l); X( 9)=l; + BODY_00_15( 8,E,T,A,B,C,D,X( 8)); HOST_c2l(data,l); X(10)=l; + BODY_00_15( 9,D,E,T,A,B,C,X( 9)); HOST_c2l(data,l); X(11)=l; + BODY_00_15(10,C,D,E,T,A,B,X(10)); HOST_c2l(data,l); X(12)=l; + BODY_00_15(11,B,C,D,E,T,A,X(11)); HOST_c2l(data,l); X(13)=l; + BODY_00_15(12,A,B,C,D,E,T,X(12)); HOST_c2l(data,l); X(14)=l; + BODY_00_15(13,T,A,B,C,D,E,X(13)); HOST_c2l(data,l); X(15)=l; + BODY_00_15(14,E,T,A,B,C,D,X(14)); + BODY_00_15(15,D,E,T,A,B,C,X(15)); + + BODY_16_19(16,C,D,E,T,A,B,X( 0),X( 0),X( 2),X( 8),X(13)); + BODY_16_19(17,B,C,D,E,T,A,X( 1),X( 1),X( 3),X( 9),X(14)); + BODY_16_19(18,A,B,C,D,E,T,X( 2),X( 2),X( 4),X(10),X(15)); + BODY_16_19(19,T,A,B,C,D,E,X( 3),X( 3),X( 5),X(11),X( 0)); + + BODY_20_31(20,E,T,A,B,C,D,X( 4),X( 4),X( 6),X(12),X( 1)); + BODY_20_31(21,D,E,T,A,B,C,X( 5),X( 5),X( 7),X(13),X( 2)); + BODY_20_31(22,C,D,E,T,A,B,X( 6),X( 6),X( 8),X(14),X( 3)); + BODY_20_31(23,B,C,D,E,T,A,X( 7),X( 7),X( 9),X(15),X( 4)); + BODY_20_31(24,A,B,C,D,E,T,X( 8),X( 8),X(10),X( 0),X( 5)); + BODY_20_31(25,T,A,B,C,D,E,X( 9),X( 9),X(11),X( 1),X( 6)); + BODY_20_31(26,E,T,A,B,C,D,X(10),X(10),X(12),X( 2),X( 7)); + BODY_20_31(27,D,E,T,A,B,C,X(11),X(11),X(13),X( 3),X( 8)); + BODY_20_31(28,C,D,E,T,A,B,X(12),X(12),X(14),X( 4),X( 9)); + BODY_20_31(29,B,C,D,E,T,A,X(13),X(13),X(15),X( 5),X(10)); + BODY_20_31(30,A,B,C,D,E,T,X(14),X(14),X( 0),X( 6),X(11)); + BODY_20_31(31,T,A,B,C,D,E,X(15),X(15),X( 1),X( 7),X(12)); + + BODY_32_39(32,E,T,A,B,C,D,X( 0),X( 2),X( 8),X(13)); + BODY_32_39(33,D,E,T,A,B,C,X( 1),X( 3),X( 9),X(14)); + BODY_32_39(34,C,D,E,T,A,B,X( 2),X( 4),X(10),X(15)); + BODY_32_39(35,B,C,D,E,T,A,X( 3),X( 5),X(11),X( 0)); + BODY_32_39(36,A,B,C,D,E,T,X( 4),X( 6),X(12),X( 1)); + BODY_32_39(37,T,A,B,C,D,E,X( 5),X( 7),X(13),X( 2)); + BODY_32_39(38,E,T,A,B,C,D,X( 6),X( 8),X(14),X( 3)); + BODY_32_39(39,D,E,T,A,B,C,X( 7),X( 9),X(15),X( 4)); + + BODY_40_59(40,C,D,E,T,A,B,X( 8),X(10),X( 0),X( 5)); + BODY_40_59(41,B,C,D,E,T,A,X( 9),X(11),X( 1),X( 6)); + BODY_40_59(42,A,B,C,D,E,T,X(10),X(12),X( 2),X( 7)); + BODY_40_59(43,T,A,B,C,D,E,X(11),X(13),X( 3),X( 8)); + BODY_40_59(44,E,T,A,B,C,D,X(12),X(14),X( 4),X( 9)); + BODY_40_59(45,D,E,T,A,B,C,X(13),X(15),X( 5),X(10)); + BODY_40_59(46,C,D,E,T,A,B,X(14),X( 0),X( 6),X(11)); + BODY_40_59(47,B,C,D,E,T,A,X(15),X( 1),X( 7),X(12)); + BODY_40_59(48,A,B,C,D,E,T,X( 0),X( 2),X( 8),X(13)); + BODY_40_59(49,T,A,B,C,D,E,X( 1),X( 3),X( 9),X(14)); + BODY_40_59(50,E,T,A,B,C,D,X( 2),X( 4),X(10),X(15)); + BODY_40_59(51,D,E,T,A,B,C,X( 3),X( 5),X(11),X( 0)); + BODY_40_59(52,C,D,E,T,A,B,X( 4),X( 6),X(12),X( 1)); + BODY_40_59(53,B,C,D,E,T,A,X( 5),X( 7),X(13),X( 2)); + BODY_40_59(54,A,B,C,D,E,T,X( 6),X( 8),X(14),X( 3)); + BODY_40_59(55,T,A,B,C,D,E,X( 7),X( 9),X(15),X( 4)); + BODY_40_59(56,E,T,A,B,C,D,X( 8),X(10),X( 0),X( 5)); + BODY_40_59(57,D,E,T,A,B,C,X( 9),X(11),X( 1),X( 6)); + BODY_40_59(58,C,D,E,T,A,B,X(10),X(12),X( 2),X( 7)); + BODY_40_59(59,B,C,D,E,T,A,X(11),X(13),X( 3),X( 8)); + + BODY_60_79(60,A,B,C,D,E,T,X(12),X(14),X( 4),X( 9)); + BODY_60_79(61,T,A,B,C,D,E,X(13),X(15),X( 5),X(10)); + BODY_60_79(62,E,T,A,B,C,D,X(14),X( 0),X( 6),X(11)); + BODY_60_79(63,D,E,T,A,B,C,X(15),X( 1),X( 7),X(12)); + BODY_60_79(64,C,D,E,T,A,B,X( 0),X( 2),X( 8),X(13)); + BODY_60_79(65,B,C,D,E,T,A,X( 1),X( 3),X( 9),X(14)); + BODY_60_79(66,A,B,C,D,E,T,X( 2),X( 4),X(10),X(15)); + BODY_60_79(67,T,A,B,C,D,E,X( 3),X( 5),X(11),X( 0)); + BODY_60_79(68,E,T,A,B,C,D,X( 4),X( 6),X(12),X( 1)); + BODY_60_79(69,D,E,T,A,B,C,X( 5),X( 7),X(13),X( 2)); + BODY_60_79(70,C,D,E,T,A,B,X( 6),X( 8),X(14),X( 3)); + BODY_60_79(71,B,C,D,E,T,A,X( 7),X( 9),X(15),X( 4)); + BODY_60_79(72,A,B,C,D,E,T,X( 8),X(10),X( 0),X( 5)); + BODY_60_79(73,T,A,B,C,D,E,X( 9),X(11),X( 1),X( 6)); + BODY_60_79(74,E,T,A,B,C,D,X(10),X(12),X( 2),X( 7)); + BODY_60_79(75,D,E,T,A,B,C,X(11),X(13),X( 3),X( 8)); + BODY_60_79(76,C,D,E,T,A,B,X(12),X(14),X( 4),X( 9)); + BODY_60_79(77,B,C,D,E,T,A,X(13),X(15),X( 5),X(10)); + BODY_60_79(78,A,B,C,D,E,T,X(14),X( 0),X( 6),X(11)); + BODY_60_79(79,T,A,B,C,D,E,X(15),X( 1),X( 7),X(12)); + + c->h0=(c->h0+E)&0xffffffffL; + c->h1=(c->h1+T)&0xffffffffL; + c->h2=(c->h2+A)&0xffffffffL; + c->h3=(c->h3+B)&0xffffffffL; + c->h4=(c->h4+C)&0xffffffffL; + + if (--num == 0) break; + + A=c->h0; + B=c->h1; + C=c->h2; + D=c->h3; + E=c->h4; + + } + } +#endif diff --git a/lib/libssl/src/fips-1.0/sha/fips_shatest.c b/lib/libssl/src/fips-1.0/sha/fips_shatest.c new file mode 100644 index 00000000000..4896b467e42 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_shatest.c @@ -0,0 +1,399 @@ +/* fips_shatest.c */ +/* Written by Dr Stephen N Henson (shenson@bigfoot.com) for the OpenSSL + * project 2005. + */ +/* ==================================================================== + * Copyright (c) 2005 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.OpenSSL.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * licensing@OpenSSL.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.OpenSSL.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * ==================================================================== + * + * This product includes cryptographic software written by Eric Young + * (eay@cryptsoft.com). This product includes software written by Tim + * Hudson (tjh@cryptsoft.com). + * + */ + +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#include <openssl/bio.h> +#include <openssl/evp.h> +#include <openssl/err.h> +#include <openssl/x509v3.h> + +#ifndef OPENSSL_FIPS + +int main(int argc, char *argv[]) +{ + printf("No FIPS SHAXXX support\n"); + return(0); +} + +#else + +static int dgst_test(BIO *err, BIO *out, BIO *in); +static int print_dgst(BIO *err, const EVP_MD *md, BIO *out, + unsigned char *Msg, int Msglen); +static int print_monte(BIO *err, const EVP_MD *md, BIO *out, + unsigned char *Seed, int SeedLen); + +int main(int argc, char **argv) + { + BIO *in = NULL, *out = NULL, *err = NULL; + + int ret = 1; + + ERR_load_crypto_strings(); + + err = BIO_new_fp(stderr, BIO_NOCLOSE); + + if (!err) + { + fprintf(stderr, "FATAL stderr initialization error\n"); + goto end; + } + + if(!FIPS_mode_set(1)) + { + ERR_print_errors(err); + goto end; + } + + if (argc == 1) + in = BIO_new_fp(stdin, BIO_NOCLOSE); + else + in = BIO_new_file(argv[1], "r"); + + if (argc < 2) + out = BIO_new_fp(stdout, BIO_NOCLOSE); + else + out = BIO_new_file(argv[2], "w"); + + if (!in) + { + BIO_printf(err, "FATAL input initialization error\n"); + goto end; + } + + if (!out) + { + fprintf(stderr, "FATAL output initialization error\n"); + goto end; + } + + if (!dgst_test(err, out, in)) + { + fprintf(stderr, "FATAL digest file processing error\n"); + goto end; + } + else + ret = 0; + + end: + + if (ret && err) + ERR_print_errors(err); + + if (in) + BIO_free(in); + if (out) + BIO_free(out); + if (err) + BIO_free(err); + + return ret; + + } + +#define SHA_TEST_MAX_BITS 102400 +#define SHA_TEST_MAXLINELEN (((SHA_TEST_MAX_BITS >> 3) * 2) + 10) + +int dgst_test(BIO *err, BIO *out, BIO *in) + { + const EVP_MD *md = NULL; + char *linebuf, *olinebuf, *p, *q; + char *keyword, *value; + unsigned char *Msg = NULL, *Seed = NULL; + long MsgLen = -1, Len = -1, SeedLen = -1; + int ret = 0; + int lnum = 0; + + olinebuf = OPENSSL_malloc(SHA_TEST_MAXLINELEN); + linebuf = OPENSSL_malloc(SHA_TEST_MAXLINELEN); + + if (!linebuf || !olinebuf) + goto error; + + + while (BIO_gets(in, olinebuf, SHA_TEST_MAXLINELEN) > 0) + { + lnum++; + strcpy(linebuf, olinebuf); + keyword = linebuf; + /* Skip leading space */ + while (isspace((unsigned char)*keyword)) + keyword++; + + /* Look for = sign */ + p = strchr(linebuf, '='); + + /* If no = or starts with [ (for [L=20] line) just copy */ + if (!p) + { + if (!BIO_puts(out, olinebuf)) + goto error; + continue; + } + + q = p - 1; + + /* Remove trailing space */ + while (isspace((unsigned char)*q)) + *q-- = 0; + + *p = 0; + value = p + 1; + + /* Remove leading space from value */ + while (isspace((unsigned char)*value)) + value++; + + /* Remove trailing space from value */ + p = value + strlen(value) - 1; + + while (*p == '\n' || isspace((unsigned char)*p)) + *p-- = 0; + + if (!strcmp(keyword,"[L") && *p==']') + { + switch (atoi(value)) + { + case 20: md=EVP_sha1(); break; + case 28: md=EVP_sha224(); break; + case 32: md=EVP_sha256(); break; + case 48: md=EVP_sha384(); break; + case 64: md=EVP_sha512(); break; + default: goto parse_error; + } + } + else if (!strcmp(keyword, "Len")) + { + if (Len != -1) + goto parse_error; + Len = atoi(value); + if (Len < 0) + goto parse_error; + /* Only handle multiples of 8 bits */ + if (Len & 0x7) + goto parse_error; + if (Len > SHA_TEST_MAX_BITS) + goto parse_error; + MsgLen = Len >> 3; + } + + else if (!strcmp(keyword, "Msg")) + { + long tmplen; + if (strlen(value) & 1) + *(--value) = '0'; + if (Msg) + goto parse_error; + Msg = string_to_hex(value, &tmplen); + if (!Msg) + goto parse_error; + } + else if (!strcmp(keyword, "Seed")) + { + if (strlen(value) & 1) + *(--value) = '0'; + if (Seed) + goto parse_error; + Seed = string_to_hex(value, &SeedLen); + if (!Seed) + goto parse_error; + } + else if (!strcmp(keyword, "MD")) + continue; + else + goto parse_error; + + BIO_puts(out, olinebuf); + + if (md && Msg && (MsgLen >= 0)) + { + if (!print_dgst(err, md, out, Msg, MsgLen)) + goto error; + OPENSSL_free(Msg); + Msg = NULL; + MsgLen = -1; + Len = -1; + } + else if (md && Seed && (SeedLen > 0)) + { + if (!print_monte(err, md, out, Seed, SeedLen)) + goto error; + OPENSSL_free(Seed); + Seed = NULL; + SeedLen = -1; + } + + + } + + + ret = 1; + + + error: + + if (olinebuf) + OPENSSL_free(olinebuf); + if (linebuf) + OPENSSL_free(linebuf); + if (Msg) + OPENSSL_free(Msg); + if (Seed) + OPENSSL_free(Seed); + + return ret; + + parse_error: + + BIO_printf(err, "FATAL parse error processing line %d\n", lnum); + + goto error; + + } + +static int print_dgst(BIO *err, const EVP_MD *emd, BIO *out, + unsigned char *Msg, int Msglen) + { + int i, mdlen; + unsigned char md[EVP_MAX_MD_SIZE]; + if (!EVP_Digest(Msg, Msglen, md, (unsigned int *)&mdlen, emd, NULL)) + { + BIO_puts(err, "Error calculating HASH\n"); + return 0; + } + BIO_puts(out, "MD = "); + for (i = 0; i < mdlen; i++) + BIO_printf(out, "%02x", md[i]); + BIO_puts(out, "\n"); + return 1; + } + +static int print_monte(BIO *err, const EVP_MD *md, BIO *out, + unsigned char *Seed, int SeedLen) + { + unsigned int i, j, k; + int ret = 0; + EVP_MD_CTX ctx; + unsigned char *m1, *m2, *m3, *p; + unsigned int mlen, m1len, m2len, m3len; + + EVP_MD_CTX_init(&ctx); + + if (SeedLen > EVP_MAX_MD_SIZE) + mlen = SeedLen; + else + mlen = EVP_MAX_MD_SIZE; + + m1 = OPENSSL_malloc(mlen); + m2 = OPENSSL_malloc(mlen); + m3 = OPENSSL_malloc(mlen); + + if (!m1 || !m2 || !m3) + goto mc_error; + + m1len = m2len = m3len = SeedLen; + memcpy(m1, Seed, SeedLen); + memcpy(m2, Seed, SeedLen); + memcpy(m3, Seed, SeedLen); + + BIO_puts(out, "\n"); + + for (j = 0; j < 100; j++) + { + for (i = 0; i < 1000; i++) + { + EVP_DigestInit_ex(&ctx, md, NULL); + EVP_DigestUpdate(&ctx, m1, m1len); + EVP_DigestUpdate(&ctx, m2, m2len); + EVP_DigestUpdate(&ctx, m3, m3len); + p = m1; + m1 = m2; + m1len = m2len; + m2 = m3; + m2len = m3len; + m3 = p; + EVP_DigestFinal_ex(&ctx, m3, &m3len); + } + BIO_printf(out, "COUNT = %d\n", j); + BIO_puts(out, "MD = "); + for (k = 0; k < m3len; k++) + BIO_printf(out, "%02x", m3[k]); + BIO_puts(out, "\n\n"); + memcpy(m1, m3, m3len); + memcpy(m2, m3, m3len); + m1len = m2len = m3len; + } + + ret = 1; + + mc_error: + if (m1) + OPENSSL_free(m1); + if (m2) + OPENSSL_free(m2); + if (m3) + OPENSSL_free(m3); + + EVP_MD_CTX_cleanup(&ctx); + + return ret; + } + +#endif diff --git a/lib/libssl/src/fips-1.0/sha/fips_standalone_sha1.c b/lib/libssl/src/fips-1.0/sha/fips_standalone_sha1.c new file mode 100644 index 00000000000..8c10c2cd831 --- /dev/null +++ b/lib/libssl/src/fips-1.0/sha/fips_standalone_sha1.c @@ -0,0 +1,170 @@ +/* ==================================================================== + * Copyright (c) 2003 The OpenSSL Project. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in + * the documentation and/or other materials provided with the + * distribution. + * + * 3. All advertising materials mentioning features or use of this + * software must display the following acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit. (http://www.openssl.org/)" + * + * 4. The names "OpenSSL Toolkit" and "OpenSSL Project" must not be used to + * endorse or promote products derived from this software without + * prior written permission. For written permission, please contact + * openssl-core@openssl.org. + * + * 5. Products derived from this software may not be called "OpenSSL" + * nor may "OpenSSL" appear in their names without prior written + * permission of the OpenSSL Project. + * + * 6. Redistributions of any form whatsoever must retain the following + * acknowledgment: + * "This product includes software developed by the OpenSSL Project + * for use in the OpenSSL Toolkit (http://www.openssl.org/)" + * + * THIS SOFTWARE IS PROVIDED BY THE OpenSSL PROJECT ``AS IS'' AND ANY + * EXPRESSED OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE OpenSSL PROJECT OR + * ITS CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; + * LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, + * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <openssl/opensslconf.h> +#include <openssl/fips_sha.h> +#include <openssl/hmac.h> + +int FIPS_selftest_failed() { return 0; } +void OPENSSL_cleanse(void *p,size_t len) {} + +#ifdef OPENSSL_FIPS + +static void hmac_init(SHA_CTX *md_ctx,SHA_CTX *o_ctx, + const char *key) + { + int len=strlen(key); + int i; + unsigned char keymd[HMAC_MAX_MD_CBLOCK]; + unsigned char pad[HMAC_MAX_MD_CBLOCK]; + + if (len > SHA_CBLOCK) + { + SHA1_Init(md_ctx); + SHA1_Update(md_ctx,key,len); + SHA1_Final(keymd,md_ctx); + len=20; + } + else + memcpy(keymd,key,len); + memset(&keymd[len],'\0',HMAC_MAX_MD_CBLOCK-len); + + for(i=0 ; i < HMAC_MAX_MD_CBLOCK ; i++) + pad[i]=0x36^keymd[i]; + SHA1_Init(md_ctx); + SHA1_Update(md_ctx,pad,SHA_CBLOCK); + + for(i=0 ; i < HMAC_MAX_MD_CBLOCK ; i++) + pad[i]=0x5c^keymd[i]; + SHA1_Init(o_ctx); + SHA1_Update(o_ctx,pad,SHA_CBLOCK); + } + +static void hmac_final(unsigned char *md,SHA_CTX *md_ctx,SHA_CTX *o_ctx) + { + unsigned char buf[20]; + + SHA1_Final(buf,md_ctx); + SHA1_Update(o_ctx,buf,sizeof buf); + SHA1_Final(md,o_ctx); + } + +#endif + +int main(int argc,char **argv) + { +#ifdef OPENSSL_FIPS + static char key[]="etaonrishdlcupfm"; + int n,binary=0; + + if(argc < 2) + { + fprintf(stderr,"%s [<file>]+\n",argv[0]); + exit(1); + } + + n=1; + if (!strcmp(argv[n],"-binary")) + { + n++; + binary=1; /* emit binary fingerprint... */ + } + + for(; n < argc ; ++n) + { + FILE *f=fopen(argv[n],"rb"); + SHA_CTX md_ctx,o_ctx; + unsigned char md[20]; + int i; + + if(!f) + { + perror(argv[n]); + exit(2); + } + + hmac_init(&md_ctx,&o_ctx,key); + for( ; ; ) + { + char buf[1024]; + int l=fread(buf,1,sizeof buf,f); + + if(l == 0) + { + if(ferror(f)) + { + perror(argv[n]); + exit(3); + } + else + break; + } + SHA1_Update(&md_ctx,buf,l); + } + hmac_final(md,&md_ctx,&o_ctx); + + if (binary) + { + fwrite(md,20,1,stdout); + break; /* ... for single(!) file */ + } + + printf("HMAC-SHA1(%s)= ",argv[n]); + for(i=0 ; i < 20 ; ++i) + printf("%02x",md[i]); + printf("\n"); + } +#endif + return 0; + } + + diff --git a/lib/libssl/src/ms/fipscheck.pl b/lib/libssl/src/ms/fipscheck.pl new file mode 100644 index 00000000000..80ffbd15ae2 --- /dev/null +++ b/lib/libssl/src/ms/fipscheck.pl @@ -0,0 +1,38 @@ +#!/usr/bin/perl + +# fipscheck.pl +# sample perl script to check integrity of critical FIPS files + +my ($fipsdir) = @ARGV; + +die "Directory $fipsdir not found or invalid" unless -d $fipsdir; + +die "Standalone SHA1 check program ${fipsdir}/fips_standalone_sha1.exe not found" unless -f "${fipsdir}/fips_standalone_sha1.exe"; + +check_hash("fips_premain.c", $fipsdir); +check_hash("fipscanister.o", $fipsdir); + +sub check_hash + { + my ($filename, $dir) = @_; + my ($hashfile, $hashval); + + $filename = "$dir/$filename"; + + die "File $filename does not exist" unless -f $filename; + die "File ${filename}.sha1 does not exist" unless -f "${filename}.sha1"; + + open(IN, "${filename}.sha1") || die "Cannot open file hash file ${filename}.sha1"; + $hashfile = <IN>; + close IN; + $hashval = `${dir}/fips_standalone_sha1.exe $filename`; + chomp $hashfile; + chomp $hashval; + $hashfile =~ s/^.*=\s+//; + $hashval =~ s/^.*=\s+//; + die "Invalid hash syntax in file" if (length($hashfile) != 40); + die "Invalid hash received for file" if (length($hashval) != 40); + die "*** HASH VALUE MISMATCH FOR FILE $filename ***" if ($hashval ne $hashfile); + } + + diff --git a/lib/libssl/src/ssl/Makefile b/lib/libssl/src/ssl/Makefile index baf191b9090..14a89e77b2c 100644 --- a/lib/libssl/src/ssl/Makefile +++ b/lib/libssl/src/ssl/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/ssl/Makefile +# OpenSSL/ssl/Makefile # DIR= ssl diff --git a/lib/libssl/src/test/Makefile b/lib/libssl/src/test/Makefile index 6aeedf7fa3f..189d14ed495 100644 --- a/lib/libssl/src/test/Makefile +++ b/lib/libssl/src/test/Makefile @@ -39,7 +39,7 @@ EXPTEST= exptest IDEATEST= ideatest SHATEST= shatest SHA1TEST= sha1test -FIPS_SHA1TEST= fips_sha1test +FIPS_SHATEST= fips_shatest MDC2TEST= mdc2test RMDTEST= rmdtest MD2TEST= md2test @@ -64,32 +64,47 @@ RSATEST= rsa_test ENGINETEST= enginetest EVPTEST= evp_test FIPS_AESTEST= fips_aesavs +FIPS_HMACTEST= fips_hmactest +FIPS_RSAVTEST= fips_rsavtest +FIPS_RSASTEST= fips_rsastest +FIPS_RSAGTEST= fips_rsagtest +FIPS_DSSVS= fips_dssvs +FIPS_RNGVS= fips_rngvs +FIPS_TEST_SUITE=fips_test_suite TESTS= alltests EXE= $(BNTEST)$(EXE_EXT) $(ECTEST)$(EXE_EXT) $(IDEATEST)$(EXE_EXT) $(MD2TEST)$(EXE_EXT) $(MD4TEST)$(EXE_EXT) $(MD5TEST)$(EXE_EXT) $(HMACTEST)$(EXE_EXT) \ $(RC2TEST)$(EXE_EXT) $(RC4TEST)$(EXE_EXT) $(RC5TEST)$(EXE_EXT) \ - $(DESTEST)$(EXE_EXT) $(FIPS_DESTEST)$(EXE_EXT) $(SHATEST)$(EXE_EXT) $(SHA1TEST)$(EXE_EXT) $(FIPS_SHA1TEST)$(EXE_EXT) $(MDC2TEST)$(EXE_EXT) $(RMDTEST)$(EXE_EXT) \ + $(DESTEST)$(EXE_EXT) $(FIPS_DESTEST)$(EXE_EXT) $(SHATEST)$(EXE_EXT) $(SHA1TEST)$(EXE_EXT) $(FIPS_SHATEST)$(EXE_EXT) $(MDC2TEST)$(EXE_EXT) $(RMDTEST)$(EXE_EXT) \ $(RANDTEST)$(EXE_EXT) $(FIPS_RANDTEST)$(EXE_EXT) $(DHTEST)$(EXE_EXT) $(ENGINETEST)$(EXE_EXT) \ $(BFTEST)$(EXE_EXT) $(CASTTEST)$(EXE_EXT) $(SSLTEST)$(EXE_EXT) $(EXPTEST)$(EXE_EXT) $(DSATEST)$(EXE_EXT) $(FIPS_DSATEST)$(EXE_EXT) $(RSATEST)$(EXE_EXT) \ - $(EVPTEST)$(EXE_EXT) $(FIPS_AESTEST)$(EXE_EXT) + $(EVPTEST)$(EXE_EXT) $(FIPS_AESTEST)$(EXE_EXT) \ + $(FIPS_HMACTEST)$(EXE_EXT) $(FIPS_RSAVTEST)$(EXE_EXT) \ + $(FIPS_RSASTEST)$(EXE_EXT) $(FIPS_RSAGTEST)$(EXE_EXT) \ + $(FIPS_DSSVS)$(EXE_EXT) $(FIPS_RNGVS)$(EXE_EXT) \ + $(FIPS_TEST_SUITE)$(EXE_EXT) # $(METHTEST)$(EXE_EXT) OBJ= $(BNTEST).o $(ECTEST).o $(IDEATEST).o $(MD2TEST).o $(MD4TEST).o $(MD5TEST).o \ $(HMACTEST).o \ $(RC2TEST).o $(RC4TEST).o $(RC5TEST).o \ - $(DESTEST).o $(FIPS_DESTEST).o $(SHATEST).o $(SHA1TEST).o $(FIPS_SHA1TEST).o $(MDC2TEST).o $(RMDTEST).o \ + $(DESTEST).o $(FIPS_DESTEST).o $(SHATEST).o $(SHA1TEST).o $(FIPS_SHATEST).o $(MDC2TEST).o $(RMDTEST).o \ $(RANDTEST).o $(FIPS_RANDTEST).o $(DHTEST).o $(ENGINETEST).o $(CASTTEST).o \ $(BFTEST).o $(SSLTEST).o $(DSATEST).o $(FIPS_DSATEST).o $(EXPTEST).o $(RSATEST).o \ - $(EVPTEST).o $(FIPS_AESTEST).o + $(EVPTEST).o $(FIPS_AESTEST).o $(FIPS_HMACTEST).o $(FIPS_RSAVTEST).o \ + $(FIPS_RSASTEST).o $(FIPS_RSAGTEST).o $(FIPS_DSSVS).o $(FIPS_RNGVS).o \ + $(FIPS_TEST_SUITE).o SRC= $(BNTEST).c $(ECTEST).c $(IDEATEST).c $(MD2TEST).c $(MD4TEST).c $(MD5TEST).c \ $(HMACTEST).c \ $(RC2TEST).c $(RC4TEST).c $(RC5TEST).c \ - $(DESTEST).c $(FIPS_DESTEST).c $(SHATEST).c $(SHA1TEST).c $(FIPS_SHA1TEST).c $(MDC2TEST).c $(RMDTEST).c \ + $(DESTEST).c $(FIPS_DESTEST).c $(SHATEST).c $(SHA1TEST).c $(FIPS_SHATEST).c $(MDC2TEST).c $(RMDTEST).c \ $(RANDTEST).c $(FIPS_RANDTEST).c $(DHTEST).c $(ENGINETEST).c $(CASTTEST).c \ $(BFTEST).c $(SSLTEST).c $(DSATEST).c $(FIPS_DSATEST).c $(EXPTEST).c $(RSATEST).c \ - $(EVPTEST).c $(FIPS_AESTEST).c + $(EVPTEST).c $(FIPS_AESTEST).c $(FIPS_HMACTEST).c $(FIPS_RSAVTEST).c \ + $(FIPS_RSASTEST).c $(FIPS_RSAGTEST).c $(FIPS_DSSVS).c $(FIPS_RNGVS).c \ + $(FIPS_TEST_SUITE).c EXHEADER= HEADER= $(EXHEADER) @@ -153,7 +168,7 @@ test_sha: ../util/shlib_wrap.sh ./$(SHATEST) ../util/shlib_wrap.sh ./$(SHA1TEST) if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - ../util/shlib_wrap.sh ./$(FIPS_SHA1TEST) sha1vectors.txt | sed s/Strings/Hashes/ | cmp sha1hashes.txt - ; \ + ../util/shlib_wrap.sh ./$(FIPS_SHATEST) < SHAmix.req | diff -w SHAmix.fax - ; \ fi test_mdc2: @@ -311,20 +326,43 @@ $(DLIBSSL): $(DLIBCRYPTO): (cd ..; $(MAKE) DIRS=crypto all) -BUILD_CMD=if [ "$(SHLIB_TARGET)" = "hpux-shared" -o "$(SHLIB_TARGET)" = "darwin-shared" ] ; then \ +BUILD_CMD=SHARED_LIBS="$(SHARED_LIBS)"; \ + if [ "$(SHLIB_TARGET)" = "darwin-shared" ] ; then \ + SHARED_LIBS=""; \ + fi; \ + if [ -z "$$SHARED_LIBS" ]; then \ set -x; $${CC:-$(CC)} -o $$target$(EXE_EXT) $(CFLAGS) $$target.o $(PEX_LIBS) $(DLIBSSL) $(LIBKRB5) $(DLIBCRYPTO) $(EX_LIBS) ; \ - elif [ -z "$(SHARED_LIBS)" ]; then \ - set -x; $${CC:-$(CC)} -o $$target$(EXE_EXT) $(CFLAGS) $$target.o $(PEX_LIBS) $(LIBSSL) $(LIBKRB5) $(LIBCRYPTO) $(EX_LIBS) ; \ - else \ - set -x; LD_LIBRARY_PATH=..:$$LD_LIBRARY_PATH \ + else set -x; LD_LIBRARY_PATH=..:$$LD_LIBRARY_PATH \ $(CC) -o $$target$(EXE_EXT) $(CFLAGS) $$target.o $(PEX_LIBS) $(LIBSSL) $(LIBKRB5) $(LIBCRYPTO) $(EX_LIBS) ; \ - fi; + fi + +FIPS_BUILD_CMD=if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ + FIPSLD_CC=$(CC); CC=$(TOP)/fips-1.0/fipsld; export CC FIPSLD_CC; \ + fi; $(BUILD_CMD) $(FIPS_AESTEST)$(EXE_EXT): $(FIPS_AESTEST).o $(DLIBCRYPTO) - @target=$(FIPS_AESTEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(FIPS_AESTEST); \ - fi + @target=$(FIPS_AESTEST); $(FIPS_BUILD_CMD) + +$(FIPS_HMACTEST)$(EXE_EXT): $(FIPS_HMACTEST).o $(DLIBCRYPTO) + @target=$(FIPS_HMACTEST); $(FIPS_BUILD_CMD) + +$(FIPS_RSAVTEST)$(EXE_EXT): $(FIPS_RSAVTEST).o $(DLIBCRYPTO) + @target=$(FIPS_RSAVTEST); $(FIPS_BUILD_CMD) + +$(FIPS_RSASTEST)$(EXE_EXT): $(FIPS_RSASTEST).o $(DLIBCRYPTO) + @target=$(FIPS_RSASTEST); $(FIPS_BUILD_CMD) + +$(FIPS_RSAGTEST)$(EXE_EXT): $(FIPS_RSAGTEST).o $(DLIBCRYPTO) + @target=$(FIPS_RSAGTEST); $(FIPS_BUILD_CMD) + +$(FIPS_DSSVS)$(EXE_EXT): $(FIPS_DSSVS).o $(DLIBCRYPTO) + @target=$(FIPS_DSSVS); $(FIPS_BUILD_CMD) + +$(FIPS_RNGVS)$(EXE_EXT): $(FIPS_RNGVS).o $(DLIBCRYPTO) + @target=$(FIPS_RNGVS); $(FIPS_BUILD_CMD) + +$(FIPS_TEST_SUITE)$(EXE_EXT): $(FIPS_TEST_SUITE).o $(DLIBCRYPTO) + @target=$(FIPS_TEST_SUITE); $(FIPS_BUILD_CMD) $(RSATEST)$(EXE_EXT): $(RSATEST).o $(DLIBCRYPTO) @target=$(RSATEST); $(BUILD_CMD) @@ -350,11 +388,8 @@ $(SHATEST)$(EXE_EXT): $(SHATEST).o $(DLIBCRYPTO) $(SHA1TEST)$(EXE_EXT): $(SHA1TEST).o $(DLIBCRYPTO) @target=$(SHA1TEST); $(BUILD_CMD) -$(FIPS_SHA1TEST)$(EXE_EXT): $(FIPS_SHA1TEST).o $(DLIBCRYPTO) - @target=$(FIPS_SHA1TEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(FIPS_SHA1TEST); \ - fi +$(FIPS_SHATEST)$(EXE_EXT): $(FIPS_SHATEST).o $(DLIBCRYPTO) + @target=$(FIPS_SHATEST); $(FIPS_BUILD_CMD) $(RMDTEST)$(EXE_EXT): $(RMDTEST).o $(DLIBCRYPTO) @target=$(RMDTEST); $(BUILD_CMD) @@ -390,19 +425,13 @@ $(DESTEST)$(EXE_EXT): $(DESTEST).o $(DLIBCRYPTO) @target=$(DESTEST); $(BUILD_CMD) $(FIPS_DESTEST)$(EXE_EXT): $(FIPS_DESTEST).o $(DLIBCRYPTO) - @target=$(FIPS_DESTEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(FIPS_DESTEST); \ - fi + @target=$(FIPS_DESTEST); $(FIPS_BUILD_CMD) $(RANDTEST)$(EXE_EXT): $(RANDTEST).o $(DLIBCRYPTO) @target=$(RANDTEST); $(BUILD_CMD) $(FIPS_RANDTEST)$(EXE_EXT): $(FIPS_RANDTEST).o $(DLIBCRYPTO) - @target=$(FIPS_RANDTEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(FIPS_RANDTEST); \ - fi + @target=$(FIPS_RANDTEST); $(FIPS_BUILD_CMD) $(DHTEST)$(EXE_EXT): $(DHTEST).o $(DLIBCRYPTO) @target=$(DHTEST); $(BUILD_CMD) @@ -411,19 +440,13 @@ $(DSATEST)$(EXE_EXT): $(DSATEST).o $(DLIBCRYPTO) @target=$(DSATEST); $(BUILD_CMD) $(FIPS_DSATEST)$(EXE_EXT): $(FIPS_DSATEST).o $(DLIBCRYPTO) - @target=$(FIPS_DSATEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(FIPS_DSATEST); \ - fi + @target=$(FIPS_DSATEST); $(FIPS_BUILD_CMD) $(METHTEST)$(EXE_EXT): $(METHTEST).o $(DLIBCRYPTO) @target=$(METHTEST); $(BUILD_CMD) $(SSLTEST)$(EXE_EXT): $(SSLTEST).o $(DLIBSSL) $(DLIBCRYPTO) - @target=$(SSLTEST); $(BUILD_CMD) - if egrep 'define OPENSSL_FIPS' $(TOP)/include/openssl/opensslconf.h > /dev/null; then \ - TOP=$(TOP) $(TOP)/fips/openssl_fips_fingerprint $(TOP)/libcrypto.a $(SSLTEST); \ - fi + @target=$(SSLTEST); $(FIPS_BUILD_CMD) $(ENGINETEST)$(EXE_EXT): $(ENGINETEST).o $(DLIBCRYPTO) @target=$(ENGINETEST); $(BUILD_CMD) @@ -587,6 +610,29 @@ fips_dsatest.o: ../include/openssl/rsa.h ../include/openssl/safestack.h fips_dsatest.o: ../include/openssl/stack.h ../include/openssl/symhacks.h fips_dsatest.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h fips_dsatest.o: fips_dsatest.c +fips_dssvs.o: ../include/openssl/opensslconf.h fips_dssvs.c +fips_hmactest.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_hmactest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_hmactest.o: ../include/openssl/bn.h ../include/openssl/buffer.h +fips_hmactest.o: ../include/openssl/cast.h ../include/openssl/conf.h +fips_hmactest.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_hmactest.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_hmactest.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_hmactest.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_hmactest.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips_hmactest.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips_hmactest.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips_hmactest.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips_hmactest.o: ../include/openssl/objects.h ../include/openssl/opensslconf.h +fips_hmactest.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips_hmactest.o: ../include/openssl/pkcs7.h ../include/openssl/rc2.h +fips_hmactest.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips_hmactest.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips_hmactest.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips_hmactest.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips_hmactest.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h +fips_hmactest.o: ../include/openssl/x509.h ../include/openssl/x509_vfy.h +fips_hmactest.o: ../include/openssl/x509v3.h fips_hmactest.c fips_randtest.o: ../e_os.h ../include/openssl/bio.h ../include/openssl/crypto.h fips_randtest.o: ../include/openssl/des.h ../include/openssl/des_old.h fips_randtest.o: ../include/openssl/e_os2.h ../include/openssl/err.h @@ -596,13 +642,117 @@ fips_randtest.o: ../include/openssl/ossl_typ.h ../include/openssl/rand.h fips_randtest.o: ../include/openssl/safestack.h ../include/openssl/stack.h fips_randtest.o: ../include/openssl/symhacks.h ../include/openssl/ui.h fips_randtest.o: ../include/openssl/ui_compat.h fips_randtest.c -fips_sha1test.o: ../e_os.h ../include/openssl/bio.h ../include/openssl/crypto.h -fips_sha1test.o: ../include/openssl/e_os2.h ../include/openssl/err.h -fips_sha1test.o: ../include/openssl/fips.h ../include/openssl/lhash.h -fips_sha1test.o: ../include/openssl/opensslconf.h ../include/openssl/opensslv.h -fips_sha1test.o: ../include/openssl/safestack.h ../include/openssl/sha.h -fips_sha1test.o: ../include/openssl/stack.h ../include/openssl/symhacks.h -fips_sha1test.o: fips_sha1test.c +fips_rngvs.o: ../include/openssl/opensslconf.h fips_rngvs.c +fips_rsagtest.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_rsagtest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_rsagtest.o: ../include/openssl/bn.h ../include/openssl/buffer.h +fips_rsagtest.o: ../include/openssl/cast.h ../include/openssl/conf.h +fips_rsagtest.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_rsagtest.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_rsagtest.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_rsagtest.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_rsagtest.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips_rsagtest.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips_rsagtest.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips_rsagtest.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips_rsagtest.o: ../include/openssl/objects.h ../include/openssl/opensslconf.h +fips_rsagtest.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips_rsagtest.o: ../include/openssl/pkcs7.h ../include/openssl/rc2.h +fips_rsagtest.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips_rsagtest.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips_rsagtest.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips_rsagtest.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips_rsagtest.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h +fips_rsagtest.o: ../include/openssl/x509.h ../include/openssl/x509_vfy.h +fips_rsagtest.o: ../include/openssl/x509v3.h fips_rsagtest.c +fips_rsastest.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_rsastest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_rsastest.o: ../include/openssl/bn.h ../include/openssl/buffer.h +fips_rsastest.o: ../include/openssl/cast.h ../include/openssl/conf.h +fips_rsastest.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_rsastest.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_rsastest.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_rsastest.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_rsastest.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips_rsastest.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips_rsastest.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips_rsastest.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips_rsastest.o: ../include/openssl/objects.h ../include/openssl/opensslconf.h +fips_rsastest.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips_rsastest.o: ../include/openssl/pkcs7.h ../include/openssl/rc2.h +fips_rsastest.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips_rsastest.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips_rsastest.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips_rsastest.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips_rsastest.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h +fips_rsastest.o: ../include/openssl/x509.h ../include/openssl/x509_vfy.h +fips_rsastest.o: ../include/openssl/x509v3.h fips_rsastest.c +fips_rsavtest.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_rsavtest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_rsavtest.o: ../include/openssl/bn.h ../include/openssl/buffer.h +fips_rsavtest.o: ../include/openssl/cast.h ../include/openssl/conf.h +fips_rsavtest.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_rsavtest.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_rsavtest.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_rsavtest.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_rsavtest.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips_rsavtest.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips_rsavtest.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips_rsavtest.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips_rsavtest.o: ../include/openssl/objects.h ../include/openssl/opensslconf.h +fips_rsavtest.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips_rsavtest.o: ../include/openssl/pkcs7.h ../include/openssl/rc2.h +fips_rsavtest.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips_rsavtest.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips_rsavtest.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips_rsavtest.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips_rsavtest.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h +fips_rsavtest.o: ../include/openssl/x509.h ../include/openssl/x509_vfy.h +fips_rsavtest.o: ../include/openssl/x509v3.h fips_rsavtest.c +fips_shatest.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_shatest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_shatest.o: ../include/openssl/bn.h ../include/openssl/buffer.h +fips_shatest.o: ../include/openssl/cast.h ../include/openssl/conf.h +fips_shatest.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_shatest.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_shatest.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_shatest.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_shatest.o: ../include/openssl/idea.h ../include/openssl/lhash.h +fips_shatest.o: ../include/openssl/md2.h ../include/openssl/md4.h +fips_shatest.o: ../include/openssl/md5.h ../include/openssl/mdc2.h +fips_shatest.o: ../include/openssl/obj_mac.h ../include/openssl/objects.h +fips_shatest.o: ../include/openssl/opensslconf.h ../include/openssl/opensslv.h +fips_shatest.o: ../include/openssl/ossl_typ.h ../include/openssl/pkcs7.h +fips_shatest.o: ../include/openssl/rc2.h ../include/openssl/rc4.h +fips_shatest.o: ../include/openssl/rc5.h ../include/openssl/ripemd.h +fips_shatest.o: ../include/openssl/rsa.h ../include/openssl/safestack.h +fips_shatest.o: ../include/openssl/sha.h ../include/openssl/stack.h +fips_shatest.o: ../include/openssl/symhacks.h ../include/openssl/ui.h +fips_shatest.o: ../include/openssl/ui_compat.h ../include/openssl/x509.h +fips_shatest.o: ../include/openssl/x509_vfy.h ../include/openssl/x509v3.h +fips_shatest.o: fips_shatest.c +fips_test_suite.o: ../include/openssl/aes.h ../include/openssl/asn1.h +fips_test_suite.o: ../include/openssl/bio.h ../include/openssl/blowfish.h +fips_test_suite.o: ../include/openssl/bn.h ../include/openssl/cast.h +fips_test_suite.o: ../include/openssl/crypto.h ../include/openssl/des.h +fips_test_suite.o: ../include/openssl/des_old.h ../include/openssl/dh.h +fips_test_suite.o: ../include/openssl/dsa.h ../include/openssl/e_os2.h +fips_test_suite.o: ../include/openssl/err.h ../include/openssl/evp.h +fips_test_suite.o: ../include/openssl/fips.h ../include/openssl/fips_sha.h +fips_test_suite.o: ../include/openssl/hmac.h ../include/openssl/idea.h +fips_test_suite.o: ../include/openssl/lhash.h ../include/openssl/md2.h +fips_test_suite.o: ../include/openssl/md4.h ../include/openssl/md5.h +fips_test_suite.o: ../include/openssl/mdc2.h ../include/openssl/obj_mac.h +fips_test_suite.o: ../include/openssl/objects.h +fips_test_suite.o: ../include/openssl/opensslconf.h +fips_test_suite.o: ../include/openssl/opensslv.h ../include/openssl/ossl_typ.h +fips_test_suite.o: ../include/openssl/rand.h ../include/openssl/rc2.h +fips_test_suite.o: ../include/openssl/rc4.h ../include/openssl/rc5.h +fips_test_suite.o: ../include/openssl/ripemd.h ../include/openssl/rsa.h +fips_test_suite.o: ../include/openssl/safestack.h ../include/openssl/sha.h +fips_test_suite.o: ../include/openssl/stack.h ../include/openssl/symhacks.h +fips_test_suite.o: ../include/openssl/ui.h ../include/openssl/ui_compat.h +fips_test_suite.o: fips_test_suite.c hmactest.o: ../e_os.h ../include/openssl/aes.h ../include/openssl/asn1.h hmactest.o: ../include/openssl/bio.h ../include/openssl/blowfish.h hmactest.o: ../include/openssl/bn.h ../include/openssl/cast.h diff --git a/lib/libssl/src/test/SHAmix.fax b/lib/libssl/src/test/SHAmix.fax new file mode 100644 index 00000000000..83bcb14126a --- /dev/null +++ b/lib/libssl/src/test/SHAmix.fax @@ -0,0 +1,129 @@ +[L = 64] + +Len = 16 +Msg = 98a1 +MD = 74d78642f70ca830bec75fc60a585917e388cfa4cd1d23daab1c4d9ff1010cac3e67275df64db5a6a7c7d0fda24f1fc3eb272678a7c8becff6743ee812129078 + +Len = 104 +Msg = 35a37a46df4ccbadd815942249 +MD = 6f5589ea195e745654885d50de687d7fe682affc8da1fb09e681540525f04ecb93022361a27759b9e272c883564223c5e4ecafeb0daaf1abce6caa4bd4153379 + +Len = 352 +Msg = a93aed0fa5e163a82c9a934aebaab8180edf7de0b32f0fe99f9c75ec305b24609334cefa372c7c758262dc8f +MD = 66a16799d606c569d2fcd70d7d8321ec90ef61711481aaf7d747744ebfd08ec2e7aead49429af7b4ceec6d8e147ed018e034efbe07982699e818db5fc4b1d71a + +Len = 1016 +Msg = 433e88eb2f8aba562d15c18126fbdffb81d5d6c9397fa052321f5f78cd629708ba099b540da5451e949eeab8687a8d6ac35c531411cb37144ab5ff6a7eb46f1ab28fbcd2ea0444cd87c57bf7d3c02952dba3d3987da07622c16e7c086d90e88ad3d9d4afee301d2bad915d868f54197b70b23c9fa385c443404fbc9abf7e6a +MD = 790bc4844e9aeef8938df0ccda17890556a4151817111a526a88919cfb172f0b03c216080c1b60210eb1942097f17b6d0691bf5b018b6d959198d6a694b922c9 + +Len = 13696 +Msg = 2c46a76a9dfbae1f5e59f085e9c3d4b600c24b2d404d062cf948e75a3d4ab5b137a31397be9eb34b2a03c78367e0b85448891b511ddee1f787cccd498b172cb7e656c044a03ffde8e42478330fbe9c34072a9e99ce31b41757cc820d98e7d564e06694b96b66f4be34c5eadd0ae4e61fe6abbe4d7ccee855104fedee8b451a7fcedb793d469b0094c0ed07c97fda00dd8c1662b44e3ee6775a5ef6368cb662d257be561a5967893433a4b63f97295036a37272176d081545df00852bc5c4162324161296cd51f76433f2df867a5840f2d0c8d5be00b4dc89443d82175bf69c3bdceb97facae2b2ed68e06ae74fef36d8bd1f75f130cba509341dd54079d45de22845cc8e77a022977c7540aa3e779cb1127f39f825d4d78e55a967ef45e7c1dfb02d9999fd15af2914ba47177177d94576f1091a0657d9e04fe81e6be7b631fc1baae66584c9c26ddbb568750d77555c927bcda1fbdc15c7cbe3e3fe88ca13ff12c59b383343c12976708c0e3dff78be0e286dd32eecf20b71a09fee50a9d0b13c85a15b320b162690f399282798aa3291fdd2f9c40ed873e829388466ddd1da42f2de16aaa9272ccf44790cf3c95382c304e25ae8cb2fc9d9869808f3ee7d42cb143bb0c3a55e03db6d1202ca1bdb744e448640c0aa60d3ebbda5c21e623bb080f4a073a48822725d764e51d415aad1d7c5a7f17433d15ac7d849f910c375ee0899f6a576dada42fd651343383f286009902bb62deeeb2514de6af7f09892c20d0b238f6021f03b62444b1e1f21beeb89acfcd7136416fe7bd8f202e76afaf5345311798be7cb25351add2bb044d2380221009c4d1cbbaba4cdc8631dc0144f2778a6aa1eb3d3c81df0b1b2142fce111af8214d049e40f536c5d462b9224a978e82cc6c420e70ecc3cdaffb726a183c793845315f730fa4dac9fe46e4180397107a6a051f7f0a58ceb9bf4df37e1a81c8e9569187228e8037df2e59c52ba815566768bedc8e09d5e7bdc9f2bff23aaaaf133bb5a3332750f6124ce185e29fda0851addfa2c3d52bb6dfb530fd4ee27dd5bfdce5dc2f41debe6740274bc651aecd4023b098a7d622e2296b50d51b79c4e3f521695a9d43f038e8f273405e26584d3db179e7c1758114a3d39970df674580bbf2884405974f0b9c4b0d8b3287a2314f3f81b6991812f354d655f62513c9551b378cc2efa4c3e08b313c56cada52217fb6112eb8299b28445aca8f72e7170a1cd8bbfee4d2145fbe8d49c6af8831c4d4fc7177a50ee55a7b484261504af946c6bd5e1d6b89092f3c487c0568fa07c356fae9b8e831b8320289039746a435b122cfbc4a0d316bf90d481d3b7d979cc50d98c1190af8dc58e0035557dd5e94f437f41fab513202643a77748f76c6b77302bf40c392cd18731da082c99bdedeb70e15cd68bff59619cabcc92adcf122753c55afde0817352bc247d1170b8ddba1ad1b0faadfe0efbfc5fe6334377fa372c3435691f53dfc2ad5e08966b2d3525b1eec2d993a5cd4ff34278bd40dd80313a0727d05e0a932156152f3e11a190d8d69726f5c57d20f811e1e8932e86409ffdac96c6251c2a2976b8757adcac5d2de94931d1cbea866ec8bcba5774f8a7fde792f6acfd0f01356fd66fdf54a416af6a9397e00f848a2e9831627cbcbb52b5a868ec174e69b4cfa1ed72cdf23f39d7eaf4bdb318c188b1f0fe75655e34ad71907cdb77a1a2b162cd7c22d93dc45321eafb17cd60282e83736267b3e1fb249c307d49509f50839942f0f493afd9ef37db053a918e3ec83d801bbdead07554a018b8ba348fe9b7dd92ea7c5fc0e65a644ba19aa1fb6c022ab768ec7cb249ba17b9dda2860bd4aaaa3dc70ec009804141ad5ebc61203658e57a0887ec0fded18d844a96e79ba7e879c4253056f23e205a80ab1471953438f85848f4ab31ab175c089e0bbb97ea0dd6a67385770356741966053735e2cc2ecdd2c8c75cc045181dd7267584b901674b553082b2c58fb8f8be0b99306194a6f069f684535423304d40a268d55784a14260fa9c9cb1306b82f91cbee3c9f43dea9e50903135cc1c6505605a100bfa28564a2057974eef0852b7b72ce264815026d0759f691db618ef760edde73ec888e181403834f7221bb27a69479ec9b28a3fb0c3f68d4467d25712fc48ad78763f9ea6e8a2e85260225ca1b1a38b720e589fafca29f07257c5467cb74ee53189b8c81b784c43e93f98abde1ed53af60b27b13df6ce45001c6e1813de3521028981086f7d88ba13f6fb1a800f312fbe2f842eebe847fd760c394668cfbfd353ec14ca0366eccd7b4cd63318116bdc42e20a632a0d2b8c5cddb37bfc0a239ebe3800a787d2ece077a7968036b3d9b31cd906f888e3ed742cd769033e2c24c5a9e3c10b6d300db5a17dd88 +MD = a86e07bcd19080d4a83e1384bd8189f60a7dd7a6998406ade0bf03f805375bd823c7656dd51cd9d63e542f8ade41f16d73794d60d0906424133778156ee54b95 + +Len = 100816 +Msg = f8ed40e878dc68ceec52cc8e2868722310fb117ca3a52e1839eb85d308b8aa00ed0bf0b76aec8a70eba4f0d14d2d85c5a0e876ce2c8ee59cb36947def6c40a587aa07b368ca8e8a08367018e45b984de0d7f1aa46b977cc18c0cd9b7bb897cbb2814aa0ce8f8c9843e03c86c19f2ba95dd2ac4a466a93aae4b3b05055ff148517ecf43e286c57744a3e10a14d0c26e139a503e7927aa688c78609170ebe3b54104390e5f6cf538093a67922e7210e77fcb584ec9b6844e829be246a266460cb442bad52ca47255fb8cfe276108c36e02f9acbd3d191d34b93d29ec40d80496d1c1bb5ef036221641200e905598c54bc4abb3527c5a5f6258e59d4bf54a0498c108a2725428efc2047e0096b32dfdc6ec69d5d72f81301f881ca62a66c22e5dab9fd9d90084c0a36b2f3a0123cc5327a3bc7a12fd947ab57169ac533e4b6a2cb80fc65b9b527cff9fba26994c7fafb5102a0acd8f9d246a3a54178c23eaa04c0fdfd3c0cd980d1fc7a72b25d74df9b95c3dedce8ca316870c654f9ebea9b806da9767cf40605a4b0c7fb06f6b3f197bae7d8cde9daf38530e25bc51b68f9aa23ec0e95199b14bca96c91f3db15bf8432f714dc46ac87218691bc66cb3a42f6865e1c30f8394c8e68c0ddf5851ab7c5906a1994a9af6ac1c44d0d6b95ff15d9f77825ccea40fb9e516d45888f2378e045d95d936d541cea9c8ca52fe5f7d0d919b2b1c59a42d06105ea4f2943c05178e59d67351c5b2c0051c93a4045e512884fa656b772cf398af89081546d920fd3d24ebd16310506a786ab33293027394c1bcb7b1efe46b550ac28529646e8d2a5ae65c59345e24b44cd7b06673f3ed3b9008aa568a739c26682fa596b7a655842cc6b2758b583487c78d14a76bdac7033806c5c210828ef313f8efc4072681f5fded748c31a58ac933b4665c445f07d603e0905e49b84aa55146eb1c1c99196413832a05efee2e64d6732fefc629b79b37bb9390fcbed7226b412204bda523b8b8af5c4a8bdb263ef9f3f6c7b9e1de3a1dc257c1f33b3d54a9101be5b4f2a9db319993c2cd137c41e35c434ce52e859afd1a635af4d8852252dc5e28c729b2b4c96a56d57f3f3854ded59fe612b9b3a51fee3fc1c83db673b0cc7433bff2472bc74a2eeb6706605e308690fd072a7042ca6474603711d8310909e47063f46f287260a26c4f11fe492298a0f98d28c45948a4899e08fcf443a6ba36457dd8329314d53ac0fd0819fcfc3357426c5bb8d3dfd706e205a81091cf08f31cd3459854f3d07e503991ba5f067e3c406c6c5396d8257496f4ba3703cb1ba25c2fe4aa54577af782cd57e85a88a2d75c54039e8b7bb559219edd6e81e41acb6d575d6f798afb2cbf7f00abd5c9c7b0fceec79f9a0fb040ebcbb7bff3602df7b71357efacd37aa57019350bb81213508a006160acde3dae5c42f03141887eaca22d7b33d6791febfb619d11ebabb13e6c5378e9a72e852ddccd31cc53a43275966b7042ddc51485ca20e1c456dcc7020cafb5407548b044d332229911fc74d7fb97de25abff7efb431da82de2ed7e25d0dcc06ffc74e57ca93a6a9f64d76a5c39776fe2266f88d6d0229b527525fd2e22a1407e26f94c5bc6adb1e7327f3c8bb8d4c983385c579dd8f5623df8cd6da569c7de73d9210e6b9253a177653a13ece075940fc81016d8c35fa4f6542df5120c174158ff32533476f4e059e35117081a24798fbdd1eb10f82809836f8dbefe755611347f75423dd8571695960c6f66cca71f0a01e8fecbe1183bee3335eff10b4ff8104132040e2145ec3164b2448f60c730887b9d7894e5f7df3f876cb17136c99cf32db1c02fba860937378dbd093c4c5112133781f06c8ca07c527c2c085e8ba5e52b399f2909e217aef6e3035ecafe2caeb1004069dea023af7eab873deb5ebcef2313c9827821bb9f89fd3d1570a569673d3ede86a4fb13dff242eb98450a8917fd8865c56e0a9f11d72394b79808b0429f3a83cf2465161596887fa2d557b367a1de9c7753666b0cca9c30cba9f0a749c03c55cdc7a6d45852c76ce2010de3e7f75d95228efdc79949b238d90b25f983868b7f07f585f7b00e45d9e132f3c09ee84f794d899759be3dabd46a256f4cf8da71270617cc2425b24cef25d1d2f3945afa6f81abfccc858cd02e05619649b1a5347650934105c02622d538447223d136a8a0455cf3c6f61f696b32266197b5cd1d936fd3ad4288520fb4a2f59bf95e659f33210446ef18debeb679dd99de0c3c74a6eb3dd783861f5db4e94a151c42ce27519d0bbbf1f3b1163563ec06c8bfd881d94a3b896fc07352fc97ada73685588a2242da1b718f81bb1077bc70fbd58b8b52163489ae403838b533851bec30ed0ecd97d72d1af534f3703db59f1f563bdc39d690a0e90e545506463a37e84974fd7b256bbb912cb4077d3e3f5bdd4bd2bab713b696c830b1f2185734c4d2dbd49d5372fe8b813ce73f5e01c36bddbb376ef4541033f2b0355613eeda8951ebf7377e08f967902eb7e23c0fa798c6ae52401721053f1095cacb1e9496500e83c412236fc21566090b3a3eee55aa402c0b774802fd81c9e8579761cfcfdfb1aa23786b2dc35dacd5ca8d8d283369f53e4a5db18060c2c6b0c303052aeeffe169fcaf7ecc63090a9ade245045ab9c8aebf738772297caaef5f857322a597846c7370083d409df27612e47b0cb240daa3cfa51c57108612ac0dddb0f59791289ccbdb3a2cb1fa9ac31a23dd5440682fb373bf0c1f41c4fe2185ad7c53eb69552807410053b0c2d40132250e637b8c425e6a35d93333b5b7d0557927b6179c848ec455fd1ab38348c0e96c60b2da49bd15118df64b6ce4fa48fbc555a4b2874141718e731a40b85382ae6e86ead31cea77f83bf5c063bf1febf71688a832d615e09d6f14badedeaeb6ffbfe343fc7274e78cd46a2aaec0a349c5f133291ee57cdcb65c5474e46294de6bb50886bce6c6f44dcb95f2a4761ed2e6c9e7bfed51e0964afab4e0f7e0b07960f2590baae66b1ec9a63ba0fb6c0d27e81508c51487dbbdc9beb8879fd58c188dfc774b3d0ddbd77ee8bdcdfa0ed8a9387728e12b13e8b3c10cc1c132bd822c2147c5ddf9a993aedbf78ec256db1be76644ca8ca7727208bf89732657152d34e948d73c47561d156f773136684d4162d02260300020123d13a95f4f835907c344942ddeccafe2abb7dc4792c4f1e39c24748c63cba933b16be0b8853e058c47a1ae2c4dfff39ec2339b345fe3557d03c1df91a0607a711636c4416ffdb73532aeeb74f237ed8bf971388a0659e4682a46b8327e751034cbf2c87c7828da9d24baf07a742ada34d1ef38ab1e8f2b4f801192c146600709533e61bc2665dc1e9e6441bf3c4f6643bc0c102a10f9a69da5b0e3d0a0c7cb694c682493032b5853f02953b5c2fc0e1348565389762fc2dcfbb34fd305f2d9df080e859396ffcbb7da78aae0a0d72e3de76c774bc6a81c87f2872b6afe97ced5269009304a4992c4add0bbe24e57632e19ad0fe37ae910193aab0aeae32cf6d618ab33eba59f6a04fad00b1d2403396e6fa661d31b695a1b349d62f56c08fe6c6eae7a482177adf341e51d03ea511d7959c721bd20bf371860ecd7fce1d25212891850b85648db0a039e6638d9c78bc958add3e41341536b5007be63fd1f7e3308876bcebcb97dc3b05a7b2eaadd00f8fcc8dcfa7b961bbe727c9aed1626ff786d6a0ffdbd1002cae8a7d047b6181962a686c152b2341c7c58c9f1dab5af424d183ed1c7d003165a1d04ea3683ff31a0f68615af6f91c21f736e67df641ed31b998445afadf9052bbe004d5dad08f62e5d353e42fc35a92242d8414d99dc4e7e81c8c027af686baa5c185e3f99abb3855b22cfdff0a62e2f47a632b7df8e00e0317af5c24ce7c64077bbb15ec27e062070cd3eb8e549ed9112469090ad9a96eb59294b021eed81987178cb2dcff67a9a2e930f6032c753e203380f8a7c987cea393234699de03a1d09ce204f0a8b6d5cf522b6887174fdbccb08f3e7c4fe2f778254465b32766c48812a45151ac37ae354dac87419f9476baa27e24b2f322b2da4ddf579750684a5881bae2269351fb7de59b9d5a4badd8951135f2713dafc57215dc626ee170fae7f20bff98e36b864e1fe0f0f9a300c903069bf0e0b6f2f8e78423cf6063e89dde6c81efcf26ef15510563c84730f611ac879a6628e55115e1a29de6945d37fbe4f803fcf2e344712d9e0d6f6c79f8773a9f199b705235e20a7830ee3357c5dca29d7a6c29a3d2628bf2c42c8f076cc4525301d8e1860729070dc53164d9fa08bf63cc889eed01b0130a7146d860bbc09ead3865a3082db0836a45f5506c3e46e452e298764939226cedfd06700e4e33c6b4a78add601140249596831e97f960b973a4e4dc3fe2813fa34eb47f998ce57270368fb81719a09298a223f7e3931ce5cdfab3f658649533354e982c87dc9e49eacebb5bb4af9a767b4f1c03d774431168cd4fec1b2726f1aae3f9a062a825f3295557eebf3af4784487b869fb049de44d03fee71194fc200af72103b157431935b5ab9bc122773ffd313d52d7acf1078386090fc011de695e71567cfd51c06317d4ff8841ceeb74ad35f4e5f4d20921123cb88bb2079674ad39e133cdfd6478d69c9bddc7a818be5d7b254bd9e0abdb030f52846fdfeae8ff370a51a9c5f6017af3c6c3db17c5c614ea18ab0e3ca0dd5de621217dffa36e5c5318fe191040a50cc3ca620683bc34da6c142e1c50afce28a86b8b66d189adcd755561a647080d93f3ede1cf54c3afb7e863fc8a82a2576d3f79e9b2bb634e598507a3d7d017e0176b7868bff3a3dfb4474b3ce03c401f33929364e727fbf8096b77eb351435c7a113b3215cc6246dd86f1517a7e550cf828900248f7c1754e40fed62477b296a37d3e53231360d012c4908b466e49b0e620c0a5031228009f259b030956ebd70e49357c3c3ac2842b6bd6e3ca5a3e985dc03f7105681fec03b320a7ca753b782ad3b52fd9c8e3bd980b48dd6ec8901dbf756108e85015821c880416e0693e0479cb31c0743450f6d9214afabc4feadb9bcee9def460a58d3a02d9e3039970068b8e3fd0a403a6ca7f2c71ae2b46ab3c731b1e65e2104c47fcb1f69e7c8c6df8c09b33f2e1cd4192faab316a44536dcac608832019f5765cc5240eabe3c87445c980c299a5e7ae0acc2c2ed19fdc8f011515bcb00476b03633c7669db1b44f97f6cd402778e9687c740dbe5686789b79d0b13f784a2a866eb91ab2d66f064c49e8df513ec348fd7272ee548ba08e1f9f99696ffb53677550d59c67f88404f6e610455a422d9cd987493ca5c366a397dccface2bba8e3e99719dafa768956cbf6fd8defc4104b8925878716a0514f70cbf3fa2c2bc2f66fabe654eed3076257e71117665703eb88c79e4c2b94e8e856e7a6ef90ee2a358409db78b98056ce1750eb80725d70e35507fdfa5933a61496ba48fbd5555717b33b59d4ef211fe096aefd478859ffc97a41372023ef114adcae5a8d5e03c21369baf1e7f417cb40326bc6db1cdf0904651dda3c1039a2f1755e7c329f7c03bf33f324206ce6e1638711c8c9a45f153aa1f847cca2a5d3af1d24fe7a1e1094819e8e712cbe10ead1012b7371b35cbcc2bd5b10505fb63bea20ac81d25e83ed0105e7595b6c28400f4d336791ce4a584323d0b455bbed44392c5f86c9d5287593f6986d4b0b8f9974a7a4157859ba801251d3b44b2bad84f29cb87dcf1680d6d10d1bfd59f0c95fb7bd07fdb3ea2fccd6e3ee80af438956ccfe31e750972f893ea5dcaa26d077fb3f09d990c2f41c8707368bba007803621ecd76540cdb8705435d74f4300eee04710a936f241c034709e625b0dd5dae1f6e86d034426819c365a05f5be420cdf4042bbff965a666a5756f67259448ebf742b6ea189fa17a4c3bfaf651d19a8a525f09d9cff637c8fac02eaa58d3ee3f7221da1e61833c0b183cd9f47686f09597e8115b435454acef80c079eafaa22b18927d07bf8b7c5ebfdec9c42a52b7824d45decef41e6184dc2db1505ca6f94172fafc10731706e79b9856dfede353d2eadeceaf72a302e3492d7dc81e3777e4e9e1f3d33cc4402833ffedb241a75a09e9495d671f80ad3acf06823bb04a92b815edd0ca7d01dcb3318c1ae5c62d3e99c0ec37908b45b51dd65f6b45b34ede2d6f553f60a45e20fafcb34ae4dbd375f52a5db9c62650deeee78e955087c2bea75ede7c304347b171fe0c1a2a033894be6e04605271307f307b2a9cf6ae24b8c87ce033a3fa4cf2bacdfcf54fcccb1f580476c7d00c631a8529a9eea2a713610341e0e25609dc8927e51c58a0a9197a54963b5cb95877354f4b8316df02ed2bea367704a12274d96bcbe0d0d728923a368bb8ab98d5db5401894c822632308ddfd309071fb4b477d8eac0ea5dbbc3e3606d8510d9051dfb5e4b7cdcf2c57c1b76902d864c3109c901da53019ed33cea84b407490486ad9f980a8a63df3d2e3921064afea137f35179130db3351f5bc3f5e7d590a5ab08b5415efbd345f9d57b71ade7dca939efa5a12d677b9af0af14468176a43712bde10cb15787c18bf066eaef8abcdea77d3a0c61d6c74ae7b54fe90940d0233e4b874c9a141dcc740d7fff43b9fbbc012a933d890232cf74fccb7ff7eac1148e203c7381b7f1d1429b1b1152ec25cbf7562596eb402a9328e43b5dc5cae36592da5523f0b9907a6817ecd395a7c778daae85bb11372b20641a04250b77b3a0ece885d07faf9622650259b874536d6d2b92181c834dc111b6fcba483167be40ecc922fb87006f63b9e8e632879563f37a8f712db9fa68c1a20ab239c0116fe022fad1279f3288b8e74a16d447e467b6381515814dd3aecab5c2a09c400b44e9100c04c720dc7e8c6d9460002da6c52004c16999975fef8752c2f9c229cbd9e6446b226cc454bd68cd665668a17328bb30f301e92ef5c7a2197a326df5c99b422096de8af231d1d8872e6e505bcfff026d4862f28d4bb3856a66ced22c9b0587451d8da4230a38561b5b1c69b523a4701a2001382aa82fcbd60733a14696a540227db44aef346d6c0a7ae5173604d59eb828614cafc1b8cfecda054dcc7306f73925e6d1af56ed74c51c6cdb66e9fee8d7a0078254fedb0c0f5dc85a4686870709b499eafbc8451aebadf848b0598ce8f955688bd2d6032abe10d1391d67c20a049841f95d2ee0c8deae2bc1baca0c098d8718cba1ddcd968981c47cd98d247aca4f838f3bf16d092eab8be8deb1f8d504d37cc44a8c96c9f22f2698036d4ad3bb48b31f109626565c147d20a4a7dfd61fb918f81548fb4f78875c1d138e819f6822651b93a3c92ad77793fba5222d870ea671f9cac967919d18f96e92778548415b2e170d90b201215354fc48a77e62823a2c2bb354782ad052732f08beb278f751529416f37d83ea26248517ae2ef2ead28c1077908995a2d25db0deaa957bcab39715283287fd626ea7388abccba2d90e364a7ff4284c84f70da68ce1aafb5be0401cb9d45e085aab41892a49e10cbd5baf2c34f5e0ca076f2772abea6f622b66020d546f8c2f134a87f96edbeb9b08394b585f2c2f98aa792f97b43b5f3aa9c34189804a9ecc2cfaeefbd0f967d85a25bf3136fd8132dec38aa82e4af6ff677682f3b62be27a180aeb22f918c24f23bf6f5954e0722324cccd06829fc32ae4fe3aee6e5a03b3651900e13fb0a759e544d033418b6ed40d037b4549a0404792c8fddc317b7f028493c4c91d6773932f8486417544f3d007e5f9e6fc02fadff175303f77f6b0e1f709bb3d3a93b38552ccf62688a39da1a602dd5e122e6f4e9171769ada5255cc5cf938dfefcbe3ab0faca434c42dc8c357e89a3d1488fa3df35c3580b124ba3bf6d0d203d586707eb692150ed05a01bf9de5c4e67bb948088784016394d47abb853f2b6b643a066ad81bcd1735aed4e108a8c1fcd025b548de874eb60de7f3c568728959147d1219e4b830e06ca2bee1f8a035e28a54ee6958d4821a84e5d1e41139905f7ec60fe67ce5f4eccdcc2c3d1e4a753a32dd3004970a4ff3824471822fe2b5010b9b6c6b01336dbf0181a95cba2624663215468519871cc39e8a7f4a151c8bd03363b402020f2fb98069b2cb8cc1b7e930938e7540d95d1d223e47865135793f9eb573660ff79f7ed2fae503e68ba44596ee745fbd8fa562c5c666d174cc01b1961736e18b8b517161ab9c8058026e0ddd6c94aed0086a26e1b959a5e05eb9d8c1ff5b2ef518ca23b4f265db61b499a48cc46bed28d23ffc1e8d9c9e345c06079ad47c88dd4e8e286575bd7f9420ab9c2d5c6685488b8b34d4c9ac04e1427ae0994cf789b48b01d1db9c2fe75fc5187727bb11119f82d0739ce4048467a08cd635bf78cc1b6cc9c28fdc199d351064a81456f81c9e56a43aef7332973804b06b18a26caa62523a7d0acc272ba49124b17bb68800d5756afd34ddb2b7e2dd8a118aac3fcf39d9f853c4d2c4fd3ed5bd25a6604d68d57db93d15aa1160f8a97e6c24238e84f272780966867f9c644ca2775cdac4af0ece036cfa6ebb1cd9d701dd7daec5763c9a4de0385db383a5647918e79c6a6de1f4ee1f6b722c561704c8d7efa4710d78dfce8ad2df0d3d82cbb59cef0bcb001f70bdc6e17af1a720b117fe02bb1dd527b18e6bce70e9447cd0cc85cbcf431fe7c006f5e4ef878a974a93b25f492847c9ae020583c9d412f4124246164d8f080b615e2eee267a7aeb5fa0974de52cefef23cdda7b305a33a91e9b50471ceb72dae337c485d636e28d6ee31f5705983808b1567d4d4ae820ec445c56e6a404cad6b408691475397c0dd6cfad232106ba96e5104052700a653e21f9ac6d79578a9f52548f426a1e81dd45bae30acdd4d22a2dafd633564d6b2f45e7d35413503c955cb0a9784b42ae8c2a5933a6729f3922f969a158540dcd201ecb6e32f88b5b4921914a2e8f424c8b031f115ea5d23a21e6f22439ffd7e5d11b08df729f65613b4f6ad3edbc9a066a5e712ecbddfa6fa764cdf170c0485f82d924a99b7e7ad8dc44c1f93e49b6469a9af3de5691944413f1417b753bcb84d5b7a34f362c383cbc802b0c88bd23a7ac471b9287571c42081b1134bfc8ce104a550942ab1f2a074cb00a90558d6e841ff15cfde6951f03e450a1bfc90dec6c513fcb2692ddccc31d22e5274d41036656183c72fce208e44920776f196193137ac67d6d65ce9cfaae774f23a86e6ee8ff3a4e9422a4667d971906e5496a4e80278774899c882708611bad282f6c1d666bc5e7c40082b43a6e98d494a18e9b3cf7f154fdbf90d786e59e83b72ad0ab893c49aca50ed37ea5202e650fda54f5c46ca2a35c476f4b009c5e6733232275abd1341199b63d22386c484cb95c43ea90e609c407bc79ddd00609cc2eb0d82848db239b249f164b7ea384d0239fe1e64d04955b9297472cafa2ff272c5c78100aaa86cdd8120556f25652a3c12da5853338e3be8f505d93ea03cd1cae7e78e95befdc0e26b760d11e05403c348e0523fe036381408033c009a8e1f117af5100a6eb91f08307df465c20bc1dd029875ef7e49338689f602d98f2dc690a57a6f2864e57098f8bd723574944ad3688b292db6d01387a16493912722ac8f91fd12b748899bdaeabdf0479df788eda440d7bf30d1c25d78d757f00b74bb556506637fc1ab87162f05d464e63a6272db3fe56e9357275035d6b6bee32bd92c4a1dc94778551e94ee1d8854f767bfac3811bd0287672aaa01ea18c25650f05a68cbacd9158e479b508e72df778589e1e03dc543b60bb3b10399e5c50de9e728e69774fb3f5fea757ddefccd0f9da75afe4b67f9c54aaaaf646e858fb001a6deed0a8a769ecef0689c988de566b6015fb8c40aeb5f2df7ea4bee60e8e69d15c4a4aa5411dbe63fbdd6418cf025d87f37362f15e22aba83abe1a3de9857c71c2234023b969eacc0bc526363b7f30b092ca114f2a6cefb34394d146866ac86a33fc497a8cb8e2a5bac398579ff7958878421fb08fff4f8f3deb8c9641b8de392647df3017a5467f9d7b23036935ec6e188dd6dbfb544b8a9e04a4b3c7fa1e4d1d9879daf69986b8083e6eb023a4b5eff80fef17f8f65433c882a21565a919448e6091d1b61013fdaf9fc3e45bbe827c9b4ab10b05600a1961e81d31c7404f8e0d32bfcac2937eaed811db167dfdc29286b0d51bad2bcdb9dea76eaf495a31a7fe717c1c98be374a36271cdd06ed06c02ef4c3c06cb42f73b3332ed488416010e6bf2f4dc4dade6e2e61f19e9306bf941868f59fa0939005743dd647f0a04b576a7e71d4c383c479453501e18ec56d7cb79fe31ff534afbd8609ed701ef163f9de31bc58114399fa0f22b62c66c380e8a10c34b7e731df2a8d39dcf36fbf3a66d67b973e3a94bf6ee0bd96f5c76baa76492032fdd2f59ecaee403d486f543f2cd7ae7b0dabe1b5566e681cd40d384a94349e9668650a6f2d2daf86c59a7b02ba466cd03ce1d50c3f0ca4c02dc4b3d1c0e7b9a77df9eae0bfcffa32117d7e05adc7195f4278c93497401629897a58d08ad7141ea52e0163f14992d7a284e7b875ce4640b4dd48ceedad1ea17d8ab1e760773044845e0899602f1bdfff4d42ab80c0765d1a8bde2ba0a830c050923956d06c80b182264ad19ae4f7c39e43195f7d421bdcda00e3eb5ec5ef2ec91d69df691ba7fe250352acf01fa92af5e2c634b9c7c97889e9147e869acc153d88cdc18908f882f371ba9c1e13c26e9cb8e3cbd4c5e1988080ca65a67b3a4c3460cfadbec904d853fddd2f5375b6070941fca53cc106b5748480213cfbdc1c34320a0478b05f76fd0454c75eca069cb1fa7b21704dab67dc40d041c8a1040db378e76655636ad725219c049e6536982d6ee9f11dd032280e622547c7ff44a938a1f233c356a98182d22d5770fbc871e20bb37483dd5d6ea1551993b95b30774a49b50d411ebe0e8c92834094e23ec2664d822c40e96fb42b8607b62b6949e05edcaa436d0ffac6a8ff384068acfc0220c0b098d368fb8113918a4f8c9de37cece74c8695cef2427e54a6e77ad092a9b7f1d94ac9f0836deff41b905b5dafc58ad6063759b0372a634f69a639e19521825d66a282f489c3172a3659264d0132af3571e637782bb6fe5c0afd24547612166fd3409d0991392fa054ea5bd07a4cd0921a13ad7b62a0b5e6d56cd8adb7f3eaa5c99576941c38aff311c49a8c9d8c755869302a2e5e40109c8365a551cd3f859b9421be189d3a0e9ed78830d5cd6a2414e9cc4c25814d94d98f8848e5386d6dbddd65d22b96c5d20020a5dd409c7e5344065871e57e01c91a443501dc8bf619890fe231319b5480c3879dee618d319962596539e2970513fb5c0c8eac3a71ff99962779cf1d7e916566d0e29d121c5cec5d7302a18ed00be9316f3de8c669a64c2a960a588f9c8a42690f6867cda7146e8ce27aa6a7fb27606eed9df6a235a42d17ce71627446e206e879de56025a66556263f06684dedcfd6f083d6a707e5fc8f8212d716e062f0f7fd0c2fc62bea93d68581265a803c31cac3f8ac8939c5f8c464ebd19df42c7e8998494af614c8383294f3f3883f2404ac10404759e182a038c97aea04a85530ec005e203807c5bc30fa9f5339b32fb0427e64915e29a25bb25ac60b92256470e7de5298d42c6b88995f8d2fb704e49d55b66b71e237af90fcbfd71d9093e1a543da2e9911ac4102346dc4704859cb33ac5f5dce2b3331a9dc9fb506461a5436c89bf90d39afcf93cbca4cfc35da6ddb112243928246ae0d1ba269b0fce0468d3ecabbdb925c9ea3241e2dbdc6b151fb4aa724a42f98b0248171fa01fa103f116d0e7deb65dc359b09126f9a420300fd209508ec7a50be56d5b470e387d0c52a1d104625f9571ce1404d1b7af3fb00475b95f752ab96610be112d33ded48624015781e7198f4dcdf917839471fbedb43c34efabe09941fab6b342cf672a29dbb1eed0db788dbfcfcc63bcfe80f7718571f691818dd6f839e3cc282f85f03fe0400171cdf1235049fa53de7450b4c40ed398d5a486f52124c1c63de2afc950e81839f52d17e2a7d32f82788465a65da6cd763c6360763561ed2bf47749080549b6e2db87514e1ee1c85a0bbd346eb6e3cc29267cbedcad67a287fc5be65ec59ba8b6854b31c83dfc5155187d4150685c5c2c342ed68b01ac9e44b60f0c100a347a0f93074dd37d8956fe2f43110dda66e9f9e6185c23dab74cfca21f3ede4bca87687549ea02662f45dfa0ad27f9959a120cacb7c419810e1b1a50fad31c12c47d5bbc61bad77044aa541d29faa6126c60ef088b82eead17a52843307d4bf798b853d90d14c5347ff10615381d85e964331b7a123d15a77a6790d93e920052ddb4db4baaac5e2b27b66ff955e53b8308151c81da4711189ccf0eb393c5bbccfa1f6c94a8d5f4bcd266fc6a12061967ce836ca042257368f567dc42de6ce0be84449234a6163b72069f25b7ead4b2003e1a7665e87ccf211abe94175d1c11bff2c0b6bc110194d34aab96934ef59804cd26e4434ba166d9833fb091be37b139cc10748b881c93690528a96ccccd2dbe024510b8da37dceab567dc52706461c486a0463369cbb99bcca2e8a4d2e005c45401964722a4b3ed37c351c9f21685e8992c9634349379f41796deebffc2928058c8ef6ea37c6e4970dedb78d1c2a00ea9e1ff1e7708470a6c60e6a2b1e966aa872776afdb238e97f716b3df8dfd42bf0f7ceb52bf9eb33731bdba5987b8f48b4599d67b383e77413107857e951ae0625059e5616ccb41131df9a480efd5beab3a9c99615921caedc53dbad675c00ba1030577db1d22731677914fa958b44792cc9c19e2ac71ebe61a05ee67ae7116e39e1c0d103f18bbc9d531164360d901da8234d29fb0b37cd2a60c7aa2adb2a4b297ea2fb14122ad95bd4592ef86c88fdae1e37dc8e44ad03c0fcdfa3801e93796771c5a2ec1e4ab12a64b3ffe48e7442c6224661ed5cc987aada6e778399941f7b20f16f94fb346b916be87f005c9c13789741602039d38270643cce3c347565eef5ee09139330301951c15756be47994de6f1802dc5131b9b011051b1d87d744756831a71cc8528487f032fee9dbffccc751e6a1ee6d07bb218b3a7ec6bf5740ead7a47b6907d7aa95b79aecedf4a637ead8fc6fb8654c93d13ee79f5d6258dcc61993aebc65e4fc14eea7d006e31f6e9f60e3bca8ce52ec559876fd20255e507daa99b185671ce1ac11d448c30bcdf97b9617195e0ccd2d15246308dd6cda74a8071114327fe203b1adbaa780f3243105c5111636a51dce966f5652e39d4f91abbbb4576234d6cacc3ec57cef2dd4dda49a6c33d12bb7595fd5ab5bb15b40301f34ddfb831a5dbf62218f496c003227fe6282e2ac054c45e7f3fc93e51b3ee8690f08612395095a0a12729d663eded879d9ffb325c62f2cb546a48bed51ae232fa6ce28a2494c132a6e09d98c2e3d478d5d2d15dce2e2665e4a3db448931068b99899c2bd8ba87349b0cf9e3c52cffdcf58a59b4fe0089b298b42ad7553f831bd60f5cfa3e09102fe773e4c05412973a678f3b3ed420433cd664dc7f218e816a17c5c9013ecb84abf2dd073557dbc41b92a91e0339d57b8b077a9a44d56427fec5748c47c1460b2e2412094db6d0ad06dea0aa0c1368592594bf0b2f590a9d6149e44dd4adc4cb42e5d9940d59397b83b33b88604c210694e3fbd84795c80c1b09ddb3b1ec8bef6e9dfc4d7f295e551a79436007ca48aa605ef5a89571e59cb26f2766e564e39d3bb441deaa0c8664549881d90a77256c0f6c77241fd6ab74b0e2890f78ff16fd2f9271ef96ebfbd0b878ba9c703900752b7447f4efaa60bd9dc9cd5673a36b39d49f54274caf03c0cf82b95141fa20ed3ce02ebf0dd74d9eff8eb9e2dd3a2976b244b12fd33ee75c1f1c459f86a1cefbc817f42d7f43ba406098165cbeab99df4fe751ae3382efce32af252e461652c7598161e74fd8eeca474fab6b1ede039935f2fd4d7562623b90a422a78941f47a76863d95857c33653d1b42b806bbafcfeccb7bb4a0c58acebf6104b2570afc3ca88e4fdf2719cf39c964a1ea7d2ae4a7fadc938abc95adac495093f6b959b1347501606b3f960b6d739291aa8c13eb49e98b0f78d2b91400b6d8961cb6165c8b684738e4d4db2f2ac30ddaa03a5e0cde4142b625e81907f08c60d7cb5729456806c89ff0efd08397423e44738ff38f8e88684f3a099dcda455521caca37ab4f4d9ed5d37975d4fdd778b97cc93babc804864a35e3a2db04598152e67a2f1f157681c3962d46ada23ea5d9a524f9cdbdd08a07a3a85b1f6fbde11d5a35c7743b83bbefd19aedf6d92241d16aeca7f33cc51839b75f111e8edaeaed808daf2f43fdb3c6f032ea45052ac31d4870c4d0d76aa75d0b88635ce449054013f234c4a16cffc58c95ba1cb8a0a0399861eecb1039bdedfab4d05f0270c6b16f03f6b8e629f687f133ebf2662c7f930530746679aac2791f54d6a95bfab5be0c33739074ed4e7ae88dde4a8036a7d6095cf41776366b6ae3f8f4a0734f48c275e129cfffff5e0abd042f99a957bf6f0f47fc7288750f4fe30198f8cad7067b36cd87ebca08abd3f9475e7443f83cca91a1ebfc42ef3494871f51f6d52a5524b9391c687571be5327c7c94ee2a096653acb410917fd51e56a92be4f24c1db6b97b465ca84c31c04c2f61eae07e952eb6554aa4d8a380d9ee81c1c462c360fcc3cdff2867a953b655562cd06162af8b99bbe662e0c27ce4d9a1c1a907def48a3231c2110c930a2f1498e32dbbfee0e5c5869332f3024fa5dfb0327a27c663cacd4e9902de34dd93529e90eb347bafa5035f56fc578e8386c7571d1f0ba335225ecd8be026b4544ad70f3af11501a53119ee39a8558ca0ed5b3d897ffb9cf0fcab55a0942d3bf7bc6b94ea27a6b748f2cfda431f35252c44610b7e843ed91ebf7e8fe10638f04f52d6d5a7752ec62350efcb7c473f80b1f2a26805151e8346d39d23551e92fbe372df7979c3f756bbb43f6bed09bbc6b65fe6fd241ae1c2f1a0d0b805c582853b85502968f9478e9a84895f9d4ef01ec4f3f571e57cd0bda68ee1f6f7e14fb6e0f4ef8c7dff6796472a935294fc27b16216966d5021339ded059687355b42b55926854bbfbd9f974a0c26eadbfca8a6183093996cf252894e6db910c71ca3ab2e82d90d371c36b92c9409cf7937bb266ea9b29c41d774aa522e103cb30bbabfe872b57beb027623742806aa7694a859ede9bc1fd7b9e32880b064b0030fce1a0e5cdf3ce558a5feaa32e323dbfab6661c5878c9377ee52a615b7c17bf1228e328aa20f92d070c71561969e1af532e76835fb0436810c3d87b982217edfb1143bfc3405ac9f6f3a50145608dfa8658b0ab642a347255c55b59cd1c5897b2cf625a0f0706c30ca1c1321e90cec57b7c3d1bd1af455e3732db80643383c41eaa6781f63da6233360ee720cc04d171ae2445b0c071e339d547f7ac32f407d29ec7abce0a9e1ef5276544877bab2f84bd2eef47ffa66f96e7170cd54d836c9badbc59435146031502c1a3cc744a470f693636d9050c5b894d2d6047df60eb0bac16d905d46cbf017ca69d66427cb88036eca4ea9d0e579f6bfd8a4a850703a0fe49d39c107c9358e98689fb62bd0475aab4b2031446b437c7f9e373caf0270a28d7b15c71f02079dde401e26175bb6e392106a9072021f0e5c5145a1db6f595b032faed8551f6e2ce318db1ab513db876a3eb42d225014949c19543e9c5dfd2290e28c5d72c87223f0195ffbcba1c02c7d0087721efd2af6881dee7dba7565e07abc35bc3fa41c6a4d6a313222ac6dbb117c69c62db2691c68869ac5fc5e987b0ae4335f815c73ea4235da2582dde81d6fdae5911617daef847be17f2bc09edd88830eac03977f89179fe03eb2dc3b38df43803ca2d38455232549110f4580ec3cc04c0d8cfe493013d2cde47c506ef6a8dfc42d998f70378fac5ce4709345926dc477e9e339d8c87ff6287ea6e2873e14d538cdc3f2a47e0e37a2601652f5b665b616a7d1ef3537a3327a76f93990f7694e6484e7a52a10e9eea2edc92b99406abfb2b11ec86667c7af4a333dfe900bf071d1bbcf4f0ad768fae4f450c53817c507d26e926e753e3395201d3ad89061f16706d841994abad283f0db74cada25beb5fe46f48669a62e0b849cb77097e1b4578b45062af4a071b04f0cfddf87519cf2bfa10ebb4b860239ff187e6dad73806ae968e6ac0f738baa88edb3ae4883a9e59be7a6b222c5f54818f95578daff9fc7a7aba8c4a41a699923e85ddf24a32bb71c808516f64d506058a70539276d57984d75161cba7d53a4a864c51a249a6b8fcad5738dd0055ba8468b56579ba5f102642df65c598490f3a0c9b1064f4eb1962c4c38bfb7d55d496a0b0f7b3f90b42f733d112c89176aaf937eea4bada845f3ca4e9b56b3a5a06b4c90fa4c1914ea47020c2f32531e270007ed389246906ecf2c4465f7cc5d6a347583dd73341ad97199021819be81100d867d628323ef7552db945e4c0be604cf6c4a8197958bcbd6c1879387d3286dff979632c54baba2a35ea84efd7726b662b94fae61464d069e0103692599fb86fdc3a06e01c6ae3deb3de6fdb21806c716e5f82b784e4ad3f0e2de629a18e3a2309003dfde9dde8e5101b83312f76e811277afc286b56879f4eb80468e58c60bc088284d05d725ddfe3185b7c51b472a7ff7db3930839142d4a452ddab628e07d43375801d7c6a711a55b452748d770b84ede35920c1ac74b595baef963d21df9418533fcf959593ccf5afccc753e86c4ae231eafe77a158c2472143faf169db29bf2b53c3288d8b3c9added65778095f85e2cb471ab58362041f0a27d874c42bbb06385a0403ca193cba67cf70029cdb7e73c7e2267b856fa0b8dd4c706b45e7174659b0ee2891df911724324f7ca5daf07c912b9b2abff762e62a1817688757492975db7185c4695f3a90895634b8d07453b36dd95197abc31d5d153dfb0d0ec92639540e99d6590f9b394f14c93a5e829fbb33616e810f59c502be44a13b700fd3009545e34c211abf9afe1bb8ced793c6f516d40010649f83a78ddbe9b71d8596582997d0aa54192e1200db61dade30500d72a184ca7dfcbfb80e5442f489d316cc8b75005564835d4b11c482e2c4d0d160f14a8b13ae0a0fb0ba5e3b782770aaca357df0e1c4d1c3b28b776a8b3e0da1abfd4f7190673fca1e1c5a31c688d6e8ddb21300e4178d07c4e854a718ac3f672b0120d6a54c16957c9ec8c444208e47737bc4eeb0bf2d801eb2fcb72f91fe988aa75f38e6cf26e858dc2a718580ff5d281d13e8fc3e3bc30c75c0193481c39c375a5b06b962d9491f3f1fb80f1cb27067f0709e0b0730573a9b5f5bdbee1708ad84b4ceb1a9a61e4c41e90655764057bfa07b8c81cc83a315be1aed6a49715479c0fd0f53f625fe6c7f36fadd001149ab978532e4d0de3d1a38934c74265b161899843704fad16ffc6189f42a5cadec98603e0f98c6889bd4a559079e074cb40678fad4690a20d988735280a1ee8ea71275069132101b35c18ecc9d3c6eceb4cfe9b165e4b6acc17d4f113ef8283c0fb6506f5635401e916d4f7e7bc3cf49aed166587a0c72cdbe673f467d81bc2e9cd08cd8dd16d90b353481df31e89b45e8b +MD = be3cfa6c965b2ee4e6fb0236665b0b95f66c8da8b338375b7393672283b0e50b96112d7cb76fffaa6db8ea4a7687fc6234dc1ee52e764d69ba8ac40c0f51beba + +[L = 48] + +Len = 16 +Msg = 3a35 +MD = 87bea682792f6bb4977fe1b92e0cc7017413dd263732c3604f0ebd63c2817ce5ddc5d78c0137f614a06e72ab1cab2f4c + +Len = 104 +Msg = 7db15b3ee240b45d4610950996 +MD = 7311a6356ab38a690c0b3a1581c3e7b6de418996c05e79849891b061c51d53dffc0fff2b8ad1c1eff165aee5ef6e18ff + +Len = 352 +Msg = d2a1efc725c46cd6a19760f49edf0bae823c1b4992ae2260085746cf65833bd008e56e64002383f51f960239 +MD = adb1778360ec659e90609e74b6af219a01a024f216b68aa944841429ed5b03b139444b8b848f73fd5f350ef02d46b6ce + +Len = 1016 +Msg = d11ad1253592c094746da7b5c88d329bc3ce1929913b8be07e82d3f6b7a536a855f31ad197376eba6f2f4534413fc4e4e7673fdff8739f774a710754b568b7c61a473059a41c98aa4e86617aa66d2601d0f0d584cd9f132afeebdc0ce3da6a8b290059e6e4aa080c195c42ae7f7e1e99865223439929b0a3a0d79b46ca6419 +MD = 0cbec7be7299f48f043c3d1aacf833b4258c32190a21a8ac2471666b4a51b63cc77fff6e081aaf5ef21b1b7523d65763 + +Len = 13696 +Msg = 2f7a9929dffaa4a4dcfeea1fc37b18e3cf935abbaa17cf9d834b3a8d61e9fabfb7683cfc387d6f46ece3f8bf845827c7ebe86a651d6dc1e83c5772cee1a9fee4b04453af2f68430bd87835126cfd1b3f8beea4d3822fb27864570e255cb65b414197480b6bc20a39c5450adf2474da93d72f6ecf8063899722d3755b7a19f71e93e782d89593ab19ddd3ddf053c54e0bf832311fbf132e8b9e540f38e4d9bcc3cdbf69de54e40ef348a9170ba2f65def167f568ce846889c0161448342fe907718a465e451bc1b0f2e4f21f9b911f186589f43dea305811473837c063b915d849c20deb43323bab4b64e61823f1df119e71962dd975700391b411f8778980a3080ba3c14a321d32c082d416ddd2345f0eb751a516d44ee55222395cfa11e7fc4edfbe7cd49bf4ebd4d7428843a2ad5538b3cd201ccd431aeafb146a65d28a4870a6948a7cc0413b0adac7e8dff3a898aeff5f4b65d10b28ceb749bd354c061c3008ec569d5f90a4d4f5caa51d35b49dc4028e738c8ff5939fef3fa202fed9ebef6f2c7dd0ba41cdb5c0c16985f96fd93a65d134fb4a90ffc0fb6cc5396b843c2151bb7c9170f2fa4fb44292a4af28df5481de0c3c917ba1c46467a35302738158493fbf6a0422cee558d4bce3d78e14b4fefb65bb05043e2cc2a6a8ea64565ff6ce2fd2c4f43fc02926ee44ee02fe1dce25cfde0115c9396c9ea06269f17b2caf58e2332cc1c8528d9705c70da1f76f22aeb1d1b93449180640fb5c4c4a708bc4621d7d2bed5b1a752191cfdd45086d34f247ed1df0f24e7c620de32bdfc4d1f882380d2cd7467c926f48abc75cbfac8788f88cd9dc5361517a5eb36311e6b39e21a85fba2038fd47d860f776697bb19cdb5a4d6746fae507e274399c91648537d905015e58910117e5914f44ebcb00e771d38b30c1473e1232d4e222cebceb4810c48e83e0fd4c852f4fffcd643c0ef9e4fae2d0ebc6f102f3f749b02a5e3a61517d53b539cc24120df3957a633d50369d46c0c226f8924cae51dcaf54d716f61385fd8cf38c2c311a32bcd6594d6930133dc18ef36a9671ba8b179abe95f588ef74e8558ebbc974dc73c26bb6eaae78ef464181e18b71f4b0f986ecc8495a9c4dc0b0b96be9806fbd3d32952ca3b4737a06ed6561e9c9581a33a720123fbaa2a70fc3233b83e56444f5aa0cfaf70fb24be6118404f3e11e6ea004cf2d079a3e93a8ac1d4e297cf4fc43851dd26314a7ed6a5a784b386daa26e50c64692f7db28c21d82234289bb45bad5042236667e6d70a24bc9525c3adcb793a6a5725d9b10911e3bc8e3fd604db7998346e7f7dd1815c0cbb735a977bd4b32b5b976932bc92ef3b56bcadc089045ec95f241cdb0a84c67f1f76353da6cb493bb27a881d37a2106b8b3010cf935eb3601ce4dce3e449eff8331e444ab117a20809a1010db4cf3be0c488f777b6532df908112e3d11592f04a0cc16232d62340cbb8b5268a662b8278d37c03d848a04f0ab498f5af43b0a20e310197b7e1395a65299fac29f051bcc5fcd09a5605bfee370ee8ea21f5807d9748acca815a44d81796d68b0014eed3bb6a94233fc51725de3809ac6f538beaacf8cbe3d96aca21a7a763a957f8892f22c6d086d9af2e5ac9d90321e186584f17e964c90739559ddd034df076c4aa38c2b78aab6dec8ef6be9adf33bfb66f159ec4826653ee6cb483539c47a4a1d95663e6cc7a42a3bf628623a4c9500a59a50a312aa104b198ce5f3e58952bb79ff1ccfa9ddba2fd4705e91b5acaddab9d6522d7666264ac5f533b6d8ac4512d8371c69c06b6d322b046ae2a0a20aec1c3bfb05f3d91b9044cabdd873abb5f2b0e3e19740df31e39828f9ff9bbb20b73541a7a70b8174ce4e43e0d356e629cdbc6c08d29bd7acb6a4347823075683ce9d7de4ab3ddda6572b175951f30a15263355fe9641b3322df7dd52077402a884cd472e6d0b6c34cd63ab63cec8760c7ebe384f7cc31066bbdb7a3417425e039c4d340166e4bba4839076ac9457c87459c57957d0a06dced2f7a18acd22b7295785dafa435a2a8a2c3a1fa05d115fe129d19fc44c5a29bf15b4d9c2b375bc8e591f92756cfc573a39b8fccb8395cad7617b11f14a60e2dbf69b897844cbbcb70363010f6e1bc0590ea594aa924597dbb32a868b55551789f82437180b85661809089d34a168d44b4d788dba23b13542715843eee797366d9ce7793e72331735bc78cd61b13421a568ba3e66926921c04e9d00888ba7ddeb474db63813756ea4a02c1823083e36ebd2d32d5c88cdebb98d511304cc276c7799cf84a1699ccac9569b13f530c762732e6bd0f8415001b2c02d11dff36660b717054b16df49ba38425e3764a56052ffddecdfc686aff22079897376cc15591e11579fe4feeccb55f +MD = 70e1259106fc7a7c6be11d95fb673bfaf0074e342fdaefb458faf4619e7f0edbd68d509b9ca7243d2e5e039d42ee3b47 + +Len = 100816 +Msg = 5f464d3301c5e0871d6b41b002dcd09abc80a805de3482d97f3fd7b9838745da1c0534168f76b93c3c53bbabd904541ffe5179cae619dea77446140b7400f47d242141c7f2e9894d88f44c9e066861498e7394f206f594a419790d697f6a11187f84bc6fb288186109343eb11172bec076d041a4c7306d7978c009fc2d2d62563614ed3555ba2d21c8fcd70e8389352dbe4ec808af3231ce990452eb05b1b0dc4fbb1b4265e69235cc3561dae4148c386cd770474863a84a822b2e5f905fc255d55f90bd6a760d441dc52240ba7d8c888a5283891a2c99963d1fe680549d6267cdea92cfead167f6c49663668f2bfdc61fa647f5abf3ce5ad2c6c175dbd456ba41436aa06f5f68f5c88e6b74ea86a79934bd05b486210d3d470a0967ad6d67f7385260578088d7e63197849354f651aad07e04ed301f1fe7a6d2047d50ce5dc6bbffbb1da6b47d740898f4eb54e3c5a1fbd18ec93254cc01f705fce04e6100ced132c519674b2345547804a372b5c925bd9ee9701527db33408d37b72f8d18b882d3c4744eb58f011d21fce336d426de1fcd5e09610216248b51fe2b79b96c2bd6ca0155e05a8a516b7a24d529a9a475284735bd9c4c437ddf399864b64fc5d0d6ffc4e5a7a3dbdd476bc39ed29a0a92e1f2b6b3506c2be5452d4f896db6eb4f895b554b2af64c4cb8dc2369b91022dc50b7291404cc9605c31569c32756a64ff8c4fbb0f1bca346c7b58a5c6774b2fc7f7fd50741d34c8564d92f396b97be782923ff3c855ea9757bde419f632c8399763003b58ee9140c2d62e914c1e1fa742661a9166d42267edc40905b35a25d5c3cb3fb457376b7422896df7bb19c23e8f764416731d2e20cf2c1beb8663c07edd8f105e078e2fed05c5e5897c430017fa2160f565a75a4c5c64a15dd7d644bf355d169ae2696ae5ed1a39e8f81055cdf315e5b0c6f9235515fc4dbf30281ef17b83a6ed604f89293904bf78c7183fcb0ab236cb1f8935e59c51559217efabc000b165d819b717118a03facb61a13a99b194f8b6c7ddfe5850127d79078397a56564c7ed6716a129409680434061b2a4782c9006587de927c1ae09d6778a5f1c39fc419fe10493eb0d4ad492fbd05485eee7913c59df82fe7182af2cf06a6e8edf06676200077bd1408f5c1cec537cb8566470cb44895826d04ec20f0aba4297c501add65c75d5767ad2ab63aa81b7b66f01b32590f1d55b7e50e6df1ee077a19c8c895f5ef62d452cc336e9aee171fa997ddcedd7af86e6cc37722fb5838a46c5e58e7f700edfb7c6bf832171d9581f660752867118e9535a6118635709d6f1c1cb21b938068958e956149d9bffc67f355cb88205d4894ba97c3e3c8be9fa2d20abe79f3f93a6a2f4f56fd075bb49a4b7dc83630e58c32a29d757fdbcaa607352f65483cf2cb4208a3bf94ca7a25e2a4e05279be31c33696c10fa4971d1b64ee938dd299f483e5c098845749a3b706a787529bf2ca56693d0a7a98243e6482a43e1f5d3086ca1b00368d8ead5ed2d0fb79b1e2f537ab9340809ca3a9b5eb2900390432293008ab7086c2811d33de0648be5597ef002c7c462b5e0f4e0b1720a98b2299ad7aa55eb78f0c77c2ab4371385f280107ae40ebf814a8223dc74f31483c63d9e4ed09fc7e5a51bac34d69d97163116a66c84ea9fe4263269b71fd228555ae3cf5109c4d6ced7b9049a2b8069bd2f71834d6c07fffbd7561939188bc07dcea08086bc7182a5270427c3199bf5fb5c4549861fd32a38ec81c4ab058c777dc01864787f0275f911a17838272cd65135f66baf06d8d93bc439eeb55d50b7c5adafed8eb8140b4b05f59871dacf954f4b096c30b7857774fcd319c096750bf605db8e31fe02cd1b9294eaf8bb009d4609f2cdb3a8657f650501b8553765de8f572fb91ac77b35db35f402453e5c58f60146f2906ff56b9c6b3a5d0bb6afb9e2201110919ac9c01a7e9750dfdb2f72afbf7a8d6f64b1c68b9de17a2c9abf289eef24074eee9b1649caf3693118165503a30200993d271aa31b8b92606a10a52612dd1fab495b82f9a98cade18b9d8a723a71ceb63fd1d27372bd281f9b40aa1839b0cc2f2177a09aa8e7b159ac118d7c145e7a4f032e788d21facde2b4dbc1d5d2238f530d9bf9bd2798f611d03ed8919f0c85bc2da99750b7a8d6322d2e66ff6ab9ebaf7424e8c1c3f4fe92be61f65359106395f5ef995e925be3868ad513f561f873acdbaf18590c903d64bd275121c11ea655124d091740887868544c5348664399d3da96e2e35fff34f062fb939d656bc072096e510b40b2f75ff010af68d64fd0acc778e2e13c9667de266b1816c4ac449521b02bbb217002c604be72e73051aa9048d192e3210a68769dd2693e5d44951711aed3a751240d42f8925844131daa36c51d7d59bbaf99623fddf1649db954705fd6f3405e63894f5258c9ffecf83208c2c90cc55b1a8d2972ea6b3a049ee54942b50526b7930953986e428b2c75e47ed870bba68dbfa624dd94112f3059da0a80c583baeb570fe8314f5c66501b34116c81148dd22396fcd6479da49f7e952c8084f97d6803ff85c3787222064ca368f596a1ebb6dab20a03916b3ab071c927d87fc10ecc4e7ab4a5761e3eadaea4de1a0dee30aa39a9e4dbee047201d7d8a4df1284cf668ae3ed7dc4cb2cc4b5cae9307353fd2ae4c105c5d9f3bb021535fc3ae9bf3ff54ddda8b2e1037cd9d69822df436dc1c750a9f557d1a3a63fbe73c64261dae0c70bba6edb57519f5b957f138d1aa5fefe01b73c1851aea42938147bac2762527a492cb85da43014c876e223b05597354d7c9b328df67f354d168a84ce86dff57d8a870db034196dbeff83ebef80bbe52425a8810f2c9fea29ee688a201cce4a5f447be789a3881a9da3b6c491288e8f1091719032608b332e0410f4576597e17e0b5dde305f069be2e80d565bb979a3915488f88e3ebb90e81c264bcaddd72b8843af4a4ae31f723d50fa0995b027c334c351128913bb93e67b1b08f101f6b8dc8202b44fbc3d3dfb530f66e5a8f35e69725c86998c05ac87c561a4706e90fa095adab4a566da4fab82bff6b20076e5bdf62dbd6614245b6a6f8cb6bf60106f8d12b9c3e26f8127dc547e2181531ce980a3273f452892110cfe1ea834a30f99d66e026a9d22dc76fc3cec8fda2d7fea701deb84dd45c97dcde57a017693e90983a156f11c4d168d89c06d8a32dbfa590adadd16850854f24bba315b0bbf372f03711a20163afa0c137383b9120b26c59f5e9e7cd2ccaf0ef4e0d70d5a81748ad441ee5fe178e14317cab184fe178fb0cc0d82105d2f423467fdcda0f9871b9d84882609248356f3053a99866dad9f9b0f8c4a897a8cb8f30365a7ae5f3ca6e772d863d445e6d57c6a478e35d719d0e4e84f3a30b1816ddb55bcd79df21ea0e95da72a19cc1fe74fc576120bc108be3ed4cae3bea889fb4ddd67efe858a994237378eb623dab070d954ac780c1e6d2095383c98ba622cbdb18fb53260979fb2672c21a4600f4bf06583a112d303096d4e30e7e1060d869f386eba3cf7aec3052ca17593dcc9969fa9cd88179c262770211cf53f53f175037a5cd445d239cee48f7ed0aa1d715a22ac18a8aeecf191d415e4afd92b76c091803f4c757a9e89f696ab7b11ad6d5f24774e4a004dcb0e3f33705dd8150431f051016af37647b9e44b10bef114276d4b1055b634461c655a82a847639a038ec9f58876e84e9a2955b696e072d8054c3f81173473604d5fcc0a75b4a340dba0c375beb87b8b01a0f2de232bbb8371c3a9d27a0ce521c4c43dd3bdeebf92f42f87d88978d5b4e3e563cba0e5f59dd29c31096885b113ea5c57e66a3be015b703bc26d3fd1d51a7c14f85f65747ac909d7e30c8e800be27eebf4a62e42e538ae30b6883907cebb7fc5e150bc9da3a138f394e817df9a9e44420078f30d0d3d6981ca581791a097a5e3982c983d5cec239096c7d8cc55c87242026d769ef1d04eb96e5b5001e3358af88d417cc61f107659791a35d8b5f7a5767ae24d5b2ba7aa12230076db1f1b9b6f213dceea62949d98bc5db38743b23a59ea75dbe4231a285678f5f07facc053c2048022fcb01f15e8c100d64a877ecd56d196a6ac60ae35e0e09a517224ba409ba7b70d8f9fe65bc427b212a4e9b3cb17b0d332267cea4f3bea7c1e550f7ffe567b20e3057aa0ebb560d00d28e2f7aff718a9f2d4d044f0d20709bb9ad567c98cff7c4810e8c542370cf90a491bc1088f69998d59f344b74db6c1bdb61f284e99b517a11452ca0bb37c7bae77fca6514b341066086e600f098a32a92935380a173c9182a2513584c54ff67e580dfe16b508acf1729a3d649ff1eae286bffd688fe658612d6c8e69e6e7f7de4ba85ec54747cdc42b1f23546b7e490e31280f066e52fac117fd3b0792e4de62d5843ee98c7201529455c85b169fdb90cb05e3403cf2f737148bd20a53c73880880a14ffff37d62130e682e50bc7210ea6c1f0c27656cc1785a0d9ce93ff94dbc5b2877519d9bac4a339e98ec594a7cc76f4ddf994fee8070dd4b8e0fe0e51b93105fcf566f83d914dd862b4ce78de7e9e16f142234bd969ff8005dddc641dcd3c7cfbdd6113cd3ba34a9503a0f433899e90e158abde2ed4ed4b3711c991577c5aafeaa982bce80835f8e6d7c7975571fafb1499991646bc499ec32930367d4b1de76ff656442cab987bdecdbcc2b2bc35ce01816594bfa4b6e33080caa41dbdf8ebf2205649f98a2d3bf331fb16b9ecd1824eacbbc9f81297b115b4d36aa7496e05f7d40d4edd1886c1bac10cf3f97840a03277e6369e7a7e90d932050ab8720fce076de5c355fb17959bd75cfaeff325b0737f8f5b1160de0b0184ba04afcc30bca77a6a37e29662302d01858c0bc1d32b883011b7df5a387805296cd91bbc835a3e76152d017ee929d4cbf137eb78db89d71617dd76cb00707aacb8088ac77a1f52ed710331193edb29933a7efd8cc153e6adfc2c6637e88cd86b06036b8177847b4d086b0ff9b5dc91f3cbd1c08217023d7449253c25331594f0f16a3c5f2e122e0145c4ec94f096b45a1fd0b2dd3f1d51e58978471782a336eae49d7bc4e050d1c6a391658f71a1f752c0ec6302bc2dba9e3766359359ce34955a2db86740c90d09cc50e92dbb76e17a39955fa7108bddeaddaf860d1aff14acec8b609ac1d336270a940604209df91cf45be72edee04277d694a6f968ae6d8e065702f3d607f3baf8db4ab7637fa4c78bb0b7fe69937eb1dcb616fca564a5a521e12df71fefbc321187159bd6a47b066a3440ba634de9153a94546b63aa33aed9da2018e1f30628df37f5360ca4f2660a46ffd73e58183e8abffdea25f7bdf798a2b7cddeaa481bcc6e682a67e99143066963d96d4a928a478951dd6ec59b1be8cb23aa688e1867738aecdd9afade39c92c0b2572bdde84eb912ed990ac618834c412231216fdb84f1e01b3f8414fc6dd0f646fd0fa62bb0157b3535e1497c9272df1cc5dcd4e6ab9a8456222655c56ac73fe0d2aa8b599035daddf0986a45b1a59510abe19a11b6dba065c8bcf8a85d20a3681c2414dab7c036cc1358b1dba98d6ae62c5948c36b5b3e307a6f860c0c822ac724a5c917ed5f98ece548a7a741d366868e6c676394c3659f7f6786594196dde332543376f9ba0724b091d30f431f91d919417e5bf7ba1e9a21cb80f6c204c3a58d59d960a5788b5cba5abd7c7518f4c5170115125de97009a6c3fc4d5773e4f57fdd433eb7422c7c4dccee57a1679633ced3b5f08df763d4577983c5ca8b49bc4e08fa76f8bff36daf0fed068db47f0c87e0e45d518dffe37c129cc6e2f5f9e0430185723098e715284a42f302a6b8368a4f2dc16f534d1e5db9d0b86659fc4ba6f16c982774115d02a57684c7e5489b1f491584b0f0546e4194a6041f5e5be3bfff3852a4fc772d83491023a61a37228ef6260edc0d1cb972cba610d5ad1d92d554700771d8236ef55e983765ed8eb21e7de7c8bb51aee9368758454fee4a3f32179c1e54af1d069e0b9728cd0554351907e018146511e4d6f0450b57c8ebd21c71450116296bdfc779945da60b9192c5bb9a67b1f04d94992df4cbb3e30732dc8af2177fef17e0b7d01740b8a64db16bc29c1e589b6bdfc967edeb2ce8a649ba892bc856a929f0b837a838ca7f917a52436ea3d20e72afacc5b9d58a7fd0fefd96787c65ffa7f910d6d0ada63d64d5c4679960e7f06aeb8c70dfef954f8e39efdb629b72979be208d616071289cfaa0756a4bb5eea5c7baf8fe7a31501e7e2d67d708d461c0c93e85f03afd70bd9e16437171e01a34f475e4b5a58d13ce4e2fba72bbba93403f3f8981e0bbd6a8a6223327bf096c44b36e0ccbf7592a98c1fa67f198b628787ec80aaef848b4fea158c715799e6f458327f399e6420f0e7821f2dc4663bbea065c7bdfe830b6102e2e7193381b9dc7f2381ba808c43b8fdf3addab4b5fa81564716f7d46e0349d9b27b559710d723c7ef2f79eb55c3a9d75b99ae6fde6877b278b583f8ae3cae776b914b0cae0772397fd19b6a27676c7ca02cd07f4b4d49bbe1ec87f2ac7e39e5f7712319c31271dbbbaf4b826af8a9f4acab696c62719f7a6a032c4bcf90922a3c630647b7c1c7b78b10afbd863f07486561a0bc8d9b1ff5fc41998a7e3c604e24af1c1df2da1dd5d83eefa2e4012f7fb5959ef9339574367deff73723484b5a969c8c23dc251a3b887f34b9ea09c9a1838e8aaabb254445d7556dda257dfd5579737fe1dd6c67f3851ca68b011e7cb7b6958d588f143828f0bb24fceca31b47b77d1ce05e75ab05b55d6c9f9107f0c738f2cf8a1629f7e9b2694324e082503937ff8ca7c5098f770289af7d038dcedcf0ed77c8b82e2a9003a6f3db69e14131e144f6be7cf0bb5353ea96aebd78befbc6ceae9bdde97823cdbc5ca8ef8a993a9d9383aee9f2d6a18fc64ab92990672ea2dc9b89ed248aacf7f1a513da43fe5953335afe76d78867a066f226ae9c727c6c60671c50a50732698ef7a492d51998eb6da5368a667baf6d12b77eb36686ee0ca239dc6f3598be0bda79e47f0891fe4d8989df8c685480de11c148a2b44c8a6bea3a50b09be557c51f545a09a30e9362cf3080e6a6bee3dbad370ce24f6c5a6f8091007ca195057fa3af8f99703a601086c2a1ffe55fde4c2c4153dbff8d6601ab68743c0d50d021b0b3099535ba6c40f866ca3ff0df7c19d709a3f58b57b40ab5e43556a8c0c1938c875267bb39c0db6b45840e8ee7c22bf6b48798bd744f70e42fca343a8bdfbd7f55f275ca5d62c7288756d4861fba68d16d842c5b893c1d8171bb3c8b593387d3426f292ace5cee7753c9f9a12e6bb9af5a24192e4184f7d3d191d862d3c3dace7853eaa235b6369fd164e5a7bddd06daa3eec7fe4130e82478d36f88a0999cba1f251ffb3a7689ea2baf016073193898716a9f933448d7ba8e0968c669bdb7dd5e6e32fd84a6ce9e8632b393f9263532ec2107b4c0d2abdf3abb2de2d63511805eb58a70bc4ded040d76640af60ce7f03b9a682b8dd84ed8a47225a48e0b94ea47828f1c8974cd64e5027d8b13d43519875d2bbe4461a7f0f5b5b8d63a472765405ea9c994225806395e64dff88506f7f7f3b6368d769e6e550d4e3e81efb13771cf403e855f75312f1383ce4c2744d0b4e3735a0f1e1b99eb014fa60c0d1ca9035fbc4403330c2fefa8411fb7c3d6ede5b5c8f4736106bbe01923d483a84f031e9685a3b6a70646a2a5059ce35fa496b3f21fca6047471a5bdd33908cc9328de9fb032347c249bf7093390b750696124621dfa67fd9c7fe85d6e5a4d277ad8f8d169f8b5e8dbee280f8443518bd94abc5ca704e781e6cb1868ba2d6fbbaa850326fbfa5a20e4df6fb5f8ee2728e86a758763a8af21e1f7a8584d3f0b09a0b19fe8fcd37bc4fdf45084d7fd92b80544f29aba52496e2c9a0aa4adeb89820be321cfd2f0a53585a15d04c7fe4ec9be6eb5df419e20b71506c1f642df75c53a9e3b2414fe6102fa8af7be3f6c95de824c31fd6fe8ef9d49e26095a2674a33cb574e9e493939bdeaf5b309b4c51256ef71e95dbbcee0a11991693b533f916e1c82ce86d65d89b6d596017fae944ec364546e78abbcbe4322b83e2fcbb4c5d4ccb54d8642c7eb9e28c08598a356a5c46f8813e6b63ec2f3e3bb721b726361f85a734e0514f4e9c4732991ed3998b1ba8f618c2071d1b943eb0f8766fdb7f0492421429bd380deca3325c8d5c7b6ed16429539ae54f1eba39748f09aa44efb67d863cda304e8653ff7499cfad44dc27807779ef8e63be4b376ec403f3c84eda4e5af31c30f9807762e0980b4e5d9dc406cad4e888bfc3ec4186de8ccfcf631b0ba5831747a1c200d45ea06ac82c7952fd09aaae5dcdf5475da427cbc8c1f71ebe5132f2fcae15975ed6fa14a11b38766e1c446894f31c0496b0e5e96507d28e6e4549d6d78841e40630ef306491a1da60eaea3fb69bffcbf192610e2e07bc1124690fea61980e8ed654c5e796f67d26db5de35b4a2c67427833e360ac2a7d4fe7a5ce572144443ed62ac460c1b19402e85c79e3d80e1c143279b20a66d8dcf2bfe1cc44a0f5aa9b0d9b36c46c2cae148dd0f2ffe9a8e6e7274d1832e57aa39fb40553da6414094e838d613a20ce9307d49f97d904648d6460985b01af769800cff9a940f70729fe40e98feb64ff0a81c5b2b096b1a9d832e440c49e4e3684bd17a5169fe138d2544d9806fec027dd2a67f1856178e090f9bb2f9b314a202e7e95f2e41fa80dccf7b1810e9cbcaed2acc2445d60e26f7d63ee4b28e4299e60ea4fc659e7d6f0de91748bf1ede1fdb2acde9482bb76bf6716847eb2dd7517e0a94f0bbf20f248d2c79fa0f518b67a44d5c4c73a9bbc3816ba85ae8344b5f377649da75cf1857d6e4338a76446c48e52cc7bc7ce283d4252f8fac5e1427299edc33f84798316f77bad4a87849e91a1a23c0b7a86898046e278eaaa15ff33730a6d3f885dfe2d1dc0acda2a9e49a71cfecb7dcaa9e70eaa8fe15d4567a280e8960ba49d5289535907e9f277f96e8e652c21d89e81696dd821db5b7e1e53e160584477aa9e4c0e12160c9956df36cce6f4e724dd543827366010ed3d843cdf4319c1bf968a70e9b1b6bcd8af96c9eb0620c569716b7bc42e13251a6adf8201faa129844b5e1d699cafa1b66a674e732c7662b0410e5bca2704c5ebed7850d0ebb825cfb0627a183cc9643b709aedeac2c06700358400c389f99666ae97ccd37f265da7addeb07df9ccad6fa777d0da2fc47b6235179136bbbb409596841e921eb278142a19e6203c7f235bf8461ccadb4b47dd290d36ac27126c808b866f9531261f1e0f5c458a6bab6f064b4efc432e1c7379f9af19ac34c5c22e76e6e7651e48f9ce44eff542f018397889d896cc9001a63e8e455fbe4a9ee9a740edad894fe1af2bb21a1dd0318e28ba982c12ed69c08835ce17336ad1638af3cfe0ea892ab8e83d3f25e6bd98d5e4d36292992e2122c265a26cbb3931dd4c1b0d0ac5ee19974d0dd45777908bb416cbce52531820effcd7f28e1fb2d3d4d826e1b2673e834485a25af9f9d174f566abc3b36732ceefdd91a7c3885e1d10d51c321ff704d0883905b7539309ba5e7b7a2bfefd0494e90e9da7541ec37858ec05ea9a9ec5672b113cd5ad6ebfc5b8fe40ed7c3f17d8a73703dc89086b4d75c5eaf06b840bb2f5b4519a4fb17bfdca9605f17253f203efffc92da96fde023007d22cdad05d18aecb4bf08085c5ca5eecd21f2b611e7e8a0ef981fe7aa2014f5ac6862fab44011dfd33be8a1226943aa7ae5fee9221b0400d9ac2ce5241b09a68cde6b13c47d50bf310ecb37f25c32770a299020d8500d8a4b5d7621e4379dbd6ef34a9aceefd4055ea6144f54bbfedefb5b5b0fbd1d81c7a51a802072ec3d84f34585f22c1df84caca07849b1ef054cbef9b40848e9fd238761df5358cf55a79a53a1bc749e49ffab7c5bd9a28bf24ad5833facf43bcc3852c1e85cfe47929fc49c325c20d74588eb9833519f192243cf96625057899b70a7c93f8fdbfb60d8129d9c43c95f8782ed8293641ffd21d21d91a0b4db69d766f6d6497e9a414ceb04b65425d6ad6c8811da00639dce8d8030038f2d08330c75b0879aab81bfb3330b950e54c13780d308fceed2a103a1a8b77a923b66aba737654ba7995acd306aa7b80f632184412e2369c353c2132ae614553e626f0a3436959104ba6e0040dc597dfbc3602a49e401bf2249699375b2c722083489f54fcdc1f616a133ef6112a1754818158ff78f245b9046100b0e89407f74145fe336976af971c054f12d98002c68b3aa2bd699fbcd71bc4dc071e430bbf694595a951e01098aaa499be2f70611f248a694539ef8936b2e8b7a3c5de8662436fed1f7bc24a4e5c17a663d9a23b4692993301b08cb3bc10f518eca51081c717ec8dfbb0c2669f7987fe6aa0bd98231d8e8b58951b42537f12884a857e02d62de4fda6b88b6b754b1b27394c6a819e0f92f6b2b2473fe245678e252ed31477cc7ec6895bc361b718fcab3aa550fc9faeccfe77cdb5b151ab1db2e569b5bc923ee26f0b6113504d295112d47218140e44652a10af10a088f95c7cf2fccd040fc93980939122411ec643e26e7d69ced3178402e320fe156e774b75b5afc2f3d6b6ab828bb4993b1436faa5728cec34d66f520f59e82716ed6d1324944c3c91d04d5ffc5a921f4716c39de24768484d0096f7d8dbce35aeec22db11f899e5e7e3d57e7668f35d6c0db3542255d9262137d39ae6cf9bcde254dfccc54a6062fcf8982f781d9ffab2df4f49ec04a72eb9646d63bf9e1799bc0bec0ec7f0675ed9f8dc9b8be15d9f2175dfa1c8bc99071c70ad7bedb10a4143fa91c89f54777f84c9eae9361cf7f4c2b7ab873ee5785a5241db0af86f3c6d7f091623d6dc576d07550a42023633a09c8dfa21d7e70cce64c13f37663f75c47921c246f3f2d1d16a8283ce7697da4cb7e016971a2a1d0c59d6202bc18b7cee3828de597efdab53b33a9fb41aa7b49f1c964512901773bb396ac80e90ba1a94c408b2860065ae9aec64a41d76cf8842d299d0babf14d5840d647d075c34175e26a786f30091a24f1ce8db30137520dce1cfffb6318a0d0fdcac883eac603bf365efa2c806eb4f194cae8c16780342165222192f6ee2e103ae2a31dc08a84dfc89c64d2e9ada7ca1839dfff62ddfb7982c79684cfc821a098bc6bf09f87317209b16d14d45c6f38fc99f7bf9bb73460977bb323665d480c87c687cec052a5f08a2c6744c8e177a8a269b4a47a925b9123cd2c014313edae988f8aeaeb633ee5ba6be7f53fe36da3aa37ab2077f5fd75a82a55a0fe62af213b85e9e7694f78cc2b0e63a8c1b89db484722fc62c688678a511c474f0eff8eef1382946d26de00e5c626ec1d7079445c1b7c6f7f05073249b11fd1fb30257724a14cd7bbf451146bf366de2e826fdf1d25705587c4460040ab963e3bd504755b6aa5b18786b68efd3c8e59e8dbd172346fe7f4a18bac98164669d73984044f3c777368f965763742ab86a3720208c64801c796f6e3a1c4748b81e41ac58dcf6ecfa0453b18fad7e3473604f57f7da302e1fa81ad538d4a0280c4ad092007bb9a7a12907227a936871886c699db97d00a1966fdef64d9f3672f1b792c1edadc6781b391c91bea1bd7275f30859dbd1707b1f554e49ceb874ca06e92ab466efa7eeb6990667a27507a7ba789e24d593ea2af8eccb3862cce58daa63eaf212bdd86c01ed471cfc79b191c481ad773d20e821d18af85a7049034e5a9c660357a4c2808b9a6139f32c55c13282b8d98904f4f027d438189dc9487c96172e50dc1100ccc224e7374cf96ea6731032c43fbc9b367a4d1d0b31aa3fa8eb589672e69f1d9144114bbd508d56c2049ecdbfd7b43545375a099ad2885353d8c550d22dbb738e6fe3f104b444c89475a2cc24d7887daced8fa05006c02dfded01c00707e2ad04c41199c5decc1eae34b0c0abb5a5beee1b5253c3350e1a077682767a0b9124a4df2e8879366fd37fc04d4dbcf89883892f46a65ce3aec22123cbe6b3af6364df1f9f5f9751bc8179b6dcc5c126dd65feb7d11a85994e90ab6342834c79c5f82413e88198c73e932c66e3cb60b6e0c0cf438622e5dc5a1036c38afe9cf13559044a9e90f5fd72a3188ef6b1043f5f4e6b40ea51f6235dcb33b3099b2d8c2e02103235f0476ad51bce6d8a2934068549633e521a3ee4c62c22b042fb86c13c8da849233205a5e277aea1129678c31f5c379a71fe08b72fad9449cb923126dd465d1e0ae8a925374149b8248b3afb69f168f3ae701c00f6ea08fe07f1b5338ce6af2f3156ba6f300310114479f2f6119367c88c12c158b84be13b9c8c7b5dd7c90edb5b3ea1fa5927a25ad6d5596992dcd4877f58a134e05dcd80dde4fc2c2a680cc0ccf3084d3f4970e3603fa6bc5a180fcf1ca4241c0b8a1e7c607dc025016e297e2b0645de4ec2fc49851b9374f3ef99edd897c284a67b647ca8c96fcef935d541e9faf334043ea50b99fb8819ecce039227b624e52d8c20003b5a43808e4990da8e4398c4fc172b983351fd11a13dcd2aae5193d42d46e1b57c92e3e01d23fc968c729f3782d6c07dd5a17af2bda96735c12cc7d8023629fb0125e974425f7914690a7ed26508343ae58c8a439ebb6232049a194768d4594f5d65aca37a5686c2a86dd04bef35d74e0755937ac0ce3ebded1c00c8adabf030e5e4a5f44193b62fcf2f1bfa9dca2a25afaf2f1ec06c5d17ef3526d26d17af3e2f257ded24b177ba41c0ba64fd4fbd5042fbd5961a105e0e9f77f3db13c1b6c5bd9a9d04801a5c00a4c544218a21016c65bdff774a44b1d05256e0693e14d76605d67bd10048d3816caf31a6d10886c88c783538bd93e92bbc4484f3388b61adac4b92b911c76ebb1dd11b7b4e40be032bccff610068746f41e34a1fbfbfe5faf57c8a4331008e2c1cfd69f57e74379ac80eb6769f4ce4196795b835201ce4ec85ebcaf5eaaec242fe6695cbce1d53fde5b002e006bba8c8a1ee57da061ceed0d21bdd57ab0cab9e46bf3764d9a6c3ab19736d43b33f32eb955f9174ee4a54666e7f19cefeb49aac7a59b7370d9ae730b7bb4e08413222f0a66bfdac252fb61bcfa838f262312febfde8add8f6843f1d64ea3da42d4ef986498604d65737a44f5a099338520cdbdb65ce73b110dd4bcf8592a4adc3e0170b13404f99f0ec8f9fb225c1275a921f09369db165e9109dd5be472b9bc1901bfd882d264d9ed8d88b4c8f3b35f88b69e3e4b8ef5debb895be536a3af492d968dc1caf31879d672f70ad9869ea98335cf9e4a2760f955fd3e8099e4b2eb4269e354548f9de9921e50e49f3f5cbd63468b9db0cfdf17250c8f13535d4c0a1f21c87967cd798fe93b9b2960447401ef90db22c3adfba0f55f5585ad37040e8d6745184dd536d5a26edec365bd6edff1bcc616cdea3bfc8b9d98c0ef9a626054e361194cd05b2287612399f6d3d3be2f71555f14ad2893af6f60ab61adef663c3c2464ade671dd5ebc71935aad290573588fe6e11f48cd2b7db62e4b9932890d1b96e1b83eff70f026d199db75fb1e83197c937b672613c66ea131f485b4318e27c079b4018d4205484993bf50ce70275b244f2caf47cb47eb2a9ca59afbc78809a912eb56a4bb65cae4694f682c6329c690003a1c355f779b5857a60091b1c3685995a366cb43d753a704d3e59c5f5003c78feed877351e27334b3fdefe5907edd9eb25588a42248b9c4a93efa7cc63bad1e5900b95b70436c35eb85cc8251c4030fab9556920141cca24d6acd3122b92b7e868dc174bf071117958a4797fc90866aca685f1456fab397ae647ab9970348082bd74865bab7f248568db98ced7ed84e8360fa91afde3f23509e6b4caf948349ad9fb6a4efe0a0468302cae7a0f999195af1c19058669fc3b88b2780b9075dc180298498caeb7ba0cf8bd42eb36b1959d5ad3ca6fd1e85f76abd27ec5fb637ee38173ad7d86304d5708b6dc8817e099e77f5d43c1a70624cdb96e4e6103bb25e59eb51d894d1dc533a74005bb79cca35b66e10c61d06b5227fcb071457025d605a0862218ca252b871f8343ec231dbee15688aeb914c0f16ebabe6edb0a489b2bd10d4392c6f1863bb6a62181de7cef61997ab02f3bad0a893cc0cd8a99cd7b3f7773085f0929de36b5d124e3729140c375de9a2d0cd9a360cadf17b9e45b7f2adbdff9e75b743b62642ed67aa703b8ef33dcf51a50edc7dbab42d3d2b49badd2457a9f92847aa6a60ae2beae457a5fce1a9e485ecf907be22913893cd1350f20fc6c81c94be426eaf01864e813a03e4674491b61516bc95d8a77c15f03d0adfc4adc27f27a5ac4165ff6518eda1a5c408708f78a9e26b834179804a312148d4f75f21a77d78387139da40c0a6293c2a59d0162437d68504f189ed970c5abb9ffc6d8e1be2b0877c7f24b1dc273b1765bfc5ce6f4b8d99a96d5b1c92ee53a39f685b304313d909c1ba8130d20d51c824cec420b0315229df295f75b453a6c131afaae0c36d7c4fff70623638a4f7ded5eb7db58d95deb6249a29b171d8ce651556dee8037bf4ca74453a4a76aab7cc07ba44e55de57dbef8542c3851ea353fb8e259ee89bbecf9ce8d8bd6227afc0028afac48a7acd9b4e8cbe982eb1475917ad6be4cdca9cf6e7cddd971b2924f2bb730264801685d387485e41993c3fa0af9987e8b52c21688fd9a9595ad8d1b9f41e0457be18492aa09f69e64e2954d1ca3cc1d32b2915cd9cf6862ca79c80beb47347c4cceadf48a37b29b1d6de4e94717d60cdb4293fcf170bba388bddf7a9035a15d433f20fd697c3e4c8b8c5f590ab44aefdda94681407008ea48d03ff21e9bbb4ae7a9aa37c855fe3537c44106e8079f18c24d2584474bd4a99367660ce6f7e6d7c294961e174366e7babc569d5f80572a21a4bd7086629363e0c9ee2599c8b8863c96613ae6c32cc67ccafc66e1cce79654567ad08e62e9abc99e44d6a79ca4d8de15b7f8a763a4741676af0e1f3bd4e002c8fa1ebfbb3bd3a65ae68a80c230422f98f6e1e9837252e045eafd585ba389958297d59aea1e8e1f665fcbc5f7ff449996aa712dc0faf582cf3caf3dbae80594f9f07fc06de63d9d672d14d7ac4662b4a54f40d4aab2de766910be2fc7f6f679b5708790b5376498d3baf0463dca2f093b51bb7e9f3e7033ba0384af0174becc3bb477bc5e86959a12a5e8924adf0bffdf5e5b9c1cf24d232881ad5c05c5c0f50318ea83d8683339ca6a583c52198c00f7c1abbda282e7fd3b179297338ecf9c923a3a87a130dfc06164e9b4c1fe11d51b382643de44b30a6831dee119241d1b6f84f2484784fdf65e41f78c38e15fb4b00e45df1edc40e3467cdcda351a4c0a0185ac4649e91024377e1c331587a8586cc0a4dfe29e14004c3536d305f5dee0eeb8c2f216c1b8d27375b239f6458e08980badd6d82e9ee9e007578c0a3b48288d9ad0ec3c934a99a8c5741149af937dc82bdb545df26428b87fc935c05f1a4964a8408539f267e23de9bc498e2a4b0083cdb7c8e27de6252bfaf680a6d5b7ec1a6dac6d7d537334a95f1553324a0739414dbdb50445a767b0f589fd4c33b35905577ef5a53b0f097191f9cee4836a908748779941de2a78fe1bde0c2efd9f48cbf232ce101d9df93d3ed40d036ae7aedc3a5ff619abd1c159ca8d2dbda7de13b4ca62576c7f925c52925eae2d7500dc969fe14c0a335ff95a7df1d276a6f242765c781208d59edb5848d412b11638b27ce5a61b8209075976c2a6aae88f6e6d8704fe9e83b425dec4defeeb3cd311b8c5a818d51f917a8a4525361791d5c4fd5d70704d4b9fa9df1ea119882f400e682753a41931712c043c120a98f0fe786a600b47befefc9d64cc5bbe8a16c191490874e258760c9e4fd215bebf848e0b4d35521f53ec5f9308644b785171fc4cc3ff886e034bd833d59dbcacebdae8f00e43c151bcb24d1d226d1cc19ecf349361530a81ba3168af3df5536fbe52b3b93621f57959df298e5b4d3c14928d2ef7b9c977c7dda54242d17f8661978a62d94d565b00abc199790b9b25fbfd4a3ffc35c95ccafe35d9a138a2c24d17f06ae2cc376e822317f16fcbcd56e23f84ec135dc935e58c61b34cfbf5a36cb00350483b6bac786030e5c5045a6b61c9aba7dfaa4f7fb21897539863ee865ae061a77c0359915de3aacb3b5dc8cfe53c4d17b393c2b6bb23652f36390407922969d510cc97b99d1df4361530aef10707d7a021b2d9576b2d49ca88b3cc83ad1baa6d88ef8c81c08f8baaf515637b21ace9d5cc8fd9fe4ca6c3aa129caea7060791d566f4de8662b90f9e5d849cdadf9bd23cf6737b07ca105142663c30de27adcea11d64d433fe1ace84b0f6917c8b655f2a421602f07e0a7127e61ae9859c5e9f652ec82416fd2566f291f417ecdf99bf3231d02864e2e5a1cf34c13f59de9aa2760d8734bbda79576c62f566b8269990e9384a41c1634271acb4c7a8b768f276685c3a8c7f20872e56b683244b1af562c3e7dcf592a9915f44f886cc2ac5f679c07d5aa1fd69cf3a460f25c722073da336a310aa551062d92c7297002060072af2f3500b9310c239bedf45c5e985c2e0d60c7dd68522376dc7b560fb34d1b5089450c32ffcbff07b35a96bb6fe01259a06868d00af697f8bbb238d03d49570a109181c9576c1ea9d2ee02000cc23e63d6c93c6cf3050bbb15b6f73b09c25da62e5abd4c2bdb1110e1f25db39f04885595cd6a388c4726c8d4cdbad87d80d42fcaeae843e2e17f44c9aed25c8f6f9736c7ba1bbd3b839126de40a930024a65aacb872936e446114e706a868444cb140e53d976816983f3dd1d57eeca01eab8211b7aa8ae99d26e35c06ea4b226e0a6e52172a40e7f0df5f67759ae2ee026749ba10b8e33694c3e01a001526f9d75f6c419cdccece3ea3f78d69014e509c741214581034bbc7e2bbaf76db8421154abb2233117a1ffe2786b21424576e295c9baef262e80fa2edb69aff800b3ea436eb827e8adb73abc48d740b86c69d557b16e874038598b25f616afeb4f4a900be7dd0d38b5b6fb4259c51a3aaf4748d7a445f518485ed72b25c7df8ed0906b74bd29bd6a5724ac3a503c990f3697a5db484821f68718470810862728a80ce34599a41fc5bd8bb46dd845a4812ae1532c457ef4211d0e41835e5a6f030247614822571c930c727ba397e723d6b3aeba9244f054e331c82e65b74c9f6504c74b4301499a1a6f6269a3352aff57f88442d4eda42a82ebcf7776c5629f97d6160bffdd8282a40ce2e6375b161e4c22ee53bce7a45f4774aa827e2da657e1a1bc07445f0bbd770b7a5a25b1b469fd58715510dbf8d97af4e1b9459a20b08a8d3fa9d92feb32db95b22d36de0bc8b1c397b09970a6826392fd8392b2d790dcc1295888f42ac81ad213c7328b2324b28be7cc1f4fb8414a7785472f1dd3e11d66017b1756d1697be92490e15f056346d7e9126a1f35fd76cb016fe2841c8996a3507c4fffe7fc45026df10b03b86fb6cf26e8418926a030b5fa62748fbb728fa19dc2f8947468c1477750771e442e4a9d25b76d359211c05df788ade5b7824f8770b5dac0819737dec916ee59b28a49666ee8b7ca81386eec8049542f18a3207e51bdbc291470eeefecac385c096a +MD = b70acba01bd715f542859a4224d035eb177fe7b34d5447e099acd1716ba6d00f515bd02021b5b3015d736b04687544de + +[L = 32] + +Len = 16 +Msg = 43cd +MD = 7c5f9ed821a021ef1850dd4e0b179a656fbe27b104463720f467db32bbfab5a4 + +Len = 104 +Msg = 5f75a437ce0698a7d8151c3fe0 +MD = 774782a9c3023dcef8b2cb83f7994324e3cca35323419b3914a9b6bc3ace5ce1 + +Len = 352 +Msg = f88bac738d1e3e10f75e46e3fe026d7e423fdcf3d7e4028b33a291bb4aabca53f780fbf99e0346d610d4a38f +MD = f114f1a390bfc30f34652751f3a38e8bdc9597625e363689459b80082eb34009 + +Len = 488 +Msg = 832e5b78a73a1012ee62e00621db7f4d248893007c6e5d6e0e689c6b291baeebc72df9cf10b289fe20e7fab80a2399271d0ac63766049da875eed56264 +MD = 7d00fe393c308eadb8c0a4f771d409e17c9a796e63b45fc8e84c0cb2bdb62532 + +Len = 13976 +Msg = deab57cdeb41974037a9bef5e292894038264eb4d8993d4d1501e6ef9c68fb0f571f57b0925640925deae9a6317e3bc4d6cdd5a0833e52fb48baca16a9ba9b6c8ca469a0555763b54f04c87d4e41aa549258f30eefe5a52d2ba06657a8773b0842e094857b6d8911d6a0636280025e56356fade362b4bf4c875cc19be0c6644b447be0454dbf390eb966c03e10e9de3487b90d0825d327c12495e3c89ad09c9d591e55c91376fb14c2fde9f7461fb25450df1a65806b65f3caf4d5c81ebc6e664871fcf915b9578bb70ee6776acc62205888dce2baa4024941209e81b4b35f0eda1bdcbd9ab1d6db6140bda4c41776fe675d5c681da5852d50c246dda4ddf9fdd7c5fdfeec85ff6c883c78689c2977584406a1ddef977606c182d6c33561c39c071668a2515e5aa6f4aa1faa392aed95b82ab32b79a15e3b5a07551ab068455131b72493126470f26c30b852e4415e1d8b719b3803ecc336e4facbcc5d1908851f4f39b776bec8b6b9794d47e5965458858560eed5a0305e260240c0849d93a19787b0f8c795eb5ba32be573845256ae6d0b0a3336e42a1beac8bdde6d1b6e0b6207903d4b105f4af2ef89bd099ded870daea2f170e03bd5f6f4490e60bc222d4876e16d4c58aeea6e6c400dbb9e9f4b2b142f0fc9bdeaf4132ded38a4a8366e107cac7210945fa2df4b124be37ef76290e5b9758aa3bfe0091bb0448206323584c2f833e0edfbdc0c33075fc9647a3404ca490bfab94302a0679a1a42fe9fec6af0cd98038b09ffbecd2832b579b2294f6ae5b96328fdc0a0b9b3a32cba04fa8bae3389c3951173bdc17caaefe526aa386f98670b177683d0b804c5875fe9c7afa233ee66349c9fd1b60bb0becf5e1d887e67fd3baf34b4f90d94699d18d6bb9d77d4af358f31edc254de2d6c5fe3ec07425c633b18c1b9e3606b78b40b543e1fd31fb578cf58c45744fc073fbf3c7d7d607e815379a5fc565892d81560eab8fb5f1ae6771b998c592e6d288014f13ab283d53fcbfa66e31a9d107308402191fac2cf2b799c7dae91b93a7676898b8a6e516a86eac58ed8f6d8ed2fd4d38031e4a4466dc8798b90c48e6adb6b4391d47872443cfaffa542b4b132f6c3408f0081af8692aadb4c9bbd55053ea56d8b82998f6b4b41d331891acfe6af1bb0d6679989978368ea463743b514866d2d01fb9950e8990867bc14f1db1142254adeccf3da812949cd03cd1d569e9d0bab7ca7405cc21096e3cd4d007cbb9629372e98584b4c6b97ad0bc314e1ab6ac71184ee555c01973570ed9b115bed956f9e4e349083013098b1e483f0fe44d5e9849f38a2f7ae152b36a266ea1faf263ea8c706632ba8629602187379546fc6b82e57ededd6d074c15c771754710731e07c207899eb47e8d7c72ffd768c36257d373375ffa06f9b3f0af11417f9ff9f9b44e1f1f96ae8aaa429af88b14da1da81c7bb38a0fe9372ed6a9ac6fb5e9e56b82593d94c5192904450227bf040b7ce0904789f979845e112a1f995c849ec3f7e49bd975a474e8201630f40fc0d80e76019f110ae158cd0f8da96ea4561f24237d8e795ebf52368218bff3e9d5b040ecd2caef4ab1e7127e53bfa2b3b4fb74829f9993ac703192aedef79dd9ad24c2c976638b4575afbce22ecacc273ba43379ed55ceeb51838b0adb80585bd1b5f2707ee16b67a7232adf7163415b24b9ff9dc94b7197fdc89e2a90d2b9eccde45e965edd064dc0d1eadabe11b8ec3aad2742b5d3323ebf913a92817749090c20758f98aef2544d4c8b48874e8936d7ee492d5585675c214deeb74fd67c4d170ac5e0aeefa607c6e37abd4f8238e776fde3921afab75cbd8f392d3e88da057903ce2e140797f4a85737bd89455e6aa27c7535687b78cd0ea59848e006c8de9c9c0cbc7a9f5e977be850adc710503ce4ba7c7bd0b042297f518abec6c8ef451c33e030251f506cbc3744228b6bb4dab86877d9e6019a0ea9f39ed37557b3b5527c171da5f013e0d3c480a038cff2c087d6e5d41b17e6c8f90c334b5e2b9ccbe9d4efd99fba1f907d00a49b71b5a08aedb644fed24bcf04e71be67b03cd20d53ccef8f854f5e9f7f28c1e98a8a53496646713bebe15a93f1ea336e6e8a4e68de5dab0fe880bf983eec75d1c5027357f6669e098411e0bc3ea2293138f5b34425f78b6508b94d4c0cc32ee9afaa409a26e5f2a1fddcd6d5ff42a89755a58b08f243957a2e208e24b055f51992ab447bc06876eba169c545fa71b88a0fc15d1e0be9d334a1dd0c86f44bd149b42c07608a9a30d0b7e13574f8d862f2ac72b2ed38904d7cab194fdb9e4dcb615f5610b24e202a36866baccac01fadb575df11dd43e00a3b92fcdd8c7702ea49d951e7dad2a56c075730b4af1ceda2bcb2310256f28312579fad40ff471336ea6a44143edfcffc297258d48bd2ea47efab8f0dc00f1e6dba1a55009ed627b7 +MD = 6e5905b22cb95e48b73c5a885f5463f554d81257bd26301c4393d57fff1c8323 + +Len = 48824 +Msg = 5223e2fece634a95e1e7c83ad4a11a0478f4a41572bd66c2d7902cf4f94404cd80b1f58fbcb8eeba3984fd759410c12f8ee922865f363f684df5a8787c87ceb3086fb8535157f7f39653dbf5c66ae7219253838ec77cf1c6db518225c5ba0a8212e5911236474b8820ddcb8111b87320adb82ff553986324aa2a21c37ce4a083c89ce9931290d4c1fea933e31d014d7507a28e83aa917ccae10bed1a490e77fe501b299f8e3b78e659407ce1934d5d68c7980800746f26ffa9794ef1d23f793bd2eab7fe524e213e58280f441ba48b40162305335b3a480c2afeac11c27f8d817792fd7805d4b61224eb52d35c0fbf471bcaede505fbc9398b216f43bfd69b1a669a61d44fd21faae410af58ff95e1c3ff1528de1aba93cef56bff4d714d8c4cc88a4ddcda52444ec1208d99ab3fd9fde98c1ee6437d8d138f62c5f782eb4660c5eb28564b5b0d46e3a2546009148f3d02b837c5284e9f508290270b97b9b29e84445a0b4df662d9711e6b73c11cebcb7120dc427034b1ccf57d8e4f5bbdb84d2e1d4bc3862a2b51931d3c9a7a5fd6ee5f4c7327c338abd011af638d730141b6eafe63469eff50f473262e9fdce636eff4c5663acb6075a4fdb00c8b8a8d3322e1700a5b3e7db90b36c1a94991b8f51657121b442db6f890e208f312466778d73bfaa8cc0ead4edd0776155f3eddf9abb1bbfc0c94421adce83d7ee94f99f61e1f25a55fb596f8b40ccedbaa8e5e2cf629496f5ca60bc4cf36d917da4e2b973eb57869dddc409dd66d5061f22642743fe843defa0b19dfb2f56425abeb234181267b5c0d2ab4268c538510feb191bbcd1631b0af6c7451cd4c641025cd8bde2d9ab6e6b948f97c1ee6f35098d553e8e9da9b4d437125046864633f109d6a558b38b270a7dd1785d44d248a863a91e3db5c0a1d7ec133decb65e81c3402c98ee329f660a092172bf6b1a02491895394ebc506882805a6c93e767c0e58a5af717d950a206c0f0055cb39ed88816a9fe3613d15f608e486ac08bfa67d462d24e6a0a37716d3fbdaeb9c0e951c1e847fb884ebc1cfe707dc6e7269eed1c44331d5957bc4ac9dfeaed4b157204a3080fafb9df8917b8d15aff9c49cdc739b8fdc26a546794991c183fa523d14797e051894f48b0d62c2b70834467ff9c993b82fc1152c1f5479ec6144c7e8fb10d1bce26bd1cdbeec4e95ee073f3bcc3c7367328e30543d371b27509a577f5c79f14d5f687ce62b82f856695af9f7dd350543ec763de75b593f1859e44c2ac01ba65f98743cfddd8a89a38115badcb51a0ff5655f830c0122af6a830aec13ae5eb89a93755b3a5a6eca233f21cb12db545a24a5334becb8fa32c3d7f5805faeaaeea85a551fc62c94807faa6474c0d74cae79b5d8ddae07498fcc5b8b4f394867112ef5fad1c9da66765ecbc7fc0f3269d29c9c38817c77778f2c19b5a3c705fde9d76a4eb86aed4a7369a832ad267312903462397f7b8fecfa8b195cc2316cd53e48c3371ed2ecaa3e484b8ecd2e22b1aee910c51ed5d71198936266f5a00655d82c089f49295feda0a2bcc1a54ec8adf565acc3a8b2d74c30eafbbd843c59e67f293f6d8296cf7b611f01b57dafec6e2d4d411a633918068c38ef47b72ceff1fae772891141c3bc496824509d78165c1e4cd4b4989321a8722643eed69950dc120fa8da3e53c3181f252d7c4cd2cedf8f086f788ee77a98ab5b019828aa02108f49ea4a51f457f7adfd2220d3e59d5f4a29194e8f5eac40ff80312ff6888ff6393c3fc0914b08c1b9990d247ad80a441558db1ee1203e07353dd99a885a7ff5d791af2548815dde0ca1f56f89d39ef6b93dbcd0cd54b854173903c12649587433f0425fbcbddfb66ebce3eb4800dfddfe7fc44d9b23a3916b1db68c187da4dd13ff0157352814b1a792de7fff855761abc6fb7b93b48525fa90fbe3a51dea974069f3f5fdea86387eccee13f58a8eeb8abc6a43fd30e9788c3bd9ae1751b30a82d420225b2abdb1bc121b9073380be16107188d20be54f2e9c658d5b443869ea0e991c496104086290b6edcc1b656adf94f0d42458750fbd8d88040c518ebbb644f4dc4f7c6971d8d60eee0272df7b51a3d5248b4b264fb22195ad891fb6ac994ae5c0bc6714ae0b0b9a484edc576638b78ee89b568195a8f33ed8362128c30f9b0c7804b3ce1355abc96b15aa55c1e16a9e9ec90d1f580e7cb412a7e85d8585bfb950acd4de5865214ce4db7f6314d81784c588c1482d5f28c5fb62e7dd7aa8237ce9396ccde3a616754414cdf7b5a958c1eb7f25a48c2781b4e0dba220f8c350d7b02ece252b94f5e2e766189c4ac1a8e67f00acacead402316196a9b0a673e24a33f18b7cb6be4a066d33e1c93abd8252feb1c8d9cff134ac0c0861150a463264e316172d0b8e7d6043f2bbf71bf97fa7f9070ca3a21b93853ec55ab67a96db884c2113bea0822a70ea46f9ae5501eb55ec74eaa3179fa96d7842092d9e023844ed96f3c9fc35bbc8ee953d677c636fdd578fd5507719e0c55702fed2eaf4f32b35ec29a7a515bbc8bf61f9baf89a77aeb8bc6f247706c41d398cae5ec80b76abc3a5380001aea500eb31b10160139d5a8e8f1a976dd2dde5ce439a29dba24d370536a14bb87cf201e088e5e3397b3b61477c6a41e22a98af53cc34bc8c55f15d7924e7e32fed4d3c3ddc2ac8eb1dfc438218c08c6a6a8eea888b208f6092dd9f9df49e7ede8bf11051afd23b0b983a81bcc8d00f7d1f2b27cb04c03aeee59c7df23a17775ae5984eda788eb2015680ac5610fb1380b4e7d7a9cda6178dca98690449f5551b66ad2826cab2b662f56903fc95b4611bc86f7a834a34ddc3be7bf142c8baa096abaa3cd51ad0c0b6d15e590eab9e50a4c60c91061f1ed6373d91974c1ad9d263110a0d43fd8b596396cafc0ae70b7ac24a59bba090a6994ec483db7ed4c572f723670a11c724e8ffa2497d8fccae37eaa1d14ac1537eaf80efbd2e597b2ffac97f2bc3cd2c4017f170544dfbb0d9109478fddf06ec0981542bc8107a725be25070d2cab4716f4edfad75fddd582ebd363c49e8efaed9a76ee51f22304eebc232a4f67f865b04f610a628fdb317116666785fe8ca30619a07c83cc449855202d687f162b12d93b63af6e7ddfb7223d4ab998a5f450523c1d521ab76f4aa113cc2967e04a38dae07c51c2d0f44fdc8605c3c53ccee91a2c73dade5dae021cbc87d5cd6e5fbefb65335827311fe1e91921ecd66b2055a6102d7a976308a80c44e6d47a67718c84f2112d65486a558f1f269b91d9f47e3e11d09c0c748625bad2718e3674898abdb19d3644bcdc9317c09a3ac02f514b2a57e6a706362e5f6e8fb16cc83daea0eec85fdc8c367d84c9230730291440a4b109f7034d510a3f70a22dd4fa69e8b65e5fdf87045d560eec71f4e59531c7711d4f8917a96e22ad07346d2f92a13fb4569fa6a075da6e1acad1eac1cb2ef19ab452264de2357c927c6dfae6598cbc821eaf3b8da754ce91a96c702c95b2c308bf3a550cbf4d22d417745b5f17d36608feb826b862747c59d26a0e8eb96547a1852f9fbd095f1c5d20721804941d462f3ee2f0876ee2825c8df24c4f00f0844e50588ac688127013df8eba3c971362dd255420649245e880212cb3d732fb82f866dda090040f28e09cf1c86eea5dc4fbfc373eb69745b4afd841ca8e172d4a8510e7698345fd4cab9ec2ca0453a274720bb2d2e5468bf0d0f85919dd762fe3df969e6c071285e25c2e2a49659b8a78289aee655965bfa3cbca9b292a19a855ec40293185354ff4da9451ccf98abfda07f1137e79bc89d688963081dec641a99656b040637402890f185edb28e7e6a2f65848a6af158f90eea440aa6246a2e6c31f5d220b9846aae2027afe5a7caad6dc16b56463367cd9e73bf22a1d6172145de4565ee369c55e3b99ccbef70fb080a3748340fbe8f6b95ba46e8b76de5a3c4bedc37c55ae24ad02267da26769a3a732badac2e0f3a5393028dd54d78701647582cd04c8310e9f1ff1b433125229547130e1737a1f33604f0d670ea7221097c3eb9c7fa4b8293d7b429af76191ea8e481dc1da31344537a09b33404d782eda1d6f5775500c1d8efc615778baf0905d9fcba1806ef986c40b1c6a72335104376b58266c36f5939a8b95123e8635c0c95e80aaeb97379b1179d6332dc07539b595ec32eebd3a336a1128f3cf2e2924db6d8504a516b62f26d012b7f75cab765c8374a3824da5a405746023b51894649ab422d636513ee809fa181d5b6fbc63351e37a1b14efc8f739e86ca78ae3e280f1c9e4824b2976ec4dd308ede6171a7474c7f530128089bbd75e10f9e57ee17408b4384f99f886a5f63a2320a9b90eb9bf692e1fc449171eae3bb1bb17a6ed937ea57af3c82db84e073b5306683e1d63705b9742a085fb802cf5a1639818417fc2223f476c2566351f4b3b17a822e11255f3c3412dd39190e200727bcd3f9799519ef792ec7c2b0b9d0e2dccf013d436dee63483c2ce83c15c00a76c4d894a60cb90366ecf9e61221ee8bdaec66d715159876d8305b35c81f96ab2cd8f81f4769e9a6e439c08c329036f5d2591ac42f2747bc0e77d4e566358a3271819b6003b290211b9b847ab70e906aed9f86cc38aae27e1098fdc3bd5d84e66c45292183f198bc329cad794aa4e430534511b7d9a75104061b409676a16c1146af0a286e2de8bf51c4a35193581a902bd3224cb9257c961989042538092af92644a63d6d6f6872a29aceca39341ad29dd22354812c4b7c7068b039ac9ca7e6358e662a28be001d4aa697ace540cc3ed3c97b98d8c5a6fd3543ae9a7962c9229b14b0b646229807747064be3e83191cf24092dd67f675638d9f6510486379f47f5eeda870a3187946819ec9ed05e7b325bfd0eed5c9a0f4a2063d63c1a8a0a309f586c94d4a68bbe860ae9599ce204c92cf9d92cb460ff99cff9e5a8b3824786360e1e1861e71158395faeaebe7aa2f61f76190f174aab9a313f0bf4f1befbbb22768b8c22719cf3fa9ec908b576fa4bbc084b1ee5b5a7eddc89b58b45ae7b421d38215aa6e49304323eb4e202655f3c8b16ebd6b03058e75a907ee63fcf6aad5eb96c1e5faea81b88b5eee525c4663af52877c0f759432913b9d48030903e7f9f70e851cd4e20bc56aaf36cb02293d992b38b583b8f0b25a08c3303d8af5b1b37f5127f7021b13934645ef3020e5caadc5e7326ed4ff56f797e26cb986b6512b0cc76f1d8e7be44aaa88e12cbc644f14a7feb979d2ab66907063c51e052d0f8b25d827377fecc5111be0d365e08d17f559e3134cb9db294f1cac03150f4232f853ec15ecde55fd1023b58e83934869796400088e9177e85a2227ee45addd049c1d6b03e5b29dd570496fdb2fde7d8cc74fbb5fe76266ebd90a3b4d57e6e6cb9f0bbdb7ca03ae955915768011c714c909a27ee20135927af55d4feaf2c345d029a54af942da6f85f2103345d059f66864e6b0578111e2ddd5a1cd8bbf4ae35b60747b93f53ec8ec64c10cf4149909b102a2b88712ff3e5ba3611cf96585a6b36fffb64b8c37a114d6b16a53879136eb0b5e003a5a068e3e8422a4fc8d7c77227cce64ebafcde2437166b62ccf486660a7a2ef37012ebacca26ecd5bdf363feeb06aee39050974c25d6a564594c67f56fcf7ed48b07fab4e25ccffe002bbe460325abafe37f23dd9c145b4667f146a1635e462330f02470b35c5a2519f1350c02b263201ec9026cfc57d3659373910e878f2b6c1c5be774df8e01e775d476956c257bd0ccdec17ee939c46e5653d5813eda752ba7bbb245a99a5db1ae55d19692074c2e5820df97c502a4bd1b12929e1be8e9ce6d802347c3e9c4202de6046436c05ab55b2fcb2c227adade6c2046d98102cfd0d859a91f8104eb9f6f155da2acf93df2405bf2c083eafd3ec41d60b810e0bdef6298b21193642a9c0c646bc6771a5c61a25604d96bdb727abd5a7ebe4ddb2a56a6ddece26d8007b26043ad44279c3c8ffb7e6ffb3cd4e10ea2780f509a8a9bc31f99a7e66201195f1543a0a020f754d9a665a29a896faf673df6811379579891374c71b2234fc61e95d4d46f15d44bdb4d7c3b3be3f46410ca46827b8cca976d8866e8ca33c4945d5c87b705588b78015b529843af0b75a7e1e871fd276c1e947d896b92e6181ab7e3ccc7077bb57fe85a6958667d3d7a790f6cde1cebb494c2912478a0eca2bfaad62492e9f1caaa0cc520da08c0d2d910cd44255f4c2ca0646dc89e789a1cf9a28e2f99315d33accb1639cbaf0c94181b85fef648bb4cc7f66dc65b8e90bf5f3b763e58520098febfe7e47bddc2d9cdd5e40dbf4ddb8d51f51bde2e57432266d248d13ed09e62f66794d188f9861c50ec41f0eee30f76f4ece250956733ee97036098db41991a4a3eb7816196c8e447db3a2913bcd992174a7bde1f42d57c764b47f5bc09533760c1ba74943a0dca291f2746bc1fcc573f9a22c72a5eca347b1679683fbc8f32b08d381baf67b7266b14b3ba46a04a3ee45881ac452f64df1bf17f70f4cf9fa4dfed9ae70184679184784a0451d2f5c19c02031e0e4957b4df68b4a069a6f6f6458f6d773924a1841ba664a55c2c3187dd33416cd410e56e4bf8d3671cf737bf67df2a4cc4dcc786872b9e2dc4009fea0e48a749353ac053d80e36357d24d468dd595bc823017c015d7450fe38149370c5decf13b00b6b0e0a2567ac08b45f7b0c8a7c89d227219d051d17a706ccbea49a42035cb327381568eae23b5e2a3b7e8beef6f260d24ab224827ca8ee9d640dd23eee94ed02c9e26abb3053cbfaeadbb1f365a24d8769d92240da842e0b361524020b5c9c22a2fd8602dc9600aaf02b35344309f6bb018a94d4cbc9639ab7430657c4046f0b25df517e31626abeedd58c2e19aa0ae1a43ed2bacad91dc04a2fdf9cc33cc420f4f04379e95988ab36731d5d5402d89fb47e826f4243bb206124364d63564a0872f8d2826eebd9046c7c6f2e7c951e49d4b22a7eec89da1fbed890d63ef15f26422185143c89da3ee269f83e1de11a7467822146042be92295a585e3a09e720ec522e1cbdcb41acf5ac45ee892677ba3ff670d71339a76ed98237be252ae21268e756f05ba0b094a1803f9da84a8a05d0ec9456cf565e1b548cae95eafa0fb01f091935e6eff2413bcb15f605f15270408216fb5b41ed83dfa1454c522375e35bdefe54275f109d0ab450636ac4d8e4d9e27f2d81a15b8cc5e98549254a1c9162918db3e399118f5864774a9d6a2347e1315753071eb1204c8bf5f52b1a0da37e484ebbe545fdfe6b031215678c3b83a19a24d7b661f626beb01eb82b384f02f42bcad4f40addd48db8a92b90d2297e6143702056123286617f86fbef4fea940f648867d790b8f803abc5f4e0e3f4226954c296afd96e287e21b7243d05e743161810da578096521805edd81f68a45500f6a3a1885cb1f45cbd399dde024df65072eb973c827fca13eeaa3f140842016f509aa9ab4603d2457c92cc9aef24950697a0044e3d7c483b8d8391886cd50dff8c2f16de3d6caa7f864c1b3874750781b2b78b545a94b4da0b0036433c6561f5cfea50eae9f5645302eef18238473606e9b9931880d0f6368fa9970d1ffbe59c4454bf97f4a5e8091801b53ee4a209e0642d83605836f69742071aaebd9d813b10f4ccac03851ee9f20cd1351f8e68554c9bc5f58ad19d474ca128edbf561d195e52ddf3c19bee3bb597ac2f92143bafc98bc09fbda6d18dd4ff2a93cd2ba17f54f75c32d3f141468c2baef4e53b6a340286dc2599bf7bb002aa86688e26f5b51a6aaf32e48ffd539d4f3f4bbf0cde2d20138151c82384f9ff29a634ab4e0103d93340bb9a7b0caa108bc7fdc88d7de14abb17e9efdad2b0f304f0bfcbabaeb1b9db75959dbf54930e67aed3a9c8309aa90506b6b9ed4f1d06c4ced19746e206e1e9b8879663bf56bf6c5c920ac5e09e6579b780cb63e1875ef0a731b726864b7ae5705a2d6d343a4a213a05928b7337a59f900fd04472382610e2a8d25383c9ab5804d609e79a88d70eaef3ea22d3aa9100fa2a6e98e97684ade9fe90d6bfc59dc9dec3d3d8db8990bc2123ba92e64253235e9b4d682e8aa04e23fb9bb6248a77c065e93249de829bb2fc5ea9e396461090222816bb29bca37bf86698fb995f62c50110cf418bbe2078a56c5f1ec9fdf3d0b09a719ac253b5bcd00932ae058b86611aff51c8ca8448978615854b69b0216a6eb8050ce199fd9a13aa0fd652570a1b187f61e6831b3a960521c3705da8c5e6c64c7b196ed4a49c2912d77b670b177c6458a7a49ecc1ffd8c57c0978d2a05cd1f1c7ac9514dd14b7b0933a52cefd40b6452ca0903df1f55828025c7e18109a6e0f2ab25724cad2d6f57cb5d894a6a508134731e9b9c61254f64990941f4faf97394b634b91860cc6ec346aa666600d323c849ea4c4a0ef55acbc56495ca004f3fca42ff0ffb11b0e1164c95ab89bf1db3d4f575ff334d4e0d7d50e0c54c422eac5ef78c5a3be95f2e18872540fccfb597211ec79d9d47b6cf41e385b9c2e92122167fe584210f63bf919c620d +MD = d7c901f0d92a868dced7e2659e90121108611dd7781325fc57e5c336c2279510 + +[L = 28] + +Len = 16 +Msg = 3dd2 +MD = b7399529fe614af98f9ecd73e45790406883cb22e3bdcdf28fadd033 + +Len = 104 +Msg = 3d232201038fe7d846ac1bd4c6 +MD = d0aee5482c509540a4ea4b902bf42fc8df3af6de42fb14e903d1b2e4 + +Len = 352 +Msg = 44c98cfc71f82215dadf494d68d1d6b92bb4eb81fa0fbf945a659d9aa2c2302b5c93fd3eedba31e479e29d36 +MD = 56c22e6066cd4c4d6415c5a225257e7f888b317ba4e98eadb72b4be0 + +Len = 504 +Msg = 02a5c7b1b749d6d49bed302d9439f23ab83020bd4d573906f4190e74216ad33aceab775f71cd31092bba5cfa42f0845bd16fc1b8bed6434dedc92f80b395aa +MD = 33a84e66cf1ce6970c35807db25e05ca05809e53d4e34cda9bfc0045 + +Len = 13976 +Msg = bd70deb2cafa75918308d703a6783fe9dc5e3d21de9bfeb6dbb1cd531ed5dafeec463a02abde302d4ae6ab3cdc2f0f94865e38339c88bde507ff71bbea6b30b9851cd8cf599e950b8c8e620c90adccba0033f934ca66ea0a936afdad575bb6235099beff1a632c9114a8045a0919fdc21083880eb05c0d8c489c7810aecef4a41766f67c37557e28a9db9a0d909c2b167ff7eba79693afd3ee3aeace38eb73a5a02a882cf89b123812cf2a0f6d5edd1d14362ce9c43257474def5cce3adbba8cb48e7af9a45e702a182dbf47e8869b3f99e953ba81628e502c60d4f8ffc551c31b3ad6ca85c52164839d5e9d493deee4d4b76604174bdb5655385d34ced2c1b09dd5a486e1f9ac501bc611f9d7aa5c748f496faecc14c6c18e1dfc6aee2991bd0207ea1701219955a751df43dbf66f57904675a0e9e6d7f9a0b8bb82a8f44951117ab2642d6671daf1e5d1639d48aff6a05781c2b5e8976653b0a164445872d393d30355acf0bb49bf2bed4265c9a3b786249afc7a438d706eadb6f90a7f93ad51bde6d2c8e6ff09dacb3dc67ba0d3030c54c8367e1e4280bb5903274191344610de61c3c770c6820a6cc9d826f7c743f88f13580ba23cfc00598fd733b5dd069bde7f10f2b8961c16b69761b0f308dd137f844a67f6054e065863f226141755b96645a291e3fa3fc853b2475fbe1d3b25ca22f4da4425dc95fc855e63d6699b311ebd5fec1c7753e6e81f747c808ec3f618f63eaeb1221075edff0532225c40ccadee304a8997c03920e7ce4e60e4df4d120611296786516dd4d9cdda2077ac52bce0fdf552e1ee89a0133f1f87a6f6f35f5c53958ed806465919a0a5fa42488bf29caf33a0dd469e13abae351d5c6fb1a800ee384da199c823c965d9d5457a3ef8292c4d9b142e3f1fb502da498eb44d95f8c85bcd6871bbdbf004bfdc09ab35758f5e8b6a0d0f366c3b255333c52c8fcd4ecb4536b5f6e72897649f3415443612d72c3436505249a344feeb04883f41f90ade40af119014b3c56fc108f1ab0a77087d9226665d416cd975e9e4605529c032e8926002a70924820c6c7e264a794b2a3beb63d69ae56e017294fad4d611cbd0d3847212a38f22d623eabe3b884a36464d8814286fff52c4dd366f6c2abfc2eb865e0dc9ec6e55ca9d81f1b8cc47e2629bb162e54655bf2a9e156ab0bafb4b8ce96858aeea6e6665607a3f268036f4890dad759486b15e3c9e791429ec8f11bae4ea7c490656fdb0551dcf0b0be017c08bc674bd97d9d701c3ac955e2941ba7d5f2ba122a6f0c1b164b1caf2d50df111fd4287e9e195d181f6f514d7dadbefdd4274edc234025b727680576046842a834b6ad89eccaff5c5209bb91d652357e3750d8bb0165572fb71d09fdfc60f6b1e5d868c67c0edead427e7aeb734e29b96e03ea174b6b1af523feacaf6bd745ceb1bdecec9251958b7f521182daddf62ff6c4f58977adeba81c616ff2e937ca4f16eb9c44e63f9e974709122083ae45524ff87d7a0cca33a90f09b660db0efeb393c61967de2564315827ef1cf42b71c0f822f471713c9d885a3c3281d7c95dbc96f1c6dde0af70ea11232b00a2d215ec8de8fcf84b6193b6ac9d46de660361aabed3371fa44a6f32107f3854262eac355f9ef98701f580b4649175cefc29950e7a0eec958f629999c4b0a98fd4bdaf5c0bd97c963b551f2220bd41ec00b8726836e949e818a49aa1ac5bf12c64fb9991111ce8be3e0cb9605f753dae1a4c84389416f17fb66cecba45d591b22d64e5a4edcde067a088d9ff7f5dbb9dbf324510000c55d50f480a640fb22da9b4862dd81080d61af9560b601edb5e3346263f5f193df97079a27e3f9876078b80ebdcdb17ca4c50aef0c8329c72a7f77584cd963e105eea9c28a2ad4e95c1d018e27d0e720ea59147f59ad796b80b6293da8a55ed47e8abdd37221db0a5eefff31688e2adc294654ab0fddf9c1ffafd4783f01eb539492cb35a77315d0ad19395f47b18298a7b353dcf5bab0b2f193ff73d99310478d2e5c4ff1c68a2493c138818edef73caec9977bd4eda6249c8933953e06d796b288f78b18c343ef561082fd03bf92b084afaaee741de3004abaf746350048294bc52450e31147173f2da13d6ffc5adc718e149f9df3702f414dd3ee88296ae8a0106b071b589e8696401da7993d58a9bf8e5bf417165498c96b4ff5fd2b45bbf88f551688425122a3737ca54b2992fdb4d60957a93097222c3cf4c45dabe18b9d6a69e6f27567d5adec489e4b6812c29a8fa52f1de642b7b0e749c16f54473ed5ca2fdf2199e885fed308fa62a3e0deb7e0b8e439e25b3e9f95d755fdcb7ebee9d73069dd57dd1cdc5145205882023b54f2c9dec6cced9e3f6d24e8cdbb8ef121b8f3eded574d81908e867af5ac82bfb8ed60848b4bfdc1d998bae3a9ca80c1c49601d11a40409c62b1536f01ca67 +MD = 60700d4ef068822d0fe6df450b4aa8e206b2790d6dcf973229a59889 + +Len = 48824 +Msg = 5fd54472a44e4476d254c0940071ad42dc723354f76ba61f63fbb9df80d1ee56136f51b6982e66c1da83602fc08093506a9e2cf27cb92085ba5c627dd63f59f8850e91a1d86cb1d4ca38ad03160f3c584b128d9b21e935570e086d3815307ab8df396cfa0c100bf6cbfc0fd7a8258fa1a656bc178e02cfdc868540d8e5ad39dd46794a8bdc205e710555ee7421ca7475a4f3232e6a0cd55d4b5d4525f0bd7eb1e455931aeea6918b9fceb2a32706d31a6d7028a85e102f228417e2e7db68317ae155af70eda98c8dc1ecc32a62e294d92855354c1114c5735a3c81e551b63a81650107557f3237bf953989d17c65a0fafd2bb1e32c237f98f55389e8f8b0810e97e201914c487a68403c6d621a98ddc515780435564245d87ce462b8785def699f7f06ebfdf33dd1ed7dd5a3e781348298c7950a387bff7d1878731d7ac66ad9a6607f2c3a3b6843c2852a5e882a8d78ae9dce2a79d595cdf09626dfa6f1dba7d40ed21caa29e304e7dbd559a89bd1f07d84165dc259ef112dc6e2c5a3e82b1c50106983f6c4965c85073c5deddbe6323003d56abb0df590f69010981ab3407e43eeaa29c6156995c492c931fff1b686eda3741a0bfb9094747d1620b2580415d431ffd6c02245f6cb03e39f87e82834dcea59355b2ba663ce145d2514e15e2b2c60cf518ff510c6c3e2f16d2dc523832762ed8352a320462ddd4d6fe755350672038163d996b44ed3b85d64989291bdf39398cb996de785b9614ec5d4bd73efcfa37fd4470b17d6240b8e4c715759286b04c3d7d791e2689927c9f18320ff2e6bc7306c805e23a5de66eced5f1a630cb43dd46db515f837f6b824b99b86c10b6df7fcf22d97be05284edf0e0be597b3f9c63556db031339f79ac9e6c5f8a1cefdbb4b30f5bcd23c2a4dcf791cbfdd6460284c5af0621ab7c5571e40a87c87be459c85ec81d746930dea24f43bb11d6611ea83409d3bf4f987778d8eed1d5b246a2112ef78ef0252f9ae464810c13f02359441d289958b4766807d9a3be0054897d35b01830deec1151f9e3d42f92b80f4aeedd65c78c6e98afc562a3bcf6d72f238c6e94a38f2288ac7929a7a61c92875c1f115c0ed8d261a727f0794f17ceaa3dabc717478f6ce7f2e8b295f000241e154b4575bfac8483f6b62f9ef4e18f7d341a65faad5e2fc1ddaf2b09adebc155ff09e63d5aa5f95206e66c7f4ef2ae3aaf3ea7c93589efa8c552df8d203e0ea181c1703d7023b56e603f33b4adb9bf44f7af290d8081210f327a6c9b0785709346087fd090c42d2b8b2711b9a1a5173eb5e246320ee27867ad6c3eadc4407bada44561a12cf5d53bf0448308bb536a8a525eabc1410c3a34becee25fd6fda453251ec229b53751f2280e142c6b331daa659ab655b78cfb08bf18e40bb02b7f1650eb2dd4ba1707f0aafa219f21c29521581ce249e2e34f5656b0a04c00485079b040e13cbc038bb9f17f47cb8f908591b26bdc28538d8baffe4cc39b17d2ecffbb9698bc2b8b31b08424034c051b535e0cfdf07b7a0a54781e33ba739759991aeb72c0ed992cbe76eb8ec0ab12c182e8b049cbadd6e82e314f1bf15fef5ae95dc86bd64b8556766f8ff62c33492198e454e5ca59ea856d8e095c04da8045522abac865506096ee1cfa1082af08ca09b3533878ea3580b6c0c57a615e0ab768246b3eda96bb6caa01a2648068e21959f843d853e948588e8c0bfda364ef1f9fbd3235c27916562eb0214891eb55ae0e059f4bf7d1838b5942656c27899dec6d67b823a981d1e1e0aaff5323b0e3d69a7dddf9b12d7787ab763a3c7a2697ac65b655aefc4bae7e6444850ad2540d5193b378682c77a4dbf9aa22e517e68cedfd1ba32e3730ecaa2e3f6ae61a4f427d6e69071dd62a9bf6c860980c9d23ce1fa82a1937e6dc1ce3a2de096b680d23d89ee102912ac0bd769c1c02095678dbb00b4430428797cfb966b2f901480811e1b9cde358b6d499c9e93f0961f050465d7b0c70d4961e75a9fe40a24e36eaad27238231dae6d0a17f446c16bce7348e669be563649eba9f23be29adb8b10f462780a066ae573f74e51215a26097b02469c25180890e06acc53ab063c742e08d51359b0a39749b84b9f6be44f3ae3da8e5a2f340a8607d4eed08877d007928d332d6f49502bb5f416c46d866fc87477c58a22d3c5932a8d6298c1151daa032c84ad92f8f90b8053b5aa6f690d1bf682f314471cbf200f3d30959e07adc6488dd17b0be5279e727f3237b8b4b19b31a220dfe63882937f8d5ead677608c42a57217f2239614c521d94559290e3b0ed8055d5474e96564224f6ca6389b40a71337da11e1c307dead8e4eb43252cc2f1c49addb18781cf20acffd3db693b02e5c8ecc949b51b99005529e0149a13390615f5df6e0bcd68e1ca82b0173d25134dbf76dfe92daa085d3f6b1e4d18217df41b70c4c40101884c2886495f2ef8a473bf23cb47ab6533c93cb38c36c6dcf6837f1272fc91a6962b6e1386fb643e1f1d71fc75ab58d5800bf4081217cdce0c7ae9e3d25de543fc4444314f32067eeb147c08c55c5c8158ed11729837547f28a300eccc312260215f50e98c4e3d4170208a50a4a4def1243538f906df8476b0c46d3449be73866d463d422595300e160840daf8c906ae4aac13a64457853b0ea6d8c32f4efe3b48c0b1450250086d459648b0ab14fd3f341a4a803be77e56a811e7a26827eb0a1a9454f90bc6ece665904adaa3cdeb2c4847858fd1d79750e8cd45d8da9163784b8bd06629410502debfed5eca3cf8fef0fa6bdcef6efaaf35a1986d6fd68e0f436dca9442077a4818ebda4606a94a3c93fda46e7ef5ccfef656896a0d3d93566b02ed8c3f6174417cdcb99a415b0c6e9816d94e64b438c295b4bfd69e0d9ad52911de5509971b7370593160629b641d690eb2828bf363857983e3b9098fcd15e66448f786f196685d2ceaa251b17ad06dacd614d9fa78ce0a8b9c1c360b529d0bc1d17ba0b70ea8ac1b8d67f6e5770f0cbaee0b38109d26b09493060dc851f5fef121e83e30aab9c3efc2b8397e8362aefea1708f7ffa14d3656f7f7610f3a629bce14648a593250c6f309c02c6c552bb42984ac58db920dbc7d98f59295f37f3e9b99da55ef074ed65801b390366669b4c7aa1c483ffd23082793f9e5cbe30c34250f63fa3ea2cd097593dc67e8d27b7e4f07e73a9f7b33a5ef6962df1381a038d4f58fdbca9d71ccf640b917f631b75d4a2e8ba46c64a6223f99cee30f47c1a935dccc7f054fc39d3498c824e10cc3ee337e781a3971f0e98295aca611bde701c2359858914248f6bafc88232bbc27bd85883b00990bba7862fd7a7cbd4c86df049071fcd10d686613ec877758d83927cacc530bed9a596b5b21c6fb748c379d676de7e05719a867c9f934b5dad99ed97dcb4e70a9b6542ed5b2f086d9f56fc9752e788785ef8f7837a31e433438cf2f18f58be37fe8412f6d21a5c35000a5efb862926700079413f76ab2c3e79e20b516eba9d8c29897097bee55157936607cabaac41337ea4cc783c0809c875259f8020e16d5045fcc39ac796d11a82f25fcc9579bf0a010200f5745065175fdc15474ed514cc796672c59637c3c8f236cfc9c0978a3db1194680c58c27746090d76ca09f7c48ee4ee7e1d3cf0ea70dbbbd88e30e8814b57404dfd7c33727a0c84cb7bd468b0bcb3c89b526679c00fb0892d2a5e7a3d73698a3db53fd7d78460cdcf24ed22b5f39b8c00b3506541ae4a5b76fae29c1cd5b0f8c3ce142e0af7ae4efe3fa4c438a604bf4a9abb41e3fef1b9227a7dccc3f4d6026ca289b4b1366d9ed546abbbbd5677c8d582e79e2b544f18dc23809ab753313d84dd10fa3ed2f723f0b46277b8877d4f3e0665e88c50caf0f0708b746b736b00c8c83a7d18500384bd035996aebb7da8f09fd6af9b76fde7fbfc0ee854d7ec02950e76abd23ffb27a6ddf1772465016c79b98a61bd3940547b207b6507e32cb9761a5604f0f546834a8edac7ae06910045de218d761a4accea886188f947b57bd876491709028e2e24b075d6b022b51af1880ca16a8c65b7c69e51b2ad580ee058acc0606f0a3a9ea1cd4342bf4be602e941dc4bef1239bb9bccbc8098a6a17d63186c6fa75ec44b6e4fd38a3fe49c5eb995f0cb884e2f3ed6be02515fa605b98453ad935682c3bac6a2971bb68f4094cefeeaceda92dec803ccd3d346f8b40b48f8f489e118a17367801e85c79e9b3bb5d73ac44a8290cdbf83a154f2f125090d42e1a1cb72f5ebbd42da46c7a4d4b9fad9612a4c800de6467ceb74f831e1395dfbf5799a3429ba34754add4b34b5960a5fee8f752dae78450322a1ab3d7102b77e907fc1eec5355991e0c7d6c0866660e5436248edeb1a37c0e769a0764cfbb6354332d6e55103b9235c84eedaff918af3f0213c435c32ab409a4b5c7eed8ab6ca9e313dba459bcfa3ee92e7d669be0526856ac3c06a57fbecbba553a9cb4655a901d98af02b74098e478076655d325bd7639d73d7ae00c62fdc361a997ea4ff5b0eba33096b12f35cc7cc0eea62950b912b47c11b9fb386a47c4c15c0602d304b2541da889cff299a1fd415e7e25c70ee4cd83feea7e6a9c50c75d9b128458513d61ec5d0299ef8c090472fe0850f384938ed44d36f10cc2c1d31daee3f946a2fa18f9982a988fd6ac973b1569313ce3c8ff5746c4dd85a241f1e9dca0e904c091832ca028533a3e34c184edcc510bf22a27f530bdca3d057928a96f72dafc73a9aa6dbf2552598e468735cc5736c67a620e9455483e9cb2108045ad80569582ea93a53b491e528c8df336fb326ad74317bc1dfb8ec30a73af01a5dff3e437b7fe48ba5dbb3e8f01ae0c6fc28675a415f23a796bb6e0ef0efeb4b14cf20d4ad88ad1966da43a76b454dac8687bdd97b89b8f8eede91eb34ca4a0523ea65736ae39341fb32b9b716f25662a37382c16f3b9c346c84f03bef54acd6efb364c6401b07b3f7679e8e7f8c9b77b75e6e98b90f4df88460f1978d19744eecccb743a999aaedd00b5a94018e9d5a56bac9d5d55f6e93bad52e84aa7340cbbf98d56213d9dd3e1970867e3972dc98e61b3cff40b64ec49463ff79a41c82dbbcaa37a82b761f432849aa83a3d3c9a209e2207b87ae9ed9959ffced165fcb0d8873668c3cd8f18ba0f92f7acd2bf50416c22ce11692bf6132eb9f558dc789cf9776da94e48cf48607f19d9a11d5df4db11dbaa67a1d20e9f0c96f5956ee3f906e371c489efc88b0c1e56d881e7bf8dd5d6742622eb873e253dbe54f2e2e6d0e6136941de8c23e9a632727bb5f88c23170316c7aa0df28d8d07589dd6022828834f7ea9b4e5876a1704944aa3186dbf89e0e81767cfba03bfb38c55a9945209c4dfd88272c49d1745dce5ceb40f0a6713b5139dc2fb87a8a4888406d2610b7b910a9e5782ef0df719028d8e50a40a269dc9bee12157038522d06537bb31fc87d21af9ad4b2e7e127bbdb313e0a116010f65126cedadd4a122d15a71cbcccc346f55100e354b997154567fe3caccd50251d137c58fc3a2048dd5883b6af9248b51040c01a80c051b8a151a8878edf0304b5554746d6116b749221a1d0082ac925e6e140f0c3b6a180742ac8a50ce0e93e6399102f151d7c14000369ff52d0b537fdd51bec99e7271b1255c6fbc36d83408c417f6825a8e2a58b9054ab2c3ead69d97ea9947fec32d720653c123ecf51a9a3f0ed88743e3fb7b94aea59d0bf0219ee50825ef220554312cb907edb90e4d85f29e316ad57d3b90d859391fcfc63e6c0fd3ec27d4e1efd6e0b5ca8165cbd6af25ed8792d805f27fce308ca1d51335ed5d727558dafe05486a6f9149b8d3bc022026656714222830be582889e6800c0b170e48ebfd069e711210e4ac7acf07652a6f5051507de68aeffc9540cab5cdac84ceee46059ec23820c04b127266c0bf8df0d2b856be3377ab42592f495980baeddbeed3ba707a85dba64fe36941eefa8fd37204ec8c18df3852febd2b142b1c9a5cd0f9e424cd408ceb7788270899fd793db99ddb8f9ca8df550c513790d8bad37a1d1f4a62c4527bb64c677462c9b093582decea70c7bbe873095536728e7ce05d5cafb5d166a1f03055e918f787fb244c5857e3d7a1009bd37f30f165564a082c1510ed19bb1633811a76da70dac67641c2478c6b335f409ef54a2d0f370c9510d0aabae3cb998bd023778375cbf9cf5ef125afd584c11efbf40bb51839aacd3016e5e4d79f134245f952dbad617c78cb6f5712bd9c0c7e1303db5029640cf9b56e29329c3e6a9e0a2371aac1a437b9b1c4477ec9842aa80eaa22c5eac11b60c661de6ddbb088e844293ab8589c13d938765bbaa44301e4137148dd0257bd4c8c766c5d3bfe53671e9417cd1b52f622870ffd90f4e17b7a4ae1b5601a2edb032e353bca652fb565beea6fb0b2cdcadac71794c662677fb1dc81d116d94f5eced526b37c004b95284cb6aa2ac415754a1f14882595dcf4d3f1d905c6e8c12cf5a9d23d3ab55bdaf9f17d2f03f933e1bab89040753648c426b072b73aee8c2fc0d1c03fce2c656e20d4c96803fb2ef471b912267eecb4d6f342d3513894b94d77767823fe0c7438e51f21bcf16f0e98b94b23a10760271281cf843989824f7061bf834f93fd8d2090f70e939700dcb4d8964a19da39a9601a7e0ed9f55f567fc7d5682d55a9ba0e68861756bb549f2f17c10ff6bd2042a80477f89743d3d762f1dfaf230bb502eab6f4c46b26135ff3bef5faa179bdfbd288e3cadd3d88d8012706e19b7fcc6e9cc2699d3ba0e624e715599480d6b7dbc6eeea0d12a9236444b17285fc7794040dd40c2b2ef175f7f3641664fc9bb7ea6d7eb3489d504f8013d64a23aebcb5ce233405f5ade067dffff253f27e926431ad806703e8fab23656e0b7431916d8d4c72a7d831e3664e5f30839c76c8167b76f3b2dc75a6ef48df515e06ea54ca51de2fd9c5eeabb1610b7eef06a2f3167859cf82e1a5b76be8ed8beee2bba28c3b15af6890d7a37226834ec9f63306a0da11aff918753d8b83fe7220803c070db98195d6d18357233f5504a6e3bd6f30115d3987f93aa5d89aa0b8b577d1fed94da057a6f088233efc0f44f86798896eae9ad0b20c8c9cdd9d72a3f02213f6797800894b864cb44fed009440fa5b0197023929f9bad16f052cc2d87327788a68b9209f46fb4776b092d75713048b5453ccd699d19cafa8e9a93fdab0f0863711916efe3bd81ee71b8e0221e12e9ffe2f6ee1a4dc1a8de6e593480f3c05b3691e916a4a7ca51971eb2f0f693dd10f6b8468f8cf7bcce285938b5a0a76ef86acfa2990f88bdafdc39a065db17b845028ed2b7a9e331c44217de20440e406868f1eca818d0be20248c2948b8f4cb118b2e456e585949139270f57c54715f3297bf714aa7c5f72ed8ddf6a074703ffbf95e45bc81a02c42822c22d2b718f2de5e03d687a4b18d605ef5ae75f9d43c8cb4e77aaa0c0101d978120f29574b22f52783c667f7daab3e1f9cfacf2e68e94a24918e3fe2c4f061deeb64891b5217fe5908e7f389897751839982b7fb736fbfb1232684e93123611b7fc8fbeb74f8815b5ae13240051920f3b6ed34483ff673c467ed7f0a8fbf619796e485affbed0697415d2d0598ba34d5b9e44ffd12a5edc323883a2e28efe9baf860324f2d2016748503eac1888213926b0e0f0335a4b51820a2bd3b42d982ec6ce307b453b6385aed7a735a1e98479394147c40f01c532926e10e1b26a5b395bc150ec4b4daf5b1436bd0baa225583ffc9d9e9d8a354f60fded37b41c7c051daea04e689ab2d4e24d7d07c75c50ccfd6a527e024d1632246c6f40f06b86ffec0b29cf894b665d53d459226b93422d37a8da23587fe884dc3c0f2fb55dea296a9a5b9a0d101f186d9fa6288c912202547cdf958569d2cbf235740eed38d10b0025dbb6de31058e98780d22149c19d4bcaf06dd7353fd91cd1f47e47f45622e1472542be2f63f463d253617eafd4f2ad609f9020884905dd5c22fba53ccc619104b6c0203a7f6c8c26fc80ff6fceb8c0c51600c2e46b4b872e6d597511524545a76cb42278b519d911e6c1320e01682c551e204ccdf91290c52e0836167a5685cbb1af338eb794c10fac92950f3f7956acf28f1ca984e380bcff9876b0c71dc7ce4011d1d0f955da9ca885c6e7bb74c6194dadb0fb9146dd725c8a9574aaf3824b727c9be3fce59c35850b162c17d3013689fca858a0a51d81cf4f30d6a8705bbfe35ff03c34cc7c56aca32140d72c8e8121fc71353596b777b266d75b322c9a97fd2c5d4e2362f19c99de66da7bd9c495c03d9a15b28431a0c051e786fa80f5503a72519e6b419263d72d553d688349c0cf30918eba0622b953a0efce4415c29515c26ba15f00e548ef108afe3f8194aeb965e5e4be94f10df6c45ea5c133a8c3398d09fb80f950b83c1866a1637d2bcc195e05cc32a9233b244cc2b1d4930e66f032cb1163c37b3e58b576ab76de759569797fa9b8bb4fad66aaaa56f09c7a0ce4641d6799d7bb47cf684990ec1e08871458c211a353ccf1285e7429c7b8520180918f7 +MD = 85747c796a910421ecb364b4b4f0e68b49e9217944f6586eac4993ec + +[L = 20] + +Len = 16 +Msg = 8a61 +MD = 60bdeabf39efdf21ba9c0f94af6552d2ffe699e1 + +Len = 104 +Msg = 37487aa02b03bdbc6bc62e7e26 +MD = f146072f92dc4a551721a10bf0b01564cc2b43df + +Len = 352 +Msg = 6ecd002568bae3bf1873993041bfa292eb94e9ad092d8eb3585be82e8a20cb36a47a06e7a57d301268a4a533 +MD = b0a2d6033cf1d8ff120a605b745d736ee4aa06d2 + +Len = 504 +Msg = f6dc1d2f6b8e126d99939664693d8709513f97d730074ec2794e536d94ede79c81f2b2ecbff3c2c26ca2d181ada2c60050997f3bb087ce48d956c18dedb227 +MD = 395dd2989edc854746e384f339f0808c515747be + +Len = 13976 +Msg = 07a6372c863c7d7c6764e4f05addbbe161762735dfd2d23bf268e2d603cd28de9c369ac379390473e1d3fa7e37af1178cca54fa0f782dfbe68070952b93462ea46c640d43ffe71f5fba42df98f4c48ada0d8aca8753e0731508bc15dff283178ae5c10a6ff132eca5dde63a78d3ac94685152897828eb25a55fdf140fd33fd4e7b03f283e201a1baae8986d25603fb0b2566aab345fb48031d648144dddc2e3556c0ceb1104f348d96ae7dc0152e45c625d21b46e70c31f250c858aec4ab2cf5e79d8c79b0854e0abf5330b9f044113d306161968f4ad6f0973160c9dc296056d5a11523ea2b56fbce8387070fccc639ec1c65ec663b9dc49aa880dc4ddd3020c9d44ff7e8cab6266e436af19b4ecb82010a0f8f9469ef380034a02e3f50051a6a3f233dcfe9d553459dc1bebc538ae0183448c9405c351271dea808d908480e61e9793cca111b4cfb9874b799626a1bd9a0f6e0929ad51b97ad81b2438f5fc255db3a3dfec9f0d8393c6b245b03d3faeb58021db3ad391b17a91174a66db4feef1b4c889699bcbea7928f4d29be2d47f76455c8cb1dc7da9cda41962a28ad8cd7b39965b809e7c7eca1c6792c1ce1c8a4cad6290170e91fcc49fa5ff64ab433b4aa081c8da2d9bbb072f9f18ca455469b946c877e3006b34ffd2219335b30ba2e0980f43cebfb629d0b11fe70dff28883ca012c6ae4855fcefea20a08e189eaeed7eb36ed6db3835976f4e60053205805727c5eec15d0e9f155637a9e66268b9c1c302bcaae6ae88cbb8cf1668a487cc996c4662c4a4e195f094cb31c717165e0e13718f8388957dfe0bf69c70cd0bd763dc38c530b67b9c12244fcab8bd13f602de848a2937699f9ef77944e5f22e3b470601789e1838fbea9359c733aaee2c7082b02ee459b7684ef9bbc200da4b62d368351f5520a65ffa506dc9b097117bb7ae88d04d85fb525e91327689ec0fe86971480c0e864012b1e9f044c7d80a4e48c07320dd4292086e4c71d4c98dd826a9bfced112bfa2beb1ce85cad204451ec45703931bf637d4fe89fe8f485620b7f4b21e011a232ade7a8c92be77925e878ae0bea9723749528fe83cf89ecb9616dae6ca0e8d5754ec6c92abb21108c2f33cdc18c6887c430b72c5b193356494cddccc577bd4c2cd53188f352846edff0c2ac7869cb74bb16a77c0f0f194a7a9477ae15abb890bd0bcfeb0c39381a87f1d05319c7e971c10e9ef687f96450b400e25b4285032892b849fd5db8649cedfb03c88defea063ee144a1ab1f3bf05f59c7db364dc39c11a446c3ce16307d78d50315ba29f5bb9a57438564c8c7b3e367cd37d74b2375a4966f47489dc5448f4979428abd32193d3840aa983d3020a9f29d760fc7493ab2576c90b1934b799c1d0d55e4f2caa78f4ce61930c79dc017c2dea0c5085d73a3b0e4a6f341e9a5061a6658af11e5edf95bdad915ac3619969e39bee15788a8de667f92f4efc84f35082d52d562aa74e12cc7f22d3425b58f5056d74afcf162cd44e65b9ee510ff91af094c3d2d42c3b088536d62a98f1c689edcf3ea3fc228d711c109d76ae83d82d6a34dcfbad563cf3726519b519fd48b51741aa86720836494b7a589c778927047a25d73508adaa401e9a6c0767a675e31c5556cbe35fadc9671359b45e985c3c8af84113989b299ae4474b85e4b5d4b0578ab1e8a2915a8df97c4f52a639fe32272cb91bbfb721505dec46d51383cb8973425a714245c2e37d0577fbe0d66381d9239db1f08a380cf609dc699698e0fada2caeda44d58d766c4f8214b10642b80b8d7d8add7cc41d47108ab7d07dab71069a2d982cc900b331caec317942122158bac6eac9175c2dcba0c04443aa9188832b553f5ca8c336880824d6bc02486a2b4c086665d276aafe3b1b93729829adca50c44466fd5b5cb977aa78fbcf5c0f0da1b09216468a11493ffb39efdeda5d669ae92bee2f2fb250aa1b9cbb11c36c7a6c6dd26cdc3cfd572ffd8c1dd72a13c27a327a34c6b6b3d80fc6c67c72152eec0c8ecbdc1bd5cb829b811e7f29af6d786f4e93dd4c96fdda295a6aa258d7b2fcf291c2d68e0b1866032475964ec0c6f2fa8c2d6a3936ecb187350def4e818507bf157c0e9b33406be7660605af14cccc9c799b4e051d0d0899e53495bb8931a6e2984bc6dbe4e02ec8b4642fc2f1cb5fd5a5520b48cfcb49e1f9533838753554dd98b6a1b8a67409279df477330e5f37367e06247ca5c3ffefd00e693dcc0c9c30754121c9ee88a574915b9e77c104fd2f921c2c096573951407ba9b440423d76bdc6fc978237a6e302cede7f99038ec31500884775556941f1edc30e3a417b0e02cb6fb5bfbe5cdfacf4006411287bedc565fb06f1be987416407dc852254934df4ab59edce476f3506e65be6ce6ddf91038642291fb8e92ba5b1f0b105670905a2c14796110bac6f52455b430a47b8eff61 +MD = 1adccf11e5b7ce2a3ddf71e920138c8647ad699c + +Len = 48824 +Msg = cd8490c93613bdf1f284b94b330f6d6f45a39c651d2a160b340e2eb696fc6d1c35e88872845190d141c669de92a97daa5433b1d7b0b899fdef2ce74b8fe72a7296a5b5be26d1dc86520367c730c7400c2fa06f91ab4c48a7bf4ae35a5b9acd5296c4fdf7451b0ad9cc439b4e34f11e5d7ef2bdda376f8dd34d6f092b219dc085dd4c4a6308b8808f588eedbbc7af7f64e83182fc7ca7cf4741a341060a7969d31445834c982fa8739ded4555108acbea1666a83da17f77cc42ee73323eb53203e3b790f81c08e94c44678b6538096ab7b09916e6cf7ceb2af85987f8e4d982dff1ab59b0bdccaae1f405a73366b5c5935dd0b43e2d2894290ceb66a0246dc02de728c5bba30255fb56ce8107c3144246c5156a8fe40ada9126adf67227fa56b66c37be63f532516211ca012977b04a97916f201f1baa2629eda520b51508ab4229df2ceedce406dece0110e0a911464f69e7be38fb91deba0addcdb3161d2799c628f5a57fa1dc37357c947681bd9c36f4832c20ac466c0c245de3b250c33282ea1a02d007f03b34ed427631283eb614db4d521f555136e7e42b4cfbee8134c63dbe3bb79b5a8b9f9f5b9f5ac61cfab1c54d197f1e3ba613f251eed616df952d691b88a16466343ef2d0f63882ddd2d55b8a6786308b2257f5d7b38af166bd7f1339d2d8899c9eda8fa86215850ba547450c267eb3c9147d96c38161a69d1584e521ffa23384313a1debcd37f72ddad02adb3cadce7ee34b7c1f42a15d0d030487daf9488aa7562845a11ee7ffccdb38b300935caa31f78a4ff3dd93403cf0c6a16ca611b58c736aafd33d6dc56f0f47878211d26f6ab801b9453a7f74b44593dae0f047ddbbf2c902891111729edec44f69a05944b18e7a601f41ad24fd6833da3dbe3029bd390de7c9841b2ee2b079b2bd2737518fe1bbec88da64769dc36e4a8bf716c219b2fe059d7dd220c1ed2c59878db5bf8b198e0689edee921ebc0cd2d3853fcf57c363050ce58071c5fda6ebcfbc1bb62e9eb956286291a108bdd4191c4ff47900d6068e1ea26b487649af119b9bb15dfed804836f2196cbe12d8fc86e3d7ce89b52ad49dc9ddbce5b370f73f512bedd853039366612453733740586d1372143b09f21dd4dbe1a2bfc308db8e4098c5e4b0c1e16141ee50e85fafefc4e2529b3c7252af37aee6f86e19df28871686107d7d57dcc812bc077602642d2ecefdd5f694b8f336913210793e4068da2178600b1f41cffb5221c9b4b6298afb47e85701d7b1a44241679d8996f916c81ff437261cfc358b9ec42a2ce16ca3bacb8690d6c1d91cfb3e0bf1e7ba45bd01606df856fd03c7e946f7ab371a89e1fde86d05fdd97bd7b1c583b04c2ed2b5f6815a460645e4e1b4e950bf6bd81dd0352d1048df85266f1696534aff5b1cbc17f15d82cc8e0c0d4f0453f9439094f8e0f7f4bc045b654d9a2f1f44a9c57019f63ecc41021c05b5380675cb56ea8bb691d79ee204d2c4edacde3c1fb3f4996a11d84b035f965e74009e2ab80e2c7ea3c84a834d4971a1e9cf423e4ea67ee526eb3c3e4c2d7372c4290a0741e1fcca5ae4cf36705abe98ac81e98a5419baefcaf3093a7e0449ef1021f88ffb7ad21b2677e41cdda12025b06542c4b2564f15e0b99db43b7c7020028bd829372122cd910227cb07c53cb58fd9dc620c0491f3e2bf883fe6ee8cb1f5b73767977d857e4513e8b5612f6ae4b56014e6a3ad2a065b65472212e2f611743484cfaef860999d1dc5608c58412fab888ad72bb87dd9b55b692f31e252daf8944ec5c02a5a9c23903c50dbd845f2fcc3bc9806af13ca7b025cabe675195b1d56f3fe7d7bca12530bcc0af217efcb03a218bdb6f9726536ea902c8303b02e3ced22be59753588b5f0e2f3419fa5345a942dbcdf3010465384a225ba26cdd0f1d74999c69f336bb6d01fae5cf81cbb8c1a7a29c1eb83ca6b51113bde56b8cfb6a5d72557622a37f039d090a689accd02b57c691174338de8e05bb3620c079705c969c58e56b079dc9eb44eb0fcebe548f5a31f4072a5ed56a2f03107bf40a359b2601eddf53cade66f294cfeaa40a0d94b9c90d15f61852f295d3911f8ea914d015885c8c64540a83badf0021a416c3e37b78236a2ecd1fce4114033416bdd3a36c18ec13250ee9c74c0fc4dd564b3d24a825802d5ae402a53bacace115ae3bbb329be79d1e5e42dbaf0a6446431145fe49b86a8703c7c41f8985d54f12e314c16ff89351d8addf66ebba2783f2d1a11965182aa0b0dd2de53586c5a695c6265c2b173958da648611090557bdebf11a1e042f089fe98e049f4796c60d26be38356fe020d9ace9008410d53a1bb7db78b52ee44bac364213f5c59f1eac4e3314f3423b92fdd7a6156608111ac6ddf58385ec1f3df12061208db98816ac948d803fad10d5ece2018c60faa13de5e5a9033745c824932e53f4122a39f635813545c1b74732cd55642f19ed6deca1585ebf7242c849bde981572a2199066e9c912b2068c8f1c8b936c43ae95c6e22bd7b80dfea05f495d751107da5928e806d0af905c87b5a0795df146af6580d8f9c6a0e2645686d43822ce9b4be0bd5937c097917e048b5af71c7e7521d490f107e9231ee5bd9fbf0727ba87774ed24cd52f471ffb71849ebd55605996515bdcfe95bb1df3541e7c42da4166dd01ec3597634aa6455d15fe14af435e8d7a55ff1682d55a2da867ae63d11fb3fd987fa5d7032ecefc35d3fb9570940e779e13da18070e6df5292f97f2a281f9598101102c955fe4808a2319c85fdef3d55b19e05bb8c2d3da64bafb67a53491513a24f6f0804aa162c8a7db25b38089373fecc45a0eaef65dd9be3b4b7f9436a5423fdcdb5a9b60138fc6a2261225390d9ae0d8ab7f0f7ffff69dca06881d33a637d634358abebb333df41151f239add91abaafc89070cb2159ce3a31655c22e4696c9fa7a7211d1251d4bb21ea4a321a3dbebc29d97f526251e40e548dcd7ed07587719a266f006179dcd22e50b3705152817057b097b043ad63b8d867edc20aea9b4c959ef4ff70f47128cfcc21e31f17978ecacc366f459ac1cc459a3976e4173ca322675f84f18036119ec2f204c3fb554a0b72f7e9d8c882ab147b3d280ca9dff7b9160b1b437b901f03cbc05fe05c6f44824b48aa8da52ae7dda1653fd500f9ccd221843cf76513b3b74d094f14d93a00d7cb954bc4cf2f04f9a35e38edcb1e84f62057647dcb3571f1dd296ca1e049f1746a8a282e85138500e7649db756b2d2ad88f11c471c89dc6be2cd43481013b8d0ae83da2b855cea7be424f8b2325b1850d1fdef03e765458df4513d57c72ba9751e1edc3c4e7f97e3202bb46eec7be89871ba3704aa6c6fc08851e551a3f655fa1fb798d12f003faf31c56b6df399a5dd0ed29ef9e4139dbc254bc5d6051840a859eabaaad56324588fae881fd638d2b70fb3813402df61d941ab495588e5fc3823249bf9a03cf877902394f512de118edaf98843a5445e9073fcfa409df3db0221f1c77e2dd21e74f9e10c9e180dc4ed17010eb949c6d67a22bd5337b2c68f9eccdec778ece728e91353696b742c8f5a3a569f054efb8c1ed478ee9b75e26c768a5816aa6bd08a4c72e745fdb5deb34ecb86b3a84346c1c70f9c16fc45bc0421f0da2f630912d5079f390cc53b78e343310de722b53d2a3b4aa386caa0d7e91986e19c3363426ba30eb5284293af81d00158a3f5233327b40c3b989725ba7dd5b31ac7abf8d3e0b737e843065cd7316dc2f374a00bed4cf9caa0d6e232c854df1bc24c3d484bc6bcb14ec770d5745474dc6ac3b3ddbffc551c9fcc2c56a5e0ae17948457c01e701bf1554022bc2b7d9dd42b2b91172fd85e6874d2d61fc7b3bb3cee2a9bfec09f6d7e98279c6f511f4140b116c856c1438e34bca59fdca2409f025b896a52d68719bf93e82e7d89bbf798991fda0af8d06d17f39eba4bca09c1fe594b537ad4c9b94ab52c895539d639425f9146b24b016368a638e5bba391bc8763cae7c52ff9c496884f1d84e5e08ed451358ecb3c4919dd410e82cac35ae744078287c05c89b42999ea6b8b127d40d53a5722d45139e8bc507a11e7add7fa9ab12cc40afeec008a4668e3e6440f27bb5780936c0e3668ac51262390c79b3f21fd041cf36ba3522f3a552714ff188bfd554c60d0e7d11213cf7d3864a5175d4047c2f3284741f18ec22995a5b82bf62190151bc1529c6d9927f9b0c1dacebd9c2dc406f7f64a973f9a70cff6e3abeebeb46514bbf2ead382f7262d46bd43d88c1b91a9011d1f8ba81fa536a7162aee2b2ec6fc0f2d6efc87b98d2e41e0f946969da659c21053775ece415a34d42b6cfd5bc52259867b411dfb991461ca618052309ca9c96468c2da12dfab0e822ff3bbe7ba281982a239ac19c47024fe1f0e3550cf0975add1f680a9dac9b2c4ab0aed4f409ddda6765eb8a0a9d1e9d07458c69ac8195541219b18efcd06c0001f2ae7fee2d404666a18ca3cb3aa4f0623e86c5b1229f6c2ca28d951111294b91edc52730b6b2c46e000672a7c89b2f38045bd3e37dbb8a75e18687a514dcf740c87a34834d3c3cc8aadf6166ec0c42d2be92f90a3af49633ff23cd80848ceb57ac550eaf9ae496bdc6a2d7cf50fe107895b4a1ed014f78af24eccd6a07420f1dc0df1e7c44b4ba937dd43cab9c798371b148325578d61931766af02b45054bdc2d9fcab2f4b49092f6fff7c27886820739d6140a4a905f0020249e8ae8dd87da1a1e7b1851eb01045aaa72dc8a2bf68055e7aed41d85336648a3405195d2ab61b0e29a770461f32fd05e14c17d72c5252f026a7b9abe7ea9176d3c46f6ed9fb716758d97b41e4f5d81a24538f763d83eecafafc668422612b40cfc32b3354b24755fbe400a2bfed494fe6d0ba0051713b776e67e2f1915e94708e6dc74b398f2f526933aad8fe7dc32faf40022606aebb6e0756b994c3176fae7640ee06d6c67bd54764c4752f1bf831f43e0227cba101174c5554ce26400f333dd8e9f6db1cdf670ce407d7d06c3aef4c0724b62edc8f1ba3e04f0e394d15a73b9255abb4d6ac70303dcf9160d32dc02d4804219ed5c7e3b48402e58ab2f58305f9bb95d2a8759947de96328ed5234cfe7d0b2a9a014df7e4cd0ae48906315f139b8635d2e6bd4aba32e62b8906cdfe5622c411bf0373d0cb07d17bb2bb5b83eae4401c243605fd1df759fd0ddc704ccab5a9776c40fbf6bde0f11b9646c699f26063a9550ac228c9884c277bcadcc0a2c225dc203e28e253c4e464b23d2529d09c7b7dd3c984667372472b615645f294c4e3b0797f9d1c234015b78502d98bfc04f1fa2f16cf3e7221d5794d035e4b172a4d84e679cb1c82df2fb49d3c6668eb1661bed56705096c2371a19d668832808eedd9e5b1256c18fe7ccc494e5e29145d453c553ec86fb7f3a634d0d45661875f2f1005ba5e734c1a976f37cd23450e4606e32d027bc9ec2edd9395e14b2082179bd7b4f9b8caa2d00a2de71d48553f7d4153cb56a1b08f11925e4b11c9281744ae9171f3d6faa3ab3f88c5c34fd23e4f6efeceafdcbc07686ef56efa62c0ad62f1cdcb4d3b5bc508c1f05263bc347158fa5495828f34eb7fcde98fefaa82bafeefed3f4a58968d751c051b52e0047f066de5be533bc3b1e439ab1c8602f6c67503803c8fa113737cb8279f358dbacdf45432b7a654d0e1122cca93420e956661d7275181c75b0d9c20e84c7007dfc49f27bc00007cf4ffa631c892981fd70141d532fcd51de5c23fe0b7a186d0dc296362f235d61698740cc315891cc9342da17843bcde274c17e462263d0e8b4832dd9075a7bbb443d4b26b41e534ad5551ed5ada102175e695363fb48d6b99ac978a3aa6f405d87f983384ce35740e930491d75675337c5dc081e3d301228e61bde5cc169968e5b4350cca2b085f9f75cc4b88497a78cd0a0073d90246c7dc102c7cbf3516498e8a41aa85d8cc5bc285ff66e8338e85ca83fb6889e2bccff52059bb9e92e92c155a349952680ffd0a3c346061a53fdf074417fc90c4d1af7c2acc3ee4b080752cbc9455ba5931b7e910f1e4af0efce905d2cc9c685923ead387fa532c0e8ad92719c76c281cd010e1acce500ae1443838b8afb48af032069dd07aa4df0d56bcb70a64592633699c8658102f1fbca441325e27f1732a7a973d8cb3a0684d72943ef6f1892f2d7ccf39bb6dfe5801ab98653bdbcfbb787bf125253be2624f6cf44177d588bd7b780d9e3f4e3a4e50b8a253fa21abce6a94b9073289c76773b46140f5a6e46b9de9ec066c176f5d1a69f380e1901216617363362d13ebb26ad74fb008ec08841550ff14ca800a1ecf2e007ebaad9f4e0d9664448d60ac0d8544243129fb81c1723b9b4bc2ee971dff736d9fcde0afbfbf5c50a4cc06a4c363998326c17bdc9e2508651dedd9a2a52bd87f8693cfcff60753acf9716c526e8635f12377e36564ae55d0fdb3c7997ec4dbdaa5b4d18c7b660acd95060831795da7d299a5a8d8cf9e92537dbd3ef7f56aebe38fa97c41da6bf0572a0270be7e5a7dcc0be3529339464c811052b65a938e874ea6da469c7d8992ce0aff1c75e82d1621ecb967213c65f2de582cb41de3804c507ddfc708ef3f6096ba4491e431160f98de806d0f334e03cfb7a3bece601099bd971253f3aa0df845da8b478603d5d88533d0cab9c89f2dd9a1404cf8939ffdda652a94093865a85fce2bc3d7babcff7b9f3306bd76b9af80c78ad518f89ee73b7a710da604e72f4927be8d65d06be2e0732fa786a83e27597cfbed9bf98df445499e0746b9f2cb9659ac0a9cef433148521f33b1d78d13c8441c0d1e20fd93ac450a3787a2292bcbd68cd1f961d34937be9a21abaf26f361bf53aa0c095e53c51f3e04d567eabe6e40d96a17c2bcc9230b18f7e079bc549a314b4ae21d30a3341aa205bc75c7f1d21b0a49549c300faeda243d0ce18da5e66c5b663cd705005dd9fea0a9564174abb797d64c58fdab1fae44576d514b75eaa31c9278b15bf9b6df7c6c2873d7a56fb91ab77b83761a09f9e1ddae535622fb87f7462256a60dd39dd3ceb6690b0272920b635ea639daf24f95462c523e5bbd8d8407c61163ab38877d5edfa04c2a78d4d240523ba97c7d01c71783f8748e85164b4dd08c25506a4ed18300b42b7bc6e417f512ae456ceec2ffc83190991a06d4a58ede215babcd3688e1d61f1975016244e80c88ae2aec05c7eeb1c50caca72b3b415b6b870bf5e10bd1ac3ba6b4acb1d1afac554444d94c97e171005fa4ea9c651bb4e527ff58d0c2f90fb453a92d6546a26e9e98395b09e8471bdcf2a145aacb649708cf048a7856ce8cf390c107ff2c66efbf2a76c5b041860ea576103cd8c6b25e50eca9ff6a2fa88083fe9ac0d1fb639c516b9bcdf23c34c6145a705498ff9b9747f15e1c08c63da6efeda4eca02c3f00dfec06c82220c9de840040118dde76be788daf84e6a2f44c81fe6defcc474f99c51c4648d297cbc48f081e0809dbda505d020cbe865e430e0491644ec8c52bd3ab8ce8c4862990f49fe2588caf804ce9500ef42d5a50c057c257168e283e4a4aedbe4ccfaf3eeffb212f9e23d15434d60bf4f455f512e2b655aff3225d1b217c261110cec0400f54dd303d6231d028c2eb649bccc91d30a6391c88bff9d447c3cf35a3467be5957e0ea4d4dc237c9f2c68ce48f658f820a3d72d559b60f233ce538c92cb148808e34fedf2d648c21e7f2ea29a77270c393bda42d869351d6c085d965dc12cbfd0311b8bf604f4391d378781eea3b5f1e0da9d0d8f8de88e56fe47d362cd46f591d3ec0f7cccb85a21f21ddcd4107821ce0ca9ddf99dfdfd9b0c9cd45053e5b1b4385bd8f5b227ada31b5c23e9420014474e8b4494fde7c38edfe70994d97b8cbdfac588df49a49c472fcce78cccc051f31cbbc1e0422878d8d490f3aee28adf1587c38fb7e7d1be54abeaa83cf54b633803a5e669ff4295df8735231ce39631616bd05e0e31117c722c2fd6787003b0bc7fe422a089c89329544e085d71102c1813769450a9f66f160d1702cdb17bd2c6fdf0f722762d193ce83623eeffab17b01b10a31db6e2feb6eb3abdbb2e36320e1a56e44e48d26090afa7f65003a98cbfef590ac3ec89b3eb230557cf6aa566e841806aa2767b21bb26fe001f11ae039e0c9a4bf1bf3d271960f16158eb5bd9ebf0080abd8369d512cab2d1aaae2b14d0ff6ee705a38fb0c801a98b0624cc138fc24834fdf430f33e1760db913da3290f34415c9e3df3e97da1780545ab68ac5a24db89f24d62f4a399728e4144a8c89f47ac2d29e30c49b0bcf790a5e3d3fcd1943c6a28f37251d9dd827a69579e6c17b629c927473b5a07b0a29d9562708d6c8ce576109ad1a3473ffb2047eb069beeec24c114bef392c929038c92abd0e6a19b610e27881361824d57008b7373d0ab76379570ded76c9b8284fe2c247791073c29b2fc6fca05019220ab92856892d3c0dcc6da0b597fe559c162d060d71513ebca050d9638164b9ae271fba5575ade787ec5aee8fc253d1b234b1df561db3e36ac64b9b0100dd6b407043537b2b141f +MD = 2cbc07b9b9c819b8fd38d8a614a8a9c3fa7e40ee diff --git a/lib/libssl/src/test/SHAmix.req b/lib/libssl/src/test/SHAmix.req new file mode 100644 index 00000000000..453fce20ce0 --- /dev/null +++ b/lib/libssl/src/test/SHAmix.req @@ -0,0 +1,99 @@ +[L = 64] + +Len = 16 +Msg = 98a1 + +Len = 104 +Msg = 35a37a46df4ccbadd815942249 + +Len = 352 +Msg = a93aed0fa5e163a82c9a934aebaab8180edf7de0b32f0fe99f9c75ec305b24609334cefa372c7c758262dc8f + +Len = 1016 +Msg = 433e88eb2f8aba562d15c18126fbdffb81d5d6c9397fa052321f5f78cd629708ba099b540da5451e949eeab8687a8d6ac35c531411cb37144ab5ff6a7eb46f1ab28fbcd2ea0444cd87c57bf7d3c02952dba3d3987da07622c16e7c086d90e88ad3d9d4afee301d2bad915d868f54197b70b23c9fa385c443404fbc9abf7e6a + +Len = 13696 +Msg = 2c46a76a9dfbae1f5e59f085e9c3d4b600c24b2d404d062cf948e75a3d4ab5b137a31397be9eb34b2a03c78367e0b85448891b511ddee1f787cccd498b172cb7e656c044a03ffde8e42478330fbe9c34072a9e99ce31b41757cc820d98e7d564e06694b96b66f4be34c5eadd0ae4e61fe6abbe4d7ccee855104fedee8b451a7fcedb793d469b0094c0ed07c97fda00dd8c1662b44e3ee6775a5ef6368cb662d257be561a5967893433a4b63f97295036a37272176d081545df00852bc5c4162324161296cd51f76433f2df867a5840f2d0c8d5be00b4dc89443d82175bf69c3bdceb97facae2b2ed68e06ae74fef36d8bd1f75f130cba509341dd54079d45de22845cc8e77a022977c7540aa3e779cb1127f39f825d4d78e55a967ef45e7c1dfb02d9999fd15af2914ba47177177d94576f1091a0657d9e04fe81e6be7b631fc1baae66584c9c26ddbb568750d77555c927bcda1fbdc15c7cbe3e3fe88ca13ff12c59b383343c12976708c0e3dff78be0e286dd32eecf20b71a09fee50a9d0b13c85a15b320b162690f399282798aa3291fdd2f9c40ed873e829388466ddd1da42f2de16aaa9272ccf44790cf3c95382c304e25ae8cb2fc9d9869808f3ee7d42cb143bb0c3a55e03db6d1202ca1bdb744e448640c0aa60d3ebbda5c21e623bb080f4a073a48822725d764e51d415aad1d7c5a7f17433d15ac7d849f910c375ee0899f6a576dada42fd651343383f286009902bb62deeeb2514de6af7f09892c20d0b238f6021f03b62444b1e1f21beeb89acfcd7136416fe7bd8f202e76afaf5345311798be7cb25351add2bb044d2380221009c4d1cbbaba4cdc8631dc0144f2778a6aa1eb3d3c81df0b1b2142fce111af8214d049e40f536c5d462b9224a978e82cc6c420e70ecc3cdaffb726a183c793845315f730fa4dac9fe46e4180397107a6a051f7f0a58ceb9bf4df37e1a81c8e9569187228e8037df2e59c52ba815566768bedc8e09d5e7bdc9f2bff23aaaaf133bb5a3332750f6124ce185e29fda0851addfa2c3d52bb6dfb530fd4ee27dd5bfdce5dc2f41debe6740274bc651aecd4023b098a7d622e2296b50d51b79c4e3f521695a9d43f038e8f273405e26584d3db179e7c1758114a3d39970df674580bbf2884405974f0b9c4b0d8b3287a2314f3f81b6991812f354d655f62513c9551b378cc2efa4c3e08b313c56cada52217fb6112eb8299b28445aca8f72e7170a1cd8bbfee4d2145fbe8d49c6af8831c4d4fc7177a50ee55a7b484261504af946c6bd5e1d6b89092f3c487c0568fa07c356fae9b8e831b8320289039746a435b122cfbc4a0d316bf90d481d3b7d979cc50d98c1190af8dc58e0035557dd5e94f437f41fab513202643a77748f76c6b77302bf40c392cd18731da082c99bdedeb70e15cd68bff59619cabcc92adcf122753c55afde0817352bc247d1170b8ddba1ad1b0faadfe0efbfc5fe6334377fa372c3435691f53dfc2ad5e08966b2d3525b1eec2d993a5cd4ff34278bd40dd80313a0727d05e0a932156152f3e11a190d8d69726f5c57d20f811e1e8932e86409ffdac96c6251c2a2976b8757adcac5d2de94931d1cbea866ec8bcba5774f8a7fde792f6acfd0f01356fd66fdf54a416af6a9397e00f848a2e9831627cbcbb52b5a868ec174e69b4cfa1ed72cdf23f39d7eaf4bdb318c188b1f0fe75655e34ad71907cdb77a1a2b162cd7c22d93dc45321eafb17cd60282e83736267b3e1fb249c307d49509f50839942f0f493afd9ef37db053a918e3ec83d801bbdead07554a018b8ba348fe9b7dd92ea7c5fc0e65a644ba19aa1fb6c022ab768ec7cb249ba17b9dda2860bd4aaaa3dc70ec009804141ad5ebc61203658e57a0887ec0fded18d844a96e79ba7e879c4253056f23e205a80ab1471953438f85848f4ab31ab175c089e0bbb97ea0dd6a67385770356741966053735e2cc2ecdd2c8c75cc045181dd7267584b901674b553082b2c58fb8f8be0b99306194a6f069f684535423304d40a268d55784a14260fa9c9cb1306b82f91cbee3c9f43dea9e50903135cc1c6505605a100bfa28564a2057974eef0852b7b72ce264815026d0759f691db618ef760edde73ec888e181403834f7221bb27a69479ec9b28a3fb0c3f68d4467d25712fc48ad78763f9ea6e8a2e85260225ca1b1a38b720e589fafca29f07257c5467cb74ee53189b8c81b784c43e93f98abde1ed53af60b27b13df6ce45001c6e1813de3521028981086f7d88ba13f6fb1a800f312fbe2f842eebe847fd760c394668cfbfd353ec14ca0366eccd7b4cd63318116bdc42e20a632a0d2b8c5cddb37bfc0a239ebe3800a787d2ece077a7968036b3d9b31cd906f888e3ed742cd769033e2c24c5a9e3c10b6d300db5a17dd88 + +Len = 100816 +Msg = f8ed40e878dc68ceec52cc8e2868722310fb117ca3a52e1839eb85d308b8aa00ed0bf0b76aec8a70eba4f0d14d2d85c5a0e876ce2c8ee59cb36947def6c40a587aa07b368ca8e8a08367018e45b984de0d7f1aa46b977cc18c0cd9b7bb897cbb2814aa0ce8f8c9843e03c86c19f2ba95dd2ac4a466a93aae4b3b05055ff148517ecf43e286c57744a3e10a14d0c26e139a503e7927aa688c78609170ebe3b54104390e5f6cf538093a67922e7210e77fcb584ec9b6844e829be246a266460cb442bad52ca47255fb8cfe276108c36e02f9acbd3d191d34b93d29ec40d80496d1c1bb5ef036221641200e905598c54bc4abb3527c5a5f6258e59d4bf54a0498c108a2725428efc2047e0096b32dfdc6ec69d5d72f81301f881ca62a66c22e5dab9fd9d90084c0a36b2f3a0123cc5327a3bc7a12fd947ab57169ac533e4b6a2cb80fc65b9b527cff9fba26994c7fafb5102a0acd8f9d246a3a54178c23eaa04c0fdfd3c0cd980d1fc7a72b25d74df9b95c3dedce8ca316870c654f9ebea9b806da9767cf40605a4b0c7fb06f6b3f197bae7d8cde9daf38530e25bc51b68f9aa23ec0e95199b14bca96c91f3db15bf8432f714dc46ac87218691bc66cb3a42f6865e1c30f8394c8e68c0ddf5851ab7c5906a1994a9af6ac1c44d0d6b95ff15d9f77825ccea40fb9e516d45888f2378e045d95d936d541cea9c8ca52fe5f7d0d919b2b1c59a42d06105ea4f2943c05178e59d67351c5b2c0051c93a4045e512884fa656b772cf398af89081546d920fd3d24ebd16310506a786ab33293027394c1bcb7b1efe46b550ac28529646e8d2a5ae65c59345e24b44cd7b06673f3ed3b9008aa568a739c26682fa596b7a655842cc6b2758b583487c78d14a76bdac7033806c5c210828ef313f8efc4072681f5fded748c31a58ac933b4665c445f07d603e0905e49b84aa55146eb1c1c99196413832a05efee2e64d6732fefc629b79b37bb9390fcbed7226b412204bda523b8b8af5c4a8bdb263ef9f3f6c7b9e1de3a1dc257c1f33b3d54a9101be5b4f2a9db319993c2cd137c41e35c434ce52e859afd1a635af4d8852252dc5e28c729b2b4c96a56d57f3f3854ded59fe612b9b3a51fee3fc1c83db673b0cc7433bff2472bc74a2eeb6706605e308690fd072a7042ca6474603711d8310909e47063f46f287260a26c4f11fe492298a0f98d28c45948a4899e08fcf443a6ba36457dd8329314d53ac0fd0819fcfc3357426c5bb8d3dfd706e205a81091cf08f31cd3459854f3d07e503991ba5f067e3c406c6c5396d8257496f4ba3703cb1ba25c2fe4aa54577af782cd57e85a88a2d75c54039e8b7bb559219edd6e81e41acb6d575d6f798afb2cbf7f00abd5c9c7b0fceec79f9a0fb040ebcbb7bff3602df7b71357efacd37aa57019350bb81213508a006160acde3dae5c42f03141887eaca22d7b33d6791febfb619d11ebabb13e6c5378e9a72e852ddccd31cc53a43275966b7042ddc51485ca20e1c456dcc7020cafb5407548b044d332229911fc74d7fb97de25abff7efb431da82de2ed7e25d0dcc06ffc74e57ca93a6a9f64d76a5c39776fe2266f88d6d0229b527525fd2e22a1407e26f94c5bc6adb1e7327f3c8bb8d4c983385c579dd8f5623df8cd6da569c7de73d9210e6b9253a177653a13ece075940fc81016d8c35fa4f6542df5120c174158ff32533476f4e059e35117081a24798fbdd1eb10f82809836f8dbefe755611347f75423dd8571695960c6f66cca71f0a01e8fecbe1183bee3335eff10b4ff8104132040e2145ec3164b2448f60c730887b9d7894e5f7df3f876cb17136c99cf32db1c02fba860937378dbd093c4c5112133781f06c8ca07c527c2c085e8ba5e52b399f2909e217aef6e3035ecafe2caeb1004069dea023af7eab873deb5ebcef2313c9827821bb9f89fd3d1570a569673d3ede86a4fb13dff242eb98450a8917fd8865c56e0a9f11d72394b79808b0429f3a83cf2465161596887fa2d557b367a1de9c7753666b0cca9c30cba9f0a749c03c55cdc7a6d45852c76ce2010de3e7f75d95228efdc79949b238d90b25f983868b7f07f585f7b00e45d9e132f3c09ee84f794d899759be3dabd46a256f4cf8da71270617cc2425b24cef25d1d2f3945afa6f81abfccc858cd02e05619649b1a5347650934105c02622d538447223d136a8a0455cf3c6f61f696b32266197b5cd1d936fd3ad4288520fb4a2f59bf95e659f33210446ef18debeb679dd99de0c3c74a6eb3dd783861f5db4e94a151c42ce27519d0bbbf1f3b1163563ec06c8bfd881d94a3b896fc07352fc97ada73685588a2242da1b718f81bb1077bc70fbd58b8b52163489ae403838b533851bec30ed0ecd97d72d1af534f3703db59f1f563bdc39d690a0e90e545506463a37e84974fd7b256bbb912cb4077d3e3f5bdd4bd2bab713b696c830b1f2185734c4d2dbd49d5372fe8b813ce73f5e01c36bddbb376ef4541033f2b0355613eeda8951ebf7377e08f967902eb7e23c0fa798c6ae52401721053f1095cacb1e9496500e83c412236fc21566090b3a3eee55aa402c0b774802fd81c9e8579761cfcfdfb1aa23786b2dc35dacd5ca8d8d283369f53e4a5db18060c2c6b0c303052aeeffe169fcaf7ecc63090a9ade245045ab9c8aebf738772297caaef5f857322a597846c7370083d409df27612e47b0cb240daa3cfa51c57108612ac0dddb0f59791289ccbdb3a2cb1fa9ac31a23dd5440682fb373bf0c1f41c4fe2185ad7c53eb69552807410053b0c2d40132250e637b8c425e6a35d93333b5b7d0557927b6179c848ec455fd1ab38348c0e96c60b2da49bd15118df64b6ce4fa48fbc555a4b2874141718e731a40b85382ae6e86ead31cea77f83bf5c063bf1febf71688a832d615e09d6f14badedeaeb6ffbfe343fc7274e78cd46a2aaec0a349c5f133291ee57cdcb65c5474e46294de6bb50886bce6c6f44dcb95f2a4761ed2e6c9e7bfed51e0964afab4e0f7e0b07960f2590baae66b1ec9a63ba0fb6c0d27e81508c51487dbbdc9beb8879fd58c188dfc774b3d0ddbd77ee8bdcdfa0ed8a9387728e12b13e8b3c10cc1c132bd822c2147c5ddf9a993aedbf78ec256db1be76644ca8ca7727208bf89732657152d34e948d73c47561d156f773136684d4162d02260300020123d13a95f4f835907c344942ddeccafe2abb7dc4792c4f1e39c24748c63cba933b16be0b8853e058c47a1ae2c4dfff39ec2339b345fe3557d03c1df91a0607a711636c4416ffdb73532aeeb74f237ed8bf971388a0659e4682a46b8327e751034cbf2c87c7828da9d24baf07a742ada34d1ef38ab1e8f2b4f801192c146600709533e61bc2665dc1e9e6441bf3c4f6643bc0c102a10f9a69da5b0e3d0a0c7cb694c682493032b5853f02953b5c2fc0e1348565389762fc2dcfbb34fd305f2d9df080e859396ffcbb7da78aae0a0d72e3de76c774bc6a81c87f2872b6afe97ced5269009304a4992c4add0bbe24e57632e19ad0fe37ae910193aab0aeae32cf6d618ab33eba59f6a04fad00b1d2403396e6fa661d31b695a1b349d62f56c08fe6c6eae7a482177adf341e51d03ea511d7959c721bd20bf371860ecd7fce1d25212891850b85648db0a039e6638d9c78bc958add3e41341536b5007be63fd1f7e3308876bcebcb97dc3b05a7b2eaadd00f8fcc8dcfa7b961bbe727c9aed1626ff786d6a0ffdbd1002cae8a7d047b6181962a686c152b2341c7c58c9f1dab5af424d183ed1c7d003165a1d04ea3683ff31a0f68615af6f91c21f736e67df641ed31b998445afadf9052bbe004d5dad08f62e5d353e42fc35a92242d8414d99dc4e7e81c8c027af686baa5c185e3f99abb3855b22cfdff0a62e2f47a632b7df8e00e0317af5c24ce7c64077bbb15ec27e062070cd3eb8e549ed9112469090ad9a96eb59294b021eed81987178cb2dcff67a9a2e930f6032c753e203380f8a7c987cea393234699de03a1d09ce204f0a8b6d5cf522b6887174fdbccb08f3e7c4fe2f778254465b32766c48812a45151ac37ae354dac87419f9476baa27e24b2f322b2da4ddf579750684a5881bae2269351fb7de59b9d5a4badd8951135f2713dafc57215dc626ee170fae7f20bff98e36b864e1fe0f0f9a300c903069bf0e0b6f2f8e78423cf6063e89dde6c81efcf26ef15510563c84730f611ac879a6628e55115e1a29de6945d37fbe4f803fcf2e344712d9e0d6f6c79f8773a9f199b705235e20a7830ee3357c5dca29d7a6c29a3d2628bf2c42c8f076cc4525301d8e1860729070dc53164d9fa08bf63cc889eed01b0130a7146d860bbc09ead3865a3082db0836a45f5506c3e46e452e298764939226cedfd06700e4e33c6b4a78add601140249596831e97f960b973a4e4dc3fe2813fa34eb47f998ce57270368fb81719a09298a223f7e3931ce5cdfab3f658649533354e982c87dc9e49eacebb5bb4af9a767b4f1c03d774431168cd4fec1b2726f1aae3f9a062a825f3295557eebf3af4784487b869fb049de44d03fee71194fc200af72103b157431935b5ab9bc122773ffd313d52d7acf1078386090fc011de695e71567cfd51c06317d4ff8841ceeb74ad35f4e5f4d20921123cb88bb2079674ad39e133cdfd6478d69c9bddc7a818be5d7b254bd9e0abdb030f52846fdfeae8ff370a51a9c5f6017af3c6c3db17c5c614ea18ab0e3ca0dd5de621217dffa36e5c5318fe191040a50cc3ca620683bc34da6c142e1c50afce28a86b8b66d189adcd755561a647080d93f3ede1cf54c3afb7e863fc8a82a2576d3f79e9b2bb634e598507a3d7d017e0176b7868bff3a3dfb4474b3ce03c401f33929364e727fbf8096b77eb351435c7a113b3215cc6246dd86f1517a7e550cf828900248f7c1754e40fed62477b296a37d3e53231360d012c4908b466e49b0e620c0a5031228009f259b030956ebd70e49357c3c3ac2842b6bd6e3ca5a3e985dc03f7105681fec03b320a7ca753b782ad3b52fd9c8e3bd980b48dd6ec8901dbf756108e85015821c880416e0693e0479cb31c0743450f6d9214afabc4feadb9bcee9def460a58d3a02d9e3039970068b8e3fd0a403a6ca7f2c71ae2b46ab3c731b1e65e2104c47fcb1f69e7c8c6df8c09b33f2e1cd4192faab316a44536dcac608832019f5765cc5240eabe3c87445c980c299a5e7ae0acc2c2ed19fdc8f011515bcb00476b03633c7669db1b44f97f6cd402778e9687c740dbe5686789b79d0b13f784a2a866eb91ab2d66f064c49e8df513ec348fd7272ee548ba08e1f9f99696ffb53677550d59c67f88404f6e610455a422d9cd987493ca5c366a397dccface2bba8e3e99719dafa768956cbf6fd8defc4104b8925878716a0514f70cbf3fa2c2bc2f66fabe654eed3076257e71117665703eb88c79e4c2b94e8e856e7a6ef90ee2a358409db78b98056ce1750eb80725d70e35507fdfa5933a61496ba48fbd5555717b33b59d4ef211fe096aefd478859ffc97a41372023ef114adcae5a8d5e03c21369baf1e7f417cb40326bc6db1cdf0904651dda3c1039a2f1755e7c329f7c03bf33f324206ce6e1638711c8c9a45f153aa1f847cca2a5d3af1d24fe7a1e1094819e8e712cbe10ead1012b7371b35cbcc2bd5b10505fb63bea20ac81d25e83ed0105e7595b6c28400f4d336791ce4a584323d0b455bbed44392c5f86c9d5287593f6986d4b0b8f9974a7a4157859ba801251d3b44b2bad84f29cb87dcf1680d6d10d1bfd59f0c95fb7bd07fdb3ea2fccd6e3ee80af438956ccfe31e750972f893ea5dcaa26d077fb3f09d990c2f41c8707368bba007803621ecd76540cdb8705435d74f4300eee04710a936f241c034709e625b0dd5dae1f6e86d034426819c365a05f5be420cdf4042bbff965a666a5756f67259448ebf742b6ea189fa17a4c3bfaf651d19a8a525f09d9cff637c8fac02eaa58d3ee3f7221da1e61833c0b183cd9f47686f09597e8115b435454acef80c079eafaa22b18927d07bf8b7c5ebfdec9c42a52b7824d45decef41e6184dc2db1505ca6f94172fafc10731706e79b9856dfede353d2eadeceaf72a302e3492d7dc81e3777e4e9e1f3d33cc4402833ffedb241a75a09e9495d671f80ad3acf06823bb04a92b815edd0ca7d01dcb3318c1ae5c62d3e99c0ec37908b45b51dd65f6b45b34ede2d6f553f60a45e20fafcb34ae4dbd375f52a5db9c62650deeee78e955087c2bea75ede7c304347b171fe0c1a2a033894be6e04605271307f307b2a9cf6ae24b8c87ce033a3fa4cf2bacdfcf54fcccb1f580476c7d00c631a8529a9eea2a713610341e0e25609dc8927e51c58a0a9197a54963b5cb95877354f4b8316df02ed2bea367704a12274d96bcbe0d0d728923a368bb8ab98d5db5401894c822632308ddfd309071fb4b477d8eac0ea5dbbc3e3606d8510d9051dfb5e4b7cdcf2c57c1b76902d864c3109c901da53019ed33cea84b407490486ad9f980a8a63df3d2e3921064afea137f35179130db3351f5bc3f5e7d590a5ab08b5415efbd345f9d57b71ade7dca939efa5a12d677b9af0af14468176a43712bde10cb15787c18bf066eaef8abcdea77d3a0c61d6c74ae7b54fe90940d0233e4b874c9a141dcc740d7fff43b9fbbc012a933d890232cf74fccb7ff7eac1148e203c7381b7f1d1429b1b1152ec25cbf7562596eb402a9328e43b5dc5cae36592da5523f0b9907a6817ecd395a7c778daae85bb11372b20641a04250b77b3a0ece885d07faf9622650259b874536d6d2b92181c834dc111b6fcba483167be40ecc922fb87006f63b9e8e632879563f37a8f712db9fa68c1a20ab239c0116fe022fad1279f3288b8e74a16d447e467b6381515814dd3aecab5c2a09c400b44e9100c04c720dc7e8c6d9460002da6c52004c16999975fef8752c2f9c229cbd9e6446b226cc454bd68cd665668a17328bb30f301e92ef5c7a2197a326df5c99b422096de8af231d1d8872e6e505bcfff026d4862f28d4bb3856a66ced22c9b0587451d8da4230a38561b5b1c69b523a4701a2001382aa82fcbd60733a14696a540227db44aef346d6c0a7ae5173604d59eb828614cafc1b8cfecda054dcc7306f73925e6d1af56ed74c51c6cdb66e9fee8d7a0078254fedb0c0f5dc85a4686870709b499eafbc8451aebadf848b0598ce8f955688bd2d6032abe10d1391d67c20a049841f95d2ee0c8deae2bc1baca0c098d8718cba1ddcd968981c47cd98d247aca4f838f3bf16d092eab8be8deb1f8d504d37cc44a8c96c9f22f2698036d4ad3bb48b31f109626565c147d20a4a7dfd61fb918f81548fb4f78875c1d138e819f6822651b93a3c92ad77793fba5222d870ea671f9cac967919d18f96e92778548415b2e170d90b201215354fc48a77e62823a2c2bb354782ad052732f08beb278f751529416f37d83ea26248517ae2ef2ead28c1077908995a2d25db0deaa957bcab39715283287fd626ea7388abccba2d90e364a7ff4284c84f70da68ce1aafb5be0401cb9d45e085aab41892a49e10cbd5baf2c34f5e0ca076f2772abea6f622b66020d546f8c2f134a87f96edbeb9b08394b585f2c2f98aa792f97b43b5f3aa9c34189804a9ecc2cfaeefbd0f967d85a25bf3136fd8132dec38aa82e4af6ff677682f3b62be27a180aeb22f918c24f23bf6f5954e0722324cccd06829fc32ae4fe3aee6e5a03b3651900e13fb0a759e544d033418b6ed40d037b4549a0404792c8fddc317b7f028493c4c91d6773932f8486417544f3d007e5f9e6fc02fadff175303f77f6b0e1f709bb3d3a93b38552ccf62688a39da1a602dd5e122e6f4e9171769ada5255cc5cf938dfefcbe3ab0faca434c42dc8c357e89a3d1488fa3df35c3580b124ba3bf6d0d203d586707eb692150ed05a01bf9de5c4e67bb948088784016394d47abb853f2b6b643a066ad81bcd1735aed4e108a8c1fcd025b548de874eb60de7f3c568728959147d1219e4b830e06ca2bee1f8a035e28a54ee6958d4821a84e5d1e41139905f7ec60fe67ce5f4eccdcc2c3d1e4a753a32dd3004970a4ff3824471822fe2b5010b9b6c6b01336dbf0181a95cba2624663215468519871cc39e8a7f4a151c8bd03363b402020f2fb98069b2cb8cc1b7e930938e7540d95d1d223e47865135793f9eb573660ff79f7ed2fae503e68ba44596ee745fbd8fa562c5c666d174cc01b1961736e18b8b517161ab9c8058026e0ddd6c94aed0086a26e1b959a5e05eb9d8c1ff5b2ef518ca23b4f265db61b499a48cc46bed28d23ffc1e8d9c9e345c06079ad47c88dd4e8e286575bd7f9420ab9c2d5c6685488b8b34d4c9ac04e1427ae0994cf789b48b01d1db9c2fe75fc5187727bb11119f82d0739ce4048467a08cd635bf78cc1b6cc9c28fdc199d351064a81456f81c9e56a43aef7332973804b06b18a26caa62523a7d0acc272ba49124b17bb68800d5756afd34ddb2b7e2dd8a118aac3fcf39d9f853c4d2c4fd3ed5bd25a6604d68d57db93d15aa1160f8a97e6c24238e84f272780966867f9c644ca2775cdac4af0ece036cfa6ebb1cd9d701dd7daec5763c9a4de0385db383a5647918e79c6a6de1f4ee1f6b722c561704c8d7efa4710d78dfce8ad2df0d3d82cbb59cef0bcb001f70bdc6e17af1a720b117fe02bb1dd527b18e6bce70e9447cd0cc85cbcf431fe7c006f5e4ef878a974a93b25f492847c9ae020583c9d412f4124246164d8f080b615e2eee267a7aeb5fa0974de52cefef23cdda7b305a33a91e9b50471ceb72dae337c485d636e28d6ee31f5705983808b1567d4d4ae820ec445c56e6a404cad6b408691475397c0dd6cfad232106ba96e5104052700a653e21f9ac6d79578a9f52548f426a1e81dd45bae30acdd4d22a2dafd633564d6b2f45e7d35413503c955cb0a9784b42ae8c2a5933a6729f3922f969a158540dcd201ecb6e32f88b5b4921914a2e8f424c8b031f115ea5d23a21e6f22439ffd7e5d11b08df729f65613b4f6ad3edbc9a066a5e712ecbddfa6fa764cdf170c0485f82d924a99b7e7ad8dc44c1f93e49b6469a9af3de5691944413f1417b753bcb84d5b7a34f362c383cbc802b0c88bd23a7ac471b9287571c42081b1134bfc8ce104a550942ab1f2a074cb00a90558d6e841ff15cfde6951f03e450a1bfc90dec6c513fcb2692ddccc31d22e5274d41036656183c72fce208e44920776f196193137ac67d6d65ce9cfaae774f23a86e6ee8ff3a4e9422a4667d971906e5496a4e80278774899c882708611bad282f6c1d666bc5e7c40082b43a6e98d494a18e9b3cf7f154fdbf90d786e59e83b72ad0ab893c49aca50ed37ea5202e650fda54f5c46ca2a35c476f4b009c5e6733232275abd1341199b63d22386c484cb95c43ea90e609c407bc79ddd00609cc2eb0d82848db239b249f164b7ea384d0239fe1e64d04955b9297472cafa2ff272c5c78100aaa86cdd8120556f25652a3c12da5853338e3be8f505d93ea03cd1cae7e78e95befdc0e26b760d11e05403c348e0523fe036381408033c009a8e1f117af5100a6eb91f08307df465c20bc1dd029875ef7e49338689f602d98f2dc690a57a6f2864e57098f8bd723574944ad3688b292db6d01387a16493912722ac8f91fd12b748899bdaeabdf0479df788eda440d7bf30d1c25d78d757f00b74bb556506637fc1ab87162f05d464e63a6272db3fe56e9357275035d6b6bee32bd92c4a1dc94778551e94ee1d8854f767bfac3811bd0287672aaa01ea18c25650f05a68cbacd9158e479b508e72df778589e1e03dc543b60bb3b10399e5c50de9e728e69774fb3f5fea757ddefccd0f9da75afe4b67f9c54aaaaf646e858fb001a6deed0a8a769ecef0689c988de566b6015fb8c40aeb5f2df7ea4bee60e8e69d15c4a4aa5411dbe63fbdd6418cf025d87f37362f15e22aba83abe1a3de9857c71c2234023b969eacc0bc526363b7f30b092ca114f2a6cefb34394d146866ac86a33fc497a8cb8e2a5bac398579ff7958878421fb08fff4f8f3deb8c9641b8de392647df3017a5467f9d7b23036935ec6e188dd6dbfb544b8a9e04a4b3c7fa1e4d1d9879daf69986b8083e6eb023a4b5eff80fef17f8f65433c882a21565a919448e6091d1b61013fdaf9fc3e45bbe827c9b4ab10b05600a1961e81d31c7404f8e0d32bfcac2937eaed811db167dfdc29286b0d51bad2bcdb9dea76eaf495a31a7fe717c1c98be374a36271cdd06ed06c02ef4c3c06cb42f73b3332ed488416010e6bf2f4dc4dade6e2e61f19e9306bf941868f59fa0939005743dd647f0a04b576a7e71d4c383c479453501e18ec56d7cb79fe31ff534afbd8609ed701ef163f9de31bc58114399fa0f22b62c66c380e8a10c34b7e731df2a8d39dcf36fbf3a66d67b973e3a94bf6ee0bd96f5c76baa76492032fdd2f59ecaee403d486f543f2cd7ae7b0dabe1b5566e681cd40d384a94349e9668650a6f2d2daf86c59a7b02ba466cd03ce1d50c3f0ca4c02dc4b3d1c0e7b9a77df9eae0bfcffa32117d7e05adc7195f4278c93497401629897a58d08ad7141ea52e0163f14992d7a284e7b875ce4640b4dd48ceedad1ea17d8ab1e760773044845e0899602f1bdfff4d42ab80c0765d1a8bde2ba0a830c050923956d06c80b182264ad19ae4f7c39e43195f7d421bdcda00e3eb5ec5ef2ec91d69df691ba7fe250352acf01fa92af5e2c634b9c7c97889e9147e869acc153d88cdc18908f882f371ba9c1e13c26e9cb8e3cbd4c5e1988080ca65a67b3a4c3460cfadbec904d853fddd2f5375b6070941fca53cc106b5748480213cfbdc1c34320a0478b05f76fd0454c75eca069cb1fa7b21704dab67dc40d041c8a1040db378e76655636ad725219c049e6536982d6ee9f11dd032280e622547c7ff44a938a1f233c356a98182d22d5770fbc871e20bb37483dd5d6ea1551993b95b30774a49b50d411ebe0e8c92834094e23ec2664d822c40e96fb42b8607b62b6949e05edcaa436d0ffac6a8ff384068acfc0220c0b098d368fb8113918a4f8c9de37cece74c8695cef2427e54a6e77ad092a9b7f1d94ac9f0836deff41b905b5dafc58ad6063759b0372a634f69a639e19521825d66a282f489c3172a3659264d0132af3571e637782bb6fe5c0afd24547612166fd3409d0991392fa054ea5bd07a4cd0921a13ad7b62a0b5e6d56cd8adb7f3eaa5c99576941c38aff311c49a8c9d8c755869302a2e5e40109c8365a551cd3f859b9421be189d3a0e9ed78830d5cd6a2414e9cc4c25814d94d98f8848e5386d6dbddd65d22b96c5d20020a5dd409c7e5344065871e57e01c91a443501dc8bf619890fe231319b5480c3879dee618d319962596539e2970513fb5c0c8eac3a71ff99962779cf1d7e916566d0e29d121c5cec5d7302a18ed00be9316f3de8c669a64c2a960a588f9c8a42690f6867cda7146e8ce27aa6a7fb27606eed9df6a235a42d17ce71627446e206e879de56025a66556263f06684dedcfd6f083d6a707e5fc8f8212d716e062f0f7fd0c2fc62bea93d68581265a803c31cac3f8ac8939c5f8c464ebd19df42c7e8998494af614c8383294f3f3883f2404ac10404759e182a038c97aea04a85530ec005e203807c5bc30fa9f5339b32fb0427e64915e29a25bb25ac60b92256470e7de5298d42c6b88995f8d2fb704e49d55b66b71e237af90fcbfd71d9093e1a543da2e9911ac4102346dc4704859cb33ac5f5dce2b3331a9dc9fb506461a5436c89bf90d39afcf93cbca4cfc35da6ddb112243928246ae0d1ba269b0fce0468d3ecabbdb925c9ea3241e2dbdc6b151fb4aa724a42f98b0248171fa01fa103f116d0e7deb65dc359b09126f9a420300fd209508ec7a50be56d5b470e387d0c52a1d104625f9571ce1404d1b7af3fb00475b95f752ab96610be112d33ded48624015781e7198f4dcdf917839471fbedb43c34efabe09941fab6b342cf672a29dbb1eed0db788dbfcfcc63bcfe80f7718571f691818dd6f839e3cc282f85f03fe0400171cdf1235049fa53de7450b4c40ed398d5a486f52124c1c63de2afc950e81839f52d17e2a7d32f82788465a65da6cd763c6360763561ed2bf47749080549b6e2db87514e1ee1c85a0bbd346eb6e3cc29267cbedcad67a287fc5be65ec59ba8b6854b31c83dfc5155187d4150685c5c2c342ed68b01ac9e44b60f0c100a347a0f93074dd37d8956fe2f43110dda66e9f9e6185c23dab74cfca21f3ede4bca87687549ea02662f45dfa0ad27f9959a120cacb7c419810e1b1a50fad31c12c47d5bbc61bad77044aa541d29faa6126c60ef088b82eead17a52843307d4bf798b853d90d14c5347ff10615381d85e964331b7a123d15a77a6790d93e920052ddb4db4baaac5e2b27b66ff955e53b8308151c81da4711189ccf0eb393c5bbccfa1f6c94a8d5f4bcd266fc6a12061967ce836ca042257368f567dc42de6ce0be84449234a6163b72069f25b7ead4b2003e1a7665e87ccf211abe94175d1c11bff2c0b6bc110194d34aab96934ef59804cd26e4434ba166d9833fb091be37b139cc10748b881c93690528a96ccccd2dbe024510b8da37dceab567dc52706461c486a0463369cbb99bcca2e8a4d2e005c45401964722a4b3ed37c351c9f21685e8992c9634349379f41796deebffc2928058c8ef6ea37c6e4970dedb78d1c2a00ea9e1ff1e7708470a6c60e6a2b1e966aa872776afdb238e97f716b3df8dfd42bf0f7ceb52bf9eb33731bdba5987b8f48b4599d67b383e77413107857e951ae0625059e5616ccb41131df9a480efd5beab3a9c99615921caedc53dbad675c00ba1030577db1d22731677914fa958b44792cc9c19e2ac71ebe61a05ee67ae7116e39e1c0d103f18bbc9d531164360d901da8234d29fb0b37cd2a60c7aa2adb2a4b297ea2fb14122ad95bd4592ef86c88fdae1e37dc8e44ad03c0fcdfa3801e93796771c5a2ec1e4ab12a64b3ffe48e7442c6224661ed5cc987aada6e778399941f7b20f16f94fb346b916be87f005c9c13789741602039d38270643cce3c347565eef5ee09139330301951c15756be47994de6f1802dc5131b9b011051b1d87d744756831a71cc8528487f032fee9dbffccc751e6a1ee6d07bb218b3a7ec6bf5740ead7a47b6907d7aa95b79aecedf4a637ead8fc6fb8654c93d13ee79f5d6258dcc61993aebc65e4fc14eea7d006e31f6e9f60e3bca8ce52ec559876fd20255e507daa99b185671ce1ac11d448c30bcdf97b9617195e0ccd2d15246308dd6cda74a8071114327fe203b1adbaa780f3243105c5111636a51dce966f5652e39d4f91abbbb4576234d6cacc3ec57cef2dd4dda49a6c33d12bb7595fd5ab5bb15b40301f34ddfb831a5dbf62218f496c003227fe6282e2ac054c45e7f3fc93e51b3ee8690f08612395095a0a12729d663eded879d9ffb325c62f2cb546a48bed51ae232fa6ce28a2494c132a6e09d98c2e3d478d5d2d15dce2e2665e4a3db448931068b99899c2bd8ba87349b0cf9e3c52cffdcf58a59b4fe0089b298b42ad7553f831bd60f5cfa3e09102fe773e4c05412973a678f3b3ed420433cd664dc7f218e816a17c5c9013ecb84abf2dd073557dbc41b92a91e0339d57b8b077a9a44d56427fec5748c47c1460b2e2412094db6d0ad06dea0aa0c1368592594bf0b2f590a9d6149e44dd4adc4cb42e5d9940d59397b83b33b88604c210694e3fbd84795c80c1b09ddb3b1ec8bef6e9dfc4d7f295e551a79436007ca48aa605ef5a89571e59cb26f2766e564e39d3bb441deaa0c8664549881d90a77256c0f6c77241fd6ab74b0e2890f78ff16fd2f9271ef96ebfbd0b878ba9c703900752b7447f4efaa60bd9dc9cd5673a36b39d49f54274caf03c0cf82b95141fa20ed3ce02ebf0dd74d9eff8eb9e2dd3a2976b244b12fd33ee75c1f1c459f86a1cefbc817f42d7f43ba406098165cbeab99df4fe751ae3382efce32af252e461652c7598161e74fd8eeca474fab6b1ede039935f2fd4d7562623b90a422a78941f47a76863d95857c33653d1b42b806bbafcfeccb7bb4a0c58acebf6104b2570afc3ca88e4fdf2719cf39c964a1ea7d2ae4a7fadc938abc95adac495093f6b959b1347501606b3f960b6d739291aa8c13eb49e98b0f78d2b91400b6d8961cb6165c8b684738e4d4db2f2ac30ddaa03a5e0cde4142b625e81907f08c60d7cb5729456806c89ff0efd08397423e44738ff38f8e88684f3a099dcda455521caca37ab4f4d9ed5d37975d4fdd778b97cc93babc804864a35e3a2db04598152e67a2f1f157681c3962d46ada23ea5d9a524f9cdbdd08a07a3a85b1f6fbde11d5a35c7743b83bbefd19aedf6d92241d16aeca7f33cc51839b75f111e8edaeaed808daf2f43fdb3c6f032ea45052ac31d4870c4d0d76aa75d0b88635ce449054013f234c4a16cffc58c95ba1cb8a0a0399861eecb1039bdedfab4d05f0270c6b16f03f6b8e629f687f133ebf2662c7f930530746679aac2791f54d6a95bfab5be0c33739074ed4e7ae88dde4a8036a7d6095cf41776366b6ae3f8f4a0734f48c275e129cfffff5e0abd042f99a957bf6f0f47fc7288750f4fe30198f8cad7067b36cd87ebca08abd3f9475e7443f83cca91a1ebfc42ef3494871f51f6d52a5524b9391c687571be5327c7c94ee2a096653acb410917fd51e56a92be4f24c1db6b97b465ca84c31c04c2f61eae07e952eb6554aa4d8a380d9ee81c1c462c360fcc3cdff2867a953b655562cd06162af8b99bbe662e0c27ce4d9a1c1a907def48a3231c2110c930a2f1498e32dbbfee0e5c5869332f3024fa5dfb0327a27c663cacd4e9902de34dd93529e90eb347bafa5035f56fc578e8386c7571d1f0ba335225ecd8be026b4544ad70f3af11501a53119ee39a8558ca0ed5b3d897ffb9cf0fcab55a0942d3bf7bc6b94ea27a6b748f2cfda431f35252c44610b7e843ed91ebf7e8fe10638f04f52d6d5a7752ec62350efcb7c473f80b1f2a26805151e8346d39d23551e92fbe372df7979c3f756bbb43f6bed09bbc6b65fe6fd241ae1c2f1a0d0b805c582853b85502968f9478e9a84895f9d4ef01ec4f3f571e57cd0bda68ee1f6f7e14fb6e0f4ef8c7dff6796472a935294fc27b16216966d5021339ded059687355b42b55926854bbfbd9f974a0c26eadbfca8a6183093996cf252894e6db910c71ca3ab2e82d90d371c36b92c9409cf7937bb266ea9b29c41d774aa522e103cb30bbabfe872b57beb027623742806aa7694a859ede9bc1fd7b9e32880b064b0030fce1a0e5cdf3ce558a5feaa32e323dbfab6661c5878c9377ee52a615b7c17bf1228e328aa20f92d070c71561969e1af532e76835fb0436810c3d87b982217edfb1143bfc3405ac9f6f3a50145608dfa8658b0ab642a347255c55b59cd1c5897b2cf625a0f0706c30ca1c1321e90cec57b7c3d1bd1af455e3732db80643383c41eaa6781f63da6233360ee720cc04d171ae2445b0c071e339d547f7ac32f407d29ec7abce0a9e1ef5276544877bab2f84bd2eef47ffa66f96e7170cd54d836c9badbc59435146031502c1a3cc744a470f693636d9050c5b894d2d6047df60eb0bac16d905d46cbf017ca69d66427cb88036eca4ea9d0e579f6bfd8a4a850703a0fe49d39c107c9358e98689fb62bd0475aab4b2031446b437c7f9e373caf0270a28d7b15c71f02079dde401e26175bb6e392106a9072021f0e5c5145a1db6f595b032faed8551f6e2ce318db1ab513db876a3eb42d225014949c19543e9c5dfd2290e28c5d72c87223f0195ffbcba1c02c7d0087721efd2af6881dee7dba7565e07abc35bc3fa41c6a4d6a313222ac6dbb117c69c62db2691c68869ac5fc5e987b0ae4335f815c73ea4235da2582dde81d6fdae5911617daef847be17f2bc09edd88830eac03977f89179fe03eb2dc3b38df43803ca2d38455232549110f4580ec3cc04c0d8cfe493013d2cde47c506ef6a8dfc42d998f70378fac5ce4709345926dc477e9e339d8c87ff6287ea6e2873e14d538cdc3f2a47e0e37a2601652f5b665b616a7d1ef3537a3327a76f93990f7694e6484e7a52a10e9eea2edc92b99406abfb2b11ec86667c7af4a333dfe900bf071d1bbcf4f0ad768fae4f450c53817c507d26e926e753e3395201d3ad89061f16706d841994abad283f0db74cada25beb5fe46f48669a62e0b849cb77097e1b4578b45062af4a071b04f0cfddf87519cf2bfa10ebb4b860239ff187e6dad73806ae968e6ac0f738baa88edb3ae4883a9e59be7a6b222c5f54818f95578daff9fc7a7aba8c4a41a699923e85ddf24a32bb71c808516f64d506058a70539276d57984d75161cba7d53a4a864c51a249a6b8fcad5738dd0055ba8468b56579ba5f102642df65c598490f3a0c9b1064f4eb1962c4c38bfb7d55d496a0b0f7b3f90b42f733d112c89176aaf937eea4bada845f3ca4e9b56b3a5a06b4c90fa4c1914ea47020c2f32531e270007ed389246906ecf2c4465f7cc5d6a347583dd73341ad97199021819be81100d867d628323ef7552db945e4c0be604cf6c4a8197958bcbd6c1879387d3286dff979632c54baba2a35ea84efd7726b662b94fae61464d069e0103692599fb86fdc3a06e01c6ae3deb3de6fdb21806c716e5f82b784e4ad3f0e2de629a18e3a2309003dfde9dde8e5101b83312f76e811277afc286b56879f4eb80468e58c60bc088284d05d725ddfe3185b7c51b472a7ff7db3930839142d4a452ddab628e07d43375801d7c6a711a55b452748d770b84ede35920c1ac74b595baef963d21df9418533fcf959593ccf5afccc753e86c4ae231eafe77a158c2472143faf169db29bf2b53c3288d8b3c9added65778095f85e2cb471ab58362041f0a27d874c42bbb06385a0403ca193cba67cf70029cdb7e73c7e2267b856fa0b8dd4c706b45e7174659b0ee2891df911724324f7ca5daf07c912b9b2abff762e62a1817688757492975db7185c4695f3a90895634b8d07453b36dd95197abc31d5d153dfb0d0ec92639540e99d6590f9b394f14c93a5e829fbb33616e810f59c502be44a13b700fd3009545e34c211abf9afe1bb8ced793c6f516d40010649f83a78ddbe9b71d8596582997d0aa54192e1200db61dade30500d72a184ca7dfcbfb80e5442f489d316cc8b75005564835d4b11c482e2c4d0d160f14a8b13ae0a0fb0ba5e3b782770aaca357df0e1c4d1c3b28b776a8b3e0da1abfd4f7190673fca1e1c5a31c688d6e8ddb21300e4178d07c4e854a718ac3f672b0120d6a54c16957c9ec8c444208e47737bc4eeb0bf2d801eb2fcb72f91fe988aa75f38e6cf26e858dc2a718580ff5d281d13e8fc3e3bc30c75c0193481c39c375a5b06b962d9491f3f1fb80f1cb27067f0709e0b0730573a9b5f5bdbee1708ad84b4ceb1a9a61e4c41e90655764057bfa07b8c81cc83a315be1aed6a49715479c0fd0f53f625fe6c7f36fadd001149ab978532e4d0de3d1a38934c74265b161899843704fad16ffc6189f42a5cadec98603e0f98c6889bd4a559079e074cb40678fad4690a20d988735280a1ee8ea71275069132101b35c18ecc9d3c6eceb4cfe9b165e4b6acc17d4f113ef8283c0fb6506f5635401e916d4f7e7bc3cf49aed166587a0c72cdbe673f467d81bc2e9cd08cd8dd16d90b353481df31e89b45e8b + +[L = 48] + +Len = 16 +Msg = 3a35 + +Len = 104 +Msg = 7db15b3ee240b45d4610950996 + +Len = 352 +Msg = d2a1efc725c46cd6a19760f49edf0bae823c1b4992ae2260085746cf65833bd008e56e64002383f51f960239 + +Len = 1016 +Msg = d11ad1253592c094746da7b5c88d329bc3ce1929913b8be07e82d3f6b7a536a855f31ad197376eba6f2f4534413fc4e4e7673fdff8739f774a710754b568b7c61a473059a41c98aa4e86617aa66d2601d0f0d584cd9f132afeebdc0ce3da6a8b290059e6e4aa080c195c42ae7f7e1e99865223439929b0a3a0d79b46ca6419 + +Len = 13696 +Msg = 2f7a9929dffaa4a4dcfeea1fc37b18e3cf935abbaa17cf9d834b3a8d61e9fabfb7683cfc387d6f46ece3f8bf845827c7ebe86a651d6dc1e83c5772cee1a9fee4b04453af2f68430bd87835126cfd1b3f8beea4d3822fb27864570e255cb65b414197480b6bc20a39c5450adf2474da93d72f6ecf8063899722d3755b7a19f71e93e782d89593ab19ddd3ddf053c54e0bf832311fbf132e8b9e540f38e4d9bcc3cdbf69de54e40ef348a9170ba2f65def167f568ce846889c0161448342fe907718a465e451bc1b0f2e4f21f9b911f186589f43dea305811473837c063b915d849c20deb43323bab4b64e61823f1df119e71962dd975700391b411f8778980a3080ba3c14a321d32c082d416ddd2345f0eb751a516d44ee55222395cfa11e7fc4edfbe7cd49bf4ebd4d7428843a2ad5538b3cd201ccd431aeafb146a65d28a4870a6948a7cc0413b0adac7e8dff3a898aeff5f4b65d10b28ceb749bd354c061c3008ec569d5f90a4d4f5caa51d35b49dc4028e738c8ff5939fef3fa202fed9ebef6f2c7dd0ba41cdb5c0c16985f96fd93a65d134fb4a90ffc0fb6cc5396b843c2151bb7c9170f2fa4fb44292a4af28df5481de0c3c917ba1c46467a35302738158493fbf6a0422cee558d4bce3d78e14b4fefb65bb05043e2cc2a6a8ea64565ff6ce2fd2c4f43fc02926ee44ee02fe1dce25cfde0115c9396c9ea06269f17b2caf58e2332cc1c8528d9705c70da1f76f22aeb1d1b93449180640fb5c4c4a708bc4621d7d2bed5b1a752191cfdd45086d34f247ed1df0f24e7c620de32bdfc4d1f882380d2cd7467c926f48abc75cbfac8788f88cd9dc5361517a5eb36311e6b39e21a85fba2038fd47d860f776697bb19cdb5a4d6746fae507e274399c91648537d905015e58910117e5914f44ebcb00e771d38b30c1473e1232d4e222cebceb4810c48e83e0fd4c852f4fffcd643c0ef9e4fae2d0ebc6f102f3f749b02a5e3a61517d53b539cc24120df3957a633d50369d46c0c226f8924cae51dcaf54d716f61385fd8cf38c2c311a32bcd6594d6930133dc18ef36a9671ba8b179abe95f588ef74e8558ebbc974dc73c26bb6eaae78ef464181e18b71f4b0f986ecc8495a9c4dc0b0b96be9806fbd3d32952ca3b4737a06ed6561e9c9581a33a720123fbaa2a70fc3233b83e56444f5aa0cfaf70fb24be6118404f3e11e6ea004cf2d079a3e93a8ac1d4e297cf4fc43851dd26314a7ed6a5a784b386daa26e50c64692f7db28c21d82234289bb45bad5042236667e6d70a24bc9525c3adcb793a6a5725d9b10911e3bc8e3fd604db7998346e7f7dd1815c0cbb735a977bd4b32b5b976932bc92ef3b56bcadc089045ec95f241cdb0a84c67f1f76353da6cb493bb27a881d37a2106b8b3010cf935eb3601ce4dce3e449eff8331e444ab117a20809a1010db4cf3be0c488f777b6532df908112e3d11592f04a0cc16232d62340cbb8b5268a662b8278d37c03d848a04f0ab498f5af43b0a20e310197b7e1395a65299fac29f051bcc5fcd09a5605bfee370ee8ea21f5807d9748acca815a44d81796d68b0014eed3bb6a94233fc51725de3809ac6f538beaacf8cbe3d96aca21a7a763a957f8892f22c6d086d9af2e5ac9d90321e186584f17e964c90739559ddd034df076c4aa38c2b78aab6dec8ef6be9adf33bfb66f159ec4826653ee6cb483539c47a4a1d95663e6cc7a42a3bf628623a4c9500a59a50a312aa104b198ce5f3e58952bb79ff1ccfa9ddba2fd4705e91b5acaddab9d6522d7666264ac5f533b6d8ac4512d8371c69c06b6d322b046ae2a0a20aec1c3bfb05f3d91b9044cabdd873abb5f2b0e3e19740df31e39828f9ff9bbb20b73541a7a70b8174ce4e43e0d356e629cdbc6c08d29bd7acb6a4347823075683ce9d7de4ab3ddda6572b175951f30a15263355fe9641b3322df7dd52077402a884cd472e6d0b6c34cd63ab63cec8760c7ebe384f7cc31066bbdb7a3417425e039c4d340166e4bba4839076ac9457c87459c57957d0a06dced2f7a18acd22b7295785dafa435a2a8a2c3a1fa05d115fe129d19fc44c5a29bf15b4d9c2b375bc8e591f92756cfc573a39b8fccb8395cad7617b11f14a60e2dbf69b897844cbbcb70363010f6e1bc0590ea594aa924597dbb32a868b55551789f82437180b85661809089d34a168d44b4d788dba23b13542715843eee797366d9ce7793e72331735bc78cd61b13421a568ba3e66926921c04e9d00888ba7ddeb474db63813756ea4a02c1823083e36ebd2d32d5c88cdebb98d511304cc276c7799cf84a1699ccac9569b13f530c762732e6bd0f8415001b2c02d11dff36660b717054b16df49ba38425e3764a56052ffddecdfc686aff22079897376cc15591e11579fe4feeccb55f + +Len = 100816 +Msg = 5f464d3301c5e0871d6b41b002dcd09abc80a805de3482d97f3fd7b9838745da1c0534168f76b93c3c53bbabd904541ffe5179cae619dea77446140b7400f47d242141c7f2e9894d88f44c9e066861498e7394f206f594a419790d697f6a11187f84bc6fb288186109343eb11172bec076d041a4c7306d7978c009fc2d2d62563614ed3555ba2d21c8fcd70e8389352dbe4ec808af3231ce990452eb05b1b0dc4fbb1b4265e69235cc3561dae4148c386cd770474863a84a822b2e5f905fc255d55f90bd6a760d441dc52240ba7d8c888a5283891a2c99963d1fe680549d6267cdea92cfead167f6c49663668f2bfdc61fa647f5abf3ce5ad2c6c175dbd456ba41436aa06f5f68f5c88e6b74ea86a79934bd05b486210d3d470a0967ad6d67f7385260578088d7e63197849354f651aad07e04ed301f1fe7a6d2047d50ce5dc6bbffbb1da6b47d740898f4eb54e3c5a1fbd18ec93254cc01f705fce04e6100ced132c519674b2345547804a372b5c925bd9ee9701527db33408d37b72f8d18b882d3c4744eb58f011d21fce336d426de1fcd5e09610216248b51fe2b79b96c2bd6ca0155e05a8a516b7a24d529a9a475284735bd9c4c437ddf399864b64fc5d0d6ffc4e5a7a3dbdd476bc39ed29a0a92e1f2b6b3506c2be5452d4f896db6eb4f895b554b2af64c4cb8dc2369b91022dc50b7291404cc9605c31569c32756a64ff8c4fbb0f1bca346c7b58a5c6774b2fc7f7fd50741d34c8564d92f396b97be782923ff3c855ea9757bde419f632c8399763003b58ee9140c2d62e914c1e1fa742661a9166d42267edc40905b35a25d5c3cb3fb457376b7422896df7bb19c23e8f764416731d2e20cf2c1beb8663c07edd8f105e078e2fed05c5e5897c430017fa2160f565a75a4c5c64a15dd7d644bf355d169ae2696ae5ed1a39e8f81055cdf315e5b0c6f9235515fc4dbf30281ef17b83a6ed604f89293904bf78c7183fcb0ab236cb1f8935e59c51559217efabc000b165d819b717118a03facb61a13a99b194f8b6c7ddfe5850127d79078397a56564c7ed6716a129409680434061b2a4782c9006587de927c1ae09d6778a5f1c39fc419fe10493eb0d4ad492fbd05485eee7913c59df82fe7182af2cf06a6e8edf06676200077bd1408f5c1cec537cb8566470cb44895826d04ec20f0aba4297c501add65c75d5767ad2ab63aa81b7b66f01b32590f1d55b7e50e6df1ee077a19c8c895f5ef62d452cc336e9aee171fa997ddcedd7af86e6cc37722fb5838a46c5e58e7f700edfb7c6bf832171d9581f660752867118e9535a6118635709d6f1c1cb21b938068958e956149d9bffc67f355cb88205d4894ba97c3e3c8be9fa2d20abe79f3f93a6a2f4f56fd075bb49a4b7dc83630e58c32a29d757fdbcaa607352f65483cf2cb4208a3bf94ca7a25e2a4e05279be31c33696c10fa4971d1b64ee938dd299f483e5c098845749a3b706a787529bf2ca56693d0a7a98243e6482a43e1f5d3086ca1b00368d8ead5ed2d0fb79b1e2f537ab9340809ca3a9b5eb2900390432293008ab7086c2811d33de0648be5597ef002c7c462b5e0f4e0b1720a98b2299ad7aa55eb78f0c77c2ab4371385f280107ae40ebf814a8223dc74f31483c63d9e4ed09fc7e5a51bac34d69d97163116a66c84ea9fe4263269b71fd228555ae3cf5109c4d6ced7b9049a2b8069bd2f71834d6c07fffbd7561939188bc07dcea08086bc7182a5270427c3199bf5fb5c4549861fd32a38ec81c4ab058c777dc01864787f0275f911a17838272cd65135f66baf06d8d93bc439eeb55d50b7c5adafed8eb8140b4b05f59871dacf954f4b096c30b7857774fcd319c096750bf605db8e31fe02cd1b9294eaf8bb009d4609f2cdb3a8657f650501b8553765de8f572fb91ac77b35db35f402453e5c58f60146f2906ff56b9c6b3a5d0bb6afb9e2201110919ac9c01a7e9750dfdb2f72afbf7a8d6f64b1c68b9de17a2c9abf289eef24074eee9b1649caf3693118165503a30200993d271aa31b8b92606a10a52612dd1fab495b82f9a98cade18b9d8a723a71ceb63fd1d27372bd281f9b40aa1839b0cc2f2177a09aa8e7b159ac118d7c145e7a4f032e788d21facde2b4dbc1d5d2238f530d9bf9bd2798f611d03ed8919f0c85bc2da99750b7a8d6322d2e66ff6ab9ebaf7424e8c1c3f4fe92be61f65359106395f5ef995e925be3868ad513f561f873acdbaf18590c903d64bd275121c11ea655124d091740887868544c5348664399d3da96e2e35fff34f062fb939d656bc072096e510b40b2f75ff010af68d64fd0acc778e2e13c9667de266b1816c4ac449521b02bbb217002c604be72e73051aa9048d192e3210a68769dd2693e5d44951711aed3a751240d42f8925844131daa36c51d7d59bbaf99623fddf1649db954705fd6f3405e63894f5258c9ffecf83208c2c90cc55b1a8d2972ea6b3a049ee54942b50526b7930953986e428b2c75e47ed870bba68dbfa624dd94112f3059da0a80c583baeb570fe8314f5c66501b34116c81148dd22396fcd6479da49f7e952c8084f97d6803ff85c3787222064ca368f596a1ebb6dab20a03916b3ab071c927d87fc10ecc4e7ab4a5761e3eadaea4de1a0dee30aa39a9e4dbee047201d7d8a4df1284cf668ae3ed7dc4cb2cc4b5cae9307353fd2ae4c105c5d9f3bb021535fc3ae9bf3ff54ddda8b2e1037cd9d69822df436dc1c750a9f557d1a3a63fbe73c64261dae0c70bba6edb57519f5b957f138d1aa5fefe01b73c1851aea42938147bac2762527a492cb85da43014c876e223b05597354d7c9b328df67f354d168a84ce86dff57d8a870db034196dbeff83ebef80bbe52425a8810f2c9fea29ee688a201cce4a5f447be789a3881a9da3b6c491288e8f1091719032608b332e0410f4576597e17e0b5dde305f069be2e80d565bb979a3915488f88e3ebb90e81c264bcaddd72b8843af4a4ae31f723d50fa0995b027c334c351128913bb93e67b1b08f101f6b8dc8202b44fbc3d3dfb530f66e5a8f35e69725c86998c05ac87c561a4706e90fa095adab4a566da4fab82bff6b20076e5bdf62dbd6614245b6a6f8cb6bf60106f8d12b9c3e26f8127dc547e2181531ce980a3273f452892110cfe1ea834a30f99d66e026a9d22dc76fc3cec8fda2d7fea701deb84dd45c97dcde57a017693e90983a156f11c4d168d89c06d8a32dbfa590adadd16850854f24bba315b0bbf372f03711a20163afa0c137383b9120b26c59f5e9e7cd2ccaf0ef4e0d70d5a81748ad441ee5fe178e14317cab184fe178fb0cc0d82105d2f423467fdcda0f9871b9d84882609248356f3053a99866dad9f9b0f8c4a897a8cb8f30365a7ae5f3ca6e772d863d445e6d57c6a478e35d719d0e4e84f3a30b1816ddb55bcd79df21ea0e95da72a19cc1fe74fc576120bc108be3ed4cae3bea889fb4ddd67efe858a994237378eb623dab070d954ac780c1e6d2095383c98ba622cbdb18fb53260979fb2672c21a4600f4bf06583a112d303096d4e30e7e1060d869f386eba3cf7aec3052ca17593dcc9969fa9cd88179c262770211cf53f53f175037a5cd445d239cee48f7ed0aa1d715a22ac18a8aeecf191d415e4afd92b76c091803f4c757a9e89f696ab7b11ad6d5f24774e4a004dcb0e3f33705dd8150431f051016af37647b9e44b10bef114276d4b1055b634461c655a82a847639a038ec9f58876e84e9a2955b696e072d8054c3f81173473604d5fcc0a75b4a340dba0c375beb87b8b01a0f2de232bbb8371c3a9d27a0ce521c4c43dd3bdeebf92f42f87d88978d5b4e3e563cba0e5f59dd29c31096885b113ea5c57e66a3be015b703bc26d3fd1d51a7c14f85f65747ac909d7e30c8e800be27eebf4a62e42e538ae30b6883907cebb7fc5e150bc9da3a138f394e817df9a9e44420078f30d0d3d6981ca581791a097a5e3982c983d5cec239096c7d8cc55c87242026d769ef1d04eb96e5b5001e3358af88d417cc61f107659791a35d8b5f7a5767ae24d5b2ba7aa12230076db1f1b9b6f213dceea62949d98bc5db38743b23a59ea75dbe4231a285678f5f07facc053c2048022fcb01f15e8c100d64a877ecd56d196a6ac60ae35e0e09a517224ba409ba7b70d8f9fe65bc427b212a4e9b3cb17b0d332267cea4f3bea7c1e550f7ffe567b20e3057aa0ebb560d00d28e2f7aff718a9f2d4d044f0d20709bb9ad567c98cff7c4810e8c542370cf90a491bc1088f69998d59f344b74db6c1bdb61f284e99b517a11452ca0bb37c7bae77fca6514b341066086e600f098a32a92935380a173c9182a2513584c54ff67e580dfe16b508acf1729a3d649ff1eae286bffd688fe658612d6c8e69e6e7f7de4ba85ec54747cdc42b1f23546b7e490e31280f066e52fac117fd3b0792e4de62d5843ee98c7201529455c85b169fdb90cb05e3403cf2f737148bd20a53c73880880a14ffff37d62130e682e50bc7210ea6c1f0c27656cc1785a0d9ce93ff94dbc5b2877519d9bac4a339e98ec594a7cc76f4ddf994fee8070dd4b8e0fe0e51b93105fcf566f83d914dd862b4ce78de7e9e16f142234bd969ff8005dddc641dcd3c7cfbdd6113cd3ba34a9503a0f433899e90e158abde2ed4ed4b3711c991577c5aafeaa982bce80835f8e6d7c7975571fafb1499991646bc499ec32930367d4b1de76ff656442cab987bdecdbcc2b2bc35ce01816594bfa4b6e33080caa41dbdf8ebf2205649f98a2d3bf331fb16b9ecd1824eacbbc9f81297b115b4d36aa7496e05f7d40d4edd1886c1bac10cf3f97840a03277e6369e7a7e90d932050ab8720fce076de5c355fb17959bd75cfaeff325b0737f8f5b1160de0b0184ba04afcc30bca77a6a37e29662302d01858c0bc1d32b883011b7df5a387805296cd91bbc835a3e76152d017ee929d4cbf137eb78db89d71617dd76cb00707aacb8088ac77a1f52ed710331193edb29933a7efd8cc153e6adfc2c6637e88cd86b06036b8177847b4d086b0ff9b5dc91f3cbd1c08217023d7449253c25331594f0f16a3c5f2e122e0145c4ec94f096b45a1fd0b2dd3f1d51e58978471782a336eae49d7bc4e050d1c6a391658f71a1f752c0ec6302bc2dba9e3766359359ce34955a2db86740c90d09cc50e92dbb76e17a39955fa7108bddeaddaf860d1aff14acec8b609ac1d336270a940604209df91cf45be72edee04277d694a6f968ae6d8e065702f3d607f3baf8db4ab7637fa4c78bb0b7fe69937eb1dcb616fca564a5a521e12df71fefbc321187159bd6a47b066a3440ba634de9153a94546b63aa33aed9da2018e1f30628df37f5360ca4f2660a46ffd73e58183e8abffdea25f7bdf798a2b7cddeaa481bcc6e682a67e99143066963d96d4a928a478951dd6ec59b1be8cb23aa688e1867738aecdd9afade39c92c0b2572bdde84eb912ed990ac618834c412231216fdb84f1e01b3f8414fc6dd0f646fd0fa62bb0157b3535e1497c9272df1cc5dcd4e6ab9a8456222655c56ac73fe0d2aa8b599035daddf0986a45b1a59510abe19a11b6dba065c8bcf8a85d20a3681c2414dab7c036cc1358b1dba98d6ae62c5948c36b5b3e307a6f860c0c822ac724a5c917ed5f98ece548a7a741d366868e6c676394c3659f7f6786594196dde332543376f9ba0724b091d30f431f91d919417e5bf7ba1e9a21cb80f6c204c3a58d59d960a5788b5cba5abd7c7518f4c5170115125de97009a6c3fc4d5773e4f57fdd433eb7422c7c4dccee57a1679633ced3b5f08df763d4577983c5ca8b49bc4e08fa76f8bff36daf0fed068db47f0c87e0e45d518dffe37c129cc6e2f5f9e0430185723098e715284a42f302a6b8368a4f2dc16f534d1e5db9d0b86659fc4ba6f16c982774115d02a57684c7e5489b1f491584b0f0546e4194a6041f5e5be3bfff3852a4fc772d83491023a61a37228ef6260edc0d1cb972cba610d5ad1d92d554700771d8236ef55e983765ed8eb21e7de7c8bb51aee9368758454fee4a3f32179c1e54af1d069e0b9728cd0554351907e018146511e4d6f0450b57c8ebd21c71450116296bdfc779945da60b9192c5bb9a67b1f04d94992df4cbb3e30732dc8af2177fef17e0b7d01740b8a64db16bc29c1e589b6bdfc967edeb2ce8a649ba892bc856a929f0b837a838ca7f917a52436ea3d20e72afacc5b9d58a7fd0fefd96787c65ffa7f910d6d0ada63d64d5c4679960e7f06aeb8c70dfef954f8e39efdb629b72979be208d616071289cfaa0756a4bb5eea5c7baf8fe7a31501e7e2d67d708d461c0c93e85f03afd70bd9e16437171e01a34f475e4b5a58d13ce4e2fba72bbba93403f3f8981e0bbd6a8a6223327bf096c44b36e0ccbf7592a98c1fa67f198b628787ec80aaef848b4fea158c715799e6f458327f399e6420f0e7821f2dc4663bbea065c7bdfe830b6102e2e7193381b9dc7f2381ba808c43b8fdf3addab4b5fa81564716f7d46e0349d9b27b559710d723c7ef2f79eb55c3a9d75b99ae6fde6877b278b583f8ae3cae776b914b0cae0772397fd19b6a27676c7ca02cd07f4b4d49bbe1ec87f2ac7e39e5f7712319c31271dbbbaf4b826af8a9f4acab696c62719f7a6a032c4bcf90922a3c630647b7c1c7b78b10afbd863f07486561a0bc8d9b1ff5fc41998a7e3c604e24af1c1df2da1dd5d83eefa2e4012f7fb5959ef9339574367deff73723484b5a969c8c23dc251a3b887f34b9ea09c9a1838e8aaabb254445d7556dda257dfd5579737fe1dd6c67f3851ca68b011e7cb7b6958d588f143828f0bb24fceca31b47b77d1ce05e75ab05b55d6c9f9107f0c738f2cf8a1629f7e9b2694324e082503937ff8ca7c5098f770289af7d038dcedcf0ed77c8b82e2a9003a6f3db69e14131e144f6be7cf0bb5353ea96aebd78befbc6ceae9bdde97823cdbc5ca8ef8a993a9d9383aee9f2d6a18fc64ab92990672ea2dc9b89ed248aacf7f1a513da43fe5953335afe76d78867a066f226ae9c727c6c60671c50a50732698ef7a492d51998eb6da5368a667baf6d12b77eb36686ee0ca239dc6f3598be0bda79e47f0891fe4d8989df8c685480de11c148a2b44c8a6bea3a50b09be557c51f545a09a30e9362cf3080e6a6bee3dbad370ce24f6c5a6f8091007ca195057fa3af8f99703a601086c2a1ffe55fde4c2c4153dbff8d6601ab68743c0d50d021b0b3099535ba6c40f866ca3ff0df7c19d709a3f58b57b40ab5e43556a8c0c1938c875267bb39c0db6b45840e8ee7c22bf6b48798bd744f70e42fca343a8bdfbd7f55f275ca5d62c7288756d4861fba68d16d842c5b893c1d8171bb3c8b593387d3426f292ace5cee7753c9f9a12e6bb9af5a24192e4184f7d3d191d862d3c3dace7853eaa235b6369fd164e5a7bddd06daa3eec7fe4130e82478d36f88a0999cba1f251ffb3a7689ea2baf016073193898716a9f933448d7ba8e0968c669bdb7dd5e6e32fd84a6ce9e8632b393f9263532ec2107b4c0d2abdf3abb2de2d63511805eb58a70bc4ded040d76640af60ce7f03b9a682b8dd84ed8a47225a48e0b94ea47828f1c8974cd64e5027d8b13d43519875d2bbe4461a7f0f5b5b8d63a472765405ea9c994225806395e64dff88506f7f7f3b6368d769e6e550d4e3e81efb13771cf403e855f75312f1383ce4c2744d0b4e3735a0f1e1b99eb014fa60c0d1ca9035fbc4403330c2fefa8411fb7c3d6ede5b5c8f4736106bbe01923d483a84f031e9685a3b6a70646a2a5059ce35fa496b3f21fca6047471a5bdd33908cc9328de9fb032347c249bf7093390b750696124621dfa67fd9c7fe85d6e5a4d277ad8f8d169f8b5e8dbee280f8443518bd94abc5ca704e781e6cb1868ba2d6fbbaa850326fbfa5a20e4df6fb5f8ee2728e86a758763a8af21e1f7a8584d3f0b09a0b19fe8fcd37bc4fdf45084d7fd92b80544f29aba52496e2c9a0aa4adeb89820be321cfd2f0a53585a15d04c7fe4ec9be6eb5df419e20b71506c1f642df75c53a9e3b2414fe6102fa8af7be3f6c95de824c31fd6fe8ef9d49e26095a2674a33cb574e9e493939bdeaf5b309b4c51256ef71e95dbbcee0a11991693b533f916e1c82ce86d65d89b6d596017fae944ec364546e78abbcbe4322b83e2fcbb4c5d4ccb54d8642c7eb9e28c08598a356a5c46f8813e6b63ec2f3e3bb721b726361f85a734e0514f4e9c4732991ed3998b1ba8f618c2071d1b943eb0f8766fdb7f0492421429bd380deca3325c8d5c7b6ed16429539ae54f1eba39748f09aa44efb67d863cda304e8653ff7499cfad44dc27807779ef8e63be4b376ec403f3c84eda4e5af31c30f9807762e0980b4e5d9dc406cad4e888bfc3ec4186de8ccfcf631b0ba5831747a1c200d45ea06ac82c7952fd09aaae5dcdf5475da427cbc8c1f71ebe5132f2fcae15975ed6fa14a11b38766e1c446894f31c0496b0e5e96507d28e6e4549d6d78841e40630ef306491a1da60eaea3fb69bffcbf192610e2e07bc1124690fea61980e8ed654c5e796f67d26db5de35b4a2c67427833e360ac2a7d4fe7a5ce572144443ed62ac460c1b19402e85c79e3d80e1c143279b20a66d8dcf2bfe1cc44a0f5aa9b0d9b36c46c2cae148dd0f2ffe9a8e6e7274d1832e57aa39fb40553da6414094e838d613a20ce9307d49f97d904648d6460985b01af769800cff9a940f70729fe40e98feb64ff0a81c5b2b096b1a9d832e440c49e4e3684bd17a5169fe138d2544d9806fec027dd2a67f1856178e090f9bb2f9b314a202e7e95f2e41fa80dccf7b1810e9cbcaed2acc2445d60e26f7d63ee4b28e4299e60ea4fc659e7d6f0de91748bf1ede1fdb2acde9482bb76bf6716847eb2dd7517e0a94f0bbf20f248d2c79fa0f518b67a44d5c4c73a9bbc3816ba85ae8344b5f377649da75cf1857d6e4338a76446c48e52cc7bc7ce283d4252f8fac5e1427299edc33f84798316f77bad4a87849e91a1a23c0b7a86898046e278eaaa15ff33730a6d3f885dfe2d1dc0acda2a9e49a71cfecb7dcaa9e70eaa8fe15d4567a280e8960ba49d5289535907e9f277f96e8e652c21d89e81696dd821db5b7e1e53e160584477aa9e4c0e12160c9956df36cce6f4e724dd543827366010ed3d843cdf4319c1bf968a70e9b1b6bcd8af96c9eb0620c569716b7bc42e13251a6adf8201faa129844b5e1d699cafa1b66a674e732c7662b0410e5bca2704c5ebed7850d0ebb825cfb0627a183cc9643b709aedeac2c06700358400c389f99666ae97ccd37f265da7addeb07df9ccad6fa777d0da2fc47b6235179136bbbb409596841e921eb278142a19e6203c7f235bf8461ccadb4b47dd290d36ac27126c808b866f9531261f1e0f5c458a6bab6f064b4efc432e1c7379f9af19ac34c5c22e76e6e7651e48f9ce44eff542f018397889d896cc9001a63e8e455fbe4a9ee9a740edad894fe1af2bb21a1dd0318e28ba982c12ed69c08835ce17336ad1638af3cfe0ea892ab8e83d3f25e6bd98d5e4d36292992e2122c265a26cbb3931dd4c1b0d0ac5ee19974d0dd45777908bb416cbce52531820effcd7f28e1fb2d3d4d826e1b2673e834485a25af9f9d174f566abc3b36732ceefdd91a7c3885e1d10d51c321ff704d0883905b7539309ba5e7b7a2bfefd0494e90e9da7541ec37858ec05ea9a9ec5672b113cd5ad6ebfc5b8fe40ed7c3f17d8a73703dc89086b4d75c5eaf06b840bb2f5b4519a4fb17bfdca9605f17253f203efffc92da96fde023007d22cdad05d18aecb4bf08085c5ca5eecd21f2b611e7e8a0ef981fe7aa2014f5ac6862fab44011dfd33be8a1226943aa7ae5fee9221b0400d9ac2ce5241b09a68cde6b13c47d50bf310ecb37f25c32770a299020d8500d8a4b5d7621e4379dbd6ef34a9aceefd4055ea6144f54bbfedefb5b5b0fbd1d81c7a51a802072ec3d84f34585f22c1df84caca07849b1ef054cbef9b40848e9fd238761df5358cf55a79a53a1bc749e49ffab7c5bd9a28bf24ad5833facf43bcc3852c1e85cfe47929fc49c325c20d74588eb9833519f192243cf96625057899b70a7c93f8fdbfb60d8129d9c43c95f8782ed8293641ffd21d21d91a0b4db69d766f6d6497e9a414ceb04b65425d6ad6c8811da00639dce8d8030038f2d08330c75b0879aab81bfb3330b950e54c13780d308fceed2a103a1a8b77a923b66aba737654ba7995acd306aa7b80f632184412e2369c353c2132ae614553e626f0a3436959104ba6e0040dc597dfbc3602a49e401bf2249699375b2c722083489f54fcdc1f616a133ef6112a1754818158ff78f245b9046100b0e89407f74145fe336976af971c054f12d98002c68b3aa2bd699fbcd71bc4dc071e430bbf694595a951e01098aaa499be2f70611f248a694539ef8936b2e8b7a3c5de8662436fed1f7bc24a4e5c17a663d9a23b4692993301b08cb3bc10f518eca51081c717ec8dfbb0c2669f7987fe6aa0bd98231d8e8b58951b42537f12884a857e02d62de4fda6b88b6b754b1b27394c6a819e0f92f6b2b2473fe245678e252ed31477cc7ec6895bc361b718fcab3aa550fc9faeccfe77cdb5b151ab1db2e569b5bc923ee26f0b6113504d295112d47218140e44652a10af10a088f95c7cf2fccd040fc93980939122411ec643e26e7d69ced3178402e320fe156e774b75b5afc2f3d6b6ab828bb4993b1436faa5728cec34d66f520f59e82716ed6d1324944c3c91d04d5ffc5a921f4716c39de24768484d0096f7d8dbce35aeec22db11f899e5e7e3d57e7668f35d6c0db3542255d9262137d39ae6cf9bcde254dfccc54a6062fcf8982f781d9ffab2df4f49ec04a72eb9646d63bf9e1799bc0bec0ec7f0675ed9f8dc9b8be15d9f2175dfa1c8bc99071c70ad7bedb10a4143fa91c89f54777f84c9eae9361cf7f4c2b7ab873ee5785a5241db0af86f3c6d7f091623d6dc576d07550a42023633a09c8dfa21d7e70cce64c13f37663f75c47921c246f3f2d1d16a8283ce7697da4cb7e016971a2a1d0c59d6202bc18b7cee3828de597efdab53b33a9fb41aa7b49f1c964512901773bb396ac80e90ba1a94c408b2860065ae9aec64a41d76cf8842d299d0babf14d5840d647d075c34175e26a786f30091a24f1ce8db30137520dce1cfffb6318a0d0fdcac883eac603bf365efa2c806eb4f194cae8c16780342165222192f6ee2e103ae2a31dc08a84dfc89c64d2e9ada7ca1839dfff62ddfb7982c79684cfc821a098bc6bf09f87317209b16d14d45c6f38fc99f7bf9bb73460977bb323665d480c87c687cec052a5f08a2c6744c8e177a8a269b4a47a925b9123cd2c014313edae988f8aeaeb633ee5ba6be7f53fe36da3aa37ab2077f5fd75a82a55a0fe62af213b85e9e7694f78cc2b0e63a8c1b89db484722fc62c688678a511c474f0eff8eef1382946d26de00e5c626ec1d7079445c1b7c6f7f05073249b11fd1fb30257724a14cd7bbf451146bf366de2e826fdf1d25705587c4460040ab963e3bd504755b6aa5b18786b68efd3c8e59e8dbd172346fe7f4a18bac98164669d73984044f3c777368f965763742ab86a3720208c64801c796f6e3a1c4748b81e41ac58dcf6ecfa0453b18fad7e3473604f57f7da302e1fa81ad538d4a0280c4ad092007bb9a7a12907227a936871886c699db97d00a1966fdef64d9f3672f1b792c1edadc6781b391c91bea1bd7275f30859dbd1707b1f554e49ceb874ca06e92ab466efa7eeb6990667a27507a7ba789e24d593ea2af8eccb3862cce58daa63eaf212bdd86c01ed471cfc79b191c481ad773d20e821d18af85a7049034e5a9c660357a4c2808b9a6139f32c55c13282b8d98904f4f027d438189dc9487c96172e50dc1100ccc224e7374cf96ea6731032c43fbc9b367a4d1d0b31aa3fa8eb589672e69f1d9144114bbd508d56c2049ecdbfd7b43545375a099ad2885353d8c550d22dbb738e6fe3f104b444c89475a2cc24d7887daced8fa05006c02dfded01c00707e2ad04c41199c5decc1eae34b0c0abb5a5beee1b5253c3350e1a077682767a0b9124a4df2e8879366fd37fc04d4dbcf89883892f46a65ce3aec22123cbe6b3af6364df1f9f5f9751bc8179b6dcc5c126dd65feb7d11a85994e90ab6342834c79c5f82413e88198c73e932c66e3cb60b6e0c0cf438622e5dc5a1036c38afe9cf13559044a9e90f5fd72a3188ef6b1043f5f4e6b40ea51f6235dcb33b3099b2d8c2e02103235f0476ad51bce6d8a2934068549633e521a3ee4c62c22b042fb86c13c8da849233205a5e277aea1129678c31f5c379a71fe08b72fad9449cb923126dd465d1e0ae8a925374149b8248b3afb69f168f3ae701c00f6ea08fe07f1b5338ce6af2f3156ba6f300310114479f2f6119367c88c12c158b84be13b9c8c7b5dd7c90edb5b3ea1fa5927a25ad6d5596992dcd4877f58a134e05dcd80dde4fc2c2a680cc0ccf3084d3f4970e3603fa6bc5a180fcf1ca4241c0b8a1e7c607dc025016e297e2b0645de4ec2fc49851b9374f3ef99edd897c284a67b647ca8c96fcef935d541e9faf334043ea50b99fb8819ecce039227b624e52d8c20003b5a43808e4990da8e4398c4fc172b983351fd11a13dcd2aae5193d42d46e1b57c92e3e01d23fc968c729f3782d6c07dd5a17af2bda96735c12cc7d8023629fb0125e974425f7914690a7ed26508343ae58c8a439ebb6232049a194768d4594f5d65aca37a5686c2a86dd04bef35d74e0755937ac0ce3ebded1c00c8adabf030e5e4a5f44193b62fcf2f1bfa9dca2a25afaf2f1ec06c5d17ef3526d26d17af3e2f257ded24b177ba41c0ba64fd4fbd5042fbd5961a105e0e9f77f3db13c1b6c5bd9a9d04801a5c00a4c544218a21016c65bdff774a44b1d05256e0693e14d76605d67bd10048d3816caf31a6d10886c88c783538bd93e92bbc4484f3388b61adac4b92b911c76ebb1dd11b7b4e40be032bccff610068746f41e34a1fbfbfe5faf57c8a4331008e2c1cfd69f57e74379ac80eb6769f4ce4196795b835201ce4ec85ebcaf5eaaec242fe6695cbce1d53fde5b002e006bba8c8a1ee57da061ceed0d21bdd57ab0cab9e46bf3764d9a6c3ab19736d43b33f32eb955f9174ee4a54666e7f19cefeb49aac7a59b7370d9ae730b7bb4e08413222f0a66bfdac252fb61bcfa838f262312febfde8add8f6843f1d64ea3da42d4ef986498604d65737a44f5a099338520cdbdb65ce73b110dd4bcf8592a4adc3e0170b13404f99f0ec8f9fb225c1275a921f09369db165e9109dd5be472b9bc1901bfd882d264d9ed8d88b4c8f3b35f88b69e3e4b8ef5debb895be536a3af492d968dc1caf31879d672f70ad9869ea98335cf9e4a2760f955fd3e8099e4b2eb4269e354548f9de9921e50e49f3f5cbd63468b9db0cfdf17250c8f13535d4c0a1f21c87967cd798fe93b9b2960447401ef90db22c3adfba0f55f5585ad37040e8d6745184dd536d5a26edec365bd6edff1bcc616cdea3bfc8b9d98c0ef9a626054e361194cd05b2287612399f6d3d3be2f71555f14ad2893af6f60ab61adef663c3c2464ade671dd5ebc71935aad290573588fe6e11f48cd2b7db62e4b9932890d1b96e1b83eff70f026d199db75fb1e83197c937b672613c66ea131f485b4318e27c079b4018d4205484993bf50ce70275b244f2caf47cb47eb2a9ca59afbc78809a912eb56a4bb65cae4694f682c6329c690003a1c355f779b5857a60091b1c3685995a366cb43d753a704d3e59c5f5003c78feed877351e27334b3fdefe5907edd9eb25588a42248b9c4a93efa7cc63bad1e5900b95b70436c35eb85cc8251c4030fab9556920141cca24d6acd3122b92b7e868dc174bf071117958a4797fc90866aca685f1456fab397ae647ab9970348082bd74865bab7f248568db98ced7ed84e8360fa91afde3f23509e6b4caf948349ad9fb6a4efe0a0468302cae7a0f999195af1c19058669fc3b88b2780b9075dc180298498caeb7ba0cf8bd42eb36b1959d5ad3ca6fd1e85f76abd27ec5fb637ee38173ad7d86304d5708b6dc8817e099e77f5d43c1a70624cdb96e4e6103bb25e59eb51d894d1dc533a74005bb79cca35b66e10c61d06b5227fcb071457025d605a0862218ca252b871f8343ec231dbee15688aeb914c0f16ebabe6edb0a489b2bd10d4392c6f1863bb6a62181de7cef61997ab02f3bad0a893cc0cd8a99cd7b3f7773085f0929de36b5d124e3729140c375de9a2d0cd9a360cadf17b9e45b7f2adbdff9e75b743b62642ed67aa703b8ef33dcf51a50edc7dbab42d3d2b49badd2457a9f92847aa6a60ae2beae457a5fce1a9e485ecf907be22913893cd1350f20fc6c81c94be426eaf01864e813a03e4674491b61516bc95d8a77c15f03d0adfc4adc27f27a5ac4165ff6518eda1a5c408708f78a9e26b834179804a312148d4f75f21a77d78387139da40c0a6293c2a59d0162437d68504f189ed970c5abb9ffc6d8e1be2b0877c7f24b1dc273b1765bfc5ce6f4b8d99a96d5b1c92ee53a39f685b304313d909c1ba8130d20d51c824cec420b0315229df295f75b453a6c131afaae0c36d7c4fff70623638a4f7ded5eb7db58d95deb6249a29b171d8ce651556dee8037bf4ca74453a4a76aab7cc07ba44e55de57dbef8542c3851ea353fb8e259ee89bbecf9ce8d8bd6227afc0028afac48a7acd9b4e8cbe982eb1475917ad6be4cdca9cf6e7cddd971b2924f2bb730264801685d387485e41993c3fa0af9987e8b52c21688fd9a9595ad8d1b9f41e0457be18492aa09f69e64e2954d1ca3cc1d32b2915cd9cf6862ca79c80beb47347c4cceadf48a37b29b1d6de4e94717d60cdb4293fcf170bba388bddf7a9035a15d433f20fd697c3e4c8b8c5f590ab44aefdda94681407008ea48d03ff21e9bbb4ae7a9aa37c855fe3537c44106e8079f18c24d2584474bd4a99367660ce6f7e6d7c294961e174366e7babc569d5f80572a21a4bd7086629363e0c9ee2599c8b8863c96613ae6c32cc67ccafc66e1cce79654567ad08e62e9abc99e44d6a79ca4d8de15b7f8a763a4741676af0e1f3bd4e002c8fa1ebfbb3bd3a65ae68a80c230422f98f6e1e9837252e045eafd585ba389958297d59aea1e8e1f665fcbc5f7ff449996aa712dc0faf582cf3caf3dbae80594f9f07fc06de63d9d672d14d7ac4662b4a54f40d4aab2de766910be2fc7f6f679b5708790b5376498d3baf0463dca2f093b51bb7e9f3e7033ba0384af0174becc3bb477bc5e86959a12a5e8924adf0bffdf5e5b9c1cf24d232881ad5c05c5c0f50318ea83d8683339ca6a583c52198c00f7c1abbda282e7fd3b179297338ecf9c923a3a87a130dfc06164e9b4c1fe11d51b382643de44b30a6831dee119241d1b6f84f2484784fdf65e41f78c38e15fb4b00e45df1edc40e3467cdcda351a4c0a0185ac4649e91024377e1c331587a8586cc0a4dfe29e14004c3536d305f5dee0eeb8c2f216c1b8d27375b239f6458e08980badd6d82e9ee9e007578c0a3b48288d9ad0ec3c934a99a8c5741149af937dc82bdb545df26428b87fc935c05f1a4964a8408539f267e23de9bc498e2a4b0083cdb7c8e27de6252bfaf680a6d5b7ec1a6dac6d7d537334a95f1553324a0739414dbdb50445a767b0f589fd4c33b35905577ef5a53b0f097191f9cee4836a908748779941de2a78fe1bde0c2efd9f48cbf232ce101d9df93d3ed40d036ae7aedc3a5ff619abd1c159ca8d2dbda7de13b4ca62576c7f925c52925eae2d7500dc969fe14c0a335ff95a7df1d276a6f242765c781208d59edb5848d412b11638b27ce5a61b8209075976c2a6aae88f6e6d8704fe9e83b425dec4defeeb3cd311b8c5a818d51f917a8a4525361791d5c4fd5d70704d4b9fa9df1ea119882f400e682753a41931712c043c120a98f0fe786a600b47befefc9d64cc5bbe8a16c191490874e258760c9e4fd215bebf848e0b4d35521f53ec5f9308644b785171fc4cc3ff886e034bd833d59dbcacebdae8f00e43c151bcb24d1d226d1cc19ecf349361530a81ba3168af3df5536fbe52b3b93621f57959df298e5b4d3c14928d2ef7b9c977c7dda54242d17f8661978a62d94d565b00abc199790b9b25fbfd4a3ffc35c95ccafe35d9a138a2c24d17f06ae2cc376e822317f16fcbcd56e23f84ec135dc935e58c61b34cfbf5a36cb00350483b6bac786030e5c5045a6b61c9aba7dfaa4f7fb21897539863ee865ae061a77c0359915de3aacb3b5dc8cfe53c4d17b393c2b6bb23652f36390407922969d510cc97b99d1df4361530aef10707d7a021b2d9576b2d49ca88b3cc83ad1baa6d88ef8c81c08f8baaf515637b21ace9d5cc8fd9fe4ca6c3aa129caea7060791d566f4de8662b90f9e5d849cdadf9bd23cf6737b07ca105142663c30de27adcea11d64d433fe1ace84b0f6917c8b655f2a421602f07e0a7127e61ae9859c5e9f652ec82416fd2566f291f417ecdf99bf3231d02864e2e5a1cf34c13f59de9aa2760d8734bbda79576c62f566b8269990e9384a41c1634271acb4c7a8b768f276685c3a8c7f20872e56b683244b1af562c3e7dcf592a9915f44f886cc2ac5f679c07d5aa1fd69cf3a460f25c722073da336a310aa551062d92c7297002060072af2f3500b9310c239bedf45c5e985c2e0d60c7dd68522376dc7b560fb34d1b5089450c32ffcbff07b35a96bb6fe01259a06868d00af697f8bbb238d03d49570a109181c9576c1ea9d2ee02000cc23e63d6c93c6cf3050bbb15b6f73b09c25da62e5abd4c2bdb1110e1f25db39f04885595cd6a388c4726c8d4cdbad87d80d42fcaeae843e2e17f44c9aed25c8f6f9736c7ba1bbd3b839126de40a930024a65aacb872936e446114e706a868444cb140e53d976816983f3dd1d57eeca01eab8211b7aa8ae99d26e35c06ea4b226e0a6e52172a40e7f0df5f67759ae2ee026749ba10b8e33694c3e01a001526f9d75f6c419cdccece3ea3f78d69014e509c741214581034bbc7e2bbaf76db8421154abb2233117a1ffe2786b21424576e295c9baef262e80fa2edb69aff800b3ea436eb827e8adb73abc48d740b86c69d557b16e874038598b25f616afeb4f4a900be7dd0d38b5b6fb4259c51a3aaf4748d7a445f518485ed72b25c7df8ed0906b74bd29bd6a5724ac3a503c990f3697a5db484821f68718470810862728a80ce34599a41fc5bd8bb46dd845a4812ae1532c457ef4211d0e41835e5a6f030247614822571c930c727ba397e723d6b3aeba9244f054e331c82e65b74c9f6504c74b4301499a1a6f6269a3352aff57f88442d4eda42a82ebcf7776c5629f97d6160bffdd8282a40ce2e6375b161e4c22ee53bce7a45f4774aa827e2da657e1a1bc07445f0bbd770b7a5a25b1b469fd58715510dbf8d97af4e1b9459a20b08a8d3fa9d92feb32db95b22d36de0bc8b1c397b09970a6826392fd8392b2d790dcc1295888f42ac81ad213c7328b2324b28be7cc1f4fb8414a7785472f1dd3e11d66017b1756d1697be92490e15f056346d7e9126a1f35fd76cb016fe2841c8996a3507c4fffe7fc45026df10b03b86fb6cf26e8418926a030b5fa62748fbb728fa19dc2f8947468c1477750771e442e4a9d25b76d359211c05df788ade5b7824f8770b5dac0819737dec916ee59b28a49666ee8b7ca81386eec8049542f18a3207e51bdbc291470eeefecac385c096a + +[L = 32] + +Len = 16 +Msg = 43cd + +Len = 104 +Msg = 5f75a437ce0698a7d8151c3fe0 + +Len = 352 +Msg = f88bac738d1e3e10f75e46e3fe026d7e423fdcf3d7e4028b33a291bb4aabca53f780fbf99e0346d610d4a38f + +Len = 488 +Msg = 832e5b78a73a1012ee62e00621db7f4d248893007c6e5d6e0e689c6b291baeebc72df9cf10b289fe20e7fab80a2399271d0ac63766049da875eed56264 + +Len = 13976 +Msg = deab57cdeb41974037a9bef5e292894038264eb4d8993d4d1501e6ef9c68fb0f571f57b0925640925deae9a6317e3bc4d6cdd5a0833e52fb48baca16a9ba9b6c8ca469a0555763b54f04c87d4e41aa549258f30eefe5a52d2ba06657a8773b0842e094857b6d8911d6a0636280025e56356fade362b4bf4c875cc19be0c6644b447be0454dbf390eb966c03e10e9de3487b90d0825d327c12495e3c89ad09c9d591e55c91376fb14c2fde9f7461fb25450df1a65806b65f3caf4d5c81ebc6e664871fcf915b9578bb70ee6776acc62205888dce2baa4024941209e81b4b35f0eda1bdcbd9ab1d6db6140bda4c41776fe675d5c681da5852d50c246dda4ddf9fdd7c5fdfeec85ff6c883c78689c2977584406a1ddef977606c182d6c33561c39c071668a2515e5aa6f4aa1faa392aed95b82ab32b79a15e3b5a07551ab068455131b72493126470f26c30b852e4415e1d8b719b3803ecc336e4facbcc5d1908851f4f39b776bec8b6b9794d47e5965458858560eed5a0305e260240c0849d93a19787b0f8c795eb5ba32be573845256ae6d0b0a3336e42a1beac8bdde6d1b6e0b6207903d4b105f4af2ef89bd099ded870daea2f170e03bd5f6f4490e60bc222d4876e16d4c58aeea6e6c400dbb9e9f4b2b142f0fc9bdeaf4132ded38a4a8366e107cac7210945fa2df4b124be37ef76290e5b9758aa3bfe0091bb0448206323584c2f833e0edfbdc0c33075fc9647a3404ca490bfab94302a0679a1a42fe9fec6af0cd98038b09ffbecd2832b579b2294f6ae5b96328fdc0a0b9b3a32cba04fa8bae3389c3951173bdc17caaefe526aa386f98670b177683d0b804c5875fe9c7afa233ee66349c9fd1b60bb0becf5e1d887e67fd3baf34b4f90d94699d18d6bb9d77d4af358f31edc254de2d6c5fe3ec07425c633b18c1b9e3606b78b40b543e1fd31fb578cf58c45744fc073fbf3c7d7d607e815379a5fc565892d81560eab8fb5f1ae6771b998c592e6d288014f13ab283d53fcbfa66e31a9d107308402191fac2cf2b799c7dae91b93a7676898b8a6e516a86eac58ed8f6d8ed2fd4d38031e4a4466dc8798b90c48e6adb6b4391d47872443cfaffa542b4b132f6c3408f0081af8692aadb4c9bbd55053ea56d8b82998f6b4b41d331891acfe6af1bb0d6679989978368ea463743b514866d2d01fb9950e8990867bc14f1db1142254adeccf3da812949cd03cd1d569e9d0bab7ca7405cc21096e3cd4d007cbb9629372e98584b4c6b97ad0bc314e1ab6ac71184ee555c01973570ed9b115bed956f9e4e349083013098b1e483f0fe44d5e9849f38a2f7ae152b36a266ea1faf263ea8c706632ba8629602187379546fc6b82e57ededd6d074c15c771754710731e07c207899eb47e8d7c72ffd768c36257d373375ffa06f9b3f0af11417f9ff9f9b44e1f1f96ae8aaa429af88b14da1da81c7bb38a0fe9372ed6a9ac6fb5e9e56b82593d94c5192904450227bf040b7ce0904789f979845e112a1f995c849ec3f7e49bd975a474e8201630f40fc0d80e76019f110ae158cd0f8da96ea4561f24237d8e795ebf52368218bff3e9d5b040ecd2caef4ab1e7127e53bfa2b3b4fb74829f9993ac703192aedef79dd9ad24c2c976638b4575afbce22ecacc273ba43379ed55ceeb51838b0adb80585bd1b5f2707ee16b67a7232adf7163415b24b9ff9dc94b7197fdc89e2a90d2b9eccde45e965edd064dc0d1eadabe11b8ec3aad2742b5d3323ebf913a92817749090c20758f98aef2544d4c8b48874e8936d7ee492d5585675c214deeb74fd67c4d170ac5e0aeefa607c6e37abd4f8238e776fde3921afab75cbd8f392d3e88da057903ce2e140797f4a85737bd89455e6aa27c7535687b78cd0ea59848e006c8de9c9c0cbc7a9f5e977be850adc710503ce4ba7c7bd0b042297f518abec6c8ef451c33e030251f506cbc3744228b6bb4dab86877d9e6019a0ea9f39ed37557b3b5527c171da5f013e0d3c480a038cff2c087d6e5d41b17e6c8f90c334b5e2b9ccbe9d4efd99fba1f907d00a49b71b5a08aedb644fed24bcf04e71be67b03cd20d53ccef8f854f5e9f7f28c1e98a8a53496646713bebe15a93f1ea336e6e8a4e68de5dab0fe880bf983eec75d1c5027357f6669e098411e0bc3ea2293138f5b34425f78b6508b94d4c0cc32ee9afaa409a26e5f2a1fddcd6d5ff42a89755a58b08f243957a2e208e24b055f51992ab447bc06876eba169c545fa71b88a0fc15d1e0be9d334a1dd0c86f44bd149b42c07608a9a30d0b7e13574f8d862f2ac72b2ed38904d7cab194fdb9e4dcb615f5610b24e202a36866baccac01fadb575df11dd43e00a3b92fcdd8c7702ea49d951e7dad2a56c075730b4af1ceda2bcb2310256f28312579fad40ff471336ea6a44143edfcffc297258d48bd2ea47efab8f0dc00f1e6dba1a55009ed627b7 + +Len = 48824 +Msg = 5223e2fece634a95e1e7c83ad4a11a0478f4a41572bd66c2d7902cf4f94404cd80b1f58fbcb8eeba3984fd759410c12f8ee922865f363f684df5a8787c87ceb3086fb8535157f7f39653dbf5c66ae7219253838ec77cf1c6db518225c5ba0a8212e5911236474b8820ddcb8111b87320adb82ff553986324aa2a21c37ce4a083c89ce9931290d4c1fea933e31d014d7507a28e83aa917ccae10bed1a490e77fe501b299f8e3b78e659407ce1934d5d68c7980800746f26ffa9794ef1d23f793bd2eab7fe524e213e58280f441ba48b40162305335b3a480c2afeac11c27f8d817792fd7805d4b61224eb52d35c0fbf471bcaede505fbc9398b216f43bfd69b1a669a61d44fd21faae410af58ff95e1c3ff1528de1aba93cef56bff4d714d8c4cc88a4ddcda52444ec1208d99ab3fd9fde98c1ee6437d8d138f62c5f782eb4660c5eb28564b5b0d46e3a2546009148f3d02b837c5284e9f508290270b97b9b29e84445a0b4df662d9711e6b73c11cebcb7120dc427034b1ccf57d8e4f5bbdb84d2e1d4bc3862a2b51931d3c9a7a5fd6ee5f4c7327c338abd011af638d730141b6eafe63469eff50f473262e9fdce636eff4c5663acb6075a4fdb00c8b8a8d3322e1700a5b3e7db90b36c1a94991b8f51657121b442db6f890e208f312466778d73bfaa8cc0ead4edd0776155f3eddf9abb1bbfc0c94421adce83d7ee94f99f61e1f25a55fb596f8b40ccedbaa8e5e2cf629496f5ca60bc4cf36d917da4e2b973eb57869dddc409dd66d5061f22642743fe843defa0b19dfb2f56425abeb234181267b5c0d2ab4268c538510feb191bbcd1631b0af6c7451cd4c641025cd8bde2d9ab6e6b948f97c1ee6f35098d553e8e9da9b4d437125046864633f109d6a558b38b270a7dd1785d44d248a863a91e3db5c0a1d7ec133decb65e81c3402c98ee329f660a092172bf6b1a02491895394ebc506882805a6c93e767c0e58a5af717d950a206c0f0055cb39ed88816a9fe3613d15f608e486ac08bfa67d462d24e6a0a37716d3fbdaeb9c0e951c1e847fb884ebc1cfe707dc6e7269eed1c44331d5957bc4ac9dfeaed4b157204a3080fafb9df8917b8d15aff9c49cdc739b8fdc26a546794991c183fa523d14797e051894f48b0d62c2b70834467ff9c993b82fc1152c1f5479ec6144c7e8fb10d1bce26bd1cdbeec4e95ee073f3bcc3c7367328e30543d371b27509a577f5c79f14d5f687ce62b82f856695af9f7dd350543ec763de75b593f1859e44c2ac01ba65f98743cfddd8a89a38115badcb51a0ff5655f830c0122af6a830aec13ae5eb89a93755b3a5a6eca233f21cb12db545a24a5334becb8fa32c3d7f5805faeaaeea85a551fc62c94807faa6474c0d74cae79b5d8ddae07498fcc5b8b4f394867112ef5fad1c9da66765ecbc7fc0f3269d29c9c38817c77778f2c19b5a3c705fde9d76a4eb86aed4a7369a832ad267312903462397f7b8fecfa8b195cc2316cd53e48c3371ed2ecaa3e484b8ecd2e22b1aee910c51ed5d71198936266f5a00655d82c089f49295feda0a2bcc1a54ec8adf565acc3a8b2d74c30eafbbd843c59e67f293f6d8296cf7b611f01b57dafec6e2d4d411a633918068c38ef47b72ceff1fae772891141c3bc496824509d78165c1e4cd4b4989321a8722643eed69950dc120fa8da3e53c3181f252d7c4cd2cedf8f086f788ee77a98ab5b019828aa02108f49ea4a51f457f7adfd2220d3e59d5f4a29194e8f5eac40ff80312ff6888ff6393c3fc0914b08c1b9990d247ad80a441558db1ee1203e07353dd99a885a7ff5d791af2548815dde0ca1f56f89d39ef6b93dbcd0cd54b854173903c12649587433f0425fbcbddfb66ebce3eb4800dfddfe7fc44d9b23a3916b1db68c187da4dd13ff0157352814b1a792de7fff855761abc6fb7b93b48525fa90fbe3a51dea974069f3f5fdea86387eccee13f58a8eeb8abc6a43fd30e9788c3bd9ae1751b30a82d420225b2abdb1bc121b9073380be16107188d20be54f2e9c658d5b443869ea0e991c496104086290b6edcc1b656adf94f0d42458750fbd8d88040c518ebbb644f4dc4f7c6971d8d60eee0272df7b51a3d5248b4b264fb22195ad891fb6ac994ae5c0bc6714ae0b0b9a484edc576638b78ee89b568195a8f33ed8362128c30f9b0c7804b3ce1355abc96b15aa55c1e16a9e9ec90d1f580e7cb412a7e85d8585bfb950acd4de5865214ce4db7f6314d81784c588c1482d5f28c5fb62e7dd7aa8237ce9396ccde3a616754414cdf7b5a958c1eb7f25a48c2781b4e0dba220f8c350d7b02ece252b94f5e2e766189c4ac1a8e67f00acacead402316196a9b0a673e24a33f18b7cb6be4a066d33e1c93abd8252feb1c8d9cff134ac0c0861150a463264e316172d0b8e7d6043f2bbf71bf97fa7f9070ca3a21b93853ec55ab67a96db884c2113bea0822a70ea46f9ae5501eb55ec74eaa3179fa96d7842092d9e023844ed96f3c9fc35bbc8ee953d677c636fdd578fd5507719e0c55702fed2eaf4f32b35ec29a7a515bbc8bf61f9baf89a77aeb8bc6f247706c41d398cae5ec80b76abc3a5380001aea500eb31b10160139d5a8e8f1a976dd2dde5ce439a29dba24d370536a14bb87cf201e088e5e3397b3b61477c6a41e22a98af53cc34bc8c55f15d7924e7e32fed4d3c3ddc2ac8eb1dfc438218c08c6a6a8eea888b208f6092dd9f9df49e7ede8bf11051afd23b0b983a81bcc8d00f7d1f2b27cb04c03aeee59c7df23a17775ae5984eda788eb2015680ac5610fb1380b4e7d7a9cda6178dca98690449f5551b66ad2826cab2b662f56903fc95b4611bc86f7a834a34ddc3be7bf142c8baa096abaa3cd51ad0c0b6d15e590eab9e50a4c60c91061f1ed6373d91974c1ad9d263110a0d43fd8b596396cafc0ae70b7ac24a59bba090a6994ec483db7ed4c572f723670a11c724e8ffa2497d8fccae37eaa1d14ac1537eaf80efbd2e597b2ffac97f2bc3cd2c4017f170544dfbb0d9109478fddf06ec0981542bc8107a725be25070d2cab4716f4edfad75fddd582ebd363c49e8efaed9a76ee51f22304eebc232a4f67f865b04f610a628fdb317116666785fe8ca30619a07c83cc449855202d687f162b12d93b63af6e7ddfb7223d4ab998a5f450523c1d521ab76f4aa113cc2967e04a38dae07c51c2d0f44fdc8605c3c53ccee91a2c73dade5dae021cbc87d5cd6e5fbefb65335827311fe1e91921ecd66b2055a6102d7a976308a80c44e6d47a67718c84f2112d65486a558f1f269b91d9f47e3e11d09c0c748625bad2718e3674898abdb19d3644bcdc9317c09a3ac02f514b2a57e6a706362e5f6e8fb16cc83daea0eec85fdc8c367d84c9230730291440a4b109f7034d510a3f70a22dd4fa69e8b65e5fdf87045d560eec71f4e59531c7711d4f8917a96e22ad07346d2f92a13fb4569fa6a075da6e1acad1eac1cb2ef19ab452264de2357c927c6dfae6598cbc821eaf3b8da754ce91a96c702c95b2c308bf3a550cbf4d22d417745b5f17d36608feb826b862747c59d26a0e8eb96547a1852f9fbd095f1c5d20721804941d462f3ee2f0876ee2825c8df24c4f00f0844e50588ac688127013df8eba3c971362dd255420649245e880212cb3d732fb82f866dda090040f28e09cf1c86eea5dc4fbfc373eb69745b4afd841ca8e172d4a8510e7698345fd4cab9ec2ca0453a274720bb2d2e5468bf0d0f85919dd762fe3df969e6c071285e25c2e2a49659b8a78289aee655965bfa3cbca9b292a19a855ec40293185354ff4da9451ccf98abfda07f1137e79bc89d688963081dec641a99656b040637402890f185edb28e7e6a2f65848a6af158f90eea440aa6246a2e6c31f5d220b9846aae2027afe5a7caad6dc16b56463367cd9e73bf22a1d6172145de4565ee369c55e3b99ccbef70fb080a3748340fbe8f6b95ba46e8b76de5a3c4bedc37c55ae24ad02267da26769a3a732badac2e0f3a5393028dd54d78701647582cd04c8310e9f1ff1b433125229547130e1737a1f33604f0d670ea7221097c3eb9c7fa4b8293d7b429af76191ea8e481dc1da31344537a09b33404d782eda1d6f5775500c1d8efc615778baf0905d9fcba1806ef986c40b1c6a72335104376b58266c36f5939a8b95123e8635c0c95e80aaeb97379b1179d6332dc07539b595ec32eebd3a336a1128f3cf2e2924db6d8504a516b62f26d012b7f75cab765c8374a3824da5a405746023b51894649ab422d636513ee809fa181d5b6fbc63351e37a1b14efc8f739e86ca78ae3e280f1c9e4824b2976ec4dd308ede6171a7474c7f530128089bbd75e10f9e57ee17408b4384f99f886a5f63a2320a9b90eb9bf692e1fc449171eae3bb1bb17a6ed937ea57af3c82db84e073b5306683e1d63705b9742a085fb802cf5a1639818417fc2223f476c2566351f4b3b17a822e11255f3c3412dd39190e200727bcd3f9799519ef792ec7c2b0b9d0e2dccf013d436dee63483c2ce83c15c00a76c4d894a60cb90366ecf9e61221ee8bdaec66d715159876d8305b35c81f96ab2cd8f81f4769e9a6e439c08c329036f5d2591ac42f2747bc0e77d4e566358a3271819b6003b290211b9b847ab70e906aed9f86cc38aae27e1098fdc3bd5d84e66c45292183f198bc329cad794aa4e430534511b7d9a75104061b409676a16c1146af0a286e2de8bf51c4a35193581a902bd3224cb9257c961989042538092af92644a63d6d6f6872a29aceca39341ad29dd22354812c4b7c7068b039ac9ca7e6358e662a28be001d4aa697ace540cc3ed3c97b98d8c5a6fd3543ae9a7962c9229b14b0b646229807747064be3e83191cf24092dd67f675638d9f6510486379f47f5eeda870a3187946819ec9ed05e7b325bfd0eed5c9a0f4a2063d63c1a8a0a309f586c94d4a68bbe860ae9599ce204c92cf9d92cb460ff99cff9e5a8b3824786360e1e1861e71158395faeaebe7aa2f61f76190f174aab9a313f0bf4f1befbbb22768b8c22719cf3fa9ec908b576fa4bbc084b1ee5b5a7eddc89b58b45ae7b421d38215aa6e49304323eb4e202655f3c8b16ebd6b03058e75a907ee63fcf6aad5eb96c1e5faea81b88b5eee525c4663af52877c0f759432913b9d48030903e7f9f70e851cd4e20bc56aaf36cb02293d992b38b583b8f0b25a08c3303d8af5b1b37f5127f7021b13934645ef3020e5caadc5e7326ed4ff56f797e26cb986b6512b0cc76f1d8e7be44aaa88e12cbc644f14a7feb979d2ab66907063c51e052d0f8b25d827377fecc5111be0d365e08d17f559e3134cb9db294f1cac03150f4232f853ec15ecde55fd1023b58e83934869796400088e9177e85a2227ee45addd049c1d6b03e5b29dd570496fdb2fde7d8cc74fbb5fe76266ebd90a3b4d57e6e6cb9f0bbdb7ca03ae955915768011c714c909a27ee20135927af55d4feaf2c345d029a54af942da6f85f2103345d059f66864e6b0578111e2ddd5a1cd8bbf4ae35b60747b93f53ec8ec64c10cf4149909b102a2b88712ff3e5ba3611cf96585a6b36fffb64b8c37a114d6b16a53879136eb0b5e003a5a068e3e8422a4fc8d7c77227cce64ebafcde2437166b62ccf486660a7a2ef37012ebacca26ecd5bdf363feeb06aee39050974c25d6a564594c67f56fcf7ed48b07fab4e25ccffe002bbe460325abafe37f23dd9c145b4667f146a1635e462330f02470b35c5a2519f1350c02b263201ec9026cfc57d3659373910e878f2b6c1c5be774df8e01e775d476956c257bd0ccdec17ee939c46e5653d5813eda752ba7bbb245a99a5db1ae55d19692074c2e5820df97c502a4bd1b12929e1be8e9ce6d802347c3e9c4202de6046436c05ab55b2fcb2c227adade6c2046d98102cfd0d859a91f8104eb9f6f155da2acf93df2405bf2c083eafd3ec41d60b810e0bdef6298b21193642a9c0c646bc6771a5c61a25604d96bdb727abd5a7ebe4ddb2a56a6ddece26d8007b26043ad44279c3c8ffb7e6ffb3cd4e10ea2780f509a8a9bc31f99a7e66201195f1543a0a020f754d9a665a29a896faf673df6811379579891374c71b2234fc61e95d4d46f15d44bdb4d7c3b3be3f46410ca46827b8cca976d8866e8ca33c4945d5c87b705588b78015b529843af0b75a7e1e871fd276c1e947d896b92e6181ab7e3ccc7077bb57fe85a6958667d3d7a790f6cde1cebb494c2912478a0eca2bfaad62492e9f1caaa0cc520da08c0d2d910cd44255f4c2ca0646dc89e789a1cf9a28e2f99315d33accb1639cbaf0c94181b85fef648bb4cc7f66dc65b8e90bf5f3b763e58520098febfe7e47bddc2d9cdd5e40dbf4ddb8d51f51bde2e57432266d248d13ed09e62f66794d188f9861c50ec41f0eee30f76f4ece250956733ee97036098db41991a4a3eb7816196c8e447db3a2913bcd992174a7bde1f42d57c764b47f5bc09533760c1ba74943a0dca291f2746bc1fcc573f9a22c72a5eca347b1679683fbc8f32b08d381baf67b7266b14b3ba46a04a3ee45881ac452f64df1bf17f70f4cf9fa4dfed9ae70184679184784a0451d2f5c19c02031e0e4957b4df68b4a069a6f6f6458f6d773924a1841ba664a55c2c3187dd33416cd410e56e4bf8d3671cf737bf67df2a4cc4dcc786872b9e2dc4009fea0e48a749353ac053d80e36357d24d468dd595bc823017c015d7450fe38149370c5decf13b00b6b0e0a2567ac08b45f7b0c8a7c89d227219d051d17a706ccbea49a42035cb327381568eae23b5e2a3b7e8beef6f260d24ab224827ca8ee9d640dd23eee94ed02c9e26abb3053cbfaeadbb1f365a24d8769d92240da842e0b361524020b5c9c22a2fd8602dc9600aaf02b35344309f6bb018a94d4cbc9639ab7430657c4046f0b25df517e31626abeedd58c2e19aa0ae1a43ed2bacad91dc04a2fdf9cc33cc420f4f04379e95988ab36731d5d5402d89fb47e826f4243bb206124364d63564a0872f8d2826eebd9046c7c6f2e7c951e49d4b22a7eec89da1fbed890d63ef15f26422185143c89da3ee269f83e1de11a7467822146042be92295a585e3a09e720ec522e1cbdcb41acf5ac45ee892677ba3ff670d71339a76ed98237be252ae21268e756f05ba0b094a1803f9da84a8a05d0ec9456cf565e1b548cae95eafa0fb01f091935e6eff2413bcb15f605f15270408216fb5b41ed83dfa1454c522375e35bdefe54275f109d0ab450636ac4d8e4d9e27f2d81a15b8cc5e98549254a1c9162918db3e399118f5864774a9d6a2347e1315753071eb1204c8bf5f52b1a0da37e484ebbe545fdfe6b031215678c3b83a19a24d7b661f626beb01eb82b384f02f42bcad4f40addd48db8a92b90d2297e6143702056123286617f86fbef4fea940f648867d790b8f803abc5f4e0e3f4226954c296afd96e287e21b7243d05e743161810da578096521805edd81f68a45500f6a3a1885cb1f45cbd399dde024df65072eb973c827fca13eeaa3f140842016f509aa9ab4603d2457c92cc9aef24950697a0044e3d7c483b8d8391886cd50dff8c2f16de3d6caa7f864c1b3874750781b2b78b545a94b4da0b0036433c6561f5cfea50eae9f5645302eef18238473606e9b9931880d0f6368fa9970d1ffbe59c4454bf97f4a5e8091801b53ee4a209e0642d83605836f69742071aaebd9d813b10f4ccac03851ee9f20cd1351f8e68554c9bc5f58ad19d474ca128edbf561d195e52ddf3c19bee3bb597ac2f92143bafc98bc09fbda6d18dd4ff2a93cd2ba17f54f75c32d3f141468c2baef4e53b6a340286dc2599bf7bb002aa86688e26f5b51a6aaf32e48ffd539d4f3f4bbf0cde2d20138151c82384f9ff29a634ab4e0103d93340bb9a7b0caa108bc7fdc88d7de14abb17e9efdad2b0f304f0bfcbabaeb1b9db75959dbf54930e67aed3a9c8309aa90506b6b9ed4f1d06c4ced19746e206e1e9b8879663bf56bf6c5c920ac5e09e6579b780cb63e1875ef0a731b726864b7ae5705a2d6d343a4a213a05928b7337a59f900fd04472382610e2a8d25383c9ab5804d609e79a88d70eaef3ea22d3aa9100fa2a6e98e97684ade9fe90d6bfc59dc9dec3d3d8db8990bc2123ba92e64253235e9b4d682e8aa04e23fb9bb6248a77c065e93249de829bb2fc5ea9e396461090222816bb29bca37bf86698fb995f62c50110cf418bbe2078a56c5f1ec9fdf3d0b09a719ac253b5bcd00932ae058b86611aff51c8ca8448978615854b69b0216a6eb8050ce199fd9a13aa0fd652570a1b187f61e6831b3a960521c3705da8c5e6c64c7b196ed4a49c2912d77b670b177c6458a7a49ecc1ffd8c57c0978d2a05cd1f1c7ac9514dd14b7b0933a52cefd40b6452ca0903df1f55828025c7e18109a6e0f2ab25724cad2d6f57cb5d894a6a508134731e9b9c61254f64990941f4faf97394b634b91860cc6ec346aa666600d323c849ea4c4a0ef55acbc56495ca004f3fca42ff0ffb11b0e1164c95ab89bf1db3d4f575ff334d4e0d7d50e0c54c422eac5ef78c5a3be95f2e18872540fccfb597211ec79d9d47b6cf41e385b9c2e92122167fe584210f63bf919c620d + +[L = 28] + +Len = 16 +Msg = 3dd2 + +Len = 104 +Msg = 3d232201038fe7d846ac1bd4c6 + +Len = 352 +Msg = 44c98cfc71f82215dadf494d68d1d6b92bb4eb81fa0fbf945a659d9aa2c2302b5c93fd3eedba31e479e29d36 + +Len = 504 +Msg = 02a5c7b1b749d6d49bed302d9439f23ab83020bd4d573906f4190e74216ad33aceab775f71cd31092bba5cfa42f0845bd16fc1b8bed6434dedc92f80b395aa + +Len = 13976 +Msg = bd70deb2cafa75918308d703a6783fe9dc5e3d21de9bfeb6dbb1cd531ed5dafeec463a02abde302d4ae6ab3cdc2f0f94865e38339c88bde507ff71bbea6b30b9851cd8cf599e950b8c8e620c90adccba0033f934ca66ea0a936afdad575bb6235099beff1a632c9114a8045a0919fdc21083880eb05c0d8c489c7810aecef4a41766f67c37557e28a9db9a0d909c2b167ff7eba79693afd3ee3aeace38eb73a5a02a882cf89b123812cf2a0f6d5edd1d14362ce9c43257474def5cce3adbba8cb48e7af9a45e702a182dbf47e8869b3f99e953ba81628e502c60d4f8ffc551c31b3ad6ca85c52164839d5e9d493deee4d4b76604174bdb5655385d34ced2c1b09dd5a486e1f9ac501bc611f9d7aa5c748f496faecc14c6c18e1dfc6aee2991bd0207ea1701219955a751df43dbf66f57904675a0e9e6d7f9a0b8bb82a8f44951117ab2642d6671daf1e5d1639d48aff6a05781c2b5e8976653b0a164445872d393d30355acf0bb49bf2bed4265c9a3b786249afc7a438d706eadb6f90a7f93ad51bde6d2c8e6ff09dacb3dc67ba0d3030c54c8367e1e4280bb5903274191344610de61c3c770c6820a6cc9d826f7c743f88f13580ba23cfc00598fd733b5dd069bde7f10f2b8961c16b69761b0f308dd137f844a67f6054e065863f226141755b96645a291e3fa3fc853b2475fbe1d3b25ca22f4da4425dc95fc855e63d6699b311ebd5fec1c7753e6e81f747c808ec3f618f63eaeb1221075edff0532225c40ccadee304a8997c03920e7ce4e60e4df4d120611296786516dd4d9cdda2077ac52bce0fdf552e1ee89a0133f1f87a6f6f35f5c53958ed806465919a0a5fa42488bf29caf33a0dd469e13abae351d5c6fb1a800ee384da199c823c965d9d5457a3ef8292c4d9b142e3f1fb502da498eb44d95f8c85bcd6871bbdbf004bfdc09ab35758f5e8b6a0d0f366c3b255333c52c8fcd4ecb4536b5f6e72897649f3415443612d72c3436505249a344feeb04883f41f90ade40af119014b3c56fc108f1ab0a77087d9226665d416cd975e9e4605529c032e8926002a70924820c6c7e264a794b2a3beb63d69ae56e017294fad4d611cbd0d3847212a38f22d623eabe3b884a36464d8814286fff52c4dd366f6c2abfc2eb865e0dc9ec6e55ca9d81f1b8cc47e2629bb162e54655bf2a9e156ab0bafb4b8ce96858aeea6e6665607a3f268036f4890dad759486b15e3c9e791429ec8f11bae4ea7c490656fdb0551dcf0b0be017c08bc674bd97d9d701c3ac955e2941ba7d5f2ba122a6f0c1b164b1caf2d50df111fd4287e9e195d181f6f514d7dadbefdd4274edc234025b727680576046842a834b6ad89eccaff5c5209bb91d652357e3750d8bb0165572fb71d09fdfc60f6b1e5d868c67c0edead427e7aeb734e29b96e03ea174b6b1af523feacaf6bd745ceb1bdecec9251958b7f521182daddf62ff6c4f58977adeba81c616ff2e937ca4f16eb9c44e63f9e974709122083ae45524ff87d7a0cca33a90f09b660db0efeb393c61967de2564315827ef1cf42b71c0f822f471713c9d885a3c3281d7c95dbc96f1c6dde0af70ea11232b00a2d215ec8de8fcf84b6193b6ac9d46de660361aabed3371fa44a6f32107f3854262eac355f9ef98701f580b4649175cefc29950e7a0eec958f629999c4b0a98fd4bdaf5c0bd97c963b551f2220bd41ec00b8726836e949e818a49aa1ac5bf12c64fb9991111ce8be3e0cb9605f753dae1a4c84389416f17fb66cecba45d591b22d64e5a4edcde067a088d9ff7f5dbb9dbf324510000c55d50f480a640fb22da9b4862dd81080d61af9560b601edb5e3346263f5f193df97079a27e3f9876078b80ebdcdb17ca4c50aef0c8329c72a7f77584cd963e105eea9c28a2ad4e95c1d018e27d0e720ea59147f59ad796b80b6293da8a55ed47e8abdd37221db0a5eefff31688e2adc294654ab0fddf9c1ffafd4783f01eb539492cb35a77315d0ad19395f47b18298a7b353dcf5bab0b2f193ff73d99310478d2e5c4ff1c68a2493c138818edef73caec9977bd4eda6249c8933953e06d796b288f78b18c343ef561082fd03bf92b084afaaee741de3004abaf746350048294bc52450e31147173f2da13d6ffc5adc718e149f9df3702f414dd3ee88296ae8a0106b071b589e8696401da7993d58a9bf8e5bf417165498c96b4ff5fd2b45bbf88f551688425122a3737ca54b2992fdb4d60957a93097222c3cf4c45dabe18b9d6a69e6f27567d5adec489e4b6812c29a8fa52f1de642b7b0e749c16f54473ed5ca2fdf2199e885fed308fa62a3e0deb7e0b8e439e25b3e9f95d755fdcb7ebee9d73069dd57dd1cdc5145205882023b54f2c9dec6cced9e3f6d24e8cdbb8ef121b8f3eded574d81908e867af5ac82bfb8ed60848b4bfdc1d998bae3a9ca80c1c49601d11a40409c62b1536f01ca67 + +Len = 48824 +Msg = 5fd54472a44e4476d254c0940071ad42dc723354f76ba61f63fbb9df80d1ee56136f51b6982e66c1da83602fc08093506a9e2cf27cb92085ba5c627dd63f59f8850e91a1d86cb1d4ca38ad03160f3c584b128d9b21e935570e086d3815307ab8df396cfa0c100bf6cbfc0fd7a8258fa1a656bc178e02cfdc868540d8e5ad39dd46794a8bdc205e710555ee7421ca7475a4f3232e6a0cd55d4b5d4525f0bd7eb1e455931aeea6918b9fceb2a32706d31a6d7028a85e102f228417e2e7db68317ae155af70eda98c8dc1ecc32a62e294d92855354c1114c5735a3c81e551b63a81650107557f3237bf953989d17c65a0fafd2bb1e32c237f98f55389e8f8b0810e97e201914c487a68403c6d621a98ddc515780435564245d87ce462b8785def699f7f06ebfdf33dd1ed7dd5a3e781348298c7950a387bff7d1878731d7ac66ad9a6607f2c3a3b6843c2852a5e882a8d78ae9dce2a79d595cdf09626dfa6f1dba7d40ed21caa29e304e7dbd559a89bd1f07d84165dc259ef112dc6e2c5a3e82b1c50106983f6c4965c85073c5deddbe6323003d56abb0df590f69010981ab3407e43eeaa29c6156995c492c931fff1b686eda3741a0bfb9094747d1620b2580415d431ffd6c02245f6cb03e39f87e82834dcea59355b2ba663ce145d2514e15e2b2c60cf518ff510c6c3e2f16d2dc523832762ed8352a320462ddd4d6fe755350672038163d996b44ed3b85d64989291bdf39398cb996de785b9614ec5d4bd73efcfa37fd4470b17d6240b8e4c715759286b04c3d7d791e2689927c9f18320ff2e6bc7306c805e23a5de66eced5f1a630cb43dd46db515f837f6b824b99b86c10b6df7fcf22d97be05284edf0e0be597b3f9c63556db031339f79ac9e6c5f8a1cefdbb4b30f5bcd23c2a4dcf791cbfdd6460284c5af0621ab7c5571e40a87c87be459c85ec81d746930dea24f43bb11d6611ea83409d3bf4f987778d8eed1d5b246a2112ef78ef0252f9ae464810c13f02359441d289958b4766807d9a3be0054897d35b01830deec1151f9e3d42f92b80f4aeedd65c78c6e98afc562a3bcf6d72f238c6e94a38f2288ac7929a7a61c92875c1f115c0ed8d261a727f0794f17ceaa3dabc717478f6ce7f2e8b295f000241e154b4575bfac8483f6b62f9ef4e18f7d341a65faad5e2fc1ddaf2b09adebc155ff09e63d5aa5f95206e66c7f4ef2ae3aaf3ea7c93589efa8c552df8d203e0ea181c1703d7023b56e603f33b4adb9bf44f7af290d8081210f327a6c9b0785709346087fd090c42d2b8b2711b9a1a5173eb5e246320ee27867ad6c3eadc4407bada44561a12cf5d53bf0448308bb536a8a525eabc1410c3a34becee25fd6fda453251ec229b53751f2280e142c6b331daa659ab655b78cfb08bf18e40bb02b7f1650eb2dd4ba1707f0aafa219f21c29521581ce249e2e34f5656b0a04c00485079b040e13cbc038bb9f17f47cb8f908591b26bdc28538d8baffe4cc39b17d2ecffbb9698bc2b8b31b08424034c051b535e0cfdf07b7a0a54781e33ba739759991aeb72c0ed992cbe76eb8ec0ab12c182e8b049cbadd6e82e314f1bf15fef5ae95dc86bd64b8556766f8ff62c33492198e454e5ca59ea856d8e095c04da8045522abac865506096ee1cfa1082af08ca09b3533878ea3580b6c0c57a615e0ab768246b3eda96bb6caa01a2648068e21959f843d853e948588e8c0bfda364ef1f9fbd3235c27916562eb0214891eb55ae0e059f4bf7d1838b5942656c27899dec6d67b823a981d1e1e0aaff5323b0e3d69a7dddf9b12d7787ab763a3c7a2697ac65b655aefc4bae7e6444850ad2540d5193b378682c77a4dbf9aa22e517e68cedfd1ba32e3730ecaa2e3f6ae61a4f427d6e69071dd62a9bf6c860980c9d23ce1fa82a1937e6dc1ce3a2de096b680d23d89ee102912ac0bd769c1c02095678dbb00b4430428797cfb966b2f901480811e1b9cde358b6d499c9e93f0961f050465d7b0c70d4961e75a9fe40a24e36eaad27238231dae6d0a17f446c16bce7348e669be563649eba9f23be29adb8b10f462780a066ae573f74e51215a26097b02469c25180890e06acc53ab063c742e08d51359b0a39749b84b9f6be44f3ae3da8e5a2f340a8607d4eed08877d007928d332d6f49502bb5f416c46d866fc87477c58a22d3c5932a8d6298c1151daa032c84ad92f8f90b8053b5aa6f690d1bf682f314471cbf200f3d30959e07adc6488dd17b0be5279e727f3237b8b4b19b31a220dfe63882937f8d5ead677608c42a57217f2239614c521d94559290e3b0ed8055d5474e96564224f6ca6389b40a71337da11e1c307dead8e4eb43252cc2f1c49addb18781cf20acffd3db693b02e5c8ecc949b51b99005529e0149a13390615f5df6e0bcd68e1ca82b0173d25134dbf76dfe92daa085d3f6b1e4d18217df41b70c4c40101884c2886495f2ef8a473bf23cb47ab6533c93cb38c36c6dcf6837f1272fc91a6962b6e1386fb643e1f1d71fc75ab58d5800bf4081217cdce0c7ae9e3d25de543fc4444314f32067eeb147c08c55c5c8158ed11729837547f28a300eccc312260215f50e98c4e3d4170208a50a4a4def1243538f906df8476b0c46d3449be73866d463d422595300e160840daf8c906ae4aac13a64457853b0ea6d8c32f4efe3b48c0b1450250086d459648b0ab14fd3f341a4a803be77e56a811e7a26827eb0a1a9454f90bc6ece665904adaa3cdeb2c4847858fd1d79750e8cd45d8da9163784b8bd06629410502debfed5eca3cf8fef0fa6bdcef6efaaf35a1986d6fd68e0f436dca9442077a4818ebda4606a94a3c93fda46e7ef5ccfef656896a0d3d93566b02ed8c3f6174417cdcb99a415b0c6e9816d94e64b438c295b4bfd69e0d9ad52911de5509971b7370593160629b641d690eb2828bf363857983e3b9098fcd15e66448f786f196685d2ceaa251b17ad06dacd614d9fa78ce0a8b9c1c360b529d0bc1d17ba0b70ea8ac1b8d67f6e5770f0cbaee0b38109d26b09493060dc851f5fef121e83e30aab9c3efc2b8397e8362aefea1708f7ffa14d3656f7f7610f3a629bce14648a593250c6f309c02c6c552bb42984ac58db920dbc7d98f59295f37f3e9b99da55ef074ed65801b390366669b4c7aa1c483ffd23082793f9e5cbe30c34250f63fa3ea2cd097593dc67e8d27b7e4f07e73a9f7b33a5ef6962df1381a038d4f58fdbca9d71ccf640b917f631b75d4a2e8ba46c64a6223f99cee30f47c1a935dccc7f054fc39d3498c824e10cc3ee337e781a3971f0e98295aca611bde701c2359858914248f6bafc88232bbc27bd85883b00990bba7862fd7a7cbd4c86df049071fcd10d686613ec877758d83927cacc530bed9a596b5b21c6fb748c379d676de7e05719a867c9f934b5dad99ed97dcb4e70a9b6542ed5b2f086d9f56fc9752e788785ef8f7837a31e433438cf2f18f58be37fe8412f6d21a5c35000a5efb862926700079413f76ab2c3e79e20b516eba9d8c29897097bee55157936607cabaac41337ea4cc783c0809c875259f8020e16d5045fcc39ac796d11a82f25fcc9579bf0a010200f5745065175fdc15474ed514cc796672c59637c3c8f236cfc9c0978a3db1194680c58c27746090d76ca09f7c48ee4ee7e1d3cf0ea70dbbbd88e30e8814b57404dfd7c33727a0c84cb7bd468b0bcb3c89b526679c00fb0892d2a5e7a3d73698a3db53fd7d78460cdcf24ed22b5f39b8c00b3506541ae4a5b76fae29c1cd5b0f8c3ce142e0af7ae4efe3fa4c438a604bf4a9abb41e3fef1b9227a7dccc3f4d6026ca289b4b1366d9ed546abbbbd5677c8d582e79e2b544f18dc23809ab753313d84dd10fa3ed2f723f0b46277b8877d4f3e0665e88c50caf0f0708b746b736b00c8c83a7d18500384bd035996aebb7da8f09fd6af9b76fde7fbfc0ee854d7ec02950e76abd23ffb27a6ddf1772465016c79b98a61bd3940547b207b6507e32cb9761a5604f0f546834a8edac7ae06910045de218d761a4accea886188f947b57bd876491709028e2e24b075d6b022b51af1880ca16a8c65b7c69e51b2ad580ee058acc0606f0a3a9ea1cd4342bf4be602e941dc4bef1239bb9bccbc8098a6a17d63186c6fa75ec44b6e4fd38a3fe49c5eb995f0cb884e2f3ed6be02515fa605b98453ad935682c3bac6a2971bb68f4094cefeeaceda92dec803ccd3d346f8b40b48f8f489e118a17367801e85c79e9b3bb5d73ac44a8290cdbf83a154f2f125090d42e1a1cb72f5ebbd42da46c7a4d4b9fad9612a4c800de6467ceb74f831e1395dfbf5799a3429ba34754add4b34b5960a5fee8f752dae78450322a1ab3d7102b77e907fc1eec5355991e0c7d6c0866660e5436248edeb1a37c0e769a0764cfbb6354332d6e55103b9235c84eedaff918af3f0213c435c32ab409a4b5c7eed8ab6ca9e313dba459bcfa3ee92e7d669be0526856ac3c06a57fbecbba553a9cb4655a901d98af02b74098e478076655d325bd7639d73d7ae00c62fdc361a997ea4ff5b0eba33096b12f35cc7cc0eea62950b912b47c11b9fb386a47c4c15c0602d304b2541da889cff299a1fd415e7e25c70ee4cd83feea7e6a9c50c75d9b128458513d61ec5d0299ef8c090472fe0850f384938ed44d36f10cc2c1d31daee3f946a2fa18f9982a988fd6ac973b1569313ce3c8ff5746c4dd85a241f1e9dca0e904c091832ca028533a3e34c184edcc510bf22a27f530bdca3d057928a96f72dafc73a9aa6dbf2552598e468735cc5736c67a620e9455483e9cb2108045ad80569582ea93a53b491e528c8df336fb326ad74317bc1dfb8ec30a73af01a5dff3e437b7fe48ba5dbb3e8f01ae0c6fc28675a415f23a796bb6e0ef0efeb4b14cf20d4ad88ad1966da43a76b454dac8687bdd97b89b8f8eede91eb34ca4a0523ea65736ae39341fb32b9b716f25662a37382c16f3b9c346c84f03bef54acd6efb364c6401b07b3f7679e8e7f8c9b77b75e6e98b90f4df88460f1978d19744eecccb743a999aaedd00b5a94018e9d5a56bac9d5d55f6e93bad52e84aa7340cbbf98d56213d9dd3e1970867e3972dc98e61b3cff40b64ec49463ff79a41c82dbbcaa37a82b761f432849aa83a3d3c9a209e2207b87ae9ed9959ffced165fcb0d8873668c3cd8f18ba0f92f7acd2bf50416c22ce11692bf6132eb9f558dc789cf9776da94e48cf48607f19d9a11d5df4db11dbaa67a1d20e9f0c96f5956ee3f906e371c489efc88b0c1e56d881e7bf8dd5d6742622eb873e253dbe54f2e2e6d0e6136941de8c23e9a632727bb5f88c23170316c7aa0df28d8d07589dd6022828834f7ea9b4e5876a1704944aa3186dbf89e0e81767cfba03bfb38c55a9945209c4dfd88272c49d1745dce5ceb40f0a6713b5139dc2fb87a8a4888406d2610b7b910a9e5782ef0df719028d8e50a40a269dc9bee12157038522d06537bb31fc87d21af9ad4b2e7e127bbdb313e0a116010f65126cedadd4a122d15a71cbcccc346f55100e354b997154567fe3caccd50251d137c58fc3a2048dd5883b6af9248b51040c01a80c051b8a151a8878edf0304b5554746d6116b749221a1d0082ac925e6e140f0c3b6a180742ac8a50ce0e93e6399102f151d7c14000369ff52d0b537fdd51bec99e7271b1255c6fbc36d83408c417f6825a8e2a58b9054ab2c3ead69d97ea9947fec32d720653c123ecf51a9a3f0ed88743e3fb7b94aea59d0bf0219ee50825ef220554312cb907edb90e4d85f29e316ad57d3b90d859391fcfc63e6c0fd3ec27d4e1efd6e0b5ca8165cbd6af25ed8792d805f27fce308ca1d51335ed5d727558dafe05486a6f9149b8d3bc022026656714222830be582889e6800c0b170e48ebfd069e711210e4ac7acf07652a6f5051507de68aeffc9540cab5cdac84ceee46059ec23820c04b127266c0bf8df0d2b856be3377ab42592f495980baeddbeed3ba707a85dba64fe36941eefa8fd37204ec8c18df3852febd2b142b1c9a5cd0f9e424cd408ceb7788270899fd793db99ddb8f9ca8df550c513790d8bad37a1d1f4a62c4527bb64c677462c9b093582decea70c7bbe873095536728e7ce05d5cafb5d166a1f03055e918f787fb244c5857e3d7a1009bd37f30f165564a082c1510ed19bb1633811a76da70dac67641c2478c6b335f409ef54a2d0f370c9510d0aabae3cb998bd023778375cbf9cf5ef125afd584c11efbf40bb51839aacd3016e5e4d79f134245f952dbad617c78cb6f5712bd9c0c7e1303db5029640cf9b56e29329c3e6a9e0a2371aac1a437b9b1c4477ec9842aa80eaa22c5eac11b60c661de6ddbb088e844293ab8589c13d938765bbaa44301e4137148dd0257bd4c8c766c5d3bfe53671e9417cd1b52f622870ffd90f4e17b7a4ae1b5601a2edb032e353bca652fb565beea6fb0b2cdcadac71794c662677fb1dc81d116d94f5eced526b37c004b95284cb6aa2ac415754a1f14882595dcf4d3f1d905c6e8c12cf5a9d23d3ab55bdaf9f17d2f03f933e1bab89040753648c426b072b73aee8c2fc0d1c03fce2c656e20d4c96803fb2ef471b912267eecb4d6f342d3513894b94d77767823fe0c7438e51f21bcf16f0e98b94b23a10760271281cf843989824f7061bf834f93fd8d2090f70e939700dcb4d8964a19da39a9601a7e0ed9f55f567fc7d5682d55a9ba0e68861756bb549f2f17c10ff6bd2042a80477f89743d3d762f1dfaf230bb502eab6f4c46b26135ff3bef5faa179bdfbd288e3cadd3d88d8012706e19b7fcc6e9cc2699d3ba0e624e715599480d6b7dbc6eeea0d12a9236444b17285fc7794040dd40c2b2ef175f7f3641664fc9bb7ea6d7eb3489d504f8013d64a23aebcb5ce233405f5ade067dffff253f27e926431ad806703e8fab23656e0b7431916d8d4c72a7d831e3664e5f30839c76c8167b76f3b2dc75a6ef48df515e06ea54ca51de2fd9c5eeabb1610b7eef06a2f3167859cf82e1a5b76be8ed8beee2bba28c3b15af6890d7a37226834ec9f63306a0da11aff918753d8b83fe7220803c070db98195d6d18357233f5504a6e3bd6f30115d3987f93aa5d89aa0b8b577d1fed94da057a6f088233efc0f44f86798896eae9ad0b20c8c9cdd9d72a3f02213f6797800894b864cb44fed009440fa5b0197023929f9bad16f052cc2d87327788a68b9209f46fb4776b092d75713048b5453ccd699d19cafa8e9a93fdab0f0863711916efe3bd81ee71b8e0221e12e9ffe2f6ee1a4dc1a8de6e593480f3c05b3691e916a4a7ca51971eb2f0f693dd10f6b8468f8cf7bcce285938b5a0a76ef86acfa2990f88bdafdc39a065db17b845028ed2b7a9e331c44217de20440e406868f1eca818d0be20248c2948b8f4cb118b2e456e585949139270f57c54715f3297bf714aa7c5f72ed8ddf6a074703ffbf95e45bc81a02c42822c22d2b718f2de5e03d687a4b18d605ef5ae75f9d43c8cb4e77aaa0c0101d978120f29574b22f52783c667f7daab3e1f9cfacf2e68e94a24918e3fe2c4f061deeb64891b5217fe5908e7f389897751839982b7fb736fbfb1232684e93123611b7fc8fbeb74f8815b5ae13240051920f3b6ed34483ff673c467ed7f0a8fbf619796e485affbed0697415d2d0598ba34d5b9e44ffd12a5edc323883a2e28efe9baf860324f2d2016748503eac1888213926b0e0f0335a4b51820a2bd3b42d982ec6ce307b453b6385aed7a735a1e98479394147c40f01c532926e10e1b26a5b395bc150ec4b4daf5b1436bd0baa225583ffc9d9e9d8a354f60fded37b41c7c051daea04e689ab2d4e24d7d07c75c50ccfd6a527e024d1632246c6f40f06b86ffec0b29cf894b665d53d459226b93422d37a8da23587fe884dc3c0f2fb55dea296a9a5b9a0d101f186d9fa6288c912202547cdf958569d2cbf235740eed38d10b0025dbb6de31058e98780d22149c19d4bcaf06dd7353fd91cd1f47e47f45622e1472542be2f63f463d253617eafd4f2ad609f9020884905dd5c22fba53ccc619104b6c0203a7f6c8c26fc80ff6fceb8c0c51600c2e46b4b872e6d597511524545a76cb42278b519d911e6c1320e01682c551e204ccdf91290c52e0836167a5685cbb1af338eb794c10fac92950f3f7956acf28f1ca984e380bcff9876b0c71dc7ce4011d1d0f955da9ca885c6e7bb74c6194dadb0fb9146dd725c8a9574aaf3824b727c9be3fce59c35850b162c17d3013689fca858a0a51d81cf4f30d6a8705bbfe35ff03c34cc7c56aca32140d72c8e8121fc71353596b777b266d75b322c9a97fd2c5d4e2362f19c99de66da7bd9c495c03d9a15b28431a0c051e786fa80f5503a72519e6b419263d72d553d688349c0cf30918eba0622b953a0efce4415c29515c26ba15f00e548ef108afe3f8194aeb965e5e4be94f10df6c45ea5c133a8c3398d09fb80f950b83c1866a1637d2bcc195e05cc32a9233b244cc2b1d4930e66f032cb1163c37b3e58b576ab76de759569797fa9b8bb4fad66aaaa56f09c7a0ce4641d6799d7bb47cf684990ec1e08871458c211a353ccf1285e7429c7b8520180918f7 + +[L = 20] + +Len = 16 +Msg = 8a61 + +Len = 104 +Msg = 37487aa02b03bdbc6bc62e7e26 + +Len = 352 +Msg = 6ecd002568bae3bf1873993041bfa292eb94e9ad092d8eb3585be82e8a20cb36a47a06e7a57d301268a4a533 + +Len = 504 +Msg = f6dc1d2f6b8e126d99939664693d8709513f97d730074ec2794e536d94ede79c81f2b2ecbff3c2c26ca2d181ada2c60050997f3bb087ce48d956c18dedb227 + +Len = 13976 +Msg = 07a6372c863c7d7c6764e4f05addbbe161762735dfd2d23bf268e2d603cd28de9c369ac379390473e1d3fa7e37af1178cca54fa0f782dfbe68070952b93462ea46c640d43ffe71f5fba42df98f4c48ada0d8aca8753e0731508bc15dff283178ae5c10a6ff132eca5dde63a78d3ac94685152897828eb25a55fdf140fd33fd4e7b03f283e201a1baae8986d25603fb0b2566aab345fb48031d648144dddc2e3556c0ceb1104f348d96ae7dc0152e45c625d21b46e70c31f250c858aec4ab2cf5e79d8c79b0854e0abf5330b9f044113d306161968f4ad6f0973160c9dc296056d5a11523ea2b56fbce8387070fccc639ec1c65ec663b9dc49aa880dc4ddd3020c9d44ff7e8cab6266e436af19b4ecb82010a0f8f9469ef380034a02e3f50051a6a3f233dcfe9d553459dc1bebc538ae0183448c9405c351271dea808d908480e61e9793cca111b4cfb9874b799626a1bd9a0f6e0929ad51b97ad81b2438f5fc255db3a3dfec9f0d8393c6b245b03d3faeb58021db3ad391b17a91174a66db4feef1b4c889699bcbea7928f4d29be2d47f76455c8cb1dc7da9cda41962a28ad8cd7b39965b809e7c7eca1c6792c1ce1c8a4cad6290170e91fcc49fa5ff64ab433b4aa081c8da2d9bbb072f9f18ca455469b946c877e3006b34ffd2219335b30ba2e0980f43cebfb629d0b11fe70dff28883ca012c6ae4855fcefea20a08e189eaeed7eb36ed6db3835976f4e60053205805727c5eec15d0e9f155637a9e66268b9c1c302bcaae6ae88cbb8cf1668a487cc996c4662c4a4e195f094cb31c717165e0e13718f8388957dfe0bf69c70cd0bd763dc38c530b67b9c12244fcab8bd13f602de848a2937699f9ef77944e5f22e3b470601789e1838fbea9359c733aaee2c7082b02ee459b7684ef9bbc200da4b62d368351f5520a65ffa506dc9b097117bb7ae88d04d85fb525e91327689ec0fe86971480c0e864012b1e9f044c7d80a4e48c07320dd4292086e4c71d4c98dd826a9bfced112bfa2beb1ce85cad204451ec45703931bf637d4fe89fe8f485620b7f4b21e011a232ade7a8c92be77925e878ae0bea9723749528fe83cf89ecb9616dae6ca0e8d5754ec6c92abb21108c2f33cdc18c6887c430b72c5b193356494cddccc577bd4c2cd53188f352846edff0c2ac7869cb74bb16a77c0f0f194a7a9477ae15abb890bd0bcfeb0c39381a87f1d05319c7e971c10e9ef687f96450b400e25b4285032892b849fd5db8649cedfb03c88defea063ee144a1ab1f3bf05f59c7db364dc39c11a446c3ce16307d78d50315ba29f5bb9a57438564c8c7b3e367cd37d74b2375a4966f47489dc5448f4979428abd32193d3840aa983d3020a9f29d760fc7493ab2576c90b1934b799c1d0d55e4f2caa78f4ce61930c79dc017c2dea0c5085d73a3b0e4a6f341e9a5061a6658af11e5edf95bdad915ac3619969e39bee15788a8de667f92f4efc84f35082d52d562aa74e12cc7f22d3425b58f5056d74afcf162cd44e65b9ee510ff91af094c3d2d42c3b088536d62a98f1c689edcf3ea3fc228d711c109d76ae83d82d6a34dcfbad563cf3726519b519fd48b51741aa86720836494b7a589c778927047a25d73508adaa401e9a6c0767a675e31c5556cbe35fadc9671359b45e985c3c8af84113989b299ae4474b85e4b5d4b0578ab1e8a2915a8df97c4f52a639fe32272cb91bbfb721505dec46d51383cb8973425a714245c2e37d0577fbe0d66381d9239db1f08a380cf609dc699698e0fada2caeda44d58d766c4f8214b10642b80b8d7d8add7cc41d47108ab7d07dab71069a2d982cc900b331caec317942122158bac6eac9175c2dcba0c04443aa9188832b553f5ca8c336880824d6bc02486a2b4c086665d276aafe3b1b93729829adca50c44466fd5b5cb977aa78fbcf5c0f0da1b09216468a11493ffb39efdeda5d669ae92bee2f2fb250aa1b9cbb11c36c7a6c6dd26cdc3cfd572ffd8c1dd72a13c27a327a34c6b6b3d80fc6c67c72152eec0c8ecbdc1bd5cb829b811e7f29af6d786f4e93dd4c96fdda295a6aa258d7b2fcf291c2d68e0b1866032475964ec0c6f2fa8c2d6a3936ecb187350def4e818507bf157c0e9b33406be7660605af14cccc9c799b4e051d0d0899e53495bb8931a6e2984bc6dbe4e02ec8b4642fc2f1cb5fd5a5520b48cfcb49e1f9533838753554dd98b6a1b8a67409279df477330e5f37367e06247ca5c3ffefd00e693dcc0c9c30754121c9ee88a574915b9e77c104fd2f921c2c096573951407ba9b440423d76bdc6fc978237a6e302cede7f99038ec31500884775556941f1edc30e3a417b0e02cb6fb5bfbe5cdfacf4006411287bedc565fb06f1be987416407dc852254934df4ab59edce476f3506e65be6ce6ddf91038642291fb8e92ba5b1f0b105670905a2c14796110bac6f52455b430a47b8eff61 + +Len = 48824 +Msg = cd8490c93613bdf1f284b94b330f6d6f45a39c651d2a160b340e2eb696fc6d1c35e88872845190d141c669de92a97daa5433b1d7b0b899fdef2ce74b8fe72a7296a5b5be26d1dc86520367c730c7400c2fa06f91ab4c48a7bf4ae35a5b9acd5296c4fdf7451b0ad9cc439b4e34f11e5d7ef2bdda376f8dd34d6f092b219dc085dd4c4a6308b8808f588eedbbc7af7f64e83182fc7ca7cf4741a341060a7969d31445834c982fa8739ded4555108acbea1666a83da17f77cc42ee73323eb53203e3b790f81c08e94c44678b6538096ab7b09916e6cf7ceb2af85987f8e4d982dff1ab59b0bdccaae1f405a73366b5c5935dd0b43e2d2894290ceb66a0246dc02de728c5bba30255fb56ce8107c3144246c5156a8fe40ada9126adf67227fa56b66c37be63f532516211ca012977b04a97916f201f1baa2629eda520b51508ab4229df2ceedce406dece0110e0a911464f69e7be38fb91deba0addcdb3161d2799c628f5a57fa1dc37357c947681bd9c36f4832c20ac466c0c245de3b250c33282ea1a02d007f03b34ed427631283eb614db4d521f555136e7e42b4cfbee8134c63dbe3bb79b5a8b9f9f5b9f5ac61cfab1c54d197f1e3ba613f251eed616df952d691b88a16466343ef2d0f63882ddd2d55b8a6786308b2257f5d7b38af166bd7f1339d2d8899c9eda8fa86215850ba547450c267eb3c9147d96c38161a69d1584e521ffa23384313a1debcd37f72ddad02adb3cadce7ee34b7c1f42a15d0d030487daf9488aa7562845a11ee7ffccdb38b300935caa31f78a4ff3dd93403cf0c6a16ca611b58c736aafd33d6dc56f0f47878211d26f6ab801b9453a7f74b44593dae0f047ddbbf2c902891111729edec44f69a05944b18e7a601f41ad24fd6833da3dbe3029bd390de7c9841b2ee2b079b2bd2737518fe1bbec88da64769dc36e4a8bf716c219b2fe059d7dd220c1ed2c59878db5bf8b198e0689edee921ebc0cd2d3853fcf57c363050ce58071c5fda6ebcfbc1bb62e9eb956286291a108bdd4191c4ff47900d6068e1ea26b487649af119b9bb15dfed804836f2196cbe12d8fc86e3d7ce89b52ad49dc9ddbce5b370f73f512bedd853039366612453733740586d1372143b09f21dd4dbe1a2bfc308db8e4098c5e4b0c1e16141ee50e85fafefc4e2529b3c7252af37aee6f86e19df28871686107d7d57dcc812bc077602642d2ecefdd5f694b8f336913210793e4068da2178600b1f41cffb5221c9b4b6298afb47e85701d7b1a44241679d8996f916c81ff437261cfc358b9ec42a2ce16ca3bacb8690d6c1d91cfb3e0bf1e7ba45bd01606df856fd03c7e946f7ab371a89e1fde86d05fdd97bd7b1c583b04c2ed2b5f6815a460645e4e1b4e950bf6bd81dd0352d1048df85266f1696534aff5b1cbc17f15d82cc8e0c0d4f0453f9439094f8e0f7f4bc045b654d9a2f1f44a9c57019f63ecc41021c05b5380675cb56ea8bb691d79ee204d2c4edacde3c1fb3f4996a11d84b035f965e74009e2ab80e2c7ea3c84a834d4971a1e9cf423e4ea67ee526eb3c3e4c2d7372c4290a0741e1fcca5ae4cf36705abe98ac81e98a5419baefcaf3093a7e0449ef1021f88ffb7ad21b2677e41cdda12025b06542c4b2564f15e0b99db43b7c7020028bd829372122cd910227cb07c53cb58fd9dc620c0491f3e2bf883fe6ee8cb1f5b73767977d857e4513e8b5612f6ae4b56014e6a3ad2a065b65472212e2f611743484cfaef860999d1dc5608c58412fab888ad72bb87dd9b55b692f31e252daf8944ec5c02a5a9c23903c50dbd845f2fcc3bc9806af13ca7b025cabe675195b1d56f3fe7d7bca12530bcc0af217efcb03a218bdb6f9726536ea902c8303b02e3ced22be59753588b5f0e2f3419fa5345a942dbcdf3010465384a225ba26cdd0f1d74999c69f336bb6d01fae5cf81cbb8c1a7a29c1eb83ca6b51113bde56b8cfb6a5d72557622a37f039d090a689accd02b57c691174338de8e05bb3620c079705c969c58e56b079dc9eb44eb0fcebe548f5a31f4072a5ed56a2f03107bf40a359b2601eddf53cade66f294cfeaa40a0d94b9c90d15f61852f295d3911f8ea914d015885c8c64540a83badf0021a416c3e37b78236a2ecd1fce4114033416bdd3a36c18ec13250ee9c74c0fc4dd564b3d24a825802d5ae402a53bacace115ae3bbb329be79d1e5e42dbaf0a6446431145fe49b86a8703c7c41f8985d54f12e314c16ff89351d8addf66ebba2783f2d1a11965182aa0b0dd2de53586c5a695c6265c2b173958da648611090557bdebf11a1e042f089fe98e049f4796c60d26be38356fe020d9ace9008410d53a1bb7db78b52ee44bac364213f5c59f1eac4e3314f3423b92fdd7a6156608111ac6ddf58385ec1f3df12061208db98816ac948d803fad10d5ece2018c60faa13de5e5a9033745c824932e53f4122a39f635813545c1b74732cd55642f19ed6deca1585ebf7242c849bde981572a2199066e9c912b2068c8f1c8b936c43ae95c6e22bd7b80dfea05f495d751107da5928e806d0af905c87b5a0795df146af6580d8f9c6a0e2645686d43822ce9b4be0bd5937c097917e048b5af71c7e7521d490f107e9231ee5bd9fbf0727ba87774ed24cd52f471ffb71849ebd55605996515bdcfe95bb1df3541e7c42da4166dd01ec3597634aa6455d15fe14af435e8d7a55ff1682d55a2da867ae63d11fb3fd987fa5d7032ecefc35d3fb9570940e779e13da18070e6df5292f97f2a281f9598101102c955fe4808a2319c85fdef3d55b19e05bb8c2d3da64bafb67a53491513a24f6f0804aa162c8a7db25b38089373fecc45a0eaef65dd9be3b4b7f9436a5423fdcdb5a9b60138fc6a2261225390d9ae0d8ab7f0f7ffff69dca06881d33a637d634358abebb333df41151f239add91abaafc89070cb2159ce3a31655c22e4696c9fa7a7211d1251d4bb21ea4a321a3dbebc29d97f526251e40e548dcd7ed07587719a266f006179dcd22e50b3705152817057b097b043ad63b8d867edc20aea9b4c959ef4ff70f47128cfcc21e31f17978ecacc366f459ac1cc459a3976e4173ca322675f84f18036119ec2f204c3fb554a0b72f7e9d8c882ab147b3d280ca9dff7b9160b1b437b901f03cbc05fe05c6f44824b48aa8da52ae7dda1653fd500f9ccd221843cf76513b3b74d094f14d93a00d7cb954bc4cf2f04f9a35e38edcb1e84f62057647dcb3571f1dd296ca1e049f1746a8a282e85138500e7649db756b2d2ad88f11c471c89dc6be2cd43481013b8d0ae83da2b855cea7be424f8b2325b1850d1fdef03e765458df4513d57c72ba9751e1edc3c4e7f97e3202bb46eec7be89871ba3704aa6c6fc08851e551a3f655fa1fb798d12f003faf31c56b6df399a5dd0ed29ef9e4139dbc254bc5d6051840a859eabaaad56324588fae881fd638d2b70fb3813402df61d941ab495588e5fc3823249bf9a03cf877902394f512de118edaf98843a5445e9073fcfa409df3db0221f1c77e2dd21e74f9e10c9e180dc4ed17010eb949c6d67a22bd5337b2c68f9eccdec778ece728e91353696b742c8f5a3a569f054efb8c1ed478ee9b75e26c768a5816aa6bd08a4c72e745fdb5deb34ecb86b3a84346c1c70f9c16fc45bc0421f0da2f630912d5079f390cc53b78e343310de722b53d2a3b4aa386caa0d7e91986e19c3363426ba30eb5284293af81d00158a3f5233327b40c3b989725ba7dd5b31ac7abf8d3e0b737e843065cd7316dc2f374a00bed4cf9caa0d6e232c854df1bc24c3d484bc6bcb14ec770d5745474dc6ac3b3ddbffc551c9fcc2c56a5e0ae17948457c01e701bf1554022bc2b7d9dd42b2b91172fd85e6874d2d61fc7b3bb3cee2a9bfec09f6d7e98279c6f511f4140b116c856c1438e34bca59fdca2409f025b896a52d68719bf93e82e7d89bbf798991fda0af8d06d17f39eba4bca09c1fe594b537ad4c9b94ab52c895539d639425f9146b24b016368a638e5bba391bc8763cae7c52ff9c496884f1d84e5e08ed451358ecb3c4919dd410e82cac35ae744078287c05c89b42999ea6b8b127d40d53a5722d45139e8bc507a11e7add7fa9ab12cc40afeec008a4668e3e6440f27bb5780936c0e3668ac51262390c79b3f21fd041cf36ba3522f3a552714ff188bfd554c60d0e7d11213cf7d3864a5175d4047c2f3284741f18ec22995a5b82bf62190151bc1529c6d9927f9b0c1dacebd9c2dc406f7f64a973f9a70cff6e3abeebeb46514bbf2ead382f7262d46bd43d88c1b91a9011d1f8ba81fa536a7162aee2b2ec6fc0f2d6efc87b98d2e41e0f946969da659c21053775ece415a34d42b6cfd5bc52259867b411dfb991461ca618052309ca9c96468c2da12dfab0e822ff3bbe7ba281982a239ac19c47024fe1f0e3550cf0975add1f680a9dac9b2c4ab0aed4f409ddda6765eb8a0a9d1e9d07458c69ac8195541219b18efcd06c0001f2ae7fee2d404666a18ca3cb3aa4f0623e86c5b1229f6c2ca28d951111294b91edc52730b6b2c46e000672a7c89b2f38045bd3e37dbb8a75e18687a514dcf740c87a34834d3c3cc8aadf6166ec0c42d2be92f90a3af49633ff23cd80848ceb57ac550eaf9ae496bdc6a2d7cf50fe107895b4a1ed014f78af24eccd6a07420f1dc0df1e7c44b4ba937dd43cab9c798371b148325578d61931766af02b45054bdc2d9fcab2f4b49092f6fff7c27886820739d6140a4a905f0020249e8ae8dd87da1a1e7b1851eb01045aaa72dc8a2bf68055e7aed41d85336648a3405195d2ab61b0e29a770461f32fd05e14c17d72c5252f026a7b9abe7ea9176d3c46f6ed9fb716758d97b41e4f5d81a24538f763d83eecafafc668422612b40cfc32b3354b24755fbe400a2bfed494fe6d0ba0051713b776e67e2f1915e94708e6dc74b398f2f526933aad8fe7dc32faf40022606aebb6e0756b994c3176fae7640ee06d6c67bd54764c4752f1bf831f43e0227cba101174c5554ce26400f333dd8e9f6db1cdf670ce407d7d06c3aef4c0724b62edc8f1ba3e04f0e394d15a73b9255abb4d6ac70303dcf9160d32dc02d4804219ed5c7e3b48402e58ab2f58305f9bb95d2a8759947de96328ed5234cfe7d0b2a9a014df7e4cd0ae48906315f139b8635d2e6bd4aba32e62b8906cdfe5622c411bf0373d0cb07d17bb2bb5b83eae4401c243605fd1df759fd0ddc704ccab5a9776c40fbf6bde0f11b9646c699f26063a9550ac228c9884c277bcadcc0a2c225dc203e28e253c4e464b23d2529d09c7b7dd3c984667372472b615645f294c4e3b0797f9d1c234015b78502d98bfc04f1fa2f16cf3e7221d5794d035e4b172a4d84e679cb1c82df2fb49d3c6668eb1661bed56705096c2371a19d668832808eedd9e5b1256c18fe7ccc494e5e29145d453c553ec86fb7f3a634d0d45661875f2f1005ba5e734c1a976f37cd23450e4606e32d027bc9ec2edd9395e14b2082179bd7b4f9b8caa2d00a2de71d48553f7d4153cb56a1b08f11925e4b11c9281744ae9171f3d6faa3ab3f88c5c34fd23e4f6efeceafdcbc07686ef56efa62c0ad62f1cdcb4d3b5bc508c1f05263bc347158fa5495828f34eb7fcde98fefaa82bafeefed3f4a58968d751c051b52e0047f066de5be533bc3b1e439ab1c8602f6c67503803c8fa113737cb8279f358dbacdf45432b7a654d0e1122cca93420e956661d7275181c75b0d9c20e84c7007dfc49f27bc00007cf4ffa631c892981fd70141d532fcd51de5c23fe0b7a186d0dc296362f235d61698740cc315891cc9342da17843bcde274c17e462263d0e8b4832dd9075a7bbb443d4b26b41e534ad5551ed5ada102175e695363fb48d6b99ac978a3aa6f405d87f983384ce35740e930491d75675337c5dc081e3d301228e61bde5cc169968e5b4350cca2b085f9f75cc4b88497a78cd0a0073d90246c7dc102c7cbf3516498e8a41aa85d8cc5bc285ff66e8338e85ca83fb6889e2bccff52059bb9e92e92c155a349952680ffd0a3c346061a53fdf074417fc90c4d1af7c2acc3ee4b080752cbc9455ba5931b7e910f1e4af0efce905d2cc9c685923ead387fa532c0e8ad92719c76c281cd010e1acce500ae1443838b8afb48af032069dd07aa4df0d56bcb70a64592633699c8658102f1fbca441325e27f1732a7a973d8cb3a0684d72943ef6f1892f2d7ccf39bb6dfe5801ab98653bdbcfbb787bf125253be2624f6cf44177d588bd7b780d9e3f4e3a4e50b8a253fa21abce6a94b9073289c76773b46140f5a6e46b9de9ec066c176f5d1a69f380e1901216617363362d13ebb26ad74fb008ec08841550ff14ca800a1ecf2e007ebaad9f4e0d9664448d60ac0d8544243129fb81c1723b9b4bc2ee971dff736d9fcde0afbfbf5c50a4cc06a4c363998326c17bdc9e2508651dedd9a2a52bd87f8693cfcff60753acf9716c526e8635f12377e36564ae55d0fdb3c7997ec4dbdaa5b4d18c7b660acd95060831795da7d299a5a8d8cf9e92537dbd3ef7f56aebe38fa97c41da6bf0572a0270be7e5a7dcc0be3529339464c811052b65a938e874ea6da469c7d8992ce0aff1c75e82d1621ecb967213c65f2de582cb41de3804c507ddfc708ef3f6096ba4491e431160f98de806d0f334e03cfb7a3bece601099bd971253f3aa0df845da8b478603d5d88533d0cab9c89f2dd9a1404cf8939ffdda652a94093865a85fce2bc3d7babcff7b9f3306bd76b9af80c78ad518f89ee73b7a710da604e72f4927be8d65d06be2e0732fa786a83e27597cfbed9bf98df445499e0746b9f2cb9659ac0a9cef433148521f33b1d78d13c8441c0d1e20fd93ac450a3787a2292bcbd68cd1f961d34937be9a21abaf26f361bf53aa0c095e53c51f3e04d567eabe6e40d96a17c2bcc9230b18f7e079bc549a314b4ae21d30a3341aa205bc75c7f1d21b0a49549c300faeda243d0ce18da5e66c5b663cd705005dd9fea0a9564174abb797d64c58fdab1fae44576d514b75eaa31c9278b15bf9b6df7c6c2873d7a56fb91ab77b83761a09f9e1ddae535622fb87f7462256a60dd39dd3ceb6690b0272920b635ea639daf24f95462c523e5bbd8d8407c61163ab38877d5edfa04c2a78d4d240523ba97c7d01c71783f8748e85164b4dd08c25506a4ed18300b42b7bc6e417f512ae456ceec2ffc83190991a06d4a58ede215babcd3688e1d61f1975016244e80c88ae2aec05c7eeb1c50caca72b3b415b6b870bf5e10bd1ac3ba6b4acb1d1afac554444d94c97e171005fa4ea9c651bb4e527ff58d0c2f90fb453a92d6546a26e9e98395b09e8471bdcf2a145aacb649708cf048a7856ce8cf390c107ff2c66efbf2a76c5b041860ea576103cd8c6b25e50eca9ff6a2fa88083fe9ac0d1fb639c516b9bcdf23c34c6145a705498ff9b9747f15e1c08c63da6efeda4eca02c3f00dfec06c82220c9de840040118dde76be788daf84e6a2f44c81fe6defcc474f99c51c4648d297cbc48f081e0809dbda505d020cbe865e430e0491644ec8c52bd3ab8ce8c4862990f49fe2588caf804ce9500ef42d5a50c057c257168e283e4a4aedbe4ccfaf3eeffb212f9e23d15434d60bf4f455f512e2b655aff3225d1b217c261110cec0400f54dd303d6231d028c2eb649bccc91d30a6391c88bff9d447c3cf35a3467be5957e0ea4d4dc237c9f2c68ce48f658f820a3d72d559b60f233ce538c92cb148808e34fedf2d648c21e7f2ea29a77270c393bda42d869351d6c085d965dc12cbfd0311b8bf604f4391d378781eea3b5f1e0da9d0d8f8de88e56fe47d362cd46f591d3ec0f7cccb85a21f21ddcd4107821ce0ca9ddf99dfdfd9b0c9cd45053e5b1b4385bd8f5b227ada31b5c23e9420014474e8b4494fde7c38edfe70994d97b8cbdfac588df49a49c472fcce78cccc051f31cbbc1e0422878d8d490f3aee28adf1587c38fb7e7d1be54abeaa83cf54b633803a5e669ff4295df8735231ce39631616bd05e0e31117c722c2fd6787003b0bc7fe422a089c89329544e085d71102c1813769450a9f66f160d1702cdb17bd2c6fdf0f722762d193ce83623eeffab17b01b10a31db6e2feb6eb3abdbb2e36320e1a56e44e48d26090afa7f65003a98cbfef590ac3ec89b3eb230557cf6aa566e841806aa2767b21bb26fe001f11ae039e0c9a4bf1bf3d271960f16158eb5bd9ebf0080abd8369d512cab2d1aaae2b14d0ff6ee705a38fb0c801a98b0624cc138fc24834fdf430f33e1760db913da3290f34415c9e3df3e97da1780545ab68ac5a24db89f24d62f4a399728e4144a8c89f47ac2d29e30c49b0bcf790a5e3d3fcd1943c6a28f37251d9dd827a69579e6c17b629c927473b5a07b0a29d9562708d6c8ce576109ad1a3473ffb2047eb069beeec24c114bef392c929038c92abd0e6a19b610e27881361824d57008b7373d0ab76379570ded76c9b8284fe2c247791073c29b2fc6fca05019220ab92856892d3c0dcc6da0b597fe559c162d060d71513ebca050d9638164b9ae271fba5575ade787ec5aee8fc253d1b234b1df561db3e36ac64b9b0100dd6b407043537b2b141f diff --git a/lib/libssl/src/tools/Makefile b/lib/libssl/src/tools/Makefile index 52a79704552..d675b5792ce 100644 --- a/lib/libssl/src/tools/Makefile +++ b/lib/libssl/src/tools/Makefile @@ -1,5 +1,5 @@ # -# SSLeay/tools/Makefile +# OpenSSL/tools/Makefile # DIR= tools diff --git a/lib/libssl/src/util/checkhash.pl b/lib/libssl/src/util/checkhash.pl new file mode 100644 index 00000000000..c61fa721780 --- /dev/null +++ b/lib/libssl/src/util/checkhash.pl @@ -0,0 +1,222 @@ +#!/usr/bin/env perl -w + +my $package = caller; + +if (!(defined $package)) + { + my $retval = check_hashes(@ARGV); + exit $retval; + } + +1; + +sub check_hashes + { + + my @args = @_; + + my $change_dir = ""; + my $check_program = "sha/fips_standalone_sha1"; + + my $verbose = 0; + my $badfiles = 0; + my $rebuild = 0; + my $force_rewrite = 0; + my $hash_file = "fipshashes.c"; + my $recurse = 0; + + my @fingerprint_files; + + while (@args) + { + my $arg = $args[0]; + if ($arg eq "-chdir") + { + shift @args; + $change_dir = shift @args; + } + elsif ($arg eq "-rebuild") + { + shift @args; + $rebuild = 1; + } + elsif ($arg eq "-verbose") + { + shift @args; + $verbose = 1; + } + elsif ($arg eq "-force-rewrite") + { + shift @args; + $force_rewrite = 1; + } + elsif ($arg eq "-hash_file") + { + shift @args; + $hash_file = shift @args; + } + elsif ($arg eq "-recurse") + { + shift @args; + $recurse = 1; + } + elsif ($arg eq "-program_path") + { + shift @args; + $check_program = shift @args; + } + else + { + print STDERR "Unknown Option $arg"; + return 1; + } + + } + + chdir $change_dir if $change_dir ne ""; + + if ($recurse) + { + @fingerprint_files = ("fingerprint.sha1", + <*/fingerprint.sha1>); + } + else + { + push @fingerprint_files, $hash_file; + } + + foreach $fp (@fingerprint_files) + { + if (!open(IN, "$fp")) + { + print STDERR "Can't open file $fp"; + return 1; + } + print STDERR "Opening Fingerprint file $fp\n" if $verbose; + my $dir = $fp; + $dir =~ s/[^\/]*$//; + while (<IN>) + { + chomp; + if (!(($file, $hash) = /^\"HMAC-SHA1\((.*)\)\s*=\s*(\w*)\",$/)) + { + /^\"/ || next; + print STDERR "FATAL: Invalid syntax in file $fp\n"; + print STDERR "Line:\n$_\n"; + fatal_error(); + return 1; + } + if (!$rebuild && length($hash) != 40) + { + print STDERR "FATAL: Invalid hash length in $fp for file $file\n"; + fatal_error(); + return 1; + } + push @hashed_files, "$dir$file"; + if (exists $hashes{"$dir$file"}) + { + print STDERR "FATAL: Duplicate Hash file $dir$file\n"; + fatal_error(); + return 1; + } + if (! -r "$dir$file") + { + print STDERR "FATAL: Can't access $dir$file\n"; + fatal_error(); + return 1; + } + $hashes{"$dir$file"} = $hash; + } + close IN; + } + + @checked_hashes = `$check_program @hashed_files`; + + if ($? != 0) + { + print STDERR "Error running hash program $check_program\n"; + fatal_error(); + return 1; + } + + if (@checked_hashes != @hashed_files) + { + print STDERR "FATAL: hash count incorrect\n"; + fatal_error(); + return 1; + } + + foreach (@checked_hashes) + { + chomp; + if (!(($file, $hash) = /^HMAC-SHA1\((.*)\)\s*=\s*(\w*)$/)) + { + print STDERR "FATAL: Invalid syntax in file $fp\n"; + print STDERR "Line:\n$_\n"; + fatal_error(); + return 1; + } + if (length($hash) != 40) + { + print STDERR "FATAL: Invalid hash length for file $file\n"; + fatal_error(); + return 1; + } + if ($hash ne $hashes{$file}) + { + if ($rebuild) + { + print STDERR "Updating hash on file $file\n"; + $hashes{$file} = $hash; + } + else + { + print STDERR "Hash check failed for file $file\n"; + } + $badfiles++; + } + elsif ($verbose) + { print "Hash Check OK for $file\n";} + } + + + if ($badfiles && !$rebuild) + { + print STDERR "FATAL: hash mismatch on $badfiles files\n"; + fatal_error(); + return 1; + } + + if ($badfiles || $force_rewrite) + { + print "Updating Hash file $hash_file\n"; + if (!open(OUT, ">$hash_file")) + { + print STDERR "Error rewriting $hash_file"; + return 1; + } + print OUT "const char * const FIPS_source_hashes[] = {\n"; + foreach (@hashed_files) + { + print OUT "\"HMAC-SHA1($_)= $hashes{$_}\",\n"; + } + print OUT "};\n"; + close OUT; + } + + if (!$badfiles) + { + print "FIPS hash check successful\n"; + } + + return 0; + + } + + +sub fatal_error + { + print STDERR "*** Your source code does not match the FIPS validated source ***\n"; + } + + diff --git a/lib/libssl/src/util/fipslink.pl b/lib/libssl/src/util/fipslink.pl new file mode 100644 index 00000000000..a893833c5c7 --- /dev/null +++ b/lib/libssl/src/util/fipslink.pl @@ -0,0 +1,78 @@ +#!/usr/bin/perl + +sub check_env + { + my @ret; + foreach (@_) + { + die "Environment variable $_ not defined!\n" unless exists $ENV{$_}; + push @ret, $ENV{$_}; + } + return @ret; + } + + +my ($fips_cc,$fips_cc_args, $fips_link,$fips_target, $fips_libdir, $sha1_exe) + = check_env("FIPS_CC", "FIPS_CC_ARGS", "FIPS_LINK", "FIPS_TARGET", + "FIPSLIB_D", "FIPS_SHA1_EXE"); + + + +if (exists $ENV{"PREMAIN_DSO_EXE"}) + { + $fips_premain_dso = $ENV{"PREMAIN_DSO_EXE"}; + } + else + { + $fips_premain_dso = ""; + } + +check_hash($sha1_exe, "fips_premain.c"); +check_hash($sha1_exe, "fipscanister.o"); + + +print "Integrity check OK\n"; + +print "$fips_cc $fips_cc_args $fips_libdir/fips_premain.c\n"; +system "$fips_cc $fips_cc_args $fips_libdir/fips_premain.c"; +die "First stage Compile failure" if $? != 0; + +print "$fips_link @ARGV\n"; +system "$fips_link @ARGV"; +die "First stage Link failure" if $? != 0; + + +print "$fips_premain_dso $fips_target\n"; +$fips_hash=`$fips_premain_dso $fips_target`; +chomp $fips_hash; +die "Get hash failure" if $? != 0; + + +print "$fips_cc -DHMAC_SHA1_SIG=\\\"$fips_hash\\\" $fips_cc_args $fips_libdir/fips_premain.c\n"; +system "$fips_cc -DHMAC_SHA1_SIG=\\\"$fips_hash\\\" $fips_cc_args $fips_libdir/fips_premain.c"; +die "Second stage Compile failure" if $? != 0; + + +print "$fips_link @ARGV\n"; +system "$fips_link @ARGV"; +die "Second stage Link failure" if $? != 0; + +sub check_hash + { + my ($sha1_exe, $filename) = @_; + my ($hashfile, $hashval); + + open(IN, "${fips_libdir}/${filename}.sha1") || die "Cannot open file hash file ${fips_libdir}/${filename}.sha1"; + $hashfile = <IN>; + close IN; + $hashval = `$sha1_exe ${fips_libdir}/$filename`; + chomp $hashfile; + chomp $hashval; + $hashfile =~ s/^.*=\s+//; + $hashval =~ s/^.*=\s+//; + die "Invalid hash syntax in file" if (length($hashfile) != 40); + die "Invalid hash received for file" if (length($hashval) != 40); + die "***HASH VALUE MISMATCH FOR FILE $filename ***" if ($hashval ne $hashfile); + } + + diff --git a/lib/libssl/src/util/pl/VC-32-GMAKE.pl b/lib/libssl/src/util/pl/VC-32-GMAKE.pl new file mode 100644 index 00000000000..b5bbcac6c2b --- /dev/null +++ b/lib/libssl/src/util/pl/VC-32-GMAKE.pl @@ -0,0 +1,222 @@ +#!/usr/local/bin/perl +# VCw32lib.pl - the file for Visual C++ 4.[01] for windows NT, static libraries +# + + +if ($fips && !$shlib) + { + $crypto="libeayfips32"; + $crypto_compat = "libeaycompat32.lib"; + } +else + { + $crypto="libeay32"; + } +$ssl= "ssleay32"; + +$o='/'; +#$cp='copy nul+'; # Timestamps get stuffed otherwise +#$rm='del'; + +$cp='cp'; +$rm='rm'; + +$zlib_lib="zlib1.lib"; + +# C compiler stuff +$cc='cl'; +$cflags=' -MD -W3 -WX -Ox -O2 -Ob2 -Gs0 -GF -Gy -nologo -DOPENSSL_SYSNAME_WIN32 -DWIN32_LEAN_AND_MEAN -DL_ENDIAN -DDSO_WIN32'; +$cflags.=' -D_CRT_SECURE_NO_DEPRECATE'; # shut up VC8 +$cflags.=' -D_CRT_NONSTDC_NO_DEPRECATE'; # shut up VC8 +$lflags="-nologo -subsystem:console -machine:I386 -opt:ref"; +$mlflags=''; + +$out_def="gmout32"; +$tmp_def="gmtmp32"; +$inc_def="gminc32"; + +if ($debug) + { + $cflags=" -MDd -W3 -WX -Zi -Yd -Od -nologo -DOPENSSL_SYSNAME_WIN32 -D_DEBUG -DL_ENDIAN -DWIN32_LEAN_AND_MEAN -DDEBUG -DDSO_WIN32"; + $lflags.=" -debug"; + $mlflags.=' -debug'; + } +$cflags .= " -DOPENSSL_SYSNAME_WINNT" if $NT == 1; + +$obj='.obj'; +$ofile="-Fo"; + +# EXE linking stuff +$link="link"; +$efile="-out:"; +$exep='.exe'; +if ($no_sock) + { $ex_libs=""; } +else { $ex_libs="wsock32.lib user32.lib gdi32.lib"; } + +# static library stuff +$mklib='lib'; +$ranlib=''; +$plib=""; +$libp=".lib"; +$shlibp=($shlib)?".dll":".lib"; +$lfile='-out:'; + +$shlib_ex_obj=""; +$app_ex_obj="setargv.obj"; +if ($nasm) { + $asm='nasmw -f win32'; + $afile='-o '; +} else { + $asm='ml -Cp -coff -c -Cx'; + $asm.=" -Zi" if $debug; + $afile='-Fo'; +} + +$bn_asm_obj=''; +$bn_asm_src=''; +$des_enc_obj=''; +$des_enc_src=''; +$bf_enc_obj=''; +$bf_enc_src=''; + +if (!$no_asm && !$fips) + { + $bn_asm_obj='crypto/bn/asm/bn_win32.obj'; + $bn_asm_src='crypto/bn/asm/bn_win32.asm'; + $des_enc_obj='crypto/des/asm/d_win32.obj crypto/des/asm/y_win32.obj'; + $des_enc_src='crypto/des/asm/d_win32.asm crypto/des/asm/y_win32.asm'; + $bf_enc_obj='crypto/bf/asm/b_win32.obj'; + $bf_enc_src='crypto/bf/asm/b_win32.asm'; + $cast_enc_obj='crypto/cast/asm/c_win32.obj'; + $cast_enc_src='crypto/cast/asm/c_win32.asm'; + $rc4_enc_obj='crypto/rc4/asm/r4_win32.obj'; + $rc4_enc_src='crypto/rc4/asm/r4_win32.asm'; + $rc5_enc_obj='crypto/rc5/asm/r5_win32.obj'; + $rc5_enc_src='crypto/rc5/asm/r5_win32.asm'; + $md5_asm_obj='crypto/md5/asm/m5_win32.obj'; + $md5_asm_src='crypto/md5/asm/m5_win32.asm'; + $sha1_asm_obj='crypto/sha/asm/s1_win32.obj'; + $sha1_asm_src='crypto/sha/asm/s1_win32.asm'; + $rmd160_asm_obj='crypto/ripemd/asm/rm_win32.obj'; + $rmd160_asm_src='crypto/ripemd/asm/rm_win32.asm'; + $cflags.=" -DBN_ASM -DMD5_ASM -DSHA1_ASM -DRMD160_ASM"; + } + +if ($shlib) + { + $mlflags.=" $lflags -dll"; +# $cflags =~ s| -MD| -MT|; + $lib_cflag=" -D_WINDLL"; + $out_def="gmout32dll"; + $tmp_def="gmtmp32dll"; + } + +$cflags.=" -Fd$out_def"; + +sub do_lib_rule + { + local($objs,$target,$name,$shlib,$ign,$base_addr, $fips_get_sig, $fips_premain_src)=@_; + local($ret,$Name); + + $taget =~ s/\//$o/g if $o ne '/'; + ($Name=$name) =~ tr/a-z/A-Z/; + my $base_arg; + if ($base_addr ne "") + { + $base_arg= " -base:$base_addr"; + } + else + { + $base_arg = ""; + } + + +# $target="\$(LIB_D)$o$target"; + if (!$shlib) + { +# $ret.="\t\$(RM) \$(O_$Name)\n"; + $ret.="$target: $objs\n"; + $ex =' advapi32.lib'; + $ret.="\t\$(MKLIB) $lfile$target $objs $ex\n\n"; + } + else + { + local($ex)=($target =~ /O_SSL/)?' $(L_CRYPTO)':''; + $ex.=' wsock32.lib gdi32.lib advapi32.lib user32.lib'; + $ex.=" $zlib_lib" if $zlib_opt == 1 && $target =~ /O_CRYPTO/; + if (defined $fips_get_sig) + { + $ret.="$target: \$(O_FIPSCANISTER) $objs $fips_get_sig\n"; + $ret.="\tFIPS_LINK=\$(LINK) "; + $ret.="FIPS_CC=\$(CC) "; + $ret.="FIPS_CC_ARGS=\"-Fo\$(OBJ_D)${o}fips_premain.obj \$(SHLIB_CFLAGS) -c\" "; + $ret.="FIPS_PREMAIN_DSO=$fips_get_sig "; + $ret.="FIPS_TARGET=$target "; + $ret.="FIPS_LIBDIR=\$(FIPSLIB_D) "; + $ret.="\$(FIPSLINK) \$(MLFLAGS) $base_arg $efile$target "; + $ret.="-def:ms/${Name}.def \$(SHLIB_EX_OBJ) $objs "; + $ret.="\$(OBJ_D)${o}fips_premain.obj $ex\n\n"; + } + else + { + $ret.="$target: $objs\n"; + $ret.="\t\$(LINK) \$(MLFLAGS) $base_arg $efile$target /def:ms/${Name}.def \$(SHLIB_EX_OBJ) $objs $ex\n\n"; + } + } + $ret.="\n"; + return($ret); + } + +sub do_link_rule + { + local($target,$files,$dep_libs,$libs,$standalone)=@_; + local($ret,$_); + $file =~ s/\//$o/g if $o ne '/'; + $n=&bname($targer); + if ($standalone) + { + $ret.="$target: $files $dep_libs\n"; + $ret.="\t\$(LINK) \$(LFLAGS) $efile$target "; + $ret.="$files $libs\n\n"; + } + elsif ($fips && !$shlib) + { + $ret.="$target: \$(O_FIPSCANISTER) $files $dep_libs\n"; + $ret.="\tFIPS_LINK=\$(LINK) "; + $ret.="FIPS_CC=\$(CC) "; + $ret.="FIPS_CC_ARGS=\"-Fo\$(OBJ_D)${o}fips_premain.obj \$(SHLIB_CFLAGS) -c\" "; + $ret.="FIPS_PREMAIN_DSO= "; + $ret.="FIPS_TARGET=$target "; + $ret.="FIPS_LIBDIR=\$(FIPSLIB_D) "; + $ret.=" \$(FIPSLINK) \$(LFLAGS) $efile$target "; + $ret.="\$(APP_EX_OBJ) $files \$(OBJ_D)${o}fips_premain.obj $libs\n\n"; + } + else + { + $ret.="$target: $files $dep_libs\n"; + $ret.="\t\$(LINK) \$(LFLAGS) $efile$target "; + $ret.="\$(APP_EX_OBJ) $files $libs\n\n"; + } + $ret.="\n"; + return($ret); + } + +sub do_rlink_rule + { + local($target,$files,$check_hash, $deps)=@_; + local($ret,$_); + + $file =~ s/\//$o/g if $o ne '/'; + $n=&bname($targer); + $ret.="$target: $check_hash $files $deps\n"; + $ret.="\t\$(PERL) util${o}checkhash.pl -chdir fips-1.0 -program_path ..$o$check_hash\n"; + $ret.="\t\$(MKCANISTER) $target $files\n"; + $ret.="\t$check_hash $target > $target.sha1\n"; + $ret.="\t\$(CP) fips-1.0${o}fips_premain.c \$(FIPSLIB_D)\n"; + $ret.="\t$check_hash \$(FIPSLIB_D)${o}fips_premain.c > \$(FIPSLIB_D)${o}fips_premain.c.sha1\n\n"; + return($ret); + } + + +1; |