summaryrefslogtreecommitdiffstats
path: root/sys/conf (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Make ddb's dependency on libz explicit.visa2021-03-311-12/+12
| | | | OK deraadt@ mpi@
* Add RA, a new 11n Tx rate adaptation module for net80211.stsp2021-03-121-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Written by Christian Ehrhardt and myself, based on ieee80211_mira.c but with significant changes. The main difference is that RA does not attempt to precisely measure actual throughput but simply deducts a loss percentage from the theoretical throughput which can be achieved by a given MCS. Unlike MiRa, RA does not use timeouts to trigger probing. Probing is triggered only by changes in measured throughput. Unlike MiRA, RA doesn't care whether a frame was part of an A-MPDU. RA simply collects statistics for individual subframes. This makes reporting very easy for drivers and seems to work well enough in practice. Another difference is that drivers can report multi-rate retries properly via ieee80211_ra_add_stats_ht(mcs, total, fail) which can be called several times before ieee80211_ra_choose() selects a new Tx rate. There is no reason any issues could not be fixed in ieee8011_mira.c but I felt it was a good moment to burn the house down and start over. And since this code diverges from how MiRA is described in the research paper applying the "MiRA" label becomes inappropriate.
* enable veb(4), it's time for wider testing.dlg2021-02-251-1/+2
| | | | | | apart from the semantic differences between bridge(4) and veb(4), the only missing bits in veb(4) is the transparent ipsec interception support, and spanning tree.
* add veb(4), a Virtual Ethernet Bridge driver.dlg2021-02-231-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | my intention is to replace bridge(4), but the way it works is different enough from from bridge that a name change is justified to distinguish them. it also makes it easier to commit it to the tree and work on it in parallel to bridge, and allows a window of migration. the main difference between veb(4) and bridge(4) is how they use interfaces as ports. veb takes over interfaces completely and only uses them to receive and transmit ethernet packets. bridge also use each interface as a port to the ethernet segment it's connected to, but also tries to continue supporting the use of the interface as a way to talk to the network stack on the local system. supporting the use of interfaces for both external and local communication is where most of my confusion with bridge comes from, both when i'm trying to operate it and also understand the code. changing this semantic is where most of the simplification in veb comes from compared to bridge. because veb takes over interfaces, the ethernet network set up on a veb is isolated from the host network stack. by default veb does not interact with pf or the ip (and mpls) stacks. to enable pf for ip frames going over veb ports link1 on the veb interface must be set. to have the stack interact with a veb network, vport interfaces must be created and added as ports to a veb. the vport interface driver is provided as part of veb, and is handled specially by veb. veb usually prevents the use of ports by the stack for sending an receiving packets, but that's why vports exist, so veb has special handling for them. veb already supports a lot of the other features that bridge has, including bridge rules and protected domains, but i got tired of working out of the tree and stopped implementing them. the main outstanding features is better address table management, the blocknonip flag on ports, transparent ipsec interception, and spanning tree. i may not bother with spanning tree unless someone tells me that they actually use it. the core ethernet learning bridge functionality is provided by the etherbridge code that was factored out of nvgre and bpe. veb is already (a lot) faster than bridge, and is better prepared to operate in parallel on multiple CPUs concurrently. thanks to hrvoje popovski for testing some earlier versions of this. discussed with many ok patrick@ jmatthew@
* cut nvgre(4) over to use common etherbridge code.dlg2021-02-211-2/+2
| | | | | | | the "ports" that nvgre provides to etherbridge are ip addresses used in the underlay network. ok patrick@ jmatthew@
* cut bpe(4) over to using the common etherbridge code.dlg2021-02-211-2/+2
| | | | | | | | | it's pretty straightforward since etherbridge was mostly based on this code in the first place. the etherbridge_ops that bpe provides to etherbridge set entries up to point at mac addresses in the underlay network. ok patrick@ jmatthew@
* add etherbridge, the guts of a learning bridge that can be reused.dlg2021-02-211-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | this allows for the factoring out of the learning bridge code i wrote in bpe and nvme, and should be reusable for other drivers needing a mac learning bridge. the core data structures are an etherbridge struct to represent the learning bridge, eb_entry structs for each mac address entry that the bridge knows about, and an etherbridge_ops struct that drivers fill in so that they can use this code. eb_entry structs are stored in a hash table made up of SMR_TAILQs to support lookups of entries quickly and concurrently in the forwarding path. they are also stored in a locked red-black tree to help manage the uniqueness of the mac address in the table. the etherbridge_ops handlers mostly deal with comparing and testing the "ports" associated with mac address table entries. the "port" that a mac address entry is associated with is opaque to the etherbridge code, which allows for this code to be used by nvgre and bpe which map mac addresses inside the bridge to addresses in their underlay networks. it also supports traditional bridges where "ports" are actual interfaces. ok patrick@ jmatthew@
* Add a RAID1C (raid1 + crypto) softraid(8) discipline.stsp2021-02-081-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The RAID1C discipline encrypts data like the CRYPTO discipline, and accepts multiple chunks during creation and assembly like the RAID1 discipline. To deal with failing disks a RAID1C volume may be assembled with a smaller number of chunks than the volume was created with. The volume will then come up in degraded state. If the volume is now detached and assembled again with the correct number of chunks, any re-added chunks will require a rebuild. Consequently, assembling RAID1C volumes requires careful attention to the chunks passed via 'bioctl -l'. If a chunk is accidentally omitted from the command line during volume assembly, then this chunk will need to be rebuilt. At least one known-good chunk is required in order to assemble the volume. Like CRYPTO, RAID1C supports passphrase and key-disk authentication. Key-disk based volumes are assembled automatically if the key disk is present while the system is booting up. Unlike CRYPTO and RAID1, there is no boot support for RAID1C yet. RAID1C largely reuses existing code of RAID1 and CRYPTO disciplines. At present RAID1C's discipline-specific data structure is shared with that of the CRYPTO discipline to allow re-use of existing CRYPTO code. A custom RAID1C data structure would require CRYPTO code to access struct sr_crypto via a pointer instead of via a member field of struct sr_discipline. ok jsing@
* 6.9-betaderaadt2021-02-061-4/+4
|
* Drop tcp_trace() from SMALL_KERNEL builds to make room on amd64 floppyvisa2021-01-281-2/+2
| | | | OK deraadt@
* kernel, sysctl(8): remove dead variable: tickadjcheloha2021-01-131-2/+1
| | | | | | | | | | | | | | | | | | | | The global "tickadj" variable is a remnant of the old NTP adjustment code we used in the kernel before the current timecounter subsystem was imported from FreeBSD circa 2004 or 2005. Fifteen years hence it is completely vestigial and we can remove it. We probably should have removed it long ago but I guess it slipped through the cracks. FreeBSD removed it in 2002: https://cgit.freebsd.org/src/commit/?id=e1d970f1811e5e1e9c912c032acdcec6521b2a6d NetBSD and DragonflyBSD can probably remove it, too. We export tickadj via the kern.clockrate sysctl(2), so update sysctl.2 and sysctl(8) accordingly. Hypothetically this change could break someone's sysctl(8) parsing script. I don't think that's very likely. ok mvs@
* Split imxiic(4) into the FDT-attachment code and the i.MX I2C codepatrick2020-11-171-1/+5
| | | | | | in preparation for upcoming ACPI-attachment. ok kettenis@
* renable POOL_DEBUGjsg2020-09-301-2/+2
| | | | ok deraadt@
* 6.8-currentjsg2020-09-301-3/+3
| | | | ok deraadt@
* take us out of -betaderaadt2020-09-251-3/+3
|
* disable POOL_DEBUG in preparation for releasebenno2020-09-221-2/+2
| | | | ok deraadt@
* crank to 6.8-betaderaadt2020-08-311-4/+4
|
* __main() is no longer used by any of our toolchainsderaadt2020-07-201-2/+1
| | | | | this fell out of a discussion with mortimer ok kettenis
* tell the kernel how to build kstatdlg2020-07-061-1/+4
| | | | it's like ksyms, but different
* enable wg(4).dlg2020-06-231-2/+2
| | | | | | | this will make testing easier for everyone. from Jason A. Donenfeld and Matt Dunwoodie ok deraadt@ tobhe@
* add a commented out entry for wg(4).dlg2020-06-211-1/+2
| | | | i think ive tempted fate enough for one day.
* tell config how to build wg(4)dlg2020-06-211-1/+7
|
* wire intrmap into the builddlg2020-06-171-1/+3
|
* wire stoeplitz code into the tree.dlg2020-06-161-1/+3
|
* reenable POOL_DEBUGnaddy2020-05-091-2/+2
|
* post-6.7 development continuesderaadt2020-05-071-3/+3
|
* leave -beta.deraadt2020-05-041-3/+3
|
* disable POOL_DEBUG in preparation for releasebenno2020-04-261-2/+2
| | | | ok deraadt@
* Add bse(4) device to unbreak build.patrick2020-04-151-1/+5
| | | | | noticed by tobhe@ diff from kettenis@ (who forgot to commit this bit)
* crank to 6.7-betaderaadt2020-04-051-4/+4
|
* Add rkdwhdmi(4), a driver for the HDMI transmitter found on the Rockchipkettenis2020-03-021-1/+6
| | | | | | RK3399 SoC. ok patrick@
* cleanup unused headers generated by configjsg2020-01-241-7/+7
| | | | ok tedu@ krw@ deraadt@
* remove unreferenced ncr5380 driver filestedu2020-01-241-3/+1
| | | | ok jsg
* Nuke references to zaurus zombies.krw2020-01-241-2/+1
| | | | ok tedu@ jsg@
* Import dt(4) a driver and framework for Dynamic Profiling.mpi2020-01-212-2/+9
| | | | | | | | | | | The design is fairly simple: events, in the form of descriptors on a ring, are being produced in any kernel context and being consumed by a userland process reading /dev/dt. Code and hooks are all guarded under '#if NDT > 0' so this commit shouldn't introduce any change as long as dt(4) is disable in GENERIC. ok kettenis@, visa@, jasper@, deraadt@
* remove sli(4)jsg2020-01-111-5/+1
| | | | | | | This driver was never completed. It only mapped memory and established an interrupt. ok krw@ mlarkin@ dlg@
* remove dpt(4) driver for DPT EATA SCSI RAIDjsg2020-01-101-5/+1
| | | | | | | Not built since 2006, and a mail from 2004 mentions no one having hardware. Unsurprisingly it does not build with clang. ok mlarkin@ krw@ deraadt@
* Move uvmexp_print() to a better place.mpi2019-12-051-2/+1
| | | | ok mlarkin@
* Kill uvm_deallocate(9) and use uvm_unmap() directly.mpi2019-11-051-2/+1
| | | | ok kettenis@, semarie@, deraadt@
* remove mobileip(4)dlg2019-11-041-3/+1
| | | | | | | noone seems to use it, and we should not encourage people to use it by having it available. it's been disabled for most of the last release and noones asked for it in 6.6, so i'm taking that as an ok for this removal.
* renable POOL_DEBUGnaddy2019-10-121-2/+2
|
* we are now hacking on 6.6-currentderaadt2019-10-121-3/+3
|
* src/sys/netinet/ip_ether.c is empty, and gif doesn't need it.dlg2019-10-051-2/+1
| | | | | | | | gif may have needed it when you could switch modes with gif, but now that's handled by if_etherip.c. ip_ether.c is empty, so we can plan to remove it. ok visa@ jca@ deraadt@
* disable POOL_DEBUG for releasejsg2019-10-041-2/+2
| | | | ok deraadt@
* stop this -current stuffderaadt2019-10-011-3/+3
|
* Replace dwge(4) with a new driver based on dwxe(4). There are manykettenis2019-09-291-6/+1
| | | | | | | | | | similarities between the two and using a common approach helps fixing bugs. The new driver is better integrated with the device tree framework and is faster (mainly because the DMA engine is configured properly now). Tested on all currently supported variants of the hardware. ok jsg@, jmatthew@
* Remove tz, the kernel timezone.cheloha2019-09-071-9/+2
| | | | | | | | | | | | | | | | | After removing timezone support from date(1), msdosfs, gettimeofday(2), settimeofday(2), boot_config(8), config(8), and introducing kern.utc_offset sysctl(2) to replace the DST/TIMEZONE options(4) to support running the RTC at an offset from UTC, the kernel timezone is unused and we can delete it. With this commit the kernel timezone now appears to be extinct in upstream BSD, though it does survive in XNU: https://github.com/opensource-apple/xnu/blob/0a798f6738bc1db01281fc08ae024145e84df927/bsd/conf/param.c#L83 Prompted by tedu@ some time back, and inspired by NetBSD and FreeBSD's work in this area. ok deraadt@
* sysctl(2): add kern.utc_offset: successor to the DST/TIMEZONE options(4)cheloha2019-08-211-1/+2
| | | | | | | | | | | | | | | | | | | | | The DST and TIMEZONE options(4) are incompatible with KARL, so we need some other way to compensate for an RTC running with a known offset. Enter kern.utc_offset, an offset in minutes East of UTC. TIMEZONE has always been minutes West, but this is inconsistent with how everyone else talks about timezones, hence the flip. TIMEZONE has the advantage of being compiled into the binary. Our new sysctl(2) has no such luck, so it needs to be set as early as possible in boot, from sysctl.conf(5), so we can correct the kernel clock from the RTC's local time to UTC before daemons like ntpd(8) and cron(8) start. To encourage this, kern.utc_offset is made immutable after the securelevel(7) is raised to 1. Prompted by yasuoka@. Discussed with deraadt@, kettenis@, yasuoka@. Additional testing by yasuoka@. ok deraadt@, yasuoka@
* really crank to 6.6-betanaddy2019-08-101-2/+2
|
* move to 6.6-betaderaadt2019-08-101-3/+3
|